| | import sys |
| | import os |
| | import xgboost as xgb |
| | import torch |
| | import numpy as np |
| | from transformers import AutoModelForMaskedLM |
| | import warnings |
| | import numpy as np |
| | from rdkit.Chem import Descriptors, rdMolDescriptors |
| | from rdkit import Chem, rdBase, DataStructs |
| | from rdkit.Chem import AllChem |
| | from typing import List |
| | from transformers import AutoModelForMaskedLM |
| |
|
| |
|
| | rdBase.DisableLog('rdApp.error') |
| | warnings.filterwarnings("ignore", category=DeprecationWarning) |
| | warnings.filterwarnings("ignore", category=UserWarning) |
| | warnings.filterwarnings("ignore", category=FutureWarning) |
| |
|
| | def fingerprints_from_smiles(smiles: List, size=2048): |
| | """ Create ECFP fingerprints of smiles, with validity check """ |
| | fps = [] |
| | valid_mask = [] |
| | for i, smile in enumerate(smiles): |
| | mol = Chem.MolFromSmiles(smile) |
| | valid_mask.append(int(mol is not None)) |
| | fp = fingerprints_from_mol(mol, size=size) if mol else np.zeros((1, size)) |
| | fps.append(fp) |
| |
|
| | fps = np.concatenate(fps, axis=0) |
| | return fps, valid_mask |
| |
|
| |
|
| | def fingerprints_from_mol(molecule, radius=3, size=2048, hashed=False): |
| | """ Create ECFP fingerprint of a molecule """ |
| | if hashed: |
| | fp_bits = AllChem.GetHashedMorganFingerprint(molecule, radius, nBits=size) |
| | else: |
| | fp_bits = AllChem.GetMorganFingerprintAsBitVect(molecule, radius, nBits=size) |
| | fp_np = np.zeros((1,)) |
| | DataStructs.ConvertToNumpyArray(fp_bits, fp_np) |
| | return fp_np.reshape(1, -1) |
| |
|
| | def getMolDescriptors(mol, missingVal=0): |
| | """ calculate the full list of descriptors for a molecule """ |
| |
|
| | values, names = [], [] |
| | for nm, fn in Descriptors._descList: |
| | try: |
| | val = fn(mol) |
| | except: |
| | val = missingVal |
| | values.append(val) |
| | names.append(nm) |
| |
|
| | custom_descriptors = {'hydrogen-bond donors': rdMolDescriptors.CalcNumLipinskiHBD, |
| | 'hydrogen-bond acceptors': rdMolDescriptors.CalcNumLipinskiHBA, |
| | 'rotatable bonds': rdMolDescriptors.CalcNumRotatableBonds,} |
| | |
| | for nm, fn in custom_descriptors.items(): |
| | try: |
| | val = fn(mol) |
| | except: |
| | val = missingVal |
| | values.append(val) |
| | names.append(nm) |
| | return values, names |
| |
|
| | def get_pep_dps_from_smi(smi): |
| | try: |
| | mol = Chem.MolFromSmiles(smi) |
| | except: |
| | print(f"convert smi {smi} to molecule failed!") |
| | mol = None |
| | |
| | dps, _ = getMolDescriptors(mol) |
| | return np.array(dps) |
| |
|
| |
|
| | def get_pep_dps(smi_list): |
| | if len(smi_list) == 0: |
| | return np.zeros((0, 213)) |
| | return np.array([get_pep_dps_from_smi(smi) for smi in smi_list]) |
| |
|
| | def check_smi_validity(smiles: list): |
| | valid_smi, valid_idx = [], [] |
| | for idx, smi in enumerate(smiles): |
| | try: |
| | mol = Chem.MolFromSmiles(smi) if smi else None |
| | if mol: |
| | valid_smi.append(smi) |
| | valid_idx.append(idx) |
| | except Exception as e: |
| | |
| | pass |
| | return valid_smi, valid_idx |
| |
|
| | class Permeability: |
| | |
| | def __init__(self, tokenizer, base_path, device=None, emb_model=None): |
| | self.device = torch.device("cuda" if torch.cuda.is_available() else "cpu") if device is None else device |
| | self.predictor = xgb.Booster(model_file=f'{base_path}/TR2-D2/tr2d2-pep/scoring/functions/classifiers/permeability-xgboost.json') |
| | if emb_model is not None: |
| | self.emb_model = emb_model.to(self.device).eval() |
| | else: |
| | self.emb_model = AutoModelForMaskedLM.from_pretrained('aaronfeller/PeptideCLM-23M-all').roformer.to(device).eval() |
| | |
| | self.tokenizer = tokenizer |
| |
|
| | def generate_embeddings(self, sequences): |
| | embeddings = [] |
| | for sequence in sequences: |
| | tokenized = self.tokenizer(sequence, return_tensors='pt') |
| | tokenized = {k: v.to(self.device) for k, v in tokenized.items()} |
| | with torch.no_grad(): |
| | output = self.emb_model(**tokenized) |
| | |
| | embedding = output.last_hidden_state.mean(dim=1).squeeze(0).cpu().numpy() |
| | embeddings.append(embedding) |
| | return np.array(embeddings) |
| | |
| | def get_features(self, input_seqs: list, dps=False, fps=False): |
| | |
| | |
| |
|
| | if fps: |
| | fingerprints = fingerprints_from_smiles(input_seqs)[0] |
| | else: |
| | fingerprints = torch.empty((len(input_seqs), 0)) |
| | |
| | if dps: |
| | descriptors = get_pep_dps(input_seqs) |
| | else: |
| | descriptors = torch.empty((len(input_seqs), 0)) |
| | |
| | embeddings = self.generate_embeddings(input_seqs) |
| | |
| |
|
| | features = np.concatenate([fingerprints, descriptors, embeddings], axis=1) |
| | |
| | return features |
| | |
| | def get_scores(self, input_seqs: list): |
| | scores = -10 * np.ones(len(input_seqs)) |
| | features = self.get_features(input_seqs) |
| | |
| | if len(features) == 0: |
| | return scores |
| | |
| | features = np.nan_to_num(features, nan=0.) |
| | features = np.clip(features, np.finfo(np.float32).min, np.finfo(np.float32).max) |
| | |
| | features = xgb.DMatrix(features) |
| | |
| | scores = self.predictor.predict(features) |
| | return scores |
| | |
| | def __call__(self, input_seqs: list): |
| | scores = self.get_scores(input_seqs) |
| | return scores |
| | |
| | def unittest(): |
| | permeability = Permeability() |
| | seq = ['N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cNc2c1cc(O)cc2)C(=O)N[C@@H](CC1=CN=C-N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H](O)C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC(=CN2)C1=C2C=CC=C1)C(=O)O'] |
| | scores = permeability(input_seqs=seq) |
| | print(scores) |
| |
|
| |
|
| | if __name__ == '__main__': |
| | unittest() |