import os import re import pandas as pd from io import StringIO import rdkit from rdkit import Chem from rdkit.Chem import AllChem, Draw import numpy as np from PIL import Image, ImageDraw, ImageFont import matplotlib.pyplot as plt import matplotlib.patches as patches from io import BytesIO import tempfile from rdkit import Chem, RDLogger RDLogger.DisableLog('rdApp.*') import pdb class PeptideAnalyzer: def __init__(self): self.bond_patterns = [ (r'OC\(=O\)', 'ester'), # Ester bond (r'N\(C\)C\(=O\)', 'n_methyl'), # N-methylated peptide bond (r'N[0-9]C\(=O\)', 'proline'), # Proline peptide bond (r'NC\(=O\)', 'peptide'), # Standard peptide bond (r'C\(=O\)N\(C\)', 'n_methyl_reverse'), # Reverse N-methylated (r'C\(=O\)N[12]?', 'peptide_reverse') # Reverse peptide bond ] # Three to one letter code mapping self.three_to_one = { 'Ala': 'A', 'Cys': 'C', 'Asp': 'D', 'Glu': 'E', 'Phe': 'F', 'Gly': 'G', 'His': 'H', 'Ile': 'I', 'Lys': 'K', 'Leu': 'L', 'Met': 'M', 'Asn': 'N', 'Pro': 'P', 'Gln': 'Q', 'Arg': 'R', 'Ser': 'S', 'Thr': 'T', 'Val': 'V', 'Trp': 'W', 'Tyr': 'Y' } def is_peptide(self, smiles): """Check if the SMILES represents a peptide structure""" # pdb.set_trace() mol = Chem.MolFromSmiles(smiles) if mol is None: return False # Look for peptide bonds: NC(=O) pattern peptide_bond_pattern = Chem.MolFromSmarts('[NH][C](=O)') if mol.HasSubstructMatch(peptide_bond_pattern): return True # Look for N-methylated peptide bonds: N(C)C(=O) pattern n_methyl_pattern = Chem.MolFromSmarts('[N;H0;$(NC)](C)[C](=O)') if mol.HasSubstructMatch(n_methyl_pattern): return True return False def is_cyclic(self, smiles): """Improved cyclic peptide detection""" # Check for C-terminal carboxyl if smiles.endswith('C(=O)O'): return False, [], [] # Find all numbers used in ring closures ring_numbers = re.findall(r'(?:^|[^c])[0-9](?=[A-Z@\(\)])', smiles) # Find aromatic ring numbers aromatic_matches = re.findall(r'c[0-9](?:ccccc|c\[nH\]c)[0-9]', smiles) aromatic_cycles = [] for match in aromatic_matches: numbers = re.findall(r'[0-9]', match) aromatic_cycles.extend(numbers) # Numbers that aren't part of aromatic rings are peptide cycles peptide_cycles = [n for n in ring_numbers if n not in aromatic_cycles] is_cyclic = len(peptide_cycles) > 0 and not smiles.endswith('C(=O)O') return is_cyclic, peptide_cycles, aromatic_cycles def split_on_bonds(self, smiles): """Split SMILES into segments with simplified Pro handling""" positions = [] used = set() # Find Gly pattern first gly_pattern = r'NCC\(=O\)' for match in re.finditer(gly_pattern, smiles): if not any(p in range(match.start(), match.end()) for p in used): positions.append({ 'start': match.start(), 'end': match.end(), 'type': 'gly', 'pattern': match.group() }) used.update(range(match.start(), match.end())) for pattern, bond_type in self.bond_patterns: for match in re.finditer(pattern, smiles): if not any(p in range(match.start(), match.end()) for p in used): positions.append({ 'start': match.start(), 'end': match.end(), 'type': bond_type, 'pattern': match.group() }) used.update(range(match.start(), match.end())) # Sort by position positions.sort(key=lambda x: x['start']) # Create segments segments = [] if positions: # First segment if positions[0]['start'] > 0: segments.append({ 'content': smiles[0:positions[0]['start']], 'bond_after': positions[0]['pattern'] }) # Process segments for i in range(len(positions)-1): current = positions[i] next_pos = positions[i+1] if current['type'] == 'gly': segments.append({ 'content': 'NCC(=O)', 'bond_before': positions[i-1]['pattern'] if i > 0 else None, 'bond_after': next_pos['pattern'] }) else: content = smiles[current['end']:next_pos['start']] if content: segments.append({ 'content': content, 'bond_before': current['pattern'], 'bond_after': next_pos['pattern'] }) # Last segment if positions[-1]['end'] < len(smiles): segments.append({ 'content': smiles[positions[-1]['end']:], 'bond_before': positions[-1]['pattern'] }) return segments def clean_terminal_carboxyl(self, segment): """Remove C-terminal carboxyl only if it's the true terminus""" content = segment['content'] # Only clean if: # 1. Contains C(=O)O # 2. No bond_after exists (meaning it's the last segment) # 3. C(=O)O is at the end of the content if 'C(=O)O' in content and not segment.get('bond_after'): print('recognized?') # Remove C(=O)O pattern regardless of position cleaned = re.sub(r'\(C\(=O\)O\)', '', content) # Remove any leftover empty parentheses cleaned = re.sub(r'\(\)', '', cleaned) print(cleaned) return cleaned return content def identify_residue(self, segment): """Identify residue with Pro reconstruction""" # Only clean terminal carboxyl if this is the last segment content = self.clean_terminal_carboxyl(segment) mods = self.get_modifications(segment) # UAA pattern matching section - before regular residues # Phenylglycine and derivatives if 'c1ccccc1' in content: if '[C@@H](c1ccccc1)' in content or '[C@H](c1ccccc1)' in content: return '4', mods # Base phenylglycine # 4-substituted phenylalanines if 'Cc1ccc' in content: if 'OMe' in content or 'OCc1ccc' in content: return '0A1', mods # 4-methoxy-Phenylalanine elif 'Clc1ccc' in content: return '200', mods # 4-chloro-Phenylalanine elif 'Brc1ccc' in content: return '4BF', mods # 4-Bromo-phenylalanine elif 'C#Nc1ccc' in content: return '4CF', mods # 4-cyano-phenylalanine elif 'Ic1ccc' in content: return 'PHI', mods # 4-Iodo-phenylalanine elif 'Fc1ccc' in content: return 'PFF', mods # 4-Fluoro-phenylalanine # Modified tryptophans if 'c[nH]c2' in content: if 'Oc2cccc2' in content: return '0AF', mods # 7-hydroxy-tryptophan elif 'Fc2cccc2' in content: return '4FW', mods # 4-fluoro-tryptophan elif 'Clc2cccc2' in content: return '6CW', mods # 6-chloro-tryptophan elif 'Brc2cccc2' in content: return 'BTR', mods # 6-bromo-tryptophan elif 'COc2cccc2' in content: return 'MOT5', mods # 5-Methoxy-tryptophan elif 'Cc2cccc2' in content: return 'MTR5', mods # 5-Methyl-tryptophan # Special amino acids if 'CC(C)(C)[C@@H]' in content or 'CC(C)(C)[C@H]' in content: return 'BUG', mods # Tertleucine if 'CCCNC(=N)N' in content: return 'CIR', mods # Citrulline if '[SeH]' in content: return 'CSE', mods # Selenocysteine if '[NH3]CC[C@@H]' in content or '[NH3]CC[C@H]' in content: return 'DAB', mods # Diaminobutyric acid if 'C1CCCCC1' in content: if 'C1CCCCC1[C@@H]' in content or 'C1CCCCC1[C@H]' in content: return 'CHG', mods # Cyclohexylglycine elif 'C1CCCCC1C[C@@H]' in content or 'C1CCCCC1C[C@H]' in content: return 'ALC', mods # 3-cyclohexyl-alanine # Naphthalene derivatives if 'c1cccc2c1cccc2' in content: if 'c1cccc2c1cccc2[C@@H]' in content or 'c1cccc2c1cccc2[C@H]' in content: return 'NAL', mods # 2-Naphthyl-alanine # Heteroaromatic derivatives if 'c1cncc' in content: return 'PYR4', mods # 3-(4-Pyridyl)-alanine if 'c1cscc' in content: return 'THA3', mods # 3-(3-thienyl)-alanine if 'c1nnc' in content: return 'TRZ4', mods # 3-(1,2,4-Triazol-1-yl)-alanine # Modified serines and threonines if 'OP(O)(O)O' in content: if '[C@@H](COP' in content or '[C@H](COP' in content: return 'SEP', mods # phosphoserine elif '[C@@H](OP' in content or '[C@H](OP' in content: return 'TPO', mods # phosphothreonine # Specialized ring systems if 'c1c2ccccc2cc2c1cccc2' in content: return 'ANTH', mods # 3-(9-anthryl)-alanine if 'c1csc2c1cccc2' in content: return 'BTH3', mods # 3-(3-benzothienyl)-alanine if '[C@]12C[C@H]3C[C@@H](C2)C[C@@H](C1)C3' in content: return 'ADAM', mods # Adamanthane # Fluorinated derivatives if 'FC(F)(F)' in content: if 'CC(F)(F)F' in content: return 'FLA', mods # Trifluoro-alanine if 'C(F)(F)F)c1' in content: if 'c1ccccc1C(F)(F)F' in content: return 'TFG2', mods # 2-(Trifluoromethyl)-phenylglycine if 'c1cccc(c1)C(F)(F)F' in content: return 'TFG3', mods # 3-(Trifluoromethyl)-phenylglycine if 'c1ccc(cc1)C(F)(F)F' in content: return 'TFG4', mods # 4-(Trifluoromethyl)-phenylglycine # Multiple halogen patterns if 'F' in content and 'c1' in content: if 'c1ccc(c(c1)F)F' in content: return 'F2F', mods # 3,4-Difluoro-phenylalanine if 'cc(F)cc(c1)F' in content: return 'WFP', mods # 3,5-Difluoro-phenylalanine if 'Cl' in content and 'c1' in content: if 'c1ccc(cc1Cl)Cl' in content: return 'CP24', mods # 2,4-dichloro-phenylalanine if 'c1ccc(c(c1)Cl)Cl' in content: return 'CP34', mods # 3,4-dichloro-phenylalanine # Hydroxy and amino derivatives if 'O' in content and 'c1' in content: if 'c1cc(O)cc(c1)O' in content: return '3FG', mods # (2s)-amino(3,5-dihydroxyphenyl)-ethanoic acid if 'c1ccc(c(c1)O)O' in content: return 'DAH', mods # 3,4-Dihydroxy-phenylalanine # Cyclic amino acids if 'C1CCCC1' in content: return 'CPA3', mods # 3-Cyclopentyl-alanine if 'C1CCCCC1' in content: if 'CC1CCCCC1' in content: return 'ALC', mods # 3-cyclohexyl-alanine else: return 'CHG', mods # Cyclohexylglycine # Chain-length variants if 'CCC[C@@H]' in content or 'CCC[C@H]' in content: return 'NLE', mods # Norleucine if 'CC[C@@H]' in content or 'CC[C@H]' in content: if not any(x in content for x in ['CC(C)', 'COC', 'CN(']): return 'ABA', mods # 2-Aminobutyric acid # Modified histidines if 'c1cnc' in content: if '[C@@H]1CN[C@@H](N1)F' in content: return '2HF', mods # 2-fluoro-l-histidine if 'c1cnc([nH]1)F' in content: return '2HF1', mods # 2-fluoro-l-histidine variant if 'c1c[nH]c(n1)F' in content: return '2HF2', mods # 2-fluoro-l-histidine variant # Sulfur and selenium containing if '[SeH]' in content: return 'CSE', mods # Selenocysteine if 'S' in content: if 'CSCc1ccccc1' in content: return 'BCS', mods # benzylcysteine if 'CCSC' in content: return 'ESC', mods # Ethionine if 'CCS' in content: return 'HCS', mods # homocysteine # Additional modifications if 'CN=[N]=N' in content: return 'AZDA', mods # azido-alanine if '[NH]=[C](=[NH2])=[NH2]' in content: if 'CCC[NH]=' in content: return 'AGM', mods # 5-methyl-arginine if 'CC[NH]=' in content: return 'GDPR', mods # 2-Amino-3-guanidinopropionic acid if 'CCON' in content: return 'CAN', mods # canaline if '[C@@H]1C=C[C@@H](C=C1)' in content: return 'ACZ', mods # cis-amiclenomycin if 'CCC(=O)[NH3]' in content: return 'ONL', mods # 5-oxo-l-norleucine if 'c1ccncc1' in content: return 'PYR4', mods # 3-(4-Pyridyl)-alanine if 'c1ccco1' in content: return 'FUA2', mods # (2-furyl)-alanine if 'c1ccc' in content: if 'c1ccc(cc1)c1ccccc1' in content: return 'BIF', mods # 4,4-biphenylalanine if 'c1ccc(cc1)C(=O)c1ccccc1' in content: return 'PBF', mods # 4-benzoyl-phenylalanine if 'c1ccc(cc1)C(C)(C)C' in content: return 'TBP4', mods # 4-tert-butyl-phenylalanine if 'c1ccc(cc1)[C](=[NH2])=[NH2]' in content: return '0BN', mods # 4-carbamimidoyl-l-phenylalanine if 'c1cccc(c1)[C](=[NH2])=[NH2]' in content: return 'APM', mods # m-amidinophenyl-3-alanine # Multiple hydroxy patterns if 'O' in content: if '[C@H]([C@H](C)O)O' in content: return 'ILX', mods # 4,5-dihydroxy-isoleucine if '[C@H]([C@@H](C)O)O' in content: return 'ALO', mods # Allo-threonine if '[C@H](COP(O)(O)O)' in content: return 'SEP', mods # phosphoserine if '[C@H]([C@@H](C)OP(O)(O)O)' in content: return 'TPO', mods # phosphothreonine if '[C@H](c1ccc(O)cc1)O' in content: return 'OMX', mods # (betar)-beta-hydroxy-l-tyrosine if '[C@H](c1ccc(c(Cl)c1)O)O' in content: return 'OMY', mods # (betar)-3-chloro-beta-hydroxy-l-tyrosine # Heterocyclic patterns if 'n1' in content: if 'n1cccn1' in content: return 'PYZ1', mods # 3-(1-Pyrazolyl)-alanine if 'n1nncn1' in content: return 'TEZA', mods # 3-(2-Tetrazolyl)-alanine if 'c2c(n1)cccc2' in content: return 'QU32', mods # 3-(2-Quinolyl)-alanine if 'c1cnc2c(c1)cccc2' in content: return 'QU33', mods # 3-(3-quinolyl)-alanine if 'c1ccnc2c1cccc2' in content: return 'QU34', mods # 3-(4-quinolyl)-alanine if 'c1ccc2c(c1)nccc2' in content: return 'QU35', mods # 3-(5-Quinolyl)-alanine if 'c1ccc2c(c1)cncc2' in content: return 'QU36', mods # 3-(6-Quinolyl)-alanine if 'c1cnc2c(n1)cccc2' in content: return 'QX32', mods # 3-(2-quinoxalyl)-alanine # Multiple nitrogen patterns if 'N' in content: if '[NH3]CC[C@@H]' in content: return 'DAB', mods # Diaminobutyric acid if '[NH3]C[C@@H]' in content: return 'DPP', mods # 2,3-Diaminopropanoic acid if '[NH3]CCCCCC[C@@H]' in content: return 'HHK', mods # (2s)-2,8-diaminooctanoic acid if 'CCC[NH]=[C](=[NH2])=[NH2]' in content: return 'GBUT', mods # 2-Amino-4-guanidinobutryric acid if '[NH]=[C](=S)=[NH2]' in content: return 'THIC', mods # Thio-citrulline # Chain modified amino acids if 'CC' in content: if 'CCCC[C@@H]' in content: return 'AHP', mods # 2-Aminoheptanoic acid if 'CCC([C@@H])(C)C' in content: return 'I2M', mods # 3-methyl-l-alloisoleucine if 'CC[C@H]([C@@H])C' in content: return 'IIL', mods # Allo-Isoleucine if '[C@H](CCC(C)C)' in content: return 'HLEU', mods # Homoleucine if '[C@@H]([C@@H](C)O)C' in content: return 'HLU', mods # beta-hydroxyleucine # Modified glutamate/aspartate patterns if '[C@@H]' in content: if '[C@@H](C[C@@H](F))' in content: return 'FGA4', mods # 4-Fluoro-glutamic acid if '[C@@H](C[C@@H](O))' in content: return '3GL', mods # 4-hydroxy-glutamic-acid if '[C@@H](C[C@H](C))' in content: return 'LME', mods # (3r)-3-methyl-l-glutamic acid if '[C@@H](CC[C@H](C))' in content: return 'MEG', mods # (3s)-3-methyl-l-glutamic acid # Sulfur and selenium modifications if 'S' in content: if 'SCC[C@@H]' in content: return 'HSER', mods # homoserine if 'SCCN' in content: return 'SLZ', mods # thialysine if 'SC(=O)' in content: return 'CSA', mods # s-acetonylcysteine if '[S@@](=O)' in content: return 'SME', mods # Methionine sulfoxide if 'S(=O)(=O)' in content: return 'OMT', mods # Methionine sulfone # Double bond containing if 'C=' in content: if 'C=C[C@@H]' in content: return '2AG', mods # 2-Allyl-glycine if 'C=C[C@@H]' in content: return 'LVG', mods # vinylglycine if 'C=Cc1ccccc1' in content: return 'STYA', mods # Styrylalanine # Special cases if '[C@@H]1Cc2c(C1)cccc2' in content: return 'IGL', mods # alpha-amino-2-indanacetic acid if '[C](=[C](=O)=O)=O' in content: return '26P', mods # 2-amino-6-oxopimelic acid if '[C](=[C](=O)=O)=C' in content: return '2NP', mods # l-2-amino-6-methylene-pimelic acid if 'c2cnc[nH]2' in content: return 'HIS', mods # histidine core if 'c1cccc2c1cc(O)cc2' in content: return 'NAO1', mods # 5-hydroxy-1-naphthalene if 'c1ccc2c(c1)cc(O)cc2' in content: return 'NAO2', mods # 6-hydroxy-2-naphthalene # Proline (P) - flexible ring numbers if any([ # Check for any ring number in bond patterns (segment.get('bond_after', '').startswith(f'N{n}C(=O)') and 'CCC' in content and any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789')) for n in '123456789' ]) or any([ # Check ending patterns with any ring number (f'CCCN{n}' in content and content.endswith('=O') and any(f'[C@@H]{n}' in content or f'[C@H]{n}' in content for n in '123456789')) for n in '123456789' ]) or any([ # Handle CCC[C@H]n patterns (content == f'CCC[C@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or (content == f'CCC[C@@H]{n}' and segment.get('bond_before', '').startswith(f'C(=O)N{n}')) or # N-terminal Pro with any ring number (f'N{n}CCC[C@H]{n}' in content) or (f'N{n}CCC[C@@H]{n}' in content) for n in '123456789' ]): return 'Pro', mods # Tryptophan (W) - more specific indole pattern if re.search(r'c[0-9]c\[nH\]c[0-9]ccccc[0-9][0-9]', content) and \ 'c[nH]c' in content.replace(' ', ''): return 'Trp', mods # Lysine (K) - both patterns if '[C@@H](CCCCN)' in content or '[C@H](CCCCN)' in content: return 'Lys', mods # Arginine (R) - both patterns if '[C@@H](CCCNC(=N)N)' in content or '[C@H](CCCNC(=N)N)' in content: return 'Arg', mods if ('C[C@H](CCCC)' in content or 'C[C@@H](CCCC)' in content) and 'CC(C)' not in content: return 'Nle', mods # Ornithine (Orn) - 3-carbon chain with NH2 if ('C[C@H](CCCN)' in content or 'C[C@@H](CCCN)' in content) and 'CC(C)' not in content: return 'Orn', mods # 2-Naphthylalanine (2Nal) - distinct from Phe pattern if ('Cc3cc2ccccc2c3' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return '2Nal', mods # Cyclohexylalanine (Cha) - already in your code but moved here for clarity if 'N2CCCCC2' in content or 'CCCCC2' in content: return 'Cha', mods # Aminobutyric acid (Abu) - 2-carbon chain if ('C[C@H](CC)' in content or 'C[C@@H](CC)' in content) and not any(p in content for p in ['CC(C)', 'CCCC', 'CCC(C)']): return 'Abu', mods # Pipecolic acid (Pip) - 6-membered ring like Pro if ('N3CCCCC3' in content or 'CCCCC3' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return 'Pip', mods # Cyclohexylglycine (Chg) - direct cyclohexyl without CH2 if ('C[C@H](C1CCCCC1)' in content or 'C[C@@H](C1CCCCC1)' in content): return 'Chg', mods # 4-Fluorophenylalanine (4F-Phe) if ('Cc2ccc(F)cc2' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return '4F-Phe', mods # Regular residue identification if ('NCC(=O)' in content) or (content == 'C'): # Middle case - between bonds if segment.get('bond_before') and segment.get('bond_after'): if ('C(=O)N' in segment['bond_before'] or 'C(=O)N(C)' in segment['bond_before']): return 'Gly', mods # Terminal case - at the end elif segment.get('bond_before') and segment.get('bond_before').startswith('C(=O)N'): return 'Gly', mods if 'CC(C)C[C@H]' in content or 'CC(C)C[C@@H]' in content: return 'Leu', mods if '[C@@H](CC(C)C)' in content or '[C@H](CC(C)C)' in content: return 'Leu', mods if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content: return 'Thr', mods if '[C@H](Cc2ccccc2)' in content or '[C@@H](Cc2ccccc2)' in content: return 'Phe', mods if ('[C@H](C(C)C)' in content or # With outer parentheses '[C@@H](C(C)C)' in content or # With outer parentheses '[C@H]C(C)C' in content or # Without outer parentheses '[C@@H]C(C)C' in content): # Without outer parentheses if not any(p in content for p in ['CC(C)C[C@H]', 'CC(C)C[C@@H]']): # Still check not Leu return 'Val', mods if '[C@H](COC(C)(C)C)' in content or '[C@@H](COC(C)(C)C)' in content: return 'O-tBu', mods if any([ 'CC[C@H](C)' in content, 'CC[C@@H](C)' in content, 'C(C)C[C@H]' in content and 'CC(C)C' not in content, 'C(C)C[C@@H]' in content and 'CC(C)C' not in content ]): return 'Ile', mods if ('[C@H](C)' in content or '[C@@H](C)' in content): if not any(p in content for p in ['C(C)C', 'COC', 'CN(', 'C(C)O', 'CC[C@H]', 'CC[C@@H]']): return 'Ala', mods # Tyrosine (Tyr) - 4-hydroxybenzyl side chain if re.search(r'Cc[0-9]ccc\(O\)cc[0-9]', content): return 'Tyr', mods # Serine (Ser) - Hydroxymethyl side chain if '[C@H](CO)' in content or '[C@@H](CO)' in content: if not ('C(C)O' in content or 'COC' in content): return 'Ser', mods # Threonine (Thr) - 1-hydroxyethyl side chain if '[C@@H]([C@@H](C)O)' in content or '[C@H]([C@H](C)O)' in content or '[C@@H](C)O' in content or '[C@H](C)O' in content: return 'Thr', mods # Cysteine (Cys) - Thiol side chain if '[C@H](CS)' in content or '[C@@H](CS)' in content: return 'Cys', mods # Methionine (Met) - Methylthioethyl side chain if ('C[C@H](CCSC)' in content or 'C[C@@H](CCSC)' in content): return 'Met', mods # Asparagine (Asn) - Carbamoylmethyl side chain if ('CC(=O)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return 'Asn', mods # Glutamine (Gln) - Carbamoylethyl side chain if ('CCC(=O)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return 'Gln', mods # Aspartic acid (Asp) - Carboxymethyl side chain if ('CC(=O)O' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return 'Asp', mods # Glutamic acid (Glu) - Carboxyethyl side chainCC(C(=O)O)N if ('CCC(=O)O' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return 'Glu', mods # Arginine (Arg) - 3-guanidinopropyl side chain if ('CCCNC(=N)N' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return 'Arg', mods # Histidine (His) - Imidazole side chain if ('Cc2cnc[nH]2' in content) and ('C[C@H]' in content or 'C[C@@H]' in content): return 'His', mods return None, mods def get_modifications(self, segment): """Get modifications based on bond types""" mods = [] if segment.get('bond_after'): if 'N(C)' in segment['bond_after'] or segment['bond_after'].startswith('C(=O)N(C)'): mods.append('N-Me') if 'OC(=O)' in segment['bond_after']: mods.append('O-linked') return mods def analyze_structure(self, smiles): """Main analysis function with debug output""" print("\nAnalyzing structure:", smiles) # Split into segments segments = self.split_on_bonds(smiles) print("\nSegment Analysis:") sequence = [] for i, segment in enumerate(segments): print(f"\nSegment {i}:") print(f"Content: {segment['content']}") print(f"Bond before: {segment.get('bond_before', 'None')}") print(f"Bond after: {segment.get('bond_after', 'None')}") residue, mods = self.identify_residue(segment) if residue: if mods: sequence.append(f"{residue}({','.join(mods)})") else: sequence.append(residue) print(f"Identified as: {residue}") print(f"Modifications: {mods}") else: print(f"Warning: Could not identify residue in segment: {segment['content']}") # Check if cyclic is_cyclic, peptide_cycles, aromatic_cycles = self.is_cyclic(smiles) three_letter = '-'.join(sequence) one_letter = ''.join(self.three_to_one.get(aa.split('(')[0], 'X') for aa in sequence) if is_cyclic: three_letter = f"cyclo({three_letter})" one_letter = f"cyclo({one_letter})" print(f"\nFinal sequence: {three_letter}") print(f"One-letter code: {one_letter}") print(f"Is cyclic: {is_cyclic}") #print(f"Peptide cycles: {peptide_cycles}") #print(f"Aromatic cycles: {aromatic_cycles}") return three_letter, len(segments) """return { 'three_letter': three_letter, #'one_letter': one_letter, 'is_cyclic': is_cyclic }""" def return_sequence(self, smiles): """Main analysis function with debug output""" print("\nAnalyzing structure:", smiles) # Split into segments segments = self.split_on_bonds(smiles) print("\nSegment Analysis:") sequence = [] for i, segment in enumerate(segments): print(f"\nSegment {i}:") print(f"Content: {segment['content']}") print(f"Bond before: {segment.get('bond_before', 'None')}") print(f"Bond after: {segment.get('bond_after', 'None')}") residue, mods = self.identify_residue(segment) if residue: if mods: sequence.append(f"{residue}({','.join(mods)})") else: sequence.append(residue) print(f"Identified as: {residue}") print(f"Modifications: {mods}") else: print(f"Warning: Could not identify residue in segment: {segment['content']}") return sequence """ def annotate_cyclic_structure(mol, sequence): '''Create annotated 2D structure with clear, non-overlapping residue labels''' # Generate 2D coordinates # Generate 2D coordinates AllChem.Compute2DCoords(mol) # Create drawer with larger size for annotations drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000) # Even larger size # Get residue list and reverse it to match structural representation if sequence.startswith('cyclo('): residues = sequence[6:-1].split('-') else: residues = sequence.split('-') residues = list(reversed(residues)) # Reverse the sequence # Draw molecule first to get its bounds drawer.drawOptions().addAtomIndices = False drawer.DrawMolecule(mol) drawer.FinishDrawing() # Convert to PIL Image img = Image.open(BytesIO(drawer.GetDrawingText())) draw = ImageDraw.Draw(img) try: # Try to use DejaVuSans as it's commonly available on Linux systems font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60) small_font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60) except OSError: try: # Fallback to Arial if available (common on Windows) font = ImageFont.truetype("arial.ttf", 60) small_font = ImageFont.truetype("arial.ttf", 60) except OSError: # If no TrueType fonts are available, fall back to default print("Warning: TrueType fonts not available, using default font") font = ImageFont.load_default() small_font = ImageFont.load_default() # Get molecule bounds conf = mol.GetConformer() positions = [] for i in range(mol.GetNumAtoms()): pos = conf.GetAtomPosition(i) positions.append((pos.x, pos.y)) x_coords = [p[0] for p in positions] y_coords = [p[1] for p in positions] min_x, max_x = min(x_coords), max(x_coords) min_y, max_y = min(y_coords), max(y_coords) # Calculate scaling factors scale = 150 # Increased scale factor center_x = 1000 # Image center center_y = 1000 # Add residue labels in a circular arrangement around the structure n_residues = len(residues) radius = 700 # Distance of labels from center # Start from the rightmost point (3 o'clock position) and go counterclockwise # Offset by -3 positions to align with structure offset = 0 # Adjust this value to match the structure alignment for i, residue in enumerate(residues): # Calculate position in a circle around the structure # Start from 0 (3 o'clock) and go counterclockwise angle = -(2 * np.pi * ((i + offset) % n_residues) / n_residues) # Calculate label position label_x = center_x + radius * np.cos(angle) label_y = center_y + radius * np.sin(angle) # Draw residue label text = f"{i+1}. {residue}" bbox = draw.textbbox((label_x, label_y), text, font=font) padding = 10 draw.rectangle([bbox[0]-padding, bbox[1]-padding, bbox[2]+padding, bbox[3]+padding], fill='white', outline='white') draw.text((label_x, label_y), text, font=font, fill='black', anchor="mm") # Add sequence at the top with white background seq_text = f"Sequence: {sequence}" bbox = draw.textbbox((center_x, 100), seq_text, font=small_font) padding = 10 draw.rectangle([bbox[0]-padding, bbox[1]-padding, bbox[2]+padding, bbox[3]+padding], fill='white', outline='white') draw.text((center_x, 100), seq_text, font=small_font, fill='black', anchor="mm") return img """ def annotate_cyclic_structure(mol, sequence): """Create structure visualization with just the sequence header""" # Generate 2D coordinates AllChem.Compute2DCoords(mol) # Create drawer with larger size for annotations drawer = Draw.rdMolDraw2D.MolDraw2DCairo(2000, 2000) # Draw molecule first drawer.drawOptions().addAtomIndices = False drawer.DrawMolecule(mol) drawer.FinishDrawing() # Convert to PIL Image img = Image.open(BytesIO(drawer.GetDrawingText())) draw = ImageDraw.Draw(img) try: small_font = ImageFont.truetype("/usr/share/fonts/truetype/dejavu/DejaVuSans.ttf", 60) except OSError: try: small_font = ImageFont.truetype("arial.ttf", 60) except OSError: print("Warning: TrueType fonts not available, using default font") small_font = ImageFont.load_default() # Add just the sequence header at the top seq_text = f"Sequence: {sequence}" bbox = draw.textbbox((1000, 100), seq_text, font=small_font) padding = 10 draw.rectangle([bbox[0]-padding, bbox[1]-padding, bbox[2]+padding, bbox[3]+padding], fill='white', outline='white') draw.text((1000, 100), seq_text, font=small_font, fill='black', anchor="mm") return img def create_enhanced_linear_viz(sequence, smiles): """Create an enhanced linear representation using PeptideAnalyzer""" analyzer = PeptideAnalyzer() # Create analyzer instance # Create figure with two subplots fig = plt.figure(figsize=(15, 10)) gs = fig.add_gridspec(2, 1, height_ratios=[1, 2]) ax_struct = fig.add_subplot(gs[0]) ax_detail = fig.add_subplot(gs[1]) # Parse sequence and get residues if sequence.startswith('cyclo('): residues = sequence[6:-1].split('-') else: residues = sequence.split('-') # Get segments using analyzer segments = analyzer.split_on_bonds(smiles) # Debug print print(f"Number of residues: {len(residues)}") print(f"Number of segments: {len(segments)}") # Top subplot - Basic structure ax_struct.set_xlim(0, 10) ax_struct.set_ylim(0, 2) num_residues = len(residues) spacing = 9.0 / (num_residues - 1) if num_residues > 1 else 9.0 # Draw basic structure y_pos = 1.5 for i in range(num_residues): x_pos = 0.5 + i * spacing # Draw amino acid box rect = patches.Rectangle((x_pos-0.3, y_pos-0.2), 0.6, 0.4, facecolor='lightblue', edgecolor='black') ax_struct.add_patch(rect) # Draw connecting bonds if not the last residue if i < num_residues - 1: segment = segments[i] if i < len(segments) else None if segment: # Determine bond type from segment info bond_type = 'ester' if 'O-linked' in segment.get('bond_after', '') else 'peptide' is_n_methylated = 'N-Me' in segment.get('bond_after', '') bond_color = 'red' if bond_type == 'ester' else 'black' linestyle = '--' if bond_type == 'ester' else '-' # Draw bond line ax_struct.plot([x_pos+0.3, x_pos+spacing-0.3], [y_pos, y_pos], color=bond_color, linestyle=linestyle, linewidth=2) # Add bond type label mid_x = x_pos + spacing/2 bond_label = f"{bond_type}" if is_n_methylated: bond_label += "\n(N-Me)" ax_struct.text(mid_x, y_pos+0.1, bond_label, ha='center', va='bottom', fontsize=10, color=bond_color) # Add residue label ax_struct.text(x_pos, y_pos-0.5, residues[i], ha='center', va='top', fontsize=14) # Bottom subplot - Detailed breakdown ax_detail.set_ylim(0, len(segments)+1) ax_detail.set_xlim(0, 1) # Create detailed breakdown segment_y = len(segments) # Start from top for i, segment in enumerate(segments): y = segment_y - i # Check if this is a bond or residue residue, mods = analyzer.identify_residue(segment) if residue: text = f"Residue {i+1}: {residue}" if mods: text += f" ({', '.join(mods)})" color = 'blue' else: # Must be a bond text = f"Bond {i}: " if 'O-linked' in segment.get('bond_after', ''): text += "ester" elif 'N-Me' in segment.get('bond_after', ''): text += "peptide (N-methylated)" else: text += "peptide" color = 'red' # Add segment analysis ax_detail.text(0.05, y, text, fontsize=12, color=color) ax_detail.text(0.5, y, f"SMILES: {segment.get('content', '')}", fontsize=10, color='gray') # If cyclic, add connection indicator if sequence.startswith('cyclo('): ax_struct.annotate('', xy=(9.5, y_pos), xytext=(0.5, y_pos), arrowprops=dict(arrowstyle='<->', color='red', lw=2)) ax_struct.text(5, y_pos+0.3, 'Cyclic Connection', ha='center', color='red', fontsize=14) # Add titles and adjust layout ax_struct.set_title("Peptide Structure Overview", pad=20) ax_detail.set_title("Segment Analysis Breakdown", pad=20) # Remove axes for ax in [ax_struct, ax_detail]: ax.set_xticks([]) ax.set_yticks([]) ax.axis('off') plt.tight_layout() return fig class PeptideStructureGenerator: """A class to generate 3D structures of peptides using different embedding methods""" @staticmethod def prepare_molecule(smiles): """Prepare molecule with proper hydrogen handling""" mol = Chem.MolFromSmiles(smiles, sanitize=False) if mol is None: raise ValueError("Failed to create molecule from SMILES") # Calculate valence for each atom for atom in mol.GetAtoms(): atom.UpdatePropertyCache(strict=False) # Sanitize with reduced requirements Chem.SanitizeMol(mol, sanitizeOps=Chem.SANITIZE_FINDRADICALS| Chem.SANITIZE_KEKULIZE| Chem.SANITIZE_SETAROMATICITY| Chem.SANITIZE_SETCONJUGATION| Chem.SANITIZE_SETHYBRIDIZATION| Chem.SANITIZE_CLEANUPCHIRALITY) mol = Chem.AddHs(mol) return mol @staticmethod def get_etkdg_params(attempt=0): """Get ETKDG parameters with optional modifications based on attempt number""" params = AllChem.ETKDGv3() params.randomSeed = -1 params.maxIterations = 200 params.numThreads = 4 # Reduced for web interface params.useBasicKnowledge = True params.enforceChirality = True params.useExpTorsionAnglePrefs = True params.useSmallRingTorsions = True params.useMacrocycleTorsions = True params.ETversion = 2 params.pruneRmsThresh = -1 params.embedRmsThresh = 0.5 if attempt > 10: params.bondLength = 1.5 + (attempt - 10) * 0.02 params.useExpTorsionAnglePrefs = False return params def generate_structure_etkdg(self, smiles, max_attempts=20): """Generate 3D structure using ETKDG without UFF optimization""" success = False mol = None for attempt in range(max_attempts): try: mol = self.prepare_molecule(smiles) params = self.get_etkdg_params(attempt) if AllChem.EmbedMolecule(mol, params) == 0: success = True break except Exception as e: continue if not success: raise ValueError("Failed to generate structure with ETKDG") return mol def generate_structure_uff(self, smiles, max_attempts=20): """Generate 3D structure using ETKDG followed by UFF optimization""" best_mol = None lowest_energy = float('inf') for attempt in range(max_attempts): try: test_mol = self.prepare_molecule(smiles) params = self.get_etkdg_params(attempt) if AllChem.EmbedMolecule(test_mol, params) == 0: res = AllChem.UFFOptimizeMolecule(test_mol, maxIters=2000, vdwThresh=10.0, confId=0, ignoreInterfragInteractions=True) if res == 0: ff = AllChem.UFFGetMoleculeForceField(test_mol) if ff: current_energy = ff.CalcEnergy() if current_energy < lowest_energy: lowest_energy = current_energy best_mol = Chem.Mol(test_mol) except Exception: continue if best_mol is None: raise ValueError("Failed to generate optimized structure") return best_mol @staticmethod def mol_to_sdf_bytes(mol): """Convert RDKit molecule to SDF file bytes""" # First write to StringIO in text mode sio = StringIO() writer = Chem.SDWriter(sio) writer.write(mol) writer.close() # Convert the string to bytes return sio.getvalue().encode('utf-8') def process_input(smiles_input=None, file_obj=None, show_linear=False, show_segment_details=False, generate_3d=False, use_uff=False): """Process input and create visualizations using PeptideAnalyzer""" analyzer = PeptideAnalyzer() temp_dir = tempfile.mkdtemp() if generate_3d else None structure_files = [] # Handle direct SMILES input if smiles_input: smiles = smiles_input.strip() # First check if it's a peptide using analyzer's method if not analyzer.is_peptide(smiles): return "Error: Input SMILES does not appear to be a peptide structure.", None, None try: # Create molecule mol = Chem.MolFromSmiles(smiles) if mol is None: return "Error: Invalid SMILES notation.", None, None # Generate 3D structures if requested if generate_3d: generator = PeptideStructureGenerator() try: # Generate ETKDG structure mol_etkdg = generator.generate_structure_etkdg(smiles) etkdg_path = os.path.join(temp_dir, "structure_etkdg.sdf") writer = Chem.SDWriter(etkdg_path) writer.write(mol_etkdg) writer.close() structure_files.append(etkdg_path) # Generate UFF structure if requested if use_uff: mol_uff = generator.generate_structure_uff(smiles) uff_path = os.path.join(temp_dir, "structure_uff.sdf") writer = Chem.SDWriter(uff_path) writer.write(mol_uff) writer.close() structure_files.append(uff_path) except Exception as e: return f"Error generating 3D structures: {str(e)}", None, None, None # Use analyzer to get sequence segments = analyzer.split_on_bonds(smiles) # Process segments and build sequence sequence_parts = [] output_text = "" # Only include segment analysis in output if requested if show_segment_details: output_text += "Segment Analysis:\n" for i, segment in enumerate(segments): output_text += f"\nSegment {i}:\n" output_text += f"Content: {segment['content']}\n" output_text += f"Bond before: {segment.get('bond_before', 'None')}\n" output_text += f"Bond after: {segment.get('bond_after', 'None')}\n" residue, mods = analyzer.identify_residue(segment) if residue: if mods: sequence_parts.append(f"{residue}({','.join(mods)})") else: sequence_parts.append(residue) output_text += f"Identified as: {residue}\n" output_text += f"Modifications: {mods}\n" else: output_text += f"Warning: Could not identify residue in segment: {segment['content']}\n" output_text += "\n" else: # Just build sequence without detailed analysis in output for segment in segments: residue, mods = analyzer.identify_residue(segment) if residue: if mods: sequence_parts.append(f"{residue}({','.join(mods)})") else: sequence_parts.append(residue) # Check if cyclic using analyzer's method is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles) three_letter = '-'.join(sequence_parts) one_letter = ''.join(analyzer.three_to_one.get(aa.split('(')[0], 'X') for aa in sequence_parts) if is_cyclic: three_letter = f"cyclo({three_letter})" one_letter = f"cyclo({one_letter})" # Create cyclic structure visualization img_cyclic = annotate_cyclic_structure(mol, three_letter) # Create linear representation if requested img_linear = None if show_linear: fig_linear = create_enhanced_linear_viz(three_letter, smiles) buf = BytesIO() fig_linear.savefig(buf, format='png', bbox_inches='tight', dpi=300) buf.seek(0) img_linear = Image.open(buf) plt.close(fig_linear) # Add summary to output summary = "Summary:\n" summary += f"Sequence: {three_letter}\n" summary += f"One-letter code: {one_letter}\n" summary += f"Is Cyclic: {'Yes' if is_cyclic else 'No'}\n" #if is_cyclic: #summary += f"Peptide Cycles: {', '.join(peptide_cycles)}\n" #summary += f"Aromatic Cycles: {', '.join(aromatic_cycles)}\n" if structure_files: summary += "\n3D Structures Generated:\n" for filepath in structure_files: summary += f"- {os.path.basename(filepath)}\n" return summary + output_text, img_cyclic, img_linear, structure_files if structure_files else None except Exception as e: return f"Error processing SMILES: {str(e)}", None, None, None # Handle file input if file_obj is not None: try: # Handle file content if hasattr(file_obj, 'name'): with open(file_obj.name, 'r') as f: content = f.read() else: content = file_obj.decode('utf-8') if isinstance(file_obj, bytes) else str(file_obj) output_text = "" for line in content.splitlines(): smiles = line.strip() if smiles: # Check if it's a peptide if not analyzer.is_peptide(smiles): output_text += f"Skipping non-peptide SMILES: {smiles}\n" continue # Process this SMILES segments = analyzer.split_on_bonds(smiles) sequence_parts = [] # Add segment details if requested if show_segment_details: output_text += f"\nSegment Analysis for SMILES: {smiles}\n" for i, segment in enumerate(segments): output_text += f"\nSegment {i}:\n" output_text += f"Content: {segment['content']}\n" output_text += f"Bond before: {segment.get('bond_before', 'None')}\n" output_text += f"Bond after: {segment.get('bond_after', 'None')}\n" residue, mods = analyzer.identify_residue(segment) if residue: if mods: sequence_parts.append(f"{residue}({','.join(mods)})") else: sequence_parts.append(residue) output_text += f"Identified as: {residue}\n" output_text += f"Modifications: {mods}\n" else: for segment in segments: residue, mods = analyzer.identify_residue(segment) if residue: if mods: sequence_parts.append(f"{residue}({','.join(mods)})") else: sequence_parts.append(residue) # Get cyclicity and create sequence is_cyclic, peptide_cycles, aromatic_cycles = analyzer.is_cyclic(smiles) sequence = f"cyclo({'-'.join(sequence_parts)})" if is_cyclic else '-'.join(sequence_parts) output_text += f"\nSummary for SMILES: {smiles}\n" output_text += f"Sequence: {sequence}\n" output_text += f"Is Cyclic: {'Yes' if is_cyclic else 'No'}\n" if is_cyclic: output_text += f"Peptide Cycles: {', '.join(peptide_cycles)}\n" #output_text += f"Aromatic Cycles: {', '.join(aromatic_cycles)}\n" output_text += "-" * 50 + "\n" return output_text, None, None except Exception as e: return f"Error processing file: {str(e)}", None, None return "No input provided.", None, None