[ { "instruction": "Please remove a benzene_ring from the molecule O=C(Cc1ccc(Cl)cc1)NC[C@](O)(c1ccccc1)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26974", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(C[NH+]1C[C@H]2CC=CC[C@H]2C1)NOCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75570", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)c1c(C)[nH]c(C(=O)NC2=NCCS2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102138", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](Oc1ccc([N+](=O)[O-])cc1F)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218964", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCCN/C(N)=[NH+]/CC[C@@H](C)SC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54266", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Ic1ncn(C2CCCC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226306", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](C)Oc1ccc(NC(=O)/C=C/C(=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116785", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]1COC[C@H](C)N1C(=O)c1cc(F)c(F)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129774", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(NCCCc1n[nH]c(=O)[nH]1)[C@H]1C[C@@H]1c1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4647", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C([C@@H](O)c1ccccc1)N1CCN(c2ncc(Cl)cc2Cl)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241035", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CO[C@@H](C)C(=O)O[C@H](C)c1ccc(C)c([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80945", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cccc(-c2cc(C3(C(=O)NC4CC[NH+](Cc5ccccc5)CC4)CC3)no2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113549", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(C1CCC1)N1C[C@@H]2CC[C@H](C1)N(C(=O)c1cc(Cl)ccc1O)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205850", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOc1ccccc1N1C[C@H](C(=O)NC)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95101", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCn1ccc2ccc(NC(=O)c3ncccc3OC(C)C)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239829", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cn1nc(-c2ccccc2F)ccc1=O)c1ccc(Cl)s1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89230", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC(C)(C)NC(=O)c1ccc(NC(=O)C(=O)NCC2CCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111718", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)Cc2csc(NC(=O)C3CC3)n2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126892", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NC(=S)Nc1cccc(N2CCCC2)c1)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244370", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule [NH3+]C[C@@H]1CCC[C@@H]1COCc1cc(Cl)ccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@@H]2C(C#N)=C(N)N(N(C)C)C3=C2C(=O)C[C@@H](c2ccccc2)C3)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131953", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCC[C@H](C[NH3+])[C@@H](O)c1cc(Cl)c2c(c1)OCCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145253", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)[C@H](O)[C@@H](c1ccccc1O)n1nnc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181034", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)[C@@H]2CCC[NH+]2Cc2cc(-c3ccccc3)[nH]n2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111420", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)c1cccc(SCCS(=O)(=O)c2ccc(C)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209834", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule N/C([S-])=[NH+]/Nc1ccc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248810", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCCC[C@H](C)[NH+]1CCN(C(=O)Cc2c(C)noc2C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117862", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCNC(=O)NC(=O)CNc1cccc(F)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101109", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nn(Cc2c(Cl)cccc2Cl)c2sc(C(=O)OCc3ncon3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54679", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])CC1(NC(=O)CC2C[C@@H]3CC[C@H](C2)[NH2+]3)CCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167518", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)NC(=O)c1cc([C@@H]2CN(C(=O)c3ccncc3)CCO2)nc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211139", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(OCc1cc(-c2ccccc2)on1)c1ccc(F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6656", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)CCNC(=O)C1(c2cccc(C)c2)CCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194868", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Sc1nccn1-c1cccc(F)c1)C(=O)Nc1ccc2c(c1)OCCO2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47089", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N1C(=O)C[C@@H]([NH+]2CC[C@H](C(=O)[O-])[C@@H]2C)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112161", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1c(C)sc2nc(S[C@H](C)C(=O)N3CCCC[C@@H]3CC)n(C[C@@H]3CCCO3)c(=O)c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221214", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1ccc(NC(=O)c2sc3nc(C)nc(N4CCC(C)CC4)c3c2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220385", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](CCc1ccc(O)cc1)NC(=O)N1CCc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163069", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C(=O)COc1cccc(N)c1)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99508", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=CCNC(=S)NNC(=O)c1cnc(-c2cnn(C)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130517", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC1(CC)CCN(c2cccc(F)c2C(C)=O)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152902", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1c(NC(=O)/C=C/c2ccccc2Br)c(=O)n(-c2ccccc2)n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94604", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule c1ccc(-n2cnnc2SCC2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237759", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C([O-])c1cccc(-c2cc(NCc3ccccn3)nc3[nH]ccc23)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82724", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCNC(=O)CNC(=O)Nc1ccccc1SC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12679", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@](C)(O)CNC(=O)C(=O)Nc2ccc(Cl)cc2)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50786", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCC[NH+]1CCC(NC(=O)N[C@@H](CO)c2cccc(OC)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215018", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc2c1N(S(=O)(=O)c1ccc(C#N)cc1C)CCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54702", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(-c2csc(NC(=O)CSc3ccc(NC(C)=O)cc3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141911", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnc([C@@H](C)NC(=O)N[C@@H]2C[C@H](C)N(c3ccccc3)C2=O)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196777", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=c1c2cnc3ncnn3c2ccn1CCCO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231735", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cc(C)c(C(N)=O)c(N[C@H]2C=C[C@H](C(=O)[O-])C2)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19214", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](Oc1ccccc1)c1nnc(NC(=O)Nc2cccc(Cl)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190465", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)Oc1ccc(CNC(=O)[C@@H](C)Oc2ccccc2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201410", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN(C(=O)N[C@H](Cc1ccccc1)c1ccccc1F)C1CCS(=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162707", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=C(CN1CCN(C(=O)[C@@]23CNC[C@@H]2C[NH2+]C3)CC1)N1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159092", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(O[C@@H](C)C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64474", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccsc1[C@H](O)[C@@H]1CCOC2(CCSCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167246", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CSC[C@H](CCO)NC(=O)Nc1cc(Br)cn(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54313", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(COc1ccc(-n2cnnn2)cc1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166187", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc([C@@H](C)[C@H](C)N[C@@H](CO)c2cc(F)c(F)c(F)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150511", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCn1cc(NC(=O)C[NH+]2CCC[C@H](Cc3nc4ccccc4[nH]3)C2)c(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40740", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H]1C(C)=CC(=O)C[C@H]1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80571", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc(C[NH+]2CCC(CNC(=O)C3CC[NH+](C)CC3)CC2)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116681", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Fc1ccc(-c2cn3c(n2)-c2ccccc2C3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175679", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CC[NH+]1CCC(C(F)(F)F)CC1)Nc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197062", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCc1ccc(F)cc1F)C1CCN(c2ncnc3c2oc2ccccc23)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178309", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc2c(c1)CCC1=C2N=N[C@@H]1C(=O)N1CC[NH+](C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212992", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCCc1nc2ccccc2s1)c1ccc(N2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160405", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(-n2nc(C(=O)N3CCCC3)c(=O)n(Cc3ccccc3)c2=O)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162186", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1c(C)sc(NC(=O)[C@H]2CC(C)=C(C)C[C@H]2C(=O)[O-])c1C(=O)NC1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1ccc(Cl)cc1Cl)Nn1cnnc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177502", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCCCN1CCOCC1)C(=O)Nc1cccc(F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14220", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc2c(c1OC)C(=O)O[C@@H]2NNC(=O)c1ccccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204754", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H]1CCCC[C@@H]1NC(=O)C[NH+]1CCC[C@H](n2c(=O)oc3ccc(Cl)cc32)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196044", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(C#N)cc(I)c1OCC(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8872", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)c1nc2sc3c(NCCCO)ncnc3c2c2c1CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77677", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1800", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)[C@@H]2CC(=O)OC2(C)C)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10928", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule N#C[C@H](NC(=O)[C@H]1CCOc2ccccc21)c1ccc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80795", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCNC(=O)[C@@H]1CCCN(C(=O)N[C@@H](CCCO)c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183163", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)(C)OC(=O)[C@H](N)c1ccnc(C#N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145485", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(NS(=O)(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186523", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCNC(=O)C[C@@H](C[NH3+])N1CC[NH+](C(C)(C)C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98075", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(NC(=O)[C@@H](NC(=O)c2ccco2)C(C)C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12410", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(COC(=O)c1ccccc1Br)NCC(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136377", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C([O-])CC1(Nc2ccc(C(F)(F)F)cc2)CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219376", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc2c(c1)=C1CCN3C(=O)CN(Cc4ccco4)C(=O)[C@]3(C)[C@H]1[NH+]=2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91829", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccc(Oc2ccc(NC(=O)N[C@H]3[C@@H](CO)[C@H]4CC[C@@H]3C4)cc2)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247209", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOCc1cccc(CNC(=O)c2cccc(NC(N)=O)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74243", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCOC(=O)[C@H](C)N(C)Cc1c[nH]nc1-c1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNS(=O)(=O)c1cc(OC)c(Cl)cc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67195", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccccc1C(=O)Nc1ccc(OCC(=O)[O-])c(-c2nc3ccccc3s2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5990", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1cccc(C)c1NC(=O)N[C@@H](C)C[NH+]1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200020", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(CC1CCC1)[N-]c1ccc(OC[C@@H]2CCCO2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153121", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(F)cc1C(=O)N(CCc1cccc(F)c1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164821", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)c(C(=O)N2CCOC[C@@H](O)C2)nn1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221605", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1c(C)cnc(CNS(=O)(=O)N2CCCC[C@H]2C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128109", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(N2C(=O)O[C@@H](c3ccccc3)[C@]2(O)c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155047", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C#N)CNC(=O)Nc1ccn(C)n1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115677", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1N[C@@H](/C=C/c2ccco2)N2CCOC[C@H]12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38125", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1[C@H](CO)CCCS(C)(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136367", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N(C)C(=O)[C@@H](C)c2cccc(F)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175475", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(N2N=C(C(=O)NCc3ccccc3)CCC2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199100", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc([C@]2(C(C)(C)C)CCC[NH2+]2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80551", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1796", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule N#C/C(=C\\c1cccc(OC2CCCC2)c1)c1ccc(C(F)(F)F)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61981", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(C(=O)C[NH+](C)[C@@H](C)c2cccc(NC(=O)c3ccccc3)c2)CCO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48780", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC[C@@H]1CCCCN1c1ncccc1C(N)=S .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144854", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(S(=O)(=O)/N=C([O-])/C(C#N)=C\\c2ccco2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19596", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1=NN(c2ccc(C(=O)N3CCN(Cc4ccsc4)CC3)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28562", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(C(=O)N[C@@H]2CCCc3ccccc32)c(=O)[nH]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109320", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H]1C[NH+]2CCCC[C@@H]2CN1c1cccc(Cl)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108288", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)NC[C@H](O)C1CCOCC1)c1cc(F)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200821", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN[C@]1(C(=O)OC)CC[C@H](n2cc(Cl)cn2)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147964", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC[C@]1(C)CC(=O)NC(=O)[C@@H]1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223895", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3843", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)CCC(=O)Nc1nc(C(C)C)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123576", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCC(=O)N[C@@H]1CCCN(C(=O)[C@H]2CN(Cc3ccccc3)CCO2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135005", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1cccc(NC(=S)Nc2ccccc2)c1)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40171", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(-c3cccc(OC)c3)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77346", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(NC(=O)NC(=O)[C@H](C)[NH2+]CC2(N3CCOCC3)CCCCC2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111617", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCNC(=O)Cn1c(=O)oc2cc(S(=O)(=O)N3C[C@H](C)C[C@@H](C)C3)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60033", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[NH2+][C@H](Cc1nc(C)c(C)s1)c1cccc(OCC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167157", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H]1C[C@H]1c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144717", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c[nH+]c(CNCCO)[nH]1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233621", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1CCCOc2ccc(C(=O)N3CCc4ccccc4C3)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169526", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule Cn1c(CN2CCNC[C@@H]2C#N)cc(=O)n(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91316", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@H]1CCCN(C(=O)c2cc(F)cc(F)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145969", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cccc2ccc(C[NH+]3CCc4nnc([C@H](C)NC(=O)C5CC5)n4CC3)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110714", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@H](CNC(=O)Nc2cc(C)ccc2C)[NH+]2CCCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24036", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN(C)C(=O)N[C@@H](c1ccccn1)c1ccccc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86107", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1cc(C)c([C@@H](C)[NH2+][C@@H](CO)c2ccc(Cl)cc2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163264", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nc(COC(=O)[C@@H](Oc2ccc(F)cc2F)C(C)C)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187087", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2ccccc2n1-c1ncc(Cl)cc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213352", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2cc(Br)ccc2c1CC(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165709", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]CCOc1ccc(NC(=O)c2ccccn2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127976", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H](C)N[C@@H](C)C(=O)Nc2ccccc2)c(F)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151869", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[NH+]1CCN(c2ncnc(Nc3cc(Cl)ccc3Cl)c2[N+](=O)[O-])CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184041", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C[NH2+]CC1(N(C)C)CCOCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11269", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]([NH2+]Cc1ccc(OC(F)(F)F)cc1)c1ccc(-n2cncn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164891", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC1(C)CCN(C(=O)[C@H](c2ccccc2)N2CCSCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44507", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc2sc(NC(=O)[C@@H]3C[C@@H]3C)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159151", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](C(=O)OCC(=O)N1CCCCC1)N1C(=O)c2ccccc2C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91444", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CSc1ccc(C(=O)[C@@H]2CCC[NH+](Cc3ccc(C#CC(C)(C)O)s3)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211205", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Nc1ccccc1C(=O)N1CCCCC1)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42213", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc([C@H](O)c2cc(F)c(F)c(F)c2)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164760", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](CSC)N(C)C(=O)NCc1ccc(OC)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98529", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCn1cc(C(=O)C(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201989", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1C[C@H](C(=O)NCCC2=CCCCC2)Cc2nc(NC(=O)c3c(F)cccc3Cl)sc21 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8226", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cc(N2CCC(NC(=O)C3C[C@@H](C)O[C@H](C)C3)CC2)ncn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192529", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule NC(=O)C[C@H](C(=O)[O-])N1C(=O)/C(=C/c2ccccc2)SC1=S .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227697", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccnc1C[NH+]1CCC[C@H](C(=O)N(C)C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179613", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@H]1CC[C@@H](SC[C@@H](C)CO)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150430", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1C[C@H]1C(=O)N1CCN(Cc2csc(CC(=O)N(C)C)n2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134912", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc([C@H](C)NC(=O)CC2(C(=O)[O-])CCCC2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163661", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C2CCC(N3C(=O)[C@H]4[C@H]5CC[C@H](C5)[C@H]4C3=O)CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175871", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOCc1ccccc1NC(=O)c1ccc(-c2cscn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31076", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CCc1ccco1)[NH2+]C[C@](C)(O)c1ccc(F)cc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140319", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(Cc2cnc(N)s2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81274", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=[N+]([O-])c1ccc(F)c2c1[C@H]1C=CC[C@H]1[C@H](c1cccnc1)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36847", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCN(C(=O)[C@@H]1CC(=O)N(c2ccccc2Cl)C1)[C@H](C)c1cccc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223814", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](NC(=O)[C@@H]1CCC[NH+](C)C1)c1ccc(NC(=O)NC2CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191188", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1487", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CO[C@@H](CNC(=O)Nc1ccc(N(C)C(C)=O)cc1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101368", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](CNC(=O)c1ccn(-c2ccccc2F)n1)c1ccsc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24927", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)S(=O)(=O)c1ccc(NC(=O)CSc2nnc(-c3ccc(F)cc3)o2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185091", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CN(C(=O)[O-])c1ccc2c(c1)CCN2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232673", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H]1CC([NH+]2CCN(CC(=O)N3CCCCC3)CC2)C[C@@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134392", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(C)C(=O)CN(C)C(=O)c1cc2ccccc2[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53275", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(=O)[C@@H]1[C@@H](c2ccc(F)cc2F)C(C#N)(C#N)[C@H]2c3ccccc3C=CN12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39033", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H]1CCN(C(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90225", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1nn(C)c(OC)c1CNC(=O)CCN1c2ccccc2CC[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112651", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC(C)Nc1cc2ccccc2cc1C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138912", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)(C)OC(=O)N1CCC[C@@H](CCOCc2ccc(Cl)nn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88403", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@@]12CCCC[C@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)/C(=N/N)CC[C@H]12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246686", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc(C[S@@](=O)c2ccccc2F)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94134", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C([O-])c1nn(-c2ccc(Br)cc2)c(=O)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38010", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCOc1ccccc1NC(=O)C(=O)NC[C@@H]1CCC[C@@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227342", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCc1[nH]nc(C(=O)Nc2cnc(-c3ccccc3)s2)c1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201716", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1C[C@H](N2CCN(c3ccc(O)cc3)CC2)C(=O)N1c1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178188", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)c1c(N)n(/N=C/c2ccc(F)cc2)c2nc3ccccc3nc12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96056", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217036", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc2ncc3c(n2n1)C[C@@H](c1ccccc1C)CC3=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96293", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccc(C(=O)Cc2ccc([N+](=O)[O-])cc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240132", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cccc([C@@H]2CCC[NH+]2CCCN2C(=O)NC(C)(C)C2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145284", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(CNC(=O)CCC(F)(F)F)c1ccccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63031", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CSc1cccc2sc(N3CCN(C(=O)C(C)C)CC3)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75232", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@H](O)[C@@H](C)N1CC[NH2+]CC1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94343", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C=C(Cl)CN(C(=O)Cc1c(C)noc1C)[C@H]1CCc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117110", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)N[C@H]2C[C@@H]2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180180", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(Nc2nnc(SCC(=O)c3ccc[nH]3)s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111311", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCC(=O)N1CCC[C@H]1c1nc2ccccc2n1CCOc1ccc(Cl)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232608", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1ccccc1)C(=O)c1ccccc1NC(=O)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115125", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](CNCc1cccc(F)c1)c1ccsc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116916", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1c(NC(=O)c2ccc(C)cc2)sc2c1CC[NH+](C(C)C)C2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82301", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc2ncc(C(=O)Nc3nnc(CC(C)C)s3)n2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12666", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NC(=O)[C@@H](C)C[NH3+] by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)C2=Cc3ccccc3OC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203995", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC[C@@H]1CN(CCC(=O)N2CCC[C@H]2C)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157830", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCS(=O)(=O)NCCc1cc2c(C)ccc(C)c2[nH]c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82382", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N2CCC[C@H](C(=O)c3ccc(F)cc3)C2)ncc1[N+](=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93578", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(-c2ccccc2F)c2ncc3c(c12)C(=O)N(c1ccc(C(C)C)cc1)C3=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10060", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)N1CC[C@@H](c2c(C(=O)Nc3cccc(OC(C)C)c3)sc3ccccc23)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221599", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1cc(C)ccc1NC(=O)c1cccc(NC(=O)c2cccs2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44621", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOc1ccc(S(=O)(=O)NC[C@H](C)C#N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47584", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](CC(=O)N[C@H](C)c1nc2ccccc2[nH]1)Cc1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14007", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc(-c2cc(C)[nH+]c3ccccc23)nc([O-])c1Br by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178339", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN(Cc1ccccc1)S(=O)(=O)c1cc(C(=O)Nc2ccc(Br)cc2)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232970", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)[C@@]1(O)CSCC(C)(C)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220560", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCN(c1ccccc1)c1[nH+]cnc(Nc2nc3ccccc3s2)c1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51392", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Oc1ccccc1NC(=O)Cc1csc(-c2ccoc2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154647", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](Cc1ccccc1NC(=O)NC[C@H](O)c1ccco1)C1CCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97482", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@@H](c1cccc(Br)c1)N(C)CC1=CCCOC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190597", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CSC(C)(C)C)[NH2+]C[C@]1(O)CCc2ccccc21 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171299", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cn1c(=O)cnc2ccccc21)N[C@H]1C[C@@H]2CCCc3cccc1c32 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201753", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCS(=O)(=O)[N-]c1ccc(C(=O)/C=C/c2ccc(C)c(F)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245517", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(OC(=O)N2CCN3C(=O)[C@H]([C@@H](C)O)NC(=O)[C@H]3C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89835", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(C(=O)CC(F)(F)F)c(Br)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171158", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COC(=O)c1cc(N)ccc1N1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(N2CC[NH+]([C@H](C)c3nc(C(C)(C)C)no3)CC2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233105", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCC(=O)Nc1cccc(C(=O)Nc2ccccn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211193", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)C(=O)Nc1cc(F)cc(F)c1)C(=O)NCc1ccco1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211399", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(C(C)(C)c2ccccc2)sc1C(=O)NCc1ncoc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139627", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(S(=O)(=O)c2ncsc2SCC(=O)NCc2ccc(C)o2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150825", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nc(C[NH+]2CCC[C@H](CNC(=O)c3ccccc3)C2)sc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53880", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCn1cnnc1[C@@H]1CCCN(C(=O)Nc2ccc(OC)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20057", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1ccc(C(=O)N2C[C@@H](C(=O)[O-])[C@H](c3ccncc3)C2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232684", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN[C@@](C)(c1ccoc1)C(F)(F)F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68106", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1NC(=S)NC(=O)C1=CNCCc1ccc(F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99379", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(NC(=O)CCn2c([S-])nnc2-c2cccs2)sc1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20520", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(/C=C1/Sc2ccccc2N(Cc2ccccc2F)C1=O)NCc1ccc2c(c1)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221860", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccccc1OCCCOc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153806", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(NC(=O)[C@@H]2CCCO2)cc1)c1cccnc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224265", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1C[C@H](Nc2ccc(NC(=O)C[NH+](C)C)cc2)C(=O)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99991", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(S(=O)(=O)Nc2ccc(Oc3ncnc4sccc34)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230837", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCc1csc(=O)[nH]1)c1coc(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34415", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(=O)N[C@@H]2C[C@H]3CC[C@]2(C)C3(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123592", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(N[C@H]1CCCC[C@@H]1C)=C1C(=O)NC(=S)NC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243030", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)c1ccc([C@@H](C)[NH2+]Cc2cnn(C)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79276", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)NCc2ccc(-c3nn4cnnc4s3)cc2)cc1OC by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21905", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Nc1ccc2c(c1)OCCO2)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71916", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NOCc1ccccc1)N1CCC(c2nc3ccccc3s2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152848", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(CO)(CO)CCSc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29264", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)c1cccc(OCCC(C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183946", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@H](C(=O)Nc1ccc(C(=O)N(C)C)cc1)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244301", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@H](C)CC(=O)N1CCc2cc([N+](=O)[O-])ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C[C@@H]1CCOC1)C(=O)Nc1ccc(Cl)c(CS(C)(=O)=O)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29878", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(CCNC(=O)C2(c3ccc(C(C)C)cc3)CCCC2)n[nH]c1=S by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158767", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96802", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](SCC1=NC(=O)C2=C3CCCC[C@@H]3SC2=N1)C(=O)NC1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31213", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCOc1ccccc1CN1CCNC(=O)[C@@H]1c1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84509", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])C[C@H]1C(=O)NCCN1C(=O)CC1CCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48716", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cc(C(F)(F)F)c2c(C3CCN(C(=O)c4cn(C)nc4C)CC3)noc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222258", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Nc1cnc(N(Cc2cccs2)C2CC2)c(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134818", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(/N=C(\\O)[C@H](C)Sc2nncn2-c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92415", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CC(NCCC(N)=O)CC(C)(C)[NH2+]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215341", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1CCCN(C(=O)Nc2ccc(CCC(F)(F)F)cc2)[C@H]1CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137966", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cccc2sc(N(C[C@H]3CCCO3)C(=O)c3ccc(Cl)cc3)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215190", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(Cc1ccc(OC)c(OC)c1)C(=O)CN1C[C@@H](C)O[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190880", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(NC(=O)C2CCN(C(=O)N3CCCC3)CC2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9486", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccccc1NS(=O)(=O)c1ccc2[nH]cc(C(=O)N[C@@H]3CCCC[C@@H]3C)c(=O)c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41012", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(/C=C2/C(=O)NC(=S)N=C2[O-])c(C)n1-c1cccc(C(=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43394", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(CCc1ccccc1)[C@@H]1CCCN(C(=O)CN2CCCCCC2=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138550", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCSCC(=O)N[C@@H](C)C(=O)OC by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67985", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OC1CCC([NH2+][C@H]2CCCc3ccc(Br)cc32)CC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27276", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@]1([C@H]([NH3+])c2ccc(Cl)cc2Cl)CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89483", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(CSc2ncc(CO)n2Cc2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227843", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1cccc(CNC(=O)NCC2CCN(c3cc[nH+]cc3)CC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162863", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC1(C)C(C[NH2+]Cc2ccc(Br)cn2)C1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240712", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cn1c([O-])c(Sc2ccc([N+](=O)[O-])cc2)c(=O)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96447", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1[C@@H](C)NC(=O)[C@H]1CC(=O)N(CC2CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220810", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=S(=O)(Cc1ccccc1Cl)NCCc1csc(-c2ccc(F)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123657", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=C(/CC(=O)Nc2ccc3c(c2)OCO3)c2nc3ccccc3s2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194796", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCc1ccc(-c2nc(NC(=O)c3cccc(S(C)(=O)=O)c3)sc2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74617", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCC1=NN(C(=O)c2ccncc2)[C@](O)(c2ccc(Cl)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206997", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@H](c1ccc(OC(C)C)cc1)c1ncc[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215074", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](NC(=O)NCCCC(=O)N(C)C)c1ccc(-c2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77717", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(Br)cc1CNC(=O)CCl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185226", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1ccccn1)c1ccc(C=O)o1 by removing a aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61811", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)[C@@H](CO)NC(=O)[C@@H](C#N)Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75178", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(CC(=O)N1CCn2cccc2[C@H]1c1ccccc1Cl)C(=O)C1CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73799", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(C(=O)NCCCc2c(C)noc2C)cc2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179620", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)[C@@H](CO)NC(=O)C(=O)N1C[C@H](C)Oc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175651", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cccc(CNC(=O)c2cccc(C#N)c2)c1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195373", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COC(=O)Cn1cc(C[NH+]2CC[C@@H]([NH+]3CCOCC3)[C@H](O)C2)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104768", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3221", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule C[C@H](C#N)NC(=O)CCn1ccc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63614", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCO[C@H](C)C(=O)NC1CCC([NH+]2CCCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166229", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2C(C#N)=C(N)O[C@H]3N=NC(C)=C23)c2ccccc12 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228539", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COCCn1c(-c2ccc(C(C)C)cc2)c[nH+]c1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217312", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)n([C@H](C)C(=O)NCc2ccccc2-c2ccc(Cn3ccnc3)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157230", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Nc1cc2[nH]c(=O)[nH]c2cc1S(=O)(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244724", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])Nc2nnc(C3CC3)s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122638", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nn(C)c2c1nc(CCCl)n2[C@@H](C)[C@@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43397", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Cc1noc(-c2ccc(-n3ccnn3)cc2)n1)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78415", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNS(=O)(=O)[C@H]1CCN(C(=O)[C@H]2C[C@@H]2c2sccc2C)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90983", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=C(NCc1ccc(N2CCOCC2)c(F)c1)N1CC[C@H](Nc2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227520", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(OC[C@@H](C)NC(=O)/C=C/C2CC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169498", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-n2c(=O)c3sccc3n(Cc3cccc(F)c3)c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31939", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccccc1NC(=O)CN1C(=O)N[C@@](C)(c2ccccc2)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152017", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](NC[C@@H](O)c1cccc(C(F)(F)F)c1)c1cc(F)cc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73347", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1cccc([N+](=O)[O-])c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36435", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCN1CCOCC1)c1cccc(I)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215667", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC[C@@H](C)CN1C(=O)Nc1cnn(-c2ccccc2S(C)(=O)=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230357", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1noc(-c2ccc(C)c(NC(=O)NCc3ncnn3C)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246869", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC(=O)c2ccccc2-c2cncnc2)cc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142563", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(=O)C[C@@H](Nc2ccc(OC(F)F)cn2)[C@@H]1c1ccc(F)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121145", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(Cc2ccccc2NC(=O)c2ccncc2F)C[C@H](C)O1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77881", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)=CC[NH+]1CCC(CCC(=O)Nc2ccccc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168321", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)c1c(C)cccc1[N-]S(=O)(=O)c1cc(C)c(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162342", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(/C=C2/SC(=S)N([C@H]3CCS(=O)(=O)C3)C2=O)ccc1O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77977", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1CCN(C(=O)[C@H](C)[NH+](C)Cc2nc3ccccc3n2C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119212", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc(C(=O)N/N=C/c2cc([N+](=O)[O-])ccc2O)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15064", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#Cc1cccc(NC(=O)c2ccc(C[C@H]3CC(=O)NC3=O)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234051", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](NC(=O)C(=O)Nc1ccc(F)cc1F)c1cccc(N2CCCC2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13189", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1nnsc1C(=O)N1CC[C@@]2(CCc3ccccc3C(=O)N2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187173", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ncccc1CNC(=O)c1cc(C2CC2)on1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153234", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc([C@H](C)NC(=O)c2csc(C#CCN)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146635", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)N(Cc1c[nH]c2ccccc12)C(=S)Nc1cccc(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39554", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](OCc1ccccc1)C(=O)NCC(=O)Nc1cccc2ccccc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176346", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2CCN(C(=O)[C@H](C)NC(=O)c3cc4cc(OC)ccc4n3C)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58997", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cc2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(CN(C)C(=O)[C@@]2(C(F)(F)F)CC[NH2+]C2)n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125440", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1CCN(C(=O)c2oc3ccc(S(=O)(=O)N4C[C@H](C)C[C@@H](C)C4)cc3c2C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22164", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CCSc1cccc(C(=O)N(CC(F)(F)F)c2ccccn2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199630", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H](Cl)c1nc2cc(Br)cnc2n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141203", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSCC[C@@H](NC(=O)c1ccc2c(c1)OCO2)C(=O)N1CCC2(CC1)NCCc1[nH+]c[nH]c12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84976", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1CCCCN1C(=O)CNc1ccc(Cl)c([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75611", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1c[nH+]ccc1N1CCCN(C(=O)[C@H]2Cc3ccccc3CN2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209298", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@@H](Cc1ccc(F)cc1Br)[C@H]1CN(C)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190485", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(C)cc1-n1c(SCC2=NC(=O)[C@@H]3SC=CC3=N2)nnc1-c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195728", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(CNc1ccc(Br)c([N+](=O)[O-])c1)OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72886", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)C[C@@H](C[C@H](O)c1ccccc1)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92339", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cnn(-c2ccccc2)n1)N1CCC(OCc2ccc(F)cc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62393", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(CNC(=O)Cn2c(=O)c3cccn3c3ccc(F)cc32)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77503", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Oc1ccccc1)C(=O)N(C)[C@H]1CCC[C@@H]1S(C)(=O)=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238856", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H](c1cncc(Br)c1)c1cc(Cl)ccc1OC by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171059", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule NC(=O)CN1CC2(CCC1=O)CC[NH+](Cc1ncccn1)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93809", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1n[nH]c(C)c1[C@@H]1CCC[NH+]1CC(=O)N1CCC(C(N)=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87967", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](CNC(=O)CS[C@@H]1CCS(=O)(=O)C1)N1C[C@@H](C)O[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210073", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#C[C@@](C)(CC)NC(=O)Cc1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38619", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2sc([C@@H](c3ccc(F)cc3)[NH+]3CCC4(CC3)OCCO4)c([O-])n2n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29552", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN1C(=O)CSc2ccc(NC(=O)N3CCC([NH+]4CCCCC4)CC3)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196915", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cn1c(=O)oc2ccccc21)NCC1CCN(c2nsc3ccccc23)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52231", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC1(CC)NC(=O)CN(C[C@]2(C)CCCO2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43003", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CNC(=O)[C@@H]1CCCCN1c1ccc(C#N)c([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143866", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S1(=O)CC[C@]2(CC[NH2+]C[C@H]2c2ccccc2Br)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162612", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCn1ncnc1C[NH2+][C@@H](C)CCCCl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36645", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(Cl)cc1NC(=O)C(=O)N[C@H](C)C[NH+]1C[C@H](C)C[C@@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110934", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCOc1ccccc1C[NH+](C)CC(=O)N1CCC(O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224616", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1cn2ccsc2n1)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62163", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)Nc2nnc(SCc3ccccc3)s2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171105", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCc1cccc(F)c1)Nc1n[nH]c2ccc([N+](=O)[O-])cc12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9738", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)(C)NC(=O)CCNS(=O)(=O)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58511", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)C[C@H](NC(=O)C1CC1)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1CCN(C(=O)[C@H]2c3ccccc3CC[NH+]2CC(=O)NCc2ccccc2Cl)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69211", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1cc(NC(=O)C(=O)N[C@H](C)[C@H]2CCCO2)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177937", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)N(C)CC[NH+](C)C1CCN(C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26896", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc(NC(=O)[C@@H](C)NC(=O)c2ccccc2Cl)sc1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122348", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH+]1CCCN(C(=O)CCNC(=O)c2ccc(F)cc2Cl)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137192", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule Cc1sc(NC(=O)c2cc(Br)cs2)c(C#N)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5804", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])[C@H]1C[C@H](O)CN1C(=O)c1ccccc1O by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159339", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)c1cnn(C(C)C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120100", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C)c1OC1CCN(C(=O)[C@H](C)c2cccs2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71980", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1[C@H](C(=O)[O-])CCN1C(=O)Nc1ccc(F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247324", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(NC(=O)c2cccc3cc[nH]c23)cccc1C(=O)N1CCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204098", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1I)C1CCN(S(=O)(=O)c2ccccc2F)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30006", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(OCC(=O)NC[C@H](c2ccc(C)o2)[NH+]2CCCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202346", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule O=C(C1CCCC1)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])s2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30122", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1csnn1)N1CCO[C@@H](c2ccc(Cl)cc2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109745", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1cc(Cl)c([N+](=O)[O-])cc1COc1ccccc1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211595", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cccc(C(=O)NN2Cc3ccccc3C2)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10193", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccc(O)c([C@@H](C)Nc2ccc(F)cc2[N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226112", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](Oc1ccccc1Br)C(=O)N/N=C\\c1cc(Cl)ccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198343", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccnc(NNC(=O)c2cccc(C#N)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85850", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)[C@H](CC)N1CCC(C(=O)N2CCCCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139437", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc([C@@H]2Nc3ccccc3C3=[NH+]CCCN32)cc(OC)c1OC by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29121", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@H](NC(=O)N1CCN(C(=O)C2CCCCC2)CC1)c1ccc(OC)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168852", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(C2=CCN(C(=O)NNC(=O)c3ccccc3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171130", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)C1=C(Nc2ccc(C)cc2)C[C@](C)(O)[C@H](C(C)=O)[C@H]1c1ccc(Cl)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75682", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NC1CCCCC1)[C@H](c1ccc(F)cc1)N(C(=O)c1cnccn1)c1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217021", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@@H](CNCc1ccc(Cl)nc1)[NH+](C)Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5221", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCCn1c(SCC(=O)N(C)C2CCCCC2)nc2cc(C)[nH]c2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106216", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccccc1NC(=O)N[C@H](C)C(=O)N1CCCC[C@@H]1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20529", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-n2c(=S)[nH]c3ccc(C)cc32)c(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76756", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)c2cccc(OC(C)=O)c2)cc1OC by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142063", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc2c(N3CCCN(S(C)(=O)=O)CC3)c(C#N)cnc12 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155984", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Cl)cc1NC(=O)C[C@H]1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149549", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(CNC(=O)/C=C/c2cccc(C)c2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113524", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(CC(=O)N2CCC3(CCC(=O)N([C@H](C)C(=O)[O-])C3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85190", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(C)C)cc1OCC(=O)N(C)[C@@H](C)c1ccc(-n2cncn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109900", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Brc1cnc(N2CCCC2)cn1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131292", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCSCC[C@H](C)N(C)C(=O)c1cc(=O)c2ccccc2o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46376", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)NCc2cscn2)cc1NC(=O)Nc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35558", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Cn1ncc2c3ccccc3n(Cc3cccc(Cl)c3)c2c1=O)N1CCC2(CC1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158899", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@H]2[C@H]3[NH+]=c4ccccc4=C3CCN2Cc2cnn(C)c2C)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87843", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CC1(C)CC(=O)C2=C(C1)OC(N)=C(C#N)[C@H]2c1ccc(C(C)(C)C)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71760", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cccc(-c2nnco2)c1)c1cn(-c2ccccc2)nc1-c1cccs1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65229", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(Oc2cncc(C[NH3+])n2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94796", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1cnc(Nc2ccccc2)nc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63016", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ncccc1C(=O)N[C@H](C(N)=S)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137343", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1[NH2+]CC[C@H]1C(=O)N(C)Cc1cc(C#N)ccc1F by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128206", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccc(C(=O)N2CCC[C@@H](c3cc(C(N)=O)[nH]n3)C2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209129", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N)c(SC[C@@H](C)CO)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198510", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc(NC(=O)c2ccccc2C(F)(F)F)cc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119998", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CO[C@@H](C)C(=O)NNc1ccccc1C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178854", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1ccc(C(C)=O)cc1OCc1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211901", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ccnc(NCCSCc2ccc(Cl)cc2Cl)c1=O by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144533", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(Nc2ccccc2)cc1)c1ccc(O)nc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98161", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC(=O)Oc1ccc(C(=O)Nc2cc(Cl)ccc2C(=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62030", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1ccccn1)C(=O)[C@H]1C[NH2+]C[C@@H]1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130742", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@H](C)NC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCN(C)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120102", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(OC(=O)CCCN2C(=O)NC3(CCCC3)C2=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141485", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule N#CCc1ccccc1C(=O)OCC(=O)NCc1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214155", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1cccc(C(=O)N2CCN(Cc3cccc([N+](=O)[O-])c3)CC2)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210127", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]1CCCCN1S(=O)(=O)c1ccc(C(=O)N(C)Cc2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143704", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc(OC)cc(-c2nnc(SCc3ccc(F)cc3)o2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75330", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccccc1C(=O)NCCC(=O)NC[C@H](O)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12008", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(Cc1csc2ccccc12)C(=O)NCc1cccc(C(N)=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182920", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(C(=O)Nc2nc3c(C)cccc3s2)cc(Cl)c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168029", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C(=O)NCCCS(=O)(=O)c1ccccc1)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132630", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)C1CC[NH+]([C@@H](C)c2cccc(C)c2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247824", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ncc2c1CCC[C@H]2N[C@H]1C[NH+]2CCC1CC2 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176970", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnoc1-c1ccc(C#N)cc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151547", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1c(C[NH2+][C@H]2CCC[C@@H](O)C2)cnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52539", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1[C@@H](C)CN[C@H](C)c1ccc(C(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230914", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOC(=O)c1cccc(NC(=O)c2ccccc2F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58395", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(OCn2ccc(C(=O)N[C@@H](C)c3cn(C)nc3C)n2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144220", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCC(=O)N1CCc2[nH]nc(C(=O)NCc3ccc4c(c3)OCO4)c2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109067", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C2=[NH+]CCN2)c(O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129929", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(C)C(=O)NCC(=O)N1CCc2[nH]nc(-c3ccc(F)c(F)c3)c2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45255", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)CN2C(=O)N[C@@](C)(c3ccccc3Br)C2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40026", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCOCC(=O)N[C@H](C)c1cnn(-c2cccc3ccccc23)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240715", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(C)N1C[C@H](NC(=O)NC[C@@](C)(O)c2ccccc2)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8321", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H](O)c1ccco1)c1ccc(SC(F)F)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89151", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC1=NN(c2ccccc2)C(=O)/C1=C\\c1ccc(OCC(=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88437", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCOc1ccccc1N1CC[NH+](Cc2nnsc2Cl)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59307", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H](CCc1ccco1)[NH2+]Cc1ncccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141912", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule NC(=O)CN1CCN(C(=O)C[C@@H](O)c2ccc(Cl)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82951", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)Nc1cccc2c1OCCO2)c1ccc(OC(F)F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180213", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C(=O)N1CCN(C(=O)Cc2c(C)noc2C)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216873", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCC(=O)N1CCN(S(=O)(=O)c2cnc(-c3ccccn3)nc2C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95366", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(O[C@H](C)C(=O)Nc2ccc(C)cc2Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6764", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-n2c(C)nc3nc([NH+]4CCCC4)nc([O-])c3c2=S)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100925", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCS[C@@H]1CCC[C@](CO)([NH2+]C(C)C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98314", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(c1)CCCN2CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76499", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CCN1C[C@@H](C(=O)Nc2ccc3cc[nH]c3c2)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220252", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CCOc1ccccc1[C@H]1C(C#N)=C(SCC(=O)Nc2cc(C)ccc2C)N=C2CCCC(=O)[C@@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4828", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1ccnc1SCC(=O)N1CCO[C@@H]2CCCC[C@H]21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34195", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1c(NC(=O)CCCc2nc(-c3ccccc3)no2)sc2c1CCCC2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221792", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccc(NC(=O)N2CCOc3ccccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207389", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(F)ccc1Cl)[C@@H]1CCCN1C(=O)c1cccs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244295", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(C[NH2+]CCc1ccccc1)Nc1ccc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC(=S)Nc1ccccn1)c1ccc(Cl)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25242", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule O=C1/C(=C/c2ccc3ccccc3n2)Oc2cc(O)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133764", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+]Cc1cnn(-c2cccc(Br)c2)c1C1CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58584", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[C@](C)(C[NH3+])[C@H](O)CCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82880", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)NCCNC(=O)/C=C/c1cc(C(F)(F)F)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133652", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]1C[C@@H]1C(=O)NC[C@@H](C)Sc1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211492", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Cc1cccc(F)c1F)c1cc(Cl)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52436", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)N[C@H]1[C@H](OC2=C[C@H]3OC(=O)C=C(C)[C@H]3C=C2)O[C@H](CO)[C@@H](O)[C@@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111231", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1nn(C)cc1C(=O)NCC1CCN(C(=O)c2cccnc2SC)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10166", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(Cl)cc1NC(=O)CNc1ccc(S(=O)(=O)N2CCCCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84888", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1NCC=Cc2c1[nH]c(Br)c2Br by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186235", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(F)cc1C(=O)COC(=O)c1csc(-c2ccc(C)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112751", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=C(Nc1cc(Cl)ccc1O)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@H](c1ccc3c(c1)OCO3)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48767", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@H]2[C@@H]3SC(=O)N=C3S[C@@H](C(=O)[O-])[C@H]2C(=O)c2ccc3c(c2)CCCC3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218466", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)Nc1ccc(NC(=O)NCCc2cccs2)cc1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110805", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2C(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3ccccc3)SC2=S)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233134", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(CN2CC[NH+](Cn3nc(C4CC4)n(C)c3=S)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11003", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1CCCN(C(=O)c2ccc(C)nc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115435", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CCOc1ccc(/C=C2/C(=O)NN(c3cc(Cl)cc(Cl)c3)C2=O)cc1OCC by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219959", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CC[C@@H](Cn2c(CCCl)nc3cccnc32)N1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172486", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc2cc(C(=O)NCc3cccc(NC(=O)N4CCCC4)c3)[nH]c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38296", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C[C@@H]1n1c(CCCl)nc2cc(Br)cnc21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119671", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccc(NC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153105", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc(C[NH+](CC2CC2)[C@H](C)c2ccccc2)cn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88532", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CCCN(C(=O)[C@@H]2CCC(=O)N(c3ccc(C)c(C)c3)C2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224456", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](C)N(C)C(=O)Nc1ccc(N(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67007", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H](O)C1CC[NH+](CC2=Cc3ccccc3OC2)CC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175371", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1csc(S[C@H](C)C(=O)NC(c2ccccc2)c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146953", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)c1sc2ccccc2c1[C@H]1CCN(C(=O)c2cccc(N(C)C)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98587", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(-n2c(SCC(=O)N3CCC(C)CC3)nc3[nH]nc(C)c3c2=[NH2+])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230603", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(C(=O)c1ccccc1NC(=O)/C=C/c1ccc(Cl)cc1)C1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225188", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(C)(C)C)cc1[S@@](=O)Cc1cn2ccccc2n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63245", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)[C@@H](OC(=O)CCn1nnc2ccccc2c1=O)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226737", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)NC(=O)C[C@H](C)NC(=O)N(C)[C@@H]1CCc2ccccc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126672", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCN1C(=O)C([O-])=C(C(C)=O)[C@H]1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141863", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COCC(=O)N[C@H](C)c1nc2ccccc2n1Cc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14303", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCC[NH+]1CCN([C@H]2CC[C@@](CO)([NH2+]C(C)C)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(-n2cc(C(=O)[O-])c3c2[C@H](c2cc(OC)c(OC)c(OC)c2)CC(=O)N3)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162454", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule [NH3+][C@H](CC[C@H]1CCOC2(CCOCC2)C1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175837", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule Cc1cc(SCC(=O)NC2(C#N)CCCCC2)nc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147952", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)Cc1nnc([C@@H](C)[NH+]2CCC(c3ccc(F)cc3)CC2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15006", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)[C@H](CC(C)C)NC(=O)[C@H]1CSC(C)(C)N1C=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198802", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1sc2nc(C[NH+]3CCN(CC(=O)NCCC4=CCCCC4)CC3)[nH]c(=O)c2c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148945", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[NH+]1CCC(O)([C@@H]2CCOC3(CCC3)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50029", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cc(Br)ccc1NCc1cccnc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40734", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C(=O)Cc1cc(C)[nH]n1)[C@@H]1CC[NH+]([C@@H](C)c2ccccc2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143151", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule N#C[C@H]1CNCCN1C(=O)c1cccc(O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143022", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1CC(C(=O)NCc2ccc(CN3CCc4ccccc43)cc2)C[C@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176997", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nnc(-c2ccc(NC(=O)C(=O)N[C@@H]3CCCC[C@@H]3C)cc2)o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212068", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nnc(NC(=O)N[C@@H](C)c2ccc(F)c(F)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133191", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCCCNC(=O)N[C@H]1CCCN(c2ccc(OC(F)F)cc2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138534", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1nsc(Nc2ccc(F)c(F)c2)c1C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167272", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N(C)c1ccccn1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131552", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](c1ccccn1)N(C)C(=O)Nc1cccc(C2SCCS2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219404", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCOc1cc(CO)cc(Br)c1OCc1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "616", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccsc1/C=N/NC(=O)/C(=C\\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167861", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CSc1cccc(NC(=O)N2CCN(c3ccccc3Cl)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216704", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccc(O)c(NS(=O)(=O)c2cc(F)c(F)c(F)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2366", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)c1nn(-c2ccccc2C)c(=O)cc1NC(=O)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56176", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H](CN1CCc2sccc2C1)c1ccccc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38353", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cn1c(=O)sc2cc(S(=O)(=O)N3CCCC3)ccc21)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53681", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2ccc(/C=C\\C(=O)c3ccccc3)cc2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220132", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(C(=O)N[C@@H](C(=O)Nc2ncc(C)s2)C(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103486", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(c1ccccn1)S(=O)(=O)c1ccc(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123881", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C/[NH+]=C(/NCc1noc(C)n1)N1CCc2cc(OC)c(OC)cc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205585", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(CC[NH+](C)[C@H]2CCCN(C(=O)c3ccncc3)C2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220130", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)c1ccccc1NC(=O)[C@H]1CC[NH2+][C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129196", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCc1coc(-c2ccccc2)n1)c1cnc([C@H]2CCCO2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107596", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[S@@](=O)[C@@H]1CCCC[C@@H]1NC(=O)Nc1ccccc1N1CCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216061", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Cc1cccc(Nc2ncnc(N3CCCC[C@H]3C)c2[N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149190", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H]1OC(=O)c2cccc(F)c21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240059", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCC[C@@H]([NH3+])c1ncc(-c2cc(F)cc(F)c2)[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71673", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(C)cc(NC(=O)C(=O)NCc2ncc(C)s2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11067", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H](NC(=O)NCc1scnc1C)C(C)(C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83046", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=c1c(N[C@H]2CCC[NH2+]C2)nccn1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219496", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C[NH2+]CC[C@H]1CCCO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189280", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CC[C@@H](C)C[NH+]1CC(=O)NC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234047", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Nc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-])c1ccc(F)cc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117396", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1c2ccccc2C(=O)N1C[C@H](c1ccco1)[NH+]1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16515", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)n1c[nH+]cc1[C@H](O)[C@@H]1CCCCC[NH2+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245161", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC(=O)N[C@@H](CC(=O)[O-])c1ccccc1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38155", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ncccc1Cl)N1CCC[C@H]1c1ccc2c(c1)OCCO2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127320", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CN(C)c1ccc([C@H]2Nc3ccc(S(=O)(=O)NCc4ccccc4)cc3[C@@H]3C=CC[C@@H]23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160486", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN1CCc2nc[nH]c2C12CC[NH+](Cc1cccc(OC3CCCC3)c1)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27595", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nn(C)c(C)c1CCC[NH2+][C@@H](C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210211", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCOc1ccc(OCCC2CC[NH2+]CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20033", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule S=C(NN=C1CCSCC1)NC1CCCCC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164892", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](Cc1ccc(Cl)cc1)N(C)C(=O)c1ccc2ncccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248653", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(F)c(C(=O)NNC(=S)NC[C@@H]2CCCO2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8369", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NN=C1CCCc2ccccc21)C(O)(c1ccccc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49912", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)N(C)CCN1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99506", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)NC(=O)CSc1nc2ccccc2c(=O)n1C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35724", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1nn(CC)c2c1CN(C(=O)C1=CC3=CC=N[C@@H]3C=C1)CC2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134342", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)c(-c2ccc(N(C)S(C)(=O)=O)cc2)nc2cc3c(cc12)OCO3 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167887", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc(-c2cc3c(N4CCc5ccccc5C4)nccn3n2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181887", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(Cc1ccccc1C(F)(F)F)C(=O)NCCOc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142223", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccnc(NNC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177111", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule N#C[C@H]1COCCN1Cc1cccc(-c2ccccn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241225", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccncc1[N-]S(=O)(=O)c1c[nH]c(C(=O)N2CCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90270", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H](N[C@H](C)c1cccc(-n2cccn2)c1)c1ccccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116102", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](NC(=O)Cc1cccc(F)c1F)C1(N2CCOCC2)CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204012", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](C)CC[C@@H](c1ccccc1)[NH+]1CCOCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79641", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)(C)CC(=O)Nc1ccc(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168748", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1c(/C=C/C(=O)N(C)C2(C#N)CCC2)c(C)n(CC)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109135", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c2nc(Cl)c(CCN3C(=O)c4ccccc4C3=O)cc12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98640", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCn1c(COc2cccc3cccnc23)nnc1SCC(N)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15982", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Cc1ccc(Cl)cc1Cl)C(=O)N(C)C1CCOCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238090", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCc1ccc(C(=O)N[C@H]2C[C@@](C)(OC)C2(C)C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117212", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@H]1CN(C(C)=O)CC[C@H]1CC(=O)Nc1nccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131407", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC)S(=O)(=O)c1ccc(NC(=O)C2CCCC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69875", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]([NH2+]CC1(CO)CCOCC1)c1cc(F)c(F)c(F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72927", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@H]1SCCc2sccc21)N1CCO[C@H](c2ccc(F)cc2)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204499", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)[C@@H](C(=O)Nc1ccn(C)n1)N1C(=O)c2ccccc2C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56665", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCNc1cc[nH+]c(CN2CCO[C@H]3CCCC[C@@H]32)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13930", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1NC(=O)CSc1nnc(-c2ccccn2)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53558", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1CCCNC(=O)Nc1cccc(C(C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242568", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(C(=O)CSc1nnc(-c2ccccc2F)o1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10298", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1nnc(SC[C@@H](O)CN2CCOCC2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59131", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)Cn1ncc(C(=O)N(C)[C@@H](C)Cc2ccsc2)c1C(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243091", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC(=O)c1c(C)nsc1N[C@H](C)c1ccc(C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194198", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(NC(=O)C(=O)NCC2(C)CCCC2)cc1[N+](=O)[O-] by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18798", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C/[NH+]=C(/NCCc1c[nH]c2cc(C)ccc12)NCc1cn2c(C)cccc2[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135449", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)c1ccc2c(c1C)N[C@H](c1cc(Br)c(OC)c(OC)c1)[C@H]1CC=C[C@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165793", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCN(Cc1ccco1)C(=O)c1cc2cc([N+](=O)[O-])ccc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc2[nH]c(=O)c(CNc3ccc(N4CCc5ccccc5C4)cc3)cc2c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116858", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(Cc1nnc2n1CCC2)C(=O)c1ccc(S(C)(=O)=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198065", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc(-c2noc(CN3C[C@H](C)c4ccccc43)n2)ccc1OC(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147864", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC(CC)N(CC(C)C)C(=O)[C@H]1CC[C@@H]([NH3+])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33899", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(CC(=O)N1N=C(c2ccc(Cl)cc2)C[C@@H]1c1ccco1)S(=O)(=O)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28564", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CN(C(=O)c1cccc(NCC(=O)NCc2ccco2)c1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89014", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1ccc(CC(=O)NNc2c(Cl)cccc2Cl)cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7136", "split": "OpenMolInst" } }, { "instruction": "Remove a thiol from the molecule SCC1(COC2CCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223264", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COC(=O)c1cc(NC(=O)C2CCN(C(=O)c3ccccc3Cl)CC2)cc(C(=O)OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232768", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCC[C@H](C(=O)NCc2ccc[nH]2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234248", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](C)N(C)C(=O)c2nnn[n-]2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62252", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(C)c(NC(=O)c2ncccc2OCC(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61692", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@H]2CC(=O)C=C(N)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247910", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCn1c(C)cc(/C=C(/C#N)C(=O)N[C@H]2CCCNC2=O)c1C by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62350", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)[C@H]1CCCC[C@H]1C(=O)[O-] by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99070", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C2=N/C(=C\\c3cc4c(cc3Cl)OCO4)C(=O)O2)ccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244156", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1nccs1)[C@H]1c2ccccc2C(=O)N(C2CCCC2)C12CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60282", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NC[C@H](c1cccs1)[NH+]1CCCC1)[C@@H]1CCCN1C(=O)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156840", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCNC(=O)c1ccc([NH+]2C[C@@H](C)[C@H](C(=O)[O-])C2)[nH+]n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99808", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1C[C@@H](c2ccc([N+](=O)[O-])cc2)[C@@H](C(=O)c2ccc(F)cc2)[C@@]12C(=O)Nc1ccccc12 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76461", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C([O-])c1ccc(N2C(=O)/C(=C/C3=c4ccccc4=[NH+]C3)SC2=S)cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88769", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CSc1nnc(-c2cccs2)n1C1CC1)Nc1cc2[nH]c(=O)[nH]c2cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56395", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCC1CCCCC1)c1cccc(NC(=O)c2scc3c2OCO3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197167", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=C(CCCNC(=O)c1cccs1)NC[C@@]1(O)CCSC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71068", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1c(Cl)cc(C(=O)OCc2nc(C)no2)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98251", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc(CC(=O)Nc2ccc(C)cc2OC)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134822", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#CCCCSc1nnc(-c2ccccc2)n1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166474", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1cccc([C@H](C)CC(=O)Nc2cnc(-c3cccc(O)c3)nc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45146", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CNC(=O)C(=O)Nc1ccccc1C[NH+]1CCCC1)NC1CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123259", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)N[C@H]1CCCC[C@@H]1CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206350", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)NCCc1nc2ccccc2n1CC(=O)NC[C@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163345", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule Cc1nc([O-])c(C#N)cc1C(=O)N1CCC[C@@H](c2[nH+]ccn2CC(N)=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238412", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)CC1CCN(C(=O)N[C@@H]2C[C@H]2c2ccccc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110180", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCCNC(=O)CNC(=O)N[C@H](CC)c1ccc(C)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200810", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Nc1ccc(S[C@H]2CCC[C@@H]2O)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191953", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)OCCC(=O)Nc1cccc(C(=O)NC(C)(C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121105", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1c(C)nc(-n2nc(-c3ccco3)cc2NC(=O)COc2cccc3c2OC(C)(C)C3)nc1[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52959", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1c(NCC2(c3ccc(F)cc3)CCOCC2)cc(C#N)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62912", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC1CCN(S(=O)(=O)c2ccc(-c3noc(CCC(=O)Nc4cccc(F)c4)n3)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90971", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(c1ccc(-c2ccc(F)cc2)o1)N(Cc1ccccn1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46982", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCOCCN(C)C(=O)NCc1ccc(O)c(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127222", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NC(=S)NNC(=O)c1cccs1)c1cc2ccccc2o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210894", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H](Cc1ccccc1)NC(=O)c1cnccn1)c1cnccn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161773", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cc1ccccc1Cl)NCc1ccnc(-n2cccn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174105", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCCc1ccc(OS(=O)(=O)c2ccc3c(c2)CCCC3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157825", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(CNc1ccc(C#N)c([N+](=O)[O-])c1)S(C)(=O)=O by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242281", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N[C@@H](C(N)=O)c2ccccc2)ccc1C(=O)NC(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125896", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(CN2CC[C@H]3[C@H](CCC[NH+]3C3CC3)C2)cc1OC(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182665", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](CC)c1ccc([N-]S(=O)(=O)c2ccc(Cl)s2)cc1C(=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112270", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@@H](NC(=O)c2ccc3c([O-])n(C)c(=S)nc3c2)[C@@H]1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129583", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CN1C(=O)/C(=C2\\C(=O)N(CC(=O)Nc3ccccc3Cl)c3ccccc32)SC1=S by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167244", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C1O[C@H](/C=N/c2ccc(C(F)(F)F)cc2)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13293", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOc1ccc([C@H]2C3=C(CCCC3=O)Nc3c(C(=O)Nc4ccc(F)cc4)cnn32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239955", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Cc1ccc(Cl)cc1)N(C)C(=O)c1c[nH]c2nccc(Cl)c12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162141", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C(=O)NNC(=O)N[C@@H](c1ccccn1)C(C)C)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92841", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCc1cc[n+](/C(C(=O)c2ccc3c(c2)OCO3)=C(/[S-])NC2CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231809", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(c1cccc(Cl)c1)N(CCN1CCOCC1)c1nc2c(F)cc(F)cc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128945", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCCCNC(=O)N1CCC[NH+](CC(=O)N(C)C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175713", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)[C@H](O)CNC(=O)C(=O)Nc1ccc(C)nc1Br by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63829", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCO[C@H](C)c1nc(C[NH+](C)CC(N)=O)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104165", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN1C(=O)Cc2ccccc2[C@H]1C(=O)NCCC1=CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102012", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule O=C(NC[C@@H](O)c1ccoc1)[C@@H]1COc2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142588", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)NC(=O)/C(C#N)=C(/[O-])[C@H]1C[C@@H]1c1ccc(C(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16353", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](Sc1nnc2ccc(C(F)(F)F)cn12)C(=O)N(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111613", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc(C)c(NC(=S)NC[C@@H](c2cccnc2)N2CCOCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56345", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C/C=C(/C)C(=O)O[C@H]1[C@@H](O[C@@]2(C)CC[C@@H](O)[C@@]3(C)CC=C(C(C)C)C[C@@H]23)O[C@H](C)[C@H](O)[C@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18667", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(C[NH+](C)CCn2cnnc2)cc(Cl)c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157191", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H](NC(=O)[C@H]1C[C@@H]1c1ccco1)c1noc(-c2ccc(Cl)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38920", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)N1CCCc2cc(NC(=O)[C@@H](C)Cc3c(C)n[nH]c3C)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86943", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1(C)Cc2c(cnn2-c2ccc(F)cc2)[C@@H](NC(=O)CCC(F)(F)F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57634", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1occc1COC(=O)c1cccnc1OCC(F)(F)F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244511", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@@H](CSc1ccc(Cl)cc1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26592", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc([C@H]2c3nc[nH]c3CCN2C(=O)c2c(C)nc3c(C)cccn23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63744", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C/C(=N\\NC(=O)CSc1ccc(Cl)cc1)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178100", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(Br)cc([N+](=O)[O-])c1O[C@@H]1CC(=O)C12CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164909", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC1=C2[C@H](c3cc(OC)ccc3OC)C(C#N)=C(N)O[C@H]2N=N1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82365", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@H](Oc1cc(Cl)ccc1Cl)C(=O)NNC(=O)[C@H]1[C@@H](C(=O)[O-])[C@H]2CC[C@@H]1C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240634", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=CCNC(=O)c1ccc(NC(=O)c2ccc3[nH]cnc3c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20516", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)/C=C/c1ccc(OC(F)F)cc1OC(F)F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222404", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CSc1ccc([C@H](O)c2cc(C)c(Cl)cc2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115485", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](c1ccccc1F)N(C)C(=O)CN(C)C(=O)c1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89866", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(OC)c(C[NH+]2CC[C@H](C)[C@@H](n3ccnc3)C2)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103517", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2C[C@@H](c3ccc(Cl)c(Cl)c3)Nc3nc(N)nn32)cc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163614", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1ccccc1-n1cccn1)n1ccnc1-c1ccco1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221454", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnc2c(c1)N(C(=O)c1ccc(C(F)(F)F)nc1)CCO2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241131", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2ccc(SCc3ccc(F)cc3)nn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236975", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)Sc1ccccc1C(=O)NCc1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9864", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Cc1csc(-c2ccccc2Cl)n1)N[C@H]1CCCNC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136211", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=N/Nc1cccc([N+](=O)[O-])c1C by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148143", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCc1ccc(Cl)c(CC)c1NC(=O)[C@H]1CS[C@@]2(C)CCC(=O)N12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70115", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2nc(NC3CC[NH2+]CC3)cc(-c3ccncc3)n2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124757", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C(CCc1ccccc1)=N\\NC(=O)c1ccc(CN2CCOCC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167678", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc([C@@]2(O)CCCS[C@H]2C)cc1OCC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214822", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCc1ccccc1C(=O)NC[C@H]1C[C@@]12CCc1ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40207", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nn(C)cc1CNC(=O)Nc1ccc(OC2CCOCC2)c(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50232", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule NC(=O)[C@@H](NCc1ccc(OC2CCCC2)nc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98191", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCn1nccc1[C@@H](C)[NH2+]Cc1cc(C(F)(F)F)n[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121095", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(NC(=O)CSc2nnc3c(Cl)cc(C(F)(F)F)cn23)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73769", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCn1c(C(=O)NCCN2CCN(C(C)=O)CC2)cc2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101778", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCC(CC)(C[NH3+])NC(=O)Cc1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51446", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cn1nnc(-c2ccccc2Cl)n1)N/N=C/c1cc(Cl)ccc1O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218089", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=C(OCC(=O)N1CCc2ccccc21)c1ccccc1NS(=O)(=O)c1ccc2c(c1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182858", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NCc1cccn1Cc1cccc(F)c1)Nc1ccccc1C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174031", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H]1CCCC[C@@H]1[NH2+]CCn1ccc2c(Cl)cccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168019", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)N1CCC(N)(C(N)=O)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212025", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1ccc(COC[C@@H](O)Cn2cnc3ccccc3c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53801", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCNC(=O)[C@@H]1CCCN(C(=O)c2ccc(OC(C)(C)C)cc2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68499", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1)[C@H]1Nc2cc(F)ccc2S(=O)(=O)N1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214657", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule OCCc1ccc(OC[C@H]2CO2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H](C)NC(=O)[C@@H]1COc2ccc(F)cc2C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OC[C@]1([NH2+]C2CC2)CC[C@@H](Sc2nc3ccccc3[nH]2)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221250", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc([C@H]([NH2+][C@@H]2CCO[C@]3(CCSC3)C2)C(C)C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119127", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(Nc2nc(-c3cccs3)c(CC(=O)[O-])s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108791", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(N[C@H](C)C(=O)N2CCOCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133328", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1[C@H]1CC(c2cccc(NS(C)(=O)=O)c2)=NN1C(=O)C1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117326", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1NC(=O)COc1cc(O)c2c(c1)OC(C)(C)CC2=O by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108225", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)CN(C)C(=O)c2cccc(N3CCCC3=O)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33854", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@H](c1ccc(OC)c(OC)c1)[C@H]1CCO[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8817", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C[C@H]([NH3+])c2ccc(OC)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200665", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CO[C@H](CNC(=O)NC[C@@H]1CN2CCCC[C@@H]2CO1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "173106", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=C(C(=O)CSc2nnc(C3=c4ccccc4=[NH+]C3)n2C2CC2)C[C@@H](C)N1C1CC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52707", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCN([C@@H](C)CS(=O)(=O)CC)S(=O)(=O)c1c[nH]c2nccc(Cl)c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90296", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCS(=O)(=O)c1ccccc1C(=O)N1CCO[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50708", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Cn1ncc(C(=O)N[C@@H]2CCCn3nc(C(C)C)nc32)c1C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106800", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc2sc(NC(=O)C[NH+]3CCC[C@@H]([C@@H](C)O)C3)nc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111359", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1ccc2oc(=O)cc(C[NH+]3CCC[C@H](N4CCCC4=O)C3)c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42603", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nn(Cc2ccccc2)c(C)c1C[NH+]1CCC[C@H](n2cccn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197349", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)C1=NN2C(=N)/C(=C\\c3ccc(OCc4ccccc4)cc3)C(=O)N=C2S1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244693", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1nc(C(=O)N[C@H](C)c2ccccn2)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242830", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cccc2c(CCNC(=O)NN[C@@]3(C)CCS(=O)(=O)C3)c[nH]c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138302", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCOC(=O)[C@](C)(O)[C@@H](C)c1cccc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18250", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(CN(C)C(=O)c2oc3ccc(F)cc3c2C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115393", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCCc1cccc(Cl)c1)c1ccc(NS(=O)(=O)c2ccc3[nH]c(=O)[nH]c3c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205387", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)c(O)c(NC(=O)[C@@H]([NH3+])Cc2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35191", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule c1ccc([C@H](NCCc2nnc3n2CCCCC3)C2CCCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52703", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@H](C)[C@H](C)Sc1ccc(N)c(F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134761", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)Nc1nn2c(-c3ccc(OC)cc3)nnc2s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112955", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@@H]1CCCC[NH+]1C[C@@H]1CCCN(C(=O)[C@H](O)c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198945", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCN(C(=O)CN(CCO)c1ccccc1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68991", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccc([C@@H](C)C(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195060", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)Cc1csc(NC(=O)c2ccc(C(F)(F)F)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49678", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(CC)S(=O)(=O)c1ccc(C(=O)N2CC[C@@H](C)[C@H](O)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167880", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc([N-]S(=O)(=O)/C=C/c2ccccc2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92665", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(Cc1cc(Br)cs1)C(=O)C[NH+](CCO)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147062", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNS(=O)(=O)c1ccc([C@H](C)NCCc2ccccn2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46045", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H]1c1ccc(/C=C/C(=O)Nc2ccccc2C(=O)NC2CC2)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131149", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+][C@H](C)CC(=O)N(C)Cc1cccc(Cl)c1)C1CCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1005", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=C(Nc1ccc2cn[nH]c2c1)c1csc(Nc2ccccn2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47819", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C=CCNc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219660", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule Cn1nc(C(F)(F)F)c(C#N)c1N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213773", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](Cc1cccs1)NC(=O)C(=O)Nc1cc(F)cc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10698", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCNc1ncnc(Nc2cccc(Br)c2)c1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107117", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(OC)c2sc(N(Cc3cccnc3)C(=O)c3c[nH]c4ccccc34)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171337", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(F)c(F)c1)NC1CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26234", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC(=O)Nc1ccc(N2CCN(Cc3nc4ccccc4n3C)CC2)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCC#N)C(=O)CN1CC[NH+](C[C@H](O)C(C)(C)C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59134", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cc(NCc2nnnn2C2CC2)ccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189835", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1c([O-])c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])c(=O)c2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154488", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C[NH2+]CCNc2ccc(F)c(Cl)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190059", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Br)cc1[C@H]1C(C#N)=C(N)Oc2cc(C)n(O)c(=O)c21 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235835", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCc1cccc(NC(=O)N2CCN(C(=O)c3ccco3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231442", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(C[NH2+]C[C@@H]2CN3CCCC[C@@H]3CO2)c(SC)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199901", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(COc1ccc2ccccc2c1)Nc1cccc(C(=O)N2CCCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171207", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@H](C)N1C(=O)S/C(=C/c2ccc(-c3ccccc3C#N)o2)C1=O by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170640", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)c1cccc2c1CCCN2C(=O)CCCn1cnc2c(C)cccc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241050", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1ccn(Cc2ccccc2)n1)c1cc(Cl)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39027", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(C(=O)c2coc3ccc(O)c(C[NH+](C)C)c23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124415", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1)[C@H]1CCCN(c2ccc(-n3ccnc3)nn2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10906", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=c1c2ccccc2oc2cc3c(c(O)c12)CCCC3 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99046", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC1=C(Br)[C@H](C(F)(F)F)N=N1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233185", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1C[C@H](C)N(C)C(=O)NC[C@H]1CN2CCCC[C@@H]2CO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141008", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1ccc(F)c(NC(=O)CC[NH+]2CCCCCCC2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126383", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#C[C@H]1CN(C(=O)c2c(O)cccc2O)CCN1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229003", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(C(=O)N(Cc2ccco2)c2nc3c(F)cccc3s2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39602", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1sc(Br)cc1S(=O)(=O)N1CCO[C@@H](C#N)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242904", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#Cc1cccc(CNC(=O)N(Cc2cccnc2)C[C@H]2CCCO2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155383", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule N#Cc1nc(-c2ccccc2)c(-c2ccccc2)nc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199243", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1occc1C(=O)[C@@H](C#N)c1nc(-c2ccc(C#N)cc2)cs1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143897", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CN1C(=O)/C(=C/c2cccs2)SC1=S)Nc1cc(C(=O)[O-])ccc1C(=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143127", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC1=C[C@H]([C@H]2NN[C@H]3SC(c4ccc5c(c4)OCCO5)=NN23)N=N1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110308", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCC[C@H]([NH2+]Cc1ccc(C)cc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74129", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1nn(-c2nc3c(Cl)c(Cl)ccc3s2)c(C)c1C(=O)NN .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29942", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(F)c([N+](=O)[O-])c(NCCCc2nnc3n2CCCCC3)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19020", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H]1C[C@@H]1NC(=O)c1oc2ccccc2c1C[NH+](C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217105", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C)c(C[C@H]([NH3+])[C@@]2(C)CCCO2)c1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56003", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(F)c1[C@H](C)NC(=O)NCC[NH+]1CCC(OC)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54221", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(OC)c1OC(=O)Cn1c(=O)sc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152905", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(CCc1ccccc1)C(=O)c1occc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53369", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOc1ccccc1CN(C[C@H]1CCCO1)C(=O)Nc1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188798", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc2c(s1)[C@@H](N(C)C(C)=O)CCC2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152906", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H]([NH2+]Cc1csc(C2CC2)n1)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204974", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)CNC(=O)N1Cc2ccccc2N(C)C[C@@H]1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228105", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCSc1nnc(NC(=O)/C=C/Sc2ccccc2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78635", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CCSCCOC(=O)/C=C/c1cccc(C#N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126133", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CCC[NH+]([C@@H](C)CNC(=O)C(=O)Nc2ccc3[nH]ncc3c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44212", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC1=NN[C@H](SCC(=O)Nc2nc(C)cs2)N1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226965", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#Cc1ccc(OCc2ccc(C(=O)N=c3[nH]c4ccccc4[nH]3)o2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228754", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)/C=C/C(=O)N1CCc2nnc(CNC(=O)c3cccc(F)c3)n2CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80910", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C(=O)NCCC/C(N)=N/O)sc1Br by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149924", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1cc(C(=O)N(C)[C@@H](C)C(C)(C)C)sc1C#CCCO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133900", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)[NH2+][C@@H]1CC(=O)N(Cc2cccc(F)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71703", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CC(C)c1nc([C@H]2CCCN2c2ncc(C#N)cc2Cl)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20191", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(C)NC(=O)[C@H]1COc2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37419", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc([C@H]2[C@@H](C[NH2+]C3CC3)CCCN2C)ccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200988", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1c(C)cc(S(=O)(=O)NCC[C@H](O)C2CC2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158917", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1OCCN1c1cccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152685", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC/[NH+]=C(/NCc1nnc2n1CCCCC2)N[C@@H]1C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98821", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(F)c([C@@H](C)CC[NH3+])cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172186", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)[C@@H]2C[C@H]3CC[C@@H]2O3)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30686", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCC(=O)N1CCCN(Cc2cnc(-c3ccccn3)nc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20514", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN1C[C@@H](NC(=O)NCc2ccnc(OC3CCC3)c2)CCC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151517", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)[C@@H](NC(=O)C(=O)Nc1cccc(-c2ncon2)c1)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34842", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NNC(=S)[S-])c1cnccn1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1c(-c2nccs2)nc2ccc(NCc3c(F)cccc3F)nc2n1Cc1ccncc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25001", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccc(C[NH2+]Cc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220339", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](SCc1ccccc1)C(=O)NC[C@@H](C)N1CC[NH+](C)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206890", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CSCc1cc(F)ccc1CNC(=O)c1c(F)cccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66611", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@@H]1NC(=O)c1c[nH]nc1-c1cccc(OC(F)F)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245427", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccc(OC)c(NS(=O)(=O)c2ccc(CC(C)C)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244919", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H](C)Cc2cccc(C(F)(F)F)c2)cc1C(N)=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123382", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc(NC(=O)c2cc(C)cc(C)c2)c(OC)cc1NC(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140818", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cccc(-n2c(C)cc(C(=O)C(=O)Nc3ccccc3F)c2C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192378", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1nc(SCC(=O)N2C[C@H](C)O[C@H](C)C2)[nH]c(=O)c1NC(=O)c1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66648", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cncc(C(=O)N2CCCc3cc(C)ccc32)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61847", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C1CCN([C@H]2CCS(=O)(=O)C2)CC1)N1CCN(Cc2ccc3c(c2)CCO3)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160161", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cn1c(SC(c2ccccc2)c2ccccc2)nnc1[C@H]1COc2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115968", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)Nc1cccc([C@H](C)NC(=O)CCc2ncc(-c3ccc(C)c(C)c3)o2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202906", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)(C)OC(=O)c1nc([O-])n(-c2ccc(Br)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185711", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(C#N)CCCNc1ccccc1C(=O)N1CCC[C@@H]1CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125072", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#Cc1csc(C(=O)NCc2cccc(NC(=O)C3CCCC3)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104792", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1nc(C(F)(F)F)c2cc(C(=O)N3C[C@@H]4CC[C@H](C3)[NH+](C)C4)sc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97535", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(F)c(N2C(=O)CNC(=O)[C@@H]2C(C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170009", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNS(=O)(=O)c1ccc(N(C)Cc2ccc(Br)cc2)c([N+](=O)[O-])c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108540", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)OCCCNC(=O)C1CCN(C(=O)[C@@H]2CCO[C@H]2C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(C)C(=O)CCc1nnc(-c2ccsc2)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188811", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccncc1)N(Cc1ccc(O)cc1)CC1CC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237720", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccccc1CNc1nc2ccc(Cl)cc2nc1-n1nc(C)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14669", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C2=N[C@H](c3ccc(F)c(Br)c3)N[C@H](c3ccccc3O)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238505", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(C(=O)NCCNc2ccccc2)c(=O)[nH]1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95571", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CC(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)no1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179431", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1c(F)cccc1C(=O)Nc1ccc(-n2ccnc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181747", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1nc(C(=O)Nc2ccccc2)cs1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243505", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)[C@](O)(Cn1cncn1)[C@@H]1O[C@@H]1c1ccc(Cl)cc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226142", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc2[nH]ccc2c1)C(=O)N[C@@H](c1nccs1)C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83388", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](C[NH+](C)CC(C)(C)S(C)(=O)=O)c1cccc(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245383", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N2C[C@H](C(=O)N3CC[C@H](c4ccccc4)C3)CC2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32010", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)C[NH+](C)Cc1cc(Cl)cc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55338", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)N(C)Cc2nnn[n-]2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209866", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CNC(=O)N[C@@H]2C=C[C@H](CO)C2)c(OC2CCCC2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75739", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN(Cc1ccccc1C(F)(F)F)C(=O)NCCc1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199713", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H]1C[C@@H](N2CCN(c3cccc(Cl)c3)CC2)C(=O)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27706", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H]1CCCC[C@@H]1[NH+](C)Cc1cc(F)cc(C#CC[NH3+])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75672", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(N2CCn3c2nnc(C(=O)NCc2cccs2)c3=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172801", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(Cl)cc1NC(=O)[C@@H]1CN(C(C)=O)c2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83727", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nnnc1-c1ccc(OC)c(S(=O)(=O)Nc2ccc(C)c(C)c2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203696", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1noc(C)c1S(=O)(=O)NCCNC(=O)c1cccn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80906", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "810", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@H]1CCN(C(=O)COc2ccccc2Br)C[C@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137152", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1cccnc1C(=O)O[C@@H](C)c1cccc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143959", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](N[C@H](c1cccnc1)c1ccc(F)c(F)c1)c1cnn(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170455", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)CNC(=O)CCN1CCO[C@@H](c2ccccc2Br)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239448", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(N(C)C)cc(C)c1NC(=O)CCn1cnc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74853", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCNC(=O)[C@@H](C)CS(=O)(=O)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4182", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)Cn2cnc(C3CCC3)cc2=O)c([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36912", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](c1nc2ccccc2s1)N(C)C(=O)c1cccc(Nc2ncccn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115180", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule N#C[C@@H]1CCC[C@H]1Sc1ccccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36740", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](c1cccnc1)N(C)C(=O)Nc1ccn(CCCC(=O)N(C)C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183095", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)c1cc([N+](=O)[O-])ccc1O[C@H]1CCC[C@@H]([NH3+])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4357", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=C2\\CCCc3c2nc2ccccc2c3C(=O)OCC(N)=O)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249133", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCO[C@H]1C[C@@H](NC(=O)C(=O)Nc2cc(C(C)C)on2)C12CCCC2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60971", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(N2CC[NH+](C)CC2)nc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233071", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(F)ccc1F)[C@H]1CCS(=O)(=O)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200537", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CO[C@@H](C)C(=O)Nc1cccc(NS(=O)(=O)c2cc(C)ccc2F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243683", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+]C[C@H](C)C(=O)NC[C@H]1CCC(=O)N1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145495", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CN/C(=[NH+]\\C)SCC(=O)N(C)Cc1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209480", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1C[C@@H]1c1ccc(CN(C)C(=O)c2ccc(NC(N)=O)cc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229002", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])[C@H]1CCCCN1C(=O)c1nc(C2CC2)n[nH]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38809", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C(=O)c1cccc(C(F)(F)F)c1F)C1C[NH2+]C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141594", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(-c2ccc(=O)n([C@@H](C)C(=O)Nc3ccc(OC)c(OC)c3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55697", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[C@@H](CO)N1CC[NH+](C2CCC(C(C)C)CC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194457", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(-c2c(-c3ccccc3)ncn2CCCO)cc(C)c1O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232000", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)c1n[nH]c([C@H]2CN(C(=O)c3ccc(=O)n(C)n3)CCO2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120031", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N2CC[C@@H](N[C@H](C)c3cccnc3Cl)C2=O)n(C)n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17279", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(CC(=O)NCc2ccccc2F)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149249", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1c(NC(=O)CSc2n[nH]c(N)n2)sc2c1CC[C@H](C)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148976", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=c1c(Cc2ccc(Cl)cc2)c([O-])ccn1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208090", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1[C@H]1CN(C(=O)C(=O)Nc2ccc(F)cc2F)CCO1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63264", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Cc1nc2ccccc2s1)N[C@H](C)c1cn(-c2ccccc2)nn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133571", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[S@](=O)[C@@H]1CCCC[C@@H]1NC(=O)NC(C)(C)c1cccc(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234871", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccc(OCC2=NN3[C@@H]([C@H]4C=c5ccccc5=[NH+]4)NN[C@H]3S2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109403", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N(C)c2ccc(O[C@H](C)C(=O)Nc3c(C)cc(C)cc3C)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105219", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=S)NC(=O)c2ccccc2[N+](=O)[O-])c(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23956", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(N2CC[C@H](O)C2)nc2cc(C(=O)NCCCOc3ccccc3)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71959", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1ccc(F)cc1)NC(=S)NNS(=O)(=O)c1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107238", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)CN1CCC([NH2+][C@@H](c2c(Cl)cccc2Cl)C(C)C)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117390", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(CN(C)C[C@H](O)CN2CCOCC2)cc(Br)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105500", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)CN(C(=O)c1cnc([C@@H]2CCCO2)s1)c1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89300", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(NC(=O)[C@@H](Sc2nnc(-c3cccnc3)n2N)c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8140", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1c(-c2ccccn2)nn(CCNC(=O)c2ccco2)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130924", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SCC(=O)NCc4ccccc4)=NC(=O)[C@H]32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93496", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)[C@H]2C[C@H](CCSC)N[C@]23C(=O)Nc2c(C)cc(Cl)cc23)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218148", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule OC[C@H]1C[C@@H]1c1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54295", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@H](C)C1NC(=O)/C=C/c1ccc(N2CCCS2(=O)=O)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73447", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCc1nc(CC[NH2+]Cc2cc(=O)c3cc(F)ccc3[nH]2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47742", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1C=Cc2ccccc2[C@H]1CC(=O)NC[C@H](CC(C)C)[NH+](C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59428", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](C(=O)N(C)C1CCCCC1)n1nnc(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55436", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCCN[C@@]1(C(=O)[O-])CC[C@H]([NH+]2CCC[C@@H]2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174828", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](SCc1ccnn1C)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233722", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(OC)cc([C@@H]2CCN(C(=O)N[C@@H]3C[C@@H]3c3ccccc3)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111672", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc2c(cc1OC)C[NH+](Cn1nc(-c3ccc(Cl)cc3)n(C)c1=S)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112674", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1518", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(S(=O)(=O)[C@H](C)C(=O)Nc2c(C)cccc2C)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114196", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N2CC[C@H](Nc3ccc([N+](=O)[O-])nc3)C2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50658", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)[C@@H](NC(=O)/C=C/c1ccc(OCC#N)cc1)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26161", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@H](C/C(N)=N/O)N1CC[NH+]2CCC[C@@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201943", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nc(CNc2ccccc2OC[C@H]2CCCCO2)sc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172184", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@@H](CNC(=O)Nc2ccc(C(N)=O)c(C)c2)[NH+](C)C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61402", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)(C)c1ncc(NC(=O)Cc2csc(-c3cnccn3)n2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)Nc1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158957", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1n[nH]c(SCCC(=O)NCc2ccc(N(C)C)cc2C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179455", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(C(=O)NCCCSc2nccs2)c(C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131661", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C[C@H]([NH3+])Cc2ccc(O)cc2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54088", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(N[C@@H](C(=O)N/N=C\\C=C\\c1ccccc1)c1n[nH]c(=O)c2ccccc12)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165631", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCN(C[C@@H](O)COc2cccc(C[NH3+])c2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12069", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[NH2+][C@@H](C(C)C)[C@H](C)c1cc(C)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38815", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCc1cc(NC(=O)N(C)Cc2ccc(F)cc2Cl)n(C)n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208100", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1927", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CN2CC[NH+](Cc3cccc(C)c3)CC2)cc1Br by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162996", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nc(C)c(NC(=O)C[C@H]2Oc3ccccc3NC2=O)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114197", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1nn(C)cc1NC(=O)CCn1c(C)csc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76779", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(CNC(=O)CN1CC[NH2+]CC1)OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(O[C@@H](C)C(=O)N(Cc2ccc(F)cc2)[C@@H]2CCS(=O)(=O)C2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140664", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NCC[NH+]1CCC(c2ccsc2)CC1)c1ccc(F)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88597", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)cc(-n2cc(C(=O)N3CCC(C)CC3)nn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196700", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccc(/C=[NH+]\\C[C@H]2COc3ccccc3O2)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167343", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CO[C@H]1CCCN(C(=O)N[C@@H](C)c2cnn(-c3ccccc3)c2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238279", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)c(C[S@](=O)CC(=O)N(C)c2ccccc2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149280", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(-n2c([C@H](C)Cl)nc3cc(C)cnc32)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186507", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](CN(C(=O)c1ccoc1)c1ccccc1)NC(=O)c1ccoc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148771", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(-n2cnnn2)cc1NC(=O)[C@@H]1C=C[C@@H]([NH3+])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12561", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC[C@@H]1CCN(C(=O)[C@@H](C)Sc2nnnn2C2CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119261", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)CSc2nnnn2C2CCCC2)n(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180592", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)[C@H]2CSCCS2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4571", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+]Cc1ccccc1NC(=O)C1C(C)(C)C1(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138682", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(c1ccc([C@H]2CCC[NH2+]2)s1)N1CCC(CN2CCOCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216572", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC(=O)N1CCC[C@H](COc2ccc(C(=O)N3CCCCC3)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204546", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H](NC(=O)C(=O)Nc1ccc2c(c1)CCC(=O)N2)c1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51575", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(S[C@H]2CSc3nc(C)cc(=O)n3[C@@H]2c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19780", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C(=O)CCN(c2ccc(F)cc2F)[C@H]1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24317", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(C(=O)Cc1ccc(F)c(F)c1)[C@@H]1CCC[C@H]1C[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "173479", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H]1CC[NH+](Cc2cccc(O)c2)C1)c1cc2ccccc2[nH]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6403", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1c(F)cccc1-c1ccc(CN[C@@H](CO)c2ccco2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1C[NH2+]CC1CC[NH2+]CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71341", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(C)c1N1CCN(C(=O)c2ccccc2Cl)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34245", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(O)c([C@H](C)NC(=O)Nc2cccc(C)c2Cl)c1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18884", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1cc(CN2CCC([NH+]3CCC[C@@H]3C)CC2)cc([N+](=O)[O-])c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8154", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nnc2ccc(C(=O)N3CCCCC[C@H]3c3cccn3C)cn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19498", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCC[NH+]1CCN(C(=S)NCc2ccco2)CC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64782", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule C[C@H]1CO[C@@H](c2ccccc2)[C@H](C)N1Cc1cnc2ccc(C#N)cn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88735", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCC[C@H]1NC(=O)C(=O)Nc1ccc(Cl)c(C(=O)NC2CC2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128684", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)NCc1ccc(F)cc1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152276", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(S(=O)(=O)NC[C@@H]2CCN(c3ccc(F)c(F)c3)C2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15721", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc2ccc(Nc3ccc4oc(=O)n(CC[NH+](C)C)c4c3)nn12 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216083", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Nc1ccc(CCNC(=O)Cc2ccc(F)c(F)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52058", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccccc1C[NH+]1CCC(Oc2ccc(C(=O)NC3CCCC3)cc2Cl)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220510", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)N1CCC[C@@H](C(=O)N[C@H]2C[C@H]2CCC)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186841", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCOc1ccc(NC(=O)CNC(C)=O)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171856", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1[nH]c(=O)c(C(=O)OC[C@@H]2C[C@H]2C)cc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38876", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc(Cl)cc1)c1ccc(CNc2c(O)c(=O)c2=[N+]2CCCCC2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119552", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)N(Cc1cccnc1)C(=O)CN1C(=O)[C@@H]2CCCC[C@H]2C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210836", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1cncc(Nc2ccc(Cl)cc2C(F)(F)F)n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239779", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]1CC[NH+](Cc2cc(Cl)ccc2O)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181976", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CNC(=S)Nc1n[nH]c(SC)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138514", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(C1=C[C@H]2N=CC=C2C=C1)N(Cc1cccnc1)CC1CC[NH+](C2CCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248091", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC[C@H]1CCC(=O)[C@H](Cc2cc(Cl)ccc2[N+](=O)[O-])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200254", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1=C(N)Oc2cc(C)n(CC[NH+](C)C)c(=O)c2[C@H]1c1ccc(Cl)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15183", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc([S@@](=O)[C@H]2CCC(C)(C)[C@@H]2[NH3+])cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67270", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NC(=S)N1CCOCC1)c1ccccc1C(=O)OCC(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190042", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1cccc(NC(=O)C(=O)N2CC[C@@H](Cc3ccccc3)C2)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135199", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nc(CN(C)C(=O)[C@@H]2CC[NH2+][C@H]2C)n[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21721", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)c1ccc(S(=O)(=O)N(C)Cc2ccc([C@H]3C[C@@H]3C)o2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89615", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c2c3ccccc3n(CCNC(=O)c3cccc4cccnc34)c2n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145981", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cc2c(cc1OC)[C@@]1(Cc3ccc(Cl)cc3)[C@@H]3CC=CC[C@@H]3C(=O)N1CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239626", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCN1C[C@H](C(=O)Cl)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177278", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2ccc(=O)n(Cc3noc(C(=O)N4CCCC4)n3)n2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245779", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NS(=O)(=O)CCN(CCO)Cc1cc(Br)ccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160211", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H](C)[C@H](C)[NH2+]C2CCN(S(=O)(=O)C3CC3)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133449", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule c1ccc(-c2cc(N3CCC[C@@H](Cn4cc[nH+]c4)C3)n3nccc3n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76853", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](NC(=O)CN1CCCC1=O)c1cccc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64542", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(OC(F)F)cc1)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49854", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1nnc2ccc(N[C@H](C)C(=O)N3CCOCC3)nn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72889", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=[N+]([O-])c1cccnc1N[C@H]1c2ccccc2C[C@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217840", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nn(C(=O)OC(C)(C)C)c(C)c1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154132", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[NH+]2CCC[C@@H]2CN1c1cc(Cl)ccc1C(=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109418", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CC(=O)N[C@@H](C)c1nc2ccccc2n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100088", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C[C@@H](C)C#N)C(=O)Nc1c(C(C)C)cccc1C(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186730", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CC1(O)CCCC1)NCc1cn2cc(Br)ccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125743", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#C[C@H]1C(=O)NC(=S)[C@@H](C(N)=O)C12CCCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163840", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cc2n(n1)CCN(C(=O)c1cc(-c3ccccc3O)n[nH]1)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97706", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C[C@H]1N1C[C@H](NC(=O)Cc2cccc(O)c2)CC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46258", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)c1ccccc1C(=O)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35311", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H]1CCN(C(=O)Nc2cccc(CS(=O)(=O)N[C@H](C)CC)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175858", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[NH+](CCC(=O)Nc1ccc(F)cc1N)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206081", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cccc(NC(=O)c2cc(C)c(C#CCO)s2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113735", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule N/C(=N/OCC(=O)N1CCCCCCC1)c1cnccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54729", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C/C(=N\\O)[C@H]1C[C@H]2C=C(C#N)[C@@H]1[NH+](Cc1ccccc1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73946", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H]1CCC[C@H]1[NH2+]CCNC(=O)CC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134512", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-n2cnc3c2N=C(O)C[C@H]3c2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64649", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=S)NC(=O)C2CCC2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40047", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1C[NH2+]C[C@]12COc1ccccc1C(=O)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149344", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1occc1C(=O)NCC(=O)NC[C@@H](C)c1nc(-c2ccccc2)no1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177583", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)c1ccc2cc(C(=O)N(C)Cc3ccc(Br)o3)[nH]c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238478", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(COc2ccc(-c3nnco3)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175797", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C(C)=O)ccc1OCC(=O)NC1C[C@@H]2CCC[C@H](C1)[NH+]2C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168043", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[NH+]1CCN(Cn2nnn(-c3ccc(Cl)cc3)c2=S)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79043", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+]Cc1ccccc1O[C@@H](C)C(=O)NC(N)=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170692", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CCNC(=O)C(=O)N/N=C\\c1cc([N+](=O)[O-])ccc1[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61582", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCc1ccc(OCc2cnc(N)s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103178", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccnc(NC(=O)[C@@H](C)c2ccc(Br)s2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107466", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule [NH2+]=c1oc2ccc(Br)cc2cc1C(=O)NCc1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174546", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](NC(=O)CCn1ccccc1=O)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223533", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H]1CCCC[C@H]1Sc1nnc(-c2ccc(Cl)s2)o1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201022", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[NH+](C)CC(=O)NC[C@H]1CN(CC(C)C)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26235", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C([O-])COCC(=O)Nc1ccc2c(c1)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccnn1Cc1cccc2ccccc12)c1cccnc1Cl by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36182", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)Nc1ccccc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46096", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC[C@@H](C)NC(=O)[C@@H]1CCCN(C(=O)Nc2ccc(C(=O)NC)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70190", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CNc1ccc(C(=O)[O-])cc1C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162466", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C/C(=C\\c1ccc(F)cc1)C(=O)OC[C@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191171", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(C)c1ccc(C[C@H](C(N)=S)c2nc3ccccc3[nH]2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131543", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(=O)n(CC(=O)N2CCn3c(C)nnc3C2)c2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141084", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)N1CCc2ccccc2[C@H]1CC(=O)O[C@@H](C)c1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75068", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1cc(F)ccc1Cl)[C@@H](O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39831", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)c1cccc(S(=O)(=O)N2CCCc3cccc(F)c32)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97439", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc([C@H]2[C@@H](C(=O)N[C@@H](C)c3nc4ccccc4o3)CCC(=O)N2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203090", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOc1ccc(-c2nc(C(=O)N3CCNC(=O)[C@@H]3CC)cs2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232374", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=CCN(C(=O)[C@@H]1CS[C@@]2(C)CCC(=O)N12)c1nc2c(s1)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81903", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CO[C@@H](C)/C(N)=N/OCCOC1CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89947", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule C[C@@H](CC#N)N(C)C(=O)Nc1ccc(Cl)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226041", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(NCC[NH+]1CCC(CO)CC1)Nc1ccc(C(F)(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211269", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(N(CCC(F)(F)F)CC2CC2)nc(-c2ccccn2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118419", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)N1CCC[C@H](C(=O)Nc2cccc(-c3nc4ccccc4s3)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97248", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)c1cccc(OCC2=C[C@@H](C(=O)NCc3ccco3)N=N2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115897", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCNc1ncnc(Nc2ccc(I)cc2)c1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170866", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccc([C@H](COC)NC(=O)C(=O)Nc2ccc3ncccc3c2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88810", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C=C(C)COc1nc(C)c2c(c1C#N)CC(C)(C)OC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158687", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule O=C([O-])C[C@](O)(c1ccco1)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246241", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOc1ccc(S(=O)(=O)NCc2ccco2)cc1C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35330", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCn1nc(C(=O)N2CCCC2)c2c1CC[C@@H](NCc1nc(-c3ccccc3)cs1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18900", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[NH2+][C@]1(C(=O)[O-])CCC[C@@H]1CCSc1ccc(C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6101", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1noc(C)c1C(=O)Nc1ccc(Cl)cc1C(F)(F)F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156633", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CN(C(=O)Cc2ccc(C(F)(F)F)cc2)CC[S@]1=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55822", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COC1CCN(c2ccc(C(F)(F)F)cc2C(N)=[NH2+])CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123318", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C(C)C)c(C)c1S(=O)(=O)[N-]c1cccc(C(=O)[O-])c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208230", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](C(=O)N1CCCC1)N1CCN(c2ccc(Cl)c(C#N)n2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228388", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CO/N=C/c1ccc(C(=O)N(C)[C@H](C)c2ccc([S@](C)=O)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86092", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CC(=O)NCCOc2c(C)cccc2C)no1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136241", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1c(-c2ccc(F)cc2)cc(-c2ccccc2)nc1N by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140901", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCO[C@@H]1CCCN(C(=O)c2nc(C(C)(C)C)n[nH]2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116479", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1-c1cnc(CNN2CCCCC2)s1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187541", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1-n1c(S[C@@H](C)C(N)=O)nc2ccccc2c1=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132929", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@@H](CCC(F)(F)F)[C@@H]1C[NH+]2CCN1CC2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44500", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@@H](O)[C@H](C)C#N by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191921", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)cc([C@H]([NH3+])Cc2cccc(C(F)(F)F)c2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197986", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(Cl)cc1/C=N/N1C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86334", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2168", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC[NH+]1CCC[C@H]1CNC(=O)c1sc2ncnc(NCc3ccc4c(c3)OCO4)c2c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235393", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](NC(=O)c1cccs1)C(=O)N1CCc2c(sc(N)c2C#N)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244950", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@]12CCCC[C@H]1[C@@H](Cc1cccnc1Cl)[NH2+]CC2 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125572", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1ccccc1OCC(=O)NCc1cscn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220551", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCN(C(=O)Cn1ncc2c(=O)oc3ccccc3c21)c1ccc(OCC)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(NC(=O)Cn2ncc3c([nH]c4ccccc43)c2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52166", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(C)C(=O)Oc1ccc(C2CCCCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32235", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(O[C@H](C)C(=O)Nc2ccnn2Cc2ccc(C)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11662", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC)C(=O)Cn1c(CNC(=O)c2ccccc2F)nc2ccccc21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235827", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)CNC(=O)c1ccc(OCc2ccccc2C#N)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15997", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Oc1ccc(O)c(C[NH2+]C2CCCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246361", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Oc2cc(CNC(=O)Nc3ccccc3)ccn2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174155", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=S(=O)(NCC[C@H]1C[C@@H]2CC[C@H]1C2)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67636", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1cc([N+](=O)[O-])ccc1F)[C@@H]1CCCN1C(=O)OCC(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16359", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1c(C(=O)N[C@@H]2CC[C@@H]([NH+](C)C)C2)cnc2c1c(=O)n(C)c(=O)n2C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68665", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@H](C)NC(=O)CSc1nnc(C2CC2)n1C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70275", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1cc([C@@H]2C3=C(C[C@H](c4ccccc4)CC3=O)Nc3ccc4ncccc4c32)ccc1OC(C)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25414", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(CC(=O)N2CCC3(CC2)CC(=O)N(C[C@H]2CCCO2)C3)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32958", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cccc(C2=CCN(C(=O)[C@H]3CC(=O)Nc4ccccc43)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214024", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=CC1CC[NH+](Cc2ccccc2OCCOC)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191280", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@H]1[C@@H](C(=O)[O-])CC[NH+]1CC(=O)NNc1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36372", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Oc1cccc(CC2(c3ccccc3)C[NH2+]C2)c1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150302", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCNC(=O)CN(CC)c1ncncc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40919", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@@H](C(N)=S)N(C)C(=O)[C@H]1CCO[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203128", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C)c(C)c1C[NH2+]CC(=O)NC1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225077", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCCn1cc[nH+]c1Cc1cc(Cl)ncn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229325", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Cn1ccc2ccc(F)cc21)N1CCN(CCc2ccccn2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149555", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[NH+]1CC[C@H](NCc2ccccc2F)[C@H](c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48408", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(C(=O)c1cc(=O)[nH]c2ccc(S(=O)(=O)[N-]c3ccc(F)cc3)cc12)[C@H]1CCS(=O)(=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77273", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](Oc1ccc(Br)cc1)C(=O)N[C@H](C)c1ccc(-n2ccnc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189406", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]1CCC[C@@H](OC(=O)c2cccc(C(F)(F)F)c2F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116799", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C)cc1[C@@H](C)NC(=O)N1CC[NH+](CC(C)C)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@H]1CC=CCC1)N1CCC([C@@]2(c3cccnc3)NC(=O)N(CCc3cccs3)C2=O)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162172", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C(=O)N(C)[C@@H](C)C2CC2)nn1-c1c(Cl)cccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177055", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C([O-])[C@H](c1c[nH]c2cc(F)ccc12)[NH+]1CCN(c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225734", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCCN[C@@H](c1ccc[nH+]c1N)[C@H]1C[NH+]2CCN1CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166513", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(C1CC1)N1CCC[C@H](CNc2ncc3c(n2)CCN3c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16221", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](c1ccccc1)n1c([C@H]2CC(=O)N(C3CCCC3)C2)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74762", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccccc1-n1nc(Br)nc1Br by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182195", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CC[S@@](=O)[C@@H](C)C(=O)Nc1cc(Cl)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247636", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)c1c(NC(=O)c2cc(C)no2)sc2c1CC[NH+](C(C)C)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221522", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@]1(NC(=O)CCc2ncc(-c3ccccc3)o2)CCOC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164802", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H]1CCCN(C(=O)Nc2cc(Br)c(=O)n(C)c2)[C@H]1CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50392", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCn1/c(=N/C(=O)C[C@H]2CCCCN2C(C)=O)[nH]c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54617", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)c1cc(=O)[nH]c2ccc(Br)cc12)c1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114778", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1noc(C)c1C[NH2+][C@@H](C)C(=O)NC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234885", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cnc(Nc2ccc(NC[C@H]3CCCO3)c(F)c2)c([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205386", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N(C)C[C@@H](O)COc2ccccc2C(F)(F)F)n2ncnc2n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64535", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(Cl)cc1N1C(=O)CS[C@@H]1c1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154081", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1c(Cl)cccc1NC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205071", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)NC1CCN(C(=O)N[C@@H](c2ccccn2)C(C)C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80869", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)Nc1cccc(NC(=O)N(CC)C[C@H](C)C#N)c1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202846", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCCC[C@H](CC)C(=O)Nc1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187905", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1oc(-c2ccc(Cl)cc2)nc1C[NH+]1CCC[C@@H](C(=O)NC2CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156112", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(C(=O)Nc2ccc3c(c2)CCCN3C)c(=O)[nH]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113654", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CCC(=O)NNC(=O)N1CC[C@H](C)C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46721", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)N(C)c1ccccc1NC(=O)Cc1ccc(NC(=O)C2CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169815", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCC[NH+](Cc1nc(Cl)ccc1Cl)C1CCC([NH3+])CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122428", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CSCC(=O)NNC(=O)N[C@@H](C)Cc1c(C)noc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150300", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(NC(=O)C(=O)N[C@@H]2CCc3ccccc32)ccc1-n1cnnn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212111", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C[C@H](C#N)CNC(=O)C(=O)Nc1ccccc1N1CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115825", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](Sc1nc2sc3c(c2c(=O)n1C)CCC3)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132772", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccn2c(=O)cc(CN(Cc3ccccc3)Cc3ccc(F)cc3)[nH+]c2c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128600", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@](C)([NH3+])C(=O)NC1CCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227766", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](CC1CCOCC1)C[C@@H]1C[C@@H]1c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCn1cncn1)N1CCC[C@H](c2[nH+]ccn2Cc2ccccc2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62140", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1cncn1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161207", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COCc1ccccc1C(=O)NC[C@H](O)c1cccc(C(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85974", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1noc(C)c1C[C@@H](C)C(=O)N[C@@H](C#N)C(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54138", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc([N+](=O)[O-])ccc1-c1ccc(/C=N\\NC(=O)c2ccccc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186079", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCCS(=O)(=O)[N-]c1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2C)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159583", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1CCC[C@@H](N(C)C(=O)Nc2ccc(Cl)c(C(=O)NC3CC3)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34663", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)Cn1cnc2cc(-c3ccc(OC)cc3)sc2c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132634", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(C)cc(SCC(=O)N[C@@H](C)c3ccccc3)nc2c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185188", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=c1[nH]c(CN(CCC(F)(F)F)C2CCCC2)nc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28127", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule COc1ccc(-c2nc(SCC(C)C)nc([O-])c2C#N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223910", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)c1c(C)sc(-c2c(-c3ccc(Cl)cc3)[nH]c3nc([O-])[nH]c(=O)c23)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231787", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)n(CCNC(=O)c2ccc([C@H]3CCC[NH+]3C(C)C)s2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185721", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(CCNC(=O)[C@H]1CC(=O)N(C2CC2)C1)c1ccccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193858", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CCl)CSc1ncnc2c1CCC2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1ccc(NCC(C)(C)N2CCOCC2)c([N+](=O)[O-])c1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249351", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1nc2ccc(F)cc2s1)c1ccccc1[N-]S(=O)(=O)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121865", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[NH+](C)[C@@H](CNC(=O)CCc1ccc(Cl)s1)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92168", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CNC(=O)c1ccc(OC)c(NC(=O)NCc2cccnc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186229", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([C@@H](C)[NH2+]Cc2cnn(-c3ccc(F)cc3)c2)c(C)s1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82789", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Nc1ccc2c(c1)OCCCO2)C(=O)Nc1ccccc1[N+](=O)[O-] by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124979", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@@H]1C(=O)N1CCN(C(=O)c2cnc(Oc3ccccc3)cn2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93750", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1c(C(=O)N[C@@H](C)CNc2nc3c(c(=O)[nH]2)CCCC3)oc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76912", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc([C@H](C)[NH2+][C@@H]2CCOc3cc(C)c(C)cc32)ccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90797", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@@H]1CC(=O)N(C[C@H]([NH2+]C)C2CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101928", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCc1nn(C)c(NC[C@@H]2C[C@@H]2c2ccccc2)c1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141314", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cc(/C=C/C(=O)N2CCCC[C@H]2C)cc2c1OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232564", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC(C)(C)O)C(=O)c1cccc(OC(F)F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126053", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](NC(=O)Cc1c(Cl)cccc1Cl)c1ccc(S(=O)(=O)N(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100111", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)SC1=NCCS1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206749", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule COC(=O)CCCc1nc2ccc([N+](=O)[O-])cc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24123", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nn(CC(C)C)c2sc(C(=O)N[C@H](C)c3ccccc3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87140", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc([C@@H]2CCCN(C(=O)c3c[nH]c(C(C)C)n3)C2)n[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54236", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(CC(=O)Nc1ccc2c(c1)OCCO2)C(=O)C=C1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211698", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCNC(=O)CN1CCOC[C@H]1C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220103", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC1(C)[C@H]2CC[C@]1(C)[C@H](NC(=O)c1ccccc1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175026", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#Cc1ccc(C(=O)Nc2nnc(-c3ccc(Br)s3)o2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211524", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(OC)cc([C@H]2CCN(C(=O)[C@@H]3CCO[C@H]3C)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41787", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2csc(NC(=O)NC[C@@H]3CCCO3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39545", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)CN(C)C(=O)Nc1ccc(F)c(C(=O)N(C)C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246440", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCCNC(=O)NCc1cc[nH+]c(N2CCN(c3ccc(F)cc3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230340", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1[C@@H](Sc2nc3ccccc3o2)CCN1c1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60481", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule N#Cc1ccc(C(=O)N2CCCS/C2=N\\c2cccc(C(F)(F)F)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24593", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc2nc(N3CCC[C@@H]3C(=O)N(C)CCc3ccccn3)nc(C)c2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194918", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)C1=C(C)[C@@H](C(=O)N2CCN(c3cccc(C)c3C)CC2)N=C1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131315", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(CC(CO)(CO)Cc2ccccc2)sc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45775", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ncnc2ccsc12)c1cc(F)ccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107239", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCC[NH2+][C@@]1(CO)CC[C@@H](n2c(C)nc3ccccc32)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196414", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1c(Cl)cccc1S(=O)(=O)NC[C@H](c1cccs1)N(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227318", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1csc(NC(=O)c2cnc([C@@H]3CCC[NH+](C)C3)cn2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213397", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCc1cccc(N[C@@H]2c3ncccc3C(=O)N2c2cc(OC)ccc2OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165929", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCN[C@H](c1cc(C)cnc1N)C(C)(C)[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58351", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@H](NC(=O)N[C@H](C)[C@@H](C)CO)c1cccc(N2CCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114805", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)NC(=O)[C@H]1CC[C@H](c2ccccc2)N(C(C)=O)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189974", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](NC(=O)[C@H]1CC=CCC1)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23455", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NCCc1nc2ccccc2s1)c1ccc(OCC(F)F)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40257", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1c2ccccc2O[C@@H]1C(=O)OCc1cc(Cl)c2c(c1)OCO2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104408", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)C[n+]2ccc(Cc3ccccc3)cc2)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20512", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS[C@@H](C#N)C(F)(F)F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224288", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nnsc1CNC(=O)c1nc2ccccn2c1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66403", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1OCC[NH2+]C[C@@]1(C)CC(C)=NO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156575", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(NC(=O)C[NH+]2CCCN(c3ncccn3)CC2)ccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225543", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOC(=O)C(F)(F)Oc1cc(C)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106946", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(CCNC(=O)N(C)[C@H](C)c2ccco2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205953", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cn1cc[nH+]c1[C@@H](NCC(C)(C)S(C)(=O)=O)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104685", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Nc1ccc(COCc2ccccc2)c2ncccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225419", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cn1cnnc1CCn1nnnc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194300", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)c2[nH]nc([N+](=O)[O-])c2Br)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+]C[C@H](C)C(=O)N1CC[C@H](C)[C@H]2CCCC[C@@H]21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191905", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN2CC[NH+](C)[C@@]3(CCNC(=O)CC3)C2)cc1Cn1cccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233001", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1ccc2c(c1)OCO2)C(=O)c1ccc2ccc(Cl)cc2n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23943", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(-n2c(-c3ccccc3)c(CC)n3c4c(=O)n(C)c(=O)n(C)c4nc23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236121", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C[C@@H](c1ccccc1)[NH+](C)CCOc1ccc(C#N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20725", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Br)cc1S(=O)(=O)N1CCC[C@H](N2CCCC2=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166022", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(N2CCOCC2)cc1C(F)(F)F)NC1CCCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200076", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@H]1C[C@@H]([NH3+])CN(Cc2nc(N)nc(N(C)C)n2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113041", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(N2CCC[C@@H]2C(=O)NCCC2=CC[C@@H]3C[C@H]2C3(C)C)nc2cc(S(C)(=O)=O)ccc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231004", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)[C@@H](C)n1c2ccccc2c2cn[nH]c(=O)c21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79413", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C[NH+](Cc2c[nH]nc2-c2ccc(F)cc2)CC[C@@]1(O)C1CCOCC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50476", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC[C@H]1CCN(C(=O)N[C@@H](C)c2ccc(-n3cncn3)cc2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57261", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nc(C)c(C[NH2+]Cc2cn(-c3ccc(F)cc3F)nc2-c2ccccc2C)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60135", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C#Cc1cccc(NC(=O)C(=O)NC2CCN(C(=O)c3ccco3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202632", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc2c(cc1OC)CCN(C(=O)c1cnn(C)c1C)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99742", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=C(C)CN(CC)C(=O)CN1CCN(C(=O)C[NH+](C)C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154577", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(N2CCOC2=O)cc1NC(=O)[C@H](C)Sc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223290", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@@H]1CN(C(=O)c2cn[nH]c2N)C[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71599", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CCOC(=O)C[C@H](C)Nc1snc(Cl)c1C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54086", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1ccc(-c2nc(CC(=O)Nc3nc(C)c(C)s3)cs2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23755", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule N#Cc1cn(C2CC2)c(=O)n(CC(=O)N2CCN(C(=O)c3ccco3)CC2)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201362", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc([S@@](=O)CCC(=O)Nc2cc(F)cc(F)c2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112618", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccc(-n2nc(C)c(CC(=O)Oc3ccc(C(N)=O)cc3)c2C)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243204", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1Nc2ccccc2C[C@@H]1C(=O)N[C@@H]1CCCC1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184141", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)c1ccc(NC(=O)c2oc3c(c2C)/C(=N/NC(N)=S)CCC3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93208", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(CCNC(=O)CCn2cnc3onc(-c4ccc(F)cc4)c3c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76526", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C2=C[C@H](C(=O)N3CCN(C(=O)c4ccco4)CC3)N=N2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123565", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(COCCNC(=O)N2CC[C@@H]3CCCC[C@H]32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74755", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COc1cc(OC)cc([C@@H]2CCN(Cc3ccc(F)cc3C#N)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198876", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)n1ccc2ccc(C(=O)NCc3nnc4ccccn34)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53851", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccccc1Oc1ccccc1)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9524", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1cccc(-n2ncc3c(O)nc(SCC(N)=O)nc32)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9991", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H]1C(=O)OCC(=O)Nc1cc(S(C)(=O)=O)ccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178416", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)[NH2+]Cc1c[nH]nc1-c1ccc(C(C)(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184774", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(CC(=O)N[C@H](C#N)C(C)(C)C)C(=O)c1ccc(Br)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77064", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCc1cc(C(=O)N(C)[C@H](C)c2cc(-c3ccccc3)[nH]n2)n(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60216", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1CCCNC(=O)N(C)Cc1c(F)cccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195815", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule N#Cc1cccc(/C=C/C(=O)N2CCCCC[C@@H]2c2ccncc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168122", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc2c(c1)CCCN2C(=O)C[NH+]1CCC[C@@H]1c1ccc(OC)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123756", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C(=O)NCc2cccnc2)nc(N(C)C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188854", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)OCc1ccccc1)C(O)(O)C(=O)CCl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6340", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(O[C@@H](C)C(=O)N2CCC(C(N)=O)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226988", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC(CC)(CO)CNC(=O)c1ccc2c(c1)COCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170385", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1CCC[C@@H](NC(=O)CN2C(=O)NC3(CCC(C(C)(C)C)CC3)C2=O)[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239787", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cccc(/N=C(\\[S-])Nc2ccc(Br)cc2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245506", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCN(CC)C(=O)CCC(=O)N1CCC[C@@H](C)[C@@H]1c1ccc(C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30692", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1cnn(C[C@H](CS)c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156973", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC[C@@H]1CSC(NC2CCCCCCC2)=[NH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158175", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CC[NH2+][C@@H]1CCOC2(CCCCC2)C1)NC1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24594", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CC(C)(C)CC[C@H]1NC(=O)N1CCN(C(=O)c2ccncc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190143", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCCCN1CC(=O)N2[C@@H](Cc3c([nH]c4ccccc34)[C@H]2c2ccc(C)cc2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175794", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN1C(=O)NC(=O)[C@]2(Cc3ccccc3N3CCN(Cc4ccc5c(c4)OCO5)C[C@@H]32)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59630", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)c1ccc(-c2csc(NC(=O)[C@@H]3CCCN3S(=O)(=O)c3ccc(C)cc3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99195", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)N[C@H](C)CCc1ccccc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51563", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@@H](C)NC(=O)Nc2ccc(NC(=O)C3CC3)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194316", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1nc(CCNc2nccc(-c3cc(C(=O)[O-])ccn3)n2)cc(=O)[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187570", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H]1C[C@H]([NH3+])CN(S(=O)(=O)c2c(F)cc(F)cc2F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6862", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)Cn2c(=O)ncc3cc(S(=O)(=O)N4CCCC[C@@H]4C)ccc32)c(C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171465", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CC[C@H](c1ccncc1)[NH+](C)Cc1csc([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109380", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1[nH]cnc2cc(-c3ccc(Cl)cc3)sc12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207962", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nnc(NC(=O)N2C[C@H](C)O[C@H](c3ccccc3)C2)s1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129603", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)N2CCC[C@@H](OC)C2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49902", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCN(CC(C)(C)O)C(=O)Cc1nc(CCl)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131995", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CS(=O)(=O)Nc1cccc(C(=O)Nc2ccc(F)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100281", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(=O)N1CCC([NH+]2CC[C@H](c3nc4cc(F)ccc4o3)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144065", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CSc1nc2ccccc2c(Nc2ccc(C(C)=O)cc2)c1C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70193", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(NC(=O)C(=O)NCc2ccc(C[NH+](C)C)cc2)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56385", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(/C(C)=C/C(=O)Nc2cc(C(=O)NC3CC3)ccc2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77091", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]1C[C@H]1c1ccc([C@H](O)Cc2ccc(O)cc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47050", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(C)C(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96480", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)[C@H](Cc1ccccc1Br)[NH2+]CC1(CO)CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236562", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CCO[C@H]1CCCC[C@H]1NC(=O)c1cc2c([nH]c1=O)CCCC2=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220902", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCC1(c2ccc(Cl)cc2)CCOCC1)c1cccnc1N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114795", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccccc1COc1cccc(C=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31060", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1cccc(C(=O)OCC(F)(F)F)c1)c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62942", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)C2CC2)cc1NC(=O)[C@@H](C)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218776", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCc1nnc(SCC(=O)Nc2c(Cl)cccc2Cl)n1-n1cccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13788", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(CCC(=O)N[C@@H](c2ccccc2)c2ccncc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10883", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1cc(S(=O)(=O)Nc2ccccc2O)c(OC)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140820", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](CO)NC(=O)N[C@H](Cc1ccccc1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142414", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CCC[C@H](CC[NH+]2CCNC(=O)C2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99778", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NC[C@H]1C[C@@]12CCc1ccccc12)N[C@@H](CO)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72118", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C=C1CCSCC1)NNC(=O)Cc1ccsc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160845", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1cc(C(=O)N(CCc2cccs2)Cc2cccnc2)c(=O)c2ccc(C)nc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136004", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(c1ccc(-n2ccnc2)cc1)N1CCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120181", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCCN(c1ccccc1)S(=O)(=O)c1cccc2nonc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9605", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCC[NH2+]Cc1ccccc1N(C)C[C@@H]1CCC[NH+]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175587", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCCNC(=O)[C@@H]1CC(=O)N(c2cccc(Cl)c2)C1)c1ccc2[nH]ccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218020", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(S(=O)(=O)N2CC[C@@]3(CCC[NH2+]C3)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221715", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(N2CCN(C(=O)COc3cccc4ccccc34)CC2)ncn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246192", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)c1cccc(C(=O)O[C@H]2CCC[C@H]2OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186989", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C(CNc1ccc(Cl)c(Br)c1)Nc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166406", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2cc(NC(=O)C(=O)NCCCN3CCOCC3)ccc2o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76524", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccccc1CCC(=O)/N=c1\\[nH]nc2cc(C)ccn12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33410", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOC(=O)c1nc2cnc(NC)nc2n(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222482", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)O[C@@H]1N=C(c2ccccc2F)c2cc(Cl)ccc2-n2c1cnc2C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228301", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)c1cccc(OCc2ncc(-c3ccc(F)cc3)o2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212973", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(F)cc(N[C@]2(CO)CCC[C@H](C)[C@@H]2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203251", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule N#Cc1ccc(CN2CCN(C(=O)CCNS(=O)(=O)c3ccc(F)c(Cl)c3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187260", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(NCc1ccc(Oc2cccnc2)c(F)c1)c1cc(Cl)ccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94184", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)[C@@H]1CCCC[C@@H]1NC(=O)CC(C)(C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35481", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)N(C)C)cc1OC(=O)c1cc(F)ccc1NC(=O)[C@H]1C[C@H]1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53669", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c2ccccc2c2cc(NC(=O)c3ccnc(-n4cncn4)c3)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72403", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCc1ccc(S(=O)(=O)N[C@H](C(=O)[O-])C(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122904", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N/N=C/c1cccs1)c1cccc(NC(=O)c2ccc(Cl)cc2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125723", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)N[C@@H](CC(=O)N1CCCCCC1)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28732", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ncccc1CNCCC[NH+]1CCCC[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129099", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(CSc2nnc(-c3ccccc3)n2N)c(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239491", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCNC(=O)Nc1ccc(OCC(=O)NCc2cc(F)ccc2F)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55537", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc([C@H]2CC(=O)NC3=C2C(=O)C[C@@H](c2ccc(C)cc2)C3)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154215", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc([C@H](C)NC(=O)c2ccc(NC(=O)C3CC3)s2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188425", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1CCN(C(=O)c2cc3c(-c4ccc(Cl)cc4)nn(C)c3s2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223158", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCCNC(=O)N1CC[C@@H](C(=O)[O-])C1)NC1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194165", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2nn(-c3ccccc3C)cc2C[NH+](C)Cc2nccn2C)cc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171785", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=N[C@H]2C(C(=O)N3CCC(N4c5[nH+]cccc5N[C@@H]4C4CCC4)CC3)=CC=CC2=C1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63279", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@@](O)(CO)CNc1ncc(Cl)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220667", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)C1(NC(=O)[C@@H](C)Oc2ccc(C)cc2)CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187659", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H]1CCC[C@@H]1C[C@@H]1CCCCO1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186332", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCn1cc(C(=O)N2CCN(C(=O)CCC3CCCCC3)CC2)c2nn(-c3ccccc3)c(=O)c-2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23306", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)Cc1ccccc1NC(=O)C[C@H]1CCOc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243403", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@]1([C@@H](Br)c2ccc(Cl)cc2Cl)CCCO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198574", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N[C@@H](C)C(=O)NCc2ccccc2)nc(-c2ccncc2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66322", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[C@](C)([C@@H](O)Cc1ccc(F)cc1Cl)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20837", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc([C@H](O)C[NH2+]C2(C(N)=O)CCCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104450", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](C)NC(=O)C(=O)Nc2cccc(-c3nccs3)c2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86042", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H](OC(=O)c1cnn2cc(Br)cnc12)c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84208", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN(Cc1ccsc1)S(=O)(=O)c1ccc(F)cc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42866", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1c(CNC(=O)c2occc2Br)oc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1Nc2ccccc2/C1=C/c1cccc(C(=O)[O-])c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152682", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1S(=O)(=O)N(C)CC(=O)N1CCCCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1/C=C1\\Oc2c(ccc(O)c2CN2CCN(c3ccccc3)CC2)C1=O by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112433", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc2c(c1)CC[NH+]([C@@H]1c3ccccc3C3(CC[NH2+]CC3)[C@H]1O)C2 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60656", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=O)ccn(CC(=O)NCCc2ccc3c(c2)OCCO3)c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49935", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](c1ccc(Cl)cc1)N(C)c1cncc(C[NH3+])n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23441", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1C[NH+]2CCCC[C@@H]2CN1Cc1ccc(F)cc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35973", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C[C@@H]1CCN(C(=O)Nc2cccc([N-]S(C)(=O)=O)c2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149616", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCl)c1ncc(Cl)cc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182159", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc2cc(C(=O)NNC(=O)c3ccc(Cl)nc3)oc2cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30855", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc2c(c1)CCC[C@@H]2CC(=O)N1CCN([C@H](C#N)C(C)C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200853", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(c1cccc2c1OCC2)N1CCC(c2[nH]ncc2-c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97209", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H]1CCC[C@H](NC(=O)C[NH+](CC(=O)N2CCCC2)C[C@@H]2CCCO2)[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180005", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)CN(C)C(=O)N[C@H]1CCCN(c2ccc(C#N)cc2F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213873", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C)n2c3c(=O)n(C)c(=O)n(C)c3nc2n1CC(=O)c1ccc(F)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224218", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=CCNC(=O)NC(=O)CN1CCOC[C@@H]1C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127995", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](c1ccccc1)[NH+]1CC[C@H](NC(=O)c2ccc(Br)o2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234613", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1cc[nH+]c1[C@@H]1[C@@H](C(=O)[O-])CC(=O)N1CCc1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C)c1NC(=O)[C@H](C)Sc1nc2ccccc2c(=O)n1Cc1ccco1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55426", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cc(N2CCC[C@H](Nc3nccc(OCc4ccccc4)n3)C2)cn1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11816", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1c(Br)cccc1CSCC(=O)NC1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116650", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)c(O)c(C(=O)Nc2cc(C(C)C)nn2-c2ncccn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36922", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1[C@H](Nc2ccc3c(c2)OCCCO3)CCCN1Cc1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25342", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(c1ccc(OC[C@@H]2CCCO2)cc1)N1CCCSc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192154", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC1=C[C@@H]([C@@H]2NN[C@H](S)N2/N=C/c2ccccc2F)N=N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69893", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]([NH2+][C@@H](C)c1ccc2c(c1)OCCO2)C(=O)Nc1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124717", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)Nc2nnc(SCC(=O)c3ccccc3)s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80188", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H]1C[C@H]([NH3+])CN(CC(=O)Nc2cc(C(C)(C)C)no2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225863", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)NC1(c2noc(CCC(=O)NC(C)(C)C)n2)CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78730", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccc(C(=O)N2CC[C@@H](C)[C@@H](O)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80101", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]([NH3+])c1cccc([C@@H]2CCc3cccnc32)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106883", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(S(=O)(=O)Oc2cc(C)ccc2C)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58569", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C/[NH+]=C(/NCCc1cc(C)cc(C)c1)NCc1ncc(C)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2551", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCCc1cc(NC(=O)C(=O)NC[C@@H](C)c2ccc(F)c(F)c2)n(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168764", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H]([NH2+]Cc1cccc2c1OCO2)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188237", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])/C(=C/c1ccccc1[N+](=O)[O-])c1ccccc1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38356", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(-c2csc(CC(=O)N(C)C)n2)c(C)n1NC(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10445", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCC1(CC)CCN(c2[nH+]cc(N)cc2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34835", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=C(C)C[C@@H]1CCC(=O)N1CCc1ccc(OC)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219095", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CSc1cccc(NC(=O)CSc2nc([O-])c3c(n2)CC[NH+](Cc2ccc(F)cc2)C3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161901", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccc([O-])c(/C=[NH+]/Cc2ccccc2)c1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241661", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1CCCN(C(=O)Cn2c(SC(F)F)nc3ccccc32)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169735", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(CCCNC(=O)CN1CC[S@](=O)C(C)(C)C1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205043", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule N#C/C(=C/c1ccc(OCc2ccccc2F)cc1)C(=O)NCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204308", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(CN2CC(=O)N[C@@H](C)C2=O)cc(C)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39316", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](C(=O)NCCc1ccco1)n1c(=O)c(C(F)(F)F)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12975", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(C(=O)c1cc(F)cc(F)c1)C1CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67361", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccc(NC(=O)c2cccc(C)c2)cc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222153", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(C(=O)[C@H]1CCCN1C(=O)Cc1cccs1)C1CCS(=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@H](C)[NH+]1CCN(CC(=O)N[C@H]2CCCC[C@H]2C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42876", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(OC(=O)c2cc(C3CC3)[nH]n2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237791", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)NC(=O)CCNC(=O)N[C@@H](C)c1c(C)noc1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242972", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1/C=C/C(=O)[C@@H](C#N)c1nnc2n1CCCCC2 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75382", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(N(Cc2ccon2)Cc2ccco2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149371", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H](CCO)CN1CC[NH+]2CCCC[C@@H]2C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243519", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)(C)[NH2+]C[C@H](c1ccccc1Cl)[C@@H]1CCS(=O)(=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229391", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccccc1NC(=O)[C@@H]1Sc2nnc(C)n2N[C@@H]1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238167", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3nc(-c4ccc5c(c4)OCO5)cs3)c2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209745", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)Nc1cccc(C(=O)N2CCCC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54609", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCCN(CC)C(=O)[C@@H]1CC(=O)N(c2ccc(NC(C)=O)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12211", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOc1c(C)cc(S(=O)(=O)NC[C@](C)(O)C2CC2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186778", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCN(CCO)C(=O)Nc1c(C)cccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248523", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Oc1ccc(C(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29165", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)NCc1ccccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47558", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@H]2CN([C@@H]3CCOC3=O)CCO2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198391", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)CCNC(=O)c1cccc(S(=O)(=O)N[C@@H]2CCCNC2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12742", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(N/N=C2/C(=N)[N-]N(C(C)=O)C2=N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213447", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+][C@@]1(CO)CC[C@@H](N2C[C@H](C)OC[C@@H]2CC)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69656", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(Cc1ccc(Cl)nc1)C(=O)[C@@H]1C[C@H]2CC[C@@H]1O2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220075", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C#CCN1CCC(C(=O)N2CCC[C@@H]2c2ccc(C(C)C)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144863", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@H](C)C[C@H](C)NC(=O)N[C@@H]1CCN(c2cnn(C)c2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206921", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[NH+]1CCC(CCNC(=O)N[C@@H]2CCC[C@@H]2CO)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120091", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccn(C/C=C/c2ccccc2)c(=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220800", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](NC(=O)C[C@H](NC(N)=O)c2ccccc2)c2ccccc2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113902", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)c1ccc(CNC(=O)c2cn(C[C@@H]3CCCO3)nn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184331", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOC(=O)C1CCC(Nc2ccc(Cn3cccn3)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96495", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c([C@H](C)NC(=O)C2CCOCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77395", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC[NH+](Cc1ccccc1Cl)Cn1nc(-c2ccncc2)n(C2CC2)c1=S .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58080", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1n[nH]c(C)c1CNC(=O)c1ccnc(OC(C)(C)C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53670", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H]1CC(=O)N(c2ccc(CN3CCOCC3)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118883", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1OCC(=O)N/N=C/c1ccc(N2CCCCCC2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108219", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cn1cc(I)c(=O)n(CC(=O)NC[C@H]2CCCO2)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133024", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C[NH+]2CC[C@]3(CCC[NH+](CC4CCC4)C3)C2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237761", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)Sc1ccc([C@@H](C)NC(=O)[C@@H]2COCCO2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213747", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[NH2+][C@]1(CO)CC[C@@H](Sc2ccc(C(C)(C)C)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59060", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C1N=C2C=C(c3ccccc3)S[C@H]2C(=O)N1c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132817", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N1CCC[C@@H](CN2CCCc3c(F)cccc32)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41166", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(N2CCCN(c3ccc(Cl)nn3)CC2)c(C(=O)[O-])c1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@@H](CCNC(=O)c2ccccc2Cn2cncn2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43443", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1c(C[NH+]2CCn3nc(C(=O)NCCO)cc3C2)[nH]c2ccc(F)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13961", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CS(=O)(=O)N1CCN(C(=O)c2cn(Cc3ccccc3)c3ccccc23)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51190", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@H]1CCC[C@@H]1NC(=O)c1cccc(Nc2cnn(C)c2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162615", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@H]1CCN(C(=O)NC[C@@H]2CCC[NH+](C)[C@@H]2c2cccs2)C[C@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162780", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C([O-])C1CCN(C(=O)COc2ccc(Cl)cc2Cl)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178657", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCN1C(=O)S[C@H](Nc2ccccc2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248776", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1c(SCC(=O)Nc2cccc3cn[nH]c23)nnc1-c1cccc(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69433", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1Cc1nnc(NC(=O)C[C@H]2C[NH2+]CCO2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18715", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[NH+](CC)CCn1c([C@H](C)Cl)nc2cnccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147308", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCN(Cc1ccccc1)C1(C[NH3+])CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160990", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)Cn1c(C[C@H]2CCN(C(=O)C(C)(C)C)C2)nc2cccnc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54182", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc2nc(C(=O)O[C@@H](C)C(=O)Nc3cccc(C(F)(F)F)c3)cn12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158845", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)N(C[C@H]1C[C@@H]1C)C(=O)Cc1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129116", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(NC(=O)CNc2ccc(C(=O)N(C)C)c(C)c2)n(C(C)(C)C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99354", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCc1ccccn1)C(=O)c1ccccc1Br by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198542", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=C(c2ccccc2)C(=O)O[C@@H]2C[C@@H](Cl)CC[C@@H]12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176596", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)CN(C(=O)Cc1ccccc1Cl)c1c(N)n(CC(C)C)c(=O)[nH]c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9739", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccsc1[C@H](O)c1ccccc1C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156694", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](Cc1cccc(C)n1)Cc1cc(C(=O)NN)no1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19003", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(C(=O)c1ccc(-n2nc(C)nc2C)cc1)C1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148773", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N2C[C@@H](C(=O)NCCS(=O)(=O)N3CCN(c4ccccc4)CC3)CC2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234166", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CCn1ncc([C@H]2C(C#N)=C(N)OC3=C2C(=O)CCC3)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199887", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[NH+]1CCC(C(=O)Nc2nnc(C(F)(F)F)s2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224389", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nnc3ccccn13)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213681", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H](C)NC(=O)c1cnn(-c2cccc(Cl)c2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37666", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N/C(=N\\OC(=O)c1ccc2ccccc2c1)c1ccccc1Cl by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167226", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1CNC(=O)N(C)Cc1nnc(C2CC2)n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18723", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[C@@](C)([C@@H](N)c1cccc(Cl)c1)[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235545", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCOC(=O)c1ccc(C[NH+]2CCCC[C@H]2[C@H](O)CC)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11017", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCC1=NN(C(=O)c2ccc(F)cc2)[C@@](O)(C(F)(F)F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226519", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@@H]1C[C@@H]1[N+](=O)[O-])N1CCS(=O)(=O)C[C@H]1c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25694", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1CCC(N(C)C(=O)CS(=O)(=O)[C@@H](C)C(C)C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163397", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CNC(=O)c1cccnc1N[C@@H]1C[C@H]2CC[C@@H]1O2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62192", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C(=N/Nc1nn2cnnc2c2ccccc12)\\c1ccc(OCc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191671", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)[C@H](O)CNC(=O)NC[C@H](c1ccc(Cl)cc1)n1cccn1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105992", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)nc(N2CCC(Oc3ccnc(C(N)=O)c3)CC2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162680", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C/C(=C1\\C(=O)NC(=O)N=C1[O-])c1cc(C)ccc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75321", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1cccc(S(=O)(=O)Nc2cc(Cl)ccc2F)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31465", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=O)c2ccccc2NC(=O)c2cc(C)n(C)n2)c(C(=O)c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115675", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1ccccn1)C(=O)[C@H]1C[C@H]1c1ccc(Cl)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38832", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc([C@H](C)[NH+]2CCCC[C@@H]2[C@@H]2CCCN2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161588", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([C@H]2C(C#N)=C(N)SC(=N)[C@H]2C#N)c(C)s1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163986", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](c1cccc(C(F)(F)F)c1)[NH+]1CC[C@@H](C(=O)[O-])[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190026", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC1CC[NH+]([C@@H](C)CNC(=O)NC[C@@H](C)C[C@@H](C)O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246940", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](NC(=O)[C@@H]1Cc2cc(C)c(C)cc2O1)c1nc2ccccc2[nH]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157663", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C(C)C)c1NC(=O)c1ccc2c([O-])n(C)c(=S)nc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248167", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S1(=O)C[C@@H](OS(=O)(=O)[O-])[C@H](c2ccccc2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235145", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1CCCCN1C(=O)CNC(=O)CNC(=O)c1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127787", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](c1ccccc1)[S@@](=O)Cc1coc(-c2cccs2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174180", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)N/C(=C/c1ccccc1)C(=O)Nc1cccc(C(C)=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7470", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(C(=O)NCC(=O)NCc2cnn(-c3ccccc3)c2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55190", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1c(NC(=O)c2ccccc2)cccc1N[C@H](C)C(=O)Nc1cccc(C#N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209595", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Br)ccc1OCCCN1CC[NH2+]CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163836", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@@H](NC(=O)CCl)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158002", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](c1cccs1)N(C)C(=O)[C@@H]1CC[C@H](C[NH3+])O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60563", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2ccc(=O)[nH]n2)cc1S(=O)(=O)N(C)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232031", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccccc1C(=O)c1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214555", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)C(C)(C)O)cc1OC(C)C by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169319", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1cc(NC(=O)c2ccc(F)c(COC)c2)ccc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184414", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccc([C@H](C)CC(=O)N2CCC[C@H](NC(=O)C(C)C)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98413", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule C[C@H](C#N)CNC(=O)c1cccc(SCC#N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244557", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[S@](=O)c1ccccc1C(=O)N[C@@H](c1ccccc1)c1ccc(OC)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121984", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1cc(Cl)ccc1/N=C/c1cc(Br)ccc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27751", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)NCc1ccc(C(=O)N[C@@H]2C[C@@H]3CCCc4cccc2c43)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135894", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cn1c(CCNC(=O)c2cccc(Br)c2)nc2ccccc21)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68516", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)CN2C(=O)CC3(CCCCC3)C2=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147159", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccn2c(=O)c(C(=O)Nc3ccc4c(c3)CC(=O)N4)cnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ocnc1C(=O)N[C@H](C)Cc1c(Cl)cccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101873", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)NC(=O)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211541", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NC(=S)Nc1ccccc1N1CCCC1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94853", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)N1CC[C@@H](NC(=O)N[C@@H]2CCCc3ccc(F)cc32)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90652", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)N1CCN(C(=O)N(C)C)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166381", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CN(C(=O)c2cc(S(C)(=O)=O)c(Cl)cc2Cl)C[C@@H](C)O1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100993", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1574", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCc1ncc(C(=O)N(C)[C@@H](C)CSCC)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178706", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)Nc1ccc(OCCC(N)=O)cc1)c1ccc(Cl)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43479", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](SCC(=O)N1CCO[C@H]2CCCC[C@@H]21)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87680", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc([C@H](C(=O)[O-])c2ccc([O-])nn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218129", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1n[nH]c(C(c2ccccc2)c2ccccc2)c1C(=O)NN by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66432", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COC(=O)c1coc(S(=O)(=O)Nc2c(C)n[nH]c2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88368", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]1C[C@H](C)C[NH+](Cc2ccccc2CNC(=O)c2ccc(Cl)cc2[N+](=O)[O-])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193335", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccccc1/C=C/C(=O)N1CCc2sccc2C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110601", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)c1ccc(N2CCN(C(=O)c3cccs3)CC2)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22019", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)NCC(=O)N2CCC(C(=O)Nc3ccccc3)CC2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69119", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCN(CC1CC1)c1ccc([C@@H](C)[NH3+])c(O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117552", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccnc1C[NH+](C)Cc1ccc(F)cc1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94550", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]1CCCC[C@]12CC[NH2+]C[C@@H]2c1ccccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187211", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(C)C(=O)CCNC(=O)C(=O)Nc1ccnn1C1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55523", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc([C@@H]2[C@@H](C(=O)Nc3cc(Cl)ccc3OC)c3ccccc3C(=O)N2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170399", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c(-c2ccc(SCC(=O)NC(C)C)nn2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208777", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@H]1CCC[C@H](Nc2cccc(-c3cnco3)c2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104192", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(NC2C[C@H](C)O[C@@H](C)C2)ccc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247037", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@H](CCNC(=O)OCCO)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73247", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(Cn2c(CNC(=O)c3ccc(OC)cc3)nc3cccnc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125238", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(S(=O)(=O)NCc2nc3nc(C)cc(C)n3n2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232573", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[C@H]([NH2+][C@@H]1CSCC(C)(C)C1)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244818", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(N2CCN(C(=O)c3ccc(Cl)s3)CC2)cc(C)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140231", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]([NH3+])[C@@H](c1ccccc1C)N1CCO[C@H](C#N)C1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180666", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1cc(F)ccc1CCNC(=O)NC[C@@](C)(O)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128367", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=[N+]([O-])c1cccc(-c2csc(N/N=C\\c3ccccc3O)n2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165071", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1OCC[C@H]1C(=O)N1CCN(C(=O)c2ccccc2OC(F)F)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72252", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CS(=O)(=O)c1ccc(-n2nnnc2COc2cccc(I)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21940", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)[C@H]2CCCN(c3ccnc(-c4ccc(F)cc4)n3)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85880", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C)c(-n2ccnc2SCC(=O)NCC(=O)NC2CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219869", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COC(=O)Nc1cc(NCCOc2ccc(F)cc2Cl)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226784", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H]1CN(C(=O)Nc2ccccc2S(=O)(=O)C(C)C)C[C@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166902", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc2occ(/C(C)=N/O)c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179262", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@H]1C[NH+]2CCC[C@@H]2CN1c1ccc(/C(N)=N/O)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186649", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C#Cc1cccc(NC(=S)NNC(=O)CNC(=O)c2ccc(F)cc2F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85716", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(NC(=O)N2CCSC(C)(C)C2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71925", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(F)c([C@@H](C)NC(=O)COC2CCCCC2)cc1OC by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167582", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(C(=O)Cn1cccc(C(F)(F)F)c1=O)C1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177720", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1n[nH]c(SCCC(=O)N(C)[C@H](C)Cc2ccsc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64273", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccccc1[C@H](C#N)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156967", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@H](CC)c1nc(CC(F)(F)F)no1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65430", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cccc2c(CC(=O)N3CC[C@@H]4CC[C@H](C3)[NH+]4C)c[nH]c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245544", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(C(=O)Nc2cccc(F)c2)CC[C@@H]1[NH3+] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191386", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@H]1Cc2ccccc2O1)N1CCN([C@@H]2CCS(=O)(=O)C2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208440", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)c1c(NC(=O)C(C)C)sc(C(=O)Nc2cccc(C)c2C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56969", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1c(C[NH2+][C@@H](C)c2ccc(Cl)s2)cnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10423", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cc([C@H]2CCCN2C(=O)c2ccc(F)cc2)on1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100891", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)c1sc2cccc(F)c2c1CSc1nnnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5312", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](C(=O)OC)N(C(=O)c1ccnc(Cl)c1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161052", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CN(S(=O)(=O)c2ccc(-c3ccc(=O)[nH]n3)s2)c2ccccc2N1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57193", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule N/C(CSc1ccccc1[N+](=O)[O-])=N\\O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191314", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)(C)C(=O)NNC(=O)NCc1cccc([N+]2=CCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239155", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cc(=O)[nH]c(-c2cccc(NC(=O)c3ccc4cc[nH]c4c3)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59316", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C#CCOc1ccc(F)cc1NC(=O)N[C@H]1CCCC[C@H]1[S@](=O)CC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93139", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1cccc(COc2cccc3c2CC[C@H]3O)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241577", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)[C@@H]1CC(=O)N(Cc2ccc3ccccc3c2)C12CC[NH+](Cc1ccco1)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212145", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](Cc1ccccn1)NC(=O)CN1C(=O)[C@H]2CC[C@@](C)(C1=O)C2(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12418", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(CNC(=O)c2cnc([C@H]3CCCO3)s2)c1O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57272", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(OC(=O)C=C2CCSCC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65014", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1ccc(NC(=O)CN2C(=O)c3cccc4cccc2c34)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19949", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(N2C(=O)S/C(=C/c3ccc(-c4ccccc4[N+](=O)[O-])o3)C2=O)cc1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198989", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule [NH3+][C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7928", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C(C)C)c(C)c1CN(C)C(=O)C[C@@H]1C(=O)NCC[NH+]1CC(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123383", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[C@](C)([C@@H](O)c1cnccn1)[NH+]1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133756", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@@H](C)C(=O)NC[C@@H](C)Oc1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100643", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Nc1nccc(Oc2ccc(F)cc2)n1)c1cccc(S(N)(=O)=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66696", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(CNc2ncnc3sccc23)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184231", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)C1CCC(=CC(=O)NC[C@@H]2CCCN(c3ncccn3)C2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161712", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1cccc(NC(=O)c2[nH]c3ccc(Cl)cc3c2Cl)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145214", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCCN1C(=O)c1cc(C(F)(F)F)ccc1NN by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180853", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CN2CCO[C@@H](CO)C2)cc1[N+](=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212008", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(c1cccc(Br)c1)N1CCN(C(=O)N2CCCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98857", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Oc1ccccc1/C=N/N1C(=S)[NH+]=N[C@@H]1c1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39204", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)NCC(C)(C)[C@H](O)c1ccccc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183977", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCCn1nnnc1C[NH+]1[C@H]2CCC[C@@H]1CC(NC(C)=O)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220644", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2NC(=O)C3=NN=C(c4ccc(C)cc4)[C@H]32)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191843", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCC1CCC(C[NH3+])([C@@H](O)c2ccccc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77709", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2sc([C@@H](c3ccccc3Cl)N(C)Cc3ccccc3)c([O-])n2n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181903", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2C(=O)C[C@H]([C@@H]3C(=O)N(c4ccccc4)N=C3C)C2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69428", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule FC(F)Oc1ccc(N2CCCC3(C2)OCCO3)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187779", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCC(=O)N1CCC[C@@H](C(=O)NC(C)(C)c2nc(C)c(C)s2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203945", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@H]1CC=CCC1)N[C@@H]1CCCN(c2ccccc2)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8456", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1-c1nnc(S[C@@H](C)C(=O)Nc2ccccc2C)n1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8853", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1[nH]c(SCC(=O)NCC(=O)N(C)C)nc1Cc1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164056", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cc(Cl)ccc1Nc1ncnc(NCc2cccnc2)c1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136596", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(-c2noc(CCC(=O)N(C)Cc3ccccc3F)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88420", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccccc1NC(=O)NCCCc1nnc2n1CCCCC2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110252", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@]1(F)CCN(S(=O)(=O)c2c(F)cccc2F)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129658", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C([O-])CCC[NH+]1CCC[C@]2(CCC(=O)N(CCc3ccccc3)C2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111997", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cncc(C(=O)O[C@H](Cn2cncn2)c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10366", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(N2C(=O)C([O-])=C(C(=O)c3ccccc3)[C@@H]2c2cccc(Cl)c2)sc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158272", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)N1CCCCCC1)S(=O)(=O)c1ccccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6777", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H]1C[C@H](c2ccccc2)Nc2ncnn21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202563", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](OC(=O)c1cc(-c2ccc(Br)cc2)n[nH]1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140963", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@H](CNC(=O)N(C)Cc1ncnn1C)[NH+]1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40106", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(C)n(-c2ccc(C(=O)NCc3cscn3)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100632", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC(=O)N[C@H](C)c1nc2ccccc2n1Cc1c(C)cc(C)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159225", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]([NH2+][C@H](C)CC1CCOCC1)c1cc(F)ccc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140807", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccccc1F)[C@@H]1CSCN1C(=O)C=C1CCSCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115232", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(C(O)(C(=O)Nc2ccccn2)c2ccc(C)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211028", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CC(C(=O)N[C@@H]2CC(=O)N(C)[C@@H]2c2ccc(Cl)cc2)C[C@@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15127", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)C(=O)N1CCN(C(=O)Nc2cccc(OC3CCCC3)c2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41658", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)COC(=O)c1ccccc1SCC(=O)N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103871", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCN(Cc1ccc(Cl)s1)C(=O)NC[C@H]1CCOC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119586", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1NC1CCN(C(=O)C(=O)Nc2ccc(C)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57860", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@@H]1Cc2ccccc2N1CCNC(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67539", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule c1ccc2c3c([nH]c2c1)CC[C@H](N[C@@H]1CC[NH+](C2CCCC2)C1)C3 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226294", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CO[C@H](C)C(=O)N1CCN(C(=O)Cc2c[nH]c3ccccc23)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9779", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(CCCn1ccnn1)N1CCN(Cc2noc(-c3cccs3)n2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121657", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CNC(=O)c1cccc(NCc2cn(-c3ccccc3)nc2C(C)C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13636", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN1CCC/C1=N\\S(=O)(=O)c1cccc(NC(=O)CCn2cnc3ccccc32)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146459", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1cc(-c2ccco2)ccc1F)c1cn2cccnc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93382", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cc2ccccc2o1)C(=O)c1ccc(-c2cscn2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213076", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnsc1C(=O)N/N=C/c1ccc([N+](=O)[O-])s1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38249", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)cc(N2CCN(C(=O)[C@@H]3CN(C)C(=O)N3)CC2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194287", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Oc1ccc(-n2cnnn2)cc1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101774", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(C)c1cccc(C(=O)Nn2cnc3ccccc3c2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200299", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1cccc(OC[C@@H](O)CN2CCN(c3cc(Cl)ccc3C)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23258", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(C)c1ccc(-c2nnn(CC(=O)N3CCCCCC3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11793", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)CCC(=O)NCc2ccc(N3CCOCC3)[nH+]c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108754", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](CN(C)C(=O)N[C@@H]1CC[NH+](C2CCCC2)C1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241223", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(Cc2nnc(NC(=O)[C@H]3CCCCN3S(=O)(=O)c3cccs3)o2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242029", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCC[C@H]1N1C(=O)C(=O)N(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211619", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=C/C(=O)N[C@H](C)C(=O)N[C@H]2[C@@H]3CCO[C@@H]3C2(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93549", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccccc1[C@@H](NS(=O)(=O)C[C@@H]1CCOC1)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108561", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1ccccc1NC(=O)[C@@H]1C[C@@H]2C=C[C@H]1C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107710", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C/C=C/C=C/C(=O)Nc1ccnn1Cc1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29615", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc(OCC(=O)NC(=S)Nc2cccc(C(=O)[O-])c2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65808", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH2+]CCSCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217862", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)N(C)C(=O)N[C@@H](C)c1c(Cl)ccc(F)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184235", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc2c(c1)COCO2)N1CCCC[C@H]1CCO by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132484", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nc(-c2ccc(N3CCN(C(=O)Cc4noc5ccccc45)CC3)[nH+]c2)no1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113473", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](Cc1cccs1)N(C)S(=O)(=O)c1ccc(O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189828", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@@H]2SCC(=O)Nc3c2c(C)nn3-c2nc3ccccc3s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229882", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Cc1ccccc1C(F)(F)F)N[C@@H](CO)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224675", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(-n2ncc3c(=O)n4c(nc32)SC[C@@H]4CC(=O)NCCCn2ccnc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)[C@H]1CCC[NH+](CC(=O)Nc2ccccc2Oc2ccccc2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64114", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1occc1-c1nnc(SCC(=O)Nc2ccccc2Cl)n1C[C@H]1CCCO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33883", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CC(=O)N(CC(C)(C)C(=O)NN)CC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176031", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=O)/c(=C\\c2ccsc2)s/c1=C(\\C#N)C(=O)c1ccccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44981", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C[C@@H](C[NH3+])c1ccccc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76354", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCc1ccc(F)c(Cl)c1)NC[C@@H]1CCCN(c2ncccn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6684", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule c1ccc(CN2CC[C@@H](c3nc(-c4ccncc4)no3)C2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96882", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC1CCC(N2C[C@@H](C(=O)N[C@H](CO)c3ccco3)CC2=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94261", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH+](Cc1nccn1Cc1ccccc1)[C@H]1CCCC[C@@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234733", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1CCC(NC(=O)C(=O)Nc2ccccc2C[NH+]2CCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58292", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1c(CCC(=O)N(C)[C@H](C)Cc2ccc(O)cc2)cnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197264", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(-n2c(C)cc(/C=C/C(=O)Nc3cccc(C(N)=O)c3)c2C)no1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132486", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@H]([C@H](O)C2(C#N)CCC2)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74660", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc2nc(C(=O)N3CCC[C@@H](C(=O)[O-])C3)cn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102177", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1CC[NH2+]C[C@H](C#N)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246363", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc([C@@H]2SCC(=O)N2c2ccccc2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62029", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C#CC[NH2+]CC(=O)Nc1ccc(F)cc1C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10329", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc(NC(=O)[C@H]2CSCN2C(=O)CC(C)(C)C)ccc1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175396", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)[NH2+]Cc1ccc(-c2ccccc2)o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189172", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc(N2C(=O)N(Cc3cccc(Cl)c3)[C@H]3CS(=O)(=O)C[C@H]32)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148253", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC(C)(C)NC(=O)[C@H](C)[S@@](=O)Cc1ccc(C(=O)NC)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58240", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)C[NH+]1CCn2nc(CNC(=O)Cc3csc4[n+]3CCN4)cc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203939", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH2+]=c1oc2ccc(Cl)cc2cc1C(=O)Nc1ccc(Cl)cc1Cl by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171694", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Cc1nnc(NC(=O)Nc2ccccc2)s1)N/N=C/c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206565", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NCCC(=O)N1CCN(C[C@H]2CCCO2)CC1)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130365", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H](c1ccc2c(c1)OCO2)N1CCOCC1)C(=O)Nc1ccccc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192894", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)[C@@H](CO)NC(=O)NCc1ccccc1OC(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139730", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCn1nc(C)c(CN2CC[NH+](Cc3ccccc3)C[C@H]2C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145611", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(OC)c([C@H]2CCC[NH+]2[C@H](C)C(=O)Nc2ccc(C(C)=O)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205308", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-n2nc(C(=O)N3CCC([C@@H](C)O)CC3)cc2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50236", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)C1CCN(C(=O)C2(c3cc(-c4ccc(Cl)cc4)on3)CC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198714", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nn(C(C)C)c(C)c1NC(=O)[C@H]1CCCN(c2ncccn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202409", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)c1ccn(C[C@H](C)C(N)=O)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94743", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)c1ccc2nc([N-]S(=O)(=O)c3ccc(I)cc3)sc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138671", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[C@@H](O)C[NH+](Cc1ccco1)C[C@@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82248", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2ccc(C(=O)[O-])c(N)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121866", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCSc1nc2ccccc2s1)Nc1ccc2oc(=O)[nH]c2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17260", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(C(=O)NCc2ccccc2OCC(C)C)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227098", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nc2ccccc2n1CCNC(=O)c1cc(Cl)cc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175173", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C([O-])[C@H]1CC=CC[C@H]1C(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137241", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCCN(C(=O)Cn1nc2ccccn2c1=O)[C@@H](C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224488", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CNc1ccc(C(F)(F)F)cc1Cl)NC(=O)NC1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191067", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)[C@]12C(=C(c3ccccc3)O[C@@H]3C=CCC[C@H]31)C(=O)C(=O)N2c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9096", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(C)c1NC(=O)C[NH2+][C@H](C)Cn1cnc(C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54463", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc([N+](=O)[O-])o1)N(Cc1ccccn1)c1ccc(F)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77400", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)C1=C(C)Nc2[nH]c(=S)[nH]c(=O)c2[C@H]1c1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133004", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1cc(C[NH+]2CCC([C@H](O)c3nccn3C)CC2)cc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94170", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc2c(-c3cccs3)nc(=O)n(Cc3ccc(Cl)cc3Cl)c2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95953", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)N(Cc1ccccc1F)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167181", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)Nc1cccc(-n2c(C)nn(C[C@H](O)c3ccccc3)c2=S)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108174", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(C(=O)c2ccc(F)cc2)cc1OCC by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C)c(C)c([C@@H]([NH3+])CO)c(C)c1C by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54995", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1cccc([N+](=O)[O-])c1)N1CCN=C1SCc1cccc(C(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174962", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc(C(=O)N2CCN(C(=O)CCc3cccnc3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131876", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(N1CCC(NS(=O)(=O)c2ccc(Cl)cc2)CC1)C1(c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239527", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Cc1ccc(NCc2ccc(C3CC3)cc2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156628", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule Cc1cccc(C)c1OCC(=O)[C@H](C#N)c1nnc(-c2ccccc2)n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83277", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(S(=O)(=O)Nc2ccc3c(c2)N(CC(C)C)C(=O)C(C)(C)CO3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227288", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCn1cc(Br)c(CN(C)S(=O)(=O)c2cnn(CC)c2C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34754", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](Cc1ccccc1F)C(=O)N[C@H]1CCS(=O)(=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48985", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](CSC)NC(=O)NCCc1ccccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39577", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)n(-c2ccc(C(=O)N(C)[C@@H]3CCC[C@H](C)C3)cn2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36877", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(NC(=O)c2cccc(NC(=O)c3ccco3)c2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165531", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(NC(=O)Cc2csc(COc3cccc(C)c3)n2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81436", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCC(CC)S(=O)(=O)/N=C(\\[O-])c1ccc(N2CCOCC2)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55864", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)NC(=O)c1cccc2c1NC(=O)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34252", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)C1CCN([C@H]2CS(=O)(=O)C[C@@H]2S(=O)(=O)c2ccc(OC)c(C)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231875", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1-n1ccc2nc(N3CCCCC3)ncc2c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121147", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NC[C@@H]1CCN(c2ccc(F)c(F)c2)C1)N1CCC2(CC1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70297", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cnc(C(=O)NCc2cnn(Cc3ccccc3)c2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20542", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)CCc1nc(-c2ccccn2)no1)c1ccc2c(c1)CCCO2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218115", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)[C@@H](NC(=O)/C=C/c1csc(C)n1)C(=O)[O-] by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225473", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccc[nH+]c1N1CCN(C(=O)C[NH+]2CCC[C@H](O)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111107", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule FC(F)(F)c1ccccc1N[C@H]1CCO[C@]2(CCSC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72539", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2nnsc2C(=O)Nc2ccc(Br)cc2F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215394", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccccc1NC(=O)NC[C@H](O)c1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137755", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Cl)cc1NC(=O)c1ccc(-n2ccnc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246819", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C(=O)Nc2nnc(C3CCCCC3)s2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169121", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(c1nc2ccc([N+](=O)[O-])cc2o1)[C@@H]1CC[NH2+]C1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89966", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccccc1N1CC[NH+](C/C=C\\c2ccc3c(c2)CCC(=O)N3)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167311", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)NC(=O)N(CC(=O)NCCc2nc3ccccc3[nH]2)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151009", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)CN2CC[NH+]([C@@H]3CC[C@H](CC)C3)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164175", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(NC(=O)Nc2ccccc2)c2ccccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49848", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CC(Nc2cccc(Oc3cnccn3)c2)C[C@@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61815", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(c1ccccc1[C@H](C)[NH3+])C(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107109", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)NC12C[C@H]3C[C@@H](C1)CC(C(=O)NCCCC1CCCC1)(C3)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62605", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC1(C)S[C@@H](c2ncc(-c3cccs3)s2)N[C@@H]1C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16629", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NCC[C@H]1CCCO1)c1ccc(Cl)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181279", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN1C(=O)c2ccc(Cl)cc2N[C@@H]1c1ccccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144154", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[NH+]1CCN(C(=O)c2ccccc2NC(=S)NC(=O)c2ccco2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26350", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@H]1C[C@H](N)C[NH+](Cc2nnc(C(C)(C)C)o2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184584", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1[nH]c(-c2ccc(Oc3ccccc3)cc2)cc1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97804", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cc2c(c(=O)n1CCc1ccccc1)[C@H](c1ccc([N+](=O)[O-])o1)C(C#N)=C(N)O2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74158", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1cccc(NC(=O)N[C@@H](C)c2ccc(C)o2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84716", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccnc(NC(=O)[C@]2(C)CC2(Cl)Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151627", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]([NH3+])c1cc(F)ccc1OCC[C@@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155885", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1OCC[C@@H]1Nc1ccc(OC(F)F)cn1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105199", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CCn1ccc2c(Cl)cccc21)NCc1nnc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66983", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1C[NH+](Cc2ccccc2)CCCN1C(=O)CCn1ccccc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11089", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccccc1C(=O)OCCn1c(N)c(S(=O)(=O)c2ccccc2)c2nc3ccccc3nc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210144", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COC[C@@H](N[C@H](C)c1nc2c(s1)CCCC2)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232147", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2c(-c3nn(C)c4ncnc(N5CC[C@H]([NH+]6CCCCC6)C5)c34)cnn2C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84521", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc([C@@H]2OC(=O)N(C)[C@@]2(O)c2ccc(OC)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192188", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](NC(=O)CC[C@H]1CCCOC1)c1cccc([N+](=O)[O-])c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113395", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)C(=O)NC[C@H](c2cccn2C)[NH+](C)C)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233028", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H](Sc1nccn1C)C(=O)Nc1ccc(OC(F)F)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158958", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1csc(CN2CCN(C(=O)/C=C/c3ccc4c(c3)OCO4)CC2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96852", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Nc1ccccc1NC(=O)N[C@H]1CCOC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68702", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccccc1/C=C/C(=O)N1CCC(NS(C)(=O)=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71723", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@@]2(C)NC(=O)N(CC(=O)N(C3CCCC3)[C@@H]3CCS(=O)(=O)C3)C2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1c(Cl)cccc1Cl)C[C@@H]1C[C@H]2CC[C@@H]1C2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145879", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(F)c(NC(=O)NCc2ccc3c(c2)CCC3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91508", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule S=C(CC12CC3CC(CC(C3)C1)C2)N1CCN(c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248955", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1S(=O)(=O)Nc1cccc(-c2ccc(=O)n(C)n2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248337", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=c1c2cc([N+](=O)[O-])ccc2ncn1Cc1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115988", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccccc1-c1ccccc1)N1CCC[NH+](C[C@H]2CCCO2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)[C@@H](C)S(=O)(=O)[C@@H](C)C(C)C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91396", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule N#CCNC(=O)C[NH+]1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109839", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)c1c(C)nc(Nc2nc3ccccc3o2)nc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150489", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(Br)c(N)c(C(=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27465", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)c2ccccc2C)c(Nc2ccco2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144011", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(N2CC[C@H](NC(=O)c3cc(F)ccc3F)C2=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57009", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24225", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc(NC(=O)c2cc(=O)c3ccccc3o2)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121713", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2044", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](NC(=O)Nc1ccn(C)n1)c1ccc(C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101555", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cccc(N2C(=O)[C@@H]3[C@H](c4ccccc4)OC4(C(=O)c5ccccc5C4=O)[C@@H]3C2=O)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48932", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(C#N)ccc1OCC(=O)Nc1ccc(C(C)=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229011", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc([C@@H](Cl)[C@H](C)c2ccccn2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156761", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N=[S@](N)c1cnc(N)s1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52847", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCNc1ccc([N+](=O)[O-])c(N)n1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30339", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Nc1ccc(F)cc1NC(=O)COCc1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158546", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1CC[NH+](CCNC(=O)C(=O)Nc2cc(F)cc(F)c2)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192015", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)ccc1CCNC(=O)NCCCn1nc2n(c1=O)CCCC2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125566", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1OC(=O)CCc1c(C)nc(-c2cccnc2)[nH]c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122996", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc([C@@H]2NC(=O)N(C)[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2cccs2)cc(OC)c1OC by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101683", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccnc1)C(F)(F)F by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188342", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1c(SCC(=O)Nc2ccc3c(c2)OCCO3)nc2c([nH]c3ccccc32)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221211", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Oc1ccc(-c2nc3ccccc3s2)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66973", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc(C(=O)N2CC[C@H](C(=O)[O-])[C@@H]2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cn(-c2ccccc2Cl)nc1NC(=O)C(=O)NCCCC(C)(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204060", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NC1CCN(c2ncc(Cl)cc2F)CC1)c1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119770", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc([C@H]2C[C@H]2C(=O)Oc2cccc(-n3cccn3)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4401", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(c1)cc(C(=O)N(Cc1ccccn1)C1CCCCC1)n2C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133645", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)N[C@H]3CCCC[C@H]3C)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176505", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(N2CCN([C@H](c3ccccc3F)c3nnnn3C3CCCCC3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177509", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)c2cccc(NC(=O)C(C)(C)C)c2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108441", "split": "OpenMolInst" } }, { "instruction": "Remove a aldehyde from the molecule CC/C(C=O)=C\\C1CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92852", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1575", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCN1C(N)=[NH+]C[C@@]1(C)c1ccc2cc(OC)ccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30720", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(=O)C(=O)N2CCOCC[C@H]2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204412", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOc1ccc(CC(=O)Nc2ccc(S(N)(=O)=O)c(C)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225288", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H]1SC2=NC(C)=C(C(=O)OCC(C)C)[C@H](c3ccc(OC)cc3)N2C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48714", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)cc1)c1ccc(-c2ccccc2[N+](=O)[O-])o1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212527", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2c(sc3nc(-c4ccccc4)ccc32)c(=O)n1CC(=O)NCc1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95756", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc(NC(=O)[C@@H]2CC(=O)N(C)C2)c(OC)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45558", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nc(C(=O)N(C)Cc2ccc(C(F)(F)F)cc2)nn1-c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247821", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Cc1ccc(F)cc1)Nc1cccc(-c2cn3c(C(=O)N4CCOCC4)csc3n2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197053", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)N[C@H](c1nccs1)C1CCN(C(=O)c2c(C(C)C)noc2C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51403", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnn([C@@H]2CCCN(C(=O)CN3C(=O)CNC3=O)C2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234246", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)CCO[C@@H]1CCN(C(=O)[C@H](C)NC(=O)c2ccc(Cl)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15707", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cnn(-c2ccccc2F)c1)N1CCSCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94932", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)[C@@H]1CCCN(Cc2cc(C(N)=O)cs2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35884", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](C(=O)Nc1ccc(Br)cc1Br)[NH+](C)C[C@@H]1COc2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129183", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1)C(=O)Nc1cc(-n2cccc2)ccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36008", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(c2cncc(C(N)=O)n2)CCO1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193161", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(F)c(NC(=O)C(=O)NCCN(C)c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209011", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=CCn1c(=O)c2c(nc3n2CCN3c2ccc(CC)cc2)n(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26521", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(C2=C[C@H]([C@H]3NN[C@H](SCC(=O)Nc4cccc(C(F)(F)F)c4)N3N)N=N2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154525", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCC[NH2+]CC[NH+](C)CC(C)(C)O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3056", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC1(C)C[C@](O)([C@@H]2CCOC3(CCC3)C2)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5319", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)C1CCN(CCC[NH2+]Cc2ccc3ccccc3c2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65375", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NS(=O)(=O)c1cccc(F)c1)C(=O)N1CCCC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231713", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOC(=O)NC1=c2c(OC)cccc2=[NH+][C@H]1C(=O)OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16480", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccccc1N1C[C@H](C(=O)NC[C@@H](C)Cn2cccn2)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201571", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@H](c1cccc(F)c1)[C@@H]1CCOC2(CCC2)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157316", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(S(=O)(=O)/N=C(\\[O-])CCn2cc(C)cn2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107757", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](CC1CCCC1)C(=O)Nc1cc(C(=O)N(C)C)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114051", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c(N2CCN(CC(=O)NCc3c(F)cccc3F)C2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241547", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOc1ccccc1[C@H]1C2=C(CCCC2=O)Nc2onc(C)c21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220034", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(F)cc(Nc2c(N)ccc(F)c2F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72735", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH+](C)C[C@H](Cc1ccccc1)NC(=O)[C@H]1CCC[NH+](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98798", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC1(C)CC(NC(=O)NC[C@@H]2CCC[C@@H](O)C2)CC(C)(C)[NH2+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142178", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nn(C)c(Cl)c1[C@@H]1CCC[NH+]1CCCS(C)(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9647", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc2cc(NC(=O)c3ccccc3)c(=O)oc12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81314", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(O[C@H](c1ccccc1)c1nccs1)c1cccc2c1OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53179", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@H](NC(=O)c1cc(C(N)=O)cn1C)c1nnc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168894", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)n1c(CC(=O)Nc2ccccc2F)n[nH]c1=S by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99121", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)C[NH2+]Cc1ncoc1-c1ccc(C(C)(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218110", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)Nc1cccc(C(F)(F)F)c1)N1CC[NH+](C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132672", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)c1ccc(NC(=O)CN2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@H]3[C@@H]3C[C@H]23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178288", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C(NNS(=O)(=O)c1ccc2c(c1)CCC2)c1ccc2ccccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176026", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[C@@H](CSC)N(C)C(=O)N[C@H]1CCCc2ccc(F)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77868", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(Cc1ccc(F)cc1F)C(=O)Cc1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194305", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C([C@H]1Cc2ccccc2S1)N1C[C@H]2C[NH2+]C[C@@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207999", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@]2(C)NC(=O)N(CC(=O)NCc3ccco3)C2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104866", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1-c1noc(C2CCN(S(=O)(=O)c3cccs3)CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231401", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cccc(C(=O)N[C@H]2CCC[C@@H]2C(=O)OC)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8638", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Clc1cc2c(cc1NCc1nc3c(s1)CCC3)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63052", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc([C@@H]2NC(=O)c3cccnc3N2)ccc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2803", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C1NC2(CCCC2)C(=O)N1C[C@H](O)c1ccccc1C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216816", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cscc1C(=O)Cc1ccc(I)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115691", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1cc(CCC(=O)Nc2cc(-c3ccncc3)n[nH]2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22335", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(CC(=O)N1C[C@H](C)O[C@H](C)C1)c1ccc(F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19280", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CNC(=O)c1cccc(NCc2cn(C)nc2-c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160342", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOc1ncccc1C(=O)Nc1cc(F)c(N(C)C)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127504", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@@](C)(NC(=O)c1cc(C)c(Br)s1)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232990", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccc(C(=O)Nc2ccc(Cl)cc2N)cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123613", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc(S(=O)(=O)N[C@@H](c2ccccc2F)c2nccn2C)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208801", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)N(C)C)c(C(=O)Nc2cccc(F)c2C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24096", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(O[C@@H](C(=O)NC1CC1)c1ccccc1)[C@H]1CC(=O)N(c2ccccc2F)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137950", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1ccc(NC(=O)CN2C(=O)N[C@]3(CCCc4ccccc43)C2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92831", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@H]1CCCC[C@H]1NC(=O)C(=O)Nc1cccc2cccnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34984", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCS(=O)(=O)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7586", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)c1ccc(CNC(=O)Nc2ccc(-c3csc(C)n3)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52702", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(CNS(C)(=O)=O)c(OC(C)(C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196840", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CSc1cccc(NC(=O)Cc2c(C)nc3cc(-c4ccccc4)nn3c2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154802", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1OCC[C@H]1C(=O)N1CCCC[C@@H]1C[NH+](C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80594", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COC(=O)C[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186201", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]([NH3+])C(=O)NCC1C(C)(C)C1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229585", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)N2CCN(c3nc4c(C)cccc4s3)CC2)c(OC)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230439", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCN(Cc1cccc(C)n1)C[C@H](Br)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13551", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(OCc2ccccc2)nc(N2CCN(c3ccccc3)CC2)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80605", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(-c2nnc(SCC(=O)Nc3nc(C)cs3)n2N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151885", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc([C@H](C)NC(=O)c2cc(C)c(C#CCN)s2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137107", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](c1ncc(Cl)cc1Cl)[C@H](C)[NH3+] by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc([N-]S(=O)(=O)[C@H]2C(C)=NC(C)=C2C(=O)N2CCCCC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19903", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN1C[C@H](C(=O)Nc2cccnc2-n2cccn2)CC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71540", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1cc(F)cc2c1OCOC2)NC[C@@H]1CCCO1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220352", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN1CCCCC/C1=N\\S(=O)(=O)c1cccc(NC(=O)C2(C)CCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccccc1-n1cnnn1)n1nnc(-c2ccccc2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182228", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCC(C)(CC)NC(=O)Nc1ccc(C(=O)NCC(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72311", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1cc(F)ccc1Cl)[C@@H]1CCCCN1C(=O)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149447", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCNC(=O)C1CC[NH+](CCC(=O)Nc2ccc(Cl)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27234", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1CCC[C@@H](NC(=O)COCC(F)(F)F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206907", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)Cn1ccnc(N[C@@H]2CCO[C@@H]2c2ccc(Cl)cc2)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98029", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Nc1cnn(-c2ccc(C(=O)N[C@@H]3CCC[NH+](Cc4ccccc4)C3)cc2)c1)c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91605", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=S1(=O)c2cccc3cccc(c23)N1C[C@@H](O)COc1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47351", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=C(c1ccc([N+](=O)[O-])o1)N1CCC(c2nc3ccccc3o2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128315", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50970", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)C(/C=N\\O)=N\\Nc2ccc(F)cc2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130521", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC1(C)C[C@]2(C[C@H](c3ccccc3)Oc3cc(O)ccc32)[NH+]=C([S-])N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54928", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)c1ccc(F)c(NCc2cc(C(N)=O)cs2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237718", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Cn1nc(-c2ccc(F)cc2)oc1=O)OCc1nc2ccccc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53927", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1[nH+]c([C@H]2CCCCN2C(=O)Cc2ccccn2)nc2c1CCCN2Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207805", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H]1OCC[C@H]1C(=O)N(CC(=O)N1CCCC1)C[C@@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159281", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ccc(F)cc1)NCc1n[nH]c(=O)c2ccccc12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180179", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule CNc1cc(CN(C)C[C@@H]2CC[NH+](C)C2)ccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146804", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C=C(C)CN(CC)C(=O)CS(=O)(=O)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccccc2C#N)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155185", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(-c2noc(-c3cccc(NC(=O)C4CC4)c3)n2)nc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101186", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]([NH2+]CCN1C(=O)CCC1=O)c1cccc(-c2ccccc2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116057", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule c1cc2c(cc1NC1=[N+]3CCCC[C@@H]3CS1)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205974", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nnc(S[C@@H](C)C(=O)N(C)c2ccccc2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8229", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(=O)Nc1cc(NC(=O)N[C@@H]2CC=CCC2)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86280", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(/C=C/c1ccc(Br)o1)NCCC1=CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56170", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCc1ccc(C(=O)N[C@@H]2C[C@H]3C[C@@H]2[C@H]2CCC[C@@H]23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221493", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](NC(=O)c1nc(Cl)ccc1Cl)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30916", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(CC(=O)N2CC[C@@H]3[C@@H](CCC[NH+]3Cc3ccccc3)C2)cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245936", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCCN(C(=O)[C@H](C)[NH+]1CCC[C@H](O)C1)[C@@H]1CCS(=O)(=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1848", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCS(=O)(=O)CC(=O)Nc1c(C)cccc1C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16370", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H]1CN(c2ccc(CCl)cc2F)C[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207588", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Nc1cc(N)nc(SCc2cc(-c3cccs3)on2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141555", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[NH+](Cc1ccc(Oc2ncccn2)cc1)[C@H]1CS(=O)(=O)C[C@@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104518", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC(=O)Nc1nonc1-c1nc2ccccc2n1Cc1cc(OC)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126475", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[NH+]1CCC[C@H](NC(=O)[C@@H]2CCC[NH2+][C@@H]2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182561", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1NC(=O)c1c([O-])c2sccc2n(Cc2ccccc2)c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195974", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]CCOCC(=O)Nc1ccc2c(c1)OCCO2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6766", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule N#Cc1csc(C(=O)N2C[C@H]3CC=CC[C@@H]3C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73039", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCl)N1N=C(c2cccs2)C[C@@H]1c1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16747", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccnc(Oc2ccc(F)cc2)c1)N[C@@H]1CCCC[C@@H]1CO by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47134", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(/N=C2/CC(=O)C(=O)c3ccccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184568", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCc1nnc2sc(-c3ccc(CNC(=S)NC(=O)c4ccc(F)cc4)cc3)nn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130104", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(CC)[C@H](O)[C@H]1CCO[C@]2(CCOC2)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238818", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(N[C@@H](C(=O)NCCN1CCOCC1)C12CC3CC(CC(C3)C1)C2)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144915", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C(NNc1nc(-c2ccncc2)no1)Nc1cnc(C2CC2)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154888", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule O=C(COc1ccc(Br)cc1)N1CCC[C@@H](O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102234", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(/C=N/NC(=O)C(=O)Nc2ccccc2Cl)c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200028", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1cccc(CNC(=O)[C@@H]2COc3ccccc3O2)c1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64683", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCO[C@@H]1C[C@@H]([O-])C12CCN(C(=O)c1cnc3c(C)cccn3c1=O)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75899", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CN[C@]1(C#N)CCC[C@@H]1CC[NH+]1CC[C@@H]2CCCC[C@@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152411", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]([NH2+][C@@H]1c2cccc(F)c2CC[C@@H]1C)c1nccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132417", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H](C(N)=O)[NH+]1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194995", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1ccc(Cl)cc1[C@H](O)[C@H]1CSCCS1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70787", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCn1c(SCC(=O)N[C@@H]2CCCC[C@H]2C)nc2ncccc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120334", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)c1ccc(N2CCO[C@@H](c3ccc(F)c(Cl)c3)C2)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196649", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)Nc1ccc(NS(=O)(=O)c2cc(C)ccc2F)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118964", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)c1ccc(N[C@H]2CCCC[C@H]2C)c([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38820", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(CCN1CCOCC1)C(=O)CCc1ncc(-c2ccccc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70715", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C[C@@](C#N)(NC2CCCC2)C(C)(C)O1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172041", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C1(NC(=O)c2cc3cc(C)ccc3o2)CCSCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88381", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(C[NH+]2CCC[C@H](N3CCCC3=O)C2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10606", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@@H](c1cccnc1)C(F)(F)F)c1cnn(-c2nccc(-c3ccco3)n2)c1C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212892", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1=C(C(=O)Nc2ccccc2C)C2(CCCCC2)[C@H](C(N)=O)C(=O)N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205220", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCCCCC[C@@H](O)[C@H]1CCc2cccnc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32498", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN[C@]1(C#N)CCC[C@H]1CCOc1ccccc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143677", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1nc(N2CC[C@@H](OCCCc3ccccc3)C2)ncc1[N+](=O)[O-] by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224917", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H](NC(=O)c2cccc(OC)n2)c2nccn2C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239462", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(OCCc2ccccc2)nc1)C(=O)N[C@@H]1CC=CCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46292", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc2[nH+]c(N3CCC(C(=O)NCCC[NH+]4CCN(c5ccc(F)cc5)CC4)CC3)[nH]c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77301", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)C(=O)NCCC[NH2+][C@@H]1CCc2c(F)cc(Br)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154188", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(NC(=O)C[C@@H](NC(N)=O)c2ccccc2)cc1C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166148", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1Cc2cc(C(=O)N3CCn4c(nnc4C4CC[NH+](C)CC4)C3)ccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232520", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(CN(C)C(=O)CSCc2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194565", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1ccco1)N(CCN1CCOCC1)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243451", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1COCCN1C(=O)[C@@H]1CC(=O)N(c2cc(OC)c(OC)c(OC)c2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83226", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)CSc2nc3ccccc3nc2N2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233934", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCC[C@H]1NC(=O)C[NH+]1CCc2nc(N3CCCC3)[nH]c(=O)c2C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174911", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)n1nccc1NC(=O)C(=O)N1CCc2cc(F)ccc2C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "801", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cc1cccs1)N1CCc2nocc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122701", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(CC(=O)Nc2ccc3c(c2)CN(CCc2ccc(F)cc2)C(=O)[C@H](C)O3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204458", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2CC(=O)Nc3c2c([O-])nc2nc4ccccc4n32)cc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220493", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(Cc1ccc(N(C)C)cc1)C(=O)c1cccc(-n2cnnn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23002", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CCNC(=O)c2sc(-c3c(F)cccc3OC)nc2C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191351", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nnc(-c2cc(S(=O)(=O)N3CCN(c4cc(Cl)ccc4C)CC3)c[nH]2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175391", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@]1(C(=O)N[C@H]2CCN(c3ccccc3)C2=O)Cc2ccccc2C(=O)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170463", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(/C=C/c2ccnc(NS(=O)(=O)c3ccc(N)cc3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70807", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCCN(Cc1ccoc1)C(=O)c1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66073", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc([C@H]2[C@@H](C(=O)[O-])CC(=O)N2C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224338", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@H](NC(=O)CNc1cccc(NC(=O)c2ccco2)c1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106986", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)c1cccc(NC(=O)N2CCC(C(=O)N(C)C(C)C)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45788", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1cccc(NC[C@@](C)(O)c2cccs2)n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38278", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CSc1ccccc1[C@H](Cl)[C@@H](C)c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45720", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)N1CCC[C@@H]1C[S@@](=O)c1nc2cc([N+](=O)[O-])ccc2s1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136717", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(N[C@H]1CCCc2ccccc21)c1ccc2c(c1)[nH]c(=O)n2C1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128495", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nsc(NCCS(=O)(=O)CC)n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143236", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(S[C@H]2CCCCNC2=O)nc2sc3c(c2c1=O)CCC3 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85147", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1c(C(=O)N2C[C@@H](c3ccccc3C)C[C@@H]2C)[nH]c(C)c1C(C)=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246965", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule CC(C)c1cc(C(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)nn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203006", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCn1cc(C(=O)NCc2cc(CC(C)C)on2)c(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227582", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(/C=C/c1ccccc1[N+](=O)[O-])OCC(=O)c1ccc2c(c1)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57732", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N2C(=O)N(Cc3ccccc3Cl)[C@H]3CS(=O)(=O)C[C@@H]32)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76202", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1cnn(CC(F)F)c1)N1CCC[C@@H](C[NH+]2CCCCCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68858", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccccc1OCCN(C)S(=O)(=O)c1ncn(C)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12325", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c(C)cc(CN2C[C@@H](C)OC[C@@H]2C)cc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220024", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)N2CCC[C@H](c3nnc(C(=O)Nc4ccc(F)cc4)s3)C2)c(C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7538", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1cc2c(cc1C[NH+]1[C@H]3CC[C@@H]1CC(O)(Cn1nc(C4CC4)ccc1=O)C3)CCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208329", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1onc(-c2ccccc2Cl)c1C(=O)NCCC1[NH+]=c2ccccc2=[NH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106199", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN[C@]1(C#N)CC[C@@H](N2CCO[C@H](C)C2)C1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129766", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCN(CCNS(C)(=O)=O)c1cccc(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93944", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)[C@@H](NC(=O)[C@@H](C)Cc1ccccc1F)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136921", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC[NH+](C1C[C@@H](C)C[C@H](C)C1)[C@@H](C)C(N)=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209290", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CN4CCCC4=O)C3)noc2n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncc([C@@H](C)[NH2+][C@H](C)c2ccc3c(c2)CC(=O)N3)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239399", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](c1ccncc1)N(C)C(=O)[C@H]1C=C[C@@H]([NH3+])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60379", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1ccc2c(c1)[C@H]1C=CC[C@@H]1[C@@H](c1cc(OC)c(OC)c(OC)c1)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206573", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cccc(F)c1N[C@@H]1CCCC[C@H]1[C@@H]1CCC[NH2+]1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146826", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C=C(/C)C(=O)Nc1cc(Cl)ccc1N1CC[NH+](C)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6552", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc(Br)cc(/C=N/c2ccc(F)cc2)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84828", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(N2CCN(c3nc4ccccc4c(=O)[nH]3)CC2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86565", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)Cc1[nH]c(=O)c(C#N)c2c1COC(C)(C)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202137", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC[C@@H]1CCC[C@](C#N)(Cc2nccs2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42728", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)/C=C(\\N)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220623", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCc1c(N)nnn1CC[NH+]1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248662", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[N+]1(C[C@H](O)COC(=O)C23CC4CC(CC(C4)C2)C3)CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12526", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCCCC[C@]1(C)NC(=O)N(Cc2csc(C)n2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127284", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1c(C(=O)NC(c2ccccc2)c2ccccc2)nnn1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180555", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)Cc1nnc(NC(=O)[C@H]2C[C@H]2c2cc(Cl)cc(Cl)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67109", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCCCn1c(C(=O)Nc2ccc(C)cc2)cc2c(=O)n3ccccc3nc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51846", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cccc(N2CC[NH+]([C@@H](CC(C)C)c3nnnn3C(C)(C)C)CC2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17810", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCOCc1ccccc1)NC[C@@H]1CN2CCCC[C@@H]2CO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194450", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1ccc(S(=O)(=O)Nc2nc(-c3ccco3)c(-c3ccco3)s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152787", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cccc(-c2cc(C(=O)N3CCN(C(=O)[C@@H]4C[C@@H]4c4ccccc4)CC3)[nH]n2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26972", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCn1c(SCC(=O)NC(=O)NCC(C)C)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77974", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(c1)c1nnc(SCC(=O)N(C)C3CCCCC3)nc1n2C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194061", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)N2CCC[C@@H](c3nnc(C)s3)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63900", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)[C@H](Sc1nnc(-c2cccs2)n1N)C(=O)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35817", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(CSc2cc(Cl)ccc2N)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104937", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(-c2ccccc2)c2nc(-c3cccs3)n3c4ccccc4nc3c2c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85492", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COC(=O)[C@@H](N)CSc1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234442", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1022", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@@H](O)CC(C)(C)CNC(=O)N1CCC[C@@H](O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40421", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(C(=O)Cn1c(CCNC(=O)c2cccnc2)nc2ccccc21)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208146", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C=CCNC(=O)CCCn1nc([N+](=O)[O-])c(Br)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92757", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN(C)Cc2c(C)n(C)n(-c3ccccc3)c2=O)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169594", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(O)C[C@]1(C(=O)[O-])CCc2ccccc2C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138384", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN[C@@H]1[C@H]([NH+](CC(C)C)C(C)C)CCC1(C)C by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202592", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@@]4(C)[C@@H]3CC[C@]12C by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27197", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(OCC[NH2+][C@H]2CCC[C@H](C)[C@@H]2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200183", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(C[C@H](O)CN1CCOCC1)c1cc[nH+]cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238169", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2csc3ncn(CC(=O)Nc4ccc(F)cc4F)c(=O)c23)s1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24880", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C=C(C)C[NH2+]C[C@@]1(O)CCCN(Cc2ccc(F)c(F)c2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130283", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1ccccc1Cl)NC12CC3CC(CC(C3)C1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140001", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CCc1ccco1)NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90657", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(C)n(Cc2cccc(NC(=O)[C@H](NC(N)=O)C(C)C)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63681", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCOC[C@H]2c2c(C)n[nH]c2C)c(Br)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174358", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOC(=O)[C@@H](C)NCc1cc(Cl)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196093", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(/C=N/C(C)C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231018", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H](C(N)=[NH2+])N1CCN(C(=O)N(CC)CC)CC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219635", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCc1cnc(CCNc2ccccc2S(=O)(=O)C(F)F)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127514", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(COc2ccccc2C(=O)N[C@H]2CCOc3ccccc32)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90111", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196133", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN1C(=O)C(C)(C)COc2cc(NC(=O)Cc3ccc(OC)cc3)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159529", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)c1ocnc1CS[C@H](C)C(=O)NCc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32968", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(N(C)C)cc3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15638", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Nc1cccc(-c2nnc3n2CCC3)c1)N[C@@H]1C[C@H]2CCCc3cccc1c32 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184890", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@@H]1C(=O)NCC[NH+]1Cc1nc(-c2ccccc2OC)oc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121893", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(-c2ccccc2Br)cc([C@H]2C[NH+]3CC[C@@H]2C[C@@H]3CNC(=O)c2ccco2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127891", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule COc1ccc(-c2nc(COC(=O)c3cc(C#N)cn3C)no2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48183", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)Nc1ccc(C)c(NC(=O)N[C@H]2C[C@H]2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169419", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(/C=C/c1nc2ccccc2o1)N1CCC[C@@H]1c1nnc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184952", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(c1csc2c1CCCC2)N1CCC[C@@H](N2CCN(c3ccccc3)CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126094", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC1=C(C(=O)N(C)C)[C@@H](c2cc(F)ccc2F)NC(=S)N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110357", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)/C(C)=C/CSc1cc(F)ccc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186575", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CC(=O)NNC(=O)COc2ccc3ccccc3c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27102", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=CCn1nc(SC[C@@H](O)CO)nc1-c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120304", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCS(=O)(=O)c1ccc(CC(=O)Nc2nnc(-c3cccc(F)c3)o2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19325", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCOc1ccc(OC(=O)c2ncccc2C(F)(F)F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210893", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cl[C@@H](CNc1ccc2nnnn2n1)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218758", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1onc(-c2ccccc2)c1C(=O)N(C)CC(=O)N(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54429", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)OC1=C(C(C)=O)N(C(C)=O)S(=O)(=O)c2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195696", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Cc1noc(/C=C\\c2ccc3c(c2)n(C)c(=O)n3C)c1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88352", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCS[C@H]1CCCCN(C(=O)[C@H](C)Sc2ccccn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213468", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)(C)c1noc(CSCCCN2C(=O)CNC2=O)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221465", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2nc3c(F)cc(F)cc3s2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100645", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CC[C@H]1CCCC[C@H]1[NH2+]Cc1ccc([N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5965", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[NH2+][C@H]1[C@H]([S@@](=O)c2cccc(OC)c2)CCCC1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13120", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@H](Cc1c[nH]cn1)NC(=O)c1ccc(-c2ccccc2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142592", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2onc3ccc(C(=O)/C=C/N(C)C)cc23)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198939", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1CC1CCN(C(=O)c2c(C)nn(C)c2C)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(CCCO)c1nc(Cl)ncc1F by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32089", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1763", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCC(=O)Nc1cc(NC(C)=O)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66523", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@H](Sc1nnc(-c2cccc(N)c2)n1C)C(=O)Nc1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242130", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C(=O)NNC(=O)CCCc1cc(F)ccc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80489", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC(=O)NC(=S)N1CCN(C(c2ccccc2)c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32736", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=S(=O)(Nc1ccccc1Cn1cncn1)c1ccc2ccccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8591", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(NC(=O)c2c(N)c(C(=O)c3ccc([N+](=O)[O-])cc3)n3ccccc23)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12773", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(=O)c(C(=O)Nc2cnc(C(C)(C)C)nc2)c[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93639", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOC(=O)c1cnc(N)nc1C(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193847", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@](C(=O)[O-])(c1cc(F)cc(F)c1)[NH+]1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226015", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(C)[C@@H](NC(=O)Cn1ccnc1)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202885", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[S@@](=O)Cc1cccc(C(=O)NCC(=O)Nc2nccs2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136996", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1/C=C/C(=O)OCC(=O)c1ccc2c(c1)OCCO2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98027", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1c(S(=O)(=O)c2cccs2)c2nc3ccccc3nc2n1/N=C/c1c[nH]c2ccccc12 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86084", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCNc1ncnc2c1cnn2CCNC(=O)c1cc(Br)ccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69777", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NC(=O)C(=O)Nc1cnc2ccccc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93026", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(c1ccc(-n2cncn2)cc1)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56332", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1occc1C(=O)NCC(=O)N1CC[C@@H](C)[C@H](O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149513", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Oc1cccc([C@H]2c3[nH+]c[nH]c3CCN2Cc2ccnn2-c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67684", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](Sc1ccccn1)C(=O)N[C@H](CO)c1cc(F)c(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1ccc(Cn2c(CN3CCOCC3)nc3ccccc3c2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59462", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CCN(CCNC(=O)CC[C@H]2Cc3ccccc3NC2=O)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121461", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@]1(c2ccccc2)NC(=O)N(C[C@@H](O)c2ccccc2Cl)C1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128773", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)COCCNC(=O)NNc1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125691", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC(=O)Nc1ccc(NC(=O)N2CCO[C@H](c3cccc(F)c3)C2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157069", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C([O-])c1ccccc1S[C@H]1CCOC2(CCCCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178314", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1ccc(NC(=O)N[C@H](CO)CC(C)C)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199628", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2cc(C(=O)N[C@@H]3CCc4ccccc43)n[nH]2)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137735", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)N1C(=O)C=C(c2ccc(Cl)cc2)Nc2cc([N+](=O)[O-])ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122208", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCc1cccs1)C(=O)c1cccc(CC#N)c1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151603", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1ccc(C[NH2+]Cc2cccc3cccnc23)cc1)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221740", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(N2CCN(C(=O)C[NH+](C)CCO)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27912", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule N#C/C(=C\\c1cc2c(cc1Br)OCO2)c1nc2ccccc2[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145464", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CCC(=O)N1CCN1CC[NH+](Cc2ccoc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197754", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Cc1ccc([C@@H](C)C(=O)N[C@H](C(=O)[O-])C(C)C)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181377", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(-c2noc(-c3ccc(OC(C)C)cc3)n2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121187", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)[C@H](C)CC(=O)Nc1ccccc1CN1C[C@@H](C)O[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178868", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nc([C@@H]2CCN(C(=O)C3(c4ccc(Cl)cc4)CCOCC3)C2)ncc1C(N)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68583", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(F)c(CN2CCC(=O)NC[C@H]2C)c1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52317", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule NC(=O)[C@@H]1CCCC[NH+]1CC(=O)NC(=O)NCC(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49331", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)c1ccc(C#N)c(SCC(=O)c2c([O-])on[n+]2C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74951", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(N(C)C)ncc1C(=O)N[C@H]1Cc2ccccc2[C@@H]1[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236839", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nn(C)c(C)c1[C@H](NC(=O)Nc1cccc2ccccc12)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145218", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccc(S(=O)(=O)N[C@H](C#N)c2ccc(Cl)cc2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206787", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(/C=C/C(=O)c2scnc2C)cc(Cl)c1O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122722", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(=O)n2c(n1)SC[C@H]2CC(=O)Nc1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161657", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCNC(=O)[C@H]1CCCN(C(=O)N[C@@H](C)CSC)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96598", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(C)n(-c2cc(N3CCC[C@@H](C(=O)Nc4ccc(Br)c(C)c4)C3)ncn2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177794", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CCN1CCCC1=O)NCC1([NH+]2CCCCC2)CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85808", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCC(=O)N1CCN(Cc2ccccn2)CC1)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83334", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(C(=O)N2CCCC2)c1NC(=O)NCc1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50140", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c([C@@H]2CCCN2C(=O)c2ccoc2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143410", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccccc1C(C)(C)C)N1CC[NH+](CCO)CC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182728", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC[C@@H]1CCN(c2cc(C)c(F)cc2[C@H](C)[NH3+])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211513", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H]2CCN(C(=O)NCc3cccc(OCC(F)F)n3)C2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212510", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccccc2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41465", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@H]1COCCN1C(=O)c1ccc2[nH]c(C)c(C)c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47190", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cn1nc2c(cc1=O)CCCC2)N1CC[C@]2(O)CCCC[C@@H]2C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26844", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)cc(NC(=S)NC(=O)c2cccc(F)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32571", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(F)c(F)c1F)c1ccc([N+](=O)[O-])o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214318", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOc1ccc(Nc2nc(CSc3nc4ccccc4o3)cc(=O)[nH]2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163014", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH+](C)CCCCn1c([C@H](C)Cl)nc2cnccc21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154572", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(C(=O)N(C)Cc2ccccc2OC(F)(F)F)cc(OC)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179508", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@]1([NH3+])CCC[C@H]1CCSc1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159885", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Cl)c(O[C@H](C)C(=O)NCCCc2ccccc2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151171", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1CNC(=O)Nc1ccc(N2CC[NH+](C)CC2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239650", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule N#Cc1nc(/C=C/c2ccccc2Cl)oc1N1CCN(C(=O)c2cccc(Cl)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86230", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(OCC(=O)Oc2ccc3c4c(c(=O)oc3c2)CCC4)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103200", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)Cc1cn2cc(Cl)cc(Cl)c2n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191604", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(C(=O)CCC(=O)N2C[C@@H](C)OC[C@@H]2C)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6363", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1oc2c(c1C(=O)NCCNC(=O)c1c(C)oc3c1CCCC3)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8350", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(C[NH+](Cc1ccco1)C1CCCC1)NCc1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97802", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)c1ccc(NCc2ccc(F)c(Br)c2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158213", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc([C@@H](C)NC(=O)N[C@H](CCCO)c2ccccc2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105398", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=[N+]([O-])/C=C/c1c(F)c(F)c(F)c(F)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67835", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(N2CCN(Cc3cccs3)CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120941", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(CN2CCS(=O)(=O)[C@H](C)[C@H]2C)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170570", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1C[C@@H](C)CN(C(=O)C[NH+](C)CC2CC[NH2+]CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72154", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CCC(=O)NNC(=O)NC[C@H](C)c1ccsc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4895", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N[C@@]1(C(F)(F)F)NC(=O)N(C)C1=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223555", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@@H](NC(=O)C1C[C@H](C)O[C@H](C)C1)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237778", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(OC)cc([C@H]2CCN(C(=O)c3c(F)cccc3Cl)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183034", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)N(C)[C@H](CC)CSC)c1ccc(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243646", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1c(SCC(=O)Nc2c(C)cccc2C)nc2sc(C)c(C)c2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239998", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cccc(C)c1NC(=O)c1cnc(SC)nc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83856", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=[S@@](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3664", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule C[C@H]1OCC[C@@H]1C(=O)NCCOc1ccc([N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32914", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1CC(=O)N1CCN([C@@H](C)c2nc(C3CC3)no2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222205", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cn2ccsc2n1)N[C@H]1CCC[C@H]1Cc1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43312", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](C#N)OC(=O)/C=C/c1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40686", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule NC(=S)N/N=C1C(=N/N=C(\\N)[S-])\\Sc2ccccc2\\1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81567", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NC1(C(=O)[O-])CCCCC1)c1c[nH]c(=O)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208886", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule OC1CC23CCCCCCC2(C1)CC(O)C3 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77605", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)N(C)Cc1c(CC)oc2ccccc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244921", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(CN2CCN(C(=O)c3cc(C#N)cn3C)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(-c2nc(Cn3cnc(C4CCC4)cc3=O)cs2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62948", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN(C)S(=O)(=O)N1CCO[C@H](c2cccc(F)c2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74799", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@@]2(CC[NH2+]C[C@@H]2c2ccccc2F)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157059", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(N)=O)cc1NC(=O)N(Cc1cccc(F)c1)C[C@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18945", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CSc1nc(-c2ccco2)nc(C)c1C(=O)NCC[C@@H](O)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141615", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](C1CC1)N(Cc1ccccc1)C(=O)c1ccc2c(c1)C(=O)N(C)C2=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83667", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1nn(C)cc1CNC(=O)Nc1cc(C)ccc1-n1cc(C)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47958", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)c1ccc(-c2cc(F)cc3c2O[C@H](CNC(=O)[C@@H]2CCOC(C)(C)C2)C3)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208872", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195234", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C2([NH+](C)C)CCC2)cc1S(C)(=O)=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42563", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=S(=O)(NCc1ccccc1)c1ccccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37423", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C1CC1)N(C(=O)CSc1nc2c(cc1C#N)CCCC2)C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212465", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1cccc2sc(NC(=O)[C@H]3CCCN(S(=O)(=O)c4ccc(C)cc4)C3)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92005", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cccc2cc(C(=O)N3CCN(C(=O)[C@@H]4C[C@H]4c4ccc(F)cc4)CC3)oc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68526", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(Br)cc1C[NH2+]C1CCC(O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166176", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nc(N3C[C@H](C)O[C@H](C)C3)ncc2-c2cncnc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240940", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)NC[C@H]1CCCCN1C(=O)CCCC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100052", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Cn1nc2c(c1NC(=O)c1cc3ccccc3o1)CSC2)NCc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94335", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nnc(SCCOc2ccc(F)cc2Cl)n1N by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249267", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)c1ccc(F)c(NC(=O)[C@@H]2CCO[C@H]2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162401", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCCC#Cc1cc(F)cc(C[NH+]2CCC[C@H]2CO)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4563", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(OC)c(N/C([O-])=C2/Oc3ccccc3NC2=O)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94266", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc2c(c1)N(C(=O)N1CCC(C(=O)Nc3ccccc3Cl)CC1)CCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219633", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1NS(=O)(=O)c1ccc2c(c1)NC(=O)[C@H](C)C(=O)N2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189934", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc(NC(=O)CSc2nccn(-c3ccc(C)c(C)c3)c2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226551", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc([C@H]2CC(=O)NC3=C2C(=O)C[C@H](c2cc(OC)c(OC)c(OC)c2)C3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181257", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1csc(-c2ccnc(N3CCCC3)c2)n1)N1CCN(c2ccccc2F)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129622", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1CN1CCN(C(=O)c2ccc(N(C)C)nc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46565", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]([NH2+]CCO)c1cc(F)cc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67854", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nc(CC(C)C)cc1C(=O)N1C[C@H]2CC=C(C)C[C@H]2C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67216", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(CC(=O)N(C)[C@H](C)c3ccc(F)cc3)coc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155846", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOC(=N)Cc1ccc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34452", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)N2CCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55774", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)Nc1nc2ccc(NC(=O)NCCC(C)C)cc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238822", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[C@@H](C(=O)OCc1cccnc1)N1CCCCC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179992", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@]1(N)CC[C@H]([NH+]2C[C@@H](C)[C@@H](C)C2)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169405", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@H]1CCN(C(=O)Cc2cccc(OCc3cccnc3)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126937", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cccc(NC2CC[NH+]([C@H](C)C(=O)Nc3cc(C)on3)CC2)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158399", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1nnn[n-]1)c1cc2ccccc2s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195187", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CCn1ccc2cc(Br)ccc21)/N=C1\\N=N[C@H]([C@H]2CCCO2)S1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92023", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](Cc1ccccc1F)C(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74534", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(CN1CCN(c2ncccn2)CC1)Nc1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224495", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)c1ccc(CNC(=O)c2cc(-c3csc(C)n3)c[nH]2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224522", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N/C(=N/OCCCOc1ccccc1)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122303", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Fc1ccccc1[C@@H]1C[C@H](c2ccc(Cl)cc2)Nc2nnnn21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216404", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCOc1ccc(NC(=O)C(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45888", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(N2CCCC2=O)cc1)Nn1cnc2ccccc2c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4692", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2ccccc2n1CCCNC(=O)c1ccc(-n2cccc2)nc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121485", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOC(=O)/C=C1\\NCCCN1Cc1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208837", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(C[NH+]2CCN(Cc3cccc(F)c3)CC2)co1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95056", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[S@](=O)[C@H]1CCCC[C@@H]1NC(=O)CNC(=O)Cc1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12608", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1c(C)nn(CCNC(=O)c2cn[nH]n2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118482", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N(C)C)cc(C)c1NC(=O)c1ccnc(OC(C)(C)C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65368", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)NC1CC[NH+](C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122401", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule Cn1ncc2nc3cc([N+](=O)[O-])ccc3c([O-])c21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147603", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)[C@H](CO)[NH+](Cc1ccccc1)C1CCSCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91759", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(C)cc(C(=O)Nc2ccc(N3C(=O)CCCC3=O)cc2)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96766", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCNC(=O)c1ccc(N2CCN(c3ncccc3C#N)CC2)nc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136572", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)/C(=C\\c1cc(Cl)c2c(c1)OCO2)CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129990", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc([C@H]2c3[nH]c4ccc(OC)cc4c3CCN2C(=O)c2ccc(Cl)cc2)cn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128453", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Clc1ccccc1CNCCc1cn2ccccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172234", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c(F)c(F)cc2c(=O)c(C(=O)NC(C)(C)CO)cn(C3CC3)c12 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149979", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CCN(C(=O)c2ccc(OC)nc2)C[C@H](Cc2ccccc2-c2ccncc2)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221164", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@](C)([C@H](NC)c1ccc(C)s1)[NH+]1CCCC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73559", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(SCCC(=O)NC2CC[NH+](CC(N)=O)CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77452", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)N2CCCC2)c(C2CCN(C(=O)c3ccoc3)CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37491", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nc(NCC[C@@H]3CCC[NH+]3C)ncc2-c2cncnc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143530", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccc(C2=NN3C(=NC(C)=C(C(N)=O)[C@H]3c3ccc4c(c3)OCO4)N2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239402", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCC1CCN(c2nc3ccccc3o2)CC1)c1ccc2ccccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208380", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Nc1c(Nc2cc(Cl)cc(Cl)c2)ncnc1NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148165", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Clc1ccc(NCc2ccncn2)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24320", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(O[C@@H](C)CNc2ncccc2C#N)c1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38436", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1ccc(I)cc1)C(F)(F)F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175409", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(=O)c1cc(F)ccc1OCC(=O)N[C@H]1CCOc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50483", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Nc1nc(CC(=O)N2CCC[C@@H](c3[nH]ncc3-c3ccccc3)C2)cc(=O)[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8617", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cccc(C(=O)NCCc2cnn(-c3ccccc3)c2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220002", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cc1ccc(F)cc1F)NCc1cc(Cl)c2c(c1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156324", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)[C@H]1CCCN(C(=O)C[C@@]2(c3ccccc3F)CC(=O)N(C3CCCC3)C2=O)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103224", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C(=O)Nc2c(Cl)cc(Cl)cc2C(=O)[O-])c(C)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22233", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Nc1ccn(Cc2ccccn2)n1)c1c[nH]c2cccc(F)c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36414", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOC(=O)[C@H](CC(C)C)Nc1ncnc2onc(C)c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134254", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1occc1-c1nnc(SCc2cccc(OCC(F)(F)F)c2)n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108500", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C/C(=C\\c1ccc(F)cc1)C(=O)O[C@@H](C)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45559", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc(CN(C(=O)c2nc(C3CC3)n3ccccc23)C(C)(C)C)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217017", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@H](C)CC(=O)Nc1ccc(N2CCO[C@@H](C)C2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45691", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)n1cc[nH+]c1C1CCN(C(=O)c2ccc3[nH]nnc3c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142978", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CO[C@H]1C[C@@H](C(=O)[O-])N(C(=O)c2cc(SC)ccc2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72341", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NCC1CCN(c2cc[nH+]cc2)CC1)Nc1c(F)cc(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236180", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H]1Cc2cc(S(=O)(=O)Nc3ccc(Br)cc3)ccc2N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230871", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)N[C@@](C)(CO)C1CCCCC1)c1ccc(C#N)cc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77183", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1c(Cl)cccc1NC(=O)C(=O)N/N=C/c1coc2ccc(Cl)cc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63725", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)[C@@H]1CCC[NH+](CC(=O)Nc2ccccc2-c2ccccc2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136221", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)c1ccc(NC(=O)Cc2csc(NC(=O)c3ccsc3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37184", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccccc1O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20753", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1noc(C(C)C)c1C(=O)N1CCC[C@H]([NH+]2CCCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213485", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cn1ccnc1[C@@H](NC(=O)[C@H]1CCCN(C(=O)Nc2ccccc2)C1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198929", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)Cc1cccc(C[NH2+]Cc2ccn(-c3ccccc3)n2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9923", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=C(NCCC1=CCCCC1)NC[C@@H]1CCC[C@H](O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225313", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(O[C@@H](C)C(=O)NCC2(N3CCOCC3)CCCCC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188221", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1(C)CNC(=O)c2nc([C@@H](O)C[NH+]3CCCCCC3)[nH]c2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186611", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Oc1ccc(CCNC(=O)N[C@@H](C)CO)cc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136295", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=CC[NH2+]CC(=O)N1CCn2cc[nH+]c2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247908", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccc(C(=O)[O-])cc1S(=O)(=O)C(CC)CC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51524", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CC(C)[C@H]1CN(c2cc(C#N)c3ccccc3n2)CCS1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96621", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)CC[S@](=O)Cc1ccc(C)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97851", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[NH2+]C[C@H](C)C(=O)N[C@H]1C=C[C@@H](C(=O)[O-])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67638", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)CC[C@@H](C)NC(=O)C(=O)Nc1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161196", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(CCc1cnccn1)C(=O)Nc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155153", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc2c(=O)c(C(=O)Nc3ccc(NC(C)=O)cc3)cn(C)c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22145", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(c1ccncc1Cl)N1CCCC[C@@H]1[C@@H]1CCC[NH2+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113946", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cnc2sc(C(=O)Nc3ccc(C)c(Cl)c3)c(C)c2c1=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18336", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)CO/N=C/C(=O)Nc1ccc(F)cc1)c1ccco1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209960", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)c1c(NC(=O)CSc2nc(C)ccc2C#N)sc2c1CCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54104", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C(=O)Nc2ccn(-c3ccc(C(C)C)cc3)n2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241335", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(C2=CCN(C(=O)NCC[C@@H](C)[S@@](C)=O)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240311", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCC[C@H](C[NH3+])C1(O)CCC(c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213848", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(C)cc1NC(=O)C(=O)NCc1cc[nH+]c(N(C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155319", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=N/NC(=O)c2cc(C)nn2C)c(C(=O)[O-])c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212620", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=[N+]([O-])c1cc(Br)c(O)c(Cc2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214119", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CCc1ccc(S(=O)(=O)N[C@@H]2C[C@@H]2c2ccccc2F)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85421", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nn(CC(=O)N2CCC[C@@H](C)C2)c(=O)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196119", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCn1cc[nH+]c1C[C@H](O)c1cc(Cl)c2c(c1)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215202", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)N(CC(=O)N2CCn3cccc3[C@@H]2c2ccc(Cl)cc2)C(C)(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37257", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CC1(n2cccc2)CCCCC1)NCCO by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174796", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C(=O)N2CCCC[C@@H]2CCn2cc[nH+]c2)c(C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64577", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)c1sc(NC(=O)c2c[nH]c(=O)cc2C)nc1C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48000", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C([C@H]1CCCC[NH+]1Cc1cccc([N+](=O)[O-])c1)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203332", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Nc1ccc2c(c1)nc1n2CCN(c2ccccc2)C1)c1cccc(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74206", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(OC[C@@H](C)NC(=O)CNC(=O)c2ccoc2C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226239", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](OC(=O)c1ccc(-n2cnnn2)cc1)C(=O)Nc1nc(-c2ccccc2)cs1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188704", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(-c2cccs2)sc1C(=O)N1c2ccccc2C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172425", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C(c1ccc(=O)n(Cc2ccccc2)n1)[n+]1ccccc1NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215921", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCN(CCc1nccs1)Cc1cc(O)ccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181153", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(SCC(=O)Nc2ccc(Br)cc2)nc2ccc(S(=O)(=O)N(C)C)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(-n3ccnn3)cc2)cc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105429", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCS(=O)(=O)[N-]c1cccc(NC(=O)c2ccccc2OC)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170485", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1c(C)cc(C)cc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96649", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=S(=O)(c1ccccc1Cl)N(C[C@@H]1CCCO1)[C@@H]1CCSC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228947", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccccc1-n1cc(C(=O)N2CCC(OCc3ccc(F)cc3)CC2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138411", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(N2C(=O)C[C@@H]([NH+]3CCC(c4ccc(O)cc4)CC3)C2=O)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107363", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)n1ncc2c(C(=O)N[C@H](C)c3ccc(NC(=O)c4ccc(F)cc4)cc3)cc(C3CC3)nc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46905", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(S(=O)(=O)CCO)cc(C(=O)[O-])c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170756", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(C(=O)NCc2nnc3n2CC[NH+](Cc2c(F)ccc(F)c2F)CC3)c(C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45948", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule c1ccc(CCCCc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159865", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CO[C@@H](CNC(=O)[C@@H]1CCC(=O)N1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150102", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(-n2ccnc2SCC(=O)N2CCC[C@H](C(N)=O)C2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228566", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)CC1CCN(C(=O)c2ccc(F)cc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123571", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C(C)C)[nH]c(=O)c1C(=O)N(C)CC(=O)[O-] by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49624", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(-c2ccc(S(=O)(=O)NC3CCCC3)s2)[nH]n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192416", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccccc1NC(=O)CSc1ccc(F)cc1N by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55626", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)c1ccc(CSCCOc2cccc(F)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189662", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cc1csc(NC(=O)c2cnccn2)n1)Nc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11653", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]1CN(C2=NC(=O)/C(=C\\c3ccc4noc(-c5ccccc5)c4c3)S2)C[C@@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90796", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc(C(=O)NCCc2nc3c(s2)CCCC3)c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155123", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)[C@@H](NC(=O)c1cccc(Cl)c1)C(=O)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180852", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CNS(=O)(=O)c1cccc(C(=O)N(C)Cc2cnn(C)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33187", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Fc1cccc(CN2CCC[C@@H](c3nnc(-c4cccnc4)o3)C2)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187415", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1[C@H](c2ccncc2)N(Cc2ccco2)C(=O)CN1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25860", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C/C(=N/NC(=O)CN(c1cccc(Br)c1)S(C)(=O)=O)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143770", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@@](O)(CNC(=O)CCn1cc([N+](=O)[O-])cn1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224494", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccc(-n2c(SCC(=O)c3ccc[nH]3)nnc2-c2ccncc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145362", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CSc1ccc(/C=C(/C)C[NH2+]CC(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30885", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1nnc(Cc2ccccc2)s1)[C@@H]1CC(=O)N(Cc2ccccc2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245791", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cc(I)ccc1NC(=O)c1ccccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82380", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC[C@H](Nc1nccn2cnnc12)c1ccccc1OC(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38213", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)Cn1c(SCC(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117146", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccccc1-n1ncc2c(O)nc(SCC(=O)N3C[C@H](C)O[C@@H](C)C3)nc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77285", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(NC(=O)N[C@@H]2CCCc3c2cnn3Cc2ccccc2)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166130", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=[S@]1N/C(=C/c2ccc(Cl)cc2)NO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241405", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)c1ccc(OC[C@@H](O)CN2CCN(c3ccccc3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14411", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)N1CCC[C@@H](C(=O)NCC(C)(C)c2ccncc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118311", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2csc(/C(C#N)=C\\c3ccc(OCC#N)cc3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112657", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)C(=O)N[C@@H](C)c2cc3ccccc3o2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144227", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Nc1cccc(C(=O)N[C@@H]2C=C[C@@H](C(=O)[O-])C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83061", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule C[C@H]1CN(c2ccc([N+](=O)[O-])cc2F)CC[NH2+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154935", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC(C)[NH2+]Cc1ccc(S[C@H](C)CCO)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67572", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCNC(=O)NC(=O)C[NH+]1Cc2ccccc2N(C)C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55703", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)(C)c1ccccc1OCC(=O)NC1CC[NH+]([C@@H]2CCOC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95423", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)CCCNC(=O)C1(c2ccc3c(c2)OCO3)CCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219953", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCCNC(=O)Cc1c(C)c2cc3c(C)c(C)oc3c(C)c2oc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18803", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)NC[C@@H](c1cccs1)N(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125986", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=CN[C@H]1CCCC[C@@H]1c1ccc([C@H]2CCCC[C@@H]2NC=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51640", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COc1ccc(NC(=O)/C(C#N)=C/c2c(Oc3ccccc3F)nc3ccccn3c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76112", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cccc2cc(CN(Cc3cccnc3)C(=S)Nc3cccc(Cl)c3)c(=O)[nH]c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187310", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule c1ccc2c(c1)CC[C@@H](N[C@@H]1CC[NH2+]C1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33103", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(C)cc1CCNC(=O)C(=O)Nc1cc(F)ccc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181264", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N)cc(Cl)c1[NH+]1CCC(C)CC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100731", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=c1oc2cc([N+](=O)[O-])ccc2n1Cc1noc(-c2cccs2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48466", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(NC(=O)NC(=O)c2ccc3ccccc3c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181613", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H]([NH2+]Cc1cccc(-c2n[nH]c(C)n2)c1)c1ccc2c(c1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183109", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H]1C[C@H](N2CCC(O)(C(F)(F)F)CC2)C(=O)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119420", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1noc(C)c1[C@@H](C)NC(=O)c1ccccc1NC(=O)NC(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205431", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=[N+]([O-])c1ccc2nc(NC3CCC3)oc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159824", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(C2(NC(=O)Cc3csc(-n4c(C)ccc4C)n3)CCCC2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151431", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+]C[C@@H]1CCCC[NH+]1Cc1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103432", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@@H](Cc1cccs1)[NH+](C)C[C@H](O)c1ccc(N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171885", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nccn1-c1ccc(C(=O)/C=C/C2=Cc3ccccc3OC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78514", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cn1cc([N+](=O)[O-])cn1)N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122584", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]CCOCC(=O)N[C@H](C(=O)[O-])C1CCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125048", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1nnc(C2CC2)n1C1CC1)N1CCN(Cc2ccccc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157978", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule FC(F)(F)CCc1noc(COC2CC[NH2+]CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105704", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule C[C@@H](CN1CCOCC1)[NH+]1CCC(Oc2cccc(C#N)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218812", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c([C@@H](C)NC(=O)Nc2c(F)cccc2F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105136", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C/C(NC[C@@H]1CCCO1)=C1\\C(=O)NC(=O)N(C2CCCCC2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84260", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1c(NNC(=O)c2ccc(Cl)cc2Cl)ncnc1NC1CCCCC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20150", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccc(NC(=O)[C@H](C)Oc2ccc(OC)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228484", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C[C@@H](C)[NH3+])cc1OCc1cccc(C)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239722", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCC[NH+]1CCC[C@H]([C@@H](C)NCc2ccc(Br)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115818", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(NC(=O)[C@H](C)[S@@](=O)Cc2nc(C)c(C)s2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14020", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccccc1[C@H](NC(=O)c1ccn(C)c(=O)c1)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243620", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C#N)Oc1ccc(C[NH+](C)Cc2csc(Br)c2)cc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152160", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(CN1CCO[C@@H](c2cccs2)C1)NOCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6257", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)NCc1ccc(C(=O)NCc2csc(-c3ccccc3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C[C@H](NC(=O)c1cccc(N2CCCS2(=O)=O)c1)c1ccc(Br)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83531", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(C)c2sc(N(Cc3ccccc3)C(=O)CC[C@@H]3CCCO3)nc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159255", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1c(C(=O)N2CCOC[C@@H]2C2CC2)sc2ccc(F)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108007", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)N1CC=C(c2cccc(C)c2)CC1)c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122393", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C(=O)C1CC=CC1)c1ccc(F)c(F)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10174", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)NCCN2C[C@@H](C)O[C@H](C)C2)c([N+](=O)[O-])c1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188926", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C#CCN(CC(=O)[O-])C(=O)c1nc(CC)n[n-]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16277", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C/[NH+]=C(/NCCN1CCc2sccc2C1)NCc1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14552", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CO[C@H](C(=O)N1CCC(n2cc(C(=O)NC3CCCC3)nn2)CC1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN(CC(F)(F)F)C(=O)[C@H]1C[C@H]1c1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38931", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CSC(SCC(=O)N2CCC(Cc3ccccc3)CC2)=N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160770", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)c1csc(-c2cccs2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15574", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(/C=C/C(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111912", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1n[nH]c(=O)c(CNC(=O)c2ccc(-n3ccnn3)cc2)c1CC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149581", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc(CN(C)C(=O)Cn2ncnc2-c2cccc(C#N)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244938", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cccc2sc(NC(=O)[C@H](C)OC)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213262", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(C[NH2+]Cc2c(C)nn(Cc3ccccc3Cl)c2Cl)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93751", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H]1CCN(C(=O)[C@@H](Oc2cccc(Cl)c2)C(C)C)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184306", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC(=O)Nc1nc2c(c3c1c(=O)oc1ccccc13)C[C@@H](C)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187307", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cnc(CCNC(=O)CO[C@@H]2CCC[C@H](C)C2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234480", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@H](C)[C@@H]1CCCCN1c1ccc(C(N)=O)cn1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186188", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH2+]Cc1cc(C)n(-c2ccc(OC)cc2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34562", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCN(C(C)C)[C@H](C[NH3+])CC(N)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229276", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#CCc1ccc(Oc2ccc(F)cc2C=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31233", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(C[NH+]1CC(c2nc(-c3cccnc3)no2)C1)N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99197", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCn1c([C@@H](C)[NH2+][C@@H](C)c2cccc(NC(C)=O)c2)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201740", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](CNC(=O)c1ccc(-c2ccccc2)[nH]c1=O)Oc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "803", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2151", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1nc(C[C@@H]2CCCN(C(=O)CCc3ccccc3)C2)cc(Nc2ncc(C)s2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48603", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule Cc1cc2c(c(=O)o1)[C@@H](c1ccc(Cl)c(Cl)c1)C(C#N)=C(N)O2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241913", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)Nc1ccc(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67828", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc2oc(Br)c(CC(=O)N3CCOCC3)c2cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63575", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(-c2ccc(=O)n([C@H](C)C(=O)Nc3nc4ccc(Cl)cc4s3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135819", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[NH+](CC)C[C@H]1CCN(C(=O)[C@@H]2CN(Cc3ccccc3)CCO2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119186", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule [NH3+]CC(=O)N1CCCC[C@@H]1CNC(=O)OCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109940", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CO[C@H]1CCCC[C@H]1NC(=O)c1cnc(C)c(Cl)c1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123914", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(C[NH2+]Cc2ccc3c(c2)CCC3)cc(C)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208901", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCCCn1ncc(C(=O)N[C@@H](CO)c2ccco2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "173565", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N)cc(S(=O)(=O)Nc2cc(C)ccc2F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139831", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1ccccc1C[NH+]1CC[C@H](c2ccccc2)[C@@H](C)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140904", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(CCC(=O)c1ccc(F)cc1)OCc1cc2c(cc1Br)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126478", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C[C@@H](C)N(C)C(=O)N[C@@H]1CCC[C@H](SC)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79958", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(C)C)c(C)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33905", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(NC(=O)[C@@]2(C)Oc3ccc(Cl)cc3NC2=O)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215467", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)C[C@H]1CCCCN1C(=O)c1nc2nccc(C)n2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102351", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1ccc(C[NH+]2CCC(C3CCOCC3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120800", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C(=O)N2CCN(Cc3ccc([C@@H]4C[C@@H]4C)o3)CC2)on1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132235", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NNc1ccc(F)cc1)Nc1ccc(C(=O)Nc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63115", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2CCCN2C(=O)COc2cc(C)ccc2F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144693", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cccc(N2C(=O)CSC23CCN(C(=O)CCl)CC3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248359", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCn1nc(C)c(Cl)c1C[C@H](C[NH3+])c1ccccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167259", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC1CC[NH+](CCCNCc2cn(C)nc2C(C)(C)C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108031", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1Nc1nc(CSc2nnc(C)n2C2CC2)cs1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212278", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH+]1CC[C@H](NS(=O)(=O)c2cccc(C(F)(F)F)c2)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106004", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H]1CCCCN1C(=O)[C@@H](C)n1nc(-c2ccccc2)ccc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222728", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccccc1NC(=O)COC(=O)c1c2c(nc3ccccc13)CC[C@@H](C)C2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7249", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCS(=O)(=O)CCN(C)C(=O)CC[C@@H]1CCCOC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53004", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1ccc(N/C([O-])=C(\\C#N)C(=O)c2ccc(C)c(C)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160577", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(N2CCN(C(=O)CCc3cc([O-])no3)CC2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74786", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=c1cc(CS(=O)(=O)c2ccccc2)nc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233074", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC(=O)Nc1cccc(CNC(=O)Nc2ccccc2N(C)C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49131", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN(C)C(=O)[C@@H](c1ccccc1)n1nnc(-c2ccc(F)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218923", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)Oc1ccc(CNC(=O)Nc2ccccc2OC(C)C)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246717", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(C1CC1)N1CCc2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242970", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(CCOc1ccc(F)cc1Cl)S(=O)(=O)c1ccc(Cl)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34155", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCOc1ccc2c(c1)s/c(=N\\C(=O)c1ccccc1F)n2CCOC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145100", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CC(=O)Oc1ccc(/C=C(\\C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5203", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC[C@H](C)NC(=O)[C@@H]1CCCN(C(=O)c2cc(F)cc(F)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172623", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC[C@H](C)N/C(NCc1cccc([N+]2=CCCC2)c1)=[NH+]\\C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29833", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(NC(=O)/C=C/c2ccccc2[N+](=O)[O-])c2cccnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108859", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(C)c1cc(C(=O)Nc2cccc(Cl)c2Cl)ccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146758", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCc1ccc(-c2nc(NC(=O)Cc3c(C)[nH]c4ccnn4c3=O)sc2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240393", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(CC(=O)NNC(=O)c2oc3ccccc3c2C)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16741", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc(NC(=O)c2cc(-c3cccc(OC)c3)n[nH]2)cc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116395", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(-c2cc(O)cc(C(F)(F)F)c2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164111", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C([C@H]1Cc2[nH+]c[nH]c2CN1)N1CCC[NH+]2CCC[C@@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94738", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(C1CC1)[C@@H](c1ccccc1)[C@H]([NH3+])Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194085", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C)n(-c2ccccc2NC(=O)N(C)C[C@H](C)c2ccccc2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195910", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)c1cccc(Oc2cnccn2)c1)c1ccncc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123651", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1csc2c1CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123258", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(NC(=O)Cc2nc(C)c(C(=O)NCC(C)C)s2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215388", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)N(C(=O)CSc1cccc[n+]1[O-])c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66335", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule NC(=O)[C@@H]1CCC[C@@H]1NC(=O)NCC1(c2cccc(F)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198604", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Oc1cc2c(cc1C[NH+]1CCN(c3cccc(C(F)(F)F)c3)CC1)CCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55821", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1n[nH]c2ncc(NC(=O)NC[C@@H](C)COCc3ccccc3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245876", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCCN(C(=O)C[NH+](C)[C@@H]1CCC[C@H](C)C1)[C@H]1CCS(=O)(=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[C@@H](NC(=O)NC(C)C)C(=O)N1CCc2nnc(-c3ccccn3)n2CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7308", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([N-]S(=O)(=O)c2c(C)noc2C)cc1NC(=O)c1ccncc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228095", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1c2ccsc2CCN1C(=O)c1cccc(S(=O)(=O)N(C)c2cccc(Cl)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54007", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(NC(=O)CCc2ncc(-c3c(F)cccc3F)o2)[nH]n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107350", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1cc(N2CCN(C(=O)Nc3cccc(F)c3)CC2)nc(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176579", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(Cl)cc1Cl)C(=O)N[C@@H]1CCSc2ccc(F)cc21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239927", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1NC(=O)C12C[C@@H]3C[C@H](C1)CC(n1cncn1)(C3)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9751", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN(C(=O)N2CCCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215625", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc(C(=O)CN2CC[NH+]3CCC[C@@H]3C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223304", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@H](O)Cc2nc3ccccc3n2C)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140388", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1cc[nH+]c(Cn2nnc(-c3ccccc3)n2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75689", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2cc([C@H]3CCCCC[NH+]3Cc3ccccn3)on2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110272", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)(CSc1ccc(Br)cn1)C(=O)NN .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42912", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(/C=C/C(=O)N2CC[C@H](C(N)=O)c3ccccc32)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20720", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](CCO)Nc1ccc2cc(Br)ccc2n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33168", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C1CC1)N1CCC(C(=O)N2CCOc3ccc(CO)cc3C2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231771", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccncc1NC(=O)NCC[C@H](C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168845", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)c1c(CC(=O)Nc2ccccn2)[nH]c(C(C)=O)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147016", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Oc2ccc(NC(=O)C(=O)NCc3ccnn3C)cn2)cc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6484", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCN(CC)c1ccc(/C=C2/C(=N)N3C(SCc4ccccc4)=NSC3=NC2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29873", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)N2CCN(Cc3cc(C#N)cs3)CC2)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53106", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cn1c(C[NH+](C)C[C@H](O)Cn2cccn2)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31263", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[NH2+]C[C@@H](O)CN1C(=O)CCCC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106622", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@H](C)[C@H](C[NH3+])c1c(Cl)cccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133584", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C(=O)NCC[NH+]2CCC(c3ccsc3)CC2)ccc1[N+](=O)[O-] by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243868", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccc(C)c2[nH]c(=O)c(CN(Cc3ccco3)C(=S)Nc3cccc(Cl)c3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34400", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCS(=O)(=O)NCC#CCOc1ccc2c(c1)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62315", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[NH+](C)Cc1cccc(CNC(=O)c2n[nH]c(C3CC3)c2Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244661", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1/N=C(/[S-])Nc1ccccc1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54900", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1cccc(N2C(=O)[C@@H]3C(C(=O)C(c4ccccc4)c4ccccc4)=NN[C@H]3C2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213230", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CCCO)NC(=O)Nc1cccc(Oc2ccncc2)c1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136675", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCC(=O)Nc1ccc(Cl)c(NC(=O)CCCO)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70978", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule [NH3+][C@H](Cc1ccc(Cl)cc1)c1c(F)cc(Br)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21172", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCc1cccnc1NC(=O)c1cnc2ccc(F)cc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137845", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1ccccc1NC(=O)[C@H]1C[C@@H]1c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114605", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Nn1c(SCC(=O)N2CCCCC2)nnc1-c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46766", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(C(=O)[C@H]2CCCN(C(=O)c3cccc(C#CC(C)(C)O)c3)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247326", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([N+](=O)[O-])c(CCl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179923", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(/C=C/c1ccc(Cl)cc1)NC(=S)Nc1cc(C(=O)[O-])ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174515", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccccc1)Nc1cccc(C(=O)Nc2ccccc2C(=O)[O-])c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26967", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CC=CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60293", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CC1=C[C@@H](CN2CCN3NC(C(=O)NC4CC4)=C[C@@H]3C2)N=N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148725", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nc(C)cc1CNc1ccn(C)n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220138", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(c1ccc(F)cc1F)N(CC(F)(F)F)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33904", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=C(Nc1ccc(C(C)C)cc1)[C@H]1C(=O)NC(=O)N(CCCC)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1c(C)[nH]c(C(=O)N2C[C@@H](C)Oc3ccc(C)cc32)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108370", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC[C@@H](C(=O)OCC(=O)c1c(N)n(C)c(=O)n(C)c1=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136564", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCn1cc(C[NH+]2CCCC[C@H]2c2nc(N(C)C)ncc2-c2ccc(F)cc2)c(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64591", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=O)CC[NH2+][C@@H]2CCN(C3CC3)C2)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141605", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)c1ccc(CNC(=O)c2oc3c(Cl)cccc3c2C)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161414", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Oc1ccc(NC(=O)C(=O)N[C@H](C)c2cccc(Cl)c2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53853", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)ncc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53154", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(OC)C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197434", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nn2ncc(C(=O)NCCc3ccc(OCc4ccccc4)cc3)c2[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103210", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule c1ccc(Cn2nnnc2[C@@H](c2ccccc2)N2CC[NH+](Cc3ccncc3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120170", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=[N+]([O-])c1ccc(-c2cc[nH]n2)cc1CS(=O)(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27690", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@@H]1CN(C(=O)c2cccs2)C[C@H]1C(=O)N1CCOCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63128", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)N1CCN(C(=O)NCc2cn3c(C)cccc3[nH+]2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177815", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H](C)Sc1ccc(N)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237916", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc2c(C)c(C(=O)N[C@@H]3c4ccccc4C[C@@H]3O)oc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197840", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCC[C@H](NC(=O)Nc1cnn(CC(N)=O)c1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116688", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=S)c1c(F)cccc1-n1cnc2ccccc21 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241653", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccccc1-c1cccc(C(=O)N(C)C[C@@H]2CC[NH+](C)C2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218284", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nsc(N2CCN(Cc3cnn(-c4ccccc4)c3)CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230672", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(NS(=O)(=O)c2cccc3nonc23)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ocnc1CNC(=O)N[C@@H]1CCCN(c2ccccc2F)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35644", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc(CNC(=O)COC(=O)c2ccc(C)c(C)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168579", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCC[C@H]([NH2+]C)c1ccc(OC)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157206", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCc1cccnc1-n1cccn1)[C@@H]1CCCN(C(=O)c2ccco2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205425", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(C[NH2+]C[C@@H]1COc2ccccc2O1)Nc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107400", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@](C)([C@@H](NC)c1cccc(F)c1F)[NH+]1CCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73383", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cscc1C[NH2+]CC(=O)NC1CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181051", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccn2c(=O)c(C(=O)N[C@@H](C)C(C)(C)C[NH+](C)C)cnc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21631", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)cc(NC(=O)CNc2ccc(C(=O)NC(C)(C)C)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103291", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+]Cc1cnn(C(C)(C)C)c1)c1ccc2c(c1)NC(=O)CO2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225789", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSCc1ccc(C(=O)N[C@H]2CCCc3ccccc32)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11293", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCO[C@H](C)C(=O)Nc1ccccc1OCC1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218999", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cn1c(=O)c2c(nc(Cl)n2CC(=O)Nc2ccccc2OC(F)F)n(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13032", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)(C)c1ccc(C2(C(=O)OC[C@@H]3CCC(=O)N3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21592", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@](C)([C@@H](N)c1c(F)cccc1F)[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216097", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C/[NH+]=C(/NCc1ccnc(-n2ccnc2)c1)NCc1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104911", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C#CCOc1ccc(F)cc1NC(=O)[C@@H](C)Sc1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81236", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc([C@@H]2C[C@H](C(F)(F)F)n3nc(C(=O)Nc4ccc(Cl)cc4)cc3N2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181137", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)C1=C([O-])C(=O)N(Cc2cccnc2)[C@@H]1c1ccc(C(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103321", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](NS(=O)(=O)c1ccccc1)c1nccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15808", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1C[C@@H](c2ccco2)Cc2c1cnn2-c1ccccc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206036", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(C)cc(C(=O)NCCn2nc(-c3ccncc3)ccc2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59983", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(CCC1CC1)C(=O)c1ccc(C(=O)OC(C)(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141538", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](O)[C@@H](C)c1ccc(C(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87363", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(CNC(=O)Cc2c(C)c3ccc(O)c(O)c3oc2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16486", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1ccccc1)[C@H]1[C@@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]2[C@H]2C=CC=CN21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223928", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2ccc(N[C@@H](C)C[C@H]3CCC[NH2+]3)cc2s1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83173", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)Cn1c([C@H]2CC(=O)N(Cc3ccccc3)C2)nc2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87777", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCn1c(SCC(=O)NN)nnc1-c1ccc(C(C)(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227752", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@@H]1C[NH+]=C(N2CCN(Cc3cnnn3C)CC2)S1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127437", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc2cc(C(=O)Nc3ccc4c(c3)C(=O)NCC4)c(=O)oc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181697", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH+]1CCC[C@@H](c2cnc(-c3ccccc3Cl)cn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98010", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2124", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1(C)C(=O)NC(=O)N1CC(=O)N[C@H]1CCC[C@@H]1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154725", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2nc(SCC(=O)NCCCN3C[C@H](C)O[C@H](C)C3)[nH]c2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156770", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H]1CC[C@](C#N)([C@H](O)c2ccc(Br)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210047", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2oc(C(=O)NCCc3ccc(F)cc3)c(C)c2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180748", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1cccc(OCC(=O)Nc2nc(-c3ccccc3)c(C(C)=O)s2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136362", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NCCOCC(F)(F)F)N[C@@H]1C[C@H]1c1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204271", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(S(=O)(=O)N(C)C)c(C)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217520", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CSc1cc(C(=O)O[C@@H](C)C(=O)Nc2c(F)cccc2F)ccc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187372", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1noc(C)c1NC(=O)N1CCN(Cc2ccccc2)C(C)(C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87024", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2nc3n(n2)[C@H](CC(=O)Nc2cccc4ccccc24)C(=O)N3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96288", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CCc1c([N+](=O)[O-])cc(C(=O)[O-])n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112659", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCCN1CCN(C(=O)c2ccc(-c3ccsc3)nc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170825", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COC(=O)c1ccc(/C=C(/C)CO)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214835", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1ncc(Cc2ccc(OC(F)(F)F)cc2)s1)c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54079", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CN1C(=O)N[C@](C)([C@H]2CCC[NH+](Cc3cccc(C#N)c3)C2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235345", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCCC[C@H]2CCNC(=O)c2snnc2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160409", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc([C@@H](O)C2(C#N)CCCCC2)c1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238083", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](NC(=O)Cc2n[nH]c(=O)c3ccccc23)C2CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87879", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule C#CC[C@H](OC(=O)Cn1cnc([N+](=O)[O-])n1)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(NC(=O)C(=O)NCC[NH+]2CCN(c3ccccc3)CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247847", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CCn1nnc2ccccc21)N1CCC[C@H]1c1nc2ccccc2[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108699", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C[NH2+][C@H](C)c2ccc(C#N)cc2)c1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120363", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1-c1ccc(Cl)c(O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234264", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCn1nc(C)c(-c2ccnc(NCc3cnn(Cc4ccccc4)c3)n2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136714", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCC1(c2ccccc2)CCCCCC1)NNC(=O)[C@H]1CCCO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245873", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(CC(=O)c2cc(F)c(C)cc2F)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171540", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cc1cc(Cl)c2c(c1)OCCO2)Nc1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233646", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CSCC[C@H](NC(=O)c1cc(Cl)nc(Cl)c1)c1nnc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133471", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1n[nH]c2ncc(C(=O)NC[C@@H]3COc4ccccc4O3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158441", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@H]1CCCc2ccccc21)c1ccc([N+](=O)[O-])s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35828", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C=CCNc1nc(N2CCCCC2)nc(N2CCCCC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166624", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1-c1nc(C(=O)Nc2cccc(C)c2C(N)=O)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201469", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)CC[NH+]2CCC(NC(=O)C3CC3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118760", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC1CCC(O)CC1)[C@@H]1C[C@@H]1c1cccc(Br)c1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123100", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc2c(s1)[C@H]([NH2+]CCOc1ccc(Cl)cn1)CCC2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1ccccc1Cl)N[C@H](CO)c1ccco1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6059", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1cc([C@H]2C[C@@H]2C(=O)OCC(=O)NC2CCCCC2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172657", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCN(Cc1cccs1)C(=O)N[C@@H](C)C(=O)N1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63310", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1cc([C@@H](C)[NH2+]C[C@@]2(O)CCOC2)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122381", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(N2C[C@H](C(=O)N3CCN(c4nccn4-c4cccc(Cl)c4)CC3)CC2=O)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99489", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccn1)[C@H]1CCCN1C(=O)c1ccc(Cl)c(Cl)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227736", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=S)N2C[C@@H](C)O[C@H](C)C2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182068", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)Cc2csc(-c3cnccn3)n2)cc1C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228480", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Cc1ccccc1)NC(=O)c1ccc(Br)nc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208916", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)N1CCN(C(=O)C[NH+]2CCCC[C@H]2Cn2cncn2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129962", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)c3ccccn3)cc2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204798", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)(C)c1cccc(NN)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216396", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1CCC[C@H](C)N1C(=O)[C@@H](C)[NH+]1CCN(CC(=O)N2CCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216900", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)/C(=C/c1cccc([N+](=O)[O-])c1)Cn1cncn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109952", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@@H]1CCCc2c1cnn2-c1ccccc1F)c1ccc(N2CCOCC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33083", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(Br)c(COc2ccc(CC[NH3+])nc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58359", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@H](c1ccccc1)[C@@H]1CCCN1C(=O)CSc1nnnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68005", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)c2c1N[C@@H](c1ccc(C(=O)[O-])cc1)[C@@H]1CC=C[C@H]21 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211355", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)C1[C@@H](c2ccccc2)C(C(=O)[O-])[C@@H]1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131680", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Oc1ccc2cc(-c3ccc(Cl)cc3)c(=O)oc2c1)[C@@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246587", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[NH+]1CCC[C@@H]1CN1C[C@H](C(=O)NCc2ccc(C(N)=O)o2)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204463", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C)n([C@@H]2CCCN(C(=O)CC[C@H]3CCCO3)C2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90694", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=S)N[C@H](NC(=O)N2CCOCC2)C(Cl)(Cl)Cl)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192910", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)Nc1ccc(NS(=O)(=O)c2ccc3oc(=O)ccc3c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81615", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(C)c(/C=N/NC(=O)COc2ccc([N+](=O)[O-])cc2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155666", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1[nH]ncc1CCCNC(=O)N[C@H](C)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245364", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc2c(c1)C(N1CCN(C(=O)c3ccccc3F)[C@@H](C)C1)=Nc1ccccc1O2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61045", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(CO[C@H](C)C(=O)N[C@H]2C[C@@H](C)N(c3ccccc3)C2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232373", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)N(Cc1cnn(C)c1)C(=O)[C@H]1CCC(=O)N(CCN2CCOCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120867", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CO[C@@H]1CCCC[C@H]1NC(=O)/C=C/c1cnc(C(C)(C)C)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217716", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)C1CC[NH+](CC(=O)N[C@H](c2ccccc2)C2CC2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214353", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1cccc(N[C@H]2CSCC(C)(C)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144889", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Clc1ccnc(CSc2nnc3n2CCCCC3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214038", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(C)c(C[S@](=O)[C@H](C)c2nc(-c3ccccc3)no2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39227", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nn(C)cc1[C@@H](C)NC(=O)c1csc(-c2ccc(Cl)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143467", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1cc(C(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)n(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20921", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NC[C@@H]1COc2ccccc2O1)[C@H]1CCCN1C(=O)OCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203216", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1CCCCN1C(=O)C[C@@H]1C=CCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175496", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Clc1ccccc1-c1nc(Cn2nccc2-c2ccncc2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94285", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C=C(C)C[C@@H](O)[C@]1([NH+](C)C)CCC[C@@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10540", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(CC(=O)Nc2sc3c(c2C#N)CCCCC3)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129696", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(C#N)c(SCC(=O)Nc2ccccc2SCC#N)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192987", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncn(C[C@@H](C)[NH2+]CC(C)(C)c2ccccc2Cl)c1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97812", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(C)c(S(=O)(=O)N(Cc2ccco2)Cc2cc3cccc(C)c3[nH]c2=O)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165186", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CNS(=O)(=O)Cc1ccccc1CNC(=O)c1c(-c2ccccc2)noc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117958", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCCNc1ncc(C[NH+]2C[C@H](C)C[C@@H](C)C2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6629", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](C(=O)N1CCCCC1)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224089", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)c1ccoc1)C(=O)N[C@H](C)c1noc(Cc2ccccc2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70286", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(C[C@H]1CCS(=O)(=O)C1)OCc1nccn1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187080", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1c(S(=O)(=O)Nc2ccc(C)c(F)c2)sc2c1CCN(C(=O)c1csnn1)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88142", "split": "OpenMolInst" } }, { "instruction": "Remove a thiol from the molecule OC[C@@H]1CCCC[NH+]1CCS .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25481", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [O-]c1nc(N2CCc3ccccc3C2)nc2ncn(-c3ccc(Cl)c(Cl)c3)c(=S)c12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225583", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)c1nc(C[S@](=O)CCCCC#N)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67389", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(CC(=O)c2ccc(F)c(F)c2F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244994", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc(NC(=O)C2=CN(C)[C@H]3C(=O)N(Cc4ccccc4)C(=O)N=C23)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133265", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)c2ccccc2CSc2nc3ccccc3[nH]2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122626", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccccc1-c1cc(C(=O)NCC(C)(C)C[NH+](C)C)c2cnn(C(C)C)c2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40756", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=O)N(C)Cc2[nH+]ccn2C)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248645", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1ccccc1NC(=O)C[C@H](c1ccccc1)C(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228989", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCO[C@H](C)c1nc(CC(=O)Nc2cccc(-c3cn[nH]c3)c2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61863", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1ccn(Cc2ccc([N+](=O)[O-])cc2Br)c1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126104", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(Br)cnc1N1CCC[C@H]1CCC[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137979", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H]1CCN(CCc2ccc(F)cc2C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28973", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cc(NC(=O)c2cc(C3CC3)nc3c2c(C)nn3C(C)(C)C)ccc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c(Cl)cccc1NC(=O)C(=O)N[C@H]1C[C@@](C)(OC)C1(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181435", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(N(C)C)sc1C[NH+]1CCC[C@@H](CC(N)=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(/C(C#N)=C/c2ccc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)o2)nc2ccccc21 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56649", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(O)CC[C@H]1C[C@@H](C(C)(C)C)CCC1=O by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35125", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[NH+]1CCN(c2ccc(N3CCC[C@H](C(=O)NCc4ccccc4)C3)nn2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171041", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)c1cccc(CNC(=O)NCC2(N3CCOCC3)CCCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39183", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1nc(C(=O)Nc2ccccc2OC(F)(F)F)ccc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237918", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule NC(=O)C(=O)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144587", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COC(=O)c1ccc(CSCCO)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34456", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)Oc1ccc2c(c1C)O/C(=C\\c1cccc([N+](=O)[O-])c1)C2=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38328", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(Cl)cnc1COC(=O)c1cc(Cl)c2c(c1)OCCO2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235954", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@@H](C#N)[C@H](O)[C@H]1CC=CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98989", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC(=O)N1c2ccccc2NC2=C(C(=O)CCC2)[C@@H]1c1ccc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2699", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(C(=O)NC[C@@H]2CCCC[C@@H]2C[NH3+])cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17480", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1CCCC[C@@H]1NC(=O)C[C@H]1OCCc2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50098", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1cc(/C=N/NC(=O)COc2cc(C)c(Cl)c(C)c2Br)ccc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154462", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N(C(C)=O)c1ccccc1/C=C1/CCOC1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74420", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(OCCNC(=O)N[C@@H]2CCC[C@@H]([NH+](C)C)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67834", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOC(=O)c1noc2nc(C)nc(NCCC3=CCCCC3)c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45718", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]1C[C@@H]([NH2+]Cc2ccccn2)CCN1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212051", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCO[C@@H]1CCC[NH+](CC(=O)N(C)[C@@H](C)c2ccc(Cl)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85152", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc2c(c(C)c1CCC(=O)NCc1ccc(=O)[nH]c1)c(=O)[nH]n2C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211623", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCN(C(=O)N[C@@H]2CCC[C@@H]2c2ccc(F)cc2)C[C@H]1O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133690", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C1N[C@H](c2ccc(Cl)c(F)c2)Nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35983", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH3+])C(=O)N[C@H]1CCCC[C@H]1[NH+](Cc1ccccc1)C1CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237623", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(COCc1nc2ccccc2s1)Nc1ccccc1N1CCCC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33463", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)C(=O)N1CCN(Cc2ccc(-c3nc4ccccc4s3)o2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90698", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)cc1)N[C@@H]1CCN(Cn2nccc2-c2ccncc2)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51652", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H]2CC=CC[C@@H]2[N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177249", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nc(C(=O)N[C@H](C)c2ccc(Cl)cc2Cl)n[nH]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17561", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C=CCc1cc(/C=N/NC(=O)Nc2ccc(F)cc2)cc(OCC)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182984", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(O[C@H](C)C(=O)Nc2cc([N+](=O)[O-])ccc2C)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63740", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCn1nc(C)c(NC(=O)N2CCC[C@H]2c2cccc(C)c2)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "797", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CN1CCCOC1=O)NCCc1nc(C(F)(F)F)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153213", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@H](C)N1C(=O)CCC(=O)N1[C@H](C)CCC[C@H]1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164211", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(c1ccc(F)cc1)N1CCN(Cc2cnc3ccccn23)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89730", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCN(CC1CC[NH2+]CC1)C(=O)Cc1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189242", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc(C(C)=O)cc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244882", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule Cc1ccccc1OCC(=O)N1CCN(c2ccc([N+](=O)[O-])c(N3CCOCC3)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87469", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)NC(=O)CN(C)C(=O)CCc1nncn1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159737", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)cc(Nc2ccc(Cl)cn2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170411", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nc(C)c(C(=O)C2=C([O-])C(=O)N(CCc3ccccc3)[C@@H]2c2ccc(F)cc2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243084", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C)c(C)c1CC(=O)[C@@H](C#N)c1ncc(C(F)(F)F)cc1Cl by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47774", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@]1(CSc2ccccc2C(=O)N2CC[C@H]3CCCC[C@@H]3C2)NC(=O)NC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154413", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CNS(=O)(=O)c1ccc(-c2ccc(OC)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211065", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1CCc2nc3sc4c5c(c(=O)[nH]c4c3cc2C1)[C@@H](c1ccc(F)cc1)C(C#N)=C(N)O5 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178119", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1nc(CC(C)(C)C)cc1NC(=O)C(=O)N[C@H]1C[C@H]1C1CCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197734", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)Nc1ccccc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205955", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCCc1cc(NC(=O)c2ncccc2C(F)(F)F)n[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158609", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(NC[C@@H]1Cc2cc(F)cc(-c3ncccn3)c2O1)c1noc2c1CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213711", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C#N)c(N[C@H]2CCc3cc(N)ccc32)n1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22661", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1nnc(NC(=O)Cc2ccccc2)s1)Nc1ccc2c(c1)OCCO2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88137", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2nnc(SCC(C)=O)n2C2CCCCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82097", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule C[S@](=O)c1ccc(CNc2cc(C#N)nc3ccccc23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6612", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[NH+](CC)Cc1nc(C2(NC(=O)C3CC=CC3)CCCC2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234369", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(C)/C=C/C(=O)c1ccc(Sc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35049", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc(C[S@](=O)Cc2coc(-c3ccc(F)c(F)c3)n2)n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66903", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccoc1C(=O)N1CC[NH+](Cc2ccc3c(c2)OCCO3)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54338", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1OCC[C@@H]1C(=O)c1ccc(Br)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21679", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CO[C@@H](C)C(=O)NNC(=O)CNc1ccc(C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236870", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccc(Cl)cc1)S(=O)(=O)c1ccc(O)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172490", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(N(CCOC(=O)c2cccnc2)C2=NS(=O)(=O)c3ccccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7789", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccnc1)C(=O)NC[C@@H](c1cccs1)N1CCc2ccccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159075", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](N[C@H](C)CC(=O)N1CCCCCC1)C(=O)OC(C)(C)C by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43439", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CCNC(=O)[C@@H]1CCO[C@H]1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159851", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccccc1[N-]S(=O)(=O)c1cc(-c2nc(C)c(C(=O)N3CCCC3)s2)n(C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207014", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(N/N=C2/C[C@H](c3ccccc3)Oc3ccccc32)nc(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190498", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H](NC(=O)NC[C@@H](C)N2CCOCC2)C(C)C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246971", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=C(NNc1cccnc1Cl)c1sccc1OC(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88698", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H]1COc2ccccc2O1)c1cc(-c2ccco2)nn1-c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129334", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)NC(=O)CCNC(=O)N[C@@H](C)C(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132763", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[S@@](=O)c1ccc(CNC(=O)NC[C@@H](O)c2ccc(F)cc2)cc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97442", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)C[C@H](C)O1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1C(=O)[C@H](CC(=O)Nc2cc(Cl)ccc2C)S/C1=N\\c1ccc(S(N)(=O)=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242161", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)[C@H]2CC[C@@](O)(C[NH3+])[C@@H]1C2 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238273", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccc(NC(=O)[C@H]2CCN(C(=O)OC(C)(C)C)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47360", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H]1C[NH2+]CC[C@@H]1c1ccc(OC)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153544", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)CCCNc1ncnc2ccccc12 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30936", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCC(C)(C)c1ccc(OC[C@H](C)C[NH3+])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14543", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@]12CN(Cc3ccccc3)C[C@@H]1NC(=O)c1ccccc1[C@@H]2[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119600", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC[C@H](C#N)OC(=O)c1ccn(-c2ccccc2Cl)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153759", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(CCNC(=O)C[C@H](O)c2cccc(F)c2)c(C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124408", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)Cc1ccc([C@H](C)c2nn3c(-c4ccccn4)nnc3s2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37791", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule F[C@H]1CCCC[C@@H]1Br by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47226", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@H](CNC(=O)N[C@@H]1CCc2c(O)cccc21)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57876", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC[C@@H]1CN(C(=O)c2ccc(=O)[nH]c2)C[C@H]1[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140986", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18784", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)[C@@H](C)Cc2ccccc2F)c(C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30862", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1[C@H](Oc2ccccc2)[C@H](c2cccs2)N1Cc1ccc2c(c1)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159455", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C[C@H](NC(=O)N[C@@H]1C[C@@H]1C)c1ccc(C#N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136653", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN/C([O-])=N/S(=O)(=O)c1ccccc1-c1ccccc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32653", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C#CCOC(=O)c2cn(C)nc2C(C)(C)C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55314", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule c1ccc(Cn2nnnc2CN2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81015", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1730", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN1CC[C@H](CNC(=O)Cn2ccc(=O)[nH]c2=O)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246966", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](CNC(=O)NC[C@@H]1CCC[C@H](O)C1)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168204", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[NH2+][C@]1(CO)CC[C@H](Sc2nnc3ccccn23)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218715", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(c1)=[NH+][C@@H](C(=O)N1CCC([C@H](C)C(=O)NCc3ccc(Cl)cc3)CC1)C=2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52961", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H](C[NH+]1CCC(Oc2ccccc2)CC1)c1cccc(Cl)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95187", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc([C@@H](C)NC(=O)c2cccc(-n3cccn3)n2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[C@H]1NC(=O)Nc1cccn(Cc2ccc(F)cc2)c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217222", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1C(=O)[C@@H]1CCOC2(CCOCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47475", "split": "OpenMolInst" } }, { "instruction": "Remove a thiol from the molecule Sc1sccc1/C=N/c1ccc2ccccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108025", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](NC(=O)C(=O)Nc1ccc2c(c1)COC2)c1cccc(-n2cccn2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181573", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(C(=O)O[C@@H](C)[C@H]2CCCO2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30115", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)C1=C(C)C(C(=O)NCc2ccc(-n3ccnc3)cc2)=N[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1[NH2+]CC[C@@H]1C(=O)Nc1cc(F)cc(F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67168", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(/C([O-])=N/c1ncnn1C)[C@@H]1CCCN(c2ccccc2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228884", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2csc(CNC(=O)c3cc(C)no3)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70664", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2nnn(CC(=O)N[C@H]3CCCn4c(C)nnc43)n2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6304", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCc1ccon1)c1cc2ccccc2c(Cl)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42099", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Cn2ccc3cc(CO)ccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29706", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(CNC(=O)NC2CC[NH+](C[C@@H]3CCOC3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182253", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(N2CCCC2=O)ccc1Cl)N1CC[C@@H]([NH+]2CCCC2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166655", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOCCCNC(=O)[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223080", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)(C)c1csc(C[C@H]2CCC[C@H](Br)C2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57771", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NC12CC3CC(CC(C3)C1)C2)c1csc(-c2cnccn2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164202", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC1CC[NH+](CCNC(=O)c2cc(C)n(-c3cc(C)on3)c2C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39666", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [O-]/[N+](=C\\c1ccc(O)cc1)c1ccc(Cl)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11174", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC1(C)CCC[C@@H](Sc2ccc(Cl)cc2)[C@H]1[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42120", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CC(=O)Nc2cc(C(=O)O[C@@H](C)C3CC3)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17225", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(CCc1ccccc1)C(=O)c1ccc[n+]([O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64378", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC(C)[C@H](C(=O)N(C)C[C@H]1CCC[NH+]1C)/C(N)=N/O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102389", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(C)(C)[C@@H]1CCCN1C(=O)c1cnc2sc(C)cn2c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175631", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(NC2=NCCS2)c(=O)n(-c2ccccc2)n1C by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141860", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(N2CCN(C(=O)C[C@@H]3C(=O)NCC[NH+]3C3CCCC3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117082", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](NC(=O)[C@@H]1CCO[C@@H]1C)C(=O)NC(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217536", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C1NCC(=O)N2CCN(C(=O)c3cnnn3-c3ccccc3)C[C@@H]12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C(=O)N/N=C/c2cc3ccc(C)cc3nc2Cl)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234504", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CC[C@H](Sc1nnnn1-c1ccc(Cl)cc1)c1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98073", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNc1cc([C@H]2CCCN(C(=O)CC(C)(C)C)C2)nc(-c2cccnc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187709", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c(Br)cccc1C[NH2+]Cc1ccco1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103706", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOc1ccc(C(=O)N[C@@]2(C)CCS(=O)(=O)C2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244320", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH2+]C[C@@H](O)CN(C)C[C@@H]1CCC[NH+]1C by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91206", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](Oc1ccccc1)C(=O)Nc1cccc(C(=O)Nc2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32658", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[S@](=O)c1ccc(C[NH2+]C[C@H]2CN3CCCC[C@@H]3CO2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101939", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCN1CCN(C2CCN(S(=O)(=O)c3ccccc3CC)CC2)C(=O)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130454", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cn1cnnn1)NC1(c2cccc(C(F)(F)F)c2)CCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244746", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCC[C@@H](NC(=O)c1ccc(Cl)c(OC)c1)C(=O)OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134045", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "522", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)[C@@H]1CCCC[NH+]1Cc1cc(C#N)cs1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209263", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(O[C@@H](C)C(=O)NC(N)=O)c(C=O)n1 by removing a aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96247", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCc1cccc(CC)c1NC(=O)CSc1nnc(-c2ccc(F)cc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221173", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCN(C(=O)C[C@@H]2CCCc3ccccc32)C[C@@H]1O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50316", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1cccc(N[C@H]2CS[C@@H](C)C2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7521", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cn1ncn2nccc2c1=O)N1CCC[C@@H](n2cncn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226564", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Cc1ccc(Cl)cc1)N1CCC[C@@H]1c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206333", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cc1ccncc1)NNC(=O)N[C@@H]1CCCC[C@H]1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48367", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[NH2+][C@@H](COC(C)C)c1ncc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50495", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OC1=Nc2c(cnn2Cc2ccccc2)[C@@H](c2ccc(F)c(F)c2F)SC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206578", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NCc1nc(-c2cccs2)n[nH]1)c1cc2cccc(Cl)c2o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86493", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NC1C2CC3CC(C2)CC1C3)C1CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152221", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]1CN(C(=O)c2ccc(-c3ncon3)cc2)C(C)(C)CO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56851", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#Cc1csc(C(=O)Oc2ccc(Br)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102071", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Oc1cccc(C[NH+]2CCC(n3cc(-c4ccccc4)nn3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29420", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule ClC[C@@H]1CCO[C@@H]1c1cc(Br)c(Br)o1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104933", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule O=S(=O)(Cc1cccc(F)c1)N[C@@H](CO)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239221", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(/C=C(\\C#N)C(=O)Nc2ccc(Cl)cc2Cl)cc(OC)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75746", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(CC1CC[NH2+]CC1)C[C@H](C#N)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209211", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCN(CC)C(=O)[C@@H]1CCC[NH+](C2CCN(CCc3ccccc3)CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91422", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cccs1)C(=O)c1cc(C2CC2)nn1-c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56703", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(C)c(OCC(=O)N(C2CCCC2)[C@@H]2CCS(=O)(=O)C2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244808", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[NH+](CCNC(=O)c2ccc(C(F)(F)F)cc2[N+](=O)[O-])C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156009", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC)C(=O)c1ccc(Oc2snc(Cl)c2C#N)cc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97780", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccccc1OCC(=O)NNC(=O)[C@@H](C)N1C(=O)c2ccccc2C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137060", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)N/N=C\\c3cccn3C)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121388", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(-c2noc([C@H]3CC(=O)N(c4ccc(C)c(F)c4)C3)n2)cc(OC)c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168013", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncccc1C(=O)NCCCO by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71457", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCC[C@H]1CN(Cc2ccc(CSC(F)F)o2)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136712", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1cccc(-c2noc(C3CCC3)n2)c1)Nc1ccc(F)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171517", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCNC(=O)CN(CCC)C(=O)c1cc(C)ccc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239206", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule [NH2+]=C(C1CC1)N1CC[NH+]2CCCC[C@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134140", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](C(=O)N(C)C1CCCCC1)[NH+]1CCC(C(=O)N2CCCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69200", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(Cl)nc1)c1ccc(Br)c(F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117294", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=S(=O)(NCc1nnc2c3ccccc3c(-c3ccc(Cl)cc3)nn12)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12694", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cccc(C(C)C)c1NC(=O)[C@H]1CC(=O)N(c2cc(F)cc(F)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207120", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]C1CCC(n2cc(C(=O)NCc3nc(C4CCCCC4)no3)nn2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63388", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nc(N2CCOCC2)cc(N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219622", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1n[nH]c(C(=O)Nc2ccccc2N2CCCC2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38105", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](NC(=O)C(=O)Nc1ccc(CC#N)cc1)c1ccc2c(c1)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127268", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSCC[C@@H](C)NC(=O)N1CCN(c2ncccc2C#N)CC1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179949", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(CCS(=O)(=O)c1ccc2ccccc2c1)N1CCN(Cc2ccccc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154909", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCn1cc[nH+]c1CN1CCN(CC(=O)NC(=O)NC2CC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134180", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N2C(=O)N[C@@H]3CCN(C(=O)CC4(CC(=O)[O-])CCCC4)[C@@H]3C2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148388", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1c(O)n[nH]c1C(=O)NN=Cc1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141609", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(CSc1nnc(Cc2cc(=O)[nH]c(=O)[nH]2)n1-c1ccc(Cl)cc1)Nc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101320", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule N#Cc1cccc([N-]S(=O)(=O)c2ccc(-c3cc(C(F)(F)F)n[nH]3)s2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138918", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CCNC(=O)c2ccc(-c3nc4ccccc4n3C)s2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233423", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CSCCn1cnc(-c2cccc([N+](=O)[O-])c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14405", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2nnc(C[NH+]3CCC[C@H]3C[NH+]3CCC[C@@H]3CO)o2)cc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17967", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1c(C#N)c(NC(=O)CN2C[C@@H](C(N)=O)Oc3ccccc32)n(Cc2ccco2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144588", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(O[C@@H](C)C(=O)N2CC[C@@H](C(=O)[O-])[C@@H]2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22594", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(=O)C[C@H](NC(=O)NCc2cccc(C#N)c2)[C@@H]1c1ccc(Cl)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29621", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCN(Cc1ccccn1)c1ccc(F)cc1CC[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141561", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc([C@H]2NC([S-])=NC3=C2[NH+]2CCC3CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129575", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCc1cc(-c2ocnc2CCl)n(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186714", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)c1ccc(S(=O)(=O)NC[C@@H]2CC[NH+](C3CC3)C2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83534", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccccc1NCc1c(C(C)C)nn(C)c1N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113995", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](CC)[C@H]1CCN([C@@H](C)C(=O)N[C@@H](C)c2ccc3c(c2)OCCO3)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123992", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)c1nc(C(=O)Nc2ccc3c(c2)OCCO3)n[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48960", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(NCc1nncn1C1CC1)Nc1cccc(Cl)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28910", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCCN(CCO)C(=O)N[C@H]1CCc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238904", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(NC(=O)[C@H](C)SCc2cccc3c2OCCO3)on1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212301", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(C2=CCN(C(=O)c3ccc(F)c(F)c3F)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101425", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(NC(=O)CC(C)C)c(C)cc1I .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85342", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/[NH+]=C(/NCc1cccc(F)c1)NCC(C)(C)N1C[C@H](C)O[C@H](C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35114", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)NC(=O)c1cccc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83042", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCn1c([S-])nc2cc(C(=O)NCc3cccs3)ccc2c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43220", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC(=O)N[C@@H](Cc1cc(Br)c(O)c(Br)c1)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50038", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCN(C(=O)C(=O)Nc2ccnn2C(C)(C)C)C[C@H]1n1cc[nH+]c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144878", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2c(-c3cccs3)c(C)nn2c(NCC[NH+](C)C)c1C by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202932", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(c1ccccc1F)N1CCN(CCn2cc[nH+]c2-c2ccccc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127024", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCOC(=O)CCC(=O)c1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125253", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](C(N)=O)N1CCN(c2nccc(Oc3ccc(F)cc3)n2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59078", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H]1CCCO1)[C@H]1CC(c2ccc(Cl)c(Cl)c2)=NO1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182793", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)(C)CC(C)(C)NC1=[NH+]CCN[C@H]1C(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159495", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CO[C@@H](C(=O)NCc1n[nH]c(=S)n1C(C)C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43340", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cccc1CN1CCc2c(Br)cccc2C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193497", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cc[nH+]c1C[C@@H]1CCCN(C(=O)C(=O)Nc2cccnc2Cl)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195963", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1c(CN2CCN(C(=O)C3CCCCC3)CC2)nc2cc(NC(=O)c3cccs3)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151264", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C/C(=N\\N)c1cccc(O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177256", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)C(=O)NCC(C)(C)[C@@H](O)c2ccccc2)c1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214575", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(C(=O)Nc2ccc(CC(=O)N(C)C)cc2)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185813", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(CCCNC(=O)N[C@@H](c2ccccc2)c2ccco2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198029", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1C[C@@H](C)N(C)C(=O)[C@H](C)NC(C)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168007", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSC[C@@](C)(O)CNC(=O)c1cc(-c2ccccc2)on1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174889", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H](CO)NC(=O)NC[C@H](C)Oc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134808", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(-n2nnc(-c3nc(-c4ccccc4F)no3)c2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184467", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)cc(C(=O)N[C@@H](CCc2ccccc2)c2ccc3c(c2)OCCCO3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230342", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](OC(=O)[C@H](C)N1C(=O)c2ccccc2C1=O)C(=O)c1ccc(F)c(F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27014", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)C(=O)Nc1c(-c2cccs2)nc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103798", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(Cl)c(NC(=O)c2csc(C#CCN)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151247", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(Br)c([C@H]2CC(=O)NC3=C2C(=O)C[C@@H](c2ccc(C)cc2)C3)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96067", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCCOc1ccc(C(=O)Nc2[nH]nc(C)c2N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89904", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)c1c(NC(=O)c2ccc(F)cc2)sc(C(=O)N[C@H](C)c2ccccc2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226968", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])[C@H]1CC(=O)N(CCN2C[C@H](C(=O)[O-])CC2=O)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161024", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)C[C@H](NC(N)=O)C(=O)N1CCc2ccc(Cl)cc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190473", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc2nc(NC(=O)CN(C)S(=O)(=O)c3cccs3)sc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47748", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C/C(Cc1ccccc1)=N\\NC(=O)CNC(=O)c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198441", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(CCCN1CC[NH+](C)CC1)C(=O)C1(c2ccc(Cl)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175739", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CCN(C(=O)COC/C=C/c2ccccc2)C[C@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135873", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cc(C)n(-c2ncnc(N3C[C@@]4(C)C[C@@H]3CC(C)(C)C4)c2N)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156041", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCC12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3cc(C(C)=O)ccc3OC)C(=O)[C@@H]12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222433", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc([C@H]2[NH2+]CCc3c2[nH]c2ccccc32)cc(OC)c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136751", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Oc1ccc(-n2cnnn2)cc1)c1cccc(N2CCCC2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165548", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc([C@H]([NH2+][C@@H](C)c2ccc(OC)cc2F)C2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58020", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@@H]1CN(C(=O)Cc2ccsc2)C[C@H]1C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81235", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CC(C)(CNC(=O)C(=O)Nc1nn(C(C)(C)C)cc1C#N)C1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242442", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(N/N=C/c1ccc(N2CCCCCC2)o1)c1cc2ccccc2o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144255", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(CN[C@@H](C)C#N)cc(C)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24665", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](c1cccc(O)c1)[NH+](C)C[C@@H]1C[C@@H]1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116233", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)NCCc2csc3nc(-c4cccs4)nn23)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115504", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCc1nnc(NC(=O)c2cc(=O)c(OCc3ccccc3)co2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136296", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1c(C[NH+]2CCN(c3ccccc3F)CC2)coc2ccc(Cl)cc12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248870", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(=O)c(C(=O)NC(C)C)nc2cc(C)c(C)cc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137537", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=C1OCC[C@H]1N1CCc2ccc([N+](=O)[O-])cc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77662", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(COc1ccccn1)NCc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2030", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(CCC#N)C(=O)c1cnn(Cc2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170322", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H]2C(C(=O)Nc3ccccc3)=C(C)Nc3nnnn32)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195330", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1c(NC(=O)Nc2cccc(NC(C)=O)c2C)c(C)nn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6884", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1-n1ncc2c1CC(C)(C)C[C@@H]2[NH2+]Cc1ccc(C#CC(C)(C)O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226995", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(S[C@H]2CCC[C@@]([NH3+])(CO)C2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44757", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](NC(=O)c1ccccc1NC(=O)OCc1ccccc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202890", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@H]1COC[C@@H](C)N1C(=O)c1cc(Cl)c2ccccc2c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145203", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CCc1ccccc1NC(=O)CSC1=C(C#N)[C@@H](c2ccc3c(c2)OCO3)[C@H]2C(=O)CCCC2=N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25039", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)NS(=O)(=O)c1ccc(NC(=O)CCC2CCCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2907", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(c1cnns1)N1CCC[C@@H]1c1cccc(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120556", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1[nH+]ccn1CCNC(=O)C1(Cc2cccc([C@H]3CCC[NH+](C)C3)c2)CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197490", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(C)c1NC(=O)CS[C@H](C)c1cc(F)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103407", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H](Cc1ccsc1)N(C)C(=O)NCc1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60307", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H]1C[NH+](CCOc2ccc(CC[NH3+])cc2)C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6972", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C(CS[C@H]1NN=C(c2cccs2)O1)C1=CC(C(=O)N2CCCC2)=NC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33675", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NCc1ccnc(OCC(F)F)c1)NC1CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113655", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1ccc(S(=O)(=O)N2CCC[C@@H](CNC(C)=O)C2)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105227", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C(=O)NCC2CCN(S(=O)(=O)C3CC3)CC2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147992", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(SCC(=O)Nc2ccc(C(=O)N(C)C)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ncccc1CNC(=O)CCC1CCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40936", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C#CCNC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11086", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C(=O)Nc2ccc3c(c2)OCCO3)sc2ncn(Cc3ccccc3F)c(=O)c12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225146", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C/C(=N\\NC(=O)[C@H](C)Oc1ccc(Cl)cc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141356", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCC(=O)N(CCC(N)=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176311", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C=CCn1/c(=N\\C(=O)Cc2ccc(S(=O)(=O)CC)cc2)sc2cc3c(cc21)OCO3 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186870", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc2c(c1)[C@H]([NH2+]C[C@@H]1CCC(=O)N1)CCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152851", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)NCc1cccc(OCc2ccccc2)c1)C1CCS(=O)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169978", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CN(C(=O)c2cccc(-n3cccn3)c2)CC[S@]1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80021", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=C(C#N)C#N)s/c(=C/c2ccc(F)cc2)c1=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178182", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(CCNC(=O)N[C@@H]1CCCC[C@@H]1CO)NC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89380", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N/C(=N/c1ccccc1)S[C@@H]1CC(=O)N(c2ccc(F)cc2)C1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200159", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cn1cnc(Cl)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22973", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOCCOc1cccc(C[NH2+]C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90349", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CC[C@H](N(C)CC(=O)NC(=O)Nc2ccc(C)c(C)c2)[C@H](C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70812", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCN(CC(C)(C)O)C(=O)Cc1ccc(C[NH3+])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22664", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1csc(CN(C)C(=O)C=C2CCSCC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108102", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(c1ccc(Br)cc1F)c1ccccc1C[N+]1=CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188740", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]([NH3+])c1cc(F)ccc1OC[C@@H]1Cc2ccccc2S1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112978", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cc(C[NH+](C)Cc2ccccc2-c2ccccc2)c(=O)n(C)c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210784", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)N[C@@H](C(=O)O[C@H](C)c1nc(C)no1)C1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89410", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)NCCn2ncnn2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198023", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule N#Cc1cnc(S[C@@H](C(=O)Nc2ccccc2)c2ccccc2)nc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113570", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1nn(C)cc1NC(=O)c1cnc2onc(C)c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241793", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)NC[C@@H]1CCO[C@@H]1C(C)(C)C)[C@H](C)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63634", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1c(C(=O)OCc2cccc(Cl)c2)oc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188777", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1ccc(F)cc1)c1cccc(-n2cnnc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14535", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=S1(=O)C[C@@H]2[C@@H](C1)N(c1cccc3ccccc13)C(=S)N2c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238638", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nn(C)c(C(=O)N/N=C/c2ccccc2)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H](CN1CC[NH+](C/C=C/c2ccccc2)CC1)c1ccc(Cl)cc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206095", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31450", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CC[C@@H]1NC(=O)NC1=O)NCc1cn2cc(Cl)ccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35177", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCNC(=O)CNC(=O)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192837", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]([NH2+]Cc1ccc(-n2ccnc2)cc1)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2cc(NS(=O)(=O)c3cccc(C#N)c3)ccc2o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110935", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)CNS(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1C by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36403", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)NCc1ccc(C(=O)N(CC2CC2)c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107663", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCc1ccccn1)[C@@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243485", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CNc1nc2ccccn2c(=O)c1/C=C1\\SC(=S)N(C[C@H]2CCCO2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234268", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](c1ccccc1)N1C[C@@H](c2nc3ccccc3n2CC(=O)N2CCOCC2)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143595", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule NC(=O)CCCOC(=O)c1ccc(F)c(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119866", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(Nc2nc(C)cc3nn(CC(=O)NCc4ccco4)c(=O)n23)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161939", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)C[C@H](C)S[C@H]1CCN(c2c(F)cccc2F)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12215", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1CNC(=O)[C@H](C)Sc1nnc(-c2c[nH]c3ccccc23)o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229805", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1-c1c(C2C(C)(C)C2(C)C)noc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145517", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(-c2ncon2)cc1)c1cccc(Br)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132169", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1ccc2c(c1)CCO2)N1CCC[C@@H]1c1nnc2ccccn12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137146", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCc1ccc([C@H](C)NC(=O)CSc2nnc(-n3nc(C)cc3C)n2N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128950", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCC(=O)N1CSC[C@H]1C(=O)N[C@@H](CC)c1c(C)nn(C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136008", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H](C)Sc2ncn[nH]2)c(C)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157647", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@H](Nc1nc2nonc2nc1NCc1ccccc1)c1nccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70839", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C)c(N)cc1S(=O)(=O)N[C@H](C)CCC(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192971", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+][C@@H](COC)C1(c2ccccc2)CCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102826", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule COC(=O)CN(CC#N)S(=O)(=O)c1cc(C)c(C)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116941", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@](C)(NS(=O)(=O)c1ccc(OC)c(F)c1)C(=O)[O-] by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166967", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)CCN(CC(C)C)C(=O)c1ccc(Cl)nc1Cl by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123568", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](C(=O)N[C@H](CC(N)=O)C1CCCCC1)n1nnc(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176440", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule N#CCC(=O)c1ccc(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45324", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(C)[C@@H]1CCC[NH+](C[C@@H]2C[C@@H]2c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29489", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=C/c1ccccc1)/C=C1/N=C(c2cccc([N+](=O)[O-])c2)OC1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216602", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[NH+](CC)CCNC(=O)N(C)Cc1ccccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106068", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1noc(C)c1S(=O)(=O)NCCn1nc(-n2ccnc2)ccc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153151", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=CCNC(=O)NC(=O)[C@H](C)N1CC[NH+](CC2CC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78104", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc([C@H](CO)NC(=O)[C@H]2CCCN2C(C)=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43647", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@](Nc1ncc([N+](=O)[O-])cc1Br)(C(=O)[O-])C1CC1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63925", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)(C)c1ccc(C(=O)N2CCN(c3c(Cl)cccc3NC(N)=S)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94272", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nn(C)cc1C(=O)N[C@@H](CC)c1ccccc1O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110774", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCSc1ccccc1)N1CCC[C@@H](c2nnc3ccc(C(F)(F)F)cn23)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40867", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(C(=O)NCCn2nc(-c3cccnc3)ccc2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248001", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](c1ccc(F)cc1F)[NH+]1CCC[C@H](C(=O)Nc2ncccc2C)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213838", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(CSc1nnc(NC(=O)c2ccccc2)s1)NCc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84817", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1noc(CC)c1CC(=O)Nc1ncc(C)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106308", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccc(CSc2nc(-c3ccccc3)c[nH]2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170332", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC1(C)[C@@H](NC(=O)c2ccc(Cl)c3cccnc23)[C@@H]2CCO[C@@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128122", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(CN3CCN(C(=O)[C@@H]4C[C@@H]4C)CC3)cc(=O)oc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121901", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)N(C)C(=O)[C@H](C)SCc1ccnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177098", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(C)OC(=O)N1CCC[C@H]1CCC(=O)NNc1cccnc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146119", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)N[C@H](C)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192843", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CNC(=O)[C@H](CC(C)C)NS(=O)(=O)c1ccc(F)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63840", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1(C)C(=O)NC(=O)CN1Cc1cccc(N)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10942", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Oc2ccc(C#N)cc2)ccc1NC(=O)N1CCc2ccccc2C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138562", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(C)C)c(OCC(=O)Nc2nc(C[NH+]3CCCCC3)cs2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244054", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(CC(=O)N[C@H]2C[C@@H]2c2cccc(F)c2)c(C)c1[N+](=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200932", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(SCC(=O)c2cc(C)n([C@@H]3CCS(=O)(=O)C3)c2C)c(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99992", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCCCC[C@@H]1Nc2ccc(F)cc2[C@H]2OCCC[C@@H]12 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14083", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@](C)([C@H](O)c1ccccc1)[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105294", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule N#CCCCn1ccc(NC(=O)Cc2cccs2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73528", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCN(C(=O)[C@@H](C[NH3+])CC(C)C)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140964", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(N/N=C/c1ccco1)c1ccc2[nH]cnc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184741", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=S(=O)(c1cn[nH]c1)N1CCC[C@H](c2cccc(-c3cccc(F)c3)n2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165063", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CCN(c2nc(NC[C@@H]3CCCO3)c3ccccc3[nH+]2)CC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32242", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)N(C1CC1)[C@H](C)C1CC1)c1ccc(-c2ccncc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60509", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC[C@@H](C)NC(=O)[C@H](C)C[NH2+]C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64813", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc(C(=O)OCC(=O)Nc2cccc(C(C)=O)c2)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39954", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCC[C@@]1(C)C[NH+]=C(N)N1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97204", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)C[C@@H](C)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58745", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)[C@H]1C[NH+](Cc2ccco2)CCN1C(=O)c1ccc(Cn2cccn2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246768", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN(C)c1c(Cl)cccc1NC(=O)CCCCO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95523", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(COC(=O)Cn1nc([O-])c2ccccc2c1=O)Nc1c(Cl)cccc1C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203730", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccc(C(=O)NC[C@H]2CCCO2)c1)Nc1ccc(F)c(F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179551", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(C(=O)N2CCC(c3cc(=O)cc(C)[nH]3)CC2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178734", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccccc1[C@H](C#N)NC(=O)[C@H]1CC(=O)N(C(C)C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94345", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1c(SCC(=O)N2CCCCCC2)nnc1-c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105741", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)[C@H]1C[C@H]2CCCC[C@H]2N1C(=O)c1ccc(-c2nc(C)no2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24590", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCSc1nc(N)c(C#N)cc1C#N by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1400", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C1N[C@H](c2ccc(F)cc2)C(C(=O)c2cccs2)=C1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114282", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COC[C@@H](C)n1c(CCCl)nc2cc(C)cnc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180107", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)NCCn1c(SCC(=O)[O-])nc2cccnc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2634", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule CCNc1nnc(Sc2ccc(C(=O)NC3CC3)cc2[N+](=O)[O-])s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56894", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1c([C@@H](C)NC(=O)CCc2nc3ccccc3s2)cnn1-c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206477", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCO[C@@H](C)c1nc(CNc2cccc(-n3nnnc3C)c2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8807", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)C[C@H]1CCCCCN1C(=O)[C@@H]1CCS(=O)(=O)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162253", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nnc2ccc(S(=O)(=O)N(CC)c3ccccc3)cn12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194066", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(N2C(=O)C(c3c(C(C)C)nn(-c4ccccc4)c3O)=C([n+]3ccccc3)C2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229620", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C)c(C(=O)NC[C@H](O)Cc2ccccc2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43403", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(CC)c(NC(=O)CC2CN(C(=O)OC(C)(C)C)C2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98493", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)NCC(=O)NCC(=O)N1C[C@H](c2ccc(F)cc2)C[C@@H]1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171576", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CCCn1cc(CC)cc1C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205052", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1N1CCN(Cc2cn3ccccc3[nH+]2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7361", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1[nH]c(CSc2nncs2)nc2ccc(Cl)cc12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13373", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@](C)([NH3+])C(=O)Nc1cc(C(=O)[O-])cc(C(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59309", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COCC(=O)N1CC[C@@H](c2nc(C)cc(Nc3nc(C)cc(C)n3)n2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197568", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cc(NC(=O)c2cccc(CN3CCN(c4cnccn4)CC3)c2)cn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41302", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1C[C@@H](N2CCC[C@H](C(=O)Nc3ccc(Cl)cn3)C2)C(=O)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100042", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCN(CC(C)(C)CS)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111923", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule N#C[C@H](c1ccccc1)N1CCN(Cc2csc(-c3ccoc3)n2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147868", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccccc1C[NH+]1CCC(CN(C[C@H]2CCCO2)C(=O)[C@H]2C=c3ccccc3=[NH+]2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15238", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN[C@@]1(C#N)CC[C@H](SC2CCCCC2)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104879", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CN1CCCOC1=O)NCc1nccc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146645", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)N1C[C@@H](C)C[C@@H](C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121200", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN1CCN(C(=O)[C@H]2C[C@H]3CC[C@@H]2[NH2+]3)C(C)(C)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192909", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2[nH]c(=S)n([C@H]3CCC(=O)NC3)c2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137835", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule c1ncn(-c2ccc(N[C@@H]3CC[NH2+]C3)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191292", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CC[C@H]1CN(C(=O)Cn2cc([N+](=O)[O-])ccc2=O)CC[C@@H]1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93581", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)[C@@H]1C[C@H]([NH3+])CN1C(=O)c1ccc(C(F)(F)F)nc1[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112857", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule FC(F)Oc1ccc(Br)cc1CNC[C@@H]1COc2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166977", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+]Cc1cnc(N2CCOCC2)nc1)c1ccc(F)c(F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54472", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H]1C[C@@H](NC(=O)Nc2ccccn2)CC[NH+]1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36896", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(C(=O)[O-])c(NC(=O)c2ccccc2OC)cc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136721", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1N1C(=O)/C(=C/c2cc(Cl)cc(Cl)c2OS(C)(=O)=O)SC1=S .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211588", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(N(C)CC[C@H](O)c2ccccc2)c2c(C)nn(C)c2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110288", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cc1cccc([N+](=O)[O-])c1)N1CCC[C@H]1C[C@@H](O)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108201", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(NS(=O)(=O)c2ccc(N3CCOC3=O)cc2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221147", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CC(=O)N1CCC([C@@H]2Nc3ccccc3S(=O)(=O)N2)CC1)n1cncn1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86357", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@](C)(NCc1ccon1)C1CC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137711", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H](C(=O)N1CC[C@@H](Oc2ccc(C(F)(F)F)cn2)C1)n1cncn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7273", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C([O-])c1ccc(S(=O)(=O)[O-])cc1N1C(=O)/C(=C\\C=C\\c2ccccc2)N=C1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188618", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccccc1NC(=O)c1cc2sccc2n1CC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78501", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](NCc1ccnc(O[C@H]2CCOC2)c1)c1ccc(C(F)(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177711", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)n1cnn(C[NH+](CCC(F)(F)F)C2CCCC2)c1=S .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89063", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=[N+]([O-])c1ccc(Nc2cnn(-c3ncccn3)c2)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159830", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@@H]1Cc2ccccc2CN1C(=O)[C@@H]1C[C@@H]1c1ccc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193521", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(C)C)c(OCC(=O)Nn2c(=O)[nH]c3ccccc3c2=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189081", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1ccc(OC/C=C2\\Oc3c(cccc3[N+](=O)[O-])[C@H]2N2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84783", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc2c(c1)O[C@@]1(CCC(=O)N([C@@H](C)C(=O)[O-])CC1)CC2=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196938", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule COc1ccc(CNC(=O)C(=O)N/N=C/c2ccccc2[N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38079", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCNC(=O)c1ccccc1NC(=O)c1ccnc(OC(C)(C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25775", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1cn(C(c2ccccc2)c2ccccc2)nn1)N1CC[NH+](Cc2cccnc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140454", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)Nc1cccc(NC(=O)C(=O)NC2CCCCCC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171964", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCNC(=O)C[NH2+][C@H]1C[C@@H](C)[NH+](C)C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239514", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(CSc1nnc(-c2ccccc2Br)n1Cc1ccccc1)C1=NC=CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25392", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)Nc2ccc(C)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178745", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CCc1ccc(O)cc1)N/N=C/c1cc(Cl)cc(Cl)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106871", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](C)C[C@@H]1CCN(C(=O)c2ccc(C[C@@H]3CC(=O)NC3=O)cc2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139970", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C=CCN(Cc1nc(-c2ccccc2)no1)S(=O)(=O)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7573", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Clc1ccc(OCC2=NN3C(=NN[C@@H]3[C@@H]3C=C(c4ccccc4)N=N3)S2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151759", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC/C(=N/NC(=O)c1ccc(F)cc1)c1cc(Cl)cc(Cl)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175994", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2ccccn2c1C(=O)Nc1ccc2c(c1)N(C(=O)C(C)C)CCC2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108331", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(C)c(C(=O)CSc2nnc(C3CC3)n2-c2ccccc2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc2ccc(N3CCN(Cc4ccccc4N4CCOCC4)CC3)nn12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147135", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C=C/C=C/C(=O)NCc1ccc(S(=O)(=O)NC)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106625", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(C)c1OCC(=O)NC[C@H](C)c1ccsc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152669", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C[C@@](CO)(NC(=O)Nc1ccc(OCc2cccc(C#N)c2)cc1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148301", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule CC(C)(C)OC(=O)N[C@H]1CCCN(c2nc3cc([N+](=O)[O-])ccc3o2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227042", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1cccc(NC(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146784", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc2c(c(C[NH+]3CCC(c4nc(C(F)(F)F)c[nH]4)CC3)c1)O[C@H](C)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116523", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNS(=O)(=O)c1ccc(CNC(=O)N(C[C@@H]2C[C@@H]2C)C(C)C)s1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20940", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](OC(=O)c1cccc(OC[C@@H]2CCCO2)c1)[C@H]1CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117429", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1[nH]c2ccc(C(=O)N[C@H]3CCCOC3)cc2c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238617", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(Nc1ccc2c(c1)OCO2)c1ccccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75061", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C[NH+]2CCC(Oc3cccc(C#N)c3)CC2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27316", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCc1[nH]c([C@H]2C[NH+](C)C[C@@H]2C(=O)N2CCCC2)c(C)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31110", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC/[NH+]=C(/N[C@H]1C[C@@H]1c1cccc(Cl)c1)N[C@@H]1CCC(=O)NC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156620", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c([C@H]2CCCN(C(=O)CCc3cccnc3)C2)n[nH]c1=S by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84283", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)N1CCN(C(=O)c2cccc(OCc3nnnn3C(C)C)c2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213636", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cnn(-c2ncccn2)c1)Nc1ccc(Cl)cc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139904", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C[NH2+]CCc2ccccc2)cc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149169", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule CC(C)=C/C([O-])=N/S(=O)(=O)c1cccc([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140490", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CS(=O)(=O)CCCNC(=O)NCCc1cc(F)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177693", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=O)c2cc(C(=O)N[C@H]3CCOc4ccccc43)cnc2n(C)c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45876", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCCSc1ccccc1C(=O)N1C[C@H](C)O[C@@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103357", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1csc(-c2cccc(C(=O)NC3CC3)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229004", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCC)nn32)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68051", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc([C@H](CO)NC(=O)Cc2ccc(OC)cc2)cc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199768", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccccc1NC(=S)N/N=C1\\C(=O)N(C)c2ccc(S(=O)(=O)N3CCOCC3)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219514", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1nnnc1NCc1c(Cl)cccc1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143948", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1nn(C2CCCCC2)c(N)c1[N+](=O)[O-] by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48464", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C1=NNc2ccc(Cl)cc2S1(=O)=O)N1CCOCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16210", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CO[C@@H]1CCCC[C@H]1[NH2+]CCC(=O)NC1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219599", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(C(=O)NC[C@@H](c2cccs2)S(=O)(=O)c2ccc(Cl)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249226", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)N1CCC(OCc2ccc(F)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50173", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OCc2cccc(C#N)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243124", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Nc1ncnc2c1nc(SCc1ccc3nsnc3c1)n2C[C@H](O)CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23278", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1c(N[C@@H](C)C(=O)Nc2cc(Cl)ccc2Cl)c(=O)n(-c2ccccc2)n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236950", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(C(=O)c1cccc2c1OCCO2)c1cccc2ncccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86283", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(C)nc(N[C@@]2(C(F)(F)F)N=C(O)N(CCc3ccccc3)C2=O)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176313", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)[C@H]1[C@H]2c3ccccc3O[C@]1(C)N=c1s/c(=C\\c3ccccc3OC)c(=O)n12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221327", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1ccc(NC(=O)c2cccc(CN3CCCC3=O)c2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26247", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cccc(OC[C@@H](C)[NH2+][C@H](C)c2cccnc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41286", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCC[NH+](C1CC[NH2+]CC1)C1CC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219845", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ncsc1C(=O)NNC(=O)NC[C@H]1CCC(C)(C)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222426", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule [NH3+][C@@H](Cc1ccc(F)c(Br)c1)c1ccc(Cl)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9500", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1nc(C(=O)OCc2cccc(Cl)c2)c2ccccc2c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67027", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Oc1ccc(Br)cc1)C(=O)Nc1ccc2c(c1)COC2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190276", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1CC(=O)N(Cc2ccc(OC)c(C#CCO)c2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57111", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CSCC[C@@H](C)N(C)C(=O)N[C@H]1CCN(c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62476", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1S(=O)(=O)N1CCO[C@H](c2ccc(F)c(Cl)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82092", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](Cc1ccc(C)cc1)NC(=O)c1ccc2c(c1)OCC(=O)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239247", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(CNC(=O)[C@@H]2CCCN(c3ccc(-c4cccs4)nn3)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196107", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=CCOc1c(OC)cccc1[C@@H]1CC(=O)Nc2c(-c3ccccc3)csc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22946", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)c1c(NC(=O)c2cc(-c3ccccc3O)[nH]n2)sc2c1CCCC2 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142883", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(N2CCN(C)C(=O)C2(C)C)c([C@@H](C)[NH3+])cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24064", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1cc(Br)ccc1C(=O)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48789", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN(CC)C(=O)c1ccc2c(c1)N(CC(=O)Nc1ccc(Cl)cc1)C(=O)CS2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120203", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccccc1N1C[C@@H](C(=O)Nc2ccc([N+](=O)[O-])cc2OC)CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249104", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccc2oc3ccccc3c2c1)Nc1ccc2c(c1)OCCO2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230624", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(=O)oc2cc(NC(=O)c3cc(OC)c(OC)c(OC)c3)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47215", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]1CC(C(=O)N2CCCC[C@@H]2c2ncc(-c3cccc(F)c3)[nH]2)C[C@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8134", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN1C(=O)COc2ccc(NC(=O)C(=O)NCCc3c[nH]c4ccccc34)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187323", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)OC(=O)c1cc2c(ccn2-c2ccc(F)cc2)n1C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116969", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CCCCN1C(=O)C[NH+](CC(=O)N1CCCC[C@@H]1C)Cc1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170996", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@H](O)[C@H](C)[NH2+]C(C)(C)CC(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105663", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(OCC(=O)N/N=C/c2ccc(O)c([N+](=O)[O-])c2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223392", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule N#C[C@H](C(=O)[C@@H]1CCC(=O)N1C(=O)c1ccc(Cl)cc1)c1nc2cc(C(F)(F)F)ccc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34671", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=CCN(C(=O)Cc1ccc(C)cc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197618", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)Nc1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191432", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)[C@H](C)Sc2c([O-])on[n+]2-c2ccccc2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52098", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C/C(=N/NC(=O)c1ccc(O)cc1)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4602", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C[C@H](O)c1ccc(F)c(F)c1)[C@@H](CCO)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53083", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)CCNC(=O)[C@@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2c3ccccc3C(=O)N12)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27869", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(NC(=O)c2ncccc2C(F)(F)F)cc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227027", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3745", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(CNC(=O)C(c1ccccc1)c1ccccc1)N/N=C/c1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111840", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(C2CC2)nc2cc(NC(=O)C(=O)N[C@@H]3CCCC[C@H]3CO)ccc21 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77021", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCOC1CC[NH+](CC[C@H]2CCC[C@H]2O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203863", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CN1CCN(Cc2ccc(F)cc2Cl)C1=O)NCc1cccs1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113310", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C)c(CNC(=O)N[C@@H](CO)c2ccc(Cl)cc2)s1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188391", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc2c(cc1OC)CN(C(=O)CSc1nnc([C@@H]3COc4ccccc4O3)n1C)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133732", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(/C=C2/C(=N)N3C(c4ccccc4)=CSC3=NC2=O)c(C)n1-c1ccc(F)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225286", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](N[C@@H]1N=NC(=O)NC1=O)C(=O)N/N=C/c1ccc(Cl)cc1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82720", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOc1ccc(N)cc1C[NH+](CC)Cc1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212976", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@H](C)NC(=O)N2C[C@@H](C)O[C@H](c3ccccc3)C2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196847", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc([C@H](NC(=O)c2cnn(C(C)C)c2C)C2CC2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84438", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@H](CO)[NH2+][C@@H](C)C(=O)N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184099", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(OCC[C@@H]2CCC[C@@]2([NH3+])CO)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43626", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](CNC(=O)c1occc1Br)Oc1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50725", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-n2ncc(NCCNC(=O)c3ccccc3Cl)c(Cl)c2=O)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197696", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCSC[C@@H](C)N(C)C(=O)N[C@@H](C)c1nnnn1-c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82383", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cn2nnnc2[C@H](c2cc3ccc(C)cc3[nH]c2=O)N2CCc3ccccc32)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88519", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC(=O)Nc1ccc(Cl)cc1)S(=O)(=O)c1ccc2c(c1)c(=O)n(C)c(=O)n2C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96907", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O[C@]12CCCC[C@@H]1C[NH+](Cc1ncccc1C(F)(F)F)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30780", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CCCC[C@H]1n1ccc2nc3ccn(CCc4ccccc4)c(=O)c3cc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133997", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC[C@H]([NH2+][C@H](CO)c1ccc(Cl)cc1)c1ccc2c(c1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113282", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@]1(N(C)C)C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224140", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(C(=O)NC2CCCCCC2)cc2cc(S(=O)(=O)N(C)C)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207367", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCOc1ccc([C@H]([NH3+])CC(=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10234", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1csc(S(=O)(=O)N2CCc3ccccc3C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16395", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C/N=C1/S/C(=C\\C(=O)Nc2ccc(Cl)cc2)C(=O)N1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189170", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COC(=O)[C@H]1ON2CCCC[C@H]2[C@]1(O)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70665", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1cccc(F)c1)N1CCC[C@@H](c2[nH]cc[nH+]2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88836", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COC(=O)[C@@H]1C[C@H](O)CN1Cc1ccc(Br)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179327", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc(NC(=O)c2ccc(N(C)C)cc2)c(Cl)cc1NC(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90759", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1[NH+]1CCC([NH2+]CCCNC(=O)c2ccc(F)cc2)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46206", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule O=[N+]([O-])c1cc(C(F)(F)F)cc(Cl)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125494", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccc(NC(=S)N(Cc2cccc(F)c2)C[C@H]2CCCO2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29373", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Fc1ccccc1C[NH2+]CCC[NH+]1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112522", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccccc1-n1cc([O-])c(C(=O)N(C)CC(C)(C)O)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245183", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)NC[C@@H]1CCCCN1C(=O)c1ccc(C#N)cc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105456", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(Cl)ncc1NC(=O)N1CC[C@H](C)[C@H](O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147888", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Nc2c(C(=O)N3CCCC3)cnc3nc(C)ccc23)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128764", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)C(C)(C)NC(=O)c1ccc(-c2cccc(Br)c2)nc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236814", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccc(CC(=O)N2C[C@@H]3CCCC[C@H]3C2)cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86602", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1nn(C)cc1C(=O)N1CCC[C@H](C(=O)N2CC[NH+](C3CCCCC3)CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45618", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H]([NH2+]Cc2ccn(-c3ccccc3)n2)CN1c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32155", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C[C@@H](Nc1ncccc1C#N)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19234", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(CSc3nnc(-c4ccc(OC(F)F)cc4)o3)cc(=O)oc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113150", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C=C/C=C/C(=O)NNC(=O)[C@@H](C)Oc1ccccc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80554", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nnco2)cc1NC(=O)N1CC[C@@H]2CCCC[C@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5436", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]1C(=O)N[C@](C)(CC)C(=O)N1CC(C)(C)S(C)(=O)=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100253", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)[C@@H](CO)NC(=O)Cc1c(F)cccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130614", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH+]1CCc2c(sc(NC(=O)c3ccnn3C)c2C(=O)OC)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15435", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)C[C@H](C[NH3+])N(C)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16581", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1cccc(CN2CCN(c3ccnc(OC)c3C#N)C[C@@H]2CCO)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150294", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)[C@H](C)n2nc(-c3ccco3)oc2=O)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152290", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1C[C@@H](O)COc1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42803", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN1CCN(C(=O)CC[C@@H]2CCCN(C(=O)CCCc3ccccc3)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84557", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=C(c1ccccc1)[C@@H]([C@H](c1ccccc1)c1c[nH]c2ccccc12)[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87231", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[C@H](C)[C@@H](O)[C@]1(C[NH3+])CCc2ccccc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57683", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1n[nH]c2cc(NC(=O)[C@@H](c3ccccc3)N3CCCCC3=O)ccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128233", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule COCC[NH2+]CC(=O)Nc1cccc([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137709", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)[C@H](C(=O)[O-])[C@H]1C(=O)Nc1ccc(C(=O)Nc2cccnc2)c(Cl)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94342", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H]1CCC[C@@H](NC(=O)C(=O)Nc2ccccc2OCC2CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213105", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)CCOc1ccc(NC(=O)Nc2cccc(-c3nnco3)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181601", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@@H]([NH+](CC(=O)[O-])CC(F)(F)F)CC[C@H]1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131872", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCn1c(S[C@H](C)C(=O)N[C@@H]2CCCC[C@@H]2C)nc2sc(C)c(C)c2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192165", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(/C=C2\\S/C(=N/N=C/c3ccco3)NC2=O)ccc1O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184770", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH+]1CC[C@@H](NC(=O)[C@@H]2CCOc3ccccc32)[C@@H]1c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155820", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H](NC(=O)c1cc(OC)ccc1Br)C(=O)OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5363", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1CN(C(=O)c2nn(Cc3ccccc3)c3c2CN(C(=O)[C@H]2CC24CCCCC4)CC3)CCN1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36935", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1cc(NC(=O)N(CCO)C2CC2)ccc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234291", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[NH+]1CCCCC[C@H]1C(=O)N1CCN(c2ccccc2C#N)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27491", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1n[nH]c(N/N=C\\c2ccccc2)nc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72883", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C[C@H](c2cccc(F)c2)n2cccc2)cc1F by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8730", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCCN(c1ccccc1)S(C)(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241789", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1c(C(=O)N2CCC[C@@H](C(C)(C)C(=O)OC)C2)[nH]c(C)c1C(C)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22297", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Oc1ccc(CNc2cc(-c3ccc(F)cc3)nc3ccnn23)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161175", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[NH+]1CCN(c2ccccc2C[NH+](C)[C@H]2CCCc3c2cnn3C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226003", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[C@@H]1CC(=O)Oc2ccccc21)Nc1ccc2[nH]ccc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177580", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(O)c(-c2nc([C@H]3C[NH+]4CCN3CC4)no2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40062", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)Nc1cccc(NC(=O)CSc2nnnn2-c2cc(C)ccc2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8622", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cccc(/C=C/[NH+](C)C)c1[N+](=O)[O-] by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107125", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](O)[C@H]1CCCC[NH+]1Cc1ccc(F)cc1C#N by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169066", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccccc1NC(=O)[C@H](C)[NH+]1CCCSCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175843", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc2nc(S/C(=C\\c3ccc(O)cc3)C(=O)[O-])[nH]c2cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137040", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc([C@H](C)C(=O)N(C)CCC2CCN(c3cc[nH+]cc3)CC2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100256", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule N#Cc1ccsc1NC(=O)CSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107523", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)N1CCN(C(=O)C(=O)NCC2CCN(C(=O)c3ccccn3)CC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242678", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1C[C@@H](NC(=O)N2CCC[C@@H]2C[NH+]2CCCCC2)CN1C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95593", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN1CCN(C(=O)c2cccn(Cc3ccc(C(F)(F)F)cc3)c2=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22400", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule c1cnc(Oc2ccc(CN3CCCC[C@@H]3c3[nH]cc[nH+]3)cc2)cn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212434", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCCOc1cccc(NC(=O)N[C@@H](C)c2c(C)noc2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115914", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(NC(=O)[C@H]2Sc3nnc(CC)n3N[C@@H]2c2ccc(OC)c(Cl)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61049", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1csc([C@@H](C)NC(=O)C[C@@H](NC(N)=O)c2cccs2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238387", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)c1cc(NC(=O)C(C)(C)F)ccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179768", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cnc2ccccc2n1)c1cc2c([nH]c1=O)CCCC2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99537", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule N#CC1=C(N)Oc2cc(O)ccc2[C@@H]1c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206149", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc(C[NH+]2CC[C@@H](COCc3ccccc3)C2)o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226632", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(Oc1ccccc1C(F)(F)F)c1cc(F)ccc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48965", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH2+]=C([C@@H]1CSCCO1)N1CCCC1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215934", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=C(C[C@H]1CCCCO1)N1CCCc2cccc(O)c21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212176", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(C(=O)Nc2ccc3c(C(C)(C)C)cc(=O)[nH]c3c2)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133548", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(C[NH+]1CCC[C@H](c2nc3ccccc3o2)C1)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206606", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCc1ccccc1NC(=O)NC[C@@H](O)c1ccc2ccccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8874", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@H](O)[C@@H]1CCC[NH+](CCc2ccc3c(c2)CCO3)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124547", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CON(C)S(=O)(=O)c1cccc(C(=O)Nc2ccc(C)cc2F)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42977", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC[C@@H](NS(=O)(=O)c1cc(C)c(C)cc1[N+](=O)[O-])c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68771", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](Oc1ccccc1)C(=O)NCc1ccc(C(=O)N2CC[NH+](C)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156977", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@@H](C[C@@H]1CCC[NH2+]1)Nc1cnc2ccccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73112", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule c1cnc(CNC[C@@H]2CCC[NH2+]2)cn1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6758", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule CCN(c1ncnc(NC[C@H]2CCCO2)c1[N+](=O)[O-])c1cccc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62495", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccc(C(=O)N2CCC3(CCC(=O)N(CC(=O)[O-])C3)CC2)cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193258", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)(C)C(=O)NCC(=O)OC(c1ccccc1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76375", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1c(C(=O)N2CCCCC2)c(S(=O)(=O)NCc2ccc3c(c2)OCO3)c(C)n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120590", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccnc(NC(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243734", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)[C@@H]1CN(C(=O)[C@@H]2CCC[NH+]2Cc2ccc(F)cc2)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213350", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN([C@H](C)c2ccc(Cl)s2)C(=O)NC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205260", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(c1cnn2c1N[C@H](c1ccccc1)C[C@H]2C(F)(F)F)N1CC[NH+](Cc2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22662", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1cccc(/C=N\\NC(=O)[C@H]2COc3cc4ccccc4cc3O2)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121507", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)c1nnnn1CC(=O)NCCc1ccc(N(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(OCC(=O)[C@H](C#N)c2ccc(F)cn2)ccc1[N+](=O)[O-] by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53940", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1cc([C@H](NC(=O)CCC[NH3+])c2ccc(F)cc2)c2cc[nH+]cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19135", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(=O)c1sc(NC(=O)c2ccc(Cl)s2)nc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35661", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule N[C@H](Cc1ccccc1)C(=O)N1CCn2nc(CCC(=O)NC3CC3)cc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161331", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(/C([O-])=N/S(=O)(=O)c2sc(C)nc2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145256", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1CC[C@]2(CCCN(c3cnccn3)C2)CN1CCc1c[nH]c[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221407", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccc(-c2n[nH]c(SCc3cc(=O)n4ccsc4n3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103491", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCSc1ccccc1NCc1ccc([O-])c[nH+]1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135235", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Nc1cccc(Cl)c1)c1nnc([C@H]2CCCN(C(=O)c3cccc(F)c3)C2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)CCC(=O)NCC1CCN(c2cc[nH+]cc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106789", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)(C)c1nnc(C[NH+]2CCCC[C@@H]2CCc2ccccc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178759", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)[NH+](CC2CC2)CC[C@]314 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31381", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](CC(=O)Nc1c(C)cc(C)cc1C)[C@H]1CCS(=O)(=O)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52263", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(NC(=O)C(=O)N[C@H]2CC[C@@H]([NH+](C)C)C2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136775", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@]1(CO)CCC[C@@H]([NH+]2C[C@@H](C)CC[C@H]2C)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101471", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc2c(cc1CN1CCO[C@@H](c3ccc(F)cc3)C1)OCCCO2 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215485", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)N2CCN(C(=O)[C@H](C)Sc3ccccn3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141846", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cccc(C)c1OCC(=O)/N=C1/NCCS1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76646", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1oc(-c2cccs2)nn1CN1CCN(c2ncccc2F)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155425", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[NH2+][C@@H](c1ccc(F)c(F)c1)[C@H](C)OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58330", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H](NC(=O)Cc1ccc(C)c(O)c1)C(C)(C)C by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89487", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(COC1CCCCC1)NC1CC[NH+](CCc2ccncc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7318", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2n(n1)C[C@@H]([NH2+]Cc1cn(-c3ccccc3)nn1)CC2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4572", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NCCCn1cccc1)c1c(F)cccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229843", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=[N+]([O-])c1ccc(-c2nc(CN3CC[NH+]4CCCC[C@@H]4C3)co2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183162", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccccc1CNC(=O)Nc1ccc(OC)cc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114270", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([C@H](c2ccccc2Cl)N2CC[NH+](C)CC2)c(NC(=O)c2ccco2)s1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34820", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "864", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccccc1NC(=O)c1cc(S(=O)(=O)N2CCCC2)cn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43103", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOC(=O)C1=C(CC)NC2=C(C(=O)CCC2)[C@@H]1c1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79488", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cn1cc(C[NH+]2CCC[C@H](O)C2)c(-c2ccccc2F)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc(OCc2nnc(S)n2C)cc1 by removing a thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204679", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)NCCCNC(=O)C(C)(C)C)cn1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211949", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC1=CC=CC2=[NH+][C@@H](c3ccc(C)cc3)CN12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129110", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN(C(C)=O)c1nc(Cn2nc(C(C)(C)C)ccc2=O)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208864", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](CC(=O)[O-])Sc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174868", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule C=CCN(C(=O)Cc1ccc(C)nc1)c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216827", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1cccc(NC(=O)c2ccc3c(c2)C(=O)N(CCCc2ccccc2)C3=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231358", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCSC[C@H]([NH3+])c1cc(OC)cc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216266", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule FC(F)(F)CCn1c(=S)[nH]c2cc(Br)cnc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84347", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1ccnc1SCc1cccc(NC(=O)OC(C)(C)C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127918", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1COC2(CCN(C(=O)NCC3(c4ccccc4)CCC3)CC2)O1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132090", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)CSc1nnc(-c2ccc(F)cc2)o1)c1ccc2c(c1)CCCC2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12906", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)C(=O)CSc1nnc(-c2ccncc2)n1-c1ccccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58362", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CS[C@H]1CC[C@H](NC(=O)c2ccccc2OC2CCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218097", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2nc(S[C@@H](C)C(=O)Nc3nccs3)[nH]c2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110659", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](c1nc2ccccc2s1)N1CC[NH+](CC(=O)N2CCCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52081", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[NH2+][C@]1(C(N)=O)CCC[C@H]1CCSC1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62441", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule c1ccc2c(c1)OC[C@H]2CNCc1cc2c(s1)CCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191276", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccc([C@@H](C)NC(=O)[C@H](C)Oc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237220", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOCCn1/c(=N/C(=O)Cc2cccs2)sc2cc(S(N)(=O)=O)ccc21 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240685", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)[C@@H]1CCCN1C1CC[NH+](CCCNC(=O)C(F)(F)F)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45151", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1c([C@H](C)[NH2+]Cc2cnn(-c3ccccc3)c2)cnn1-c1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149108", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(S(=O)(=O)NCc2nc(-c3ccccc3)no2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110208", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=S)N2CCN(C/C=C/c3ccccc3)CC2)c(C)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89346", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3520", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COc1ccc(/C=C(\\C#N)C(=O)N(C)C)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136916", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCN(C(=O)[C@H]1C[C@H]2CC[C@@H]1O2)c1ccc(C)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244571", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N/C(=C\\c2cn(Cc3ccc(F)cc3)c3ccccc23)C(=O)N1Cc1ccccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185698", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)N1CC[C@H](COc2nc3cc([N+](=O)[O-])ccc3o2)C1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94684", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H]2CC(=O)N(Cc3ccco3)C2)nc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131461", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc(C[C@@H](C)NC(=O)c2ccccc2C(C)=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110896", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc(N2C(=O)S[C@H](Nc3cccc(F)c3)C2=O)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72728", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1ccc(N2CCCC2=O)cc1)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190903", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2nc(N(C[C@@H]3CCCO3)C(=O)CCS(=O)(=O)c3ccccc3)sc2c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110633", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(/C=C/c1ccc(O)cc1)NC[C@@H]1CC[C@H](C(=O)[O-])O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23946", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN1CCn2c([nH+]c3cc([N-]S(=O)(=O)c4ccc(Cl)cc4)ccc32)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186254", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)[C@@H]1CN(C(C)=O)C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37472", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cn2c(N)c3ccccc3nc2=S)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143099", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1CCC(C(=O)N2CCC(c3[nH+]ccn3Cc3ccccn3)CC2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75085", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc2cc(CN3CCn4c(nnc4C(F)(F)F)C3)oc2cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150354", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)[NH2+]Cc1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24244", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)C(=O)N2CCC([NH+]3CCCC3)CC2)c(Cl)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142155", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)COc1ccccc1F)c1cccc(C#N)c1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138494", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)[C@@H]1CCCN(C(N)=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19342", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1C[C@H](C(=O)Nc2ccc(F)cc2F)[C@@H]2C(=O)N=C(SCc3ccccc3F)N=C2N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88720", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)COC(=O)c1ccc(NC(=O)[C@H]2[C@@H](C(=O)[O-])[C@@H]3C=C[C@H]2C3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82825", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccc(NC(=O)c2cc(OC)no2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235033", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)NS(=O)(=O)c1ccc(NC(=O)c2ccc(C)c(Br)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39461", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC)C(=O)c1cccc(S(=O)(=O)NC2CC2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172472", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(C)c(S(=O)(=O)N2CCC([NH+]3CCCCC3)CC2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58454", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](NC(=O)c1ccc(N)cc1)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208313", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(C[C@H]([NH3+])CSc2ccccc2Cl)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246370", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H](CNC(=O)N1CC[C@@H]([N+]2=CCCC2)C1)[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222631", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC)C(=O)Cn1cc(Br)c(=O)[nH]c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201378", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(-c2nccs2)cc1)c1ccccc1I by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111072", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1CCC(C(=O)N2CCOC[C@@H]2C[NH+](C)C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19937", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(Cc1cnn(-c2ccccc2)c1)S(=O)(=O)c1cccc(OC(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38838", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)Cc1noc(-c2coc3ccccc23)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170865", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nc(C)c([C@H](C)OC(=O)Cc2ccc(N3CCCC3=O)cc2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23086", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCC[NH+](C1CC1)C1(CN)CCN(C(C)C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53632", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C[C@H](C)CNC(=O)c2ccc(C(N)=O)cn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202236", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CNC(=O)[C@H]2CCCN(C(=O)NC3CC3)C2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136578", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(N=c1[nH]c2ccccc2[nH]1)c1cc(Cl)ccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3096", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@@H]1CCC[C@](CO)(Nc2nc3cc(N)ccc3o2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211253", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule NC(=O)N1CCC[C@@H](C(=O)Nc2ccccc2C(=O)NCC(F)(F)F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218387", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC1(C)CC(NC(=O)N2CCN(C(=O)c3ccc(O)cc3)CC2)CC(C)(C)[NH2+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24420", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccccc1-n1cc(CN(C)C(=O)[C@H]2CCCCC[NH+]2C)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216438", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(-n2c(N)c(C(=O)Nc3cccc(F)c3)sc2=S)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77743", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(C)c(C(=O)Nc2cccc(NC(=O)NCc3ccncc3)c2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241348", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)[C@H](C)c2cccs2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162563", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1)c1ccccc1Br by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41279", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1cc[nH+]c1CNC(=O)CCc1cc(Cl)ccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35500", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(C=O)cc(Cl)c1O[C@@H](C)[C@H](C)O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196774", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(NC(=O)[C@@H]2C[C@@H]2c2ccccc2)n(-c2ccc(F)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C(=O)N2CCCc3cc(NC(=O)C(=O)NCC4(c5cccs5)CCOCC4)cc1c32 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21157", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COCC1CCN(C(=O)N[C@H]2CCCN(c3ccc(C)cc3)C2=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207085", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](C)NC(=O)N1CCN(Cc2cc(OC)cc(OC)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86481", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(N2CCN(C(=O)CCc3n[nH]c4c3CCCC4)CC2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24080", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N/N=C\\c1ccccc1Br)c1ccc(O)cc1O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33657", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1ccc(C(=O)Nc2ccnc(C(=O)N(C)C)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117403", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCC(=O)N1CC[C@@H]2CCCC[C@H]21)c1cc2ccccc2[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60726", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSC(=S)N(C)NC(=O)c1ncccn1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191143", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCN(C(C)(C)C(=O)NCC2(c3ccc(F)cc3)CCC2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151907", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[C@@H](C)[C@@](C)(O)C[NH2+]Cc1ncc(-c2ccccc2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215593", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(Cl)c(C)cc1NC(=O)N[C@@H]1CC[C@H]([NH+](C)C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79834", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCc1cc2c(N[C@@H](C)c3cccc(S(=O)(=O)NC)c3)ncnc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54444", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCOCCCC(=O)N1c2ccc(N)cc2C[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178302", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCc1nn(C)cc1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59094", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(OCC(=O)Nc2ccc3c(c2)nc(C[NH+]2CCCCC2)n3C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75952", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1nccc(N[C@H](C)CCC[NH3+])n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51045", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(CNC(=O)c1ccoc1)Nc1cc(C(F)(F)F)c[nH]c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6391", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1ncnc1-c1c(-c2ccccc2)ncn1[C@@H](C)Cc1cc(C)n[nH]1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97168", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@](O)(CNC(=O)CC1([NH3+])CCC1)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67065", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)C[NH2+][C@@H](C)c3cccc(F)c3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117954", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCN(CC(=O)[O-])C(=O)C1C[NH2+]C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92208", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1[C@H]2C[C@@H](Br)[C@H](Br)C[C@@H]2C(=O)N1c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100696", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccc(-n2ncc3c(N4CCCc5ccccc54)ncnc32)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108658", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nn(CC[C@H]2CCC[C@]2(CO)[NH2+]C2CC2)c(C)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61829", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCNc1nc(NCC)nc(Nc2ccc(C)c(C)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9987", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1626", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@H](C)NC(=O)CS(=O)(=O)[C@@H](C)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189635", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1/c(=N/C(=O)c2ccccc2O)[nH]c2cc(Cl)ccc21 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89313", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H](CCl)C[C@H]1COc2ccccc21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203983", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-n2nnc(C(=O)NCc3ccccc3)c2C(C)C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93111", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(C1CCN(C[C@@H]2CCC[NH+]3CCCC[C@@H]23)CC1)N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21012", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CC[C@H](N(C)Cc2cccc(C(F)(F)F)c2)[C@H](C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52598", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)N[C@@H](CC(=O)N(C)CC(=O)Nc1c(C)cccc1C)c1ccc(C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186516", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H](C)CN(Cc1ccccc1)C(=O)c1ccc2n[nH]c(=O)n2c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229852", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1CC[NH+]([C@H](C)C(=O)Nc2cccc(C#N)c2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161951", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](C)Sc1cccc(F)c1C(N)=[NH2+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171258", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)(C)Oc1ccc(Cl)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88727", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCn1nnc(NCc2ccc(C)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150038", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(-c2nnc(NC(=O)c3ccc(Cl)cc3)o2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72188", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule C[C@H](CC#N)[NH+](C)Cc1ccc(Cl)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117919", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc(/C(C#N)=C/c2ccccc2OCC(=O)Nc2ccccc2)n1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125903", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccnc(Nc2ccc(N(C)C)[nH+]c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77399", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N[C@H](C)C2CC2)cc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177129", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)NCc2ccccc2S(=O)(=O)N(C)C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38802", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(NC(=O)C(=O)N/N=C/c2cc([N+](=O)[O-])ccc2[O-])c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242184", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Cc1ccc(C[C@@H](C)Nc2ccc([N+](=O)[O-])cc2S(N)(=O)=O)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159594", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)n1cc(CN2CCN(CC#N)CC2)c(-c2ccccc2Cl)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158945", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)NC2CC2)cc1NC(=O)c1cc(C)n(C2CC2)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175829", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@H](C)OCC(=O)Nc1cn(C)nc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc(C(=O)NC[C@H](c2ccc(F)cc2)[NH+](C)C)cn1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219008", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccccc1NCc1cn(-c2ccccc2)nn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21903", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccsc1C(=O)N[C@@H](CC(C)C)C(=O)N(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86340", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN(Cc1cnn(C)c1)S(=O)(=O)c1cc(Cl)c(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164156", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCC(=O)N1CCN(c2ccc(NC(=O)COc3ccc(C)cc3)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11262", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(c1)[C@]1(CCN(C(=O)CC(C)C)C1)C(=O)N2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200465", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](CC)c1ccc(NC(=O)[C@H](C)Oc2ccc(C)cc2C)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73855", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](Cc1ccc(C)cc1)N(C)C(=O)Cc1nc2nc(C)cc(C)n2n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6538", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC(C(=O)N2CCCSc3ccc(Cl)cc32)C[C@@H](C)O1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26912", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)CCNC(=O)N[C@@H](c1ccccc1)c1ccccn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81715", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Nc1nc(CCNC(=O)c2ccc(C[NH+]3CCCCC3)cc2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138847", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C[NH+]2C[C@@H]3CC[C@H](C2)N(C(=O)c2oc(C)nc2C)C3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194256", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1cc(NCc2ccc(C(=O)OC)o2)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45504", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule CN(CCc1ccccc1Cl)c1ncc([N+](=O)[O-])s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101414", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)[C@H]2[C@@H]3C(=O)N(c4cc(C)on4)C[C@]34C=C[C@H]2O4)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8747", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)CCN(CC(=O)N1CCNCC1)C(=O)c1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239180", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cn(-c2ccccc2)nc1C(=O)OCC(=O)N1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68048", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)OCC(=O)NCc2cccc(C)c2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38874", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC1(CNC(=O)CNC(=O)c2ccc(F)c(F)c2)CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137039", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)NCc1cn(-c2ccccc2)nc1-c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135911", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cccc(C)c1NC(=O)NCC1CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13859", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H]1CCCCN1C(=O)NCc1ccc(F)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236810", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCC(=O)N1CCC(c2nc3ccccc3s2)CC1)c1ccc2ccccc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144829", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cc1ccc2c(c1)OCO2)N1CCC[C@H]1c1nc(-c2ccccn2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191684", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(OCCn2cnc3ccc(Cl)cc3c2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105797", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(CC1CCCCC1)NCc1nc2ccccc2[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235339", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule N#Cc1cc([N+](=O)[O-])ccc1Sc1nc(-c2ccccc2F)n[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21939", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1cnc(-n2nc(C)cc2C)nc1Nc1ccc(C)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96538", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C1[C@@H]2ON(c3ccccc3)[C@@H](c3cccs3)[C@H]2C(=O)N1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204050", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+][C@](C)(CN1C[C@@H]2CCCC[NH+]2C[C@@H]1C)C(N)=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159839", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(=O)N1CCC([NH2+][C@H](CC(F)(F)F)c2ccc(F)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131690", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc(OC)c1C(=O)Nc1ccc(C(=O)NC[C@@H]2CCCO2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17245", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1S(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc3ncn(C)c3c2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)c(NC(=O)[C@@H]2CC(O)=Nc3nncn32)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140597", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(OC)c(NS(=O)(=O)c2cc(C(=O)N3CCC3)ccc2C)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181971", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](NC(=O)NCCS(=O)(=O)C(C)(C)C)c1ccc(C)c(F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242948", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(OC)c(CN2CCN(C(=O)C[C@H](C)c3ccccc3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43857", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)N2CCC[C@@H]2c2nnc3ccccn23)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140570", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCc1ccc(C(=O)Nc2nc(-c3cccc(C(F)(F)F)c3)cs2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126481", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1cc(NC(=O)/C=C/c2ccco2)cc(C(=O)[O-])c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71990", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(NC(=O)[C@@H]1CCC(=O)N(C2CCCC2)C1)C12CC3CC(CC(C3)C1)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79050", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)c1ccc(C(=O)Oc2ccc(N3CCCC3)cc2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234522", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cccc(Cl)c1CSC1=N[C@@H]2CCCC[C@@H]2N1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46313", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1ccc(NC(=O)COC(=O)c2c3c(nc4ccccc24)/C(=C/c2ccc(O)cc2)CC3)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77890", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@@H](C)CN(C(=O)C[NH+](CCC#N)CC(C)(C)C)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25236", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(CCS(=O)(=O)c1ccccc1)N1CCN(c2nc3ccc(OC(F)(F)F)cc3s2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120649", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOc1ccc(-n2ncc(C(=O)N[C@H]3CCCCC[C@H]3C(=O)OC)c2C)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120257", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC(NC(=O)CSc2nc([O-])c3cnn(-c4cccc(Cl)c4)c3n2)=NO1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99862", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN1C(=O)COc2ccc(C(=O)Cn3nnc4ccccc43)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166553", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CC[NH+]1CCN(c2ccccc2)CC1)NNC(=O)Nc1cccc(C(F)(F)F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162654", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCC(=CC(=O)Nc1nccs1)CCC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56360", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc([C@H]2CCCCN2C(=O)[C@@H]2CCOc3ccccc32)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222333", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[NH+](Cc1ccc(Br)cc1)Cc1nnc(-c2cccs2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56758", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1ncccc1C(F)(F)F)N1CC[C@H](Oc2cccnc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134573", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(/C=N/NC(=O)c2cccc(F)c2)c(Br)c(Br)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78814", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(CC)S(=O)(=O)/N=C(\\[O-])[C@@H]1CCC[C@@H](C(F)(F)F)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(/C=C2\\SC(S)=NC2=O)c(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23483", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1[C@@H](C)NC(=O)N1CCC(OCc2ccccc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48141", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C=C1c2ccccc2C(=O)N1CCC(=O)N1CCc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33920", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CN1CCO[C@@H](CNC(=O)c2ccc[nH]c2=O)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26892", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC1(NC(=O)c2cc3cc(F)ccc3oc2=O)Cc2ccccc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156757", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH+](CCC#N)[C@@H]1CCOC2(CCOCC2)C1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132341", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(c1ccc(CSc2nc3ccncc3n2Cc2ccccc2F)cc1)N1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157944", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nn(C)c(Cl)c1CS(=O)(=O)c1ccc([N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8740", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCC(C(=O)N[C@@H]2CCCc3nc(-c4cccnc4)ncc32)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33019", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(-n2c(C)cc(/C=C/C(=O)N3CCC[C@@H]3c3ccccc3)c2C)no1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29719", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N([C@@H](C)/C(O)=N/C[C@H]2CCCO2)C(=O)[C@@]31C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164587", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccc(Br)cc1CNc1cnccc1C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162689", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=S(=O)(c1cccc(C(F)(F)F)c1)N(Cc1ccsc1)Cc1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147011", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Fc1ccc2c(c1)[C@@H]([NH2+]Cc1cccc(OCC(F)F)c1)CCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)NC(=O)[C@H]1CSCN1C(=O)Cc1ccc2c(c1)CCO2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188512", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2ccc(N(C)C(=O)[C@@H](C)NC(=O)C(C)(C)C)cc2s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6751", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c(C(=O)C[C@@H]2c3c(cc4c(c3OC)OCO4)CC[NH+]2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148356", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(CS/C(N)=[NH+]/C(C)(C)C)cc(=O)oc2c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35327", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(CNC(=O)c2ccc(-c3ccccc3)cc2)c(C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19604", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nc(C)c(CNC(=O)Nc2ccc(OC(C)C)cc2C)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72048", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)NC(=O)[C@@H](C)N1CCc2onc(-c3ccc(C(F)(F)F)cc3)c2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53044", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nn(CCCNC(=O)Nc2ccccc2C(F)(F)F)c(C)c1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104304", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)NC(C)(C)C(=O)NCC[C@H](O)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61747", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(OC[C@@H](O)Cn2c([C@@H]3CC(=O)N(c4ccccc4C)C3)nc3ccccc32)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149342", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cn1c(Cc2ccccc2)nn(-c2ccc(Cl)cc2)c1=O)NC1CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206596", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1cnc2ccccc2n1)c1cc2cc(F)ccc2oc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51886", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=C(Nc1ccccc1)Nc1ccc(NC(=O)c2cccc([N+](=O)[O-])c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120080", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(/C([O-])=N/S(=O)(=O)c2ccc(C#N)cc2)cc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186816", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=S)N/N=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66330", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc(C[C@H](O)[C@@H]2CCCc3cccnc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166417", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccnc(N[C@@H]2CCc3cc(N)ccc32)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212405", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nc(CN2CCN(c3ncc(Cl)cc3Cl)CC2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131279", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(C)c(C(=O)N2CCc3c([nH]c4ccccc34)C2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76590", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule Cc1cc(O)c(C[NH+]2C[C@@H](C)C[C@H](C)C2)c2c1C(=O)/C(=C\\c1ccc([N+](=O)[O-])cc1)O2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227355", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)Nc2cccc3[nH]cnc23)cc1[N+](=O)[O-] by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224844", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CNc1ccc(/C=C/C(=O)c2ccc(SC)c(OC)c2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99515", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(C)S(=O)(=O)N1CCN(CC(=O)N2CCCC[C@H]2C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217048", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H]1C[C@H]1Nc1nc(Br)cn2ccnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111443", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H](C)C(=O)Nc1cccc(NC(=O)c2ccco2)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccn(COc2ccc(Br)cc2)n1)N1CCCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51993", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule COc1ccc(/C=N/NC(=O)COc2ccccc2C)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123719", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1CC[NH+](C[C@@H]2CCCN(C(=O)N[C@H](C)CC(=O)NC(C)C)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247258", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(F)cc1CSCc1nc(CC(C)C)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177877", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1c([O-])nc(SCC(=O)Nc2nccs2)n(-c2ccc(F)cc2)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99225", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule N[C@]1(C(=O)[O-])CC[C@@H]([NH+]2CCC(C(F)(F)F)CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136498", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC1(C)c2[nH]c3ccccc3c2C[C@@H]2C(=O)N(C3CCCC3)CC(=O)N21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74675", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1[C@@H](NC(=O)/C=C/c1cnn(C)c1C)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185507", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(/C=C/c1ccc2c(c1)OCO2)NNC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96474", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1ccc(CC(=O)Nc2ccccc2C2[NH+]=c3ccccc3=[NH+]2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24339", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=Cc1c(C)nn(-c2ccccc2)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120026", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCn1c2ccccc2c2cc(NC(=O)c3ccc(F)c(S(=O)(=O)N4CCOCC4)c3)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127469", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule O=C(c1ccccc1Cl)N1N=C(C(F)(F)F)C[C@@]1(O)C1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168412", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC(n2cncn2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95587", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COCCN(Cc1ccccn1)C(=O)[C@H]1C[C@H]1c1ccccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31082", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cccc2c1=[NH+]CC=2/C=C(\\C#N)c1nc2ccccc2[nH]1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16087", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1c(C2CC2)csc1NC(=O)/C=C/c1ccc(C)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220779", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(NC(=O)c2ccc(/C=C3\\SC(=O)N(c4cccc(C(F)(F)F)c4)C3=O)cc2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88187", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=[N+]([O-])c1cccc2c1N[C@H](c1cccc(Cl)c1)[C@@H]1CC=C[C@@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175410", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccsc1CNC(=O)CSc1ncn[nH]1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201619", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1C[C@@H](C(=O)NC[C@H]2CCCN(c3ncccn3)C2)c2ccc(F)cc2N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94561", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ncn2c1C(=O)N(c1ccc(C)c(F)c1)[C@](C)(C(=O)NCc1ccccc1OC)C2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234008", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule C[C@@H]1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)C[C@@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87327", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2C[C@@H](C)N(c3cccc[nH+]3)C2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150068", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCC[C@H](C)NC(=O)[C@H](C)Nc1c(C)nn(-c2ccccc2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145987", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ncnc2sc3c(c12)CCCC3)NC[C@@H]1CCCO1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30138", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1COC[C@@H](C)N1C(=O)CSc1nnnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22525", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](NC(=O)c1ccccc1I)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81971", "split": "OpenMolInst" } }, { "instruction": "Please remove a thiol from the molecule SCC1(CSc2nncs2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178196", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])[C@H]1CCN(c2ccc(F)cc2)[C@@H]1c1ccc(C(F)(F)F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181321", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc(NC(=O)N(C)[C@H](C)c2nc(C)sc2C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157199", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)[C@H](C)Sc2cccc(F)c2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206848", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCCC1CCC(C[NH3+])([C@@H](O)c2cccs2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43377", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C)c2nc(NC[C@H](c3ccncc3)N3CCOCC3)sc12 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4449", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=S(=O)(NCCCn1ccnc1-c1ccccc1)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241759", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1c(C(=O)Nc2cccc(COCC3CC3)c2)cnn1-c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198348", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(C(=O)N/N=C\\c2ccc(Sc3cccc4cccnc34)o2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222008", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CC[NH+](Cc2ccc([N+](=O)[O-])c(O)c2)C[C@@H]1C by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231015", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1ccc(Br)cc1)c1cccnc1NCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240544", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule COc1cc(/C(C#N)=C/c2cccc3c2OCCCO3)ccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41223", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)Cc1noc(C[NH2+][C@H](C)c2ccc(Cl)cc2Cl)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191245", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1C(=O)Nc1cccc(C(=O)N2CCC[C@@H]2C(=O)NCCc2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201795", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)c1cc(C(=O)NCCNC(=O)c2ccc(Cl)cc2)n(C)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195391", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H]2CC(O)=Nc3c2c(=O)[nH]n3C(C)C)c(OC)c1OC by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138102", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](Sc1ncc2ccccn12)C(=O)N(Cc1ccccc1)Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72891", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@](C)([NH3+])C(=O)NC[C@H](c1ccccc1)[NH+]1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217739", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(N2C(=O)C[C@H](SCC(=O)Nc3cccc(Cl)c3C)C2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18702", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCS(=O)(=O)C[C@@H](C)NC(=O)c1ccc(OC(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9587", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](OC(=O)c1ccc(CC#N)cc1)c1nc2ccc(Cl)cc2n1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50578", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1=C(C(=O)Nc2cc(C)ccn2)[C@H](c2cc([N+](=O)[O-])ccc2Cl)C2=C(CC(C)(C)CC2=O)N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54671", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCN[C@]1(C(N)=O)CC[C@H]([NH+]2CCC(C)(C)C2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238362", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)(C)C[C@H](CO)NC(=O)c1cccnc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24962", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[NH+]1CC[C@H](N(C)C(=O)c2cccc(-n3cccn3)c2)[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178092", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(O)c(C(=O)Nc2cccc(I)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176787", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)CSc2nc3ccccc3nc2-c2ccccc2)cc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163983", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](C(N)=O)N1CC[NH+](Cc2ccc3c(c2)CC(C)(C)O3)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155145", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nc2cc(NC(=O)C(=O)NCC3(C)CCC3)ccc2o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205206", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)(C)OC(=O)N1CCC(COc2ccc(OC(F)(F)F)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22896", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(CN(C(C)=O)c2c(C)nc3ccccn23)c1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225345", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule [NH3+][C@@H](Cc1ccc(F)c(F)c1)c1ccc(F)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172373", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(COc1ccccc1-c1noc(-c2ccc(Cl)cc2)n1)N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16047", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1ccc(Br)cc1C(=O)[O-])c1ccc(Br)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53496", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule COc1ccc(COc2ccc(CO)cc2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88389", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCn1c(C)cc(-c2csc(NC(=O)c3scnc3C)n2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4743", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Nc1cccc2cnccc12)N(Cc1ccccc1F)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5096", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1[C@@H]1CC(=O)C2=C(C1)Nc1ncnn1[C@@H]2c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223862", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)(F)c1cnn(-c2nc(Br)cs2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10616", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1c([C@@H]2c3ccccc3C(=O)N2CC(=O)Nc2cccnc2)c2ccccc2n1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53668", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(CSc1cc(-c2ccccc2)ncn1)N1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41909", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H]1CCCO1)c1cccs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57020", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CNC(=O)c1cccc2[nH]ccc12)[NH+]1CCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91042", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](c1ccccc1)N(C)C(=O)C[NH+]1CCCC[C@@H]1C(=O)N1CCOCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240691", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(CC(=O)OCC(=O)c1ccc(Cl)s1)c1ncccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85564", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc([N-]S(=O)(=O)c2ccc3c(c2)CN(C(=O)C(C)(C)C)CC3)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215683", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ncccc1NC(=O)/C=C(/c1ccccc1)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81232", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc([S@@](=O)/N=C/c2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccnc1OCC(F)(F)F)c1ccc2[nH]cnc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37108", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccc(Oc2nc3ccccn3c(=O)c2/C=C2/SC(=S)N(C[C@@H]3CCCO3)C2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162717", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)(C)n1cc(NC(=O)N[C@H]2C[C@H]2c2ccccc2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234858", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule NC(=O)c1ccc(NCc2cccc(Br)c2)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239725", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCC(Oc3nc4c(C)cccc4s3)CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137377", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](C)c1ccc([C@@H](O)c2cscc2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45404", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1nccnc1N1CCC[C@@H](N2CCCC2=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20985", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(-n2cncn2)ccc1C(=O)Nc1c(C)cccc1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12028", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1c(Cl)cccc1-n1ccnc1S[C@@H](C)C(=O)NC(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94487", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1csc(N(C(=O)/C=C/c2ccccc2)c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113918", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)C1CCN(C(=O)COC(=O)c2n[nH]c3ccccc23)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248221", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(C)c2sc(N(CC[NH+](C)C)C(=O)c3snnc3C)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125324", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(C)c(S(=O)(=O)Nc2ccc3c(c2)CN(C(=O)c2cccs2)CC3)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175387", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(F)c(NC(=O)c2cccnc2SC)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4492", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN1C(=O)C(C#N)=C(C)/C(=C/c2ccc(OC)cc2OC)C1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176475", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)N[C@@H]1CCCN(C(=O)c2cccc(N[C@@H](C)C(C)C)c2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59050", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1c(C(=O)N(C)c2ccccc2Cl)oc2c1/C(=N/O)CC(C)(C)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92660", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@@H]2CN(C(=O)CSc3nc(C)n[nH]3)C[C@H]2C(=O)[O-])c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179331", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(NC(=O)[C@@H](O)c2ccccc2)cc1)C1CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141136", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(C1=C([O-])C(=O)N(Cc2cccnc2)[C@H]1c1ccc(Cl)cc1)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235427", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOCC[NH+](C)[C@H](C)C(=O)N1CCC(C(N)=O)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H](O)c1ccccc1)c1cccc(N2CCOC2=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25719", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCc1nccn1-c1cccc([C@@H](C)[NH2+]CC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22846", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCCC(=O)Nc1nnc(CC(=O)N/N=C/c2ccccc2Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242163", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=N/N=C2\\NC(=O)[C@@H](Cc3cccc(Cl)c3)S2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162140", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](C(=O)NCCC1=CCCCC1)N1CCn2c(nnc2C2CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160016", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(S(=O)(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)cc1Br by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114019", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CCCCN(C)C(=O)C1CC[NH+](Cc2cn3ccccc3c2C#N)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184085", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1c(=O)[nH]c2cc(C(=O)N[C@@H]3c4ccccc4C[C@@H]3O)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232933", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1C[C@@H](c2ccc(F)cc2)C[NH+]1CC(=O)NNC(=O)C1CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223588", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)(O)CSCCNC(=O)N1CC[C@@H]2CCCC[C@@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41585", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)[C@@H]1C[C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141738", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(Cc1ccc(Cl)cc1)N1CCN(CC(F)(F)F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16029", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COC(=O)[C@@H](N)C12CC3CC(CC(C3)C1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29711", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Nc1ccc(Oc2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47198", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C([O-])CSC(=S)Nc1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188749", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)[C@@H](C)n2c(=O)cc(C)c3cc(C)cc(C)c32)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47787", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CN(CC(=O)N(CCC(N)=O)c2ccc(F)cc2)C(C)(C)CO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9008", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(N2CCN([C@H]3CCC[NH+](Cc4[nH]c5ccccc5c4C)C3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5876", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(C)C(=S)SCC(=O)N1c2ccccc2NC(=O)C1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107964", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncn(-c2cc(N3CCN(C(=O)Cc4ccccc4)CC3)ncn2)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221656", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cccc(Nc2nc3nccc(-c4cccs4)c3c(=O)[nH]2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48533", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COC(=O)C(C)(C)Cn1ccc([C@H](C)O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179993", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(N2C(=O)[C@@H](C)S/C2=C(\\C#N)C(=O)N[C@H](C)c2ccccc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237163", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(C[NH+]2CC[C@@H](NC(=O)c3ccn(C(C)C)n3)C2)cc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240650", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Cn1ccc(Nc2ccncc2[N+](=O)[O-])n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66118", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCCC(C)(C)CNc1ncnc2[nH]cnc12 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247386", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO[C@H]1CCC[C@@H]1OC(=O)CCCNC(C)=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103041", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCCn1c(=O)c2ccc(Cl)cc2n2c(SCC(=O)Nc3cccc(C)c3)nnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216337", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1NC(=O)NNC(=O)c1cccc(NC(=O)C2CCCCC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190013", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)[C@@H](NC[C@@H]1CCCO1)c1ccc(Br)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227896", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)C2CC2)cc1)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228110", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](O)c1cccn1Cc1cc(Br)ccc1F by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93586", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule N#Cc1ccc(NC(=O)N2CCN(C(=O)CCC3CCCCC3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24565", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)N=c1[nH]c2ccccc2[nH]1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200450", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1C[C@H]1CCCN1C(=O)c1cnc([C@H]2CCCO2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86482", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H]1CC[C@H](C[NH3+])CN1[C@@H](C)c1cc(F)cc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22420", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1C[C@H]1c1ccc(CN(C(=O)c2c[nH]c(=O)c(Cl)c2)C2CC2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137334", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC[C@H](C)NC(=O)C(=O)Nc1cccc(-c2nc(C3CC3)n[nH]2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35182", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCN(C(=O)c2cc(=O)[nH]c3cc(F)ccc23)C[C@H]1O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198905", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(Cn2nc(C)c(C(=O)N3CCN(CCOc4ccccc4)CC3)c2Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130851", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(C)c(CCC(=O)N[C@@H]3C[C@@H]3C)c(=O)oc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90042", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)Nc1ccc(F)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45541", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(-n2nc(C)cc2NC(=O)C(=O)N(C)CC(=O)NC(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82299", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(C)CC(=O)Nc1ccccc1Oc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235201", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C([C@H]1CCC[NH+]1[C@H]1CCC[C@@H](C2CC2)C1)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242827", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(=O)Nc1ccc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120558", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CS(=O)(=O)Cc1noc(-c2ccccc2Cl)n1)NCC1CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181869", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)c1cccc(NC(=O)/C(=C/c2ccco2)c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185864", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCN(CC)C(=O)c1ccc([N+](=O)[O-])c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206801", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc(CNC(=O)[C@@H]2CSCN2C(=O)OC(C)(C)C)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194608", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H](CCO)c1cccnc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92787", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C#CCC[C@@H](O)[C@]1([NH+](C)C)CCC[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149027", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC1CCN(C(=O)[C@@H](C)Sc2nnnn2Cc2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197619", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Cc1ccoc1C(=O)OCc1ccc([N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31084", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule OC1(C(F)(F)F)CC[NH+](Cc2ncc(-c3cccc(Cl)c3)o2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168644", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(Cc1ccc(Cl)nc1)C(=O)NCc1ccc(-n2cncn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222627", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1-n1c(SCc2c(C)noc2C)nc2ccsc2c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170677", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Cc1ccsc1)N(C)C(=O)c1ccc(CNS(C)(=O)=O)o1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182393", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(N2C[C@H](c3nc4ccccc4n3C[C@@H](O)COc3ccc(Cl)cc3)CC2=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168698", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[C@@H](C)NC(=O)N1CC[C@H](Oc2ccc(C(F)(F)F)cn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209142", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3807", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(=O)N(CCc1ccccc1)CC(=O)Nc1ccc(C(N)=O)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106584", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)c1ccc(F)c(NC(=O)c2ccnc(Cl)c2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94524", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1c[nH]c(CN(C)C(=O)[C@@]23CNC[C@@H]2C[NH2+]C3)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101365", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H]1c2cccn2CCN1C(=O)CN(C(=O)c1ccco1)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32789", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCCOc1ccc(-c2nc(N)ccc2[N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18956", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1c(Br)cccc1CNC(=O)N(C)[C@H](C)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176285", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nnc(NC(=O)c2ccccc2NC(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)s1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201625", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)NNC(=O)CCc2c[nH]c3c(C)cccc23)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233705", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN(C)c1nc(N)nc(CN2CC[C@H](c3cccc(F)c3)C2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179507", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CNC(=O)CCC[NH+]2CCN(c3ccccc3)CC2)on1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19884", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)c1ccc(Nc2ccccc2)c(N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36647", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@@H](c1ccccc1OCC)[C@@H](C)c1ccccn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24068", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1[nH]c2ccccc2c1CC(=O)OCC(=O)N(C(C)C)C(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225306", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cc2nc3ccccc3n2CC(=O)N2CCCC[C@@H]2C)cc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114451", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1ccc(C[NH+]2CCCCC2)c(Cl)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207567", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)[C@H]([NH3+])c1noc(Cc2ccc(F)c(F)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70730", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Nc1ccc2nc(-c3cccc(-c4nc5ccc(N)cc5s4)n3)sc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85999", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cccc(CN(C)Cc2ncnn2C)c1OC(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9874", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N)nn1Cc1ccc(F)cc1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138032", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C)n(C[C@@H]2CCC[NH+]2Cc2cnn(-c3ccccc3)n2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199376", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-c2nc3ccccc3c3nnc(S[C@H](C)C(=O)NC[C@@H]4CCCO4)n23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214620", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)S(=O)(=O)c1cc(C(=O)NCc2csc(=O)[nH]2)co1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94637", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[S@](=O)c1ccc(CNC(=O)CCc2c(F)cccc2F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54449", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "959", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1c(C[NH2+]CC(C)C)cnn1-c1ccccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113513", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc(N2CCN(C(=O)c3cccc(OC)c3O)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135573", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNc1ncnc(-c2cc(Br)ccc2F)c1[N+](=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73681", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nsc(NC(=O)[C@@H]2C=C[C@@H]([NH3+])C2)c1C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCc2nc(C[NH+](C)CC(=O)Nc3ccccc3)sc2C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87312", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCC[C@@H](C(=O)NCC(=O)Nc2cccc(F)c2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111949", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(F)cc1NC(=O)[C@@H](C)O/N=C/C(=O)Nc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180668", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)C2CC[NH+](Cc3ccc(-n4cncn4)c(C)c3)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76161", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cn1ccnc1SCC(=O)NCc1coc(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131561", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)C(=O)Nc1c(C)cc(C)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53723", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CCN(CC(=O)[O-])[C@H](C)c1ccccc1[N+](=O)[O-] by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172485", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)[C@H](C(=O)Oc1cccc(-n2cccn2)c1)N1CCCC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180418", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Br)cc1/C=N/N1C(=S)[NH+]=N[C@@H]1c1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183295", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=C(Nc1cccc2c1CCCC2)c1ccc([N+](=O)[O-])s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53736", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2CCN(C(=O)CN3C(=O)[C@@H]4CC=CC[C@H]4C3=O)CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236718", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CSc1cc2c(cc1NC(=O)c1cccc(F)c1Cl)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39753", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CC(=O)N1CC[NH2+]CC1)CC(C)(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171727", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H]2Oc3ccccc3[C@H]2NC(=O)C2=NN=C(c3cc(Cl)ccc3O)C2)cc1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164249", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@H](NC(=O)c1ccccc1F)C(=O)N1CCOC[C@H]1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174961", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)Nc1ccc(S(=O)(=O)N(C(=O)CC)c2ccccc2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109015", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1C[C@H]([NH3+])CN(CC(=O)N2CCC[C@H]3CCCC[C@@H]32)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57102", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H]1CCCO1)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc3ccccc3c1)N2 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100085", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3858", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCC(C)(C)NC(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=O)ccn(CC(=O)NC2(c3ccc(F)cc3F)CCCC2)c1=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226050", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ncc(CN(C)C(=O)c2c[nH]nc2-c2ccc(OC)cc2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45772", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(Cl)cc1NC(=O)CC[C@@H]1CCC[NH+](C2CCOCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132003", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CC2(CO)CCN(c3ccc4ccccc4[nH+]3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204733", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(-c2nnc(CN3CCC[C@H]3Cc3cccc(F)c3)o2)c(C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26467", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(NC(=O)C(=O)N(C)Cc2cccs2)cc1[N+](=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153486", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1CCc2nc[nH]c2C12CC[NH+](Cc1cnn(-c3ccccc3F)c1)CC2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nn(-c2ccccc2Cl)c(N)c1I by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169868", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1ccc(C[NH+]2CCN(C(=O)Cc3ccccc3F)CC2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83390", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1c(NC(=O)c2ccc(SC)cc2)sc2c1CC[NH+](CC)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84311", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)[C@@H]2CC(=O)N=C(N3CC[NH+](Cc4ccc5c(c4)OCO5)CC3)N2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186206", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc2c1OC[C@@H](C(=O)N1CCC[C@H](c3ccn[nH]3)C1)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44978", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCc1ccc(-n2cccn2)cc1)N1CCC[C@H]1c1ccc2c(c1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187776", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CO[C@H]1C[NH2+][C@H](C(=O)NCCc2ccc(F)cc2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "178449", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nn1cnc2ccccc2c1=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243795", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(-c2ccccc2Cl)nc2sc(C(=O)[O-])c(N)c12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92926", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)CONC(=O)[C@H]1CCCc2sccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4010", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NN)c2cccc(OC(F)(F)F)c2[nH+]1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "460", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@H](NC(=O)C1=Cc2cc(Cl)ccc2OC1)c1c(C)nn(C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194062", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccccc1NS(=O)(=O)c1ccc(Cc2cc(C)n[nH]c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ccc2cc(S(=O)(=O)N3CCC[C@H](C(=O)N4CCC5(CC4)OCCO5)C3)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149824", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCc1cccs1)c1ccc([C@H]2Nc3ccccc3S(=O)(=O)N2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "239006", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CNc1ccc(C[NH+]2C[C@H](C)[C@@H](C)C2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226478", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(CC(F)F)C(=O)C1C[C@H](C)O[C@H](C)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125154", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC[C@H](NC(=O)Cc1coc2cc(C)c(C)cc12)C(N)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128523", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nn(C)c(Cl)c1CSc1nnnn1C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149126", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule NC(=O)c1cccc(CNC(=O)[C@H]2C[C@H]2c2ccc(F)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168731", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)c1cc(-c2cs/c(=N\\C[C@@H]3CCCO3)n2/N=C/c2ccccn2)ccc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166885", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(-n2nc(N3CCC[C@H](C(=O)Nc4ccc(F)cc4F)C3)ccc2=O)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218331", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CSCCOC(=O)[C@@H](C)Oc1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133352", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCCS(C)(=O)=O)C(=O)[C@H]1CCCC[NH+]1Cc1cccnc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127165", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CSc1ccc([C@H](C)[NH2+][C@H](C[C@@H]2CCOC2)c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136936", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H]1Sc2nnc(-c3ccncc3)n2N=C1c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42293", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(c1ccc(-c2nc(Cc3ccc(F)cc3)no2)c[nH+]1)C1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188535", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1C[C@@H](N(C)C(=O)c2cc(CCc3ccccc3)ccc2O)CC[NH+]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112944", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(CCn1ccc2ccccc21)Nc1ccc2c(c1)CCC(=O)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123033", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1cc(Cl)c(OC)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168939", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(NC(=O)[C@H](C)Nc2ccc3c(c2)CCN3C(C)=O)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60736", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COCc1ccc(C(=O)NCCC2CCN(c3cc[nH+]cc3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59367", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC(C)=CC(=O)C[C@@](O)(c1ccccc1)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57585", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)CNC(=O)CCc1c[nH]c2ccc(C)cc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45916", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1NC(=O)[C@@H](CC(=O)N2CCOCC2)N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42810", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN(Cc1ccco1)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89813", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCNC(=O)CC2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)c2cc(C)nc3c2c(C)nn3-c2ccc(F)cc2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56915", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2cc(NC(=O)[C@H]3CCCN(c4ccc(-n5ccnc5)nn4)C3)ccc2s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109356", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Cl)cc1N1CCN([C@@H](c2ccccc2F)c2nnnn2Cc2ccco2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139750", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C(=O)Nc2ccc3c(c2)OCCCO3)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25598", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccccc1NC(=O)CN(C)C(=O)[C@@H]1CC(=O)N(c2ccccc2CC)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117474", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[NH+](CCNC(=O)N[C@H]1CC(=O)N(C(C)(C)C)C1)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2493", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1OCC[C@H]1C(=O)Nc1ccc2nc(-c3cccs3)[nH]c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205310", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)[C@](C)(O)[C@@H]1CCC[NH2+]C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177148", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C([O-])CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117860", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)N(C)CCOc2ccccc2F)cc1-n1cnnn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238912", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@@H](CCO)SCC(=O)c1cc(F)ccc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65251", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[NH2+][C@@H](CC[C@@H]1Cc2ccccc2S1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129199", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@@H]1CN(C(=O)[C@H]2CC(=O)N(c3ccc4c(c3)OCCO4)C2)c2ccccc2O1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199246", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1c(F)cc(NC(=O)C(=O)N2CC[C@H](OCCC(C)C)C2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219408", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)c1cc(=O)[nH]c(-n2nc(-c3cccs3)cc2NC(=O)Cc2ccc(Cl)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237259", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C1OC(/C=C\\c2ccccc2)=N/C1=C\\c1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13468", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H]1CN(Cc2ccc(N3CCOCC3)c(F)c2)CC[NH2+]1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132502", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(CC)CNc1nccn(CC(C)C)c1=O by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13492", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@@H](Cc1ccc(O)cc1)NC(=O)Nc1cc(C#N)ccc1OC(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190762", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1cc(C)cc(OC[C@H](O)C[NH+]2CCC[C@@H]2c2cc(C)no2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70993", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(F)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174284", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1c(F)cccc1C(=O)NCCC(=O)N1CCCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208985", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H](Cc3ccccc3)NC(=O)c3ccco3)CC2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29307", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1cccc(NC(=O)c2sc3c(c2C)[C@H](c2cccc(O)c2)CC(O)=N3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "41691", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1c(NS(C)(=O)=O)cccc1C(=O)N1CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247442", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@@H]([NH2+]Cc2cccc(Oc3ccccc3)c2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115986", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(C(=O)N[C@H](C)c2cccnc2)sc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88983", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Cn1ccnc1)NCc1ccc(-c2ccc(Cl)cc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245901", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]1COCCN1Cc1cc(Cl)c(OC)c(OC)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193701", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1ccc2ccc([C@@H](Nc3cccc[nH+]3)c3ccc(O)cc3)c([O-])c2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95045", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1ccc2c(c1)N(C(=O)C1CCCC1)CC2)c1ccc2ccccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36559", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc2c(c1)OCO2)c1cn(C[C@H]2CCCO2)cc2c(=O)n(-c3ccccc3)nc1-2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119364", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)NCC(=O)Nc1cccc(OCc2cccc(F)c2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141530", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(Br)ccc1NC(=O)CCCn1c2ccccc2c(=O)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103209", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCN[C@@](C)(C[NH+]1C[C@@H](C)[C@@H](C)C1)C(N)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126856", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)N[C@H](C)c1ccc(S(N)(=O)=O)cc1)[NH+]1CCC(C)(C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103784", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@@H]1CCCC[C@@H]1N(C)C(=O)Nc1ccc(C(=O)NC)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14069", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H](Oc1ccc([N+](=O)[O-])cc1C=O)C(=O)Nc1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5633", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(S(=O)(=O)NCC[NH+]2CCN(c3ccccc3F)CC2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89895", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](Sc1ccc(F)cc1)C(=O)Nc1ccc(OC(F)(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168394", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CCO[C@H](c2nc(-c3cccc(C[NH3+])c3)cs2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32186", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCN(CC)S(=O)(=O)c1ccc(NC(=O)Cc2coc3cc(C)c(C)cc23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148367", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)[C@@H](C#N)c2nnc3n2CCCCC3)cc1Br by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111379", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(CCC(=O)NC2(C(N)=O)CCCC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111720", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCC[C@@]1(C2CCN(C(=O)c3noc4c3CCCC4)CC2)NC(=O)N(CCc2ccccn2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181121", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1c(-c2ccc3c(c2)OCCO3)cnc1S[C@H](C)C(=O)NC(=O)NC(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122342", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)N[C@@H](c1ccccc1)C(C)(C)C)c1nncn1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144432", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COc1ccc([C@@H]2C(C#N)=C(N)OC3=C2[C@@H](C)N=N3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203720", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@H](Cc1cc(C)cc(C)c1)[C@@H]1C[NH+]2CCN1CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175576", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C[C@H](NS(C)(=O)=O)C(=O)OC by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238005", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)NCc1ccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15954", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[S@@](=O)CCN1C(=O)NC(C)(C)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10481", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(CC(=O)N2CCOc3ccccc32)cc1)C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135868", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)CCn1cc(C(=O)NCc2ccc([S@@](C)=O)cc2)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230102", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=c1c([N+](=O)[O-])c(NCc2ccsc2)nc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83776", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1CCCC2=c3cccc(C(N)=O)c3=[NH+][C@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75406", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(NC(=O)[C@H]2COc3ccccc3O2)c2ncccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166866", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)C[NH2+][C@H]1CSCCC1(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105401", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)c1csc(-c2cccs2)n1)[C@H]1CCCO1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44847", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCCOc1ccc(CN2CCO[C@H](c3nc(C)cs3)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104150", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(NC(=O)Cn2c(=O)n(Cc3ccccc3F)c(=O)c3sccc32)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42934", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1N1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77862", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN(C)C(=O)c2cn(Cc3cccnc3)nn2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234024", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N1CCC2(CC1)Oc1ccc(Br)cc1[C@H]1CC(c3ccncc3)=NN12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCOc1ncccc1C(=O)N1CC[S@@](=O)C(C)(C)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108828", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CO[C@H](CNC(=O)c1ccoc1C)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6922", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1C(=O)N[C@@H](C(=O)N1CCOc2ccccc21)C(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238584", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)C1CCN(C(=O)CC(F)(F)F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37612", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1CSc1ccccc1C(=O)N1CCO[C@H](c2ccc(F)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142065", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1ccoc1)C(=O)N1CCN(Cc2ccsc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2288", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(N[C@@H]1CCCCC[C@H]1C(=O)[O-])[C@@H]1CCOC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218066", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](Cc1ccco1)NC(=O)c1ccc2nsnc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75060", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1=C(C)N(C)C(=S)N[C@H]1c1cccc(NC(=O)c2ccc(Br)cc2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1CN(C(=O)c1cnn3c(-c4ccccc4)ccnc13)CC2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20624", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O[C@@H](COCc1cccs1)Cn1nnc(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70242", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](C(=O)Nc1ccc2c(c1)OCO2)N(Cc1cccnc1)C(=O)Cn1nnc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175845", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)N3CCN(c4ncccn4)CC3)c2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144596", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)CN2CC[NH+](C[C@@H]3CCCO3)CC2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34875", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(N2C(=O)/C(=C/c3c[nH]c4ccccc34)SC2=S)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174375", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@](C)([NH2+]Cc1ccc(C(N)=O)cc1F)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220349", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cnc(CNC(=O)NNc2ccccc2Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108506", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN[C@]1(C(=O)OC)CC[C@@H](N2CCOC[C@@H]2C)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195113", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[NH+]1CCN(c2ccc(F)cc2[N+](=O)[O-])CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70066", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)CSCc1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59564", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C/C(=C/C(=O)OCc1nc(N)c2ccccc2n1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189964", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(CCn1cc[nH+]c1)Nc1cccc(C(=O)N2CCOC[C@@H]2C2CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232002", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1cccc(NCc2cccc(C)n2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10833", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC(C)C[NH+](C1CCCC1)[C@H]1C[C@H](C(C)(C)C)CC[C@@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216640", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(=O)n(-c2ccccc2C)nc1C(=O)Nc1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32675", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOCC1(CNc2nc(C)nc3c2c(C)nn3C)CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186070", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1CSCc1nnc(-c2ccccc2F)o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182297", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCc1cccc(CNC(=O)c2cc(C(N)=O)cn2C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167780", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Oc2nccn3c(=O)n(CC(=O)N4CCN(c5ccccc5F)CC4)nc23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63254", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(C(=O)c2ccc(Br)o2)sc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121266", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Clc1ccc(NCc2ccc[nH]2)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164376", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#Cc1ccc(CCC(=O)Oc2ccc(Cl)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76198", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c(N(CC(=O)N2CCOCC2)S(C)(=O)=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148420", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule NC(=O)CCn1nc(-c2ccc(F)cc2)c2ccccc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139767", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1c(C(=O)N[C@H]2CCC[C@H](S(C)(=O)=O)C2)cc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204894", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Cc1cn2ccccc2[nH+]1)Nc1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225319", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(C[C@H]1CCS(=O)(=O)C1)Oc1cccc(Oc2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119625", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nn(C)cc1NC(=O)C(=O)NCC1(c2ccccc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87453", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CSc1nccnc1CNC[C@@H]1CCCC[NH2+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183959", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(NC(=O)NCCc2cccc(Cl)c2)cc1NC(C)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114463", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(OCc1cccc(F)c1)c1ccc(N2CCNC2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79386", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc([N+](=O)[O-])cc1S(=O)(=O)[N-]c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242558", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(NC(=O)CSc2ccc(S(=O)(=O)N3CCCC3)cn2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162515", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)C(=O)NC[C@H]1CCCN(C(=O)c2cc(F)cc(F)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135481", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(OC)cc(C(=O)Nn2cc(C(=O)NCc3ccccn3)c3ccccc3c2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227144", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1O[C@H](C)CNC(=O)CN1C(=O)c2ccccc2C1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153260", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)N1Cc2cc(C)ccc2OC2(CCN(C(=O)c3cc[nH]n3)CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15766", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule S=C1SCCN1CN1CCc2ccc(Cl)cc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193460", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](NC(=O)C(C)(C)NC(=O)Nc1ccccc1)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155725", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule NC(=O)[C@H]1CCN(C(=O)[C@H]2C[C@@H]2c2ccccc2Cl)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83527", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](Nc1ccc2nnc(-c3ccccc3F)n2n1)c1noc(C)n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236372", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccn2cc(C[S@](=O)[C@H](C)C(=O)NCc3ccccc3)nc12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218086", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#Cc1ccc(CCC(=O)N[C@@H](Cc2ccccc2)C2CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15200", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCNC(=O)NNC(=O)Cc1cccs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233755", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H](C)N[C@H]2CCN(CC(F)(F)F)C2=O)c(OC)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11340", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nc(-c2cccc(C[NH2+][C@H](C)c3cnn(C(C)C)c3)c2)n[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185275", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@@H](c1ccn(CCC(F)(F)F)c1)C1CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89840", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNc1cc[nH+]c(Cn2nccc2C)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1ccc(OCC(=O)N/N=C/c2ccc(N3CCOCC3)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192259", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Fc1ccc([C@H]2OCC[C@H]2CCl)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196590", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=C(\\C)c2ccncc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111272", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc([C@H]2[C@@H](C(=O)NCc3ccc(F)cc3)c3ccccc3C(=O)N2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92090", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccc([C@@H]2SCCN2C(=S)Nc2ccc(Cl)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122887", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule NS(=O)(=O)CC1CC[NH+](Cc2ncc(-c3ccccc3Cl)o2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52051", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNS(=O)(=O)[C@@H]1CC[NH+](CC(=O)Nc2ccccc2C(C)(C)C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97489", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1[C@H]2[C@H]3C=C[C@H](CC3)[C@H]2C(=O)N1/N=C/c1cn(Cc2ccccc2Cl)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111963", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)Cn1c(=O)n(CCc2ccccc2)c(=O)c2c3c(sc21)COC(C)(C)C3 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96974", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cn1c(CNc2ccc(C(N)=O)c(F)c2)nnc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99146", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)[C@@H](C)N2CCO[C@H](c3ccccc3)C2)c(F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212323", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C)c(NC(=O)N2C[C@@H](C)C[C@@H](C)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231545", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C[NH+]1CCCCC1)NC(=O)N1CCC(c2ccc(O)cc2)CC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66859", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1c2cc3c(cc2C2(CCCC2)CN1C(=O)c1cccc(C#N)c1)OCCO3 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187292", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1OCC[C@@H]1C(=O)N1CCC[NH+](CC(=O)N(C)C)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53305", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)NNC(=O)Cc2ccc(-c3ccccc3)cc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19537", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](CC(=O)NN1C(=O)N[C@](C)(c2ccccc2)C1=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6154", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1ccc(CNc2cccc(OCCCC#N)c2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151442", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cc(C(=O)Nc2cc(Cl)ccc2[N-]S(=O)(=O)c2ccccc2F)cn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150763", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)N[C@@H]1CCN(c2nc(C)nc3c2c(C)nn3C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201939", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cccc(C)c1NC(=O)C[NH+](C)CC(=O)N1CCC[C@H]2CCCC[C@@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62437", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)[C@@H](C[NH2+]CC(=O)N1CCc2ccccc21)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49395", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1CN(C(C)(C)CNC(=O)CSCC(F)(F)F)C[C@@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210665", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](NC(=O)[C@H](C)Oc1ccccc1C(F)(F)F)C(=O)N(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247757", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOC(=O)[C@@H]1CCCN(C(=O)N[C@@H](C)c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97656", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)OCc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217601", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=C([O-])c1ccc(/N=C\\c2ccccc2O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201961", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COC[C@@](C)(C#N)NC(=O)c1ccc(Br)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153293", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1ccnc1CNC(=O)c1cn(Cc2ccccc2F)nn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179824", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2csc3ncn(CC(=O)Nc4ccc(F)cc4F)c(=O)c23)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150335", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCO)S(C)(=O)=O)c(C3CC3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154548", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule N#Cc1ccc([C@H]2Nc3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64377", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C1=C[C@@H](S(=O)(=O)NC[C@H]2CCCO2)C=N1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127673", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCCNC(=O)C(=O)c1c[nH]c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165405", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule BrCC1(C[C@@H]2C[C@H]3CC[C@@H]2C3)CCCC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98988", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccccc1N1CC[C@@H]([NH2+][C@@H](C)C[C@H]2CCCO2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "234627", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(CCCNC(=O)[C@@H]2CN(C)CCO2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211636", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cc([O-])nc(SCc2ccc(F)cc2)n1)N1CCN(c2cccc[nH+]2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34888", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1C(=O)Nc1cc(NC(=O)c2ccccc2C)cc(C(=O)[O-])c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184353", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule OC[C@@]1([NH2+]C2CC2)CCC[C@H]1CCOC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165736", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC(=O)c1ccc(NCc2cccc([N+](=O)[O-])c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19602", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NC[C@H]1COc2ccccc2C1)[C@H]1COc2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "243958", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=[N+]([O-])c1cnc(NCCCn2cc[nH+]c2)c(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115081", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(NC(=O)C[S@](=O)[C@H](C)c2ccc(Cl)c(Cl)c2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10327", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(CC(=O)N(CCC(F)(F)F)C1CCC1)c1ncnc2[nH]cnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "173716", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)NC(=O)C[NH+](C)Cc1nc2ccc(N)cc2o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141388", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nc2ccc(NC(=O)C(=O)NC3CC[NH+](CC4CCCCC4)CC3)cc2o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104059", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)N1CCC(CNC(=O)[C@H]2CC(=O)N(c3ccc(C)c(C)c3)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48009", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)n1cc(C(=O)Nc2ccc3cc[nH]c3c2)c2ccccc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92079", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CC(C(=O)N2CCC[C@@H]2C(=O)N2CCN(C)CC2)C[C@@H](C)O1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208881", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccnc1NCc1cnc(-c2ccccn2)s1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35796", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H]1CCCC[C@H]1OC(=O)CCc1cc(Cl)cs1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10915", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cc1cccc2ccccc12)N[C@H](c1ccccc1)c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77724", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "498", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(COC(=O)c1cccs1)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60056", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCOc1ccc([C@@H]([NH2+]C)c2c(F)cccc2F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48484", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1nc(-c2ccccc2)c[nH]1)N1CCN(c2ccccc2F)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221387", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccccc1F)c1ccc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5474", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CN(C(=O)CSc2nnc(-c3ccccc3)n2N)C[C@@H](C)O1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25846", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)[nH]2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109447", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1CCCC[C@H]1NC(=O)Cc1coc2cc3c(cc12)CCC3 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100931", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1noc(CN(C)C(=O)Nc2ccc(N3CCO[C@@H](C)C3)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122144", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C)c1OC[C@H](O)Cn1c([C@H]2CC(=O)N(c3ccccc3F)C2)nc2ccccc21 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91803", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#Cc1ccc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210960", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)[C@H](C)SCC(=O)NC1(C#N)CCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30335", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CC(=O)NC[C@H](c2cccs2)[NH+]2CCCCCC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195881", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@H]([NH2+]Cc1cnn(C)c1C)C1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50591", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@@H](CCCO)NC(=O)N1CCN(c2ncnc3sccc23)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22650", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CSc2ncccc2C(=O)Nc2ccc3oc(C)nc3c2)no1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87977", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(COc1ccc(Oc2ccccc2)cc1)Nc1cc(N2CCCC2=O)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75699", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc2c1C(=O)O[C@H]2S(=O)(=O)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17122", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C2(C(=O)N3CCC[C@@H](c4ccn[nH]4)C3)CCCC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176172", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[NH2+][C@H]1c2cc(F)c(F)cc2[S@](=O)[C@@H](C)[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16075", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "539", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Br)c(C(=O)N2CCC3(CC2)OCCN3S(=O)(=O)c2ccccc2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165374", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Nc1ccc(=O)n(CCCN2CCN3C(=O)NC[C@@H]3C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48039", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3375", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](OC(=O)c1cn(C)c2ccccc12)C(=O)Nc1ccc(S(N)(=O)=O)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227309", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH2+][C@H](CCO)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10844", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1ccc(S[C@@H](C(=O)[O-])C2CC2)cc1F by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116944", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)C(=O)NCC(=O)Nc1ccc(OC)c2ncccc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187003", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@](C)([NH2+]CC(=O)Nc1c(C)n[nH]c1C)C(=O)[O-] by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195491", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCCNC(=O)c1ccnc2ncccc12)c1cccc(F)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44420", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H](NC(=O)c1cnc(Oc2ccccc2)cn1)[C@@H]1CCOC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156349", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1cc(=O)n(CC(=O)Nc2ccc(OC)cc2OC)c(-c2cccc(F)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206280", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CNC(=O)c1ccc(CNC(=O)N[C@@H]2C[C@H](C)CC[C@H]2C(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176923", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C[C@@H]1CC[C@](C#N)(C2(O)CCOCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7835", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCn1c(C[NH+]2CCC(NC(=O)c3ccoc3C)CC2)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148039", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1c(C)[nH]c(C(=O)N[C@@]2(C)CCS(=O)(=O)C2)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200849", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2CCN([C@@H]3CC(=O)N(c4ccc(C(F)(F)F)cc4)C3=O)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80831", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)NC(=O)NCc1ccc(C[NH+](C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100316", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccccc1[C@H]([NH3+])CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158075", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CN1CCO[C@@H](CNC(=O)CN2CC[S@@](=O)C(C)(C)C2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9214", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NC1CCCCC1)[C@H]1CC(c2c(F)cccc2Cl)=NO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190180", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)N[C@@H]1CCCC[C@@H]1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215702", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCCNC(=O)[C@@H]1CC=CCC1)[C@@H]1CC=CCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249128", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CN1CCN(C(=O)Cc2c[nH]c(=O)n(C)c2=O)[C@H](C)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111050", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(COC(=O)CCc2nc(-c3ncccn3)no2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171678", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1[nH]nc(C(N)=O)c1NC(=O)[C@H](C)c1ccc(Br)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62363", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)CN(C)C(=O)NCCOCC(=O)[O-] by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155275", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N/N=C/c2cccs2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101634", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1Cn1cc(C(=O)N2CCC([C@H](O)CCc3ccccc3)CC2)nn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5987", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H](NC(=O)c1ccccc1Cl)[C@H]1COc2ccccc2O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCn1ccc2ccc(NC(=O)c3cccc(-n4cnnn4)c3)cc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88185", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN1CCO[C@@H](C(=O)NCc2ccc(Cn3ccccc3=O)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223764", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccnc1)C1CC[NH+](C2CC[NH+](CC3CCCC3)CC2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246624", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1ccc(Cl)cc1F)[C@@H]1CCCN1C(=O)c1cc(Cl)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220927", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc([C@H](CNC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)[NH+](C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45825", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nc(C[NH2+]Cc2ccc(N3CCC[C@H](C(N)=O)C3)cc2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78748", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Oc1cccc(/C=C2/SC(=S)N(c3ccc(Cl)c(Cl)c3)C2=O)c1)C(=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183600", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COC(=O)c1ccc(NC(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185877", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C([O-])c1c(-c2ccc(Cl)cc2)noc1CO[C@@H]1CCCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144020", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC1=NN(C(=O)COc2ccc(C(C)(C)c3ccccc3)cc2)[C@@](O)(C(F)(F)F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33001", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nc(CS(=O)(=O)Cc2ccc(F)c(Br)c2)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148846", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCn1ncc(C[NH+]2CCC3(CC2)c2ccccc2[C@@H]([NH+](C)C)[C@@H]3O)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156129", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)CN[C@H]1CC[C@H]([NH3+])C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164718", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@H](OC(=O)c1nccnc1N)c1nc(C(C)(C)C)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120380", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2cc(C(=O)N(C)c3ccc(OC)nc3)[nH]c2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6098", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(N(C(=O)c2cc(=O)c3ccccc3o2)C2CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64711", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NC[C@@H](O)c1ccccc1Cl)c1ccc(OC(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188397", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule N#C[C@]1(C2(O)CC[NH2+]CC2)CCc2ccccc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20060", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1ccc(NC(=S)NC(=O)C2CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238699", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=C(c1ccccc1NS(=O)(=O)/C=C/c1ccccc1)N1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181679", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)(C)Oc1cc(C(=O)N2CCC(CO)CC2)ccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34522", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC(F)F)C(=O)CCc1ccc(F)cc1F by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16662", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(-c2nn3c(SCC(=O)c4ccc(Cl)cc4)nnc3nc2[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72047", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCN[C@@]1(C(=O)OC)CC[C@@H](OC(C)(C)C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123669", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]([C@H](C)C[NH2+]C(C)(C)C)N(C)Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245999", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)Nc1ccc(NC(=O)c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49945", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(N2CCn3c2nn(CC(=O)N2CCCCCC2)c(=O)c3=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182163", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CCC[NH+](C(C)(C)CNC(=O)/C=C/c2ccc3c(c2)OCO3)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136059", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1/c(=N/C(=O)CN2C(=O)CCC2=O)sc2cc(F)cc(F)c21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136893", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CN1CCN(C(=O)CCCN2C(=O)/C(=C/c3cccc(Br)c3)SC2=S)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97434", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO/N=C(/C(=O)Nc1cc(C(N)=O)c(F)cc1F)c1ccco1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101316", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(/N=C2/C(=O)N(CN3CCOCC3)c3ccccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73639", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC1=NC(=O)[C@H](c2ccc(Br)cc2)C([O-])=N1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48440", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccccc1NC(=O)c1ccc(NC(=O)C[NH+]2CCC[C@H]2c2ccc3c(c2)OCCO3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242407", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(NC(=O)C(C)C)cc1NCC(=O)N1C[C@@H](C)O[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96234", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCc2c(C(=O)N3CCN(c4cc[nH+]cc4)CC3)csc2C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nn1c(C)cc(CN2CCN(c3[nH+]cccc3C)CC2)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63231", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(O)c(C(=O)NCc2ccc(-c3csc(C)n3)s2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131127", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@]1(O)CCOc2ccccc21)C1CCC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21627", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1c(C)nn(CN2CCO[C@@H](c3ccccc3Cl)C2)c1=S by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199758", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CO)N(C)C(=O)CCn1cnc2sc3c(c2c1=O)CCCC3 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176082", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cccc(NC(=O)c2cn(-c3ccc(-c4noc(C5CC5)n4)cc3)nc2C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32457", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2csc(Nc3ncccc3C)n2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169324", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC[C@@H](C)CN(CC)c1ncnc2ccc(N)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93493", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1cnc(CCNC(=O)Nc2cc(OC)ccc2F)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187404", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H]1C[C@]1(O)c1cscn1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200840", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)Nc1ccc(-c2nc(Cn3cccn3)c(C)o2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79696", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccn2c(=O)c(C(=O)NC[C@@H](C)CN3CCOCC3)cnc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227504", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(C)n2c(CN(CC(F)F)C3CC3)cnc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48366", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1=C(N)OC2=C(C(=O)CC(C)(C)C2)[C@H]1c1c(OCC)ccc2ccccc12 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104181", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@@H]2CC(=O)C(/C=N/C3Cc4ccccc4C3)=C([O-])C2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189984", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC(C(=O)N[C@@H]2CCc3c2ccc(Cl)c3Cl)C[C@@H](C)O1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141677", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1ccccc1CN1CCN(c2cccc3c2C(=O)N(CC2(O)CCCCC2)C3=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66610", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(CC(=O)N2CCN(S(=O)(=O)c3ccc4c(c3)sc(=O)n4C)CC2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8405", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCNC(=O)NNC(=O)[C@H]1CCC(=O)N(c2ccc(C)c(C)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115858", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nnc(C[NH+](Cc2c(F)cccc2N2CCCC2)C(C)(C)C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118526", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2n[nH]c(CC(C)C)c2NC(=O)c2cccc(Cl)c2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42730", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1ccccc1OCC(F)(F)F)C(=O)N[C@@H]1CCc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46195", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](NC(=O)C(C)(C)c1ccccc1)c1ccc2c(c1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110956", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1nnc(-c2cccc(SC(C)C)c2)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226418", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](NC(=O)N[C@H](C)Cc1c(C)nn(C)c1C)C(C)(C)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115835", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1CC[C@H](COC(=O)[C@@H]2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11886", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc([S@@](=O)Cc2nnc(-c3ccccc3C)o2)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180750", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule C=CCN1C(=O)S/C(=C/c2ccccc2[N+](=O)[O-])C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28490", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(C(C)=O)cc1CC(=O)N[C@H](C)c1cn(C)nc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55918", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1sc(NC(=O)c2ccccc2)c(CN2CCc3ccccc3C2)c1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99980", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCCC[C@]1(CO)CCCN(S(=O)(=O)c2ccc(C)c(F)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177221", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C1C[C@@H]([NH2+]CCC2=CCCCC2)C(=O)N1c1cccc(Cl)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238047", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1ccc(-c2ccc(Br)cc2)nn1Cc1ccc(F)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16193", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCCN1C(=O)[C@@H](C(=O)Nc2nc3ccccc3[nH]2)[C@H](O)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112110", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(N2CC[NH+](C)[C@@]3(CCNC(=O)CC3)C2)nc(OC)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23491", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC[C@H](C[NH3+])Nc1nc2ccc(Br)cn2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92226", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc2c(c1)[C@H](CC(=O)N(C)Cc1ccno1)C(=O)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211148", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(-n2c(SCC(=O)N[C@@H]3CCS(=O)(=O)C3)nc3sc(C)c(C)c3c2=O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93617", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc([C@H](C)NC2CC[NH+](C)CC2)ccc1O by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105300", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC[C@@H](Cl)CN(C)C[C@@H]1COc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165511", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[C@H](Nc1cnn(C)c(=O)c1Cl)C(=O)Nc1nccs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187732", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)OCC[NH+]1CCC(NC(=O)CN2CCCCC2=O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196674", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](CC(=O)NC(=O)NCc1ccco1)C[C@@H]1COc2ccccc2O1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211293", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(OCC(=O)N1CCCC1)c1cn(-c2ccccc2)nc1-c1ccc(F)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5892", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](C(=O)Nc1cccc([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22358", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C[C@H](C)C#N)C(=O)Cn1cnc2c(cnn2-c2ccccc2)c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204815", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(N2CCC(C(=O)NCc3ccccc3Cl)CC2)nc2cc(S(C)(=O)=O)ccc12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204493", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc2nc(NC(=O)CSc3nnc(Cn4c(=O)sc5ccccc54)n3C)sc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66546", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccc(-n2nc3ccc(NC(=O)c4cc([N+](=O)[O-])ccc4Br)cc3n2)cc1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44411", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(CN(C)C(=O)c2cnn(-c3nccc(-c4ccco4)n3)c2C)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169801", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@@H](C(=O)Nc1c(C(=O)OC)[nH]c2ccc(C)cc12)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176723", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C=CCN(Cc1cccc(C#N)c1)Cc1c[nH]nc1-c1ccc2c(c1)OCCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52384", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(NCc1cccc(Cl)c1)C(=O)N[C@H]1CCCCNC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58145", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@](C)(NC(=O)CCOC1CCOCC1)c1nccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126141", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(OCC(=O)NNC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)ccc1Cl by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176148", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Cc1ccc(-n2cccc2)cc1)NCc1csc(C2CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190315", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1cccc2sc(N3CCN(C(=O)/C=C/c4ccccc4Cl)CC3)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47466", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CCCO)N[C@H]1C[NH+]2CCC1CC2 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71649", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(NCCCCN1CCOCC1)c1csc2c1CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65169", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cc(C(=O)N2CCCCC2)cc(NC(=O)c2cc(=O)c3ccccc3o2)c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49553", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)[C@@H](O)CNC(=O)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72018", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@H](C)NC(=O)[C@H](C)SCC(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84799", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(/C=N/NC(=O)CC#N)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134402", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=[S@@](CCN1CCCN(Cc2cccs2)CC1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187285", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule N#Cc1ccc(/C=C\\c2[nH+]ccc3c2[nH]c2ccccc23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205982", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1ccccc1)N1C[C@@H]2CC[C@H](C1)N(C(=O)CCc1ccccn1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218437", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#CCCN(Cc1ccccn1)Cc1n[nH]c(=O)[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191046", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "304", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2F)N2CCc3ccccc32)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117282", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C([O-])CNC(=O)/C=C/c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21600", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H]1CCC[C@](O)(CNC(=O)Cc2c(F)cccc2F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210050", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C/C(=N\\NC(N)=S)c1ccc(O)cc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162744", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc2c(n1-c1ccc(C(=O)NCc3ccccc3)cc1)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49951", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C[C@H]1CCC[NH2+]C1)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147902", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule N#Cc1csc(C[NH2+][C@H]2CCC[C@@H](OCC(F)(F)F)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194241", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1c(C)sc(NC(=S)N2CC[NH+]3CCC[C@H]3C2)c1C(=O)OC by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200930", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O[C@H]1C[C@@H](c2cc(F)ccc2F)N(Cc2cnc(C3CC3)s2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86448", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1csc(C[C@H](O)Cc2nccs2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247401", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(CNC(=O)[C@H](C)Sc2nc(C)nc3ccccc23)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169721", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(N[C@H]1C(=O)N/[N+](=C\\c2ccc(Br)cc2)[C@H]1c1ccccc1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85029", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)NC(=O)c1cccc(NC(=O)[C@H]2CCCC[C@@H]2C(=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136361", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1ccc(NS(=O)(=O)c2ccccc2)cc1)N1CCc2ccccc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "43131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=C(C)C[C@@H](C(=O)NNC(=O)c2sccc2C)[C@@H](C(=O)[O-])C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "32348", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ncc(Cl)c(C(=O)N[C@H]2CC[C@H]([NH+](C)C)C2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246693", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Cc1cccs1)NCCOc1ccc2nnc(-c3ccccc3)n2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92630", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCOC(=O)[C@H](C)Nc1cc(-n2ncc(=O)n(C)c2=O)c(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184459", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1ccc(NC(=O)c2ccccc2Cl)cc1)c1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101987", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N/C(CCCSc1ccccc1[N+](=O)[O-])=N\\O by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC1=[NH+]CCC1)C(=O)[O-] by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67827", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule COc1cccc(N2C(=O)c3oc4ccccc4c(=O)c3[C@H]2c2cccc([N+](=O)[O-])c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31805", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(S(C)(=O)=O)cc1C(=O)NCCOCC(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134741", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(Cl)c(C)cc1NC(=O)[C@H](C)N1CCN(S(=O)(=O)c2c(C)noc2C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "449", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOCCn1c(NN)nc2c1c(=O)n(C)c(=O)n2C by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51606", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(Nc1ccc(Oc2ccc(Br)cc2)cc1)c1cnc2n(c1=O)CCS2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176348", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NCc2ccccc2C#N)c(OC)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C[NH+]2CCNC(=O)[C@@H]2CC(=O)N2CCNC(=O)C2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226716", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCn1c([C@@H](C)NC[C@@H](C2CC2)[NH+](C)C)nc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149521", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Clc1ccc(-c2cnc3cccnc3n2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247113", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCCc1ccc(F)cc1)NC[C@@H]1CC[NH+](C2CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111995", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule NC(=O)c1ccc(CSCCOc2ccc(F)cc2Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187630", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CN1CCN(C(=O)c2cccc(Cl)c2Cl)CC1)NCC1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129018", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc(N2C(=O)CCC2=O)cc1)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249414", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(CN2CCO[C@H](c3nccs3)C2)cc1F by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228977", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=CCOc1cccc(NC(=O)[C@@H](C)Oc2cccc(C)c2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101667", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C#CCn1/c(=N\\C(=O)C2CCN(S(C)(=O)=O)CC2)sc2cc(F)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128964", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccc2nc(/N=C(\\N)NC(=S)Nc3ccc(Cl)cc3)nc(C)c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115492", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCCCSc1nc2n(n1)[C@@H](c1sccc1C)C(C(C)=O)=C(C)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100549", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(C2=CC[NH+](C[C@@H](O)COC[C@@H]3CCCO3)CC2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117440", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(C(=O)/C=C/c1cccnc1)c1cccc2ncccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162182", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCn1c(SCc2ccccc2)nnc1-c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135899", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N(Cc1ccc(NC(=O)[C@@H]2CCCC[NH+]2C)cc1)C1CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49130", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule c1ccc(-n2cnc(C[NH+]3CC[C@@]4(CCOC4)C3)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199049", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCc1ccc(N2CCOCC2)cc1)Nc1cncc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48940", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N2/C(=N/C(=O)CCNC(=O)OC(C)(C)C)S[C@H]3CS(=O)(=O)C[C@@H]32)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95572", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NN1C(SCC(=O)Nc2ccc(Cl)cc2)=NN[C@@H]1[C@@H]1N=NC2=C1CCC2 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89567", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cccc(S(=O)(=O)NCc2csc(C3CC3)n2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120315", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@@H]([C@@H](C)[NH3+])N2CCN(C)C(=O)C2(C)C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37725", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cn1ncnc1CCNS(=O)(=O)c1cccc(C#N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82749", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)N[C@H](C#N)c2cccc(Cl)c2Cl)cc1[N-]S(C)(=O)=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83067", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)CSc1ccc([N+](=O)[O-])cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143102", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1CC[C@@]2(CCC1=O)CN(C(=O)CCN(C)S(C)(=O)=O)CCN2C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148717", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(CNC(=O)N(C)Cc2cn(-c3ccccc3)nc2-c2ccccc2)c(=O)[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151059", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CCN(C(=O)Cc1cccc(OCC#N)c1)C1CCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65505", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule O=C(Cn1ccc(=O)c2ccccc21)N[C@@H]1c2ccccc2C[C@@H]1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175765", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[NH+]1CCC(CC(=O)N[C@H](C(=O)[O-])c2ccc(F)cc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8365", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule C[C@@H](CCO)[NH2+][C@@H]1CCc2[nH]c3ccccc3c2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6653", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CNc1cc[nH+]c(CN2CCC[C@H](C)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17786", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)C[NH+](C)Cc1nc2ccccc2n1C)c1ccco1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "241378", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CC(=O)Nc2nonc2-c2ccc(OC(C)C)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66876", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@](C)(NC(=O)c1ccc2ccccc2c1O)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "14155", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC[NH+](Cc1nc2c(N)cccc2o1)C[C@@H](C)C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158593", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@@H](C)N(CC)C(=O)c1ccccc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "589", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](NC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99115", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc(NC(=O)[C@@H](C)n2nc(-c3cc(C)oc3C)cc(N)c2=O)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125694", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CCOC(=O)c1ccc(CN2CCO[C@H](C#N)C2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23931", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCc1ccc(C(=O)N2C[C@@H](C[NH+](C)C)[C@@H](CO)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135941", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CC#N)N1CCc2c(F)ccc(F)c2C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145238", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@@H](C)NC(=O)[C@@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52333", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1OCC[C@H]1C(=O)NCc1ccc(C(=O)NCC[NH+](C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172342", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(C)c1ccccc1NC(=O)NC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169274", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc([C@@H]2CC(=O)NC3=NC(SCc4ccccc4Cl)=NC(=O)[C@H]32)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81887", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CCNC(=O)c1cccn1-c1cccnc1)[NH+]1CCCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111656", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCC1(c2ccccc2Cl)CCOCC1)c1cccc(F)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196786", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule COc1ccc(N(C)C(=O)CCCO)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170191", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)C1(C)CCN(C(=O)c2cc(CC)n[nH]2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "228339", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(F)cc1NC(=O)[C@@H]1C[C@H]1c1ccc(C)s1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135167", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(Cl)cc1C[C@H](O)[C@@H](C)OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123277", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N1CCC(C(=O)OCc2ccc(-n3cccn3)cc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235894", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule C[C@@H]1C[C@](CCO)([C@@H](C)[NH3+])CS1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86690", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)CN2CCN(C(=O)CCS(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227114", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(-n2ccnc2)c(C(=O)N2CCN(C(=O)[C@H]3C[C@H]3C)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194692", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(C)C(=O)CC1CCN(C(=O)C(C)(C)c2ccccc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64081", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1CCC[C@@H](OCC(=O)NNc2ccc(-c3ccccc3)nn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7899", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(OCCn2c([C@@H]3CC(=O)N(Cc4ccccc4)C3)nc3ccccc32)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196859", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC(C)CC[C@@H](O)[C@H]1CCO[C@]2(CCSC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91992", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)[C@@H]1CC(=O)N(CCC2=c3cc(F)ccc3=[NH+]C2)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217902", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@]12CCC(=O)N1[C@H](C(=O)NCc1ccc(Br)cc1F)CS2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96111", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc(C)cc1[C@@H](O)CN1CCN(c2nccs2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([NH+](C)C[C@H]2C[C@@H]2C)cc(C(=O)[O-])c1N by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215139", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1ccc(Oc2cccc(C(=O)[O-])c2)nc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98506", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC(=O)N1CCC[C@@H](c2nc3c(c(C)[nH+]2)CCCN3Cc2ccc(F)cc2)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207664", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC[NH+]1CCN([C@@H](C)C[NH2+][C@@H](C)c2nc3cc(Cl)ccc3n2C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31059", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(C[NH2+][C@H]2CCC(=O)N(C)C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55440", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](Oc1cccc(Cl)c1)C(=O)N[C@H](C)c1ccc(S(N)(=O)=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174899", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCCC[C@@H](C)NC(=O)NCc1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "126338", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1CCCC[C@H]1NC(=O)C1CCN(c2ncnc3c2nc2n3CCCCC2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174660", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]([NH2+][C@H]1CC(=O)N(CC(F)(F)F)C1)c1cc(C)ccc1OC by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148843", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC1=C(C(=O)Nc2ccccc2)[C@@H](c2ccc(O)c(O)c2)n2ncnc2N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152444", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC1CC1)c1ccccc1NC(=O)C1CCOCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140246", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccsc1C(=O)NNS(=O)(=O)c1c(C)cccc1[N+](=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67874", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@]1(C(=O)NCc2ccc(F)cc2)CCCN(C(=O)Nc2ccc(F)c(Cl)c2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170001", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1[C@@H]2CCC[C@@H]2N1C[NH+]1CCC(c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42611", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc2[nH]nnc2c1)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61487", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[NH+](Cc1ccc(Br)cc1)[C@H]1CCC[C@@H]1S(C)(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48001", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)C[NH+](C)[C@]1(CN)CCN(Cc2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156782", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(N)cc(C)c1S(=O)(=O)NC[C@@H]1CCC(=O)N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145472", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1sc(N2C(=O)C([O-])=C(C(=O)c3ccccc3)[C@@H]2c2ccccc2OC)nc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62541", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]([NH2+]Cc1ccc2c(c1)n(C)c(=O)n2C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208563", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(C)c1noc(CCCC(=O)N[C@@H]2CC[NH+]3CCCC[C@H]23)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53325", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule Cc1cc(C)c2c(=O)cc(CS[C@@H]3NN[C@@H](c4ccco4)[NH+]3C)[nH]c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23528", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCCn1c(=O)c(=O)[nH]c2ccccc21)[C@H]1CCCN(c2ncccn2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122894", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)Oc1ccc(O)c([C@H]2CCC[NH2+]2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244141", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(C)n([C@@H](C)C(=O)N2CCc3c([nH+]cn3C3CC3)C2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144449", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1C[C@@H](C)CN(C(=O)CN2CCN(C(=O)CC(F)(F)F)CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167379", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCN1CCN(C(=O)c2cccc([N+](=O)[O-])c2)CC1)c1ccc(F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35867", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)CN(C)C(=O)N[C@@H]1C=CCCC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137643", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C=CCN(CC=C)C(=O)[C@@H](C)NC(=O)c1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H](C)CCN1C(=O)C[C@H](O)c1ccc(Cl)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139797", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCNC(=O)C1CN(C(=O)C(=O)Nc2cccc(C[NH+]3CCCCC3)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198771", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c([C@@H]2CCC[NH2+]C2)nn(C/C=C/c2ccccc2)c1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151765", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(F)cc(CNC(=O)c2sccc2Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88691", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C=C/c1cnc(-c2cccnc2)nc1C1CCN(C(=O)[C@H](C)Oc2ccccc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132109", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3134", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN1CCN(C(=O)c2ccn(C)n2)C[C@@H](Cc2ccc(-c3ccccc3)cc2)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77681", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(=O)NCc1ccc(S(=O)(=O)N/N=C/c2cccc([N+](=O)[O-])c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184622", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule CN[C@](C#N)(CSC[C@@H](C)CO)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64604", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOCC(=O)NNC(=O)c1sc2cccc(F)c2c1COC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120959", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cccc1[C@@H](CNC(=O)NCCc1ccccc1)[NH+]1CCCCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59252", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(CNc2ccc(C(=O)[O-])c(F)c2F)sc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96346", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C([C@H]1Cc2ccccc2O1)N(Cc1cccnc1)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186660", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](NC(=O)Cn1nnc(-c2ccsc2)n1)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169430", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)NCC(=O)Nc1nc(-c2ccc3ccccc3c2)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52500", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2csc(NC(=O)CCN3C(=O)[C@@H]4CC[C@](C)(C3=O)C4(C)C)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30950", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1ccc(N2C(=O)[C@@H]3CC4=c5ccccc5=[NH+][C@H]4[C@@H](c4cccc(OC)c4)N3C2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167719", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Cn1cnc2nc3c(cc2c1=O)CCCC3)NCCC[NH+]1CCc2ccccc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56486", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C[C@@H](NC(=O)c1ccc[n+]([O-])c1)c1ccc(F)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64276", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1n[nH]c(-c2cccc(CNC(=O)[C@H](C)Cc3cccc(Cl)c3)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121276", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccccc1[C@]1(CC(=O)N(C)[C@H](C)c2nccs2)CC(=O)N(Cc2cccnc2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95607", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cn1cc(S(=O)(=O)[N-]c2c(F)cc(Cl)cc2F)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19989", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2ocnc2C(=O)NCCCn2ccnc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)[C@@H](CC(C)C)N2Cc3ccccc3C2=O)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238954", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nc(Cc2ccc(F)cc2)sc1C(=O)NNC(=O)C[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222710", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCN(CC)C(=O)Nc1ccc([C@H](C)NC(=O)C2CC=CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "247765", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1CCC[C@@H](c2cc(CCO)n(C)n2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155198", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1992", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)N1CCc2cc(NC(=O)c3ccccc3Cc3ccccc3)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122666", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(NC(=O)c2cnc3n(c2=O)CCS3)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140513", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C[NH+](C)Cc2c([O-])[nH+]nn2-c2ccccc2)s1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159427", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(F)cc1S(=O)(=O)N1CCc2c(c(COCc3ccc(F)cc3Cl)nn2C)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16702", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(C[C@H](O)Cc2ccccc2F)nc2ccccc21 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200632", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)CCC(=O)Nc2ccc(F)c(C(=O)N(C)C)c2)cc1C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37496", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Fc1ccc(C(Br)c2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183937", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1c2ccsc2CCN1C(=O)Cn1ccc(=O)c2sccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54550", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cncs1)N1CCC(n2c(CCc3ccccc3)nc3cccnc32)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7447", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1c(N2CCC[C@H](C(=O)NCc3ccco3)C2)cc(=O)n(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203908", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1nccn1-c1ccc(CNC(=O)[C@@H]2CNC(=O)N2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90181", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc(CC(=O)N(C)Cc2ncnn2C)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "33755", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#Cc1ccc(S(=O)(=O)N[C@H](CN2CCOCC2)c2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209513", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(CSc1nc(-c2ccc(Cl)cc2)cs1)Nc1cccc2nsnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10301", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CON(C)C(=O)CN1CCN(Cc2csc(-c3ccccc3)n2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184009", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COCCNC(=O)[C@H](C)OC(=O)c1cc(C)ccc1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8933", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccc2ccccc2c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155210", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNS(=O)(=O)c1ccc2c(c1)OCCO2 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "107258", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=O)n(C)c2cc(NC(=O)CCc3nc4ccccc4s3)ccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172785", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccc(-[n+]2noc([O-])c2C[NH2+]Cc2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215961", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)[C@@H]1[C@H](CBr)N1N1C(=O)c2ccccc2C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3033", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1cccc2ncccc12)c1cc(-c2ccco2)n([C@H]2CCS(=O)(=O)C2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28868", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(COc2ccc(Br)cc2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209521", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nnc(SCCC(=O)Nc2cccc(F)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "249373", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule N#Cc1cccc(CNC(=O)Nc2ccc3c4c(cccc24)CC3)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248038", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CC1C[C@@H]2CC[C@H](C1)[NH2+]2)NCCc1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78141", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)C1CCN(c2ccc(N3CCCC3)nn2)CC1)c1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CCCCl)[NH2+]CCC(C)(C)C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103779", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CN(C(=O)N[C@@H]2CCS(=O)(=O)C2)C[C@H](c2ccc(F)cc2)O1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18326", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)Nn1c(C)c(C(N)=O)c(C(=O)OC)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159687", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H](Cc1nnc(NC(=O)C2CCN(C(=O)[C@H]3CC(=O)N(C(C)(C)C)C3)CC2)s1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229462", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](C(=O)NN)[C@H](C)[NH+](C)C[C@@H]1CCCOC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158042", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COC(=O)/C(C#N)=C/c1cccc(OC(=O)c2ccc([N+](=O)[O-])cc2Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74227", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1ccc(Cl)cc1)NC[C@H]1CN2CCCC[C@@H]2CO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155361", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)[N-]c1cccc(NC(=O)C2(c3cc(-c4ccccc4)on3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84990", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc(/C(Cl)=N/O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195727", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C/C(=C/c1cc2c(cc1[N+](=O)[O-])OCO2)S(=O)(=O)c1ccc(Cl)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175486", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCOC23CCN(C(=O)C(=O)NCCC(C)C)CC3)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235946", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C#CCNC(=O)COC(=O)c1sc(NC(=O)c2ccco2)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219846", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC(C)(C)O)C(=O)CN1CCCCCC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101768", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=S(=O)(Nc1nc2ccc(Br)cc2s1)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90220", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@](C)([C@@H](NC)c1ccc(F)c(C)c1)[NH+](C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24308", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COC(=O)c1ccccc1NC(=O)[C@H]1CCCCN1S(=O)(=O)c1ccc(Br)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233267", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)NC(=O)c1ccc(NC(=O)c2cnns2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63678", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)Nc2ccc(C)s2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230090", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(-c2cc(Cl)ncn2)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74074", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(Cl)c(OCC(=O)N(C2CCCCC2)[C@H]2CCS(=O)(=O)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112555", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Fc1ccc(Br)c(C[NH+]2CCCNCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H]1CCC[C@@H](O)C1)NCC1(c2ccccc2)CCC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231152", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCC1=c2ccccc2=[NH+]C1)c1ccc2c(c1)[C@H](c1ccccc1)ON2 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6532", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2nc(-n3nc(C)cc3NC(=O)c3ccc([N+](=O)[O-])s3)sc2c1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156855", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC(C)CCN(C(=O)[C@@H](C)/C(N)=N/O)C1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155007", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(CSc2nnc(C3CC3)n2-c2ccccc2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203272", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(O)c(C(=O)N2CCOC[C@@H]2C#N)c1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62394", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C#CCNCC(=O)N[C@@H](C)CS(C)(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62296", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH+](C)[C@@H](CNC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52256", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc2oc(=O)n(C[NH+]3CCC[C@H](NS(C)(=O)=O)C3)c2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163370", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCc1ccc(S(=O)(=O)Nc2cccc(C)c2O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42076", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2189", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H](C)NC(=O)[C@H]1CCCN(C(=O)c2cccc3[nH]ccc23)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21425", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216271", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1[C@@H](C)N(C(=O)NCCc2ccc(N(C)C)cc2)CCS1(=O)=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158492", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)c1ccc(NC(=O)c2c(C)cccc2C)c(O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246409", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCCc1nc(C)c([C@H](C)[NH2+]Cc2ccccc2C)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8538", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc(NC(=O)COC(=O)c2ccccc2C(F)(F)F)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168291", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCOc1ccc(N2C(=O)C[C@H]([NH2+]Cc3ccc(F)cc3)C2=O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34278", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H]([NH2+][C@H](C)[C@@H](C)C(=O)[O-])c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55765", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=C(C)COc1cccc(NC(=O)N2CC[C@@H](COCC)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220658", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)(C)OC(=O)N1CC[C@@H](C[S@@](=O)Cc2ccc(Cl)nc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150659", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(CNC(=O)C[C@H]2CCCCN2S(=O)(=O)c2ccc(F)cc2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171551", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)CCNn1cnnc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "70671", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H]1NC(=O)N(C)CCc1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94373", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)[C@@H]1C[NH+](C(C)C)CCC(=O)N1Cc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19379", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1-c1nnc(CS(=O)(=O)Cc2ccccc2)o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89868", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C/C(=C\\c1cccc(Cl)c1)C(=O)N1CC[C@@H](C)[C@H](O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157479", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1cc(S(=O)(=O)NCC[NH+]2CCN(c3ccccc3)CC2)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6410", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOC(=O)c1csc(CNC(=O)/C=C/c2ccnc(Cl)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95275", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@@H](CC12CC3CC(CC(C3)C1)C2)c1ccc(Br)s1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172926", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1cccc1C(=O)NNC(=O)c1ccc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113648", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccc(SC(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20534", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C1NCCN1[C@H]1CCC[NH+](C[C@@H]2CC(c3ccc(Cl)cc3)=NO2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17453", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(NC(=O)Cn2cccc(-c3nc(-c4ccc(Cl)cc4)no3)c2=O)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121080", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)[C@@H](Oc1ccccc1C#N)C(=O)N1CCN(C[C@H](C)O)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196158", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC(C)(C)CC(C)(C)NC(=S)N[C@H]1C[C@H]2CC[C@@H]1C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117927", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(CNC(=O)Cn2cnc3c(c(C)c(C)n3-c3ccc(Cl)cc3)c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52872", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1OCC[C@H]1C(=O)N[C@@H]1CC(=O)N(CC(F)(F)F)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157681", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1C[C@@H](N(C)C(=O)CSCC(F)(F)F)CC[NH+]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CN1C(=O)[C@H]2[C@@H]3C=C[C@@H](C3)[C@@H]2C1=O)N1CCN(c2ccccc2Cl)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21467", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCc1ccc(CNC(=O)N[C@@H](CO)c2ccc(Cl)cc2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209134", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(-n2c(C)cn(CN3CCC(O)(C(F)(F)F)CC3)c2=O)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91242", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CC[C@@H](C)[NH+](CC)[C@@H]1CCc2ccc(OC)cc2[C@@H]1NC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108032", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)NC1CCCCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130100", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#CC1=C(N)C(C#N)(C#N)[C@H](c2ccc(COc3ccc(F)cc3F)o2)[C@@H]2CCCC=C12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@H](Cc1cc(=O)[nH]c(-c2ccccn2)n1)c1ccccc1)C1CCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35201", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@@H]1O[C@H](C)Cn2c(-c3ccccc3)c3c(=O)n(C)c(=O)n(C)c3c21 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "210825", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H]2[C@@H](C(=O)NCc3ccccn3)c3ccccc3C(=O)N2c2ccc(OC)cc2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149935", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)C[C@@H]1COCCN1C(=O)NNC(=O)Cc1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113709", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COC(=O)c1s/c(=N/C(=O)[C@H]2CC(=O)N(CC(C)C)C2)[nH]c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55921", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(C[NH+]2CCCCC2)nc2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc21 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54500", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COC(=O)c1ccccc1OS(=O)(=O)c1ccc(C)cc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162986", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)NCC(=O)N1[C@@H](C)[C@@H](c2ccccc2)OC[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62452", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=C(C(N)=O)[C@H](c2ccc(Cl)cc2)n2nc(-c3cccc(Cl)c3)nc2N1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106508", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@@H]1[C@@H](CN(C)c2ccc(OC)cc2)CCC1(C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78175", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN(Cc1ccco1)C(=O)[C@H]1C=C(Cn2cnc3ccccc32)N=N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38337", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCCN(CCO)c1ncnc2ccc(F)cc12 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194564", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](C)c1ccc(OCc2ccc(C(=O)OC)o2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37421", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule Cn1ccc(-c2cccc(-c3ccc(C#N)cc3)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154245", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CC[C@H](C)NC(=O)Nc2cccnc2-n2cccn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209256", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[NH2+]C[C@]1(c2ccc(OCC(C)C)cc2)CC[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180421", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule Cc1nn(-c2ccc(C#N)c(N)c2)c(C)c1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18073", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N/N=C/c1cccc2ccccc12)c1ccccc1F by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220403", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CC[NH+](CC)C[C@H](C)Nc1cc(C)c([N+](=O)[O-])cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195922", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccc([C@@H](C)NC(=O)C2CCN(S(C)(=O)=O)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152164", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[C@H](O)Cc1ccc(OC)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77808", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C1CC1)n1c(N)nc2c[nH+]ccc21 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98838", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@H](Nc1ccc([NH+]2CCCCC2)cc1)C(=O)Nc1cccc([N+](=O)[O-])c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165329", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc([C@@H]2CCCN2S(=O)(=O)N[C@@H](C)c2nncn2C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145858", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C#Cc1cc(F)c(NC(=O)NCCCN2CCCCCC2=O)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20899", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@](O)(c1ccccc1)C(F)(F)F)c1ccccc1Cl by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "223990", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CN(C[C@H](O)C1CC1)c1cc(Cl)c(C(F)(F)F)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208815", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](C(=O)N1CCC(OCc2ccccc2C)CC1)c1c(C)noc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21091", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1ccc(CN2C(=O)CCC2=O)cc1)c1cnc(Cl)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196393", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H]2CC(Cl)=CC[C@@H]2C(=O)[O-])cc1[N+](=O)[O-] by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "154075", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)ccc1N[C@H]1CCCS[C@H]1C by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113001", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccnc(-c2ccccc2)n1)c1cnn(-c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "169493", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCn1c(SCC(=O)Nc2ccc(Cl)cn2)nnc1-c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90688", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)[C@H](OC(=O)[C@H]1CCS(=O)(=O)C1)c1cccc(C(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78575", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1cc(COc2ccc(NC(=O)c3cccc(C)c3)cc2)on1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110887", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cccc(C(C)C)c1NC(=O)N(CC[NH+](C)C)Cc1cccc(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "81049", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(C(=O)NCc2ccc(Br)cc2F)cc1OCC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214979", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]1CCCCCN1c1ccc(S(N)(=O)=O)c(N)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104028", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCC(=O)NCc1cc2n(n1)CCC[NH+](Cc1ccc3occc3c1)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232057", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C1[NH+]=c2ccc(C(=O)NCc3cccc(Cl)c3)cc2=[NH+]C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194739", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C1NN(c2cccc(Cl)c2)C(=O)/C1=C\\c1ccc(-c2ccccc2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183028", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)Nc1ccccc1C(=O)N1CCC[C@@H]1CO by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208635", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(Nc2ccccc2C(=O)[O-])nc(Nc2ccccc2C(=O)[O-])n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187224", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](CCc1ccccc1)NC(=O)Nc1ccc(OC(F)F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120486", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Oc1cccc(N2C(=O)[C@H]3CC=CC[C@@H]3C2=O)c1)c1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10410", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)c1noc2ncc(C(=O)N3CCc4sccc4[C@H]3c3ccccc3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122183", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O[C@@H]1CCCC[C@@H]1CC(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193921", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@H](C#N)OC(=O)CCOC1CCOCC1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202915", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1ccc(NC(=O)N2CCc3ccc(O)cc3C2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202083", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@H]1C(C(=O)OC[C@H]2CCCO2)=C(C)NC2=C1C(=O)CCC2 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216451", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)n1cc2cc(NC(=O)C(=O)NCC(C)(C)C(N)=O)ccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=C(C)C[NH+]1CCC(NC(=O)c2c(O)cc(Cl)cc2Cl)CC1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCCC[C@H]1c1ncc2c(n1)CCN(C(=O)CCC1CCCC1)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159921", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COC(=O)[C@@H]1CCCC[C@@H]1OC(=O)c1ccc(F)c(NC(C)=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108772", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2)cc1[N+](=O)[O-] by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225275", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C1CCCC[C@@H]1[C@H]1CCCCN1C(=O)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10600", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@](C)(NC(=O)Nc1cn[nH]c1)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97845", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cccc2sc(N3CCN(C(=O)[C@@H]4CCCN4S(=O)(=O)c4cccs4)CC3)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "218563", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O/N=C1/CCCN(Cc2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79738", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CCO)C(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244487", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1ccc(C)c(NC(=O)N2CCN(c3ccccc3F)CC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99634", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CS(=O)(=O)N(Cc1ccc(Cl)cc1)c1ccc(C(=O)Nc2ccccc2C(=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "55624", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1cc(NC(=O)c2cc(C)oc2C)cc(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233768", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@H]1c1cccc(O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221804", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CNc1ncccc1S(=O)(=O)N1CC[NH+]2CCCC[C@@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240581", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Nc1c(C(=O)c2cccs2)sc2nsc(SCC[NH+]3CCCCC3)c12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5993", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCO[C@H]1C[C@@H]1C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211177", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cn1c(=O)c2c(nc(N/N=C\\C(Br)=C/c3ccccc3)n2Cc2ccccc2)n(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15978", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule N#Cc1ccccc1OCC(=O)NNC(=O)c1ccc2c(c1)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19272", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CNc1ccc(-c2nnnn2C2CC2)cc1)N1N=C(c2ccc(Cl)cc2)C[C@H]1c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179635", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nc(C)c(C(=O)N2CCC[C@H](NC(=O)c3scnc3C)CC2)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164070", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#Cc1cccc(CSc2nnc(C[C@H]3CCS(=O)(=O)C3)o2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214215", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232789", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(CNC(=O)[C@H](C)N2Cc3ccccc3C2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181001", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)=C[C@@H]1[C@@H](C(=O)Nc2cc3c(cc2Cl)NC(=O)CO3)C1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83674", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnc([C@@H](C)NC(=O)NCC(=O)NC2CCCCC2)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152287", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ccc2c(C(=O)N3CCC[C@H](c4nc[nH]n4)C3)cccc21 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211766", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(CC(=O)Nc2ccc(C)cn2)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "167808", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccccc1)N1CCC(NS(=O)(=O)c2ccccc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79466", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc(Br)c(C(=O)N2CCN(CCO)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237270", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule C[C@H](N[C@@H](C)c1nc2c(s1)CCCC2)c1ccc(-n2cncn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201053", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@H](C)[C@@H](NC(=O)[C@@H]1Cc2ccccc2C[NH2+]1)C(=O)NC1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140837", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1[C@H](NC(=O)N[C@H](C)c1ccc(C)o1)c1nccn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176441", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule O=[N+]([O-])c1c(Nc2cc(Cl)cc(Cl)c2)ncnc1NC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134932", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(=O)N(c1nc(CSCC(C)C)cs1)c1cccc(C)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150527", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(c1)CCCN2S(=O)(=O)c1ccc(C#N)cc1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232363", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule C=C(C)C[NH+](CC)Cc1cc([N+](=O)[O-])cc2c1OCOC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Oc1cccc(Cl)c1)C(=O)N1CCC[C@@H]1C(=O)N(C)C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95196", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CCC[C@@H](C)C[C@H](O)c1ncc[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65278", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3333", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCc1nnc(NC(=O)c2cccc(S(C)(=O)=O)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226506", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(C)[C@H](C)NC(=O)N[C@H](C)c1ccc(F)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100382", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule N#CCC[C@H](C#N)CN1CCc2c(cccc2N2CCOC2=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98069", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)c1sc(=S)n(-c2ccccc2F)c1N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162607", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1[nH+]ccn1CCN1CCN(C(=O)C(C)(C)Oc2ccc(Cl)cc2)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6118", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccnc1NCCNC(=O)c1ccc(F)nc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187848", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(C[NH+](C)CC2CC(Cl)C2)c2ccccc2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150398", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1N(C)CC[C@@H]1CCC[C@]1([NH3+])CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118870", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2ccc(NC(=O)c3cccc(CS(C)(=O)=O)c3)cc2o1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211427", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCOC(=O)CS[C@H]1CC(=O)N(c2ccc(O)cc2C)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109817", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(OCCCCn2cnc3ccccc3c2=O)c(C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64721", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H](C)NC(=O)[C@H](C)Sc1cccc2cccnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9313", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCCN1C(=O)CN1CC[NH+](CC(=O)Nc2ccccc2SCC#N)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177872", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=[N+]([O-])c1c(NCCNS(=O)(=O)c2ccccc2)nc2ccccn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150618", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@H]1NC(C(=O)Nc2cnn(C)c2)=NN(c2ccccc2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30735", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1nccc1CNC(=O)C(=O)Nc1ccc(Oc2ccc(Cl)cc2)nc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19439", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(F)c(NC(=O)N[C@@H](C)c2cc(OC)c(OC)cc2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191248", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule N#CC(C#N)=C(N=C(c1ccccc1)c1ccccc1)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245821", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CCc1nc(CNc2ccccc2S[C@H](C)CC#N)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180364", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(/C([O-])=N/S(=O)(=O)c2ccc(C(C)=O)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137911", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C/C(C(=O)NC1CCCCC1)=C(\\[O-])c1cccc(-c2ccoc2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194087", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC1CCC(N(C)C(=O)Nc2cc(N3CCCC3=O)ccc2Cl)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89950", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1ccc2c(=O)n(C3CCC(O)CC3)cnc2c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113007", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1cn(-c2ccc(F)cc2)nc1C(=O)N1CCC(Cc2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185970", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCCNc1ccccc1OC(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48781", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(c1ccco1)N1CCN(c2ncc(Cl)cc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224983", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1csc(C(=O)NCC(=O)OC2CCCCC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108756", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)c2ccc(Cn3nc(-n4cccc4)c4c(C)cc(C)nc43)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155449", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCS[C@@H]1CCC[C@@H](NC(=O)[C@@H]2CCC(=O)O2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68091", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(NC(=O)C[C@@H]2Nc3cc(C)c(C)cc3NC2=O)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15855", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=C1C=C([O-])N2C(=NC(NCCC3=c4cc(OC)ccc4=[NH+]C3)=[NH+][C@@H]2c2ccccc2)N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175289", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/[NH+]=C(/NC[C@H](C)C#N)NC[C@@H]1CCC[NH+](C)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "198116", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)Nc2nc(CN3C[C@H](C)O[C@@H](C)C3)cs2)cc1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180490", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc([C@@H]2C(C#N)=C(N)Oc3[nH]nc(C)c32)ccc1OC(F)F by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42815", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)n1cc(C#N)c(NC(=O)C(=O)N2CC[C@H]([N+]3=CCCC3)C2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181752", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(OCC(=O)N2N=C3CCCC[C@@H]3[C@]2(O)C(F)(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201414", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCN(C(=O)C2CCN(S(=O)(=O)c3cccc4nsnc34)CC2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104586", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Fc1ccc2nc(CN3CCC[C@H](c4nncn4C4CC4)C3)oc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134058", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1c(=O)c2ccc(Cl)cc2n2c(SCc3cccc(OC)c3)nnc12 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113187", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1ccc(SCC(=O)Nc2cccc(Cl)c2Cl)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52942", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CCc1nn(C)cc1NCc1ccccc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106490", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ncccc1C(=O)N[C@@H]1CC(=O)N(C2CCCCCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231232", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H]1Nc2ccc(Br)cc2NC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248633", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "541", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(OCc1cc(=O)oc2cc(O)c(O)cc12)c1nn(-c2ccccc2)c(=O)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230546", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[NH2+][C@H]1CC[C@@H](Cc2cccc(O)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202207", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2c(cc1C)O[C@@H](C(=O)N1CCC[C@@H](CCC(N)=O)C1)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245849", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule NC(=O)c1ccc(C(=O)Nc2ccc(N3CCSCC3)c(Cl)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40155", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccccc1CNC(=O)c1nn2ccccc2c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93725", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=S1(=O)C[C@H]2Sc3nncn3[C@@H]2[C@H]1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200110", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(=O)n(CC(=O)N2CCC(c3[nH+]ccn3C)CC2)c2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@H](NC(=O)c1c(F)cccc1F)C(=O)NCC[NH+]1CCc2ccccc2C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117219", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cc(C(F)(F)F)nc2nc(NC(=O)c3ccco3)ccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "16908", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1c(C(=O)N2CCCCC[C@H]2C[C@@H](O)c2ccco2)cnn1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140775", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)[C@@H](NC(=O)c1ccccc1)C(=O)N1CCCSCC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148093", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN1C(=O)c2oc3cc(C)cc(C)c3c(=O)c2[C@H]1c1cccc(O)c1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180926", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C2=CC[NH+]([C@H](C)c3nnc(C)o3)CC2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18291", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1[C@H]2CC=CC[C@@H]2C(=O)N1CCN1CCCS1(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28410", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN1C(=O)N(CC(=O)[O-])C(=O)C12CCCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31590", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule N#Cc1ccc(Oc2ccnc(-c3ccccc3)n2)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "28232", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)NCC(=O)N1CCCC[C@@H]1Cc1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190926", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(C(=O)Nc2ccc(C(=O)OC(C)(C)C)cc2)c(=O)[nH]c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157048", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(c1ccc(=O)n(-c2ccccc2)n1)N1C[C@H]2CCC[C@@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27580", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1/C=C\\C=c1/sc2nc(-c3ccccc3OC(C)=O)nn2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138224", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccoc1C(=O)OCCCn1nnc(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179632", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CNC(=O)N1CCCn1nnc(-c2ccc(Br)cc2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139752", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COCCCNC(=O)c1cccc2c1N[C@H](c1ccccc1Cl)[C@H]1CC=C[C@@H]21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196207", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(CCCc1ccccc1)Nc1c(C(=O)Nc2ccc3c(c2)OCCO3)oc2ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199404", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCCCN(C)c1cc[nH+]c(CN2CCN(C(C)=O)CC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64628", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1cccc(OCC(=O)NC2CCOCC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "46410", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1nn(C)c(C)c1NC(=S)NCc1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219843", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C=CCC[C@H](C)OC(=O)c1cc(NC(C)=O)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205563", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2CCOCC2)c(NC(=O)c2cc(OC)c(OC)c(OC)c2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92510", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]([NH2+]C1CCN(C(=O)[C@@H]2COc3ccccc3O2)CC1)c1ccccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101051", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CC[C@@H]1CCc2nc(NC(=O)c3ccc([N+](=O)[O-])o3)sc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10938", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(C[NH+](C)CC(=O)N[C@H]2CCS(=O)(=O)C2)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "69034", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(C(=O)CCc2cscn2)[C@H](C)CN1C(=O)OC(C)(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "158024", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccccc1NC(=O)CCN1C[C@H](C(=O)[O-])CC1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "166044", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CSc1ccc(CCNC(=O)c2cc(=O)nc3sc(N4CCCCCC4)nn23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15270", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CNC(SCc1cc2c(cc1Cl)OCO2)=C(C(C)=O)C(C)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42027", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C[C@H]1CCCC[C@H]1NC(=O)N1CCC[NH+](Cc2ccc(C#N)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215948", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1c(Cl)cc(C[NH+]2CCC(N3CCCCC3=O)CC2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48070", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(F)c(C(=O)N[C@H]2C[C@](C)(OC)C2(C)C)c1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188329", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCN(Cc1cnn(C)c1)S(=O)(=O)c1cccc(C(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246917", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccccc1-n1nnnc1SCC(=O)Nc1ccccc1C(=O)NC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181113", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCc1nnc2sc(-c3ccc(OC)c(NC(=O)c4cc(Cl)c(OC)c(Cl)c4)c3)nn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "45650", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@H](CSC)N(C)C(=O)[C@@H]1CN(Cc2ccccc2)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200495", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2cc3c(=O)n(CC(=O)Nc4ccc(C(C)C)cc4)ccn3n2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170673", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1ccc(NC(=O)C(F)(F)F)c(Cl)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203367", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COC(=O)CNC(=O)c1cnn(-c2ccc(Cl)cc2)c1-n1cccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108041", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COCCO[C@@H](C)C(=O)Nc1cc(F)c(F)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196929", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1(C)CCN(C(=O)[C@@H]([NH3+])CC(=O)[O-])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128241", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nn(C)c2ncc(NC(=O)COc3ccc4ccccc4c3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39225", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=C(NCCC(=O)N1CCCC1)Nc1ccn(Cc2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "102452", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cccnc1SC1CCCC1)N1CCC([C@H](O)c2ccccc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75837", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)(CNC(=O)NCc1cccc(Cn2cncn2)c1)c1ccncc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179957", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCn1c(C)nnc1S[C@@H](C(=O)Nc1cccc(F)c1)C(C)C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193543", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC1(C)COC(=O)[C@@H](Br)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152672", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1nccc1CNC(=O)c1cccc(C#N)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36799", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCOc1cc(C)ccc1NC(=O)N1CCCC[C@@H]1CN1CCCC1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15117", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CS[C@@H](CO)[C@H](C)NC(=O)c1cn(C)nc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20909", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CCC[C@@H](NC(=O)C(=O)Nc2ccc(Oc3ccc(F)cc3)nc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42793", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(=O)[nH]c(C)c1CC(=O)Nc1sccc1C(=O)[O-] by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232342", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cn1cc(C(=O)NC[C@@]2(O)CCCc3ccccc32)c(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193267", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC(C)(C)OC(=O)N1CC[NH+](Cc2ccc(Cl)nc2)[C@H](C(=O)[O-])C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H](C)c1cnc(-c2cncc(Br)c2)nc1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162417", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CCc2cc(F)ccc2N1S(=O)(=O)CCOc1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19613", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C#CCN/C(NCC(C)(C)[NH+]1CCCCC1)=[NH+]/CC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195832", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccn2c(=O)c(C(=O)N3CCOC[C@@H]3C3CC3)cnc2c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "238455", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=C(NCc1c(O)ccc2c1CCCC2)N[C@@H]1CCN(CC(F)(F)F)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51754", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)(C)c1ccc(-c2csc(NC(=O)c3ccccc3OCC(N)=O)n2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139638", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule N#C[C@@H]1COCCN1Cc1cc(O)ccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222716", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(CC(=O)NCC[NH+](C)C)S(=O)(=O)c1cc(Cl)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160782", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(F)cc1)N1CCS[C@@H]1c1cccc(F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191903", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(C(=O)NCc2ccc(NC(=O)C3CC3)cc2)cc(S(N)(=O)=O)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "212213", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule C[C@H]1C[C@H](Nc2ncccc2C#N)C(=O)N1c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215283", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](Cc1ccc(-c2ccccc2OC)cc1)CC(C)(C)O by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180890", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+]Cc1ccc(C(N)=O)o1)c1cc(Br)ccc1F by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181552", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(N(Cc2cc3cc(C)ccc3[nH]c2=O)C(=O)c2ccc([N+](=O)[O-])cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165127", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Nc1c(Nc2nc3ccccc3s2)ncnc1Nc1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185805", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CCN(C(=O)[C@@H](C)n2c3ccccc3c3cnn(C)c(=O)c32)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211725", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC[C@@H](C)N[C@@H]1CCCC[C@@H]1[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "101456", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cccc([C@@H]([C@H](C)[NH3+])N(C)C[C@@H]2CCC[NH+]2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199955", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)c1ccc(C(F)(F)F)cc1)[C@@H]1CCCN(c2ccccc2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129516", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccc(CN(C(=O)c2sc3ccccc3c2Cl)[C@H]2CCS(=O)(=O)C2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145588", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1nc([O-])c(C(=O)N[C@@H](C)c2ccccc2C)cc1C#N by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109196", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nnc(NC(=O)c2noc3c2COc2ccc(C)cc2-3)s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211935", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-n2nc(C(=O)[O-])c3c2CCC3)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37820", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cn1nc(C(=O)Nc2ccccc2C(C)(C)C)ccc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220147", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc(OC(=O)[C@H](C)S(=O)(=O)c2ccc(F)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106260", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(CC)N1C(=O)C2(CCCC2)NC(=O)C1(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67238", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H]1Nc2ccc(C(=O)NCc3ccccc3Cl)cc2NC1=O by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203208", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1ccc(CN2CCN(CCn3cc[nH+]c3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114012", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "968", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1cc2c(cc1/C=C/C(=O)NCC(C)(C)[NH+](C)C)O[C@@H](C)C2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "137518", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[NH2+]C[C@@H](C)C(=O)NCCNC(C)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152538", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1N1C[C@H](C(=O)Nc2ccc(O)cc2)CC1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84563", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COCC(=O)N/N=C/c1cc(Br)ccc1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226174", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)Nc1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190493", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc(C[C@H](O)Cc2ccn(C(C)C)n2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6861", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CSCCOC(=O)C1CCN(C(=O)c2ccc(F)cc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217994", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCCNC(=O)c1cc2c([nH]c1=O)CC[C@H](C)C2 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185737", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]([NH2+]CC1(CS(C)(=O)=O)CC1)c1ccc(N2CCCCC2)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83366", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2[C@@H]1c1ccc(OCC(N)=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135144", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](OC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1)C(=O)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232156", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@H](C)N(C)C(=O)[C@H]1CCC[NH2+][C@@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237902", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc([C@@H]2c3c(oc4ccc(C)cc4c3=O)C(=O)N2Cc2ccc(C)cc2)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85217", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(Cc1ccc(F)c(F)c1)C[C@H](O)c1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "47792", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1C[NH+](C)Cc1c(O)ccc2ccccc12 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCCNC(=O)[C@@H]1COc2ccccc2O1)Nc1nc2ccccc2s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "129256", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule OC[C@H](Nc1cccc(Br)c1)c1cccc(C2CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232539", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCn1c(=O)c(N2CCC(C(=O)Nc3cccc(Cl)c3)CC2)c(C)n(-c2ccccc2)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "74504", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCc1cc(C(=O)NCC(=O)N2CCc3ccccc3C2)no1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240977", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)(C)c1ccc(NC(=O)/C=C/c2ccc(S(C)(=O)=O)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193256", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](NC(=O)C(C)(C)C)c1nc2ccccc2n1CC(=O)N(C)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171420", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[C@H]1CC[C@H]([C@H](O)Cc2cccc(O)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "56137", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C1CSc2ccc(NC(=O)c3cccc4cn[nH]c34)cc2N1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "30536", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@]1([C@@H](O)c2ccc3c(c2)OCCO3)CCOC1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144929", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nc(C)sc2CC(=O)Nc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182837", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)CCn1ccc(NC(=O)c2ccccc2C)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181972", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N[C@@]2(CCc3ccccc32)C(=O)N1Cc1nnc(-c2ccco2)o1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "123394", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(Cc1ccco1)C(=O)Cn1cnc2sc(-c3ccccc3)cc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "65181", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H]1C(=O)N=C(N2CC[NH+](CC)CC2)[N-][C@H]1c1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68552", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](C[NH+]1CCCCC1)NC(=O)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40465", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccc([C@H](C)C(=O)N(CCC(N)=O)c2ccc(F)cc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "89622", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)c1ccc(CNC(C)=O)cc1)c1cccc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77428", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1[nH+]ccn1CCN1CCN(C(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "225010", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(CN2CCN(C(=O)Cn3cncn3)CC2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111314", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(CNc2ccc([N+](=O)[O-])c(N)n2)CCCC1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134416", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(=O)N2CCN(C(=O)Nc3cccc(C)c3)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161325", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1nn(C)cc1-c1cc(C(F)(F)F)nc(N2CCC[C@@H]2C(=O)[O-])n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179631", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CN[C@@]1(C(=O)OC)CCC[C@@H]([NH+]2CCC(COC)CC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "204911", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)[C@H](C#N)NC(=O)[C@]1(C)CCCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162366", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccccc1NC(=O)C(=O)NCc1ccccc1Cn1cccn1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170525", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC[C@H]([NH2+]C1CCSCC1)c1ccc(Cl)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "7057", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C1CCCC1)[C@H]1CC[C@]([NH3+])(CO)C1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192128", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCOc1cccc2sc(N(C[C@H]3CCCO3)C(=O)[C@@H]3Oc4ccccc4O[C@H]3C)nc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111284", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCn1cc(-c2c(-c3ccccc3)ncn2CCNC(=O)c2cccnc2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211389", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1CNc1ccc(NC(=O)[C@@H]2CCCO2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88105", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(c1)c(=O)c(S(=O)(=O)c1ccccc1)cn2CC(=O)Nc1ccc(C)c(Cl)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "128496", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)NCCNC(=O)NCc1ccc(CN2CCc3ccccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229326", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1cc(Cl)c(C)cc1NC(=O)CS(=O)(=O)Cc1cc(C)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116547", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COCC[S@](=O)[C@H](C)C(=O)Nc1ccc(F)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193531", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1ccncc1)[NH+](C)CC(=O)N[C@@H](c1ccc(F)cc1)C1CCCC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135060", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H](NC(=O)NCC(=O)Nc1ccccc1)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40400", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H](O)[C@@H](C)SCC(=O)Nc1ccccc1C(=O)Nc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "98636", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1cc(C(=O)[O-])cc(-c2cc(Cl)ccc2OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "13713", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(C(=O)N[C@@H]2CCCC[C@@H]2C(F)(F)F)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "18965", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CNC(=O)N[C@@H]1C[C@H]1c1cccc(Cl)c1)NCc1ccccc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "10545", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCC([NH+]2CCCC[C@@H]2CC(N)=O)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95249", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1ccccc1N1CCCC1)c1ccc(-n2cncn2)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "35403", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](CC(=O)N(C)[C@H]1CCCC[C@@H]1S(C)(=O)=O)n1cccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "110550", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nc(-c2cccc(OC)c2)nc(CC)c1CC[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "157314", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule O=[N+]([O-])c1ccc(S(=O)(=O)NC[C@](O)(c2ccccc2)C(F)(F)F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "161878", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(Nc1nc(-c2ccc(Cl)cc2)cs1)c1cc2c([nH]c1=O)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111711", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OC/C=C(\\Cl)c1ccc(Cl)cc1Cl by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "82715", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCC[NH+]1CCC(CNC(=O)C(=O)Nc2ccc(F)c(C(N)=O)c2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242509", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCCN1C(N)=[NH+]C[C@]12CC(C)(C)OC2(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170787", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=C1N[C@@H](C(=O)NC[C@@H](O)c2cc(Cl)cc(Cl)c2)CS1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232277", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CNc1cccc(COc2cncc(Cl)c2)[nH+]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141952", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOc1cc(C=O)cc(Br)c1OC(=O)c1ccccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "214265", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1cccc(NC(=O)CCN2C(=O)[C@@H]3Cc4cc(OC)c(OC)cc4CN3C2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240981", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule N#Cc1ccc(NC(=O)c2c3c(nc4ccccc24)CCC3)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11121", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)[C@@H](CNC(=O)C(=O)Nc1ccccc1)N1CC[NH+](C)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186509", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1nc2ncnn2c(N2CCC(O)(C(F)(F)F)CC2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38200", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc([C@H](C)NC(=O)C2CC=CC2)c(C)o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "26496", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccccc1CNC(=O)NCc1ccc(OC(C)C)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215221", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(NC(=O)C[C@@H](NC(C)=O)c2ccc(Cl)cc2)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203226", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(SCc2ccc(Cl)c(Cl)c2)=N[C@@H]2CS(=O)(=O)C[C@H]21 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135649", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1ccc(C#N)cc1)C2=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135961", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H]1CCC[C@@H](NC(=O)c2ccc3c(c2)NC(=O)CO3)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227770", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](O)C[NH+]1CCC2(CCC(=O)N(Cc3ccccc3)C2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164491", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C(=O)c1ccc(F)cc1F)n1cnc2c1c(=O)n(C)c(=O)n2C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "27378", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(NCc1ccc2c3c(cccc13)C(=O)N2)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37077", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]1C[C@@H]1C(=O)N1CCN(C(=O)CNC(=O)c2ccc(C#N)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9996", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NC[C@@H]1COC2(CCCC2)O1)Nc1c(F)cccc1Oc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34805", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc([C@H]2CCCN2C(=O)Nc2ccc(OC)c(C)c2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219022", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCNC(=O)c1cc2cccc(Cl)c2o1)NCc1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34732", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CNc1ccc(CN2CC[C@@H](CN3CCOCC3)C2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "174383", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cn1c(=O)c(=O)n(CC(=O)N2CCC3(CC2)OCCO3)c2cccnc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "345", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(SCCC(=O)Oc2ccc3ccc(=O)oc3c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163982", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC[C@H](CNC(=O)c1ccc([N+](=O)[O-])cc1F)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "222733", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H]1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)CCO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9072", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCNC(=O)CNC(=O)Nc1ccccc1N1CC[NH+](CC)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213306", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)Nc1nc2ccccc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176380", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccc(/C=N/NC(=O)CSc2nnc(-c3ccncc3)n2N)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106472", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[NH+](CC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)CC(=O)Nc1c(Cl)cccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181514", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccc(C2=N[NH+]=C(N3CCN(C(=O)C(C)C)CC3)SC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120310", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(NC(=O)[C@@H]2C=C(c3ccncc3)N=N2)cc1N(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235767", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC[NH+](C)C1CCCCC1)C(=O)CCn1nnc2ccccc2c1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192424", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nnc(N2C(=O)c3oc4cc(OC)ccc4c(=O)c3[C@H]2c2cccc([N+](=O)[O-])c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203330", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1c(-c2ccc3ccccc3c2)csc1NC(=O)c1cccnc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159447", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N2CCN(c3ccccc3OC)CC2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103915", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule N#Cc1ccc(N2CCC(O)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134219", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)C[C@@H]1Oc2ccccc2N(Cc2snnc2C(C)C)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245734", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1[nH]nc(C(N)=O)c1NC(=O)CCC(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71099", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C=CCOc1ccc(/C=C(\\C#N)C(=O)c2c[nH]c3ccccc23)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92395", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(C2(O)CC[NH+](CC(=O)N3C[C@H](C)O[C@H](C)C3)CC2)nc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "162610", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCN(CC)c1ccc(C(=O)Nc2ccc3oc(COC)nc3c2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52632", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(C1=C([O-])C(=O)N(CC[NH+]2CCCCC2)[C@@H]1c1cccnc1)C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193822", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Cn2cc(-n3c([S-])nnc3[C@@H](C)Cn3nc(C(F)(F)F)cc3C)cn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103266", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2c(N(C)CC(=O)NC(C)(C)C)ncnc2s1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "177142", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H]1CCCN(C(=O)Nc2ccc(F)c(Br)c2)[C@H]1CO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "124601", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CCNc2ncnc3sc(C(=O)[O-])c(C)c23)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164508", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCN1C(=O)c2ccc(C(=O)N(C)[C@H](C)c3ccccc3)cc2S1(=O)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237961", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCOc1ccc([C@H]2C(C#N)=C(N)Oc3cc(OC(=O)[C@@H]4COc5ccccc5O4)ccc32)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "58944", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(C)cc(NC(=O)c2ccc(NC(=O)[C@H]3[C@@H]4C[C@@H]5OC(=O)[C@@H]3[C@@H]5C4)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66675", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=S(=O)(N[C@H]1CCCc2ccccc21)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "42218", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1ccccc1NC(=O)Cn1c(C)nc2c(sc3nc(-c4ccccc4)ccc32)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37390", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H]1CCCN(C(=O)c2ccccc2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201612", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1sc2ccccc2c1Br by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231839", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccccc1-c1nc(C[NH2+][C@H](C)C(C)(C)C)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207693", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCOC(=O)[C@@H]1CCCN(C(=O)Nc2ccc(OCC)c(Cl)c2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83603", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)[C@@H](CNC(=O)c1cc(F)ccc1O)Cc1ccc(F)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221747", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](O)c1cc2cccc3c2n(c1=O)CCC3 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "152878", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CN1CCN(C(=O)c2cnn(-c3ccccc3)c2)[C@@H](c2ccccc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87568", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Br)cc1-c1nnc2n(Cc3ccccc3)c3c(=O)n(C)c(=O)n(C)c3n12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8009", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule O=C([O-])CCCC(=O)Nc1ccc([N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)OC[C@H]2COC(C)(C)O2)c(F)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73996", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CNC(=O)c1ccc(CSCc2cccc(NC(C)=O)c2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "87765", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@]1(C(=O)Nc2ccc(C#N)cc2)Oc2ccccc2NC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230370", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1cncc(NC(=O)C(=O)N[C@@H]2CCCC[C@H]2O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22736", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cccc2c1[nH]c1nc(SCC(=O)Nc3ccc(Cl)cc3)nnc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72565", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(NC(=O)[C@H]2CS[C@@]3(C)CCC(=O)N23)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206552", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cc(Br)c([C@H]2OCC[C@@H]2CO)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36286", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule N#Cc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@@H]2C=C[C@@]3(CO)O2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125055", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCNC(=O)/C(C#N)=C/c1cccc(O)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "401", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1cccc(NC[C@H](O)c2ccco2)n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "83201", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1ccc(C(=O)N2CSC[C@H]2C(=O)[O-])o1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "97477", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(C[NH+](C)Cc2nc(-c3ccc(C)s3)oc2C)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187284", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1nn(C2CCC2)c2cc(F)ccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "179385", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCSc1cncc(NCc2scnc2C)n1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211197", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule C/C(=C\\C(=O)NCc1cc(C#N)ccc1F)CCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "105886", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]([NH2+][C@@H](C)c1nc2cc(Cl)ccc2n1C)C(=O)N1CCOCC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171750", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN(C(=S)Nc2c(C)cc(C)cc2C)C2CC[NH+](C)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127760", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CCC(=O)N1CCN(C(=O)N[C@@H](C)c2ccc(C#N)cc2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)CN(C)C(=O)Cc1coc(-c2ccccc2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22704", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1c[nH+]c(NCc2ccc(C#N)cc2)nc1NCc1ccc(C#N)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "200920", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule FC(F)(F)C1(C(F)(F)F)CCN(Cc2cnn3c2NCCC3)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196344", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=S(=O)(/C=C/c1ccc(Cl)cc1)NCc1ccc2ccccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1OCC(=O)O[C@H](C)C[NH+]1CCOCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79510", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=c1c2ccccc2ncn1CC(O)Cn1cnc2ccccc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226277", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(COc1ccc([N+](=O)[O-])cc1Cl)NC1CCCCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4837", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(C[C@@H]1C=NN=C1c1ccccc1)C(=O)c1cccc(C#CC(C)(C)O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "227713", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1cccnc1)c1ccccc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60773", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1ccc(N)cc1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1550", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(C2=CCN(C(=O)c3cnn(C)c3-n3cccc3)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "22494", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COCC[C@@H](C)NC(=O)Nc1cc(F)ccc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130219", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CN1CCO[C@H](COc2ccc(CC(N)=S)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "159867", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](Nc1nnnn1-c1ccccc1)C(=O)NC[C@@H]1CCCO1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183153", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCC[C@H](NC(=O)CSc1nc2ccccc2n(C)c1=O)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "193899", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@@H](Nc2ncnc3[nH]cnc23)C1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9240", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cscc1C(=O)Nc1ccc(C#CC[NH3+])cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "34972", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@](N)(C(=O)OCc1ccc(Cl)cc1)C(F)(F)F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "86098", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCCOCC(=O)Nc1cc(C(N)=O)ccc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "113391", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH+]1CCC[C@H](C(F)(F)F)C1)Nc1nccs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220037", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCCCc1nc(C)c(C(=O)N(CC(N)=O)C2CCCC2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224290", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule N/N=C1\\C[C@@H](c2ccccc2)Oc2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195871", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C(=O)Nc1cc3c(cc1Cl)OCCCO3)CC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119328", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC1(C)C[C@@H](Nc2cc(S(C)(=O)=O)ccc2Cl)C(C)(C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "104665", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=S(=O)(c1cccc(Br)c1)N1CCN(C[C@H](O)c2ccccc2F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118940", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=C(Br)CN1CCC[C@H]1CN1CCOCC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94135", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C1C[C@@H](C(=O)N2CCC[C@@H](O)C2)CN1CCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9827", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(C)C)cc2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170686", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1csc(N2CCCN(C(=O)[C@@H]3C[C@@H]3c3ccccc3C)CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "2468", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(N2C[C@@H](C(=O)N3CCCSC[C@H]3C[NH+](C)C)CC2=O)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216559", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@@H]1CN(C(=O)NCc2ncnn2C)C[C@@H](c2ccccc2)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "144956", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(CCC(=O)c1cccs1)N[C@H]1CCCN(Cc2ccccc2)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103069", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N2CCc3ccccc3C2)c(Cl)c1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "64531", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(/C=N/NC(=O)CNC(=O)c2ccccc2I)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44767", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1nc(C[C@H](O)CCOc2ccccc2)sc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141568", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cc(C)n(-c2ccc(N3CCN(C(=O)c4ccc(F)cc4F)CC3)nn2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244287", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule c1ccc(-c2nc(SCc3cn4cccnc4n3)oc2-c2ccccc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76494", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCCNC(=O)CN1C(=O)/C(=N\\NC(=O)c2ccccc2Cl)c2ccccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11971", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](Cc1cccc(F)c1)C(=O)NCC(C)(C)c1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "246749", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc(C(=O)Cn2c(=O)c(C#N)cn(C3CC3)c2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111693", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H]1CN(C(=O)/C=C/c2ccc(N3CCCC3=O)cc2)C(C)(C)CO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "91267", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C/[NH+]=C(/NCC(=O)Nc1ccc(F)cc1)N[C@@H]1C[C@H]1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240168", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(C(=O)NCc2cccc(OC)c2)ccc1OC by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186219", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1ccc(C)c(NC(=O)N[C@@H]2CC(=O)N(c3cccc(F)c3)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202987", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)c2ccc(-n3cncn3)nc2)ccc1N(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "156220", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C)c(CNS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)s1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61376", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(=O)N[C@@H](c2ccccc2Cl)C2=C1CN(CC(=O)NCc1ccccc1)C2=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15960", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCOc1nnc(CN2CCN(c3ncccc3F)CC2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164353", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(C)c1cc(C(=O)Nc2ccc([S@](C)=O)cc2)ccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "51821", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1cccc(CN(C)S(=O)(=O)c2ccc(C(C)C)cc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29411", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(/C=C/C1CCOCC1)NC1(c2ccc(F)cc2F)CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108000", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@](C)([C@H](N)Cc1cccc(Br)c1)[NH+]1CCCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199314", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CSc1ccc2cc(CN3C(=O)N[C@](C)(c4ccco4)C3=O)c(Cl)nc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119380", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN1C(=O)c2[nH]nc(-c3cc(C)ccc3O)c2[C@@H]1c1ccc(C)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23503", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)c1ccc(-c2nc3cc(NS(=O)(=O)Cc4cccc(F)c4)ccc3n2C)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17624", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cccc(OCc2nnc(SCc3cc(F)cc4cccnc34)o2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "133814", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)NC(=S)NC(=O)c1ccc(OC(C)C)c(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164487", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCS(=O)(=O)N1CCC[C@@H](C(=O)NC2CCCCCC2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139612", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule COc1ccc(NC(=S)NC(=O)c2ccccc2Br)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213423", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cn1ccnc1Sc1ccc(N)c(N)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "236197", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule c1cc(CCCNc2ccc(-c3nc(C4CC4)no3)c[nH+]2)ccn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189903", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule N/C(=[NH+]\\[N-]S(=O)(=O)c1ccccc1OC(F)(F)F)c1ccc(C(F)(F)F)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "231511", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule Cc1csc([C@@H](C#N)C(=O)c2ccc(F)c(F)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "226748", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@H]1CC(OCc2cc(F)cc(C#CC[NH3+])c2)C[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189255", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COc1ccccc1NC(=O)[C@H](C)Oc1ccccc1C#N .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211036", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1cc(NC(=O)CCc2cnn(C)c2C)ncc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "170177", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1cnc(C(C)(C)NC(=O)CCCOc2ccccc2Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17564", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(-c2cc(N)c(=O)n(CC(=O)N3[C@@H](C)CCC[C@@H]3C)n2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "184207", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@@H](Cn1cncn1)NC(=O)Nc1cc(F)cc(N2CCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "242164", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229826", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC[C@H](O)C[C@@H](Cc1ccccc1OC)C(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209382", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)(CNC(=O)NC[C@H]1CCN(c2ccccc2)C1)C(N)=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "143109", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule COc1ccc(NC(=O)c2cc(C)cc(OC)c2O)c(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172903", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC1CCN(C(=O)/C=C(/C)c2ccccc2OC(F)F)CC1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73774", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@@H]1COc2ccc(F)cc2C1)N1CCC[C@@H]1c1ccccc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188219", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C)c(S(=O)(=O)N[C@@H](C#N)c2ccccc2F)cc1OC by removing a nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "23100", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule NC(=O)c1cccc(OCC(=O)N[C@@H](c2ccc3c(c2)CCCC3)c2cccs2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90821", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CSc1ccc(C(=O)NC[C@H]2C[C@@H](O)C[NH+]2Cc2ccccc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127089", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1C(=O)NC(=S)Nc1sc2c(c1C#N)CCCC2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80126", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(/N=C2/S[C@@H](CC(=O)Nc3ccc(C(=O)[O-])cc3)C(=O)N2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "54301", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)[C@@H](C)N2CCO[C@H](C)C2)ccc1Br .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "187788", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nc(COc2ccccc2)sc1C(=O)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5588", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](SCC1=NC(=O)C2=C(c3ccccc3)CSC2=N1)C(=O)N1CCN(c2nccs2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "36098", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[NH+](CC(=O)c1c(C)cc(C)cc1C)CC(C)(C)O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229895", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCC[C@H]1NS(=O)(=O)c1ccc(CC(=O)[O-])cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95726", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CC[S@@](=O)[C@H]1CCCC[C@@H]1NC(=O)NCc1ccc(OC)c(O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "135709", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCc1nnc(NC(=O)c2c(C)c(-c3ccccc3)nc3ccccc23)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]C[C@H](Cc1ccccc1)Cc1cccc(O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189348", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(N[C@@H]1CCCCC[C@H]1C(=O)[O-])C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248830", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule CC(=O)N1c2ccccc2C[C@H]1C(=O)N(Cc1ccccc1)[C@@H](C)CCO .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80131", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc(F)c(N[C@H](C)c2sc(C)nc2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "165272", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule CC(C)S(=O)(=O)CC(=O)N1CCN(c2ncccc2C#N)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "3095", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CCNC(=O)c1cccc[n+]1[O-])c1cccc(C(F)(F)F)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151507", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)CN1CC[NH2+]CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175575", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1noc([C@@H]2CCC(=O)N(CCCN3CCCC3=O)C2)n1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "48859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@@]2(C)NC(=O)N(Cc3cccc(F)c3)C2=O)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "181487", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@H]1CN(C(=O)c2ccc(Br)s2)C[C@H]1C by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25319", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Cl)cc(C)c1Oc1cc([C@H](C)O)ccn1 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75233", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)n(-c2cccc(NC(=O)NC3CCCCCC3)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146025", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccccc1OCC(=O)Nc1cccc(C(=O)N(C)c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29889", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@H]1CCN(C(=O)CCc2nc(-c3ncccn3)no2)[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116194", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cnc(CNC(=O)[C@@H](OC(C)(C)C)c2ccccc2)n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "199131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CC(=O)[O-])N1C(=O)S/C(=C\\c2ccc(Cl)cc2)C1=O by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146330", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@@H](c1cc(F)cc(Br)c1)[C@H]1CCOC2(CCOCC2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "62490", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)C(=O)N1CCc2c(c(C(=O)N3CCC(C(=O)NC4CCCCCC4)CC3)nn2C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "15490", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COC[C@@H](NCc1ccc(OC)c(C#N)c1)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188195", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC[C@H](C(=O)NCc1cc(-c2ccccc2)on1)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "208264", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc([C@H](CNS(=O)(=O)c2ccc(C)cc2Cl)N2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "145414", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCc1nnc(S[C@@H](CC)C(=O)NCc2ccco2)c2cc3occc3n12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "71679", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@@H](C)Oc1ccc(C[NH2+]C2CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213878", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC1=C/C(=N\\OC(=O)c2ccccc2Cl)C(C(C)C)=CC1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59275", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C)c(OC2CCN(Cc3scnc3C)CC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84342", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)N(C1CC1)[C@@H](C)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "90011", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H](OCC(F)(F)F)C(=O)N1CCC(c2ccc(F)cc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "244338", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@@H]1C[C@@H](C)C[NH+](Cc2ccccc2CNC(=O)N2CCO[C@H](C)C2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "108614", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Cc1ccc(-c2ccc(N)cc2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216748", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1cc(N2CCCC2)ncn1)Nc1cccc(Cl)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79908", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(=O)c1c(C)[nH]c(C(=O)NC2CCC(O)CC2)c1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215264", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]([NH2+][C@@H](COC)c1ccc(F)c(F)c1)c1cnn(C)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "114102", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)[C@H](C)S(=O)(=O)Cc2c(C)nn(C)c2Cl)cc1C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94699", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1[NH2+]CCC[C@@H]1C(=O)Nc1ccc(CCO)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185291", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule N#Cc1ccccc1/C([O-])=N/S(=O)(=O)N1CCc2ccccc2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "142664", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)NC[C@@H](C)Oc2ccccc2F)s1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220183", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule C[C@H]1CC(C(=O)NCc2ccc(OCc3ccccn3)cc2)C[C@H](C)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12362", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule COc1ccc(-c2cnc(SCC(=O)Nc3ccc(F)c(F)c3)n2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "12371", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(CC(=O)N2CCC[C@H]2Cn2nc(C)cc2C)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "121697", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H]1CN([C@H]2CCN(CC(F)(F)F)C2=O)CCO1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155595", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(CNc2nc(-c3ccccn3)nc3c2CC[NH+](C)CC3)n[nH]1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "93279", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/N=N/c2cc(C)ccc2O)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "132771", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule N[C@H]1CCCn2c1nc1cc([N+](=O)[O-])ccc1c2=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117253", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc(Cl)c(C(=O)OCc2ccc(Cl)nc2)c1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "21457", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[C@@H](NC(=O)CSc1nnnn1C)c1cc(F)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "139363", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@H](NC(=O)c1cc(-c2cccs2)nc2ccccc12)[C@@H](C)N1CCOCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "195140", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)NCC(=O)N1CC[NH+](C2CCC(C)CC2)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76192", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Oc1ccc(C[NH+]2CCC[C@H]2C[C@@H](O)c2ccco2)c(O)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "164455", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=[N+]2C(=N)/C(=C/c3ccc(-c4cc([N+](=O)[O-])ccc4C)o3)C(=O)N=C2SC1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11633", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])c(NC(=O)[C@@H](C)[NH+]2CCCCCC2)c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "122788", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule COc1cc(OC)cc(-c2cc(N)n(S(=O)(=O)c3ccc(OC)c(OC)c3)n2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209514", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1cc([C@@H]2NC(=O)NC2=N)cc(C)c1O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)N1CCC[C@H](O)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "248049", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule Cc1csc(Cn2ccc([C@@H](O)C(C)C)c2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "116620", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CCn1nc(C(=O)N2CCC(C(N)=O)CC2)ccc1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "117401", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@@H]1[C@H](C[NH+](C)C[C@@H](C)O)CCC1(C)C by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "194065", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+][C@@H](C)c1cccc(O[C@@H]2CCCCNC2=O)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175427", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)c2ccc(NC(=O)c3ccccc3Cl)cc2)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "11014", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C[C@@H](C(=O)NC1CCCCC1)[S@@](=O)Cc1nnnn1C1CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52268", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN(Cc1ccccc1)C(=O)CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151283", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(/C=C/c1ccco1)Nc1ccc(NC(=O)c2ccco2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172431", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1nn(Cc2ccccc2)c(C)c1CNc1cncc(C(N)=O)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111261", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule O=[N+]([O-])c1cc(Br)ccc1N1CC[C@H](O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "202606", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CN1C(=O)C([C@@H]2c3c(n(C)c(=O)n(C)c3=O)Oc3ccc4ccccc4c32)C(=O)N(C)C1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160909", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1noc(COCC(=O)N2CCSC[C@@H]2c2ccc(C)o2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119368", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N/C(=N/C(=O)c2ccc(C)cc2)NC[C@@H]2CCCO2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "52925", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C1CC[C@@]2(CCCN(C(=O)c3c[nH]c(=O)cn3)C2)CN1Cc1cccnc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237254", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-c2noc(C[S@@](=O)[C@H](C)c3ccccc3)n2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "67026", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Oc1ncnc(N(C)[C@H]2CCS(=O)(=O)C2)c1N by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79148", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[C@@H](C)n1c([C@@H]2CCC[NH2+]2)nc2cc(C(F)(F)F)ccc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134302", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cc(S(N)(=O)=O)ccc1NC[C@@H]1CCC[C@@H]1O by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245164", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1cccc(C(N)=O)c1)C(c1ccccc1)c1ccccc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "72817", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccon1)N[C@H](c1ccc(F)cc1)[C@H]1CCCO1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201411", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1cnc2nc(C)ccc2c1Nc1ccc(S(N)(=O)=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "160269", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(=O)C(=Cc2c(N3CCCCC3)nc3ccccn3c2=O)C(=O)N(C)C1=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235514", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)(C)NC(=O)N1CC[C@@]2(C1)C(=O)Nc1ccccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17035", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC1(C)CC(=O)C2=C(C1)OC(/N=C/N1CCCC1)=C(C#N)[C@H]2c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "76762", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Sc2nncn2C)ncc1N by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136540", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(CCC(=O)N1CCN(c2ccccc2F)CC1)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6203", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1=C(C)C[C@H]2C(=O)N(c3ccccc3C)C(=O)[C@H]2C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "44341", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)c1ccsc1NC(=O)c1ccsc1NC(=O)c1cccs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211331", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "1814", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitrile from the molecule COc1ccc(C(=O)c2c(C)c(C#N)c(=O)n([C@@H](C)c3ccccc3)c2[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235828", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CC(=O)N1CCCN(C(=O)C(=O)Nc2cccc(Cl)c2Cl)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "224397", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule CCCCN(C)C(=O)N[C@H]1CCCc2ccc(F)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "172210", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(C)(C)C(=O)O[C@H](C)c2ccccn2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "40891", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(N(C(C)=O)c2nc(CSc3nnc(C(F)(F)F)n3N)cs2)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "25218", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=S(=O)([N-]c1nc2ccccc2nc1Cl)c1ccc2ccccc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "207471", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCSc1nc(CC(=O)N2CCC3(CC2)OCCC[C@@H]3OC)cs1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168980", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CN1CCc3sccc3C1)C2=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130573", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule NC(=O)[C@@H]1CCC[NH+]1[C@H](C(=O)[O-])c1c[nH]c2cc(NC(=O)c3ccccc3)ccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20167", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCn1cc(CN2CCO[C@H](c3cc(C(=O)NCC(C)C)c4ccccc4n3)C2)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125620", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=NN2C(=N)/C(=C\\c3cc(C)n(-c4ccc(Cl)cc4)c3C)C(=O)N=C2S1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "168709", "split": "OpenMolInst" } }, { "instruction": "Remove a nitrile from the molecule N#CCc1nc2cc(C(F)(F)F)c(C#N)cc2s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "211104", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule CCc1nn(C)c(OC)c1CN[C@H](C)c1ccnc(Cl)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131676", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(c1)[C@H](O)[C@@H]([NH+]1CCCC(C)(C)C1)CC2 by removing a hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "140159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(C[NH2+][C@@H]2CCCC[C@H]2C(F)(F)F)[nH]1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "20890", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCc1ccc(NC(=O)NCc2n[nH]c(=S)n2C(C)C)cc1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "100634", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccc(C(=O)N2CCN(Cc3noc(-c4cccc(Cl)c4)n3)CC2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "182021", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(N[C@H]1CCOc2ccccc21)c1cnc([C@@H]2CCCO2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "141700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N2CCCC[C@@H]2C)n2nc(-c3ccccc3C)nc2n1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31522", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCNC(=O)c1ccc(N(CCC[NH3+])C2CC2)[nH+]n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155577", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCn1c(=O)c2c(nc3n(-c4ccc(C)c(C)c4)c(C)cn23)n(C)c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "125064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC1CC[NH+](C)CC1)[C@@H](C[NH3+])c1cc(Cl)cs1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4641", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C([O-])c1ccc2c(c1)[N-]C1=NS(=O)(=O)N=C1N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "192817", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)n1c(S[C@@H](C)C(=O)NC2CC2)nnc1N(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37626", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCS(=O)(=O)c1cccc(C(=O)N(Cc2ccncc2)c2nc3cc(OC)ccc3s2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "150207", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#C/C(=C\\c1ccco1)C(=O)Nc1ncc(Cc2ccc(F)cc2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109777", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)C[NH2+]C1C(C)(C)C1(C)C by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "6034", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCc1ccc([C@@H](O)[C@]2(C)CCCO2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "146076", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CC(=O)N(Cc2ccc(C)o2)c2ccc(F)cc2)no1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "120971", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CO[C@@H]1C=C[C@@](CNC(=O)[C@@H]2CCCN(c3cc(-n4cccn4)ncn3)C2)(OC)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "106244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Nc2nnc(S[C@H]3CC(=O)N(c4cccc(Cl)c4C)C3=O)s2)cc1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96704", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Nc1ccccc1F)c1ccc(S(=O)(=O)N[C@H]2CC[NH2+]C2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "9717", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CC[NH2+]C[C@@H](Cc1ccc(F)cc1)c1ccccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "197671", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule Cc1c(NC(=O)[C@@H](C)Sc2nncs2)cccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "206885", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)N(C)C(=O)NCCc1csc(-c2ccccc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78436", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CC(C)(C)c1nc(CCNC(=O)c2c(O)cccc2O)cs1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "134400", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule Cc1ccc(F)cc1[C@@]1(O)CCCC1(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2nc(NC(=O)C3CCN(c4cnccn4)CC3)sc2C)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180139", "split": "OpenMolInst" } }, { "instruction": "Remove a amine from the molecule O=S(=O)(NCc1nnnn1-c1ccc(F)c(F)c1)c1cccc(C(F)(F)F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "49291", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule COc1cccc([C@@H](CNC(=O)Nc2ccc([N+](=O)[O-])cc2)[NH+](C)C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "78788", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(C)n1nccc1NC(=O)C(=O)N[C@@H]1CCCC[C@H]1OC1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "84062", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH+](Cc1ccc([N+](=O)[O-])cc1)CC1CC[NH2+]CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147768", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1cc(F)c([C@@H]2C[S@@](=O)CC(C)(C)N2)cc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "95180", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN[C@@H](Cc1ccccc1Cl)C[NH+](C)C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "24980", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1ccc(C(=O)Nc2ccccc2N2CCNC(=O)C2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "73090", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule Cc1sc(C[NH3+])nc1-c1ccc(Cl)cc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66957", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@H]1CCCCN1C(=O)[C@H](C)OC(=O)c1ccc2nc(C)c(C)nc2c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68750", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule CC(C)(C)C(=O)NC(=S)Nc1cccc(C(=O)N2CCCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "68112", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1n[nH]c2ncc(C(=O)Nc3nnc(C4CC4)s3)cc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131032", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)Cn1c(C2CCCCC2)nc2ccccc21)C(N)=O by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "88178", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1n[nH]cc1CNC(=O)c1ccncc1C#CC[NH3+] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "190959", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCO[C@@H]1C[C@H]1C(=O)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "5163", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CSCC[C@@H](NC(=O)c1ccccc1Cl)C(=O)N[C@@]1(C)CCS(=O)(=O)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196221", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1ccc(O[C@H](C)C(=O)N/N=C/c2cccnc2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138474", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule CCCc1ccc(C(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19015", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Cc1oc(-c2ccc(C(=O)NC3CCCC3)cc2)nc1C[S@@](=O)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "180868", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule NC(=O)NC(=O)CSc1ncnc2sc3c(c12)CCCC3 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "94544", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[C@H](Sc1ccccc1)c1nc(-c2cnccn2)no1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "240671", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cccc(C(=O)Nc2nc(-c3ccccc3)ns2)c1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "188102", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(C)n1nccc1NC(=O)COc1cc(F)ccc1F .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "216569", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc(NC(=O)N[C@H](C)c2cnn(CC)c2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "176195", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@H](Oc2ccc(C)cc2)C1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "183677", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc([C@H](CNC(=O)c2ccc(-n3cccc3)cc2)N2CCOCC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "196687", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc2c(CCNC(=O)N(C)Cc3ccccc3O)c[nH]c12 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "219290", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)N1CCc2ccccc2C1)[NH+]1CCC[C@H](O)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "186887", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCO[C@@H](C)c1noc(CN2CCN(C(=O)CC(F)(F)F)CC2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "191341", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cccc(C(=O)/N=C(/[N-]Cc2cccnc2)Nc2ccc(Cl)cc2C)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "112066", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=C(NC(=S)Nc1cccc(CO)c1)c1ccccc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "203923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cccc(S(=O)(=O)Oc2ccc(Cl)cc2)c1)N1CCCC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163942", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCC(=O)N(C)c1ccccc1C(=O)NCC(=O)OC(C)(C)C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "38540", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=Cc1cccc(OCc2cccc3ccccc23)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217086", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nsnc1COc1cccc(C(=O)N[C@@H]2CCS(=O)(=O)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "31294", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1onc(C)c1NC(=O)N(Cc1ccc(Cl)c(Cl)c1)C1CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "59246", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCN(C(=O)c1cc(C2CC2)n(C(C)(C)C)n1)c1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "17484", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@@H](OC(=O)c1ccc2c(c1)CCC(=O)N2)C(=O)Nc1ccc(Cl)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "153060", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1c(C)cccc1C1=N/C(=C\\c2ccc([N+](=O)[O-])cc2)C(=O)O1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "19390", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCN(C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237517", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule C[NH+]1CCC(N(Cc2ccco2)C(=S)Nc2cc(Cl)ccc2C(F)(F)F)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8470", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@H](C)[NH2+]CC(C)(C)N2CCS(=O)CC2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80717", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c(CCC(=O)Nc2cccc(-c3n[nH]c(C)n3)c2)c1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "147498", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC(C)CC(C)(C)C(=O)NC1CCN(c2ccccc2)CC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99405", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(COC(=O)c1ccco1)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "155066", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule Nc1cccc(C(=O)/C=C/c2ccccc2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "29606", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C[C@@H](C)C[NH+](CCNC(=O)NCc2ccccc2F)C1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "221152", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CC(=O)N1CC[C@@H](NC(=O)NCc2ccc(N3CC[NH+](CC4CC4)CC3)cc2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "232163", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COC(=O)[C@H](CC(C)C)NC(=O)c1cnc2ccc(C)cn12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "220152", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(NC(=O)c2ccc(Cl)c(N)c2)c1 by removing a amine.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "235590", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)CC2CCCC2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "66874", "split": "OpenMolInst" } }, { "instruction": "Remove a nitro from the molecule Nc1ccc(C(=O)Nc2ccccc2SC(F)F)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "57681", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC1(C)Cc2c(sc(NC(=O)C(=O)NC[C@@H]3CCCO3)c2C(N)=O)CO1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "118391", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=[N+]([O-])[C@H]1C[C@@H]1/C([O-])=N/S(=O)(=O)c1ccc(Cl)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209027", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule O=S(=O)(NC[C@H](c1cccs1)S(=O)(=O)c1ccc(Cl)cc1)c1ccc(F)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "79306", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CCc1nnc(NC(=O)NCc2cccc(C[NH+](C)C)c2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92669", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CC[C@H](Sc1nncn1C(C)(C)C)C(=O)NCc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148157", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1nnc(S[C@H](C)C(=O)N(C)c2ccccc2)n1-c1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "61749", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule O=C(NCc1nccc2ccccc12)c1c(Cl)cccc1Cl .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "233334", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(C2=CCN(C(=O)c3ccc(Cl)nc3)CC2)cc1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "115375", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccnc(N2CCc3c(cccc3NC(C)=O)C2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "37078", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1CCC([C@H]2CC=CCN(Cc3ccccc3)C2=O)CC1 by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8175", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule C=CCO[C@H](C)C(=O)Oc1ccc2c(c1)CCC(=O)N2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "171564", "split": "OpenMolInst" } }, { "instruction": "Remove a halo from the molecule C[C@H]1CC(Oc2c(F)cc(CC[NH3+])cc2F)C[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "4959", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule O=C(c1cnccn1)N(Cc1ccc2c(c1)OCO2)C1CCCC1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "185293", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule C[C@@H]1CC[C@H](NC(=O)Nc2cc(C(=O)N(C)C)ccc2F)[C@H](C)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "8189", "split": "OpenMolInst" } }, { "instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)Nc2ccccc2N2CCCC2)cc1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "111176", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCOc1ccc(NC(=O)N(C)CC[C@@H](C)O)cc1OC .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "163205", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(Nc1cccc(C(=O)Nc2nccs2)c1)c1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "130918", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc([C@@H](OC)[C@@H](C)NC(=O)c2sc(C(C)C)nc2C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "80901", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)NC[C@@H](c1ccco1)[NH+](C)C)c1ccc(C(F)(F)F)cc1 by removing a halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "119108", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule CN(C(=O)COCCOc1ccccc1)c1cccc2ncccc12 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "127321", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1Cc1noc(CN2CCC[C@@H](C[NH+]3CCCC[C@@H]3C)C2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "245840", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N[C@@H](c1ccccc1)c1ccco1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "148288", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCN(C(=O)c2cc(=O)[nH]c3cc(F)ccc23)[C@@H](C)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "230991", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1cccc(C(=O)N2CCC[C@H](Nc3ccc(F)cc3)C2)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "75352", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COc1ccc2[nH]cc(C(=O)N[C@@H](C(=O)Nc3ccc(C)cc3)c3ccccc3)c2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "50681", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CN(CCO)C(=O)C[C@H]1C(=O)NCCN1Cc1ccc(F)c(F)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "205363", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCOC(=O)c1cccc([N+](=O)[O-])c1C by removing a benzene_ring.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "175432", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2c(cnn2C(C)C)cc1C(=O)N1CCC[C@H](c2[nH]cc[nH+]2)C1 by removing a amide.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "85844", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule Cc1cc([C@@H](C)NC(=O)CCCCO)c(C)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "60204", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)Cn2ncccc2=O)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "92585", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cn1cc(COC(=O)/C=C/c2ccccc2OC(F)(F)F)cn1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "213680", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1ccc(CCCC(=O)NCc2nc(-c3ccncc3)no2)s1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "136356", "split": "OpenMolInst" } }, { "instruction": "Please remove a hydroxyl from the molecule O=C(NC[C@@H]1CC[C@H](C(=O)[O-])O1)c1ccc(CO)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "109610", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Oc1cccc(/C=C(\\C#N)C(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])c1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217490", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule O=NNc1nc2ccccc2n1Cc1ccccc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "229756", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule Cc1n[nH]c(-c2ccc(NC(=O)CCC(C)C)cc2)n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "237014", "split": "OpenMolInst" } }, { "instruction": "Please remove a nitro from the molecule CNc1ncnc(NC[C@H]2CCCO2)c1[N+](=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "99567", "split": "OpenMolInst" } }, { "instruction": "Remove a amide from the molecule CCCCn1nc(C(=O)N2CCC(C(=O)c3ccc4c(c3)OCCO4)CC2)c2ccccc2c1=O .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "215495", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccc(-c2nc(=S)c3c(n2-c2ccccc2)CCCC3)cc1 by removing a nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "103396", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-c2nc(C[NH2+]C3CCN(c4cccc(C)[nH+]4)CC3)co2)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "209214", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule COc1ccc([C@@H]2CN(C(=O)c3cccc(Cl)c3)C[C@H]2C(=O)NCCC(C)C)cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "189757", "split": "OpenMolInst" } }, { "instruction": "Please remove a halo from the molecule O=C(Cc1ccncc1)N1CCC[C@H](c2cccc(Cc3ccccc3F)n2)C1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "151632", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=C2\\Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c(OC)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "63729", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule CCOCCSc1nc([O-])c2cnn(CCO)c2n1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131873", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule O=C(N/N=C/c1ccccc1F)c1cncc(Br)c1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "149290", "split": "OpenMolInst" } }, { "instruction": "Remove a hydroxyl from the molecule COc1ccc2c(c1)c(C(=O)N/N=C/c1ccc(O)c(O)c1)c(C)n2C .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "77383", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COc1cc(/C=N/NC(=O)c2cc(Cl)ccc2O)ccc1OCC(=O)[O-] .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "131395", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule C[C@](O)(CNC(=O)c1n[nH]c2ccccc12)c1ccsc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "96641", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule COCC(=O)N[C@H](C)c1nc2ccccc2[nH]1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "201743", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule CCCNC(=O)[C@@H](C)S(=O)(=O)Cc1cc(-c2ccccc2)on1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "39688", "split": "OpenMolInst" } }, { "instruction": "Please remove a amide from the molecule CC(=O)c1cc2c(cc1NC(=O)CCC(C)C)OCO2 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "217104", "split": "OpenMolInst" } }, { "instruction": "Remove a benzene_ring from the molecule N#C[C@@H](c1ccccc1)[C@@H]1CCCN1c1ccc([N+](=O)[O-])cc1 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "138476", "split": "OpenMolInst" } }, { "instruction": "Please remove a benzene_ring from the molecule COCCn1ccc2ccc(NC(=O)[C@H](C)c3ccc(OC)cc3)cc21 .", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "delete_component", "index": "53134", "split": "OpenMolInst" } } ]