Add README and evaluation results
Browse files- CrossEncoderRerankingEvaluator_results_@10.csv +9 -0
- README.md +483 -3
CrossEncoderRerankingEvaluator_results_@10.csv
ADDED
|
@@ -0,0 +1,9 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
epoch,steps,MAP,MRR@10,NDCG@10
|
| 2 |
+
0,0,0.201234224737145,0.24622625665838818,0.3333765906191056
|
| 3 |
+
0,0,0.201234224737145,0.24622625665838818,0.3333765906191056
|
| 4 |
+
1.0,6238,0.42031973501159536,0.661484421265373,0.681130899332091
|
| 5 |
+
1.0,6238,0.4175184482992122,0.6579728914084031,0.677183299653141
|
| 6 |
+
2.0,12476,0.42596499853521474,0.6698020841462649,0.6890968672904094
|
| 7 |
+
2.0,12476,0.42618104932280626,0.6712443276500806,0.6884164601804822
|
| 8 |
+
3.0,18714,0.4266379953496367,0.6710111071325281,0.6901091880496036
|
| 9 |
+
3.0,18714,0.4264841421286288,0.6705833257778512,0.6898266949491281
|
README.md
CHANGED
|
@@ -1,3 +1,483 @@
|
|
| 1 |
-
---
|
| 2 |
-
license: apache-2.0
|
| 3 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
---
|
| 2 |
+
license: apache-2.0
|
| 3 |
+
tags:
|
| 4 |
+
- sentence-transformers
|
| 5 |
+
- cross-encoder
|
| 6 |
+
- reranker
|
| 7 |
+
- modchembert
|
| 8 |
+
- cheminformatics
|
| 9 |
+
- smiles
|
| 10 |
+
- generated_from_trainer
|
| 11 |
+
- dataset_size:3193917
|
| 12 |
+
- loss:MultipleNegativesRankingLoss
|
| 13 |
+
base_model: Derify/ModChemBERT-IR-BASE
|
| 14 |
+
pipeline_tag: text-ranking
|
| 15 |
+
library_name: sentence-transformers
|
| 16 |
+
metrics:
|
| 17 |
+
- map
|
| 18 |
+
- mrr@10
|
| 19 |
+
- ndcg@10
|
| 20 |
+
co2_eq_emissions:
|
| 21 |
+
emissions: 3666.7922463213226
|
| 22 |
+
energy_consumed: 17.863338649668595
|
| 23 |
+
source: codecarbon
|
| 24 |
+
training_type: fine-tuning
|
| 25 |
+
on_cloud: false
|
| 26 |
+
cpu_model: AMD Ryzen 7 3700X 8-Core Processor
|
| 27 |
+
ram_total_size: 62.69877243041992
|
| 28 |
+
hours_used: 29.477
|
| 29 |
+
hardware_used: 2 x NVIDIA GeForce RTX 3090
|
| 30 |
+
model-index:
|
| 31 |
+
- name: 'Derify/ChemRanker-alpha-qed-sim'
|
| 32 |
+
results:
|
| 33 |
+
- task:
|
| 34 |
+
type: cross-encoder-reranking
|
| 35 |
+
name: Cross Encoder Reranking
|
| 36 |
+
dataset:
|
| 37 |
+
name: Unknown
|
| 38 |
+
type: unknown
|
| 39 |
+
metrics:
|
| 40 |
+
- type: map
|
| 41 |
+
value: 0.4266379953496367
|
| 42 |
+
name: Map
|
| 43 |
+
- type: mrr@10
|
| 44 |
+
value: 0.6710111071325281
|
| 45 |
+
name: Mrr@10
|
| 46 |
+
- type: ndcg@10
|
| 47 |
+
value: 0.6901091880496036
|
| 48 |
+
name: Ndcg@10
|
| 49 |
+
---
|
| 50 |
+
|
| 51 |
+
# Derify/ChemRanker-alpha-qed-sim
|
| 52 |
+
|
| 53 |
+
This [Cross Encoder](https://www.sbert.net/docs/cross_encoder/usage/usage.html) is finetuned from [Derify/ModChemBERT-IR-BASE](https://huggingface.co/Derify/ModChemBERT-IR-BASE) using hard-negative triplets derived from [Derify/pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity). Positive SMILES pairs are first filtered by quality and similarity constraints, then reduced to one strongest positive target per anchor molecule to create a high-signal training set for reranking. The model computes relevance scores for pairs of SMILES strings, enabling SMILES reranking and molecular semantic search.
|
| 54 |
+
|
| 55 |
+
For this variant, positives are selected with a composite ranking criterion that combines high QED and similarity without an additional similarity-contribution cutoff. The quality stage uses strict inequality filtering (`QED > 0.85`, `similarity > 0.5`, with similarity also bounded below 1.0), and then keeps the top-scoring pair per anchor molecule.
|
| 56 |
+
|
| 57 |
+
Hard negatives are mined with [Sentence Transformers](https://www.sbert.net/) using [Derify/ChemMRL-beta](https://huggingface.co/Derify/ChemMRL-beta) as the teacher model and a TopK-PercPos-style margin setting based on [NV-Retriever](https://arxiv.org/abs/2407.15831), with `relative_margin=0.05` and `max_negative_score_threshold = pos_score * percentage_margin`. Training uses triplet-format samples with 5 mined negatives per anchor-positive pair and optimizes a multiple-negatives ranking objective, while reranking evaluation uses n-tuple samples with 30 mined negatives per query.
|
| 58 |
+
|
| 59 |
+
## Model Details
|
| 60 |
+
|
| 61 |
+
### Model Description
|
| 62 |
+
- **Model Type:** Cross Encoder
|
| 63 |
+
- **Base model:** [Derify/ModChemBERT-IR-BASE](https://huggingface.co/Derify/ModChemBERT-IR-BASE) <!-- at revision 1d8fd449edb3eadeaa5ebdd1c891e3ce95aebc3d -->
|
| 64 |
+
- **Maximum Sequence Length:** 512 tokens
|
| 65 |
+
- **Number of Output Labels:** 1 label
|
| 66 |
+
- **Training Dataset:**
|
| 67 |
+
- [Derify/pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity) Mined Hard Negatives
|
| 68 |
+
<!-- - **Language:** Unknown -->
|
| 69 |
+
- **License:** apache-2.0
|
| 70 |
+
|
| 71 |
+
### Model Sources
|
| 72 |
+
|
| 73 |
+
- **Documentation:** [Sentence Transformers Documentation](https://sbert.net)
|
| 74 |
+
- **Documentation:** [Cross Encoder Documentation](https://www.sbert.net/docs/cross_encoder/usage/usage.html)
|
| 75 |
+
- **Repository:** [Sentence Transformers on GitHub](https://github.com/huggingface/sentence-transformers)
|
| 76 |
+
- **Hugging Face:** [Cross Encoders on Hugging Face](https://huggingface.co/models?library=sentence-transformers&other=cross-encoder)
|
| 77 |
+
|
| 78 |
+
## Usage
|
| 79 |
+
|
| 80 |
+
### Direct Usage (Sentence Transformers)
|
| 81 |
+
|
| 82 |
+
First install the Transformers and Sentence Transformers libraries:
|
| 83 |
+
|
| 84 |
+
```bash
|
| 85 |
+
pip install -U "transformers>=4.57.1,<5.0.0"
|
| 86 |
+
pip install -U sentence-transformers
|
| 87 |
+
```
|
| 88 |
+
|
| 89 |
+
Then you can load this model and run inference.
|
| 90 |
+
```python
|
| 91 |
+
from sentence_transformers import CrossEncoder
|
| 92 |
+
|
| 93 |
+
# Download from the 🤗 Hub
|
| 94 |
+
model = CrossEncoder("Derify/ChemRanker-alpha-qed-sim")
|
| 95 |
+
# Get scores for pairs of texts
|
| 96 |
+
pairs = [
|
| 97 |
+
['c1snnc1C[NH2+]Cc1cc2c(s1)CCC2', 'c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2'],
|
| 98 |
+
['c1sc2c(c1-c1nc(C3CCOC3)no1)CCCC2', 'O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1'],
|
| 99 |
+
['c1sc(C[NH2+]C2CC2)nc1C[NH+]1CCN2CCCC2C1', 'c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1'],
|
| 100 |
+
['c1sc(CC[NH+]2CCOCC2)nc1C[NH2+]C1CC1', 'CCc1nc(C[NH2+]C2CC2)cs1'],
|
| 101 |
+
['c1sc(CC2CCC[NH2+]2)nc1C1CCCO1', 'c1sc(CC2CCC[NH2+]2)nc1C1CCCC1'],
|
| 102 |
+
]
|
| 103 |
+
scores = model.predict(pairs)
|
| 104 |
+
print(scores.shape)
|
| 105 |
+
# (5,)
|
| 106 |
+
|
| 107 |
+
# Or rank different texts based on similarity to a single text
|
| 108 |
+
ranks = model.rank(
|
| 109 |
+
'c1snnc1C[NH2+]Cc1cc2c(s1)CCC2',
|
| 110 |
+
[
|
| 111 |
+
'c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2',
|
| 112 |
+
'O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1',
|
| 113 |
+
'c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1',
|
| 114 |
+
'CCc1nc(C[NH2+]C2CC2)cs1',
|
| 115 |
+
'c1sc(CC2CCC[NH2+]2)nc1C1CCCC1',
|
| 116 |
+
]
|
| 117 |
+
)
|
| 118 |
+
# [{'corpus_id': ..., 'score': ...}, {'corpus_id': ..., 'score': ...}, ...]
|
| 119 |
+
```
|
| 120 |
+
|
| 121 |
+
<!--
|
| 122 |
+
### Direct Usage (Transformers)
|
| 123 |
+
|
| 124 |
+
<details><summary>Click to see the direct usage in Transformers</summary>
|
| 125 |
+
|
| 126 |
+
</details>
|
| 127 |
+
-->
|
| 128 |
+
|
| 129 |
+
<!--
|
| 130 |
+
### Downstream Usage (Sentence Transformers)
|
| 131 |
+
|
| 132 |
+
You can finetune this model on your own dataset.
|
| 133 |
+
|
| 134 |
+
<details><summary>Click to expand</summary>
|
| 135 |
+
|
| 136 |
+
</details>
|
| 137 |
+
-->
|
| 138 |
+
|
| 139 |
+
<!--
|
| 140 |
+
### Out-of-Scope Use
|
| 141 |
+
|
| 142 |
+
*List how the model may foreseeably be misused and address what users ought not to do with the model.*
|
| 143 |
+
-->
|
| 144 |
+
|
| 145 |
+
## Evaluation
|
| 146 |
+
|
| 147 |
+
### Metrics
|
| 148 |
+
|
| 149 |
+
#### Cross Encoder Reranking
|
| 150 |
+
|
| 151 |
+
* Evaluated with [<code>CrossEncoderRerankingEvaluator</code>](https://sbert.net/docs/package_reference/cross_encoder/evaluation.html#sentence_transformers.cross_encoder.evaluation.CrossEncoderRerankingEvaluator) with these parameters:
|
| 152 |
+
```json
|
| 153 |
+
{
|
| 154 |
+
"at_k": 10
|
| 155 |
+
}
|
| 156 |
+
```
|
| 157 |
+
|
| 158 |
+
| Metric | Value |
|
| 159 |
+
| :---------- | :--------- |
|
| 160 |
+
| map | 0.4266 |
|
| 161 |
+
| mrr@10 | 0.671 |
|
| 162 |
+
| **ndcg@10** | **0.6901** |
|
| 163 |
+
|
| 164 |
+
<!--
|
| 165 |
+
## Bias, Risks and Limitations
|
| 166 |
+
|
| 167 |
+
*What are the known or foreseeable issues stemming from this model? You could also flag here known failure cases or weaknesses of the model.*
|
| 168 |
+
-->
|
| 169 |
+
|
| 170 |
+
<!--
|
| 171 |
+
### Recommendations
|
| 172 |
+
|
| 173 |
+
*What are recommendations with respect to the foreseeable issues? For example, filtering explicit content.*
|
| 174 |
+
-->
|
| 175 |
+
|
| 176 |
+
## Training Details
|
| 177 |
+
|
| 178 |
+
### Training Dataset
|
| 179 |
+
|
| 180 |
+
#### GenMol Similarity Hard Negatives
|
| 181 |
+
|
| 182 |
+
* Dataset: GenMol Similarity Hard Negatives
|
| 183 |
+
* Size: 3,193,917 training samples
|
| 184 |
+
* Columns: <code>smiles_a</code>, <code>smiles_b</code>, and <code>negative</code>
|
| 185 |
+
* Approximate statistics based on the first 1000 samples:
|
| 186 |
+
| | smiles_a | smiles_b | negative |
|
| 187 |
+
| :------ | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- |
|
| 188 |
+
| type | string | string | string |
|
| 189 |
+
| details | <ul><li>min: 19 characters</li><li>mean: 33.64 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 20 characters</li><li>mean: 34.24 characters</li><li>max: 48 characters</li></ul> | <ul><li>min: 19 characters</li><li>mean: 33.27 characters</li><li>max: 57 characters</li></ul> |
|
| 190 |
+
* Samples:
|
| 191 |
+
| smiles_a | smiles_b | negative |
|
| 192 |
+
| :---------------------------------------------- | :------------------------------------------------- | :------------------------------------------------- |
|
| 193 |
+
| <code>c1sc2cc3c(cc2c1CC[NH2+]C1CC1)OCCO3</code> | <code>FC(F)(F)[NH2+]CCc1csc2cc3c(cc12)OCCO3</code> | <code>[NH3+]CCCc1cc2c(cc1C1CC1)OCO2</code> |
|
| 194 |
+
| <code>c1sc2cc3c(cc2c1CC[NH2+]C1CC1)OCCO3</code> | <code>FC(F)(F)[NH2+]CCc1csc2cc3c(cc12)OCCO3</code> | <code>COc1cc2c(cc1C[NH2+]C1CCC1)OCO2</code> |
|
| 195 |
+
| <code>c1sc2cc3c(cc2c1CC[NH2+]C1CC1)OCCO3</code> | <code>FC(F)(F)[NH2+]CCc1csc2cc3c(cc12)OCCO3</code> | <code>O=c1[nH]c2cc3c(cc2cc1CNC1CCCCC1)OCCO3</code> |
|
| 196 |
+
* Loss: [<code>MultipleNegativesRankingLoss</code>](https://sbert.net/docs/package_reference/cross_encoder/losses.html#multiplenegativesrankingloss) with these parameters:
|
| 197 |
+
```json
|
| 198 |
+
{
|
| 199 |
+
"scale": 10.0,
|
| 200 |
+
"num_negatives": 4,
|
| 201 |
+
"activation_fn": "torch.nn.modules.activation.Sigmoid"
|
| 202 |
+
}
|
| 203 |
+
```
|
| 204 |
+
|
| 205 |
+
### Evaluation Dataset
|
| 206 |
+
|
| 207 |
+
#### GenMol Similarity Hard Negatives
|
| 208 |
+
|
| 209 |
+
* Dataset: GenMol Similarity Hard Negatives
|
| 210 |
+
* Size: 165,968 evaluation samples
|
| 211 |
+
* Columns: <code>smiles_a</code>, <code>smiles_b</code>, <code>negative_1</code>, <code>negative_2</code>, <code>negative_3</code>, <code>negative_4</code>, <code>negative_5</code>, <code>negative_6</code>, <code>negative_7</code>, <code>negative_8</code>, <code>negative_9</code>, <code>negative_10</code>, <code>negative_11</code>, <code>negative_12</code>, <code>negative_13</code>, <code>negative_14</code>, <code>negative_15</code>, <code>negative_16</code>, <code>negative_17</code>, <code>negative_18</code>, <code>negative_19</code>, <code>negative_20</code>, <code>negative_21</code>, <code>negative_22</code>, <code>negative_23</code>, <code>negative_24</code>, <code>negative_25</code>, <code>negative_26</code>, <code>negative_27</code>, <code>negative_28</code>, <code>negative_29</code>, and <code>negative_30</code>
|
| 212 |
+
* Approximate statistics based on the first 1000 samples:
|
| 213 |
+
| | smiles_a | smiles_b | negative_1 | negative_2 | negative_3 | negative_4 | negative_5 | negative_6 | negative_7 | negative_8 | negative_9 | negative_10 | negative_11 | negative_12 | negative_13 | negative_14 | negative_15 | negative_16 | negative_17 | negative_18 | negative_19 | negative_20 | negative_21 | negative_22 | negative_23 | negative_24 | negative_25 | negative_26 | negative_27 | negative_28 | negative_29 | negative_30 |
|
| 214 |
+
| :------ | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :-------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- | :--------------------------------------------------------------------------------------------- |
|
| 215 |
+
| type | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string | string |
|
| 216 |
+
| details | <ul><li>min: 17 characters</li><li>mean: 37.57 characters</li><li>max: 96 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 34.45 characters</li><li>max: 70 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.67 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 12 characters</li><li>mean: 35.13 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.28 characters</li><li>max: 81 characters</li></ul> | <ul><li>min: 17 characters</li><li>mean: 35.36 characters</li><li>max: 73 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.12 characters</li><li>max: 70 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.09 characters</li><li>max: 84 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.16 characters</li><li>max: 64 characters</li></ul> | <ul><li>min: 13 characters</li><li>mean: 35.26 characters</li><li>max: 90 characters</li></ul> | <ul><li>min: 11 characters</li><li>mean: 35.16 characters</li><li>max: 90 characters</li></ul> | <ul><li>min: 15 characters</li><li>mean: 35.36 characters</li><li>max: 74 characters</li></ul> | <ul><li>min: 12 characters</li><li>mean: 35.16 characters</li><li>max: 63 characters</li></ul> | <ul><li>min: 15 characters</li><li>mean: 35.51 characters</li><li>max: 73 characters</li></ul> | <ul><li>min: 13 characters</li><li>mean: 35.21 characters</li><li>max: 69 characters</li></ul> | <ul><li>min: 10 characters</li><li>mean: 34.93 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 17 characters</li><li>mean: 35.41 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.1 characters</li><li>max: 72 characters</li></ul> | <ul><li>min: 15 characters</li><li>mean: 35.43 characters</li><li>max: 62 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.36 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.48 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.25 characters</li><li>max: 65 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.48 characters</li><li>max: 81 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.38 characters</li><li>max: 68 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.67 characters</li><li>max: 68 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.53 characters</li><li>max: 67 characters</li></ul> | <ul><li>min: 14 characters</li><li>mean: 35.39 characters</li><li>max: 83 characters</li></ul> | <ul><li>min: 18 characters</li><li>mean: 35.74 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 17 characters</li><li>mean: 35.56 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 11 characters</li><li>mean: 35.37 characters</li><li>max: 64 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.51 characters</li><li>max: 77 characters</li></ul> | <ul><li>min: 16 characters</li><li>mean: 35.35 characters</li><li>max: 72 characters</li></ul> |
|
| 217 |
+
* Samples:
|
| 218 |
+
| smiles_a | smiles_b | negative_1 | negative_2 | negative_3 | negative_4 | negative_5 | negative_6 | negative_7 | negative_8 | negative_9 | negative_10 | negative_11 | negative_12 | negative_13 | negative_14 | negative_15 | negative_16 | negative_17 | negative_18 | negative_19 | negative_20 | negative_21 | negative_22 | negative_23 | negative_24 | negative_25 | negative_26 | negative_27 | negative_28 | negative_29 | negative_30 |
|
| 219 |
+
| :--------------------------------------------------- | :---------------------------------------------------------- | :---------------------------------------------------------- | :---------------------------------------------------- | :------------------------------------------------- | :------------------------------------------ | :-------------------------------------------------- | :----------------------------------------- | :------------------------------------------------- | :--------------------------------------------------- | :---------------------------------------------------- | :------------------------------------------------- | :------------------------------------------------------- | :----------------------------------------------- | :------------------------------------------------------ | :------------------------------------------------ | :------------------------------------------------------ | :--------------------------------------------------- | :------------------------------------------------ | :----------------------------------------------- | :---------------------------------------------------- | :----------------------------------------------- | :----------------------------------------------------- | :-------------------------------------------------- | :----------------------------------------------------- | :------------------------------------------------- | :--------------------------------------------- | :--------------------------------------------------------- | :------------------------------------------------ | :--------------------------------------------------- | :------------------------------------------------------- | :----------------------------------------------- |
|
| 220 |
+
| <code>c1snnc1C[NH2+]Cc1cc2c(s1)CCC2</code> | <code>c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2</code> | <code>c1snnc1CCC[NH2+]Cc1cc2c(s1)CCC2</code> | <code>Cn1cc(C[NH2+]Cc2cc3c(s2)CCC3)nn1</code> | <code>Cn1cc(CC[NH2+]Cc2cc3c(s2)CCC3)nn1</code> | <code>Cc1cc(C[NH2+]Cc2csnn2)sc1C</code> | <code>NC(=O)c1csc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>Cc1cc(CC[NH2+]Cc2csnn2)sc1C</code> | <code>N#CCc1csc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>Ic1ccc(C[NH2+]Cc2cc3c(s2)CCC3)o1</code> | <code>c1ncc(C[NH2+]Cc2csnn2)s1</code> | <code>c1c(C[NH2+]CC2CC2)sc2c1CSCC2</code> | <code>N#Cc1cc(F)cc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>c1cc(C[NH2+]Cc2nc3c(s2)CCC3)no1</code> | <code>CCc1ccc(C[NH2+]Cc2csnn2)s1</code> | <code>NCc1csc(NCc2cc3c(s2)CCC3)n1</code> | <code>C[NH+](Cc1cscn1)Cc1nnc(-c2cc3c(s2)CCCC3)o1</code> | <code>Fc1cc(C[NH2+]Cc2cc3c(s2)CCC3)ccc1Br</code> | <code>FC(F)(F)C[NH2+]Cc1cc2c(s1)CCSC2</code> | <code>c1cc(C[NH2+]Cc2cc3c(s2)CCC3)c[nH]1</code> | <code>Cc1cc(C)c(CC[NH2+]Cc2cc3c(s2)CCC3)c(C)c1</code> | <code>Oc1ccc(C[NH2+]Cc2cc3c(s2)CCC3)cc1Br</code> | <code>O=C([O-])c1ccc(CC[NH2+]Cc2cc3c(s2)CCC3)s1</code> | <code>c1c(C[NH2+]CC2CCCC2)sc2c1CCC2</code> | <code>O=C([O-])c1ccc(C[NH2+]Cc2cc3c(s2)CCC3)s1</code> | <code>COc1cc(C)cc(C[NH2+]Cc2cc3c(s2)CCC3)c1</code> | <code>CCc1cnc(C[NH2+]Cc2csnn2)s1</code> | <code>Clc1cc(C[NH2+]Cc2cc3c(s2)CCC3)ccc1Br</code> | <code>c1c(C[NH2+]CC2CC2)sc2c1CCCCC2</code> | <code>Cc1ccccc1C[NH2+]Cc1cc2c(s1)CCC2</code> | <code>c1cc(C[NH+]2CCCC2)sc1C[NH2+]Cc1cc2c(s1)CCC2</code> | <code>Cc1cc(C[NH2+]Cc2cc3c(s2)CCC3)ccc1F</code> |
|
| 221 |
+
| <code>c1sc2c(c1-c1nc(C3CCOC3)no1)CCCC2</code> | <code>O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1</code> | <code>Nc1sc2c(c1-c1nc(C3CCOC3)no1)CCCC2</code> | <code>Nc1sc2c(c1-c1nc(C3CCC3)no1)CCCC2</code> | <code>c1c(-c2nc(C3CCCNC3)no2)sc2c1CCCCCC2</code> | <code>Nc1sccc1-c1nc(C2CCCOC2)no1</code> | <code>Nc1sc2c(c1-c1nc(C3CCCO3)no1)CCCC2</code> | <code>Cc1csc(-c2nc(C3CCOCC3)no2)c1N</code> | <code>Cc1oc2c(c1-c1nc(C3CCOC3)no1)C(=O)CCC2</code> | <code>c1c(-c2nc(C3C[NH2+]CCO3)no2)sc2c1CCCCC2</code> | <code>O=C([O-])Nc1sc2c(c1-c1nc(C3CC3)no1)CCCC2</code> | <code>c1cc2c(s1)CCCC2c1nc(C2CC2)no1</code> | <code>CC(=O)N1CCCC(c2noc(-c3cc4c(s3)CCCCCC4)n2)C1</code> | <code>Cc1cc(-c2nc([C@@H]3CCOC3)no2)c(N)s1</code> | <code>c1cc2c(nc1-c1noc(C3CCCOC3)n1)CCCC2</code> | <code>Nc1sccc1-c1nc(C2CCCC2)no1</code> | <code>c1cc2c(nc1-c1noc(C3CCOCC3)n1)CCCC2</code> | <code>[NH3+]C(c1noc(-c2cc3c(s2)CCCC3)n1)C1CC1</code> | <code>c1cc2c(c(-c3nc(C4CCOCC4)no3)c1)CCCN2</code> | <code>c1c(-c2nc(C3CC3)no2)nn2c1CCCC2</code> | <code>CN1CC(c2noc(-c3cc4c(s3)CCCC4)n2)CC1=O</code> | <code>O=C([O-])Cc1noc(-c2csc3c2CCCC3)n1</code> | <code>Oc1c(-c2nc(C3CCC(F)(F)C3)no2)ccc2c1CCCC2</code> | <code>Cc1cc(=O)c(-c2noc(C3CCCOC3)n2)c2n1CCC2</code> | <code>O=C([O-])CNc1sc2c(c1-c1nc(C3CC3)no1)CCCC2</code> | <code>CC1CCc2c(sc(N)c2-c2nc(C3CC3)no2)C1</code> | <code>Cn1nc(-c2nc(C3CCCO3)no2)c2c1CCCC2</code> | <code>O=C(Nc1sc2c(c1-c1nc(C3CC3)no1)COCC2)C1=CCCCC1</code> | <code>Cc1cscc1-c1noc(C2CCOCC2)n1</code> | <code>CC1(C)CCCc2sc(N)c(-c3nc(C4CC4)no3)c21</code> | <code>Clc1cc2c(c(-c3nc(C4CCOC4)no3)c1)OCC2</code> | <code>Nc1sc2c(c1-c1nnc(C3CC3)o1)CCCC2</code> |
|
| 222 |
+
| <code>c1sc(C[NH2+]C2CC2)nc1C[NH+]1CCN2CCCC2C1</code> | <code>c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1</code> | <code>c1sc(C[NH2+]C2CC2)nc1C1CC([NH+]2CCN3CCCC3C2)C1</code> | <code>CC(C)[NH2+]Cc1nc(C[NH+]2CCC3CCCCC3C2)cs1</code> | <code>CN1C2CCC1C[NH+](Cc1csc(C[NH3+])n1)CC2</code> | <code>Nc1nc(CC[NH+]2CCCN3CCCC3C2)cs1</code> | <code>CC1C[NH+](Cc2csc(C[NH2+]C3CC3)n2)CCN1C</code> | <code>Oc1csc(CN2CCCC3C[NH2+]CC32)n1</code> | <code>CCc1nc(C[NH+]2CCCC3CCCCC32)cs1</code> | <code>C[NH2+]Cc1csc(N2CC[NH+]3CCCC3C2)n1</code> | <code>[NH3+]Cc1nc(C[NH+]2CCC3CCCCC32)cs1</code> | <code>CC1CN2CCCCC2C[NH+]1Cc1csc(CC[NH3+])n1</code> | <code>CCCc1nc(CN2CCCC2C2CCC[NH2+]2)cs1</code> | <code>ClCCc1nc(CN2CCCC2C2CCC[NH2+]2)cs1</code> | <code>c1cc(C[NH2+]C2CC2)c(C[NH+]2CCN3CCCCC3C2)o1</code> | <code>O=C(Cc1nc(CCl)cs1)N1CCC[NH+]2CCCC2C1</code> | <code>N#CCc1nc(C[NH+]2CCCC3CCCCC32)cs1</code> | <code>CC[NH2+]Cc1csc(N2CCC3C(CCC[NH+]3C)C2)n1</code> | <code>c1sc(C[NH2+]C2CC2)nc1C[NH+]1CCCCC1</code> | <code>[NH3+]Cc1nc(C[NH+]2CCCC2C2CCCC2)cs1</code> | <code>Cc1csc(C[NH+]2CCC3C[NH2+]CC3C2)n1</code> | <code>ClOCc1csc(C[NH+]2CC3C[NH2+]CC3C2)n1</code> | <code>c1cc(C[NH+]2CCCN3CCCC3C2)nc(C2CC2)n1</code> | <code>Cc1ccsc1C[NH2+]CCN1CCN2CCCC2C1</code> | <code>c1sc(C[NH2+]C2CCCC2)nc1C[NH+]1CCCCC1</code> | <code>Brc1csc(C[NH2+]CCN2CCN3CCCCC3C2)c1</code> | <code>Cc1nc(CCC[NH2+]C2CCN3CCCCC23)cs1</code> | <code>CCOC(=O)c1nc(CN2CC3CCC[NH2+]C3C2)cs1</code> | <code>CCCC(=O)c1nc(CN2CC3CCC[NH2+]C3C2)cs1</code> | <code>CC(C)(C)c1csc(CN2CCC[NH2+]C(C3CC3)C2)n1</code> | <code>COCc1nc(CN2CCC([NH3+])C2)cs1</code> | <code>CCC[NH2+]Cc1nc(C[NH+]2CC3CCC2C3)cs1</code> |
|
| 223 |
+
* Loss: [<code>MultipleNegativesRankingLoss</code>](https://sbert.net/docs/package_reference/cross_encoder/losses.html#multiplenegativesrankingloss) with these parameters:
|
| 224 |
+
```json
|
| 225 |
+
{
|
| 226 |
+
"scale": 10.0,
|
| 227 |
+
"num_negatives": 4,
|
| 228 |
+
"activation_fn": "torch.nn.modules.activation.Sigmoid"
|
| 229 |
+
}
|
| 230 |
+
```
|
| 231 |
+
|
| 232 |
+
### Training Hyperparameters
|
| 233 |
+
#### Non-Default Hyperparameters
|
| 234 |
+
|
| 235 |
+
- `eval_strategy`: epoch
|
| 236 |
+
- `per_device_train_batch_size`: 256
|
| 237 |
+
- `per_device_eval_batch_size`: 256
|
| 238 |
+
- `torch_empty_cache_steps`: 1000
|
| 239 |
+
- `learning_rate`: 3e-05
|
| 240 |
+
- `weight_decay`: 1e-05
|
| 241 |
+
- `max_grad_norm`: None
|
| 242 |
+
- `lr_scheduler_type`: warmup_stable_decay
|
| 243 |
+
- `lr_scheduler_kwargs`: {'num_decay_steps': 6238, 'warmup_type': 'linear', 'decay_type': '1-sqrt'}
|
| 244 |
+
- `warmup_steps`: 6238
|
| 245 |
+
- `seed`: 12
|
| 246 |
+
- `data_seed`: 24681357
|
| 247 |
+
- `bf16`: True
|
| 248 |
+
- `bf16_full_eval`: True
|
| 249 |
+
- `tf32`: True
|
| 250 |
+
- `dataloader_num_workers`: 8
|
| 251 |
+
- `dataloader_prefetch_factor`: 2
|
| 252 |
+
- `load_best_model_at_end`: True
|
| 253 |
+
- `optim`: stable_adamw
|
| 254 |
+
- `optim_args`: decouple_lr=True,max_lr=3e-05
|
| 255 |
+
- `dataloader_persistent_workers`: True
|
| 256 |
+
- `resume_from_checkpoint`: False
|
| 257 |
+
- `gradient_checkpointing`: True
|
| 258 |
+
- `torch_compile`: True
|
| 259 |
+
- `torch_compile_backend`: inductor
|
| 260 |
+
- `torch_compile_mode`: max-autotune
|
| 261 |
+
- `batch_sampler`: no_duplicates
|
| 262 |
+
|
| 263 |
+
#### All Hyperparameters
|
| 264 |
+
<details><summary>Click to expand</summary>
|
| 265 |
+
|
| 266 |
+
- `overwrite_output_dir`: False
|
| 267 |
+
- `do_predict`: False
|
| 268 |
+
- `eval_strategy`: epoch
|
| 269 |
+
- `prediction_loss_only`: True
|
| 270 |
+
- `per_device_train_batch_size`: 256
|
| 271 |
+
- `per_device_eval_batch_size`: 256
|
| 272 |
+
- `per_gpu_train_batch_size`: None
|
| 273 |
+
- `per_gpu_eval_batch_size`: None
|
| 274 |
+
- `gradient_accumulation_steps`: 1
|
| 275 |
+
- `eval_accumulation_steps`: None
|
| 276 |
+
- `torch_empty_cache_steps`: 1000
|
| 277 |
+
- `learning_rate`: 3e-05
|
| 278 |
+
- `weight_decay`: 1e-05
|
| 279 |
+
- `adam_beta1`: 0.9
|
| 280 |
+
- `adam_beta2`: 0.999
|
| 281 |
+
- `adam_epsilon`: 1e-08
|
| 282 |
+
- `max_grad_norm`: None
|
| 283 |
+
- `num_train_epochs`: 3
|
| 284 |
+
- `max_steps`: -1
|
| 285 |
+
- `lr_scheduler_type`: warmup_stable_decay
|
| 286 |
+
- `lr_scheduler_kwargs`: {'num_decay_steps': 6238, 'warmup_type': 'linear', 'decay_type': '1-sqrt'}
|
| 287 |
+
- `warmup_ratio`: 0.0
|
| 288 |
+
- `warmup_steps`: 6238
|
| 289 |
+
- `log_level`: passive
|
| 290 |
+
- `log_level_replica`: warning
|
| 291 |
+
- `log_on_each_node`: True
|
| 292 |
+
- `logging_nan_inf_filter`: True
|
| 293 |
+
- `save_safetensors`: True
|
| 294 |
+
- `save_on_each_node`: False
|
| 295 |
+
- `save_only_model`: False
|
| 296 |
+
- `restore_callback_states_from_checkpoint`: False
|
| 297 |
+
- `no_cuda`: False
|
| 298 |
+
- `use_cpu`: False
|
| 299 |
+
- `use_mps_device`: False
|
| 300 |
+
- `seed`: 12
|
| 301 |
+
- `data_seed`: 24681357
|
| 302 |
+
- `jit_mode_eval`: False
|
| 303 |
+
- `bf16`: True
|
| 304 |
+
- `fp16`: False
|
| 305 |
+
- `fp16_opt_level`: O1
|
| 306 |
+
- `half_precision_backend`: auto
|
| 307 |
+
- `bf16_full_eval`: True
|
| 308 |
+
- `fp16_full_eval`: False
|
| 309 |
+
- `tf32`: True
|
| 310 |
+
- `local_rank`: 0
|
| 311 |
+
- `ddp_backend`: None
|
| 312 |
+
- `tpu_num_cores`: None
|
| 313 |
+
- `tpu_metrics_debug`: False
|
| 314 |
+
- `debug`: []
|
| 315 |
+
- `dataloader_drop_last`: True
|
| 316 |
+
- `dataloader_num_workers`: 8
|
| 317 |
+
- `dataloader_prefetch_factor`: 2
|
| 318 |
+
- `past_index`: -1
|
| 319 |
+
- `disable_tqdm`: False
|
| 320 |
+
- `remove_unused_columns`: True
|
| 321 |
+
- `label_names`: None
|
| 322 |
+
- `load_best_model_at_end`: True
|
| 323 |
+
- `ignore_data_skip`: False
|
| 324 |
+
- `fsdp`: []
|
| 325 |
+
- `fsdp_min_num_params`: 0
|
| 326 |
+
- `fsdp_config`: {'min_num_params': 0, 'xla': False, 'xla_fsdp_v2': False, 'xla_fsdp_grad_ckpt': False}
|
| 327 |
+
- `fsdp_transformer_layer_cls_to_wrap`: None
|
| 328 |
+
- `accelerator_config`: {'split_batches': False, 'dispatch_batches': None, 'even_batches': True, 'use_seedable_sampler': True, 'non_blocking': False, 'gradient_accumulation_kwargs': None}
|
| 329 |
+
- `parallelism_config`: None
|
| 330 |
+
- `deepspeed`: None
|
| 331 |
+
- `label_smoothing_factor`: 0.0
|
| 332 |
+
- `optim`: stable_adamw
|
| 333 |
+
- `optim_args`: decouple_lr=True,max_lr=3e-05
|
| 334 |
+
- `adafactor`: False
|
| 335 |
+
- `group_by_length`: False
|
| 336 |
+
- `length_column_name`: length
|
| 337 |
+
- `project`: huggingface
|
| 338 |
+
- `trackio_space_id`: trackio
|
| 339 |
+
- `ddp_find_unused_parameters`: None
|
| 340 |
+
- `ddp_bucket_cap_mb`: None
|
| 341 |
+
- `ddp_broadcast_buffers`: False
|
| 342 |
+
- `dataloader_pin_memory`: True
|
| 343 |
+
- `dataloader_persistent_workers`: True
|
| 344 |
+
- `skip_memory_metrics`: True
|
| 345 |
+
- `use_legacy_prediction_loop`: False
|
| 346 |
+
- `push_to_hub`: False
|
| 347 |
+
- `resume_from_checkpoint`: False
|
| 348 |
+
- `hub_model_id`: None
|
| 349 |
+
- `hub_strategy`: every_save
|
| 350 |
+
- `hub_private_repo`: None
|
| 351 |
+
- `hub_always_push`: False
|
| 352 |
+
- `hub_revision`: None
|
| 353 |
+
- `gradient_checkpointing`: True
|
| 354 |
+
- `gradient_checkpointing_kwargs`: None
|
| 355 |
+
- `include_inputs_for_metrics`: False
|
| 356 |
+
- `include_for_metrics`: []
|
| 357 |
+
- `eval_do_concat_batches`: True
|
| 358 |
+
- `fp16_backend`: auto
|
| 359 |
+
- `push_to_hub_model_id`: None
|
| 360 |
+
- `push_to_hub_organization`: None
|
| 361 |
+
- `mp_parameters`:
|
| 362 |
+
- `auto_find_batch_size`: False
|
| 363 |
+
- `full_determinism`: False
|
| 364 |
+
- `torchdynamo`: None
|
| 365 |
+
- `ray_scope`: last
|
| 366 |
+
- `ddp_timeout`: 1800
|
| 367 |
+
- `torch_compile`: True
|
| 368 |
+
- `torch_compile_backend`: inductor
|
| 369 |
+
- `torch_compile_mode`: max-autotune
|
| 370 |
+
- `include_tokens_per_second`: False
|
| 371 |
+
- `include_num_input_tokens_seen`: no
|
| 372 |
+
- `neftune_noise_alpha`: None
|
| 373 |
+
- `optim_target_modules`: None
|
| 374 |
+
- `batch_eval_metrics`: False
|
| 375 |
+
- `eval_on_start`: False
|
| 376 |
+
- `use_liger_kernel`: False
|
| 377 |
+
- `liger_kernel_config`: None
|
| 378 |
+
- `eval_use_gather_object`: False
|
| 379 |
+
- `average_tokens_across_devices`: True
|
| 380 |
+
- `prompts`: None
|
| 381 |
+
- `batch_sampler`: no_duplicates
|
| 382 |
+
- `multi_dataset_batch_sampler`: proportional
|
| 383 |
+
- `router_mapping`: {}
|
| 384 |
+
- `learning_rate_mapping`: {}
|
| 385 |
+
|
| 386 |
+
</details>
|
| 387 |
+
|
| 388 |
+
### Training Logs
|
| 389 |
+
| Epoch | Step | Training Loss | Validation Loss | ndcg@10 |
|
| 390 |
+
| :-----: | :-------: | :-----------: | :-------------: | :--------: |
|
| 391 |
+
| 0.0002 | 1 | 1.2724 | - | - |
|
| 392 |
+
| 0.1603 | 1000 | 0.1583 | - | - |
|
| 393 |
+
| 0.3206 | 2000 | 0.0196 | - | - |
|
| 394 |
+
| 0.4809 | 3000 | 0.0112 | - | - |
|
| 395 |
+
| 0.6412 | 4000 | 0.0079 | - | - |
|
| 396 |
+
| 0.8015 | 5000 | 0.0063 | - | - |
|
| 397 |
+
| 0.9618 | 6000 | 0.0053 | - | - |
|
| 398 |
+
| 1.0 | 6238 | - | 1.6835 | 0.6811 |
|
| 399 |
+
| 1.1222 | 7000 | 0.0045 | - | - |
|
| 400 |
+
| 1.2825 | 8000 | 0.0041 | - | - |
|
| 401 |
+
| 1.4428 | 9000 | 0.0037 | - | - |
|
| 402 |
+
| 1.6031 | 10000 | 0.0034 | - | - |
|
| 403 |
+
| 1.7634 | 11000 | 0.0032 | - | - |
|
| 404 |
+
| 1.9237 | 12000 | 0.003 | - | - |
|
| 405 |
+
| 2.0 | 12476 | - | 1.6853 | 0.6891 |
|
| 406 |
+
| 2.0840 | 13000 | 0.0028 | - | - |
|
| 407 |
+
| 2.2443 | 14000 | 0.0026 | - | - |
|
| 408 |
+
| 2.4046 | 15000 | 0.0026 | - | - |
|
| 409 |
+
| 2.5649 | 16000 | 0.0025 | - | - |
|
| 410 |
+
| 2.7252 | 17000 | 0.0024 | - | - |
|
| 411 |
+
| 2.8855 | 18000 | 0.0023 | - | - |
|
| 412 |
+
| **3.0** | **18714** | **-** | **1.6982** | **0.6901** |
|
| 413 |
+
|
| 414 |
+
* The bold row denotes the saved checkpoint.
|
| 415 |
+
|
| 416 |
+
### Environmental Impact
|
| 417 |
+
Carbon emissions were measured using [CodeCarbon](https://github.com/mlco2/codecarbon).
|
| 418 |
+
- **Energy Consumed**: 17.863 kWh
|
| 419 |
+
- **Carbon Emitted**: 3.667 kg of CO2
|
| 420 |
+
- **Hours Used**: 29.477 hours
|
| 421 |
+
|
| 422 |
+
### Training Hardware
|
| 423 |
+
- **On Cloud**: No
|
| 424 |
+
- **GPU Model**: 2 x NVIDIA GeForce RTX 3090
|
| 425 |
+
- **CPU Model**: AMD Ryzen 7 3700X 8-Core Processor
|
| 426 |
+
- **RAM Size**: 62.70 GB
|
| 427 |
+
|
| 428 |
+
### Framework Versions
|
| 429 |
+
- Python: 3.13.7
|
| 430 |
+
- Sentence Transformers: 5.1.2
|
| 431 |
+
- Transformers: 4.57.1
|
| 432 |
+
- PyTorch: 2.9.0+cu128
|
| 433 |
+
- Accelerate: 1.11.0
|
| 434 |
+
- Datasets: 4.4.1
|
| 435 |
+
- Tokenizers: 0.22.1
|
| 436 |
+
|
| 437 |
+
## Citation
|
| 438 |
+
|
| 439 |
+
### BibTeX
|
| 440 |
+
|
| 441 |
+
#### Sentence Transformers
|
| 442 |
+
```bibtex
|
| 443 |
+
@inproceedings{reimers-2019-sentence-bert,
|
| 444 |
+
title = "Sentence-BERT: Sentence Embeddings using Siamese BERT-Networks",
|
| 445 |
+
author = "Reimers, Nils and Gurevych, Iryna",
|
| 446 |
+
booktitle = "Proceedings of the 2019 Conference on Empirical Methods in Natural Language Processing",
|
| 447 |
+
month = "11",
|
| 448 |
+
year = "2019",
|
| 449 |
+
publisher = "Association for Computational Linguistics",
|
| 450 |
+
url = "https://arxiv.org/abs/1908.10084",
|
| 451 |
+
}
|
| 452 |
+
```
|
| 453 |
+
|
| 454 |
+
#### NV-Retriever
|
| 455 |
+
```bibtex
|
| 456 |
+
@misc{moreira2025nvretrieverimprovingtextembedding,
|
| 457 |
+
title={NV-Retriever: Improving text embedding models with effective hard-negative mining},
|
| 458 |
+
author={Gabriel de Souza P. Moreira and Radek Osmulski and Mengyao Xu and Ronay Ak and Benedikt Schifferer and Even Oldridge},
|
| 459 |
+
year={2025},
|
| 460 |
+
eprint={2407.15831},
|
| 461 |
+
archivePrefix={arXiv},
|
| 462 |
+
primaryClass={cs.IR},
|
| 463 |
+
url={https://arxiv.org/abs/2407.15831},
|
| 464 |
+
}
|
| 465 |
+
```
|
| 466 |
+
|
| 467 |
+
<!--
|
| 468 |
+
## Glossary
|
| 469 |
+
|
| 470 |
+
*Clearly define terms in order to be accessible across audiences.*
|
| 471 |
+
-->
|
| 472 |
+
|
| 473 |
+
<!--
|
| 474 |
+
## Model Card Authors
|
| 475 |
+
|
| 476 |
+
*Lists the people who create the model card, providing recognition and accountability for the detailed work that goes into its construction.*
|
| 477 |
+
-->
|
| 478 |
+
|
| 479 |
+
<!--
|
| 480 |
+
## Model Card Contact
|
| 481 |
+
|
| 482 |
+
*Provides a way for people who have updates to the Model Card, suggestions, or questions, to contact the Model Card authors.*
|
| 483 |
+
-->
|