""" StereoGNN-BBB: Blood-Brain Barrier Permeability Predictor State-of-the-Art Model: AUC 0.9612 (External Validation on B3DB) Author: Nabil Yasini-Ardekani GitHub: https://github.com/abinittio Streamlit Cloud Deployment Version - Self-Contained """ import streamlit as st import pandas as pd import numpy as np import torch import torch.nn as nn from pathlib import Path from datetime import datetime import json import base64 import io import os # Page config - MUST be first Streamlit command st.set_page_config( page_title="StereoGNN-BBB | BBB Predictor", page_icon="🧠", layout="wide", initial_sidebar_state="expanded" ) # RDKit imports try: from rdkit import Chem from rdkit.Chem import Descriptors, AllChem from rdkit.Chem.Draw import rdMolDraw2D from rdkit.Chem import rdMolDescriptors from rdkit.Chem.EnumerateStereoisomers import EnumerateStereoisomers, StereoEnumerationOptions RDKIT_AVAILABLE = True except ImportError: RDKIT_AVAILABLE = False st.error("RDKit not available. Please install: pip install rdkit") # PyTorch Geometric imports try: from torch_geometric.nn import GATv2Conv, TransformerConv, global_mean_pool, global_max_pool from torch_geometric.data import Data TORCH_GEOMETRIC_AVAILABLE = True except ImportError: TORCH_GEOMETRIC_AVAILABLE = False # Custom CSS st.markdown(""" """, unsafe_allow_html=True) # ============================================================================ # MODEL ARCHITECTURE (Self-contained) # ============================================================================ if TORCH_GEOMETRIC_AVAILABLE: class StereoAwareEncoder(nn.Module): """Stereo-aware molecular encoder using GATv2 + Transformer.""" def __init__(self, node_features=21, hidden_dim=128, num_layers=4, heads=4, dropout=0.1): super().__init__() self.node_features = node_features self.hidden_dim = hidden_dim # Input projection self.input_proj = nn.Sequential( nn.Linear(node_features, hidden_dim), nn.LayerNorm(hidden_dim), nn.ReLU(), nn.Dropout(dropout) ) # GATv2 layers self.gat_layers = nn.ModuleList() self.gat_norms = nn.ModuleList() for i in range(num_layers): in_channels = hidden_dim out_channels = hidden_dim // heads self.gat_layers.append( GATv2Conv(in_channels, out_channels, heads=heads, dropout=dropout, add_self_loops=True) ) self.gat_norms.append(nn.LayerNorm(hidden_dim)) # Transformer layer self.transformer = TransformerConv(hidden_dim, hidden_dim // heads, heads=heads, dropout=dropout) self.transformer_norm = nn.LayerNorm(hidden_dim) self.dropout = nn.Dropout(dropout) def forward(self, x, edge_index, batch): x = self.input_proj(x) for gat, norm in zip(self.gat_layers, self.gat_norms): residual = x x = gat(x, edge_index) x = norm(x + residual) x = self.dropout(x) residual = x x = self.transformer(x, edge_index) x = self.transformer_norm(x + residual) x_mean = global_mean_pool(x, batch) x_max = global_max_pool(x, batch) return torch.cat([x_mean, x_max], dim=1) class BBBClassifier(nn.Module): """BBB classifier with stereo encoder.""" def __init__(self, encoder, hidden_dim=128): super().__init__() self.encoder = encoder self.classifier = nn.Sequential( nn.Linear(hidden_dim * 2, hidden_dim), nn.BatchNorm1d(hidden_dim), nn.ReLU(), nn.Dropout(0.3), nn.Linear(hidden_dim, hidden_dim // 2), nn.ReLU(), nn.Dropout(0.2), nn.Linear(hidden_dim // 2, 1) ) def forward(self, x, edge_index, batch): graph_embed = self.encoder(x, edge_index, batch) return self.classifier(graph_embed) # ============================================================================ # MOLECULAR FEATURIZATION # ============================================================================ def get_atom_features(atom): """Generate 21-dimensional atom features including stereochemistry.""" features = [] # Atomic number (one-hot, common atoms) atom_types = [6, 7, 8, 9, 15, 16, 17, 35, 53] # C, N, O, F, P, S, Cl, Br, I atom_num = atom.GetAtomicNum() features.extend([1 if atom_num == t else 0 for t in atom_types]) # Degree (0-5) features.append(min(atom.GetDegree(), 5) / 5.0) # Formal charge features.append((atom.GetFormalCharge() + 2) / 4.0) # Hybridization hyb = atom.GetHybridization() hyb_types = [Chem.rdchem.HybridizationType.SP, Chem.rdchem.HybridizationType.SP2, Chem.rdchem.HybridizationType.SP3] features.extend([1 if hyb == h else 0 for h in hyb_types]) # Aromaticity features.append(1 if atom.GetIsAromatic() else 0) # In ring features.append(1 if atom.IsInRing() else 0) # Stereochemistry features (6 features) chiral_tag = atom.GetChiralTag() features.append(1 if chiral_tag != Chem.rdchem.ChiralType.CHI_UNSPECIFIED else 0) features.append(1 if chiral_tag == Chem.rdchem.ChiralType.CHI_TETRAHEDRAL_CW else 0) features.append(1 if chiral_tag == Chem.rdchem.ChiralType.CHI_TETRAHEDRAL_CCW else 0) # E/Z stereo (from bonds) has_ez = False is_e = False is_z = False for bond in atom.GetBonds(): stereo = bond.GetStereo() if stereo in [Chem.rdchem.BondStereo.STEREOE, Chem.rdchem.BondStereo.STEREOZ]: has_ez = True if stereo == Chem.rdchem.BondStereo.STEREOE: is_e = True else: is_z = True features.extend([1 if has_ez else 0, 1 if is_e else 0, 1 if is_z else 0]) return features def smiles_to_graph(smiles): """Convert SMILES to PyG Data object with 21-dim features.""" if not RDKIT_AVAILABLE or not TORCH_GEOMETRIC_AVAILABLE: return None mol = Chem.MolFromSmiles(smiles) if mol is None: return None atom_features = [] for atom in mol.GetAtoms(): atom_features.append(get_atom_features(atom)) x = torch.tensor(atom_features, dtype=torch.float) edge_index = [] for bond in mol.GetBonds(): i = bond.GetBeginAtomIdx() j = bond.GetEndAtomIdx() edge_index.extend([[i, j], [j, i]]) if len(edge_index) == 0: edge_index = torch.zeros((2, 0), dtype=torch.long) else: edge_index = torch.tensor(edge_index, dtype=torch.long).t().contiguous() return Data(x=x, edge_index=edge_index) # ============================================================================ # DESCRIPTOR-BASED PREDICTOR (Fallback when no model weights) # ============================================================================ class DescriptorBBBPredictor: """ Descriptor-based BBB predictor using optimized rules. Based on published BBB penetration rules and trained coefficients. """ def __init__(self): # Optimized coefficients from training on BBBP dataset self.coefficients = { 'intercept': 0.65, 'mw': -0.0012, # Negative: higher MW = less penetration 'logp': 0.08, # Positive: higher logP = more penetration 'tpsa': -0.008, # Negative: higher TPSA = less penetration 'hbd': -0.12, # Negative: more H-donors = less penetration 'hba': -0.05, # Negative: more H-acceptors = less penetration 'rotatable': -0.02, # Negative: more flexibility = less penetration 'aromatic_rings': 0.05, 'n_atoms': -0.005, } def predict(self, smiles): """Predict BBB permeability from SMILES.""" mol = Chem.MolFromSmiles(smiles) if mol is None: return None, "Invalid SMILES" # Calculate descriptors mw = Descriptors.MolWt(mol) logp = Descriptors.MolLogP(mol) tpsa = Descriptors.TPSA(mol) hbd = Descriptors.NumHDonors(mol) hba = Descriptors.NumHAcceptors(mol) rotatable = Descriptors.NumRotatableBonds(mol) aromatic_rings = Descriptors.NumAromaticRings(mol) n_atoms = mol.GetNumAtoms() # Calculate score score = self.coefficients['intercept'] score += self.coefficients['mw'] * (mw - 300) / 100 score += self.coefficients['logp'] * (logp - 2) score += self.coefficients['tpsa'] * (tpsa - 60) score += self.coefficients['hbd'] * hbd score += self.coefficients['hba'] * (hba - 4) score += self.coefficients['rotatable'] * rotatable score += self.coefficients['aromatic_rings'] * aromatic_rings score += self.coefficients['n_atoms'] * (n_atoms - 25) # Sigmoid to get probability prob = 1 / (1 + np.exp(-score * 2)) # Clamp to reasonable range prob = max(0.05, min(0.95, prob)) return prob, None # ============================================================================ # STEREOISOMER ENUMERATION # ============================================================================ def enumerate_stereoisomers(smiles, max_isomers=16): """Enumerate all stereoisomers for a molecule.""" if not RDKIT_AVAILABLE: return [smiles] mol = Chem.MolFromSmiles(smiles) if mol is None: return [smiles] opts = StereoEnumerationOptions( tryEmbedding=True, unique=True, maxIsomers=max_isomers ) try: isomers = list(EnumerateStereoisomers(mol, options=opts)) if len(isomers) == 0: return [smiles] return [Chem.MolToSmiles(iso, isomericSmiles=True) for iso in isomers] except: return [smiles] # ============================================================================ # MODEL LOADING # ============================================================================ @st.cache_resource def load_model(): """Load the BBB model or fallback to descriptor predictor.""" # First try to load GNN model with weights if TORCH_GEOMETRIC_AVAILABLE: try: encoder = StereoAwareEncoder(node_features=21, hidden_dim=128, num_layers=4) model = BBBClassifier(encoder, hidden_dim=128) # Try to load weights from various locations possible_dirs = [ Path(__file__).parent / 'models', Path('.') / 'models', Path.home() / 'BBB_System' / 'models', ] model_files = [ 'bbb_stereo_v2_best.pth', 'bbb_stereo_v2_fold4_best.pth', 'bbb_stereo_v2_fold5_best.pth', 'bbb_stereo_fold4_best.pth', 'bbb_stereo_fold5_best.pth', ] for model_dir in possible_dirs: for mf in model_files: model_path = model_dir / mf if model_path.exists(): try: state_dict = torch.load(model_path, map_location='cpu', weights_only=True) model.load_state_dict(state_dict) model.eval() return {'type': 'gnn', 'model': model, 'name': mf}, None except Exception as e: continue except Exception as e: pass # Fallback to descriptor-based predictor if RDKIT_AVAILABLE: predictor = DescriptorBBBPredictor() return {'type': 'descriptor', 'model': predictor, 'name': 'Descriptor-Based (Fallback)'}, None return None, "No prediction method available" # ============================================================================ # PREDICTION # ============================================================================ def predict_single(model_info, smiles): """Predict BBB permeability for a single SMILES.""" if model_info['type'] == 'gnn': model = model_info['model'] graph = smiles_to_graph(smiles) if graph is None: return None, "Invalid SMILES" if graph.x.shape[1] != 21: return None, f"Feature mismatch: expected 21, got {graph.x.shape[1]}" graph.batch = torch.zeros(graph.x.shape[0], dtype=torch.long) with torch.no_grad(): logit = model(graph.x, graph.edge_index, graph.batch) prob = torch.sigmoid(logit).item() return prob, None elif model_info['type'] == 'descriptor': return model_info['model'].predict(smiles) return None, "Unknown model type" def predict_with_stereo_enumeration(model_info, smiles): """Predict with stereoisomer enumeration.""" isomers = enumerate_stereoisomers(smiles) predictions = [] for iso in isomers: prob, err = predict_single(model_info, iso) if prob is not None: predictions.append((iso, prob)) if not predictions: return None, "All stereoisomers failed" probs = [p[1] for p in predictions] return { 'mean': np.mean(probs), 'min': np.min(probs), 'max': np.max(probs), 'std': np.std(probs) if len(probs) > 1 else 0, 'n_isomers': len(predictions), 'predictions': predictions }, None # ============================================================================ # MOLECULAR PROPERTIES # ============================================================================ def get_properties(smiles): """Calculate molecular properties.""" if not RDKIT_AVAILABLE: return None mol = Chem.MolFromSmiles(smiles) if mol is None: return None props = { 'mw': Descriptors.MolWt(mol), 'logp': Descriptors.MolLogP(mol), 'tpsa': Descriptors.TPSA(mol), 'hbd': Descriptors.NumHDonors(mol), 'hba': Descriptors.NumHAcceptors(mol), 'rotatable': Descriptors.NumRotatableBonds(mol), 'formula': rdMolDescriptors.CalcMolFormula(mol), 'atoms': mol.GetNumAtoms(), } # BBB rules (based on literature) props['rules'] = { 'mw': 150 <= props['mw'] <= 500, 'logp': 0 <= props['logp'] <= 5, 'tpsa': props['tpsa'] <= 90, 'hbd': props['hbd'] <= 3, 'hba': props['hba'] <= 7, } props['rules_passed'] = sum(props['rules'].values()) return props def mol_to_image(smiles, size=(350, 250)): """Generate molecule image.""" if not RDKIT_AVAILABLE: return None mol = Chem.MolFromSmiles(smiles) if mol is None: return None try: AllChem.Compute2DCoords(mol) drawer = rdMolDraw2D.MolDraw2DCairo(size[0], size[1]) drawer.drawOptions().addStereoAnnotation = True drawer.DrawMolecule(mol) drawer.FinishDrawing() img_data = drawer.GetDrawingText() b64 = base64.b64encode(img_data).decode() return f"data:image/png;base64,{b64}" except: return None # ============================================================================ # COMMON MOLECULES DATABASE # ============================================================================ MOLECULES = { "caffeine": ("CN1C=NC2=C1C(=O)N(C(=O)N2C)C", "Caffeine"), "aspirin": ("CC(=O)Oc1ccccc1C(=O)O", "Aspirin"), "morphine": ("CN1CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@@H]2C=C[C@@H]4O)c35", "Morphine"), "cocaine": ("COC(=O)[C@H]1[C@@H]2CC[C@H](C2)N1C", "Cocaine"), "dopamine": ("NCCc1ccc(O)c(O)c1", "Dopamine"), "serotonin": ("NCCc1c[nH]c2ccc(O)cc12", "Serotonin"), "ethanol": ("CCO", "Ethanol"), "glucose": ("OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O", "Glucose"), "diazepam": ("CN1C(=O)CN=C(c2ccccc2)c3cc(Cl)ccc13", "Diazepam"), "thc": ("CCCCCc1cc(O)c2[C@@H]3C=C(C)CC[C@H]3C(C)(C)Oc2c1", "THC"), "nicotine": ("CN1CCC[C@H]1c2cccnc2", "Nicotine"), "melatonin": ("CC(=O)NCCc1c[nH]c2ccc(OC)cc12", "Melatonin"), "ibuprofen": ("CC(C)Cc1ccc(cc1)[C@H](C)C(=O)O", "Ibuprofen"), "acetaminophen": ("CC(=O)Nc1ccc(O)cc1", "Acetaminophen"), "fentanyl": ("CCC(=O)N(c1ccccc1)[C@@H]2CCN(CCc3ccccc3)CC2", "Fentanyl"), "heroin": ("CC(=O)O[C@H]1C=C[C@H]2[C@H]3CC4=C5C(=C(OC(C)=O)C=C4C[C@@H]1[C@]23C)OCO5", "Heroin"), "lsd": ("CCN(CC)C(=O)[C@H]1CN([C@@H]2Cc3cn(C)c4cccc(C2=C1)c34)C", "LSD"), "mdma": ("CC(NC)Cc1ccc2OCOc2c1", "MDMA"), "ketamine": ("CNC1(CCCCC1=O)c2ccccc2Cl", "Ketamine"), "psilocybin": ("CN(C)CCc1c[nH]c2cccc(OP(=O)(O)O)c12", "Psilocybin"), "atenolol": ("CC(C)NCC(O)COc1ccc(CC(N)=O)cc1", "Atenolol"), "metformin": ("CN(C)C(=N)NC(=N)N", "Metformin"), "penicillin": ("CC1(C)S[C@@H]2[C@H](NC(=O)Cc3ccccc3)C(=O)N2[C@H]1C(=O)O", "Penicillin"), "amoxicillin": ("CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](N)c3ccc(O)cc3)C(=O)N2[C@H]1C(=O)O", "Amoxicillin"), } def resolve_input(user_input): """Resolve user input to SMILES.""" if not user_input: return None, None, "Please enter a molecule" if not RDKIT_AVAILABLE: return None, None, "RDKit not available" text = user_input.strip() # Check if valid SMILES if Chem.MolFromSmiles(text) is not None: return text, "Custom Molecule", None # Check database (case-insensitive) key = text.lower().strip() if key in MOLECULES: return MOLECULES[key][0], MOLECULES[key][1], None return None, None, f"Could not resolve '{text}'. Enter a valid SMILES or drug name." # ============================================================================ # MAIN APP # ============================================================================ def main(): # Header st.markdown('

StereoGNN-BBB

', unsafe_allow_html=True) st.markdown('

Blood-Brain Barrier Permeability Predictor | State-of-the-Art Performance

', unsafe_allow_html=True) # Check dependencies if not RDKIT_AVAILABLE: st.error("RDKit is not installed. Please install it with: pip install rdkit") st.stop() # Load model model_info, error = load_model() if error: st.error(f"Model loading failed: {error}") st.stop() # Show model info is_gnn = model_info['type'] == 'gnn' # Sidebar with st.sidebar: st.header("Model Info") if is_gnn: st.success(f"GNN Model: {model_info['name']}") st.markdown("**Performance (External Validation):**") st.metric("AUC", "0.9612") st.metric("Sensitivity", "97.96%") st.metric("Specificity", "65.25%") else: st.warning(f"Mode: {model_info['name']}") st.markdown("""
Using descriptor-based prediction.
For full GNN accuracy, upload model weights to models/ folder.
""", unsafe_allow_html=True) st.markdown("---") st.subheader("Interpretation") st.success("BBB+ (>=0.6): Crosses BBB") st.warning("Moderate (0.4-0.6)") st.error("BBB- (<0.4): Does not cross") st.markdown("---") st.subheader("Features") st.markdown(""" - Stereo-aware predictions - Stereoisomer enumeration - Molecular property analysis - BBB rule assessment """) st.markdown("---") st.markdown("**Author:** Nabil Yasini-Ardekani") st.markdown("[GitHub](https://github.com/abinittio)") # Main input st.subheader("Enter Molecule") col1, col2 = st.columns([4, 1]) with col1: user_input = st.text_input( "SMILES or drug name", placeholder="e.g., Caffeine, Aspirin, Morphine, or enter SMILES", label_visibility="collapsed" ) with col2: predict_btn = st.button("Predict", type="primary", use_container_width=True) # Quick examples st.markdown("**Quick Examples:**") examples = ["Caffeine", "Morphine", "THC", "Dopamine", "Glucose", "Atenolol"] cols = st.columns(6) for i, ex in enumerate(examples): with cols[i]: if st.button(ex, key=f"ex_{ex}", use_container_width=True): st.session_state['mol_input'] = ex st.rerun() if 'mol_input' in st.session_state: user_input = st.session_state['mol_input'] del st.session_state['mol_input'] predict_btn = True # Stereo enumeration option enumerate_stereo = st.checkbox("Enumerate stereoisomers", value=True, help="Predict all possible stereoisomers and show range") if predict_btn and user_input: smiles, name, err = resolve_input(user_input) if err: st.error(err) st.stop() st.markdown(f"**{name}**: `{smiles}`") with st.spinner("Predicting..."): if enumerate_stereo: result, pred_err = predict_with_stereo_enumeration(model_info, smiles) else: prob, pred_err = predict_single(model_info, smiles) if prob is not None: result = {'mean': prob, 'min': prob, 'max': prob, 'std': 0, 'n_isomers': 1} else: result = None props = get_properties(smiles) img = mol_to_image(smiles) if pred_err: st.error(f"Prediction failed: {pred_err}") st.stop() st.markdown("---") # Results col1, col2, col3 = st.columns([1.2, 1, 1]) score = result['mean'] with col1: if score >= 0.6: card_class = "prediction-positive" category = "BBB+" interp = "HIGH permeability - likely crosses BBB" elif score >= 0.4: card_class = "prediction-moderate" category = "BBB+/-" interp = "MODERATE - may partially cross" else: card_class = "prediction-negative" category = "BBB-" interp = "LOW permeability - unlikely to cross" st.markdown(f"""

{category}

{score:.4f}

{interp}

""", unsafe_allow_html=True) if result['n_isomers'] > 1: st.markdown(f"""
Stereoisomer Analysis ({result['n_isomers']} isomers)
Range: {result['min']:.4f} - {result['max']:.4f}
Std Dev: {result['std']:.4f}
""", unsafe_allow_html=True) with col2: if img: st.image(img, caption=name, use_container_width=True) else: st.info("Molecule image not available") with col3: if props: st.markdown(f"**Formula:** {props['formula']}") st.markdown(f"**MW:** {props['mw']:.1f} Da") st.markdown(f"**LogP:** {props['logp']:.2f}") st.markdown(f"**TPSA:** {props['tpsa']:.1f} A²") st.markdown(f"**H-Donors:** {props['hbd']}") st.markdown(f"**H-Acceptors:** {props['hba']}") rules_color = "green" if props['rules_passed'] >= 4 else "orange" if props['rules_passed'] >= 3 else "red" st.markdown(f"**BBB Rules:** :{rules_color}[{props['rules_passed']}/5 passed]") # Download section st.markdown("---") st.subheader("Export Results") report = { 'molecule': name, 'smiles': smiles, 'bbb_score': round(score, 4), 'category': category, 'interpretation': interp, 'n_stereoisomers': result['n_isomers'], 'score_min': round(result['min'], 4), 'score_max': round(result['max'], 4), 'score_std': round(result['std'], 4), 'model_type': model_info['type'], 'model_name': model_info['name'], 'timestamp': datetime.now().isoformat() } if props: report.update({ 'formula': props['formula'], 'molecular_weight': round(props['mw'], 2), 'logp': round(props['logp'], 2), 'tpsa': round(props['tpsa'], 2), 'h_donors': props['hbd'], 'h_acceptors': props['hba'], 'bbb_rules_passed': props['rules_passed'], }) col1, col2, col3 = st.columns(3) with col1: st.download_button( "Download JSON", json.dumps(report, indent=2), f"{name.replace(' ','_')}_bbb_prediction.json", "application/json", use_container_width=True ) with col2: df = pd.DataFrame([report]) st.download_button( "Download CSV", df.to_csv(index=False), f"{name.replace(' ','_')}_bbb_prediction.csv", "text/csv", use_container_width=True ) with col3: # Create simple text report text_report = f"""BBB Permeability Prediction Report ===================================== Molecule: {name} SMILES: {smiles} Score: {score:.4f} Category: {category} Interpretation: {interp} Model: {model_info['name']} Timestamp: {datetime.now().strftime('%Y-%m-%d %H:%M:%S')} Molecular Properties: - Formula: {props['formula'] if props else 'N/A'} - MW: {props['mw']:.1f if props else 'N/A'} Da - LogP: {props['logp']:.2f if props else 'N/A'} - TPSA: {props['tpsa']:.1f if props else 'N/A'} A² - BBB Rules: {props['rules_passed'] if props else 'N/A'}/5 passed Generated by StereoGNN-BBB Author: Nabil Yasini-Ardekani """ st.download_button( "Download TXT", text_report, f"{name.replace(' ','_')}_bbb_prediction.txt", "text/plain", use_container_width=True ) # Footer with available molecules with st.expander("Available Drug Names (click to expand)"): drug_list = sorted(MOLECULES.keys()) cols = st.columns(5) for i, drug in enumerate(drug_list): with cols[i % 5]: st.write(f"• {drug.capitalize()}") if __name__ == "__main__": main()