Upload 14 files
Browse files- 1_Pooling/config.json +10 -0
- README.md +515 -3
- config.json +26 -0
- config_chem_mrl.json +37 -0
- config_sentence_transformers.json +14 -0
- merges.txt +1 -0
- model.safetensors +3 -0
- modules.json +20 -0
- sentence_bert_config.json +4 -0
- similarity_evaluation_pubchem_10m_genmol_similarity_float32_results.csv +38 -0
- special_tokens_map.json +51 -0
- tokenizer.json +684 -0
- tokenizer_config.json +59 -0
- vocab.json +1 -0
1_Pooling/config.json
ADDED
|
@@ -0,0 +1,10 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"word_embedding_dimension": 1024,
|
| 3 |
+
"pooling_mode_cls_token": false,
|
| 4 |
+
"pooling_mode_mean_tokens": true,
|
| 5 |
+
"pooling_mode_max_tokens": false,
|
| 6 |
+
"pooling_mode_mean_sqrt_len_tokens": false,
|
| 7 |
+
"pooling_mode_weightedmean_tokens": false,
|
| 8 |
+
"pooling_mode_lasttoken": false,
|
| 9 |
+
"include_prompt": true
|
| 10 |
+
}
|
README.md
CHANGED
|
@@ -1,3 +1,515 @@
|
|
| 1 |
-
---
|
| 2 |
-
|
| 3 |
-
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
---
|
| 2 |
+
language:
|
| 3 |
+
- en
|
| 4 |
+
tags:
|
| 5 |
+
- sentence-transformers
|
| 6 |
+
- sentence-similarity
|
| 7 |
+
- feature-extraction
|
| 8 |
+
- dense
|
| 9 |
+
- generated_from_trainer
|
| 10 |
+
- dataset_size:19692766
|
| 11 |
+
- loss:Matryoshka2dLoss
|
| 12 |
+
- loss:MatryoshkaLoss
|
| 13 |
+
- loss:TanimotoSentLoss
|
| 14 |
+
base_model: Derify/ChemBERTa-druglike
|
| 15 |
+
widget:
|
| 16 |
+
- source_sentence: CC1CCc2c(N)nc(C3CCCC3)n2C1
|
| 17 |
+
sentences:
|
| 18 |
+
- CC1CCc2c(N)nc(OC3CC3)n2C1
|
| 19 |
+
- CN1CC[NH+](C[C@H](O)C2CC2)C2(CCCCC2)C1
|
| 20 |
+
- Cc1c(F)cc(CNCC2CCC(C3CCC(C)CO3)CO2)cc1F
|
| 21 |
+
- source_sentence: CC(CCCO)NC(=O)CNc1ccccc1
|
| 22 |
+
sentences:
|
| 23 |
+
- CC(CCCO)N[C@H]1CCCN(Nc2ccccc2)[C@H]1C
|
| 24 |
+
- Cc1ccc(OC2=NCCO2)nc1
|
| 25 |
+
- Cc1ccccc1C#Cc1ccccc1N(O)c1ccccc1
|
| 26 |
+
- source_sentence: CCCCCCCc1ccc(CC=N[NH+]=C(N)N)cc1
|
| 27 |
+
sentences:
|
| 28 |
+
- COCC1(N2CCN(C)CC2)CCC[NH+]1Cc1cnc(N(C)C)nc1
|
| 29 |
+
- Cc1ccc(N=C(c2ccccc2)c2ccc(-n3ccnn3)cc2)cc1
|
| 30 |
+
- CCCCCCCc1cncc(CC=N[NH+]=C(N)N)c1
|
| 31 |
+
- source_sentence: CC(=CCCS(=O)(=O)[O-])C(=O)OCCCS(=O)(=O)[O-]
|
| 32 |
+
sentences:
|
| 33 |
+
- CC(=CCCS(=O)(=O)[O-])C(=O)OCCCS(=O)(=O)[O-]
|
| 34 |
+
- CCCCCOc1ccc(NC(=S)NC=O)cc1
|
| 35 |
+
- CCC(=O)N1CCCC(NC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)C1
|
| 36 |
+
- source_sentence: Clc1nccc(C#CCCc2nc3ccccc3o2)n1
|
| 37 |
+
sentences:
|
| 38 |
+
- O=Cc1nc2ccccc2o1
|
| 39 |
+
- O=C([O-])COc1ccc(CCCS(=O)(=O)c2ccc(Cl)cc2)cc1NC(=O)c1cccc(C=Cc2nc3ccccc3s2)c1
|
| 40 |
+
- O[C@H]1CN(C(Cc2ccccc2)c2ccccc2)C[C@@H]1Cc1cnc[nH]1
|
| 41 |
+
datasets:
|
| 42 |
+
- Derify/pubchem_10m_genmol_similarity
|
| 43 |
+
pipeline_tag: sentence-similarity
|
| 44 |
+
library_name: sentence-transformers
|
| 45 |
+
metrics:
|
| 46 |
+
- spearman
|
| 47 |
+
model-index:
|
| 48 |
+
- name: SentenceTransformer based on Derify/ChemBERTa-druglike
|
| 49 |
+
results:
|
| 50 |
+
- task:
|
| 51 |
+
type: semantic-similarity
|
| 52 |
+
name: Semantic Similarity
|
| 53 |
+
dataset:
|
| 54 |
+
name: pubchem 10m genmol similarity
|
| 55 |
+
type: pubchem_10m_genmol_similarity
|
| 56 |
+
metrics:
|
| 57 |
+
- type: spearman
|
| 58 |
+
value: 0.9932120589500998
|
| 59 |
+
name: Spearman
|
| 60 |
+
---
|
| 61 |
+
|
| 62 |
+
# SentenceTransformer based on Derify/ChemBERTa-druglike
|
| 63 |
+
|
| 64 |
+
This is a [Chem-MRL](https://github.com/emapco/chem-mrl) ([sentence-transformers](https://www.SBERT.net)) model finetuned from [Derify/ChemBERTa-druglike](https://huggingface.co/Derify/ChemBERTa-druglike) on the [pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity) dataset. It maps SMILES to a 1024-dimensional dense vector space and can be used for semantic textual similarity, semantic search, database indexing, molecular classification, clustering, and more.
|
| 65 |
+
|
| 66 |
+
## Model Details
|
| 67 |
+
|
| 68 |
+
### Model Description
|
| 69 |
+
- **Model Type:** ChemMRL (Sentence Transformer)
|
| 70 |
+
- **Base model:** [Derify/ChemBERTa-druglike](https://huggingface.co/Derify/ChemBERTa-druglike) <!-- at revision 5e76559157fde4f1aead643d9e1d402289f522af -->
|
| 71 |
+
- **Maximum Sequence Length:** 128 tokens
|
| 72 |
+
- **Output Dimensionality:** 1024 dimensions
|
| 73 |
+
- **Similarity Function:** Tanimoto
|
| 74 |
+
- **Training Dataset:**
|
| 75 |
+
- [pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity)
|
| 76 |
+
- **Language:** en
|
| 77 |
+
- **License:** [Apache-2.0](https://huggingface.co/Derify/ChemBERTa-druglike/blob/main/LICENSE)
|
| 78 |
+
|
| 79 |
+
### Model Sources
|
| 80 |
+
|
| 81 |
+
- **Repository:** [Chem-MRL on GitHub](https://github.com/emapco/chem-mrl)
|
| 82 |
+
- **Demo App Repository:** [Chem-MRL-demo on GitHub](https://github.com/emapco/chem-mrl-demo)
|
| 83 |
+
|
| 84 |
+
### Full Model Architecture
|
| 85 |
+
|
| 86 |
+
```
|
| 87 |
+
SentenceTransformer(
|
| 88 |
+
(0): Transformer({'max_seq_length': 128, 'do_lower_case': False, 'architecture': 'RobertaModel'})
|
| 89 |
+
(1): Pooling({'word_embedding_dimension': 1024, 'pooling_mode_cls_token': False, 'pooling_mode_mean_tokens': True, 'pooling_mode_max_tokens': False, 'pooling_mode_mean_sqrt_len_tokens': False, 'pooling_mode_weightedmean_tokens': False, 'pooling_mode_lasttoken': False, 'include_prompt': True})
|
| 90 |
+
(2): Normalize()
|
| 91 |
+
)
|
| 92 |
+
```
|
| 93 |
+
|
| 94 |
+
## Usage
|
| 95 |
+
|
| 96 |
+
### Direct Usage (Sentence Transformers)
|
| 97 |
+
|
| 98 |
+
First install the Sentence Transformers library:
|
| 99 |
+
|
| 100 |
+
```bash
|
| 101 |
+
pip install -U sentence-transformers
|
| 102 |
+
```
|
| 103 |
+
|
| 104 |
+
Then you can load this model and run inference.
|
| 105 |
+
```python
|
| 106 |
+
from chem_mrl import ChemMRL
|
| 107 |
+
|
| 108 |
+
# Download from the 🤗 Hub
|
| 109 |
+
model = ChemMRL("Derify/ChemMRL-beta")
|
| 110 |
+
# Run inference
|
| 111 |
+
sentences = [
|
| 112 |
+
"Clc1nccc(C#CCCc2nc3ccccc3o2)n1",
|
| 113 |
+
"O=Cc1nc2ccccc2o1",
|
| 114 |
+
"O[C@H]1CN(C(Cc2ccccc2)c2ccccc2)C[C@@H]1Cc1cnc[nH]1",
|
| 115 |
+
]
|
| 116 |
+
embeddings = model.encode(sentences)
|
| 117 |
+
print(embeddings.shape)
|
| 118 |
+
# [3, 1024]
|
| 119 |
+
|
| 120 |
+
# Get the similarity scores for the embeddings
|
| 121 |
+
similarities = model.similarity(embeddings, embeddings)
|
| 122 |
+
print(similarities)
|
| 123 |
+
# tensor([[1.0000, 0.4848, 0.2158],
|
| 124 |
+
# [0.4848, 1.0000, 0.1735],
|
| 125 |
+
# [0.2158, 0.1735, 1.0000]])
|
| 126 |
+
```
|
| 127 |
+
|
| 128 |
+
## Evaluation
|
| 129 |
+
|
| 130 |
+
### Metrics
|
| 131 |
+
|
| 132 |
+
#### Semantic Similarity
|
| 133 |
+
|
| 134 |
+
* Dataset: `pubchem_10m_genmol_similarity`
|
| 135 |
+
* Evaluated with <code>chem_mrl.evaluation.EmbeddingSimilarityEvaluator.EmbeddingSimilarityEvaluator</code> with these parameters:
|
| 136 |
+
```json
|
| 137 |
+
{
|
| 138 |
+
"precision": "float32"
|
| 139 |
+
}
|
| 140 |
+
```
|
| 141 |
+
|
| 142 |
+
| Metric | Value |
|
| 143 |
+
| :----------- | :--------- |
|
| 144 |
+
| **spearman** | **0.9932** |
|
| 145 |
+
|
| 146 |
+
<!--
|
| 147 |
+
## Bias, Risks and Limitations
|
| 148 |
+
|
| 149 |
+
*What are the known or foreseeable issues stemming from this model? You could also flag here known failure cases or weaknesses of the model.*
|
| 150 |
+
-->
|
| 151 |
+
|
| 152 |
+
<!--
|
| 153 |
+
### Recommendations
|
| 154 |
+
|
| 155 |
+
*What are recommendations with respect to the foreseeable issues? For example, filtering explicit content.*
|
| 156 |
+
-->
|
| 157 |
+
|
| 158 |
+
## Training Details
|
| 159 |
+
|
| 160 |
+
### Training Dataset
|
| 161 |
+
|
| 162 |
+
#### pubchem_10m_genmol_similarity
|
| 163 |
+
|
| 164 |
+
* Dataset: [pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity) at [f68d779](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity/tree/f68d779a6284578132a3922655f6b1f74c576642)
|
| 165 |
+
* Size: 19,692,766 training samples
|
| 166 |
+
* Columns: <code>smiles_a</code>, <code>smiles_b</code>, and <code>label</code>
|
| 167 |
+
* Approximate statistics based on the first 1000 samples:
|
| 168 |
+
| | smiles_a | smiles_b | label |
|
| 169 |
+
| :------ | :---------------------------------------------------------------------------------- | :---------------------------------------------------------------------------------- | :-------------------------------------------------------------- |
|
| 170 |
+
| type | string | string | float |
|
| 171 |
+
| details | <ul><li>min: 17 tokens</li><li>mean: 39.66 tokens</li><li>max: 119 tokens</li></ul> | <ul><li>min: 11 tokens</li><li>mean: 38.29 tokens</li><li>max: 115 tokens</li></ul> | <ul><li>min: 0.02</li><li>mean: 0.57</li><li>max: 1.0</li></ul> |
|
| 172 |
+
* Samples:
|
| 173 |
+
| smiles_a | smiles_b | label |
|
| 174 |
+
| :--------------------------------------------------------------------------------------------------- | :------------------------------------------------------------------------------------------------- | :------------------------------ |
|
| 175 |
+
| <code>COc1ccc(NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4ccc(F)c(F)c4)cc3C)CC2)cc1NC(=O)C1CCCCC1</code> | <code>Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1NC(=O)C(C)[NH+]1CCC(C(=O)Nc2cccc(NC(=O)C3CCCCC3)c2)CC1</code> | <code>0.8495575189590454</code> |
|
| 176 |
+
| <code>OCCN1CC[NH+](Cc2ccccc2OC2CC2)CC1</code> | <code>OCCN1CC[NH+](Cc2ccccc2On2cccn2)CC1</code> | <code>0.6615384817123413</code> |
|
| 177 |
+
| <code>CC1CN(C(=O)C2CC[NH+](Cc3cccc(C(N)=O)c3)CC2)CC(C)O1</code> | <code>CC1CN(C(=O)C2CC[NH+](Cc3ccccc3)CC2)CC(C)O1</code> | <code>0.7123287916183472</code> |
|
| 178 |
+
* Loss: [<code>Matryoshka2dLoss</code>](https://sbert.net/docs/package_reference/sentence_transformer/losses.html#matryoshka2dloss) with these parameters:
|
| 179 |
+
```json
|
| 180 |
+
{
|
| 181 |
+
"loss": "TanimotoSentLoss",
|
| 182 |
+
"n_layers_per_step": -1,
|
| 183 |
+
"last_layer_weight": 2.0,
|
| 184 |
+
"prior_layers_weight": 1.0,
|
| 185 |
+
"kl_div_weight": 0.5,
|
| 186 |
+
"kl_temperature": 0.3,
|
| 187 |
+
"matryoshka_dims": [
|
| 188 |
+
1024,
|
| 189 |
+
512,
|
| 190 |
+
256,
|
| 191 |
+
128,
|
| 192 |
+
64,
|
| 193 |
+
32,
|
| 194 |
+
16,
|
| 195 |
+
8
|
| 196 |
+
],
|
| 197 |
+
"matryoshka_weights": [
|
| 198 |
+
1,
|
| 199 |
+
1,
|
| 200 |
+
1,
|
| 201 |
+
1,
|
| 202 |
+
1,
|
| 203 |
+
1,
|
| 204 |
+
1,
|
| 205 |
+
1
|
| 206 |
+
],
|
| 207 |
+
"n_dims_per_step": -1
|
| 208 |
+
}
|
| 209 |
+
```
|
| 210 |
+
|
| 211 |
+
### Training Hyperparameters
|
| 212 |
+
#### Non-Default Hyperparameters
|
| 213 |
+
|
| 214 |
+
- `eval_strategy`: steps
|
| 215 |
+
- `per_device_train_batch_size`: 64
|
| 216 |
+
- `per_device_eval_batch_size`: 128
|
| 217 |
+
- `learning_rate`: 8e-06
|
| 218 |
+
- `weight_decay`: 6.505130550397454e-06
|
| 219 |
+
- `warmup_ratio`: 0.2
|
| 220 |
+
- `data_seed`: 42
|
| 221 |
+
- `fp16`: True
|
| 222 |
+
- `tf32`: True
|
| 223 |
+
- `load_best_model_at_end`: True
|
| 224 |
+
- `optim`: adamw_apex_fused
|
| 225 |
+
- `dataloader_pin_memory`: False
|
| 226 |
+
|
| 227 |
+
#### All Hyperparameters
|
| 228 |
+
<details><summary>Click to expand</summary>
|
| 229 |
+
|
| 230 |
+
- `overwrite_output_dir`: False
|
| 231 |
+
- `do_predict`: False
|
| 232 |
+
- `eval_strategy`: steps
|
| 233 |
+
- `prediction_loss_only`: True
|
| 234 |
+
- `per_device_train_batch_size`: 64
|
| 235 |
+
- `per_device_eval_batch_size`: 128
|
| 236 |
+
- `per_gpu_train_batch_size`: None
|
| 237 |
+
- `per_gpu_eval_batch_size`: None
|
| 238 |
+
- `gradient_accumulation_steps`: 1
|
| 239 |
+
- `eval_accumulation_steps`: None
|
| 240 |
+
- `torch_empty_cache_steps`: None
|
| 241 |
+
- `learning_rate`: 8e-06
|
| 242 |
+
- `weight_decay`: 6.505130550397454e-06
|
| 243 |
+
- `adam_beta1`: 0.9
|
| 244 |
+
- `adam_beta2`: 0.999
|
| 245 |
+
- `adam_epsilon`: 1e-08
|
| 246 |
+
- `max_grad_norm`: 1.0
|
| 247 |
+
- `num_train_epochs`: 3
|
| 248 |
+
- `max_steps`: -1
|
| 249 |
+
- `lr_scheduler_type`: linear
|
| 250 |
+
- `lr_scheduler_kwargs`: {}
|
| 251 |
+
- `warmup_ratio`: 0.2
|
| 252 |
+
- `warmup_steps`: 0
|
| 253 |
+
- `log_level`: passive
|
| 254 |
+
- `log_level_replica`: warning
|
| 255 |
+
- `log_on_each_node`: True
|
| 256 |
+
- `logging_nan_inf_filter`: True
|
| 257 |
+
- `save_safetensors`: True
|
| 258 |
+
- `save_on_each_node`: False
|
| 259 |
+
- `save_only_model`: False
|
| 260 |
+
- `restore_callback_states_from_checkpoint`: False
|
| 261 |
+
- `no_cuda`: False
|
| 262 |
+
- `use_cpu`: False
|
| 263 |
+
- `use_mps_device`: False
|
| 264 |
+
- `seed`: 42
|
| 265 |
+
- `data_seed`: 42
|
| 266 |
+
- `jit_mode_eval`: False
|
| 267 |
+
- `use_ipex`: False
|
| 268 |
+
- `bf16`: False
|
| 269 |
+
- `fp16`: True
|
| 270 |
+
- `fp16_opt_level`: O1
|
| 271 |
+
- `half_precision_backend`: auto
|
| 272 |
+
- `bf16_full_eval`: False
|
| 273 |
+
- `fp16_full_eval`: False
|
| 274 |
+
- `tf32`: True
|
| 275 |
+
- `local_rank`: 0
|
| 276 |
+
- `ddp_backend`: None
|
| 277 |
+
- `tpu_num_cores`: None
|
| 278 |
+
- `tpu_metrics_debug`: False
|
| 279 |
+
- `debug`: []
|
| 280 |
+
- `dataloader_drop_last`: False
|
| 281 |
+
- `dataloader_num_workers`: 0
|
| 282 |
+
- `dataloader_prefetch_factor`: None
|
| 283 |
+
- `past_index`: -1
|
| 284 |
+
- `disable_tqdm`: False
|
| 285 |
+
- `remove_unused_columns`: True
|
| 286 |
+
- `label_names`: None
|
| 287 |
+
- `load_best_model_at_end`: True
|
| 288 |
+
- `ignore_data_skip`: False
|
| 289 |
+
- `fsdp`: []
|
| 290 |
+
- `fsdp_min_num_params`: 0
|
| 291 |
+
- `fsdp_config`: {'min_num_params': 0, 'xla': False, 'xla_fsdp_v2': False, 'xla_fsdp_grad_ckpt': False}
|
| 292 |
+
- `fsdp_transformer_layer_cls_to_wrap`: None
|
| 293 |
+
- `accelerator_config`: {'split_batches': False, 'dispatch_batches': None, 'even_batches': True, 'use_seedable_sampler': True, 'non_blocking': False, 'gradient_accumulation_kwargs': None}
|
| 294 |
+
- `deepspeed`: None
|
| 295 |
+
- `label_smoothing_factor`: 0.0
|
| 296 |
+
- `optim`: adamw_apex_fused
|
| 297 |
+
- `optim_args`: None
|
| 298 |
+
- `adafactor`: False
|
| 299 |
+
- `group_by_length`: False
|
| 300 |
+
- `length_column_name`: length
|
| 301 |
+
- `ddp_find_unused_parameters`: None
|
| 302 |
+
- `ddp_bucket_cap_mb`: None
|
| 303 |
+
- `ddp_broadcast_buffers`: False
|
| 304 |
+
- `dataloader_pin_memory`: False
|
| 305 |
+
- `dataloader_persistent_workers`: False
|
| 306 |
+
- `skip_memory_metrics`: True
|
| 307 |
+
- `use_legacy_prediction_loop`: False
|
| 308 |
+
- `push_to_hub`: False
|
| 309 |
+
- `hub_model_id`: None
|
| 310 |
+
- `hub_strategy`: every_save
|
| 311 |
+
- `hub_private_repo`: None
|
| 312 |
+
- `hub_always_push`: False
|
| 313 |
+
- `hub_revision`: None
|
| 314 |
+
- `gradient_checkpointing`: False
|
| 315 |
+
- `gradient_checkpointing_kwargs`: None
|
| 316 |
+
- `include_inputs_for_metrics`: False
|
| 317 |
+
- `include_for_metrics`: []
|
| 318 |
+
- `eval_do_concat_batches`: True
|
| 319 |
+
- `fp16_backend`: auto
|
| 320 |
+
- `push_to_hub_model_id`: None
|
| 321 |
+
- `push_to_hub_organization`: None
|
| 322 |
+
- `mp_parameters`:
|
| 323 |
+
- `auto_find_batch_size`: False
|
| 324 |
+
- `full_determinism`: False
|
| 325 |
+
- `torchdynamo`: None
|
| 326 |
+
- `ray_scope`: last
|
| 327 |
+
- `ddp_timeout`: 1800
|
| 328 |
+
- `torch_compile`: False
|
| 329 |
+
- `torch_compile_backend`: None
|
| 330 |
+
- `torch_compile_mode`: None
|
| 331 |
+
- `include_tokens_per_second`: False
|
| 332 |
+
- `include_num_input_tokens_seen`: False
|
| 333 |
+
- `neftune_noise_alpha`: None
|
| 334 |
+
- `optim_target_modules`: None
|
| 335 |
+
- `batch_eval_metrics`: False
|
| 336 |
+
- `eval_on_start`: False
|
| 337 |
+
- `use_liger_kernel`: False
|
| 338 |
+
- `liger_kernel_config`: None
|
| 339 |
+
- `eval_use_gather_object`: False
|
| 340 |
+
- `average_tokens_across_devices`: False
|
| 341 |
+
- `prompts`: None
|
| 342 |
+
- `batch_sampler`: batch_sampler
|
| 343 |
+
- `multi_dataset_batch_sampler`: proportional
|
| 344 |
+
- `router_mapping`: {}
|
| 345 |
+
- `learning_rate_mapping`: {}
|
| 346 |
+
|
| 347 |
+
</details>
|
| 348 |
+
|
| 349 |
+
### Training Logs
|
| 350 |
+
<details><summary>Click to expand</summary>
|
| 351 |
+
|
| 352 |
+
| Epoch | Step | Training Loss | pubchem_10m_genmol_similarity_spearman |
|
| 353 |
+
| :----: | :----: | :-----------: | :------------------------------------: |
|
| 354 |
+
| 0.0796 | 24500 | 121.4633 | - |
|
| 355 |
+
| 0.08 | 24616 | - | 0.9739 |
|
| 356 |
+
| 0.1592 | 49000 | 118.6111 | - |
|
| 357 |
+
| 0.16 | 49232 | - | 0.9817 |
|
| 358 |
+
| 0.2389 | 73500 | 117.491 | - |
|
| 359 |
+
| 0.24 | 73848 | - | 0.9848 |
|
| 360 |
+
| 0.3185 | 98000 | 116.3786 | - |
|
| 361 |
+
| 0.32 | 98464 | - | 0.9865 |
|
| 362 |
+
| 0.3997 | 123000 | 115.9773 | - |
|
| 363 |
+
| 0.4 | 123080 | - | 0.9873 |
|
| 364 |
+
| 0.4794 | 147500 | 115.2441 | - |
|
| 365 |
+
| 0.48 | 147696 | - | 0.9885 |
|
| 366 |
+
| 0.5590 | 172000 | 114.8674 | - |
|
| 367 |
+
| 0.56 | 172312 | - | 0.9887 |
|
| 368 |
+
| 0.6386 | 196500 | 114.6483 | - |
|
| 369 |
+
| 0.64 | 196928 | - | 0.9892 |
|
| 370 |
+
| 0.7199 | 221500 | 114.0507 | - |
|
| 371 |
+
| 0.72 | 221544 | - | 0.9898 |
|
| 372 |
+
| 0.7995 | 246000 | 113.5606 | - |
|
| 373 |
+
| 0.8 | 246160 | - | 0.9902 |
|
| 374 |
+
| 0.8791 | 270500 | 113.2762 | - |
|
| 375 |
+
| 0.88 | 270776 | - | 0.9907 |
|
| 376 |
+
| 0.9587 | 295000 | 113.3295 | - |
|
| 377 |
+
| 0.96 | 295392 | - | 0.9908 |
|
| 378 |
+
| 1.0400 | 320000 | 112.9253 | - |
|
| 379 |
+
| 1.04 | 320008 | - | 0.9909 |
|
| 380 |
+
| 1.1196 | 344500 | 112.584 | - |
|
| 381 |
+
| 1.12 | 344624 | - | 0.9910 |
|
| 382 |
+
| 1.1992 | 369000 | 112.616 | - |
|
| 383 |
+
| 1.2 | 369240 | - | 0.9916 |
|
| 384 |
+
| 1.2788 | 393500 | 112.4692 | - |
|
| 385 |
+
| 1.28 | 393856 | - | 0.9914 |
|
| 386 |
+
| 1.3585 | 418000 | 112.2679 | - |
|
| 387 |
+
| 1.3600 | 418472 | - | 0.9917 |
|
| 388 |
+
| 1.4397 | 443000 | 112.1639 | - |
|
| 389 |
+
| 1.44 | 443088 | - | 0.9919 |
|
| 390 |
+
| 1.5193 | 467500 | 112.1139 | - |
|
| 391 |
+
| 1.52 | 467704 | - | 0.9921 |
|
| 392 |
+
| 1.5990 | 492000 | 111.8096 | - |
|
| 393 |
+
| 1.6 | 492320 | - | 0.9923 |
|
| 394 |
+
| 1.6786 | 516500 | 111.8252 | - |
|
| 395 |
+
| 1.6800 | 516936 | - | 0.9922 |
|
| 396 |
+
| 1.7598 | 541500 | 111.836 | - |
|
| 397 |
+
| 1.76 | 541552 | - | 0.9924 |
|
| 398 |
+
| 1.8395 | 566000 | 111.8471 | - |
|
| 399 |
+
| 1.8400 | 566168 | - | 0.9924 |
|
| 400 |
+
| 1.9191 | 590500 | 111.7778 | - |
|
| 401 |
+
| 1.92 | 590784 | - | 0.9925 |
|
| 402 |
+
| 1.9987 | 615000 | 111.4892 | - |
|
| 403 |
+
| 2.0 | 615400 | - | 0.9927 |
|
| 404 |
+
| 2.0799 | 640000 | 111.2659 | - |
|
| 405 |
+
| 2.08 | 640016 | - | 0.9928 |
|
| 406 |
+
| 2.1596 | 664500 | 111.3635 | - |
|
| 407 |
+
| 2.16 | 664632 | - | 0.9927 |
|
| 408 |
+
| 2.2392 | 689000 | 111.0114 | - |
|
| 409 |
+
| 2.24 | 689248 | - | 0.9928 |
|
| 410 |
+
| 2.3188 | 713500 | 111.0559 | - |
|
| 411 |
+
| 2.32 | 713864 | - | 0.9929 |
|
| 412 |
+
| 2.3984 | 738000 | 110.5276 | - |
|
| 413 |
+
| 2.4 | 738480 | - | 0.9929 |
|
| 414 |
+
| 2.4797 | 763000 | 110.9828 | - |
|
| 415 |
+
| 2.48 | 763096 | - | 0.9930 |
|
| 416 |
+
| 2.5593 | 787500 | 110.8404 | - |
|
| 417 |
+
| 2.56 | 787712 | - | 0.9930 |
|
| 418 |
+
| 2.6389 | 812000 | 111.1937 | - |
|
| 419 |
+
| 2.64 | 812328 | - | 0.9931 |
|
| 420 |
+
| 2.7186 | 836500 | 110.6662 | - |
|
| 421 |
+
| 2.7200 | 836944 | - | 0.9931 |
|
| 422 |
+
| 2.7998 | 861500 | 110.7714 | - |
|
| 423 |
+
| 2.8 | 861560 | - | 0.9932 |
|
| 424 |
+
| 2.8794 | 886000 | 110.7638 | - |
|
| 425 |
+
| 2.88 | 886176 | - | 0.9932 |
|
| 426 |
+
| 2.9591 | 910500 | 110.7021 | - |
|
| 427 |
+
| 2.96 | 910792 | - | 0.9932 |
|
| 428 |
+
| 2.9997 | 923000 | 110.6097 | - |
|
| 429 |
+
</details>
|
| 430 |
+
|
| 431 |
+
### Training Hardware
|
| 432 |
+
- **On Cloud**: No
|
| 433 |
+
- **GPU Model**: 1 x NVIDIA GeForce RTX 3090
|
| 434 |
+
- **CPU Model**: AMD Ryzen 7 3700X 8-Core Processor
|
| 435 |
+
- **RAM Size**: 62.70 GB
|
| 436 |
+
|
| 437 |
+
### Framework Versions
|
| 438 |
+
- Python: 3.12.11
|
| 439 |
+
- Sentence Transformers: 5.0.0
|
| 440 |
+
- Transformers: 4.53.3
|
| 441 |
+
- PyTorch: 2.7.1+cu126
|
| 442 |
+
- Accelerate: 1.9.0
|
| 443 |
+
- Datasets: 3.6.0
|
| 444 |
+
- Tokenizers: 0.21.2
|
| 445 |
+
|
| 446 |
+
## Citation
|
| 447 |
+
|
| 448 |
+
### BibTeX
|
| 449 |
+
|
| 450 |
+
#### Sentence Transformers
|
| 451 |
+
```bibtex
|
| 452 |
+
@inproceedings{reimers-2019-sentence-bert,
|
| 453 |
+
title = "Sentence-BERT: Sentence Embeddings using Siamese BERT-Networks",
|
| 454 |
+
author = "Reimers, Nils and Gurevych, Iryna",
|
| 455 |
+
booktitle = "Proceedings of the 2019 Conference on Empirical Methods in Natural Language Processing",
|
| 456 |
+
month = "11",
|
| 457 |
+
year = "2019",
|
| 458 |
+
publisher = "Association for Computational Linguistics",
|
| 459 |
+
url = "https://arxiv.org/abs/1908.10084",
|
| 460 |
+
}
|
| 461 |
+
```
|
| 462 |
+
|
| 463 |
+
#### Matryoshka2dLoss
|
| 464 |
+
```bibtex
|
| 465 |
+
@misc{li20242d,
|
| 466 |
+
title={2D Matryoshka Sentence Embeddings},
|
| 467 |
+
author={Xianming Li and Zongxi Li and Jing Li and Haoran Xie and Qing Li},
|
| 468 |
+
year={2024},
|
| 469 |
+
eprint={2402.14776},
|
| 470 |
+
archivePrefix={arXiv},
|
| 471 |
+
primaryClass={cs.CL}
|
| 472 |
+
}
|
| 473 |
+
```
|
| 474 |
+
|
| 475 |
+
#### MatryoshkaLoss
|
| 476 |
+
```bibtex
|
| 477 |
+
@misc{kusupati2024matryoshka,
|
| 478 |
+
title={Matryoshka Representation Learning},
|
| 479 |
+
author={Aditya Kusupati and Gantavya Bhatt and Aniket Rege and Matthew Wallingford and Aditya Sinha and Vivek Ramanujan and William Howard-Snyder and Kaifeng Chen and Sham Kakade and Prateek Jain and Ali Farhadi},
|
| 480 |
+
year={2024},
|
| 481 |
+
eprint={2205.13147},
|
| 482 |
+
archivePrefix={arXiv},
|
| 483 |
+
primaryClass={cs.LG}
|
| 484 |
+
}
|
| 485 |
+
```
|
| 486 |
+
|
| 487 |
+
#### CoSENTLoss
|
| 488 |
+
```bibtex
|
| 489 |
+
@online{kexuefm-8847,
|
| 490 |
+
title={CoSENT: A more efficient sentence vector scheme than Sentence-BERT},
|
| 491 |
+
author={Su Jianlin},
|
| 492 |
+
year={2022},
|
| 493 |
+
month={Jan},
|
| 494 |
+
url={https://kexue.fm/archives/8847},
|
| 495 |
+
}
|
| 496 |
+
```
|
| 497 |
+
|
| 498 |
+
#### TanimotoSentLoss
|
| 499 |
+
```bibtex
|
| 500 |
+
@online{emapco-chem-mrl-tanimotosentloss,
|
| 501 |
+
title={TanimotoSentLoss: Tanimoto Loss for SMILES Embeddings},
|
| 502 |
+
author={Emmanuel Cortes},
|
| 503 |
+
year={2025},
|
| 504 |
+
month={Jan},
|
| 505 |
+
url={https://github.com/emapco/chem-mrl/blob/main/chem_mrl/losses/TanimotoLoss.py},
|
| 506 |
+
}
|
| 507 |
+
```
|
| 508 |
+
|
| 509 |
+
## Model Card Authors
|
| 510 |
+
|
| 511 |
+
[@eacortes](https://huggingface.co/eacortes)
|
| 512 |
+
|
| 513 |
+
## Model Card Contact
|
| 514 |
+
|
| 515 |
+
Manny Cortes (manny@derifyai.com)
|
config.json
ADDED
|
@@ -0,0 +1,26 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"architectures": [
|
| 3 |
+
"RobertaModel"
|
| 4 |
+
],
|
| 5 |
+
"attention_probs_dropout_prob": 0.1,
|
| 6 |
+
"bos_token_id": 0,
|
| 7 |
+
"classifier_dropout": null,
|
| 8 |
+
"eos_token_id": 2,
|
| 9 |
+
"hidden_act": "gelu",
|
| 10 |
+
"hidden_dropout_prob": 0.1,
|
| 11 |
+
"hidden_size": 1024,
|
| 12 |
+
"initializer_range": 0.02,
|
| 13 |
+
"intermediate_size": 4096,
|
| 14 |
+
"layer_norm_eps": 1e-12,
|
| 15 |
+
"max_position_embeddings": 130,
|
| 16 |
+
"model_type": "roberta",
|
| 17 |
+
"num_attention_heads": 8,
|
| 18 |
+
"num_hidden_layers": 12,
|
| 19 |
+
"pad_token_id": 1,
|
| 20 |
+
"position_embedding_type": "absolute",
|
| 21 |
+
"torch_dtype": "float32",
|
| 22 |
+
"transformers_version": "4.53.3",
|
| 23 |
+
"type_vocab_size": 1,
|
| 24 |
+
"use_cache": false,
|
| 25 |
+
"vocab_size": 581
|
| 26 |
+
}
|
config_chem_mrl.json
ADDED
|
@@ -0,0 +1,37 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"__version__": "0.7.2",
|
| 3 |
+
"embedding_pooling": "mean",
|
| 4 |
+
"eval_metric": "spearman",
|
| 5 |
+
"eval_similarity_fct": "tanimoto",
|
| 6 |
+
"kl_div_weight": 0.5,
|
| 7 |
+
"kl_temperature": 0.3,
|
| 8 |
+
"last_layer_weight": 2.0,
|
| 9 |
+
"loss_func": "tanimotosentloss",
|
| 10 |
+
"model_name": "Derify/ChemBERTa-druglike",
|
| 11 |
+
"mrl_dimension_weights": [
|
| 12 |
+
1,
|
| 13 |
+
1,
|
| 14 |
+
1,
|
| 15 |
+
1,
|
| 16 |
+
1,
|
| 17 |
+
1,
|
| 18 |
+
1,
|
| 19 |
+
1
|
| 20 |
+
],
|
| 21 |
+
"mrl_dimensions": [
|
| 22 |
+
1024,
|
| 23 |
+
512,
|
| 24 |
+
256,
|
| 25 |
+
128,
|
| 26 |
+
64,
|
| 27 |
+
32,
|
| 28 |
+
16,
|
| 29 |
+
8
|
| 30 |
+
],
|
| 31 |
+
"n_dims_per_step": -1,
|
| 32 |
+
"n_layers_per_step": -1,
|
| 33 |
+
"prior_layers_weight": 1.0,
|
| 34 |
+
"tanimoto_similarity_loss_func": null,
|
| 35 |
+
"use_2d_matryoshka": true,
|
| 36 |
+
"use_query_tokenizer": false
|
| 37 |
+
}
|
config_sentence_transformers.json
ADDED
|
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"model_type": "SentenceTransformer",
|
| 3 |
+
"__version__": {
|
| 4 |
+
"sentence_transformers": "5.0.0",
|
| 5 |
+
"transformers": "4.53.3",
|
| 6 |
+
"pytorch": "2.7.1+cu126"
|
| 7 |
+
},
|
| 8 |
+
"prompts": {
|
| 9 |
+
"query": "",
|
| 10 |
+
"document": ""
|
| 11 |
+
},
|
| 12 |
+
"default_prompt_name": null,
|
| 13 |
+
"similarity_fn_name": "tanimoto"
|
| 14 |
+
}
|
merges.txt
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
#version: 0.2
|
model.safetensors
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:388917cb9c0d52f13ac2a3ac337e4d1992d99de10fc65cb7f3859e6f17369d33
|
| 3 |
+
size 611764232
|
modules.json
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
[
|
| 2 |
+
{
|
| 3 |
+
"idx": 0,
|
| 4 |
+
"name": "0",
|
| 5 |
+
"path": "",
|
| 6 |
+
"type": "sentence_transformers.models.Transformer"
|
| 7 |
+
},
|
| 8 |
+
{
|
| 9 |
+
"idx": 1,
|
| 10 |
+
"name": "1",
|
| 11 |
+
"path": "1_Pooling",
|
| 12 |
+
"type": "sentence_transformers.models.Pooling"
|
| 13 |
+
},
|
| 14 |
+
{
|
| 15 |
+
"idx": 2,
|
| 16 |
+
"name": "2",
|
| 17 |
+
"path": "2_Normalize",
|
| 18 |
+
"type": "sentence_transformers.models.Normalize"
|
| 19 |
+
}
|
| 20 |
+
]
|
sentence_bert_config.json
ADDED
|
@@ -0,0 +1,4 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"max_seq_length": 128,
|
| 3 |
+
"do_lower_case": false
|
| 4 |
+
}
|
similarity_evaluation_pubchem_10m_genmol_similarity_float32_results.csv
ADDED
|
@@ -0,0 +1,38 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
epoch,steps,spearman
|
| 2 |
+
0.08,24616,0.9738617225555145
|
| 3 |
+
0.16,49232,0.981745903231021
|
| 4 |
+
0.24,73848,0.9848138153161644
|
| 5 |
+
0.32,98464,0.9865317179098163
|
| 6 |
+
0.4,123080,0.9873270071133374
|
| 7 |
+
0.48,147696,0.9884562662848129
|
| 8 |
+
0.56,172312,0.9886743337938196
|
| 9 |
+
0.64,196928,0.9891768507175762
|
| 10 |
+
0.72,221544,0.9897869837572465
|
| 11 |
+
0.8,246160,0.9901589904466065
|
| 12 |
+
0.88,270776,0.9906949631377245
|
| 13 |
+
0.96,295392,0.9908014916462329
|
| 14 |
+
1.04,320008,0.9909399147553232
|
| 15 |
+
1.12,344624,0.9910215920276151
|
| 16 |
+
1.2,369240,0.9915920186173117
|
| 17 |
+
1.28,393856,0.9914454622783068
|
| 18 |
+
1.3599999999999999,418472,0.9917370160239519
|
| 19 |
+
1.44,443088,0.9918566710914087
|
| 20 |
+
1.52,467704,0.9921180116562484
|
| 21 |
+
1.6,492320,0.992290711551611
|
| 22 |
+
1.6800000000000002,516936,0.9921708494174164
|
| 23 |
+
1.76,541552,0.9924133694566644
|
| 24 |
+
1.8399999999999999,566168,0.9923654392219101
|
| 25 |
+
1.92,590784,0.9925184941462679
|
| 26 |
+
2.0,615400,0.9926690989243799
|
| 27 |
+
2.08,640016,0.9927617759812062
|
| 28 |
+
2.16,664632,0.9926963360759598
|
| 29 |
+
2.24,689248,0.9928226049510629
|
| 30 |
+
2.32,713864,0.9928830258172597
|
| 31 |
+
2.4,738480,0.9929211735586345
|
| 32 |
+
2.48,763096,0.9929776131958243
|
| 33 |
+
2.56,787712,0.9930113241157583
|
| 34 |
+
2.64,812328,0.9930781880900686
|
| 35 |
+
2.7199999999999998,836944,0.9931109671330001
|
| 36 |
+
2.8,861560,0.9931538502353688
|
| 37 |
+
2.88,886176,0.9932005964928086
|
| 38 |
+
2.96,910792,0.9932120589500998
|
special_tokens_map.json
ADDED
|
@@ -0,0 +1,51 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"bos_token": {
|
| 3 |
+
"content": "<s>",
|
| 4 |
+
"lstrip": false,
|
| 5 |
+
"normalized": true,
|
| 6 |
+
"rstrip": false,
|
| 7 |
+
"single_word": false
|
| 8 |
+
},
|
| 9 |
+
"cls_token": {
|
| 10 |
+
"content": "<s>",
|
| 11 |
+
"lstrip": false,
|
| 12 |
+
"normalized": true,
|
| 13 |
+
"rstrip": false,
|
| 14 |
+
"single_word": false
|
| 15 |
+
},
|
| 16 |
+
"eos_token": {
|
| 17 |
+
"content": "</s>",
|
| 18 |
+
"lstrip": false,
|
| 19 |
+
"normalized": true,
|
| 20 |
+
"rstrip": false,
|
| 21 |
+
"single_word": false
|
| 22 |
+
},
|
| 23 |
+
"mask_token": {
|
| 24 |
+
"content": "<mask>",
|
| 25 |
+
"lstrip": true,
|
| 26 |
+
"normalized": false,
|
| 27 |
+
"rstrip": false,
|
| 28 |
+
"single_word": false
|
| 29 |
+
},
|
| 30 |
+
"pad_token": {
|
| 31 |
+
"content": "<pad>",
|
| 32 |
+
"lstrip": false,
|
| 33 |
+
"normalized": true,
|
| 34 |
+
"rstrip": false,
|
| 35 |
+
"single_word": false
|
| 36 |
+
},
|
| 37 |
+
"sep_token": {
|
| 38 |
+
"content": "</s>",
|
| 39 |
+
"lstrip": false,
|
| 40 |
+
"normalized": true,
|
| 41 |
+
"rstrip": false,
|
| 42 |
+
"single_word": false
|
| 43 |
+
},
|
| 44 |
+
"unk_token": {
|
| 45 |
+
"content": "<unk>",
|
| 46 |
+
"lstrip": false,
|
| 47 |
+
"normalized": true,
|
| 48 |
+
"rstrip": false,
|
| 49 |
+
"single_word": false
|
| 50 |
+
}
|
| 51 |
+
}
|
tokenizer.json
ADDED
|
@@ -0,0 +1,684 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"version": "1.0",
|
| 3 |
+
"truncation": {
|
| 4 |
+
"direction": "Right",
|
| 5 |
+
"max_length": 128,
|
| 6 |
+
"strategy": "LongestFirst",
|
| 7 |
+
"stride": 0
|
| 8 |
+
},
|
| 9 |
+
"padding": {
|
| 10 |
+
"strategy": "BatchLongest",
|
| 11 |
+
"direction": "Right",
|
| 12 |
+
"pad_to_multiple_of": null,
|
| 13 |
+
"pad_id": 1,
|
| 14 |
+
"pad_type_id": 0,
|
| 15 |
+
"pad_token": "<pad>"
|
| 16 |
+
},
|
| 17 |
+
"added_tokens": [
|
| 18 |
+
{
|
| 19 |
+
"id": 0,
|
| 20 |
+
"content": "<s>",
|
| 21 |
+
"single_word": false,
|
| 22 |
+
"lstrip": false,
|
| 23 |
+
"rstrip": false,
|
| 24 |
+
"normalized": true,
|
| 25 |
+
"special": true
|
| 26 |
+
},
|
| 27 |
+
{
|
| 28 |
+
"id": 1,
|
| 29 |
+
"content": "<pad>",
|
| 30 |
+
"single_word": false,
|
| 31 |
+
"lstrip": false,
|
| 32 |
+
"rstrip": false,
|
| 33 |
+
"normalized": true,
|
| 34 |
+
"special": true
|
| 35 |
+
},
|
| 36 |
+
{
|
| 37 |
+
"id": 2,
|
| 38 |
+
"content": "</s>",
|
| 39 |
+
"single_word": false,
|
| 40 |
+
"lstrip": false,
|
| 41 |
+
"rstrip": false,
|
| 42 |
+
"normalized": true,
|
| 43 |
+
"special": true
|
| 44 |
+
},
|
| 45 |
+
{
|
| 46 |
+
"id": 3,
|
| 47 |
+
"content": "<unk>",
|
| 48 |
+
"single_word": false,
|
| 49 |
+
"lstrip": false,
|
| 50 |
+
"rstrip": false,
|
| 51 |
+
"normalized": true,
|
| 52 |
+
"special": true
|
| 53 |
+
},
|
| 54 |
+
{
|
| 55 |
+
"id": 4,
|
| 56 |
+
"content": "<mask>",
|
| 57 |
+
"single_word": false,
|
| 58 |
+
"lstrip": true,
|
| 59 |
+
"rstrip": false,
|
| 60 |
+
"normalized": false,
|
| 61 |
+
"special": true
|
| 62 |
+
}
|
| 63 |
+
],
|
| 64 |
+
"normalizer": null,
|
| 65 |
+
"pre_tokenizer": {
|
| 66 |
+
"type": "ByteLevel",
|
| 67 |
+
"add_prefix_space": false,
|
| 68 |
+
"trim_offsets": true,
|
| 69 |
+
"use_regex": true
|
| 70 |
+
},
|
| 71 |
+
"post_processor": {
|
| 72 |
+
"type": "RobertaProcessing",
|
| 73 |
+
"sep": [
|
| 74 |
+
"</s>",
|
| 75 |
+
2
|
| 76 |
+
],
|
| 77 |
+
"cls": [
|
| 78 |
+
"<s>",
|
| 79 |
+
0
|
| 80 |
+
],
|
| 81 |
+
"trim_offsets": true,
|
| 82 |
+
"add_prefix_space": false
|
| 83 |
+
},
|
| 84 |
+
"decoder": {
|
| 85 |
+
"type": "ByteLevel",
|
| 86 |
+
"add_prefix_space": true,
|
| 87 |
+
"trim_offsets": true,
|
| 88 |
+
"use_regex": true
|
| 89 |
+
},
|
| 90 |
+
"model": {
|
| 91 |
+
"type": "BPE",
|
| 92 |
+
"dropout": null,
|
| 93 |
+
"unk_token": null,
|
| 94 |
+
"continuing_subword_prefix": "",
|
| 95 |
+
"end_of_word_suffix": "",
|
| 96 |
+
"fuse_unk": false,
|
| 97 |
+
"byte_fallback": false,
|
| 98 |
+
"ignore_merges": false,
|
| 99 |
+
"vocab": {
|
| 100 |
+
"<s>": 0,
|
| 101 |
+
"<pad>": 1,
|
| 102 |
+
"</s>": 2,
|
| 103 |
+
"<unk>": 3,
|
| 104 |
+
"<mask>": 4,
|
| 105 |
+
"c": 5,
|
| 106 |
+
"C": 6,
|
| 107 |
+
"(": 7,
|
| 108 |
+
")": 8,
|
| 109 |
+
"O": 9,
|
| 110 |
+
"1": 10,
|
| 111 |
+
"2": 11,
|
| 112 |
+
"=": 12,
|
| 113 |
+
"N": 13,
|
| 114 |
+
".": 14,
|
| 115 |
+
"n": 15,
|
| 116 |
+
"3": 16,
|
| 117 |
+
"F": 17,
|
| 118 |
+
"Cl": 18,
|
| 119 |
+
">>": 19,
|
| 120 |
+
"~": 20,
|
| 121 |
+
"-": 21,
|
| 122 |
+
"4": 22,
|
| 123 |
+
"[C@H]": 23,
|
| 124 |
+
"S": 24,
|
| 125 |
+
"[C@@H]": 25,
|
| 126 |
+
"[O-]": 26,
|
| 127 |
+
"Br": 27,
|
| 128 |
+
"#": 28,
|
| 129 |
+
"/": 29,
|
| 130 |
+
"[nH]": 30,
|
| 131 |
+
"[N+]": 31,
|
| 132 |
+
"s": 32,
|
| 133 |
+
"5": 33,
|
| 134 |
+
"o": 34,
|
| 135 |
+
"P": 35,
|
| 136 |
+
"[Na+]": 36,
|
| 137 |
+
"[Si]": 37,
|
| 138 |
+
"I": 38,
|
| 139 |
+
"[Na]": 39,
|
| 140 |
+
"[Pd]": 40,
|
| 141 |
+
"[K+]": 41,
|
| 142 |
+
"[K]": 42,
|
| 143 |
+
"[P]": 43,
|
| 144 |
+
"B": 44,
|
| 145 |
+
"[C@]": 45,
|
| 146 |
+
"[C@@]": 46,
|
| 147 |
+
"[Cl-]": 47,
|
| 148 |
+
"6": 48,
|
| 149 |
+
"[OH-]": 49,
|
| 150 |
+
"\\": 50,
|
| 151 |
+
"[N-]": 51,
|
| 152 |
+
"[Li]": 52,
|
| 153 |
+
"[H]": 53,
|
| 154 |
+
"[2H]": 54,
|
| 155 |
+
"[NH4+]": 55,
|
| 156 |
+
"[c-]": 56,
|
| 157 |
+
"[P-]": 57,
|
| 158 |
+
"[Cs+]": 58,
|
| 159 |
+
"[Li+]": 59,
|
| 160 |
+
"[Cs]": 60,
|
| 161 |
+
"[NaH]": 61,
|
| 162 |
+
"[H-]": 62,
|
| 163 |
+
"[O+]": 63,
|
| 164 |
+
"[BH4-]": 64,
|
| 165 |
+
"[Cu]": 65,
|
| 166 |
+
"7": 66,
|
| 167 |
+
"[Mg]": 67,
|
| 168 |
+
"[Fe+2]": 68,
|
| 169 |
+
"[n+]": 69,
|
| 170 |
+
"[Sn]": 70,
|
| 171 |
+
"[BH-]": 71,
|
| 172 |
+
"[Pd+2]": 72,
|
| 173 |
+
"[CH]": 73,
|
| 174 |
+
"[I-]": 74,
|
| 175 |
+
"[Br-]": 75,
|
| 176 |
+
"[C-]": 76,
|
| 177 |
+
"[Zn]": 77,
|
| 178 |
+
"[B-]": 78,
|
| 179 |
+
"[F-]": 79,
|
| 180 |
+
"[Al]": 80,
|
| 181 |
+
"[P+]": 81,
|
| 182 |
+
"[BH3-]": 82,
|
| 183 |
+
"[Fe]": 83,
|
| 184 |
+
"[C]": 84,
|
| 185 |
+
"[AlH4]": 85,
|
| 186 |
+
"[Ni]": 86,
|
| 187 |
+
"[SiH]": 87,
|
| 188 |
+
"8": 88,
|
| 189 |
+
"[Cu+2]": 89,
|
| 190 |
+
"[Mn]": 90,
|
| 191 |
+
"[AlH]": 91,
|
| 192 |
+
"[nH+]": 92,
|
| 193 |
+
"[AlH4-]": 93,
|
| 194 |
+
"[O-2]": 94,
|
| 195 |
+
"[Cr]": 95,
|
| 196 |
+
"[Mg+2]": 96,
|
| 197 |
+
"[NH3+]": 97,
|
| 198 |
+
"[S@]": 98,
|
| 199 |
+
"[Pt]": 99,
|
| 200 |
+
"[Al+3]": 100,
|
| 201 |
+
"[S@@]": 101,
|
| 202 |
+
"[S-]": 102,
|
| 203 |
+
"[Ti]": 103,
|
| 204 |
+
"[Zn+2]": 104,
|
| 205 |
+
"[PH]": 105,
|
| 206 |
+
"[NH2+]": 106,
|
| 207 |
+
"[Ru]": 107,
|
| 208 |
+
"[Ag+]": 108,
|
| 209 |
+
"[S+]": 109,
|
| 210 |
+
"[I+3]": 110,
|
| 211 |
+
"[NH+]": 111,
|
| 212 |
+
"[Ca+2]": 112,
|
| 213 |
+
"[Ag]": 113,
|
| 214 |
+
"9": 114,
|
| 215 |
+
"[Os]": 115,
|
| 216 |
+
"[Se]": 116,
|
| 217 |
+
"[SiH2]": 117,
|
| 218 |
+
"[Ca]": 118,
|
| 219 |
+
"[Ti+4]": 119,
|
| 220 |
+
"[Ac]": 120,
|
| 221 |
+
"[Cu+]": 121,
|
| 222 |
+
"[S]": 122,
|
| 223 |
+
"[Rh]": 123,
|
| 224 |
+
"[Cl+3]": 124,
|
| 225 |
+
"[cH-]": 125,
|
| 226 |
+
"[Zn+]": 126,
|
| 227 |
+
"[O]": 127,
|
| 228 |
+
"[Cl+]": 128,
|
| 229 |
+
"[SH]": 129,
|
| 230 |
+
"[H+]": 130,
|
| 231 |
+
"[Pd+]": 131,
|
| 232 |
+
"[se]": 132,
|
| 233 |
+
"[PH+]": 133,
|
| 234 |
+
"[I]": 134,
|
| 235 |
+
"[Pt+2]": 135,
|
| 236 |
+
"[C+]": 136,
|
| 237 |
+
"[Mg+]": 137,
|
| 238 |
+
"[Hg]": 138,
|
| 239 |
+
"[W]": 139,
|
| 240 |
+
"[SnH]": 140,
|
| 241 |
+
"[SiH3]": 141,
|
| 242 |
+
"[Fe+3]": 142,
|
| 243 |
+
"[NH]": 143,
|
| 244 |
+
"[Mo]": 144,
|
| 245 |
+
"[CH2+]": 145,
|
| 246 |
+
"%10": 146,
|
| 247 |
+
"[CH2-]": 147,
|
| 248 |
+
"[CH2]": 148,
|
| 249 |
+
"[n-]": 149,
|
| 250 |
+
"[Ce+4]": 150,
|
| 251 |
+
"[NH-]": 151,
|
| 252 |
+
"[Co]": 152,
|
| 253 |
+
"[I+]": 153,
|
| 254 |
+
"[PH2]": 154,
|
| 255 |
+
"[Pt+4]": 155,
|
| 256 |
+
"[Ce]": 156,
|
| 257 |
+
"[B]": 157,
|
| 258 |
+
"[Sn+2]": 158,
|
| 259 |
+
"[Ba+2]": 159,
|
| 260 |
+
"%11": 160,
|
| 261 |
+
"[Fe-3]": 161,
|
| 262 |
+
"[18F]": 162,
|
| 263 |
+
"[SH-]": 163,
|
| 264 |
+
"[Pb+2]": 164,
|
| 265 |
+
"[Os-2]": 165,
|
| 266 |
+
"[Zr+4]": 166,
|
| 267 |
+
"[N]": 167,
|
| 268 |
+
"[Ir]": 168,
|
| 269 |
+
"[Bi]": 169,
|
| 270 |
+
"[Ni+2]": 170,
|
| 271 |
+
"[P@]": 171,
|
| 272 |
+
"[Co+2]": 172,
|
| 273 |
+
"[s+]": 173,
|
| 274 |
+
"[As]": 174,
|
| 275 |
+
"[P+3]": 175,
|
| 276 |
+
"[Hg+2]": 176,
|
| 277 |
+
"[Yb+3]": 177,
|
| 278 |
+
"[CH-]": 178,
|
| 279 |
+
"[Zr+2]": 179,
|
| 280 |
+
"[Mn+2]": 180,
|
| 281 |
+
"[CH+]": 181,
|
| 282 |
+
"[In]": 182,
|
| 283 |
+
"[KH]": 183,
|
| 284 |
+
"[Ce+3]": 184,
|
| 285 |
+
"[Zr]": 185,
|
| 286 |
+
"[AlH2-]": 186,
|
| 287 |
+
"[OH2+]": 187,
|
| 288 |
+
"[Ti+3]": 188,
|
| 289 |
+
"[Rh+2]": 189,
|
| 290 |
+
"[Sb]": 190,
|
| 291 |
+
"[S-2]": 191,
|
| 292 |
+
"%12": 192,
|
| 293 |
+
"[P@@]": 193,
|
| 294 |
+
"[Si@H]": 194,
|
| 295 |
+
"[Mn+4]": 195,
|
| 296 |
+
"p": 196,
|
| 297 |
+
"[Ba]": 197,
|
| 298 |
+
"[NH2-]": 198,
|
| 299 |
+
"[Ge]": 199,
|
| 300 |
+
"[Pb+4]": 200,
|
| 301 |
+
"[Cr+3]": 201,
|
| 302 |
+
"[Au]": 202,
|
| 303 |
+
"[LiH]": 203,
|
| 304 |
+
"[Sc+3]": 204,
|
| 305 |
+
"[o+]": 205,
|
| 306 |
+
"[Rh-3]": 206,
|
| 307 |
+
"%13": 207,
|
| 308 |
+
"[Br]": 208,
|
| 309 |
+
"[Sb-]": 209,
|
| 310 |
+
"[S@+]": 210,
|
| 311 |
+
"[I+2]": 211,
|
| 312 |
+
"[Ar]": 212,
|
| 313 |
+
"[V]": 213,
|
| 314 |
+
"[Cu-]": 214,
|
| 315 |
+
"[Al-]": 215,
|
| 316 |
+
"[Te]": 216,
|
| 317 |
+
"[13c]": 217,
|
| 318 |
+
"[13C]": 218,
|
| 319 |
+
"[Cl]": 219,
|
| 320 |
+
"[PH4+]": 220,
|
| 321 |
+
"[SiH4]": 221,
|
| 322 |
+
"[te]": 222,
|
| 323 |
+
"[CH3-]": 223,
|
| 324 |
+
"[S@@+]": 224,
|
| 325 |
+
"[Rh+3]": 225,
|
| 326 |
+
"[SH+]": 226,
|
| 327 |
+
"[Bi+3]": 227,
|
| 328 |
+
"[Br+2]": 228,
|
| 329 |
+
"[La]": 229,
|
| 330 |
+
"[La+3]": 230,
|
| 331 |
+
"[Pt-2]": 231,
|
| 332 |
+
"[N@@]": 232,
|
| 333 |
+
"[PH3+]": 233,
|
| 334 |
+
"[N@]": 234,
|
| 335 |
+
"[Si+4]": 235,
|
| 336 |
+
"[Sr+2]": 236,
|
| 337 |
+
"[Al+]": 237,
|
| 338 |
+
"[Pb]": 238,
|
| 339 |
+
"[SeH]": 239,
|
| 340 |
+
"[Si-]": 240,
|
| 341 |
+
"[V+5]": 241,
|
| 342 |
+
"[Y+3]": 242,
|
| 343 |
+
"[Re]": 243,
|
| 344 |
+
"[Ru+]": 244,
|
| 345 |
+
"[Sm]": 245,
|
| 346 |
+
"*": 246,
|
| 347 |
+
"[3H]": 247,
|
| 348 |
+
"[NH2]": 248,
|
| 349 |
+
"[Ag-]": 249,
|
| 350 |
+
"[13CH3]": 250,
|
| 351 |
+
"[OH+]": 251,
|
| 352 |
+
"[Ru+3]": 252,
|
| 353 |
+
"[OH]": 253,
|
| 354 |
+
"[Gd+3]": 254,
|
| 355 |
+
"[13CH2]": 255,
|
| 356 |
+
"[In+3]": 256,
|
| 357 |
+
"[Si@@]": 257,
|
| 358 |
+
"[Si@]": 258,
|
| 359 |
+
"[Ti+2]": 259,
|
| 360 |
+
"[Sn+]": 260,
|
| 361 |
+
"[Cl+2]": 261,
|
| 362 |
+
"[AlH-]": 262,
|
| 363 |
+
"[Pd-2]": 263,
|
| 364 |
+
"[SnH3]": 264,
|
| 365 |
+
"[B+3]": 265,
|
| 366 |
+
"[Cu-2]": 266,
|
| 367 |
+
"[Nd+3]": 267,
|
| 368 |
+
"[Pb+3]": 268,
|
| 369 |
+
"[13cH]": 269,
|
| 370 |
+
"[Fe-4]": 270,
|
| 371 |
+
"[Ga]": 271,
|
| 372 |
+
"[Sn+4]": 272,
|
| 373 |
+
"[Hg+]": 273,
|
| 374 |
+
"[11CH3]": 274,
|
| 375 |
+
"[Hf]": 275,
|
| 376 |
+
"[Pr]": 276,
|
| 377 |
+
"[Y]": 277,
|
| 378 |
+
"[S+2]": 278,
|
| 379 |
+
"[Cd]": 279,
|
| 380 |
+
"[Cr+6]": 280,
|
| 381 |
+
"[Zr+3]": 281,
|
| 382 |
+
"[Rh+]": 282,
|
| 383 |
+
"[CH3]": 283,
|
| 384 |
+
"[N-3]": 284,
|
| 385 |
+
"[Hf+2]": 285,
|
| 386 |
+
"[Th]": 286,
|
| 387 |
+
"[Sb+3]": 287,
|
| 388 |
+
"%14": 288,
|
| 389 |
+
"[Cr+2]": 289,
|
| 390 |
+
"[Ru+2]": 290,
|
| 391 |
+
"[Hf+4]": 291,
|
| 392 |
+
"[14C]": 292,
|
| 393 |
+
"[Ta]": 293,
|
| 394 |
+
"[Tl+]": 294,
|
| 395 |
+
"[B+]": 295,
|
| 396 |
+
"[Os+4]": 296,
|
| 397 |
+
"[PdH2]": 297,
|
| 398 |
+
"[Pd-]": 298,
|
| 399 |
+
"[Cd+2]": 299,
|
| 400 |
+
"[Co+3]": 300,
|
| 401 |
+
"[S+4]": 301,
|
| 402 |
+
"[Nb+5]": 302,
|
| 403 |
+
"[123I]": 303,
|
| 404 |
+
"[c+]": 304,
|
| 405 |
+
"[Rb+]": 305,
|
| 406 |
+
"[V+2]": 306,
|
| 407 |
+
"[CH3+]": 307,
|
| 408 |
+
"[Ag+2]": 308,
|
| 409 |
+
"[cH+]": 309,
|
| 410 |
+
"[Mn+3]": 310,
|
| 411 |
+
"[Se-]": 311,
|
| 412 |
+
"[As-]": 312,
|
| 413 |
+
"[Eu+3]": 313,
|
| 414 |
+
"[SH2]": 314,
|
| 415 |
+
"[Sm+3]": 315,
|
| 416 |
+
"[IH+]": 316,
|
| 417 |
+
"%15": 317,
|
| 418 |
+
"[OH3+]": 318,
|
| 419 |
+
"[PH3]": 319,
|
| 420 |
+
"[IH2+]": 320,
|
| 421 |
+
"[SH2+]": 321,
|
| 422 |
+
"[Ir+3]": 322,
|
| 423 |
+
"[AlH3]": 323,
|
| 424 |
+
"[Sc]": 324,
|
| 425 |
+
"[Yb]": 325,
|
| 426 |
+
"[15NH2]": 326,
|
| 427 |
+
"[Lu]": 327,
|
| 428 |
+
"[sH+]": 328,
|
| 429 |
+
"[Gd]": 329,
|
| 430 |
+
"[18F-]": 330,
|
| 431 |
+
"[SH3+]": 331,
|
| 432 |
+
"[SnH4]": 332,
|
| 433 |
+
"[TeH]": 333,
|
| 434 |
+
"[Si@@H]": 334,
|
| 435 |
+
"[Ga+3]": 335,
|
| 436 |
+
"[CaH2]": 336,
|
| 437 |
+
"[Tl]": 337,
|
| 438 |
+
"[Ta+5]": 338,
|
| 439 |
+
"[GeH]": 339,
|
| 440 |
+
"[Br+]": 340,
|
| 441 |
+
"[Sr]": 341,
|
| 442 |
+
"[Tl+3]": 342,
|
| 443 |
+
"[Sm+2]": 343,
|
| 444 |
+
"[PH5]": 344,
|
| 445 |
+
"%16": 345,
|
| 446 |
+
"[N@@+]": 346,
|
| 447 |
+
"[Au+3]": 347,
|
| 448 |
+
"[C-4]": 348,
|
| 449 |
+
"[Nd]": 349,
|
| 450 |
+
"[Ti+]": 350,
|
| 451 |
+
"[IH]": 351,
|
| 452 |
+
"[N@+]": 352,
|
| 453 |
+
"[125I]": 353,
|
| 454 |
+
"[Eu]": 354,
|
| 455 |
+
"[Sn+3]": 355,
|
| 456 |
+
"[Nb]": 356,
|
| 457 |
+
"[Er+3]": 357,
|
| 458 |
+
"[123I-]": 358,
|
| 459 |
+
"[14c]": 359,
|
| 460 |
+
"%17": 360,
|
| 461 |
+
"[SnH2]": 361,
|
| 462 |
+
"[YH]": 362,
|
| 463 |
+
"[Sb+5]": 363,
|
| 464 |
+
"[Pr+3]": 364,
|
| 465 |
+
"[Ir+]": 365,
|
| 466 |
+
"[N+3]": 366,
|
| 467 |
+
"[AlH2]": 367,
|
| 468 |
+
"[19F]": 368,
|
| 469 |
+
"%18": 369,
|
| 470 |
+
"[Tb]": 370,
|
| 471 |
+
"[14CH]": 371,
|
| 472 |
+
"[Mo+4]": 372,
|
| 473 |
+
"[Si+]": 373,
|
| 474 |
+
"[BH]": 374,
|
| 475 |
+
"[Be]": 375,
|
| 476 |
+
"[Rb]": 376,
|
| 477 |
+
"[pH]": 377,
|
| 478 |
+
"%19": 378,
|
| 479 |
+
"%20": 379,
|
| 480 |
+
"[Xe]": 380,
|
| 481 |
+
"[Ir-]": 381,
|
| 482 |
+
"[Be+2]": 382,
|
| 483 |
+
"[C+4]": 383,
|
| 484 |
+
"[RuH2]": 384,
|
| 485 |
+
"[15NH]": 385,
|
| 486 |
+
"[U+2]": 386,
|
| 487 |
+
"[Au-]": 387,
|
| 488 |
+
"%21": 388,
|
| 489 |
+
"%22": 389,
|
| 490 |
+
"[Au+]": 390,
|
| 491 |
+
"[15n]": 391,
|
| 492 |
+
"[Al+2]": 392,
|
| 493 |
+
"[Tb+3]": 393,
|
| 494 |
+
"[15N]": 394,
|
| 495 |
+
"[V+3]": 395,
|
| 496 |
+
"[W+6]": 396,
|
| 497 |
+
"[14CH3]": 397,
|
| 498 |
+
"[Cr+4]": 398,
|
| 499 |
+
"[ClH+]": 399,
|
| 500 |
+
"b": 400,
|
| 501 |
+
"[Ti+6]": 401,
|
| 502 |
+
"[Nd+]": 402,
|
| 503 |
+
"[Zr+]": 403,
|
| 504 |
+
"[PH2+]": 404,
|
| 505 |
+
"[Fm]": 405,
|
| 506 |
+
"[N@H+]": 406,
|
| 507 |
+
"[RuH]": 407,
|
| 508 |
+
"[Dy+3]": 408,
|
| 509 |
+
"%23": 409,
|
| 510 |
+
"[Hf+3]": 410,
|
| 511 |
+
"[W+4]": 411,
|
| 512 |
+
"[11C]": 412,
|
| 513 |
+
"[13CH]": 413,
|
| 514 |
+
"[Er]": 414,
|
| 515 |
+
"[124I]": 415,
|
| 516 |
+
"[LaH]": 416,
|
| 517 |
+
"[F]": 417,
|
| 518 |
+
"[siH]": 418,
|
| 519 |
+
"[Ga+]": 419,
|
| 520 |
+
"[Cm]": 420,
|
| 521 |
+
"[GeH3]": 421,
|
| 522 |
+
"[IH-]": 422,
|
| 523 |
+
"[U+6]": 423,
|
| 524 |
+
"[SeH+]": 424,
|
| 525 |
+
"[32P]": 425,
|
| 526 |
+
"[SeH-]": 426,
|
| 527 |
+
"[Pt-]": 427,
|
| 528 |
+
"[Ir+2]": 428,
|
| 529 |
+
"[se+]": 429,
|
| 530 |
+
"[U]": 430,
|
| 531 |
+
"[F+]": 431,
|
| 532 |
+
"[BH2]": 432,
|
| 533 |
+
"[As+]": 433,
|
| 534 |
+
"[Cf]": 434,
|
| 535 |
+
"[ClH2+]": 435,
|
| 536 |
+
"[Ni+]": 436,
|
| 537 |
+
"[TeH3]": 437,
|
| 538 |
+
"[SbH2]": 438,
|
| 539 |
+
"[Ag+3]": 439,
|
| 540 |
+
"%24": 440,
|
| 541 |
+
"[18O]": 441,
|
| 542 |
+
"[PH4]": 442,
|
| 543 |
+
"[Os+2]": 443,
|
| 544 |
+
"[Na-]": 444,
|
| 545 |
+
"[Sb+2]": 445,
|
| 546 |
+
"[V+4]": 446,
|
| 547 |
+
"[Ho+3]": 447,
|
| 548 |
+
"[68Ga]": 448,
|
| 549 |
+
"[PH-]": 449,
|
| 550 |
+
"[Bi+2]": 450,
|
| 551 |
+
"[Ce+2]": 451,
|
| 552 |
+
"[Pd+3]": 452,
|
| 553 |
+
"[99Tc]": 453,
|
| 554 |
+
"[13C@@H]": 454,
|
| 555 |
+
"[Fe+6]": 455,
|
| 556 |
+
"[c]": 456,
|
| 557 |
+
"[GeH2]": 457,
|
| 558 |
+
"[10B]": 458,
|
| 559 |
+
"[Cu+3]": 459,
|
| 560 |
+
"[Mo+2]": 460,
|
| 561 |
+
"[Cr+]": 461,
|
| 562 |
+
"[Pd+4]": 462,
|
| 563 |
+
"[Dy]": 463,
|
| 564 |
+
"[AsH]": 464,
|
| 565 |
+
"[Ba+]": 465,
|
| 566 |
+
"[SeH2]": 466,
|
| 567 |
+
"[In+]": 467,
|
| 568 |
+
"[TeH2]": 468,
|
| 569 |
+
"[BrH+]": 469,
|
| 570 |
+
"[14cH]": 470,
|
| 571 |
+
"[W+]": 471,
|
| 572 |
+
"[13C@H]": 472,
|
| 573 |
+
"[AsH2]": 473,
|
| 574 |
+
"[In+2]": 474,
|
| 575 |
+
"[N+2]": 475,
|
| 576 |
+
"[N@@H+]": 476,
|
| 577 |
+
"[SbH]": 477,
|
| 578 |
+
"[60Co]": 478,
|
| 579 |
+
"[AsH4+]": 479,
|
| 580 |
+
"[AsH3]": 480,
|
| 581 |
+
"[18OH]": 481,
|
| 582 |
+
"[Ru-2]": 482,
|
| 583 |
+
"[Na-2]": 483,
|
| 584 |
+
"[CuH2]": 484,
|
| 585 |
+
"[31P]": 485,
|
| 586 |
+
"[Ti+5]": 486,
|
| 587 |
+
"[35S]": 487,
|
| 588 |
+
"[P@@H]": 488,
|
| 589 |
+
"[ArH]": 489,
|
| 590 |
+
"[Co+]": 490,
|
| 591 |
+
"[Zr-2]": 491,
|
| 592 |
+
"[BH2-]": 492,
|
| 593 |
+
"[131I]": 493,
|
| 594 |
+
"[SH5]": 494,
|
| 595 |
+
"[VH]": 495,
|
| 596 |
+
"[B+2]": 496,
|
| 597 |
+
"[Yb+2]": 497,
|
| 598 |
+
"[14C@H]": 498,
|
| 599 |
+
"[211At]": 499,
|
| 600 |
+
"[NH3+2]": 500,
|
| 601 |
+
"[IrH]": 501,
|
| 602 |
+
"[IrH2]": 502,
|
| 603 |
+
"[Rh-]": 503,
|
| 604 |
+
"[Cr-]": 504,
|
| 605 |
+
"[Sb+]": 505,
|
| 606 |
+
"[Ni+3]": 506,
|
| 607 |
+
"[TaH3]": 507,
|
| 608 |
+
"[Tl+2]": 508,
|
| 609 |
+
"[64Cu]": 509,
|
| 610 |
+
"[Tc]": 510,
|
| 611 |
+
"[Cd+]": 511,
|
| 612 |
+
"[1H]": 512,
|
| 613 |
+
"[15nH]": 513,
|
| 614 |
+
"[AlH2+]": 514,
|
| 615 |
+
"[FH+2]": 515,
|
| 616 |
+
"[BiH3]": 516,
|
| 617 |
+
"[Ru-]": 517,
|
| 618 |
+
"[Mo+6]": 518,
|
| 619 |
+
"[AsH+]": 519,
|
| 620 |
+
"[BaH2]": 520,
|
| 621 |
+
"[BaH]": 521,
|
| 622 |
+
"[Fe+4]": 522,
|
| 623 |
+
"[229Th]": 523,
|
| 624 |
+
"[Th+4]": 524,
|
| 625 |
+
"[As+3]": 525,
|
| 626 |
+
"[NH+3]": 526,
|
| 627 |
+
"[P@H]": 527,
|
| 628 |
+
"[Li-]": 528,
|
| 629 |
+
"[7NaH]": 529,
|
| 630 |
+
"[Bi+]": 530,
|
| 631 |
+
"[PtH+2]": 531,
|
| 632 |
+
"[p-]": 532,
|
| 633 |
+
"[Re+5]": 533,
|
| 634 |
+
"[NiH]": 534,
|
| 635 |
+
"[Ni-]": 535,
|
| 636 |
+
"[Xe+]": 536,
|
| 637 |
+
"[Ca+]": 537,
|
| 638 |
+
"[11c]": 538,
|
| 639 |
+
"[Rh+4]": 539,
|
| 640 |
+
"[AcH]": 540,
|
| 641 |
+
"[HeH]": 541,
|
| 642 |
+
"[Sc+2]": 542,
|
| 643 |
+
"[Mn+]": 543,
|
| 644 |
+
"[UH]": 544,
|
| 645 |
+
"[14CH2]": 545,
|
| 646 |
+
"[SiH4+]": 546,
|
| 647 |
+
"[18OH2]": 547,
|
| 648 |
+
"[Ac-]": 548,
|
| 649 |
+
"[Re+4]": 549,
|
| 650 |
+
"[118Sn]": 550,
|
| 651 |
+
"[153Sm]": 551,
|
| 652 |
+
"[P+2]": 552,
|
| 653 |
+
"[9CH]": 553,
|
| 654 |
+
"[9CH3]": 554,
|
| 655 |
+
"[Y-]": 555,
|
| 656 |
+
"[NiH2]": 556,
|
| 657 |
+
"[Si+2]": 557,
|
| 658 |
+
"[Mn+6]": 558,
|
| 659 |
+
"[ZrH2]": 559,
|
| 660 |
+
"[C-2]": 560,
|
| 661 |
+
"[Bi+5]": 561,
|
| 662 |
+
"[24NaH]": 562,
|
| 663 |
+
"[Fr]": 563,
|
| 664 |
+
"[15CH]": 564,
|
| 665 |
+
"[Se+]": 565,
|
| 666 |
+
"[At]": 566,
|
| 667 |
+
"[P-3]": 567,
|
| 668 |
+
"[124I-]": 568,
|
| 669 |
+
"[CuH2-]": 569,
|
| 670 |
+
"[Nb+4]": 570,
|
| 671 |
+
"[Nb+3]": 571,
|
| 672 |
+
"[MgH]": 572,
|
| 673 |
+
"[Ir+4]": 573,
|
| 674 |
+
"[67Ga+3]": 574,
|
| 675 |
+
"[67Ga]": 575,
|
| 676 |
+
"[13N]": 576,
|
| 677 |
+
"[15OH2]": 577,
|
| 678 |
+
"[2NH]": 578,
|
| 679 |
+
"[Ho]": 579,
|
| 680 |
+
"[Cn]": 580
|
| 681 |
+
},
|
| 682 |
+
"merges": []
|
| 683 |
+
}
|
| 684 |
+
}
|
tokenizer_config.json
ADDED
|
@@ -0,0 +1,59 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"add_prefix_space": false,
|
| 3 |
+
"added_tokens_decoder": {
|
| 4 |
+
"0": {
|
| 5 |
+
"content": "<s>",
|
| 6 |
+
"lstrip": false,
|
| 7 |
+
"normalized": true,
|
| 8 |
+
"rstrip": false,
|
| 9 |
+
"single_word": false,
|
| 10 |
+
"special": true
|
| 11 |
+
},
|
| 12 |
+
"1": {
|
| 13 |
+
"content": "<pad>",
|
| 14 |
+
"lstrip": false,
|
| 15 |
+
"normalized": true,
|
| 16 |
+
"rstrip": false,
|
| 17 |
+
"single_word": false,
|
| 18 |
+
"special": true
|
| 19 |
+
},
|
| 20 |
+
"2": {
|
| 21 |
+
"content": "</s>",
|
| 22 |
+
"lstrip": false,
|
| 23 |
+
"normalized": true,
|
| 24 |
+
"rstrip": false,
|
| 25 |
+
"single_word": false,
|
| 26 |
+
"special": true
|
| 27 |
+
},
|
| 28 |
+
"3": {
|
| 29 |
+
"content": "<unk>",
|
| 30 |
+
"lstrip": false,
|
| 31 |
+
"normalized": true,
|
| 32 |
+
"rstrip": false,
|
| 33 |
+
"single_word": false,
|
| 34 |
+
"special": true
|
| 35 |
+
},
|
| 36 |
+
"4": {
|
| 37 |
+
"content": "<mask>",
|
| 38 |
+
"lstrip": true,
|
| 39 |
+
"normalized": false,
|
| 40 |
+
"rstrip": false,
|
| 41 |
+
"single_word": false,
|
| 42 |
+
"special": true
|
| 43 |
+
}
|
| 44 |
+
},
|
| 45 |
+
"bos_token": "<s>",
|
| 46 |
+
"clean_up_tokenization_spaces": false,
|
| 47 |
+
"cls_token": "<s>",
|
| 48 |
+
"eos_token": "</s>",
|
| 49 |
+
"errors": "replace",
|
| 50 |
+
"extra_special_tokens": {},
|
| 51 |
+
"mask_token": "<mask>",
|
| 52 |
+
"max_len": 128,
|
| 53 |
+
"model_max_length": 128,
|
| 54 |
+
"pad_token": "<pad>",
|
| 55 |
+
"sep_token": "</s>",
|
| 56 |
+
"tokenizer_class": "RobertaTokenizer",
|
| 57 |
+
"trim_offsets": true,
|
| 58 |
+
"unk_token": "<unk>"
|
| 59 |
+
}
|
vocab.json
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
{"<s>":0,"<pad>":1,"</s>":2,"<unk>":3,"<mask>":4,"c":5,"C":6,"(":7,")":8,"O":9,"1":10,"2":11,"=":12,"N":13,".":14,"n":15,"3":16,"F":17,"Cl":18,">>":19,"~":20,"-":21,"4":22,"[C@H]":23,"S":24,"[C@@H]":25,"[O-]":26,"Br":27,"#":28,"/":29,"[nH]":30,"[N+]":31,"s":32,"5":33,"o":34,"P":35,"[Na+]":36,"[Si]":37,"I":38,"[Na]":39,"[Pd]":40,"[K+]":41,"[K]":42,"[P]":43,"B":44,"[C@]":45,"[C@@]":46,"[Cl-]":47,"6":48,"[OH-]":49,"\\":50,"[N-]":51,"[Li]":52,"[H]":53,"[2H]":54,"[NH4+]":55,"[c-]":56,"[P-]":57,"[Cs+]":58,"[Li+]":59,"[Cs]":60,"[NaH]":61,"[H-]":62,"[O+]":63,"[BH4-]":64,"[Cu]":65,"7":66,"[Mg]":67,"[Fe+2]":68,"[n+]":69,"[Sn]":70,"[BH-]":71,"[Pd+2]":72,"[CH]":73,"[I-]":74,"[Br-]":75,"[C-]":76,"[Zn]":77,"[B-]":78,"[F-]":79,"[Al]":80,"[P+]":81,"[BH3-]":82,"[Fe]":83,"[C]":84,"[AlH4]":85,"[Ni]":86,"[SiH]":87,"8":88,"[Cu+2]":89,"[Mn]":90,"[AlH]":91,"[nH+]":92,"[AlH4-]":93,"[O-2]":94,"[Cr]":95,"[Mg+2]":96,"[NH3+]":97,"[S@]":98,"[Pt]":99,"[Al+3]":100,"[S@@]":101,"[S-]":102,"[Ti]":103,"[Zn+2]":104,"[PH]":105,"[NH2+]":106,"[Ru]":107,"[Ag+]":108,"[S+]":109,"[I+3]":110,"[NH+]":111,"[Ca+2]":112,"[Ag]":113,"9":114,"[Os]":115,"[Se]":116,"[SiH2]":117,"[Ca]":118,"[Ti+4]":119,"[Ac]":120,"[Cu+]":121,"[S]":122,"[Rh]":123,"[Cl+3]":124,"[cH-]":125,"[Zn+]":126,"[O]":127,"[Cl+]":128,"[SH]":129,"[H+]":130,"[Pd+]":131,"[se]":132,"[PH+]":133,"[I]":134,"[Pt+2]":135,"[C+]":136,"[Mg+]":137,"[Hg]":138,"[W]":139,"[SnH]":140,"[SiH3]":141,"[Fe+3]":142,"[NH]":143,"[Mo]":144,"[CH2+]":145,"%10":146,"[CH2-]":147,"[CH2]":148,"[n-]":149,"[Ce+4]":150,"[NH-]":151,"[Co]":152,"[I+]":153,"[PH2]":154,"[Pt+4]":155,"[Ce]":156,"[B]":157,"[Sn+2]":158,"[Ba+2]":159,"%11":160,"[Fe-3]":161,"[18F]":162,"[SH-]":163,"[Pb+2]":164,"[Os-2]":165,"[Zr+4]":166,"[N]":167,"[Ir]":168,"[Bi]":169,"[Ni+2]":170,"[P@]":171,"[Co+2]":172,"[s+]":173,"[As]":174,"[P+3]":175,"[Hg+2]":176,"[Yb+3]":177,"[CH-]":178,"[Zr+2]":179,"[Mn+2]":180,"[CH+]":181,"[In]":182,"[KH]":183,"[Ce+3]":184,"[Zr]":185,"[AlH2-]":186,"[OH2+]":187,"[Ti+3]":188,"[Rh+2]":189,"[Sb]":190,"[S-2]":191,"%12":192,"[P@@]":193,"[Si@H]":194,"[Mn+4]":195,"p":196,"[Ba]":197,"[NH2-]":198,"[Ge]":199,"[Pb+4]":200,"[Cr+3]":201,"[Au]":202,"[LiH]":203,"[Sc+3]":204,"[o+]":205,"[Rh-3]":206,"%13":207,"[Br]":208,"[Sb-]":209,"[S@+]":210,"[I+2]":211,"[Ar]":212,"[V]":213,"[Cu-]":214,"[Al-]":215,"[Te]":216,"[13c]":217,"[13C]":218,"[Cl]":219,"[PH4+]":220,"[SiH4]":221,"[te]":222,"[CH3-]":223,"[S@@+]":224,"[Rh+3]":225,"[SH+]":226,"[Bi+3]":227,"[Br+2]":228,"[La]":229,"[La+3]":230,"[Pt-2]":231,"[N@@]":232,"[PH3+]":233,"[N@]":234,"[Si+4]":235,"[Sr+2]":236,"[Al+]":237,"[Pb]":238,"[SeH]":239,"[Si-]":240,"[V+5]":241,"[Y+3]":242,"[Re]":243,"[Ru+]":244,"[Sm]":245,"*":246,"[3H]":247,"[NH2]":248,"[Ag-]":249,"[13CH3]":250,"[OH+]":251,"[Ru+3]":252,"[OH]":253,"[Gd+3]":254,"[13CH2]":255,"[In+3]":256,"[Si@@]":257,"[Si@]":258,"[Ti+2]":259,"[Sn+]":260,"[Cl+2]":261,"[AlH-]":262,"[Pd-2]":263,"[SnH3]":264,"[B+3]":265,"[Cu-2]":266,"[Nd+3]":267,"[Pb+3]":268,"[13cH]":269,"[Fe-4]":270,"[Ga]":271,"[Sn+4]":272,"[Hg+]":273,"[11CH3]":274,"[Hf]":275,"[Pr]":276,"[Y]":277,"[S+2]":278,"[Cd]":279,"[Cr+6]":280,"[Zr+3]":281,"[Rh+]":282,"[CH3]":283,"[N-3]":284,"[Hf+2]":285,"[Th]":286,"[Sb+3]":287,"%14":288,"[Cr+2]":289,"[Ru+2]":290,"[Hf+4]":291,"[14C]":292,"[Ta]":293,"[Tl+]":294,"[B+]":295,"[Os+4]":296,"[PdH2]":297,"[Pd-]":298,"[Cd+2]":299,"[Co+3]":300,"[S+4]":301,"[Nb+5]":302,"[123I]":303,"[c+]":304,"[Rb+]":305,"[V+2]":306,"[CH3+]":307,"[Ag+2]":308,"[cH+]":309,"[Mn+3]":310,"[Se-]":311,"[As-]":312,"[Eu+3]":313,"[SH2]":314,"[Sm+3]":315,"[IH+]":316,"%15":317,"[OH3+]":318,"[PH3]":319,"[IH2+]":320,"[SH2+]":321,"[Ir+3]":322,"[AlH3]":323,"[Sc]":324,"[Yb]":325,"[15NH2]":326,"[Lu]":327,"[sH+]":328,"[Gd]":329,"[18F-]":330,"[SH3+]":331,"[SnH4]":332,"[TeH]":333,"[Si@@H]":334,"[Ga+3]":335,"[CaH2]":336,"[Tl]":337,"[Ta+5]":338,"[GeH]":339,"[Br+]":340,"[Sr]":341,"[Tl+3]":342,"[Sm+2]":343,"[PH5]":344,"%16":345,"[N@@+]":346,"[Au+3]":347,"[C-4]":348,"[Nd]":349,"[Ti+]":350,"[IH]":351,"[N@+]":352,"[125I]":353,"[Eu]":354,"[Sn+3]":355,"[Nb]":356,"[Er+3]":357,"[123I-]":358,"[14c]":359,"%17":360,"[SnH2]":361,"[YH]":362,"[Sb+5]":363,"[Pr+3]":364,"[Ir+]":365,"[N+3]":366,"[AlH2]":367,"[19F]":368,"%18":369,"[Tb]":370,"[14CH]":371,"[Mo+4]":372,"[Si+]":373,"[BH]":374,"[Be]":375,"[Rb]":376,"[pH]":377,"%19":378,"%20":379,"[Xe]":380,"[Ir-]":381,"[Be+2]":382,"[C+4]":383,"[RuH2]":384,"[15NH]":385,"[U+2]":386,"[Au-]":387,"%21":388,"%22":389,"[Au+]":390,"[15n]":391,"[Al+2]":392,"[Tb+3]":393,"[15N]":394,"[V+3]":395,"[W+6]":396,"[14CH3]":397,"[Cr+4]":398,"[ClH+]":399,"b":400,"[Ti+6]":401,"[Nd+]":402,"[Zr+]":403,"[PH2+]":404,"[Fm]":405,"[N@H+]":406,"[RuH]":407,"[Dy+3]":408,"%23":409,"[Hf+3]":410,"[W+4]":411,"[11C]":412,"[13CH]":413,"[Er]":414,"[124I]":415,"[LaH]":416,"[F]":417,"[siH]":418,"[Ga+]":419,"[Cm]":420,"[GeH3]":421,"[IH-]":422,"[U+6]":423,"[SeH+]":424,"[32P]":425,"[SeH-]":426,"[Pt-]":427,"[Ir+2]":428,"[se+]":429,"[U]":430,"[F+]":431,"[BH2]":432,"[As+]":433,"[Cf]":434,"[ClH2+]":435,"[Ni+]":436,"[TeH3]":437,"[SbH2]":438,"[Ag+3]":439,"%24":440,"[18O]":441,"[PH4]":442,"[Os+2]":443,"[Na-]":444,"[Sb+2]":445,"[V+4]":446,"[Ho+3]":447,"[68Ga]":448,"[PH-]":449,"[Bi+2]":450,"[Ce+2]":451,"[Pd+3]":452,"[99Tc]":453,"[13C@@H]":454,"[Fe+6]":455,"[c]":456,"[GeH2]":457,"[10B]":458,"[Cu+3]":459,"[Mo+2]":460,"[Cr+]":461,"[Pd+4]":462,"[Dy]":463,"[AsH]":464,"[Ba+]":465,"[SeH2]":466,"[In+]":467,"[TeH2]":468,"[BrH+]":469,"[14cH]":470,"[W+]":471,"[13C@H]":472,"[AsH2]":473,"[In+2]":474,"[N+2]":475,"[N@@H+]":476,"[SbH]":477,"[60Co]":478,"[AsH4+]":479,"[AsH3]":480,"[18OH]":481,"[Ru-2]":482,"[Na-2]":483,"[CuH2]":484,"[31P]":485,"[Ti+5]":486,"[35S]":487,"[P@@H]":488,"[ArH]":489,"[Co+]":490,"[Zr-2]":491,"[BH2-]":492,"[131I]":493,"[SH5]":494,"[VH]":495,"[B+2]":496,"[Yb+2]":497,"[14C@H]":498,"[211At]":499,"[NH3+2]":500,"[IrH]":501,"[IrH2]":502,"[Rh-]":503,"[Cr-]":504,"[Sb+]":505,"[Ni+3]":506,"[TaH3]":507,"[Tl+2]":508,"[64Cu]":509,"[Tc]":510,"[Cd+]":511,"[1H]":512,"[15nH]":513,"[AlH2+]":514,"[FH+2]":515,"[BiH3]":516,"[Ru-]":517,"[Mo+6]":518,"[AsH+]":519,"[BaH2]":520,"[BaH]":521,"[Fe+4]":522,"[229Th]":523,"[Th+4]":524,"[As+3]":525,"[NH+3]":526,"[P@H]":527,"[Li-]":528,"[7NaH]":529,"[Bi+]":530,"[PtH+2]":531,"[p-]":532,"[Re+5]":533,"[NiH]":534,"[Ni-]":535,"[Xe+]":536,"[Ca+]":537,"[11c]":538,"[Rh+4]":539,"[AcH]":540,"[HeH]":541,"[Sc+2]":542,"[Mn+]":543,"[UH]":544,"[14CH2]":545,"[SiH4+]":546,"[18OH2]":547,"[Ac-]":548,"[Re+4]":549,"[118Sn]":550,"[153Sm]":551,"[P+2]":552,"[9CH]":553,"[9CH3]":554,"[Y-]":555,"[NiH2]":556,"[Si+2]":557,"[Mn+6]":558,"[ZrH2]":559,"[C-2]":560,"[Bi+5]":561,"[24NaH]":562,"[Fr]":563,"[15CH]":564,"[Se+]":565,"[At]":566,"[P-3]":567,"[124I-]":568,"[CuH2-]":569,"[Nb+4]":570,"[Nb+3]":571,"[MgH]":572,"[Ir+4]":573,"[67Ga+3]":574,"[67Ga]":575,"[13N]":576,"[15OH2]":577,"[2NH]":578,"[Ho]":579,"[Cn]":580}
|