[
{
"instruction": "Please add a amide to the molecule CC(C)(CNC(=O)N[C@H]1CCN(CC(F)(F)F)C1)NS(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101639",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(COc1cccc(I)c1)N(c1ccccc1)[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224282",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc2nc(N3C(=O)C([O-])=C(C(=O)c4ccncc4)[C@H]3c3ccccc3)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222794",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cnc(S(=O)(=O)Cc2noc3c2CCCC3)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)(C)OC(=O)N1CCC[C@H](C(=O)N[C@H]2CCS(=O)(=O)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6906",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(c1cccc(O)c1)N1CC[NH+]([C@H]2CCC[C@H](C3CC3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nnc2n1CCC[C@H]2NC(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35178",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1coc(-c2cccc(NC(=O)C(=O)N[C@H]3CC[C@H]([NH+](C)C)C3)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102437",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CC(=O)Nc2ccccc2N1C(=O)/C=C/c1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180042",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CSCC[C@H]1[NH+]=C(c2ccccc2)N(C2CC2)C1=[NH2+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144193",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[NH2+][C@H](CC)c1ccccc1OCc1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCC(=O)N1CCO[C@H](C(N)=S)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105820",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCCN/C([O-])=C(\\C#N)C(=O)Cn1c(=O)n(CC)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H](NCCc1nc2c(F)cccc2n1C)c1ccc(F)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227562",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(NC(=O)CSc2nnc(C(F)(F)F)n2-c2ccccc2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1n[nH]c(COc2ccccc2)c1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33778",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@@H]1c2cc(OC)ccc2CC[C@H]1S[C@@H](C)CC by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141553",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CCN(Cc2cncs2)CC(F)(F)F)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211941",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(-c2nc3cc(Cl)c([N+](=O)[O-])cc3[nH]2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135463",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCC[NH+](CCC)CC(=O)Nc1ccc(C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83309",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule NC(=O)COc1ccc(CN2CCO[C@H](C(F)(F)F)C2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79088",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2ccccc2)c(C)c1N1CCN(C(=O)CC2CCCC2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228434",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C(C)C)cc1C(=O)N1CSC[C@H]1C(=O)[O-] by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206143",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOC(=O)C(=O)NC[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145187",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(CS(=O)(=O)Cc2cc(=O)n3cccc(C)c3n2)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66687",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(c1ccnc(OC2CCC2)c1)N1CCOc2cc(F)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41737",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccccc1NC(=O)C1=C(C)Nc2nnnn2[C@@H]1c1cc(Cl)ccc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74084",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2ncn(C(=O)[C@H]3CC(=O)N(c4ccc(C)c(Cl)c4)C3)c2cc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25315",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule CCS(=O)(=O)N1CCC(NS(=O)(=O)c2c(C)c(Cl)cc(C)c2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242609",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C)c2ccc(OCC(=O)Nc3ccc(F)cc3F)cc2oc1=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241907",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Brc1cc(-c2ccccc2)c(C2CC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152956",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1nc2sccc2c(=O)n1NC(=O)c1cccc2ncccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(C)C(=O)CN(C)C(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202776",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(Nc1cccc(OC(F)F)c1)N[C@@H]1CC[NH+](Cc2ccccc2)C[C@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106040",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccc(N(C(=O)Nc2cccc([N+](=O)[O-])c2)[C@@H](C)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147646",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[NH+](C)CCNc1cc(-c2ccc3ncnc(N)c3c2)c2cc[nH]c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199779",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(CNC(=S)Nc2ccc(Cl)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78569",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(C)=O)cc1NC(=O)CCC1CCCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79988",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CO[C@@H](CNC(=O)C[C@@H](O)c1ccc(Cl)cc1)C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104536",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(CC(=O)NCC#CCOc2cccc3ccccc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177480",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ncsc1CCS(=O)(=O)c1nccn1-c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91943",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ccccc1NS(=O)(=O)c1ccc(C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85559",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ncc(Cl)c1C(=O)N1CCCCC[C@H]1c1cc(-c2cccs2)on1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223596",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(c1nc(Cl)ncc1F)C1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94153",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COCc1nn2c(ncc3c(=O)n(Cc4ccccc4)ccc32)c1-c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176341",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc2cc(-c3cc(F)cc(F)c3)c(=O)oc2c1)Nc1cccnc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137172",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@H](Cc1cc(=O)[nH]c(-c2ccccn2)n1)c1ccccc1)C1CCCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35201",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule [NH3+][C@H]1CCC[C@@H]1CNC(=O)CC12CC3CC(CC(C3)C1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCS(=O)(=O)N1CCC[C@H]1C(=O)NCC[NH+]1CCCCC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45656",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+]1CCN(CCNC(=O)c2sc(-n3cccc3)nc2C(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171261",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccc(Cl)c1Cl)C(=O)N[C@@H](c1ccccc1)C1CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76256",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)c1cc(C)n(-c2ccccc2)n1)c1cccc(F)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209948",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(O[C@H](C)C(=O)Nc2cnn(C)c2)ccc1C(C)C by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135184",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)c1cc(O)n(-c2cc(Cl)cc(Cl)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171049",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(c1ccc2[nH]cnc2c1)N1CCn2c1nc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(/C=C/C(=O)NC[C@H](C2CC2)[NH+](C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169661",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NCCc1ccccn1)Nc1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146572",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1c(=O)n(CC(=O)Nc2ncc(C)s2)c2ccccc21 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239467",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(C(=O)N(C)CC(=O)[O-])n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NCc1cccc(N(C)C)[nH+]1)c1ccc(S(=O)(=O)N(C)C)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21642",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CSC[C@H](C)N(C)C(=O)Nc1ccccc1C(=O)N1CCC(C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115574",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCOC(=O)c1cccc(-n2nnc3c(sc4nc(C)cc(COC)c43)c2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173196",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCC(=O)/N=c1\\sc2cc(OC)ccc2n1CCSC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59020",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(N(C)C(=O)c2ccc(F)cc2O)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192067",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[C@@](C)(NS(=O)(=O)c1ccc(F)c(F)c1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24258",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)Nc2ccc3c(c2)C(=[N+]2CCOCC2)Nc2cc(Cl)ccc2O3)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(OCCNC(=O)NCCc2cccc(O)c2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142648",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC1=C(C(=O)OC(C)C)[C@@H](C)N=C1C(=O)Nc1ccc2c(c1)NC(=O)[C@@H](C)O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSC1=NC(=O)C2=C3CCCC[C@H]3SC2=N1)Nc1nnc(C2CC2)s1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CCN(CC)C(=O)N1CCc2cc(OC)c(OC)cc2[C@H]1c1cc2cc(C)cc(C)c2[nH]c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cccc(OC[C@@H](O)CN2CCN(Cc3[nH+]ccn3C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187296",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)NC2CC[NH+](Cc3cnc4cnccn34)CC2)c(C)o1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186833",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOC(=O)N/N=C(\\C)c1cccc(NC(=O)C2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229818",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3225",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)(C)OC(=O)N1CC[C@H](C(=O)Nc2ccc(-c3cc[nH]n3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193803",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1n[nH]c(C)c1C[C@H](C)C(=O)N[C@@H](C)c1ccc(-c2cccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236109",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CN(C[C@H](O)C1CC1)C(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81826",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCc1nc(CO/N=C(/N)c2cccs2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11924",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CCCC[C@H]1CCn1cnc2ccccc2c1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1OCC[C@H]1N1CCC(C(=O)N2CCCCC2)CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191277",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(CCc1nc(-c2ccncc2)no1)N[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1cccc(NC(=O)CSc2nccnc2N2CCN(c3ccccc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173100",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccc(F)cc1)N(C)C(=O)Cc1csc(-c2ccccn2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233647",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc2c(c(=O)n1CC[NH+](C)C)[C@@]1(C(=O)N(CC(C)C)c3ccccc31)C(C#N)=C(N)O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23416",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@@H](C(=O)Nc1cccc(C#N)c1)N1CCN(S(C)(=O)=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160633",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(C)cc1NC(=O)c1oc2c(c1C)/C(=N/NC(=O)c1ccc(C)cc1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169706",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Nc1cccc([N+](=O)[O-])c1)C(=O)N1CCO[C@@H](c2cccc(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)N1CCC[NH+](Cc2ccccn2)CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29726",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(=O)Nc1cccc(C(=O)N(C)[C@@H](C)c2ccc(F)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86202",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCOC(=O)c1sc(NC(=O)c2cc3ccc(OC)cc3[nH]2)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58015",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc2c(c1)OCO2)N1CCC(n2cccc2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24185",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1c(C(=O)N2CCC[C@]3(CC=CCC3)C2)cnn1-c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128137",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1)c1nnc([C@H]2CCCN(C(=O)Nc3ccc(F)cc3)C2)s1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23148",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Nc1cc(-n2ccnc2)ncn1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97646",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOC(=O)[C@H]1[NH+]=c2ccc(F)cc2=C1NC(=O)CN1CCN(c2cccc(C)c2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191090",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(N2CC[C@H](NC(=O)N3CCC([C@H](C)O)CC3)C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCN(CC(C)(C)O)C(=O)Nc1cccc([C@H](C)[NH3+])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155850",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COCC[NH+]1CCCN(C(=O)c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17685",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H]1CCC[C@@](Cc2ccccn2)(C(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194509",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc2nc(Cl)c([C@@H]3CC(c4ccco4)=NN3S(=O)(=O)c3ccccc3)cc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223807",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2oc3c(c(=O)c2c1)[C@H](c1ccc(Cl)c(Cl)c1)N(CC[NH+](C)C)C3=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1noc(-c2ccnc(N[C@H](C)Cc3c(C)noc3C)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71231",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOc1ccc([C@H]2[C@H]3CN(C(C)C)CC=C3C(C#N)=C(N)C2(C#N)C#N)cc1OCC by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NCc1ccc(F)cc1)Nc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142243",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[NH+](C1CCCC1)[C@H]1CCCC(C)(C)[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54852",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1ccccc1C[C@@H](C)NC(=O)CN(C)CC#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78235",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](N[C@H](C)C(=O)NC(N)=O)c1ccccc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23312",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)CN(C)C(=O)CSc2nc(C(F)(F)F)nc3ccccc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221252",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C(C)(C)c2cccc(Cl)c2)cc1C(=O)N(C)C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1c[nH]c2ncccc12)N1CCN([C@@H]2CCCC[C@H]2O)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CO[C@@H](C)c1cccc(NC(=O)c2cc(S(=O)(=O)N(C)C)c(C)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58880",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccccc1[C@H]1C(C#N)=C(N)Oc2cc3c(cc21)OCO3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151721",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1cc(CSCc2coc(-c3ccc(F)cc3)n2)nc2sccn12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223249",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CN(CCc1ccccn1)c1ncc(-c2ccncc2)c(-c2cccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85182",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cc(C=C2C(=O)OC3(CCCC3)OC2=O)cc(Br)c1OC(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237439",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCC[NH+](C)C[C@H]1CCN(C(=O)Cc2ccc(F)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208543",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(SCC(=O)c2ccc3ccccc3c2)nnc1-c1cccs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133028",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(C)CO[C@@H](C)c1noc(C[NH+](C)[C@@H]2CCS(=O)(=O)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196390",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[NH2+][C@@H](C)c1ccccc1O[C@H](C)C(=O)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64473",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(C[C@@H]1OCCc2ccsc21)N1CCN(CCO)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153410",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule C[C@@H](Nc1ncccc1[N+](=O)[O-])C(=O)NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75603",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C([O-])COc1ccc(-c2cc3cc(Br)ccc3oc2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90556",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c2ncc(NC(=O)NCc3ccnc(OCC4CC4)c3)cc12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45610",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccc([N+](=O)[O-])c1)N1CCC[C@H]1c1cccnc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46850",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCOc1ccc([C@@H]([NH3+])c2cc(F)cc(F)c2)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189993",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c(C(=O)N2CCC[C@H]2c2nc3ccccc3[nH]2)c(C)c1C(=O)OC(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107420",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)cc1NC(=O)C(=O)N1CCC[NH+](Cc2ccccc2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84529",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](O)C[NH+](Cc1cc2ccccc2[nH]c1=O)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239921",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)[C@H]1C[C@@](O)(Cc2nc3ccccc3s2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214658",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2nc(/C(C#N)=C/C=C/c3ccccc3)[nH]c2cc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54349",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@H](C)N(C)CC1=Cc2ccccc2OC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93660",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1nc2cc3c(cc2s1)OCO3)c1ccc([N+](=O)[O-])s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117467",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1cnn([C@H](C)C2CC2)c1NC(=O)c1ccc(-c2ncn[nH]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144088",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)NC(=O)N(CC(=O)NCCc2cn3ccccc3[nH+]2)C1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22085",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(C(=O)N[C@@H]2CCSc3ccccc32)cc1S(=O)(=O)N1CCCC[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170908",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc(F)cc1NC(=O)Nc1cnn(CCO)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22940",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(/C=C\\c1cccs1)Nc1ccc(-c2cc[nH]n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122184",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)NC(=O)[C@H](C)Sc1c(Cl)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175955",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOc1cc([C@@H]2C(C#N)=C(N)OC3=C2C(=O)CCC3)ccc1OCC[NH+]1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221778",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cn1cc(N2CC[C@@H](Nc3ccc(CO)cc3)C2=O)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96328",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccccc1N1C[C@@H](C(=O)Nc2ccc(N3CCCCC3)c(Cl)c2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191117",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(=O)[C@@H](c1cccc(C#N)c1)N(C)Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219807",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2nc3c(s2)CCCC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189338",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOC(=O)NCCC(=O)N1CCC[C@H]2CCCC[C@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(O)c(C(=O)N(C)[C@H](C)c2ccc(-n3cncn3)cc2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153800",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC[C@H](C)C(=O)N1CCC[C@@H](C(=O)N[C@@H](C)c2ccc(C)c(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96324",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cc(-c2nc(CN3CCCC4(C3)OCCO4)no2)cs1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113751",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ncc2c(N3CCCC3)nc(N3CCN(c4ccccc4)CC3)nc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73638",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCN(Cc1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc(Br)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201027",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CC(C)(C)C(=O)NC[C@@H](C)c1cccs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185648",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCC[NH2+][C@H](C1C[C@@H](C)C[C@H](C)C1)[C@]1(C)CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231090",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nc2ccccc2nc1S[C@H](C(N)=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156385",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule CC[C@@H](C)[C@@H](NC(=O)[C@@H]1Cc2ccccc2CN1)C(=O)NC[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167481",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NC[C@H]1CCN(c2ccccc2)C1)C(=O)Nc1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69193",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1onc(-c2ccccc2Cl)c1C(=O)Nc1cccc(C2OCCO2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CNC(=O)c1ccc(CN(C)C(=O)c2ccncc2F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)Sc1ccc(NC(=O)NCC2(O)CCCCCC2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4248",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOC[C@H]1O[C@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@@H]21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224666",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule N#Cc1ccc(Sc2nnc3ccccn23)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11338",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(NC(=O)C(=O)N[C@H](C)CCC2CCCC2)c2ncccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215716",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCCOc1ccccc1C(=O)N1C[C@@H]([NH+](C)C)[C@H](c2ccc(OC)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1CCCCC1)c1nc(N2CCCCCC2)c2oc3ccccc3c2n1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15794",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule N/C(CCCCNC(=O)N[C@@H]1CCOC1)=N/O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109215",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule NC(=O)c1ccc(/C=C/C(=O)N2CCN(Cc3ccccc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248005",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "532",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC1=C[C@@H](C(=O)N2CC[C@]3(CCCN(Cc4cccc(F)c4F)C3=O)C2)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162903",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccc(O[C@@H](C)CNC(=O)[C@@H]2CCCN2C(N)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72034",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(=O)N1CCC2(CC1)OCCO2)c1ccc2ccccc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242115",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(C[NH2+]C[C@@H](O)c2ccc(OC)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37944",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=S(=O)(C[C@H](Br)C(F)(F)F)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc(/C(C)=N\\NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148108",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1ccc(CNC(=O)c2ccc(CS(C)(=O)=O)cc2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1cc(CN2C[C@@H](C(N)=O)O[C@H](C)C2)c(C)n1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NCc1cn2ccsc2n1)c1cc(COc2ccc3c(c2)OCO3)[nH]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102172",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c2c3nc4ccccc4nc3n(-c3cccc(C(F)(F)F)c3)c2ncn1C[C@@H]1CCCO1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183683",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CN(C(C)C)S(=O)(=O)c1cc(N)c(Cl)cc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177400",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(OC(F)F)c(NC(=O)c2cc3ccccc3oc2=O)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228852",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCOCc1ccc(CNC(=O)C[NH+]2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212440",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@](C)([NH3+])c1nc(C)c(-c2ccco2)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100430",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccc(Cl)cc1-n1c(C)cc(/C=C2\\C(=O)NC(=S)N(c3cccc(F)c3)C2=O)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179009",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(C(C)(C)CNC(=O)/C=C/c2cncc(C(=O)NC)c2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113873",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(=O)Nc1cc(Cl)ccc1NC(=O)[C@H]1Cc2cc(C)c(C)cc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90881",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cn1cc(S[C@@H]2CCC[C@]([NH2+]C3CC3)(C(=O)[O-])C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(c1ccc(COc2ccc3ccccc3c2)o1)N1CCS(=O)(=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228407",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H](NC(=O)N[C@@H]1C[C@@H]1C1CCCCC1)c1nc(C(C)(C)C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57048",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1c(O[C@@H](C)C(=O)NCCCN2CCCC2=O)ccc2c3c(c(=O)oc12)CCCC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113382",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1c(C(=O)NCC2(C)CCCC2)cnn1-c1ccc([O-])nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48340",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2cc(NC=C(C#N)C#N)ccc2n1-c1ccccc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139169",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1c(C(=O)CSc2nc3ncccn3n2)sc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76637",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=C(C)C[C@@H]([NH2+]CC)c1ccc(OC)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151957",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(=O)c1cnc(NC[C@@H]2OCCc3ccccc32)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106266",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule N#C/C(=C/c1c[nH]nc1-c1cccc([N+](=O)[O-])c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1CC[C@H]1CCCN(c2nccs2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242690",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(F)cccc1NC(=O)N(C)C1CCCCCC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87744",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@@H](NC(=O)N1CCC(c2ccn[nH]2)CC1)[C@@H]1COc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(C(=O)N2CCC[C@@H](C(=O)[O-])C2)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168926",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)[C@H](C)N(Cc1ccccc1)C(=O)c1ccc(Cl)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73144",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[NH+]1CCN(CCC(=O)N2CCO[C@H](c3ccc(F)cc3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1ccc2noc(-c3ccccc3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(CN2CCOc3c(cc(-c4ccc(C)s4)cc3OC)C2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CSc1ccnc(-c2nc([O-])c3cc(F)c(F)cc3n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212481",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(Cn2c([O-])c(C(N)=O)c3snnc3c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49796",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)N2C[C@@H](C[NH+]3CCCC3)C[C@@H](CO)C2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC1(C)C[C@@H]([NH2+]Cc2cccc3c2OCO3)C(C)(C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193395",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(CNCc2ncc(-c3ccccc3)s2)c(F)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169056",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccccc1[C@@H]1CN(C(=O)C(C)(C)C#N)[C@@H](C)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28230",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCSC[C@@H](C)N(C)c1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85799",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@H]3C(=O)N(CCO)CC(=O)N32)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@@H]2C(=O)C[C@](C)(O)[C@@H](C(=O)Nc3ccc(C)cc3C)[C@H]2c2ccncc2)c(C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99306",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cccc1C(=O)C(=O)NCc1ccco1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188090",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCCNC(=O)c1ccc(NC(=O)C(=O)N[C@H]2CC=CCC2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43260",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)c1cccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)CO3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100838",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCn1cc(C(=O)N2CCN(Cc3ccccc3)C[C@H]2CO)nn1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53848",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(Cn1cnc2ccccc2c1=O)N(Cc1ccccc1)Cc1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192097",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(CN(C[C@@H]1CCCO1)C(=O)c1cc2c(s1)CCCC2)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[C@@H]1CN(C(=O)c2ccc(CC)o2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148068",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)C[NH2+]Cc1ncnn1[C@H]1CCOC2(CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117356",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)C[NH+]1CCN(CCc2nc(-c3ccccc3)no2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96532",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H]1CCC[C@H](N(Cc2ccc3c(c2)OCO3)C(=O)Nc2cc3c(cc2Cl)NC(=O)CO3)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28864",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=O)Cc3cn4ccsc4n3)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159290",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cn1cccc1[C@H]1CC(c2ccccc2Cl)=NN1C(=O)C[NH+](C)Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110757",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCC[C@H]1CN(C)Cc1nnsc1NC by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61784",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cccc(C(=O)NCCc2csc(C(C)C)n2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22587",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H]1CCCC[C@@H]1NC(=O)Nc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143137",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COCc1ccccc1NC(=O)[C@H](C)[NH+]1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56110",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc(Cl)nc1Sc1nc(N)cc(=O)[nH]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78108",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(C)c(NC(=O)Cc2csc(NC(=O)OCC(C)C)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H](SCc1nc(N)nc(N(C)C)n1)C(=O)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126129",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H](NC(=O)c1ccccc1OC1CCN(S(C)(=O)=O)CC1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119071",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C=C1c2ccccc2C=Cc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49821",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCN[C@@]1(C(=O)OC)CC[C@@H]([NH+]2CCC(OC)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95909",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1onc(-c2c(F)cccc2Cl)c1C(=O)NCc1ccnc(OCc2ccccc2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCc1nn2c(=O)cc(COC(=O)CSc3ccc(C)cc3)nc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247135",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(CCC(=O)Nc1ccccc1Cl)NNC(=O)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37312",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule NC(=O)c1cc(NC(=O)NC[C@@H](CCO)c2ccccc2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161004",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(NC(=O)[C@@H](C)Sc2ccccn2)sc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76351",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC[C@](O)(Cc2nc(-c3ccccc3)cs2)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27571",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)CNC(=O)CCCn1cnc2c1c(=O)n(C)c(=O)n2C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187824",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)[C@H](C[NH3+])Nc1ncc(Cl)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69049",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=CCOc1ccc(C(=O)N[C@H]2[C@H]3CCO[C@@H]3C2(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166369",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COCCN(C)C(=O)Nc1cccc(COc2cccc(F)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)[C@@H](CC(C)C)N2C(=O)[C@H]3CC=CC[C@H]3C2=O)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156003",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc2c(CC(=O)Nc3cc(Cl)ccc3Cl)coc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185892",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H]1CC=CC[C@H]1COC(=O)C(C)(C)S(=O)(=O)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H]1C[C@@H]([NH2+]CCCc2ccc(Cl)cc2)CN1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101113",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@@H]1c2ccccc2CCN1C(=O)CN(C)S(=O)(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15765",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CN(C(=O)[C@H]1CSCN1C(=O)[C@@H]1CCC(=O)N1)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24862",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc([C@@H]2c3ccccc3CCN2C(=O)c2ccccc2F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86395",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCSc1cncc(NC2CC(C)(C)[NH2+]C(C)(C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194270",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCC[C@@H](C)Nc1nc2cc([N+](=O)[O-])ccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108823",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)N=c2c(C#N)cc3c(=O)n4cccc(C)c4nc3n2C(C)C)cc1OC by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42375",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOC(=O)Nc1cccc(C(=O)Nc2ccc(F)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171550",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CN(C(=O)c1ccc[nH]c1=O)[C@@H]1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193661",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "877",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule [NH3+]C1CCN(Cc2cc(Cl)ccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181062",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@H]1C[NH+](CCC(=O)NC(C)C)CCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111372",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCn1cc(C)c(C(=O)[O-])c1CC(=O)NCc1cccc(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175186",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@@H]1C[NH+](CCCCCO)C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H]1CCc2cc(F)ccc21)c1cnc([C@@H]2CCCO2)s1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153754",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[NH+](C)CCNS(=O)(=O)C1=CN=C([C@H]2NN[C@H](c3ccc(F)cc3)O2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247165",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Br)ccc1NC(=O)CNC(=O)Nc1ccccc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70918",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCC[NH+]1CCC(NC(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246002",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]1N=N[C@H](NC(=O)CSC2[NH+]=c3ccccc3=[NH+]2)S1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26167",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)CNC(=O)C1([NH2+]CCn2cccn2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82181",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H](NC(=O)N1C[C@H]2CCCC[C@@H]2C1)c1ccc(S(C)(=O)=O)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171855",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS[C@H]1CCCCN(C(=O)[C@H](C)NC(=O)C(C)(C)C)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51464",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCCC(=O)N1CCC[C@@H](c2nc(Nc3ccccc3)cc(-c3cccnc3)n2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54736",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)COc2ccccc2OC)cc1Br by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172207",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COCc1c(C(=O)NCc2c(C)cc(C)[nH]c2=O)oc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50094",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(c1ccccc1Cl)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51096",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H](c1ccc(-n2cncn2)cc1)N(C)C(=O)CSCc1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177027",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)c2ccccc2CSc2nc3ccccc3[nH]2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122626",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)nc(N2CCC[C@H]([NH3+])C2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(-c2nc(NC(=O)c3nn(C)cc3[N+](=O)[O-])sc2C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137862",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1C[C@H](Sc2nnc(N3CCCC3)n2Cc2ccco2)C(=O)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Oc1ccc2nccnc2c1)c1ccccc1-n1cccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187407",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cn1ncc(N2CC[C@@H](CNC(=O)c3c[nH]c(-c4ccccc4)n3)C2)cc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199075",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)-c1c(c(C(=O)Nc3ccc(F)cc3F)nn1C)CS2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25743",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2ncc(C(=O)Nc3cc(OC)ccc3F)s2)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9585",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(NC(=O)N(C)CC(=O)Nc2ccccc2)cccc1[N+](=O)[O-] by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240042",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H]1CCCC[C@H]1NC(=O)CNC(=O)c1ccc(Br)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCOc1ccc(Br)cc1C(=O)Nc1cccc(OC[C@H]2CCCO2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91876",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCNC(=O)[C@H]1CCCN(C(=O)N[C@H](C)c2cc(C)sc2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246683",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NC1CCCC1)[C@H]1CCCN(c2nnc(N3CCCCC3=O)s2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc2sc(NC(=O)CN(C)c3nc4ccccc4s3)nc12 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150691",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncc(S(=O)(=O)Nc2[nH]nc(C)c2C)s1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124624",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[NH2+]Cc1ccccc1OCc1cccc(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117868",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1cc(C)n(Cc2ccc(C(=O)N3C[C@@H](C)OC[C@@H]3C)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203210",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)nc(N/C(=[NH+]\\C(=O)NC23CC4CC(CC(C4)C2)C3)N2CCN(c3cccc[nH+]3)CC2)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(SCC[NH+]2CCC(CS(N)(=O)=O)CC2)cc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204735",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)N1CCCc2cc([N-]S(=O)(=O)c3cccc([N+](=O)[O-])c3)ccc21 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247404",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "963",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cn2c(CN(C)C(=O)CO[C@@H]3CCCC[C@@H]3C)c(C)nc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169088",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C/c1ccc([N+](=O)[O-])cc1)C(=O)Nc1cccc(F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199378",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCN(C[C@H]1CCOC1)C(=O)NCCCc1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142246",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CNC(=O)[C@H]2CCCN(S(=O)(=O)N3CCCCCC3)C2)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127240",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(CCC(=O)c1ccccc1)NC[C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127021",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1nnc(/N=C(\\[O-])[C@H](C)[NH+]2CCc3ccccc3C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105682",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](C)OC(=O)c1ncoc1C(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67145",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)Oc1ccccc1C(F)(F)F by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc2[nH+]c3c(n2c1)[C@H](c1ccc(O)cc1Cl)CC(=O)NC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126124",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCCc2cc(NC(=O)NCC(C)(C)c3ccncc3)ccc21 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H]1C(=O)N1CCN(Cc2cnc[nH]2)CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37608",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2csc(CN3CCN(C(=O)C4(c5cccs5)CCCC4)CC3)n2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCN(CC)c1cc(C2CC[NH+](C[C@H]3CC=CCC3)CC2)nc(-c2cnccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59821",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@H]1OCC[C@H]1C(=O)Nc1ccsc1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196247",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1ccccn1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70144",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(Cl)cc1/N=C1/S[C@@H](CC(=O)Nc2ccc(C)cc2)C(=O)N1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98237",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC(C)[C@@](C)(C#N)NC(=O)CN1CCCSc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206468",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(CCn1cnnn1)N1CCCN(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192933",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1CCCC[NH+]1CC(=O)N1N=C(c2ccc(F)cc2)C[C@H]1c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176700",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc(C(=O)Nc2ccc(N3CCN(C(=O)c4ccco4)CC3)c(Cl)c2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34243",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOc1ccccc1NC(=O)/C(C#N)=C\\c1ccc(F)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc(C2=C[C@H](C(=O)N3CCN(C(=O)c4ccccc4Br)CC3)N=N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10636",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(C)NS(=O)(=O)c1ccc(NC(=O)C2=Cc3ccccc3OC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224724",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(/C=N/N=C2\\CC[C@@H]3[C@H]4CCc5cc(O)ccc5[C@@H]4CC[C@]23C)cnn1C by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170318",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCNC(=O)NC(=O)C[NH+](C)CCOc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248586",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)CC1(C(=O)N(C)[C@H](C)CC[NH3+])CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196170",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1CN(c2nc3ccc(F)cn3n2)CC[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1cc(C(N)=[NH2+])ccc1OCc1nc(C)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148455",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@H]1N1C(=O)C(=O)N(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)C1=O by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211619",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N=C1NC(=O)/C(=C/c2cc(Cl)ccc2O)S1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116263",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN1C(=O)NC(=O)[C@@]12CCC[NH2+]C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188091",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](SCc1ccccc1)C(=O)Nc1ccc(OC2CC[NH+](C)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12710",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CNc1cc(Br)cc(F)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16849",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC(CC)(NC(=O)N(C)C1CC[NH2+]CC1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221136",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@@H](C(=O)[O-])N1C(=O)/C(=C/c2ccc(F)cc2)SC1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173424",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(C[NH2+]Cc2cccnc2N2CC[NH+](C)CC2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76932",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCC[NH2+][C@@H](C)c1ccnc(N(C)[C@@H]2CCSC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37295",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cn1nnnc1C1C(C)(C)C1(C)C)C(=O)[O-] by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186309",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc([C@@H]2CCCCCN2S(C)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92822",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[NH2+]Cc1ccccc1S(=O)(=O)NC1C(C)(C)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=[S@@](Cc1cc(Cl)c2c(c1)OCCO2)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)N1CCc2cc(C(=O)Nc3ccc(Oc4ccccc4)cc3)ccc21 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42722",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)c1ccc([C@H]2Nc3c(C(=O)N(C)C)cccc3[C@H]3C=CC[C@H]32)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51118",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cn(C2CC2)c(=O)n(Cc2ncc(-c3cccs3)o2)c1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197850",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]([NH3+])(CCCSC1COC1)C(N)=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168548",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(C)c2[nH]c(=O)c(CN(Cc3ccco3)C(=S)Nc3cccc(Cl)c3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34400",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1cccc(N2CC(n3cc(C(=O)[O-])nn3)C2)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111568",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Fc1ccc(C(F)(F)F)cc1C[NH2+]C[C@@H]1CCCN(c2ncccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244024",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CCl)CS(=O)(=O)[N-]c1cccc(-n2ccnc2)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107761",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)c1ccc(N2CCN(C(=O)[C@H]3CCCN(S(=O)(=O)c4cccc5nonc45)C3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(OCC(=O)Nc2nn(-c3ccccc3Cl)cc2C)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136346",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@H](Nc1ccc(NC(=O)[C@H]2CCO[C@@H]2C)cc1Cl)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139884",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C/c1ccc(N2CCOCC2)o1)c1cccc([N+](=O)[O-])c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1cccs1)N(C)c1ncc(C(=O)[O-])s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106706",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCCCN1CC(=O)N2[C@@H](c3cc(OC)c(OC)c(OC)c3)[C@@H]3[NH+]=c4ccccc4=C3C[C@@H]2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule NS(=O)(=O)c1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217883",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH+]1CCCC[C@@H]1C(=O)N[C@@H](C)c1cccc(C#N)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240079",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(C)cc(OC[C@@H]2N=[NH+]C(=S)N2NC(=O)Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH+](C)C[C@@H]1CCN(Cc2c(C)nn(C)c2OC)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146448",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)(C)CC(=O)N1CCC([NH2+]C[C@](C)(O)CN2CCOCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201489",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)Nc2nn(C(C)(C)C)cc2C#N)cc1-n1c(C)ccc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69041",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)N(C)c1cccc(NC(=O)c2cccc(-n3nc([O-])ccc3=O)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135194",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cccc(C)c1C(=O)NCC(C)(C)c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133460",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1nc(=O)c2ccccc2[nH]1)[NH+]1CCN(c2ncccn2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22932",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@@H](CO)NC(=O)Nc1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136438",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NCCC1=CCCCC1)[C@@H]1CCCC2=c3ccccc3=[NH+][C@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134299",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccc(NCc2ncc(-c3ccccc3)o2)c1)N1CCOCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89295",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCOC(=O)N[C@@H]1CC2(CCCCC2)Oc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16830",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1O[C@H](C)CNC(=O)NC[C@@H]1CCC[C@H](O)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82695",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc2ccc(C[NH+]3C[C@@H]4CC[C@@](O)(c5ccc(C)cn5)[C@H]4C3)nc12 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81035",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cc(C(=O)N2CCO[C@@H](CC(=O)[O-])C2)sc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220639",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc(-c2csc3ncnc(NCc4ccccc4)c23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77875",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCCn1c(C)nn(CN2CCN(CC(F)(F)C(F)F)CC2)c1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NC(=O)Nc1ccccc1Br by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9361",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc([C@@H](C)[S@](=O)Cc2cc(Cl)c3c(c2)OCCO3)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(NC(=O)[C@@H]2C[C@H]2c2ccccc2F)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC1=C(C(=O)Nc2ccccc2)[C@H](c2c(C)cc(C)cc2C)NC(=O)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181421",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H]([NH2+][C@@H]1CCCN(c2ccc(C#N)cc2F)C1)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182092",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC(=O)[C@H](C)Sc1nnc(-c2ccco2)n1-c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140448",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CNC(=O)[C@H](C)CN(C)C(=O)CNC(=O)c1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222280",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(C[C@@](C)(O)C[C@@H]1CCCN(S(C)(=O)=O)C1)OC by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101628",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(Br)c(C(=O)NCCc2ccc(C(F)(F)F)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172996",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1cc(NC(=O)N2CC[C@@H](C)C[C@@H]2C)ccc1C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47301",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN([C@@H](C)C(=O)Nc1ccc(C)cc1)S(=O)(=O)c1ccccc1Cl by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C(=O)N2CCN(Cc3ccccn3)CC2)c2c(=O)[nH]n(C)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33837",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H]1C[C@H](NC(=O)COc2ccccc2C#N)CN1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32995",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N(CC2CC2)C(C)C)c(NN)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184388",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule NNc1ncc(Br)cc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59741",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccccc1-n1c(-c2ccc(F)cc2)coc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223922",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C)cc(Oc2ccc(NC(=O)N(C)CCC#N)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190963",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1c[nH]c2ccccc12)[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110500",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C1OC(c2ccc3c(c2)OCO3)=N/C1=C\\c1cccc(NC(=O)C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96348",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CC[C@H](c2cc[nH]n2)C1)N1CCCC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188441",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1ccsc1NC(=O)CN1C(=O)N[C@]2(CCOc3ccccc32)C1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CNC(=O)Cc1ccc(NC(=O)C(=O)NCc2ccc(C)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25058",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1nc(CNc2cc(C)[nH+]c3ccc(F)cc23)cs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31562",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCCC[NH+]1CCNC(=O)c1nnc(C(=O)Nc2ccc(F)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc(C(=O)N[C@H](C)c2nc3ccccc3n2Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104842",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@@H]1CCCN(C(=O)CCCNc2ccc([N+](=O)[O-])cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230230",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(F)c(NC(=O)CCCNS(=O)(=O)c2ccc3c(c2)OCCO3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccc(NC2CCCC2)c1)c1ncncc1Cl by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=S(=O)([O-])c1cccc(/N=N\\c2ccc3c(O)cccc3c2O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112880",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(Cn2nccc2NC(=O)COc2ccc(Br)cc2C=O)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171768",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)c1cncc(-c2sccc2C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223135",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([C@H]1SCCc2ccccc21)N1CCSc2ncccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cc(N2CC[NH2+]CC2)[nH+]c2ccccc12 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183250",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C1C[C@@H](C(=O)N2CC[C@@H](Nc3ccccc3)C2)CN1CC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195938",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[S@](=O)[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)C(C)(C)C by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50999",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1cc(OC)c(NC(=O)[C@@H]2CS[C@]3(c4cccs4)CCC(=O)N23)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160833",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COCCN(Cc1ccco1)C(=O)c1cc2cc([N+](=O)[O-])ccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(-c2ncon2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179345",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CNC(=O)NCc1cccc(C[NH+](C)C)c1)[NH+]1CCc2ccccc2C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(NC(=O)Cn2nnc(C(=O)Nc3cccc(C)c3C)c2C)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12284",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CO[C@@]1(C)C[C@H](OC(=O)c2cnc3c(C)cccn3c2=O)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202553",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1nc(CNC(=O)NCC2(Sc3ccccc3)CC2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74576",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CNc1oc(-c2ccccc2Cl)nc1S(=O)(=O)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70585",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@@](C[NH3+])(N(C)CCS(C)(=O)=O)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128378",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1C[C@@H](C(=O)[O-])[C@@H](c2cccc(F)c2F)[NH+]1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91216",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1[nH]c2ccccc2c1CC(=O)N(Cc1cccnc1)C[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCn1cc(CN2CCO[C@@H](c3cc(F)c(Cl)cc3Cl)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)Cc1ccc(NC(=O)c2sc(C3CCCC3)nc2C)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219819",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc(=O)[nH]c(SCCOc2cccc(C(F)(F)F)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238196",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1cnc2c(c1)[nH]c(=S)n2[C@H](C)Cc1ccc(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218613",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOc1ccc(C2=NC(=O)[C@H]3SC(=S)N(C)C3=N2)cc1OCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176159",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cn1ccc(NC(=O)N2CCC(c3ccc(F)cc3)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69250",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C([C@@H]1CN(C(=O)Cc2cccs2)c2ccccc2O1)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1cccc(NC(=O)c2ccc(C)c(NC(=O)c3ccccc3)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177894",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1nc2ccc(C(=O)N(C3CC3)[C@@H]3CC([O-])=NC3=O)cc2nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83833",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CNc1cc[nH+]c(N(C)Cc2ccc(C[NH+](C)C)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)CNC(=O)NC1CCCCC1)c1cc(C)ccc1C by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36262",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cc(OC)c(-c2cnc(CNN(C)C)s2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32329",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]12CCC[C@@H]3C(=O)C(Cl)(Cl)C(=O)N(c4ccccc41)[C@@H]32 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141741",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H](C(=O)c1ccccc1)[C@]1(O)C(=O)Nc2ccc(Cl)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=S)NN=C1CCC(C(C)(C)C)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184142",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(CCOCC1CC1)C(=O)C1(c2ccccc2)CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117541",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COC(=O)Cc1c(C)c2c(O)cc(O)cc2oc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32515",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@]1([NH2+]C(C)C)CC[C@@H](n2cc[nH+]c2C)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(N2CCN(c3ncnc4c5cc(OC)ccc5n(C)c34)C[C@H]2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73455",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)(C)C[C@@](C)(O)C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148012",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[NH+](CC)c1ccc(CN2CCS(=O)(=O)[C@H](C)[C@@H]2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45497",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)C[C@H]2OCCc3ccsc32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35552",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOc1ccccc1NC(=O)Nc1nnc(Cc2ccccc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN1C[C@H](c2cc(=O)n3nc(-c4cccc(Cl)c4)cc3[nH]2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234899",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCn1nc(COc2ccc(C=O)nc2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217294",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCC(C[NH3+])([C@@](C)(O)c2ccc(F)cc2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33413",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cl[C@@H](CNc1ccc2nnnn2n1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C[NH+]2CCC[C@@H](C(=O)NN)C2)ccc1OC(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29628",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(=O)c(=O)[nH]c2cc(C(=O)N[C@H](c3cccc(F)c3)c3nccn3C)ccc21 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164782",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(C)=O)cc1NC(=O)[C@@H](C)N1CCc2cc(C)ccc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc2cc3c(cc2n2c(SCC(=O)Nc4nc(C(C)(C)C)cs4)nnc12)OCCO3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241831",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)N1CCOCC1)N1CCN(CC(=O)Nc2cc(F)cc(F)c2)CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136392",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)c1ccc2c(n1)CCN(Cc1ccccc1)C2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127234",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCNc1ccc(C#N)c([N+](=O)[O-])c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172201",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(c1ccccc1I)N1CCC[C@H]2CCCC[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56991",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCc1cc(NC(=O)[C@H](C)CCC)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37865",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(C(=O)NC[C@H](C)Oc2ccccc2C)s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148541",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1c2cc3c(cc2C2(CCCC2)CN1C(=O)c1cccc(C#N)c1)OCCO3 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187292",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCOc1cccc(C(=O)Nc2nc(-c3ccccc3)ns2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188102",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH+]1CCC[C@@H]1CNC(=O)c1ccc(N2CCCCCC2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236067",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule c1ccc([C@@H](NC[C@H]2C[NH+]3CCN2CC3)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(C(=O)NCC[C@H](O)c3ccccc3)ccc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224255",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)N1CCN(Cc2nc3cc(NC(=O)c4ccc([N+](=O)[O-])cc4)ccc3n2CC)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58744",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)CSCCC[NH+](C)[C@@H]1CCSC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133027",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)NC[C@@H](CC(C)C)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213656",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(OCC(=O)Nc2c(F)cc(F)cc2F)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238606",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1c(C#N)c(NC(=O)CSc2nccn2C)n(C2CCCC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212961",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@H]1C[C@@H]([NH3+])CN(c2[nH+]c3ccccc3n2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98713",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1nn(C)c(Cl)c1S(=O)(=O)N1[C@H]2CC[C@@H]1c1cnc(N3CCOCC3)nc1C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32272",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C([O-])[C@H]1CCC(=O)N(CCc2ccccc2F)[C@@H]1c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234534",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cc(C#N)ccc1S(=O)(=O)NCCc1cn2cccc(C)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(CN2CC[C@@H](C[NH+]3CCCCC3)C2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205952",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CNC(=O)CN(C)C(=O)c1ccc(C#N)c(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99165",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@@H](C(=O)NCc1ccc(F)cc1)[S@@](=O)Cc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113797",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H](NC(=O)C1CCN(S(C)(=O)=O)CC1)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196182",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C(COc1ccc(Br)cc1)N1CCOC[C@@H]1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139640",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@]1(c2ccc(Cl)cc2)NC(=O)N(CN(C)Cc2c(C)noc2C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54520",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCO[C@H](F)C(=O)OCC by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131969",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule O=C(Nc1cccnc1Cl)c1cc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122625",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cccc(C[NH+](C)C[C@]2(C(=O)[O-])CCC[C@H](C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28079",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)NCC1(O)CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224491",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Fc1cccc(C/[NH+]=C2\\NC[C@@H](c3ccccc3)S2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCC[C@@H](NC(=O)C=C1CCSCC1)c1ccccc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236801",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1c(C(=O)NCC(=O)[O-])nnn1-c1ccc(Cl)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77163",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=[N+]([O-])c1cccc(Cn2nnc(-c3ccccc3)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236201",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCc1nc2sc([C@H](c3cccc(OC)c3)N3CC[NH+](Cc4ccccc4)CC3)c(O)n2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(-c2csc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)n2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225868",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCCOc1ccc(CNC(=O)c2cn(C)nc2CC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70569",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1cc(NC(=O)N[C@H](C)C(=O)NCc2ccco2)cn1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C=O)c1OS(=O)(=O)c1ccc(Cl)cc1C#N by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1CCCN(C(=O)/C=C/c2ccc(NC(C)=O)cc2)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27550",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](O)CC(=O)N/N=C1\\C(=O)N(CC[NH+]2CCCCC2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215161",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Nc1ccc(N[C@@H](C)C(=O)Nc2c(C)cccc2CC)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55322",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc2cccc(NC(=O)c3ccc(-c4cccc([N+](=O)[O-])c4)o3)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156353",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2[nH]ncc2c1)c1ccc([N+](=O)[O-])cc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222765",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CC[C@H](CNC(=O)N[C@H]2CCOC2)c2ccccc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2849",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H]1C[C@H]([NH2+]CCOc2ccccc2)CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42182",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Br)cc1[C@H]([NH3+])c1ccc(Br)o1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200860",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)N1CCc2cc(S(=O)(=O)Nc3cc(C)cc(C)c3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68558",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H]1CN(c2ccc(N[C@H](C(N)=O)c3ccccc3)cc2F)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(C(=O)Nc2cccc3ccccc23)[C@@H](c2ccccc2)C1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cccc(C)c1-n1c(=S)[nH]c2sc3c(c2c1=O)CCN(Cc1ccccc1)C3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166503",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC[NH+](CCC(C)C)CC1CC[NH2+]CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32179",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(N[C@@H](C)[C@H](C)O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43695",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1CCN(Cc2ccccn2)CC1)Nc1nc(-c2ccco2)cs1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39647",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccc(Br)cc1)C(=O)[C@@H](O)c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118871",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=CCC[C@H](C)OC(=O)/C=C/c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248148",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(C(=O)N(C)Cc2cc(C)on2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84398",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1ccc(CCNC(=O)Cn2nc(-c3ccc(C)c(C)c3)ccc2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166945",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[C@@H](NC(=O)OC(C)(C)C)CC[NH+]1Cc1cncs1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104559",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nn(C(F)F)c(C)c1CC(=O)N[C@@H](Cc1ccccc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242930",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC[C@@H](O)CN(C)C(=O)c1cc(C)n(-c2ccc(OC)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162484",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOc1ccccc1[C@@H]1C[C@@H]1[C@@H](C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93078",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1186",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[NH2+][C@H](CN1CCOCC1=O)c1ccc(C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60286",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCCN1CCN(c2ccc(NS(=O)(=O)c3ccccc3Cl)cc2C(=O)[O-])CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC[C@H](C)Sc1ccc(NC(=O)N(C)CC[NH+](C)C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102096",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCCCN(C)C(=O)[C@@](C)(N)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200823",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CCC(=O)N1C(=O)C(F)(F)F by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171536",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule C[C@H](NC(=O)C(=O)Nc1ccc(N(C)C)cc1)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60259",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(C(=O)C2=C([O-])C(=O)N(C[C@@H]3CCCO3)[C@H]2c2sccc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248484",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccc(Cl)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139530",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CN(C)C(=O)c2cn(C)nc2C(C)(C)C)no1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204942",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCN(CC#C)CC(=O)N[C@@H](C)C(=O)N(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213257",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cccc(C)c1NC(=O)CSCc1ccon1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160125",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C=CCNC(=O)c1cc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243012",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)/C=C(/C(=O)C(F)(F)F)c1ncc(C(F)(F)F)cc1Cl by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32777",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nnc(NCCCc2c(C)noc2C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233584",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(NC[C@H]1CCN(c2ccccc2)C1)[C@H]1CC=CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(CCSC1=[NH+]CCN1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177568",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc(C(=O)NCC(=O)NCCc2ccc(F)cc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32212",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(NC[C@H](O)c2c(F)cccc2F)c(C(F)(F)F)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163767",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(/C=C2\\SC(=O)N(CCNC(=O)c3ccc(C)s3)C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115459",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1cc(C[NH+](CCO)Cc2cccnc2)c(Br)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60203",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@@H](C)[NH+](C)CCC(C)C)c(C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79150",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CO)NC(=O)N[C@H](Cc1ccccc1)C1CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142414",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(NC(=O)C[NH+](C)[C@H](C)C(=O)Nc2ccccc2C#N)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2c(c1)CN(C(=O)C1CC1)CC2)[C@H]1CC(=O)N(c2ccc(Cl)cc2)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152379",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CNc1snc(C)c1-c1nnc2cc(C)ncn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86611",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CN(C(=O)/C=C/c1ccnc(Cl)c1)c1cccc2ncccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(CC(C)=O)cc(OC)c1OC by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174677",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[NH+]2CCC[C@@H]2CN1C(=O)N1CC(C(=O)[O-])C1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9082",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1cccc2ccccc12)N(C)CC(C)(C)C[NH3+] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC(=O)N1CCC[C@H](C(C)(C)C(=O)OC)C1)C1CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45165",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCOc1cc(/C=C/C(=O)N2CCC[C@@H](CNC(C)=O)C2)cc(Cl)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCO[C@H](C(=O)NCC(C)(C)[NH+]2CCCCC2)C1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206039",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCc2c(sc3c2C(O)=N[C@H](/C=C\\c2ccc([N+](=O)[O-])cc2)N3)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181483",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1cn2c([nH+]1)CC[C@@H](NS(=O)(=O)c1ccc(C(C)(C)C)s1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155887",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(=O)c1cc(C(=O)N2CCN(c3ccccc3)CC2)cc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185298",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H](C)c1ccc(NC(=O)c2ccc(C)nc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202174",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCc1ncc(S(=O)(=O)N2CCCCC[C@H]2CC(C)=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224986",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc(CCNC(=O)N[C@H](C)c2ccc(F)c(Cl)c2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235152",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COC(=O)c1[nH]c(C)c(C(=O)[C@@H](C)N(C(=O)c2cccs2)C2CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64015",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@H]1C[C@H](C)CN(S(=O)(=O)c2cccc(C(=O)NCCOc3ccccc3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33550",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H]2C[C@H](c3ccccc3)n3ncnc3N2C(=O)c2ccccc2[N+](=O)[O-])cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171508",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCn1cc(/C=C2/Oc3c(ccc4c3CN([C@@H]3CCS(=O)(=O)C3)CO4)C2=O)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79230",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)N[C@@H]1CC[C@H]([NH+](C)C)C1)c1ccccc1-n1cccn1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOC(=O)[C@@H]1CC(C)(C)C(=O)N1C(=O)OC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77980",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1c(NC(=O)[C@H]2CN(C)CCO2)cccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53946",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[C@@H]([NH2+]Cc1cc(F)ccc1F)c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244425",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCc1c(C)nn(CCNC(=O)c2cn[nH]n2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118482",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[NH+](CCNS(C)(=O)=O)C1CCC(c2ccc(O)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199065",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1cc(C(C)(C)C)n[nH]1)Cc1ncc[nH]1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102659",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC[C@@H](C)c1nc(Cl)nn1-c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120645",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC(=O)c1[nH]c(C)c(C(=O)Nc2ccc3c(C)n[nH]c3c2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](C)c1cc(F)ccc1O[C@H](C)C(=O)NC1CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31996",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)C1=CC(=O)CCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=C(C)C[C@@H]([NH2+]CC)c1ccc(F)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6949",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(O)cc1)[C@H]1CC=CC[C@H]1C(=O)[O-] by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240526",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS[C@@H](C)c1cccc(NC(=O)c2cn(C)nc2-c2ccccc2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175582",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH+](C1CC1)[C@H]1CCC[C@@H]1C#N by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129750",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccnc(-c2n[nH]c(CO)n2)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242308",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)=C(CCNS(=O)(=O)c1cc(C)c(OC)cc1C)[C@H](C)[NH+]=2 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(C(=O)NCc2cnn(C)c2N)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175184",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(O[C@H](C)CNC(=O)c2cccc(-c3nnc(C)o3)c2)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191918",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule NS(=O)(=O)c1ccc(CCNC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C/C(=C/CCCl)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67891",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)C(=O)N[C@@H]1CCC[NH+](CCS(=O)(=O)c2ccc(C#N)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc([N+](=O)[O-])cc1)N1CCCCC[C@H]1c1ccncc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183960",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Fc1ccc(Nc2ccnc(Cl)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58779",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H]([NH2+]CC1CCC(C(=O)[O-])CC1)c1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239772",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cccc(CNC(=O)[C@@H](C)C2CCN(C(=O)c3cc4ccc(OC)cc4[nH]3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81308",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(NC(=O)C(C)(C)Nc2ccc([N+](=O)[O-])cc2)s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150033",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC/C(=C/C(=O)[C@H](Cc1ccc(Cl)cc1Cl)C(=O)[O-])N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77472",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@H]1COc2ccccc2O1)N1CCC(Cn2ccc3cccnc32)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20839",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1363",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc([C@H](NC(=O)N2C[C@H]3CC=CC[C@H]3C2)C2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80627",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COCC[NH2+]CC(=O)N[C@H]1CCC[C@H]1n1cc[nH+]c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157102",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COC(=O)c1sccc1NC(=O)C[NH+](C)[C@H](C)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8146",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCN1c2ccccc2C2=C([C@@H](c3cccc(F)c3)C(C#N)=C(N)O2)S1(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172323",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(C(=O)OCc2nncn2C2CC2)cc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71335",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCC[C@@H](n2c([C@@H](C)Cl)nc3cnccc32)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211063",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C[C@]2(c3ccc(C)cc3)NC(N)=NC2=O)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule [NH3+][C@H]1CN(C(=O)OCC2c3ccccc3-c3ccccc32)C[C@@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45149",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc(C(C)(C)O)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245925",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=N\\NC(=O)[C@H]1C[C@@H]1c1ccccc1)c1ccccc1O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(CN(C)C(=O)C[NH2+]C(C)C)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COC1CCN(c2ccc(C(F)(F)F)cc2C(N)=[NH2+])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CN2CCN([C@H](C)C(=O)N3CCOCC3)CC2)cc1[N+](=O)[O-] by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82310",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCC(=O)Nc1cccc(NC(=O)c2ccc(Cl)cc2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70137",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)N(CC(=O)[O-])C(=O)C[C@@H]1CCCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80269",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([O-])CNC(=O)NCc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244166",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1063",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccccc1F)NNC(=O)NCCc1ccccc1Cl by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208656",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)[C@H]2CS[C@@]3(C)CCC(=O)N23)cn1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206552",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Nc2nn[nH]c2C(=O)NCc2cc(F)cc(F)c2)cc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94083",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)CC[NH+]1CCc2ccccc2C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248777",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CC[NH3+])CCC(=O)NC[C@@]1(C)CCCO1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75041",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CSc1ccc(Cl)c(C(=O)NCc2ccc3c(c2)=C2CCCC[C@H]2[NH+]=3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143399",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cc(C(=O)N[C@@H](c2nc3ccccc3[nH]2)C(C)C)cc(OC)c1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243687",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(C(=O)Nc2cc(NC(C)=O)ccc2F)n[nH]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C=CCOc1ccccc1/C=C/C[NH2+]CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1nc(CSc2ncc(Cl)cc2Cl)nc(Nc2ccccc2)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168568",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC1(C)CCC[C@]1(O)[C@@H]1CCO[C@]2(CCSC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206834",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(NC(=O)N2CCN([C@H](C)C(F)(F)F)CC2)ccc1N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240380",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CCc1cccc(N[C@H](C)C(=O)Nc2cccc(C(C)=O)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90045",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC[NH+](CC)CCNC(=O)c1ccc(NC(=O)N2CC[C@H](C)[C@H](O)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62842",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule O[C@@H](Cc1ccc(F)cc1)[C@@H]1CCO[C@]2(CCOC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218075",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccn2c(=O)c(C(=O)Nc3ccc4c(c3)OCO4)cnc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109715",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=CCn1nns/c1=N/CC(=O)Nc1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96302",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@@H](O)[C@H](O)C1=N[C@H]2C(=O)N=C([NH-])NC2=[NH+]C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193593",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCCCNC(=O)[C@H](C)Oc1ccc(C#N)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22577",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(C2=NS(=O)(=O)N(C)C(C(=O)N3CCN(Cc4ccccc4)CC3)=C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOC(=O)[C@@H](C)Sc1nc(C)c(C(C)=O)cc1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116153",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule Cc1ccc(CCC(=O)OC[C@@H]2CCCN2C(N)=O)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163480",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(CNC(=O)CSCc2nsnc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53191",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H]1CCC[NH+]([C@@H]2CCC[C@H](O)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157791",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N[C@H](CC(=O)N(C)[C@H]1CCc2ccccc2C1)c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5277",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Nc1cc(F)ccc1-c1nc2cc(Cl)ccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168472",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@@H](NC(=O)CN1CCN(c2ccc(O)cc2)CC1)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)c2sc(-n3nc(C)c(Cl)c3C)nc2C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101033",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1/c(=N/C(=O)Cc2ccc3c(c2)OCO3)sc2cc3c(cc21)OCCO3 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109476",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=S(=O)(NC[C@@H]1C[NH+]2CCN1CC2)c1ccc(C(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6934",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(N2C[C@H](C(=O)N(C)C)CC2=O)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115579",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cn1ncc2c1N=C(O)C[C@H]2c1cc(Cl)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28409",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1oc(-c2cccs2)nc1C[NH+](C)CC(=O)[O-] by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38199",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@@H]1CC[NH+](CCCN2C(=O)NC(C)(C)C2=O)[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13322",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(C)c(/N=C/c2ccc(Cl)c([N+](=O)[O-])c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H]1CCC[C@@H]1c1cscc1Br by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196060",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule NS(=O)(=O)c1cscc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50013",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1OC)[C@@H](C(=O)Nc1cccc(C)n1)[C@H](c1cccs1)N(C)C2=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105714",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc(CC)c1CNC(=O)Nc1cccc(-n2nnnc2C)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NO[C@H]1CCCCO1)c1cc([N+](=O)[O-])ccc1Cl by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65843",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)[C@H]1CCCc2[nH]ncc21)c1ccc(Cl)s1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20095",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COC(=O)C1=C(NC(=O)c2ccc(OC)cc2)CCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202547",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc(C[NH+]2CC[C@@H](C)[C@@H](n3ccnc3)C2)c1OC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H]2c3[nH]c4ccccc4c3C[C@@H]3C(=O)N(C4CCCC4)CC(=O)N23)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215180",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCC[NH2+][C@@H](Cc1ccccn1)c1ccc(CC)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186737",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccc(OC(F)F)cc1OC(F)F)N1CCOCC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80559",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(C(=O)N2C[C@@H](C)C[C@H](C)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65560",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)C[N+](C)(C)CCO by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150256",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Br)cc1CSc1cc(N)ccc1Cl by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7681",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1nn(C)c2c1nc(CCl)n2Cc1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33291",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cc(OC)c(-c2cc(C(=O)[O-])c3c(-c4ccc(Cl)cc4)[nH]nc3n2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118656",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@@H](CS(=O)(=O)c1ccccc1)[NH2+][C@@H](C)c1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190054",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(C[NH+](C)Cc2nc(-c3cccnc3)no2)ccc1-n1cncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41309",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule c1ccc2[nH]c(SC[C@@H]3CC[NH2+]C3)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11995",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(NC(=O)c2ccc(N3C(=O)[C@H](C)CS3(=O)=O)cc2Cl)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158040",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule c1cn2c(CN3CC[C@H](C[NH+]4CCCCC4)C3)cnc2cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39915",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)Sc2nnc3cc(C)c4ccccc4n23)c1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197629",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@@H]1CC[C@@H](CN2C(=O)CC3(CCCC3)CC2=O)O1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132229",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(F)ccc1CCN1CCC([NH3+])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216702",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(-c2cccnc2N2CCC[C@@H](NC(=O)C(C)C)C2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[C@H]1[C@H](C)CCC[NH+]1Cc1ncc(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21208",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)[NH+](Cc1csc(-c2cnn(C)c2)n1)C1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109704",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1/c(=N/C(=O)[C@@H]2COc3ccccc3O2)sc2cc(OC)ccc21 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24524",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccccc1NC(=O)c1cc(C)n(Cc2ccccn2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158493",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)(C)OC(=O)NC[C@H]1CCC[NH+]1CC(=O)Nc1sccc1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86581",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCOc1ccccc1/C=C/C(=O)Oc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44289",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(C(=O)CN2CCC[C@@H]([NH+]3CCCCCC3)C2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1OCC(=O)N1CCN(c2ccc([N+](=O)[O-])c(N3CCOCC3)c2)CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87469",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc(C(C)C)c(OCC(=O)N/N=C/c2ccco2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249239",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCc1nc(C)c([C@H](C)[NH2+]Cc2ccccc2C)s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8538",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Oc1ccccc1C(=O)Nc1ccc(Cl)cc1Cl by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162999",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1nc(C)nc(N2CCN(C(=O)c3cccc(OC)c3)CC2)c1Cc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241741",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(NC(=O)c2noc3c2CCCCC3)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15607",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1c(CCC(=O)Nc2cccc(-c3ccc4c(c3)CCO4)c2)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21028",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(C)c1ncccc1N(C)C(=O)[C@H]1CC(c2c(F)cccc2F)=NO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206984",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cc1ccc(C(=O)C2CC[NH+](Cc3ccc(C#N)o3)CC2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53761",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CNc1ncccc1C#N)Oc1ccccc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160374",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@](O)(CNC(=O)Nc1ccccc1S(C)(=O)=O)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70308",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CN(Cc1[nH+]ccn1C)C(=O)[C@@H]1CC(=O)Nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28934",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC[C@H](NC(=O)N1CCC[C@@H]1c1ccccc1C)C(=O)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18887",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Fc1ccccc1C/[NH+]=C1\\NCC[NH2+]C12CCCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169295",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc2c(C)c(C(=O)N[C@@H](C)C(=O)N3CCOCC3)oc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126572",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC1=NN=C2CCN(C(=O)c3ccc4ncsc4c3)C[C@H]21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)ccc1/C=C1\\SC(=S)N([C@H](C)[C@H]2CCCO2)C1=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4420",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1nc(C)c([C@H](C)NC[C@@H](OC)c2ccc(F)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccccc1C#N)C(=O)N1CCC[C@@H](C(F)(F)F)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10048",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1nn(C)c(CC)c1CNC(=O)[C@H]1CCO[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)CC(=O)Nc1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccccc1O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11599",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(-c2nc(C(=O)N[C@@H](C)c3nnc4ccccn34)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118762",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCc2cc(S(=O)(=O)NC3CC[NH+](Cc4ccccc4)CC3)ccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61168",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(c1cc(N2CCC(c3nc4ccccc4s3)CC2)ccc1[N+](=O)[O-])N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24458",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(CCOCC1CC1)C(=O)[C@@H]1CCCCN1S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127005",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(C)C(=O)[C@@]1(C)CCCN(c2ncccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147267",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCc1nnc(NC(=O)c2ccccc2NC(=O)c2ccc(C)c([N+](=O)[O-])c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212616",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(C1CC[NH+](Cc2cccc(Cl)c2)CC1)N1CCN(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27008",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCN1CCN(C2=NC(=O)/C(=C/c3ccc(N(C)C)cc3)S2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237476",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(CCNC(=O)c1cnc(-c2ccncc2)nc1)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127598",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([C@@H]1NCCc2[nH]c[nH+]c21)N1CCSCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20375",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1F)O/N=C/c1ccncc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159556",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cc(CNC(=O)CNC(=O)C(C)(C)C)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106828",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1C(=O)C2=C(C[C@@H]1C)NC(C)=C(C(=O)OC1CCCC1)[C@@H]2c1coc2ccccc2c1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75107",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN(CCS(C)(=O)=O)C(=O)Nc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44382",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)c2cccc(NC3=N[C@H]4CS(=O)(=O)C[C@@H]4S3)c2)cc1OC by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCc1ccccc1CNC(=O)NCc1nccc2ccccc12 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54296",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H]1COc2ccccc2O1)Nc1ccc2c(c1)OCO2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule C[C@H]1CC(C(=O)Oc2cc(F)ccc2[N+](=O)[O-])C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(Cl)c(Cl)c1)C1CCN(C(=O)[C@H]2CC(=O)N(c3ccccc3)C2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122429",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COC(=O)C[C@H](NC(=O)Nc1cc(F)ccc1F)c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5273",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)CCN2C(=O)/C(=C/c3ccccc3O)SC2=S)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247074",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cccc(O[C@@H](C)C(=O)N/N=C/c2ccc3c(c2)OCO3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198453",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2ncc(C(=O)N3C[C@@H]4OCCN(C)[C@@H]4C3)n2c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132743",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccccc1)Nc1ccc(S(=O)(=O)NC[C@H]2CCCO2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ccc(C=O)cc1OCC(=O)NC1CCC(C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21704",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)CNC(=O)[C@@H]1Cc2ccccc2CN1C(=O)c1cc2ccncc2cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197609",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(=O)c1ccnc(Oc2cccc(Br)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222563",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cc(C)ccc1NC(=O)c1cccc(OCc2cscn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185355",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCCN(C(=O)C2CC[NH+](Cc3cccc(-c4ccccn4)c3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91081",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CN1CC(=O)N(CC(=O)N[C@@H]2CCc3[nH+]ccn3C2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171196",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COCCNC(=O)c1ccc(C[NH+]2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186701",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C[C@H](Cc1cccc(F)c1F)c1cccc(C)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110340",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cc([C@@H]2C[C@H]2C[NH2+]C2CC2)ccc1C1CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96351",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)N[C@H](C)C[C@@H](O)c1ccco1)c1ccc(Cl)s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149742",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1C(=O)O[C@@H](C(=O)Nc1ccc(Cl)cc1C(F)(F)F)c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133521",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](Nc1ncc(Br)cn1)c1cc2ccccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26278",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccnc(NNC(=O)[C@H]2CCOc3ccccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159369",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1CC[C@@H]([NH+]2CCC[C@H](Cn3ccnn3)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCN(Cc1cccs1)C(=O)NCC(C)(C)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170133",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](C(=O)Nc1cccc(Cl)c1)[C@@H]1Sc2ccccc2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49617",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCCCN(C)S(N)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80483",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)c1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132190",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC1(C)[C@@H]([NH2+]Cc2cccnc2N2CCC[C@H](C(N)=O)C2)[C@@]2(C)CC[C@@H]1C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16645",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ccccc1OCCOc1ccccc1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93311",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1nc2n(n1)CCC[C@@H]2NC(=O)NC[C@H]1CCO[C@@H]1C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124833",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ncsc1CCC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141798",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1ccccc1C[NH2+][C@@H]1CCO[C@@]2(CCOC2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225808",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule ON(/C(=N\\c1ccccc1)c1ccccc1Cl)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105617",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C/[N+]([O-])=C\\c1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71142",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]1CNc2c(C)[nH+]n(C)c2N1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60470",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCC[C@H]1C[C@H]2CC[C@@H]1C2)c1cccc(CN2C(=O)CNC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187485",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cccc(NC(=O)c2cc3ccccc3o/c2=[NH+]\\c2ccc3c(c2)OCCO3)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178012",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C([O-])c1cc(SCCn2cccn2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132592",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C/C(Nc1ccc(C(=O)[O-])c(O)c1)=C1/C(=O)O[C@H](C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36327",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(SCc2noc(-c3ccccc3)n2)nc2ccsc2c1=O by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182034",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc(C)c([N-]S(=O)(=O)c2c(F)cccc2[N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145936",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@H](C)NC(=O)CN1CCN(C(=O)c2ccncc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205281",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=c1cc(CSc2cccc(Br)c2)nc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174451",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2cccc(NC(=O)C(=O)NC[C@@H](C)C#N)c2n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77907",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+][C@@H]1CCCc2sccc21)[C@H](OC1CCOCC1)c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=S)NNC(=O)[C@@H](C)NC(=O)c2ccccc2)c1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37190",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)[C@H](C)[S@@](=O)Cc1ccc(F)cc1F)c1ccccc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nncs1)NC1CC[NH+](CC2CCCCC2)CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccccc1CNC(=O)N[C@H]1CCCOc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69141",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)c1cc(S(=O)(=O)N(C)C)c(C)o1)c1cc(C)ccc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCc2c(sc3ncnc(NCCC4[NH+]=c5ccccc5=[NH+]4)c23)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148559",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C#CC[C@@H](C)OC(=O)c1cc(C)oc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56499",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COCCOc1ccccc1CN1CCNC(=O)C[C@@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36319",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC(=O)[C@@H]1CN(C(=O)c2ccc(Br)s2)C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C[C@@H]1CCC(=O)N1)C(=O)c1cc(Cl)c[nH]c1=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195906",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C)n(-c2ccc(C(=O)Nc3ccccn3)nn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CCc1ccccc1)NC(=O)c1cc2ccccc2[nH]1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194748",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[S@@](=O)c1ccc(C(=O)N(Cc2ccco2)CC(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166378",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H](NC(=S)NNC(=O)c1ccc2c(c1)CCCC2)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129148",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC[C@H]1CCCN(C(=O)c2csc(COC)n2)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163941",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule NC(=O)CSc1nnc(-c2ccco2)n1Cc1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243823",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CS(=O)(=O)N1CCCn2nc(CNc3ncccn3)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220496",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@H](CSC)N(C)C(=O)c1cccc(C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225766",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](O)[C@H](C)[NH2+][C@H](C)CC(=O)N2CCOCC2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84218",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@@H]1CCCC[C@H]1NC(=O)CN1CCO[C@H](CC(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31086",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C)C(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75040",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1cccc(CNC(=O)NC2CC[NH+](C[C@H]3CCOC3)CC2)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103507",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C[NH+](CC(=O)NCC(=O)N2CCCC2)C(C)C)s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227053",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COC(=O)NCCOC(=O)c1ccc(C(F)(F)F)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93556",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCCO[C@@H]1CCC[NH+](CC2(CS)CCCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125609",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCOc3ccc(C(=O)NCc4ccccc4F)cc3C2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91738",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule [NH3+]C[C@H]1CCCC[C@H]1N1C(=O)CCCC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103409",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1C(=O)N[C@@H](C)c1ccccc1Br by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176641",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@@H](OC(=O)c1ccc(F)nc1)c1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98349",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCOc1ccc(C(=O)CN2C(=O)N[C@@]3(CCCC[C@@H]3C)C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55295",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccccc1NC(=O)NC[C@@H](O)c1c(F)cccc1F by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51548",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C#CCOC(=O)C1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6493",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CCCC(=O)N2C[C@@H](C(N)=O)CC[C@H]2C)cc1F by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185609",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(C1=C([O-])C(=O)N(CC[NH+]2CCCCC2)[C@@H]1c1cccnc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193822",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)[C@H]([NH3+])Cc1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210402",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCn1nc(C(=O)N[C@@H](c2cccs2)C(C)C)c2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)S(=O)(=O)Cc1ccc(NC(=O)N2CCC(Cc3[nH+]ccn3C)CC2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80928",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc(CNC(=O)C(=O)Nc2ccc(C(C)C)cc2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221610",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1sc(N2CCCCC2)[s+]c1SCC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82716",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc([C@H](C)[NH2+][C@@H]2CCN(C(C)=O)C2)c(OCc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107764",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CO[C@H](C)c1noc(CC[C@@H](C)CC[NH3+])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118723",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+](CC)C[C@H]1CCN(C(=O)c2ccc(Br)c(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248212",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1C1(CNC(=O)NCCc2ccccn2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75377",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cn1cc[nH+]c1)NC(=O)N1CCO[C@@H](c2ccc(F)cc2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71485",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1[nH]ncc1C(=O)N[C@H](C)c1nc(-c2ccc(Cl)cc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191061",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2CCC[C@@H]([NH+]3CCC(CN4CCOCC4)CC3)C2=O)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@@H](C)CN(CC)[C@@H](C[NH3+])c1cccc(Cl)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242576",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)c1ccc(-n2cncn2)cc1)c1cc(Cl)cc(Cl)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212680",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@H](NC(=O)CCc1ncc(-c2c(F)cccc2F)o1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76572",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule NC(=O)[C@H]1CCN(C(=O)Cn2cc([N+](=O)[O-])ccc2=O)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77972",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1n[nH]cc1CNC1(c2ccc(F)cc2F)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164629",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1nc(C[NH+]2CCCCCCC2)nc2ccccc12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182474",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C(CS(=O)(=O)Cc1cccc(Br)c1)N[C@H](c1ccccc1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140312",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCCNC(=O)[C@H]1C[C@H](O)C[NH2+]1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)(C)C1=C[C@@H]([C@H]2CC(=O)NC[C@H]3N=C4C=CC=CN4[C@H]23)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59700",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1cc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115764",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCCCn1nc(C)c2c(C(=O)N[C@@H](C)c3cnn(C)c3C)cc(C3CC3)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236337",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(N2C(=O)c3oc4ccc(F)cc4c(=O)c3[C@@H]2c2cccc(OCCC(C)C)c2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162924",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(CCN1C(=O)/C(=C/c2ccccc2F)SC1=S)N[C@@H]1CSC[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138794",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn2c(c1-c1ccccc1)NC1=C(C(=O)C[C@H](C)C1)[C@@H]2c1ccccc1[N+](=O)[O-] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179763",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccccc1N1CCN(C(=O)c2cc(-c3ccc(C)cc3C)n[nH]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201446",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCN1CC2(CCC1=O)CC[NH+](Cc1nc(C(F)(F)F)no1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204592",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCC[C@H](C#N)CN1CCc2c(cccc2N2CCOC2=O)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98069",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS[C@H](CO)[C@H](C)NC(=O)N[C@@H](C)c1ccc(-c2cncnc2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31210",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCn1c(C(=O)NC(C)(C)c2ncc(C)s2)cc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78932",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1n[nH]c(C)c1CCC(=O)N(C)Cc1csc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H]([NH3+])c2n[nH]c(COc3ccc(C(C)(C)C)cc3)n2)cc1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)N1CCC([NH+]2CCC[C@@H]2c2cccc3c2OCCO3)CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151492",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cc(Cl)cc([N+](=O)[O-])c1)N1CCOC[C@@H]1CCO by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128954",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cc(CNC(=O)c2n[nH]c(C(C)C)n2)cc(C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153449",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H]1SCCC[C@@]1(C[NH3+])N1CC[NH+](CC2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191806",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(c1ccc(-c2nnco2)cc1)N1CCC[C@H]1c1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154084",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCN1C(=O)c2ccccc2C1=O)Nc1cc(Cl)ccc1Oc1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60821",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@@H]1C[NH2+][C@H](c2cc(F)cc(F)c2)CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161566",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Fc1cc(NC(=S)NC2CC2)ccc1N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216795",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(/C=C2\\C(=O)N(Cc3ccco3)C(=O)N=C2[O-])c(C)n1-c1ccc(Cl)c(C(=O)[O-])c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202193",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CS(=O)(=O)c1cccc(NCCc2ccc(F)cc2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58683",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CC[C@H](C)[C@H](C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187072",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(-c2nnc(CCC(=O)N3CCC(Cc4ccccc4)CC3)c([O-])n2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242620",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H](c1ccccc1)N(C)C(=O)CC1(O)CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182546",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)NC(=O)N(CC[NH+]2CCC(C(=O)N3CCCC3)CC2)C1=O by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126543",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)Nc2cccc(C(F)(F)F)c2)nnn1-c1ccc(C(C)C)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30307",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(CSc1nnnn1Cc1cccs1)c1c[nH]c(C(=O)N2CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112736",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C[C@H](C(=O)N2CCNC(=O)C2)CC1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132204",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H](c1ccc(C(F)(F)F)cc1)N1CCOCC1)[C@@H]1COc2ccccc21 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230977",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)C[C@@H]1CCCN1C(=O)NCc1ccc(CN2CCCC2=O)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138465",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cccnc1[C@@H]([NH2+][C@@H](C)c1ccc(F)cn1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133722",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccccc1CNC(=O)NC1CCC(Oc2ccc(C#N)cn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98390",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)[C@H](NC(=O)N1CCCCC1)C(=O)[O-] by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2556",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)CC[C@@H]2CCCN(C(=O)c3sccc3C)C2)cc1Cl by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Nc1c(C(=O)NCCc2ccccc2)nnn1-c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134701",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(C)c(NC(=O)Cc2ccc[nH]2)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C#CCn1/c(=N/C(=O)CCC)sc2cc(OC)c(OC)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109364",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(c1cc(Br)ccc1Cl)N1CCC(Cn2cc[nH+]c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182329",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(NC(=O)CSCc2cc(=O)n3nc(C4CCCCC4)sc3n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20919",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCOC(=O)[C@@H]1[C@@H]2C(=O)N(c3ccccc3Cl)C[C@]23C=C[C@H]1O3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105204",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@H](C)[C@@H](C)Br)ccc1Cl by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(NCCCn1ccnc1)c1cnn(-c2ccccc2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70439",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H]1[NH2+]CC[C@H]1C(=O)N1CCC[C@@H]1c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97490",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C[NH3+])Sc1ccncc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230046",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCS(=O)(=O)CCN(C)C(=O)/C=C/c1nc2ccccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cccc(C(N)=O)c1NCc1cn2cccc(C)c2[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121160",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(C)c1c(C[NH2+]CC)c(C)nn1C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule [O-]c1nc(SCC2[NH+]=c3ccccc3=[NH+]2)nc2nc[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193339",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C1N[C@@H](O)c2cc(Br)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](NC(=O)NCC1CC[NH+](C)CC1)c1cccc(-n2ccnc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NC[C@@H](O)COc1ccc(F)cc1)NC[C@H]1Cc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154490",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(Cn2nnnc2[C@@H](c2cc3cccc(C)c3[nH]c2=O)N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[NH2+][C@H](c1ccc(SC)cc1)c1ccc(OC)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCNS(=O)(=O)[C@H]1CC[NH+](CC(=O)Nc2cc(C)on2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115239",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCC1=c2ccccc2=[NH+][C@@H]1c1ccc(F)cc1)N1CCN(c2ccccc2O)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142156",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(-c2cn3nc(SCC(=O)Nc4ccc5c(c4)OCCO5)ccc3n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193461",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@H](OC(=O)c1ccc(Br)cc1F)[C@H]1CCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135434",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)[C@@H](C)SCC(=O)Nc1ccc(OC(F)(F)F)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8957",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule [NH3+]C[C@H]1CCC[C@@H]1NC(=O)C[C@H]1CCCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21660",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCN(Cc1ccc(Cl)cc1)S(C)(=O)=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222489",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](NC(=O)c1ccco1)C(=O)Nc1ccc(C(N)=O)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151945",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(OCc2nc(CC(=O)N3C[C@@H](C)CC[C@@H]3C)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174193",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C/C(=N\\Nc1cccc([N+](=O)[O-])c1)c1ccc(O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175910",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1n[nH]c(-c2ccc(C(=O)NCC(=O)N3CCCC3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116551",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC(C)[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)NCCc1cn2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55827",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(C)c1ccc(CNc2cnn(-c3ccccc3S(C)(=O)=O)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107721",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cscc1-c1noc(-c2cc(Cl)cc(Cl)c2N)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105336",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(CNC(=O)Cn2ncc3c(C)n(Cc4ccccc4F)c(C)c3c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4604",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+]1CCN([C@H](C)CNC(=O)c2ccc(F)cc2Br)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43607",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@H]1CCC[C@@H](NC(=O)C(=O)Nc2cccc(OC(F)F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199772",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1nc([C@@H]2CCN(C(=O)C3(c4ccc(Cl)cc4)CCOCC3)C2)ncc1C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68583",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(CCc1csc2nc(-c3ccccc3)cn12)Nc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)COc1cccc([C@@H]2CC(=O)N[C@@H]3[C@H]2C([O-])=Nc2nc4ccccc4n23)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214527",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc2c(CCNC(=O)N[C@@H](CO)c3ccccc3F)c[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212286",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCc2c(sc3nc(CN(C)CCS(C)(=O)=O)nc(N)c23)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130258",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)N1CCc2nc(NC(=O)NC3CCCC3)sc2C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119483",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CNC(=O)NCC(=O)N1CCC[C@H]1Cc1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113617",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(COc1ccc(F)cc1)NCc1ccc(N2CCOCC2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47202",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1sc2ncn(CC(=O)Nc3nc(-c4ccc(Br)cc4)cs3)c(=O)c2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129999",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCc1noc(C)c1C(=O)N(C)C1(C(=O)OC)CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191487",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nn(C2CCCCC2)c(C)c1C[C@@H](C)C[NH2+]C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196524",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCN1C(=O)[C@@H](CC(=O)Nc2ccc(Cl)cc2)S/C1=N\\c1ccc(F)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156267",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CC(=O)NCc2ccc[nH+]c2N(C)C)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130753",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cn(-c2ccccc2)nc1C(=O)N(C)[C@@H](C)c1ccc(F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](C)c1cccn1CCn1cccn1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208706",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[NH2+][C@@H](C1CC1)C1(N2CCOCC2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167048",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=NN(C(=O)[C@@H](CC(C)C)NC(=O)c2ccccc2)[C@@](C)(O)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38862",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)(C)C(=O)N1CCN(C(=O)Nc2cccc(OC3CCCC3)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41658",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@H](C(=O)Nc1ccc2[nH]nc(C(=O)OC)c2c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153703",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)NC[C@@H](C)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1c(C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cnn1C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148351",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)C[NH+](C)C[C@@H]1CCCC(C)(C)C1=O by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCOc1cccc(C(F)(F)F)c1)N[C@H]1CCC[C@@H]1CO by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202184",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC[C@@H](COC)NC(=O)c1c[nH]c(C)cc1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143477",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CS[C@H]1CC[C@@H](NC(=O)c2cc3ccccc3oc2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195561",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C=CCn1c(=O)c2c(nc(N/N=C/c3cccc(OC)c3)n2C)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)NCc1ccccc1[C@@H]1CCC[NH2+]C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63076",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(N(C(=O)c2ccc(-n3cccn3)cc2)c2ccccc2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38063",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Br)ccc1C(=O)Nc1ccc2c(c1)COC2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96317",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc([C@H](C[NH3+])CCOc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46155",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)CNC(=O)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153530",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cccc(N2CCN(C(=O)C3CCN(c4ncnc5c4oc4ccccc45)CC3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30498",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H]1CC[C@@H](C)C[NH+]1Cc1nnc(-c2ccc(C#N)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65481",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc([C@H](NC(=O)Cn2cc(C(C)C)nn2)c2ccncc2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167467",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC[C@H]1CCCN(C(=O)N[C@@H]2CCC[C@@H]2c2ccccc2C(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200228",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CSCCNC(=O)NNC(=O)c2cccnc2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49991",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CO[C@H]1CCC[C@@H](OC(=O)CCn2cnc3ccccc3c2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198408",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOc1ccc([C@@H](C)NC(=O)Cn2ccnc2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120136",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(N)cccc1S(=O)(=O)N[C@H]1CCC[C@@H](C)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[NH2+][C@H](C(C)C)[C@H]1CCO[C@H](C(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135948",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc2nc(Nc3nc4c(c(=O)[nH]3)CCCC4)nc(C)c2cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOC[C@@H]1CCN(C(=O)Cn2c(C)cc(=O)c3ccccc32)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CNC(=O)COc1ccccc1CN1CCO[C@@H]2CC[C@@H](OC)C[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162189",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)c1ccc2c(c1)[C@]1(NC(=O)[C@H]3COCCN31)C(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186528",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C[NH+](C)Cc2cccn2C)cc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201754",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOc1cc(F)ccc1NC(=O)c1cc(OC)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51630",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(NC[C@@H]1CCCS1(=O)=O)N[C@H](CO)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139084",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1csc(N2CCCC2=O)n1)N[C@@H]1CC[NH+]2CCCC[C@H]12 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130142",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccccc1NC(=O)COc1ccc2ccccc2c1C=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240506",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC[C@@H](O)COc2ccc(F)c(F)c2)n2c(nc3ccccc32)c1C#N by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76460",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1CC[C@@]1(C[NH3+])c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159294",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H](CNC(=O)C(=O)Nc2cccc([N+](=O)[O-])c2)N2CC[NH+](C)CC2)cc1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1cc(C[NH+]2[C@@H](C)CCC[C@H]2C)ccc1[N+](=O)[O-] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190755",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[NH2+][C@H](C)c1ccc(N2CCC[C@H](C(N)=O)C2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196130",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCc1ccc(S(=O)(=O)N[C@@H]2CC[C@@H]([NH+](C)C)C2)s1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234249",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCn1nc(C)c(NCc2cnc(-c3ccccn3)s2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182244",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[NH+](C)C1(C(=O)Cc2ccc(C(C)(C)C)cc2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42607",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1C(=O)NC(=O)C[C@H]1c1ccc(CC)s1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2572",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NCc1cccnc1OCC(F)(F)F)c1ccc2[nH]cnc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37108",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](c1ccccc1F)N(C)C(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37254",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CCCN2CCN(C3=[NH+]C[C@H](C)S3)CC2)cs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32740",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(=O)Cc1nsc(NC(=O)c2ccccc2Br)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235880",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)C(=O)Nc1ccccc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11028",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Nc2ccc([N+](=O)[O-])ccc2=O)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88462",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COC[C@@H](C)Cc1nc(C[NH2+]C(C)C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118272",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule CCC[C@]1(C)CN(Cc2ccccc2)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C[NH2+]C/C=C/c2ccc(C#N)cc2)sc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159954",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CS(=O)(=O)CCNc1nc(C[NH+]2CCCC2)nc2sc3c(c12)CCCC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233046",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@@](O)([C@]2(C[NH3+])CCOC2)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185371",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(CNC(=O)Cc1n[nH]c2c(Cl)cccc12)NCC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC/C=C(/C)C(=O)N1C[C@@H](C)O[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123904",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1cc(S(=O)(=O)Nc2cc(C)ccc2O)cs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98412",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CC(=O)Nc1ccc(C(C)=O)cc1OCc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2sc(N3CC[NH+](CCNC(=O)c4ccc(Br)cc4)CC3)nc2c1C by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170860",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CS(=O)(=O)c1ccc([C@H](O)CN(Cc2ccccc2)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191719",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1n[nH]c2ccc([N+](=O)[O-])cc12)N1CCC[C@@H]2CCCC[C@@H]21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162282",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1COc1cc2ccccc2cc1C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17123",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(F)c(OCCCCCS)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202679",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)[C@@H](NC(=O)[C@H]1C=C[C@@H]([NH3+])C1)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule NC(=O)[C@H]1CCC[NH+](CCCNC(=O)Nc2cccc([N+](=O)[O-])c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21019",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCOc1cc(OC)ccc1C(=O)CN1C(=O)c2ccccc2O[C@@H](C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220581",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(=O)N[C@H]1C(=O)N(Cc2ccccc2Cl)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156415",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1cccc([C@H]2Nc3c(C(=O)N4CCOCC4)cccc3[C@@H]3C=CC[C@@H]23)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20536",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(=O)Nc1ccc(-c2csc(NC(=O)[C@H]3[C@H](C=C(C)C)C3(C)C)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101949",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=c1ccc2cc(S(=O)(=O)NCCc3ccccc3)ccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191736",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule [O-]c1c([C@@H](c2ccccc2)[NH+]2CCC(Cc3ccccc3)CC2)sc2ncnn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33833",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CNC(=O)c1ccc(CNC(=O)Cc2ccc(NC(=O)C3CC3)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54233",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(Cc1cnn(C)c1)C(=O)C(=O)Nc1ccccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCc1nc(N2CCOCC2)sc1C(=O)NCc1ccccc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141040",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C[NH+]1CCCN(Cc2cccs2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@H]1CN(c2ccc3nnnn3n2)[C@@H](CC)C[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223688",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cn1c(CCN2CCOCC2)nc2cc(NC(=O)c3cccc([N+](=O)[O-])c3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55222",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CN(C)c1n[nH]c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51696",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CO[C@@H](CNC(=O)CC[C@@H]1CCCO1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245370",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C/C(=C\\C(=O)c1cccnc1)Nc1ccc(C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61670",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cn1cc([C@H]2CN(C(=O)Nc3ccnn3Cc3ccccn3)CCO2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176954",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCc1ncc(C[NH+]2CCC3(CC2)CN(S(C)(=O)=O)Cc2ccccc2O3)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33579",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1c(C(=O)N2CC[C@@H](OCCC(C)C)C2)cnn1-c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191785",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@@H]1CCC[C@@H](NC(=O)c2occc2Br)C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152365",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCc1cccc(NC(=S)N(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155637",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccc([C@@H]2[C@@H]3[NH+]=c4ccccc4=C3CCN2Cc2ccccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137420",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H](NC(=O)N(C)[C@@H]1CCc2ccccc21)c1cccc(S(N)(=O)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19760",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1cccc(CNC(=O)c2cc(S(=O)(=O)NC3CC3)ccc2Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159918",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2ncc(C(=O)N3CC[C@@H](C(N)=O)C3)s2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187386",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1csc(C2(NC(=O)CC3(O)CCCC3)CCCC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19594",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH+](C)C[C@@H]1CCN(C(=O)N[C@@H](CC)c2ccc3c(c2)OCCO3)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156561",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[NH+](C(C)C)[C@H](C)[C@H]([NH3+])c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@@H](NS(C)(=O)=O)C(=O)N1CC[C@H](C(=O)[O-])[C@H]1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60651",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cc(NC[C@H]2C[C@@H](O)C[NH+]2Cc2ccccc2)n2ncnc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228965",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1CC(C(=O)N(CC[NH+](C)C)Cc2ccc(C#N)cc2)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119325",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC1(C)O[C@H]2O[C@H]([C@H](O)c3cc(O)c4c(c3O)C(=O)c3ccccc3C4=O)[C@@](C)(O)[C@H]2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccccc1NC(=O)C(=O)NC[C@]1(O)CCOc2ccccc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101798",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule O=C(N[C@@H](c1ccc2c(c1)CCCC2)c1cccs1)c1ncccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122752",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc(N)n(Cc2ccccn2)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NCC(=O)NNC(=O)c2ncccc2C(F)(F)F)c(C)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199568",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc2oc(=O)cc(CN3C(=O)N[C@](C)(c4ccc5c(c4)CCC5)C3=O)c2cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101374",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C)cc(OCCNC(=O)CCN2C(=O)c3ccccc3C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47442",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC(C)(C)[C@@H]1CCC[NH+]1CCCc1nnc(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73371",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCC[C@@](C#N)([C@](C)(O)Cc2ccccc2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212632",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)N1C(=O)[C@@H]2[C@H](CC(N)=O)N[C@@]3(C(=O)Nc4ccccc43)[C@@H]2C1=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)COc1ccc([C@@H]2CC(=O)N(c3ccccc3)c3c2sc(=O)n3C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216382",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCN1C=C(C(=O)OCc2ccc(F)cc2)C(C)=NS1(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89641",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CN1c2cc(F)ccc2C(=O)NC12CCN(C(=O)NC1CCCCC1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63874",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1CC1)C(=O)CSc1nncc2c1[nH]c1ccc(F)cc12 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100611",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCCN1CCN(c2cc(-c3cncc(-c4cccs4)c3)nc(-c3ccccc3)n2)CC1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153323",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C(/C)C(=O)N1CC[NH+](C)Cc2ccccc21 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16409",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(/C=C/c1cnc2ccccc2n1)NCc1ccc(S(=O)(=O)N2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76882",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H](c1ccccc1)[NH+]1CC[C@@H](N[C@H](C)CCCO)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule c1ccc2c(c1)C[C@H](C[NH2+]CCC1CCCCC1)S2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229393",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)N1CCc2cc(Br)ccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130797",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1877",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC[C@@]1(CO)CCCN(C(=O)c2coc(CN3CCOCC3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170767",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cnc(N2CC[NH+]3CCCC[C@@H]3C2)c(C[NH2+]C2CC2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34324",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1ccnc(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137544",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2CCC[C@@H](NC(=O)COCC3CC3)C2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142902",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc(F)cc1)c1nc2cc(Cl)ccn2c1F by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38176",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1ccc(CN2C[C@H]3[C@@H](C2)OCCN3Cc2ccccc2)o1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21166",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule N/C(Cc1cccs1)=N\\OC(=O)COc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235435",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOC(=O)[C@H]1NCCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121513",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2CCOC2=O)cc1NC(=O)c1oc2ccccc2c1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58204",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C(CSc1nnc(NC(=O)c2cccs2)s1)Nc1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156677",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]1C[C@H]([NH3+])CN(CCCC(C)(C)C#N)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1CN(C(=O)[C@@H](C)C(N)=S)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11623",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule [NH3+]C[C@H]1CCCC[C@H]1[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185687",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](NC(=O)c1ccccc1)C1([N+](=O)[O-])CCCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)n(C[C@H](C)C(=O)N2CCN([C@H](c3ccccc3)c3[nH+]ccn3C)CC2)n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90019",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)Nc1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190500",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1cccc(-c2c(-c3ccccc3)ncn2Cc2ccc3nonc3c2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85178",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc(-c2ccc3nnc(SCc4cccc(F)c4)n3n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149045",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ncsc1C(=O)N[C@H](Cc1cc(=O)[nH]c(-c2ccccn2)n1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29026",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(NC(=S)N[C@H](NC(=O)N2CCOCC2)C(Cl)(Cl)Cl)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245647",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[C@H](C)C(=O)N1CCCC[C@H]1CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113404",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)c1cc(Br)c(C)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18457",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(F)c(C(=O)N2CC[C@@H](C)[C@H](O)C2)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54940",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NNS(=O)(=O)c1cc(Cl)ccc1Cl)c1ccc(Br)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135158",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CN(C(=O)Cc1cccc(OCc2cccnc2)c1)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127842",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC[C@H](NC(=O)CCCc1cc(F)ccc1F)[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71529",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC[C@H](C)NC(=O)Cn1cccc2cc(C(F)F)nc1-2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177643",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc(CN2C(=O)C[C@@H](C(=O)Nc3ccccc3OC)S/C2=N\\c2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123891",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@H]1CCCC[C@H]1NC(=O)NCCC(=O)NCc1ccncc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1c(C)[nH]c(C(=O)N2CCC(OCc3ccccc3C)CC2)c1C(C)C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(C(=O)NCC(=O)N2CCC3(CC2)OC[C@@H](C)O3)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203358",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CNC(=O)NC(=O)CCSc1csc(C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92890",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCn1ccc(C(=O)N2C[C@H]3CC[C@@H]2CN(C(=O)c2ccccc2)C3)cc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22296",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@@H](OC(=O)c1ccccc1)C(=O)Nc1cccc(S(N)(=O)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC[C@H](c2nc(=O)c(-c3ccc(Cl)cc3)c([O-])[nH]2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186599",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(CCCCl)N(Cc1ccsc1)CC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27750",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CN(C(=O)c1ccc([N+](=O)[O-])cc1)[C@@H]1CCN(c2ccccc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77360",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCCn1c(C)nnc1S[C@@H](C(=O)N1CCCC[C@H]1C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1sccc1C(=O)[O-])c1cc2c(F)cccc2s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242796",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC[C@]1(Br)C=CC=CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116034",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(Oc2cc(NN)ncn2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100804",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(CNC(=O)c1ccc2c(c1)CCC2)NC[C@@H]1CCC[C@@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213382",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(=O)[C@@H](C)Oc1ccc2c(-c3cc4ccc(OC)cc4oc3=O)cc(=O)oc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(C)C[NH+](C)[C@H](C)C(=O)Nc1ccc(F)cc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33756",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCCNC(=O)N1CCN(C(=O)c2ccc(CC)cc2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239133",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccccc1CC(=O)NCc1nccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69053",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@](N)(C(=O)NC[C@@H](O)CO)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140323",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1c2c(cc3c1O/C(=C\\c1c(F)cccc1Cl)C3=O)CN(C1CC1)CO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153586",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1cccc(CNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72243",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H]1CCC(=O)N(Cc2cccc(Cl)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147018",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)NC(=O)CO4)CC2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16345",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(N/C([S-])=[NH+]/Cc2ccccc2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25726",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1CN(C(=O)c2cc(COc3cccc(C(C)=O)c3)[nH]n2)CC[NH2+]1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143025",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC[C@H]1CC[C@H](Cl)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183279",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC([NH3+])(CC)C(=O)Nc1cc([N+](=O)[O-])c(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS[C@H]1CCCC[C@H]1NC(=O)Nc1cnccc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53993",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)(C)c1ccc(/C(=N\\O)N[C@H](O)C(Cl)(Cl)Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140178",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NCc1ccc(C(=O)Nc2cccnc2)cc1)c1cc2sccn2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])/C=C/C(=O)Nc1ccc2[nH]ncc2c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212430",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H]1C[C@@H](C)CN(C(=O)C[NH+]2CCc3n[nH]cc3C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62317",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@H]1CC[C@H](NC(=O)c2ccc(S[C@@H]3CCOC3=O)cc2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213703",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCCN(C)C(=O)c1ccc(-n2ccnn2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178153",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@@H]1C[C@H](NC(=O)Cc2ccccc2O)CC[NH+]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217433",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Cn1cccn1)NCc1ccc(C(=O)N2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87596",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(Oc2ncnc(NC3CCCCCC3)c2[N+](=O)[O-])cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201537",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Fc1ccccc1[C@@H]1CN(Cc2cnn3c2NCCC3)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206569",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(N[C@@H]1CCCSC1)N1CCOC[C@@H]1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68700",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CN(Cc1ccccc1N1CCOCC1)C(=O)c1scnc1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98355",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1cc(C(=O)N(C)[C@H](C)c2ccc([S@@](C)=O)cc2)cc(Cl)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCCS(=O)(=O)N1CCC2(CC1)CC(=O)N(C/C=C/c1ccccc1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22959",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(=O)N2CCC[C@@H](CCc3c(F)cccc3F)C2)cs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97566",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCOc1cc2c(cc1NC(=O)c1cc(C(C)C)no1)O[C@@H](C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136855",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](C)[NH+]1CCN(CC(=O)NCc2ccc(C)c(F)c2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7068",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@]1(c2cccc(NC(=O)CN3C(=O)CCOc4ccccc43)c2)NC(=O)NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29930",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CS[C@@H]1CC[C@@H](NC(=O)CNC(=O)c2cc(-c3ccccc3)on2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168858",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C[NH+](CCCC#N)Cc2ccco2)s1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57778",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCSc1nnc2c(n1)O[C@H](c1c(OC)cc(OC)cc1OC)Nc1ccccc1-2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140382",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1C[C@@H](c2cccc(F)c2)N(CCc2cnn(C)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21917",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(c1cncc(-c2ccsc2)c1)N1CCC2(CC1)OCc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C([O-])CCN1C(=O)/C(=C2/C(=O)N(Cc3ccccc3)c3ccccc32)SC1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49701",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cccc(N2CCN(C(=O)CCS(=O)(=O)c3cc4c5c(c3)CCN5C(=O)CC4)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215241",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule c1ccc(-n2ncc3c(NC4CCCCCC4)ncnc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193061",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)CCN(C)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28016",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1nnnn1C)C(=O)Nc1ccc(N(C)C)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64336",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@H](Cc1ccc(C)cc1)NC(=O)NCC(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109460",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cc(C)c(CSc2ccccc2N)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197461",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule COCC[NH+]1CCC[C@H]1CNS(=O)(=O)c1cc(C)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45592",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@]1(c2ccco2)NC(=O)N(CC(F)(F)F)C1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242478",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(CCC(=O)N1CCOCC1)OCc1ncc(-c2ccc(F)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182344",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC[NH+]1CCCC[C@H]1CNC(=O)N(C)C[C@@H](C)O by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180836",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(=O)[nH]c(SCC(=O)Nc2ncc(Cc3ccc(F)cc3)s2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16992",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@H](Br)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96705",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@@H](C(=O)Nc1ccccc1Cl)n1nc(-c2ccccc2)cc(NC(C)=O)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173768",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CNC(=O)c1cccc(NC(=O)C(=O)N2C[C@H]3CC=CC[C@H]3C2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152797",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CN(Cc1nccn1Cc1ccccc1)C(=O)[C@@H]1C[C@H]1c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(NOCc1ccccc1)C1CCN(S(=O)(=O)c2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102691",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C([O-])[C@H]1[C@H]2CC[C@H](C2)[C@H]1NC/C(Cl)=C/Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49486",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H](NC(=O)[C@H]1CCC[NH+](C)C1)c1nnnn1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94156",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(Cl)c(C(=O)N[C@@H]2CCCc3ccc(F)cc32)c1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(c1cn(Cc2ccccc2)nc1-c1cccnc1)N1CCN(c2ccccc2O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26642",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CC(=O)N2CCN(CC(C)(C)O)CC2)cn1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30790",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc([N+](=O)[O-])c(N2CC[C@H](C(N)=O)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52701",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(Nc1cc(-c2ccco2)ccc1F)c1ccc(Cn2cccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)[C@@H](C)[S@](=O)Cc1ncoc1C(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201898",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(/C=C/CBr)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule F[C@H]1CCCC[C@@H]1Br by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47226",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(CNC(=O)C(=O)Nc2ccccc2OC[C@@H]2CCCCO2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1C[C@@H](c2cccs2)[C@@H](c2ccccc2)C(=O)N1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20159",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C=CCn1c(=O)c2c(nc3n2CCCN3c2ccccc2)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114859",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([O-])[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2c[nH]c3ccccc23)[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)c2ccccc2-c2nc(-c3ccccc3)no2)no1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18332",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46125",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N1C(=O)NC(=O)/C(=C/c2cc([N+](=O)[O-])ccc2N2CC[NH2+]CC2)C1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5802",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cn1ncnc1CCNC(=O)c1ccc(Oc2ccc(F)cc2F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54240",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1CCC[C@@H]([NH+]2CCN(Cc3ccccn3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@H](NC(=O)C(=O)Nc2ccc(Cl)c(C(=O)NC3CC3)c2)[C@@H]1C by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCOc1ncccc1C(=O)Nc1cc(C(C)(C)C)nn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166494",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)(C(=O)OCCNc1cccnn1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98034",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(c1ccccc1O)N1CCN(Cc2ccc(Cl)o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136432",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CNC(=O)c1scc(-c2ccc(F)cc2)c1-n1cccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22518",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1NC(=O)CSc1nc2ccccc2n1CC(=O)N1C[C@@H](C)C[C@H](C)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75359",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cc(C(=O)N(Cc2ccccc2C(F)(F)F)C2CC2)nn1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112187",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)Cc1ccc2c(c1)CCCC2)C(=O)N1CCOCC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84898",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)N[C@H]1CCc2c(O)cccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155472",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCC[NH2+][C@@H](C1CC1)[C@@H]1CCOC2(CCOCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O[C@@H](c1ccccc1)C1(C[NH2+]C2CCN(c3cccc[nH+]3)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(C[C@H](C)CNC(=O)Nc2c[nH]nc2-c2ccccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129138",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(NCCc1cn2ccccc2n1)NCc1ccnc(OC2CCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193410",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=S(=O)(CCCF)/N=C([O-])/C=C/c1ccc(N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103590",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(CN1CCOCC1)N1CCC[C@@H](c2nnc(-c3nccc4ccccc34)o2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191159",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1cccc(CSCc2csc(-c3ccco3)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3730",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(NC[C@](O)(c1ccco1)C1CC1)c1cccc(C(F)(F)F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215468",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[NH+](CCCCN1C(=O)c2ccccc2C1=O)[C@@H]1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215312",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(C1=c2ccccc2=[NH+]C1)[C@@H](S[C@@H]1NN=NN1C1CCCC1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137308",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1ccccc1)[NH+]1CC[C@H](N2CCc3cc(S(N)(=O)=O)ccc32)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143631",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1cc([C@@H]2N[C@H](C(=O)[O-])CS2)ccc1OC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28523",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC1(C)C[C@H]([NH2+]C[C@@H]2CCC[C@@H]2NS(C)(=O)=O)C(C)(C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35732",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)[C@@]1(SCCN1C(=O)C1CCCC1)C(=O)N2Cc1ccccc1Cl by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136882",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@@H](CC(=O)c1ccccc1F)C(=O)N[C@@H]1CC(=O)N(c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231531",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(=O)[C@H]1[C@H](c2cccc(OCc3ccccc3)c2)NC(=O)N[C@]1(O)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63622",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(OC)c(C(=O)/C=C/c2ccccc2OC(=O)N2CCOCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156602",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCCNc1ncc(CN2C[C@@H]3CCC[NH+]3C[C@@H]2C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99480",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nn(CN2C[C@H](C)O[C@@H](C)C2)c(=S)n1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89834",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule N#CCOc1ccc(C(=O)/C=C/c2cnc(-c3ccccc3)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203856",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)[NH+](C)Cc1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62035",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOC(=O)C1(C)CC[NH+]([C@@H](C)c2ccccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169030",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(C[C@@H](c1ccc(Cl)cc1)C1C(=O)NC(=S)NC1=O)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204921",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(C[C@H]1OC(=O)c2ccccc21)NC[C@@H]1CCCN(c2ncccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135856",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(c1cccc(Cn2cccn2)c1)N1CCO[C@H](C(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76696",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1n[nH]c(C(=O)N2CCN(S(C)(=O)=O)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191019",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(OCc1nc(C2CC2)cs1)C1(c2ccccc2)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148581",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(N(C)[C@@H](C)Cc2cccs2)c(N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CSCC[C@H](NC(=O)c1ccccc1Cl)C(=O)Nc1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245602",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc([C@H]2[C@H]3[NH+]=c4ccccc4=C3CCN2C(=O)Cc2cccs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76287",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccc2nnc(N3CCC[C@@H](C(=O)NCc4cccs4)C3)n12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cc2nc(C(=O)Nc3ccc([N+](=O)[O-])c(C)n3)cs2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199577",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](O)CC[NH2+][C@H](c1ccccc1)C(C)C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114026",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)Nc1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17707",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc2n(n1)CCN(Cc1ncccc1C(=O)[O-])C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117933",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cn1cc(C(=O)Nc2cccc(N3CCOC3=O)c2)c(C(C)(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](NS(=O)(=O)CCC1CC1)c1ccccc1O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159840",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccccc1CC(=O)Nc1cc(C)ccc1NC(=O)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20238",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1ccc(C)c(C(=O)NNC(=O)[C@@H]2CCS(=O)(=O)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26347",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CNS(=O)(=O)c1cccc([C@H](C)NC(=O)Nc2ccc(C)c(F)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5459",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ccnc1[C@H](NC(=O)COc1ccc2ccccc2c1)c1ccc(F)cc1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175376",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])COCC(=O)/N=C1\\S[C@@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Cl)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24801",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C1CCC(=O)N1C[C@H](O)Cn1c2ccccc2c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58618",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCc1cc(N2CCOCC2)nc(-c2ccc([N+](=O)[O-])cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195151",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cc(C(=O)Nc2nc(C)cs2)cc([N+](=O)[O-])c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29161",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1nc2sc3c(c2c(=O)[nH]1)CC[C@@H](C)C3)[NH+]1CCC(C(=O)Nc2ccccc2O)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2C[C@@H](C(=O)NCC3CCN(C(=O)c4ccccn4)CC3)CC2=O)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22470",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCN(CC)C(=O)c1ccc(NC(=O)[C@H]2CCC(=O)O2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69355",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC[C@@H]1CCC[C@H](NC(=O)C(=O)Nc2cc(COC)ncn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27333",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1nnc(-c2ccccc2)o1)N[C@H]1CCCC[C@@H]1O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86737",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=c1[nH]c(Cc2ccc(Br)cc2)nc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230736",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C[NH+](C)C(C)(C)CO)c(OC(F)F)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC(=O)[C@@H]1CC[C@H](NC(=O)c2cccc(-c3ccoc3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84802",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCOC(=O)N1CC[N+](=C(N)Nc2nc(C)cc(C)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)CN(CC)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156730",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc2[nH]c(=O)c([C@H](c3nnnn3C3CCCC3)[NH+]3CCN(c4ccccc4F)CC3)cc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166881",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CCNC(=O)Cc1ccc2ccccc2c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167144",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)c1nn(C)cc1C[NH2+]CCCn1cnc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc([C@@H]2CN(C(=O)c3cc(=O)[nH]c([O-])n3)C[C@H]2NC(C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178775",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(NC(=O)c2cccn(CC(=O)Nc3nc4c(s3)C[C@H](C)CC4)c2=O)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127331",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3555",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc(-c2ccc(Cc3nn4c(-c5cccnc5)nnc4s3)cc2)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57117",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)c1nc([C@H](C)[NH2+][C@@H]2CC(=O)N(Cc3ccccc3)[C@H]2C)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42475",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@H]1CCC[C@@H]([C@@H](Cc2ccccc2F)C(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36951",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3650",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccccc1NC(=O)[C@@H]1CC(=O)N(c2ccc3oc(C)nc3c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207015",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C=CCNC(=O)[C@@]1(C#N)O[C@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231341",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(N[C@H]1CCS(=O)(=O)C1)c1ccc(-n2cncn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCc1nc2c(s1)[C@H](NCc1cccc(OCC(F)F)c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10399",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@H]1[C@@H](C)N(C(=O)N[C@@H]2CCc3cc(Cl)ccc32)CCS1(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42042",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(C)c(NC(=O)c2cc(Cl)ccc2F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35630",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nc(CNC(=O)c2ccc(C(C)(C)C)cc2)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116837",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(C)c(NC(=O)c2cc(C3CC3)nc3c2c(C)nn3[C@H]2CCS(=O)(=O)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102979",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@H](NC(=O)CNC(=O)c1cccs1)c1ccc(-c2cncnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78823",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C=CCn1c(=O)c2ccccc2n2c(SCC(=O)N(C)Cc3c(F)cccc3Cl)nnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163564",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(N2C(=O)c3ccc(C(=O)N4CCN(C=O)CC4)cc3C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39469",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule Cc1cc(C)n(-c2ccc(C(=O)OCCN3C(=O)c4ccccc4C3=O)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163524",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH2+][C@@]1(CO)CCC[C@H]1CCO[C@@H]1CCOC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163875",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(NC(=O)CCN2C(=O)/C(=C/c3ccccc3O)SC2=S)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193150",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H](O)C[C@@H]1CCC[NH+]1Cc1ccc([S@](C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142942",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ccccc1-c1ccc(C[NH+]2CCN(C3CC[NH+](C)CC3)[C@@H](CCO)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143488",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H](Oc1ccc(-c2ccccc2)cc1)C(=O)OCc1cnn(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H](O)c1ccc(F)cc1)N[C@H]1CC(=O)N(C2CC2)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224062",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccc(NC(=O)C(=O)NCCSc2ccc(Cl)cc2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225638",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cn1cnc(S(=O)(=O)N[C@@H]2CCc3cc(Cl)ccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214963",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccccc1)N[C@H](Cc1ccccc1)C(=O)N1CCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96189",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC[NH+](C)[C@H](C)C(=O)NC(=O)Nc1ccc(C)cc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75921",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1nn(C)cc1C(=O)N[C@@H](C)c1c(Cl)ccc(F)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8441",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COCCN(C(=O)N1CC[C@H](C(=O)[O-])[C@H]1C)[C@@H](C)COC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217002",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1ncc(C[NH+]2CCC[C@H]2CN2Cc3ccccc3OC[C@@H]2C[NH+](C)C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CCN(Cc2nc(-c3ccc(Cl)cc3)no2)CC1)Nc1cccc(F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21686",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(Nc1cnc(-c2ccccc2)s1)c1ccc(-n2ccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51661",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccc(NC(=O)C(=O)N3CCO[C@H](c4ccccc4F)C3)cc2o1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235965",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CN(CC[C@H]1CCCCO1)C(=O)[C@H]1C=C(Cn2ccc3ccccc32)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7098",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)CCn1ccc(N[C@@H](C)c2cccc(Cl)c2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9343",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1CCC[C@H](NC(=O)NCCC[NH+](C)CC(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23430",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccc(NC(=O)c2cccs2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165520",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CN1C(=O)[C@@]2(c3ccccc31)[C@H]1C[C@@H](C(C)(C)C)CC=C1C(C#N)=C(N)C2(C#N)C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47991",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[NH2+][C@@H](C1CCCCC1)[C@H]1CCOC2(CCSCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224268",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1ccncc1)N1CCC([NH2+][C@H](C)c2ccc3[nH]c(=O)[nH]c3c2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224783",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(C[C@H]2S/C(=N/N=C/c3ccc(OC(C)C)cc3)NC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94579",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[NH2+]C[C@H]1C[C@H]1c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9126",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+](CC)[C@@H](C)CNC(=O)c1cccc(OC)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17749",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(C[S@](=O)Cc1ccccc1)N1CCc2sccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66824",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Cc1n[nH]c(=O)c2ccccc12)NCc1cn(-c2ccccc2)nc1-c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3119",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCc1cc2c(CN3CCC[C@@H]3c3ccc(OC)cc3)cc(=O)oc2cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule NC(=S)Cc1ccc(S(=O)(=O)NCc2cscn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCC[NH2+]C1CC(C(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N1CC[C@H](NC(=O)N(C)Cc2nc(C(F)(F)F)cs2)C1=O by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153194",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ccc(-c2nc(NC(=O)c3nccn4ccnc34)sc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247584",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cn1ccs/c1=N\\C(=O)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cn1ncnc1/N=C(\\[O-])N1CCCC[C@@H]1c1nc(-c2ccccc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[C@H]2C[C@](C)(CN2c2cncc(/C(N)=[NH+]\\NC(=S)N3CCCC3)n2)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85910",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H](NC(=O)[C@H]1CCO[C@@H]1C)c1ccc(OC(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@H](NC(=O)C(=O)Nc2cccc(C(=O)N3CCCC3)c2)[C@@H]1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207898",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(-c2nc(C#N)c(NC[C@H](c3ccccc3)[NH+](C)C)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127230",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccc(F)c(F)c1)N1CCS(=O)(=O)CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201567",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH2+][C@@]1(CO)CCC[C@@H]([NH+](CC(C)C)C(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCOc1ccc(CN2CCO[C@H](c3nc(C)cs3)C2)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104150",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OCC(=O)Nc2sccc2C(=O)[O-])ccc1Cl by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166344",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C=CCn1c(=O)oc2ccc(C(=O)N3CCN(c4cccc[nH+]4)CC3)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190968",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[C@@H]([NH2+][C@@H]1CCCCC1(C)C)c1ccc2c(c1)CCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159167",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(CCC1CCCC1)Nc1c(C(=O)Nc2ccc([N+](=O)[O-])cc2)oc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162349",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[NH+]1CCN([C@@H]2CC[NH+](Cc3ccco3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49283",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)[NH2+][C@H](C)c1nccs1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(/C=C/c1c(Cl)nc2sccn12)NCCc1cc(F)cc2c1OCOC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231307",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCC#N)C(=O)Cn1nnc(-c2ccsc2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57390",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COCc1cc(C)nc(SCC(=O)c2ccc(Cl)cc2Cl)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176054",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc2c(c1)[C@](O)([C@@H]1CC[C@H](C)[C@@H](C)C1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203783",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(CC(=O)N2CCCCC2)cc1)c1ccc(N2CCCOC2=O)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112769",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)N(C)[C@H](C)c1cccnc1)n1c([S-])nnc1-c1cccs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38565",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccccc1CN1CCN2C(=O)[C@H](CC(C)C)NC(=O)[C@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159834",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nnc(N2CCCC2)s1)NC[C@@H]1CCCO1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242564",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@@H](C[NH+](C)C)NC(=O)C(=O)Nc1ccc2[nH]ncc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76447",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(C1=NC=C(c2csc(NC[C@H]3CCCO3)n2)C1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[NH+](C)C[C@@H]1CCN(C(=O)Nc2ccc3c(c2)CCO3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188860",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC[NH2+][C@H]1[C@@H](C[NH+]2CC[C@H](COC)C2)CCC1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25007",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule COc1ccc(Cl)cc1C(=O)Nc1ccc(N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69722",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COCCOc1ccccc1C=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169047",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COC(=O)c1ccsc1NC(=O)[C@@H](C)c1ccsc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NC[C@@H](CCO)c1ccccc1)[C@@H]1C[C@@]12CCCc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212377",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCn1c(SCC(=O)Nc2cccc(Cl)c2)nnc1-c1cn(C)nc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192674",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCN([C@@H](C)c1ccc(F)cc1)S(=O)(=O)c1cn(C)c(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170632",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(S(C)(=O)=O)c(C)c(S(=O)(=O)N2CCO[C@H](C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N(CCC#N)C(=O)CSC2=N[C@H](C)CS2)cc1C by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28993",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H]1CSCCN1C(=O)Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44317",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCc1ncc2c(n1)C[NH+](CCCS(=O)(=O)c1ccccc1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40213",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C)n(CCNC(=O)CCSc2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236198",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc([C@@H]2C[C@H](C)[NH+](Cc3cnc(-c4cccnc4)s3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77475",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C(=O)N(C)Cc1nc(-c2ccncc2)no1)n1cccn1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106928",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)c1cnc(CN2C[C@@H](c3ccc(F)cc3)C[C@H]2C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104221",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH+](CCNC(=O)C(=O)Nc1cccc(F)c1C)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182498",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CSC[C@@H](C)NC(=O)Nc1ccc(C)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77363",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC1(C)C(=O)[C@]2(C(=O)N3CCN(C(=O)[C@@]45CC[C@@H](C4)C(C)(C)C5=O)CC3)CC[C@H]1C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28576",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H](Nc1ccc(C(N)=O)nn1)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151383",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(NC(=O)CCN2CCN(C(=O)[C@H]3COc4ccccc4O3)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152842",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(NCC[NH+]1CCCC1)c1cccc([C@@H]2CCCN(C(=O)Nc3ccc(Cl)cc3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99152",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Nc1cccc(NC(=O)c2cccnc2Cl)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(C)c(/C([O-])=N/S(=O)(=O)CCCF)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51242",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH2+][C@](C)(C[NH+]1CCC(C)(C)C1)C(=O)[O-] by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148202",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H](C)NC(=O)CNc2ccc(F)c(C(=O)N(C)C)c2)cc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237422",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(C)N1C(N)=[NH+]C[C@]1(C)c1ccccc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67017",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule C[NH2+][C@H]1CC(C)(C)c2c(C)cc(Cl)c(C)c21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CSc1ccc(NC(=O)[C@H](C)[NH+]2CCC(N3CCO[C@H](C)C3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144844",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(N2CCC[C@H](C(=O)Nc3ccc(Cn4cncn4)cc3)C2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193285",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(CCSc1ccc2c(c1)OCCCO2)NCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86273",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)n1ncc(C(=O)N2CCC(c3nc(C)no3)CC2)c1C1CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ccc(-c2[nH+]c([C@H]3CC(=O)N(CC(C)C)C3)[nH]c2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18677",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC1CCN(S(=O)(=O)c2ccc(N3C[C@@H](C(=O)Nc4ccc(F)cc4)CC3=O)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137439",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](NCc1cnc(C(C)(C)C)s1)c1nc(C(F)(F)F)cs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152864",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NC(=O)NC(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28060",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCC[C@@H](NC(=O)[C@@H]1CCN(C(C)=O)C1)C(=O)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83271",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule Cc1ccc(N2C[C@@H](C(=O)N3CCC(c4nc(-c5ccc(F)cc5)no4)CC3)CC2=O)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228024",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc2[nH]c(CSCC(=O)Nc3ccc(F)cc3)cc(=O)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125918",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H](C)NC(=O)c1cccc(-c2ccc(N3CCOCC3)[nH+]c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CC[NH+]1CC=C(c2ccc(O)cc2)CC1)Nc1cc(Cl)ccc1Cl by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24104",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)C(=O)Nc2ccc(-n3nccn3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7271",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](C)c1cc(F)ccc1Sc1cccc(F)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163306",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H](Cc1nc2ccccc2s1)NCc1ncn(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10109",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=[N+]([O-])c1ccc(N2CCOCC2)c(/C=N/n2cnnc2SCc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(C)cnc(C[C@]2(C[NH3+])CCC(C)(C)[C@H]2O)c1C by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232330",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCn1nc(C)c(C[NH+]2C[C@H]3[C@@H](C2)OC(=O)N3CCc2ccccn2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218425",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccccc1[C@@H]([NH2+]CC(C)(C)NS(C)(=O)=O)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179762",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1nnc(C[NH+]2CCC3(CC2)CC(=O)N(Cc2c(C)noc2C)C3)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236791",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cccc(-c2cc(C[NH2+][C@@H]3CCOC4(CCOCC4)C3)on2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59259",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1(C)CCN(C(=O)c2[nH]nc(C3CC3)c2Cl)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111143",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1nn(CCCC(=O)NCc2ccccc2)c(=O)c2cc3occc3n12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145008",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cc(C=O)cc(Cl)c1O[C@@H](C)[C@H](C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196774",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC1(C)CCSC[C@@]1(O)c1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148621",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H](NC(=O)C[C@H]1CCc2ccccc21)c1noc(Cc2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226696",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C(=O)N[C@H]1CCS(=O)(=O)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127667",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(SCc2n[nH]c3c2[C@H](c2cccs2)C(C#N)=C(N)O3)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43596",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](NC[C@H]1CCCc2ccccc21)c1ccc(S(N)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135761",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cccc(-c2cc(C(=O)N3CCC[C@@H]3c3cc(C(C)C)no3)on2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89406",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)c1ccccc1NC(=O)[C@@H]1CCCS1)C1CCCCC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41590",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc(C)c(C)c(C(=O)NCC[NH+]3CCC(CO)CC3)c2c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8533",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1OC(=O)COc1ccc(Cl)cc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130654",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)c1ncc(CN2CCO[C@@H]3CCCC[C@@H]32)s1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC)[C@H](CNC(=O)Nc1cccnc1)c1ccsc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58280",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)Nc1cccc(N2CCCCCC2)c1)C(=O)NC(C)(C)C by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165516",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C1C[C@@H](c2ccccc2F)c2c(n[nH]c2-c2ccccc2)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)O[C@@]1(CCC(=O)N([C@@H](C)C(=O)[O-])CC1)CC2=O by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196938",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](OC(=O)Cc1csc(N2CCNC2=O)n1)c1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(COc1ccc(Oc2ccccc2)cc1)NNC(=O)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(C)c(NC(=O)CCNc2nccc(N3CCC(O)CC3)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164405",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(-c2ccc(C(=O)Nc3cccn(C)c3=O)cc2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62376",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CNC(=S)n1nnc2cc(Cl)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(NC(=O)c2ccc([N+](=O)[O-])o2)CCS(=O)(=O)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240489",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)c1ccc(NC(=O)C(=O)NC[C@]2(O)CCc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CNC(=O)N1CCC(NS(C)(=O)=O)CC1)[NH+]1CCC[C@@H](C)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230298",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1cccc(C[NH+](Cc2c[nH]nc2-c2cccnc2)CC2CC2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5865",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOC(=O)N1CCC(Nc2nc(-c3c[nH]c4ccccc34)cs2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114002",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C(#CCN1CCCC1)C=C(c1ccccc1)c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36835",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nn(C)cc1[C@@H](C)NC(=O)NCC1(C)Cc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@@H]1CCC[C@H](NS(=O)(=O)c2c[nH]c3ncccc23)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25031",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(/C=C/c1ccc2c(c1)OCO2)NCC#CCOc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143991",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CSC[C@H]1CCN(S(=O)(=O)c2c(C)sc3ccccc23)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237197",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1C[C@H]1NC(=O)c1ccnc(F)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205773",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1CC[NH+](C[C@@H](O)c2ccccc2)CC1)C(=O)C[C@H]1C=CCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159401",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1n[nH]c(C)c1C[C@@H](C)C(=O)N(Cc1ccccc1)[C@H](C)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95176",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCn1cc(CC(=O)N[C@H](CO)c2ccco2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125112",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3560",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CN(Cc1cc(Br)ccc1F)C(=O)C[C@@H](O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232546",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc2ncc(C(=O)N[C@H]3CCO[C@@]4(CCSC4)C3)n2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158200",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C[C@@H](C)CC(=O)N1CCC[C@@H](n2cncn2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51132",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ccc(COc2ccccc2OC)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84263",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2c(cnn2C(C)C)cc1C(=O)OCc1cccnc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151570",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cc(-c2ccc(C)c(C)c2)n(-c2ccc(C(=O)N3CCCCC3)cc2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107063",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule N#Cc1ccc(C(=O)N[C@@H](CO)c2ccccc2F)[n-]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc([C@@H]2[C@H](C(=O)NC[C@](C)(O)C(C)C)CCC(=O)N2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156744",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)NC(=O)CN(C)S(=O)(=O)c1ccc2ccccc2c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C=C(C)Cn1ccc(-c2ccsc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2539",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1nccn1-c1ccc([C@@H](C)NC(=O)C2CCN(S(C)(=O)=O)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Nc1ccc(S(=O)(=O)NC2CCC(C)CC2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53284",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nc(C[NH+]2CCN(Cc3cc(C)n(-c4nccs4)c3C)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196152",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C)C(=O)[C@H]1CSCN1C(=O)c1ccc(F)c(F)c1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78154",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c(N2CCN(C(=O)[C@H]3CCCO3)CC2)c1[N+](=O)[O-] by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44954",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(C)c(NC(=O)C(=O)NCC2CCN(c3ncccn3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68426",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule C#CCC[C@H](O)[C@](C)(CC)[NH+]1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221567",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(NC(=O)C[NH+](C)C[C@@H]2CCCO2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc(NC(=O)NC(=O)COc2ccc3c4c(c(=O)oc3c2)CCC4)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202541",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N2C[C@H](C)C[C@@H](C)C2)cc1NC(=O)c1cccnc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194537",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[NH+](CC(=O)N[C@@](C)(C#N)C1CC1)Cc1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210600",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)C1=C(NC(=O)NC(=O)c2ccccc2)c2ccccc2CC12CCCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156434",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1csc(-c2ccccc2Cl)n1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1ccccc1)[NH2+][C@H]1CCOC2(CCCCC2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59392",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(-n2c(C)cc(/C=N\\NC(=O)CN3CCOCC3)c2C)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38855",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H]1CC(=O)CC[C@@H]1C(=O)N[C@@H](c1cccc(C(F)(F)F)c1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155342",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cn(CC(=O)Nc2cccc(-c3ccc(=O)[nH]n3)c2)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214672",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CSc1ccc(/C=N/NC(=O)CCCc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53930",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COC(=O)c1ccc(CN(C)C(=O)C[NH+]2CCS[C@H](C(C)C)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)CC(=O)N[C@@H]1CC[NH2+]C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95800",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule c1ccc(OCc2nc(CNc3cnn(-c4ncccn4)c3)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20299",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Sc1nnc2ccc(-c3cccnc3)nn12 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199158",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCCC(=O)c1cc(C)c(C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150784",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@]1(C(=O)c2ccc3ccccc3c2)CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[NH2+][C@H](C)c1cccc(OCC[NH+](C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21115",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2c(c1)COC2)[C@@H]1CSc2ccccc21 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21909",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccccc1[C@]1(CC(=O)N2C[C@@]3(C)C[C@@H]2CC(C)(C)C3)CC(=O)N(C2CCCC2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191881",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)c2cc3c(cc2NC(=O)COc2ccc(F)cc2)n(C)c(=O)n3C)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79710",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCOc1c(CN2C[C@H]3CCC[NH+]3C[C@@H]2C)c(C)nn1CC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198852",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cn1cc([C@H](O)CNC(=O)Nc2ccc([N+](=O)[O-])cc2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137925",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1nc(N2CCN(C(=O)C3CCC3)CC2)ncc1Br by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38216",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@H](CC(=O)NNC(=O)[C@@H]1CCS(=O)(=O)C1)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54475",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ccc([C@H]2Oc3ccccc3C3=Nc4ncnn4[C@@H](c4ccccc4F)[C@H]32)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@H](C(=O)N1CC[C@@H](O)C1)c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182054",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1ccc2ccc(OC3CC[NH2+]CC3)cc2o1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134161",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Fc1nc(F)c(F)c(NCc2nncn2C2CC2)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108855",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH2+][C@@H](C[C@@H]1CCCO1)[C@@H]1CCC[C@H](S(C)(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20774",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c(Br)c(Br)c1[O-] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107746",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCC[NH+]1[C@@H]1CCc2ccc(OC)cc2[C@@H]1O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143463",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(Cl)ccc1Cl)[C@H]1Cc2ccccc2O/C1=N\\O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204637",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O[C@H]1C[C@@H](c2cc(F)ccc2F)N(Cc2cnc(C3CC3)s2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86448",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](CNCc1c(F)cccc1Cl)[NH+]1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56626",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1cc([C@@H]2C(C#N)=C(N)Oc3c2oc(CO)cc3=O)c(OC)c2c1OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217310",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule N#CCc1noc2cc([N+](=O)[O-])ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206981",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)/C(=N\\Nc2ccc(Cl)cc2Cl)c2ccccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164481",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)c1ccc(NC(=O)CCNC(=O)N(C)Cc2ccccc2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52483",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@@H]2CC(=O)NC2CCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236245",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCN(CC)C(=O)CCC(=O)Nc1cccc(-n2nc(C)cc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cc(=O)[nH]c(-c2ccc(N[C@@H]3CCN(C(=O)OC)C3)nc2)n1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29994",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1ccc(N2CCCCC2)cc1)c1csc(-c2ncccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105866",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cccc(NC(=O)CSC2=C(C#N)[C@@H](c3ccco3)C3=C([O-])CCCC3=N2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34851",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC[C@@H](C)[NH+]1CCN1CCN(Cc2cc(O)ccc2[N+](=O)[O-])CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27406",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@]1(c2cc(F)ccc2F)NC(=O)N(CC(=O)C2=NC=CC2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116508",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSc1cncc(N(C)C[C@H](C)O)n1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)Cn2cc(I)c(=O)c(I)c2)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215409",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)c2ccc(CNC(=O)[C@@H](C)[NH+]3CCCCCC3)cc2)C[C@H](C)O1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58897",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc2c(cc1NC(=O)c1cnn(C(C)C)c1C)O[C@H](C)C2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171888",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccccc1-n1nc(C(C)C)nc1CCc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)([NH3+])C(=O)Nc1cc(Cl)cc(Br)c1OC by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87190",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(N2CCCCC2)cc(=O)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18645",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1nn(-c2ccccc2)cc1CN1CCN([C@@H](C)C(=O)N2CCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249196",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(C)c1nc(N)nc(COC(=O)c2cc3ccccc3c(=O)[nH]2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180882",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccccc1O)C(=O)CSCc1cccnc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70100",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)Nn2cnnc2)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117240",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nsc(N(C)C(=O)[C@@H]2CC(=O)N(C)C2)c1C(=O)[O-] by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99325",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCNC(=O)c1cc(=O)n(CC(=O)Nc2ccc(C)c(C)c2)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189041",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cccc(CC(=O)Nc2cc(C(C)C)n[nH]2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214489",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(C[C@H]1CCC[NH+]1C)C(=O)N1CCCCC[C@@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15850",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cn1c(-n2ncc(N(CCO)Cc3ccccc3)c(Cl)c2=O)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94414",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])C[C@@H]1CN(C[C@H]2CCOC2)CCO1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199348",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(/C=C/c1c(Cl)cccc1Cl)N1CCC[C@H](c2[nH]cc[nH+]2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Nc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)NC(=O)NC1CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COC(=O)[C@@]1(F)CCN(C(=O)Cc2cccc(O)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215970",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COCCn1cc(Nc2nn3c(C(F)(F)F)nnc3c(C)c2C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70103",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1cccs1)CN1C(=O)N[C@](CC)(c2ccccc2)C1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209697",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1sc(NC(=O)C2CC2)c(C(=O)N2CC[C@H](Nc3ccccc3)C2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164378",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1[C@H]1CN(C(=O)NCc2cccc(OCC(F)F)n2)CCO1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20446",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc(C[NH2+][C@@H](C)CO)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131820",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H](C)CN(S(=O)(=O)N(CCC#N)Cc2ccccn2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65907",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(NC(=O)CC[NH+]2CCN(c3nccs3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)[C@@H]1CC[C@@H](CNc2ccc(C#N)cc2C(F)(F)F)O1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230428",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C([O-])CNS(=O)(=O)c1ccc2[nH]c(=O)cnc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102956",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule [NH3+][C@H](c1ccc(Cl)cn1)[C@H]1CCc2cccnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5528",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[NH2+]CC[C@H]1NC(=O)c1c(F)cccc1F by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23547",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1csc([C@H](C)NC(=O)N[C@H](C)c2oc3ccc(F)cc3c2C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Oc1cc(Br)c(O)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94436",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nnnn1/C(=C\\c1ccccc1)C(=O)N[C@H]1CC[NH+]2CCCC[C@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(C)C(=O)CCN1C(=O)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)(C)C1CCC(C#N)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156452",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c2ccccc2nc(SCc2cccnc2)n1C1CCCCC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11769",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(N[C@@H]1CC[NH2+]C2(CCC2)C1)[C@@H]1CSc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C([O-])[C@@]1([C@@H]2CCO[C@@]3(CCOC3)C2)CCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136441",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Nc1ccccc1OCC(=O)c1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9007",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[NH+](C)Cc1ccc(C(=O)N2CCC[C@@H]3CCCC[C@@H]32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174240",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cc(NC(=O)[C@H](C)SCC(=O)Nc2ccccc2-c2nc3ccccc3s2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243248",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(OC(F)(F)F)cc3)cc2)C[C@@H](C)O1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43130",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4107",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N(C)Cc2[nH+]ccn2C)cc1[N+](=O)[O-] by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118030",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)N[C@H](C)c1ccc2c(c1)OCCO2)c1nc(C(C)(C)C)no1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59852",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCONC(=O)C1CCCCC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120603",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](/N=C1\\C(=O)C(=O)[C@H]1N1CCCC1)C(=O)[O-] by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129748",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC1CCC(N(C)C(=O)CCCn2cncn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28578",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)C2CC2)cc1-n1cnnn1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36328",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1[N+](=O)[O-])c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132072",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1ccc(C#N)cc1)C(=O)Nc1ccccc1-c1ncc[nH]1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27073",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1cccc(C(=O)N[C@@H](c2ccco2)c2c(O)ccc3ccccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42410",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCc1ccc(C(=O)Nc2cc(-c3nn4cnnc4s3)ccc2OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16416",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCCO[C@@H]1CCCC(C)(C)[C@H]1[NH2+]C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97496",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CNC(=O)c1cccc(C[NH+](C)C)c1)Oc1ccc(Cl)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78874",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc([C@@H](C)C(=O)NN2C(=O)N[C@](C)(c3ccccc3)C2=O)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100527",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)([C@H](O)c1ccccc1Cl)[NH+]1CCCCC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58453",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1cccc([C@@H](CC(F)(F)F)C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11344",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCCNC(=O)N[C@H](C)c1nc(C)cs1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149139",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCc2c(cccc2NC(=O)N2CCN(CCOC)C(=O)C2)C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34781",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@H]1C[C@H](c2ccc(F)cc2)C[NH+]1Cc1cnc(N(C)C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29364",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC1(CC)[C@@H](NC(=O)N2CCO[C@H](c3nccs3)C2)[C@H](C)[C@@H]1OC by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78129",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)N(C)CCOc1ccc(Cl)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85450",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](NC(=O)c1ccccc1[N+](=O)[O-])c1ccc(NC(=O)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28447",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1nccc1C(=O)Nc1nnc(-c2cc(Cl)sc2Cl)o1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142896",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule NS(=O)(=O)c1ccc(C(=O)NCc2ccc(N3CCCC3)[nH+]c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64658",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H](O)C1CCCC1)N[C@H]1CC=CCC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233036",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1cccc(F)c1C(=O)N1CCO[C@H](C#N)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45195",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(Cc1ccccc1)C(=O)c1ccccc1NC(=O)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214175",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule N#Cc1ccc(Oc2cccc(NC(=O)[C@@H]3COc4ccccc43)c2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39207",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)n1ncnc1C[C@@H](C[NH3+])c1ccccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N)c(S(=O)(=O)NC[C@@H]2CN(C)CCO2)cc1C by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26563",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C(c1[nH]nc(C2CC2)c1Cl)N1CC[C@@H]1c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39380",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCNC(=O)NC(=O)C[NH+](CC1CC[NH2+]CC1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)CC[C@](C)(O)CNC(=O)Cn1c(=O)[nH]c2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199371",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H]1CCCC[C@@]1(NC(=O)N[C@@H]1CCOC1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69691",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(NC(=O)c2ccc(NC(=O)c3ccco3)cc2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196998",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(Cc1c(F)cccc1Cl)C(=O)c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197237",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(C(C)C)c(O[C@H](C)C(=O)Nc2nnc(CC(C)C)s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153225",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[NH+](CC(=O)Nc1c(Cl)cc(N)cc1Cl)CC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35035",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCS(=O)(=O)[N-]c1ccc(C(=O)/C=C/c2ccc(C)c(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245517",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule COc1c(C)cccc1C[NH+]1CCCC[C@H]1c1ncc2c(n1)CCN(C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203728",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H](CNC(=O)NCc1ccncc1)[NH+](C)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20166",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cn(-c2ccccc2)nc1-c1cccs1)C(=O)Cc1cccs1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25268",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cc(Cl)c(NC(=O)c2cccc(OC)c2)cc1OC by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26243",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(Nc1nnc(C(F)(F)F)s1)c1ccc2[nH]cnc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45529",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCC1CCC(NC(=O)C(=O)Nc2cnc3c(c2)c(C)nn3C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51071",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=S(=O)(NCCNc1cc(-n2cccc2)ncn1)c1ccc2cccc3c2c1CC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96744",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nn(C)c(C)c1CC(=O)N(C)c1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173104",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1cc(C[NH+]2CC[C@@H](Oc3cccnc3)C2)cc2c1OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18617",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(=O)Nc1ccc(C(C)=O)cc1OCC(=O)Nc1ccc2c(c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146373",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@H]1C[C@]2(C(=O)N(C)c3ccc(F)cc32)[NH+]2CCC[C@H]12 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229098",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N2CCC[C@H](C(F)(F)F)C2)s1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240002",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ncc([C@@H](C)N[C@H]2CCCN(S(C)(=O)=O)C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77701",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(C)c1cc(C(=O)Nc2sc3c(c2C#N)CCCC3)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44409",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc2cccc(NC(=O)C(=O)N[C@@H](C)C[NH+]3CCC[C@H](C)C3)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13442",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H](C)NC(=O)C[C@@H]2C=CCC2)cc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199247",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nccn1-c1ncccc1NC(=O)[C@@H]1COc2ccccc2C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148972",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ncccc1CNC(=O)N[C@@H](c1ccccc1)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82719",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H]1CN(C(=O)c2cc(Cl)cn2C)CC[C@H]1[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100671",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(-c2ncc(-c3c(-c4ccccc4)ncn3CCC(N)=O)cn2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188346",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(c1cc(-c2ccco2)on1)N1CCC(Oc2cccnc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59827",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](NC(=O)NCc1cccnc1)c1cccc(OC(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30809",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc(F)cc(-c2ccc(C(=O)[O-])cc2C)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44248",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ncc(CNc2ccc(-c3nc(C4CC4)n[nH]3)cc2)s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109950",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(CN(C)c1c[nH]c(=O)[nH]c1=O)OC by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC/[NH+]=C(/NCC#Cc1ccccc1)NC[C@@H](C)C#N by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27604",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(F)cc(/C([O-])=N/S(=O)(=O)c2ccccc2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202189",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](O)C2(C#N)CCCCCC2)cc1Br by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29257",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COC[C@H](C)[C@@](C)(O)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174890",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CN(C)C(=O)c1nnc(C(=O)[O-])s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239777",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNS(=O)(=O)c1ccc2c(c1)[C@H]1C=CC[C@@H]1[C@H](c1ccc(SC)cc1)N2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23163",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H]([NH3+])C[C@H](C)[C@@H]1CCc2cccnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150029",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(CCCSc1ncnc2sccc12)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112599",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](c1ccncc1)N(C)S(=O)(=O)c1ccc(C#N)cc1C by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221366",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[NH+](C)CCN(Cc1ccco1)C(=O)c1cc(-c2cccs2)[nH]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205404",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130741",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCO[C@H](C(=O)N[C@@H](c2ccccc2)c2ccc3nc[nH]c3c2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30061",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(N2C(=O)N=C([O-])/C(=C\\c3ccccc3C)C2=O)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73990",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1ccc(C(=O)Nc2cc(F)ccc2F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168911",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(C[NH2+]Cc2cnn(C)c2C)cc1C[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134013",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(OCC(=O)Nc2nc3c(s2)COCC3)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214375",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)c1cccc(C(C)C)c1NC(=O)N1CCO[C@@H](c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=S(=O)(c1ccccc1Br)N1CCN(c2nc3ccccc3s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40727",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCNC(=O)c1ccccc1NC(=O)C1=NO[C@H](c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110023",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule N#Cc1ccc(N2CCN(C(=O)c3ccc4c(c3)OCCCO4)CC2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22143",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc(C)nc2cc(F)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C#CCOc1cc(F)ccc1NC(=O)Nc1cc(CCC)nn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103448",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1CC[NH+](Cc2ccccc2)CC1)C(=O)[C@@H]1CC12CCC2 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247381",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1noc([C@@H](C)[NH+]2CCN(c3cccc(F)c3C#N)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105879",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CNC(=O)COc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191990",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(F)cc1)n1nnc2ccccc21 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151713",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNC(=O)c1cc(=O)[nH]c2c(C)cccc12 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185484",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1c([C@@H]2CC(=O)N(c3ccc4c(c3)OCO4)C2)nc2ccccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194844",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](NC(=O)CN1C(=O)[C@H]2CC=CC[C@@H]2C1=O)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86347",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc([C@@H](NC(=O)N2CCOC[C@H]2C2CC2)C2CC2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2335",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)c1cc(NC(=O)[C@H]2COc3ccc(Br)cc32)[nH]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51921",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)c1ccc(NC(=O)[C@@H]2Nc3ccccc3S(=O)(=O)N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50104",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COCCN1C(=O)C([O-])=C(C(=O)c2c(C)nn(C)c2C)[C@@H]1c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66966",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOc1ccccc1CNC(=O)N(C1CC1)[C@@H](C)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24235",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCN1C(=O)C(C)(C)COc2cc(NC(=O)c3cccn(C)c3=O)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148691",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1Cc2ccccc2N1C(=O)CSc1ccc(Cl)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180962",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=S(=O)(c1ccc(F)cc1F)N1CC[C@@H](Nc2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38246",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1CCCC[NH+]1CCC[NH2+]Cc1ccc(CO)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39949",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCCOc1ccc(C(=O)N(Cc2ccc(F)cc2)c2ccccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38401",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(COc1ccc(I)cc1)NCCc1c[nH]c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42508",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1cccc(Cl)c1)c1nnc([C@H]2CCCN(C(=O)c3cccc(F)c3)C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176153",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c2nc(NC(=O)Cc3c(C)nc4nc(N)nn4c3C)sc2c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138329",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccc[n+]1Cc1ccccc1)c1cnc2ccc(F)cc2c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130419",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C#Cc1cccc(N(C)C(=O)C=C2CCSCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152772",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](CCc1cccn1C)NC(=O)COc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116813",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(N/N=C\\c1ccc(Sc2ccccc2)o1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172114",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@H](C(=O)N1CCCCCC1)N1CC[NH+](C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45957",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@@H](C)[C@@H](O)CSc1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21640",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN(C(=O)c1cc(-c2ccccc2)[nH]n1)C1(C#N)CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91073",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)[C@H]1CS(=O)(=O)CC[C@H](C)[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214759",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc([C@@H]2C[S@](=O)C[C@H](C)N2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209785",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(Oc2ccc(S(C)(=O)=O)cc2N)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@H]1Oc2ccc(S(=O)(=O)N3CCN(C(=O)c4ccc(C)c(F)c4)CC3)cc2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52650",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@@H](NC(=O)c1ccc2c(c1)CCN2S(C)(=O)=O)c1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227933",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCc1nc(-c2ccc(-n3cc(C(=O)Nc4ccc(Br)cc4F)c(C)n3)cc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183490",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([O-])C[NH+](C1CCCC1)[C@@H]1CCOC2(CCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109584",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nnc(CN(C)C(=O)N[C@@H](C)C(C)C)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114233",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCN1CCN(C(=O)CN2CCCC2=O)C[C@H](Cc2cccc(-c3ccccc3C)c2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(Cc2nc(CCc3ccccc3)no2)[C@H](C)CO1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46176",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1911",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOc1ccc(O[C@@H](C)C(=O)NNC(=O)c2[nH]c3ccccc3c2Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OCC(C)(C)C(=O)[O-])cc(C(C)C)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(=O)c1ccc(OC(=O)Cc2csc(NC(=O)c3ccco3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76769",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1ncc(CN(C)[C@@H](C)Cc2cccs2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138350",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)CCSc1nnc2c(S(=O)(=O)N3CCOCC3)cccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C1CC[C@H](C(=O)NNC(=O)COc2ccccc2-c2ccccc2)CN1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217615",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(NCc2ccc(C3=NN=CC3)cc2)c(C#N)c(=O)n(C)c1=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147712",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCCCN(C)C(=O)[C@@H]1CC(=O)N(c2cccc3ccccc23)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76327",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1CCO[C@H](c2cccc(F)c2)C1)NCc1cccc(Cl)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168192",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CN(C(=O)c2oc3ccc(C)cc3c2C)[C@H]2CCS(=O)(=O)C2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84608",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C([O-])c1cccnc1C(=O)Nc1ccc(Cl)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90299",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule FC(F)(F)c1nc2ccccc2n1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159712",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]Cc1n[nH]c(=O)n1-c1ccc(C)cc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146122",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC1(C)[C@@H](NC(=O)N[C@@H]2CC(=O)N(C(C)(C)C)C2)[C@@H]2CCO[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36857",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CNC(=O)Cc1ccccc1NC(=O)NCc1ccccc1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130531",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1csc(C(=O)NCc2nc(-c3cccs3)no2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178338",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1c(O[C@@H](C)C(=O)NCCc2c[nH]c3ccccc23)ccc2c3c(c(=O)oc12)CCC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242560",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(N2C[C@H](c3nc(-c4oc5ccc(OC)cc5c4C)no3)CC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CC[NH+](CC[NH2+]CCc2ccsc2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nonc1COc1ccccc1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199375",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1ccc(C[NH+]2CCCCC2)cc1)Nc1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCOC(=O)C1CCN(C(=O)C2CCN(c3ncnc4sc(C)c(C)c34)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236169",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CN(CCOCC1CC1)c1nc2ccc(N)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152431",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(Oc2cc(N[C@@H](C)C(=O)N3CCCC3)ccc2OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161863",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cccc(C)c1CCNC(=O)c1cnc([C@H]2CCCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOc1ccc(/C=C2/C(=O)N(CCc3ccc(OC)cc3)C(=O)C(C#N)=C2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111138",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COC(=O)c1ccc(-c2ccc(/C=C3/C(=O)N=C(N)N3C)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61169",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)C(=O)Nc1ccc(C(=O)N2CCC[C@H](C(=O)NC3CCCCCC3)C2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101998",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC1=C(C(=O)OC(C)C)[C@@H](c2cccc([N+](=O)[O-])c2)NC(=O)N1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156062",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule NC(=O)c1ccc(OCC(=O)NC[C@@H](O)c2cccc(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104854",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H]1[NH+]=N/C(=N\\C(=O)c2ccco2)S1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37166",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(NCc2c[nH]nc2-c2ccccc2)sc1-c1ccn(C[C@@H]2COc3ccccc3O2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132238",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCN(CC)c1ccc(CNC(=O)[C@H](C)N2C(=O)c3ccc(C)cc3C2=O)c[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172445",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCCCCCSc1nnc(-c2ccccc2N)c([O-])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186411",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1C(=O)S/C(=C\\c2ccccc2)C1=O)N1CCN(CCO)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51102",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCn1c(CCCCO)nc2cc(C#N)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149656",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COCc1nc(C)cc(N2CCC[C@@H](CNC(=O)OC(C)(C)C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76579",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS/C(=N\\S(=O)(=O)c1ccc(C)cc1)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237828",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc2nc(N3CCO[C@@H](c4cccc(O)c4)C3)ccc2c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131319",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule NC(=O)C1(NC(=O)c2nc(C3CC3)n3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237443",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H](Sc1nnc(C2CC2)n1C1CC1)C(=O)Nc1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22568",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1ccc2c(c1)OCO2)N1CCC(Oc2nc3c(F)cccc3s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231132",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H](OC(=O)c1ccc(-n2cnnn2)cc1)C(=O)Nc1nc(-c2ccccc2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCc1ccccc1NC(=O)CN1CCN(C(=O)NCc2ccc(N3CCCCCC3)[nH+]c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cn1cnnc1[C@H]1CCCN1C(=O)c1c(O)cc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167421",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[NH+](Cc1ccccc1F)CC1(CS)CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99525",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(C2=C(O)c3cccc4cccc(c34)C2=O)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187952",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1nc(C(=O)Nc2cccc3ncccc23)co1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9397",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)C2CCN(C(=O)c3ccco3)CC2)cc1S(=O)(=O)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16256",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CC(=O)N1CCN(S(C)(=O)=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164093",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(OCCNC(=O)Nc2nnc(C)s2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46796",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccccc1[C@H](NC(=O)[C@H](C)NC(=O)c1ccoc1)C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96731",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)[C@H](NC(=O)NC[C@@H]1CN2CCCC[C@@H]2CO1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135191",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nn(-c2ccccc2)c(C)c1CN(C)C(=O)[C@@H]1CCO[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209046",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(Nc1ccc(F)c(Cl)c1)N1CCN(Cc2ccccc2)c2ncccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8923",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COC(=O)[C@H](C)NC(=O)c1cc(Br)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121765",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)C1(C(=O)N2CCNC(=O)[C@@H]2c2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(N2CCN(C(=O)Cn3ncc4ccccc43)CC2)c1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100795",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@@H]2CCC[C@@H]2N1C[NH+]1CCC(c2ccccc2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42611",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](C)n1c(C)cc(C(=O)Cn2nnc(-c3ccccc3C)n2)c1C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246303",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)C[C@@H]1CCCN1c1nc(C2CC2)ns1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121377",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccc(CN2CCCC2=O)c1)[C@H]1Cc2ccccc2O1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72016",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COCCN1C(=O)CC[C@@H](C(=O)[O-])[C@H]1c1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44136",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H](Sc1nccn1C)C(=O)NC1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78008",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc2c(c1)CC[C@@H]2NC1=[NH+]CCCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(C[NH+]2CCC[C@H]3CCC[C@@H]32)cc1)N1CCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173331",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule COC(=O)[C@@H](C)N1CCc2c(F)ccc(F)c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168414",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc([C@H](NC(=O)C2C[C@@H](C)O[C@H](C)C2)c2nccn2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218877",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(NCc1ccccn1)c1nn(CC2CC2)c2c1CN(C(=O)[C@H]1COc3ccccc3C1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60306",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)c(C[NH+]2CCC[C@@H]2c2c(C)n[nH]c2C)s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47182",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H]1C[NH+]2CCC[C@@H]2CN1C(=O)c1ccccc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220956",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCCc1cc(=O)n2nc(-c3ccc(C)cc3)c(C)c2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58368",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C[C@H]1Cn2ncnc2NC1=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40678",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)[C@@H](NC(=O)Nc1ccccc1)C(=O)N1C[C@@H](C)O[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248230",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)OC(=O)[C@@H](C)N(C)Cc1ccc(C(=O)N(C)C)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216798",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@@H](NC(=O)COc1ccc(OC)cc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41624",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ncc(C[NH+](C)CCn2c(=O)oc3ccccc32)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17491",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule N#C[C@H](Nc1cccc2ccccc12)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5834",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CC(C)([C@@H](N)[C@H]1CCc2cccnc21)[NH+]1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47858",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CN(CCS(C)(=O)=O)C(=O)C[C@@H]1CCC[NH2+]C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29824",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOCCC(=O)NCC(C)(C)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115327",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC1(C)CC[C@@H](CN2CCOCC2)[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13343",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccccc2c(=O)n1CCOC(=O)C(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143903",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc([N+](=O)[O-])c(NCCCN2CCOCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109729",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N=C1/C(=C/c2cccn2-c2ccc(Cl)c(Cl)c2)C(=O)N=C2SC(c3ccco3)=NN12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115169",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1c(Cl)nnc(NC[C@]2(C)CCCO2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1ccc([N+](=O)[O-])cc1CN1CCN(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196581",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=S(=O)(N/N=C\\c1cccc(OCc2ccc(F)cc2Cl)c1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106573",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCn1c(SCC(=O)N(C)[C@@H]2CCCC[C@@H]2C)nnc1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191952",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)N2C[C@H](CO)OC[C@@H]2C)c(Cl)cc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C[NH+]2CCn3nc(C(=O)NCCO)cc3C2)[nH]c2ccc(F)cc12 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13961",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)Oc1ccc(C(=O)NN2CCOCC2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cc(-c2ccsc2)n2nc(SCc3ccc4c(c3)OCCCO4)nc2n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152710",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOC(=O)c1c(NC(=O)c2cc(Cl)ccc2OC)sc2c1CCS(=O)(=O)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(C)C[C@@H](C)[NH2+][C@H](C)CC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232468",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Nc1cc2[nH]c(=O)[nH]c2cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60512",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1cccc2c(C(=O)COc3ccc(-c4nnco4)cc3)c[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78092",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OC(=O)[C@H](C)Cl)cc2c1C(=O)/C(=C/c1ccc(Cl)cc1)O2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143980",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nc(-c2ccccc2F)sc1[C@H](C)NCc1cccc(N(C)C)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(Nc1cccc(OC[C@H]2CCCO2)c1)[C@@H]1CCCN(c2cnccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205317",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C(=O)N2C[C@@H](C)OCC2(C)C)c1F by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule NC(=O)c1ccc(NC(=O)N2CCC(c3ccc(F)cc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116532",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CO[C@H](CNC(=O)Cn1ccc(=O)[nH]c1=O)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184274",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccc(NC(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)CCCC(=O)N4)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213967",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C/C(=N\\c1ncccc1C)c1c(-c2ccccc2)nn(-c2ccc(F)cc2)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)Cc2cccc(Cl)c2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109073",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccccc1-c1nnc2n1N=C(c1ccc([N+](=O)[O-])cc1)CS2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@]12NC(=O)N(CC(=O)Nc1nc3ccc(Cl)cc3s1)C2=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cccc(OCCN(C)C(=O)NCCC(=O)N(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72965",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1cccc(NC(=O)CSc2cc(-c3ccccn3)nc(C)n2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72865",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(C)NS(=O)(=O)c1ccsc1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64466",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CNc1c(C#N)c(=O)n(C)c(=O)n1C)N1CC[NH+](C)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233548",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC[C@@H]1CC[C@H](NC(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1ccc(OC)c(N2C[C@@](O)(c3ccc(Br)cc3)[N+]3=C2CCCCC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36580",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)c1c([O-])[nH]c(-c2ccc(Cl)cn2)nc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157090",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(C)(C)[NH2+]CC[C@@](C)(O)[C@H]1CCOC2(CCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150109",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1csc(SCc2cc(=O)oc3cc(C)c(C)cc23)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1520",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccccc1-c1ccc(/C=C(\\C#N)C(=O)[O-])o1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217853",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccc2[nH+]c(CNC(=O)c3ccc4cc[nH]c4c3)cn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139386",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCOc1cccc2c1O[C@]1(C)C[C@H]2NC(=S)N1c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200458",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@]1(C(=O)[O-])CCN(C(=O)[C@@H]2CC[NH2+][C@@H]2C)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6436",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=CN1CCC[C@H]1[C@@H]1CCCC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169882",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COCC[NH+](C[C@@H]1CCC[NH+](C2Cc3ccccc3C2)C1)C1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35697",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(SCCC(=O)NC2=NCCS2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57960",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nnc(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38263",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2oc(-c3ccc(C)c(NC(=S)NC(=O)c4ccc([N+](=O)[O-])cc4)c3)nc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224309",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cc(C(=O)N(C)Cc2cccc3ncccc23)cs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69058",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nn(C)c2c1nc([C@H](C)Cl)n2CC(C)(C)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221157",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@](C)([C@@H](O)c1ccc(F)c(C)c1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11977",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=c1[nH]c2c(c(=O)n1-c1ccccc1)CCCS2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25757",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2nnn(CC(=O)N(c3cnc4ccccc4c3)[C@H](C)C(=O)NC3CCCC3)n2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131189",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=S(=O)(Cc1ccccc1Cl)NCc1ccoc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221010",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+]Cc1ccc(N(C)CCC#N)cc1)c1ccc2c(c1)OCO2 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134547",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccccc1C(=O)Nc1ccnn1C1CC[NH+](Cc2cc(C)c(C)o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32543",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC[C@H](O)CC[NH2+][C@H](C)c1c[nH]c2cc(Cl)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65527",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Nn1c(SCc2ccccn2)nnc1C1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221581",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cccc(CN2C(=O)N[C@@]3(CCCc4ccccc43)C2=O)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151435",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([N-]S(=O)(=O)c2cccc(N)c2C)ccn1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1NC(=O)NCC1(CN2CCOCC2)CCCCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217646",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NCCNC(=O)c2ccc3c(c2)COCO3)n[nH+]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131254",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCC(CC)C[NH+]1C[C@@H]([NH3+])C[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189957",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cccc(CN2C(=O)C([O-])=C(S(=O)(=O)c3ccc(Cl)cc3)[C@@H]2c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41670",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CCc2c1cnn2-c1ccccc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110045",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)N[C@H](C[NH+](C)C)c2ccccc2)cnn1-c1ccccc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76056",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)[C@@H](NC(=O)c1cc([N-]S(C)(=O)=O)ccc1O)c1cccs1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24728",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([O-])c1ccccc1C(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171490",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@H]1[C@H](CN2CCCOCC2)CCC1(C)C by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30819",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccccc1/C=C/C[NH+]1CCC2(CC1)C[C@H]2C(=O)N(C)Cc1cscn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164799",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(=O)c1ccc(NS(=O)(=O)c2ccccc2C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122900",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2C[C@H](C(=O)N3CCN(c4c(C)nn(-c5ccccn5)c4C)CC3)CC2=O)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46285",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(CCC)C(=O)Nc1nccs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154904",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(c1ccc(S(=O)(=O)N2CCCCC2)cc1)N(c1ccccc1)[C@@H]1C=CS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57673",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule Fc1cc([C@H]2OCC[C@@H]2Nc2ncnc3[nH]cnc23)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235247",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN(C)S(=O)(=O)c1cccc(NC(=O)COc2ccc(Br)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146729",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=[N+]([O-])c1cc(F)ccc1OC[C@H]1Cc2ccccc2S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247155",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CS(=O)(=O)CCn1cnc2ccc(Br)cc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187934",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCO[C@@H]1C[C@H](NC(=O)N(C)C2CCS(=O)CC2)C12CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38800",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CC(=O)N(C)[C@@H]2CCC[C@@H](C)C2)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209826",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(N)cc(S(=O)(=O)Nc2ccccc2C(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219741",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](Oc1ccccc1)c1nnc(SCC(=O)N2CCc3ccccc32)n1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44353",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nnc(NCCOc2cccc(Br)c2)c(C#N)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191376",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(C[C@@H]1CCCO1)Nc1ccc(Br)cc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137914",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)=CC(=O)N1CCN2NC([C@@H]3[NH+]=c4ccc(Cl)cc4=[NH+]3)=C[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225911",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule c1ccc(CCCOC2C[NH2+]C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228855",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@H]1CCc2cc(F)ccc2N1C(=O)Nc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170006",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(CNc2cccc(C(=O)N3CCSCC3)c2C)no1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144869",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@@H]1Cc2cc(C(=O)C3=C([O-])C(=O)N(C[C@@H]4CCCO4)[C@H]3c3cccc([N+](=O)[O-])c3)ccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@H]1CSC(SCc2coc(-c3ccc(F)cc3)n2)=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51629",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COCCNC(=O)Nc1ccc(C(=O)N2CCCCC2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158569",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCC1=c2ccccc2=[NH+]C1)[C@@H](Cc1ccccc1)NC(=O)N1CC(O)=Nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51960",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@H]1COCCN1CC(=O)Nc1ccc(F)c(Cl)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46480",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule [NH3+]CCC1=c2cc([N+](=O)[O-])ccc2=[NH+][C@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53527",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(NC[C@@H](c1ccco1)N1CCOCC1)c1ccc(Cl)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130867",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2ccc(N)cc2)c(C)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(=O)N1CCc2cc(CNC(=O)Cc3ccc(F)cc3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134108",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1ccc(NC(=O)N(C)CCC#N)c(OCC(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116911",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CN(Cc1cccc(F)c1)c1ccc(CO)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10323",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=S(=O)(c1cn[nH]c1)N1CCC[C@H](c2cccc(-c3cccc(F)c3)n2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165063",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([O-])c1cc(Br)ccc1OCc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56383",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C1CC[C@@H](NC(=O)C/C=C/c2ccc(F)cc2)CN1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)S(=O)(=O)c1ccc([C@@H](C)NC(=O)c2ccc(C)c(C)c2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71072",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCO[C@@H]1C[C@@H]([O-])C12CC[NH+](Cc1cc(C)c(C)cc1C)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162138",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)[C@@H](C)[NH2+][C@@H](CCC#N)c1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81888",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CCNC(=O)NCCC(=O)NC1CCCC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90212",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCN1CCN[C@@H](Cc2ccc(-c3cccc(OC)c3)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34957",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@H](NC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131119",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCCCNC(=O)c1cccn1-c1nnc(N2CCCCC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225831",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCC(=O)Nc1ccc(N2CCN(Cc3nc4ccccc4n3C)CC2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124374",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCNC(=O)[C@@H](C)[NH2+]C[C@@H](O)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203161",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C=CCC/C=C/CC[NH2+]C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(NC(=O)C(=O)NCC(N)=S)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240960",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)Oc1ccc(C(=O)/C=C/c2cccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94035",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC1(C)CCC[C@@]2(O[C@H]2c2ccc(Cl)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179566",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1ccc(CNC(=O)[C@@H]2c3ccccc3C(=O)N3CCc4cc(OC)c(OC)cc4[C@H]23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112012",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)N(C)C(=O)C1CC[NH+](CC(=O)N2CC(=O)Nc3ccccc32)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20976",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOC(=O)[C@H]1CCCN(C(=O)[C@@H](C(=O)c2ccccc2)n2ccccc2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143651",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](C1CC1)N(C(=O)[C@H]1CCCN(C(=O)COc2ccccc2)C1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)c1cc(-c2cnc(C(C)C)nc2)nc2cc(C)ccc12)C(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71997",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)=CC(=O)NCc1ccc(C(=O)NCCc2ccc(C)nc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82412",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@@H]1C=C[C@@H](C(=O)NCCc2cccs2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12831",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CN(CCS(C)(=O)=O)c1ncc(C[NH2+]C(C)(C)C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48933",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCN1C(=O)c2[nH]nc(-c3ccco3)c2[C@@H]1c1ccccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83605",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc(C(=O)C2=NN(c3ccccc3)[C@H]3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)[C@H]23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105364",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@@H](NC(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)[C@@H]1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN1CC(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62585",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[NH2+][C@H](Cc1nc(C)cs1)c1cc(C)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71130",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)([NH3+])c1ncc(-c2ccc(C)o2)[nH]1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147790",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[C@@H](OC)C(=O)N[C@H](C)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75062",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)CS[C@H](C)C(C)C)c(C)n1[C@@H]1CCS(=O)(=O)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133550",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)Cc1cccc(OCc2cccnc2)c1)c1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227920",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CC[C@H](OC(=O)/C=C/c1ccc([C@H]2C[C@@H]2C)o1)c1ccccn1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109475",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCS(=O)(=O)[N-]c1cccc(C(=O)N2CCC[C@@H]2c2ccc[nH]2)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113478",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCC[C@@H]([C@](C)(O)C2(C)CC2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185560",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCC[C@@H]1CNC(=O)CN1C(=O)c2ccccc2C1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158842",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[C@@H](NC(=O)NCc1ncn(C)n1)[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244760",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(NC(=O)CSc2nccn2-c2cccc(F)c2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120852",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)CCc1c[nH]c2ccccc12)[C@H]1CCc2ccccc2C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180390",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C/[NH+]=C(/NC[C@H]1CCC[NH+](C)C1)N1CCN(Cc2cccc(Cl)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@H]1CCCCN1S(=O)(=O)NCc1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49297",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc(-c2nnc(NC(=O)C3CC3)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86317",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1cccc(N2C(=O)c3c(C(=O)OC)ncn3C[C@]2(C)C(=O)NC2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73777",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)OC[C@@H]1CCC[C@H]([NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124305",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cn1cc(S(=O)(=O)N2CCC(C(=O)Nc3ncccn3)CC2)cc1C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137173",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCc1cc(Cn2ccc([C@H]([NH3+])CC)c2)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56435",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccnn1[C@H](C)C(=O)N1CCC2(CC1)NC(=O)N(Cc1ccccc1)C2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69665",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCC[C@@H]1CCC(=O)[C@H](C(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48611",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(NC(=O)CSC2=N[C@H]3CS(=O)(=O)C[C@@H]3N2c2cccc(Cl)c2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CCC(=O)N1CCSc1ncc(-c2ccc(F)cc2)[nH]1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36603",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule S=C1[NH+]=N[C@H](c2cccc[nH+]2)N1/N=C/c1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1CN(Cc2cccc(OC(F)F)c2)C(C)(C)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132716",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(CCOCc1ccccc1)NC[C@@H]1CN2CCCC[C@@H]2CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194450",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@](C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "415",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C=CCOC(=O)c1ccccc1C(=O)Nc1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8919",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(=O)N1CCCC[C@@H]1C[NH+](C)CCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2n[nH]cc2CN(C)[C@H](C)CS(C)(=O)=O)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231626",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OC(=O)N1CCC(NC(=O)Cc2ccc(F)c(F)c2)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211097",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCC#N)C(=O)c1cc2ccc(OC)cc2[nH]1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136977",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC(=O)Nc1ccc(/N=C/c2c(Cl)cccc2Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97199",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(Nc1ccccc1C(=O)N1CCOCC1)[C@H]1CCCN(C(=O)N2CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103170",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc([N-]S(=O)(=O)c2cc(N)cc(Cl)c2F)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228554",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccncc1NC(=O)N[C@@H]1C[C@@H]1C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45067",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=c1[nH]c([O-])nc(/C=C/c2cccc(OCc3ccccc3F)c2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70911",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(c1ccccc1)c1ccc2n1CC[C@H]2C(=O)NC(CO)(CO)CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132153",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule N#Cc1cc(-c2nc(-c3ccccc3)cs2)c(N)nc1SCC(=O)N1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(OCC(=O)NNC(=O)N[C@@H]2CCCC[C@@H]2C)cc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191216",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(CS[C@H]2[NH+]=c3ccc([N+](=O)[O-])cc3=[NH+]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14176",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nc2ccccc2n1CCC(=O)N1CCC([C@@]2(CCc3ccccc3)NC(=O)NC2=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65676",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Nc1nnc(SC(Sc2nnc(N)s2)C(=O)c2ccccc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45225",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(CCO)c1ncnc2c1CCCCC2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1202",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[C@H](C)[C@@H](C)[NH2+][C@@H]1CCCn2nc(C)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53994",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H](Nc1ccc2[nH]ccc2c1)c1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249345",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CS(=O)(=O)N1CCCC[C@H]1C(=O)NCc1ccc(NC(=O)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184759",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(C(=O)NCC(F)(F)F)sc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69712",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCN(Cc1cccs1)C(=O)c1ccc(-n2cnc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201751",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(Br)cc1S(=O)(=O)N(C)CC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193525",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)[C@H]1CCCC[C@H]1NC(=O)Cn1c(=O)oc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200105",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COC[C@H](O)C[NH+]1CCC(NC(=O)C[C@@H]2CCCC(C)(C)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208940",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(Nc1cccc(-c2nnnn2C2CC2)c1)c1cncc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199067",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)NC(=O)[C@H](NC(=O)c1ccccc1Cl)C1CCN(C(C)=O)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206561",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109390",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1nn(CCO)c(C)c1C[NH+]1CC[C@@H](C)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26947",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nnc2ccc(Nc3ccc4c(c3)N(C)C(=O)CO4)nn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204258",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOC(=O)[C@H]1C=CNC(=O)[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200954",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(Br)cc(C)c1NC(=O)c1ccc2cc[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16077",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C=CCN1C(=O)[C@]2(c3ccccc31)[C@H]1CCCC=C1C(C#N)=C(N)C2(C#N)C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197860",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSC1=N/C(=C/c2ccc(Cl)cc2)C(=O)N1Cc1ccco1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nc(CN2CCN(C(=O)[C@@H]3CCO[C@@H]3C)CC2)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205852",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CN(C)c1ncc(-c2ccc(F)cc2)c([C@@H]2CCCN(S(=O)(=O)N(C)C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C/c1ccc(OC(=O)[C@@H]2C[C@H]2OCC)c(OC)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167660",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1nc(C(=O)N(C)OC)cc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159413",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)N1CCC([NH+]2CCC(CO)(Cc3ccccc3Cl)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164767",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCCCOC(=O)C1=C(C)NC(=O)N[C@H]1c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103431",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)NC[C@H](c1ccco1)S(=O)(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125772",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@@H](Nc1cccc(C(N)=O)c1)C(=O)Nc1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5079",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc([C@@H]2CCC[NH+]2Cc2ccc(S(=O)(=O)N(C)C)o2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9512",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)c1ccccc1N1C[C@H](C(=O)N2CCN(C)CC2)CC1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "985",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COCC[C@H](C)C(=O)Nc1cc(F)ccc1Sc1nccn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72355",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(Nc1ccccn1)c1ccnc(OC2CCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173289",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccc(-c2nc3cc(NC(=O)c4ccccc4F)ccc3o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124897",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)[NH2+][C@H]1C=C[C@@H](C(=O)[O-])C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42863",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COC1(NC(=O)c2ccc([N+](=O)[O-])cc2)C(C)=CC(=O)C=C1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22017",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule N#Cc1ccc(-c2cn3cccnc3n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98850",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCOc1cccc(NC(=O)NCCNC(=O)c2ccccc2Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30896",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccc(C)cc1N1C[C@@H](C(=O)NNC(=O)c2cccs2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237726",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCN1CCc2ccccc21)[C@@H]1CCC[NH+](C2CCOCC2)C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(-n3nc(C)c4c3NC(=O)C[C@@H]4c3ccc(F)c(F)c3)sc2c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNC1=NS(=O)(=O)c2ccccc21)N1CCC[C@H]1CCc1ccccc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216102",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1[nH+]ccn1C)C(=O)c1cc(S(C)(=O)=O)ccc1Cl by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192574",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NNC(=O)c1ccc(Cl)cc1Cl by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1081",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C/[NH+]=C(\\NCc1cccc(C)c1)NCc1ccc(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17030",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)(C)Oc1ccc(C(=O)NCC(=O)Nc2cccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74616",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[S@@](Cc1nc(-c2ccsc2)no1)C(c1ccccc1)c1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62156",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(Br)cc1)c1ccc(CSC2=NCCS2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180602",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C1CCCN1CCN1CCCc2c1cccc2[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1=CC2=CC=N[C@@H]2C=C1)[C@@H]1SNN[C@@H]1c1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149118",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(CCn1nnc(-c2ccc(Cl)cc2)n1)NCc1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84412",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc(-n2ncc(CNCCc3ccccn3)n2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211645",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cccc2sc(N(C[C@@H]3CCCO3)C(=O)c3ccc(C(C)=O)cc3)nc12 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42090",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCn1nc(C)cc1NC(=O)c1cc(-c2ccc(OC)cc2)[nH]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174650",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule NC(=O)Cn1c(C[NH+]2CCCCC2)nc2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238952",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C/C(=N\\c1ccc(C)cc1)c1ccc(O)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129792",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1C[C@@H]2C[C@H]1[C@H](C(=O)[O-])C2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148145",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(S(=O)(=O)NCc2nc3cccnc3n2C2CC2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153988",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(=O)NC[C@H]1CCCN(C(=O)c2cc(C)cc(Br)c2O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208626",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NCCCC(=O)N1CCN(c2cccc[nH+]2)CC1)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214529",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN[C@]1(C#N)CCC[C@@H](OCC)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179398",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1csc(SCC(=O)N2CC[C@]3(CCCN(CC4CC4)C3=O)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@H](C1CC1)N(C)C(=O)c1ccc(-c2ccc(Cl)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82559",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1cc2c(cc1C[NH+]1C[C@@H]3[C@@H](CC[C@@]3(O)c3ncccc3C)C1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45557",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(C)cc1NC(=O)C[NH+](C1CC1)[C@H](C)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214838",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[NH+](Cc1nc(-c2ccc(Cl)cc2)no1)C1CC(C)(C)[NH2+]C(C)(C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243955",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(NC(=O)CN2C(=O)COc3ccc(Cl)cc32)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230832",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCC(=O)N1CC[C@@H](C(=O)O[C@@H]2C=C(c3ccc(Cl)cc3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46002",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC1(C)CCN(C(=O)C2(C(N)=S)CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(=O)c1ccccc1OC(F)(F)[C@H](F)Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176967",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N#CC1=C(N)Oc2n[nH]c(-c3ccc(F)cc3)c2[C@@H]1c1ccc(Br)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188047",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C(=O)Nc2sc3c(c2C(N)=O)CC[C@H](C)C3)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](Nc1nncc(-c2ccccc2F)n1)c1nc2cc(C)ccc2[nH]1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31090",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)(C)[NH2+]C[C@H](c1ccccc1Cl)[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NC[C@H](c1cccs1)N1CCOCC1)Nc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20981",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@@H](C)[C@H]1NC(=O)CN(c2ccc(Cl)c(Br)c2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111569",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccccc1[C@H](C)NC(=O)C(=O)Nc1ccccc1CC(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209526",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ncc(C[NH2+]CC2CCC(C(N)=O)CC2)s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(NC[C@H](C)C(N)=O)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108443",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCN1CCN(c2ccccc2F)CC1)C1CCN(c2ccc(N3CCCCC3)nn2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149489",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCc1noc(C)c1C(=O)N(C)Cc1cc(Cl)cc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143696",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(S(=O)(=O)N2Cc3ccccc3OC3(CCOCC3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(=O)C1=C(C)C(C(=O)N[C@H](Cc2ncc[nH]2)c2ccccc2)=N[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232605",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COCC[NH2+]C[C@@H]1CCCCN1c1ccc(C(N)=O)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110830",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc([C@@](O)(CC(=O)N(C)CCc2ccncc2)C(F)(F)F)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202352",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[S@@](=O)[C@H]1CCCC[C@@H]1NC(=O)NCC(=O)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156525",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NC2CCN(C(=O)[C@@H](C)c3ccsc3)CC2)s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243961",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC[C@@H](C)NC(=O)[C@@H](C)[NH+](C)Cc1sccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78662",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[C@H]1CN(C(=O)Nc2ccc(CC)c(F)c2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137024",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(OC)c2[nH]c(C(F)(F)F)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1cc(CN2CC[NH+](Cc3ccccn3)CC2)cc(OC)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146115",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC/C(=N\\NC(=O)[C@@H]1C[C@@H]1c1ccccc1)c1cccc(Cl)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74852",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH2+][C@](C)(CCN1C[C@@H]2CCC[NH+]2C[C@@H]1C)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181448",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)NC2CCCCC2)cc1F by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191394",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSC[C@H](C)N(C)C(=O)[C@@H](C)Cc1c(C)noc1C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCOc1ccc2nc(NC(=O)C[NH+]3[C@H]4CC[C@@H]3CNC(=O)C4)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7477",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)c1ccc([C@H](NC(=O)N(C)C2CCS(=O)CC2)C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59467",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Clc1ccc2nc(NC3CCCCC3)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98335",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC1=NO[C@@H](CNC(=O)c2ccccc2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107872",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCn1c(C(=O)N(C)[C@H](C)c2ccc([S@](C)=O)cc2)cc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1cccnc1N1CCC2(CC1)OCCO2 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128161",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C=CCONC(=O)Nc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101492",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+][C@H](CO)c1ccccc1F)c1ccc(Cl)c(Cl)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83902",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CCC[C@H](O)C1)N(Cc1ccc(F)cc1)C12CC3CC(CC(C3)C1)C2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206162",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C[C@H]1CCCO1)C(=O)c1cnc2ccc(C)cn12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84475",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](O)CC[NH2+][C@@H]1CCc2ccc(OC)cc2C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92026",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule c1ccc2c(c1)C[C@H](C[NH2+]C[C@@H]1CN3CCC[C@@H]3CO1)O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62563",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)(CCO)c1cc(Cl)sc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37573",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[NH+]1CCC[C@H]1CN(C)C(=O)c1ccc(NC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201013",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1ccc(NC(=O)C2CC[NH+](Cn3nc(C4CC4)n(Cc4ccccc4)c3=S)CC2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81884",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule N#CC1(NC(=O)C[NH+](CCc2ccccc2)[C@H]2CCOC2)CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184262",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H](C)[NH2+]CC(=O)Nc1ccc(C(F)(F)F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37366",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H]1C[C@H]([NH2+][C@@H]2CC(=O)N(C)C2=O)CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221443",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@@H](Cc1cccc(Br)c1)[C@@H]1CSCCS1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187598",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "757",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)c1ccc([C@@H](O)c2cscc2C)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc2c1OC[C@@H](NC(=O)Nc1cncc3ccccc13)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157997",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(NC1CCC(c2ccccc2)CC1)C1C[C@@H]2CCC[C@H](C1)C2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116282",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)Nc1cc(F)ccc1F by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103667",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(c1ccc(-c2csc(C3CC3)n2)cc1)N1CCN(c2cccc(Cl)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243097",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCC(=O)c1ccc(OC[C@@H](O)C[NH+]2CCCC[C@@H]2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119794",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@@H](Cc1ccc(Br)cc1F)[C@H](C)[NH2+]C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22649",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c2ccc(-c3nnc(SCC(=O)N4CCN(c5ccccc5)CC4)o3)cc2c1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173222",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=c1oc2ccc([N+](=O)[O-])cc2n1CCCOc1cccc[n+]1[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111597",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1ccc(OC)c(NC(=O)c2cc(C)n(C3CC3)c2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(S(=O)(=O)CC(=O)Nc2nc3c(s2)CCCC3)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176376",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)CN1C(=O)COc2ccc(C(C)(C)C)cc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38484",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc(OCCn2cnc3c(oc4ccccc43)c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244341",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CN(Cc1ccc(F)cc1)C[C@H]1CCC(C)(C)[C@@H]1[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17315",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc2c(cc1Br)OCCO2)c1cc([N+](=O)[O-])ccc1Cl by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102801",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cnc(-c2cccc(NC(=O)NCCCC[NH+]3CCC[C@@H](C)C3)c2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51103",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)(O)c1ccccc1C(C)(C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198511",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Sc1nnc(-c2ccc(F)cc2)c2ccccc12)C(=O)NC(N)=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154604",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nncn1CCNC(=O)N1CCNC(=O)[C@@H]1C(C)C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192604",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule N#CC1(C(=O)OC[C@H]2CCCCO2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219971",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NCc1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242839",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1cc(S(=O)(=O)N2CCN(C(=O)c3cc(C4CC4)nc4c3c(C)nn4C)CC2)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163830",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2065",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOc1ccc(N(Cc2nnc3n2CCCCC3)C(=O)Nc2cccc(Cl)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39677",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C(CSc1ccncc1)Nc1cnc(-c2ccccc2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167553",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nn(C)c2sc(C(=O)Nc3ccnc4ccnn34)cc12 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162976",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C)cc([C@H]2CCN(C(=O)OC(C)(C)C)C[C@@H]2[NH3+])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80267",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[NH+](C)C1(CNC(=O)CNC(=O)N2CCc3ccccc3C2)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144512",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(Nn1ccc2c(nnc3c(-c4ccc(F)cc4)cnn32)c1=O)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171146",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1ccoc1)C(=O)O[C@@H](c1ccccc1)c1ccncc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225226",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nc(C2CCN(C(=O)N[C@H](C)c3ncc(C)s3)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)COC(=O)N1CCC[C@@H]1C(=O)Nc1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171844",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[NH2+][C@H]1CCN(c2cccc(C(C)C)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1COC[C@@H](C)N1Cc1ccc([N+](=O)[O-])o1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126738",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H]1CCCN(C(=O)NCc2ccc(C#CC[NH3+])cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81832",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@H]1Cc2cc(F)c(F)c(F)c2[C@H]1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223966",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(Cn2c(=O)c3ccccc3n3c(-c4ccc(C#N)cc4)nnc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@@H](C[C@@H]1CCC[NH2+]1)[NH2+]C[C@]1(O)CCC[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15724",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(CSc1nnc(Nc2cccc(F)c2)s1)N(c1ccccc1)[C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114796",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C(=O)CCCOc1ccc(Cl)cc1)CC2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164807",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c([C@@H]2CCC[NH2+]C2)nn(Cc2ncccn2)c1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77223",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nc2c(c(=O)n1-c1ccc(Br)cc1)SCC2)NCc1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C#CCCN1CCN(C(=O)C[C@@H](O)c2ccc(Cl)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8542",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@H](CNC(=O)c1[nH]nc(C2CC2)c1Cl)Oc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233723",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@H](CO)[NH+]1CCN(Cc2cccc(F)c2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231108",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@@H]1CN(C(=O)c2ccc(=O)[nH]c2)C[C@H](c2ccccc2)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206418",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H](O)c1ccnc(S[C@@H]2CCC[C@@H](C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119894",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1CCN(C(=O)CCCCc2ccc(Cl)c(Cl)c2)C[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231844",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(c1ccccc1)C1CCN(C(=O)c2c(O)cccc2O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138438",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Cc1cccc(Cl)c1)NC(=O)c1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91261",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nnc(-c2ccncc2)s1)c1cc2c(ccc3ccccc32)oc1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Br)cc(CN(C)CCc2ncc(C)s2)c1O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201198",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)Cn1c(SCC(=O)c2ccc3c(c2)CCCC3)nnc1N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202487",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1OCC(F)(F)F)N1CCC[C@@H]1c1cccc(F)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15087",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1349",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CC[C@@H]1NC(=O)N(CCc2c[nH]c3ccc(F)cc23)C1=O)Nc1cccc(F)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192366",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CSCc1ccnc(NCc2ccc(N3CCc4ccccc4C3)[nH+]c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)c2ccc(C(C)(C)C)cc2)cc1O by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(CC(=O)NCc2cc(C(C)C)no2)ccc1C by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240397",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(NC(=O)N2CCc3ccc(O)cc3C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202083",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)c1nc(C2CC2)n2ccccc12)C(=O)Nc1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97275",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(c1ccc(O)cc1)C1CCN(C(=O)CN2C(=O)N[C@]3(CCCc4ccccc43)C2=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53061",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1cccc(N2CC[NH+]([C@H](C)c3nc(C(C)(C)C)no3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(C)N1C[C@H](C(=O)N2CCC(N(C)c3ccccc3)CC2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117275",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C#CCNC(=O)c1ccccc1NC(=O)c1nnn(-c2ccc(C)cc2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(Cc1ccc2ccccc2c1)N1CCN(c2nc3ccc(F)cc3s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217164",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[NH2+][C@H]1CCC[C@H]([NH+]2CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159788",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)c1ccc([C@H]2[C@H]3[NH+]=c4ccccc4=C3C[C@H]3C(=O)N(CCN4CCOCC4)CC(=O)N32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138837",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cccc(O[C@H](C)C(=O)Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172576",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule Cc1ccc(OCc2cn3cc(Br)ccc3n2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(NCc2ccc(C3CC3)cc2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156628",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](Cc1ccc(Cl)cc1)N(C)C(=O)NCCc1ccc(O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131882",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)n1c([C@H](C)CC)nc2cc(C(=O)[O-])ccc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38881",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]([NH2+][C@H](C)c1c(C)noc1C)C(=O)Nc1cc(C)on1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217498",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(NCCC(=O)N1CCCCC1)Nc1cccc(N2CCCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41648",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cc(C)c2c(c1)/C(=N\\NC(=O)[C@@H](C)SCc1ccccc1)C(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145186",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C[NH+]1CCCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227320",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(C(=O)NC2CC[NH+](CC(=O)N[C@@H]3CCCC[C@H]3C)CC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccc(NC(=O)NCC(=O)NCc2ccccc2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176130",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1cc(NC(=O)c2cnc(C)cn2)ccc1NC(=O)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99764",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(OCC(=O)N2CCCSC[C@H]2C[NH+](C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157901",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COCCN1C[C@@]23C=C[C@@H](O2)[C@@H](C(=O)N(C)Cc2cc(C)on2)[C@H]3C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80283",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCC[C@@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCC(=O)N1CC[C@H](n2c(-c3ccco3)nc3cccnc32)C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98613",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc2[nH]cc(C3=CC[NH+](Cc4nc(CC(F)(F)F)no4)CC3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198429",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(NCCn1cc[nH+]c1)[C@H]1CC=CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10627",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2ncc(C(=O)N3CCCN(C(=O)C(C)(C)C)CC3)n2c1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50935",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cc(-c2ccccc2)n[nH]1)N(Cc1ccccn1)C[C@H]1CCCO1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167912",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCCc1nnc(Cn2nc(-c3ccco3)oc2=O)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150059",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1nc(C2CCN(S(=O)(=O)N(C)C)CC2)nc2c1CC(=O)N2CCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(NCc1cccnc1-n1cccn1)c1cccs1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144049",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COCC1CCN(c2ccc(C#N)cn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136490",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@](O)(c1ccc(Cl)cc1)[C@H]1CCC[C@H](S(C)(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162700",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C1CN(Cc2[nH][nH]c(=O)[nH+]2)[C@@H]2CCCC[C@H]2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185936",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1cccc2c1OCCCN(C(=O)c1cn3c(n1)C[NH2+]CC3)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72406",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C(=O)N2CCC(c3nnc(Cn4cccn4)n3C)CC2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178140",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOc1ccc([C@H]2c3c(oc4cc(OC)ccc4c3=O)C(=O)N2CC[NH+](C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66726",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCN(C(=O)[C@H](N)c2ccccc2)C(C)(C)C1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24739",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(-c2ccc(=O)n(CC(=O)Nc3cc(Cl)cc(Cl)c3)n2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213469",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H]([C@@H]1CCOC2(CCCC2)C1)[C@]1(C)CCCO1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1CCC[C@](C[NH3+])(C[C@@H]2CCCN(S(C)(=O)=O)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Oc1ccc(-n2ccnn2)cc1)C1CC=CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)cc(N[C@@H](C(N)=O)C2CCC(C)CC2)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136147",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCCCc1ccc([C@H](O)C(F)(F)C(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179028",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C=CCSc1nnc(-c2ccc(NC(=O)c3ccccc3OC)cc2)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108235",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(C)c2nc(C3CC3)cc(C(=O)NCCCc3nc(C)no3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(C(=O)OC(C)(C)C)[C@@H]1CCN(C(=O)Cc2cccc(F)c2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(Nc1ccccc1OC[C@H]1CCCO1)N1CCc2n[nH]cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]1CN(C(=O)Nc2ccccc2N2C[C@H](C)O[C@H](C)C2)CCO1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5347",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](CNC(=O)[C@H]2CC=CCC2)[NH+](C)C)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137385",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(Nc1ccc(Br)cn1)c1ccc(Cn2cnc([N+](=O)[O-])n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237500",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccc(C(=O)[O-])cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152157",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCN(Cc1ccc(OC)cc1O)[C@@H]1CCS(=O)(=O)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152034",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2cc3cccnc3n2CCC(=O)[O-])cn1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41821",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(/C=C(/CO)C(C)C)cc(Cl)c1OC by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc([N+](=O)[O-])cc1C(=O)NC[C@@H]1CN(C2CC2)CCO1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227043",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H]1CC[C@@H](C(C)(C)[C@@H]2CCO[C@]3(CCOC3)C2)[C@H](Br)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cn1cnc([N+](=O)[O-])c1Oc1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172686",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CNC(=O)C1CC[NH+]([C@@H](C)C(=O)N[C@@H](C)c2ccccc2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56692",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC1CC[NH+](CC(=O)Nc2ccc3c(c2)COC3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14252",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[NH2+][C@@H]1c2cc(OC)ccc2CC[C@H]1n1cncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76017",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC[C@@H](C)N(CC)C(=O)[C@@H]1C=C[C@@H]([NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81381",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CN(CCc1cccs1)c1cccc(Cl)c1C=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206674",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC(=O)C1=C([O-])C(=O)N(CCc2ccccc2)[C@@H]1c1ccc(O)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91640",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Fc1ccc([C@H](CC(F)(F)F)NCc2ccc3c(c2)OCCO3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118336",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc(CNC(=O)c2cccc(C#N)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20776",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CN(C)C(=O)[C@@H]1CCCN1C(=O)C1=NN(c2ccc(F)cc2)[C@@H](C(N)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174228",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)CCc1ccc(NC(=O)C2C[C@@H](C)O[C@H](C)C2)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73218",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccccc1NC(=O)c1ccc(SCc2cccnc2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24753",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@@H](O)C[NH+]1CCC(NS(=O)(=O)c2cnc3c(c2)c(C)nn3C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42464",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Cl)c(C)cc1NC(=O)CSC(=S)N(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145457",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cccc(Oc2nc(C(F)(F)F)nc3ccccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58124",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)c1nnc(CCC(=O)N2CC=C(c3ccc(Cl)cc3)CC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165900",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(NCCC1=CCCCC1)N1CCC(n2cncn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165116",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cc(Cl)c(C)cc1NS(=O)(=O)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188710",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCCCN(C(=O)N[C@H](C)Cc1cc(C)cc(C)c1)[C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199059",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1cc(C)c(CNc2ncnc3[nH]ncc23)c(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231640",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccc(S(=O)(=O)N(C)Cc2ccc([C@H]3C[C@@H]3C)o2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCn1c(SCc2nccn2C)nc2sc(C)c(C)c2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241468",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCNC(=O)N1CC[C@@H]([NH2+][C@@H](C)c2cc(Br)ccc2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(CCNC(=O)[C@H]2C=C3C(=O)[NH+]=c4ccccc4=C3S2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199771",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(Nc2c(Cc3ccccc3)c(C)nc3ncnn23)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119163",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](Sc2nccs2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96887",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)(C)Oc1cc(CNC(=O)c2ccc3nnnn3c2)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17214",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@H](NC(=O)NCCOC[C@H]1CCCO1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44895",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1c(Cl)cc(CN[C@@H]2CC[C@@H]([NH+](C)C)C2)cc1OC by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236755",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(SCCNC(=O)N2CCC[C@@H](c3nc(C)no3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205683",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c2[nH]c(=O)c(CN(Cc3ccc(F)cc3)Cc3nnnn3C(C)(C)C)cc2c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134341",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN([C@@H](C)c2nnnn2-c2ccccc2)C[C@@H](C)O1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234088",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc([C@@](C)([NH3+])[C@H]2CCO[C@]3(CCSC3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58169",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1ccc(Br)cc1/C=N/c1n[nH]c2ncccc12 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68849",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc2c3c1O[C@H]1[C@@H](O)CC=C[C@@]31CC[N+](C)(C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46260",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(C[NH+](C)CC2CCOCC2)c(-c2cccnc2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155473",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(=O)N1CCOC[C@@H]1C1CC1)C(=O)c1cccs1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49877",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H]2CCCN2C(=O)N[C@H](CCCO)c2ccccc2)s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182171",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cccc(NC(=O)[C@@H]2Cc3ccccc3S2)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166121",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1cc(C)c(C(=O)N[C@@H]2CC3(CCOCC3)Oc3ccccc32)c(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124507",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COC(=O)C1CCN(C(=O)[C@@H](C)[NH+](C)Cc2sccc2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(c1cc2c(s1)CCCCC2)N(Cc1cccnc1)C[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130587",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ccc(-c2nc3cc(C)ccc3n2C)cc1OCCCC#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57365",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)NC(=O)CN1CCN(C(=O)NCCCn2cccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230463",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)C[C@@H](O)CNC(=O)Nc1ccccc1C(=O)N1C[C@H](C)C[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4541",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H](C)[NH2+][C@H](CN=[N+]=[N-])C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129616",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(Nc1cccnc1)[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20239",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(OC)c(C(=O)N[C@@H]2CC(C)(C)Cc3oc(C)cc32)cc1OC by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(OC(=O)c4cccc(Cl)c4)ccc32)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110726",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H]1CCCN(c2ncc(C(F)(F)F)cc2Cl)C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215854",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule NC(=O)c1ccc(Cl)c(NC(=O)c2ccc(F)cc2I)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237904",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOCCSc1ccc(N)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215715",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(NC(=O)CO[C@H]2CCC[C@@H](C)C2)n(Cc2ccccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90477",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3736",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1nc(N2CCOCC2)[nH]c(=O)c1CCC(=O)Nc1ccc2c(c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118559",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(NC(=O)CCc2cc(OC)ccc2OC)sc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190948",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccc(NC(=O)N2CCC[C@H](c3nc(C)no3)C2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175778",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OC[C@@H](C)NC(=O)c2ccc(C)[nH]c2=O)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCn1nc(C)c2c(C(F)(F)F)cc(-c3ccc(OC(F)F)cc3)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21282",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cnc(CNC(=O)N[C@H]2[C@H]3CCO[C@@H]3C23CCCC3)s1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237404",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)c1ccc(Oc2ccc(C(=O)NC3(C#N)CC3)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCC[C@](O)(Cc2[nH+]c3ccccc3n2C)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169428",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cnc2c(c1)[nH]c(=S)n2CC(C)(C)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4687",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CNC(=O)[C@H]1CCCC[C@@H]1[NH2+][C@@H](C)CCc1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(C(=O)Nc2ccc(N(C)C)cc2)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167998",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Oc1ccccc1NC[C@@H](O)Cn1ccc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43598",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H](C#N)C[NH2+][C@@H]1CCC[C@H](NC(=O)OC(C)(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123188",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC1=NN(C(=O)c2ccc(-c3ccccc3)cc2)[C@@](O)(C(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111486",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule NS(=O)(=O)C[C@@H]1CCCN(C(=O)c2cc3cccc(Cl)c3o2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45835",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H](C#N)NC(=O)c1cc(C(C)C)no1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236024",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@@H](CCN1CCOCC1)[NH2+][C@H](C)c1cccc(N2CCOC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196479",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(NC1(c2nc(-c3cnccn3)no2)CCCCC1)c1cc2cc(Cl)ccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219315",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCC[C@H]1CN(C(=O)c2nc(-c3ccccc3)[nH]c2C)C[C@@H]1[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66129",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ccc(F)cc1NC(=O)N1CCC[C@@H](C)[C@@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCCN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccc(C(F)(F)F)cc4)o3)cc2)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32184",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccccc2c(=O)n1/N=C\\c1ccc(F)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196920",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H](Sc1nnc(-c2ccc(Cl)cc2)o1)C(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164824",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COCC[S@](=O)[C@H](C)C(=O)Nc1ccc(F)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193531",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[NH+](C)CCNc1ccc(C#N)c(N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19705",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOC(=O)N1CCC([NH2+]C[C@@H](C)c2nc(-c3ccccc3)no2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)NC(=O)[C@@H](C)Sc1nnc(-c2ccccc2)n1-c1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203189",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSCc1ccnc(NC2CCN(C(=O)CC)CC2)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149901",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)c1nc2cc(NC(=O)CN3CCS(=O)(=O)CC3)ccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100946",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(N[C@H]1CC[C@@H]2CCC[C@@H]21)c1ncc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224839",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1Cc2cc(-c3cc(CNC(=O)CCn4cnc5ccccc5c4=O)no3)ccc2O1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53769",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](CS)C[NH+](C)Cc1ccncc1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25513",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C#CCN1C(=O)S/C(=C/c2ccccc2OCc2ccc(C)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188159",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]1C[C@@H](C(N)=O)c2ccccc2N1S(=O)(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113565",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1ncnc(N)c1CN1CCO[C@H](c2ccc(Br)cc2)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200480",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)NC[C@H]1CCCN(C(=O)Nc2ccc(N(C)C(C)C)c(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134198",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](NC(=O)CS[C@@H]1N=NNN1c1ccccc1Cl)C1[NH+]=c2ccccc2=[NH+]1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168048",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCc1ccccc1NC(=O)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147503",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nn(C)c(=O)c(C(=O)N2C[C@@H](O)C[C@H]2c2cc(F)ccc2F)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227480",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+]1CCN(c2cc(CNc3cccc(C(=O)OC)n3)cc[nH+]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36493",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc([C@@H](C)N2CCN(c3ccc(C#N)cc3F)CC2)o1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104980",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CN(C)[C@@H](C(=O)N1CC(c2cccnc2)C1)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203946",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1cc(C(=O)N2CCN(CC(C)(C)C[NH+](C)Cc3ccccc3)CC2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11055",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CCCCNC(=O)Cc1noc(CN2CCc3c([nH+]cn3C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32918",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC(=O)N1CCN(C(=O)NCc2ccc3c(c2)CCCN3C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26042",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc([C@H](C)N2CC[NH2+]C[C@@H]2C(=O)N(C)C)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15343",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2nc(N3CCCC3)nn2c(Cl)c1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169268",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cn1ncnc1CCNC(=O)N[C@H]1CCCC[C@@H]1C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179518",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(Nc1ccccc1)Nc1nnc(COc2ccc(Br)cc2Br)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225545",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1c(C)c[nH+]c(CN(C)c2c(C)noc2C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107277",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccccc3OC)C2)[C@@H]1c1ccc(OC(C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45056",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NC(=O)c2ccc3c(c2)NC(=O)[C@H](C)S3)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207764",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=S(=O)(Nc1cnn(Cc2ccccc2F)c1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210504",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CN([C@@H]2CCN(c3ccccc3Cl)C2=O)CC[S@@]1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2372",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cnc(C(C)(C)NC(=O)CCc2c(C)noc2C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104848",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CNC(=O)Cc1c(C)noc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152818",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1c(Cl)cccc1NC(=O)[C@]1(C)Oc2ccccc2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32236",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule COc1ccc(OC)c(N(CC(=O)N2CCOCC2)S(C)(=O)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148420",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC[C@H](C)N1CCN(C(=O)c2cnc(-c3ccsc3)s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNC(=O)NC(=O)Cn1nnc(-c2cccc(C(F)(F)F)c2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148296",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)(C)[C@@]1(CCCc2ccccc2)CCC[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81410",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)[C@@H](C)[NH+]1CCNC(=O)C1)c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72459",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=S(=O)(C(N=C(Cl)Cl)=C(Cl)Cl)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100168",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(Cc1cc(-c2ccc(F)cc2)on1)Nc1ccc(Br)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119519",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)[C@H](F)[C@](C)(O)c1ccc(S(C)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7954",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(Cn1nc2n(c1=O)-c1ccccc1SC2)N/N=C/c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50205",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCC(CC)([C@@H](Cc1ccc(O)cc1)NC)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233630",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](NC=C1C(=O)N(C)C(=O)N(C)C1=O)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(O)c2c1[C@@H]1C=CC[C@@H]1[C@H](c1cc([N+](=O)[O-])ccc1O)N2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105941",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(NCC1(O)CCSCC1)[C@H]1C[C@@H]1c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241296",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[NH2+][C@@H](c1cccc2cnccc12)[C@@H]1CSCCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214871",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cn1cc(-c2nc(C(=O)OCc3ccc(C#N)cc3)cs2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29853",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ncnc(SC2CCCCC2)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)Cc1cc(C)[nH]n1)[C@@H]1CC[NH+]([C@@H](C)c2ccccc2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143151",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOc1ncnc(Nc2ccc(Br)cc2C)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74774",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCCN(CC(F)(F)F)[C@@H]1CCc2cc(N)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75250",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(-n2cnnc2SCC(=O)Nc2ncc(Cl)c(C)c2Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243126",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@@H](c1ccncc1)N(C)C(=O)NC[C@@H](C)C[NH+]1CCN(C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139986",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)c1ccc(S(=O)(=O)NC[C@]2(O)CCOc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32604",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1O[C@H](C)CNC(=O)[C@@H]1CCC[NH+](C)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176968",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC1=NN2C(=N)/C(=C\\c3cc(C)n(-c4ccc(Cl)cc4)c3C)C(=O)N=C2S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168709",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1cccc(C[NH+]2CCN(C3CC3)C(=O)C2)c1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27709",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCN(CC)C(=O)c1ccccc1NC(=O)C(=O)N[C@H](C)c1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31300",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(NCCNC(=O)OC(C)(C)C)c(C#N)c1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17114",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1C[C@H](C(=O)OC[C@@H]2CC=CC[C@H]2C)CC1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171548",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cc(C(=O)N(CC2=C[C@H]3N=CC=C3C=C2)C2CC2)cc(OC)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202076",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COC(=O)C(C)(C)[C@@H]1CCCN(C(=O)c2ccc(C)c(C)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102482",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cn1c(=O)c2ccccc2n2c(CN3CCO[C@@H](c4cccc(F)c4)C3)nnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221230",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(=O)Nc1cc(C(=O)N(C)[C@@H]2CCCC[C@@H]2S(C)(=O)=O)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229375",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)c(NC(=O)C(=O)NCc2cc(C#N)ccc2F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162420",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1700",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)[C@H](NC(=O)/C(=C\\c1ccc(Cl)cc1)NC(=O)c1ccco1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227564",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nn(C(=O)[C@H]2CCCN2S(=O)(=O)c2ccccc2)c(C)c1Sc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1nn(-c2ccccn2)c2c1C(=O)[C@@H](Br)C(C)(C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137323",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(C(=O)c1ccc2c(c1)C(=O)N(C)C2=O)[C@@H]1CCc2ccccc2C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112808",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@H]1CCCCN1C(=O)Cn1c(CNC(=O)c2cccc(Br)c2)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144402",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@@H](Cc1cccc(F)c1)NC(=O)N1C[C@H]2CCCC[C@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93831",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1OCCN(Cc2ccc(OC[C@@H]3CCCO3)cc2)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213435",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CN1C(=O)C(C)(C)Oc2ccc([C@@H](O)c3ccco3)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34725",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule c1ccc2c(c1)O[C@H](c1ccsc1)N1N=C(c3ccc4c(c3)OCO4)C[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2cccc(Oc3ncnc(NN(c4ccccc4)c4ccccc4)c3N)c2n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116504",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)Cn1ccnc(NC[C@@H](C)Nc2ccccc2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154012",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C([O-])[C@H]1C[C@@H]1C(=O)Nc1ccc(I)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39006",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[NH2+]C[C@H]1CCCCN1c1nc(Br)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241259",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)=C[C@@H]1[C@@H](C(=O)Nc2ccc(OCC(N)=O)cc2)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240493",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(c1cccc(Cl)c1)N1CCN(c2nc(C3CC3)no2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232068",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(CN1CCN(C(=O)C2CC2)CC1)Nc1ccccc1C(=O)Nc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247988",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@@H]1C[NH+](C2CC[NH+](Cc3ccccc3Cl)CC2)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194114",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ccc(C(=O)Nc2nc[nH]n2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246511",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C(=O)[O-])c1ccc([N-]S(=O)(=O)c2c(F)cc(F)cc2F)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186275",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC[C@@]1(C)CCC[NH+](CCC(=O)Nc2ccccc2[N+](=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204887",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(C[NH+]2CCC(NC(=O)N(C)C3CCOCC3)CC2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232712",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1n[nH]c(-c2ccc(NS(=O)(=O)c3cccc(F)c3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79082",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCNC(=O)c1ccco1)Nc1cc(-c2ccco2)ccc1F by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75351",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(C(C)C)cc1O[C@H](C)C(=O)NC[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72860",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule [NH3+]CCCCSc1cc2ccccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244814",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(CN(C)Cc2ncnn2C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155599",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@H]1CCCCN1C(=O)Cn1cccc1-c1nc(-c2cccc(Cl)c2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5262",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(C)c1ccc(C(=O)NCCS(N)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143707",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCCn1cc[nH+]c1)N1CCO[C@H](c2ccc(F)c(Cl)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191024",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc(/C=C(/C#N)C(=O)N2CCC[C@H](C)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100883",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)c1cc(NC(=O)CCc2nnc(-c3ccoc3C)o2)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6483",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(-c2nc(C(=O)NCc3nnc4n3CCC4)cs2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13463",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H](NC(=O)c2cccc(OC)n2)c2nccn2C)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239462",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)n1cc(NC(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176848",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)(C)n1cc(CN2CCS(=O)(=O)CC2)c(-c2ccccc2Cl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58223",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOC(=O)N1CCC2(CC1)NC(=O)N(C1CC[NH+](Cc3cccc(F)c3)CC1)C2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99671",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccsc1CNS(=O)(=O)c1ccc(C(=O)[O-])s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31013",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(CC[NH+]1CCCC1)N1CCN(c2ncccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71849",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1cccc(-n2c(N)[nH+]c3ccccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186402",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(NC(=O)NCc2cccc(Cn3cncn3)c2)cc1C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2525",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC1=C[C@@H](c2c(C)sc(C)c2S(=O)(=O)NC2CCCCCC2)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202963",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@H]([NH2+]Cc1ccc(F)c(Br)c1)c1ccccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205749",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule c1ccc(CC[NH+]2CCC[C@@H](c3cccc(-n4ccnc4)n3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106963",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1cccc(C(=O)N[C@@H](C)c2ccc(C)o2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5843",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)C[NH+]1CCC(O)CC1)c1cccc2ccccc12 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196967",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(NCC[NH+]1CCCCC1)N1CCN(C(=O)c2ccoc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169275",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1S/C(=N/N=C/c2cc(Br)ccc2OC)N(Cc2ccccc2C)C1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231709",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)N1CCC[C@H](NC(=O)[C@@H](C)Cc2c(C)n[nH]c2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49415",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN([C@@H]1CCCc2ccccc21)S(=O)(=O)c1ccc2c(c1)OCCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125145",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)N/N=C1\\CCCc2oc(C(=O)Nc3cccc4ccccc34)c(C)c21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64763",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cccc(O[C@H](C)C(=O)Nc2ccccc2C(=O)N[C@@H](C)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132130",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCOc1ccc(NC(=O)C(=O)NCC2CCN(c3nc4ccccc4o3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40722",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN[C@@]1(C#N)CCC[C@@H]1CCOCC(C)C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192601",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule N#Cc1nc(COc2cccc(Cl)c2)oc1N1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42935",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOC(=O)/C=C/COc1ccc(F)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209647",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NCc1cc(F)ccc1Br)NC[C@H](O)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc2c(c1)[C@@H](N[C@H](C)[C@H](O)c1ccc(OC)cc1)CCO2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219707",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CSC[C@@H]1CCN(C(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181329",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H](Sc1nnc(Nc2ccccc2F)s1)C(=O)N1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193290",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCOC(=O)CCN1CC[S@@](=O)C(C)(C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54985",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCOc1ccc(N2C(=O)[C@@H](C)CS2(=O)=O)cc1S(=O)(=O)N[C@@H]1CCCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184368",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(CNC(=O)c2cccc(NC(=O)[C@@H]3C[C@@H]3C)c2)c(N(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52939",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCCCN(C)C(=O)C(=O)Nc1cc(Cl)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72656",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1ccc(-c2csc(NC(=O)COC(=O)C3CC3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48880",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)(C)OC(=O)N1CC(=CC(=O)NC2CC=CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60930",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CNc1ccnc([C@H]2CN3CCC[C@@H]3CO2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COCCC[n+]1c(N)c(C(=O)NC[C@H]2CCCO2)cc2c(=O)n3ccccc3nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61595",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccccc1C1(CNC(=O)NCc2ccc(C(N)=O)o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146348",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)NC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@]1(CNS(=O)(=O)c2cncc(Br)c2)CCCO1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119609",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)[C@H]1CCCC[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226888",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ccc(Cl)cc1)Nc1cccc(NC(=O)c2ccco2)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153687",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)c1ocnc1Cn1nnc(CN(C)C(=O)c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(NCc1cccc(NC(=O)[C@H]2CCCO2)c1)C1C2CC3CC(C2)CC1C3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60007",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCS[C@@H]1CC[C@@H]([NH+](C)Cc2nnc(-c3ccccc3Cl)o2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200964",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2occ(/C=N\\NC(=O)c3csc4ccccc34)c(=O)c2c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80677",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1693",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule c1nc(N2CCC[C@H]([NH+]3CCCC3)C2)c2ccsc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15919",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[NH2+][C@@H](Cc1cccc(F)c1F)c1ccc(OC)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230044",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C=CCN(Cc1ccccc1OCC)C(=O)c1nc([O-])c2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173226",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN1C(=O)/C(=C\\NCCN2CC[NH2+]CC2)C(=O)N(c2ccccc2)C1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39662",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(C[C@]2(O)CC(C)(C)OC2(C)C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142823",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(CN1CC[NH+](C[C@@H](O)C2CC2)CC1)NCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79052",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2ccc(C=O)o2)cc1[N+](=O)[O-] by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40487",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COCCOc1ccccc1C(=O)Nc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158975",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(=O)Nc1cccc(C(=O)/C=C/c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCC(=O)N1CCC[C@@H]1C(=O)NNc1cc(C#N)cc(Cl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126461",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2C[C@@H](C)N(Cc3noc(C4CC4)n3)C2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](SCc1cccc(C(=O)N(C)C)c1)c1cccs1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54992",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)ccc1NC(=O)CN(c1cc(Cl)ccc1Cl)S(C)(=O)=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105270",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC1(c2nc(C3CCCCC3)n[nH]2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)CCC1=C2N=N[C@@H]1c1nc(-c2ccc(OC)c(OC)c2)no1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47533",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)CC1CCN(C(=O)C[C@H]2C[C@H]3CC[C@@H]2C3)CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CNC(=O)[C@H](C)N2C(=O)c3ccccc3C2=O)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88245",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(NC(=O)N2CSC[C@H]2C(=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215660",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule S=C(Nc1ccccc1)N1CCC(Cc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139880",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccccc1Cl)N(C)C(=O)N[C@@H]1CC[C@H]([NH+](C)C)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114978",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOC(=O)[C@](C)(O)[C@H](C)c1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101517",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc[n+]1CC(=O)Nc1ccc(/N=N/c2ccccc2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142177",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1COC(=O)Cn1c(C(F)(F)F)nc2ccccc21 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43191",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=C/C(=O)N1CC[C@@H](C)[C@H](O)C1)c1ccccc1F by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123754",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=S(=O)(c1cc(F)ccc1F)N1CCN(Cc2cccc3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211891",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(=O)c1ccc(N2C(=O)c3oc4ccc(F)cc4c(=O)c3[C@H]2c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152746",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1cc(C(F)(F)F)nn1CC(=O)NN1C(=O)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CNC(=O)C1(NC(=O)[C@H](C)NC(=O)c2ccco2)CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144814",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(NCCc1ccsc1)c1cc(-c2ccccc2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16153",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nc(C)n(-c2ccccc2NC(=O)[C@@H]2COc3ccc(F)cc3C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65561",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCCC1=C2[C@H](N=N1)OC(N)=C(C#N)[C@@H]2c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41907",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Nc1nonc1Nc1n[nH]nc1-c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58170",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCn1/c(=N/C(=O)[C@@H]2CC(=O)N(C)C2)[nH]c2ccc(Br)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95464",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC1CCN(S(=O)(=O)c2cccn(CC#N)c2=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105010",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc(CNC(=O)Cn2cnc3scc(-c4ccc(C)s4)c3c2=O)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38331",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1c(C)c[nH+]c(CN2CCC[C@@H]2C[NH+]2CCCCC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80472",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[C@@H]1CN(C[C@@H](CS)c2ccccc2)CC[NH+]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24040",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)c1ccc(Oc2ncnc(Oc3cccc4cccnc34)c2[N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81645",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1cccc(C[C@H](C)N[C@@H](C)c2cccs2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78304",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(CN2CCC[C@H]2c2noc(C3CC3)n2)nnc1C1CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193376",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NC[C@@]1(O)CCCN(C(=O)c2cc(C3CC3)n[nH]2)CC1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75745",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(SCCCC(=O)Nc2nnc(-c3ccccc3)o2)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7904",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ccc(Cc2nc3ccc(OC)cc3c(=O)[nH]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116235",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(NC(=S)N/N=C(/C)c2ccc3ccccc3c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221203",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(N[C@H](c1ccc(Cl)cc1)C1CC1)c1ccc(-n2cccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44091",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[NH+]1CCC(N(C)C(=O)NC[C@H](C)C[NH+]2CCN(C)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26277",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(NC(=O)Cn2ccc3ccccc32)c(N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc([C@H](C)[NH2+][C@@H]2CCO[C@]3(CCOC3)C2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC[NH+](C)Cc1ccccc1N1CCOCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14123",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(=O)c1cc(C(=O)NC[C@H]2CC[C@H](C(=O)[O-])O2)n(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](CSC1CCCCC1)[C@H]1CCOC2(CCC2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1nncn1C1CC1)C1(c2cccc(F)c2)CCOCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223528",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCC(=O)CCc1ccc(F)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8347",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1nn(C)c2nc(C3CC3)cc(C(=O)N[C@@H](C)c3ccccc3)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216733",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1CN1CCC[NH2+][C@H](C(C)C)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1oc2c(C)c3oc(=O)c(CC(=O)N[C@@H](C)CC4=c5ccccc5=[NH+]C4)c(C)c3cc2c1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COCCNc1ncnc(Oc2cccc3ccc(C)nc23)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182123",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@H]1[C@H](Oc2ccccc2OC)CCC1(C)C by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95643",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C([O-])c1ccc(-n2cnc3ccccc32)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)c2ccc(O)cc2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19466",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCc1ccc(NC(=O)CSc2ncnc3sccc23)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222986",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ncsc1C(=O)N[C@@H]1CCCOc2c1ccc1ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41229",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(C(=O)OCCCc2nc3ccccc3s2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200868",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOCCS(=O)(=O)N1CCNC[C@H]1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181694",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1CN(S(=O)(=O)N2CCC(OCc3ccc(F)cc3)CC2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245143",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Cc1cccs1)[NH+](C)CCn1nc2ccccn2c1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40344",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule Cc1ccc(S[C@H](C)C(=O)N2CCC[C@@H](C(N)=O)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81212",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCOc1ccc(/C=C2\\SC(=S)N(c3ccc(OC)cc3OC)C2=O)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115556",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Brc1cccc(C[NH+]2CCC(CN3CCOCC3)CC2)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178843",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)cc1NC(=O)/C=C/c1csc(C)n1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133712",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1nn(CC(=O)N(C[C@@H]2CCOC2)C2CC2)c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1ccnc(N2CCCC[C@H]2C(=O)[O-])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93002",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1c(Cl)cccc1S(=O)(=O)Nc1ccc2c(c1)CCC(=O)N2C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162453",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule NC(=O)CC[C@H]1CCCN(S(=O)(=O)Cc2cccc(C(F)(F)F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131175",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)CCS3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60102",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccc(I)c1)c1ccc(CO)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31354",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc([C@@H]2C[C@@H]2C(=O)N2C[C@H](n3cccn3)Cc3ccccc32)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39654",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccn2c(=O)c(C(=O)N3CC[C@H](c4ccccc4)[C@H]3C)cnc12 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233083",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCC(CC)([C@H](O)c1ccc(C)s1)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148947",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(Cc2cnc(NC(=O)[C@@H]3Oc4ccccc4O[C@@H]3C)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116064",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(C)C[C@H](O)CNC(=O)Nc1ccc(-c2csnn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219227",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C/C(=N\\NC(=O)OC(C)(C)C)c1ccc(Cl)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1ccc(OC(=O)Cc2ccc(F)c(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Oc1ccc(Cl)cc1N1C(=O)[C@H]2CC=CC[C@@H]2C1=O)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57286",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@H](c1ccccc1)[NH+]1CC[C@H](NCC[NH+](C)C2CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147190",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ncncc1C(=O)NC1CC[NH+](Cc2cc(-c3ccc(F)cc3)nn2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59571",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H](Sc1cc(C)ncn1)C(=O)Nc1nc2ccc(C)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157050",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Fc1ccc(C2(C[NH2+]C3CCSCC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56326",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(C)cc1-c1csc(NC(=O)c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28568",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CCC(=O)Nc2c(C(N)=O)n[nH]c2C)ccc1Br by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239103",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NCCCCn1cnnc1)c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242561",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C#Cc1cccc(NC(=O)c2ccccc2S(=O)(=O)N(C)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61297",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNc1ncnc(Nc2ccc3c(c2)OCO3)c1N by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160801",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COC[C@H](C)NC(=O)Nc1cccc(SC(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110652",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(OC)c(OC)cc1/C=C1\\N=C(c2ccc(C)c(C)c2)OC1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223037",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCCNc1nc([C@@H]2CSCCS2)nc2sc(C)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188605",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(CC(=O)N(C[C@H]3CCCCO3)C(C)C)c[nH]c2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62468",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)(CNC(=O)[C@H](C[NH3+])Cc1ccccc1)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134870",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cn1c(CCCNC(=O)[C@H]2CCCO2)nc2cc(NC(=O)c3ccccc3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81712",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccccc1-c1cc(=O)[nH]c(N2CCN(c3ccc(F)cc3)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174450",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H]1CCCC[C@@H]1OC(=O)CC1CC[NH2+]CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38900",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccc(NC(=O)C(=O)NC3CC[NH+](CC4CCCCC4)CC3)cc2o1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104059",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1n[nH]c(C)c1N[C@@H]1CC[C@H](NC(=O)OC(C)(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168577",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)(CC(=O)Nc1cccc(Br)c1)C(=O)[O-] by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164833",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@H](NC(=O)/C=C/c1ccc(F)cc1)c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48788",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nc2sccn2c1CN1CCO[C@H](c2ccccc2Cl)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62911",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=[N+]([O-])c1c(C(F)(F)F)nn(-c2ccc(Cl)c(F)c2)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCC(=O)N(C)c1ccccc1C(=O)N[C@H](C)c1nc(C2CCCC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4561",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1cc([C@@H](C)Nc2ncncc2N)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154394",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)CNC(=O)c1ccc(NC(=O)NNC(=O)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14740",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc2cc3c([nH+]c2c1)N(c1ccc(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])cc1)CC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30042",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)N(C)Cc1ccccc1NCC1CC[NH2+]CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236726",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+](C)Cc1cc(C(=O)OC)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67074",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COC(=O)c1cc(S(=O)(=O)NC[C@@H]2CC[NH+](C3CC3)C2)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57807",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COC(=O)[C@@H]1C[C@H]1C(=O)N1CC[NH+](C2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216879",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(NC(=O)C[NH+]2CCC[C@H](C(=O)NCC(F)(F)F)C2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97800",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](NC(=O)c1c[nH]nc1-c1ccccc1F)[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144184",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)cc1NC(=O)CCNS(=O)(=O)c1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@@H](c1ccc(Cl)cc1)[C@H](C)NC(=O)N1CCOC(C)(C)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108558",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)O[C@@H](C)c1nc2ccc(C(=O)[O-])cc2[nH]1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191616",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)c1noc([C@@H](C)SCCOc2ccc(F)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204029",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=c1[nH]c2ccccc2c(=O)n1CCc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1[C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-] by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89671",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)(CNc1nccc(C(F)(F)F)n1)S(C)(=O)=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77093",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCCc1nc2sc3c(NCCN4CCOCC4)nc(SC)nc3c2c2c1CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96430",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc([C@@H](C)[NH2+]Cc2ccccc2Cl)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCc1nn(C)cc1C(=O)NC[C@@H](C)Cn1nc(C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114897",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CO[C@H](C(=O)Nc1cccc(-c2ccnc(C)n2)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11161",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(C[NH2+][C@H]1CCCN(c2cccnn2)C1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228599",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nc2c(s1)[C@H](NCc1ccnc(OC3CCC3)c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80581",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C1N[C@H](C(=O)Nc2cnn(-c3ccccc3F)c2)CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174791",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CCc2cc(OC(=O)/C=C/c3ccccc3OC(F)F)ccc2N1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@@H](C)NC(=O)C(=O)Nc1cccc(C#Cc2cccc(C(=O)OC)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5219",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CS(=O)(=O)c1cccc(S(=O)(=O)N(Cc2cccnc2)c2ccc(Cl)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177657",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1C(N)=[NH+]C[C@@]1(C)c1ccccn1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CCn1cc(C(=O)NC2CCCC2)c(=O)c(C(=O)N2CCN(c3ccccc3F)CC2)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226712",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)c1nnc2ccc(N3CCC[C@H](C(=O)NCc4ccccc4Cl)C3)nn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117272",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](NCCc1ccccc1F)c1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148579",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[NH+]1CCN(c2ccc(NC(=O)c3cccnc3Cl)cn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58517",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Fc1ccc(C[C@H]2CCCC[NH2+]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125187",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC1(C#N)CCC(C)CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1772",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N2CCN(C(=O)c3cc4ccccc4o3)CC2)nc(C)[nH+]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46042",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1cc(C)c(CN2CCN(C(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)CC2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195467",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(NC(=O)[C@@H]2CSc3nc(C(C)(C)C)cc(=O)n3C2)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186574",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOc1ccc(/N=C2/NC(=O)[C@@H](CC(=O)Nc3ccc(Br)cc3)S2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(C[S@](=O)c1cccc(F)c1)Nc1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111351",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[NH+](CC)CC(=O)Nc1c(C)cccc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177270",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(C)C[C@H](NC(=O)Cc1ccon1)c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210384",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H]1CCC[NH+]1Cc1cccc(OCc2ccc(F)cc2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19483",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COC[C@@H]1CCCN(C(=O)N[C@@H](c2ccccn2)c2ccccc2OC)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102893",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOc1cc(C)ccc1NC(=O)c1nccn2ccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119800",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H](NC(=O)Nc1cnn(CC(F)F)c1)c1nc(C(C)(C)C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127444",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1nc(=O)n([C@H]2CCCOC2)c(CC)c1CC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153626",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N/C(=N/OC(=O)Nc1csc(-c2cccc(Cl)c2Cl)n1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42416",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)[C@@H]1CCCN(c2cncc(Cl)n2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44286",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CSCC(=O)Nc2ccccc2Cc2ccccc2)on1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180839",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(C)cnc(CNC(=O)N(C)C[C@H](C)O)c1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173913",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)[C@](O)(C(=O)[O-])[C@@H](C)c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205026",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(C1=C(O)C(=O)N(CC[NH+]2CCOCC2)[C@H]1c1ccc(Cl)c(Cl)c1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181738",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1cc[nH+]c1C1CCN(C(=O)COc2cccc(F)c2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230465",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc([N+](=O)[O-])c(C(=O)NC[C@@](C)(O)c2ccsc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94180",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CNC(=O)[C@H]1CCCN(Cc2nc3c(s2)C[C@H](C)CC3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47462",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COCCN1C(=O)C[C@@](CC(=O)N2C[C@H](C)O[C@H](C)C2)(c2ccccc2OC)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107509",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)S/C(=C/c2ccccc2OCc2ccc(Br)cc2)C1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140812",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1CN(C(=O)C2CC2)[C@@H](C)CN1C(=O)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149125",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=[N+]([O-])c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46616",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H]1CN(C(=O)Nc2ccc(O)c(C(=O)[O-])c2)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120799",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCCCCN(C)S(=O)(=O)c1cc(Cl)cc(C(=O)[O-])c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16410",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1cc(/C=C2\\NC(=S)NC2=O)ccc1OCc1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124740",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[NH+]1CCCN(C(=O)[C@@H]2CN(C(=O)NCc3ccco3)CCO2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231277",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2ccc(C(=O)c3nccn3C)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC1CCN(C(=O)[C@H](C)Oc2ccccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10304",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C[NH+](C)C[C@@H]2COc3ccccc3O2)cc(=O)n(C)c1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(N2C(=O)C(c3c([O-])[nH]c4ccc(Br)cc34)=NC2=S)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185651",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](NC(=O)c1cc(-c2cccc(Cl)c2)no1)C(N)=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223390",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COCCC1(C[NH2+][C@H]2CCOc3c(C(C)C)cccc32)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131064",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN(C(=O)/C=C/c1ccccc1)C1CC[NH+](Cc2ccncc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200664",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCC(=O)N1CCCC[C@@H]1C(=O)NN=C(c1ccccc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123356",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCC(CC)(CO)NC(=O)Nc1cc(Br)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80589",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@@H](NC(=O)c1ccc(F)nc1)c1cccc([N-]S(C)(=O)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15508",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNS(=O)(=O)[C@@H]1CC[NH+](Cc2nc(-c3ccc(F)cc3)no2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133297",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CSC[C@H](C)C(=O)N1CCN(Cc2nc(-c3ccccc3C)no2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88506",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C2=NO[C@H]3CN(C(=O)C4CCN(S(C)(=O)=O)CC4)C[C@H]23)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63588",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@@H]1COc2ccc(F)cc2C1)N1CCN(c2ccccc2)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155829",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H]1Cc2cc(S(=O)(=O)NCCC3=CCCCC3)ccc2N1C(=O)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223240",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCC[C@@]([C@H]([NH3+])Cc2cnn(C)c2)(N(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238388",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cncc(Cc2nnc3n2CCN(c2nccc(C4CCCC4)n2)CC3)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163978",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ncc(CN2CCC[C@H]2c2noc(C3CC3)n2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120502",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1nc(-c2ccncc2)ncc1[C@@H](C)[NH2+]CC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17765",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H](NC(=O)Nc1cccc(C#N)c1)c1noc(Cc2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CN(C)C(=O)N[C@H](C)COCC(C)C)s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37995",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COC[C@@H]1CCCN(C(=O)c2ccc(NCc3ccncc3C)nc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13893",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCS[C@@H]1CCCCN(C(=O)NCCCCn2cc[nH+]c2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225793",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2C[C@@H](C(=O)NCCS(=O)(=O)N3CCc4ccccc4C3)CC2=O)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140970",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc(NC(=O)N2CCC[C@H](c3nnc(C(=O)Nc4ccccc4C)s3)C2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17102",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc([C@@H](C)OC(=O)[C@@H]2CC(=O)N(CC(F)(F)F)C2)n1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11981",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1c(C(=O)NCC(=O)NCC(C)C)cnn1-c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47176",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(C1CC1)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216532",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(CN2C[C@H](C(=O)Nc3ccc(Br)cc3Cl)CC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235188",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNC(=O)[C@@H](NC(=O)N1CCn2c1nc1ccccc12)[C@@H](C)CC by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81881",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1nc(C[C@@H]2CCC[NH+](Cc3cnc(C)n3-c3ccccc3)C2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73274",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(=O)Nc1ccc(NC(=O)CN2C(=O)C=C(c3ccccc3)Nc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163274",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC1(Cc2ccc(Cl)s2)C[NH2+]C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16513",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1sc2nc(S)n(Cc3cccs3)c(=O)c2c1-c1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(Nc1nc(-c2ccccc2)cs1)c1cccc(F)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)c1ccc2cc(C(=O)Nc3ccc(NC(=O)CN4CCOCC4)cc3)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86618",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(-c2nc3cc(C(F)(F)F)ccc3n2Cc2ccccc2)c(=O)n(C)c1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165539",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CNC(=O)c1ccc(CN(C)C(=O)C[C@@H](NC(C)=O)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195723",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc2c(cc1C)/C(=C/C(=O)[O-])CO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nc2c(cnn2C(C)C)cc1C(=O)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133479",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CNC(=O)c1nn(CC(=O)N(C)[C@@H](C)CC(C)C)c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154181",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C)n(-c2cncc(NCCCc3ccc(O)cc3)n2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245753",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COC(=O)c1nn(-c2ccc([O-])nn2)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100212",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCS(=O)(=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+][C@H]1CCCc2cccnc21)c1ccncc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249439",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CN(C(=O)c2cccc3c2oc(=O)n3C)C(C)(C)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104421",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule NC(=O)c1ccsc1NC(=O)c1oc2ccccc2c1CSCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248485",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C/C(=N\\NC(=O)CNc1cccc2ccccc12)c1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18772",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cc(C(=O)CSc2nnnn2C[C@@H]2CCCO2)c(C)n1-c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143603",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cn1c(=O)n(CC(=O)N2CCN(Cc3ccccc3)CC2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127146",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)n(-c2ccc(C(=O)N(C3CCCC3)C3CC3)cc2)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C)c(S(=O)(=O)NC[C@H](O)Cc2ccccc2)c1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211218",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CN(C(=O)NCCOc1ccc(C#N)cc1)[C@H]1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-c2nc(CC(=O)NC3CCCCC3)no2)c(C)n1C1CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191768",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN(CCc1cccs1)c1cc(Br)cc(F)c1C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)c1ccc2c(c1)[C@@]1(CC(O)=Nc3c1cnn3Cc1ccc(Cl)cc1)C(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46077",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1ccc2c(-c3ccccc3)c(C(=O)Nc3nc(CN4C[C@H](C)O[C@@H](C)C4)cs3)oc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53806",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H]1CCCN1CCc1nc2ccccc2c(=O)[nH]1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96511",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCCc1c(-c2ccc(Cl)s2)n[nH]c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54521",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccsc1CNS(=O)(=O)Cc1cccc2cccnc12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185100",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(=O)CN1C(=O)/C(=N\\NC(=O)COc2cc(C)c(Cl)c(C)c2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244293",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSC[C@@H](C)NC(=O)c1c[nH]c2nccc(Cl)c12 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122680",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1nc2c(C)cccn2c1C(=O)C1=C([O-])C(=O)N(CCC[NH+](C)C)[C@@H]1c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174141",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CC[NH+](C[C@@H]2C=NN=C2c2ccc3cc(OC)ccc3c2)[C@@H](C)C1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75930",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CO[C@@H]1CCCN(C(=O)N[C@@H](c2nc(C)cs2)C2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242728",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1c(F)cccc1O[C@@H](F)C(=O)[O-] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139647",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccc(OCC(F)F)n1)[C@@H]1COCCO1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142667",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc2c(cc1CSCc1nnnn1-c1ccccc1)O[C@H](C)C2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25287",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H](NC[C@H]2C[NH+]3CCN2CC3)C2CC2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182927",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)Cn2cnc([N+](=O)[O-])c2)c(C)n1-c1nccs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1n[nH]c2ccc(NC(=O)c3cnn(CC(C)C)c3C3CC3)cc12 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153875",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C2CC2)n[nH]c1NC(=O)c1cc(C#N)cn1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69478",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc3c(cc(C(=O)NCc4cccnc4)c(N)[n+]3Cc3cccnc3)c(=O)n2c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105499",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CN(C(=O)c2cnccn2)[C@H](C(=O)Nc2ccc(F)cc2)c2ccccc2C)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21174",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CN(C)S(=O)(=O)N[C@H](C)c2ccccc2C)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49236",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@H](Sc1nnc2c3ccccc3n(C(C)C)c2n1)C(=O)Nc1nnc(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13003",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc([C@@H]2C(C(=O)c3cc4ccccc4o3)=C([O-])C(=O)N2c2nc(C)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(NC(=O)C[NH+]2CC[C@@H](C(=O)[O-])[C@@H]2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85461",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H](NC(=O)c1n[nH]c(C2CC2)n1)c1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](c1ccccc1)N(C)C(=O)CS(=O)(=O)C1CCCC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220372",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCC[NH2+][C@H](c1cccnc1)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126530",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)[C@H](C)N(C(=O)NCc1cn(-c2ccccc2)nn1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160766",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC(F)(F)F)c1ccc([C@H](C)[NH2+]C)c(O)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14052",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cc(F)ccc1NC(=O)c1cnn(-c2ccncc2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216443",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2208",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CNC(=O)N1CCN(S(C)(=O)=O)CC1)N1CCOCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2611",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(N[C@@H]1CCc2[nH]ncc2C1)N[C@@H]1C[C@H]2CCCc3cccc1c32 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231700",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1c(CNC(=O)C2C[C@H](C)O[C@@H](C)C2)oc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219144",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nc(C)c(C(=O)N2C[C@H](C)CCC[C@@H]2C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95544",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=CCn1c(S)nnc1-c1ccc(C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(CNC[C@@H](O)c2c(F)cccc2F)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100321",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4108",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)CSc2nccn2-c2cccc(Cl)c2)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103528",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)c1ccc(C=C2C(=O)OC(c3ccccc3)OC2=O)o1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94522",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNC(=O)CS(=O)(=O)Cc1coc(-c2cccc(Cl)c2)n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H](C)CN(C)C(=O)C1=NN(c2cc(C)ccc2C)C(=O)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107058",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCc1ccccc1)C1CCN(C(=O)c2cc3oc(-c4ccccc4)cc3[nH]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21383",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(N/[NH+]=C\\N1CCCc2ccccc21)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232415",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC[C@H](NC(=O)[C@H](C)Oc1cccc(Br)c1)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218223",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCc1nnc(CN2CCO[C@@H](CNc3cccn[nH+]3)C2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnn(C[C@@H](C)[NH2+]CC(C)(C)C)c1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137759",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "729",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C=CCN1C(=O)/C(=C\\NC23CC4CC(CC(C4)C2)C3)C(=O)NC1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cc(Cl)c(C)cc1NC(=O)CSc1cc(=O)n(C)c2cc(Cl)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87645",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)Cc1ccccc1[N+](=O)[O-])c1cccc(N2CCCC2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108527",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[C@]1(C)Cc2nc3sc4c(=O)n(CCc5ccccc5)cnc4c3cc2CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67790",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NCC1(C)Cc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OC(=O)N1CCC(NC(=O)c2nc(C3CC3)n3ccccc23)CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181498",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "336",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1cc(C(=O)N2CCN(C3=NS(=O)(=O)c4ccccc43)CC2)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101897",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS[C@@H](C)c1cccc(NC(=O)N[C@@H](c2nc(C3CC3)no2)C(C)C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75338",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC[C@H](NC(=O)NC[C@@](C)(O)c2ccco2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96455",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(c1ccc2nccnc2c1)N(C[C@H]1CCCO1)c1nc2ccc(Cl)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183789",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C=CCNC(=O)C(=O)NCC1(c2ccccc2OC)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219362",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])C[C@@H](Br)C(=O)c1ccc2c(c1)CCC2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC[C@@](C)(O)c1ccc(F)cc1)c1ccc(NC(=O)NC2CC2)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223493",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc(C)n(-c2cc(Cl)ccc2-c2cncnc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(=O)n1CC(=O)Nc1ccc(N)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38319",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cnc(CNC(=O)N[C@@H]2CCC[C@@H](C(=O)NC(C)C)C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(OCc1cc(-c2ccccc2)on1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6656",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cn1cc(N2CCC[C@@H](NC(=O)NCCNc3ncccc3C#N)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249434",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccccc1CN1CCN(CC(=O)NCc2ccco2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196940",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S1(=O)CCC(C[NH2+][C@H]2CCc3c2ccc(Cl)c3Cl)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34580",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1oc(-c2cccs2)nc1CC(=O)N1CCNC(=O)[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112750",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)c1noc([C@H]2C=C[C@@H]([NH3+])C2)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20826",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cn1ccc(NCc2cc(=O)n(C)c(=O)n2C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99258",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule FC(F)(F)c1cc(-c2ccc(Cl)nn2)cc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96665",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCOc1ccc(C(=O)N(C)C)cc1NC(=O)NCC1CC[NH+](C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47314",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C([C@@H]1C[C@@H]1c1ccccc1F)N1CCCCC[C@@H]1c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115104",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)c1ccc([C@H]2Nc3ccc(S(=O)(=O)N(C)C)cc3[C@H]3C=CC[C@@H]32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152500",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(C[NH+]2CCC3(CC2)C(=O)N(C)C(=O)N3CC(C)C)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCNC(=O)N1CCN(Cc2ncc(Cl)n2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50194",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1NCCN1[C@@H]1CCCN(c2nc3ccccc3o2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(Nc1cccc(Cl)c1)Nc1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64772",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C=CCOC(=O)c1s/c(=N\\C(=O)[C@H]2Sc3cc(C)ccc3[C@H]2Cl)[nH]c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242112",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(N/N=C/c1ccccc1Cl)c1cc(C2CC2)nc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131621",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1CC[C@H](NC(=O)Cc2cccc(OCC#N)c2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c([C@H](C)NC(=O)c2ccc(Cl)s2)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56584",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1ncsc1CNC(=O)N(C)[C@H](C)Cc1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78929",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CN1C(=O)C[C@H](N2CCN(C(=O)C[NH+]3CCCC3)CC2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132639",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc([C@@H](C)Nc2ccc3[nH]c(=O)[nH]c3c2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59552",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nc2ccc(NC(=O)NC[C@H]3CCCN(c4ncccn4)C3)cc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194488",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc2c(c1)CCCN2C(=O)NC[C@H](C)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56029",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule OCC1(CNc2nn3cc(-c4ccc(F)cc4)nc3s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92598",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)n1ccc(C[C@@H](C(=O)[O-])c2cccc(Cl)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151677",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(CO)CCC[C@H]1NC(=O)c1nc2ccccc2c(=O)[nH]1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235193",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@H]1CCSc2c(F)cccc21)c1ccc(NS(=O)(=O)c2cccs2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89584",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1c(C[NH+]2C[C@@H]3CC[C@H](C2)N(CC2CCC2)C3=O)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2c(C)nn(-c3ccccc3)c2/N=C/N2CCOCC2)cc1OC by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164852",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1ccc(O)cc1)C(=O)Nc1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)c1sccc1NC(=O)C1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62464",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COC(=O)c1nn(C[NH+](C)Cc2ccc(Cl)cc2)c(=O)c2noc(C)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150497",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CCCC(=O)N2CCc3ccc([N+](=O)[O-])cc3C2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110829",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nn(C)c2c1nc(N)n2C[C@H]1CC[NH+](C(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154407",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C)c1CN1C(=O)N[C@@](C)(c2cccs2)C1=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138646",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)CN1CCN(C(=O)N[C@H](Cn2cncn2)c2ccccc2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31179",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C=CC(=O)N[C@@H](C)c1nc2ccccc2n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100088",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule c1ccc(-c2nn3c(-c4cccnc4)nnc3c3ccccc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127484",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[NH+]1CCCC[C@@H]1CNC(=O)CSCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30187",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCSc1cncc(Sc2nnc(-c3cc4ccccc4o3)o2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127695",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(Br)c(COc2ccc(CC[NH3+])nc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58359",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Nc1ccc2c(c1)OCO2)C1CC[NH+]([C@@H](C(=O)Nc2ccc(F)cc2)c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12108",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CC(=O)C(/C=N/c2ccc([N+](=O)[O-])cc2)=C([O-])C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182850",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[NH+](C[C@@H]1Cc2[nH+]c[nH]c2CN1)C[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40436",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)C1(NC(=O)[C@@H]2CCCc3sccc32)CCSCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49685",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1nc(C)n(C[C@@H]2CCC[NH+]2Cc2nc(C3CC3)no2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28398",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ncccc1Oc1ccc(C[NH3+])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229490",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(c1cc(Br)ccc1Cl)N1CCC(C(=O)N2CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2oc(C(=O)OCC(=O)NC(=O)NC(C)(C)C)c(C)c2c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ccc2nc(SC[C@H](C)/C(N)=N/O)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132790",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(C/C=C/c1ccccc1)C(=O)C[C@@H]1C(=O)N=C(C)N=C1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202797",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(OCC(=O)O[C@@H](C)CN2CCOCC2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232793",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1OCCN(C)C(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103499",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1C[S@@](=O)[C@H](C)C(=O)NC1CCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116968",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(CC1=NC(=O)[C@H]2SC=CC2=N1)Cc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144364",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)n1ccc(C/C=C/CCCl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199123",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nn(C)c(C)c1CCC/[NH+]=C(/N)Nc1ccc2c(c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67898",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=S(=O)(/C=C/c1ccccc1)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172766",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@H]1C[C@H](C)CN(c2nc3c(c(=O)[nH]2)[C@@H](c2cccc([N+](=O)[O-])c2)[C@@H](C#N)C(=O)N3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114218",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOC(=O)c1ccc(N(CC2CC2)C(=O)c2cccc(=O)n2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148446",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2nc(NC(=O)c3ccc(-c4ccc(C(C)=O)cc4)o3)sc2C)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7949",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2[nH]cc(CC(=O)Nc3cccc(N(C)C(C)=O)c3)c2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCO/N=C(/N)c1cccnc1N1CCCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33633",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(NC(=O)N2CCCN(C(=O)c3ccsc3)CC2)cc1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65597",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(C(=O)N[C@@H](C(=O)/N=c2\\[nH]cn[nH]2)C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77100",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cccc2cc(CN(C[C@H]3CCCO3)C(=O)Nc3ccccc3Cl)c(=O)[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115267",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](C)[C@@H]1CCCC(C)(C)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174829",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(O[C@@H](c1ccccc1)c1nccs1)[C@H]1COc2ccccc2O1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOC(=O)N1CC[C@]2(CCC[NH+](C/C=C/c3ccco3)C2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81313",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C1CN([C@@H]2CCCS(=O)(=O)C2)C(=O)[C@@H]2CCCCN12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174176",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(Cn2c(CNC(=O)c3ccc(OC)cc3)nc3cccnc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCc1cccs1)Nc1ccc2c(c1)OCCCO2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30697",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(C)C(=O)Sc1ccc(COc2cccc(C(=O)N(C)C)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110316",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H](NC(=O)c1ccc(F)cc1)[C@@H](c1cccs1)N1CCN(c2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206923",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(NCc1nncn1CCc1ccccc1)c1cccc(-n2cnnc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(C)n2c(SCC(=O)c3c[nH]c(C(=O)N4CCCC4)c3)nnc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214673",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCCC(C)(C)NC(=O)c1nn(-c2ccccc2)c(C)cc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83813",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+]Cc1ccnn1C[C@@H]1C[C@H]2CC[C@@H]1C2 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112580",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule NNc1cc(COCc2ccc(Cl)cc2)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249035",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN(Cc1nnc(C2CC2)n1C)C(=O)CCc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20880",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c[nH]c(=O)n1-c1ccc([C@H](C)[NH2+]CCN2CCCS2(=O)=O)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166013",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S1(=O)CCC[C@H]([NH2+][C@@H]2CCOC3(CCCCC3)C2)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159654",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=c1ccc(-c2ccc3c(c2)OCO3)nn1C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81764",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@H]([NH2+]Cc1cccs1)c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166916",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule COc1ccc(NC(C)=O)cc1NC(=O)N[C@H](c1cccs1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100399",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(S(=O)(=O)N2CCN(C(=O)[C@@H]3C[C@H]3C)CC2)sc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2c(-c3ccccc3F)nc(Cl)nc2s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@]1(C(N)=O)CCC[C@H]1CCn1nc(C)c(Cl)c1C by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202862",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc([C@@H](Cl)Cc2nc3ccccc3o2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244687",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ccc(C[NH2+][C@H]2CCC[C@H](S(C)(=O)=O)C2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc([C@@H](C)[NH+]2CCC(CO)CC2)n1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188062",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(CNC(=O)N2CCN(c3ccccc3Cl)CC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134306",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)C[C@@H](CNc1ncc(C(=O)N2CCCCC2)cc1Cl)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220569",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(SCC(=O)N[C@@H](C)c2ccco2)n1Cc1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158822",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C1[C@H]2CN(c3nccc4nc(C(F)(F)F)ccc34)CCN2C(=O)N1CCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3921",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ncnc(N2CCC[C@H]2C2CCCC2)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48774",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1ccn(CN2CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC2)c1=S by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99626",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1cc([N+](=O)[O-])ccc1NC(=O)C1CCN(C(=O)Nc2cccs2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72116",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCOC(=O)[C@]1(C#N)C(N)=C(C#N)C2=C(CCCC2)[C@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOc1ccc(S(=O)(=O)NCC2CCN(C(=O)OC)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100166",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]1C[C@@H](O)[C@@]2(C)C(C(=O)[O-])=CCC[C@@H]2[C@@]1(C)CCC1=C[C@H](O)OC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5814",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccn2cc(C(N)=O)nc12 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11048",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH+]ccn1CCCC(=O)N1CSC[C@H]1C(=O)Nc1ccc(C#N)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC(=O)CN1C[C@@H]1C(=O)OCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184416",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccc(F)c1)N1CCN(c2cccc([N+](=O)[O-])c2)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCNC(=O)C[NH+]1CCCC[C@H]1[C@@H]1CCCC1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)CCOC2CCOCC2)ncc1Br by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207794",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(=O)Nc1cccc(-n2cnn(CN3CCO[C@H]4CCCC[C@@H]43)c2=S)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69761",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(N/N=C/c1cccc([N+](=O)[O-])c1)c1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247852",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)C1=NC=C(Br)C1)C(=O)C1=c2ccccc2=[NH+]C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC1CC[NH+](CCNC(=O)c2ccc3c(c2)CCN3C(C)=O)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178435",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(C)c([C@H](O)CN2CCN(CC(=O)NC(C)C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236010",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Clc1ncccc1OCc1coc(-c2cccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3872",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(-c2[nH]nc3nc(-c4ccc(C(F)(F)F)cc4)cc(C(=O)[O-])c23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58332",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C)ccc1NC(=O)C(=O)NCCc1ccccn1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32047",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C([O-])[C@@H]1CS[C@H](c2ncc(-c3ccccc3)s2)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120554",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1c(C(=O)N(C)CC(F)(F)F)nnn1-c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159764",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H]1CN(C(=O)[C@@H]2CC(=O)N(C3CCCC3)C2)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72052",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1csc([C@H](C#N)C(=O)[C@H]2Cc3ccccc3S2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118337",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COCCCNC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175207",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CS(=O)(=O)c1ccc(C(=O)Nc2ccccc2SCC(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79341",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@H](NC(=O)COc1ccc(Cl)cc1Br)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169138",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)OC(=O)c1cccc(-c2ccc([C@H]3[NH2+][C@H](C(=O)[O-])C(C)(C)S3)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4405",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Nc1cccc2c(Cl)ccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)c2oc3c(c2C)/C(=N/NS(=O)(=O)c2ccccc2)CCC3)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(C)(C)c1cnc(S[C@@H]2CCCC[C@H]2O)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157429",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CCC([NH+](C)CC2CC[NH+](CCc3cccc(F)c3)CC2)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78467",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-n2nnnc2SCC(=O)Nc2ccccc2[N+](=O)[O-])cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34078",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nnsc1C(=O)N1CCC[C@H](c2nnc(-c3ccccc3F)s2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)Nc1ccc2c(c1)COC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165440",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@H](C(=O)[O-])N1C(=O)C[C@@H](N2C(=O)/C(=C/c3ccccc3)SC2=S)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule OCCC[NH+]1CCN(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65733",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[C@H]1C(=O)NC[C@@H]1C[C@H](O)C[NH+]1Cc1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192269",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COCc1ccccc1/C([O-])=N/S(=O)(=O)c1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134310",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C(C[NH2+]C[C@]2(C)CCC[NH2+]C2)C1(C)C by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84714",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1cc(C=O)c([N+](=O)[O-])cc1OC[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37154",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)OC[C@@H](O)CI .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91271",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)Nc1nc(CC(=O)Nc2ccc3c(c2)OCCO3)cs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12446",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C=CCOc1cccc(/C=N/NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183536",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](NC(=O)Cc1cccc(F)c1F)C1(N2CCOCC2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204012",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cn1nc2n(c1=O)CC[NH+](Cc1nc(CCc3ccccc3)no1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52487",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C([C@H]1CC(=O)N(c2ccc(Cl)cc2)C1)N1CC(c2nc(-c3ncccn3)no2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38824",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC1CC[NH+](C[C@@H](O)Cn2c(C(F)(F)F)nc3ccccc32)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91668",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(OCC2CC2)cc1)N1CC(O)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92027",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)c2ccc(-c3cnco3)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111698",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC1CCC(NC(=O)C(=O)Nc2ccccc2C[NH+]2CCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58292",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1C[C@@H](C)C[NH+](Cc2ccccc2CNC(=O)[C@@H]2CSC(=O)N2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215884",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H]1CC[NH+](Cc2ccc(C(=O)[O-])cn2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224014",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Clc1ccccc1-c1noc(OCc2cccnc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCOc1ncnc(Nc2ccc3c(c2)OCO3)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151446",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1nccs1)[C@@H]1CCC[NH+]1Cc1ccc(F)c(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97146",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ncccc1C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40768",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1csc(SCc2ccc(C(=O)NCc3ccc4c(c3)OCO4)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80750",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C#CCN(CC(=O)[O-])C(=O)NCc1ccnc(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51001",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(Nc1ccc(OC(F)F)c(F)c1)C(=O)N1CCC2(CCCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38313",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1O[C@@H]2C=C[C@@H]3OC(=O)[C@@H]4C=C[C@H]1C4C32 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169272",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@@H](C)[C@H](C)NC(=O)Nc1ccccc1-n1nc(C)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5325",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule NNC(=O)c1cccc(-c2nc3cc(Cl)ccc3o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160139",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule NC(=O)COc1ccc(NCc2cc(Cl)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180481",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccccc1CCC(=O)N1C[C@H]2CC[C@@H]1CN(S(C)(=O)=O)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191348",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(C)c1ccc(C(=O)N2CCC[C@@H]2c2ncc3c(n2)CC[NH2+]C3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175515",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)=CC(=O)Nc1ccc(C(=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62559",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C)cc(-n2c(S[C@@H](C)C#N)nc3ccccc3c2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174192",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1nccnc1N1CCC2(CC1)c1[nH+]c[nH]c1CCN2CC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61092",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(-c2ccc(NC(=O)C(=O)NC[C@@H](C)[NH+](C)C3CC3)cc2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88627",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(Cn1cc(C(F)(F)F)ccc1=O)NCCc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)[C@]2(c3cc(F)ccc31)N(C)C[C@@H](c1ccco1)[C@@]21SC(=S)N(Cc2ccco2)C1=O by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177407",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNc1ccnc(N2CCC([C@@H](O)c3ccccn3)CC2)n1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102401",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1N[C@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]12 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)COC1CCCCC1)c1cccc2ncccc12 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209495",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc(N2C[C@@H](C(=O)N3CCC[C@@H](c4nn(C)c(=O)n4-c4ccccc4)C3)CC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103245",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C[C@H](O)C1CC1)C(=O)[C@@H]1CSCN1C(=O)c1ccc(Cl)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53907",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1nc(SCC(=O)N(C)Cc2cnn(Cc3ccccc3)c2)c2c(C)c(C)sc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6727",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCS(=O)(=O)c1ccc(Cl)cc1)NCCc1ccc(F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164338",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(CN[C@H](CC(C)C)C(=O)NC)nc2ccccc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150516",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(C[C@H](c1cccs1)n1cccc1)NCc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162685",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CC(C)(C)CCN1CC[NH2+]CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126009",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Cc1cc(F)ccc1F)N1CC[C@@H](Cc2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31860",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc(-c2cc(-c3nnc4sc(-c5ccccc5)nn34)[nH]n2)cc1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30825",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccn2cc(CC(=O)N3CCC[C@@H](n4cc[nH+]c4C)C3)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(S(=O)(=O)Nc2ccccc2C(=O)NC2CCCCC2)cc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202922",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCO)c1ccc(Oc2nnc(-c3ccccc3)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85096",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCSc1sccc1[C@@H]1C(C#N)=C(N)N(c2cccnc2)C2=C1C(=O)C[C@@H](c1ccccc1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229046",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CN1CCN(C(=O)CSc2ccc(Cl)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@@H](CC(=O)NC[C@@H]1C[C@H](O)C[NH+]1Cc1ccccc1)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(=O)oc2cc(OCC(=O)N3CCN(CC(=O)N4CCCC4)CC3)ccc12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148132",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(N(CC(=O)NC2CC[NH+](C)CC2)S(C)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186448",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(C)c(CC(=O)Nc2nnc(Cc3ccc(C)c(C)c3)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110056",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)NC(=O)[C@H](C)Nc1ccc2c(c1)CCN2C(C)=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196475",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1cc2c(oc(=O)c3cc(C)cc(OC)c32)c2c([C@H]3O[C@@H](C)[C@@H](O)[C@](C)(O)[C@H]3O)ccc(O)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163445",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1222",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COC(=O)c1ccc2c(c1)CCN2C(=O)c1ccn(-c2cccc(F)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225430",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=Cc1ccc(-c2cccc(C(=O)NC3CC3)c2)cc1O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28110",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(S(=O)(=O)[C@@H](C)C(=O)Nc2ccccc2C(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72762",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C(COC(=O)Cn1[nH]c(=O)c2ccccc2c1=O)NCc1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)[C@@H]([NH3+])[C@H](C)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67848",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(NC(=O)c2nn(C)c3c2CS(=O)(=O)CC3)s1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235245",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)c1ccc(N2CCN(CC(=O)N3CCNC3=O)CC2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16313",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](Cc1nnc(SCC(=O)c2ccc(F)cc2)o1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100255",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1C(=O)N(C)[C@@H](C)c1ccccc1F by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccc(CS(=O)(=O)c2nccn2-c2cccc(Cl)c2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81389",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C(=O)c2ccccc2Cl)c(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)CCCNC(=O)C(=O)Nc1ccc(N(C)C)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106708",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc(C(=O)N[C@@H](C)c2ccc(C)c(C)c2)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111278",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)c1ccc(C(=O)/N=C2/N=N[C@@H](c3ccco3)S2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195778",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#C[C@H](C)OC(=O)[C@H](C)c1ccc(OC)c(OC)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89297",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)Nc1ccccc1OCC(=O)N1CCN(C(=O)c2cccs2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196548",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule OCCN1CC[NH+](C2CCN(C3CCCCCC3)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140912",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(C(=O)NC(=S)Nc2ccc(C)c(C)c2)cc1[N+](=O)[O-] by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CN([C@@H]1CC[NH2+]C1)[C@@H]1CCC[C@H](S(C)(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133539",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cc(C)nc(N/C(=N/C(=O)c2cccs2)[N-]CCc2c[nH]c3ccccc23)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76411",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OC[C@H](O)CN2C(=O)N[C@](C)(c3ccc(C(F)(F)F)cc3)C2=O)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26925",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CC[C@@H](NC(=O)Nc1ccc(C(=O)N(C)C)c(C)c1)c1ccc(C)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5562",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCOC(OCC)[C@@H](O)[C@H]1CCCC[C@@H]1CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]C[C@@H]1CN(C(=O)N2CCCCC2)CCO1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88361",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H](Oc1ccc(/C=C\\C(=O)c2ccccc2)cc1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)c1cc(S(N)(=O)=O)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192683",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C1[C@@H]2CN[C@@]3(C(=O)Nc4ccccc43)[C@H]2C(=O)N1C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc2ccccc2c1Br)NC[C@H]1CCCO1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108483",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@H](C)N(c1ccc2[nH]ccc2c1)S(=O)(=O)Cc1cccc(C#N)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86893",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1c(C(=O)OCC(=O)c2cccc(Cl)c2)cccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72335",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc(O[C@H](C)C(=O)N[C@@]2(C)CCS(=O)(=O)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1100",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(NCC[C@@H]1CCCO1)c1cc2c([nH]c1=O)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81946",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC[C@H]1NC(=O)N(Cc2c(F)cccc2Br)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148136",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Nc1ccnc(CN(Cc2ccncc2)C2CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44103",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3929",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ccc(C(=O)N2CCc3ccc(CNC(=O)Nc4ccc(F)cc4)cc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103088",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccc(CS(=O)(=O)NCCNC(=O)c2cccnc2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37919",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(NCCNC(=O)c1ccc(F)cc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146937",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH2+]C[C@@]1(c2ccc(C)c(C)c2)CCC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20552",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@H](Cc1ccc(CC)cc1)c1cncc(Br)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112276",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c([C@H](C)[NH2+][C@H]2CCO[C@]3(CCSC3)C2)c(C)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199634",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(C[S@](=O)C/C=C/c1ccccc1)NNC(=O)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217816",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](OC(=O)c1c2c(nc3ccccc13)/C(=C/c1ccc(Cl)cc1)CC2)C(=O)NC(N)=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60607",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(Cn2c(CNC(=O)[C@@H]3CCCO3)nc3ccccc32)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94194",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(N[C@H]1CCCC[C@H]1N1CC[NH+](C2CCCCC2)CC1)c1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158885",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCOc1ccc(Oc2nc(N(C)C)nc(N(C)C)n2)nn1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C1C[C@H](c2cc3c(cc2Br)OCO3)c2ccc3ccccc3c2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117686",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)CC[C@H]1NC(=O)N(c2ccc(F)cc2)C1=O)c1ccc2c(c1)OCCO2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248300",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCn1cc(CN(C)C(=O)CCn2cc(C(=O)[O-])cn2)c(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97313",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1cc(C)n(-c2cccc(CC[NH3+])c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210983",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=Cc1ccc(N2CCN(c3ccc(C=O)cc3[N+](=O)[O-])CC2)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21075",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1C[C@H](OCCOCCS)CC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172189",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCS(=O)(=O)c1nc2ncc(Cl)cc2s1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79850",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H](C)CNC(=O)c1cccc(C(F)(F)F)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183837",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)c1ccc(O[C@H]2O[C@H]3CO[C@H](c4ccccc4)O[C@@H]3[C@@H](O)[C@H]2NC(C)=O)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(/C=C/c1ccc2ncccc2c1)c1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172191",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC(CC)(NC(=O)C[C@@H]1CCC[NH2+]C1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18662",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1cc(CNC(=O)Nc2ccc(F)cc2Cl)ccc1OCCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25257",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nccc(N(Cc2ccccc2)[C@H](C)CCO)n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108112",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[NH2+]C1(CCNCc2sccc2C)CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90289",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CNC(=O)c1ccc(Cl)c(NC(=O)[C@@H](C[NH3+])CC(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239368",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@@H](/C([O-])=N/S(=O)(=O)c1cccc(OC)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203759",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCN(Cc1ccccn1)C(=O)C1CCC(C(=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178471",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(CNC(=O)C12CC3CC(CC(C3)C1)C2)N/N=C\\c1cccc(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59377",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1c([C@@H]2CCCN2Cc2c(F)cccc2Br)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164953",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(-c2nnc(SCC(=O)N[C@@H](C)C(C)C)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219194",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC(C)COc1ccc(COC[C@H]2O[C@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1NC(=O)C2(CC(C(=O)N3CCN(Cc4cccc(F)c4)CC3)C2)N1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182705",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1oc(C(=O)N(C)c2cccc(C(C)C)c2)cc1S(=O)(=O)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138446",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nc(-c2ccc(S(=O)(=O)N[C@H](C)C[NH+]3C[C@@H](C)C[C@@H](C)C3)cc2)co1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64707",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cn1nc(C(=O)NCc2ccco2)cc1NC(=O)Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2472",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule NC(=O)NC(=O)OCCCN1CCc2ccc(Br)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40288",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOC(=O)c1ccccc1[N-]S(=O)(=O)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237800",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C(=O)NCCN1C(=O)CSc1nccc(-c2ccc(Cl)cc2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101106",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C1NC2(CCCCCC2)C(=O)N1Cc1c(Cl)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120090",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(CN(C)C(=O)C(=O)Nc2ccccc2F)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33264",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CNc1ccc([N+](=O)[O-])cc1C(=O)NCCNC(=O)c1ccc(O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141652",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1ccc(NC(=O)[C@@H]2N=NC3=C2CCc2ccccc23)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164712",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC(CN(CCc2ccccc2)C(=O)[C@@H]2CC=CCC2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88806",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCc1nc2n(n1)CCC[C@@H]2NC(=O)N[C@H](c1ncccc1C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171459",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nnc2n1CCC[C@H]2NC(=O)c1ncoc1-c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183579",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNC(=O)c1ccc(NC(=O)C(=O)N2CCC[C@H](C)CC2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208382",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(C(=O)NC2C[C@@H]3CCC[C@H](C2)[NH+]3C)n[nH]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38784",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(Nc1ccccc1C(=O)NCCC1=c2cc(Cl)ccc2=[NH+]C1)C1=CSCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N(C)C(=O)c2cc3ccc(C)cc3[nH]2)cc1OC by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51151",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(CCC)C(=O)Nc1ccc2c(c1)C(=O)NCC2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42310",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)COc1ccc(NC(=O)C(=O)N[C@@H]2CC=CCC2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236048",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)NC(=O)[C@H]1CCCCN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155886",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccn(Cc2cccc3cccnc23)n1)[C@@H]1CCCO1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC[C@@H](C)NC(=O)[C@H](C)NC(=O)Nc1cnn(CC(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13861",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]Cc1cncc(N2CCC[C@H]3CCC[C@@H]32)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88193",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2c3c(C)nn(-c4cccc(Cl)c4)c3Oc3ncn4nc(C)nc4c32)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179612",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccccc1C(=O)NNC(=O)[C@@H]1CC=CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148329",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1[nH]ncc1CCCNc1ncnc2cc(F)c(F)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186319",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C=CCNC(=O)[C@H](C)SCc1ccc(-n2cccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8795",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COCc1ccc(C(=O)NC(c2cccs2)c2cccs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133324",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(OCC(=O)N(C)Cc2nc(-c3ccccc3)no2)c(Br)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39120",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCS(=O)(=O)[N-]c1ccc2c[nH]nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6353",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "314",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)c([C@H](C)NC(=O)c2sc3nc(C(F)(F)F)ccc3c2C)s1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152047",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(/C=C/c1ccc(N2CCCC2=O)cc1)Nc1cc(Cl)ccc1OC[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)([C@@H]([NH3+])CC1CC1)[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35648",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(=O)C1=C(C)C(C(=O)CSc2nnc(-c3ccncc3)n2-c2cccc(Cl)c2C)=N[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215873",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(S(=O)(=O)CCCn2c3c(sc2=O)C[C@H](C)CC3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80261",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(C)c2oc3c(c(=O)c2c1)[C@@H](c1ccc(Br)cc1)N(CCCO)C3=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170515",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=c1n(Cc2cccc(F)c2)nc2nc(N3CCCC3)ccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234430",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)[C@](C)(C#N)NC(=O)CNc1cc2c(cc1Cl)OCCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73623",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH+](CCC#N)CC[C@H]1CCCC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85274",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)N2[C@H](C)CCC[C@H]2C)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36321",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H](NC(=O)C(=O)Nc1ccc(OC)cc1)c1c(C)nn(C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213238",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc(S(=O)(=O)N2CCN(Cc3nonc3C)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223402",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCn1c2ccccc2c2nnc(S[C@H](C)C(=O)N[C@@H](C)CC)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203724",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CN2CCN(/N=C\\c3ccccc3F)CC2)c(C)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66770",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1OCC[C@@H]1C(=O)N1CCN(Cc2ccc(F)cc2Cl)CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112925",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(Cc2csc(C=O)c2)c(C)c1[N+](=O)[O-] by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48514",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(Cl)cc1NC(=O)[C@H](C)S(=O)(=O)c1cccc[n+]1[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158394",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[NH2+]CCN1C(=O)N1CCOCC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95943",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](Nc1cccc(N2CCCC2=O)c1)C(=O)Nc1ccc(Oc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102368",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc([C@@H]2CSCCN2C(=O)CNC(=O)c2ccoc2C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207011",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Brc1cnc(Sc2nc(Cc3cccs3)n[nH]2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74325",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(NC(=O)C2(c3cccs3)CCCC2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146422",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[NH2+][C@@]1(CO)CC[C@@H](Oc2ccccc2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157564",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1ccc(/[NH+]=c2\\oc3cc(O)ccc3cc2C(=O)Nc2nccs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152572",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC(C(=O)N2CCC(Cc3ccccc3)CC2)C[C@H](C)O1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228875",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc2nc(NC(=O)c3ccc(N4C(=O)CCC4=O)cc3)sc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163091",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(c1cn[nH]c1-c1cccc(Br)c1)N1CCC([NH+]2CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221993",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC(CC)(C(=O)c1cscc1Br)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132860",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccccc1C(=O)NCc1ccnc(OCC(F)F)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39778",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cc(N(C)C)ccc1NC(=O)C[C@H]1SC(N)=NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196251",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)(C)c1csc(C[C@@]2(C(=O)[O-])C[C@H]3CC[C@@H]2C3)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217937",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(C[C@H]1CCCCC[NH2+]1)c1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28919",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H]2[C@@H](c3ccccn3)n3ncnc3N[C@@H]2C)c(C)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115084",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc2nc(N(CC[NH+](C)C)C(=O)c3cc(C)no3)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159739",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule CC1=C(NC(=O)CSc2nc(-c3cccs3)c(-c3cccs3)[nH]2)[C@H](C)N(C)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152198",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CC1CC[NH+](Cc2ccc([S@](C)=O)cc2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202014",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)[C@]12CC[C@](C)(/C(=N/O)C1=O)C2(C)C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23718",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC[C@@H](COC)NC(=O)Nc1ccc2c(c1)oc(=O)n2C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245123",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cc(Cl)cnc1N1CCC2(CC1)OCCO2 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29299",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(C(C)C)cc1O[C@H](C)C(=O)[C@@H](C#N)c1ccc(F)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90236",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@H]3c4ccccc4C=CN3[C@H](C(C)=O)[C@@H]2C1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242333",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+]C/C(=C\\c1cccc(C)c1C)C(C)C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225510",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COCCS(=O)(=O)NC[C@@H](O)c1c(Cl)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83597",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC[C@H](O)C[NH+]1CCC(NC(=O)c2cccc(Cl)c2[N+](=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245472",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(NCCc1cccs1)C1CCN(C(=O)c2cc3ccccc3cc2NC(=O)C2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89943",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1cc(CN2CC[NH+]([C@H]3CCC[C@H](C)C3)CC2)cc(OC)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1Oc2ccc(NC(=O)N3CCCC3(C)C)cc2NC1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167196",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC[C@H]1C(=O)NCCN1C(=O)CCCCOc1cc(C)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145815",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(C(=O)Cc2cccc(O)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule C=COCCC[NH2+]Cc1ccc(Br)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95611",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC[NH+](CC(=O)NCCC#N)Cc1ccc(Br)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236772",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C/[NH+]=C(/NC[C@@H](C)c1cccs1)N[C@H]1[C@@H]2CCO[C@@H]2C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177053",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)nc(NNC(=O)c2cc(-c3ccncc3)nc3ccccc23)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206769",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(-n2ccnc2)nc1)N1CCCC[C@H]1CCc1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228942",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(C)CSc1nnc(-c2ccoc2C)n1C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72177",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSCC[C@@H](C)N(C)C(=O)c1ccc(N)c([N+](=O)[O-])c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82612",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1C[C@H]([NH+](C)Cc2ccc(N3CCCCCC3)cc2)CCN1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182966",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COCc1cc(NC(=O)N(C[C@H]2CCOC2)C2CC2)ncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31229",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc(NC(=O)[C@H]2CCO[C@H]2C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82992",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCOCc1ccc(NC(=O)COc2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247087",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCSC1=C(C#N)[C@@H](CC(C)C)C2=C([O-])CCCC2=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105731",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc(C(=O)NCc2ccc(N3CCOCC3)cc2)c(C)n1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59610",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc([C@H](CC[C@@H]2CCCCO2)[NH2+]C)c(Br)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6417",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(NC(=O)c2cc(C3CC3)nc3c2cnn3C(C)C)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC(=O)N1CCc2sccc2[C@H]1C(=O)OC by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27788",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(=O)c1ccc(NC(=O)Cc2c(C)nc3nc(-c4ccccc4Cl)nn3c2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50705",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)CN(C)S(=O)(=O)c2ccccc2)cc1C by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91092",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1nccn2ccnc12)N1CCC[C@@H]1c1nc2ccccc2s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29056",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(C)c2cc(C(=O)NC[C@@H](C)C[C@@H](C)O)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110868",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CNC(=O)C[NH2+]C[C@H]1CCCN(S(C)(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=[N+]([O-])c1ccc(S(=O)(=O)NCC[C@@H](O)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126967",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)[C@H]1CC[C@H](OC(=O)c2sccc2SC(F)F)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(C)n2nc(C(=O)NCc3nccc4ccccc34)nc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142171",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC1(CC)CCN(c2nc(C)c(C(C)=O)s2)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28434",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(OCC(=O)N2CCN(c3cccc[nH+]3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31817",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cn1c(=O)c2c(ncn2CCOc2cccc(C#N)c2)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8329",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)c1ccc(F)cc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181663",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC(=O)N(C1CC1)[C@H]1NN=C(S[C@@H]2C(=O)[NH+]=c3ccccc3=C2C)S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151871",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCN(C1CC[NH+](Cc2ccc(F)c(C(F)(F)F)c2)CC1)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95154",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)C(=O)NCC[NH2+][C@@H](C)C[C@@H]1CCCCC[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(CSc1nc2cc(Cl)ccc2o1)Nc1cc(F)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237899",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CSc1ccc(Cl)cc1NC(=O)NCCc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202021",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C(=O)NC(=S)N2CCN(C)CC2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130062",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCCO)N1CCN(C[C@@H]2CCCO2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242178",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)NN1C(=O)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20263",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(N(CCC#N)C(=O)COc2ccc(F)cc2F)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56708",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cc(CC(=O)NCC2([NH2+][C@@H](C)c3ccccc3)CCCC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72494",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccsc1[C@H](C)[C@H](C)[NH2+]C(C)C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(N2C[C@H](C)Cn3c2nc2c3c(=O)n(CCc3ccccc3)c(=O)n2C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29178",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule N#C[C@H](NC(=O)C[C@H](O)c1ccccc1)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122305",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC(=O)N1C=Cc2ccccc2[C@@H]1CC(=O)NCCCCC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60231",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CNC(=O)/C(C#N)=C/c1cn(-c2ccccc2)nc1-c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78989",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@]1(CNC(=O)N2CCC(OCc3ccccc3F)CC2)CCCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169655",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[n+]1c(/C=C2\\Sc3ccccc3N2C)ccc2cc(C)ccc21 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201919",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nn(C)cc1[C@H]1C[C@H](C(=O)Nc2ccccc2C(F)(F)F)N(C)S(=O)(=O)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)N(C(=O)COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246307",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+](C)Cc1ccccc1C/[NH+]=C(/N)N[C@@H]1CCOc2ccccc21 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80279",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)[C@@H](C)N1C(=O)S/C(=C/C=C/c2ccc(OC)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(=O)NCCNc1cc(C)[nH+]c(N2CCCCC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196233",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nccn1-c1cncc(N2CC[C@@H](S(=O)(=O)NC(C)C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211475",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1C(=O)[C@@]2(C(C(=O)OC)=C(N)OC3=C2C(=O)CCC3)c2ccccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54626",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NC[C@H](O)c1ccoc1)c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230275",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1c(C(=O)NC(C(N)=O)C(N)=O)cnn1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113626",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C1NC2(CC[NH2+]CC2)C(=O)N1CCc1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121985",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC1(OCC)[C@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)[C@H]1C(=O)C=CC(=O)[C@H]12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule C[C@@H](NC[C@H](O)c1ccncc1)c1cc(F)c(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20368",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@H](c1ccc(Cl)cc1Cl)[NH+]1CCC(OCCC[NH3+])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133556",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=Cc1c(Cl)cccc1Sc1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135106",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(=O)Nc1ccc(-n2nnnc2SCC(=O)N(C2CCCCC2)C2CCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93648",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)[C@H]2CCc3[nH]c[nH+]c3C2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108418",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)Cc1csc(-c2cccs2)n1)c1ccc2c(c1)NC(=O)CO2 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109962",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1ccc([C@H]([NH3+])c2n[nH]c(C)n2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183123",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(/C([O-])=N/S(=O)(=O)C[C@H]2CCCCO2)o1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C(C)(C)C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1CCN(C(=O)c2ncoc2-c2ccco2)c2ccccc21 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184520",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(CCc1ccsc1)OCC(=O)c1ccc[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136961",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC1(C)[C@H]2CC[C@]1(C)[C@H](NC(=O)NCc1nnc3n1CCC3)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(=O)N2CCC(c3nnc(C(C)C)o3)CC2)cs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78487",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)Oc1cc(CNC(=O)NC[C@@H](O)C(C)(C)C)ccn1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40327",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC[C@H]1C(=O)N[C@](C)(CC)C(=O)N1CC(C)(C)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100253",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1cccc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3[nH]nc(O)c32)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158496",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(c1scnc1C1CC1)N1CCO[C@@H](c2ccsc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9182",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cccc(N2CCOC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71006",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)Nc1ccc2c(c1)nc(C1CC1)n2C)c1ccccc1F by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64716",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)Sc1ccccc1C(=O)N(C)C1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112449",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1cc(-c2nnc3n(Cc4ccccc4)c(=O)c4ccccc4n23)cc(OC)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21579",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC1(CC)CC[NH+]([C@]2(C[NH3+])CCCS[C@H]2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159960",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](Oc1cccc(Cl)c1)C(=O)N[C@H](CC)c1ccc(C)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14196",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc2[nH]c(C(=O)[O-])c(NC(=O)[C@H]3C[C@H]3c3ccccc3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14675",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1CN(S(=O)(=O)c2cccc(C(=O)NC3(C(=O)[O-])CCCCC3)c2)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242267",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CO[C@@H](CO)CN1Cc1c[nH]nc1-c1ccc2c(c1)OCCO2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216034",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1c(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c(=O)n(C)c(=O)n1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8508",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C=CCn1c(O)nc(O)c([C@H]2[NH2+]CCc3c2[nH]c2ccc(OC)cc32)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93841",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1ccc(C(=O)COc2ccc3c(c2C)O/C(=C\\c2ccccc2OC)C3=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(CNC(=O)C2CC[NH+](Cc3ccc(C#N)o3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78996",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Cc1ccccc1NC(=O)c1cccc2ccoc12)NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199799",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCc1nc(NCC2CC2)nc(OCC(=O)[O-])c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198897",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cccc(NC(=O)c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](c2ccc4c(c2)OCO4)N3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185171",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-n2nnc(-c3nsc(NC(=O)c4cccc(F)c4)n3)c2C)cc1OC by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76776",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1ON=C(c2ccc(Cl)cc2)/C1=C/c1ccccc1OS(=O)(=O)c1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97773",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule c1ccc(-c2nc(CNc3ccc(O[C@H]4CCOC4)cc3)no2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111883",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(COC(=O)c1nc(Cl)ccc1Cl)NC(=O)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150704",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCN(C(=O)c2cccc(S(=O)(=O)NC[C@@H]3CCCO3)c2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COCCN1C[C@H]2CC[C@@H]1C[NH+](Cc1ccc(-c3cc[nH]n3)o1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50272",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nnc(N2CCCN(c3ncccc3C#N)CC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64184",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(Cc1ccc(F)c(F)c1)N1CCS[C@@H](c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc([C@H](C)NC(=O)N[C@@H]2C[C@@H]2C2CCCCC2)s1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59871",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CSCc1ccnc(N[C@H]2CCc3cc(F)ccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(C)Oc1ccc(CNc2cnn(CC(=O)N3CCOCC3)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90223",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(NCC#CCOc1cccc(Br)c1)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175543",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#Cc1cc(F)c(NC(=O)N(C)C[C@H](O)CN2CCOCC2)c(F)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccccc1-c1ccsc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122493",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1CCCN(C(=O)Nc2ccc(CCC(F)(F)F)cc2)[C@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1CCCCN1C(=O)c1ccc(S(=O)(=O)N2C[C@@H](C)C[C@@H](C)C2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112802",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(/C(C#N)=C/c2ccc(N(C)CCC#N)cc2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148020",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C1CCCC[C@H]1[C@@H]1CCCCN1C(=O)[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244636",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(C(=O)NNC(=O)CCSc2ccc(F)cc2)c(C(C)(C)C)n1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194596",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccncc1NCCCOc1ncc(C(F)(F)F)cc1Cl by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225951",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@](O)(C(=O)N/N=C/c1ccccc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC[C@@]2(CC(=O)NC(=O)[C@@H]2c2ccc(Cl)cc2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198679",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1cc(NC(=S)NC(=O)c2cccc(Cl)c2)ccc1NC(=O)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77827",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H]1CCCN(c2ccc(C(=O)O[C@@H](C)C(N)=O)cc2[N+](=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128160",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H](O)C[C@H](C)CNC(=O)c1cccc(F)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1n[nH]c2c1[C@@H](c1ccc(F)c(Br)c1)C(C#N)=C(N)O2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[NH+](CC)[C@](C)(CC)[C@@H](O)Cc1ccc2c(c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123177",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NCCN1CCOCC1)[C@H]1CCCC[NH+]1Cc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNC(=O)COc1c(F)cc(CO)cc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99588",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[NH+](CC(=O)NC(C)C)[C@H]1CCCC(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133323",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NC(=O)c2cccc(F)c2)ccc1NC(=O)C(C)C by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242419",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COC(=O)NCc1ccc(NC(=O)N2CCC[C@H]3CCC[C@H]32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204765",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C1CC1)N(C)C(=O)N[C@H](C)c1ccc(NC(=O)NC2CC2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cn1c(-c2cscn2)nc2ccccc21)NC[C@@H]1CCCO1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Oc2ccc(NC(=O)NC3CCC(O)CC3)cc2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([N+](=O)[O-])ccc1OCC(=O)N1N=C(c2ccc(Cl)cc2)C[C@H]1c1ccco1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(C(=O)N2CCCC2)cc(NC(=O)CCc2ccccc2)c1=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171340",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1cc(C)c(S(=O)(=O)N2CCCCC2)cc1[N+](=O)[O-] by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129360",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H]1CCO[C@@H]1c1ccccc1)N(Cc1ccccc1)C1CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219588",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)C=C(C(=O)NCCc1cccc(C(N)=O)c1)CO2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199681",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(/C=C/c1ccccc1)Nc1nc(CC(=O)N2CCN(C(=O)[C@@H]3CCCO3)CC2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)CNC(=O)c2ccc(S(=O)(=O)Nc3ccc(F)cc3)cc2)c1C by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)c1cn(C2CCC(NC(=O)C(C)(C)C)CC2)nn1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19197",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule NC(=O)c1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64352",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CCC2CCN(C(=O)CNC(=O)c3ccccc3Cl)CC2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113064",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1cc(Cl)c(C)cc1NC(=O)C[C@@H](c1ccc(F)cc1)N1Cc2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81295",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc2nc[nH+]c(N3CCN(c4ccc(F)cn4)CC3)c12 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161017",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(-n2c(C)c(C[NH2+]Cc3ccc(F)cc3)c(C(=O)[O-])c2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180884",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C(NCC(=O)N1CCC(Cc2ccccc2)CC1)c1cnn[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCc1nn(CC)c(CC)c1C[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225917",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CNC(=O)[C@@H]1CCC[NH+]1CC(C)(C)C(=O)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11571",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)CC1=NN=C2CCN(C(=O)c3ccc4c(c3)CCO4)C[C@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)[C@@H]1C[C@](CC#N)(c2ccccc2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235612",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc([C@@H]2CCCCCN2C(=O)[C@H](O)c2ccccc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36871",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC1CCN(c2ccc(C(=O)N3CCN(c4ccc(C(F)(F)F)cn4)CC3)cc2[N+](=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NCCc1cn2ccccc2n1)c1nc2c(s1)CCCC2 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87122",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Nc1c(N2CCN(c3ccc(F)cc3)CC2)ncnc1N1CCN(c2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76881",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(Cl)cc1/N=C1/S[C@H](CC(=O)Nc2c(C)cccc2C)C(=O)N1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199423",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc2c(c1)CN(Cc1cnnn1C)[C@@H](c1ccccc1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126073",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C(=O)N1CC[C@H]2NC(=O)N(c3ccc(C)cc3)C(=O)[C@H]21 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154225",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule NC(=O)N1CCC[C@@H](C(=O)N[C@H]2CCSc3c(F)cccc32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17217",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nc([C@@H]2CCCN(C(=O)c3cccc4ncccc34)C2)ncc1C(=O)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195560",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(C(=O)N[C@H](C#N)c2cccc(Cl)c2Cl)cc1[N-]S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83067",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccccc1F)NC[C@H]1CC[NH+](CC(F)(F)F)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20002",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H](C#N)NC(=O)CCOc1c(C)cccc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134107",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[C@@H](C)CN(C(=O)C(=O)Nc2ccccc2N2CCCC2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73837",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1nn(CCCC(=O)N[C@H]2CCCC[C@@H]2C)c(=O)c2c1sc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33967",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@H](NC(=O)CCOc1cccc(C=O)c1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167136",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](N[C@@H](Cc1ccccc1)C(=O)N1CCCCC1)c1cncc(F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](CO)NC(=O)c1csc(-c2ccc(Cl)cc2)n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139115",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCS(=O)(=O)c1ccc2oc(SCC(=O)N3C[C@H](C)O[C@H](C)C3)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81964",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(c1cc2c([nH]c1=O)CCCC2)N1CCC[C@H](OCc2ccccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(=O)Nc1cc(C(=O)Nc2ccc(C(C)=O)c(C)c2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210806",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(SCC(=O)N2CCN(c3ccc(OC)cc3)CC2)nnc1-c1ccco1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174651",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(c1ccc(-c2ccco2)[nH]c1=O)N1CC[C@@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc(OCc2nccs2)cc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194393",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc(CC(=O)NCc2nc(-c3cccc(Br)c3)no2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194380",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(C(=O)N[C@@H]2N=C3[C@H](CC[C@@H]3C(=O)NCCc3c[nH]c4ccccc34)S2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157704",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)C[C@@H](C)NC(=O)N1CCC([C@@H](C)O)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192440",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cccc([C@H]2C3=C(CCCC3=O)Nc3nnnn32)c1OC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165380",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCc1ccc(C(=O)N(CCC#N)CC2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233355",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule [NH3+][C@@](Cc1ccc(F)cc1)(C(=O)[O-])c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C(=O)Nc2cccc([S@@](C)=O)c2)c(C)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1cc(N2CCCC2=O)ccc1Cl)N1CC[C@@H]([NH+]2CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166655",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COCC[C@@H](C)C(=O)Nc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91097",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COCc1c(Cl)cccc1NC(=O)N[C@@H](C)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)n(-c2ccc(C(=O)NC[C@H](C)[NH+]3CCC(C)CC3)cc2)n1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18611",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(C)CNC(=O)[C@@H](C)SCc1coc(-c2ccc(Cl)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27011",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C#CCNC(=O)[C@]1(Cc2ccccc2-c2cccnc2)CCN(C(=O)[C@H]2CCCO2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117132",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)NCc1cccc(COC2CCOCC2)c1)[NH+]1CCCCCC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45945",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cn1ncc2c(N3CCN(Cc4cccc5ccccc45)CC3)ncnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29330",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Sc2ccc(NC(=O)CNC(=O)c3cc([N+](=O)[O-])cn3C)cc2)cc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230540",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CNc1nc(Cc2ccc(OC)nc2)ns1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40546",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)c1c(N)nnn1CCOc1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235778",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCNC(=O)CNC(=O)NCc1ccc(C)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75373",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)c1ccccc1NC(=O)N[C@H](C)c1ccc(NC(=O)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CN1C(=O)c2cc3ccsc3n2C[C@]1(C)C(=O)NCc1ccc(F)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9245",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cncc(NC(=O)C(=O)NCc2ccc(Br)cc2)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@H](Sc1nc(-c2ccccc2F)n[nH]1)C(=O)N[C@@H](C)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50485",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1cccc(CNC(=O)N[C@H](C)c2ccc(Cl)s2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24030",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)C=C(C(=O)N(Cc1ccccc1)[C@H](C)CCO)CO2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150027",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1SC[C@H](C(=O)[O-])N1C(=O)[C@@H]1CSc2ccccc21 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237383",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[NH+](CC)C(C)(C)C(=O)c1ccc(C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120126",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)NC(=O)CNC(=O)c1cc(-c2ccccc2)nc2c1cnn2Cc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165592",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Nc1ccccc1)C1CCN(C(=O)c2nc3c(F)cccc3s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32440",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc([O-])c2c(n1)C[NH+](Cc1cccn1Cc1ccccc1F)CC2 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(c1ccnc(OCC(F)F)c1)N1CCC[C@@H]1c1ccc(O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90621",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC(C)[C@@H]1C[C@@H](NC(=O)CCN2C(=O)COc3ccccc32)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132967",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CNc1cc(C(=O)NCc2cccc(-c3n[nH]c(C)n3)c2)cc(Cl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215733",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC[C@H]1C(=O)NC(=O)C[C@H]1C(CC)CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69667",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(/C(N)=N/O)c(SC2COC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82137",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]Cc1cc(F)ccc1CS(=O)(=O)c1cccc(F)c1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCN1CC[C@@]2(CCC1=O)C[C@@H](NC(=O)c1ccncc1)c1ccccc1O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228990",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccccc1OCc1ccc(C(=O)N2CCC[C@H](C(N)=O)C2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197741",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncsc1C[NH+]1[C@@H](C)CC[C@@H]1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10648",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)c1cccc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCCCC2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCCNC(=O)c1cccc(CNC(=O)[C@]23CC[C@H](C[C@@H]2Br)C3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160558",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(C(=O)NC[C@H]2C(=O)N=C(C)C=C2C)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32780",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1nn(C)c(OC)c1C[NH+](C)[C@@H](C)[C@@H]1Cc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1CC1)c1ccc(CN(C2CC2)S(=O)(=O)c2ccc3c(c2)CCCC3)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188660",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1ccccc1NS(=O)(=O)c1ccc(OC)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77994",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@H]1[C@@H](C(=O)[O-])CCN1C(=O)c1cc2cc(F)ccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40158",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)[C@@H]2C/C(=N\\O)[C@](C)([NH2+]Cc3ccccc3)[C@H]1C2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159601",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(/C=C/C(=O)N2CCN(c3nccs3)CC2)cs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54827",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccccc1NC(=O)[C@@H]1CCCN1C(=O)OCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80769",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC1=C[C@@H]2C=c3ccccc3=C2C=C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181418",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Sc1ccccc1Cl)C(=O)Nc1nc(-c2cccnc2)cs1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135082",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Fc1ccc(-c2ccc(/C=N/c3c(F)c(F)c(F)c(F)c3F)[nH]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211824",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@@H](CC[NH3+])CCC(=O)N[C@@H]1CCCCC1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161224",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(C[N-]C1=NC(Cl)=N[C@H]2N=CN=C12)NCCN1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7196",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1nn(C)c(C)c1C[C@H](C)NC(=O)c1cccc(OCC(F)F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161293",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H]([NH2+][C@@H]1CCOC2(CCCCC2)C1)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56797",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1cccc(C=O)c1)C(=O)N1CCN(Cc2ccncc2)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220742",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2noc(CN[C@@H](C3CCCC3)C(F)(F)F)n2)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25144",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc(NC(C2CC2)C2CC2)c([N+](=O)[O-])c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138202",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CNC(=O)C(C)(C)CNC(=O)c1cccc(OC)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(Nc2ccccn2)c2ccccc12 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206807",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1cccc(C2=NC3(CCN(C(=O)OC(C)(C)C)CC3)NC2=S)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187128",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(C)C[C@@H]([NH2+]CC)[C@@H]1CN2CCC[C@@H]2CO1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200909",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)CC[NH+]2CCN(Cc3ccc(Cl)s3)CC2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119283",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CN1C(=O)c2ccccc2Oc2ccc(C(=O)NC3CCCCC3)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155518",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccn([C@H](C)CC(=O)Nc2ccccc2F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17992",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCC[C@@H]1CCC[C@H]1NC(=O)C(=O)Nc1nnc(C(F)(F)F)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)(C)CC(=O)N1CSC[C@H]1C(=O)NCc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14292",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nn(CCCl)c(C)c1C(=O)NNC(=O)Cc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184246",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C/C(=N\\O)c1ccc(N2C(=O)[C@H]3CC=C(Cl)C[C@H]3C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47162",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(F)(F)F)nc(N2CCN[C@H](C(=O)NC3CC3)C2)c1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120982",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)Nc2ccn([C@@H](C)c3ccccc3)n2)[C@@H](C)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172230",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Nc1cc(-c2ccccc2)nn1S(=O)(=O)c1ccc(C2CCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221425",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(C(=O)CC1([NH3+])CCC1)c1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN1C[C@]2(CCC[NH+](Cc3ccc(SC)cc3)C2)CCC1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccccc1CSc1nnc(COc2ccc(Cl)cc2)o1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51488",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOc1ccc(-n2c(CN[C@H](C)c3ccc4c(c3)OCCO4)nc3ccccc3c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112152",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N#C/C(=C/c1ccc(OCc2ccccc2F)cc1)C(=O)NCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204308",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[C@H](C)N(CC)S(N)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(O[C@@H]2CCC[C@@]([NH2+]C)(C(N)=O)C2)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(NCc1ccncc1)[C@H]1c2ccccc2C(=O)N(Cc2ccccc2)C12CCCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116043",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(-n2nc(C)c3c2OC(N)=C(C#N)[C@H]3c2ccccc2F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@](NC(=O)CSCc1cccs1)(C(=O)[O-])C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107751",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(-c2nc(C[NH+]3CCN(Cc4ccc(F)cc4)C(=O)C3)c(C)o2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45297",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NC(=O)c2ccccc2F)ccc1-c1ccc(CO)o1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149458",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCNC(=O)CNC(=O)NCc1ccc(NC(=O)c2ccco2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98789",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@H]1S/C(=N\\N=C\\c2ccco2)N(Cc2ccccc2C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80367",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(C(=O)c1ccccc1)c1nc(-c2ccc(OC)cc2)cs1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133852",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1OCc1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102136",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccccc1-c1nnc(SCC(=O)Nc2cccc3ccccc23)nc1[O-] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H](C)C[NH+](CCCNC(=O)NCc2ncn(C)n2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112158",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1nc(CNS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233151",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCO[C@H](C[NH2+]Cc2cncn2C2CC2)C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47990",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NCc1cc(F)cc(F)c1)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCn1ncc2ccc([C@@H]3CCCN(Cc4[nH]cc[nH+]4)C3)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171957",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(Cn1c(=O)oc2ccccc21)Nc1ccc(-c2nc3ccccc3o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158332",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](Cc2ccccc2)c2sccc2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121119",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@H](C)N(C)C(=O)Nc1ccc2c(c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCC[C@@H]1[C@H](C)CCCN1C(=O)c1ccc(Cl)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43041",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule C[C@@H]1C[C@H](NC(=O)[C@@H]2C[C@@H]2C)CC(C)(C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](NC(=O)N[C@H]1CCCC[C@@H]1OC)c1nc(C)cs1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@@H](c1ccccc1)c1nc2ccccc2[nH]c1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92715",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule N#Cc1ccc(OS(=O)(=O)c2cccc3cnccc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90818",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cn1cc[nH+]c1CN(CCO)C(=O)[C@@H]1CC2(CC[NH2+]CC2)CN1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49658",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(CNc2ncc(Br)cn2)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142623",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1[nH]c(=O)sc1S(=O)(=O)N[C@@H]1CCCCC[C@@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38685",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(NC(=O)C(=O)NC[C@H](c2cccnc2)N2CCN(c3ccccc3F)CC2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41945",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C2CCN(c3ncnc4onc(C)c34)CC2)c(C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20697",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CN(CCn1cnnc1)S(=O)(=O)N1CCC(C(C)(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169557",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCOC(=O)C1CCN(C(=O)C2(c3ccc(Cl)cc3)CCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14114",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCN(CC)C(=O)c1ccc(NC(=O)[C@@H](C)n2cncn2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88263",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCN(C(=O)CCc2csc(NC(=O)c3ccc(=O)[nH]c3)n2)CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47334",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCN1C(=O)/C(=C\\c2c(N3C[C@H](C)O[C@H](C)C3)nc3c(C)cccn3c2=O)SC1=S by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237830",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1cc(C)n(Cc2ccc(C(=O)N3CCC(=O)N(CCOc4ccccc4)CC3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16744",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(C)c(OC(=O)[C@@H]2C[C@H]3CC[C@@H]2O3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203129",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@H]1CN(CCCCNC(=O)C(C)(C)c2ccccc2F)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112724",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)C[C@@H](O)COc2ccc(F)cc2Cl)c(C)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN([C@]2(C[NH3+])CCCC2(C)C)CCO1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25688",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nnc(/N=C([O-])/C(Cc2ccccc2)=C2/SC(=S)N(Cc3ccccc3)C2=O)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46014",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(CSc1nc2ncccn2n1)N1CCC[C@H]2CCCC[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58358",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccccc1C[NH2+]CCc1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69666",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)C1CCN(C(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cccs2)CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173311",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(NC1CC[NH+](Cc2ccc(Cl)cc2)CC1)c1cncc(F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225608",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C1CC2(CCCC2)C(=O)N1CC(=O)N(c1ccccc1)[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125058",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)Nc2cc(C(C)(C)C)nn2C(C)(C)C)C[C@@H]1O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222509",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[S@@](=O)[C@H]1CCCC[C@@H]1NC(=O)CNC(=O)c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61067",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1/C=C1\\Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "549",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule NC(=O)[C@@H]1CCCCN1C(=O)N[C@H]1C=C[C@@H](C(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(C)c1[C@@H]1CCCN1C(=O)NCCCc1ccc(Cl)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141687",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(c1nc(Cl)ccc1Cl)N1CCN2C(=O)NC[C@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2C(=O)C[C@@H](Nc3ccc(S(=O)(=O)[N-]c4nccs4)cc3)C2=O)cc1Cl by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83836",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(C)c(O)c(NC(=O)[C@@H](C)[NH3+])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154150",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(N1CCCc2ccccc21)C1(c2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235291",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(C)cc(CS(=O)(=O)Cc2cccnc2C#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1noc(COc2cccnc2F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87413",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC[C@]1(c2ccccc2)NC(=O)N(CC(=O)NC(C)(C)CC)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)c1cc(C)ccc1NC(=O)c1cccc(Nc2cnn(C)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111310",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O[C@H](COc1cc(Cl)ccc1Cl)CSc1nc(-c2ccncc2)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226510",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc(C(=O)Nc2cccc([S@](C)=O)c2)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42955",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COCCCN(C(=O)[C@H]1CC=CCC1)[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20645",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CO[C@@H](CNC(=O)N1CCC[C@@H](CN2CCOCC2)C1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H](Cc1cc(Cl)ccc1Cl)[C@@H]1C[NH+]2CCN1CC2 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCc1nn(C)c(OC)c1CNC(=O)N1CCC(CN2CCOCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217391",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccccc1[C@@H](CNC(=O)c1cc2ccccc2oc1=O)[NH+]1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181346",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(NCc1csc(=O)[nH]1)c1coc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34415",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cc(-c2ccccc2)c2c(n1)CCCC2=O by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99894",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H](C)[NH+]1CCC(O)CC1)c1ccc2c(c1)CCCC2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6644",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1cc(C)cc(N2C(=O)[C@H]3[C@@H]4C=C[C@H]([C@H]3C2=O)C42CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40424",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CCNC(=O)c1ccc(Cn2nnc3ccccc3c2=O)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125128",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)sc1-c1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134965",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[NH2+]CC(=O)N1CCC[C@H](CCc2c(F)cccc2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87007",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](Sc1nnnn1C1CC1)C(=O)Nc1ccccc1OC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24616",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCCN(C(=O)c2cc3cc(Cl)ccc3oc2=O)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64064",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([O-])[C@H]1CC(=O)N(CCS(=O)(=O)c2ccc(F)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2cc(C)ccc2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213880",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CC[C@H](O)[C@H](C)c2ccccn2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "177385",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(CNC(=O)c2cnc(C)cn2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171412",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCCCCn1nc(C(=O)NC2(C#N)CCCCC2)c2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109969",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc(/N=C2/COCCN2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2396",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)N2CCO[C@H](C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130692",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1C[C@H]1C(=O)NNc1cc(C#N)cc(Cl)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8901",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cn1nccc1C(=O)Nc1nc2ccccc2n1CC[NH+]1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@H](C(OC)OC)[C@H]1CCOC2(CCOCC2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100708",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NCCCn1cc[nH+]c1)N1CCc2ccc(O)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34930",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(C[NH2+]Cc2c(C)nn(Cc3ccccc3)c2C)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37955",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(NC(=O)c2ccccc2OCc2noc(C)n2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74079",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCOC(=O)c1cccc(NC(=O)Cn2c3c(c(=O)n2-c2ccccc2)Cc2ccccc2O3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule N#Cc1ccc(N(C(=O)c2cc3c(s2)CCOC3)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94508",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc(S(=O)(=O)Nc2nc(C(=O)Nc3ccccc3OC)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211173",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1Cc2cc(S(=O)(=O)NCc3ccco3)ccc2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49176",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1cc(Br)ccc1NC(=O)NNc1cnccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42184",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(Nc2nc(C)cc(C)n2)cc([C@H]2CCC[NH+]2CC(=O)Nc2ccccc2F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccccc1CNC(=O)[C@@]1(C)Cn2c(cc3ccccc32)C(=O)N1CCc1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223605",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)OC1CCC(NC(=O)Nc2cncc3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168745",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cc(C(=O)N2CCN(S(C)(=O)=O)CC2)cc2occc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233395",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1cc(C(=O)N2CCC(O)(c3ccc(C)cn3)CC2)c(C)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49094",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(CC[C@H](O)c1ccccc1)N/N=C/c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(NC(=O)N2CCC[C@H]2C(N)=O)cc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90760",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCc1noc(CC)c1CNC(=O)Nc1cc(Br)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CNC(=O)[C@H](C)NC(=O)c1sc2cccc(F)c2c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218951",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(Cn1ncn2nc(-c3ccccc3)cc2c1=O)NCC[NH+]1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCNC(=O)CN1C(=O)N[C@@](C)(c2ccc(C(C)(C)C)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121060",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]([NH2+]CC1(CO)CCOCC1)c1cncc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65765",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1621",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Clc1cccnc1NC1CC[NH+]([C@H]2CCOC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183358",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(c1ccccc1)N1N=C(c2ccccc2[N-]S(=O)(=O)c2ccccc2)C[C@H]1c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167242",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C)c(C(=O)N(CCC(F)(F)F)CC2CC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114846",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(Br)cc1NC(=O)Cc1csc2nc(-c3ccccc3)cn12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45453",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@H](c1ccc(-c2nc3c([nH]2)CC[NH2+]C3)cc1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101001",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn2c(c1-c1ccc(OC)c(OC)c1)NC(=O)[C@H]2CC(=O)Nc1cccc2ccccc12 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216318",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(Cc1cccc(F)c1)Nc1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[C@@H]1NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20548",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)C[C@H](C[NH+](C)C)NCc1cccc(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166723",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCCC[NH+](C)CC(=O)Nc1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219912",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS[C@H]1CC[C@@H]([NH+](C)CC(=O)Nc2c(C)cccc2CC)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224750",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1OC/C=C/C[NH+](C)C by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)c([C@H](N)C(F)(F)F)c1Cl by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231499",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC(=O)OCc1cn(C)nc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115941",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCc1nn(C)cc1CNC(=O)c1cc(-c2cc(C)sc2C)nc2c1cnn2C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101966",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CS(=O)(=O)c1ccc(C(=O)Nc2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104700",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(CN1CCN(c2ccc(O)cc2)CC1)Nc1nc2ccc(F)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231975",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2[nH]/c(=N/C(=O)[C@@H]3CC(=O)C(OCc4ccccc4)=CO3)sc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6741",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](c1ccccc1)n1c(-c2nccn2CCO)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36361",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Sc1ccccc1)C(=O)NNC(=O)c1csc(N2CCOCC2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52502",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nc2n(n1)CCC[C@H]2NC(=O)Nc1cncc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96180",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc(NC(=O)[C@@H]2CC(=O)N(CCC3=c4cc(Cl)ccc4=[NH+]C3)C2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235662",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CCNC(=O)c2nc3ccccc3s2)on1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49419",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(=O)N1N=C(COc2ccc(Cl)cc2Cl)O[C@H]1c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233224",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(Cc1ccc2c(c1)OCO2)Nc1nc(-c2ccc(Cl)s2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231131",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@](C)([NH3+])C(=O)Nc1ccc(C(F)(F)F)cc1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60295",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ccc(C)c(C[NH+](CCC(N)=O)Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106760",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NCCc1cccs1)Nc1cccc(-c2nnc3n2CCC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccccc1Cl)[C@@H]1CCCN1C(=O)C1CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65766",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(Nc1ccccc1Cl)N1CCN(c2ccc(O)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169476",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(S(=O)(=O)N2CCN(C(=O)[C@H]3C[C@H]3c3ccc(Cl)cc3)CC2)c(C)s1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "354",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2n[nH]cc2CN2CC[C@H](S(=O)(=O)NC3CC3)C2)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13802",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC[C@@H](NC(=O)Nc1cc(OC)c(OC)cc1F)c1cc(F)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145691",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(C)C[NH+]1CCN(C(=O)N[C@H](C)c2ccc3c(c2)OCO3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78796",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC(=O)c1ccc(OC(=O)Cn2nnc(-c3ccccc3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66656",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(S[C@@H](C)C(=O)Nc2ccccc2Sc2ccccc2)n1N by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22714",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=[N+]([O-])c1cccc([C@@H](O)C[NH2+]CCc2c[nH]c3ccccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(/N=C(\\[O-])[C@H]1CCCC[C@@H]1C(F)(F)F)c1cc(F)ccc1F by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121654",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(C[C@@H]2CCC[NH+]2Cc2ccc(-n3cncn3)cc2)C[C@@H](C)O1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243539",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc2occ(CC(=O)NNC(=O)C[C@H]3CCS(=O)(=O)C3)c2cc1C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88330",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule Cc1cccc(S(=O)(=O)Nc2ccccc2N2CCCN(Cc3ccc(F)cc3)C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170978",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O[C@H](Cn1nnc2cc(Cl)c(Cl)cc21)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40685",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCCC[NH+]1CC(=O)Nc1cccc(C(=O)NC2CC2)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5607",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Cl)c(C[NH+]2CCC[C@H](N3CCCC3=O)C2)cc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117843",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cn(-c2ccccc2Cl)nc1NC(=O)C(=O)N[C@@H](CO)c1ccccc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOc1cc(/C=N/N2C(=S)N=N[C@H]2[C@H]2C=C(c3ccccc3)N=N2)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96975",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CN(C)C(=O)C[C@](O)(c2nccn2C)C(F)(F)F)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNC(=O)NC(=O)[C@@H](C)N1CCO[C@H](c2ccc(F)cc2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule N#Cc1cccnc1NCCNC(=O)C[NH+]1CCc2sccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60513",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NC(=O)CCCN1C(=O)c2cccnc2Oc2ccccc21 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138585",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCn1ccnc(NCc2ccccc2CN2C[C@H](C)O[C@@H](C)C2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(NC(C1CC1)C1CC1)C1(c2ccc(Br)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82402",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@](Cl)(c1ccccc1)C1OCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218864",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H]1CCC[C@@H](NC(=O)CNC(=O)C(C)(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)N1CCCC[C@H]1C(=O)N[C@H](C)c1cccc(N2CCCC2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26659",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc([C@@H](C)N[C@H](C)c2c(F)cccc2F)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162346",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1-c1noc(COc2ccc(C=O)cc2Cl)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CCCN(C(=O)c2cc(C3CC3)n(C(C)(C)C)n2)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39160",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1C[C@@H](C)CN(S(=O)(=O)c2cccc(C(=O)NCc3ccc(N4CCCC4)nc3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200936",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOc1ccc(C2=C[C@H](C(=O)N/N=C/c3cc(Br)ccc3O)N=N2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52116",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccc([C@H]([NH2+]C2CCCCC2)c2ccccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143646",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(NC(=O)[C@H]2CCc3nc(N4CCOCC4)ncc3C2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236533",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cc(N2CC[C@H](N[C@H]3CC(C)(C)Oc4cc(F)ccc43)C2=O)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75748",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)N2CCc3[nH]c4ccc(Cl)cc4c3C2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239031",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)NCc2cccc(-c3ccc(C#N)s3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31953",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)Nc1ccc(F)c(NC(=O)[C@@H]2C[C@@H]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95375",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)c1cc(C(=O)N[C@H](C)c2ccc(F)c(Cl)c2)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52173",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1c(C(=O)NCC[NH+]2CCCC[C@H]2C)nnn1-c1cccc2cccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25888",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1ccc2c(c1)cc1c(=O)n(CC(=O)NCc3ccccn3)nc(C)n12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73684",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@H]1OCC[C@@H]1C(=O)NC[C@H](O)c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43090",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(NC(=O)c2cc(-c3cccnc3)on2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233483",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1CCCCC[C@H]1Nc1ccc([N+](=O)[O-])c(N)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104303",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N#CC1(CSc2nnc(-c3ccncc3)o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107169",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1nc([C@H]2CN(C(=O)[C@@H]3C[C@@H]3c3ccc(F)cc3)CCO2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCNC(=O)[C@@H](C)Sc1ccc(NC(C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15424",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCC(CC)(NC(=O)NC[C@@H]1CCCOC1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44880",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule NS(=O)(=O)c1ccc(NC(=O)CCC(=O)N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54795",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOc1ccc(C(=O)N2CCC[NH+]([C@H]3CCN(CC4CC4)C3=O)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22133",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCN(Cc1ccccc1)C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179263",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1Oc2ccccc2N(CC(=O)NCc2cc3ccccc3[nH]2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43178",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)N1c2ncnn2[C@H](c2ccc(Cl)cc2)C[C@H]1c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78997",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc([N+](=O)[O-])o1)N1CCC(c2c[nH]c3ncccc23)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77631",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cccc(CN2CCc3nnc([C@H](C)NC(=O)C4CC4)n3CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158547",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCOCCN(C)C(=O)c1ccc(Cl)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146244",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1c(F)cc(N)cc1S(=O)(=O)N1CCOC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235819",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(-n2nnnc2N[C@H]2CC[NH+]3CCC[C@@H]3C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138038",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Nc1cnc(N(Cc2cccs2)C2CC2)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134818",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](C(=O)Nc1ccc(N2CCCCC2)cc1C(N)=O)[NH+]1CCSCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156952",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COC(=O)Cc1n[n-]c(NC(=O)c2nc(C3CC3)n3ccccc23)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38145",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NNc1nc(-c2ccccc2)no1)c1cnn(-c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)N1C(=O)C[C@@H](NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC1(C)C[C@@H]1[NH2+]Cc1ccc(C(=O)[O-])cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10680",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1CCC[C@@H](NC(=O)COCC(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(=O)c1ccc(NC(=O)N[C@H](C)c2nc3ccccc3[nH]2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(OCC(=O)O[C@H](C)[C@H]2CCOC2)c(C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9705",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CSC[C@@H](CCO)NC(=O)Nc1c(C)cc(Br)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43466",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOC(=O)N1CCC(C(=O)Nc2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209809",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CS(=O)(=O)NCCNC(=O)c1ccccc1I .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3ccc(S(N)(=O)=O)cc3)o2)cc1Cl by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184080",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1[C@H](C)S(=O)(=O)CCN1C(=O)c1ccnc(OC(C)(C)C)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124946",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule N#Cc1ccc(S(=O)(=O)N2CCC[C@@H]2c2ccncc2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204604",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#C[C@@H](NC)C1([NH+]2CCCC2)CCCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225483",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cccs1)C(=O)c1nc(-c2cccs2)n(-c2cccc(F)c2)n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96827",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cn1ncc2c(=O)n(Cc3ccc(NN)nc3)nnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nc(-c2ccc(NC(=O)Nc3ccc4nsnc4c3)cc2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11591",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(C(=O)[O-])cc1NC(=O)c1ccc(Br)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cc(N2C(=O)C([O-])=C(C(=O)c3ccc(C)o3)[C@H]2c2ccc(C(C)(C)C)cc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148974",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(/C=C(\\C#N)c2nc(-c3ccc(C)cc3)cs2)cc([N+](=O)[O-])c1[O-] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCC[C@H](NC(=O)c1ccc(O)c(Cl)c1)C(=O)N1CCc2sccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54085",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1csc([C@@H](C)NC(=O)N2CCC[NH+](CCCc3ccccc3)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54564",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC1=C2C(=O)CCCC2=N[C@@H]1C(=O)N(C)Cc1ccc(OC(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35357",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CCCSC[C@H](O)[C@H](C)CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249315",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCn1c(SCC(=O)Nc2cc(C)n[nH]2)nc2ccsc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163492",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cccc([C@H](C)[NH2+]Cc2ccnn2C)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54157",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1cccc(S(=O)(=O)[C@@H](C)C(=O)NCC(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153379",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nc(CN2C[C@H]3C[NH2+]C[C@@H]3C2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(CC(N)=O)C(=O)C[C@@H]1COc2ccc(C(=O)N3CCOCC3)cc2N1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201211",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Cn1cccn1)OC(=O)c1scnc1C1CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86711",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(=O)N(c1nccs1)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCCC(=O)NNC(=O)c1cccc(S(C)(=O)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139281",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)n(CC(=O)N2CCC(n3c(C4CCC4)nc4cc(F)ccc43)CC2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17034",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(N2C(=O)[C@H]3[C@H]4C=C[C@H](C4)[C@H]3C2=O)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95875",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC[C@@H](C(=O)N1CCc2c(nc(-c3cccnc3)[nH]c2=O)C1)n1cccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22090",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1/C(=C\\c2cc3ccccc3o2)SC(=S)N1c1ccc(F)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13098",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1SCCC[C@H]1[NH2+]Cc1ccc(N(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80523",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)N1CC[C@]2(O)CCN(C(=O)Cc3cc(C)ccc3C)C[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54535",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[NH+](C)[C@@H](CNC(=O)NNC(=O)c1cccc2ccccc12)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123728",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@H](c1ccccc1F)N(C)C(=O)CC[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155120",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCN1CC(=O)N2[C@@H](CC3=c4ccccc4=[NH+][C@H]3[C@@H]2c2ccccc2C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43471",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)NC(=O)CNS(=O)(=O)c1ccc(C(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186626",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1C[C@@H](C(=O)N2CCCCC2)[C@@H](c2ccc3c(c2)OCCO3)O1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76328",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)Nc1c(C)cc(N[C@H]2C[NH+](Cc3ccccc3)C(C)(C)C2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56129",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CS(=O)(=O)CCC(=O)N[C@@H](c1ccccc1)c1ccc2nc[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203227",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(C(=O)NCc2ccc(-c3nc4ccccc4s3)o2)cn1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(N2CCCN(C(=O)[C@@H](C)n3ccnc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94748",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(F)cc1C(=O)C1=C([O-])C(=O)N(CC[NH+]2CCCC2)[C@H]1c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78249",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C=CCO[C@H](C)C(=O)Oc1cccc(-n2cccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185527",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOC(=O)c1c(NC(=O)CSc2n[nH]c(N)n2)sc2c1CC[C@H](C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148976",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1nc(C(C)(C)C)no1)[NH+]1CCC(OCc2ccccc2F)CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22669",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+]1CCN(c2ncnc(NNC(=O)c3ccccc3C)c2N)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(Br)cc1S(=O)(=O)N1Cc2ccccc2C[C@@H]1C(=O)OCC#N by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226960",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=C/C(=O)Nc1cn(C)nc1-c1ccccc1)c1ccc(F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39302",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccccc1[C@@H](Cc1ncnn1C(C)C)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248098",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)NCC(N)=S)cc1O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115493",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc2[nH]cc(CC(=O)NC[C@](C)(O)c3ccsc3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108390",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cc(C)cc(NC(=O)Cn2c(=O)n(CCc3ccccc3)c(=O)c3ncccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@](O)(CCC[C@H]1CCCO1)c1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11354",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nccc1C(=O)NC1CC[NH+](CC2(c3ccc(Cl)cc3)CCC2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152899",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(Nc1ccccc1O)c1ccc2ncsc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130796",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CO[C@H](CNC(=O)C1CC[NH+](C)CC1)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111347",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@@H](Cc1ccc(O)cc1)NC(=O)Nc1ccc(C(=O)N2CCCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70529",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=c1c2ccccc2nc(SCc2cccc(Br)c2)n1C[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccccc1-n1ncc(C(=O)NNC(=O)CC(C)C)c1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154153",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(CNC(=O)[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1)OCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175511",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC[C@@H](c1nnnn1C(C)(C)C)[NH+](Cc1cc2ccc(C)cc2[nH]c1=O)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100793",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(OC)[C@H](C)NC(=O)[C@](C)(N)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118271",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1c(Cl)c(C(F)(F)F)nn1CC(=O)Nc1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116111",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@H]2N=[NH+]C(=S)N2/N=C/c2ccc(OC(C)=O)c(OC)c2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231122",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Nc1cccc(COc2cc(F)c([N+](=O)[O-])cc2F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115867",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1c(N)sc(C)c1-c1ccc(Cl)cc1Cl by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112584",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(=O)C[C@H]1CCCCCN1C(=O)c1ccc(C)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50482",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ccsc1CC[NH2+]C[C@@]1(O)CCCN(CC2CCCCC2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170354",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc(CN2CCN(CCn3cc[nH+]c3)CC2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114012",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule [S-]c1cc(-c2ccccc2)nc(-c2cnccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28766",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule COc1ccccc1/C=C/C=C1\\N=C(c2c(-c3ccccc3)noc2C)OC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229203",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccccc1C1=C[C@H]([C@H]2NC(c3cccc(F)c3)=NO2)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1ccc2nnnn2c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170469",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C(c1ccccc1)C1CCN(c2nccc(Oc3ccc(F)cc3)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120226",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(N)c(C(=O)COC(=O)/C=C/c2cccc(Br)c2)c(=O)n(C)c1=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@@H]1CCCC[C@@H]1[NH+]1CCC(NCCc2nncn2C2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(C(=O)NC[C@@H](c3ccco3)[NH+](C)C)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92310",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OC(=O)N1CCC([NH2+][C@H]2CCCc3sccc32)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1ccc(Cn2c3nc4ccccc4nc3c3c(=O)n(CCc4ccccc4)cnc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215500",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nn(Cc2ccccc2)c(C)c1NC(=O)c1cc2c(Cl)cccc2n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule c1cc(-c2cscn2)cc(N2CCC([NH2+]CCc3cccs3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56724",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)c1ccc(CN2CCc3nnc(CNS(=O)(=O)c4ccccc4)n3CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161164",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1noc(CN(C)c2cc[nH+]c(C(=O)NCc3ccccc3)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62995",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC[C@H]1CC[C@@H]([NH+](CC(=O)OC)C2CCOCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17901",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCC(=O)N1CCCC[C@@H]1c1nc2c(c(=O)[nH]1)CCN(C(=O)c1cccs1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84366",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1C[NH2+]C(C)(C)CN1Cc1nccs1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231849",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc2ccccc2n1CC(=O)Nc1ccccc1C[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147766",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](N[C@@H](c1cccc(Cl)c1)C1CCCC1)c1nccs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131537",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CS(=O)(=O)N1CCCN(CCOc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181525",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CNC(=O)c1ccc(NC(=O)Nc2cnn(CC(C)C)c2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7712",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CO[C@@]1(C)C[C@@H](N(C)Cc2cc(=O)n3nccc3[nH]2)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138536",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cn1c(S[C@H]2CCCCNC2=O)nc2sc3c(c2c1=O)CCC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1ccccc1[C@H](O)[C@@]1(C#N)CCOC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195220",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCN(Cc1ccccc1C)C(=O)N[C@@H](C)c1ccc2c(c1)NC(=O)CO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140712",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cc1cn(C)nc1C(=O)N(Cc1cccnc1)c1nc2c(C(C)C)cccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95511",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(/C=C(\\[O-])c1ccc2c(c1)OCO2)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40276",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCS(=O)(=O)c1ccc(F)cc1)Nc1cccc(Cl)c1Cl by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72328",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)(C)OC(=O)N1CC[C@H]([NH+]2CCCCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87585",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1cccc2cc(C(=O)N3CCC[C@H]3C[NH+]3CCCCC3)oc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67527",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)C[C@H]1COCCN1C(=O)NC[C@@H]1C[NH+](C)CCN1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136795",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCCC1=NN2C(=N)/C(=C/c3ccc(O)cc3)C(=O)N=C2S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208308",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1ccc(F)c(F)c1F)c1cc2c(s1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21632",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COCCCN(C)C(=O)NCC1(c2cccc(Cl)c2)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5626",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(C)(C)C[C@@H](C)NC(=O)NC1CCC(O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13565",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CN(C)c1ccc(C(F)(F)F)cc1NC(=O)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule COc1cc(C)ccc1NC(=O)N1CC[C@@H](C)C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33982",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1cc(OC)cc(-c2ccc(C(=O)[O-])o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102960",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCNC(=O)c1ccc(N(C)CCS(C)(=O)=O)[nH+]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160767",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COC[C@@H](C)NC(=O)NCCC(=O)Nc1ccc(C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230828",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C=CCn1c([O-])c2ccc(C(=O)NC(C3CC3)C3CC3)cc2nc1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131073",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)n1cc(NC(=O)N2CCCC[C@H]2Cc2ccccc2)cn1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65258",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@@H]2Cc3c([nH]c4ccccc34)CN2C(=O)CN1/N=C/c1c(F)cccc1Cl by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63413",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)NCC[C@H]1CCCCN1C(=O)Cc1ccc[nH]1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101529",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCn1c(-c2ccc3c(c2)OCCO3)cnc1SCC(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/[NH+]=C(/NC[C@H]1C[C@@H]1c1ccccc1)N[C@@H]1CC[C@H](SC)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89533",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=c1c2nnc3ncnn3c2ccn1-c1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190897",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccnc1CN1C[C@@H](C)[C@@H]1c1ccccc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24112",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[NH2+][C@@H](C)c1ccc(S(=O)(=O)NC[C@]2(C)CCCO2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C(=N/c1cccn2cc(-c3ccccc3)nc12)\\c1cccs1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143189",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@@H]1[C@@H](Sc2ccccc2F)CCC1(C)C by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107624",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCO[C@@H]1C[C@@H]([O-])C12CCN(C(=O)c1cnc3c(C)cccn3c1=O)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75899",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1ccc2c(c1)C1=NN(C(C)=O)[C@@H](c3ccc(C)cc3)[C@@H]1CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196243",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@@](C)(CCO)[NH2+]Cc1nnsc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226567",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c2ccccc2c1C(=O)C(=O)Nc1ccc2ccccc2n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CC[C@@H](C)[C@@H](C)[NH2+][C@@H]1CCN(c2cnn(C)c2)C1=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83554",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cc(C[C@H](C)N[C@H]2CCOc3ccc(F)cc32)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234395",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1C(=O)NCCN1Cc1cn(Cc2ccccc2)nc1-c1cccnc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137311",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccccc1NS(=O)(=O)c1cccc(NC(=O)Nc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97883",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(c1cnccn1)N1CC(C(=O)N(Cc2ccccc2)Cc2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152010",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C(NN1CCOCC1)[C@H]1[C@H]2C=C[C@H](CC2)[C@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233266",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NCc2cnc(-c3cccnc3)s2)cc(OC)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34574",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[NH+]1CCC(N(Cc2ccco2)C(=O)NCCC2CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159735",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CNC(=O)NCc1cnn(C)c1)c1nc(-c2ccccc2)no1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CCC[S@](=O)Cc2cnc(C)s2)cs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15357",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCC[C@@H]1CC[C@H](C#N)[C@H]([NH+](C)CC)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47969",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1C[C@H](C)C[NH+](C(C)(C)CNC(=O)NCc2cccs2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144659",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C([C@@H]1CCCC[NH+]1Cc1ccccc1OCC1CC1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118831",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[NH2+][C@@H]1c2ccccc2CCC[C@H]1SCC[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc2ccccc2c1)N[C@@H]1CCc2ccccc2C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93161",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1nc(CC(=O)N2CCN(C/C=C/c3ccccc3)CC2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48271",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)C(=Cc2ccc([N+](=O)[O-])o2)C(=O)N(C)C1=S by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24079",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc2nc(C)cc(C(=O)Nc3ccc(C)c(S(N)(=O)=O)c3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221667",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc([C@@H]2C[C@@H](C)[NH+](CC(=O)NCc3cccs3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95492",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(C)cc1S(=O)(=O)N1CCC[C@H](N2CCNC2=O)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1ccccc1F)N(C)C(=O)c1cn(Cc2cccnc2)nn1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228161",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ncc(Cl)c(C(=O)O[C@@H](C)C(=O)c2ccc(Br)cc2)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@@H]1C[NH+]=C(N)N1C1CCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule C[C@H]1CCN(C(=O)c2ccn(-c3ccc(Cl)cc3Cl)n2)C[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)[C@H]2Cc3ccccc3C(=O)O2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51093",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1ccc(C(=O)N2CCCC[C@H]2c2ccccn2)cc1N1CCNC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32707",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCC[NH+](C)C[C@H]1CCN(C(=O)c2sccc2-n2c(C)ccc2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176922",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1ccc(NC(=O)CSc2ccccc2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225075",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=CCSC1=NC(=O)[C@@H]2C(=N1)NC(C)=C(C(=O)OCC)[C@H]2c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11157",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC[C@H](NC(=O)CC[C@H]1CCCOC1)c1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cc(C(=O)CSc2nnnn2C)c(C)n1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC1CCN(c2ccc(C(=O)OCCC(=O)N(C)C)cc2[N+](=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138347",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C(=O)C[n+]2ccn(C)c2C(=O)c2cccs2)cc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67670",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)CCCN2S(=O)(=O)c1ccc(C#N)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232363",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)CCNC(=O)NC[C@@H](C)[NH+]1CCC(C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220853",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(COc1ccc(F)cc1F)c1ccc2c(c1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)N2CCN(c3nnnn3-c3ccccc3)CC2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CC(C)COc1ccc(NC(=O)[C@@H]2CCCN2C(N)=O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128944",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCn1c(C[NH+]2CCCC2)nnc1C1CC[NH+](Cc2coc(C)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45990",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28424",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1n(CCl)nc2ccccn12 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154886",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cn1cccn1)NC(=O)NC[C@H](O)C[NH+]1CCCCC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1CCCN(C(=O)NCC(N)=[NH2+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230106",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1ccc(Cl)c(CC)c1NC(=O)NCc1nnc2n1CCCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202974",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCc1ccc(-c2csc(NC(=O)c3ccccc3SCC(=O)N3CCCC3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41004",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc([C@@H]2N=C(c3cccc(Br)c3)C[C@@H](c3ccccc3O)[NH2+]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18785",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C2CCN(C(=O)c3ccc4cc[nH]c4c3)CC2)n[nH]c1=S by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11734",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@H](C(=O)NN)[NH+](C)CCc1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85041",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc(-c2ccc(=O)n(CC(=O)NCc3ccco3)n2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59025",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ccc2c(c1)OCCCO2)NCCc1ccc(F)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229937",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCC1=C(C(=O)OCC)[C@@H](c2cccc(C)c2)NC(=S)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75646",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nc(C(=O)NC2CCC(C(=O)OC(C)(C)C)CC2)c(=O)[nH]c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116084",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1c(CCC(=O)NCc2ccnc(OC3CCC3)c2)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42889",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccccc1CNC(=O)CS(=O)(=O)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161144",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule [S-]c1nnc(C2CCCCC2)n1/N=C/c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120345",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1OCC[C@@H]1C(=O)N(C)c1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138507",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]1CC[C@@H](Nc2ccc(S(N)(=O)=O)c(N)c2)[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184213",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCN(CC)C(=O)c1cccc(NC(=O)NCc2cn3c(C)cccc3[nH+]2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133421",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@]1(F)CCN(S(=O)(=O)c2ccc(-c3ccccc3)cc2)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149660",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[NH2+][C@@H](c1cncnc1)[C@@](C)(CC)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127699",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)C(=O)NC(=S)Nc1cccc(C(=O)N2CCCCC2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68112",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1csc([C@@H](C)NC(=O)NC[C@H](C)[NH+]2CCc3ccccc3C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H]1CN(c2ccc(Cl)cn2)CCO1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29773",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Brc1cccc([C@H]2CC(c3ccc(I)cc3)=Nc3ncnn32)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23966",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)Oc1ncnc(N(C)[C@H]2CCS(=O)(=O)C2)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79148",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(NCCc1ccco1)c1cc(NC(=O)C2CC2)n(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243045",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(CCC(=O)NCCc2nc3ccc(F)cc3n2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](NC(=O)c2ccc3c(c2)nnn3C)C2CCOCC2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75674",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@]1(C(N)=O)CCC[C@H]1CCSC1CCOCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62441",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](O)C[NH+](CC(F)(F)F)C1CCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "47172",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2oc(-c3ccc4c(c3)OCO4)c/c(=[NH+]/[C@H](C)C(=O)[O-])c2c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217003",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCc1nn(C)c(OC)c1CN[C@H](C)c1ccnc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2ncc([C@@H](C)[NH2+][C@H]3CCc4c(O)cccc43)c(C)n2n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C2=Nn3c(nnc3-c3ccc4ccccc4c3)SC2)cc(OC)c1OC by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71370",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)CC(=O)Nc1ccc(C2=NCCO2)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146036",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc2c(c1)=C[C@@H](CN(C(=O)c1ccc(C(C)(C)C)cc1)C(C)C)C(=O)[NH+]=2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156559",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)NC2(CCN(C(=O)CCCc3nc4cc(Cl)ccc4n3C)CC2)C1=O by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176739",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)[C@H](C)SCc1nc2sc(C)c(C)c2c(=O)[nH]1)C1CCCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165840",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1noc(C)c1CN[C@H](C)c1ccccc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225192",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Nc1ccc(SCc2nc(-c3ccco3)no2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139022",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)c1ccc(F)cc1)C1CCCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138000",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CCC(CC)N(C)c1nc(C(F)(F)F)ccc1/C(N)=N/O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65658",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule CC(C)(C)n1ncc2c(=O)[nH]c(NCC3([NH+]4CCSCC4)CCCC3)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224442",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(Cc1cccc2ccccc12)NNC(=O)c1ccc(NC(=O)C2CCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176518",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cn1cc(Br)cc(NC(=O)N2CCC[C@H]2CC(C)(C)C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122324",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule NNC(=O)c1cccc2c1-c1ccccc1C2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94566",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc2nc(N3CCCCC3)c(C[NH+]3CCCC[C@H]3c3ncon3)cc2c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143453",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCC[C@H]1[NH2+]Cc1cc2c(cc1Br)OCO2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92872",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC[C@@H](O)CNc1nc2ccccc2c(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226597",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)Cc1c(F)cccc1Cl)[C@H]1CCc2ccccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198148",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N1CCC[C@@H]([S@](=O)c2ccc(F)c(F)c2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231874",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCNS(C)(=O)=O)Cc1ccccc1C#N by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168208",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccccc1-n1cc([O-])c(C(=O)N2CC[S@](=O)C(C)(C)C2)n1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181700",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule NC(=O)N1CCC[C@H](C(=O)NCc2cc(-c3ccco3)on2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7999",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(Nc1ccc2c3c(c(=O)[nH]c2c1)CCCC3)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16037",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1ccc(/C=[NH+]/C[C@H]2COc3ccccc3O2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6558",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(CSc1ccc(Cl)nn1)Nc1ccc(Cl)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34139",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](CO)NC(=O)N[C@H](Cc1ccccc1)c1ccccc1F by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222950",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H]([NH2+][C@H](C)c1cccc(OCC(=O)N(C)C)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cc(=O)[nH]c(SCC(=O)[O-])n1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65252",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(S(=O)(=O)NC[C@H]2O[C@@H](CO)[C@@H](O)[C@H]2N2CCN(c3cccc[nH+]3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114471",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nn(Cc2ccccc2Cl)c(C)c1C[NH2+][C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106276",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1sc2nc(SC)nc(-c3ccc(Cl)cc3)c2c1N by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37231",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCCN(C)c1ncnc2c1oc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160536",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCC[C@@H]1CN(Cc1cc2cccc(C)c2[nH]c1=O)C(=O)Nc1cccc(Cl)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11517",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCC(=O)Nc1ccc(NC(=O)CBr)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78353",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OCC(=O)N[C@H](C)CCc2ccccc2)ccc1Cl by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187154",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CNC(=O)N2CC[C@@H](C)[C@@H](O)C2)cc1F by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146560",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CS(=O)(=O)c1cccc(C(=O)N2CCC[C@H]2c2nnc3n2CCCCC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25651",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[NH+](C)CCO[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13941",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc2c(c1)CN(C=O)C2 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85009",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[C@H]1C[C@@H]1NC(=O)/C=C/c1ccc(-n2ccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](C)NC(=O)c1cc(S(=O)(=O)Nc2ccc(C)cc2)ccc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154855",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C=CCc1cc(C=O)ccc1OCCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80488",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H]1C[C@H](Nc2cccc(N3CCCC3=O)c2)CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199410",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCC[C@@H]1C[NH+](C)Cc1ccc(N)c(C)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132281",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)N(C)CC12CC3CC(CC(C3)C1)C2)N1C(=O)[C@H]2CCCC[C@@H]2C1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223270",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(Nc2nn[nH]c2C(=O)NCc2cc(F)cc(F)c2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=C(CCn1cnc2c(Cl)cc(Cl)cc2c1=O)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211512",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1cc(C2CC(C(=O)[O-])C2)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59710",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCN1C(=O)N=C(N)[C@@H]1c1cc(OC)c(OC)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC(=O)NNC(=O)C[C@H]1Sc2ccc(Cl)cc2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205764",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@@H]2Oc3c(OC)cc(/C=C/C(=O)[O-])cc3[C@@H]2CO)ccc1O by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102179",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1nc(C[NH2+][C@H]2CCCc3c2cnn3C)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172047",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC1CCCCC1)C(=O)Nc1nccs1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142977",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(OCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2ccsc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237088",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(NC(=O)[C@@H]2CSCN2C(=O)[C@H]2CCO[C@@H]2C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81724",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C=CCO[C@H](C)C(=O)N[C@@H](c1cccs1)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184646",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1c(CO[C@H]2CC[C@H]([NH3+])C2)cccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99886",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)N1CCCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159802",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCC[NH+](Cc1cccc2cn[nH]c12)[C@H](C)C(=O)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(-c2cc(C(=O)N3CCC[C@H]3c3cc(C)on3)no2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11030",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC1(C)CSC[C@H](N[C@H]2CC[NH+](C3CC3)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52957",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule N#C/C(=C\\c1ccco1)C(=O)Nc1cccc(C2SCCS2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167538",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)C[C@@H](C(=O)NCCc1ncnn1C)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213959",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C1CC[C@H](C(=O)N2CC[NH+](Cc3cccs3)CC2)CN1Cc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196680",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COCc1nc(C)c(C(=O)Nc2ccc3c(c2)C(=O)NC3)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122502",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C/C(=N/NC(=O)CC#N)c1ccc2cc[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173308",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H]1CCC[NH+](CCCC[NH2+][C@@H](C)c2nccs2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "158241",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(N(CCC#N)C(=O)c2ccoc2C)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26949",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC1(C)CC[NH+](Cc2cccc(C#N)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81692",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(C#N)[C@@](NC(=O)c2cccc([N+](=O)[O-])c2)(C(F)(F)F)C([O-])=N1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40731",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CNC(=O)[C@H](C)CN(C)C(=O)Cc1ccc(-c2csc(C)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81846",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)[C@H]2CCCN(c3ncccn3)C2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])CNC(=O)CCCNC(=O)c1cccs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184879",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COC(=O)[C@@H](c1ccccc1)N1C(=O)/C(=C/c2ccc(C(=O)[O-])cc2)SC1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152986",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](NC(=O)COc1cc(F)ccc1F)c1cccc(NC(=O)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146946",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCNC(=O)CNC(=O)N[C@H](CC)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138973",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN1CCO[C@H](CNC2=[NH+][C@H](c3ccccc3)CS2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72468",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1ccc(O[P@@](C)(=O)Nc2cc(Cl)ccc2Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224322",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(C[n+]1ccc2ccccc2c1)c1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245735",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2cc(C(=O)N/N=C(\\C)c3ccc([N+](=O)[O-])cc3)[nH]n2)c(OC)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1cccc(NC(=O)N2C[C@H](C)CC[C@@H]2C)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44287",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc([C@]2(C)NC(=O)N(CC(=O)c3ccc4c(c3)CCC4)C2=O)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105860",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(NC1(c2ccc(Br)cc2)CCC1)C1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154369",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)CCN2C(=O)CN1C(=O)c2ccc(C)cc2C1=O by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135133",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCC([NH2+][C@H]2C[C@@H](Cc3cc(CN4CCN(c5ccccc5)CC4)on3)C2(C)C)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(=O)N1CCOCC1)C(=O)c1cccc(Cl)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccccc1-c1noc([C@H](C)SCC2(CO)COC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131411",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccc(OCCSC2=N[C@H]3CCCC[C@@H]3N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1ccc(OS(=O)(=O)c2ccccc2Br)cc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244102",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[C@@H]([NH2+][C@H](CCC#N)c2ccccc2)c2ccc(F)cc2O1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139985",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@@H](NC(=O)[C@@H](C)NC(C)=O)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243582",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1C(=O)Nc1ccc(C(=O)NNC(=O)/C=C/c2cccs2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66667",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C/C(=C/c1cc(Br)cs1)c1nc(-c2ccc(C#N)cc2)cs1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23320",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc([C@H](C)[NH2+][C@H](C)C(=O)Nc2cccc(C)c2C)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166941",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H]([NH3+])c1ccc(S[C@H](C)CCO)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114137",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(/C=N/NC(N)=S)c(C)n1-c1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52916",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COCCOCc1cccc(NC(=O)N[C@H]2CCCC[C@H]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144473",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[NH+]1CCN(c2ccccc2NC(=O)CSc2nnc(-c3ccccc3F)o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164332",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCCn1nnnc1CSc1cc(N)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173488",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "752",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccc(CN2CCO[C@@]3(CCc4ccccc43)C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204565",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC[C@@H](O)CNC(=O)N[C@H](C)c1ccc(-c2ccc(Cl)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N#C[C@@H]1CN(c2ccc3c(c2)NC(=O)[C@@H]3O)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125204",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COC(=O)c1cc(NC(=O)Nc2ccc(C)cc2)cc(C(=O)OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74042",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)N2CCC(N3CCCC3=O)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151556",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSC[C@H](C)N(C)C(=O)N[C@H]1CCC[C@H](C)C1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116268",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(Cn1cnc2cc(F)c(F)cc21)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215272",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC1(CNC(=O)N[C@@H](C)Cc2c(C)noc2C)CCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103148",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccccc1Cl)[C@H]1CCCN(c2ncnc3[nH]cnc23)C1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27979",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1ccccc1NC(=O)[C@H]1CCC(=O)N(c2ccc(OC)cc2)[C@@H]1c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76886",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)[C@@H](C)Oc1cccc(C=O)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C1C[C@@H](C(=O)N2CCCCC[C@H]2c2ccncc2)CN1CC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150512",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nccn1Cc1cccc(CNC(=O)[C@H]2C[C@@H]3C=C[C@H]2C3)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76124",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(Cl)cc1NCCNc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107066",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1nnc2n1N[C@@H](c1ccc(F)cc1)[C@@H](C(=O)Nc1ccc(C)c(C)c1)S2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210902",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule ON(c1ccccc1)[C@H](Br)[C@@H](Br)c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146576",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NCc2ccnc(-n3ccnc3)c2)c([N+](=O)[O-])c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129646",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](N[C@@H]1CSCc2ccccc21)[C@@H]1COc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58412",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1cccc(N2CCN(C(=O)[C@H]3C=C(c4ccc(C)cc4C)N=N3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188570",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc2c(S(=O)(=O)N3CCC(C(=O)NCC(C)C)CC3)cccc2c1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198412",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]1CN(C(=O)[C@H](C)OCCOC)CCO1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98541",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@@H](NC(=O)c1cnn(-c2ccc(Cl)cc2)c1C(C)C)C(N)=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207285",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](C(=O)Nc1nc2ccc(F)cn2n1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203417",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C[NH+]2CC[C@H](CNS(=O)(=O)C3CC3)C2)oc2ccccc12 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91610",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+]C/C(=C\\c1cc(Cl)cs1)CC by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126031",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(-c2nc(C(=O)N3CCN(c4ccccc4[N+](=O)[O-])CC3)cs2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154594",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1cccc(-c2cc3n(C)c(C)c(CCC(=O)NCc4ccc5c(c4)OCO5)c(=O)n3n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153429",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H]1Cc2c(NC(=O)Cc3ccc(-c4ccccc4)cc3)nn(C)c2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234759",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC1=C2C(CSc3c(Cl)cccc3Cl)=CC(=O)N=C2S[C@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184143",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H](C)[NH+]2CCCC[C@@H]2[C@@H]2CCCN2)cc1F by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161588",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)CC[C@@H](C)NC(=O)Nc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111911",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule O=C(OCc1nncn1C1CC1)[C@H]1C[C@@H]1c1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21379",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2cccc(N3CCCC3=O)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168738",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(F)cc1C[NH+]1CCN(CC(=O)Nc2sccc2C#N)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19683",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]1C[NH+](CC(=O)c2ccccc2F)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cl)cc1N(C)C(=O)c1nn(C)c2c1COc1ccccc1-2 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38003",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)CC(C)(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124240",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc([C@H](C)OC(=O)Cc2c(F)cccc2F)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218982",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cccc(OCC(=O)Nc2scnc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154668",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Nc1ccccc1-c1nc(-c2ccco2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2[nH+]c(CN3CCN(S(=O)(=O)c4cc(C)sc4C)CC3)cn2c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18197",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc(C(=O)N2CC[NH+](Cc3nc(-c4ccc(C)cc4)oc3C)CC2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76795",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)CSCC(=O)N(C)[C@H]2CCC[C@@H](C)C2)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184411",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCCCC(=O)N1CCC([NH+]2CCC[C@@H](C(=O)NCc3ccccn3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204409",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CN(CCOc1ccccc1F)c1ccc([N+](=O)[O-])cc1C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131157",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1cc(Cl)ccc1Cl)N1CCC[C@@H](c2ncc[nH]2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145600",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)(C)c1ccc(SCC2(CS)CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "2402",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1CCCCN1C(=O)C(=O)NCC[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C=CCN(CC=C)C(=O)Nc1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164730",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CSc2nnc(N/N=C/c3ccc(Cl)cc3)[nH]2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C/C(=N\\NC(=O)C[NH+]1CCN(c2ccccc2)CC1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204820",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cccc(NC(=O)CN2CCN(C(=O)c3ccc(C)cc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114120",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cnn(Cc2ccccc2)c1)N1CCN(Cc2ccccc2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@H]1CCCC[C@@H]1OC(=O)[C@@H]1CC[C@H](C[NH3+])O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233677",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(N(CCC#N)C(=O)CN2CC[NH+](C(C)C)CC2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196951",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cnn(C[C@H]2CN(CCCOc3ccc4c(c3)OCO4)CCO2)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4553",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1ccc(CN[C@H](C)[C@H]2CCC[NH+](C)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75719",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2oc([C@H](C)NC(=O)NC[C@H](C)C[C@@H](C)O)c(C)c2c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63701",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]2CCCC[C@@H]2N1C(=O)c1ccccn1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45163",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccccc1C(=O)Nc1ccc(F)c(S(=O)(=O)NC2CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155459",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCOC(CNC(=O)[C@@H]1COc2ccccc2O1)OCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173449",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule C#CCOc1ccc([C@@H]2CC(=O)Nc3c2c(=O)nc(SCc2ccc(Cl)cc2)n3C)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29934",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1[C@H](C)CCCN1C(=O)CN1C(=O)NC(=O)C1(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225968",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(OC(=O)c2cccc(N3NC(=O)[C@@H]4CC=CC[C@H]4C3=O)c2)cc1C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223242",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1nc(N)nc(COc2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86659",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H]1OCC[C@H]1[C@H]([NH3+])c1ccc(-c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccc(Nc2ncnc3sc(-c4ccccc4)c(C)c23)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)[C@@H](CNC(=O)Nc1ccccc1F)N1CC[NH+](C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104760",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(C)n1nnnc1COc1ccc(C(=O)N(C)Cc2cccc(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246887",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C/C=C/C(=O)NC[C@@H]1CCN(c2ccc(F)c(F)c2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210076",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCc1ccccc1S(=O)(=O)NCc1ccc2c(c1)N(C(=O)c1ccccc1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70779",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@]1(C)C[C@@H]([NH+](C)CCC(=O)N(C)CCC#N)C1(C)C by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208721",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cn1cccc1[C@@H]1CCCCCN1C(=O)[C@@H]1C[C@@H]1c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214154",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)CCN1CCCC1=O)C1CCN(c2cccc(F)c2)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14531",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc(NC(C)=O)cc1NCc1noc(-c2cccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206130",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCC(=O)OC)C(=O)c1csc2c1CCCC2 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86681",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cccc(O[C@H](C)CNC(=O)N2C[C@H]3CC=CC[C@@H]3C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111248",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule C[NH2+][C@@H]1CCCN(C(=O)c2cc(C)c(Br)s2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191007",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1nc(C2CC2)no1)[C@H]1CCN(c2ccccc2Cl)C1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201214",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cc(F)cc(CNC(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135841",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COc1ccc(Cl)cc1C(=O)n1cnc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136804",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C#N)Oc1cccc(CNC(=O)N(C)C[C@H](C)O)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97509",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCOC(=O)C1CC[NH+](Cc2nnn(-c3cc(F)cc(F)c3)c2-c2ccncc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156290",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cc(/C=N\\NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)c(C)n1-c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](NCc1ncc(-c2ccccc2)s1)C(=O)N1CCCC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204907",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)N1CCO[C@@H]2CCCC[C@H]21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208730",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCCCN(C(=O)N[C@H](C)c1ncc(C)s1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9658",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[NH+]1CCC(NC(=O)CCc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67070",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(NCCS(=O)(=O)N1CCc2ccccc21)c1ccc(F)cc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234718",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccsc1C[NH+]1CCC(C(=O)N2C[C@H](C)O[C@H](C)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70949",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCc2cc(NCc3csc4ccccc34)ccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152569",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C(=N\\Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1)\\c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(Cl)cc1)Nc1ccc(-c2nnc3n2CCCCC3)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204435",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(NC(=O)COc2cc(C)nc(N3CCCCC3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148593",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1cc(C)c2sc(NC(=O)c3cc4ccccc4o3)nc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157182",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN[C@H](c2cccc(C3CC3)c2)S1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12579",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(O[C@H](C)C(=O)N(Cc2ccc([C@@H]3C[C@@H]3C)o2)[C@@H]2CCS(=O)(=O)C2)cc(C)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C=C1C(=O)[C@]2(C)CC[C@H]1C2(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94638",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(NC(=O)c3ccc4nc(C)sc4c3)sc2c1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156883",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(CNC(=O)N2CCC(OC[C@@H]3CCCO3)CC2)cc1F by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124150",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncc(-c2ccncc2)c([C@H]2CCCN(C(=O)c3ccco3)C2)n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123175",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CS(=O)(=O)c1ccc(C(=O)N2C[C@@H](C(=O)[O-])[C@H](c3ccncc3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCCCC/C(=N/O)c1ccccn1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199095",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(=O)Nc1ccc(OC(=O)[C@@H]2CC(=O)N(CCc3ccccc3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202099",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](C(=O)NN)[C@@H](C)n1ccc([N+](=O)[O-])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55728",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(C)c(NC(=O)[C@H](C)[NH2+][C@@H](C)c2ccc(C)cc2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138548",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1sc2nc(S[C@@H](C)C(N)=O)n(C)c(=O)c2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65712",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cn1c(=O)oc2cc(NC(=O)NCCC(=O)NC3CCCCC3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221864",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H](OC(=O)[C@@H]1C[C@@H]1C)c1cccc(C#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48719",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=S)N(Cc2cccnc2)C2CC2)c1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10988",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cccc(C[NH3+])c1O[C@H]1CCC[C@H](S(C)(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163972",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCC(=O)C(=O)N1CCc2nnc(CCc3ccccc3)n2CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153513",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(=O)NCCNC(=O)N[C@@H]1CCCC[C@@H]1C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91229",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCn1nc(CC(C)C)cc1C(=O)Nn1cnnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35331",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1nc(C)c(NC(=O)c2cc(SC)ccc2C)c1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246998",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(C)n(-c2ccc(C(=O)O[C@@H](C)C(=O)Nc3cc(C)on3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217429",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc(-c2ncn(Cc3ccc4c(c3)OCCCO4)c2[C@H]2CCOC2)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115658",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)c(CNC(=O)N[C@H]2CC[C@@H]([NH+](C)C)C2)c1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95035",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc(C(=O)N2CCC[C@H]2C(=O)[O-])c2c(C)noc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245076",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C(C[S@@](=O)CCN1C(=O)c2ccccc2C1=O)Nc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226469",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+](CC[NH+]1CCCCC1)C[C@@H](C)O by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121841",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCO[C@H]([C@H]([NH3+])Cc2cc(Br)ccc2F)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1cc2cc(NC(=O)C(=O)N[C@@H]3CCC[C@@H]([NH+](C)C)C3)ccc2n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231733",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(Nc1cccc(Cl)c1)N(CCCN1CCOCC1)Cc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228887",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(NC(=O)C[C@H](C)[NH2+]CCc2ccncc2C)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76253",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N#C[C@@H]1CN(C(=O)c2cccc(C(F)(F)F)c2N)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86130",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCN(CCO)C(=O)Nc1nc(C)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21753",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCS(=O)(=O)NCCNC(=O)Cc1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228006",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(S(C)(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210362",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(NCc1ccc(Cl)nc1)[C@@H]1CC(=O)N(CC(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68746",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1cccc(Nc2c(C#N)cnc3ccc(Cl)cc23)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80206",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1ccc(-n2nc(C)cc2NC(=O)CCc2ccc3c(c2)OCO3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7640",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(C)c(C(=O)Nc2n[nH]c3ccc([N+](=O)[O-])cc23)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238571",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H]1C[NH+]([C@@H](C)C[C@@H](C)O)C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200865",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NC[C@@H](c1ccccc1Cl)N1CCOCC1)Nc1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "469",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=Cc1c(I)cc(I)c(O)c1I .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214274",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)/C(=C\\c1ccc([C@@H]2C[C@@H]2C)o1)C[NH2+]C1CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88728",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1cc([C@H]2CCC[NH2+]C2)nc2cc(-c3ccc(F)cc3)nn12 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35309",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=[N+]([O-])c1ccc(NC[C@@H]2CCCN(c3ncccn3)C2)c2ncccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)N1c2ncnn2[C@H](c2ccccc2OC)C[C@@H]1c1ccc(C)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N[C@H]1CCN(C(=O)CNC(=O)c2cccc(Cl)c2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-n2cc(CNC(=O)c3cnn(C)c3)nn2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131145",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1cccc(CNC(=O)[C@@]2(C)CCCN(C(=O)Nc3cccc(Br)c3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(NCc2cccc(OC)c2O)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208866",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=[N+]([O-])c1ccc(NCC[NH2+]Cc2c(Cl)cccc2Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13305",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(C)c(NC(=O)[C@@H]2CCCN(C(=O)c3ccc(OC)c4ccccc34)C2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38898",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1cc(C)cc(-c2nnc(SCCC(=O)Nc3ccc([N+](=O)[O-])cc3)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42770",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1c[nH+]c(C)nc1N1CCC[C@H]([NH+]2CCN(c3ccccc3OC)CC2)C1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93150",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule N#Cc1ccc(OCc2ccc(C(=O)NN)cn2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107945",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)[C@H]2C[NH2+]C[C@@H]2CN1C(=O)c1ccncc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42667",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)N(C)c1ccc(OCCc2cnn(C)c2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193312",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](Oc1ccccc1C)C(=O)Nc1cncc(C)c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142382",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H](CCOc1ccccc1)C(=O)N1CCCN(CC(F)(F)F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138372",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc([C@@H]2CC(=O)C3=C(C2)Nc2ccccc2N[C@H]3c2ccsc2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213984",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](C)NC(=O)c1ccc(Cl)c(S(=O)(=O)N2C[C@H](C)O[C@H](C)C2)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112160",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCSCCOC(=O)C1=C(C)NC(=O)N[C@@H]1c1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@@H]1C(=O)N2CCC[C@H]2C(=O)N1Cc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42643",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cccc(C(=O)OCC(=O)Nc2ccc(F)cc2F)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167124",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)cc1C(=O)Nc1ccc(C(=O)NC(C)C)c(C)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54076",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC[C@H](C)NC(=O)N[C@H](C)CC(C)(C)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215084",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3446",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](CCc1ccc(O)cc1)NC(=O)N(C)CCc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23434",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[NH+]1CCC[C@@H](C(=O)NCC(=O)Nc2cccc(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111949",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(c1csc(-c2ccccc2)n1)N1CCN(c2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130266",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[NH+](C)CC(=O)Nc1ccc(NC(=O)[C@H]2CSc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151754",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(C[NH+](CC(=O)N2CCO[C@@H](C)C2)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87480",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCC[C@@H]1SC[C@@H](C(=O)[O-])N1C(=O)C1C(C)(C)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204094",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@](C)(C#N)[C@]1(O)CCC[NH+](C(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1cc([O-])nc2nc(C(F)(F)F)nn12)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)c1cc2c([nH]c1=O)CCCC2=O)[C@H]1CCCC[C@H]1C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197392",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(C)cc(CN[C@H](C)C(N)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16028",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CON(C)c1nc(-c2ccncc2)nc2c1CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34599",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nc2ccccc2s1)[C@@H]1CCCN(c2ccc(-n3cccn3)nn2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149518",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(CCn1ccc(=O)[nH]c1=O)Nc1ccc2c(c1)C(=O)N1CCCC[C@H]1CCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccnn1C[C@@H](C)C(=O)NC[C@H](c1cccs1)[NH+]1CCCCCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159384",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CNC(=O)CCc1ccc(C#N)cc1)N1CCc2ccccc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87001",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@@H]1CCN(C(=O)c2ccccc2[N+](=O)[O-])C[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64192",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CC[n+]1c(NC(=O)NCC)sn(CC)c1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "224781",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H](OC(=O)[C@H]1CSCN1C(=O)C(C)(C)C)c1cnc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134179",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cn1ccnc1)[NH2+]Cc1nncn1C1CCCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67564",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(C)CNC(=O)C1(NCc2cccc3cccnc23)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132779",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1cccc(SCC(=O)NC2CCCC2)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114034",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cn2c(=O)c(C(=O)NCCCc3cccc(F)c3)cnc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96831",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc[nH+]c(N[C@H]2CC[NH2+]C2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88336",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCn1c([C@@H]2CCC[NH+]2Cc2occc2C)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200723",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule N#C[C@]1(NC2CC2)CCC[C@H](Sc2cccs2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230948",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nc([C@@]2(C)CCCO2)nc(C)c1C[NH2+]C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113017",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH2+][C@@H](CCC(F)(F)F)[C@@H]1CCC[C@H](S(C)(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114074",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(=O)C1=NN[C@@]2(C)C(=O)N(c3ccccc3)C(=O)[C@@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86303",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(NC(=O)CN(C)C(=O)[C@@H](C)Sc2ccc(Br)cc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H](C)CN(C)Cc1ccc([N+](=O)[O-])c(F)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122138",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H](CO)NC(=O)NCc1cccc(Cn2ccnc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202384",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@@H](C)Oc1cccc(NC(=O)[C@](C)(N)C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188009",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCOCCn1cc(I)c(=O)[nH]c1=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220524",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cccc(NC(=O)NC[C@@H](c2ccc(F)cc2)N2CCOCC2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10331",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1-c1nc(C(=O)Nc2cccc(C)c2C(N)=O)cs1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201469",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C1C[C@@H](C(=O)N2CCC[C@@H](c3nnc4ccccn34)C2)CN1CC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180715",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCC(=O)N1CC[C@@H](C(=O)O[C@@H](c2ccc(F)c(F)c2)C(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176563",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COC[C@@H]1CCC[NH+]1Cc1cc(C)n(Cc2ccco2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76465",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COCC1CC[NH+](C/C=C/c2ccc(C#N)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159949",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(OCCCCN2CC[NH2+]CC2)c(C(C)(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63084",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cccc([C@@H](C)CNC(=O)c2nccnc2C(N)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244049",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)Cc1cccc(NC(=O)N2CCC[C@H]2CCc2ccccc2)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73006",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc([C@@H](C)NC(=O)c2cnc([C@@H]3CCCO3)s2)s1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30776",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCOC(=O)[C@@](C)(N)C(F)(F)F by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249374",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H]1C[C@@H](N(C)C(=O)c2cn(C)nc2C(C)(C)C)CC[NH+]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40602",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1ccc(S(=O)(=O)[N-]c2nc(-c3cccc(F)c3)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166519",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C)nc(NS(=O)(=O)c2cc(Cl)ccc2Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63536",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nnc(SCCC(=O)[O-])s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127012",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1onc(-c2ccccc2Cl)c1C(=O)NCC(=O)N1CCO[C@@H](c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219181",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN[C@@H](C[NH+](C)C)c1cc(C)cc(F)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30430",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)c1ccc(CN(C(=O)CN2C(=O)NC3(CCCC3)C2=O)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H]([NH2+]Cc1ccco1)c1cccc(C#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223960",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C/[NH+]=C(/NCCc1nc(C(C)C)no1)N1CCN(C(=O)[C@@H]2CCCO2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106333",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc2cc(C(=O)Nc3ccc(C(C)=O)cc3)c(=O)oc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185381",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@H]2CC3=c4ccccc4=[NH+][C@H]3CN2C(=O)CN1/N=C/c1ccccc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(OCC(=O)OC(C)C)cc2c1C(=O)/C(=C/c1cc(Br)cc3c1OCOC3)O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134484",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOc1ccc2c(c1)CN(C(=O)N[C@H]1CCCn3c(C)nnc31)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115521",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC(=O)Nc1nc(C)cc(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207503",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccc(NC(=O)C(=O)N/N=C/c2coc3ccccc3c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCc1ccc(S(=O)(=O)N2CCCC2)cc1)Nc1nc[nH]n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "203758",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC1(CNC(=O)NCCc2nnc3n2CCC3)CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1nn(C)c2ncc(NC(=O)N(C)[C@@H](C)c3ccccc3Cl)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176351",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)Sc1ccc(CNc2ccc(C#N)cc2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34031",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C/C=C(\\C)C(=O)N/N=C/c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108035",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@H]2C3=C(CCCC3=O)Nc3ncnn32)cc(OC)c1O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245237",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS[C@@H]1CC[C@@H](NC(=O)N[C@@H](CO)c2ccccc2F)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77859",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(=O)c1cccc(NC(=O)[C@@H](C)Nc2ccc3c(c2)OC(F)(F)O3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46843",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOC[C@@H]1CCCN1C(=O)c1ccc(-n2nc(C)cc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12603",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)Cc1cc(C(=O)N[C@@H](CO)C(=O)[O-])n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180900",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc([C@H](C)[NH2+]CC(C)(C)N2CCS(=O)CC2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148368",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNC(=O)C[C@@H](C[NH3+])N1CC[NH+](C(C)(C)C)CC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98075",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)N[C@](C)(C#N)CCC[NH+]1C[C@H](C)[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157205",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCS[C@H]1CCCC[C@H]1NC(=O)NCC(=O)N1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)NC(=O)[C@@H]1C[C@H]2CCCC[C@@H]2CN1C(=O)c1ccc(C(F)(F)F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125216",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=c1cc([O-])cc(-c2ccc(Cl)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174998",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccccn2c1C(=O)NCC(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98030",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(COC(=O)c1ccccc1Br)Nc1ccc(F)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221547",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccc(F)cc1[C@@H](C(=O)[O-])[NH+](C)CCn1ccnc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22609",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1CC1)c1cn(-c2ccc(-c3nc(C4CC4)no3)cn2)cn1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160890",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(c1ccccc1C(=O)Nc1ccccc1Sc1ccccc1)S(C)(=O)=O by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56570",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Clc1ccc([C@H](CNCc2csc(C3CC3)n2)n2cccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80482",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cc(NC(=O)NCCCC[NH+]2CCCC2)ccc1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86286",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C)c1NC(=O)CN(C)c1ncnc2[nH]ncc12 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cccc(C)c1NC(=O)[C@@H]1CC(=O)N(c2ccccc2OC)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78379",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[NH+](CCOC(F)(F)F)CC(C)(C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124628",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)NCCn2c(C)cc3ccccc32)cccc1[N+](=O)[O-] by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167214",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]1CCCC[C@@H]1OCc1ccc(N)c2cccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1nc2cc(Cl)ccc2[nH]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114076",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(NS(C)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245269",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)C(=O)N2CC=C(c3ccc(Cl)cc3)CC2)n(C)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175168",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(COc2ccccc2-c2ccccc2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120969",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cn[nH]c1-c1cccc(Cl)c1)N1CCN(c2ccc(F)cc2)CC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112668",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(Nc1c[nH]nc1-c1ccccn1)N1CC[C@H](CO)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8255",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1cc2nc(C(C)C)cc(N[C@@H](c3nc(C4CC4)no3)C(C)C)n2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC1CCC(C[C@@H](O)C(F)(F)F)(C(=O)[O-])CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240521",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C)c(Br)cc1C(=O)c1c(F)ccc(N)c1F by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131768",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COC(=O)c1ccc([N+](=O)[O-])c(OCC(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCc1ccccc1NC(=O)C1=Cc2cc(F)ccc2OC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41280",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@H]1[C@H]2C[C@H](C)CC=C2C(C#N)=C(N)C1(C#N)C#N by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12808",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NC1CCCCC1)[C@H]1C[C@H](O)CN1C(=O)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197093",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)NC[C@@H]1CCCN1C(=O)c1ccc(Cl)cn1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H]1CCC[NH+](Cc2ccc(-c3ccc(OC)cc3[N+](=O)[O-])o2)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243024",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1nc(NC(=O)N[C@H]2CCOC2)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188720",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H](NC(=O)c1ccccc1)C(=O)N[C@H](C)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123467",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCCOc1ccccc1NC(=O)c1coc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34143",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule NC(=O)CCSc1ccccc1NC(=O)Cc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45166",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCC1C2CC3CC(C2)CC1C3)c1ccc(C[NH+]2CCCCCC2)[nH]c1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198651",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CC[NH+]1CC[C@H](N(C)Cc2cnc(-c3ccccn3)s2)[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189597",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(/C=C/C(=O)N2CCC(C3[NH+]=c4ccccc4=[NH+]3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146095",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CS(=O)(=O)NCC[C@@H]1CCCC[NH+]1Cc1nnnn1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60520",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc([C@H](C)N(C)C(=O)NCCN2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1nnc(CN(C)[C@H]2CCSC2)s1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48854",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@@H]1C[C@H]1NC(=O)Nc1ccc(S(=O)(=O)C(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106395",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1CCCS(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222449",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCn1cc2c(C(F)F)cc(=O)n(CCC(=O)Nc3cccc(C(F)(F)F)c3)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246086",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cc(-c2ccccc2)on1)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CO[C@@]1(C)C[C@H]([NH2+]Cc2cccc(OCC#N)c2)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85101",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CCC(=O)Nc1cc(-c2ccncc2)n[nH]1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98323",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2ccccc2)c(C)c1NC(=O)N[C@H]1CCCC[C@H]1C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126042",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc(C)c1C(=O)N1CC[C@@]2(CCC[NH+](Cc3cccc(OC)c3OC)C2)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80756",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C)cc1Nc1c([N+](=O)[O-])nn(-c2ccccc2C)[n+]1[O-] by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209213",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC1CC[NH+]([C@H]2CC[C@](NC3CC3)(C(N)=O)C2)CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "136645",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(-c2ccc(NC(=O)c3cc4ccccc4oc3=O)cc2)cs1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103469",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(C(=O)[C@@H](C)N[C@@H](C)c1ccc(C)cc1)[C@H]1CCS(=O)(=O)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183415",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COC(=O)c1sccc1C[NH+]1CCCC[C@H]1CCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161154",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC(=O)c1ccc(NC(=O)Cc2coc3cc(C)c(C)cc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165077",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1=NC(=O)C2=C3CCC[C@@H]3SC2=N1)Cc1cccc(F)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183725",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(F)c(CN2CCC[C@](O)(C[NH2+]C3(C(N)=O)CCCC3)C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOCCN(C)CN1C[C@@H](c2ccccc2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241854",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1-c1n[nH]c2c1CN(S(=O)(=O)c1ccsc1)CC2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93591",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1onc(C)c1NC(=O)[C@H]1CCCN1C(=O)Cc1cccs1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29302",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)C[C@@H](NC(=O)N1CCN(c3cccc(Cl)c3)CC1)CO2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccccc1Cl)C(=O)Nc1cccc(I)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70538",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CCn1cc(C(=O)N[C@@H](CC(C)C)C(=O)N2CCN(C)CC2)c(=O)c2cc3c(cc21)OCO3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196570",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CNC(=O)/C=C/C1CC1)c1ccccc1Cl by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228396",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)c1ocnc1CN(C)Cc1cc([N+](=O)[O-])ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35811",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(C)C(=O)Cn1nnc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195472",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)CO[C@H]1CC[NH+](Cc2c[nH]nc2-c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20719",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3343",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule c1ccc(CC[NH+]2CCCN(Cc3noc(C4CC4)n3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226065",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H]1S[C@H](C)C(=O)N1c1c(C)n(C)n(-c2ccccc2)c1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34152",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(OCC(=O)N1CCOCC1)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26398",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCOC[C@H]1CCCN(C(=O)/C=C/c2cccc(Cl)c2Cl)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule CCC(=O)N1CCC(N2C[C@@H](CO)OC[C@@H]2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149546",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CCOC(=O)NCCC(=O)Nc1ccc2c(c1)COC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CN(C)C(=O)c1ccc(=O)[nH]c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62158",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1c(NC(=O)COC(=O)C2CCC2)sc2c1CCC2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C1CCC([NH2+]CCN2CCOCC2)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197758",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C#CCCOc1ccc(F)cc1C(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210919",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule COC(=O)c1cc(O)c2c(c1)OC(C)(C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74254",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)CCO[C@@H]1CCN(C(=O)Nc2cc(C#N)ccc2OC(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(c1cn[nH]c1-c1cccc(Br)c1)N1CCN(c2ncccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125860",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@@H](CNC(=O)NCC[C@@H](C)O)Oc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4871",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS[C@H]1CC[C@H](Nc2ccc([N+](=O)[O-])cc2C(N)=O)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55694",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1cccc([C@H]2CCCN2C(=O)c2cccc(CCC(C)(C)O)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42057",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC1(CC)C[NH+]([C@H]2CCCCC[C@H]2[NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144028",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1cccc(C(=O)NC(C)(C)c2nc(C)cs2)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4253",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCCCCBr)C[C@H]1CCC[NH+]1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49421",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)CC(=O)N1C(=O)[C@H]2CCCCN2C(=O)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191458",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCCC[C@@H]1NC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5359",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCCC(=O)Nc1cccc(CNc2nc(-c3ccccn3)nc(C)c2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39773",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule COCCN(Cc1ccccn1)C(=O)N[C@H]1CCCC[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](NC(=O)[C@@H]1CC[C@H](C[NH3+])O1)c1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148072",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N2CCC3=c4ccccc4=[NH+][C@@H]3[C@H]2c2ccc([N+](=O)[O-])cc2)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)(C)c1cc(=O)[nH]c2cc(NC(=O)[C@@H]3CC(=O)N(c4ccccc4)C3)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138529",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)n1c(SCC(=O)Nc2nc(-c3ccc(F)cc3)cs2)nc2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64117",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1c(NC(=O)c2cc(C)no2)c(C)nn1C by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123392",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc([C@H](O)CNC(=O)CC2CCCCC2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6291",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCC[C@H](C(=O)Nc1ccc(C(C)=O)cc1)N1C(=O)c2ccccc2C1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12189",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(C)C(=O)CCc1cccc(NC(=O)[C@H]2CCCC[C@@H]2C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)C(=O)Nc2ccccc2N2CCCCC2)C[C@H](C)O1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120067",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C/C(=N/NC(=O)COc1ccc(F)cc1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234993",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(c1ccccc1)c1ccc(OCC[NH+]2CCCC2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215297",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc(CC)c1CNC(=O)Nc1cccc(-c2nnnn2CC)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58019",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccsc1NC(=O)CN1C(=O)NC2(CCCCCCC2)C1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155958",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(CCC1CCCC1)N1CCc2nc(-c3cnccn3)nc(O)c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54860",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=[N+]([O-])c1ccccc1SN1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232086",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)CCC(=O)N1CCC[C@@H](C)[C@@H]1c1ccc(C)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30692",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCc1nc(C(=O)N2CCC[NH+]3CCC[C@@H]3C2)n[nH]1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200570",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)CSC[C@@H](C)CO)c1nc2ccccc2s1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93813",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccccc1CCNC(=O)C[S@](=O)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24597",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1sc2nc(CN3CC[C@@H]4[C@H](CCC[NH+]4C4CC4)C3)nc(N)c2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204630",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccccc1F)C(=O)NCCc1c(F)cccc1F by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128347",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)c1ccccc1)n1cnc2ccc(F)cc2c1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106941",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1c([C@@H](C)NC(=O)CCc2nc3ccccc3s2)cnn1-c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206477",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C1=NN2C(=N)/C(=C/c3cn(Cc4ccccc4[N+](=O)[O-])c4ccccc34)C(=O)N=C2S1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160410",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CN1CCO[C@@H]([C@H](O)Cc2ccncc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58678",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]1SCCC[C@@H]1N[C@@H]1CC[NH+]2CCC[C@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109267",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)N1CCC[C@@H](C(=O)Nc2ccnn2Cc2ccc(Cl)cc2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122636",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(CNC(=O)c2ccccc2NC(=O)c2ccc(NC(=O)C(C)C)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H]1CN(C(=O)c2sc(C)nc2C)C[C@H]1C by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23939",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)Nc2ccc(OC3CCCC3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135440",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C[C@H](C(=O)Nc2cccc(OC[C@@H]3CCCO3)c2)CC1=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C)cc(NC(=O)C(=O)NCc2ncc(C)s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11067",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1ccc(C(=O)[O-])cc1)[C@H]1CC(C)(C)OC1(C)C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233304",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@@H](OC(=O)[C@@H](C)N1C(=O)c2ccccc2C1=O)C(=O)Nc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4213",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[NH2+][C@H](Cc1ccc(OC)c(Br)c1)[C@H]1CSCCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134323",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCN(Cc1ccccn1)S(=O)(=O)c1ccc(F)c(NC(C)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208053",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@H]1C[C@@H]1COC(=O)CCNC(=O)c1ccsc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167907",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H]2CC(=O)C3=C(C2)NC(=O)C[C@H]3c2ccc(OC)c(OC)c2OC)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210954",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H]1C2=C(C[C@@H](c3ccc(O)cc3)CC2=O)Nc2onc(C)c21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97645",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1onc(-c2ccc(F)cc2)c1C(=O)NCc1ccnc(Oc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44824",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccsc1C(=O)NC[C@H](O)c1c(Cl)cccc1Cl by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(OCC2CC[NH+](CC(=O)Nc3ccn(C)n3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20222",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCC(=O)N1CCC(Cc2cc(NC3CCCC3)nc(C)[nH+]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73320",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule [NH3+]CC1([C@@H](O)c2ccc3ccccc3n2)CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25525",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1ccc([N-]S(=O)(=O)c2ccccc2[N+](=O)[O-])cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCc1ccc(O)c(NC(=O)CO[C@H]2CCC[C@H](C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126879",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC1(C)CN(C(=O)C2CCN(C(=O)CCOc3ccccc3)CC2)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245573",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc2[nH]cc(C(=O)N(C)Cc3ccccc3)c(=O)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143171",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@H]1CCCC[C@H]1NC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)CCNC(=O)N(C)Cc1cccc(Cl)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67574",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1C[C@H](C)CN(C(=O)c2ccccc2NC(=O)NCCNC(=O)C2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150976",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@H](NC(=O)c1nccn2ccnc12)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51163",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC1(C)C[C@H]2C[C@](C)(C[NH+]2CCC#N)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129117",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1ccc(C(=O)N2CCC[C@@H](C[NH3+])C2)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206629",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@H](NC(=O)C(C)(C)C)c1nc(C(F)(F)F)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95934",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1nnnn1[C@@H]1CCOC2(CCSCC2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207134",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc(C2=CC[NH+](CCCS(C)(=O)=O)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cc(Cl)cc(C[NH2+]Cc2cccc(CN3CCOCC3)c2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239202",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCO[C@H]1C[C@@H]([O-])C12CC[NH+](Cc1nnc(C3CC3)o1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34582",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C[C@@H](O[C@H]1CCC[C@@H]1C[NH3+])c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192058",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1)N1CCC[C@H]1c1nc2ccccc2s1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100099",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NCc1ccc2c(c1)OCO2)c1cn(CCC2CCCCC2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116680",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOC(=O)C[C@@H](C)Sc1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139855",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)(C)c1nnc(NC(=O)Cc2cc(F)ccc2F)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)[C@H](NC(=O)c1ccc(-c2nnn[n-]2)cc1)C(=O)[O-] by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181995",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1cc([C@H]2CN3C(=O)CNC(=O)[C@]3(C)c3[nH]c4ccccc4c32)ccc1OC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N#Cc1ccccc1NC(=O)C(=O)NC[C@@H](c1ccc(F)cc1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "11383",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(COC(=O)c1ccccc1Br)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23357",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule CCc1ccc([C@H](C)NC(=O)CN(C)S(=O)(=O)c2ccc(Cl)nc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33791",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccccc1OC[C@@H](C)CNc1cnccc1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccccc1C(=O)Nc1ccc(I)cc1C(=O)Nc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185452",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=[N+]([O-])c1ccc(/C=N/c2ccc(Cl)cc2Cl)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113666",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H](Nc1ccc2c(c1)NC(=O)[C@@H](C)O2)c1nc(C(C)(C)C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1nnnn1CCc1ccsc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174982",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@@H]1CN(C(=O)c2ccc3nncn3c2)C[C@@H]1N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86695",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COCCN1[C@@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "329",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(OC)c(CN2CC[NH+](Cc3nc4ccc(Cl)cc4c(=O)[nH]3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](Cc1cc2cc(OC)ccc2[nH]c1=O)[C@@H]1CCS(=O)(=O)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c([C@@H]2CCCN2C(=O)[C@@H](C)Oc2ccc(-n3cnnn3)cc2)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210585",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(-c2cc(C(=O)Nc3cc4c(cc3C)OCCO4)[nH]n2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule COC(=O)c1ccc(C(=O)N2CC[C@@H](C)[C@H](O)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209519",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(F)(F)C(=O)N[C@@H]2CC[C@@H]([NH+](C)C)C2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65218",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCN(CC(F)F)C(=O)N[C@@H]1CC[C@H](SC)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141858",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CO[C@H]1CCC[C@H](OC(=O)c2ccc(-n3ccnn3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(OCCCC(=O)N2CCOC[C@@H]2C)cc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104874",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H](Oc1ccc(Br)cc1Br)C(=O)N1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239156",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(S(=O)(=O)Cc2nnc(-c3ccccc3C)o2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)Cn1ncc2ccccc21)C1CCS(=O)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1ccccc1)C(=O)CNC(=O)N[C@@H]1CCC[C@@]1(C)CO by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95497",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CN(C)C(=O)CNC(=O)CNC(=O)c1cc2sccc2n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206675",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COC(=O)c1ccc(NC(=O)CNc2cccc(NC(C)=O)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(NC(=O)c2cccc(-c3ccoc3)c2)cc1F by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1CC[C@H](C)N(C(=O)NC[C@@H](C)c2nc(-c3ccccc3)no2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51651",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)C[C@@H]1CCCN1S(=O)(=O)N1CCCC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132636",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC(=O)c1c(NC(=O)N/N=C\\c2cccc(OC)c2OC)sc2c1CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121297",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CSCc1ccc(C(=O)N[C@](C)(C(=O)[O-])C(F)(F)F)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210228",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1CCC[C@]2(CC[NH+](Cc3ncccn3)C2)C1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119607",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CNc1cccc(CSC[C@H](C)CO)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccc([C@@H](CC(=O)[O-])C(=O)[O-])cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193995",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(CCNC(=O)[C@@H]2CCCN(c3nc4cc(Br)ccc4[nH]3)C2)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=C\\C(=O)NCc1nc(C)no1)C(C)(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)[C@H]2[C@@H](C(=O)[O-])C2(C)C)n(-c2ccc(F)cc2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126409",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@](O)(CNC(=O)N[C@@H](c1ccccc1)C1CCCC1)CN1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229005",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1c(S(=O)(=O)c2ccc(C(C)C)cc2)nnn1-c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159175",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C[C@@H](O)C1CC1)C(=O)Cc1ccc(OC(F)(F)F)cc1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45049",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C)n(-c2cc(N3CCC[C@@H](C(=O)N4CCCCCC4)C3)ncn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16834",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(Br)cc1S(=O)(=O)N1CCCC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9988",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ncsc1CNC(=O)N[C@@H]1CCCOc2c1ccc1ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "68069",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(-n2cnnn2)cc1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78651",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C(/C=C/c1cccnc1)N(Cc1ccccn1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184673",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(S(=O)(=O)NCC#CCOc2cccc(C(F)(F)F)c2)cc1F by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104246",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCCOC(=O)c1oc2c(c1C)/C(=N/NC(=O)c1ccc(C)cc1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54650",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cnc(-c2ccccc2F)s1)N1CCO[C@H]2CCC[C@H]21 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235682",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1c(C[NH2+]CC(C)C)cnn1[C@H](C)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80600",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc([C@H](C/[NH+]=C/c2ccccc2O)N2CCOCC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168332",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc([C@H]([NH2+]CC2(CO)CCOCC2)C(C)C)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(NC(=O)c2ccco2)cc1NC(=O)COc1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202556",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNC(=O)[C@@H](C)[NH+](C)[C@@H]1CCN(c2ccccc2Cl)C1=O by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(COc1cccc(Cl)c1)N/N=C1/C(=O)Nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218028",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[NH+](C[C@H](O)COc1ccc(F)cc1)C[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29680",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CCNC(=O)[C@H]1CCCN(C(=O)NC2CCCC2)C1)C(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206588",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C([O-])[C@@H]1CC=CC[C@@H]1C(=O)n1cccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144219",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1[nH]c2ccc(C(=O)O[C@@H](C)C(=O)Nc3ccc(Cl)cn3)cc2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238194",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)(C)[NH2+]CC(=O)NC[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57997",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C1c2ccccc2[C@@H]2OC[C@@H](Cc3ccccc3)N12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106439",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCC[C@@H](O)c1ccn(CC(=O)Nc2ccc(Cl)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218216",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NNC(=O)c1cccc2cn[nH]c12)c1cc(-c2ccccc2)on1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103141",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(C)(C)NCc2ccncc2)sc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239452",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COC(=O)C1(c2ccccc2)CCN(C(=O)c2cc(C)oc2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150032",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3417",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H](NC(=O)c1cnn(CC(=O)NC2CCCCC2)c1)C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34359",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CNc1ncc(CN(C)C(=O)[C@H]2CC[C@@H]([NH3+])C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74484",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(Cl)c(NNC(=O)c2cccc(NC(C)=O)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211628",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1COC[C@@H](C)N1Cc1cc(Cl)c2c(c1)OCCO2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "229893",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C1N(Cc2ccc(Cl)cc2Cl)C[C@@H]2C[NH2+]CCN12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61135",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1nc(C[C@@H]2CCC[NH+](Cc3c(C)nc4sccn34)C2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124593",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC[C@H]1CCCN(C(=O)Cc2csc(NC(=O)C(C)(C)C)n2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216862",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CSCC[C@H](C)NC(=O)NC[C@H](O)c1cc(Cl)cc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80568",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C=CC(C)(C)c1cc2ccc(OC)c(O)c2oc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2ccccc2)sc2c1CC[C@H](C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216385",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1nn(C)cc1CN1CCOC[C@H]1CC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79190",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(NC(=O)[C@H](C)Nc2cccc(OCC(F)(F)F)c2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164814",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](Nc1c[nH+]ccc1N(C)C)c1ccoc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76389",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@@H](O)CC(C)(C)CNC(=O)/C=C/c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Nc1ccc(Cl)c(NC(=O)CCCO)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70978",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H]([NH2+]Cc1cccc2cccnc12)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37631",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1ccc(F)c(Cl)c1)C1CC[NH+](Cc2ccsc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171504",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2n(n1)[C@@H](c1ccccc1)C1=C(C[C@H](C)CC1=O)N2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88515",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule COc1cccc(C(=O)N2CCN(C(=O)c3cc(C)oc3C)CC2)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234016",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CN(C)C(=O)N[C@H](C)c2ccc(OC(C)C)cc2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85672",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1ccc(N2C(=O)CS[C@@H]2c2cc(OC)ccc2OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129979",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSC[C@H](C)N(C)C(=O)c1cc(C)nc2ccc(OC)cc12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109957",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccc(NC(=O)N[C@H]2CCCc3c2cnn3C)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "154835",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cn1c2c(c(=O)[nH]c1=O)[C@@H](c1ccc(F)cc1)C1=C(N2)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34654",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cc(CN2CCN(C(=O)c3ccon3)CC2)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "85853",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(C)(C)CNC(=O)N1CCOC[C@@H]1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206281",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(Cc2cccc(Oc3ccccc3)c2)c(C)c1NC(=O)c1ccc2c(c1)OCO2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126614",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1[C@@H](C(=O)[O-])CC[NH+]1C1CCC(C(F)(F)F)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30076",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCC[C@H](O)CNS(=O)(=O)N1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8523",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CN(C)C(=O)N[C@@H](C)COc2ccccc2F)cs1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190960",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H](C)N[C@H](C)c2ccc(C#N)cc2)cc1[N+](=O)[O-] by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165461",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(CNC(=O)CN2CCCOC2=O)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238880",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC1=C(C(=O)Nc2cccc(C)c2C)[C@H](c2c(F)cccc2F)NC(=S)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51503",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1cccc(SCC(=O)N[C@H](C)c2nc3ccccc3[nH]2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240908",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cc(C(F)(F)F)ccc1N(C)C1CCCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235997",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule O=C(CNC(=O)Nc1ccc(-n2cccn2)nc1)Nc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3444",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H](NC(=O)C(=O)Nc1cccnc1Cl)[C@H]1CN(C)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CCc1ccccc1NC(=O)C[NH+](C)CC(=O)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1ccc(Cc2nnc(SCC(=O)Nc3cccc(O)c3)n2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182397",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CC[C@H](Br)C(=O)Nc1nc2ccc(C(C)C)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216441",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CN(C(=O)C1CC1)c1ccccc1C(=O)NNC(=O)Cc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "218656",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CN(CCO)C(=O)Nc1cccc(Cl)c1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144817",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(Br)c(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C1=C(C)NC(=S)N[C@H]1c1ccc(C)cc1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cccc(C(N)=O)c1)C(=O)[C@H]1SCCc2ccccc21 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108980",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(C)CC(=O)Nc1cccc(CNC(=O)Nc2ccccc2N(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49131",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1cc(N2CC[NH+](C)CC2)nc(Cl)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170567",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[NH+]1CC[C@@H](Cc2nccnc2C(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81731",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2C(C#N)=C(N)O[C@H]3N=NC(C)=C32)cc1COc1ccc(C)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14311",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CN(Cc1cnn(C)c1)C(=O)Nc1cccc(-c2nnc3n2CCC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221710",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C([O-])c1nc2c(F)cccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19381",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ncccc1NC(=O)N1CCN(Cc2cccc3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147733",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C([O-])c1ccc(-n2cccc2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60498",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)c1ccc(C[NH+]2CCC(Oc3ccc(C#N)cc3)CC2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129981",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CCc1nc(N2CCOCC2)c2onc(-c3ccc(C)cc3)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78163",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cccc(NC(=O)[C@@H]2CC[NH2+][C@H]2C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153897",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CN1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115554",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CS(=O)(=O)[C@H]1CCC[C@@H](Nc2ccc(C#N)cc2[N+](=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16902",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "3226",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CSc1nnc(SC[C@@H]2CCOCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241908",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccc(OCC(F)F)n1)[C@@H]1CC(=O)N(c2cn[nH]c2)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133664",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC[C@@H](NS(=O)(=O)c1ccc(CC#N)cc1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74949",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C1N[C@H](C2CC2)C(=O)N([C@@H]2CCOC2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182556",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)C[C@H](NC(=O)C=C1C[C@@H]2CC[C@H](C1)[NH+]2C)C(=O)Nc1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule BrCCC[C@H]1CCCC[NH+]1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78194",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1[C@H]1C=NN=C1[C@H]1CCCN(C(=O)CCCc2ccccc2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212601",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[NH+](C1CCSCC1)[C@@H]1CCN(c2ccccc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111326",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H](c1cc2ccccc2o1)N(C)C(=O)CN(C)Cc1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=CC1=CCC[C@@H]([N+](=O)[O-])C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10567",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)C[NH+]2CCC[C@@H]2c2cccs2)c(C)n1-c1c(C)n(C)n(-c2ccccc2)c1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144315",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cccc(CNC(=O)Nc2cc(C)cc3cccnc23)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168300",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nccc1CNC(=O)Cc1noc2ccccc12 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221018",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nc(C)c(C(=O)N(C)[C@@H]2CCC[C@@H](C)C2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62336",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C[C@@H]1CCOC1)C(=O)Nc1cnn(C[C@H]2CCCO2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112200",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule CCCc1cc(NC(=O)C(=O)N[C@@H]2CCC[C@H]2c2ccc(F)cc2)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50920",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CCC[NH2+][C@]1(C(=O)[O-])CCC[C@@H]([NH+](C)[C@@H](C)C2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222111",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC1(C)[C@H]2CC[C@]1(C)C(=O)[C@@H]2COC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28583",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOCCN(C)C(=O)c1oc2c(OC)cccc2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220107",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)[C@@H]1CCC[NH+](Cc2nc(-c3cccs3)oc2C)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81501",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)Oc1ncccc1CNC(=O)c1cnccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89821",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCCN(Cc1cccnc1)C(=O)c1sccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162376",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cn1nnnc1-c1cccc(NC(=O)CCS(=O)(=O)c2ccc(Cl)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223018",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Clc1ccc([C@@H](Cl)[C@H]2COCCO2)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185492",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCC[NH2+][C@H](Cc1ccncc1)[C@H]1CSCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "241356",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)N1C[C@H](C(=O)N2CCC(C(=O)Nc3cccc(F)c3)CC2)CC1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(C)NC(=O)CCN1C(=O)[C@H](C)SC1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17632",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@]([NH3+])(c2nc([C@]3(C)CCCO3)no2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155806",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)(C)C(=O)/C=C\\c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48693",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ncccc1C(=O)O[C@@H]1CCC[C@H](C(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[C@H]1SCCNC1=O)Nc1cc(Cl)cc(Cl)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37111",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CS(=O)(=O)NC1CCN(C(=O)CCCSc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133377",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1ccc(CNC(=O)NC[C@@H]2CC[C@@H](C(=O)[O-])O2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183641",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1C(=O)CCc2cc(NC(=O)c3cscc3C)ccc21 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199136",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOC(=O)c1cn[nH]c1S(=O)(=O)NCc1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9912",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)CCCC[NH3+])C1CCC(C)(C)CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156638",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CCOc1ccc(F)c(C(=O)NCC(=O)N(C)C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c([C@H]2CCN(C(=O)OC(C)(C)C)CC2=O)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149688",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H]1CCOC1)c1ccc(S(=O)(=O)N2CCC(CO)CC2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40389",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(C)c(Nc2nc(C)nc3sc4c(c23)CCC4)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157277",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc[nH+]c(N2CCO[C@H](c3cccc(O)c3)C2)c1=O by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43501",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(CN(C)C(=O)[C@@H]2[C@@H]3C=C[C@@]4(CN(Cc5ccc(C)c(C)c5)C(=O)[C@H]24)O3)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156669",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1csc(SCc2ccc(C(=O)Nc3nc4ccccc4[nH]3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152030",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1ccc([C@H]2N=C(CS[C@@H]3N=NC(=O)c4cc(-c5cccs5)nn43)[C@H](C)O2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30468",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C(=O)N2CCC[C@@H]3CCC[C@@H]32)CCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238900",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)OCCS(=O)(=O)NCc1ccccc1C#CCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21265",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN1C(=O)c2cc(C(=O)NCCC3=c4ccccc4=[NH+]C3)nn2C[C@@]1(C)C(=O)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213906",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cc(C)n(-c2ccc(C(=O)NC[C@H]3CCC[C@@H]3O)cc2F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239004",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(C)cnc(COc2cccc(N)c2C)c1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236210",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(Cl)c(NC(=O)C(=O)N2CC[C@@H](O)C2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule NC(=O)c1cc(NC(=O)[C@@H]2CC=CCC2)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67957",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(C)(CC(=O)N1CCc2ccccc2C1)CC1=Nc2ccccc2S(=O)(=O)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89799",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](Cc1ccccc1)c1cc(C(F)(F)F)ccc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131048",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C(=O)c1ccc(Br)s1)C(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1cnn(CCc2ccccc2)c1)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108759",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule NC1=C[C@@H](C(=O)N2CCN(C(=O)c3ccccc3)CC2)N=[NH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58405",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCCCOc1ccc(F)cc1)N1CCCCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63111",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(c1ccc([O-])nn1)N1CCN(Cc2ccncc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75174",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)CCC(=O)NC(C)(C)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184206",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1nc(-c2cccc(C(=O)N[C@H]3C[C@H]3c3c(F)cccc3F)c2)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246923",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CCc1ncc(CN[C@@H](C)[C@@H](O)c2ccc(F)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50249",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cc(S(=O)(=O)[N-]c2ccccc2-n2cc(Br)cn2)c[nH]1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188931",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(Sc2nc(C3CC3)n(-c3ccccc3)n2)c2ccccc12 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cn(Cc2ccccc2F)nn1)N1CCC(O)(c2ccccc2)CC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245761",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)C1CC[NH+](C[C@@H](O)Cn2cnc3cc(C)c(C)cc32)CC1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124354",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)[C@H](C)[NH2+][C@@H](C)c1nc(Cc2ccccc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228113",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Nc1ccccc1)c1ccc(C(=O)N2CCOC[C@@H]2CCO)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33723",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC[C@@H]1CC[NH+](Cc2cc(C#N)n(C)c2C)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168270",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1cc([C@@H](C)NC(=O)C(=O)Nc2ccc3[nH]ccc3c2)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110242",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)Cc1noc(C[NH+](Cc2cccc(Cl)c2)C(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94750",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CNC(=O)NC(=O)[C@H](N[C@@H](C)c1cc(C)ccc1OC)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118123",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCCN(C)C(=O)NC[C@@H]1CN2CCCC[C@@H]2CO1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81953",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCN(C(=O)c2csc(C(C)C)c2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8465",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(C)c1ccccc1NC(=O)CCSc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34931",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N2CCC[C@H](CCc3ccccc3F)C2)cc1O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180116",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)CCc1c(C)[nH]c2c(C(=O)Nc3cc(Cl)ccc3C)cnn2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169236",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(C[C@H]1CCC[NH2+]C1)c1ncc(Cl)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88172",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C1N=C(N2CCCCC2)S/C1=C1/C(=O)Nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "286",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H]1NC(=O)/C(=C/c2ccccc2Cl)NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156373",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CNC(=O)CCCn1cc(C(=O)[O-])cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215583",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Cc1ccccc1)Nc1cccc(C(=O)Nc2ccccc2C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26967",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H](NC1CC[NH+]([C@H](C)c2ccncc2)CC1)c1ccc(F)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "226415",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Cn1ncc(C(=O)Nc2cccc(-c3ncc[nH]3)c2)c1-n1cccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134666",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CN(CCC#N)Cc1ccccc1OCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96940",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(SCC(=O)N2CC[NH+](Cc3ccccc3)CC2)nnc1-c1cccc([N+](=O)[O-])c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145154",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCCc1cc(NC(=O)Cc2csc(Cc3ccccc3)n2)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142943",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(c1ccccc1O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189874",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NCc1cccnc1)[C@@H]1CCC[NH+](C2CCN(Cc3nccs3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86031",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CNS(=O)(=O)c1cc(C(=O)NCc2cccs2)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35837",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H](NC(=O)Cc1c[nH]c2cc(Cl)ccc12)C(=O)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7301",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCCC[C@H]1CCC[C@@H]1NC(=O)NCc1ccc(N2CCO[C@H](C)C2)[nH+]c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132874",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@H](C)n1ncc(C(=O)NCc2ccc(C)s2)c1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69412",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])C[C@H](NC(=O)c1ccc(Cl)cc1)c1ccc2c(c1)OCO2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81865",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)N(CCC[NH3+])C1CCCCC1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145546",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cn1nc([C@H]2CCC[NH2+]C2)c2nccnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28446",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H]1C[NH+](Cc2ccc(C[NH2+]C(C)(C)C)cn2)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61316",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H]1CCC(=O)[C@@H](CCc2ccc3c(c2)CCO3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19442",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1nc(-c2cccnc2)cs1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223191",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CO[C@@H]1C(=O)C(C(C)=O)=C(O)[C@]2(O)C(=O)c3c(cc4cccc(O)c4c3O)C[C@@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81515",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)S(=O)(=O)c1ccc(OC)c(C(=O)N2CCC3(CCCCC3)CC2)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "143634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C(=O)N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)cc2sccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235512",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCS[C@@H]1CC[C@@H](NC(=O)NC2(c3nccs3)CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245703",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C(=O)N1CCN(CCS(C)(=O)=O)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75126",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COC(=O)c1cnn(-c2cccc(C)c2)c1-n1cccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)c2[nH]c(C)c(C(=O)OC(C)C)c2C)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190360",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCCn1cccn1)NCC1CCCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113303",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(N)nc(-c2ncc[nH]2)[nH]c1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95679",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)c1n[nH]c(SCC(=O)c2c[nH]c3ccccc23)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148375",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)N/N=C/c2ccc(C)s2)[nH]n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183041",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccccc1NC(=O)CN1C(=O)COc2ccc(Cl)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13597",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Cc1ccc(F)c(F)c1)N[C@H]1CCSc2ccc(F)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169763",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC(C)C[C@H]1Nc2ccc(C(=O)NCC[NH+]3CCCCCC3)cc2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152834",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule c1ccc([C@H]([NH2+]Cc2cccnc2)c2ccccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49354",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccccc1/C=N/Nc1nncc(-c2ccccc2)n1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1OCC[C@@H]1C(=O)N[C@@H]1CCN(CC(F)(F)F)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212738",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(NCCC(C)C)=C1C(=O)N(C)C(=O)N(C)C1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234176",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC(=O)c1ccccc1S(=O)(=O)N1CCC(C(=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230695",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c2ccccc2c1CC(=O)N[C@H](CO)Cc1c[nH]c2ccccc12 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74283",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[NH2+][C@H](C)C(C)(C)C[NH+](C)CCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170837",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(=O)C(C)(C)C[NH+](C)C[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249234",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C=C[C@H](O)[C@@H](F)C(=O)OCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225901",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc([C@@H](C)N[C@@H](C)C(=O)N(C(C)C)C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209026",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]([C@]2(O)CCCCC2(C)C)CC[C@H]1C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74089",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(C(=O)Cc1c(C(=O)[O-])c(C)cn1CC)c1cccc(Cl)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146811",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1csc(CC[NH2+]C[C@@H]2C=C[C@@H]([NH3+])C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "24853",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule Cc1ccc(Cl)cc1N1CCN(C(=O)c2ccc3c(c2)OCO3)[C@H](C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25587",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cc2c(C(=O)Nc3ccc(F)cc3F)cn(CC(C)C)c(=O)c2cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137991",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CN[C@]1(C(=O)OC)CCC[C@@H]1CCn1cc(Cl)c(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64889",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1cc([C@H]2C(C(=O)Nc3ccccn3)=C(C)NC3=C2C(=O)CCC3)ccc1OCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "977",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC(=O)c1ccc(CC(N)=O)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235910",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[C@@](C)([N+](=O)[O-])[C@@](C)(CC)[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176935",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nn(C)cc1[C@H](C)NS(=O)(=O)N(C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1cccc(CCNc2cc(-n3cccn3)nc(N)n2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106914",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)ccc1C(=O)OCc1nncn1C1CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88690",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C[NH2+]Cc2ccc(Br)c(C)c2)c1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210746",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule C[NH+]1CCN(CCC(=O)N2CCC3=c4ccccc4=[NH+][C@H]3[C@H]2c2cc(F)ccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26129",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H]1OCC[C@@H]1C(=O)NCCCC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67331",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc(C[C@H](N[C@H](C)c2cnc3cc(C)nn3c2C)C2CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206191",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(NCc1nccc2ccccc12)c1cnn(-c2cccc(Cl)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90153",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(=O)Nc1ccc([C@@H](O)C[NH+]2CCC3(CC2)C[C@@H](O)c2ccc4ccccc4c2O3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "174674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOC(=O)C(C)(C)NC(=O)c1cc(Br)cn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89288",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1ccccc1[C@@H]1CC(c2ccccc2NS(C)(=O)=O)=NN1C(=O)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215506",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C[NH+]2CCC(CS(N)(=O)=O)CC2)nnc1-c1ccccc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C=CCOc1cccc([C@@H]2c3c(-c4cc(C)cc(C)c4O)n[nH]c3C(=O)N2Cc2ccco2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16756",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCc1n[nH]c(-c2cccnc2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192295",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)/C=N\\C(=O)c1cc(C(=O)c2ccc(C(C)(C)C)cc2)c[nH]1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210508",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)c1cccc(N(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184620",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[NH+](CC(=O)Nc1c(C)cc(C)cc1Cl)[C@H](C)c1cccc(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198425",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(O)CC[NH+]1CCC[C@H]1C1CC[NH2+]CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1ccc(F)c(F)c1)C(=O)OCCc1cccnc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9666",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(CN2CCC[C@@H](c3nnc(-c4cccnc4)o3)C2)c1F by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187415",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN1CCc2cc(C[NH2+]C3CCN(c4ccc(C(=O)NCc5ccc6c(c5)OCO6)cc4)CC3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131387",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOC(=O)C(=O)N1CCN(c2cnc3ccccc3n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183022",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C=C(C)C(=O)[C@H]1CCOc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141332",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1nc2ccccc2n1CCNC(=O)c1ccc(S(=O)(=O)N(C)C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103520",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)Oc1cccnc1C(=O)NCc1cnn(Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165982",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(=O)c1cccc(NC(=O)c2nn(-c3ccccc3)c(C)cc2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "202057",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2c(c1)OCCO2)c1cccc(C(=O)Nc2ccc3c(c2)OCCO3)n1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12955",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1cc(C)c(C(=O)NC[C@H]2CCO[C@@H]2C(C)C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16455",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(NC(=O)C2CCN(C(=O)N[C@@H](CC(C)C)C[NH+](C)C)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175637",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H](C(=O)Oc1ccc2cc(Br)ccc2c1)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189251",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCC[C@H](Cc1ccc(O)cc1)[NH2+]CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131790",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cccc(-c2cnc(CSc3nnc(Cc4ccccc4)o3)o2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119249",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C[n+]2c(C)n(-c3ccccc3)c3ccccc32)cs1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118019",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccccc1[C@H](C)NC(=O)N[C@@H]1CC(=O)N(C(C)(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161946",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule O=C(c1ccccc1CSc1nc2ccccc2[nH]1)N1CCN(C[C@@H]2CCCO2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188078",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCS(=O)(=O)Nc1cccc(C2=NN(C(=O)c3ccccc3)[C@H](c3ccccc3F)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182295",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc(F)c(NC(=O)N2CCC(c3nc(C)no3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103850",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(-n2nccc2C(F)(F)F)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53330",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOC(=O)C1(C)CC[NH+]([C@@H](C)C(=O)Nc2nc(C)c(C)s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92468",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCC[NH2+][C@@H](Cc1ncccc1C)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15905",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@H](O)CNc1c(C#N)nnc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90218",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cccnc1C[NH+]1CCC(C(=O)N(Cc2ccccc2)C2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189373",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@](F)(Cl)C(F)(F)F)c(C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216732",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COC(=O)c1n[nH]c2ccc(NC(=O)N(C)CC3CCC3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223023",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(-n2nc(O[C@@H](C)C(=O)Nc3cc(Cl)ccc3C)ccc2=O)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35312",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(N[C@H](CO)c1ccccc1F)c1cnc([C@H]2CCCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141641",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[NH+](C)[C@@H](CNC(=O)NNc1cccc(C#N)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167094",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(CN2CC[C@@H](NS(C)(=O)=O)C2)cn1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157715",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](CSC)N(C)C(=O)c1cccc(OC(C)C)n1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195397",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCN(C(=O)c2ccccc2[N+](=O)[O-])c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5502",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@H](CC(=O)Nc1nnn[n-]1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103881",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCOc1ccc(NC(=O)CCn2ccccc2=O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "235127",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule Clc1ccc(C2=NN3[C@@H](C2)c2ccccc2O[C@H]3c2ccncc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36970",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc(C2=[NH+]CN(c3ccc(C)cc3)C(=S)N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76943",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(OCC(=O)NNC(=O)Nc2ccccc2)c(Br)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69346",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CONC(=O)[C@@H]1CCC(=O)N(C)[C@@H]1c1ccc(C(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61782",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1cccc(NC2CCN(C(=O)Cc3ccccc3Cl)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96775",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CN(C)S(=O)(=O)N(C)[C@H]1CCN(c2ccccc2Cl)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23232",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule O=C(NNC(=O)c1ccncc1)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196154",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)C(=O)Nc2cccnc2Cl)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131758",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[C@@H]1S/C(=N\\N=C\\c2cccc(OS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2)NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118373",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCNC(=O)C1CCN(c2ccc([N+](=O)[O-])s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(N2CC[C@H](CO)C2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8003",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCOC(=O)c1cc(S(=O)(=O)N2CCN(c3ccc(C(C)=O)cc3)CC2)cn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189238",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C#CCCN1CCN(C(=O)c2nn(-c3ccccc3)cc2OC)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98121",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(Cn2cccc(C(=O)N3CCOc4ccccc4C3)c2=O)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191426",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCN1C(=O)[C@@H](CC(=O)Nc2ccc(F)cc2)S/C1=N\\c1ccc(F)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141464",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOc1ccc2c(c1)sc(=S)n2CN1C[C@H](C)O[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53922",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1C2CC3CC(C2)CC1C3)C1CCC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "152221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@@H](NS(C)(=O)=O)C(=O)NCc1cccnc1Oc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80630",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC(=O)n1cc(/C=N/NC(=O)c2ccc(Cl)cc2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1cc(C(=O)NCc2ccc3c(c2)OCCO3)ccc1OC by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)c(NC(=O)CCc2cc(F)ccc2F)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88811",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(-c2ncco2)cc1NC(=O)c1cccc2[nH]ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238170",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule c1coc(C[NH2+]C2CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17750",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(CSc1nc2ccc([N+](=O)[O-])cc2s1)NCCc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141396",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C=CC[NH+]1CCN(c2ccccc2NC(=O)CSc2ccccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56194",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(Nc2nc3ccc(C)cc3s2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37857",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H](CCc1ccc(Br)cc1)NC(=O)[C@@H]1Cc2ccccc2S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C[C@@H](C)N[C@H]2CCOc3ccccc32)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217554",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Fc1ccccc1COc1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCN1CCCN(C(=O)Nc2ccc(F)cc2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75113",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1cnc(OCc2nnc(Cc3ccccc3C)o2)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "211458",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=c1[nH]c(CNc2cccc(Cl)c2)nc2scc(-c3ccccc3)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74536",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(OCC#N)ccc2c1O/C(=C\\c1ccncc1)C2=O by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191396",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule ClCCc1nc2cnccc2n1[C@H]1C[C@H]2CC[C@@H]1C2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172240",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H]([NH2+][C@H](C)[C@H](C)c1ccccc1)C(=O)N1CCCC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1ccc2c(c1)OCCOCCOCCO2 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCNC(=O)N1CC[C@@H]([NH2+][C@@H](C)c2cccc(S(=O)(=O)NC)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191798",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1nc(N2CC[C@](O)(C(F)(F)F)C2)nc(C)c1CC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66777",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCC[NH+](C)C[C@H]1CCN(c2ccc(C(C)=O)cc2[N+](=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86804",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1nn(Cc2ccc(Cl)cc2Cl)c(C)c1NC(=O)c1c(C(=O)[O-])cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(CC(=O)N2CCN(Cc3ccc(C(N)=O)cc3)CC2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "112223",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNC(=O)c1ccc(Cl)cc1)N/N=C\\c1ccco1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25480",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COc1cccc(CNS(=O)(=O)c2cc(-c3nc(-c4ccccc4)no3)sc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73400",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(CCCC(=O)Nc2ccc(-c3ncon3)cc2)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106693",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1N=C(c2ccc([N+](=O)[O-])s2)O[C@H]1c1cccc(NC(=O)c2ccc(Cl)cc2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133467",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)[C@@H](N[C@H](C)c1cc2ccccc2o1)c1nc(-c2nc[nH]n2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101055",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1noc2ncc(C(=O)N3CCOC[C@H]3C3CC3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59465",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[C@@H](C(=O)NCc1cc(C)c(F)c(C)c1)C(N)=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NC(=O)c1ccccc1NC(=O)c1cccc(C(=O)OC)c1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130838",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN1N=C(C)Cn2c1nc1c2c(=O)n(CCOC)c(=O)n1C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77336",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCc1noc(CN(C)C(=O)c2c(C)cc(C)cc2C)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95763",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC(=O)N1C=C[C@H]2C(C)=C[C@@H]1C(C#N)(C#N)C2(C#N)C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142788",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(/C=C/C(=O)Nc2cc(F)c(F)cc2F)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "214760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)Cn1cc(NC(=O)Cc2ccccc2F)cn1)C1CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122723",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c2c1N[C@H](c1ccc(N(C)C)cc1)[C@@H]1CC=C[C@@H]21 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20028",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCOC(=O)C1CCC([NH+]2CCC(OCc3ccccc3)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "162751",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCC[C@@H]1[C@@H](C)CCCN1C(=O)/C=C/c1ccc(C(N)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115022",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1ccccc1[N-]S(=O)(=O)c1ccc2oc(S[C@H](C)C(=O)N3CCNC3=O)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64220",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]1CCC[C@@H]([NH+](C)C2CCC([NH3+])CC2)CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192897",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1071",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)c1ccc(-c2ccco2)n1CC(=O)N1CCN(c2cccc[nH+]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140860",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(-n2nc(C)c3c2N=C(O)C[C@@H]3c2ccc(OCc3ccccc3F)c(OC)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCc1ccccc1N1C[C@H](C(=O)N2CCOC[C@H]2C#N)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179235",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COC[C@@H](C)N(C)C(=O)N1CCC(CC(=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230609",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC[C@@H](Cc1nc(-c2ccccc2)cs1)[NH2+]C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129218",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)S(=O)(=O)c1ccc2c(c1)c(C(N)=O)cn2C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "82729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](N[C@H]1CCCN(c2ccn(C)n2)C1=O)c1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120686",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1nn(-c2ccc(Cl)nn2)c(CC)c1CC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104359",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1noc2ncnc(N3CC[C@@H](NC(=O)c4ccccn4)[C@H](O)C3)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222848",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@]1(C2CC2)CN(CC2CC2)c2ccccc2C[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153916",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc([C@@H](C)[NH2+]Cc2ccco2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135536",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCC[NH2+]C[C@@H]1Cc2ccccc2S1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238122",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@H](NC(=O)CSc1nc2ccccc2c(=O)n1C[C@H]1CCCO1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132916",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCOC(=O)[C@@H]1CCCN(C(=O)C[NH+](C)Cc2cccc(F)c2Cl)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171969",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1cccc(C2=CCN(C(=O)c3cccnc3-n3cccn3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79823",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1CN(C(=O)c2n[nH]c(C3CC3)n2)CCO1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13230",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule Cc1ccccc1C1(C(=O)NCCCc2c(C)noc2C)CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98097",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule N#Cc1cccc(NC(=O)CS[C@H]2N=C3C=C(c4ccccc4)N=C3C(=O)N2Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134663",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(C)c(NNC(=O)C2C[C@@H](C)O[C@H](C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89968",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@H](CC(N)=O)[NH2+][C@H](CO)CC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139063",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]([NH3+])c1noc([C@@H]2Cc3ccccc3S2)n1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219985",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "500",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCC1CCC(N(C)C(=O)c2nc(C(C)(C)C)n[nH]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CC[NH+](CC(=O)[O-])Cc1nnc(-c2ccc(C)cc2)o1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123214",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc(Cl)cc1Cl)Nc1ccccc1C(=O)N1CCCCCC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62433",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc([N+](=O)[O-])ccc1NC(=O)C[C@H]1Sc2ccccc2NC1=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21665",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C[NH+]2CCN(CCO)CC2)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27089",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCCN(CC#N)Cc1noc(-c2ccoc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140930",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COC[C@H](C)NC(=S)N1CCN(c2ncccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200443",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(=O)n(-c2ccccc2)nc1C(=O)N1CCC[C@@H](C)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1N1CCCCC1=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210560",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CC[NH+]1CC[C@H](CNCc2ccc(C(=O)[O-])cn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54194",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(NC1CCN(C(=S)NCc2ccco2)CC1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147872",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H]1C[C@@H]1C(=O)N1CCN(c2c(F)cc(C#N)cc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248058",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C=CCOc1ccccc1C(=O)N/N=C(/C)c1cc(O)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1cccc(CN(Cc2ccccc2)C(=O)Nc2ccc(Cl)c(Cl)c2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)c([C@@H](C)NCC[C@H]2CSCC[NH2+]2)s1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48605",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cscc1C(=O)N[C@@H](C#N)c1ccccc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155800",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(NC(=O)CCCCl)n(-c2nc(C)c(C)c([O-])n2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@H]1CCCN(C(=O)COC(=O)[C@@H]2COc3ccccc3O2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101077",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CNC(=O)c1sc2ccccc2c1C[C@H]1CCCCN1C(=O)Cn1nc(C)ccc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105065",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(CBr)c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2CC(=O)N(CC(=O)Nc3cccc(C)c3C)c3ccccc3S2)cc1OC by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230568",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(NC(=O)N[C@H]2CC[C@@H]([NH+](C)C)C2)cc1S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1OC)CN(C(=O)NC[C@H](C)Cn1cccn1)CC2 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76634",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(=O)N[C@@H]1CN(Cc2ccc(-n3cccn3)cc2)C[C@H]1c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223145",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CC[NH+](Cc2csc(CS(C)(=O)=O)n2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "6253",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)c1ccccc1NC(=O)c1ccc(Cl)o1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228330",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)[C@@H]1C[C@@H]1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141738",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1cccc2c1=[NH+]C(=O)[C@@H](CN(C[C@@H]1CCCO1)C(=O)c1ccccc1F)C=2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(C)cc(C2=CCN(C(=O)c3n[nH]c4c3CCC4)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163343",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2CCCN2C(=O)CN2C(=O)NC3(CCCCC3)C2=O)cc1OC by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132057",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H]1CCN(C(=O)c2c(F)cccc2F)C[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159309",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule CS(=O)(=O)N1CCC[C@@H](C[S@@](=O)c2ncccc2N)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COCCN(C(=O)C[NH+]1[C@@H](C)C[C@H]2CCCC[C@@H]21)[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59207",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCS(=O)(=O)c1ccc2oc([C@H]3CC[NH+](CC4CCCCC4)C3)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108319",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(=O)Nc1ccc(C[NH+]2CCC[C@@H](CNC(=O)c3cccnc3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201860",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cc(NC(=O)CCC(=O)c2ccc(F)cc2F)ccc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122322",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule NC(=O)CN1CC[NH+](Cc2nc(C3CC3)no2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248033",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitrile to the molecule O[C@H](c1ccc(Cl)cc1)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117838",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COC(=O)CCC(=O)OC[C@]1(C)CCC[C@]2(C)[C@@H]1CC[C@@]13C=C[C@@](C)(CC[C@@H]21)C3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "207813",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cccc2c(CC(=O)NCc3ccnc(OC(C)(C)C)c3)c[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "84735",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COCCCN1C(=O)S/C(=C\\c2sccc2C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CCOCCSc1ccccc1S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89373",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC(C)NC(=O)CSc1n[nH]c(N/N=C/c2ccc(Br)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90990",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COCc1cccc(NC(=O)N[C@H](C)c2ncc(C)s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32084",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(C[n+]1ccc(C(=O)NCCO)cc1)c1ccc(-c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160840",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCCOc1cc([N+](=O)[O-])c(Cl)cc1NC(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106939",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cc1ccc(C(C)C)c(OC[C@@H](O)C[NH+]2C(C)(C)CC(O)CC2(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190908",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc(CN(C)[C@H]2CS(=O)(=O)c3ccccc32)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@H]1COCCN1C(=O)Cc1ccon1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172639",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)(C)[C@@H](O)CCNC(=O)[C@H]1CC(=O)N(c2ccc(Cl)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108591",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)C[C@H]2SC(=O)N(Cc3ccccc3)C2=O)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113171",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C1CCC[C@H]1[C@@H]1CCC[NH+]1CC1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90308",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c([C@H](C)NC(=O)[C@@H]2CCCN(S(C)(=O)=O)C2)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1[nH]c2ccccc2c1[C@@H]1c2ccccc2C(=O)N1CCC(=O)Nc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236637",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(c1cccc(-c2ccoc2)c1)N1CCCC[C@H]1C1OCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183418",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@H](C)NC(=S)NNC(=O)c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157875",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@@H](Sc1ncccn1)c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10741",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1nccc1CNc1ccc(C)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240020",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H](NC(=O)Cn1cccc1C(=O)[O-])c1cccs1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "160753",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@H](CNC(=O)Nc1ccc(C)c(C(N)=O)c1)[NH+]1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "64322",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccccc1C[NH+]1CCC(CN(C[C@H]2CCCO2)C(=O)[C@H]2C=c3ccccc3=[NH+]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)c1ccc(OC)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29574",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=S(=O)(Cc1nc(-c2cccs2)no1)c1ccc2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18990",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)C[C@H]1CCCCN1S(=O)(=O)C1CCS(=O)(=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131553",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(S(=O)(=O)/N=C(\\[O-])c2cc3c(s2)CCC3)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125251",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(=O)c1ccc(NC(=O)/C=C/c2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150652",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C#CCN(C(=O)NCc1ncc(C(C)(C)C)o1)[C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66545",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNC(=O)NC(=O)CN1C(=O)N[C@](C)(c2ccc(Cl)cc2Cl)C1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139392",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cl)c2c1NC(=O)C2 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H](C)NC(=O)c2ccc(N3CCNC3=O)cc2)o1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1ccc(OC(F)(F)F)cc1)c1cc([O-])n(-c2ccccc2)c(=O)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "7235",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC[NH2+][C@H](C)c1cnc([C@H]2C[NH+]3CCN2CC3)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73154",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CO[C@H](C)c1cccc(NC(=O)NCCC(=O)Nc2ccc(C)cc2Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33627",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(C)n2c(CN(CC(F)F)C3CC3)cnc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48366",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1cccc2cc(C(=O)Nc3nnc(CSc4ccccc4)o3)oc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129297",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](NC(=O)C(=O)Nc1cccc(Cl)c1Cl)c1ccncc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131080",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC(C[NH+](C)Cc2ccn(Cc3ccccc3)c2)CC1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145818",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C)c2ccccc2CN1C(=O)N[C@@H]1CC[C@H]([NH+](C)C)C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C1C[C@H]([NH2+]C(C2CC2)C2CC2)CN1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146660",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C[C@]1(c2cc(C)cc(C)c2)CCC[C@H]1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189054",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(NC(=O)NCc2ccc(Cl)cc2)n(Cc2ccccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72104",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1C[NH+]=C(N2CCN(Cc3cnnn3C)CC2)S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127437",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)c1ccc(C(=O)NC2=NCCS2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210835",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule O=C(C[C@@H]1C(=O)Nc2c(-c3ccc(F)cc3)cnn21)Nc1cccc(OC(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125422",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NCc2c[nH]nc2C(C)(C)C)c(OC)cc1Cl by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(=O)N1N/C(=C2\\C(=O)N(C)C(=O)N=C2[O-])C[C@@H]1c1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "42308",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CC[n+]1c(Nc2ccccc2OC)sc(NC(C)=O)c1-c1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C/[NH+]=C(\\[S-])NCCc1c[nH]c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164594",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCN(CC)C(=S)NC(=O)c1cc(Br)ccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66510",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1nc(-c2ccc(F)cc2)c[nH]1)c1nc2ccccc2c(=O)[nH]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "204115",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@H]1CC[C@@H](C)C[NH+]1Cc1csc(CS(C)(=O)=O)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66340",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule C[C@@H](NC(=O)Cn1cnc2ccc(F)cc2c1=O)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1cc2s/c(=N\\C(=O)Cc3ccccc3)n(CCSC)c2cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74286",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule Cc1ccccc1OCC(=O)NCCC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32464",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)CN(C[C@H](O)c1ccccc1)S(=O)(=O)c1cccc2c1COC2=O by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16539",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCS(=O)(=O)N1CCC[C@@H]1C(=O)N1CCc2[nH]ncc2C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(OCC(=O)Nc2cccc(-c3ccc(CO)o3)c2)c(Br)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221142",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1OCCC(=O)N[C@@H]1CCCC[C@@H]1C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228528",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C=CCn1c(SCc2nc3ccccc3[nH]2)nnc1-c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65140",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(C)[C@@H]([NH2+]C[C@H]1CCC[C@H](O)C1)c1ccc2c(c1)CCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217435",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COc1ccc(F)cc1NC(=O)c1cc2c([nH]c1=O)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "103080",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule CC(C)(C)C[C@H](CO)NC(=O)c1cncc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184443",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cn1ccc(NC(=O)c2cccc([N+](=O)[O-])c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87498",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](SCc1cc(-c2ccc(Cl)cc2)no1)C(=O)NC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161966",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC1(C)C(C(=O)NCC2(S(C)(=O)=O)CCOCC2)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "108388",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[NH+](C)[C@H](CNC(=O)[C@@H]1Cc2ccccc2O1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27840",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCC[NH+]1CCCN(C(=O)NCCc2ccc(O)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65469",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@@H]1[NH2+]C[C@@H](c1cccc(F)c1)N(C)C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55296",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(O[C@@H](C)C(=O)Oc2cc(F)ccc2[N+](=O)[O-])cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2c(c(=O)[nH]1)C(=O)O/C2=C\\c1ccc(I)o1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128540",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCCn1cncc1[C@@H](O)[C@@]1(C#N)CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60865",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)N1CCC(N[C@@H](c2ccc(F)cc2)C(F)(F)F)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "23150",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C=C(C)C(=O)Nc1cc(Cl)c(C)c(Cl)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "69481",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(C)cc(OCCCN2C(=O)N[C@@]3(CCOc4ccccc43)C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99008",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C[C@H](O)CCC(=O)N1CCC(NC(=O)C2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135744",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1nc(CN(CCO)Cc2cc(Br)ccc2F)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209132",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[NH+](Cc1ccc(/C(N)=N/O)cc1F)[C@@H]1CCSC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](NC(=O)N1CCOC[C@H]1C1CC1)c1ccc(F)cc1F by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242162",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccnc1)C(=O)N1CCN(Cc2cccs2)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59752",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)N(C)C(=O)c1cc(NC(=O)CC(C)(C)C)ccc1O2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "115341",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule Cn1c(CNc2c3c(nc4nncn24)CCC3)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92052",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)C[C@@H](O)c1cccc(F)c1)[C@@H](CCO)c1ccccc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150837",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule C[C@@H](C(=O)N1CCC[C@H](C(N)=O)C1)N1CCN(c2ncccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C(C[NH+]1CCC(O)CC1)Nc1ccc(N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105282",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)N1C[C@@](C)(C2CC2)[NH2+]CC12CCCCC2 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233060",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CN(Cc1ccc(Cl)c(Cl)c1)C(=O)C[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146900",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC(C)[C@@H](NC(=O)NNc1ccc(C(C)(C)C)nn1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5042",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(S(=O)(=O)N(C)C)cc(NC(=O)CCc2ccco2)c1C by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39739",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccncc1)C(=O)[C@@H]1CCCC[NH+]1Cc1ccccc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155413",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(C)C)c(O[C@H](C)C(=O)N2CCOC[C@H]2C(N)=O)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25484",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCC[NH2+]C[C@@H](C(C)C)N1C[C@@H]2CCCC[NH+]2C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17286",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nc(-c2ccco2)n[nH]1)N[C@@H]1SC2=C(CCCC2)[C@H]1C(=O)Nc1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "172560",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)nc(N/C(=N/C(=O)NC23CC4CC(CC(C4)C2)C3)N2CCC[C@@H](C)C2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150721",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(NCCC(F)(F)F)N1CCOc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199169",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@@H]([NH2+][C@H](C)c1ccc(F)cn1)c1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116602",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCCN(CCCl)c1ncnc2c1CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118791",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC[C@H]1CCCN(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183353",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(=O)Nc1cccc(NC(=O)[C@H](C)c2ccc3ccccc3c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58126",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1cccc(NC(=O)Cn2cc(-c3nc(-c4cccc(C)c4)no3)ccc2=O)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "239724",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1ccc(O)c(C[NH+](CCO)[C@H]2CCc3ccccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87085",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]([NH2+]C1C(C)(C)C1(C)C)c1ccc(S(C)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29108",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H]1C[C@@H]1CNC(=O)CCn1nc([O-])c2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74368",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COC(=O)C1=C(C)N=C(C(=O)N2CCC[C@H](C(=O)NCc3ccc(Cl)cc3)C2)[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100556",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(C(=O)N(C)CCc2cccc3ccccc23)o1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157558",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCn1cc(C(=O)O[C@H](C)c2ccccn2)c(C(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225311",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)CCn1ccc(NC(=O)c2cc(NC(=O)C(C)(C)C)ccc2F)n1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[NH+](Cc1ccc(OC)c(O)c1)Cc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220447",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(Nc1nc2c(s1)C(=O)CCC2)c1ccc(Cl)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "184788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](OC[C@@H](O)CN1CCn2c(nn(C)c2=O)C1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "99049",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](C[NH2+][C@H](C)c1ccc2[nH]c(=O)[nH]c2c1)Oc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156079",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC(C)CN(C(=O)NCC1CCC1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N[C@@H](CC(=O)NCc1ccco1)c1ccc(Cl)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145982",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule N#C/C(=C\\c1ccc(N2CCOCC2)cc1)[C@@H]1[NH+]=c2cc(Br)cnc2=[NH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22585",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)c1cc2c(cc1NC(C)=O)OCCO2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "72115",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cncc(-c2ccnc(Cl)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](NC(=O)c1ccn(-c2cccc(Cl)c2)n1)c1c(C)nn(C)c1C by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117062",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C(=C/c1ccccc1)\\C[NH2+]Cc1ccon1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COCCCNc1ccc(N)c(OC(C)(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59200",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule O=C(NC[C@@H](CCO)c1ccccc1)C1=NO[C@@H](c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)cc1C(=O)NC1CC[NH+](CC(N)=O)CC1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215767",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule COc1cccc(C[NH+](C)[C@@H](C)C(=O)Nc2ccc(Cl)cc2Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111746",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccccc1COCC1(CS)CCOCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67635",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H]1CCOC2(CCCC2)C1)N[C@@H]1CCCC[C@@H]1OC1CCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76444",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)Cn1cc(NC(=O)c2ccccc2-c2nc(C(C)(C)C)no2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153276",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@@]1(C(=O)OC)CCC[C@H](Sc2ccc(F)cc2)C1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CSc1cccc(NC(=O)C[NH2+]C2(c3nccs3)CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCn1c(=O)c(C(=O)Nc2ccc(C)cc2Cl)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194814",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC[NH+]1CCN([C@@H]2CC[NH+](Cc3ccccc3N3C[C@H](C)O[C@H](C)C3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "114047",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCc1nnsc1Cl)[C@@H]1COc2ccc(Cl)cc2C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC1(C)CC(=O)C2=C(C1)Nc1ccc3ncccc3c1[C@H]2c1ccccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18641",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(C)n2nc(C(=O)OCC(=O)Nc3cccc(Cl)c3Cl)nc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(N[C@@H]1CC(=O)N(Cc2ccc(F)cc2)C1)c1ccc[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "104652",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1cccc(C/C([O-])=N/S(=O)(=O)Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50580",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1ccc(C[NH+](C)Cn2nc(-c3cccc([N+](=O)[O-])c3)ccc2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51341",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc([C@H](NC(=O)Nc2cccc(F)c2C)C2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95003",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1cc(C(=O)N2CCc3c([nH]c4ccccc34)[C@@H]2c2cccc(C(F)(F)F)c2)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45199",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C=CCNC(=O)CN1CCN(c2nc(C)nc3sc4c(c23)CCCC4)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27507",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(/C=N/c2ccccc2)c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53064",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CC[C@H](NC(=O)[C@H]1CN(C)CCO1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249241",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H](NC(=O)N[C@@H](C)Cn1cc[nH+]c1)c1nccn1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30980",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc([C@H]([NH2+]C[C@@H]2CCS(=O)(=O)C2)C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249299",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)O[S@@](=O)c1cccc2ccccc12 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105681",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=c1[nH]c2ccc(S(=O)(=O)N3CCN(c4nccs4)CC3)cc2[nH]c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178732",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H](CC1CCOCC1)[NH2+]C[C@H](O)C1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146061",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(CSCC(F)(F)F)N[C@@H]1CCN(CC(F)(F)F)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "222572",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCN1CCN(c2ccccc2)CC1)c1ccc2c(c1)OCCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146268",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1/C(=C/c2ccc[nH]2)c2ccccc2N1c1ccccc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171413",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCc1ccc(/C=N/OCC(=O)N(C)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "228567",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule N#Cc1cc2c(nc1NC(=O)c1cncc(-c3ccccc3)c1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98303",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=[N+]([O-])c1c(Br)cccc1N1CCN(Cc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "130581",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)(C)OC(=O)N1C[C@@H](Oc2cccnc2)C[C@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105924",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N[C@H]1CC[C@H]([NH2+]C(CO)CO)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65604",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@H](c1cncc(Br)c1)c1cccc(C)c1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66229",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC/[NH+]=C(/NC[C@@H](C)CN1CCOCC1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "164650",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Nc1nnc(SCC(=O)NCCc2cc(N3CCCC3)ncn2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nc2cc(S(=O)(=O)N3CCCCC3)ccc2o1)N1CCC[C@@H]2CCCC[C@@H]21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14415",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(/C=N/NC(=O)[C@@H]2COc3ccccc3O2)c(C)n1-c1cccc(Br)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22999",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1cc(-c2cc3nc(C)c(C)c(NCCN4CCCC4=O)n3n2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232763",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CS[C@@H]1CCC[C@@H]1N(C)C(=O)CCc1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "123615",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Nc2nn(-c3ccccc3)c3c2C(=O)C[C@@H](c2ccco2)C3)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "199522",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1ccc(C(=O)NNC(=O)c2ccc(C(=O)N(C)C)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOc1cc(C(=O)NCc2c(CC)nn(C)c2OC)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153661",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOc1ccc(-c2cn3c4c(=O)n(C)c(=O)n(C)c4nc3n2-c2ccc(Cl)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242708",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1nc2c3ccccc3nc(SCC(=O)N(C)[C@@H](C)CC(C)C)n2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "83331",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1nn([C@@H](C)C(=O)Nc2cccc([N+](=O)[O-])c2)c(C)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244493",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(c1cc(Cl)ccc1Cl)c1ccccc1C[N+]1=CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246501",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule O=C(CNC(=O)Nc1ccc(Oc2ccccc2)cc1)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242543",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Cc1cccnc1)N1CCCC[C@H]1c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "192102",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cn1c(C(C)(C)C)nc2cc(NC(=O)C(=O)NCC3(C4CC4)CC3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32843",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC(=O)Nc1ccc(C(=O)[C@@H](C)Sc2ncccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "173428",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C1N[C@H](c2ccc(F)c(-c3cccs3)c2)N2CCOC[C@@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196802",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(C)c(C(=O)N3CCc4cc(OC)c(OC)cc4C3)oc2c1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NS(=O)(=O)c1ccc(NC(=O)NCCc2c(F)cccc2F)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "14580",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CN(CCC(N)=S)C(=O)COc1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16593",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1NCCN(C(=O)C[C@@H]2C=CCC2)[C@H]1c1cccc(F)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "45662",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(NC(=O)N[C@@H](C)c2ccc(C#N)cc2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "90622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccccc1N1CCN(C(=O)c2nc(C)sc2-c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186135",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C(Cc1cccc2cccnc12)N1CCOC[C@@H]1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "55479",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)c1nc([C@H](C)[NH2+][C@H](C)c2nccs2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "40044",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOC(=O)/C(=N/O)c1csc(N)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75329",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccc(Cl)cc1CCNC(=O)NCCc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "248783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCSc1nnc(S[C@H](C)C(=O)N(C)Cc2ccccc2C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "117963",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)N(CCO)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183807",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "951",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[S@](=O)c1ccccc1NC(=O)C[C@@H]1OCCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "128740",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC[C@H](C)C(=O)Nc1cccc(C(=O)N2CCOCC2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "194840",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOc1cc(/C=N/N2C(=O)[C@H]3[C@@H]4C=C[C@H]([C@@H]3C2=O)[C@@H]2C[C@H]42)cc(Cl)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "80050",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc2oc(C(=O)N3CCC(Cc4ncncc4C(=O)NC4CCCC4)CC3)cc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170772",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccccc1CC(=O)N1C[C@@H](C)S[C@H](C)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22853",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@H](C(=O)N(C)Cc1nc2ccccc2s1)[NH+](C)CCS(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150576",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@@H](C(C)C)N1CCC(=O)N2CCCC[C@@H]2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167546",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C1=C[C@@H]([NH+]2CCN(c3ncccn3)CC2)CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93866",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COCC[C@@H](C)C(=O)Nc1ccc(-n2ccnc2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200763",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2/C(=N/C(=O)C3CCCCC3)S[C@H]3CS(=O)(=O)C[C@H]32)c(OC)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(NC(=O)CSc2nc3sc4c(c3c(=O)n2Cc2ccccc2)CCCC4)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96025",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)NN=Cc2ccc(C(C)C)cc2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73435",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H]1CN(C(=O)CCOCC(F)(F)F)C[C@@H]1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17442",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccccc1[C@@H]1CN(C2CCSCC2)[C@H](C)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81390",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CO[C@@H]1CCCN(C(=O)c2ccc(-c3ccco3)[nH]c2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118777",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CC[C@H]([NH3+])[C@H](Sc1ccncc1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197480",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH2+][C@H]1[C@H](N(C)Cc2cnn(C)c2)CCCC1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70011",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C/[NH+]=C(/NCc1cc(F)cc(Br)c1)N[C@H]1C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "134335",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@]1(c2ccccc2)C[NH+]=C(N)N1C[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148942",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)(C)c1ccc(OC[C@H](O)C[NH+]2CCC(CO)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175256",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C=CCc1cc(-c2ccccc2)cc(C=O)c1OCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118181",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1cccc2sc(NC(=O)Cc3ccc(C)cc3C)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163403",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C[C@@H](N)c1cc[nH+]c(N(C)C2CCCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244387",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(CCOCC1CC1)C(=O)C(C)(C)CCl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181266",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nnc(SCC(=O)N2CCCCC2)s1)c1ccc(F)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139828",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)N1CCSC(C)(C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "9136",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CN(C)C(=O)N1CCC(C(=O)Nc2ccc(N(C)C3CCCCC3)c(F)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "244559",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(NNc1cnccn1)Nc1ccccc1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "182777",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CN1CCc2ccc(NC(=O)N3CCC[C@H]3CN3CCOCC3)cc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule O=C(COc1ccc(Br)cc1F)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150693",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CC(C)OC(=O)[C@H](C)CNC(=O)N1CCO[C@H](c2ccccc2Cl)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "21159",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=CNc1ccc(C(=O)N[C@H]2CCCN(c3ccccc3Cl)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75957",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(C[C@](C)(O)CNC(=O)C(=O)Nc2ccccc2F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "39244",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[NH+]1CCN(c2ccc(NC(=O)[C@@H](Sc3ccccc3)c3ccccc3)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65207",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H](N)C[NH+](Cc2nnc(-c3cccs3)o2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242813",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1ccc2ncc(C(=O)Oc3cccc(N4CCCC4=O)c3)n2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155243",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)N1CCN(C(=O)CSc2nc3ccccc3c(=O)n2[C@H]2CCC[C@@H](C)[C@H]2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50618",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(Nc1cccc([C@H]2C=c3ccccc3=[NH+]2)c1)C1CCN(C(=O)C2=CCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125616",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]([NH2+]C)[C@H](CC)N1C[C@@H]2CCC[NH+]2C[C@@H]1C by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60765",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccccc1NCC(=O)NCc1ccc2c(c1)OCO2 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197495",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H]1CCCN(C(=O)Cn2c(-c3cccs3)cc3ccccc32)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13650",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H](NCCc1ccc(F)cc1)c1nc2c(s1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "142209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)cc(C(=O)N(C)C[C@H](O)CN2CCOCC2)c1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132748",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccnc1)c1n[nH]nc1Nc1ccc(Cl)cc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "139894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule Cc1ccc(N[C@H](C)C(=O)N(C)CCC#N)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(CC(=O)NC)[C@@H]1CCC[NH+](Cc2ccccc2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170796",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=C(CSc1ncnc2sc(-c3ccccc3)cc12)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "216233",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule CC[C@H]1C[NH+](CC2CCN(C(=O)OC(C)(C)C)CC2)CCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148247",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule COc1ccccc1OC[C@H]1CN(C(=O)Cc2cccs2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "234165",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1ccc(N2CCC[C@H](NC(=O)NCc3ccc(Cl)nc3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206519",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(C(=O)N2CCCCC[C@H]2c2cccn2C)nc1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "32237",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@H]([NH2+]Cc1ccc(F)cc1)c1cc(F)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "145567",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCOCCN(C)C(=O)C(=O)Nc1ccc(C)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25557",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C/C(=C\\c1ccc2ccccc2c1)C(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186731",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule N#Cc1ccccc1Cn1cccc1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "58909",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H]1CN(C(=O)Cn2cc(SCC(=O)Nc3ccc(F)cc3)c3ccccc32)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "149988",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC[C@@H]1CN(CCSc2ccccc2)[C@H](C2CC2)C[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "44407",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCN1CCN(C(=O)[C@H]2Cc3cc(S(=O)(=O)N(CC)CC)ccc3N2C(C)=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88538",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule O=Cc1cnccc1-c1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "132228",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN1C[C@H](C(=O)N2CCN(C(=O)c3ccccc3)CC2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOc1ccc([C@H]2C[NH+]=C(N)N2C(C)C)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236155",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)(C)c1cc(C(=O)Oc2ccc3c(c2)OCCO3)[nH]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189356",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CC1CCC(C(=O)N[C@@H]2CONC2=O)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCN(CC)C(=O)CCC(=O)N1CCCN(C(N)=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73196",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(C)n2c(SCc3ccccc3)nnc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191545",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CCC[C@@H](C)NC(=O)[C@H](C)Oc1ccc2c(C)cc(=O)oc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53472",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COC(=O)COc1ccccc1)Nc1cc2c(cc1Cl)C(=O)c1ccccc1C2=O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "107911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3)C2=O)ccc1O by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79464",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COCC1CCN(C(=O)NC[C@H]2CC[C@H](C(=O)[O-])O2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187468",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@H]1CCC[C@@H]([NH2+][C@H]2CCc3sc(Cl)cc32)C1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "33126",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@H](NC(=O)c1ccc(Cl)nc1)c1nc(-c2ccncc2)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@@H](C)Nc1ncnc2c1oc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183114",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc(N2CCNC(=O)[C@H]2C(C)C)c([N+](=O)[O-])c1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119792",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H]1CCCO1)C1=CC2=c3ccccc3=[NH+][C@H]2C(c2ccc(F)cc2)=N1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65295",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C[C@H](NC(=O)c1ccoc1)C(=O)Nc1ccc([C@@]2(C)NC(=O)NC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135292",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc(CN(C)C(=O)NCC2(c3ccc(Cl)cc3)CC2)n1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75493",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[C@H](NC(=O)C1CCCC1)c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "195954",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule C#CCN1C(=O)[C@@]2(C(C#N)=C(N)Nc3nc(SCc4cccc(F)c4)[nH]c(=O)c32)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232366",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN/C(=[NH+]\\C)SCC(=O)N1CC[C@@H](C)Sc2ccccc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34001",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(NC(=O)c2ccc(N3C(=O)CSCC3=O)cc2)cc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159866",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)CN(C(=O)C[NH+]1CCC(C(=O)Nc2ccccc2)CC1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217589",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2C(=O)CSC23CCN(S(=O)(=O)c2ccc(OC)cc2)CC3)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71655",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@](C)(O)c1cccc(OC(C)C)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60362",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(C(=O)N(C)C)cc1N[C@H]1CC[NH2+]C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "237434",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1cc(C(=O)N2CCC(C)CC2)ccc1NC(=O)N1CCC[C@@H]1c1cccn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146638",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)c2ccc3nncn3c2)[C@@H](C)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "29014",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCNC(=S)N[C@@H]1CCCc2ccccc21 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "213529",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1nn(C)cc1-c1cc(-c2cnn(-c3ccccc3F)c2)nc(N)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "77277",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CC[NH+](CCNC(=O)[C@@H]2SCCc3sccc32)CC1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "169684",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[NH+](CC)Cc1ccc(C[NH2+]C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "209388",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COCc1ccc(C/[NH+]=C/c2ccccc2O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159897",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule Cc1cc(C(=O)Nc2nnc(-c3ccc4c(c3)OCCO4)o2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26867",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(NCC(F)(F)F)[C@@H]1CCC[NH+](CC2=Cc3ccccc3OC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178441",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCC([NH+]2CCCC[C@@H]2CC(N)=O)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "95249",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule [NH3+]C[C@@H]1CN(Cc2cccn2-c2ccc(Cl)cn2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196084",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccccc1NC(=O)c1sc(-c2ccsc2)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "200439",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1cc(C)n2nc(C(=O)NC[C@H](C)Oc3ccccc3Cl)nc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "153033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CN(CCC(F)(F)F)c1cc[nH+]c2ccsc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76938",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@H]1COCCN1C(=O)Cc1csc(-c2cccc(F)c2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "183943",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C(NCc1cccc(OCC(F)F)n1)N[C@@H]1[C@@H]2CCO[C@@H]2C12CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1COCCN1C(=O)NCc1cc2ccccc2o1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78223",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule O=C(Nc1cccc2cccnc12)C1(c2cc(-c3ccccc3)on2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61385",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccccc1C(=O)N[C@H](C(=O)Nc1ccc2ncccc2c1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109459",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)Nc2ccc(F)cc2)nnn1-c1cccc(Cl)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198643",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule C1CC(C[NH+]2C[C@H]3CC[C@@H]2CN(Cc2nnc(C4CC4)o2)C3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "223721",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(OC)c(CN2CCN(c3nc(C)nc4c3CC[NH2+]C4)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "81185",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule [NH2+]=C1NC[C@H]([C@@H]2CCOC2)N1c1ccc(Cl)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "240898",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1cccc(C(=O)Nc2cc(CN3CCOCC3)ccc2C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "121020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(NC(=O)CNC(=O)c2ccc([O-])nn2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50371",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1cc[nH+]c1CN1CCN2C(=O)CN(C)C(=O)[C@@H]2C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180411",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC[C@@H](C)C(=O)Nc1ccccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "111474",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitrile to the molecule OCc1ccc(OCCC2OCCCO2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76527",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCOC(=O)N1CCN(C(=O)COc2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "191869",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(C(=O)N2N=C(C(F)(F)F)C[C@]2(O)C(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "217079",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(Br)cc(C[NH2+]Cc2ccco2)cc1Br by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31755",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC(C)CCOc1cccc(N2C[C@H]([NH3+])CC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129871",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CCN(CC)c1nc(C)cc(C(=O)N(C)Cc2ccco2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62384",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCCc1[o+]cc(-c2ccccc2)c2c1CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(=S)[nH]c(=O)c2c(C(=O)OC)cc(-c3ccccc3F)nc21 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "144928",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COC[C@@H](O)C[NH+]1CCC(N[C@H]2CCOc3ccc(C)c(C)c32)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75825",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1ccc(C(=O)N2CCCSc3ccccc32)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "57983",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1ccccn1)NCc1cccc(NC(=O)[C@H]2CCCO2)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](Oc1ccc2c(c1)CCC2)C(=O)Nc1ccn(CC#N)n1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156763",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCOc1ccc2nc(S[C@@H](C)[C@@H](C)C(=O)NN)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "131793",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(C(=O)Nc2ccc(S(=O)(=O)CC)cc2)n[nH]1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66325",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1cc(C#CCCO)ccc1OCc1ccc(O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "13500",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule CC(=O)OCC(=O)[C@@]12OC(C)(C)O[C@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@]3(F)[C@@H](O)C[C@@]12C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219552",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCc1cc2c(Nc3ccncc3)ncnc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "197097",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cc(Cl)cc(Cl)c1)C(=O)c1cccc(C[S@@](C)=O)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8311",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCNc1cccc(CN2CC[C@@H](c3ccccc3)C2)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "56340",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule C#CCNC(=O)CN1C(=O)N[C@@](C)(CCC)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "53169",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOC(=O)CCc1c(C)c2cc3c(c(C)c2oc1=O)OC[NH+]([C@@H](C)CC)C3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51965",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(N2CCN(C(=O)COc3ccc(S(=O)(=O)Nc4ccccc4)cc3)CC2)c1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106645",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCO[C@H](C)c1noc(C[NH+]2C[C@H](C)C[C@@H]2c2cccc(F)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule CCC1CCC([NH2+][C@H](C)[C@@H]2CN(C)CCO2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "15955",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1cccc(-c2nnc3ccc(OCCNC(=O)c4cc5ccccc5o4)nn23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=c1ncn(CCc2c[nH]c3ccccc23)cc1-c1ncc(C(F)(F)F)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "196634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(C(=O)N(C)[C@@H](C)c2ccncc2)cn1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245100",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1ccc(NC(=O)[C@H]2C[C@H]2c2cccc(F)c2)cc1N1CCOC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75455",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCC[NH+](CC)Cc1ccc(C(=O)OC)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27376",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(NC(=O)Nc2ccc(N3CCCS3(=O)=O)cc2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "113281",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(C[NH+](C)CCS(C)(=O)=O)cc1/C(N)=N/O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "79651",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1ccc(Cl)cc1C(=O)NCC1C(C)(C)C1(C)C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125380",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccccc1C(=O)N(CC(=O)N1CCc2sccc2[C@@H]1COc1ccccc1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190714",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CSC[C@@H](C)C(=O)NC[C@H](c1ccc(C)cc1)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "156587",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule C[C@H]1Oc2ccc(NC(=O)N(Cc3cccnc3)C[C@@H]3CCCO3)cc2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=Cc1cccc(OCC(=O)NCc2nnc3ccccn23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOC(=O)c1sc(NC(=O)Nc2ccc(Cl)cc2)c(C#N)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "157094",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)N[C@@H](CC(C)C)C(=O)N1CCC(n2cc(CO)nn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "43324",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1nc(NC2CC2)ncc1C(=O)N1CCCC1)[C@@H]1CCCO1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20618",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C1(N(C)[C@@H]2CCN(C(=O)OC(C)(C)C)C2)CCCC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76302",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2C[C@@H](c3ccc(C)c(C)c3)Nc3ncnn32)c(OC)c1OC by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198925",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CNC(=O)Cc1ccc(NC(=O)NC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "74704",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCNC(=O)NCc1ccccc1C[NH+]1CCCC[C@H]1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125148",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1ccc(F)cc1)N1CCN=C1SCc1c(F)cccc1Cl by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86152",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a thiol to the molecule COCCCN1C(=O)c2cccc3cc(NC(C)=O)cc(c23)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "187095",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule C/C(=N\\NC(=S)[C@H]1COc2ccccc2O1)[C@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88890",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(CNC(=O)CN2CC[NH+](Cc3ccccn3)CC2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(C(=O)Nc2ccc(Cl)cc2)[C@H](c2cnn(Cc3ccccc3)c2)NC(=S)N1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206456",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1cc2c(cc1OC)[C@@H]1CCCC[C@@H]1O[C@H]2c1cccc(NS(C)(=O)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30157",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCCO)NCCc1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127931",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule Cc1c(Cl)cccc1NC(=O)[C@@H](C)N1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2[C@@H]2C[C@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "48809",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[NH+](CC(=O)N[C@@H]1CCS(=O)(=O)C1)Cc1cccc(Cl)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19399",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1Cl by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=C(CN1C(=O)C[C@@H](c2ccco2)S(=O)(=O)c2ccccc21)Nc1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88147",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(=O)Nc1ccc(C(=O)Nc2nc(-c3c[nH]c4ccccc34)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "19961",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "135457",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule CC(C)NC(=O)NC[C@H]1C[C@H]2CC[NH+]1C[C@@H]2C[NH+]1CCN(c2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146987",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CN(C)c1ccc([C@@H](CNC(=O)C(=O)NC2CCCC2)N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230006",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC(=O)NCc1ccc(F)cc1)C(=O)C1CCCCC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16007",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[NH2+]C(C)(C)CN1Cc1ccnc2ccccc12 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "221036",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CCSc1cncc(Sc2nnc(C3CC[NH2+]CC3)n2C(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193556",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nccn1-c1cncc(N2CCN(c3cc[nH+]cc3Cl)CC2)n1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "94883",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(C(=O)NC[C@@H](O)c2ccco2)ccc1OC by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "20432",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CCOc1ccc(C=O)cc1[C@H](C)CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "220872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]1CN(C(=O)[C@@H]2Cc3cccc(F)c3O2)CCO1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "62492",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCO[C@@H](C)C(=O)Nc1cccc(-c2nnn[n-]2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "212953",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule Clc1ccc(C2SCCCS2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "188680",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule CC[C@H]1CCCCCN1C(=O)c1cccc(OC)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61207",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H](c1cc2ccccc2o1)N(C)C(=O)COc1ccc([N+](=O)[O-])c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "166451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule O=C1C(Br)=C[C@H]2[C@H]1[C@H]1C=C[C@]2(Br)C12OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "181441",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@H](CCCO)NC(=O)Cc1ccc(O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236351",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1cc(C#N)ccc1OC(=O)/C=C/c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "17836",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule O=C(NCc1ccccc1)[C@@H]1CN(C(=O)c2ccccc2)C[C@@H]1c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71438",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a aldehyde to the molecule C[C@@H](c1ccccn1)[NH+](C)CC(=O)NCc1ccccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168954",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule [NH3+][C@H]1CCCC[C@H]1Nc1nc2c([N+](=O)[O-])cccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "245990",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/N=C/c2ccc3c(c2)OCO3)cc1 by adding a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137572",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)Nc2ccncc2)cc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148322",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CCCN(CN2C(=O)[C@H]3CCC[C@H]32)CC1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "179150",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H](C(=O)NCc1ccccc1)N1CCN(Cc2ccc(Cl)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4275",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule COc1ccc(C)cc1Nc1ncnc(-n2cnc3ccccc32)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "28725",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C(NNC(=O)c1cccc(NC(=O)c2ccco2)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137021",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C[C@H](Oc1ccc(F)cc1)C(=O)N1CCN(c2ncc3c(n2)CCOC3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "105670",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(N2CCOCC2)nc(Nc2ccc(NC(=O)c3ccccc3Cl)cc2)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205526",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(Cl)c(C(=O)Nc3cccc([N+](=O)[O-])c3)sc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168531",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2cc(NC(=O)[C@@H]3CC34CCN(C(=O)[C@H]3CC(=O)c5ccccc53)CC4)ccc2s1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165425",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(N3CC(C(=O)N4CCN(CCc5ccccc5)CC4)C3)sc2c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "146549",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccc([C@@H](C)NC(=O)N[C@H]2CCC[C@@]2(C)CO)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "75528",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "1407",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1c(F)cccc1NC(=O)C(=O)NCC(C)(C)[NH2+][C@H](C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "193001",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule O=C1[C@H](NCc2cccc(O)c2)CCN1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118717",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(-c2cc(C)cc3c2O[C@@H](C[NH3+])C3)ncc1C by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124972",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CC(C)(Oc1ccc(Cl)cc1)C(=O)N1CC[S@](=O)C(C)(C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "176608",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule O=C1COc2ncc(C(=O)N[C@@H](C(=O)Nc3ccccc3)c3ccccc3)cc2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "118077",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1ccsc1NC(=O)COC(=O)c1ccc(Cl)nc1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "35764",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cn1ccc(Nc2cc(C(F)(F)F)nc(-c3ccccn3)n2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "170613",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH+]1CCC[C@@H](NCc2ccc(C3CC3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138965",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule N#Cc1c(NC(=O)c2cc(F)ccc2Br)sc2c1CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102089",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc([C@@H]2c3c(oc4ccc(C)cc4c3=O)C(=O)N2c2cccc(C)n2)cc1OC by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18551",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amine to the molecule O=C([C@H]1CC(=O)N(C2CCCCCCC2)C1)N1CCC2(CC1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1cccc(C(=O)N2CCSC(C)(C)C2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "124191",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CSC[C@H](C)C(=O)Nc1nc2ccc(C)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246844",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN1CCO[C@@H](CN2C(=O)c3cc(N)ccc3S2(=O)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127705",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1nc(-n2cccc2)sc1C(=O)N1CCN(c2ccccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78695",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule Cc1c(Cl)cccc1/N=C1\\NN=C(c2ccc3c(c2)C[C@H](C)N3S(C)(=O)=O)CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "116445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(O)c([C@H](C)NC(=O)N[C@H](c2nc(C)cs2)C2CC2)c1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150907",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(Nc1cc(Cl)ccc1F)N1CCCC[C@@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "161304",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc(-c2noc(CCCn3ccnn3)n2)c(Cl)c1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "233394",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@@H](CC(=O)NCCc1c[nH]c2ccccc12)NC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10746",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)c1cccc(NC(=O)C(=O)NCc2ccc(-n3cccn3)cc2)c1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227944",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Cn1cccn1)C(=O)N1CCc2c(nc(-c3ccccn3)[nH]c2=O)C1 by adding a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151462",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule COc1ccccc1NC(=O)N(CC[NH+]1CCCC1)Cc1cc2cc3c(cc2[nH]c1=O)OCO3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "151717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc(NC(=O)C2CCN(C(=O)c3ccccc3Cl)CC2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101617",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule COCCOC1CCN(C(=O)C(C)(C)c2cccc(Cl)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "41307",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a carboxyl to the molecule CC[C@@H](C)[C@@H](C[NH3+])N1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "50974",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(CCN1CCCC1=O)N[C@H]1CC[NH+](CC2CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H]1CCCN(C(=O)c2ccc3c(c2)ncn3-c2ccccc2)C1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "22803",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@@H]1[C@H](Sc2nc(C)cc(C)n2)CCC1(C)C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159170",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)CCN2C(=O)c1ccn(C2CCCC2)n1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "59327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CCOc1ccc(C(=O)N2c3ccccc3C[C@H]2C(N)=O)cc1OCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "219339",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1ccccc1NC(=O)NC[C@@H](c1ccc2c(c1)CCCN2C)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "63385",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CCC(CC)N1C[C@@]23C=C[C@@H](O2)[C@@H](C(=O)N2CCNC(=O)C2)[C@@H]3C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "86147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cn1ccnc1)N1CCC[C@@H](c2nc(-c3cccs3)cc(=O)[nH]2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "236278",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN(c1nc2ccccc2n2c(C3CCCCC3)nnc12)S(=O)(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "66170",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule O=C(NCCc1cccc([N+](=O)[O-])c1)c1cc2ccccc2c(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "230650",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule Cc1noc([C@@H]2CCCN2C(=O)c2cccc([N+](=O)[O-])c2C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "16051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)N2CC(=O)N3CCc4ccccc4[C@H]3C2)cc1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "155242",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ncccc1C(=O)N1Cc2nn(-c3ccc(C)c(C)c3)c(-n3cccc3)c2C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "206181",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(C(=O)N2CCc3ccc([N+](=O)[O-])cc3C2)Cc2ccccc2C(=O)O1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "78890",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1c(NC(=O)C(=O)N(C)Cc2ccc(N(C)C)cc2)cccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31406",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC(=O)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "247931",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc(S(=O)(=O)NC2CCN(C(=O)C3CC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "51591",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule COc1cccc(C(=O)Nc2c(C)c(C)nn2-c2ccc(C#N)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232387",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule O=S(=O)(NC[C@H](c1cccnc1)N1CCN(c2ccccc2F)CC1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "133030",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule CS[C@H]1CCCC[NH+](Cc2ccc(OCc3c(C)noc3C)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "54735",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(NCCc1csc2ccccc12)N[C@@H]1C=C[C@H](CO)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "73534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule CC(C)C1CCC(C[NH3+])([C@@](C)(O)c2ccccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147167",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule CCc1ccc(N2C(=O)CS[C@@H]2c2ccccc2F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205612",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc[nH+]c1CCN[C@@H]1CC[C@H]([NH3+])C1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "198250",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)cc1CC(=O)N1CC[C@@](O)(C2CCOCC2)[C@H](C)C1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "148988",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@](C)(O)[C@@H]2CCCN2C(=O)Nc2cccnc2Cl)cc1 by adding a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "91441",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@H]1C(=O)NCCN1C(=O)[C@@H](C)Oc1cc(Cl)cc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "5736",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@H]1CCCN(S(=O)(=O)c2ccc(CNc3cncc(-n4cccn4)n3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "126789",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(/C=C/c1ccccc1)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "31412",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc(CN(CC)C(=O)c2ccc(Cn3nc(C)cc3C)cc2)n1 by adding a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H]([NH3+])[C@H]1CCOC2(CCCCC2)C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87912",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CS[C@H]1CCC[C@H]1NC(=O)N(C)Cc1ccc([S@](C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "88074",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule COc1cccc(/C(C)=C/C(=O)OCc2csc(-c3ccccn3)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "120506",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule C[C@@H]1CCC[C@@]([C@H]([NH3+])Cc2ccc(F)cc2Cl)([NH+](C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "243146",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule COC[C@H](C)NC(=O)NC[C@@H](C)C[C@@H](C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCc1cnc2c(c1SCC(=O)OC)c(=O)n(C)c(=O)n2C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "18346",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnsc1C(=O)NCCc1ccccc1 by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "10101",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@H]1CC[C@@H](Nc2ccc(C(N)=O)cn2)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "141272",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCOc1ccc2[nH]c(=O)c([C@@H](c3nnnn3Cc3ccccc3)[NH+]3CCc4ccccc4C3)cc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "137484",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule Cc1ccc([C@H](CNC(=O)N[C@@H](C)c2nncn2C)[NH+](C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150360",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[NH+]1CCN([C@@H]2CCN(Cc3c(C)nn(C)c3OC)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159904",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a nitro to the molecule Cc1ccc(/C=C2\\C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "122608",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(N)nc(SCC(=O)N(C2CC2)[C@@H]2CCS(=O)(=O)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "61366",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(F)ccc1F by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "147791",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule Cc1cc(=O)n2nc(NCCCN3C[C@@H](C)O[C@H](C)C3)sc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "163890",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule C[C@@H]([NH2+][C@@H]1CC[C@H]([NH+](C)C)C1)[C@H](C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38674",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1sc(N2C(=O)C([O-])=C(C(=O)c3c(C)nc4ccccn34)[C@H]2c2ccccc2F)nc1C by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "238758",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(CN2C(=O)CC[C@H]2C(=O)NC2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "38097",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCC[C@H]1[C@H](C)CCCN1C(=O)CCS(=O)(=O)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "71207",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CC[NH+](CC(=O)N[C@H](C)c1ccc(F)cc1)[C@@H](C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246028",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CCC[C@@H](C#N)NC(=O)COc1cc(Cl)cc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "25371",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)n(-c2ccc(CNC(=O)N3CC[C@@H](C)[C@H](O)C3)cn2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "185223",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule O=c1[nH]c2ccccc2nc1/C=C/c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "189697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1-n1c(CCl)nc2ccsc2c1=O by adding a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "150235",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(CN2CCN(S(=O)(=O)N(C)CCC#N)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "249222",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule COc1ccccc1C[C@H]1CCCN(C(=O)[C@H]2CCCO2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "231259",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CONC(=O)C1(c2ccccc2Cl)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "100801",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule COC[C@H](C)OC(=O)c1c(N)n(Cc2ccccc2)c2nc3ccccc3nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "60861",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1ncc(F)c(-c2cnn(C)c2)n1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "109373",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule COc1ccccc1C[C@@H](C)C[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "36893",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule O=C(Nc1cc(Cl)cc(Cl)c1)C(=S)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "140040",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCC[NH+]1CCCCC1)N1CCC(OCc2ccccc2)CC1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "167262",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)c2ccn(-c3cccc(Cl)c3)n2)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "89283",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1cccc(Cl)c1)[NH+](C)Cc1ccc(Br)cc1N by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "171300",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1ccc(CNC(=O)c2cccc(C)c2[N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "12453",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule Cc1cc(S(=O)(=O)Nc2cccc3cccnc23)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "242522",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1ccc([C@H]2c3[nH]c4ccccc4c3CC[NH+]2Cc2cnn(C)c2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "101402",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule C[C@@H]1CN(C)c2ccccc2CN1C(=O)NCC(C)(C)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "190989",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CN(C)C(=O)C[C@@H]([NH2+]C[C@@H]1CCCO1)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "93847",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]1CCC[C@H]([NH+](CC2CC[NH2+]CC2)C2CC2)CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "49171",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a thiol to the molecule Cc1cc(C)cc(C[S@@](=O)[C@@H](C)CC#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "34971",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CC(C)(C)OC1CCN(C(=O)c2cnc([C@@H]3CCCO3)s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "27130",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)NC[C@@H](C)[NH+]1CCc2sccc2C1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "125811",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CC[C@@H]([NH2+][C@@H](C)[C@@H]1CN(C)CCO1)c1ccccc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "165445",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule CCN(CC(C)(C)O)C(=O)c1cc(N2CCCC2=O)cc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "208956",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC1CC[NH+](CCC(=O)Nc2ccc(F)c(N)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "76052",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amine to the molecule CC[C@@H]1CCC[C@H](NC(=O)Nc2cccc(NC(C)=O)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "127938",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a aldehyde to the molecule Cc1ccc(CN(C)C(=O)c2cccc(CN3C(=O)CSC3=O)c2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "210077",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a nitro to the molecule Cc1nn(CCO)c(C)c1C[NH+]1CCC[C@H](CCC(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "46312",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1cc(C)n(-c2ccc(NCC[S@@](=O)Cc3ccccc3)nn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "246471",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COc1ccc(C[NH+]2CC[C@]3(O)CCCC[C@@H]3C2)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "4516",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule COc1ccc(NC(=O)[C@H]2N=NC3=C2CCc2ccccc23)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "70024",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COc1ccccc1CNC(=O)c1nn(C)c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "8558",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule CC[C@@H](C)[C@@](C)(O)C[NH2+]Cc1ncc(-c2ccccc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "215593",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)Nc1cccc(CS(C)(=O)=O)c1)c1ccc(Cl)cc1 by adding a carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "227041",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule C[C@@H]1CCCC[C@@H]1NC(=O)C(=O)Nc1ccccc1-n1cncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "201299",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COc1cc(C)ccc1OS(=O)(=O)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "138034",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule COC(=O)[C@]1(N)CCC[C@@H](Oc2ccccc2CO)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "96039",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC[C@@H]([NH3+])Cc1ccccc1OC[C@@H]1CN(CC)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119743",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCOCC[NH2+]Cc1ccc([S@](C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "232014",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(-c2nc(CC(=O)N[C@@H](C)c3ccncc3)cs2)cc1 by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "119357",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a halo to the molecule Cc1ccc([C@H](NC(=O)C(=O)Nc2ccc(C(=O)NC3CC3)cc2)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "37783",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule C[C@@H]1CCC[C@H]1[NH2+]Cc1cc(F)ccc1CS(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "52372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNC(=O)C(=O)Nc1ccc2c(c1)Cc1ccccc1-2)NC1CC1 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "178809",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a benzene ring to the molecule C[C@H](NC(=O)c1cccc(S(C)(=O)=O)c1)c1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "97409",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CC[C@H](CN(C)C(=O)CCCn2ccc3cc(Cl)ccc32)C1 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "102608",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H]1CN(C)C(=O)c1cc(C(F)(F)F)ccc1NN by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "67448",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C[C@@H](C)SC[C@@H]1CSc2ccccc21 by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "159653",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule COc1cc(C)c(I)c(C)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "26160",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCO[C@@H]1C[C@@H]([NH+](C)C[C@@H]2CCCN(S(C)(=O)=O)C2)C12CCCCC2 by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "378",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule Cc1ccccc1NC(=S)N(Cc1ccncc1)Cc1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92503",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule COCCN1C(N)=[NH+]C[C@H]1c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "205932",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a amide to the molecule C=CCc1cc(C(=O)CC)ccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "30546",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC1CCC(CNC(=O)NCc2ccc(C(=O)[O-])o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "98001",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCCC[C@]1(c2ccc(F)cc2)NC(=O)N(CN2CC[NH+]([C@H]3CCS(=O)(=O)C3)CC2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "175317",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a halo to the molecule O=C(NCc1ccc(S(=O)(=O)N2CCCC2)s1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "110168",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a carboxyl to the molecule COC(=O)c1c(NC(=O)c2oc3ccc(OC)cc3c2C)sc(C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "225861",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a hydroxyl to the molecule CC(C)(COc1cc(F)c([N+](=O)[O-])cc1F)C(=O)NN .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "180430",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])CCCc1nc2cc(Br)ccc2o1 by adding a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "87547",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1SCCN(C(=O)c2c[nH]c3ccccc3c2=O)[C@@H]1C by adding a benzene ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "168097",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a hydroxyl to the molecule CN[C@]1(C#N)CC[C@@H](Oc2ccc(C)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "106317",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCOC(=O)Cc1nnc(=O)[nH]c1[O-] by adding a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "129640",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](COC)NC(=O)c1sc2cccc(C)c2c1Cl by adding a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "65045",
"split": "OpenMolInst"
}
},
{
"instruction": "Add a amide to the molecule CCSc1nc(=O)c2c(n1C)NC(=O)C[C@@H]2c1c(F)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "186981",
"split": "OpenMolInst"
}
},
{
"instruction": "Please add a benzene ring to the molecule CCS(=O)(=O)N1CC[NH+](Cc2cccc(OC)c2OC)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "add_component",
"index": "92554",
"split": "OpenMolInst"
}
}
]