[
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Cc1ccc(Cl)cc1)NC[C@](O)(c1ccccc1)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(C[NH+]1C[C@H]2CC=CC[C@H]2C1)NOCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)c1c(C)[nH]c(C(=O)NC2=NCCS2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102138",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](Oc1ccc([N+](=O)[O-])cc1F)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218964",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCCN/C(N)=[NH+]/CC[C@@H](C)SC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54266",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Ic1ncn(C2CCCC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226306",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](C)Oc1ccc(NC(=O)/C=C/C(=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]1COC[C@H](C)N1C(=O)c1cc(F)c(F)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129774",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(NCCCc1n[nH]c(=O)[nH]1)[C@H]1C[C@@H]1c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4647",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C([C@@H](O)c1ccccc1)N1CCN(c2ncc(Cl)cc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241035",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CO[C@@H](C)C(=O)O[C@H](C)c1ccc(C)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80945",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cccc(-c2cc(C3(C(=O)NC4CC[NH+](Cc5ccccc5)CC4)CC3)no2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113549",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(C1CCC1)N1C[C@@H]2CC[C@H](C1)N(C(=O)c1cc(Cl)ccc1O)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205850",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOc1ccccc1N1C[C@H](C(=O)NC)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95101",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCn1ccc2ccc(NC(=O)c3ncccc3OC(C)C)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239829",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cn1nc(-c2ccccc2F)ccc1=O)c1ccc(Cl)s1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89230",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC(C)(C)NC(=O)c1ccc(NC(=O)C(=O)NCC2CCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111718",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)Cc2csc(NC(=O)C3CC3)n2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126892",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NC(=S)Nc1cccc(N2CCCC2)c1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule [NH3+]C[C@@H]1CCC[C@@H]1COCc1cc(Cl)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H]2C(C#N)=C(N)N(N(C)C)C3=C2C(=O)C[C@@H](c2ccccc2)C3)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131953",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCC[C@H](C[NH3+])[C@@H](O)c1cc(Cl)c2c(c1)OCCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145253",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)[C@H](O)[C@@H](c1ccccc1O)n1nnc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181034",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)[C@@H]2CCC[NH+]2Cc2cc(-c3ccccc3)[nH]n2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111420",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)c1cccc(SCCS(=O)(=O)c2ccc(C)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209834",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule N/C([S-])=[NH+]/Nc1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248810",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCCC[C@H](C)[NH+]1CCN(C(=O)Cc2c(C)noc2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117862",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCNC(=O)NC(=O)CNc1cccc(F)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101109",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nn(Cc2c(Cl)cccc2Cl)c2sc(C(=O)OCc3ncon3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])CC1(NC(=O)CC2C[C@@H]3CC[C@H](C2)[NH2+]3)CCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167518",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)NC(=O)c1cc([C@@H]2CN(C(=O)c3ccncc3)CCO2)nc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211139",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCc1cc(-c2ccccc2)on1)c1ccc(F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6656",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)CCNC(=O)C1(c2cccc(C)c2)CCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Sc1nccn1-c1cccc(F)c1)C(=O)Nc1ccc2c(c1)OCCO2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47089",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N1C(=O)C[C@@H]([NH+]2CC[C@H](C(=O)[O-])[C@@H]2C)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112161",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1c(C)sc2nc(S[C@H](C)C(=O)N3CCCC[C@@H]3CC)n(C[C@@H]3CCCO3)c(=O)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221214",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1ccc(NC(=O)c2sc3nc(C)nc(N4CCC(C)CC4)c3c2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220385",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](CCc1ccc(O)cc1)NC(=O)N1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C(=O)COc1cccc(N)c1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99508",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=CCNC(=S)NNC(=O)c1cnc(-c2cnn(C)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130517",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC1(CC)CCN(c2cccc(F)c2C(C)=O)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152902",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1c(NC(=O)/C=C/c2ccccc2Br)c(=O)n(-c2ccccc2)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94604",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule c1ccc(-n2cnnc2SCC2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237759",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C([O-])c1cccc(-c2cc(NCc3ccccn3)nc3[nH]ccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82724",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCNC(=O)CNC(=O)Nc1ccccc1SC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@](C)(O)CNC(=O)C(=O)Nc2ccc(Cl)cc2)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50786",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCC[NH+]1CCC(NC(=O)N[C@@H](CO)c2cccc(OC)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215018",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc2c1N(S(=O)(=O)c1ccc(C#N)cc1C)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(-c2csc(NC(=O)CSc3ccc(NC(C)=O)cc3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc([C@@H](C)NC(=O)N[C@@H]2C[C@H](C)N(c3ccccc3)C2=O)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196777",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=c1c2cnc3ncnn3c2ccn1CCCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231735",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cc(C)c(C(N)=O)c(N[C@H]2C=C[C@H](C(=O)[O-])C2)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19214",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](Oc1ccccc1)c1nnc(NC(=O)Nc2cccc(Cl)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190465",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)Oc1ccc(CNC(=O)[C@@H](C)Oc2ccccc2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201410",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN(C(=O)N[C@H](Cc1ccccc1)c1ccccc1F)C1CCS(=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162707",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=C(CN1CCN(C(=O)[C@@]23CNC[C@@H]2C[NH2+]C3)CC1)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159092",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(O[C@@H](C)C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64474",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccsc1[C@H](O)[C@@H]1CCOC2(CCSCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167246",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CSC[C@H](CCO)NC(=O)Nc1cc(Br)cn(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54313",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(COc1ccc(-n2cnnn2)cc1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166187",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc([C@@H](C)[C@H](C)N[C@@H](CO)c2cc(F)c(F)c(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150511",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCn1cc(NC(=O)C[NH+]2CCC[C@H](Cc3nc4ccccc4[nH]3)C2)c(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40740",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H]1C(C)=CC(=O)C[C@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(C[NH+]2CCC(CNC(=O)C3CC[NH+](C)CC3)CC2)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116681",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Fc1ccc(-c2cn3c(n2)-c2ccccc2C3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175679",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CC[NH+]1CCC(C(F)(F)F)CC1)Nc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197062",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCc1ccc(F)cc1F)C1CCN(c2ncnc3c2oc2ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178309",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc2c(c1)CCC1=C2N=N[C@@H]1C(=O)N1CC[NH+](C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212992",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCCc1nc2ccccc2s1)c1ccc(N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160405",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(-n2nc(C(=O)N3CCCC3)c(=O)n(Cc3ccccc3)c2=O)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162186",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1c(C)sc(NC(=O)[C@H]2CC(C)=C(C)C[C@H]2C(=O)[O-])c1C(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccc(Cl)cc1Cl)Nn1cnnc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177502",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCCCN1CCOCC1)C(=O)Nc1cccc(F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14220",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc2c(c1OC)C(=O)O[C@@H]2NNC(=O)c1ccccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204754",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H]1CCCC[C@@H]1NC(=O)C[NH+]1CCC[C@H](n2c(=O)oc3ccc(Cl)cc32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196044",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(C#N)cc(I)c1OCC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8872",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)c1nc2sc3c(NCCCO)ncnc3c2c2c1CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77677",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1800",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)[C@@H]2CC(=O)OC2(C)C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule N#C[C@H](NC(=O)[C@H]1CCOc2ccccc21)c1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80795",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCNC(=O)[C@@H]1CCCN(C(=O)N[C@@H](CCCO)c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183163",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)(C)OC(=O)[C@H](N)c1ccnc(C#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145485",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NS(=O)(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCNC(=O)C[C@@H](C[NH3+])N1CC[NH+](C(C)(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98075",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(NC(=O)[C@@H](NC(=O)c2ccco2)C(C)C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12410",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(COC(=O)c1ccccc1Br)NCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136377",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C([O-])CC1(Nc2ccc(C(F)(F)F)cc2)CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219376",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc2c(c1)=C1CCN3C(=O)CN(Cc4ccco4)C(=O)[C@]3(C)[C@H]1[NH+]=2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccc(Oc2ccc(NC(=O)N[C@H]3[C@@H](CO)[C@H]4CC[C@@H]3C4)cc2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOCc1cccc(CNC(=O)c2cccc(NC(N)=O)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74243",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCOC(=O)[C@H](C)N(C)Cc1c[nH]nc1-c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1cc(OC)c(Cl)cc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67195",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccccc1C(=O)Nc1ccc(OCC(=O)[O-])c(-c2nc3ccccc3s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5990",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1cccc(C)c1NC(=O)N[C@@H](C)C[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200020",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(CC1CCC1)[N-]c1ccc(OC[C@@H]2CCCO2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153121",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(F)cc1C(=O)N(CCc1cccc(F)c1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164821",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)c(C(=O)N2CCOC[C@@H](O)C2)nn1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221605",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1c(C)cnc(CNS(=O)(=O)N2CCCC[C@H]2C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128109",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(N2C(=O)O[C@@H](c3ccccc3)[C@]2(O)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155047",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C#N)CNC(=O)Nc1ccn(C)n1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115677",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1N[C@@H](/C=C/c2ccco2)N2CCOC[C@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38125",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1[C@H](CO)CCCS(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136367",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N(C)C(=O)[C@@H](C)c2cccc(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175475",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(N2N=C(C(=O)NCc3ccccc3)CCC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199100",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc([C@]2(C(C)(C)C)CCC[NH2+]2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80551",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1796",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule N#C/C(=C\\c1cccc(OC2CCCC2)c1)c1ccc(C(F)(F)F)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61981",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)C[NH+](C)[C@@H](C)c2cccc(NC(=O)c3ccccc3)c2)CCO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC[C@@H]1CCCCN1c1ncccc1C(N)=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144854",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(S(=O)(=O)/N=C([O-])/C(C#N)=C\\c2ccco2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19596",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1=NN(c2ccc(C(=O)N3CCN(Cc4ccsc4)CC3)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28562",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C(=O)N[C@@H]2CCCc3ccccc32)c(=O)[nH]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109320",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H]1C[NH+]2CCCC[C@@H]2CN1c1cccc(Cl)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108288",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)NC[C@H](O)C1CCOCC1)c1cc(F)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200821",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN[C@]1(C(=O)OC)CC[C@H](n2cc(Cl)cn2)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147964",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC[C@]1(C)CC(=O)NC(=O)[C@@H]1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223895",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3843",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)CCC(=O)Nc1nc(C(C)C)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123576",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCC(=O)N[C@@H]1CCCN(C(=O)[C@H]2CN(Cc3ccccc3)CCO2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135005",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1cccc(NC(=S)Nc2ccccc2)c1)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40171",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(-c3cccc(OC)c3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77346",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(NC(=O)NC(=O)[C@H](C)[NH2+]CC2(N3CCOCC3)CCCCC2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111617",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCNC(=O)Cn1c(=O)oc2cc(S(=O)(=O)N3C[C@H](C)C[C@@H](C)C3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[NH2+][C@H](Cc1nc(C)c(C)s1)c1cccc(OCC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H]1C[C@H]1c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144717",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c[nH+]c(CNCCO)[nH]1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233621",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1CCCOc2ccc(C(=O)N3CCc4ccccc4C3)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169526",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule Cn1c(CN2CCNC[C@@H]2C#N)cc(=O)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@H]1CCCN(C(=O)c2cc(F)cc(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145969",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cccc2ccc(C[NH+]3CCc4nnc([C@H](C)NC(=O)C5CC5)n4CC3)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110714",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@H](CNC(=O)Nc2cc(C)ccc2C)[NH+]2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24036",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN(C)C(=O)N[C@@H](c1ccccn1)c1ccccc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1cc(C)c([C@@H](C)[NH2+][C@@H](CO)c2ccc(Cl)cc2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nc(COC(=O)[C@@H](Oc2ccc(F)cc2F)C(C)C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187087",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccccc2n1-c1ncc(Cl)cc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213352",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2cc(Br)ccc2c1CC(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCOc1ccc(NC(=O)c2ccccn2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127976",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H](C)N[C@@H](C)C(=O)Nc2ccccc2)c(F)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151869",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[NH+]1CCN(c2ncnc(Nc3cc(Cl)ccc3Cl)c2[N+](=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184041",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C[NH2+]CC1(N(C)C)CCOCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11269",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]([NH2+]Cc1ccc(OC(F)(F)F)cc1)c1ccc(-n2cncn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164891",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC1(C)CCN(C(=O)[C@H](c2ccccc2)N2CCSCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44507",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc2sc(NC(=O)[C@@H]3C[C@@H]3C)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159151",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](C(=O)OCC(=O)N1CCCCC1)N1C(=O)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91444",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CSc1ccc(C(=O)[C@@H]2CCC[NH+](Cc3ccc(C#CC(C)(C)O)s3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211205",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Nc1ccccc1C(=O)N1CCCCC1)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc([C@H](O)c2cc(F)c(F)c(F)c2)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164760",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](CSC)N(C)C(=O)NCc1ccc(OC)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98529",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCn1cc(C(=O)C(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201989",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1C[C@H](C(=O)NCCC2=CCCCC2)Cc2nc(NC(=O)c3c(F)cccc3Cl)sc21 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8226",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cc(N2CCC(NC(=O)C3C[C@@H](C)O[C@H](C)C3)CC2)ncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192529",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule NC(=O)C[C@H](C(=O)[O-])N1C(=O)/C(=C/c2ccccc2)SC1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227697",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccnc1C[NH+]1CCC[C@H](C(=O)N(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179613",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@H]1CC[C@@H](SC[C@@H](C)CO)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150430",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1C[C@H]1C(=O)N1CCN(Cc2csc(CC(=O)N(C)C)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc([C@H](C)NC(=O)CC2(C(=O)[O-])CCCC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163661",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C2CCC(N3C(=O)[C@H]4[C@H]5CC[C@H](C5)[C@H]4C3=O)CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175871",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOCc1ccccc1NC(=O)c1ccc(-c2cscn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31076",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CCc1ccco1)[NH2+]C[C@](C)(O)c1ccc(F)cc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(Cc2cnc(N)s2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81274",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=[N+]([O-])c1ccc(F)c2c1[C@H]1C=CC[C@H]1[C@H](c1cccnc1)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36847",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCN(C(=O)[C@@H]1CC(=O)N(c2ccccc2Cl)C1)[C@H](C)c1cccc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](NC(=O)[C@@H]1CCC[NH+](C)C1)c1ccc(NC(=O)NC2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191188",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1487",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CO[C@@H](CNC(=O)Nc1ccc(N(C)C(C)=O)cc1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101368",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](CNC(=O)c1ccn(-c2ccccc2F)n1)c1ccsc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24927",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)S(=O)(=O)c1ccc(NC(=O)CSc2nnc(-c3ccc(F)cc3)o2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185091",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CN(C(=O)[O-])c1ccc2c(c1)CCN2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232673",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H]1CC([NH+]2CCN(CC(=O)N3CCCCC3)CC2)C[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134392",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(C)C(=O)CN(C)C(=O)c1cc2ccccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53275",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(=O)[C@@H]1[C@@H](c2ccc(F)cc2F)C(C#N)(C#N)[C@H]2c3ccccc3C=CN12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39033",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H]1CCN(C(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90225",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1nn(C)c(OC)c1CNC(=O)CCN1c2ccccc2CC[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112651",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC(C)Nc1cc2ccccc2cc1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)(C)OC(=O)N1CCC[C@@H](CCOCc2ccc(Cl)nn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88403",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@@]12CCCC[C@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)/C(=N/N)CC[C@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246686",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(C[S@@](=O)c2ccccc2F)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94134",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C([O-])c1nn(-c2ccc(Br)cc2)c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38010",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCOc1ccccc1NC(=O)C(=O)NC[C@@H]1CCC[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCc1[nH]nc(C(=O)Nc2cnc(-c3ccccc3)s2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201716",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1C[C@H](N2CCN(c3ccc(O)cc3)CC2)C(=O)N1c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178188",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)c1c(N)n(/N=C/c2ccc(F)cc2)c2nc3ccccc3nc12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96056",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217036",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc2ncc3c(n2n1)C[C@@H](c1ccccc1C)CC3=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96293",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccc(C(=O)Cc2ccc([N+](=O)[O-])cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240132",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cccc([C@@H]2CCC[NH+]2CCCN2C(=O)NC(C)(C)C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CNC(=O)CCC(F)(F)F)c1ccccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63031",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CSc1cccc2sc(N3CCN(C(=O)C(C)C)CC3)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75232",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@H](O)[C@@H](C)N1CC[NH2+]CC1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94343",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C=C(Cl)CN(C(=O)Cc1c(C)noc1C)[C@H]1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117110",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)N[C@H]2C[C@@H]2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180180",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(Nc2nnc(SCC(=O)c3ccc[nH]3)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111311",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCC(=O)N1CCC[C@H]1c1nc2ccccc2n1CCOc1ccc(Cl)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232608",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1ccccc1)C(=O)c1ccccc1NC(=O)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115125",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](CNCc1cccc(F)c1)c1ccsc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116916",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1c(NC(=O)c2ccc(C)cc2)sc2c1CC[NH+](C(C)C)C2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc2ncc(C(=O)Nc3nnc(CC(C)C)s3)n2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12666",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NC(=O)[C@@H](C)C[NH3+] by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)C2=Cc3ccccc3OC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203995",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC[C@@H]1CN(CCC(=O)N2CCC[C@H]2C)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157830",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCS(=O)(=O)NCCc1cc2c(C)ccc(C)c2[nH]c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82382",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N2CCC[C@H](C(=O)c3ccc(F)cc3)C2)ncc1[N+](=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93578",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2ccccc2F)c2ncc3c(c12)C(=O)N(c1ccc(C(C)C)cc1)C3=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10060",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)N1CC[C@@H](c2c(C(=O)Nc3cccc(OC(C)C)c3)sc3ccccc23)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221599",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1cc(C)ccc1NC(=O)c1cccc(NC(=O)c2cccs2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44621",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOc1ccc(S(=O)(=O)NC[C@H](C)C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47584",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](CC(=O)N[C@H](C)c1nc2ccccc2[nH]1)Cc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14007",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(-c2cc(C)[nH+]c3ccccc23)nc([O-])c1Br by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178339",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN(Cc1ccccc1)S(=O)(=O)c1cc(C(=O)Nc2ccc(Br)cc2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)[C@@]1(O)CSCC(C)(C)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220560",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCN(c1ccccc1)c1[nH+]cnc(Nc2nc3ccccc3s2)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51392",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccccc1NC(=O)Cc1csc(-c2ccoc2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154647",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1ccccc1NC(=O)NC[C@H](O)c1ccco1)C1CCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@@H](c1cccc(Br)c1)N(C)CC1=CCCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190597",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CSC(C)(C)C)[NH2+]C[C@]1(O)CCc2ccccc21 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171299",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cn1c(=O)cnc2ccccc21)N[C@H]1C[C@@H]2CCCc3cccc1c32 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201753",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCS(=O)(=O)[N-]c1ccc(C(=O)/C=C/c2ccc(C)c(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245517",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(OC(=O)N2CCN3C(=O)[C@H]([C@@H](C)O)NC(=O)[C@H]3C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89835",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(C(=O)CC(F)(F)F)c(Br)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171158",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COC(=O)c1cc(N)ccc1N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(N2CC[NH+]([C@H](C)c3nc(C(C)(C)C)no3)CC2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233105",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCC(=O)Nc1cccc(C(=O)Nc2ccccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211193",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)C(=O)Nc1cc(F)cc(F)c1)C(=O)NCc1ccco1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211399",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(C(C)(C)c2ccccc2)sc1C(=O)NCc1ncoc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139627",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(S(=O)(=O)c2ncsc2SCC(=O)NCc2ccc(C)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150825",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nc(C[NH+]2CCC[C@H](CNC(=O)c3ccccc3)C2)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53880",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCn1cnnc1[C@@H]1CCCN(C(=O)Nc2ccc(OC)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20057",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1ccc(C(=O)N2C[C@@H](C(=O)[O-])[C@H](c3ccncc3)C2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN[C@@](C)(c1ccoc1)C(F)(F)F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1NC(=S)NC(=O)C1=CNCCc1ccc(F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(NC(=O)CCn2c([S-])nnc2-c2cccs2)sc1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20520",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(/C=C1/Sc2ccccc2N(Cc2ccccc2F)C1=O)NCc1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221860",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccccc1OCCCOc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153806",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(NC(=O)[C@@H]2CCCO2)cc1)c1cccnc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224265",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1C[C@H](Nc2ccc(NC(=O)C[NH+](C)C)cc2)C(=O)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99991",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(S(=O)(=O)Nc2ccc(Oc3ncnc4sccc34)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230837",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCc1csc(=O)[nH]1)c1coc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34415",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(=O)N[C@@H]2C[C@H]3CC[C@]2(C)C3(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123592",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(N[C@H]1CCCC[C@@H]1C)=C1C(=O)NC(=S)NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243030",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)c1ccc([C@@H](C)[NH2+]Cc2cnn(C)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79276",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)NCc2ccc(-c3nn4cnnc4s3)cc2)cc1OC by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21905",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Nc1ccc2c(c1)OCCO2)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71916",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NOCc1ccccc1)N1CCC(c2nc3ccccc3s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(CO)(CO)CCSc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29264",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)c1cccc(OCCC(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183946",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@H](C(=O)Nc1ccc(C(=O)N(C)C)cc1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244301",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@H](C)CC(=O)N1CCc2cc([N+](=O)[O-])ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C[C@@H]1CCOC1)C(=O)Nc1ccc(Cl)c(CS(C)(=O)=O)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29878",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(CCNC(=O)C2(c3ccc(C(C)C)cc3)CCCC2)n[nH]c1=S by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158767",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96802",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](SCC1=NC(=O)C2=C3CCCC[C@@H]3SC2=N1)C(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31213",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCOc1ccccc1CN1CCNC(=O)[C@@H]1c1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84509",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])C[C@H]1C(=O)NCCN1C(=O)CC1CCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48716",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cc(C(F)(F)F)c2c(C3CCN(C(=O)c4cn(C)nc4C)CC3)noc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222258",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Nc1cnc(N(Cc2cccs2)C2CC2)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134818",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(/N=C(\\O)[C@H](C)Sc2nncn2-c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92415",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CC(NCCC(N)=O)CC(C)(C)[NH2+]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215341",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1CCCN(C(=O)Nc2ccc(CCC(F)(F)F)cc2)[C@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137966",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cccc2sc(N(C[C@H]3CCCO3)C(=O)c3ccc(Cl)cc3)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215190",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(Cc1ccc(OC)c(OC)c1)C(=O)CN1C[C@@H](C)O[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190880",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(NC(=O)C2CCN(C(=O)N3CCCC3)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9486",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccccc1NS(=O)(=O)c1ccc2[nH]cc(C(=O)N[C@@H]3CCCC[C@@H]3C)c(=O)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41012",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(/C=C2/C(=O)NC(=S)N=C2[O-])c(C)n1-c1cccc(C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(CCc1ccccc1)[C@@H]1CCCN(C(=O)CN2CCCCCC2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138550",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCSCC(=O)N[C@@H](C)C(=O)OC by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67985",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OC1CCC([NH2+][C@H]2CCCc3ccc(Br)cc32)CC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27276",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@]1([C@H]([NH3+])c2ccc(Cl)cc2Cl)CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89483",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(CSc2ncc(CO)n2Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227843",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1cccc(CNC(=O)NCC2CCN(c3cc[nH+]cc3)CC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162863",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC1(C)C(C[NH2+]Cc2ccc(Br)cn2)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240712",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cn1c([O-])c(Sc2ccc([N+](=O)[O-])cc2)c(=O)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96447",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1[C@@H](C)NC(=O)[C@H]1CC(=O)N(CC2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=S(=O)(Cc1ccccc1Cl)NCCc1csc(-c2ccc(F)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123657",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=C(/CC(=O)Nc2ccc3c(c2)OCO3)c2nc3ccccc3s2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194796",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCc1ccc(-c2nc(NC(=O)c3cccc(S(C)(=O)=O)c3)sc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74617",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCC1=NN(C(=O)c2ccncc2)[C@](O)(c2ccc(Cl)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206997",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@H](c1ccc(OC(C)C)cc1)c1ncc[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215074",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](NC(=O)NCCCC(=O)N(C)C)c1ccc(-c2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77717",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(Br)cc1CNC(=O)CCl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185226",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1ccccn1)c1ccc(C=O)o1 by removing a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61811",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)[C@@H](CO)NC(=O)[C@@H](C#N)Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75178",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(CC(=O)N1CCn2cccc2[C@H]1c1ccccc1Cl)C(=O)C1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73799",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(C(=O)NCCCc2c(C)noc2C)cc2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179620",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)[C@@H](CO)NC(=O)C(=O)N1C[C@H](C)Oc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175651",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cccc(CNC(=O)c2cccc(C#N)c2)c1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195373",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COC(=O)Cn1cc(C[NH+]2CC[C@@H]([NH+]3CCOCC3)[C@H](O)C2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule C[C@H](C#N)NC(=O)CCn1ccc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63614",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCO[C@H](C)C(=O)NC1CCC([NH+]2CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2C(C#N)=C(N)O[C@H]3N=NC(C)=C23)c2ccccc12 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228539",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COCCn1c(-c2ccc(C(C)C)cc2)c[nH+]c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217312",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)n([C@H](C)C(=O)NCc2ccccc2-c2ccc(Cn3ccnc3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157230",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Nc1cc2[nH]c(=O)[nH]c2cc1S(=O)(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244724",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])Nc2nnc(C3CC3)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122638",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nn(C)c2c1nc(CCCl)n2[C@@H](C)[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43397",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Cc1noc(-c2ccc(-n3ccnn3)cc2)n1)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78415",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNS(=O)(=O)[C@H]1CCN(C(=O)[C@H]2C[C@@H]2c2sccc2C)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90983",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=C(NCc1ccc(N2CCOCC2)c(F)c1)N1CC[C@H](Nc2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227520",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OC[C@@H](C)NC(=O)/C=C/C2CC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169498",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-n2c(=O)c3sccc3n(Cc3cccc(F)c3)c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccccc1NC(=O)CN1C(=O)N[C@@](C)(c2ccccc2)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152017",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](NC[C@@H](O)c1cccc(C(F)(F)F)c1)c1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73347",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1cccc([N+](=O)[O-])c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36435",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCN1CCOCC1)c1cccc(I)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215667",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC[C@@H](C)CN1C(=O)Nc1cnn(-c2ccccc2S(C)(=O)=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230357",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1noc(-c2ccc(C)c(NC(=O)NCc3ncnn3C)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246869",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC(=O)c2ccccc2-c2cncnc2)cc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)C[C@@H](Nc2ccc(OC(F)F)cn2)[C@@H]1c1ccc(F)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121145",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(Cc2ccccc2NC(=O)c2ccncc2F)C[C@H](C)O1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77881",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)=CC[NH+]1CCC(CCC(=O)Nc2ccccc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168321",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)c1c(C)cccc1[N-]S(=O)(=O)c1cc(C)c(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(/C=C2/SC(=S)N([C@H]3CCS(=O)(=O)C3)C2=O)ccc1O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77977",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCN(C(=O)[C@H](C)[NH+](C)Cc2nc3ccccc3n2C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119212",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc(C(=O)N/N=C/c2cc([N+](=O)[O-])ccc2O)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15064",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#Cc1cccc(NC(=O)c2ccc(C[C@H]3CC(=O)NC3=O)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234051",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](NC(=O)C(=O)Nc1ccc(F)cc1F)c1cccc(N2CCCC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13189",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1nnsc1C(=O)N1CC[C@@]2(CCc3ccccc3C(=O)N2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187173",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ncccc1CNC(=O)c1cc(C2CC2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153234",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc([C@H](C)NC(=O)c2csc(C#CCN)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146635",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)N(Cc1c[nH]c2ccccc12)C(=S)Nc1cccc(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39554",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](OCc1ccccc1)C(=O)NCC(=O)Nc1cccc2ccccc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176346",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2CCN(C(=O)[C@H](C)NC(=O)c3cc4cc(OC)ccc4n3C)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58997",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cc2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(CN(C)C(=O)[C@@]2(C(F)(F)F)CC[NH2+]C2)n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125440",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1CCN(C(=O)c2oc3ccc(S(=O)(=O)N4C[C@H](C)C[C@@H](C)C4)cc3c2C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCSc1cccc(C(=O)N(CC(F)(F)F)c2ccccn2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199630",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H](Cl)c1nc2cc(Br)cnc2n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141203",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCC[C@@H](NC(=O)c1ccc2c(c1)OCO2)C(=O)N1CCC2(CC1)NCCc1[nH+]c[nH]c12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84976",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1CCCCN1C(=O)CNc1ccc(Cl)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75611",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1c[nH+]ccc1N1CCCN(C(=O)[C@H]2Cc3ccccc3CN2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209298",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@@H](Cc1ccc(F)cc1Br)[C@H]1CN(C)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190485",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(C)cc1-n1c(SCC2=NC(=O)[C@@H]3SC=CC3=N2)nnc1-c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195728",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(CNc1ccc(Br)c([N+](=O)[O-])c1)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72886",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)C[C@@H](C[C@H](O)c1ccccc1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92339",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cnn(-c2ccccc2)n1)N1CCC(OCc2ccc(F)cc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62393",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(CNC(=O)Cn2c(=O)c3cccn3c3ccc(F)cc32)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77503",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1ccccc1)C(=O)N(C)[C@H]1CCC[C@@H]1S(C)(=O)=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](c1cncc(Br)c1)c1cc(Cl)ccc1OC by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171059",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule NC(=O)CN1CC2(CCC1=O)CC[NH+](Cc1ncccn1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93809",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1n[nH]c(C)c1[C@@H]1CCC[NH+]1CC(=O)N1CCC(C(N)=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87967",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](CNC(=O)CS[C@@H]1CCS(=O)(=O)C1)N1C[C@@H](C)O[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210073",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#C[C@@](C)(CC)NC(=O)Cc1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38619",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2sc([C@@H](c3ccc(F)cc3)[NH+]3CCC4(CC3)OCCO4)c([O-])n2n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN1C(=O)CSc2ccc(NC(=O)N3CCC([NH+]4CCCCC4)CC3)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196915",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cn1c(=O)oc2ccccc21)NCC1CCN(c2nsc3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52231",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC1(CC)NC(=O)CN(C[C@]2(C)CCCO2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43003",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CNC(=O)[C@@H]1CCCCN1c1ccc(C#N)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S1(=O)CC[C@]2(CC[NH2+]C[C@H]2c2ccccc2Br)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162612",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCn1ncnc1C[NH2+][C@@H](C)CCCCl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36645",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(Cl)cc1NC(=O)C(=O)N[C@H](C)C[NH+]1C[C@H](C)C[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110934",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCOc1ccccc1C[NH+](C)CC(=O)N1CCC(O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224616",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1cn2ccsc2n1)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62163",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)Nc2nnc(SCc3ccccc3)s2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171105",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCc1cccc(F)c1)Nc1n[nH]c2ccc([N+](=O)[O-])cc12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9738",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)(C)NC(=O)CCNS(=O)(=O)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58511",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)C[C@H](NC(=O)C1CC1)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCN(C(=O)[C@H]2c3ccccc3CC[NH+]2CC(=O)NCc2ccccc2Cl)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69211",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1cc(NC(=O)C(=O)N[C@H](C)[C@H]2CCCO2)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177937",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)N(C)CC[NH+](C)C1CCN(C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26896",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(NC(=O)[C@@H](C)NC(=O)c2ccccc2Cl)sc1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122348",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CCCN(C(=O)CCNC(=O)c2ccc(F)cc2Cl)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137192",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule Cc1sc(NC(=O)c2cc(Br)cs2)c(C#N)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5804",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@H]1C[C@H](O)CN1C(=O)c1ccccc1O by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159339",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)c1cnn(C(C)C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120100",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C)c1OC1CCN(C(=O)[C@H](C)c2cccs2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71980",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1[C@H](C(=O)[O-])CCN1C(=O)Nc1ccc(F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247324",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(NC(=O)c2cccc3cc[nH]c23)cccc1C(=O)N1CCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204098",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1I)C1CCN(S(=O)(=O)c2ccccc2F)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(OCC(=O)NC[C@H](c2ccc(C)o2)[NH+]2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202346",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule O=C(C1CCCC1)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1csnn1)N1CCO[C@@H](c2ccc(Cl)cc2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109745",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1cc(Cl)c([N+](=O)[O-])cc1COc1ccccc1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211595",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cccc(C(=O)NN2Cc3ccccc3C2)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10193",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccc(O)c([C@@H](C)Nc2ccc(F)cc2[N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226112",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](Oc1ccccc1Br)C(=O)N/N=C\\c1cc(Cl)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198343",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccnc(NNC(=O)c2cccc(C#N)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85850",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)[C@H](CC)N1CCC(C(=O)N2CCCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139437",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@@H]2Nc3ccccc3C3=[NH+]CCCN32)cc(OC)c1OC by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29121",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@H](NC(=O)N1CCN(C(=O)C2CCCCC2)CC1)c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168852",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(C2=CCN(C(=O)NNC(=O)c3ccccc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171130",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)C1=C(Nc2ccc(C)cc2)C[C@](C)(O)[C@H](C(C)=O)[C@H]1c1ccc(Cl)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75682",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NC1CCCCC1)[C@H](c1ccc(F)cc1)N(C(=O)c1cnccn1)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217021",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@@H](CNCc1ccc(Cl)nc1)[NH+](C)Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5221",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCCn1c(SCC(=O)N(C)C2CCCCC2)nc2cc(C)[nH]c2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106216",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccccc1NC(=O)N[C@H](C)C(=O)N1CCCC[C@@H]1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20529",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-n2c(=S)[nH]c3ccc(C)cc32)c(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76756",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)c2cccc(OC(C)=O)c2)cc1OC by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142063",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc2c(N3CCCN(S(C)(=O)=O)CC3)c(C#N)cnc12 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155984",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cl)cc1NC(=O)C[C@H]1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149549",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CNC(=O)/C=C/c2cccc(C)c2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113524",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(CC(=O)N2CCC3(CCC(=O)N([C@H](C)C(=O)[O-])C3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85190",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(C)C)cc1OCC(=O)N(C)[C@@H](C)c1ccc(-n2cncn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109900",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Brc1cnc(N2CCCC2)cn1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131292",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCSCC[C@H](C)N(C)C(=O)c1cc(=O)c2ccccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46376",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)NCc2cscn2)cc1NC(=O)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35558",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Cn1ncc2c3ccccc3n(Cc3cccc(Cl)c3)c2c1=O)N1CCC2(CC1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@H]2[C@H]3[NH+]=c4ccccc4=C3CCN2Cc2cnn(C)c2C)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87843",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CC1(C)CC(=O)C2=C(C1)OC(N)=C(C#N)[C@H]2c1ccc(C(C)(C)C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cccc(-c2nnco2)c1)c1cn(-c2ccccc2)nc1-c1cccs1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(Oc2cncc(C[NH3+])n2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94796",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cnc(Nc2ccccc2)nc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63016",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ncccc1C(=O)N[C@H](C(N)=S)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137343",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1[NH2+]CC[C@H]1C(=O)N(C)Cc1cc(C#N)ccc1F by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128206",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccc(C(=O)N2CCC[C@@H](c3cc(C(N)=O)[nH]n3)C2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209129",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N)c(SC[C@@H](C)CO)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198510",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc(NC(=O)c2ccccc2C(F)(F)F)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119998",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CO[C@@H](C)C(=O)NNc1ccccc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178854",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1ccc(C(C)=O)cc1OCc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ccnc(NCCSCc2ccc(Cl)cc2Cl)c1=O by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144533",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(Nc2ccccc2)cc1)c1ccc(O)nc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98161",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC(=O)Oc1ccc(C(=O)Nc2cc(Cl)ccc2C(=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62030",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1ccccn1)C(=O)[C@H]1C[NH2+]C[C@@H]1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130742",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@H](C)NC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCN(C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120102",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OC(=O)CCCN2C(=O)NC3(CCCC3)C2=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141485",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule N#CCc1ccccc1C(=O)OCC(=O)NCc1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214155",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1cccc(C(=O)N2CCN(Cc3cccc([N+](=O)[O-])c3)CC2)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210127",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]1CCCCN1S(=O)(=O)c1ccc(C(=O)N(C)Cc2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc(OC)cc(-c2nnc(SCc3ccc(F)cc3)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75330",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccccc1C(=O)NCCC(=O)NC[C@H](O)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12008",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(Cc1csc2ccccc12)C(=O)NCc1cccc(C(N)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182920",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(C(=O)Nc2nc3c(C)cccc3s2)cc(Cl)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168029",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C(=O)NCCCS(=O)(=O)c1ccccc1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132630",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)C1CC[NH+]([C@@H](C)c2cccc(C)c2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247824",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ncc2c1CCC[C@H]2N[C@H]1C[NH+]2CCC1CC2 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnoc1-c1ccc(C#N)cc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151547",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1c(C[NH2+][C@H]2CCC[C@@H](O)C2)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52539",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1[C@@H](C)CN[C@H](C)c1ccc(C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOC(=O)c1cccc(NC(=O)c2ccccc2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58395",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(OCn2ccc(C(=O)N[C@@H](C)c3cn(C)nc3C)n2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCC(=O)N1CCc2[nH]nc(C(=O)NCc3ccc4c(c3)OCO4)c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109067",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C2=[NH+]CCN2)c(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129929",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(C)C(=O)NCC(=O)N1CCc2[nH]nc(-c3ccc(F)c(F)c3)c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45255",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)CN2C(=O)N[C@@](C)(c3ccccc3Br)C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40026",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOCC(=O)N[C@H](C)c1cnn(-c2cccc3ccccc23)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240715",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(C)N1C[C@H](NC(=O)NC[C@@](C)(O)c2ccccc2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H](O)c1ccco1)c1ccc(SC(F)F)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC1=NN(c2ccccc2)C(=O)/C1=C\\c1ccc(OCC(=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88437",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCOc1ccccc1N1CC[NH+](Cc2nnsc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59307",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H](CCc1ccco1)[NH2+]Cc1ncccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule NC(=O)CN1CCN(C(=O)C[C@@H](O)c2ccc(Cl)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82951",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)Nc1cccc2c1OCCO2)c1ccc(OC(F)F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180213",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C(=O)N1CCN(C(=O)Cc2c(C)noc2C)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216873",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCC(=O)N1CCN(S(=O)(=O)c2cnc(-c3ccccn3)nc2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95366",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(O[C@H](C)C(=O)Nc2ccc(C)cc2Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6764",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-n2c(C)nc3nc([NH+]4CCCC4)nc([O-])c3c2=S)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCS[C@@H]1CCC[C@](CO)([NH2+]C(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(c1)CCCN2CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76499",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CCN1C[C@@H](C(=O)Nc2ccc3cc[nH]c3c2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220252",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CCOc1ccccc1[C@H]1C(C#N)=C(SCC(=O)Nc2cc(C)ccc2C)N=C2CCCC(=O)[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4828",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1ccnc1SCC(=O)N1CCO[C@@H]2CCCC[C@H]21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34195",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1c(NC(=O)CCCc2nc(-c3ccccc3)no2)sc2c1CCCC2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221792",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccc(NC(=O)N2CCOc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207389",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(F)ccc1Cl)[C@@H]1CCCN1C(=O)c1cccs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244295",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(C[NH2+]CCc1ccccc1)Nc1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC(=S)Nc1ccccn1)c1ccc(Cl)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25242",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule O=C1/C(=C/c2ccc3ccccc3n2)Oc2cc(O)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133764",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]Cc1cnn(-c2cccc(Br)c2)c1C1CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58584",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[C@](C)(C[NH3+])[C@H](O)CCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82880",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)NCCNC(=O)/C=C/c1cc(C(F)(F)F)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133652",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]1C[C@@H]1C(=O)NC[C@@H](C)Sc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211492",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Cc1cccc(F)c1F)c1cc(Cl)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52436",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)N[C@H]1[C@H](OC2=C[C@H]3OC(=O)C=C(C)[C@H]3C=C2)O[C@H](CO)[C@@H](O)[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111231",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1nn(C)cc1C(=O)NCC1CCN(C(=O)c2cccnc2SC)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10166",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(Cl)cc1NC(=O)CNc1ccc(S(=O)(=O)N2CCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84888",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1NCC=Cc2c1[nH]c(Br)c2Br by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186235",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(F)cc1C(=O)COC(=O)c1csc(-c2ccc(C)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112751",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=C(Nc1cc(Cl)ccc1O)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@H](c1ccc3c(c1)OCO3)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48767",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@H]2[C@@H]3SC(=O)N=C3S[C@@H](C(=O)[O-])[C@H]2C(=O)c2ccc3c(c2)CCCC3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218466",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Nc1ccc(NC(=O)NCCc2cccs2)cc1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2C(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3ccccc3)SC2=S)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233134",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(CN2CC[NH+](Cn3nc(C4CC4)n(C)c3=S)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11003",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1CCCN(C(=O)c2ccc(C)nc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115435",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCOc1ccc(/C=C2/C(=O)NN(c3cc(Cl)cc(Cl)c3)C2=O)cc1OCC by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219959",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CC[C@@H](Cn2c(CCCl)nc3cccnc32)N1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172486",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc2cc(C(=O)NCc3cccc(NC(=O)N4CCCC4)c3)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38296",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[C@@H]1n1c(CCCl)nc2cc(Br)cnc21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119671",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccc(NC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153105",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(C[NH+](CC2CC2)[C@H](C)c2ccccc2)cn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88532",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCCN(C(=O)[C@@H]2CCC(=O)N(c3ccc(C)c(C)c3)C2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224456",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](C)N(C)C(=O)Nc1ccc(N(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67007",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H](O)C1CC[NH+](CC2=Cc3ccccc3OC2)CC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175371",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1csc(S[C@H](C)C(=O)NC(c2ccccc2)c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146953",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)c1sc2ccccc2c1[C@H]1CCN(C(=O)c2cccc(N(C)C)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98587",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(-n2c(SCC(=O)N3CCC(C)CC3)nc3[nH]nc(C)c3c2=[NH2+])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230603",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(C(=O)c1ccccc1NC(=O)/C=C/c1ccc(Cl)cc1)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225188",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(C)(C)C)cc1[S@@](=O)Cc1cn2ccccc2n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63245",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)[C@@H](OC(=O)CCn1nnc2ccccc2c1=O)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226737",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)NC(=O)C[C@H](C)NC(=O)N(C)[C@@H]1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCN1C(=O)C([O-])=C(C(C)=O)[C@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141863",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COCC(=O)N[C@H](C)c1nc2ccccc2n1Cc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14303",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCC[NH+]1CCN([C@H]2CC[C@@](CO)([NH2+]C(C)C)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(-n2cc(C(=O)[O-])c3c2[C@H](c2cc(OC)c(OC)c(OC)c2)CC(=O)N3)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162454",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule [NH3+][C@H](CC[C@H]1CCOC2(CCOCC2)C1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule Cc1cc(SCC(=O)NC2(C#N)CCCCC2)nc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147952",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)Cc1nnc([C@@H](C)[NH+]2CCC(c3ccc(F)cc3)CC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)[C@H](CC(C)C)NC(=O)[C@H]1CSC(C)(C)N1C=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198802",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1sc2nc(C[NH+]3CCN(CC(=O)NCCC4=CCCCC4)CC3)[nH]c(=O)c2c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148945",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[NH+]1CCC(O)([C@@H]2CCOC3(CCC3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cc(Br)ccc1NCc1cccnc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40734",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)Cc1cc(C)[nH]n1)[C@@H]1CC[NH+]([C@@H](C)c2ccccc2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule N#C[C@H]1CNCCN1C(=O)c1cccc(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143022",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1CC(C(=O)NCc2ccc(CN3CCc4ccccc43)cc2)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176997",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(-c2ccc(NC(=O)C(=O)N[C@@H]3CCCC[C@@H]3C)cc2)o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212068",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nnc(NC(=O)N[C@@H](C)c2ccc(F)c(F)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133191",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCCCNC(=O)N[C@H]1CCCN(c2ccc(OC(F)F)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1nsc(Nc2ccc(F)c(F)c2)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167272",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N(C)c1ccccn1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131552",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](c1ccccn1)N(C)C(=O)Nc1cccc(C2SCCS2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCOc1cc(CO)cc(Br)c1OCc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "616",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccsc1/C=N/NC(=O)/C(=C\\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167861",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CSc1cccc(NC(=O)N2CCN(c3ccccc3Cl)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccc(O)c(NS(=O)(=O)c2cc(F)c(F)c(F)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2366",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)c1nn(-c2ccccc2C)c(=O)cc1NC(=O)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56176",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H](CN1CCc2sccc2C1)c1ccccc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38353",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cn1c(=O)sc2cc(S(=O)(=O)N3CCCC3)ccc21)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53681",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2ccc(/C=C\\C(=O)c3ccccc3)cc2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220132",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(C(=O)N[C@@H](C(=O)Nc2ncc(C)s2)C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103486",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(c1ccccn1)S(=O)(=O)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123881",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C/[NH+]=C(/NCc1noc(C)n1)N1CCc2cc(OC)c(OC)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205585",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(CC[NH+](C)[C@H]2CCCN(C(=O)c3ccncc3)C2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220130",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)c1ccccc1NC(=O)[C@H]1CC[NH2+][C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129196",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCc1coc(-c2ccccc2)n1)c1cnc([C@H]2CCCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107596",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[S@@](=O)[C@@H]1CCCC[C@@H]1NC(=O)Nc1ccccc1N1CCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216061",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Cc1cccc(Nc2ncnc(N3CCCC[C@H]3C)c2[N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149190",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H]1OC(=O)c2cccc(F)c21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240059",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCC[C@@H]([NH3+])c1ncc(-c2cc(F)cc(F)c2)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71673",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(C)cc(NC(=O)C(=O)NCc2ncc(C)s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11067",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H](NC(=O)NCc1scnc1C)C(C)(C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83046",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=c1c(N[C@H]2CCC[NH2+]C2)nccn1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219496",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C[NH2+]CC[C@H]1CCCO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CC[C@@H](C)C[NH+]1CC(=O)NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234047",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Nc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-])c1ccc(F)cc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117396",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1c2ccccc2C(=O)N1C[C@H](c1ccco1)[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16515",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)n1c[nH+]cc1[C@H](O)[C@@H]1CCCCC[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245161",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC(=O)N[C@@H](CC(=O)[O-])c1ccccc1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ncccc1Cl)N1CCC[C@H]1c1ccc2c(c1)OCCO2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127320",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CN(C)c1ccc([C@H]2Nc3ccc(S(=O)(=O)NCc4ccccc4)cc3[C@@H]3C=CC[C@@H]23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160486",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN1CCc2nc[nH]c2C12CC[NH+](Cc1cccc(OC3CCCC3)c1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nn(C)c(C)c1CCC[NH2+][C@@H](C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCOc1ccc(OCCC2CC[NH2+]CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20033",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule S=C(NN=C1CCSCC1)NC1CCCCC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164892",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](Cc1ccc(Cl)cc1)N(C)C(=O)c1ccc2ncccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)c(C(=O)NNC(=S)NC[C@@H]2CCCO2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8369",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NN=C1CCCc2ccccc21)C(O)(c1ccccc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)N(C)CCN1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99506",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)NC(=O)CSc1nc2ccccc2c(=O)n1C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35724",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1nn(CC)c2c1CN(C(=O)C1=CC3=CC=N[C@@H]3C=C1)CC2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)c(-c2ccc(N(C)S(C)(=O)=O)cc2)nc2cc3c(cc12)OCO3 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167887",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc(-c2cc3c(N4CCc5ccccc5C4)nccn3n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181887",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(Cc1ccccc1C(F)(F)F)C(=O)NCCOc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142223",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccnc(NNC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177111",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule N#C[C@H]1COCCN1Cc1cccc(-c2ccccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241225",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccncc1[N-]S(=O)(=O)c1c[nH]c(C(=O)N2CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90270",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H](N[C@H](C)c1cccc(-n2cccn2)c1)c1ccccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116102",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](NC(=O)Cc1cccc(F)c1F)C1(N2CCOCC2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204012",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](C)CC[C@@H](c1ccccc1)[NH+]1CCOCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79641",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)(C)CC(=O)Nc1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168748",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1c(/C=C/C(=O)N(C)C2(C#N)CCC2)c(C)n(CC)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109135",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c2nc(Cl)c(CCN3C(=O)c4ccccc4C3=O)cc12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98640",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCn1c(COc2cccc3cccnc23)nnc1SCC(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15982",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1ccc(Cl)cc1Cl)C(=O)N(C)C1CCOCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238090",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCc1ccc(C(=O)N[C@H]2C[C@@](C)(OC)C2(C)C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117212",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@H]1CN(C(C)=O)CC[C@H]1CC(=O)Nc1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131407",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)S(=O)(=O)c1ccc(NC(=O)C2CCCC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69875",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+]CC1(CO)CCOCC1)c1cc(F)c(F)c(F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72927",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@H]1SCCc2sccc21)N1CCO[C@H](c2ccc(F)cc2)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204499",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)[C@@H](C(=O)Nc1ccn(C)n1)N1C(=O)c2ccccc2C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56665",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCNc1cc[nH+]c(CN2CCO[C@H]3CCCC[C@@H]32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13930",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1NC(=O)CSc1nnc(-c2ccccn2)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53558",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1CCCNC(=O)Nc1cccc(C(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242568",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(C(=O)CSc1nnc(-c2ccccc2F)o1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10298",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1nnc(SC[C@@H](O)CN2CCOCC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59131",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)Cn1ncc(C(=O)N(C)[C@@H](C)Cc2ccsc2)c1C(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243091",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC(=O)c1c(C)nsc1N[C@H](C)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194198",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NC(=O)C(=O)NCC2(C)CCCC2)cc1[N+](=O)[O-] by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18798",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C/[NH+]=C(/NCCc1c[nH]c2cc(C)ccc12)NCc1cn2c(C)cccc2[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135449",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)c1ccc2c(c1C)N[C@H](c1cc(Br)c(OC)c(OC)c1)[C@H]1CC=C[C@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165793",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCN(Cc1ccco1)C(=O)c1cc2cc([N+](=O)[O-])ccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc2[nH]c(=O)c(CNc3ccc(N4CCc5ccccc5C4)cc3)cc2c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116858",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(Cc1nnc2n1CCC2)C(=O)c1ccc(S(C)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198065",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc(-c2noc(CN3C[C@H](C)c4ccccc43)n2)ccc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147864",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC(CC)N(CC(C)C)C(=O)[C@H]1CC[C@@H]([NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33899",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(CC(=O)N1N=C(c2ccc(Cl)cc2)C[C@@H]1c1ccco1)S(=O)(=O)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28564",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CN(C(=O)c1cccc(NCC(=O)NCc2ccco2)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89014",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1ccc(CC(=O)NNc2c(Cl)cccc2Cl)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7136",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a thiol from the molecule SCC1(COC2CCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COC(=O)c1cc(NC(=O)C2CCN(C(=O)c3ccccc3Cl)CC2)cc(C(=O)OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC[C@H](C(=O)NCc2ccc[nH]2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234248",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](C)N(C)C(=O)c2nnn[n-]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62252",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(C)c(NC(=O)c2ncccc2OCC(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61692",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@H]2CC(=O)C=C(N)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1c(C)cc(/C=C(/C#N)C(=O)N[C@H]2CCCNC2=O)c1C by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)[C@H]1CCCC[C@H]1C(=O)[O-] by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99070",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C2=N/C(=C\\c3cc4c(cc3Cl)OCO4)C(=O)O2)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244156",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1nccs1)[C@H]1c2ccccc2C(=O)N(C2CCCC2)C12CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60282",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NC[C@H](c1cccs1)[NH+]1CCCC1)[C@@H]1CCCN1C(=O)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156840",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCNC(=O)c1ccc([NH+]2C[C@@H](C)[C@H](C(=O)[O-])C2)[nH+]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1C[C@@H](c2ccc([N+](=O)[O-])cc2)[C@@H](C(=O)c2ccc(F)cc2)[C@@]12C(=O)Nc1ccccc12 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76461",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C([O-])c1ccc(N2C(=O)/C(=C/C3=c4ccccc4=[NH+]C3)SC2=S)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88769",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CSc1nnc(-c2cccs2)n1C1CC1)Nc1cc2[nH]c(=O)[nH]c2cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCC1CCCCC1)c1cccc(NC(=O)c2scc3c2OCO3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197167",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=C(CCCNC(=O)c1cccs1)NC[C@@]1(O)CCSC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71068",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1c(Cl)cc(C(=O)OCc2nc(C)no2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98251",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc(CC(=O)Nc2ccc(C)cc2OC)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#CCCCSc1nnc(-c2ccccc2)n1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166474",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1cccc([C@H](C)CC(=O)Nc2cnc(-c3cccc(O)c3)nc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45146",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNC(=O)C(=O)Nc1ccccc1C[NH+]1CCCC1)NC1CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123259",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)N[C@H]1CCCC[C@@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206350",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)NCCc1nc2ccccc2n1CC(=O)NC[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163345",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule Cc1nc([O-])c(C#N)cc1C(=O)N1CCC[C@@H](c2[nH+]ccn2CC(N)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238412",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)CC1CCN(C(=O)N[C@@H]2C[C@H]2c2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110180",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCCNC(=O)CNC(=O)N[C@H](CC)c1ccc(C)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Nc1ccc(S[C@H]2CCC[C@@H]2O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191953",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)OCCC(=O)Nc1cccc(C(=O)NC(C)(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121105",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1c(C)nc(-n2nc(-c3ccco3)cc2NC(=O)COc2cccc3c2OC(C)(C)C3)nc1[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52959",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1c(NCC2(c3ccc(F)cc3)CCOCC2)cc(C#N)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62912",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC1CCN(S(=O)(=O)c2ccc(-c3noc(CCC(=O)Nc4cccc(F)c4)n3)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90971",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(c1ccc(-c2ccc(F)cc2)o1)N(Cc1ccccn1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46982",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCOCCN(C)C(=O)NCc1ccc(O)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127222",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NC(=S)NNC(=O)c1cccs1)c1cc2ccccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210894",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H](Cc1ccccc1)NC(=O)c1cnccn1)c1cnccn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cc1ccccc1Cl)NCc1ccnc(-n2cccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCCc1ccc(OS(=O)(=O)c2ccc3c(c2)CCCC3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157825",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CNc1ccc(C#N)c([N+](=O)[O-])c1)S(C)(=O)=O by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242281",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N[C@@H](C(N)=O)c2ccccc2)ccc1C(=O)NC(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125896",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(CN2CC[C@H]3[C@H](CCC[NH+]3C3CC3)C2)cc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182665",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC)c1ccc([N-]S(=O)(=O)c2ccc(Cl)s2)cc1C(=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112270",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@@H](NC(=O)c2ccc3c([O-])n(C)c(=S)nc3c2)[C@@H]1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129583",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CN1C(=O)/C(=C2\\C(=O)N(CC(=O)Nc3ccccc3Cl)c3ccccc32)SC1=S by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167244",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C1O[C@H](/C=N/c2ccc(C(F)(F)F)cc2)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13293",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOc1ccc([C@H]2C3=C(CCCC3=O)Nc3c(C(=O)Nc4ccc(F)cc4)cnn32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239955",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Cc1ccc(Cl)cc1)N(C)C(=O)c1c[nH]c2nccc(Cl)c12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162141",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C(=O)NNC(=O)N[C@@H](c1ccccn1)C(C)C)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92841",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCc1cc[n+](/C(C(=O)c2ccc3c(c2)OCO3)=C(/[S-])NC2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231809",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(c1cccc(Cl)c1)N(CCN1CCOCC1)c1nc2c(F)cc(F)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128945",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCCCNC(=O)N1CCC[NH+](CC(=O)N(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175713",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)[C@H](O)CNC(=O)C(=O)Nc1ccc(C)nc1Br by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCO[C@H](C)c1nc(C[NH+](C)CC(N)=O)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104165",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN1C(=O)Cc2ccccc2[C@H]1C(=O)NCCC1=CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102012",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule O=C(NC[C@@H](O)c1ccoc1)[C@@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142588",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)NC(=O)/C(C#N)=C(/[O-])[C@H]1C[C@@H]1c1ccc(C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16353",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](Sc1nnc2ccc(C(F)(F)F)cn12)C(=O)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111613",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc(C)c(NC(=S)NC[C@@H](c2cccnc2)N2CCOCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56345",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C/C=C(/C)C(=O)O[C@H]1[C@@H](O[C@@]2(C)CC[C@@H](O)[C@@]3(C)CC=C(C(C)C)C[C@@H]23)O[C@H](C)[C@H](O)[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18667",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(C[NH+](C)CCn2cnnc2)cc(Cl)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157191",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H](NC(=O)[C@H]1C[C@@H]1c1ccco1)c1noc(-c2ccc(Cl)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38920",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)N1CCCc2cc(NC(=O)[C@@H](C)Cc3c(C)n[nH]c3C)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86943",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1(C)Cc2c(cnn2-c2ccc(F)cc2)[C@@H](NC(=O)CCC(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1occc1COC(=O)c1cccnc1OCC(F)(F)F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244511",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@@H](CSc1ccc(Cl)cc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc([C@H]2c3nc[nH]c3CCN2C(=O)c2c(C)nc3c(C)cccn23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63744",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C/C(=N\\NC(=O)CSc1ccc(Cl)cc1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178100",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(Br)cc([N+](=O)[O-])c1O[C@@H]1CC(=O)C12CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164909",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC1=C2[C@H](c3cc(OC)ccc3OC)C(C#N)=C(N)O[C@H]2N=N1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82365",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@H](Oc1cc(Cl)ccc1Cl)C(=O)NNC(=O)[C@H]1[C@@H](C(=O)[O-])[C@H]2CC[C@@H]1C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240634",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=CCNC(=O)c1ccc(NC(=O)c2ccc3[nH]cnc3c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20516",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)/C=C/c1ccc(OC(F)F)cc1OC(F)F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CSc1ccc([C@H](O)c2cc(C)c(Cl)cc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115485",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1ccccc1F)N(C)C(=O)CN(C)C(=O)c1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89866",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(OC)c(C[NH+]2CC[C@H](C)[C@@H](n3ccnc3)C2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103517",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2C[C@@H](c3ccc(Cl)c(Cl)c3)Nc3nc(N)nn32)cc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163614",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccccc1-n1cccn1)n1ccnc1-c1ccco1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221454",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc2c(c1)N(C(=O)c1ccc(C(F)(F)F)nc1)CCO2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241131",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2ccc(SCc3ccc(F)cc3)nn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236975",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)Sc1ccccc1C(=O)NCc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9864",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Cc1csc(-c2ccccc2Cl)n1)N[C@H]1CCCNC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136211",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=N/Nc1cccc([N+](=O)[O-])c1C by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148143",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCc1ccc(Cl)c(CC)c1NC(=O)[C@H]1CS[C@@]2(C)CCC(=O)N12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70115",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2nc(NC3CC[NH2+]CC3)cc(-c3ccncc3)n2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124757",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(CCc1ccccc1)=N\\NC(=O)c1ccc(CN2CCOCC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167678",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc([C@@]2(O)CCCS[C@H]2C)cc1OCC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCc1ccccc1C(=O)NC[C@H]1C[C@@]12CCc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40207",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)cc1CNC(=O)Nc1ccc(OC2CCOCC2)c(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50232",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule NC(=O)[C@@H](NCc1ccc(OC2CCCC2)nc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98191",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCn1nccc1[C@@H](C)[NH2+]Cc1cc(C(F)(F)F)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121095",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(NC(=O)CSc2nnc3c(Cl)cc(C(F)(F)F)cn23)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73769",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1c(C(=O)NCCN2CCN(C(C)=O)CC2)cc2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101778",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCC(CC)(C[NH3+])NC(=O)Cc1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51446",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cn1nnc(-c2ccccc2Cl)n1)N/N=C/c1cc(Cl)ccc1O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218089",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=C(OCC(=O)N1CCc2ccccc21)c1ccccc1NS(=O)(=O)c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182858",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NCc1cccn1Cc1cccc(F)c1)Nc1ccccc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174031",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H]1CCCC[C@@H]1[NH2+]CCn1ccc2c(Cl)cccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168019",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N1CCC(N)(C(N)=O)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212025",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1ccc(COC[C@@H](O)Cn2cnc3ccccc3c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53801",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNC(=O)[C@@H]1CCCN(C(=O)c2ccc(OC(C)(C)C)cc2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68499",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1)[C@H]1Nc2cc(F)ccc2S(=O)(=O)N1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214657",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule OCCc1ccc(OC[C@H]2CO2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H](C)NC(=O)[C@@H]1COc2ccc(F)cc2C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OC[C@]1([NH2+]C2CC2)CC[C@@H](Sc2nc3ccccc3[nH]2)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221250",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc([C@H]([NH2+][C@@H]2CCO[C@]3(CCSC3)C2)C(C)C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119127",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(Nc2nc(-c3cccs3)c(CC(=O)[O-])s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108791",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(N[C@H](C)C(=O)N2CCOCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133328",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1[C@H]1CC(c2cccc(NS(C)(=O)=O)c2)=NN1C(=O)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117326",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1NC(=O)COc1cc(O)c2c(c1)OC(C)(C)CC2=O by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108225",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)CN(C)C(=O)c2cccc(N3CCCC3=O)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33854",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@H](c1ccc(OC)c(OC)c1)[C@H]1CCO[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8817",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C[C@H]([NH3+])c2ccc(OC)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200665",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CO[C@H](CNC(=O)NC[C@@H]1CN2CCCC[C@@H]2CO1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "173106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(C(=O)CSc2nnc(C3=c4ccccc4=[NH+]C3)n2C2CC2)C[C@@H](C)N1C1CC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52707",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCN([C@@H](C)CS(=O)(=O)CC)S(=O)(=O)c1c[nH]c2nccc(Cl)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90296",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCS(=O)(=O)c1ccccc1C(=O)N1CCO[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50708",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cn1ncc(C(=O)N[C@@H]2CCCn3nc(C(C)C)nc32)c1C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106800",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc2sc(NC(=O)C[NH+]3CCC[C@@H]([C@@H](C)O)C3)nc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111359",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1ccc2oc(=O)cc(C[NH+]3CCC[C@H](N4CCCC4=O)C3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42603",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nn(Cc2ccccc2)c(C)c1C[NH+]1CCC[C@H](n2cccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197349",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)C1=NN2C(=N)/C(=C\\c3ccc(OCc4ccccc4)cc3)C(=O)N=C2S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244693",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1nc(C(=O)N[C@H](C)c2ccccn2)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242830",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cccc2c(CCNC(=O)NN[C@@]3(C)CCS(=O)(=O)C3)c[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138302",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCOC(=O)[C@](C)(O)[C@@H](C)c1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18250",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(CN(C)C(=O)c2oc3ccc(F)cc3c2C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115393",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCCc1cccc(Cl)c1)c1ccc(NS(=O)(=O)c2ccc3[nH]c(=O)[nH]c3c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205387",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)c(O)c(NC(=O)[C@@H]([NH3+])Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35191",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule c1ccc([C@H](NCCc2nnc3n2CCCCC3)C2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52703",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H](C)[C@H](C)Sc1ccc(N)c(F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134761",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)Nc1nn2c(-c3ccc(OC)cc3)nnc2s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112955",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@@H]1CCCC[NH+]1C[C@@H]1CCCN(C(=O)[C@H](O)c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198945",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCN(C(=O)CN(CCO)c1ccccc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68991",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccc([C@@H](C)C(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195060",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)Cc1csc(NC(=O)c2ccc(C(F)(F)F)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(CC)S(=O)(=O)c1ccc(C(=O)N2CC[C@@H](C)[C@H](O)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167880",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc([N-]S(=O)(=O)/C=C/c2ccccc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92665",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(Cc1cc(Br)cs1)C(=O)C[NH+](CCO)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147062",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1ccc([C@H](C)NCCc2ccccn2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46045",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]1c1ccc(/C=C/C(=O)Nc2ccccc2C(=O)NC2CC2)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131149",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+][C@H](C)CC(=O)N(C)Cc1cccc(Cl)c1)C1CCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1005",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=C(Nc1ccc2cn[nH]c2c1)c1csc(Nc2ccccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47819",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C=CCNc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219660",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule Cn1nc(C(F)(F)F)c(C#N)c1N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](Cc1cccs1)NC(=O)C(=O)Nc1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10698",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCNc1ncnc(Nc2cccc(Br)c2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107117",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(OC)c2sc(N(Cc3cccnc3)C(=O)c3c[nH]c4ccccc34)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(F)c(F)c1)NC1CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26234",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC(=O)Nc1ccc(N2CCN(Cc3nc4ccccc4n3C)CC2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCC#N)C(=O)CN1CC[NH+](C[C@H](O)C(C)(C)C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59134",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cc(NCc2nnnn2C2CC2)ccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189835",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1c([O-])c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])c(=O)c2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154488",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C[NH2+]CCNc2ccc(F)c(Cl)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Br)cc1[C@H]1C(C#N)=C(N)Oc2cc(C)n(O)c(=O)c21 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCc1cccc(NC(=O)N2CCN(C(=O)c3ccco3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231442",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(C[NH2+]C[C@@H]2CN3CCCC[C@@H]3CO2)c(SC)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199901",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(COc1ccc2ccccc2c1)Nc1cccc(C(=O)N2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171207",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H](C)N1C(=O)S/C(=C/c2ccc(-c3ccccc3C#N)o2)C1=O by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170640",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)c1cccc2c1CCCN2C(=O)CCCn1cnc2c(C)cccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241050",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1ccn(Cc2ccccc2)n1)c1cc(Cl)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39027",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(C(=O)c2coc3ccc(O)c(C[NH+](C)C)c23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124415",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1)[C@H]1CCCN(c2ccc(-n3ccnc3)nn2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10906",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=c1c2ccccc2oc2cc3c(c(O)c12)CCCC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99046",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC1=C(Br)[C@H](C(F)(F)F)N=N1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233185",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1C[C@H](C)N(C)C(=O)NC[C@H]1CN2CCCC[C@@H]2CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141008",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc(F)c(NC(=O)CC[NH+]2CCCCCCC2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126383",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#C[C@H]1CN(C(=O)c2c(O)cccc2O)CCN1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229003",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(C(=O)N(Cc2ccco2)c2nc3c(F)cccc3s2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39602",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1sc(Br)cc1S(=O)(=O)N1CCO[C@@H](C#N)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242904",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#Cc1cccc(CNC(=O)N(Cc2cccnc2)C[C@H]2CCCO2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155383",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule N#Cc1nc(-c2ccccc2)c(-c2ccccc2)nc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199243",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1occc1C(=O)[C@@H](C#N)c1nc(-c2ccc(C#N)cc2)cs1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143897",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1C(=O)/C(=C/c2cccs2)SC1=S)Nc1cc(C(=O)[O-])ccc1C(=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143127",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC1=C[C@H]([C@H]2NN[C@H]3SC(c4ccc5c(c4)OCCO5)=NN23)N=N1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110308",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCC[C@H]([NH2+]Cc1ccc(C)cc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74129",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1nn(-c2nc3c(Cl)c(Cl)ccc3s2)c(C)c1C(=O)NN .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29942",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(F)c([N+](=O)[O-])c(NCCCc2nnc3n2CCCCC3)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19020",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]1C[C@@H]1NC(=O)c1oc2ccccc2c1C[NH+](C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217105",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c(C[C@H]([NH3+])[C@@]2(C)CCCO2)c1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56003",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(F)c1[C@H](C)NC(=O)NCC[NH+]1CCC(OC)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54221",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(OC)c1OC(=O)Cn1c(=O)sc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(CCc1ccccc1)C(=O)c1occc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53369",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOc1ccccc1CN(C[C@H]1CCCO1)C(=O)Nc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188798",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc2c(s1)[C@@H](N(C)C(C)=O)CCC2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152906",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H]([NH2+]Cc1csc(C2CC2)n1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204974",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)CNC(=O)N1Cc2ccccc2N(C)C[C@@H]1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228105",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCSc1nnc(NC(=O)/C=C/Sc2ccccc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78635",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CCSCCOC(=O)/C=C/c1cccc(C#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126133",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CCC[NH+]([C@@H](C)CNC(=O)C(=O)Nc2ccc3[nH]ncc3c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44212",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC1=NN[C@H](SCC(=O)Nc2nc(C)cs2)N1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226965",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#Cc1ccc(OCc2ccc(C(=O)N=c3[nH]c4ccccc4[nH]3)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228754",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)/C=C/C(=O)N1CCc2nnc(CNC(=O)c3cccc(F)c3)n2CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)NCCC/C(N)=N/O)sc1Br by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1cc(C(=O)N(C)[C@@H](C)C(C)(C)C)sc1C#CCCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133900",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)[NH2+][C@@H]1CC(=O)N(Cc2cccc(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71703",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CC(C)c1nc([C@H]2CCCN2c2ncc(C#N)cc2Cl)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20191",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(C)NC(=O)[C@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37419",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc([C@H]2[C@@H](C[NH2+]C3CC3)CCCN2C)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200988",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1c(C)cc(S(=O)(=O)NCC[C@H](O)C2CC2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158917",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1OCCN1c1cccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152685",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC/[NH+]=C(/NCc1nnc2n1CCCCC2)N[C@@H]1C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98821",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(F)c([C@@H](C)CC[NH3+])cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172186",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)[C@@H]2C[C@H]3CC[C@@H]2O3)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30686",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCC(=O)N1CCCN(Cc2cnc(-c3ccccn3)nc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20514",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN1C[C@@H](NC(=O)NCc2ccnc(OC3CCC3)c2)CCC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151517",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)[C@@H](NC(=O)C(=O)Nc1cccc(-c2ncon2)c1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34842",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NNC(=S)[S-])c1cnccn1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c(-c2nccs2)nc2ccc(NCc3c(F)cccc3F)nc2n1Cc1ccncc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25001",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccc(C[NH2+]Cc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220339",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](SCc1ccccc1)C(=O)NC[C@@H](C)N1CC[NH+](C)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206890",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CSCc1cc(F)ccc1CNC(=O)c1c(F)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66611",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H]1NC(=O)c1c[nH]nc1-c1cccc(OC(F)F)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245427",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccc(OC)c(NS(=O)(=O)c2ccc(CC(C)C)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244919",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H](C)Cc2cccc(C(F)(F)F)c2)cc1C(N)=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123382",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc(NC(=O)c2cc(C)cc(C)c2)c(OC)cc1NC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140818",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cccc(-n2c(C)cc(C(=O)C(=O)Nc3ccccc3F)c2C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192378",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1nc(SCC(=O)N2C[C@H](C)O[C@H](C)C2)[nH]c(=O)c1NC(=O)c1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66648",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cncc(C(=O)N2CCCc3cc(C)ccc32)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61847",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C1CCN([C@H]2CCS(=O)(=O)C2)CC1)N1CCN(Cc2ccc3c(c2)CCO3)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160161",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cn1c(SC(c2ccccc2)c2ccccc2)nnc1[C@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115968",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)Nc1cccc([C@H](C)NC(=O)CCc2ncc(-c3ccc(C)c(C)c3)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202906",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)(C)OC(=O)c1nc([O-])n(-c2ccc(Br)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185711",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(C#N)CCCNc1ccccc1C(=O)N1CCC[C@@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125072",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#Cc1csc(C(=O)NCc2cccc(NC(=O)C3CCCC3)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104792",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1nc(C(F)(F)F)c2cc(C(=O)N3C[C@@H]4CC[C@H](C3)[NH+](C)C4)sc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97535",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(F)c(N2C(=O)CNC(=O)[C@@H]2C(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170009",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1ccc(N(C)Cc2ccc(Br)cc2)c([N+](=O)[O-])c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108540",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OCCCNC(=O)C1CCN(C(=O)[C@@H]2CCO[C@H]2C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C)C(=O)CCc1nnc(-c2ccsc2)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188811",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccncc1)N(Cc1ccc(O)cc1)CC1CC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237720",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccccc1CNc1nc2ccc(Cl)cc2nc1-n1nc(C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14669",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C2=N[C@H](c3ccc(F)c(Br)c3)N[C@H](c3ccccc3O)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238505",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C(=O)NCCNc2ccccc2)c(=O)[nH]1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CC(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)no1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179431",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1c(F)cccc1C(=O)Nc1ccc(-n2ccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1nc(C(=O)Nc2ccccc2)cs1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243505",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)[C@](O)(Cn1cncn1)[C@@H]1O[C@@H]1c1ccc(Cl)cc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226142",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2[nH]ccc2c1)C(=O)N[C@@H](c1nccs1)C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83388",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](C[NH+](C)CC(C)(C)S(C)(=O)=O)c1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245383",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2C[C@H](C(=O)N3CC[C@H](c4ccccc4)C3)CC2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32010",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)C[NH+](C)Cc1cc(Cl)cc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)N(C)Cc2nnn[n-]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CNC(=O)N[C@@H]2C=C[C@H](CO)C2)c(OC2CCCC2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75739",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN(Cc1ccccc1C(F)(F)F)C(=O)NCCc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199713",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H]1C[C@@H](N2CCN(c3cccc(Cl)c3)CC2)C(=O)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27706",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H]1CCCC[C@@H]1[NH+](C)Cc1cc(F)cc(C#CC[NH3+])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75672",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(N2CCn3c2nnc(C(=O)NCc2cccs2)c3=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172801",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(Cl)cc1NC(=O)[C@@H]1CN(C(C)=O)c2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83727",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nnnc1-c1ccc(OC)c(S(=O)(=O)Nc2ccc(C)c(C)c2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203696",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1noc(C)c1S(=O)(=O)NCCNC(=O)c1cccn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80906",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@H]1CCN(C(=O)COc2ccccc2Br)C[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137152",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1cccnc1C(=O)O[C@@H](C)c1cccc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143959",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](N[C@H](c1cccnc1)c1ccc(F)c(F)c1)c1cnn(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170455",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)CNC(=O)CCN1CCO[C@@H](c2ccccc2Br)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239448",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(N(C)C)cc(C)c1NC(=O)CCn1cnc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74853",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCNC(=O)[C@@H](C)CS(=O)(=O)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4182",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)Cn2cnc(C3CCC3)cc2=O)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](c1nc2ccccc2s1)N(C)C(=O)c1cccc(Nc2ncccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115180",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule N#C[C@@H]1CCC[C@H]1Sc1ccccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36740",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](c1cccnc1)N(C)C(=O)Nc1ccn(CCCC(=O)N(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183095",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)c1cc([N+](=O)[O-])ccc1O[C@H]1CCC[C@@H]([NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4357",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=C2\\CCCc3c2nc2ccccc2c3C(=O)OCC(N)=O)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249133",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCO[C@H]1C[C@@H](NC(=O)C(=O)Nc2cc(C(C)C)on2)C12CCCC2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60971",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(N2CC[NH+](C)CC2)nc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(F)ccc1F)[C@H]1CCS(=O)(=O)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200537",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CO[C@@H](C)C(=O)Nc1cccc(NS(=O)(=O)c2cc(C)ccc2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243683",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]C[C@H](C)C(=O)NC[C@H]1CCC(=O)N1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CN/C(=[NH+]\\C)SCC(=O)N(C)Cc1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209480",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1C[C@@H]1c1ccc(CN(C)C(=O)c2ccc(NC(N)=O)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229002",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@H]1CCCCN1C(=O)c1nc(C2CC2)n[nH]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38809",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)c1cccc(C(F)(F)F)c1F)C1C[NH2+]C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141594",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(-c2ccc(=O)n([C@@H](C)C(=O)Nc3ccc(OC)c(OC)c3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55697",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[C@@H](CO)N1CC[NH+](C2CCC(C(C)C)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194457",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-c2c(-c3ccccc3)ncn2CCCO)cc(C)c1O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232000",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)c1n[nH]c([C@H]2CN(C(=O)c3ccc(=O)n(C)n3)CCO2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120031",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N2CC[C@@H](N[C@H](C)c3cccnc3Cl)C2=O)n(C)n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17279",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(CC(=O)NCc2ccccc2F)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149249",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1c(NC(=O)CSc2n[nH]c(N)n2)sc2c1CC[C@H](C)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148976",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=c1c(Cc2ccc(Cl)cc2)c([O-])ccn1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208090",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1[C@H]1CN(C(=O)C(=O)Nc2ccc(F)cc2F)CCO1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1nc2ccccc2s1)N[C@H](C)c1cn(-c2ccccc2)nn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133571",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[S@](=O)[C@@H]1CCCC[C@@H]1NC(=O)NC(C)(C)c1cccc(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234871",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc(OCC2=NN3[C@@H]([C@H]4C=c5ccccc5=[NH+]4)NN[C@H]3S2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109403",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N(C)c2ccc(O[C@H](C)C(=O)Nc3c(C)cc(C)cc3C)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=S)NC(=O)c2ccccc2[N+](=O)[O-])c(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(N2CC[C@H](O)C2)nc2cc(C(=O)NCCCOc3ccccc3)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71959",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccc(F)cc1)NC(=S)NNS(=O)(=O)c1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)CN1CCC([NH2+][C@@H](c2c(Cl)cccc2Cl)C(C)C)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117390",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(CN(C)C[C@H](O)CN2CCOCC2)cc(Br)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105500",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)CN(C(=O)c1cnc([C@@H]2CCCO2)s1)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89300",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(NC(=O)[C@@H](Sc2nnc(-c3cccnc3)n2N)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8140",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1c(-c2ccccn2)nn(CCNC(=O)c2ccco2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SCC(=O)NCc4ccccc4)=NC(=O)[C@H]32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93496",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)[C@H]2C[C@H](CCSC)N[C@]23C(=O)Nc2c(C)cc(Cl)cc23)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule OC[C@H]1C[C@@H]1c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54295",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@H](C)C1NC(=O)/C=C/c1ccc(N2CCCS2(=O)=O)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73447",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCc1nc(CC[NH2+]Cc2cc(=O)c3cc(F)ccc3[nH]2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47742",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1C=Cc2ccccc2[C@H]1CC(=O)NC[C@H](CC(C)C)[NH+](C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59428",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](C(=O)N(C)C1CCCCC1)n1nnc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55436",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCCN[C@@]1(C(=O)[O-])CC[C@H]([NH+]2CCC[C@@H]2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](SCc1ccnn1C)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233722",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(OC)cc([C@@H]2CCN(C(=O)N[C@@H]3C[C@@H]3c3ccccc3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc2c(cc1OC)C[NH+](Cn1nc(-c3ccc(Cl)cc3)n(C)c1=S)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112674",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1518",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(S(=O)(=O)[C@H](C)C(=O)Nc2c(C)cccc2C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114196",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2CC[C@H](Nc3ccc([N+](=O)[O-])nc3)C2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50658",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)[C@@H](NC(=O)/C=C/c1ccc(OCC#N)cc1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26161",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@H](C/C(N)=N/O)N1CC[NH+]2CCC[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201943",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nc(CNc2ccccc2OC[C@H]2CCCCO2)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172184",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H](CNC(=O)Nc2ccc(C(N)=O)c(C)c2)[NH+](C)C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61402",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)(C)c1ncc(NC(=O)Cc2csc(-c3cnccn3)n2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)Nc1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158957",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1n[nH]c(SCCC(=O)NCc2ccc(N(C)C)cc2C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(C(=O)NCCCSc2nccs2)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131661",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C[C@H]([NH3+])Cc2ccc(O)cc2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54088",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(N[C@@H](C(=O)N/N=C\\C=C\\c1ccccc1)c1n[nH]c(=O)c2ccccc12)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(C[C@@H](O)COc2cccc(C[NH3+])c2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[NH2+][C@@H](C(C)C)[C@H](C)c1cc(C)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCc1cc(NC(=O)N(C)Cc2ccc(F)cc2Cl)n(C)n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208100",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1927",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CN2CC[NH+](Cc3cccc(C)c3)CC2)cc1Br by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162996",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)c(NC(=O)C[C@H]2Oc3ccccc3NC2=O)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114197",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1nn(C)cc1NC(=O)CCn1c(C)csc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76779",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(CNC(=O)CN1CC[NH2+]CC1)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(O[C@@H](C)C(=O)N(Cc2ccc(F)cc2)[C@@H]2CCS(=O)(=O)C2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140664",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NCC[NH+]1CCC(c2ccsc2)CC1)c1ccc(F)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88597",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)cc(-n2cc(C(=O)N3CCC(C)CC3)nn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196700",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccc(/C=[NH+]\\C[C@H]2COc3ccccc3O2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167343",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CO[C@H]1CCCN(C(=O)N[C@@H](C)c2cnn(-c3ccccc3)c2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238279",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)c(C[S@](=O)CC(=O)N(C)c2ccccc2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149280",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(-n2c([C@H](C)Cl)nc3cc(C)cnc32)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186507",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](CN(C(=O)c1ccoc1)c1ccccc1)NC(=O)c1ccoc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148771",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(-n2cnnn2)cc1NC(=O)[C@@H]1C=C[C@@H]([NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12561",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC[C@@H]1CCN(C(=O)[C@@H](C)Sc2nnnn2C2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119261",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)CSc2nnnn2C2CCCC2)n(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)[C@H]2CSCCS2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]Cc1ccccc1NC(=O)C1C(C)(C)C1(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138682",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(c1ccc([C@H]2CCC[NH2+]2)s1)N1CCC(CN2CCOCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216572",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC(=O)N1CCC[C@H](COc2ccc(C(=O)N3CCCCC3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204546",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](NC(=O)C(=O)Nc1ccc2c(c1)CCC(=O)N2)c1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51575",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(S[C@H]2CSc3nc(C)cc(=O)n3[C@@H]2c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19780",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C(=O)CCN(c2ccc(F)cc2F)[C@H]1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24317",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(C(=O)Cc1ccc(F)c(F)c1)[C@@H]1CCC[C@H]1C[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "173479",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H]1CC[NH+](Cc2cccc(O)c2)C1)c1cc2ccccc2[nH]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1c(F)cccc1-c1ccc(CN[C@@H](CO)c2ccco2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1C[NH2+]CC1CC[NH2+]CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71341",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(C)c1N1CCN(C(=O)c2ccccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34245",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(O)c([C@H](C)NC(=O)Nc2cccc(C)c2Cl)c1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1cc(CN2CCC([NH+]3CCC[C@@H]3C)CC2)cc([N+](=O)[O-])c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8154",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nnc2ccc(C(=O)N3CCCCC[C@H]3c3cccn3C)cn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCC[NH+]1CCN(C(=S)NCc2ccco2)CC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64782",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule C[C@H]1CO[C@@H](c2ccccc2)[C@H](C)N1Cc1cnc2ccc(C#N)cn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88735",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@H]1NC(=O)C(=O)Nc1ccc(Cl)c(C(=O)NC2CC2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)NCc1ccc(F)cc1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152276",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(S(=O)(=O)NC[C@@H]2CCN(c3ccc(F)c(F)c3)C2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15721",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc2ccc(Nc3ccc4oc(=O)n(CC[NH+](C)C)c4c3)nn12 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216083",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Nc1ccc(CCNC(=O)Cc2ccc(F)c(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52058",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccccc1C[NH+]1CCC(Oc2ccc(C(=O)NC3CCCC3)cc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220510",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)N1CCC[C@@H](C(=O)N[C@H]2C[C@H]2CCC)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186841",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCOc1ccc(NC(=O)CNC(C)=O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171856",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1[nH]c(=O)c(C(=O)OC[C@@H]2C[C@H]2C)cc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc(Cl)cc1)c1ccc(CNc2c(O)c(=O)c2=[N+]2CCCCC2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)N(Cc1cccnc1)C(=O)CN1C(=O)[C@@H]2CCCC[C@H]2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210836",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cncc(Nc2ccc(Cl)cc2C(F)(F)F)n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239779",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1CC[NH+](Cc2cc(Cl)ccc2O)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181976",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CNC(=S)Nc1n[nH]c(SC)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138514",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(C1=C[C@H]2N=CC=C2C=C1)N(Cc1cccnc1)CC1CC[NH+](C2CCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248091",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC[C@H]1CCC(=O)[C@H](Cc2cc(Cl)ccc2[N+](=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200254",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1=C(N)Oc2cc(C)n(CC[NH+](C)C)c(=O)c2[C@H]1c1ccc(Cl)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc([S@@](=O)[C@H]2CCC(C)(C)[C@@H]2[NH3+])cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67270",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NC(=S)N1CCOCC1)c1ccccc1C(=O)OCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1cccc(NC(=O)C(=O)N2CC[C@@H](Cc3ccccc3)C2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135199",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nc(CN(C)C(=O)[C@@H]2CC[NH2+][C@H]2C)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21721",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)c1ccc(S(=O)(=O)N(C)Cc2ccc([C@H]3C[C@@H]3C)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89615",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c2c3ccccc3n(CCNC(=O)c3cccc4cccnc34)c2n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145981",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cc2c(cc1OC)[C@@]1(Cc3ccc(Cl)cc3)[C@@H]3CC=CC[C@@H]3C(=O)N1CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239626",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCN1C[C@H](C(=O)Cl)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177278",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2ccc(=O)n(Cc3noc(C(=O)N4CCCC4)n3)n2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245779",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NS(=O)(=O)CCN(CCO)Cc1cc(Br)ccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160211",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](C)[C@H](C)[NH2+]C2CCN(S(=O)(=O)C3CC3)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133449",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule c1ccc(-c2cc(N3CCC[C@@H](Cn4cc[nH+]c4)C3)n3nccc3n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76853",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](NC(=O)CN1CCCC1=O)c1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64542",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(OC(F)F)cc1)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49854",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1nnc2ccc(N[C@H](C)C(=O)N3CCOCC3)nn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72889",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=[N+]([O-])c1cccnc1N[C@H]1c2ccccc2C[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217840",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nn(C(=O)OC(C)(C)C)c(C)c1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154132",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[NH+]2CCC[C@@H]2CN1c1cc(Cl)ccc1C(=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109418",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CC(=O)N[C@@H](C)c1nc2ccccc2n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100088",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C[C@@H](C)C#N)C(=O)Nc1c(C(C)C)cccc1C(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186730",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CC1(O)CCCC1)NCc1cn2cc(Br)ccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125743",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#C[C@H]1C(=O)NC(=S)[C@@H](C(N)=O)C12CCCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163840",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc2n(n1)CCN(C(=O)c1cc(-c3ccccc3O)n[nH]1)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97706",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[C@H]1N1C[C@H](NC(=O)Cc2cccc(O)c2)CC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46258",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)c1ccccc1C(=O)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35311",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H]1CCN(C(=O)Nc2cccc(CS(=O)(=O)N[C@H](C)CC)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175858",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[NH+](CCC(=O)Nc1ccc(F)cc1N)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206081",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cccc(NC(=O)c2cc(C)c(C#CCO)s2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113735",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule N/C(=N/OCC(=O)N1CCCCCCC1)c1cnccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54729",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C/C(=N\\O)[C@H]1C[C@H]2C=C(C#N)[C@@H]1[NH+](Cc1ccccc1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73946",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H]1CCC[C@H]1[NH2+]CCNC(=O)CC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134512",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-n2cnc3c2N=C(O)C[C@H]3c2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64649",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=S)NC(=O)C2CCC2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40047",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1C[NH2+]C[C@]12COc1ccccc1C(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149344",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1occc1C(=O)NCC(=O)NC[C@@H](C)c1nc(-c2ccccc2)no1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177583",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)c1ccc2cc(C(=O)N(C)Cc3ccc(Br)o3)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238478",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(COc2ccc(-c3nnco3)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175797",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C(C)=O)ccc1OCC(=O)NC1C[C@@H]2CCC[C@H](C1)[NH+]2C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[NH+]1CCN(Cn2nnn(-c3ccc(Cl)cc3)c2=S)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]Cc1ccccc1O[C@@H](C)C(=O)NC(N)=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170692",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CCNC(=O)C(=O)N/N=C\\c1cc([N+](=O)[O-])ccc1[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61582",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCc1ccc(OCc2cnc(N)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103178",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccnc(NC(=O)[C@@H](C)c2ccc(Br)s2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107466",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule [NH2+]=c1oc2ccc(Br)cc2cc1C(=O)NCc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174546",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](NC(=O)CCn1ccccc1=O)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223533",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H]1CCCC[C@H]1Sc1nnc(-c2ccc(Cl)s2)o1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201022",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[NH+](C)CC(=O)NC[C@H]1CN(CC(C)C)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26235",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C([O-])COCC(=O)Nc1ccc2c(c1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccnn1Cc1cccc2ccccc12)c1cccnc1Cl by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36182",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)Nc1ccccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46096",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC[C@@H](C)NC(=O)[C@@H]1CCCN(C(=O)Nc2ccc(C(=O)NC)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70190",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CNc1ccc(C(=O)[O-])cc1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162466",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C/C(=C\\c1ccc(F)cc1)C(=O)OC[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191171",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(C)c1ccc(C[C@H](C(N)=S)c2nc3ccccc3[nH]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131543",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(=O)n(CC(=O)N2CCn3c(C)nnc3C2)c2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141084",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)N1CCc2ccccc2[C@H]1CC(=O)O[C@@H](C)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75068",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1cc(F)ccc1Cl)[C@@H](O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39831",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)c1cccc(S(=O)(=O)N2CCCc3cccc(F)c32)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97439",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc([C@H]2[C@@H](C(=O)N[C@@H](C)c3nc4ccccc4o3)CCC(=O)N2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203090",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOc1ccc(-c2nc(C(=O)N3CCNC(=O)[C@@H]3CC)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232374",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=CCN(C(=O)[C@@H]1CS[C@@]2(C)CCC(=O)N12)c1nc2c(s1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81903",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CO[C@@H](C)/C(N)=N/OCCOC1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89947",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule C[C@@H](CC#N)N(C)C(=O)Nc1ccc(Cl)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226041",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(NCC[NH+]1CCC(CO)CC1)Nc1ccc(C(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211269",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(N(CCC(F)(F)F)CC2CC2)nc(-c2ccccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118419",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)N1CCC[C@H](C(=O)Nc2cccc(-c3nc4ccccc4s3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97248",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)c1cccc(OCC2=C[C@@H](C(=O)NCc3ccco3)N=N2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115897",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCNc1ncnc(Nc2ccc(I)cc2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170866",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccc([C@H](COC)NC(=O)C(=O)Nc2ccc3ncccc3c2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88810",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C=C(C)COc1nc(C)c2c(c1C#N)CC(C)(C)OC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158687",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule O=C([O-])C[C@](O)(c1ccco1)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246241",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOc1ccc(S(=O)(=O)NCc2ccco2)cc1C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35330",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCn1nc(C(=O)N2CCCC2)c2c1CC[C@@H](NCc1nc(-c3ccccc3)cs1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18900",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[NH2+][C@]1(C(=O)[O-])CCC[C@@H]1CCSc1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6101",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc(C)c1C(=O)Nc1ccc(Cl)cc1C(F)(F)F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156633",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CN(C(=O)Cc2ccc(C(F)(F)F)cc2)CC[S@]1=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COC1CCN(c2ccc(C(F)(F)F)cc2C(N)=[NH2+])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C(C)C)c(C)c1S(=O)(=O)[N-]c1cccc(C(=O)[O-])c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208230",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](C(=O)N1CCCC1)N1CCN(c2ccc(Cl)c(C#N)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228388",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CO/N=C/c1ccc(C(=O)N(C)[C@H](C)c2ccc([S@](C)=O)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86092",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CC(=O)NCCOc2c(C)cccc2C)no1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136241",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1c(-c2ccc(F)cc2)cc(-c2ccccc2)nc1N by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCO[C@@H]1CCCN(C(=O)c2nc(C(C)(C)C)n[nH]2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116479",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1-c1cnc(CNN2CCCCC2)s1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187541",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1-n1c(S[C@@H](C)C(N)=O)nc2ccccc2c1=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](CCC(F)(F)F)[C@@H]1C[NH+]2CCN1CC2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44500",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H](O)[C@H](C)C#N by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)cc([C@H]([NH3+])Cc2cccc(C(F)(F)F)c2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(Cl)cc1/C=N/N1C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86334",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2168",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC[NH+]1CCC[C@H]1CNC(=O)c1sc2ncnc(NCc3ccc4c(c3)OCO4)c2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235393",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](NC(=O)c1cccs1)C(=O)N1CCc2c(sc(N)c2C#N)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244950",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@]12CCCC[C@H]1[C@@H](Cc1cccnc1Cl)[NH2+]CC2 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125572",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1ccccc1OCC(=O)NCc1cscn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220551",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCN(C(=O)Cn1ncc2c(=O)oc3ccccc3c21)c1ccc(OCC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(NC(=O)Cn2ncc3c([nH]c4ccccc43)c2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52166",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(C)C(=O)Oc1ccc(C2CCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32235",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(O[C@H](C)C(=O)Nc2ccnn2Cc2ccc(C)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11662",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)Cn1c(CNC(=O)c2ccccc2F)nc2ccccc21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235827",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CNC(=O)c1ccc(OCc2ccccc2C#N)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15997",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Oc1ccc(O)c(C[NH2+]C2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246361",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Oc2cc(CNC(=O)Nc3ccccc3)ccn2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174155",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=S(=O)(NCC[C@H]1C[C@@H]2CC[C@H]1C2)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67636",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1cc([N+](=O)[O-])ccc1F)[C@@H]1CCCN1C(=O)OCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16359",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1c(C(=O)N[C@@H]2CC[C@@H]([NH+](C)C)C2)cnc2c1c(=O)n(C)c(=O)n2C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68665",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](C)NC(=O)CSc1nnc(C2CC2)n1C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70275",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1cc([C@@H]2C3=C(C[C@H](c4ccccc4)CC3=O)Nc3ccc4ncccc4c32)ccc1OC(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25414",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CC(=O)N2CCC3(CC2)CC(=O)N(C[C@H]2CCCO2)C3)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32958",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cccc(C2=CCN(C(=O)[C@H]3CC(=O)Nc4ccccc43)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214024",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=CC1CC[NH+](Cc2ccccc2OCCOC)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191280",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@H]1[C@@H](C(=O)[O-])CC[NH+]1CC(=O)NNc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1cccc(CC2(c3ccccc3)C[NH2+]C2)c1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150302",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCNC(=O)CN(CC)c1ncncc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40919",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@@H](C(N)=S)N(C)C(=O)[C@H]1CCO[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203128",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c(C)c1C[NH2+]CC(=O)NC1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225077",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCCn1cc[nH+]c1Cc1cc(Cl)ncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229325",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Cn1ccc2ccc(F)cc21)N1CCN(CCc2ccccn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149555",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[NH+]1CC[C@H](NCc2ccccc2F)[C@H](c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48408",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(C(=O)c1cc(=O)[nH]c2ccc(S(=O)(=O)[N-]c3ccc(F)cc3)cc12)[C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77273",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](Oc1ccc(Br)cc1)C(=O)N[C@H](C)c1ccc(-n2ccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189406",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]1CCC[C@@H](OC(=O)c2cccc(C(F)(F)F)c2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116799",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C)cc1[C@@H](C)NC(=O)N1CC[NH+](CC(C)C)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@H]1CC=CCC1)N1CCC([C@@]2(c3cccnc3)NC(=O)N(CCc3cccs3)C2=O)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162172",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(=O)N(C)[C@@H](C)C2CC2)nn1-c1c(Cl)cccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177055",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C([O-])[C@H](c1c[nH]c2cc(F)ccc12)[NH+]1CCN(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225734",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCCN[C@@H](c1ccc[nH+]c1N)[C@H]1C[NH+]2CCN1CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166513",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(C1CC1)N1CCC[C@H](CNc2ncc3c(n2)CCN3c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](c1ccccc1)n1c([C@H]2CC(=O)N(C3CCCC3)C2)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74762",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccccc1-n1nc(Br)nc1Br by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182195",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CC[S@@](=O)[C@@H](C)C(=O)Nc1cc(Cl)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247636",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)c1c(NC(=O)c2cc(C)no2)sc2c1CC[NH+](C(C)C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221522",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@]1(NC(=O)CCc2ncc(-c3ccccc3)o2)CCOC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164802",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H]1CCCN(C(=O)Nc2cc(Br)c(=O)n(C)c2)[C@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50392",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCn1/c(=N/C(=O)C[C@H]2CCCCN2C(C)=O)[nH]c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)c1cc(=O)[nH]c2ccc(Br)cc12)c1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114778",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1noc(C)c1C[NH2+][C@@H](C)C(=O)NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234885",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cnc(Nc2ccc(NC[C@H]3CCCO3)c(F)c2)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205386",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N(C)C[C@@H](O)COc2ccccc2C(F)(F)F)n2ncnc2n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64535",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(Cl)cc1N1C(=O)CS[C@@H]1c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154081",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1c(Cl)cccc1NC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NC1CCN(C(=O)N[C@@H](c2ccccn2)C(C)C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80869",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)Nc1cccc(NC(=O)N(CC)C[C@H](C)C#N)c1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202846",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCCC[C@H](CC)C(=O)Nc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1oc(-c2ccc(Cl)cc2)nc1C[NH+]1CCC[C@@H](C(=O)NC2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156112",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C(=O)Nc2ccc3c(c2)CCCN3C)c(=O)[nH]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113654",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CCC(=O)NNC(=O)N1CC[C@H](C)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46721",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)N(C)c1ccccc1NC(=O)Cc1ccc(NC(=O)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169815",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCC[NH+](Cc1nc(Cl)ccc1Cl)C1CCC([NH3+])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122428",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CSCC(=O)NNC(=O)N[C@@H](C)Cc1c(C)noc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150300",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(NC(=O)C(=O)N[C@@H]2CCc3ccccc32)ccc1-n1cnnn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212111",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C[C@H](C#N)CNC(=O)C(=O)Nc1ccccc1N1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115825",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](Sc1nc2sc3c(c2c(=O)n1C)CCC3)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132772",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccn2c(=O)cc(CN(Cc3ccccc3)Cc3ccc(F)cc3)[nH+]c2c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128600",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@](C)([NH3+])C(=O)NC1CCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227766",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](CC1CCOCC1)C[C@@H]1C[C@@H]1c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCn1cncn1)N1CCC[C@H](c2[nH+]ccn2Cc2ccccc2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62140",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1cncn1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161207",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COCc1ccccc1C(=O)NC[C@H](O)c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85974",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1noc(C)c1C[C@@H](C)C(=O)N[C@@H](C#N)C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54138",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc([N+](=O)[O-])ccc1-c1ccc(/C=N\\NC(=O)c2ccccc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186079",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCCS(=O)(=O)[N-]c1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2C)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159583",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1CCC[C@@H](N(C)C(=O)Nc2ccc(Cl)c(C(=O)NC3CC3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34663",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)Cn1cnc2cc(-c3ccc(OC)cc3)sc2c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(C)cc(SCC(=O)N[C@@H](C)c3ccccc3)nc2c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185188",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=c1[nH]c(CN(CCC(F)(F)F)C2CCCC2)nc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28127",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule COc1ccc(-c2nc(SCC(C)C)nc([O-])c2C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223910",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)c1c(C)sc(-c2c(-c3ccc(Cl)cc3)[nH]c3nc([O-])[nH]c(=O)c23)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231787",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)n(CCNC(=O)c2ccc([C@H]3CCC[NH+]3C(C)C)s2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185721",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(CCNC(=O)[C@H]1CC(=O)N(C2CC2)C1)c1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193858",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CCl)CSc1ncnc2c1CCC2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccc(NCC(C)(C)N2CCOCC2)c([N+](=O)[O-])c1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249351",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nc2ccc(F)cc2s1)c1ccccc1[N-]S(=O)(=O)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121865",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[NH+](C)[C@@H](CNC(=O)CCc1ccc(Cl)s1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92168",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CNC(=O)c1ccc(OC)c(NC(=O)NCc2cccnc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([C@@H](C)[NH2+]Cc2cnn(-c3ccc(F)cc3)c2)c(C)s1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82789",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Nc1ccc2c(c1)OCCCO2)C(=O)Nc1ccccc1[N+](=O)[O-] by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124979",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H]1C(=O)N1CCN(C(=O)c2cnc(Oc3ccccc3)cn2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93750",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1c(C(=O)N[C@@H](C)CNc2nc3c(c(=O)[nH]2)CCCC3)oc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76912",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@H](C)[NH2+][C@@H]2CCOc3cc(C)c(C)cc32)ccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90797",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@@H]1CC(=O)N(C[C@H]([NH2+]C)C2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCc1nn(C)c(NC[C@@H]2C[C@@H]2c2ccccc2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141314",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cc(/C=C/C(=O)N2CCCC[C@H]2C)cc2c1OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232564",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(C)(C)O)C(=O)c1cccc(OC(F)F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126053",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](NC(=O)Cc1c(Cl)cccc1Cl)c1ccc(S(=O)(=O)N(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100111",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)SC1=NCCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206749",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule COC(=O)CCCc1nc2ccc([N+](=O)[O-])cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24123",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nn(CC(C)C)c2sc(C(=O)N[C@H](C)c3ccccc3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87140",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc([C@@H]2CCCN(C(=O)c3c[nH]c(C(C)C)n3)C2)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54236",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(CC(=O)Nc1ccc2c(c1)OCCO2)C(=O)C=C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211698",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCNC(=O)CN1CCOC[C@H]1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220103",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC1(C)[C@H]2CC[C@]1(C)[C@H](NC(=O)c1ccccc1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175026",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#Cc1ccc(C(=O)Nc2nnc(-c3ccc(Br)s3)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211524",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(OC)cc([C@H]2CCN(C(=O)[C@@H]3CCO[C@H]3C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2csc(NC(=O)NC[C@@H]3CCCO3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39545",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)CN(C)C(=O)Nc1ccc(F)c(C(=O)N(C)C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246440",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCCNC(=O)NCc1cc[nH+]c(N2CCN(c3ccc(F)cc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230340",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1[C@@H](Sc2nc3ccccc3o2)CCN1c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60481",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule N#Cc1ccc(C(=O)N2CCCS/C2=N\\c2cccc(C(F)(F)F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24593",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc2nc(N3CCC[C@@H]3C(=O)N(C)CCc3ccccn3)nc(C)c2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194918",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)C1=C(C)[C@@H](C(=O)N2CCN(c3cccc(C)c3C)CC2)N=C1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131315",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CC(CO)(CO)Cc2ccccc2)sc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ncnc2ccsc12)c1cc(F)ccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107239",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCC[NH2+][C@@]1(CO)CC[C@@H](n2c(C)nc3ccccc32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196414",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1c(Cl)cccc1S(=O)(=O)NC[C@H](c1cccs1)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227318",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1csc(NC(=O)c2cnc([C@@H]3CCC[NH+](C)C3)cn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213397",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCc1cccc(N[C@@H]2c3ncccc3C(=O)N2c2cc(OC)ccc2OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165929",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCN[C@H](c1cc(C)cnc1N)C(C)(C)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58351",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@H](NC(=O)N[C@H](C)[C@@H](C)CO)c1cccc(N2CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)NC(=O)[C@H]1CC[C@H](c2ccccc2)N(C(C)=O)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](NC(=O)[C@H]1CC=CCC1)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NCCc1nc2ccccc2s1)c1ccc(OCC(F)F)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40257",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1c2ccccc2O[C@@H]1C(=O)OCc1cc(Cl)c2c(c1)OCO2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104408",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)C[n+]2ccc(Cc3ccccc3)cc2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20512",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS[C@@H](C#N)C(F)(F)F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nnsc1CNC(=O)c1nc2ccccn2c1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1OCC[NH2+]C[C@@]1(C)CC(C)=NO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NC(=O)C[NH+]2CCCN(c3ncccn3)CC2)ccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225543",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOC(=O)C(F)(F)Oc1cc(C)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(CCNC(=O)N(C)[C@H](C)c2ccco2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205953",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cn1cc[nH+]c1[C@@H](NCC(C)(C)S(C)(=O)=O)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104685",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Nc1ccc(COCc2ccccc2)c2ncccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225419",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cn1cnnc1CCn1nnnc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194300",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)c2[nH]nc([N+](=O)[O-])c2Br)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]C[C@H](C)C(=O)N1CC[C@H](C)[C@H]2CCCC[C@@H]21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN2CC[NH+](C)[C@@]3(CCNC(=O)CC3)C2)cc1Cn1cccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233001",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccc2c(c1)OCO2)C(=O)c1ccc2ccc(Cl)cc2n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23943",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(-n2c(-c3ccccc3)c(CC)n3c4c(=O)n(C)c(=O)n(C)c4nc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236121",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C[C@@H](c1ccccc1)[NH+](C)CCOc1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20725",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Br)cc1S(=O)(=O)N1CCC[C@H](N2CCCC2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166022",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(N2CCOCC2)cc1C(F)(F)F)NC1CCCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200076",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@H]1C[C@@H]([NH3+])CN(Cc2nc(N)nc(N(C)C)n2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113041",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(N2CCC[C@@H]2C(=O)NCCC2=CC[C@@H]3C[C@H]2C3(C)C)nc2cc(S(C)(=O)=O)ccc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231004",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)[C@@H](C)n1c2ccccc2c2cn[nH]c(=O)c21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79413",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[NH+](Cc2c[nH]nc2-c2ccc(F)cc2)CC[C@@]1(O)C1CCOCC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50476",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC[C@H]1CCN(C(=O)N[C@@H](C)c2ccc(-n3cncn3)cc2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57261",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)c(C[NH2+]Cc2cn(-c3ccc(F)cc3F)nc2-c2ccccc2C)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60135",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C#Cc1cccc(NC(=O)C(=O)NC2CCN(C(=O)c3ccco3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202632",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc2c(cc1OC)CCN(C(=O)c1cnn(C)c1C)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99742",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(C)CN(CC)C(=O)CN1CCN(C(=O)C[NH+](C)C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154577",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(N2CCOC2=O)cc1NC(=O)[C@H](C)Sc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223290",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@@H]1CN(C(=O)c2cn[nH]c2N)C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71599",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CCOC(=O)C[C@H](C)Nc1snc(Cl)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54086",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1ccc(-c2nc(CC(=O)Nc3nc(C)c(C)s3)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23755",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule N#Cc1cn(C2CC2)c(=O)n(CC(=O)N2CCN(C(=O)c3ccco3)CC2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201362",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc([S@@](=O)CCC(=O)Nc2cc(F)cc(F)c2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112618",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccc(-n2nc(C)c(CC(=O)Oc3ccc(C(N)=O)cc3)c2C)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243204",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1Nc2ccccc2C[C@@H]1C(=O)N[C@@H]1CCCC1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)c1ccc(NC(=O)c2oc3c(c2C)/C(=N/NC(N)=S)CCC3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93208",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(CCNC(=O)CCn2cnc3onc(-c4ccc(F)cc4)c3c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76526",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C2=C[C@H](C(=O)N3CCN(C(=O)c4ccco4)CC3)N=N2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123565",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(COCCNC(=O)N2CC[C@@H]3CCCC[C@H]32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74755",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COc1cc(OC)cc([C@@H]2CCN(Cc3ccc(F)cc3C#N)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198876",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)n1ccc2ccc(C(=O)NCc3nnc4ccccn34)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53851",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccccc1Oc1ccccc1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9524",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1cccc(-n2ncc3c(O)nc(SCC(N)=O)nc32)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9991",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]1C(=O)OCC(=O)Nc1cc(S(C)(=O)=O)ccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178416",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)[NH2+]Cc1c[nH]nc1-c1ccc(C(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(CC(=O)N[C@H](C#N)C(C)(C)C)C(=O)c1ccc(Br)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77064",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCc1cc(C(=O)N(C)[C@H](C)c2cc(-c3ccccc3)[nH]n2)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60216",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1CCCNC(=O)N(C)Cc1c(F)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195815",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule N#Cc1cccc(/C=C/C(=O)N2CCCCC[C@@H]2c2ccncc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168122",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc2c(c1)CCCN2C(=O)C[NH+]1CCC[C@@H]1c1ccc(OC)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123756",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C(=O)NCc2cccnc2)nc(N(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188854",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)OCc1ccccc1)C(O)(O)C(=O)CCl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6340",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(O[C@@H](C)C(=O)N2CCC(C(N)=O)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226988",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC(CC)(CO)CNC(=O)c1ccc2c(c1)COCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170385",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1CCC[C@@H](NC(=O)CN2C(=O)NC3(CCC(C(C)(C)C)CC3)C2=O)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(/N=C(\\[S-])Nc2ccc(Br)cc2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245506",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCN(CC)C(=O)CCC(=O)N1CCC[C@@H](C)[C@@H]1c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30692",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1cnn(C[C@H](CS)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156973",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC[C@@H]1CSC(NC2CCCCCCC2)=[NH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158175",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CC[NH2+][C@@H]1CCOC2(CCCCC2)C1)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24594",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC(C)(C)CC[C@H]1NC(=O)N1CCN(C(=O)c2ccncc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190143",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCCCN1CC(=O)N2[C@@H](Cc3c([nH]c4ccccc34)[C@H]2c2ccc(C)cc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175794",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN1C(=O)NC(=O)[C@]2(Cc3ccccc3N3CCN(Cc4ccc5c(c4)OCO5)C[C@@H]32)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59630",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)c1ccc(-c2csc(NC(=O)[C@@H]3CCCN3S(=O)(=O)c3ccc(C)cc3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99195",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)N[C@H](C)CCc1ccccc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51563",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@@H](C)NC(=O)Nc2ccc(NC(=O)C3CC3)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1nc(CCNc2nccc(-c3cc(C(=O)[O-])ccn3)n2)cc(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H]1C[C@H]([NH3+])CN(S(=O)(=O)c2c(F)cc(F)cc2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)Cn2c(=O)ncc3cc(S(=O)(=O)N4CCCC[C@@H]4C)ccc32)c(C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171465",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CC[C@H](c1ccncc1)[NH+](C)Cc1csc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109380",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1[nH]cnc2cc(-c3ccc(Cl)cc3)sc12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207962",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(NC(=O)N2C[C@H](C)O[C@H](c3ccccc3)C2)s1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129603",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)N2CCC[C@@H](OC)C2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49902",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCN(CC(C)(C)O)C(=O)Cc1nc(CCl)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131995",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CS(=O)(=O)Nc1cccc(C(=O)Nc2ccc(F)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100281",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(=O)N1CCC([NH+]2CC[C@H](c3nc4cc(F)ccc4o3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144065",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CSc1nc2ccccc2c(Nc2ccc(C(C)=O)cc2)c1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70193",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(NC(=O)C(=O)NCc2ccc(C[NH+](C)C)cc2)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56385",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(/C(C)=C/C(=O)Nc2cc(C(=O)NC3CC3)ccc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77091",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]1C[C@H]1c1ccc([C@H](O)Cc2ccc(O)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47050",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C)C(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96480",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)[C@H](Cc1ccccc1Br)[NH2+]CC1(CO)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236562",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CCO[C@H]1CCCC[C@H]1NC(=O)c1cc2c([nH]c1=O)CCCC2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCC1(c2ccc(Cl)cc2)CCOCC1)c1cccnc1N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114795",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccccc1COc1cccc(C=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31060",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1cccc(C(=O)OCC(F)(F)F)c1)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62942",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)C2CC2)cc1NC(=O)[C@@H](C)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218776",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCc1nnc(SCC(=O)Nc2c(Cl)cccc2Cl)n1-n1cccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13788",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(CCC(=O)N[C@@H](c2ccccc2)c2ccncc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10883",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1cc(S(=O)(=O)Nc2ccccc2O)c(OC)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140820",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](CO)NC(=O)N[C@H](Cc1ccccc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142414",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CCC[C@H](CC[NH+]2CCNC(=O)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99778",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NC[C@H]1C[C@@]12CCc1ccccc12)N[C@@H](CO)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72118",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C=C1CCSCC1)NNC(=O)Cc1ccsc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160845",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1cc(C(=O)N(CCc2cccs2)Cc2cccnc2)c(=O)c2ccc(C)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136004",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1ccc(-n2ccnc2)cc1)N1CCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120181",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCCN(c1ccccc1)S(=O)(=O)c1cccc2nonc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9605",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCC[NH2+]Cc1ccccc1N(C)C[C@@H]1CCC[NH+]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175587",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCCNC(=O)[C@@H]1CC(=O)N(c2cccc(Cl)c2)C1)c1ccc2[nH]ccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(S(=O)(=O)N2CC[C@@]3(CCC[NH2+]C3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221715",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(N2CCN(C(=O)COc3cccc4ccccc34)CC2)ncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246192",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)c1cccc(C(=O)O[C@H]2CCC[C@H]2OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186989",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C(CNc1ccc(Cl)c(Br)c1)Nc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166406",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2cc(NC(=O)C(=O)NCCCN3CCOCC3)ccc2o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76524",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1CCC(=O)/N=c1\\[nH]nc2cc(C)ccn12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33410",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOC(=O)c1nc2cnc(NC)nc2n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222482",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)O[C@@H]1N=C(c2ccccc2F)c2cc(Cl)ccc2-n2c1cnc2C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228301",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)c1cccc(OCc2ncc(-c3ccc(F)cc3)o2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212973",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(F)cc(N[C@]2(CO)CCC[C@H](C)[C@@H]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203251",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule N#Cc1ccc(CN2CCN(C(=O)CCNS(=O)(=O)c3ccc(F)c(Cl)c3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187260",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(NCc1ccc(Oc2cccnc2)c(F)c1)c1cc(Cl)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94184",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)[C@@H]1CCCC[C@@H]1NC(=O)CC(C)(C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35481",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N(C)C)cc1OC(=O)c1cc(F)ccc1NC(=O)[C@H]1C[C@H]1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53669",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c2ccccc2c2cc(NC(=O)c3ccnc(-n4cncn4)c3)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCc1ccc(S(=O)(=O)N[C@H](C(=O)[O-])C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122904",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C/c1cccs1)c1cccc(NC(=O)c2ccc(Cl)cc2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125723",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)N[C@@H](CC(=O)N1CCCCCC1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28732",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ncccc1CNCCC[NH+]1CCCC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(CSc2nnc(-c3ccccc3)n2N)c(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239491",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCNC(=O)Nc1ccc(OCC(=O)NCc2cc(F)ccc2F)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55537",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc([C@H]2CC(=O)NC3=C2C(=O)C[C@@H](c2ccc(C)cc2)C3)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154215",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc([C@H](C)NC(=O)c2ccc(NC(=O)C3CC3)s2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188425",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCN(C(=O)c2cc3c(-c4ccc(Cl)cc4)nn(C)c3s2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223158",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCNC(=O)N1CC[C@@H](C(=O)[O-])C1)NC1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194165",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2nn(-c3ccccc3C)cc2C[NH+](C)Cc2nccn2C)cc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171785",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=N[C@H]2C(C(=O)N3CCC(N4c5[nH+]cccc5N[C@@H]4C4CCC4)CC3)=CC=CC2=C1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63279",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@@](O)(CO)CNc1ncc(Cl)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220667",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)C1(NC(=O)[C@@H](C)Oc2ccc(C)cc2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187659",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H]1CCC[C@@H]1C[C@@H]1CCCCO1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186332",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCn1cc(C(=O)N2CCN(C(=O)CCC3CCCCC3)CC2)c2nn(-c3ccccc3)c(=O)c-2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23306",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)Cc1ccccc1NC(=O)C[C@H]1CCOc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243403",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@]1([C@@H](Br)c2ccc(Cl)cc2Cl)CCCO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198574",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N[C@@H](C)C(=O)NCc2ccccc2)nc(-c2ccncc2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66322",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[C@](C)([C@@H](O)Cc1ccc(F)cc1Cl)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc([C@H](O)C[NH2+]C2(C(N)=O)CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104450",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](C)NC(=O)C(=O)Nc2cccc(-c3nccs3)c2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H](OC(=O)c1cnn2cc(Br)cnc12)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84208",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(Cc1ccsc1)S(=O)(=O)c1ccc(F)cc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42866",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1c(CNC(=O)c2occc2Br)oc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1Nc2ccccc2/C1=C/c1cccc(C(=O)[O-])c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152682",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1S(=O)(=O)N(C)CC(=O)N1CCCCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1/C=C1\\Oc2c(ccc(O)c2CN2CCN(c3ccccc3)CC2)C1=O by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112433",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc2c(c1)CC[NH+]([C@@H]1c3ccccc3C3(CC[NH2+]CC3)[C@H]1O)C2 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60656",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=O)ccn(CC(=O)NCCc2ccc3c(c2)OCCO3)c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49935",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](c1ccc(Cl)cc1)N(C)c1cncc(C[NH3+])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23441",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1C[NH+]2CCCC[C@@H]2CN1Cc1ccc(F)cc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C[C@@H]1CCN(C(=O)Nc2cccc([N-]S(C)(=O)=O)c2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149616",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCl)c1ncc(Cl)cc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182159",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc2cc(C(=O)NNC(=O)c3ccc(Cl)nc3)oc2cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30855",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc2c(c1)CCC[C@@H]2CC(=O)N1CCN([C@H](C#N)C(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200853",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(c1cccc2c1OCC2)N1CCC(c2[nH]ncc2-c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97209",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H]1CCC[C@H](NC(=O)C[NH+](CC(=O)N2CCCC2)C[C@@H]2CCCO2)[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180005",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)CN(C)C(=O)N[C@H]1CCCN(c2ccc(C#N)cc2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213873",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C)n2c3c(=O)n(C)c(=O)n(C)c3nc2n1CC(=O)c1ccc(F)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224218",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=CCNC(=O)NC(=O)CN1CCOC[C@@H]1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127995",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](c1ccccc1)[NH+]1CC[C@H](NC(=O)c2ccc(Br)o2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234613",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1cc[nH+]c1[C@@H]1[C@@H](C(=O)[O-])CC(=O)N1CCc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C)c1NC(=O)[C@H](C)Sc1nc2ccccc2c(=O)n1Cc1ccco1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55426",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(N2CCC[C@H](Nc3nccc(OCc4ccccc4)n3)C2)cn1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11816",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1c(Br)cccc1CSCC(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116650",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)c(O)c(C(=O)Nc2cc(C(C)C)nn2-c2ncccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36922",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@H](Nc2ccc3c(c2)OCCCO3)CCCN1Cc1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25342",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(c1ccc(OC[C@@H]2CCCO2)cc1)N1CCCSc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192154",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC1=C[C@@H]([C@@H]2NN[C@H](S)N2/N=C/c2ccccc2F)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69893",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]([NH2+][C@@H](C)c1ccc2c(c1)OCCO2)C(=O)Nc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)Nc2nnc(SCC(=O)c3ccccc3)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80188",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H]1C[C@H]([NH3+])CN(CC(=O)Nc2cc(C(C)(C)C)no2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225863",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)NC1(c2noc(CCC(=O)NC(C)(C)C)n2)CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78730",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccc(C(=O)N2CC[C@@H](C)[C@@H](O)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80101",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]([NH3+])c1cccc([C@@H]2CCc3cccnc32)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106883",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(S(=O)(=O)Oc2cc(C)ccc2C)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58569",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C/[NH+]=C(/NCCc1cc(C)cc(C)c1)NCc1ncc(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2551",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCCc1cc(NC(=O)C(=O)NC[C@@H](C)c2ccc(F)c(F)c2)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168764",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H]([NH2+]Cc1cccc2c1OCO2)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188237",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])/C(=C/c1ccccc1[N+](=O)[O-])c1ccccc1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38356",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(-c2csc(CC(=O)N(C)C)n2)c(C)n1NC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10445",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCC1(CC)CCN(c2[nH+]cc(N)cc2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=C(C)C[C@@H]1CCC(=O)N1CCc1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219095",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CSc1cccc(NC(=O)CSc2nc([O-])c3c(n2)CC[NH+](Cc2ccc(F)cc2)C3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc([O-])c(/C=[NH+]/Cc2ccccc2)c1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241661",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1CCCN(C(=O)Cn2c(SC(F)F)nc3ccccc32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169735",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(CCCNC(=O)CN1CC[S@](=O)C(C)(C)C1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205043",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule N#C/C(=C/c1ccc(OCc2ccccc2F)cc1)C(=O)NCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204308",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(CN2CC(=O)N[C@@H](C)C2=O)cc(C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](C(=O)NCCc1ccco1)n1c(=O)c(C(F)(F)F)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12975",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(C(=O)c1cc(F)cc(F)c1)C1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67361",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccc(NC(=O)c2cccc(C)c2)cc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222153",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(C(=O)[C@H]1CCCN1C(=O)Cc1cccs1)C1CCS(=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](C)[NH+]1CCN(CC(=O)N[C@H]2CCCC[C@H]2C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OC(=O)c2cc(C3CC3)[nH]n2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237791",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NC(=O)CCNC(=O)N[C@@H](C)c1c(C)noc1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242972",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1/C=C/C(=O)[C@@H](C#N)c1nnc2n1CCCCC2 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75382",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(N(Cc2ccon2)Cc2ccco2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149371",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](CCO)CN1CC[NH+]2CCCC[C@@H]2C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243519",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)(C)[NH2+]C[C@H](c1ccccc1Cl)[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccccc1NC(=O)[C@@H]1Sc2nnc(C)n2N[C@@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238167",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3nc(-c4ccc5c(c4)OCO5)cs3)c2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209745",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)Nc1cccc(C(=O)N2CCCC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54609",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCCN(CC)C(=O)[C@@H]1CC(=O)N(c2ccc(NC(C)=O)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOc1c(C)cc(S(=O)(=O)NC[C@](C)(O)C2CC2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186778",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCN(CCO)C(=O)Nc1c(C)cccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248523",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccc(C(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29165",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)NCc1ccccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47558",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@H]2CN([C@@H]3CCOC3=O)CCO2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)CCNC(=O)c1cccc(S(=O)(=O)N[C@@H]2CCCNC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12742",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(N/N=C2/C(=N)[N-]N(C(C)=O)C2=N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213447",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@@]1(CO)CC[C@@H](N2C[C@H](C)OC[C@@H]2CC)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69656",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(Cc1ccc(Cl)nc1)C(=O)[C@@H]1C[C@H]2CC[C@@H]1O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220075",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C#CCN1CCC(C(=O)N2CCC[C@@H]2c2ccc(C(C)C)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144863",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@H](C)C[C@H](C)NC(=O)N[C@@H]1CCN(c2cnn(C)c2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206921",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[NH+]1CCC(CCNC(=O)N[C@@H]2CCC[C@@H]2CO)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120091",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccn(C/C=C/c2ccccc2)c(=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220800",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](NC(=O)C[C@H](NC(N)=O)c2ccccc2)c2ccccc2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)c1ccc(CNC(=O)c2cn(C[C@@H]3CCCO3)nn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184331",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOC(=O)C1CCC(Nc2ccc(Cn3cccn3)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96495",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c([C@H](C)NC(=O)C2CCOCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77395",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC[NH+](Cc1ccccc1Cl)Cn1nc(-c2ccncc2)n(C2CC2)c1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58080",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(C)c1CNC(=O)c1ccnc(OC(C)(C)C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53670",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H]1CC(=O)N(c2ccc(CN3CCOCC3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118883",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1OCC(=O)N/N=C/c1ccc(N2CCCCCC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cn1cc(I)c(=O)n(CC(=O)NC[C@H]2CCCO2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133024",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C[NH+]2CC[C@]3(CCC[NH+](CC4CCC4)C3)C2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237761",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)Sc1ccc([C@@H](C)NC(=O)[C@@H]2COCCO2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213747",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[NH2+][C@]1(CO)CC[C@@H](Sc2ccc(C(C)(C)C)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59060",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C1N=C2C=C(c3ccccc3)S[C@H]2C(=O)N1c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N1CCC[C@@H](CN2CCCc3c(F)cccc32)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41166",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(N2CCCN(c3ccc(Cl)nn3)CC2)c(C(=O)[O-])c1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@@H](CCNC(=O)c2ccccc2Cn2cncn2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43443",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1c(C[NH+]2CCn3nc(C(=O)NCCO)cc3C2)[nH]c2ccc(F)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13961",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CS(=O)(=O)N1CCN(C(=O)c2cn(Cc3ccccc3)c3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51190",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1CCC[C@@H]1NC(=O)c1cccc(Nc2cnn(C)c2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162615",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@H]1CCN(C(=O)NC[C@@H]2CCC[NH+](C)[C@@H]2c2cccs2)C[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162780",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C([O-])C1CCN(C(=O)COc2ccc(Cl)cc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCN1C(=O)S[C@H](Nc2ccccc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248776",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1c(SCC(=O)Nc2cccc3cn[nH]c23)nnc1-c1cccc(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1Cc1nnc(NC(=O)C[C@H]2C[NH2+]CCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18715",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[NH+](CC)CCn1c([C@H](C)Cl)nc2cnccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147308",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCN(Cc1ccccc1)C1(C[NH3+])CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160990",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)Cn1c(C[C@H]2CCN(C(=O)C(C)(C)C)C2)nc2cccnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54182",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc2nc(C(=O)O[C@@H](C)C(=O)Nc3cccc(C(F)(F)F)c3)cn12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158845",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)N(C[C@H]1C[C@@H]1C)C(=O)Cc1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129116",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(NC(=O)CNc2ccc(C(=O)N(C)C)c(C)c2)n(C(C)(C)C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99354",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCc1ccccn1)C(=O)c1ccccc1Br by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198542",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(c2ccccc2)C(=O)O[C@@H]2C[C@@H](Cl)CC[C@@H]12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176596",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)CN(C(=O)Cc1ccccc1Cl)c1c(N)n(CC(C)C)c(=O)[nH]c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9739",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccsc1[C@H](O)c1ccccc1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](Cc1cccc(C)n1)Cc1cc(C(=O)NN)no1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19003",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(C(=O)c1ccc(-n2nc(C)nc2C)cc1)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N2C[C@@H](C(=O)NCCS(=O)(=O)N3CCN(c4ccccc4)CC3)CC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234166",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CCn1ncc([C@H]2C(C#N)=C(N)OC3=C2C(=O)CCC3)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199887",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[NH+]1CCC(C(=O)Nc2nnc(C(F)(F)F)s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224389",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nnc3ccccn13)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213681",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H](C)NC(=O)c1cnn(-c2cccc(Cl)c2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37666",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N/C(=N\\OC(=O)c1ccc2ccccc2c1)c1ccccc1Cl by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167226",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1CNC(=O)N(C)Cc1nnc(C2CC2)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18723",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[C@@](C)([C@@H](N)c1cccc(Cl)c1)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235545",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCOC(=O)c1ccc(C[NH+]2CCCC[C@H]2[C@H](O)CC)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11017",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCC1=NN(C(=O)c2ccc(F)cc2)[C@@](O)(C(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226519",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@@H]1C[C@@H]1[N+](=O)[O-])N1CCS(=O)(=O)C[C@H]1c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCC(N(C)C(=O)CS(=O)(=O)[C@@H](C)C(C)C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163397",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CNC(=O)c1cccnc1N[C@@H]1C[C@H]2CC[C@@H]1O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62192",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C(=N/Nc1nn2cnnc2c2ccccc12)\\c1ccc(OCc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191671",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)[C@H](O)CNC(=O)NC[C@H](c1ccc(Cl)cc1)n1cccn1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105992",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)nc(N2CCC(Oc3ccnc(C(N)=O)c3)CC2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162680",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C/C(=C1\\C(=O)NC(=O)N=C1[O-])c1cc(C)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(S(=O)(=O)Nc2cc(Cl)ccc2F)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31465",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=O)c2ccccc2NC(=O)c2cc(C)n(C)n2)c(C(=O)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115675",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1ccccn1)C(=O)[C@H]1C[C@H]1c1ccc(Cl)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38832",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc([C@H](C)[NH+]2CCCC[C@@H]2[C@@H]2CCCN2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161588",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([C@H]2C(C#N)=C(N)SC(=N)[C@H]2C#N)c(C)s1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163986",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](c1cccc(C(F)(F)F)c1)[NH+]1CC[C@@H](C(=O)[O-])[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190026",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC1CC[NH+]([C@@H](C)CNC(=O)NC[C@@H](C)C[C@@H](C)O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246940",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](NC(=O)[C@@H]1Cc2cc(C)c(C)cc2O1)c1nc2ccccc2[nH]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157663",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C(C)C)c1NC(=O)c1ccc2c([O-])n(C)c(=S)nc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248167",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S1(=O)C[C@@H](OS(=O)(=O)[O-])[C@H](c2ccccc2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235145",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1CCCCN1C(=O)CNC(=O)CNC(=O)c1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](c1ccccc1)[S@@](=O)Cc1coc(-c2cccs2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174180",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)N/C(=C/c1ccccc1)C(=O)Nc1cccc(C(C)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(C(=O)NCC(=O)NCc2cnn(-c3ccccc3)c2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55190",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1c(NC(=O)c2ccccc2)cccc1N[C@H](C)C(=O)Nc1cccc(C#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Br)ccc1OCCCN1CC[NH2+]CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163836",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@@H](NC(=O)CCl)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158002",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](c1cccs1)N(C)C(=O)[C@@H]1CC[C@H](C[NH3+])O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2ccc(=O)[nH]n2)cc1S(=O)(=O)N(C)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232031",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccccc1C(=O)c1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214555",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)C(C)(C)O)cc1OC(C)C by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169319",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1cc(NC(=O)c2ccc(F)c(COC)c2)ccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184414",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccc([C@H](C)CC(=O)N2CCC[C@H](NC(=O)C(C)C)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule C[C@H](C#N)CNC(=O)c1cccc(SCC#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244557",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[S@](=O)c1ccccc1C(=O)N[C@@H](c1ccccc1)c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121984",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1cc(Cl)ccc1/N=C/c1cc(Br)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27751",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCc1ccc(C(=O)N[C@@H]2C[C@@H]3CCCc4cccc2c43)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135894",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cn1c(CCNC(=O)c2cccc(Br)c2)nc2ccccc21)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68516",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)CN2C(=O)CC3(CCCCC3)C2=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147159",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccn2c(=O)c(C(=O)Nc3ccc4c(c3)CC(=O)N4)cnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ocnc1C(=O)N[C@H](C)Cc1c(Cl)cccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101873",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)NC(=O)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211541",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NC(=S)Nc1ccccc1N1CCCC1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94853",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)N1CC[C@@H](NC(=O)N[C@@H]2CCCc3ccc(F)cc32)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90652",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)N1CCN(C(=O)N(C)C)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166381",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(C(=O)c2cc(S(C)(=O)=O)c(Cl)cc2Cl)C[C@@H](C)O1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100993",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1574",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCc1ncc(C(=O)N(C)[C@@H](C)CSCC)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178706",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)Nc1ccc(OCCC(N)=O)cc1)c1ccc(Cl)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43479",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](SCC(=O)N1CCO[C@H]2CCCC[C@@H]21)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87680",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc([C@H](C(=O)[O-])c2ccc([O-])nn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218129",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(C(c2ccccc2)c2ccccc2)c1C(=O)NN by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66432",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COC(=O)c1coc(S(=O)(=O)Nc2c(C)n[nH]c2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88368",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]1C[C@H](C)C[NH+](Cc2ccccc2CNC(=O)c2ccc(Cl)cc2[N+](=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193335",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1/C=C/C(=O)N1CCc2sccc2C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110601",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)c1ccc(N2CCN(C(=O)c3cccs3)CC2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22019",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)NCC(=O)N2CCC(C(=O)Nc3ccccc3)CC2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69119",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCN(CC1CC1)c1ccc([C@@H](C)[NH3+])c(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117552",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccnc1C[NH+](C)Cc1ccc(F)cc1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94550",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1CCCC[C@]12CC[NH2+]C[C@@H]2c1ccccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187211",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(C)C(=O)CCNC(=O)C(=O)Nc1ccnn1C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55523",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc([C@@H]2[C@@H](C(=O)Nc3cc(Cl)ccc3OC)c3ccccc3C(=O)N2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170399",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(-c2ccc(SCC(=O)NC(C)C)nn2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208777",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@H]1CCC[C@H](Nc2cccc(-c3cnco3)c2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104192",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(NC2C[C@H](C)O[C@@H](C)C2)ccc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247037",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@H](CCNC(=O)OCCO)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73247",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(Cn2c(CNC(=O)c3ccc(OC)cc3)nc3cccnc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(S(=O)(=O)NCc2nc3nc(C)cc(C)n3n2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232573",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@H]([NH2+][C@@H]1CSCC(C)(C)C1)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244818",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(N2CCN(C(=O)c3ccc(Cl)s3)CC2)cc(C)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140231",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]([NH3+])[C@@H](c1ccccc1C)N1CCO[C@H](C#N)C1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180666",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1cc(F)ccc1CCNC(=O)NC[C@@](C)(O)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128367",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=[N+]([O-])c1cccc(-c2csc(N/N=C\\c3ccccc3O)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1OCC[C@H]1C(=O)N1CCN(C(=O)c2ccccc2OC(F)F)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72252",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CS(=O)(=O)c1ccc(-n2nnnc2COc2cccc(I)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)[C@H]2CCCN(c3ccnc(-c4ccc(F)cc4)n3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85880",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C)c(-n2ccnc2SCC(=O)NCC(=O)NC2CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219869",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COC(=O)Nc1cc(NCCOc2ccc(F)cc2Cl)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226784",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H]1CN(C(=O)Nc2ccccc2S(=O)(=O)C(C)C)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166902",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc2occ(/C(C)=N/O)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179262",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@H]1C[NH+]2CCC[C@@H]2CN1c1ccc(/C(N)=N/O)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186649",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C#Cc1cccc(NC(=S)NNC(=O)CNC(=O)c2ccc(F)cc2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85716",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(NC(=O)N2CCSC(C)(C)C2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71925",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(F)c([C@@H](C)NC(=O)COC2CCCCC2)cc1OC by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167582",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(C(=O)Cn1cccc(C(F)(F)F)c1=O)C1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177720",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1n[nH]c(SCCC(=O)N(C)[C@H](C)Cc2ccsc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccccc1[C@H](C#N)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156967",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H](CC)c1nc(CC(F)(F)F)no1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65430",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cccc2c(CC(=O)N3CC[C@@H]4CC[C@H](C3)[NH+]4C)c[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245544",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)Nc2cccc(F)c2)CC[C@@H]1[NH3+] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191386",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@H]1Cc2ccccc2O1)N1CCN([C@@H]2CCS(=O)(=O)C2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208440",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)c1c(NC(=O)C(C)C)sc(C(=O)Nc2cccc(C)c2C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56969",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1c(C[NH2+][C@@H](C)c2ccc(Cl)s2)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10423",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cc([C@H]2CCCN2C(=O)c2ccc(F)cc2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100891",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)c1sc2cccc(F)c2c1CSc1nnnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5312",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](C(=O)OC)N(C(=O)c1ccnc(Cl)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161052",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CN(S(=O)(=O)c2ccc(-c3ccc(=O)[nH]n3)s2)c2ccccc2N1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57193",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule N/C(CSc1ccccc1[N+](=O)[O-])=N\\O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)(C)C(=O)NNC(=O)NCc1cccc([N+]2=CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239155",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cc(=O)[nH]c(-c2cccc(NC(=O)c3ccc4cc[nH]c4c3)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59316",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C#CCOc1ccc(F)cc1NC(=O)N[C@H]1CCCC[C@H]1[S@](=O)CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93139",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1cccc(COc2cccc3c2CC[C@H]3O)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241577",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)[C@@H]1CC(=O)N(Cc2ccc3ccccc3c2)C12CC[NH+](Cc1ccco1)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212145",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](Cc1ccccn1)NC(=O)CN1C(=O)[C@H]2CC[C@@](C)(C1=O)C2(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12418",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CNC(=O)c2cnc([C@H]3CCCO3)s2)c1O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57272",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(OC(=O)C=C2CCSCC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65014",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1ccc(NC(=O)CN2C(=O)c3cccc4cccc2c34)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19949",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(N2C(=O)S/C(=C/c3ccc(-c4ccccc4[N+](=O)[O-])o3)C2=O)cc1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198989",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule [NH3+][C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C(C)C)c(C)c1CN(C)C(=O)C[C@@H]1C(=O)NCC[NH+]1CC(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123383",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[C@](C)([C@@H](O)c1cnccn1)[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@@H](C)C(=O)NC[C@@H](C)Oc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100643",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Nc1nccc(Oc2ccc(F)cc2)n1)c1cccc(S(N)(=O)=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66696",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(CNc2ncnc3sccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184231",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)C1CCC(=CC(=O)NC[C@@H]2CCCN(c3ncccn3)C2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161712",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1cccc(NC(=O)c2[nH]c3ccc(Cl)cc3c2Cl)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145214",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCCN1C(=O)c1cc(C(F)(F)F)ccc1NN by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180853",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CN2CCO[C@@H](CO)C2)cc1[N+](=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212008",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(c1cccc(Br)c1)N1CCN(C(=O)N2CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98857",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Oc1ccccc1/C=N/N1C(=S)[NH+]=N[C@@H]1c1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39204",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)NCC(C)(C)[C@H](O)c1ccccc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183977",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCCn1nnnc1C[NH+]1[C@H]2CCC[C@@H]1CC(NC(C)=O)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220644",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2NC(=O)C3=NN=C(c4ccc(C)cc4)[C@H]32)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191843",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCC1CCC(C[NH3+])([C@@H](O)c2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2sc([C@@H](c3ccccc3Cl)N(C)Cc3ccccc3)c([O-])n2n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2C(=O)C[C@H]([C@@H]3C(=O)N(c4ccccc4)N=C3C)C2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69428",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule FC(F)Oc1ccc(N2CCCC3(C2)OCCO3)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187779",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCC(=O)N1CCC[C@@H](C(=O)NC(C)(C)c2nc(C)c(C)s2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203945",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@H]1CC=CCC1)N[C@@H]1CCCN(c2ccccc2)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8456",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1-c1nnc(S[C@@H](C)C(=O)Nc2ccccc2C)n1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8853",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c(SCC(=O)NCC(=O)N(C)C)nc1Cc1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164056",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cc(Cl)ccc1Nc1ncnc(NCc2cccnc2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136596",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(-c2noc(CCC(=O)N(C)Cc3ccccc3F)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88420",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccccc1NC(=O)NCCCc1nnc2n1CCCCC2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110252",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@]1(F)CCN(S(=O)(=O)c2c(F)cccc2F)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129658",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C([O-])CCC[NH+]1CCC[C@]2(CCC(=O)N(CCc3ccccc3)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111997",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cncc(C(=O)O[C@H](Cn2cncn2)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10366",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(N2C(=O)C([O-])=C(C(=O)c3ccccc3)[C@@H]2c2cccc(Cl)c2)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158272",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)N1CCCCCC1)S(=O)(=O)c1ccccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6777",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H]1C[C@H](c2ccccc2)Nc2ncnn21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)c1cc(-c2ccc(Br)cc2)n[nH]1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140963",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@H](CNC(=O)N(C)Cc1ncnn1C)[NH+]1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40106",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(C)n(-c2ccc(C(=O)NCc3cscn3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100632",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC(=O)N[C@H](C)c1nc2ccccc2n1Cc1c(C)cc(C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159225",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]([NH2+][C@H](C)CC1CCOCC1)c1cc(F)ccc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140807",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccccc1F)[C@@H]1CSCN1C(=O)C=C1CCSCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115232",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(C(O)(C(=O)Nc2ccccn2)c2ccc(C)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211028",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CC(C(=O)N[C@@H]2CC(=O)N(C)[C@@H]2c2ccc(Cl)cc2)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15127",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)C(=O)N1CCN(C(=O)Nc2cccc(OC3CCCC3)c2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41658",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)COC(=O)c1ccccc1SCC(=O)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103871",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCN(Cc1ccc(Cl)s1)C(=O)NC[C@H]1CCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1NC1CCN(C(=O)C(=O)Nc2ccc(C)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57860",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@@H]1Cc2ccccc2N1CCNC(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67539",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule c1ccc2c3c([nH]c2c1)CC[C@H](N[C@@H]1CC[NH+](C2CCCC2)C1)C3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CO[C@H](C)C(=O)N1CCN(C(=O)Cc2c[nH]c3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9779",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(CCCn1ccnn1)N1CCN(Cc2noc(-c3cccs3)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CNC(=O)c1cccc(NCc2cn(-c3ccccc3)nc2C(C)C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13636",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN1CCC/C1=N\\S(=O)(=O)c1cccc(NC(=O)CCn2cnc3ccccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146459",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1cc(-c2ccco2)ccc1F)c1cn2cccnc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93382",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cc2ccccc2o1)C(=O)c1ccc(-c2cscn2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213076",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnsc1C(=O)N/N=C/c1ccc([N+](=O)[O-])s1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38249",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)cc(N2CCN(C(=O)[C@@H]3CN(C)C(=O)N3)CC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194287",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Oc1ccc(-n2cnnn2)cc1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(C)c1cccc(C(=O)Nn2cnc3ccccc3c2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200299",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1cccc(OC[C@@H](O)CN2CCN(c3cc(Cl)ccc3C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23258",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(C)c1ccc(-c2nnn(CC(=O)N3CCCCCC3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11793",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)CCC(=O)NCc2ccc(N3CCOCC3)[nH+]c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108754",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](CN(C)C(=O)N[C@@H]1CC[NH+](C2CCCC2)C1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241223",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(Cc2nnc(NC(=O)[C@H]3CCCCN3S(=O)(=O)c3cccs3)o2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@H]1N1C(=O)C(=O)N(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211619",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=C/C(=O)N[C@H](C)C(=O)N[C@H]2[C@@H]3CCO[C@@H]3C2(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93549",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccccc1[C@@H](NS(=O)(=O)C[C@@H]1CCOC1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccccc1NC(=O)[C@@H]1C[C@@H]2C=C[C@H]1C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107710",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C/C=C/C=C/C(=O)Nc1ccnn1Cc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc(OCC(=O)NC(=S)Nc2cccc(C(=O)[O-])c2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65808",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH2+]CCSCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217862",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)N(C)C(=O)N[C@@H](C)c1c(Cl)ccc(F)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184235",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc2c(c1)COCO2)N1CCCC[C@H]1CCO by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132484",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nc(-c2ccc(N3CCN(C(=O)Cc4noc5ccccc45)CC3)[nH+]c2)no1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113473",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](Cc1cccs1)N(C)S(=O)(=O)c1ccc(O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189828",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@@H]2SCC(=O)Nc3c2c(C)nn3-c2nc3ccccc3s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229882",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Cc1ccccc1C(F)(F)F)N[C@@H](CO)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224675",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(-n2ncc3c(=O)n4c(nc32)SC[C@@H]4CC(=O)NCCCn2ccnc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)[C@H]1CCC[NH+](CC(=O)Nc2ccccc2Oc2ccccc2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64114",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1occc1-c1nnc(SCC(=O)Nc2ccccc2Cl)n1C[C@H]1CCCO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33883",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CC(=O)N(CC(C)(C)C(=O)NN)CC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176031",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=O)/c(=C\\c2ccsc2)s/c1=C(\\C#N)C(=O)c1ccccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44981",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C[C@@H](C[NH3+])c1ccccc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76354",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCc1ccc(F)c(Cl)c1)NC[C@@H]1CCCN(c2ncccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc(CN2CC[C@@H](c3nc(-c4ccncc4)no3)C2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96882",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC1CCC(N2C[C@@H](C(=O)N[C@H](CO)c3ccco3)CC2=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94261",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH+](Cc1nccn1Cc1ccccc1)[C@H]1CCCC[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1CCC(NC(=O)C(=O)Nc2ccccc2C[NH+]2CCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58292",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1c(CCC(=O)N(C)[C@H](C)Cc2ccc(O)cc2)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-n2c(C)cc(/C=C/C(=O)Nc3cccc(C(N)=O)c3)c2C)no1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@H]([C@H](O)C2(C#N)CCC2)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74660",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc2nc(C(=O)N3CCC[C@@H](C(=O)[O-])C3)cn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102177",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1CC[NH2+]C[C@H](C#N)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246363",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc([C@@H]2SCC(=O)N2c2ccccc2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62029",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C#CC[NH2+]CC(=O)Nc1ccc(F)cc1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10329",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(NC(=O)[C@H]2CSCN2C(=O)CC(C)(C)C)ccc1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175396",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)[NH2+]Cc1ccc(-c2ccccc2)o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189172",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc(N2C(=O)N(Cc3cccc(Cl)c3)[C@H]3CS(=O)(=O)C[C@H]32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148253",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC(C)(C)NC(=O)[C@H](C)[S@@](=O)Cc1ccc(C(=O)NC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58240",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)C[NH+]1CCn2nc(CNC(=O)Cc3csc4[n+]3CCN4)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH2+]=c1oc2ccc(Cl)cc2cc1C(=O)Nc1ccc(Cl)cc1Cl by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171694",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Cc1nnc(NC(=O)Nc2ccccc2)s1)N/N=C/c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206565",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NCCC(=O)N1CCN(C[C@H]2CCCO2)CC1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130365",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H](c1ccc2c(c1)OCO2)N1CCOCC1)C(=O)Nc1ccccc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)[C@@H](CO)NC(=O)NCc1ccccc1OC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139730",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCn1nc(C)c(CN2CC[NH+](Cc3ccccc3)C[C@H]2C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145611",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(OC)c([C@H]2CCC[NH+]2[C@H](C)C(=O)Nc2ccc(C(C)=O)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205308",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-n2nc(C(=O)N3CCC([C@@H](C)O)CC3)cc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50236",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)C1CCN(C(=O)C2(c3cc(-c4ccc(Cl)cc4)on3)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198714",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nn(C(C)C)c(C)c1NC(=O)[C@H]1CCCN(c2ncccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202409",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)c1ccn(C[C@H](C)C(N)=O)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94743",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)c1ccc2nc([N-]S(=O)(=O)c3ccc(I)cc3)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[C@@H](O)C[NH+](Cc1ccco1)C[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82248",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2ccc(C(=O)[O-])c(N)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCSc1nc2ccccc2s1)Nc1ccc2oc(=O)[nH]c2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17260",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(C(=O)NCc2ccccc2OCC(C)C)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227098",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nc2ccccc2n1CCNC(=O)c1cc(Cl)cc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175173",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C([O-])[C@H]1CC=CC[C@H]1C(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137241",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCCN(C(=O)Cn1nc2ccccn2c1=O)[C@@H](C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224488",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNc1ccc(C(F)(F)F)cc1Cl)NC(=O)NC1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191067",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)[C@]12C(=C(c3ccccc3)O[C@@H]3C=CCC[C@H]31)C(=O)C(=O)N2c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9096",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(C)c1NC(=O)C[NH2+][C@H](C)Cn1cnc(C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54463",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc([N+](=O)[O-])o1)N(Cc1ccccn1)c1ccc(F)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77400",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)C1=C(C)Nc2[nH]c(=S)[nH]c(=O)c2[C@H]1c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133004",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1cc(C[NH+]2CCC([C@H](O)c3nccn3C)CC2)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94170",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc2c(-c3cccs3)nc(=O)n(Cc3ccc(Cl)cc3Cl)c2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95953",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)N(Cc1ccccc1F)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167181",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)Nc1cccc(-n2c(C)nn(C[C@H](O)c3ccccc3)c2=S)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108174",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(C(=O)c2ccc(F)cc2)cc1OCC by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C)c(C)c([C@@H]([NH3+])CO)c(C)c1C by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54995",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1cccc([N+](=O)[O-])c1)N1CCN=C1SCc1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174962",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc(C(=O)N2CCN(C(=O)CCc3cccnc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(N1CCC(NS(=O)(=O)c2ccc(Cl)cc2)CC1)C1(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239527",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Cc1ccc(NCc2ccc(C3CC3)cc2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156628",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule Cc1cccc(C)c1OCC(=O)[C@H](C#N)c1nnc(-c2ccccc2)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83277",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(S(=O)(=O)Nc2ccc3c(c2)N(CC(C)C)C(=O)C(C)(C)CO3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCn1cc(Br)c(CN(C)S(=O)(=O)c2cnn(CC)c2C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34754",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](Cc1ccccc1F)C(=O)N[C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48985",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](CSC)NC(=O)NCCc1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39577",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)n(-c2ccc(C(=O)N(C)[C@@H]3CCC[C@H](C)C3)cn2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36877",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(NC(=O)c2cccc(NC(=O)c3ccco3)c2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165531",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NC(=O)Cc2csc(COc3cccc(C)c3)n2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81436",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCC(CC)S(=O)(=O)/N=C(\\[O-])c1ccc(N2CCOCC2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55864",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)NC(=O)c1cccc2c1NC(=O)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34252",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)C1CCN([C@H]2CS(=O)(=O)C[C@@H]2S(=O)(=O)c2ccc(OC)c(C)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231875",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1-n1ccc2nc(N3CCCCC3)ncc2c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NC[C@@H]1CCN(c2ccc(F)c(F)c2)C1)N1CCC2(CC1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70297",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cnc(C(=O)NCc2cnn(Cc3ccccc3)c2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20542",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)CCc1nc(-c2ccccn2)no1)c1ccc2c(c1)CCCO2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218115",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)[C@@H](NC(=O)/C=C/c1csc(C)n1)C(=O)[O-] by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225473",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccc[nH+]c1N1CCN(C(=O)C[NH+]2CCC[C@H](O)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule FC(F)(F)c1ccccc1N[C@H]1CCO[C@]2(CCSC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72539",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2nnsc2C(=O)Nc2ccc(Br)cc2F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccccc1NC(=O)NC[C@H](O)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137755",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cl)cc1NC(=O)c1ccc(-n2ccnc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246819",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C(=O)Nc2nnc(C3CCCCC3)s2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169121",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(c1nc2ccc([N+](=O)[O-])cc2o1)[C@@H]1CC[NH2+]C1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89966",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccccc1N1CC[NH+](C/C=C\\c2ccc3c(c2)CCC(=O)N3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167311",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)NC(=O)N(CC(=O)NCCc2nc3ccccc3[nH]2)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151009",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)CN2CC[NH+]([C@@H]3CC[C@H](CC)C3)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164175",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(NC(=O)Nc2ccccc2)c2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CC(Nc2cccc(Oc3cnccn3)c2)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(c1ccccc1[C@H](C)[NH3+])C(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107109",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NC12C[C@H]3C[C@@H](C1)CC(C(=O)NCCCC1CCCC1)(C3)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62605",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC1(C)S[C@@H](c2ncc(-c3cccs3)s2)N[C@@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NCC[C@H]1CCCO1)c1ccc(Cl)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181279",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN1C(=O)c2ccc(Cl)cc2N[C@@H]1c1ccccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144154",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[NH+]1CCN(C(=O)c2ccccc2NC(=S)NC(=O)c2ccco2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26350",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@H]1C[C@H](N)C[NH+](Cc2nnc(C(C)(C)C)o2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184584",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1[nH]c(-c2ccc(Oc3ccccc3)cc2)cc1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97804",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cc2c(c(=O)n1CCc1ccccc1)[C@H](c1ccc([N+](=O)[O-])o1)C(C#N)=C(N)O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74158",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1cccc(NC(=O)N[C@@H](C)c2ccc(C)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84716",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccnc(NC(=O)[C@]2(C)CC2(Cl)Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151627",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]([NH3+])c1cc(F)ccc1OCC[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155885",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1OCC[C@@H]1Nc1ccc(OC(F)F)cn1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105199",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CCn1ccc2c(Cl)cccc21)NCc1nnc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66983",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1C[NH+](Cc2ccccc2)CCCN1C(=O)CCn1ccccc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11089",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccccc1C(=O)OCCn1c(N)c(S(=O)(=O)c2ccccc2)c2nc3ccccc3nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210144",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COC[C@@H](N[C@H](C)c1nc2c(s1)CCCC2)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2c(-c3nn(C)c4ncnc(N5CC[C@H]([NH+]6CCCCC6)C5)c34)cnn2C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84521",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc([C@@H]2OC(=O)N(C)[C@@]2(O)c2ccc(OC)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192188",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](NC(=O)CC[C@H]1CCCOC1)c1cccc([N+](=O)[O-])c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113395",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)C(=O)NC[C@H](c2cccn2C)[NH+](C)C)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233028",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H](Sc1nccn1C)C(=O)Nc1ccc(OC(F)F)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158958",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1csc(CN2CCN(C(=O)/C=C/c3ccc4c(c3)OCO4)CC2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96852",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Nc1ccccc1NC(=O)N[C@H]1CCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68702",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccccc1/C=C/C(=O)N1CCC(NS(C)(=O)=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71723",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@]2(C)NC(=O)N(CC(=O)N(C3CCCC3)[C@@H]3CCS(=O)(=O)C3)C2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1c(Cl)cccc1Cl)C[C@@H]1C[C@H]2CC[C@@H]1C2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145879",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(F)c(NC(=O)NCc2ccc3c(c2)CCC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91508",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule S=C(CC12CC3CC(CC(C3)C1)C2)N1CCN(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248955",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1S(=O)(=O)Nc1cccc(-c2ccc(=O)n(C)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248337",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=c1c2cc([N+](=O)[O-])ccc2ncn1Cc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115988",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccccc1-c1ccccc1)N1CCC[NH+](C[C@H]2CCCO2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)[C@@H](C)S(=O)(=O)[C@@H](C)C(C)C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule N#CCNC(=O)C[NH+]1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109839",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)c1c(C)nc(Nc2nc3ccccc3o2)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150489",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(Br)c(N)c(C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)c2ccccc2C)c(Nc2ccco2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144011",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(N2CC[C@H](NC(=O)c3cc(F)ccc3F)C2=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57009",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24225",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(NC(=O)c2cc(=O)c3ccccc3o2)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121713",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2044",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](NC(=O)Nc1ccn(C)n1)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101555",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cccc(N2C(=O)[C@@H]3[C@H](c4ccccc4)OC4(C(=O)c5ccccc5C4=O)[C@@H]3C2=O)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48932",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(C#N)ccc1OCC(=O)Nc1ccc(C(C)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229011",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc([C@@H](Cl)[C@H](C)c2ccccn2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156761",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N=[S@](N)c1cnc(N)s1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52847",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNc1ccc([N+](=O)[O-])c(N)n1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30339",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Nc1ccc(F)cc1NC(=O)COCc1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158546",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CC[NH+](CCNC(=O)C(=O)Nc2cc(F)cc(F)c2)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192015",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)ccc1CCNC(=O)NCCCn1nc2n(c1=O)CCCC2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125566",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1OC(=O)CCc1c(C)nc(-c2cccnc2)[nH]c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122996",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@@H]2NC(=O)N(C)[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2cccs2)cc(OC)c1OC by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101683",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccnc1)C(F)(F)F by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188342",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1c(SCC(=O)Nc2ccc3c(c2)OCCO3)nc2c([nH]c3ccccc32)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Oc1ccc(-c2nc3ccccc3s2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66973",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc(C(=O)N2CC[C@H](C(=O)[O-])[C@@H]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cn(-c2ccccc2Cl)nc1NC(=O)C(=O)NCCCC(C)(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204060",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NC1CCN(c2ncc(Cl)cc2F)CC1)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119770",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc([C@H]2C[C@H]2C(=O)Oc2cccc(-n3cccn3)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4401",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)cc(C(=O)N(Cc1ccccn1)C1CCCCC1)n2C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133645",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)N[C@H]3CCCC[C@H]3C)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176505",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(N2CCN([C@H](c3ccccc3F)c3nnnn3C3CCCCC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177509",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)c2cccc(NC(=O)C(C)(C)C)c2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108441",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a aldehyde from the molecule CC/C(C=O)=C\\C1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92852",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1575",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCN1C(N)=[NH+]C[C@@]1(C)c1ccc2cc(OC)ccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30720",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(=O)C(=O)N2CCOCC[C@H]2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204412",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOc1ccc(CC(=O)Nc2ccc(S(N)(=O)=O)c(C)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H]1SC2=NC(C)=C(C(=O)OCC(C)C)[C@H](c3ccc(OC)cc3)N2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48714",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)cc1)c1ccc(-c2ccccc2[N+](=O)[O-])o1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212527",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2c(sc3nc(-c4ccccc4)ccc32)c(=O)n1CC(=O)NCc1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc(NC(=O)[C@@H]2CC(=O)N(C)C2)c(OC)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45558",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nc(C(=O)N(C)Cc2ccc(C(F)(F)F)cc2)nn1-c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247821",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Cc1ccc(F)cc1)Nc1cccc(-c2cn3c(C(=O)N4CCOCC4)csc3n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197053",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)N[C@H](c1nccs1)C1CCN(C(=O)c2c(C(C)C)noc2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51403",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnn([C@@H]2CCCN(C(=O)CN3C(=O)CNC3=O)C2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234246",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)CCO[C@@H]1CCN(C(=O)[C@H](C)NC(=O)c2ccc(Cl)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cnn(-c2ccccc2F)c1)N1CCSCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94932",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@@H]1CCCN(Cc2cc(C(N)=O)cs2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35884",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](C(=O)Nc1ccc(Br)cc1Br)[NH+](C)C[C@@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129183",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1)C(=O)Nc1cc(-n2cccc2)ccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36008",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(c2cncc(C(N)=O)n2)CCO1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193161",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(F)c(NC(=O)C(=O)NCCN(C)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209011",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=CCn1c(=O)c2c(nc3n2CCN3c2ccc(CC)cc2)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26521",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(C2=C[C@H]([C@H]3NN[C@H](SCC(=O)Nc4cccc(C(F)(F)F)c4)N3N)N=N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154525",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCC[NH2+]CC[NH+](C)CC(C)(C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3056",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC1(C)C[C@](O)([C@@H]2CCOC3(CCC3)C2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)C1CCN(CCC[NH2+]Cc2ccc3ccccc3c2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65375",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NS(=O)(=O)c1cccc(F)c1)C(=O)N1CCCC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231713",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOC(=O)NC1=c2c(OC)cccc2=[NH+][C@H]1C(=O)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16480",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccccc1N1C[C@H](C(=O)NC[C@@H](C)Cn2cccn2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@H](c1cccc(F)c1)[C@@H]1CCOC2(CCC2)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(S(=O)(=O)/N=C(\\[O-])CCn2cc(C)cn2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](CC1CCCC1)C(=O)Nc1cc(C(=O)N(C)C)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114051",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c(N2CCN(CC(=O)NCc3c(F)cccc3F)C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241547",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOc1ccccc1[C@H]1C2=C(CCCC2=O)Nc2onc(C)c21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220034",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(F)cc(Nc2c(N)ccc(F)c2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72735",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH+](C)C[C@H](Cc1ccccc1)NC(=O)[C@H]1CCC[NH+](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98798",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC1(C)CC(NC(=O)NC[C@@H]2CCC[C@@H](O)C2)CC(C)(C)[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142178",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nn(C)c(Cl)c1[C@@H]1CCC[NH+]1CCCS(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9647",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc2cc(NC(=O)c3ccccc3)c(=O)oc12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81314",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(O[C@H](c1ccccc1)c1nccs1)c1cccc2c1OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53179",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@H](NC(=O)c1cc(C(N)=O)cn1C)c1nnc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168894",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1c(CC(=O)Nc2ccccc2F)n[nH]c1=S by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99121",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)C[NH2+]Cc1ncoc1-c1ccc(C(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218110",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)Nc1cccc(C(F)(F)F)c1)N1CC[NH+](C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)c1ccc(NC(=O)CN2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@H]3[C@@H]3C[C@H]23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C(NNS(=O)(=O)c1ccc2c(c1)CCC2)c1ccc2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176026",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[C@@H](CSC)N(C)C(=O)N[C@H]1CCCc2ccc(F)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(Cc1ccc(F)cc1F)C(=O)Cc1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194305",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C([C@H]1Cc2ccccc2S1)N1C[C@H]2C[NH2+]C[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207999",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@]2(C)NC(=O)N(CC(=O)NCc3ccco3)C2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104866",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1-c1noc(C2CCN(S(=O)(=O)c3cccs3)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231401",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cccc(C(=O)N[C@H]2CCC[C@@H]2C(=O)OC)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8638",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Clc1cc2c(cc1NCc1nc3c(s1)CCC3)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63052",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc([C@@H]2NC(=O)c3cccnc3N2)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2803",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C1NC2(CCCC2)C(=O)N1C[C@H](O)c1ccccc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216816",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cscc1C(=O)Cc1ccc(I)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115691",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1cc(CCC(=O)Nc2cc(-c3ccncc3)n[nH]2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22335",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(CC(=O)N1C[C@H](C)O[C@H](C)C1)c1ccc(F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CNC(=O)c1cccc(NCc2cn(C)nc2-c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOc1ncccc1C(=O)Nc1cc(F)c(N(C)C)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127504",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@@](C)(NC(=O)c1cc(C)c(Br)s1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232990",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccc(C(=O)Nc2ccc(Cl)cc2N)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123613",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(S(=O)(=O)N[C@@H](c2ccccc2F)c2nccn2C)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208801",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)N(C)C)c(C(=O)Nc2cccc(F)c2C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24096",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(O[C@@H](C(=O)NC1CC1)c1ccccc1)[C@H]1CC(=O)N(c2ccccc2F)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137950",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1ccc(NC(=O)CN2C(=O)N[C@]3(CCCc4ccccc43)C2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92831",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@H]1CCCC[C@H]1NC(=O)C(=O)Nc1cccc2cccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34984",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCS(=O)(=O)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)c1ccc(CNC(=O)Nc2ccc(-c3csc(C)n3)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52702",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(CNS(C)(=O)=O)c(OC(C)(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196840",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CSc1cccc(NC(=O)Cc2c(C)nc3cc(-c4ccccc4)nn3c2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154802",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1OCC[C@H]1C(=O)N1CCCC[C@@H]1C[NH+](C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80594",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COC(=O)C[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186201",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]([NH3+])C(=O)NCC1C(C)(C)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229585",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)N2CCN(c3nc4c(C)cccc4s3)CC2)c(OC)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230439",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCN(Cc1cccc(C)n1)C[C@H](Br)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13551",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(OCc2ccccc2)nc(N2CCN(c3ccccc3)CC2)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80605",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(-c2nnc(SCC(=O)Nc3nc(C)cs3)n2N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151885",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc([C@H](C)NC(=O)c2cc(C)c(C#CCN)s2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137107",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](c1ncc(Cl)cc1Cl)[C@H](C)[NH3+] by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc([N-]S(=O)(=O)[C@H]2C(C)=NC(C)=C2C(=O)N2CCCCC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN1C[C@H](C(=O)Nc2cccnc2-n2cccn2)CC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71540",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1cc(F)cc2c1OCOC2)NC[C@@H]1CCCO1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220352",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN1CCCCC/C1=N\\S(=O)(=O)c1cccc(NC(=O)C2(C)CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccccc1-n1cnnn1)n1nnc(-c2ccccc2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182228",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCC(C)(CC)NC(=O)Nc1ccc(C(=O)NCC(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72311",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1cc(F)ccc1Cl)[C@@H]1CCCCN1C(=O)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149447",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCNC(=O)C1CC[NH+](CCC(=O)Nc2ccc(Cl)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27234",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1CCC[C@@H](NC(=O)COCC(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)Cn1ccnc(N[C@@H]2CCO[C@@H]2c2ccc(Cl)cc2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98029",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Nc1cnn(-c2ccc(C(=O)N[C@@H]3CCC[NH+](Cc4ccccc4)C3)cc2)c1)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91605",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=S1(=O)c2cccc3cccc(c23)N1C[C@@H](O)COc1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47351",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=C(c1ccc([N+](=O)[O-])o1)N1CCC(c2nc3ccccc3o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128315",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)C(/C=N\\O)=N\\Nc2ccc(F)cc2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC1(C)C[C@]2(C[C@H](c3ccccc3)Oc3cc(O)ccc32)[NH+]=C([S-])N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54928",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)c1ccc(F)c(NCc2cc(C(N)=O)cs2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237718",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Cn1nc(-c2ccc(F)cc2)oc1=O)OCc1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53927",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1[nH+]c([C@H]2CCCCN2C(=O)Cc2ccccn2)nc2c1CCCN2Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207805",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H]1OCC[C@H]1C(=O)N(CC(=O)N1CCCC1)C[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159281",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ccc(F)cc1)NCc1n[nH]c(=O)c2ccccc12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180179",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule CNc1cc(CN(C)C[C@@H]2CC[NH+](C)C2)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146804",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C=C(C)CN(CC)C(=O)CS(=O)(=O)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccccc2C#N)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155185",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(-c2noc(-c3cccc(NC(=O)C4CC4)c3)n2)nc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101186",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+]CCN1C(=O)CCC1=O)c1cccc(-c2ccccc2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116057",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule c1cc2c(cc1NC1=[N+]3CCCC[C@@H]3CS1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nnc(S[C@@H](C)C(=O)N(C)c2ccccc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8229",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(=O)Nc1cc(NC(=O)N[C@@H]2CC=CCC2)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86280",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(/C=C/c1ccc(Br)o1)NCCC1=CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56170",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCc1ccc(C(=O)N[C@@H]2C[C@H]3C[C@@H]2[C@H]2CCC[C@@H]23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221493",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](NC(=O)c1nc(Cl)ccc1Cl)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30916",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(CC(=O)N2CC[C@@H]3[C@@H](CCC[NH+]3Cc3ccccc3)C2)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245936",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCCN(C(=O)[C@H](C)[NH+]1CCC[C@H](O)C1)[C@@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCS(=O)(=O)CC(=O)Nc1c(C)cccc1C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16370",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H]1CN(c2ccc(CCl)cc2F)C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207588",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Nc1cc(N)nc(SCc2cc(-c3cccs3)on2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141555",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[NH+](Cc1ccc(Oc2ncccn2)cc1)[C@H]1CS(=O)(=O)C[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104518",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC(=O)Nc1nonc1-c1nc2ccccc2n1Cc1cc(OC)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126475",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[NH+]1CCC[C@H](NC(=O)[C@@H]2CCC[NH2+][C@@H]2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1NC(=O)c1c([O-])c2sccc2n(Cc2ccccc2)c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195974",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCOCC(=O)Nc1ccc2c(c1)OCCO2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6766",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule N#Cc1csc(C(=O)N2C[C@H]3CC=CC[C@@H]3C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73039",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCl)N1N=C(c2cccs2)C[C@@H]1c1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccnc(Oc2ccc(F)cc2)c1)N[C@@H]1CCCC[C@@H]1CO by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47134",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(/N=C2/CC(=O)C(=O)c3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184568",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCc1nnc2sc(-c3ccc(CNC(=S)NC(=O)c4ccc(F)cc4)cc3)nn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)[C@H](O)[C@H]1CCO[C@]2(CCOC2)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238818",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(N[C@@H](C(=O)NCCN1CCOCC1)C12CC3CC(CC(C3)C1)C2)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144915",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C(NNc1nc(-c2ccncc2)no1)Nc1cnc(C2CC2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154888",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule O=C(COc1ccc(Br)cc1)N1CCC[C@@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102234",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(/C=N/NC(=O)C(=O)Nc2ccccc2Cl)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200028",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1cccc(CNC(=O)[C@@H]2COc3ccccc3O2)c1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64683",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCO[C@@H]1C[C@@H]([O-])C12CCN(C(=O)c1cnc3c(C)cccn3c1=O)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75899",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CN[C@]1(C#N)CCC[C@@H]1CC[NH+]1CC[C@@H]2CCCC[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152411",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]([NH2+][C@@H]1c2cccc(F)c2CC[C@@H]1C)c1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132417",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H](C(N)=O)[NH+]1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194995",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1ccc(Cl)cc1[C@H](O)[C@H]1CSCCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70787",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCn1c(SCC(=O)N[C@@H]2CCCC[C@H]2C)nc2ncccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120334",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)c1ccc(N2CCO[C@@H](c3ccc(F)c(Cl)c3)C2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196649",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)Nc1ccc(NS(=O)(=O)c2cc(C)ccc2F)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118964",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)c1ccc(N[C@H]2CCCC[C@H]2C)c([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38820",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(CCN1CCOCC1)C(=O)CCc1ncc(-c2ccccc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70715",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[C@@](C#N)(NC2CCCC2)C(C)(C)O1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172041",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C1(NC(=O)c2cc3cc(C)ccc3o2)CCSCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88381",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(C[NH+]2CCC[C@H](N3CCCC3=O)C2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10606",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H](c1cccnc1)C(F)(F)F)c1cnn(-c2nccc(-c3ccco3)n2)c1C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212892",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1=C(C(=O)Nc2ccccc2C)C2(CCCCC2)[C@H](C(N)=O)C(=O)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCCCCC[C@@H](O)[C@H]1CCc2cccnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN[C@]1(C#N)CCC[C@H]1CCOc1ccccc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143677",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1nc(N2CC[C@@H](OCCCc3ccccc3)C2)ncc1[N+](=O)[O-] by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224917",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H](NC(=O)c2cccc(OC)n2)c2nccn2C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239462",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(OCCc2ccccc2)nc1)C(=O)N[C@@H]1CC=CCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46292",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc2[nH+]c(N3CCC(C(=O)NCCC[NH+]4CCN(c5ccc(F)cc5)CC4)CC3)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)C(=O)NCCC[NH2+][C@@H]1CCc2c(F)cc(Br)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154188",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(NC(=O)C[C@@H](NC(N)=O)c2ccccc2)cc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1Cc2cc(C(=O)N3CCn4c(nnc4C4CC[NH+](C)CC4)C3)ccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232520",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(CN(C)C(=O)CSCc2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194565",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccco1)N(CCN1CCOCC1)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243451",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1COCCN1C(=O)[C@@H]1CC(=O)N(c2cc(OC)c(OC)c(OC)c2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83226",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)CSc2nc3ccccc3nc2N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233934",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@H]1NC(=O)C[NH+]1CCc2nc(N3CCCC3)[nH]c(=O)c2C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)n1nccc1NC(=O)C(=O)N1CCc2cc(F)ccc2C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "801",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cc1cccs1)N1CCc2nocc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122701",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(CC(=O)Nc2ccc3c(c2)CN(CCc2ccc(F)cc2)C(=O)[C@H](C)O3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204458",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2CC(=O)Nc3c2c([O-])nc2nc4ccccc4n32)cc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220493",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(Cc1ccc(N(C)C)cc1)C(=O)c1cccc(-n2cnnn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23002",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CCNC(=O)c2sc(-c3c(F)cccc3OC)nc2C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191351",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nnc(-c2cc(S(=O)(=O)N3CCN(c4cc(Cl)ccc4C)CC3)c[nH]2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@]1(C(=O)N[C@H]2CCN(c3ccccc3)C2=O)Cc2ccccc2C(=O)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170463",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(/C=C/c2ccnc(NS(=O)(=O)c3ccc(N)cc3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70807",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCCN(Cc1ccoc1)C(=O)c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66073",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc([C@H]2[C@@H](C(=O)[O-])CC(=O)N2C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224338",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@H](NC(=O)CNc1cccc(NC(=O)c2ccco2)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106986",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)c1cccc(NC(=O)N2CCC(C(=O)N(C)C(C)C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cccc(NC[C@@](C)(O)c2cccs2)n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CSc1ccccc1[C@H](Cl)[C@@H](C)c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45720",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N1CCC[C@@H]1C[S@@](=O)c1nc2cc([N+](=O)[O-])ccc2s1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(N[C@H]1CCCc2ccccc21)c1ccc2c(c1)[nH]c(=O)n2C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128495",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nsc(NCCS(=O)(=O)CC)n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143236",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(S[C@H]2CCCCNC2=O)nc2sc3c(c2c1=O)CCC3 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1c(C(=O)N2C[C@@H](c3ccccc3C)C[C@@H]2C)[nH]c(C)c1C(C)=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246965",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule CC(C)c1cc(C(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)nn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203006",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCn1cc(C(=O)NCc2cc(CC(C)C)on2)c(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227582",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(/C=C/c1ccccc1[N+](=O)[O-])OCC(=O)c1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57732",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N2C(=O)N(Cc3ccccc3Cl)[C@H]3CS(=O)(=O)C[C@@H]32)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76202",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1cnn(CC(F)F)c1)N1CCC[C@@H](C[NH+]2CCCCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68858",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccccc1OCCN(C)S(=O)(=O)c1ncn(C)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12325",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(C)cc(CN2C[C@@H](C)OC[C@@H]2C)cc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220024",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)N2CCC[C@H](c3nnc(C(=O)Nc4ccc(F)cc4)s3)C2)c(C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7538",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1cc2c(cc1C[NH+]1[C@H]3CC[C@@H]1CC(O)(Cn1nc(C4CC4)ccc1=O)C3)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208329",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1onc(-c2ccccc2Cl)c1C(=O)NCCC1[NH+]=c2ccccc2=[NH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106199",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN[C@]1(C#N)CC[C@@H](N2CCO[C@H](C)C2)C1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129766",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCN(CCNS(C)(=O)=O)c1cccc(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)[C@@H](NC(=O)[C@@H](C)Cc1ccccc1F)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC[NH+](C1C[C@@H](C)C[C@H](C)C1)[C@@H](C)C(N)=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209290",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CN4CCCC4=O)C3)noc2n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncc([C@@H](C)[NH2+][C@H](C)c2ccc3c(c2)CC(=O)N3)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239399",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](c1ccncc1)N(C)C(=O)[C@H]1C=C[C@@H]([NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60379",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1ccc2c(c1)[C@H]1C=CC[C@@H]1[C@@H](c1cc(OC)c(OC)c(OC)c1)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206573",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(F)c1N[C@@H]1CCCC[C@H]1[C@@H]1CCC[NH2+]1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146826",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C(/C)C(=O)Nc1cc(Cl)ccc1N1CC[NH+](C)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc(Br)cc(/C=N/c2ccc(F)cc2)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84828",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(N2CCN(c3nc4ccccc4c(=O)[nH]3)CC2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86565",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)Cc1[nH]c(=O)c(C#N)c2c1COC(C)(C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202137",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC[C@@H]1CCC[C@](C#N)(Cc2nccs2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42728",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)/C=C(\\N)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220623",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCc1c(N)nnn1CC[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248662",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[N+]1(C[C@H](O)COC(=O)C23CC4CC(CC(C4)C2)C3)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12526",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCCCC[C@]1(C)NC(=O)N(Cc2csc(C)n2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127284",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1c(C(=O)NC(c2ccccc2)c2ccccc2)nnn1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180555",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)Cc1nnc(NC(=O)[C@H]2C[C@H]2c2cc(Cl)cc(Cl)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67109",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCCCn1c(C(=O)Nc2ccc(C)cc2)cc2c(=O)n3ccccc3nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cccc(N2CC[NH+]([C@@H](CC(C)C)c3nnnn3C(C)(C)C)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCOCc1ccccc1)NC[C@@H]1CN2CCCC[C@@H]2CO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194450",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1ccc(S(=O)(=O)Nc2nc(-c3ccco3)c(-c3ccco3)s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cccc(-c2cc(C(=O)N3CCN(C(=O)[C@@H]4C[C@@H]4c4ccccc4)CC3)[nH]n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26972",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCn1c(SCC(=O)NC(=O)NCC(C)C)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77974",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)c1nnc(SCC(=O)N(C)C3CCCCC3)nc1n2C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194061",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)N2CCC[C@@H](c3nnc(C)s3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63900",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)[C@H](Sc1nnc(-c2cccs2)n1N)C(=O)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35817",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(CSc2cc(Cl)ccc2N)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104937",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2ccccc2)c2nc(-c3cccs3)n3c4ccccc4nc3c2c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85492",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COC(=O)[C@@H](N)CSc1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234442",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1022",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@@H](O)CC(C)(C)CNC(=O)N1CCC[C@@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40421",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(C(=O)Cn1c(CCNC(=O)c2cccnc2)nc2ccccc21)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208146",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C=CCNC(=O)CCCn1nc([N+](=O)[O-])c(Br)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN(C)Cc2c(C)n(C)n(-c3ccccc3)c2=O)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169594",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(O)C[C@]1(C(=O)[O-])CCc2ccccc2C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138384",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN[C@@H]1[C@H]([NH+](CC(C)C)C(C)C)CCC1(C)C by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202592",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@@]4(C)[C@@H]3CC[C@]12C by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27197",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(OCC[NH2+][C@H]2CCC[C@H](C)[C@@H]2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(C[C@H](O)CN1CCOCC1)c1cc[nH+]cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238169",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2csc3ncn(CC(=O)Nc4ccc(F)cc4F)c(=O)c23)s1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24880",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C=C(C)C[NH2+]C[C@@]1(O)CCCN(Cc2ccc(F)c(F)c2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130283",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1ccccc1Cl)NC12CC3CC(CC(C3)C1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140001",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CCc1ccco1)NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(C)n(Cc2cccc(NC(=O)[C@H](NC(N)=O)C(C)C)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63681",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCOC[C@H]2c2c(C)n[nH]c2C)c(Br)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174358",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOC(=O)[C@@H](C)NCc1cc(Cl)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196093",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/C=N/C(C)C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H](C(N)=[NH2+])N1CCN(C(=O)N(CC)CC)CC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219635",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCc1cnc(CCNc2ccccc2S(=O)(=O)C(F)F)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127514",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(COc2ccccc2C(=O)N[C@H]2CCOc3ccccc32)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90111",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196133",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1C(=O)C(C)(C)COc2cc(NC(=O)Cc3ccc(OC)cc3)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159529",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)c1ocnc1CS[C@H](C)C(=O)NCc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32968",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(N(C)C)cc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Nc1cccc(-c2nnc3n2CCC3)c1)N[C@@H]1C[C@H]2CCCc3cccc1c32 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184890",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@@H]1C(=O)NCC[NH+]1Cc1nc(-c2ccccc2OC)oc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121893",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(-c2ccccc2Br)cc([C@H]2C[NH+]3CC[C@@H]2C[C@@H]3CNC(=O)c2ccco2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127891",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule COc1ccc(-c2nc(COC(=O)c3cc(C#N)cn3C)no2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)Nc1ccc(C)c(NC(=O)N[C@H]2C[C@H]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169419",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(/C=C/c1nc2ccccc2o1)N1CCC[C@@H]1c1nnc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184952",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(c1csc2c1CCCC2)N1CCC[C@@H](N2CCN(c3ccccc3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126094",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC1=C(C(=O)N(C)C)[C@@H](c2cc(F)ccc2F)NC(=S)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110357",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)/C(C)=C/CSc1cc(F)ccc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186575",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CC(=O)NNC(=O)COc2ccc3ccccc3c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27102",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=CCn1nc(SC[C@@H](O)CO)nc1-c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCS(=O)(=O)c1ccc(CC(=O)Nc2nnc(-c3cccc(F)c3)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19325",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCOc1ccc(OC(=O)c2ncccc2C(F)(F)F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210893",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cl[C@@H](CNc1ccc2nnnn2n1)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1onc(-c2ccccc2)c1C(=O)N(C)CC(=O)N(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54429",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)OC1=C(C(C)=O)N(C(C)=O)S(=O)(=O)c2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195696",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Cc1noc(/C=C\\c2ccc3c(c2)n(C)c(=O)n3C)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88352",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCS[C@H]1CCCCN(C(=O)[C@H](C)Sc2ccccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213468",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)(C)c1noc(CSCCCN2C(=O)CNC2=O)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2nc3c(F)cc(F)cc3s2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100645",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CC[C@H]1CCCC[C@H]1[NH2+]Cc1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5965",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[NH2+][C@H]1[C@H]([S@@](=O)c2cccc(OC)c2)CCCC1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13120",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H](Cc1c[nH]cn1)NC(=O)c1ccc(-c2ccccc2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142592",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2onc3ccc(C(=O)/C=C/N(C)C)cc23)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CC1CCN(C(=O)c2c(C)nn(C)c2C)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(CCCO)c1nc(Cl)ncc1F by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32089",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1763",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCC(=O)Nc1cc(NC(C)=O)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66523",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@H](Sc1nnc(-c2cccc(N)c2)n1C)C(=O)Nc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242130",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C(=O)NNC(=O)CCCc1cc(F)ccc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80489",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC(=O)NC(=S)N1CCN(C(c2ccccc2)c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32736",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=S(=O)(Nc1ccccc1Cn1cncn1)c1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8591",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)c2c(N)c(C(=O)c3ccc([N+](=O)[O-])cc3)n3ccccc23)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12773",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(=O)c(C(=O)Nc2cnc(C(C)(C)C)nc2)c[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93639",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOC(=O)c1cnc(N)nc1C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@](C(=O)[O-])(c1cc(F)cc(F)c1)[NH+]1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226015",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(C)[C@@H](NC(=O)Cn1ccnc1)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202885",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[S@@](=O)Cc1cccc(C(=O)NCC(=O)Nc2nccs2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136996",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1/C=C/C(=O)OCC(=O)c1ccc2c(c1)OCCO2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98027",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1c(S(=O)(=O)c2cccs2)c2nc3ccccc3nc2n1/N=C/c1c[nH]c2ccccc12 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86084",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNc1ncnc2c1cnn2CCNC(=O)c1cc(Br)ccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69777",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NC(=O)C(=O)Nc1cnc2ccccc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93026",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(c1ccc(-n2cncn2)cc1)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56332",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1occc1C(=O)NCC(=O)N1CC[C@@H](C)[C@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149513",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Oc1cccc([C@H]2c3[nH+]c[nH]c3CCN2Cc2ccnn2-c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67684",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](Sc1ccccn1)C(=O)N[C@H](CO)c1cc(F)c(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(Cn2c(CN3CCOCC3)nc3ccccc3c2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59462",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCN(CCNC(=O)CC[C@H]2Cc3ccccc3NC2=O)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121461",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@]1(c2ccccc2)NC(=O)N(C[C@@H](O)c2ccccc2Cl)C1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128773",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)COCCNC(=O)NNc1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125691",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC(=O)Nc1ccc(NC(=O)N2CCO[C@H](c3cccc(F)c3)C2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157069",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C([O-])c1ccccc1S[C@H]1CCOC2(CCCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1ccc(NC(=O)N[C@H](CO)CC(C)C)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199628",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2cc(C(=O)N[C@@H]3CCc4ccccc43)n[nH]2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137735",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)N1C(=O)C=C(c2ccc(Cl)cc2)Nc2cc([N+](=O)[O-])ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122208",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCc1cccs1)C(=O)c1cccc(CC#N)c1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151603",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1ccc(C[NH2+]Cc2cccc3cccnc23)cc1)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221740",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(N2CCN(C(=O)C[NH+](C)CCO)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27912",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule N#C/C(=C\\c1cc2c(cc1Br)OCO2)c1nc2ccccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145464",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CCC(=O)N1CCN1CC[NH+](Cc2ccoc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197754",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cc1ccc([C@@H](C)C(=O)N[C@H](C(=O)[O-])C(C)C)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181377",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(-c2noc(-c3ccc(OC(C)C)cc3)n2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121187",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)[C@H](C)CC(=O)Nc1ccccc1CN1C[C@@H](C)O[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178868",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nc([C@@H]2CCN(C(=O)C3(c4ccc(Cl)cc4)CCOCC3)C2)ncc1C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68583",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)c(CN2CCC(=O)NC[C@H]2C)c1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52317",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule NC(=O)[C@@H]1CCCC[NH+]1CC(=O)NC(=O)NCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49331",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)c1ccc(C#N)c(SCC(=O)c2c([O-])on[n+]2C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74951",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(N(C)C)ncc1C(=O)N[C@H]1Cc2ccccc2[C@@H]1[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236839",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nn(C)c(C)c1[C@H](NC(=O)Nc1cccc2ccccc12)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145218",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccc(S(=O)(=O)N[C@H](C#N)c2ccc(Cl)cc2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(/C=C/C(=O)c2scnc2C)cc(Cl)c1O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122722",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(=O)n2c(n1)SC[C@H]2CC(=O)Nc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161657",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCNC(=O)[C@H]1CCCN(C(=O)N[C@@H](C)CSC)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96598",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(C)n(-c2cc(N3CCC[C@@H](C(=O)Nc4ccc(Br)c(C)c4)C3)ncn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177794",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CCN1CCCC1=O)NCC1([NH+]2CCCCC2)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85808",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCC(=O)N1CCN(Cc2ccccn2)CC1)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83334",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(C(=O)N2CCCC2)c1NC(=O)NCc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50140",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c([C@@H]2CCCN2C(=O)c2ccoc2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143410",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccccc1C(C)(C)C)N1CC[NH+](CCO)CC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182728",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC[C@@H]1CCN(c2cc(C)c(F)cc2[C@H](C)[NH3+])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211513",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2CCN(C(=O)NCc3cccc(OCC(F)F)n3)C2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212510",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccccc2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41465",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@H]1COCCN1C(=O)c1ccc2[nH]c(C)c(C)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47190",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cn1nc2c(cc1=O)CCCC2)N1CC[C@]2(O)CCCC[C@@H]2C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26844",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)cc(NC(=S)NC(=O)c2cccc(F)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32571",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(F)c(F)c1F)c1ccc([N+](=O)[O-])o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214318",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOc1ccc(Nc2nc(CSc3nc4ccccc4o3)cc(=O)[nH]2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163014",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+](C)CCCCn1c([C@H](C)Cl)nc2cnccc21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(C(=O)N(C)Cc2ccccc2OC(F)(F)F)cc(OC)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179508",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@]1([NH3+])CCC[C@H]1CCSc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159885",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cl)c(O[C@H](C)C(=O)NCCCc2ccccc2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151171",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1CNC(=O)Nc1ccc(N2CC[NH+](C)CC2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239650",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule N#Cc1nc(/C=C/c2ccccc2Cl)oc1N1CCN(C(=O)c2cccc(Cl)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86230",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(OCC(=O)Oc2ccc3c4c(c(=O)oc3c2)CCC4)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103200",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)Cc1cn2cc(Cl)cc(Cl)c2n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191604",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(C(=O)CCC(=O)N2C[C@@H](C)OC[C@@H]2C)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6363",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1oc2c(c1C(=O)NCCNC(=O)c1c(C)oc3c1CCCC3)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8350",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(C[NH+](Cc1ccco1)C1CCCC1)NCc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97802",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)c1ccc(NCc2ccc(F)c(Br)c2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc([C@@H](C)NC(=O)N[C@H](CCCO)c2ccccc2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105398",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=[N+]([O-])/C=C/c1c(F)c(F)c(F)c(F)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(N2CCN(Cc3cccs3)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120941",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(CN2CCS(=O)(=O)[C@H](C)[C@H]2C)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170570",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1C[C@@H](C)CN(C(=O)C[NH+](C)CC2CC[NH2+]CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72154",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CCC(=O)NNC(=O)NC[C@H](C)c1ccsc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4895",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N[C@@]1(C(F)(F)F)NC(=O)N(C)C1=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223555",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@@H](NC(=O)C1C[C@H](C)O[C@H](C)C1)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237778",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(OC)cc([C@H]2CCN(C(=O)c3c(F)cccc3Cl)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183034",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)N(C)[C@H](CC)CSC)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243646",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1c(SCC(=O)Nc2c(C)cccc2C)nc2sc(C)c(C)c2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239998",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cccc(C)c1NC(=O)c1cnc(SC)nc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83856",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=[S@@](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3664",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule C[C@H]1OCC[C@@H]1C(=O)NCCOc1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1CC(=O)N1CCN([C@@H](C)c2nc(C3CC3)no2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222205",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cn2ccsc2n1)N[C@H]1CCC[C@H]1Cc1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43312",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](C#N)OC(=O)/C=C/c1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40686",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule NC(=S)N/N=C1C(=N/N=C(\\N)[S-])\\Sc2ccccc2\\1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81567",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NC1(C(=O)[O-])CCCCC1)c1c[nH]c(=O)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208886",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule OC1CC23CCCCCCC2(C1)CC(O)C3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77605",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)N(C)Cc1c(CC)oc2ccccc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244921",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(CN2CCN(C(=O)c3cc(C#N)cn3C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(-c2nc(Cn3cnc(C4CCC4)cc3=O)cs2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62948",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN(C)S(=O)(=O)N1CCO[C@H](c2cccc(F)c2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74799",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@@]2(CC[NH2+]C[C@@H]2c2ccccc2F)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157059",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(N)=O)cc1NC(=O)N(Cc1cccc(F)c1)C[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18945",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CSc1nc(-c2ccco2)nc(C)c1C(=O)NCC[C@@H](O)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](C1CC1)N(Cc1ccccc1)C(=O)c1ccc2c(c1)C(=O)N(C)C2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83667",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1nn(C)cc1CNC(=O)Nc1cc(C)ccc1-n1cc(C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47958",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)c1ccc(-c2cc(F)cc3c2O[C@H](CNC(=O)[C@@H]2CCOC(C)(C)C2)C3)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208872",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195234",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C2([NH+](C)C)CCC2)cc1S(C)(=O)=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42563",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=S(=O)(NCc1ccccc1)c1ccccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C1CC1)N(C(=O)CSc1nc2c(cc1C#N)CCCC2)C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212465",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1cccc2sc(NC(=O)[C@H]3CCCN(S(=O)(=O)c4ccc(C)cc4)C3)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92005",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cccc2cc(C(=O)N3CCN(C(=O)[C@@H]4C[C@H]4c4ccc(F)cc4)CC3)oc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(Br)cc1C[NH2+]C1CCC(O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166176",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nc(N3C[C@H](C)O[C@H](C)C3)ncc2-c2cncnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)NC[C@H]1CCCCN1C(=O)CCCC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100052",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Cn1nc2c(c1NC(=O)c1cc3ccccc3o1)CSC2)NCc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94335",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(SCCOc2ccc(F)cc2Cl)n1N by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249267",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)c1ccc(F)c(NC(=O)[C@@H]2CCO[C@H]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162401",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCCC#Cc1cc(F)cc(C[NH+]2CCC[C@H]2CO)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4563",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(OC)c(N/C([O-])=C2/Oc3ccccc3NC2=O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94266",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc2c(c1)N(C(=O)N1CCC(C(=O)Nc3ccccc3Cl)CC1)CCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219633",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1NS(=O)(=O)c1ccc2c(c1)NC(=O)[C@H](C)C(=O)N2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189934",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc(NC(=O)CSc2nccn(-c3ccc(C)c(C)c3)c2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226551",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc([C@H]2CC(=O)NC3=C2C(=O)C[C@H](c2cc(OC)c(OC)c(OC)c2)C3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181257",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1csc(-c2ccnc(N3CCCC3)c2)n1)N1CCN(c2ccccc2F)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1CN1CCN(C(=O)c2ccc(N(C)C)nc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46565",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]([NH2+]CCO)c1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67854",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(CC(C)C)cc1C(=O)N1C[C@H]2CC=C(C)C[C@H]2C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67216",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(CC(=O)N(C)[C@H](C)c3ccc(F)cc3)coc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOC(=N)Cc1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34452",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)N2CCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55774",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)Nc1nc2ccc(NC(=O)NCCC(C)C)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238822",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@@H](C(=O)OCc1cccnc1)N1CCCCC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179992",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@]1(N)CC[C@H]([NH+]2C[C@@H](C)[C@@H](C)C2)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169405",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@H]1CCN(C(=O)Cc2cccc(OCc3cccnc3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126937",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cccc(NC2CC[NH+]([C@H](C)C(=O)Nc3cc(C)on3)CC2)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158399",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nnn[n-]1)c1cc2ccccc2s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195187",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CCn1ccc2cc(Br)ccc21)/N=C1\\N=N[C@H]([C@H]2CCCO2)S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92023",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](Cc1ccccc1F)C(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(CN1CCN(c2ncccn2)CC1)Nc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)c1ccc(CNC(=O)c2cc(-c3csc(C)n3)c[nH]2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224522",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N/C(=N/OCCCOc1ccccc1)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122303",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Fc1ccccc1[C@@H]1C[C@H](c2ccc(Cl)cc2)Nc2nnnn21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216404",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCOc1ccc(NC(=O)C(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45888",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(N2CCCC2=O)cc1)Nn1cnc2ccccc2c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4692",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccccc2n1CCCNC(=O)c1ccc(-n2cccc2)nc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121485",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOC(=O)/C=C1\\NCCCN1Cc1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(C[NH+]2CCN(Cc3cccc(F)c3)CC2)co1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95056",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[S@](=O)[C@H]1CCCC[C@@H]1NC(=O)CNC(=O)Cc1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12608",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1c(C)nn(CCNC(=O)c2cn[nH]n2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118482",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N(C)C)cc(C)c1NC(=O)c1ccnc(OC(C)(C)C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65368",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)NC1CC[NH+](C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122401",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule Cn1ncc2nc3cc([N+](=O)[O-])ccc3c([O-])c21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147603",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)[C@H](CO)[NH+](Cc1ccccc1)C1CCSCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91759",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(C)cc(C(=O)Nc2ccc(N3C(=O)CCCC3=O)cc2)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96766",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCNC(=O)c1ccc(N2CCN(c3ncccc3C#N)CC2)nc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136572",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)/C(=C\\c1cc(Cl)c2c(c1)OCO2)CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129990",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc([C@H]2c3[nH]c4ccc(OC)cc4c3CCN2C(=O)c2ccc(Cl)cc2)cn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128453",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Clc1ccccc1CNCCc1cn2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172234",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(F)c(F)cc2c(=O)c(C(=O)NC(C)(C)CO)cn(C3CC3)c12 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149979",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CCN(C(=O)c2ccc(OC)nc2)C[C@H](Cc2ccccc2-c2ccncc2)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)([C@H](NC)c1ccc(C)s1)[NH+]1CCCC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73559",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(SCCC(=O)NC2CC[NH+](CC(N)=O)CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77452",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)N2CCCC2)c(C2CCN(C(=O)c3ccoc3)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37491",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nc(NCC[C@@H]3CCC[NH+]3C)ncc2-c2cncnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143530",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccc(C2=NN3C(=NC(C)=C(C(N)=O)[C@H]3c3ccc4c(c3)OCO4)N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239402",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCC1CCN(c2nc3ccccc3o2)CC1)c1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208380",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Nc1c(Nc2cc(Cl)cc(Cl)c2)ncnc1NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148165",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Clc1ccc(NCc2ccncn2)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24320",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(O[C@@H](C)CNc2ncccc2C#N)c1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38436",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1ccc(I)cc1)C(F)(F)F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175409",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(=O)c1cc(F)ccc1OCC(=O)N[C@H]1CCOc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50483",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Nc1nc(CC(=O)N2CCC[C@@H](c3[nH]ncc3-c3ccccc3)C2)cc(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cccc(C(=O)NCCc2cnn(-c3ccccc3)c2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220002",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cc1ccc(F)cc1F)NCc1cc(Cl)c2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156324",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)[C@H]1CCCN(C(=O)C[C@@]2(c3ccccc3F)CC(=O)N(C3CCCC3)C2=O)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103224",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C(=O)Nc2c(Cl)cc(Cl)cc2C(=O)[O-])c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22233",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Nc1ccn(Cc2ccccn2)n1)c1c[nH]c2cccc(F)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36414",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOC(=O)[C@H](CC(C)C)Nc1ncnc2onc(C)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134254",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1occc1-c1nnc(SCc2cccc(OCC(F)(F)F)c2)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108500",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C/C(=C\\c1ccc(F)cc1)C(=O)O[C@@H](C)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45559",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(CN(C(=O)c2nc(C3CC3)n3ccccc23)C(C)(C)C)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H](C)CC(=O)Nc1ccc(N2CCO[C@@H](C)C2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45691",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)n1cc[nH+]c1C1CCN(C(=O)c2ccc3[nH]nnc3c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142978",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CO[C@H]1C[C@@H](C(=O)[O-])N(C(=O)c2cc(SC)ccc2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72341",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NCC1CCN(c2cc[nH+]cc2)CC1)Nc1c(F)cc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236180",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H]1Cc2cc(S(=O)(=O)Nc3ccc(Br)cc3)ccc2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230871",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)N[C@@](C)(CO)C1CCCCC1)c1ccc(C#N)cc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1c(Cl)cccc1NC(=O)C(=O)N/N=C/c1coc2ccc(Cl)cc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63725",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)[C@@H]1CCC[NH+](CC(=O)Nc2ccccc2-c2ccccc2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)c1ccc(NC(=O)Cc2csc(NC(=O)c3ccsc3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37184",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccccc1O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20753",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1noc(C(C)C)c1C(=O)N1CCC[C@H]([NH+]2CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213485",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cn1ccnc1[C@@H](NC(=O)[C@H]1CCCN(C(=O)Nc2ccccc2)C1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)Cc1cccc(C[NH2+]Cc2ccn(-c3ccccc3)n2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9923",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=C(NCCC1=CCCCC1)NC[C@@H]1CCC[C@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225313",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(O[C@@H](C)C(=O)NCC2(N3CCOCC3)CCCCC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1(C)CNC(=O)c2nc([C@@H](O)C[NH+]3CCCCCC3)[nH]c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186611",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccc(CCNC(=O)N[C@@H](C)CO)cc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136295",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=CC[NH2+]CC(=O)N1CCn2cc[nH+]c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247908",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccc(C(=O)[O-])cc1S(=O)(=O)C(CC)CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51524",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CC(C)[C@H]1CN(c2cc(C#N)c3ccccc3n2)CCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96621",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)CC[S@](=O)Cc1ccc(C)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97851",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[NH2+]C[C@H](C)C(=O)N[C@H]1C=C[C@@H](C(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)CC[C@@H](C)NC(=O)C(=O)Nc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161196",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(CCc1cnccn1)C(=O)Nc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155153",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc2c(=O)c(C(=O)Nc3ccc(NC(C)=O)cc3)cn(C)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22145",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(c1ccncc1Cl)N1CCCC[C@@H]1[C@@H]1CCC[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cnc2sc(C(=O)Nc3ccc(C)c(Cl)c3)c(C)c2c1=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18336",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)CO/N=C/C(=O)Nc1ccc(F)cc1)c1ccco1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209960",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)c1c(NC(=O)CSc2nc(C)ccc2C#N)sc2c1CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)Nc2ccn(-c3ccc(C(C)C)cc3)n2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241335",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(C2=CCN(C(=O)NCC[C@@H](C)[S@@](C)=O)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240311",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCC[C@H](C[NH3+])C1(O)CCC(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(C)cc1NC(=O)C(=O)NCc1cc[nH+]c(N(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155319",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=N/NC(=O)c2cc(C)nn2C)c(C(=O)[O-])c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212620",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=[N+]([O-])c1cc(Br)c(O)c(Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCc1ccc(S(=O)(=O)N[C@@H]2C[C@@H]2c2ccccc2F)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85421",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nn(CC(=O)N2CCC[C@@H](C)C2)c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196119",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCn1cc[nH+]c1C[C@H](O)c1cc(Cl)c2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215202",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)N(CC(=O)N2CCn3cccc3[C@@H]2c2ccc(Cl)cc2)C(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37257",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CC1(n2cccc2)CCCCC1)NCCO by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174796",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C(=O)N2CCCC[C@@H]2CCn2cc[nH+]c2)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64577",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)c1sc(NC(=O)c2c[nH]c(=O)cc2C)nc1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48000",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C([C@H]1CCCC[NH+]1Cc1cccc([N+](=O)[O-])c1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203332",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Nc1ccc2c(c1)nc1n2CCN(c2ccccc2)C1)c1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OC[C@@H](C)NC(=O)CNC(=O)c2ccoc2C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226239",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](OC(=O)c1ccc(-n2cnnn2)cc1)C(=O)Nc1nc(-c2ccccc2)cs1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188704",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(-c2cccs2)sc1C(=O)N1c2ccccc2C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172425",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C(c1ccc(=O)n(Cc2ccccc2)n1)[n+]1ccccc1NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215921",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCN(CCc1nccs1)Cc1cc(O)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181153",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(SCC(=O)Nc2ccc(Br)cc2)nc2ccc(S(=O)(=O)N(C)C)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(-n3ccnn3)cc2)cc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105429",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCS(=O)(=O)[N-]c1cccc(NC(=O)c2ccccc2OC)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170485",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1c(C)cc(C)cc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96649",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=S(=O)(c1ccccc1Cl)N(C[C@@H]1CCCO1)[C@@H]1CCSC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228947",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccccc1-n1cc(C(=O)N2CCC(OCc3ccc(F)cc3)CC2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138411",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(N2C(=O)C[C@@H]([NH+]3CCC(c4ccc(O)cc4)CC3)C2=O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107363",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)n1ncc2c(C(=O)N[C@H](C)c3ccc(NC(=O)c4ccc(F)cc4)cc3)cc(C3CC3)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46905",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(S(=O)(=O)CCO)cc(C(=O)[O-])c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(C(=O)NCc2nnc3n2CC[NH+](Cc2c(F)ccc(F)c2F)CC3)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45948",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule c1ccc(CCCCc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159865",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CO[C@@H](CNC(=O)[C@@H]1CCC(=O)N1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150102",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(-n2ccnc2SCC(=O)N2CCC[C@H](C(N)=O)C2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228566",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)CC1CCN(C(=O)c2ccc(F)cc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(C)C)[nH]c(=O)c1C(=O)N(C)CC(=O)[O-] by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-c2ccc(S(=O)(=O)NC3CCCC3)s2)[nH]n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192416",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccccc1NC(=O)CSc1ccc(F)cc1N by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55626",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)c1ccc(CSCCOc2cccc(F)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189662",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cc1csc(NC(=O)c2cnccn2)n1)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11653",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]1CN(C2=NC(=O)/C(=C\\c3ccc4noc(-c5ccccc5)c4c3)S2)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90796",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc(C(=O)NCCc2nc3c(s2)CCCC3)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155123",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)[C@@H](NC(=O)c1cccc(Cl)c1)C(=O)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180852",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CNS(=O)(=O)c1cccc(C(=O)N(C)Cc2cnn(C)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33187",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Fc1cccc(CN2CCC[C@@H](c3nnc(-c4cccnc4)o3)C2)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187415",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1[C@H](c2ccncc2)N(Cc2ccco2)C(=O)CN1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25860",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C/C(=N/NC(=O)CN(c1cccc(Br)c1)S(C)(=O)=O)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143770",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@@](O)(CNC(=O)CCn1cc([N+](=O)[O-])cn1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224494",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccc(-n2c(SCC(=O)c3ccc[nH]3)nnc2-c2ccncc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145362",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CSc1ccc(/C=C(/C)C[NH2+]CC(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30885",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nnc(Cc2ccccc2)s1)[C@@H]1CC(=O)N(Cc2ccccc2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245791",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cc(I)ccc1NC(=O)c1ccccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82380",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC[C@H](Nc1nccn2cnnc12)c1ccccc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38213",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)Cn1c(SCC(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117146",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccccc1-n1ncc2c(O)nc(SCC(=O)N3C[C@H](C)O[C@@H](C)C3)nc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77285",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)N[C@@H]2CCCc3c2cnn3Cc2ccccc2)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166130",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=[S@]1N/C(=C/c2ccc(Cl)cc2)NO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241405",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)c1ccc(OC[C@@H](O)CN2CCN(c3ccccc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14411",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)N1CCC[C@@H](C(=O)NCC(C)(C)c2ccncc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118311",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2csc(/C(C#N)=C\\c3ccc(OCC#N)cc3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)C(=O)N[C@@H](C)c2cc3ccccc3o2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144227",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Nc1cccc(C(=O)N[C@@H]2C=C[C@@H](C(=O)[O-])C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83061",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule C[C@H]1CN(c2ccc([N+](=O)[O-])cc2F)CC[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154935",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC(C)[NH2+]Cc1ccc(S[C@H](C)CCO)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67572",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCNC(=O)NC(=O)C[NH+]1Cc2ccccc2N(C)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55703",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)(C)c1ccccc1OCC(=O)NC1CC[NH+]([C@@H]2CCOC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)CCCNC(=O)C1(c2ccc3c(c2)OCO3)CCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219953",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCCNC(=O)Cc1c(C)c2cc3c(C)c(C)oc3c(C)c2oc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18803",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)NC[C@@H](c1cccs1)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125986",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=CN[C@H]1CCCC[C@@H]1c1ccc([C@H]2CCCC[C@@H]2NC=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51640",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COc1ccc(NC(=O)/C(C#N)=C/c2c(Oc3ccccc3F)nc3ccccn3c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76112",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cccc2cc(CN(Cc3cccnc3)C(=S)Nc3cccc(Cl)c3)c(=O)[nH]c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187310",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule c1ccc2c(c1)CC[C@@H](N[C@@H]1CC[NH2+]C1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33103",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(C)cc1CCNC(=O)C(=O)Nc1cc(F)ccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N)cc(Cl)c1[NH+]1CCC(C)CC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100731",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=c1oc2cc([N+](=O)[O-])ccc2n1Cc1noc(-c2cccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48466",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(NC(=O)NC(=O)c2ccc3ccccc3c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181613",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H]([NH2+]Cc1cccc(-c2n[nH]c(C)n2)c1)c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183109",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H]1C[C@H](N2CCC(O)(C(F)(F)F)CC2)C(=O)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119420",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1noc(C)c1[C@@H](C)NC(=O)c1ccccc1NC(=O)NC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205431",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=[N+]([O-])c1ccc2nc(NC3CCC3)oc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159824",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(C2(NC(=O)Cc3csc(-n4c(C)ccc4C)n3)CCCC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C[C@@H]1CCCC[NH+]1Cc1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103432",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@@H](Cc1cccs1)[NH+](C)C[C@H](O)c1ccc(N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171885",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nccn1-c1ccc(C(=O)/C=C/C2=Cc3ccccc3OC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78514",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cn1cc([N+](=O)[O-])cn1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122584",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCOCC(=O)N[C@H](C(=O)[O-])C1CCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125048",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nnc(C2CC2)n1C1CC1)N1CCN(Cc2ccccc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157978",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule FC(F)(F)CCc1noc(COC2CC[NH2+]CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule C[C@@H](CN1CCOCC1)[NH+]1CCC(Oc2cccc(C#N)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218812",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c([C@@H](C)NC(=O)Nc2c(F)cccc2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C/C(NC[C@@H]1CCCO1)=C1\\C(=O)NC(=O)N(C2CCCCC2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84260",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1c(NNC(=O)c2ccc(Cl)cc2Cl)ncnc1NC1CCCCC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20150",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccc(NC(=O)[C@H](C)Oc2ccc(OC)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228484",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C[C@@H](C)[NH3+])cc1OCc1cccc(C)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239722",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCC[NH+]1CCC[C@H]([C@@H](C)NCc2ccc(Br)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115818",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NC(=O)[C@H](C)[S@@](=O)Cc2nc(C)c(C)s2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccccc1[C@H](NC(=O)c1ccn(C)c(=O)c1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243620",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C#N)Oc1ccc(C[NH+](C)Cc2csc(Br)c2)cc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152160",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(CN1CCO[C@@H](c2cccs2)C1)NOCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6257",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)NCc1ccc(C(=O)NCc2csc(-c3ccccc3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C[C@H](NC(=O)c1cccc(N2CCCS2(=O)=O)c1)c1ccc(Br)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83531",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(C)c2sc(N(Cc3ccccc3)C(=O)CC[C@@H]3CCCO3)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159255",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1c(C(=O)N2CCOC[C@@H]2C2CC2)sc2ccc(F)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108007",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)N1CC=C(c2cccc(C)c2)CC1)c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122393",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)C1CC=CC1)c1ccc(F)c(F)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10174",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)NCCN2C[C@@H](C)O[C@H](C)C2)c([N+](=O)[O-])c1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188926",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C#CCN(CC(=O)[O-])C(=O)c1nc(CC)n[n-]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16277",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C/[NH+]=C(/NCCN1CCc2sccc2C1)NCc1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CO[C@H](C(=O)N1CCC(n2cc(C(=O)NC3CCCC3)nn2)CC1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(CC(F)(F)F)C(=O)[C@H]1C[C@H]1c1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38931",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CSC(SCC(=O)N2CCC(Cc3ccccc3)CC2)=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160770",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)c1csc(-c2cccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15574",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(/C=C/C(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111912",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1n[nH]c(=O)c(CNC(=O)c2ccc(-n3ccnn3)cc2)c1CC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149581",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc(CN(C)C(=O)Cn2ncnc2-c2cccc(C#N)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244938",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cccc2sc(NC(=O)[C@H](C)OC)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213262",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(C[NH2+]Cc2c(C)nn(Cc3ccccc3Cl)c2Cl)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93751",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H]1CCN(C(=O)[C@@H](Oc2cccc(Cl)c2)C(C)C)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184306",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC(=O)Nc1nc2c(c3c1c(=O)oc1ccccc13)C[C@@H](C)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187307",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cnc(CCNC(=O)CO[C@@H]2CCC[C@H](C)C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234480",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@H](C)[C@@H]1CCCCN1c1ccc(C(N)=O)cn1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186188",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH2+]Cc1cc(C)n(-c2ccc(OC)cc2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34562",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCN(C(C)C)[C@H](C[NH3+])CC(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229276",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#CCc1ccc(Oc2ccc(F)cc2C=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31233",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(C[NH+]1CC(c2nc(-c3cccnc3)no2)C1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99197",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCn1c([C@@H](C)[NH2+][C@@H](C)c2cccc(NC(C)=O)c2)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201740",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](CNC(=O)c1ccc(-c2ccccc2)[nH]c1=O)Oc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "803",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2151",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1nc(C[C@@H]2CCCN(C(=O)CCc3ccccc3)C2)cc(Nc2ncc(C)s2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48603",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule Cc1cc2c(c(=O)o1)[C@@H](c1ccc(Cl)c(Cl)c1)C(C#N)=C(N)O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241913",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)Nc1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc2oc(Br)c(CC(=O)N3CCOCC3)c2cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63575",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(-c2ccc(=O)n([C@H](C)C(=O)Nc3nc4ccc(Cl)cc4s3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135819",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[NH+](CC)C[C@H]1CCN(C(=O)[C@@H]2CN(Cc3ccccc3)CCO2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119186",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule [NH3+]CC(=O)N1CCCC[C@@H]1CNC(=O)OCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CO[C@H]1CCCC[C@H]1NC(=O)c1cnc(C)c(Cl)c1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123914",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(C[NH2+]Cc2ccc3c(c2)CCC3)cc(C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208901",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCCCn1ncc(C(=O)N[C@@H](CO)c2ccco2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "173565",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N)cc(S(=O)(=O)Nc2cc(C)ccc2F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139831",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccccc1C[NH+]1CC[C@H](c2ccccc2)[C@@H](C)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140904",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(CCC(=O)c1ccc(F)cc1)OCc1cc2c(cc1Br)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126478",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C[C@@H](C)N(C)C(=O)N[C@@H]1CCC[C@H](SC)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79958",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(C)C)c(C)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33905",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(NC(=O)[C@@]2(C)Oc3ccc(Cl)cc3NC2=O)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215467",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)C[C@H]1CCCCN1C(=O)c1nc2nccc(C)n2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102351",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1ccc(C[NH+]2CCC(C3CCOCC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120800",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C(=O)N2CCN(Cc3ccc([C@@H]4C[C@@H]4C)o3)CC2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132235",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NNc1ccc(F)cc1)Nc1ccc(C(=O)Nc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63115",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2CCCN2C(=O)COc2cc(C)ccc2F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144693",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cccc(N2C(=O)CSC23CCN(C(=O)CCl)CC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248359",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCn1nc(C)c(Cl)c1C[C@H](C[NH3+])c1ccccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167259",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC1CC[NH+](CCCNCc2cn(C)nc2C(C)(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108031",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1Nc1nc(CSc2nnc(C)n2C2CC2)cs1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212278",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CC[C@H](NS(=O)(=O)c2cccc(C(F)(F)F)c2)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106004",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H]1CCCCN1C(=O)[C@@H](C)n1nc(-c2ccccc2)ccc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222728",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1NC(=O)COC(=O)c1c2c(nc3ccccc13)CC[C@@H](C)C2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7249",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCS(=O)(=O)CCN(C)C(=O)CC[C@@H]1CCCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53004",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1ccc(N/C([O-])=C(\\C#N)C(=O)c2ccc(C)c(C)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160577",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(N2CCN(C(=O)CCc3cc([O-])no3)CC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74786",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=c1cc(CS(=O)(=O)c2ccccc2)nc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC(=O)Nc1cccc(CNC(=O)Nc2ccccc2N(C)C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49131",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN(C)C(=O)[C@@H](c1ccccc1)n1nnc(-c2ccc(F)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218923",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)Oc1ccc(CNC(=O)Nc2ccccc2OC(C)C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(C1CC1)N1CCc2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(CCOc1ccc(F)cc1Cl)S(=O)(=O)c1ccc(Cl)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34155",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCOc1ccc2c(c1)s/c(=N\\C(=O)c1ccccc1F)n2CCOC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145100",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CC(=O)Oc1ccc(/C=C(\\C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5203",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC[C@H](C)NC(=O)[C@@H]1CCCN(C(=O)c2cc(F)cc(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172623",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC[C@H](C)N/C(NCc1cccc([N+]2=CCCC2)c1)=[NH+]\\C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29833",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(NC(=O)/C=C/c2ccccc2[N+](=O)[O-])c2cccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(C)c1cc(C(=O)Nc2cccc(Cl)c2Cl)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146758",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCc1ccc(-c2nc(NC(=O)Cc3c(C)[nH]c4ccnn4c3=O)sc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240393",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(CC(=O)NNC(=O)c2oc3ccccc3c2C)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16741",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc(NC(=O)c2cc(-c3cccc(OC)c3)n[nH]2)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(-c2cc(O)cc(C(F)(F)F)c2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164111",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C([C@H]1Cc2[nH+]c[nH]c2CN1)N1CCC[NH+]2CCC[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94738",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(C1CC1)[C@@H](c1ccccc1)[C@H]([NH3+])Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194085",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)n(-c2ccccc2NC(=O)N(C)C[C@H](C)c2ccccc2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)c1cccc(Oc2cnccn2)c1)c1ccncc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123651",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1csc2c1CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123258",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(NC(=O)Cc2nc(C)c(C(=O)NCC(C)C)s2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215388",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)N(C(=O)CSc1cccc[n+]1[O-])c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66335",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule NC(=O)[C@@H]1CCC[C@@H]1NC(=O)NCC1(c2cccc(F)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198604",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Oc1cc2c(cc1C[NH+]1CCN(c3cccc(C(F)(F)F)c3)CC1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55821",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1n[nH]c2ncc(NC(=O)NC[C@@H](C)COCc3ccccc3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCCN(C(=O)C[NH+](C)[C@@H]1CCC[C@H](C)C1)[C@H]1CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@@H](NC(=O)NC(C)C)C(=O)N1CCc2nnc(-c3ccccn3)n2CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7308",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([N-]S(=O)(=O)c2c(C)noc2C)cc1NC(=O)c1ccncc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228095",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1c2ccsc2CCN1C(=O)c1cccc(S(=O)(=O)N(C)c2cccc(Cl)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54007",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(NC(=O)CCc2ncc(-c3c(F)cccc3F)o2)[nH]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107350",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1cc(N2CCN(C(=O)Nc3cccc(F)c3)CC2)nc(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176579",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(Cl)cc1Cl)C(=O)N[C@@H]1CCSc2ccc(F)cc21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239927",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1NC(=O)C12C[C@@H]3C[C@H](C1)CC(n1cncn1)(C3)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9751",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN(C(=O)N2CCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215625",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc(C(=O)CN2CC[NH+]3CCC[C@@H]3C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223304",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@H](O)Cc2nc3ccccc3n2C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140388",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1cc[nH+]c(Cn2nnc(-c3ccccc3)n2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75689",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2cc([C@H]3CCCCC[NH+]3Cc3ccccn3)on2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110272",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)(CSc1ccc(Br)cn1)C(=O)NN .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42912",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/C=C/C(=O)N2CC[C@H](C(N)=O)c3ccccc32)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20720",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](CCO)Nc1ccc2cc(Br)ccc2n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33168",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C1CC1)N1CCC(C(=O)N2CCOc3ccc(CO)cc3C2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231771",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccncc1NC(=O)NCC[C@H](C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168845",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)c1c(CC(=O)Nc2ccccn2)[nH]c(C(C)=O)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147016",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Oc2ccc(NC(=O)C(=O)NCc3ccnn3C)cn2)cc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6484",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCN(CC)c1ccc(/C=C2/C(=N)N3C(SCc4ccccc4)=NSC3=NC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29873",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N2CCN(Cc3cc(C#N)cs3)CC2)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53106",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cn1c(C[NH+](C)C[C@H](O)Cn2cccn2)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31263",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[NH2+]C[C@@H](O)CN1C(=O)CCCC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106622",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@H](C)[C@H](C[NH3+])c1c(Cl)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133584",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)NCC[NH+]2CCC(c3ccsc3)CC2)ccc1[N+](=O)[O-] by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccc(C)c2[nH]c(=O)c(CN(Cc3ccco3)C(=S)Nc3cccc(Cl)c3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34400",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCS(=O)(=O)NCC#CCOc1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62315",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[NH+](C)Cc1cccc(CNC(=O)c2n[nH]c(C3CC3)c2Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244661",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1/N=C(/[S-])Nc1ccccc1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54900",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1cccc(N2C(=O)[C@@H]3C(C(=O)C(c4ccccc4)c4ccccc4)=NN[C@H]3C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213230",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CCCO)NC(=O)Nc1cccc(Oc2ccncc2)c1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136675",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCC(=O)Nc1ccc(Cl)c(NC(=O)CCCO)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70978",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule [NH3+][C@H](Cc1ccc(Cl)cc1)c1c(F)cc(Br)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21172",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCc1cccnc1NC(=O)c1cnc2ccc(F)cc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137845",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1ccccc1NC(=O)[C@H]1C[C@@H]1c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114605",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Nn1c(SCC(=O)N2CCCCC2)nnc1-c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46766",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(C(=O)[C@H]2CCCN(C(=O)c3cccc(C#CC(C)(C)O)c3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247326",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([N+](=O)[O-])c(CCl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179923",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(/C=C/c1ccc(Cl)cc1)NC(=S)Nc1cc(C(=O)[O-])ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174515",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccccc1)Nc1cccc(C(=O)Nc2ccccc2C(=O)[O-])c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26967",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CC=CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60293",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CC1=C[C@@H](CN2CCN3NC(C(=O)NC4CC4)=C[C@@H]3C2)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148725",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)cc1CNc1ccn(C)n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220138",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(c1ccc(F)cc1F)N(CC(F)(F)F)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33904",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=C(Nc1ccc(C(C)C)cc1)[C@H]1C(=O)NC(=O)N(CCCC)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1c(C)[nH]c(C(=O)N2C[C@@H](C)Oc3ccc(C)cc32)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC[C@@H](C(=O)OCC(=O)c1c(N)n(C)c(=O)n(C)c1=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136564",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCn1cc(C[NH+]2CCCC[C@H]2c2nc(N(C)C)ncc2-c2ccc(F)cc2)c(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64591",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=O)CC[NH2+][C@@H]2CCN(C3CC3)C2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141605",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)c1ccc(CNC(=O)c2oc3c(Cl)cccc3c2C)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161414",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ccc(NC(=O)C(=O)N[C@H](C)c2cccc(Cl)c2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53853",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)ncc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53154",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(OC)C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197434",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nn2ncc(C(=O)NCCc3ccc(OCc4ccccc4)cc3)c2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103210",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule c1ccc(Cn2nnnc2[C@@H](c2ccccc2)N2CC[NH+](Cc3ccncc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120170",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=[N+]([O-])c1ccc(-c2cc[nH]n2)cc1CS(=O)(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27690",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H]1CN(C(=O)c2cccs2)C[C@H]1C(=O)N1CCOCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63128",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)N1CCN(C(=O)NCc2cn3c(C)cccc3[nH+]2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177815",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H](C)Sc1ccc(N)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237916",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc2c(C)c(C(=O)N[C@@H]3c4ccccc4C[C@@H]3O)oc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197840",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCC[C@H](NC(=O)Nc1cnn(CC(N)=O)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116688",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=S)c1c(F)cccc1-n1cnc2ccccc21 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1-c1cccc(C(=O)N(C)C[C@@H]2CC[NH+](C)C2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218284",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nsc(N2CCN(Cc3cnn(-c4ccccc4)c3)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230672",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(NS(=O)(=O)c2cccc3nonc23)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ocnc1CNC(=O)N[C@@H]1CCCN(c2ccccc2F)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35644",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc(CNC(=O)COC(=O)c2ccc(C)c(C)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168579",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCC[C@H]([NH2+]C)c1ccc(OC)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157206",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCc1cccnc1-n1cccn1)[C@@H]1CCCN(C(=O)c2ccco2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205425",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(C[NH2+]C[C@@H]1COc2ccccc2O1)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107400",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)([C@@H](NC)c1cccc(F)c1F)[NH+]1CCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73383",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cscc1C[NH2+]CC(=O)NC1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccn2c(=O)c(C(=O)N[C@@H](C)C(C)(C)C[NH+](C)C)cnc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21631",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)cc(NC(=O)CNc2ccc(C(=O)NC(C)(C)C)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103291",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+]Cc1cnn(C(C)(C)C)c1)c1ccc2c(c1)NC(=O)CO2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225789",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCc1ccc(C(=O)N[C@H]2CCCc3ccccc32)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11293",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCO[C@H](C)C(=O)Nc1ccccc1OCC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218999",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cn1c(=O)c2c(nc(Cl)n2CC(=O)Nc2ccccc2OC(F)F)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13032",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)(C)c1ccc(C2(C(=O)OC[C@@H]3CCC(=O)N3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@](C)([C@@H](N)c1c(F)cccc1F)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216097",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C/[NH+]=C(/NCc1ccnc(-n2ccnc2)c1)NCc1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104911",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C#CCOc1ccc(F)cc1NC(=O)[C@@H](C)Sc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81236",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc([C@@H]2C[C@H](C(F)(F)F)n3nc(C(=O)Nc4ccc(Cl)cc4)cc3N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181137",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)C1=C([O-])C(=O)N(Cc2cccnc2)[C@@H]1c1ccc(C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103321",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](NS(=O)(=O)c1ccccc1)c1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1C[C@@H](c2ccco2)Cc2c1cnn2-c1ccccc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206036",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(C)cc(C(=O)NCCn2nc(-c3ccncc3)ccc2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59983",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(CCC1CC1)C(=O)c1ccc(C(=O)OC(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141538",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](O)[C@@H](C)c1ccc(C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87363",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(CNC(=O)Cc2c(C)c3ccc(O)c(O)c3oc2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16486",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1ccccc1)[C@H]1[C@@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]2[C@H]2C=CC=CN21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccc(N[C@@H](C)C[C@H]3CCC[NH2+]3)cc2s1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83173",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)Cn1c([C@H]2CC(=O)N(Cc3ccccc3)C2)nc2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87777",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCn1c(SCC(=O)NN)nnc1-c1ccc(C(C)(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227752",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@@H]1C[NH+]=C(N2CCN(Cc3cnnn3C)CC2)S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127437",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc2cc(C(=O)Nc3ccc4c(c3)C(=O)NCC4)c(=O)oc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181697",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH+]1CCC[C@@H](c2cnc(-c3ccccc3Cl)cn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98010",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2124",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1(C)C(=O)NC(=O)N1CC(=O)N[C@H]1CCC[C@@H]1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154725",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc(SCC(=O)NCCCN3C[C@H](C)O[C@H](C)C3)[nH]c2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156770",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H]1CC[C@](C#N)([C@H](O)c2ccc(Br)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210047",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2oc(C(=O)NCCc3ccc(F)cc3)c(C)c2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180748",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1cccc(OCC(=O)Nc2nc(-c3ccccc3)c(C(C)=O)s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136362",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NCCOCC(F)(F)F)N[C@@H]1C[C@H]1c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204271",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(S(=O)(=O)N(C)C)c(C)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217520",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CSc1cc(C(=O)O[C@@H](C)C(=O)Nc2c(F)cccc2F)ccc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187372",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1noc(C)c1NC(=O)N1CCN(Cc2ccccc2)C(C)(C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87024",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2nc3n(n2)[C@H](CC(=O)Nc2cccc4ccccc24)C(=O)N3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CCc1c([N+](=O)[O-])cc(C(=O)[O-])n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112659",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCCN1CCN(C(=O)c2ccc(-c3ccsc3)nc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170825",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COC(=O)c1ccc(/C=C(/C)CO)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1ncc(Cc2ccc(OC(F)(F)F)cc2)s1)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54079",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CN1C(=O)N[C@](C)([C@H]2CCC[NH+](Cc3cccc(C#N)c3)C2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235345",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCCC[C@H]2CCNC(=O)c2snnc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160409",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc([C@@H](O)C2(C#N)CCCCC2)c1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238083",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H](NC(=O)Cc2n[nH]c(=O)c3ccccc23)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87879",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule C#CC[C@H](OC(=O)Cn1cnc([N+](=O)[O-])n1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NC(=O)C(=O)NCC[NH+]2CCN(c3ccccc3)CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247847",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CCn1nnc2ccccc21)N1CCC[C@H]1c1nc2ccccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108699",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C[NH2+][C@H](C)c2ccc(C#N)cc2)c1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1-c1ccc(Cl)c(O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCn1nc(C)c(-c2ccnc(NCc3cnn(Cc4ccccc4)c3)n2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136714",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCC1(c2ccccc2)CCCCCC1)NNC(=O)[C@H]1CCCO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245873",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CC(=O)c2cc(F)c(C)cc2F)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171540",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cc1cc(Cl)c2c(c1)OCCO2)Nc1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233646",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CSCC[C@H](NC(=O)c1cc(Cl)nc(Cl)c1)c1nnc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133471",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1n[nH]c2ncc(C(=O)NC[C@@H]3COc4ccccc4O3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158441",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@H]1CCCc2ccccc21)c1ccc([N+](=O)[O-])s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35828",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C=CCNc1nc(N2CCCCC2)nc(N2CCCCC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1-c1nc(C(=O)Nc2cccc(C)c2C(N)=O)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201469",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)CC[NH+]2CCC(NC(=O)C3CC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1CCC(O)CC1)[C@@H]1C[C@@H]1c1cccc(Br)c1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123100",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc2c(s1)[C@H]([NH2+]CCOc1ccc(Cl)cn1)CCC2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1ccccc1Cl)N[C@H](CO)c1ccco1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6059",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1cc([C@H]2C[C@@H]2C(=O)OCC(=O)NC2CCCCC2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172657",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCN(Cc1cccs1)C(=O)N[C@@H](C)C(=O)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63310",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1cc([C@@H](C)[NH2+]C[C@@]2(O)CCOC2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122381",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(N2C[C@H](C(=O)N3CCN(c4nccn4-c4cccc(Cl)c4)CC3)CC2=O)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99489",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccn1)[C@H]1CCCN1C(=O)c1ccc(Cl)c(Cl)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227736",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=S)N2C[C@@H](C)O[C@H](C)C2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182068",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)Cc2csc(-c3cnccn3)n2)cc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228480",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Cc1ccccc1)NC(=O)c1ccc(Br)nc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208916",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)N1CCN(C(=O)C[NH+]2CCCC[C@H]2Cn2cncn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129962",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)c3ccccn3)cc2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204798",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)(C)c1cccc(NN)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216396",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1CCC[C@H](C)N1C(=O)[C@@H](C)[NH+]1CCN(CC(=O)N2CCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216900",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)/C(=C/c1cccc([N+](=O)[O-])c1)Cn1cncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109952",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H]1CCCc2c1cnn2-c1ccccc1F)c1ccc(N2CCOCC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33083",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(Br)c(COc2ccc(CC[NH3+])nc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58359",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@H](c1ccccc1)[C@@H]1CCCN1C(=O)CSc1nnnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68005",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)c2c1N[C@@H](c1ccc(C(=O)[O-])cc1)[C@@H]1CC=C[C@H]21 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211355",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)C1[C@@H](c2ccccc2)C(C(=O)[O-])[C@@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131680",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Oc1ccc2cc(-c3ccc(Cl)cc3)c(=O)oc2c1)[C@@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246587",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[NH+]1CCC[C@@H]1CN1C[C@H](C(=O)NCc2ccc(C(N)=O)o2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204463",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)n([C@@H]2CCCN(C(=O)CC[C@H]3CCCO3)C2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=S)N[C@H](NC(=O)N2CCOCC2)C(Cl)(Cl)Cl)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192910",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)Nc1ccc(NS(=O)(=O)c2ccc3oc(=O)ccc3c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81615",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(C)c(/C=N/NC(=O)COc2ccc([N+](=O)[O-])cc2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155666",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1[nH]ncc1CCCNC(=O)N[C@H](C)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245364",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc2c(c1)C(N1CCN(C(=O)c3ccccc3F)[C@@H](C)C1)=Nc1ccccc1O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61045",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CO[C@H](C)C(=O)N[C@H]2C[C@@H](C)N(c3ccccc3)C2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232373",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)N(Cc1cnn(C)c1)C(=O)[C@H]1CCC(=O)N(CCN2CCOCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120867",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CO[C@@H]1CCCC[C@H]1NC(=O)/C=C/c1cnc(C(C)(C)C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217716",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)C1CC[NH+](CC(=O)N[C@H](c2ccccc2)C2CC2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214353",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1cccc(N[C@H]2CSCC(C)(C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144889",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Clc1ccnc(CSc2nnc3n2CCCCC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214038",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(C)c(C[S@](=O)[C@H](C)c2nc(-c3ccccc3)no2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39227",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nn(C)cc1[C@@H](C)NC(=O)c1csc(-c2ccc(Cl)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143467",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1cc(C(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20921",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NC[C@@H]1COc2ccccc2O1)[C@H]1CCCN1C(=O)OCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203216",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCCCN1C(=O)C[C@@H]1C=CCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175496",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Clc1ccccc1-c1nc(Cn2nccc2-c2ccncc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94285",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C=C(C)C[C@@H](O)[C@]1([NH+](C)C)CCC[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10540",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(CC(=O)Nc2sc3c(c2C#N)CCCCC3)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129696",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C#N)c(SCC(=O)Nc2ccccc2SCC#N)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192987",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncn(C[C@@H](C)[NH2+]CC(C)(C)c2ccccc2Cl)c1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97812",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(C)c(S(=O)(=O)N(Cc2ccco2)Cc2cc3cccc(C)c3[nH]c2=O)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165186",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CNS(=O)(=O)Cc1ccccc1CNC(=O)c1c(-c2ccccc2)noc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117958",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCCNc1ncc(C[NH+]2C[C@H](C)C[C@@H](C)C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6629",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](C(=O)N1CCCCC1)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224089",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)c1ccoc1)C(=O)N[C@H](C)c1noc(Cc2ccccc2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70286",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(C[C@H]1CCS(=O)(=O)C1)OCc1nccn1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187080",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1c(S(=O)(=O)Nc2ccc(C)c(F)c2)sc2c1CCN(C(=O)c1csnn1)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88142",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a thiol from the molecule OC[C@@H]1CCCC[NH+]1CCS .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25481",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [O-]c1nc(N2CCc3ccccc3C2)nc2ncn(-c3ccc(Cl)c(Cl)c3)c(=S)c12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225583",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)c1nc(C[S@](=O)CCCCC#N)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67389",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(CC(=O)c2ccc(F)c(F)c2F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244994",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(NC(=O)C2=CN(C)[C@H]3C(=O)N(Cc4ccccc4)C(=O)N=C23)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133265",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)c2ccccc2CSc2nc3ccccc3[nH]2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122626",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccccc1-c1cc(C(=O)NCC(C)(C)C[NH+](C)C)c2cnn(C(C)C)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40756",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=O)N(C)Cc2[nH+]ccn2C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248645",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccccc1NC(=O)C[C@H](c1ccccc1)C(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228989",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCO[C@H](C)c1nc(CC(=O)Nc2cccc(-c3cn[nH]c3)c2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61863",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccn(Cc2ccc([N+](=O)[O-])cc2Br)c1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126104",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(Br)cnc1N1CCC[C@H]1CCC[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137979",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H]1CCN(CCc2ccc(F)cc2C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc(NC(=O)c2cc(C3CC3)nc3c2c(C)nn3C(C)(C)C)ccc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(Cl)cccc1NC(=O)C(=O)N[C@H]1C[C@@](C)(OC)C1(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181435",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(N(C)C)sc1C[NH+]1CCC[C@@H](CC(N)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(/C(C#N)=C/c2ccc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)o2)nc2ccccc21 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56649",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(O)CC[C@H]1C[C@@H](C(C)(C)C)CCC1=O by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35125",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[NH+]1CCN(c2ccc(N3CCC[C@H](C(=O)NCc4ccccc4)C3)nn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171041",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)c1cccc(CNC(=O)NCC2(N3CCOCC3)CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1nc(C(=O)Nc2ccccc2OC(F)(F)F)ccc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237918",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule NC(=O)C(=O)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144587",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COC(=O)c1ccc(CSCCO)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34456",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Oc1ccc2c(c1C)O/C(=C\\c1cccc([N+](=O)[O-])c1)C2=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38328",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(Cl)cnc1COC(=O)c1cc(Cl)c2c(c1)OCCO2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235954",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@@H](C#N)[C@H](O)[C@H]1CC=CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98989",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC(=O)N1c2ccccc2NC2=C(C(=O)CCC2)[C@@H]1c1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2699",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(C(=O)NC[C@@H]2CCCC[C@@H]2C[NH3+])cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17480",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCCC[C@@H]1NC(=O)C[C@H]1OCCc2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50098",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1cc(/C=N/NC(=O)COc2cc(C)c(Cl)c(C)c2Br)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154462",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N(C(C)=O)c1ccccc1/C=C1/CCOC1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74420",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(OCCNC(=O)N[C@@H]2CCC[C@@H]([NH+](C)C)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67834",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOC(=O)c1noc2nc(C)nc(NCCC3=CCCCC3)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]1C[C@@H]([NH2+]Cc2ccccn2)CCN1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212051",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCO[C@@H]1CCC[NH+](CC(=O)N(C)[C@@H](C)c2ccc(Cl)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85152",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc2c(c(C)c1CCC(=O)NCc1ccc(=O)[nH]c1)c(=O)[nH]n2C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211623",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCN(C(=O)N[C@@H]2CCC[C@@H]2c2ccc(F)cc2)C[C@H]1O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133690",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C1N[C@H](c2ccc(Cl)c(F)c2)Nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35983",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH3+])C(=O)N[C@H]1CCCC[C@H]1[NH+](Cc1ccccc1)C1CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237623",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(COCc1nc2ccccc2s1)Nc1ccccc1N1CCCC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33463",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)C(=O)N1CCN(Cc2ccc(-c3nc4ccccc4s3)o2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)cc1)N[C@@H]1CCN(Cn2nccc2-c2ccncc2)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51652",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([C@@H]2CC=CC[C@@H]2[N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177249",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nc(C(=O)N[C@H](C)c2ccc(Cl)cc2Cl)n[nH]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17561",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C=CCc1cc(/C=N/NC(=O)Nc2ccc(F)cc2)cc(OCC)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182984",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(O[C@H](C)C(=O)Nc2cc([N+](=O)[O-])ccc2C)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63740",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1nc(C)c(NC(=O)N2CCC[C@H]2c2cccc(C)c2)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "797",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CN1CCCOC1=O)NCCc1nc(C(F)(F)F)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153213",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@H](C)N1C(=O)CCC(=O)N1[C@H](C)CCC[C@H]1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164211",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1ccc(F)cc1)N1CCN(Cc2cnc3ccccn23)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89730",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCN(CC1CC[NH2+]CC1)C(=O)Cc1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189242",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(C(C)=O)cc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244882",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule Cc1ccccc1OCC(=O)N1CCN(c2ccc([N+](=O)[O-])c(N3CCOCC3)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87469",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)NC(=O)CN(C)C(=O)CCc1nncn1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159737",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)cc(Nc2ccc(Cl)cn2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170411",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nc(C)c(C(=O)C2=C([O-])C(=O)N(CCc3ccccc3)[C@@H]2c2ccc(F)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243084",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c(C)c1CC(=O)[C@@H](C#N)c1ncc(C(F)(F)F)cc1Cl by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@]1(CSc2ccccc2C(=O)N2CC[C@H]3CCCC[C@@H]3C2)NC(=O)NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CNS(=O)(=O)c1ccc(-c2ccc(OC)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211065",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCc2nc3sc4c5c(c(=O)[nH]c4c3cc2C1)[C@@H](c1ccc(F)cc1)C(C#N)=C(N)O5 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nc(CC(C)(C)C)cc1NC(=O)C(=O)N[C@H]1C[C@H]1C1CCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197734",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)Nc1ccccc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205955",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCCc1cc(NC(=O)c2ncccc2C(F)(F)F)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158609",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(NC[C@@H]1Cc2cc(F)cc(-c3ncccn3)c2O1)c1noc2c1CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213711",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C#N)c(N[C@H]2CCc3cc(N)ccc32)n1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22661",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nnc(NC(=O)Cc2ccccc2)s1)Nc1ccc2c(c1)OCCO2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88137",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2nnc(SCC(C)=O)n2C2CCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82097",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule C[S@](=O)c1ccc(CNc2cc(C#N)nc3ccccc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6612",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[NH+](CC)Cc1nc(C2(NC(=O)C3CC=CC3)CCCC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234369",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(C)/C=C/C(=O)c1ccc(Sc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35049",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(C[S@](=O)Cc2coc(-c3ccc(F)c(F)c3)n2)n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccoc1C(=O)N1CC[NH+](Cc2ccc3c(c2)OCCO3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54338",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1OCC[C@@H]1C(=O)c1ccc(Br)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21679",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CO[C@@H](C)C(=O)NNC(=O)CNc1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccc(Cl)cc1)S(=O)(=O)c1ccc(O)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172490",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(N(CCOC(=O)c2cccnc2)C2=NS(=O)(=O)c3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7789",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccnc1)C(=O)NC[C@@H](c1cccs1)N1CCc2ccccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159075",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](N[C@H](C)CC(=O)N1CCCCCC1)C(=O)OC(C)(C)C by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43439",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCNC(=O)[C@@H]1CCO[C@H]1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159851",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccccc1[N-]S(=O)(=O)c1cc(-c2nc(C)c(C(=O)N3CCCC3)s2)n(C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207014",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(N/N=C2/C[C@H](c3ccccc3)Oc3ccccc32)nc(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H](NC(=O)NC[C@@H](C)N2CCOCC2)C(C)C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246971",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=C(NNc1cccnc1Cl)c1sccc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H]1COc2ccccc2O1)c1cc(-c2ccco2)nn1-c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129334",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NC(=O)CCNC(=O)N[C@@H](C)C(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132763",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[S@@](=O)c1ccc(CNC(=O)NC[C@@H](O)c2ccc(F)cc2)cc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97442",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)C[C@H](C)O1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1C(=O)[C@H](CC(=O)Nc2cc(Cl)ccc2C)S/C1=N\\c1ccc(S(N)(=O)=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242161",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)[C@H]2CC[C@@](O)(C[NH3+])[C@@H]1C2 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238273",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccc(NC(=O)[C@H]2CCN(C(=O)OC(C)(C)C)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47360",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1C[NH2+]CC[C@@H]1c1ccc(OC)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153544",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)CCCNc1ncnc2ccccc12 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30936",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCC(C)(C)c1ccc(OC[C@H](C)C[NH3+])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14543",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@]12CN(Cc3ccccc3)C[C@@H]1NC(=O)c1ccccc1[C@@H]2[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119600",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC[C@H](C#N)OC(=O)c1ccn(-c2ccccc2Cl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153759",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CCNC(=O)C[C@H](O)c2cccc(F)c2)c(C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124408",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)Cc1ccc([C@H](C)c2nn3c(-c4ccccn4)nnc3s2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37791",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule F[C@H]1CCCC[C@@H]1Br by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47226",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@H](CNC(=O)N[C@@H]1CCc2c(O)cccc21)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC[C@@H]1CN(C(=O)c2ccc(=O)[nH]c2)C[C@H]1[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140986",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18784",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)[C@@H](C)Cc2ccccc2F)c(C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30862",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1[C@H](Oc2ccccc2)[C@H](c2cccs2)N1Cc1ccc2c(c1)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159455",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C[C@H](NC(=O)N[C@@H]1C[C@@H]1C)c1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN/C([O-])=N/S(=O)(=O)c1ccccc1-c1ccccc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C#CCOC(=O)c2cn(C)nc2C(C)(C)C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55314",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc(Cn2nnnc2CN2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81015",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1730",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN1CC[C@H](CNC(=O)Cn2ccc(=O)[nH]c2=O)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246966",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](CNC(=O)NC[C@@H]1CCC[C@H](O)C1)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168204",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[NH2+][C@]1(CO)CC[C@H](Sc2nnc3ccccn23)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218715",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(c1)=[NH+][C@@H](C(=O)N1CCC([C@H](C)C(=O)NCc3ccc(Cl)cc3)CC1)C=2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52961",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H](C[NH+]1CCC(Oc2ccccc2)CC1)c1cccc(Cl)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95187",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc([C@@H](C)NC(=O)c2cccc(-n3cccn3)n2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@H]1NC(=O)Nc1cccn(Cc2ccc(F)cc2)c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217222",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1C(=O)[C@@H]1CCOC2(CCOCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47475",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a thiol from the molecule Sc1sccc1/C=N/c1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108025",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](NC(=O)C(=O)Nc1ccc2c(c1)COC2)c1cccc(-n2cccn2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181573",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(C(=O)O[C@@H](C)[C@H]2CCCO2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30115",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)C1=C(C)C(C(=O)NCc2ccc(-n3ccnc3)cc2)=N[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1[NH2+]CC[C@@H]1C(=O)Nc1cc(F)cc(F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67168",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(/C([O-])=N/c1ncnn1C)[C@@H]1CCCN(c2ccccc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228884",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2csc(CNC(=O)c3cc(C)no3)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70664",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2nnn(CC(=O)N[C@H]3CCCn4c(C)nnc43)n2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCc1ccon1)c1cc2ccccc2c(Cl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42099",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Cn2ccc3cc(CO)ccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29706",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(CNC(=O)NC2CC[NH+](C[C@@H]3CCOC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182253",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(N2CCCC2=O)ccc1Cl)N1CC[C@@H]([NH+]2CCCC2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166655",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCCCNC(=O)[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223080",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)(C)c1csc(C[C@H]2CCC[C@H](Br)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57771",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NC12CC3CC(CC(C3)C1)C2)c1csc(-c2cnccn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164202",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC1CC[NH+](CCNC(=O)c2cc(C)n(-c3cc(C)on3)c2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39666",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [O-]/[N+](=C\\c1ccc(O)cc1)c1ccc(Cl)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11174",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC1(C)CCC[C@@H](Sc2ccc(Cl)cc2)[C@H]1[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42120",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CC(=O)Nc2cc(C(=O)O[C@@H](C)C3CC3)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17225",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(CCc1ccccc1)C(=O)c1ccc[n+]([O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64378",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC(C)[C@H](C(=O)N(C)C[C@H]1CCC[NH+]1C)/C(N)=N/O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102389",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(C)(C)[C@@H]1CCCN1C(=O)c1cnc2sc(C)cn2c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(NC2=NCCS2)c(=O)n(-c2ccccc2)n1C by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141860",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(N2CCN(C(=O)C[C@@H]3C(=O)NCC[NH+]3C3CCCC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](NC(=O)[C@@H]1CCO[C@@H]1C)C(=O)NC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217536",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C1NCC(=O)N2CCN(C(=O)c3cnnn3-c3ccccc3)C[C@@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C(=O)N/N=C/c2cc3ccc(C)cc3nc2Cl)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234504",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CC[C@H](Sc1nnnn1-c1ccc(Cl)cc1)c1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98073",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNc1cc([C@H]2CCCN(C(=O)CC(C)(C)C)C2)nc(-c2cccnc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(Br)cccc1C[NH2+]Cc1ccco1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103706",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOc1ccc(C(=O)N[C@@]2(C)CCS(=O)(=O)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244320",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH2+]C[C@@H](O)CN(C)C[C@@H]1CCC[NH+]1C by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91206",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](Oc1ccccc1)C(=O)Nc1cccc(C(=O)Nc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32658",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[S@](=O)c1ccc(C[NH2+]C[C@H]2CN3CCCC[C@@H]3CO2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101939",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCN1CCN(C2CCN(S(=O)(=O)c3ccccc3CC)CC2)C(=O)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130454",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cn1cnnn1)NC1(c2cccc(C(F)(F)F)c2)CCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244746",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCC[C@@H](NC(=O)c1ccc(Cl)c(OC)c1)C(=O)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134045",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "522",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)[C@@H]1CCCC[NH+]1Cc1cc(C#N)cs1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209263",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(O[C@@H](C)C(=O)NC(N)=O)c(C=O)n1 by removing a aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96247",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCc1cccc(CC)c1NC(=O)CSc1nnc(-c2ccc(F)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221173",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)C[C@@H]2CCCc3ccccc32)C[C@@H]1O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cccc(N[C@H]2CS[C@@H](C)C2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cn1ncn2nccc2c1=O)N1CCC[C@@H](n2cncn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226564",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Cc1ccc(Cl)cc1)N1CCC[C@@H]1c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206333",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cc1ccncc1)NNC(=O)N[C@@H]1CCCC[C@H]1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48367",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[NH2+][C@@H](COC(C)C)c1ncc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50495",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OC1=Nc2c(cnn2Cc2ccccc2)[C@@H](c2ccc(F)c(F)c2F)SC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206578",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NCc1nc(-c2cccs2)n[nH]1)c1cc2cccc(Cl)c2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86493",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NC1C2CC3CC(C2)CC1C3)C1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]1CN(C(=O)c2ccc(-c3ncon3)cc2)C(C)(C)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56851",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#Cc1csc(C(=O)Oc2ccc(Br)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102071",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Oc1cccc(C[NH+]2CCC(n3cc(-c4ccccc4)nn3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29420",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule ClC[C@@H]1CCO[C@@H]1c1cc(Br)c(Br)o1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104933",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule O=S(=O)(Cc1cccc(F)c1)N[C@@H](CO)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239221",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(/C=C(\\C#N)C(=O)Nc2ccc(Cl)cc2Cl)cc(OC)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75746",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(CC1CC[NH2+]CC1)C[C@H](C#N)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209211",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCN(CC)C(=O)[C@@H]1CCC[NH+](C2CCN(CCc3ccccc3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91422",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cccs1)C(=O)c1cc(C2CC2)nn1-c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56703",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(C)c(OCC(=O)N(C2CCCC2)[C@@H]2CCS(=O)(=O)C2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[NH+](CCNC(=O)c2ccc(C(F)(F)F)cc2[N+](=O)[O-])C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156009",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)c1ccc(Oc2snc(Cl)c2C#N)cc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97780",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccccc1OCC(=O)NNC(=O)[C@@H](C)N1C(=O)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137060",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)N/N=C\\c3cccn3C)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121388",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(-c2noc([C@H]3CC(=O)N(c4ccc(C)c(F)c4)C3)n2)cc(OC)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168013",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncccc1C(=O)NCCCO by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71457",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCC[C@H]1CN(Cc2ccc(CSC(F)F)o2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136712",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1cccc(-c2noc(C3CCC3)n2)c1)Nc1ccc(F)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171517",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNC(=O)CN(CCC)C(=O)c1cc(C)ccc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239206",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule [NH2+]=C(C1CC1)N1CC[NH+]2CCCC[C@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134140",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](C(=O)N(C)C1CCCCC1)[NH+]1CCC(C(=O)N2CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69200",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(Cl)nc1)c1ccc(Br)c(F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=S(=O)(NCc1nnc2c3ccccc3c(-c3ccc(Cl)cc3)nn12)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12694",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cccc(C(C)C)c1NC(=O)[C@H]1CC(=O)N(c2cc(F)cc(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207120",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]C1CCC(n2cc(C(=O)NCc3nc(C4CCCCC4)no3)nn2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63388",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nc(N2CCOCC2)cc(N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(C(=O)Nc2ccccc2N2CCCC2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38105",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](NC(=O)C(=O)Nc1ccc(CC#N)cc1)c1ccc2c(c1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127268",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCC[C@@H](C)NC(=O)N1CCN(c2ncccc2C#N)CC1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179949",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(CCS(=O)(=O)c1ccc2ccccc2c1)N1CCN(Cc2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154909",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCn1cc[nH+]c1CN1CCN(CC(=O)NC(=O)NC2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2C(=O)N[C@@H]3CCN(C(=O)CC4(CC(=O)[O-])CCCC4)[C@@H]3C2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148388",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1c(O)n[nH]c1C(=O)NN=Cc1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141609",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(CSc1nnc(Cc2cc(=O)[nH]c(=O)[nH]2)n1-c1ccc(Cl)cc1)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101320",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule N#Cc1cccc([N-]S(=O)(=O)c2ccc(-c3cc(C(F)(F)F)n[nH]3)s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138918",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CCNC(=O)c2ccc(-c3nc4ccccc4n3C)s2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233423",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CSCCn1cnc(-c2cccc([N+](=O)[O-])c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14405",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2nnc(C[NH+]3CCC[C@H]3C[NH+]3CCC[C@@H]3CO)o2)cc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17967",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1c(C#N)c(NC(=O)CN2C[C@@H](C(N)=O)Oc3ccccc32)n(Cc2ccco2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144588",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(O[C@@H](C)C(=O)N2CC[C@@H](C(=O)[O-])[C@@H]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22594",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)C[C@H](NC(=O)NCc2cccc(C#N)c2)[C@@H]1c1ccc(Cl)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29621",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCN(Cc1ccccn1)c1ccc(F)cc1CC[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141561",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc([C@H]2NC([S-])=NC3=C2[NH+]2CCC3CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129575",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCc1cc(-c2ocnc2CCl)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186714",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)c1ccc(S(=O)(=O)NC[C@@H]2CC[NH+](C3CC3)C2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccccc1NCc1c(C(C)C)nn(C)c1N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113995",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC)[C@H]1CCN([C@@H](C)C(=O)N[C@@H](C)c2ccc3c(c2)OCCO3)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123992",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)c1nc(C(=O)Nc2ccc3c(c2)OCCO3)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48960",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(NCc1nncn1C1CC1)Nc1cccc(Cl)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28910",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCCN(CCO)C(=O)N[C@H]1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238904",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(NC(=O)[C@H](C)SCc2cccc3c2OCCO3)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212301",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(C2=CCN(C(=O)c3ccc(F)c(F)c3F)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101425",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(NC(=O)CC(C)C)c(C)cc1I .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/[NH+]=C(/NCc1cccc(F)c1)NCC(C)(C)N1C[C@H](C)O[C@H](C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35114",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)NC(=O)c1cccc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83042",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCn1c([S-])nc2cc(C(=O)NCc3cccs3)ccc2c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC(=O)N[C@@H](Cc1cc(Br)c(O)c(Br)c1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50038",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCN(C(=O)C(=O)Nc2ccnn2C(C)(C)C)C[C@H]1n1cc[nH+]c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144878",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2c(-c3cccs3)c(C)nn2c(NCC[NH+](C)C)c1C by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202932",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1ccccc1F)N1CCN(CCn2cc[nH+]c2-c2ccccc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127024",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCOC(=O)CCC(=O)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125253",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](C(N)=O)N1CCN(c2nccc(Oc3ccc(F)cc3)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59078",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H]1CCCO1)[C@H]1CC(c2ccc(Cl)c(Cl)c2)=NO1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182793",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)(C)CC(C)(C)NC1=[NH+]CCN[C@H]1C(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159495",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CO[C@@H](C(=O)NCc1n[nH]c(=S)n1C(C)C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43340",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cccc1CN1CCc2c(Br)cccc2C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193497",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc[nH+]c1C[C@@H]1CCCN(C(=O)C(=O)Nc2cccnc2Cl)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195963",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1c(CN2CCN(C(=O)C3CCCCC3)CC2)nc2cc(NC(=O)c3cccs3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C/C(=N\\N)c1cccc(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177256",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)C(=O)NCC(C)(C)[C@@H](O)c2ccccc2)c1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214575",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(C(=O)Nc2ccc(CC(=O)N(C)C)cc2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185813",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(CCCNC(=O)N[C@@H](c2ccccc2)c2ccco2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198029",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1C[C@@H](C)N(C)C(=O)[C@H](C)NC(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168007",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSC[C@@](C)(O)CNC(=O)c1cc(-c2ccccc2)on1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174889",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H](CO)NC(=O)NC[C@H](C)Oc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134808",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(-n2nnc(-c3nc(-c4ccccc4F)no3)c2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184467",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)cc(C(=O)N[C@@H](CCc2ccccc2)c2ccc3c(c2)OCCCO3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](OC(=O)[C@H](C)N1C(=O)c2ccccc2C1=O)C(=O)c1ccc(F)c(F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27014",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)C(=O)Nc1c(-c2cccs2)nc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103798",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(Cl)c(NC(=O)c2csc(C#CCN)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151247",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(Br)c([C@H]2CC(=O)NC3=C2C(=O)C[C@@H](c2ccc(C)cc2)C3)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96067",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCCOc1ccc(C(=O)Nc2[nH]nc(C)c2N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89904",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)c1c(NC(=O)c2ccc(F)cc2)sc(C(=O)N[C@H](C)c2ccccc2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226968",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@H]1CC(=O)N(CCN2C[C@H](C(=O)[O-])CC2=O)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161024",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)C[C@H](NC(N)=O)C(=O)N1CCc2ccc(Cl)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190473",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc2nc(NC(=O)CN(C)S(=O)(=O)c3cccs3)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47748",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C/C(Cc1ccccc1)=N\\NC(=O)CNC(=O)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198441",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(CCCN1CC[NH+](C)CC1)C(=O)C1(c2ccc(Cl)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175739",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CCN(C(=O)COC/C=C/c2ccccc2)C[C@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135873",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cc(C)n(-c2ncnc(N3C[C@@]4(C)C[C@@H]3CC(C)(C)C4)c2N)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156041",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCC12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3cc(C(C)=O)ccc3OC)C(=O)[C@@H]12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc([C@H]2[NH2+]CCc3c2[nH]c2ccccc32)cc(OC)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136751",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Oc1ccc(-n2cnnn2)cc1)c1cccc(N2CCCC2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165548",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc([C@H]([NH2+][C@@H](C)c2ccc(OC)cc2F)C2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58020",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@@H]1CN(C(=O)Cc2ccsc2)C[C@H]1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81235",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CC(C)(CNC(=O)C(=O)Nc1nn(C(C)(C)C)cc1C#N)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242442",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(N/N=C/c1ccc(N2CCCCCC2)o1)c1cc2ccccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144255",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(CN[C@@H](C)C#N)cc(C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24665",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](c1cccc(O)c1)[NH+](C)C[C@@H]1C[C@@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116233",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)NCCc2csc3nc(-c4cccs4)nn23)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115504",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCc1nnc(NC(=O)c2cc(=O)c(OCc3ccccc3)co2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136296",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c(C[NH+]2CCN(c3ccccc3F)CC2)coc2ccc(Cl)cc12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(=O)c(C(=O)NC(C)C)nc2cc(C)c(C)cc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137537",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=C1OCC[C@H]1N1CCc2ccc([N+](=O)[O-])cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77662",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(COc1ccccn1)NCc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2030",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(CCC#N)C(=O)c1cnn(Cc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170322",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2C(C(=O)Nc3ccccc3)=C(C)Nc3nnnn32)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195330",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1c(NC(=O)Nc2cccc(NC(C)=O)c2C)c(C)nn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1-n1ncc2c1CC(C)(C)C[C@@H]2[NH2+]Cc1ccc(C#CC(C)(C)O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226995",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(S[C@H]2CCC[C@@]([NH3+])(CO)C2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](NC(=O)c1ccccc1NC(=O)OCc1ccccc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202890",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@H]1COC[C@@H](C)N1C(=O)c1cc(Cl)c2ccccc2c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145203",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CCc1ccccc1NC(=O)CSC1=C(C#N)[C@@H](c2ccc3c(c2)OCO3)[C@H]2C(=O)CCCC2=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25039",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)NS(=O)(=O)c1ccc(NC(=O)CCC2CCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2907",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(c1cnns1)N1CCC[C@@H]1c1cccc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120556",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1[nH+]ccn1CCNC(=O)C1(Cc2cccc([C@H]3CCC[NH+](C)C3)c2)CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197490",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(C)c1NC(=O)CS[C@H](C)c1cc(F)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103407",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H](Cc1ccsc1)N(C)C(=O)NCc1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60307",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H]1C[NH+](CCOc2ccc(CC[NH3+])cc2)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6972",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C(CS[C@H]1NN=C(c2cccs2)O1)C1=CC(C(=O)N2CCCC2)=NC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33675",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NCc1ccnc(OCC(F)F)c1)NC1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113655",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1ccc(S(=O)(=O)N2CCC[C@@H](CNC(C)=O)C2)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105227",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C(=O)NCC2CCN(S(=O)(=O)C3CC3)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147992",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(SCC(=O)Nc2ccc(C(=O)N(C)C)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ncccc1CNC(=O)CCC1CCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40936",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C#CCNC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11086",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)Nc2ccc3c(c2)OCCO3)sc2ncn(Cc3ccccc3F)c(=O)c12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225146",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C/C(=N\\NC(=O)[C@H](C)Oc1ccc(Cl)cc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141356",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCC(=O)N(CCC(N)=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176311",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C=CCn1/c(=N\\C(=O)Cc2ccc(S(=O)(=O)CC)cc2)sc2cc3c(cc21)OCO3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186870",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc2c(c1)[C@H]([NH2+]C[C@@H]1CCC(=O)N1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152851",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)NCc1cccc(OCc2ccccc2)c1)C1CCS(=O)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169978",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CN(C(=O)c2cccc(-n3cccn3)c2)CC[S@]1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80021",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=C(C#N)C#N)s/c(=C/c2ccc(F)cc2)c1=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178182",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(CCNC(=O)N[C@@H]1CCCC[C@@H]1CO)NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89380",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N/C(=N/c1ccccc1)S[C@@H]1CC(=O)N(c2ccc(F)cc2)C1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200159",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cn1cnc(Cl)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCCOc1cccc(C[NH2+]C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90349",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CC[C@H](N(C)CC(=O)NC(=O)Nc2ccc(C)c(C)c2)[C@H](C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70812",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCN(CC(C)(C)O)C(=O)Cc1ccc(C[NH3+])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22664",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1csc(CN(C)C(=O)C=C2CCSCC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108102",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(c1ccc(Br)cc1F)c1ccccc1C[N+]1=CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188740",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]([NH3+])c1cc(F)ccc1OC[C@@H]1Cc2ccccc2S1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112978",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(C[NH+](C)Cc2ccccc2-c2ccccc2)c(=O)n(C)c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210784",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)N[C@@H](C(=O)O[C@H](C)c1nc(C)no1)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89410",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)NCCn2ncnn2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198023",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule N#Cc1cnc(S[C@@H](C(=O)Nc2ccccc2)c2ccccc2)nc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1nn(C)cc1NC(=O)c1cnc2onc(C)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241793",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)NC[C@@H]1CCO[C@@H]1C(C)(C)C)[C@H](C)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63634",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1c(C(=O)OCc2cccc(Cl)c2)oc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188777",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1ccc(F)cc1)c1cccc(-n2cnnc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14535",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=S1(=O)C[C@@H]2[C@@H](C1)N(c1cccc3ccccc13)C(=S)N2c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238638",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nn(C)c(C(=O)N/N=C/c2ccccc2)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H](CN1CC[NH+](C/C=C/c2ccccc2)CC1)c1ccc(Cl)cc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31450",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CC[C@@H]1NC(=O)NC1=O)NCc1cn2cc(Cl)ccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35177",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCNC(=O)CNC(=O)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]([NH2+]Cc1ccc(-n2ccnc2)cc1)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2cc(NS(=O)(=O)c3cccc(C#N)c3)ccc2o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110935",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)CNS(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1C by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)NCc1ccc(C(=O)N(CC2CC2)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107663",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCc1ccccn1)[C@@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243485",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CNc1nc2ccccn2c(=O)c1/C=C1\\SC(=S)N(C[C@H]2CCCO2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234268",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](c1ccccc1)N1C[C@@H](c2nc3ccccc3n2CC(=O)N2CCOCC2)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143595",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule NC(=O)CCCOC(=O)c1ccc(F)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(Nc2nc(C)cc3nn(CC(=O)NCc4ccco4)c(=O)n23)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161939",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)C[C@H](C)S[C@H]1CCN(c2c(F)cccc2F)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12215",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CNC(=O)[C@H](C)Sc1nnc(-c2c[nH]c3ccccc23)o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1-c1c(C2C(C)(C)C2(C)C)noc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145517",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(-c2ncon2)cc1)c1cccc(Br)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132169",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccc2c(c1)CCO2)N1CCC[C@@H]1c1nnc2ccccn12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137146",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCc1ccc([C@H](C)NC(=O)CSc2nnc(-n3nc(C)cc3C)n2N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128950",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCC(=O)N1CSC[C@H]1C(=O)N[C@@H](CC)c1c(C)nn(C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136008",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H](C)Sc2ncn[nH]2)c(C)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157647",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@H](Nc1nc2nonc2nc1NCc1ccccc1)c1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70839",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C)c(N)cc1S(=O)(=O)N[C@H](C)CCC(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192971",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@@H](COC)C1(c2ccccc2)CCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102826",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule COC(=O)CN(CC#N)S(=O)(=O)c1cc(C)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116941",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)(NS(=O)(=O)c1ccc(OC)c(F)c1)C(=O)[O-] by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166967",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CCN(CC(C)C)C(=O)c1ccc(Cl)nc1Cl by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123568",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](C(=O)N[C@H](CC(N)=O)C1CCCCC1)n1nnc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176440",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule N#CCC(=O)c1ccc(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45324",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(C)[C@@H]1CCC[NH+](C[C@@H]2C[C@@H]2c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29489",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=C/c1ccccc1)/C=C1/N=C(c2cccc([N+](=O)[O-])c2)OC1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216602",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[NH+](CC)CCNC(=O)N(C)Cc1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106068",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1noc(C)c1S(=O)(=O)NCCn1nc(-n2ccnc2)ccc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=CCNC(=O)NC(=O)[C@H](C)N1CC[NH+](CC2CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc([C@H](CO)NC(=O)[C@H]2CCCN2C(C)=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43647",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@](Nc1ncc([N+](=O)[O-])cc1Br)(C(=O)[O-])C1CC1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)(C)c1ccc(C(=O)N2CCN(c3c(Cl)cccc3NC(N)=S)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94272",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)cc1C(=O)N[C@@H](CC)c1ccccc1O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110774",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCSc1ccccc1)N1CCC[C@@H](c2nnc3ccc(C(F)(F)F)cn23)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40867",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(C(=O)NCCn2nc(-c3cccnc3)ccc2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248001",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](c1ccc(F)cc1F)[NH+]1CCC[C@H](C(=O)Nc2ncccc2C)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213838",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(CSc1nnc(NC(=O)c2ccccc2)s1)NCc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1noc(CC)c1CC(=O)Nc1ncc(C)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106308",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc(CSc2nc(-c3ccccc3)c[nH]2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170332",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC1(C)[C@@H](NC(=O)c2ccc(Cl)c3cccnc23)[C@@H]2CCO[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(CN3CCN(C(=O)[C@@H]4C[C@@H]4C)CC3)cc(=O)oc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121901",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)N(C)C(=O)[C@H](C)SCc1ccnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177098",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(C)OC(=O)N1CCC[C@H]1CCC(=O)NNc1cccnc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146119",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)N[C@H](C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192843",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CNC(=O)[C@H](CC(C)C)NS(=O)(=O)c1ccc(F)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63840",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1(C)C(=O)NC(=O)CN1Cc1cccc(N)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10942",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Oc2ccc(C#N)cc2)ccc1NC(=O)N1CCc2ccccc2C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138562",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(C)C)c(OCC(=O)Nc2nc(C[NH+]3CCCCC3)cs2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244054",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(CC(=O)N[C@H]2C[C@@H]2c2cccc(F)c2)c(C)c1[N+](=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200932",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(SCC(=O)c2cc(C)n([C@@H]3CCS(=O)(=O)C3)c2C)c(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99992",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCCCC[C@@H]1Nc2ccc(F)cc2[C@H]2OCCC[C@@H]12 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14083",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@](C)([C@H](O)c1ccccc1)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule N#CCCCn1ccc(NC(=O)Cc2cccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73528",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCN(C(=O)[C@@H](C[NH3+])CC(C)C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140964",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(N/N=C/c1ccco1)c1ccc2[nH]cnc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184741",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=S(=O)(c1cn[nH]c1)N1CCC[C@H](c2cccc(-c3cccc(F)c3)n2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165063",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CCN(c2nc(NC[C@@H]3CCCO3)c3ccccc3[nH+]2)CC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32242",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)N(C1CC1)[C@H](C)C1CC1)c1ccc(-c2ccncc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60509",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC[C@@H](C)NC(=O)[C@H](C)C[NH2+]C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64813",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc(C(=O)OCC(=O)Nc2cccc(C(C)=O)c2)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39954",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCC[C@@]1(C)C[NH+]=C(N)N1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97204",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)C[C@@H](C)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58745",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)[C@H]1C[NH+](Cc2ccco2)CCN1C(=O)c1ccc(Cn2cccn2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246768",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN(C)c1c(Cl)cccc1NC(=O)CCCCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95523",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(COC(=O)Cn1nc([O-])c2ccccc2c1=O)Nc1c(Cl)cccc1C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203730",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccc(C(=O)NC[C@H]2CCCO2)c1)Nc1ccc(F)c(F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179551",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(C(=O)N2CCC(c3cc(=O)cc(C)[nH]3)CC2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178734",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccccc1[C@H](C#N)NC(=O)[C@H]1CC(=O)N(C(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94345",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1c(SCC(=O)N2CCCCCC2)nnc1-c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105741",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)[C@H]1C[C@H]2CCCC[C@H]2N1C(=O)c1ccc(-c2nc(C)no2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24590",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCSc1nc(N)c(C#N)cc1C#N by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1400",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C1N[C@H](c2ccc(F)cc2)C(C(=O)c2cccs2)=C1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COC[C@@H](C)n1c(CCCl)nc2cc(C)cnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180107",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)NCCn1c(SCC(=O)[O-])nc2cccnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2634",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule CCNc1nnc(Sc2ccc(C(=O)NC3CC3)cc2[N+](=O)[O-])s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1c([C@@H](C)NC(=O)CCc2nc3ccccc3s2)cnn1-c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206477",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCO[C@@H](C)c1nc(CNc2cccc(-n3nnnc3C)c2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8807",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)C[C@H]1CCCCCN1C(=O)[C@@H]1CCS(=O)(=O)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162253",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc2ccc(S(=O)(=O)N(CC)c3ccccc3)cn12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(N2C(=O)C(c3c(C(C)C)nn(-c4ccccc4)c3O)=C([n+]3ccccc3)C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229620",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(C(=O)NC[C@H](O)Cc2ccccc2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43403",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(CC)c(NC(=O)CC2CN(C(=O)OC(C)(C)C)C2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98493",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCC(=O)NCC(=O)N1C[C@H](c2ccc(F)cc2)C[C@@H]1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171576",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CCCn1cc(CC)cc1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205052",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1N1CCN(Cc2cn3ccccc3[nH+]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7361",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1[nH]c(CSc2nncs2)nc2ccc(Cl)cc12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13373",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@](C)([NH3+])C(=O)Nc1cc(C(=O)[O-])cc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59309",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COCC(=O)N1CC[C@@H](c2nc(C)cc(Nc3nc(C)cc(C)n3)n2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197568",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(NC(=O)c2cccc(CN3CCN(c4cnccn4)CC3)c2)cn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41302",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1C[C@@H](N2CCC[C@H](C(=O)Nc3ccc(Cl)cn3)C2)C(=O)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCN(CC(C)(C)CS)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111923",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule N#C[C@H](c1ccccc1)N1CCN(Cc2csc(-c3ccoc3)n2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147868",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccccc1C[NH+]1CCC(CN(C[C@H]2CCCO2)C(=O)[C@H]2C=c3ccccc3=[NH+]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN[C@@]1(C#N)CC[C@H](SC2CCCCC2)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104879",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CN1CCCOC1=O)NCc1nccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146645",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)N1C[C@@H](C)C[C@@H](C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121200",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN1CCN(C(=O)[C@H]2C[C@H]3CC[C@@H]2[NH2+]3)C(C)(C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192909",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2[nH]c(=S)n([C@H]3CCC(=O)NC3)c2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule c1ncn(-c2ccc(N[C@@H]3CC[NH2+]C3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191292",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CC[C@H]1CN(C(=O)Cn2cc([N+](=O)[O-])ccc2=O)CC[C@@H]1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93581",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)[C@@H]1C[C@H]([NH3+])CN1C(=O)c1ccc(C(F)(F)F)nc1[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112857",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule FC(F)Oc1ccc(Br)cc1CNC[C@@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166977",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+]Cc1cnc(N2CCOCC2)nc1)c1ccc(F)c(F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54472",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H]1C[C@@H](NC(=O)Nc2ccccn2)CC[NH+]1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36896",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(C(=O)[O-])c(NC(=O)c2ccccc2OC)cc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136721",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1N1C(=O)/C(=C/c2cc(Cl)cc(Cl)c2OS(C)(=O)=O)SC1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211588",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(N(C)CC[C@H](O)c2ccccc2)c2c(C)nn(C)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cc1cccc([N+](=O)[O-])c1)N1CCC[C@H]1C[C@@H](O)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108201",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(NS(=O)(=O)c2ccc(N3CCOC3=O)cc2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CC(=O)N1CCC([C@@H]2Nc3ccccc3S(=O)(=O)N2)CC1)n1cncn1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86357",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@](C)(NCc1ccon1)C1CC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137711",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H](C(=O)N1CC[C@@H](Oc2ccc(C(F)(F)F)cn2)C1)n1cncn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C([O-])c1ccc(S(=O)(=O)[O-])cc1N1C(=O)/C(=C\\C=C\\c2ccccc2)N=C1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188618",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccccc1NC(=O)c1cc2sccc2n1CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78501",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](NCc1ccnc(O[C@H]2CCOC2)c1)c1ccc(C(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177711",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)n1cnn(C[NH+](CCC(F)(F)F)C2CCCC2)c1=S .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89063",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=[N+]([O-])c1ccc(Nc2cnn(-c3ncccn3)c2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159830",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)[C@@H]1Cc2ccccc2CN1C(=O)[C@@H]1C[C@@H]1c1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193521",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(C)C)c(OCC(=O)Nn2c(=O)[nH]c3ccccc3c2=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189081",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1ccc(OC/C=C2\\Oc3c(cccc3[N+](=O)[O-])[C@H]2N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc2c(c1)O[C@@]1(CCC(=O)N([C@@H](C)C(=O)[O-])CC1)CC2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196938",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule COc1ccc(CNC(=O)C(=O)N/N=C/c2ccccc2[N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38079",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCNC(=O)c1ccccc1NC(=O)c1ccnc(OC(C)(C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25775",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1cn(C(c2ccccc2)c2ccccc2)nn1)N1CC[NH+](Cc2cccnc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140454",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)Nc1cccc(NC(=O)C(=O)NC2CCCCCC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171964",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCNC(=O)C[NH2+][C@H]1C[C@@H](C)[NH+](C)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239514",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(CSc1nnc(-c2ccccc2Br)n1Cc1ccccc1)C1=NC=CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25392",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)Nc2ccc(C)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178745",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CCc1ccc(O)cc1)N/N=C/c1cc(Cl)cc(Cl)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106871",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](C)C[C@@H]1CCN(C(=O)c2ccc(C[C@@H]3CC(=O)NC3=O)cc2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139970",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C=CCN(Cc1nc(-c2ccccc2)no1)S(=O)(=O)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7573",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Clc1ccc(OCC2=NN3C(=NN[C@@H]3[C@@H]3C=C(c4ccccc4)N=N3)S2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151759",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC/C(=N/NC(=O)c1ccc(F)cc1)c1cc(Cl)cc(Cl)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175994",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccccn2c1C(=O)Nc1ccc2c(c1)N(C(=O)C(C)C)CCC2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108331",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(C)c(C(=O)CSc2nnc(C3CC3)n2-c2ccccc2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc2ccc(N3CCN(Cc4ccccc4N4CCOCC4)CC3)nn12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147135",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C/C=C/C(=O)NCc1ccc(S(=O)(=O)NC)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106625",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(C)c1OCC(=O)NC[C@H](C)c1ccsc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152669",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C[C@@](CO)(NC(=O)Nc1ccc(OCc2cccc(C#N)c2)cc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148301",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule CC(C)(C)OC(=O)N[C@H]1CCCN(c2nc3cc([N+](=O)[O-])ccc3o2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227042",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cccc(NC(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146784",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc2c(c(C[NH+]3CCC(c4nc(C(F)(F)F)c[nH]4)CC3)c1)O[C@H](C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116523",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1ccc(CNC(=O)N(C[C@@H]2C[C@@H]2C)C(C)C)s1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](OC(=O)c1cccc(OC[C@@H]2CCCO2)c1)[C@H]1CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117429",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1[nH]c2ccc(C(=O)N[C@H]3CCCOC3)cc2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(Nc1ccc2c(c1)OCO2)c1ccccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75061",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C[NH+]2CCC(Oc3cccc(C#N)c3)CC2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27316",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCc1[nH]c([C@H]2C[NH+](C)C[C@@H]2C(=O)N2CCCC2)c(C)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31110",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC/[NH+]=C(/N[C@H]1C[C@@H]1c1cccc(Cl)c1)N[C@@H]1CCC(=O)NC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156620",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c([C@H]2CCCN(C(=O)CCc3cccnc3)C2)n[nH]c1=S by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84283",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)N1CCN(C(=O)c2cccc(OCc3nnnn3C(C)C)c2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213636",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cnn(-c2ncccn2)c1)Nc1ccc(Cl)cc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139904",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C[NH2+]CCc2ccccc2)cc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149169",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule CC(C)=C/C([O-])=N/S(=O)(=O)c1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140490",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CS(=O)(=O)CCCNC(=O)NCCc1cc(F)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177693",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=O)c2cc(C(=O)N[C@H]3CCOc4ccccc43)cnc2n(C)c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCCSc1ccccc1C(=O)N1C[C@H](C)O[C@@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103357",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1csc(-c2cccc(C(=O)NC3CC3)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229004",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCC)nn32)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc([C@H](CO)NC(=O)Cc2ccc(OC)cc2)cc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199768",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccccc1NC(=S)N/N=C1\\C(=O)N(C)c2ccc(S(=O)(=O)N3CCOCC3)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219514",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1nnnc1NCc1c(Cl)cccc1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143948",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1nn(C2CCCCC2)c(N)c1[N+](=O)[O-] by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48464",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C1=NNc2ccc(Cl)cc2S1(=O)=O)N1CCOCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16210",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CO[C@@H]1CCCC[C@H]1[NH2+]CCC(=O)NC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219599",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(C(=O)NC[C@@H](c2cccs2)S(=O)(=O)c2ccc(Cl)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249226",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)N1CCC(OCc2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50173",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OCc2cccc(C#N)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243124",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Nc1ncnc2c1nc(SCc1ccc3nsnc3c1)n2C[C@H](O)CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23278",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1c(N[C@@H](C)C(=O)Nc2cc(Cl)ccc2Cl)c(=O)n(-c2ccccc2)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236950",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(C(=O)c1cccc2c1OCCO2)c1cccc2ncccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86283",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(C)nc(N[C@@]2(C(F)(F)F)N=C(O)N(CCc3ccccc3)C2=O)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176313",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)[C@H]1[C@H]2c3ccccc3O[C@]1(C)N=c1s/c(=C\\c3ccccc3OC)c(=O)n12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221327",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(NC(=O)c2cccc(CN3CCCC3=O)c2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26247",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cccc(OC[C@@H](C)[NH2+][C@H](C)c2cccnc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41286",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCC[NH+](C1CC[NH2+]CC1)C1CC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219845",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ncsc1C(=O)NNC(=O)NC[C@H]1CCC(C)(C)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222426",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule [NH3+][C@@H](Cc1ccc(F)c(Br)c1)c1ccc(Cl)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9500",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1nc(C(=O)OCc2cccc(Cl)c2)c2ccccc2c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67027",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1ccc(Br)cc1)C(=O)Nc1ccc2c(c1)COC2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190276",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CC(=O)N(Cc2ccc(OC)c(C#CCO)c2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57111",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CSCC[C@@H](C)N(C)C(=O)N[C@H]1CCN(c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1S(=O)(=O)N1CCO[C@H](c2ccc(F)c(Cl)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82092",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](Cc1ccc(C)cc1)NC(=O)c1ccc2c(c1)OCC(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239247",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(CNC(=O)[C@@H]2CCCN(c3ccc(-c4cccs4)nn3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=CCOc1c(OC)cccc1[C@@H]1CC(=O)Nc2c(-c3ccccc3)csc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)c1c(NC(=O)c2cc(-c3ccccc3O)[nH]n2)sc2c1CCCC2 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142883",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(N2CCN(C)C(=O)C2(C)C)c([C@@H](C)[NH3+])cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24064",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1cc(Br)ccc1C(=O)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48789",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN(CC)C(=O)c1ccc2c(c1)N(CC(=O)Nc1ccc(Cl)cc1)C(=O)CS2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120203",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccccc1N1C[C@@H](C(=O)Nc2ccc([N+](=O)[O-])cc2OC)CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc2oc3ccccc3c2c1)Nc1ccc2c(c1)OCCO2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(=O)oc2cc(NC(=O)c3cc(OC)c(OC)c(OC)c3)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47215",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]1CC(C(=O)N2CCCC[C@@H]2c2ncc(-c3cccc(F)c3)[nH]2)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8134",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN1C(=O)COc2ccc(NC(=O)C(=O)NCCc3c[nH]c4ccccc34)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187323",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)OC(=O)c1cc2c(ccn2-c2ccc(F)cc2)n1C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116969",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CCCCN1C(=O)C[NH+](CC(=O)N1CCCC[C@@H]1C)Cc1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170996",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@H](O)[C@H](C)[NH2+]C(C)(C)CC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105663",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(OCC(=O)N/N=C/c2ccc(O)c([N+](=O)[O-])c2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223392",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule N#C[C@H](C(=O)[C@@H]1CCC(=O)N1C(=O)c1ccc(Cl)cc1)c1nc2cc(C(F)(F)F)ccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=CCN(C(=O)Cc1ccc(C)cc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197618",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)Nc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191432",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)[C@H](C)Sc2c([O-])on[n+]2-c2ccccc2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52098",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C/C(=N/NC(=O)c1ccc(O)cc1)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4602",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C[C@H](O)c1ccc(F)c(F)c1)[C@@H](CCO)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53083",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)CCNC(=O)[C@@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2c3ccccc3C(=O)N12)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27869",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(NC(=O)c2ncccc2C(F)(F)F)cc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227027",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3745",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(CNC(=O)C(c1ccccc1)c1ccccc1)N/N=C/c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111840",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C2CC2)nc2cc(NC(=O)C(=O)N[C@@H]3CCCC[C@H]3CO)ccc21 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77021",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCOC1CC[NH+](CC[C@H]2CCC[C@H]2O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203863",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1CCN(Cc2ccc(F)cc2Cl)C1=O)NCc1cccs1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113310",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)c(CNC(=O)N[C@@H](CO)c2ccc(Cl)cc2)s1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc2c(cc1OC)CN(C(=O)CSc1nnc([C@@H]3COc4ccccc4O3)n1C)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133732",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(/C=C2/C(=N)N3C(c4ccccc4)=CSC3=NC2=O)c(C)n1-c1ccc(F)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225286",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](N[C@@H]1N=NC(=O)NC1=O)C(=O)N/N=C/c1ccc(Cl)cc1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOc1ccc(N)cc1C[NH+](CC)Cc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212976",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@H](C)NC(=O)N2C[C@@H](C)O[C@H](c3ccccc3)C2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196847",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc([C@H](NC(=O)c2cnn(C(C)C)c2C)C2CC2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84438",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@H](CO)[NH2+][C@@H](C)C(=O)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184099",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(OCC[C@@H]2CCC[C@@]2([NH3+])CO)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43626",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](CNC(=O)c1occc1Br)Oc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50725",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-n2ncc(NCCNC(=O)c3ccccc3Cl)c(Cl)c2=O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197696",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSC[C@@H](C)N(C)C(=O)N[C@@H](C)c1nnnn1-c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82383",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cn2nnnc2[C@H](c2cc3ccc(C)cc3[nH]c2=O)N2CCc3ccccc32)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88519",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(=O)Nc1ccc(Cl)cc1)S(=O)(=O)c1ccc2c(c1)c(=O)n(C)c(=O)n2C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96907",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O[C@]12CCCC[C@@H]1C[NH+](Cc1ncccc1C(F)(F)F)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CCCC[C@H]1n1ccc2nc3ccn(CCc4ccccc4)c(=O)c3cc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133997",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC[C@H]([NH2+][C@H](CO)c1ccc(Cl)cc1)c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113282",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@]1(N(C)C)C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224140",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(C(=O)NC2CCCCCC2)cc2cc(S(=O)(=O)N(C)C)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207367",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCOc1ccc([C@H]([NH3+])CC(=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10234",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1csc(S(=O)(=O)N2CCc3ccccc3C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C/N=C1/S/C(=C\\C(=O)Nc2ccc(Cl)cc2)C(=O)N1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189170",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COC(=O)[C@H]1ON2CCCC[C@H]2[C@]1(O)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70665",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1cccc(F)c1)N1CCC[C@@H](c2[nH]cc[nH+]2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88836",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COC(=O)[C@@H]1C[C@H](O)CN1Cc1ccc(Br)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc(NC(=O)c2ccc(N(C)C)cc2)c(Cl)cc1NC(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90759",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1[NH+]1CCC([NH2+]CCCNC(=O)c2ccc(F)cc2)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46206",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule O=[N+]([O-])c1cc(C(F)(F)F)cc(Cl)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125494",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc(NC(=S)N(Cc2cccc(F)c2)C[C@H]2CCCO2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Fc1ccccc1C[NH2+]CCC[NH+]1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112522",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccccc1-n1cc([O-])c(C(=O)N(C)CC(C)(C)O)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245183",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)NC[C@@H]1CCCCN1C(=O)c1ccc(C#N)cc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105456",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(Cl)ncc1NC(=O)N1CC[C@H](C)[C@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147888",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Nc2c(C(=O)N3CCCC3)cnc3nc(C)ccc23)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128764",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)C(C)(C)NC(=O)c1ccc(-c2cccc(Br)c2)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccc(CC(=O)N2C[C@@H]3CCCC[C@H]3C2)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86602",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1nn(C)cc1C(=O)N1CCC[C@H](C(=O)N2CC[NH+](C3CCCCC3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45618",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]([NH2+]Cc2ccn(-c3ccccc3)n2)CN1c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32155",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C[C@@H](Nc1ncccc1C#N)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19234",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc2c(CSc3nnc(-c4ccc(OC(F)F)cc4)o3)cc(=O)oc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113150",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C/C=C/C(=O)NNC(=O)[C@@H](C)Oc1ccccc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80554",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nnco2)cc1NC(=O)N1CC[C@@H]2CCCC[C@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5436",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1C(=O)N[C@](C)(CC)C(=O)N1CC(C)(C)S(C)(=O)=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100253",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)[C@@H](CO)NC(=O)Cc1c(F)cccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130614",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH+]1CCc2c(sc(NC(=O)c3ccnn3C)c2C(=O)OC)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15435",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)C[C@H](C[NH3+])N(C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16581",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1cccc(CN2CCN(c3ccnc(OC)c3C#N)C[C@@H]2CCO)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150294",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)[C@H](C)n2nc(-c3ccco3)oc2=O)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152290",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1C[C@@H](O)COc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42803",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN1CCN(C(=O)CC[C@@H]2CCCN(C(=O)CCCc3ccccc3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84557",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=C(c1ccccc1)[C@@H]([C@H](c1ccccc1)c1c[nH]c2ccccc12)[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87231",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[C@H](C)[C@@H](O)[C@]1(C[NH3+])CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57683",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1n[nH]c2cc(NC(=O)[C@@H](c3ccccc3)N3CCCCC3=O)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128233",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule COCC[NH2+]CC(=O)Nc1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)[C@H](C(=O)[O-])[C@H]1C(=O)Nc1ccc(C(=O)Nc2cccnc2)c(Cl)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H]1CCC[C@@H](NC(=O)C(=O)Nc2ccccc2OCC2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)CCOc1ccc(NC(=O)Nc2cccc(-c3nnco3)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181601",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H]([NH+](CC(=O)[O-])CC(F)(F)F)CC[C@H]1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131872",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCn1c(S[C@H](C)C(=O)N[C@@H]2CCCC[C@@H]2C)nc2sc(C)c(C)c2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192165",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(/C=C2\\S/C(=N/N=C/c3ccco3)NC2=O)ccc1O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184770",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH+]1CC[C@@H](NC(=O)[C@@H]2CCOc3ccccc32)[C@@H]1c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155820",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H](NC(=O)c1cc(OC)ccc1Br)C(=O)OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5363",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1CN(C(=O)c2nn(Cc3ccccc3)c3c2CN(C(=O)[C@H]2CC24CCCCC4)CC3)CCN1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36935",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cc(NC(=O)N(CCO)C2CC2)ccc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234291",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[NH+]1CCCCC[C@H]1C(=O)N1CCN(c2ccccc2C#N)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27491",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1n[nH]c(N/N=C\\c2ccccc2)nc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72883",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C[C@H](c2cccc(F)c2)n2cccc2)cc1F by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8730",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCCN(c1ccccc1)S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241789",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1c(C(=O)N2CCC[C@@H](C(C)(C)C(=O)OC)C2)[nH]c(C)c1C(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22297",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1ccc(CNc2cc(-c3ccc(F)cc3)nc3ccnn23)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161175",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[NH+]1CCN(c2ccccc2C[NH+](C)[C@H]2CCCc3c2cnn3C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226003",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[C@@H]1CC(=O)Oc2ccccc21)Nc1ccc2[nH]ccc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177580",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(O)c(-c2nc([C@H]3C[NH+]4CCN3CC4)no2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40062",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)Nc1cccc(NC(=O)CSc2nnnn2-c2cc(C)ccc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cccc(/C=C/[NH+](C)C)c1[N+](=O)[O-] by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107125",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](O)[C@H]1CCCC[NH+]1Cc1ccc(F)cc1C#N by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccccc1NC(=O)[C@H](C)[NH+]1CCCSCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175843",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc2nc(S/C(=C\\c3ccc(O)cc3)C(=O)[O-])[nH]c2cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137040",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc([C@H](C)C(=O)N(C)CCC2CCN(c3cc[nH+]cc3)CC2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100256",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule N#Cc1ccsc1NC(=O)CSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)N1CCN(C(=O)C(=O)NCC2CCN(C(=O)c3ccccn3)CC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1C[C@@H](NC(=O)N2CCC[C@@H]2C[NH+]2CCCCC2)CN1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95593",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN1CCN(C(=O)c2cccn(Cc3ccc(C(F)(F)F)cc3)c2=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22400",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cnc(Oc2ccc(CN3CCCC[C@@H]3c3[nH]cc[nH+]3)cc2)cn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212434",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCCOc1cccc(NC(=O)N[C@@H](C)c2c(C)noc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115914",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(NC(=O)[C@H]2Sc3nnc(CC)n3N[C@@H]2c2ccc(OC)c(Cl)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61049",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1csc([C@@H](C)NC(=O)C[C@@H](NC(N)=O)c2cccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)c1cc(NC(=O)C(C)(C)F)ccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cnc2ccccc2n1)c1cc2c([nH]c1=O)CCCC2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule N#CC1=C(N)Oc2cc(O)ccc2[C@@H]1c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206149",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(C[NH+]2CC[C@@H](COCc3ccccc3)C2)o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226632",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(Oc1ccccc1C(F)(F)F)c1cc(F)ccc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48965",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH2+]=C([C@@H]1CSCCO1)N1CCCC1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215934",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=C(C[C@H]1CCCCO1)N1CCCc2cccc(O)c21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212176",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(C(=O)Nc2ccc3c(C(C)(C)C)cc(=O)[nH]c3c2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133548",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(C[NH+]1CCC[C@H](c2nc3ccccc3o2)C1)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206606",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCc1ccccc1NC(=O)NC[C@@H](O)c1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8874",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@H](O)[C@@H]1CCC[NH+](CCc2ccc3c(c2)CCO3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124547",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CON(C)S(=O)(=O)c1cccc(C(=O)Nc2ccc(C)cc2F)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42977",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC[C@@H](NS(=O)(=O)c1cc(C)c(C)cc1[N+](=O)[O-])c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68771",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](Oc1ccccc1)C(=O)NCc1ccc(C(=O)N2CC[NH+](C)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156977",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@@H](C[C@@H]1CCC[NH2+]1)Nc1cnc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73112",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1cnc(CNC[C@@H]2CCC[NH2+]2)cn1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6758",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule CCN(c1ncnc(NC[C@H]2CCCO2)c1[N+](=O)[O-])c1cccc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccc(C(=O)N2CCC3(CCC(=O)N(CC(=O)[O-])C3)CC2)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193258",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)(C)C(=O)NCC(=O)OC(c1ccccc1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76375",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1c(C(=O)N2CCCCC2)c(S(=O)(=O)NCc2ccc3c(c2)OCO3)c(C)n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccnc(NC(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243734",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)[C@@H]1CN(C(=O)[C@@H]2CCC[NH+]2Cc2ccc(F)cc2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN([C@H](C)c2ccc(Cl)s2)C(=O)NC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205260",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(c1cnn2c1N[C@H](c1ccccc1)C[C@H]2C(F)(F)F)N1CC[NH+](Cc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22662",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1cccc(/C=N\\NC(=O)[C@H]2COc3cc4ccccc4cc3O2)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121507",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)c1nnnn1CC(=O)NCCc1ccc(N(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(OCC(=O)[C@H](C#N)c2ccc(F)cn2)ccc1[N+](=O)[O-] by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1cc([C@H](NC(=O)CCC[NH3+])c2ccc(F)cc2)c2cc[nH+]cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19135",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(=O)c1sc(NC(=O)c2ccc(Cl)s2)nc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35661",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule N[C@H](Cc1ccccc1)C(=O)N1CCn2nc(CCC(=O)NC3CC3)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161331",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(/C([O-])=N/S(=O)(=O)c2sc(C)nc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145256",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1CC[C@]2(CCCN(c3cnccn3)C2)CN1CCc1c[nH]c[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221407",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccc(-c2n[nH]c(SCc3cc(=O)n4ccsc4n3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103491",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCSc1ccccc1NCc1ccc([O-])c[nH+]1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135235",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Nc1cccc(Cl)c1)c1nnc([C@H]2CCCN(C(=O)c3cccc(F)c3)C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CCC(=O)NCC1CCN(c2cc[nH+]cc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106789",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)(C)c1nnc(C[NH+]2CCCC[C@@H]2CCc2ccccc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178759",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)[NH+](CC2CC2)CC[C@]314 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31381",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC(=O)Nc1c(C)cc(C)cc1C)[C@H]1CCS(=O)(=O)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52263",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CNC(=O)c1cccc(NC(=O)C(=O)N[C@H]2CC[C@@H]([NH+](C)C)C2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@]1(CO)CCC[C@@H]([NH+]2C[C@@H](C)CC[C@H]2C)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101471",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1CN1CCO[C@@H](c3ccc(F)cc3)C1)OCCCO2 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215485",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C(=O)N2CCN(C(=O)[C@H](C)Sc3ccccn3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cccc(C)c1OCC(=O)/N=C1/NCCS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76646",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1oc(-c2cccs2)nn1CN1CCN(c2ncccc2F)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155425",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[NH2+][C@@H](c1ccc(F)c(F)c1)[C@H](C)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58330",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H](NC(=O)Cc1ccc(C)c(O)c1)C(C)(C)C by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89487",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(COC1CCCCC1)NC1CC[NH+](CCc2ccncc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2n(n1)C[C@@H]([NH2+]Cc1cn(-c3ccccc3)nn1)CC2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NCCCn1cccc1)c1c(F)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229843",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=[N+]([O-])c1ccc(-c2nc(CN3CC[NH+]4CCCC[C@@H]4C3)co2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183162",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccccc1CNC(=O)Nc1ccc(OC)cc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114270",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([C@H](c2ccccc2Cl)N2CC[NH+](C)CC2)c(NC(=O)c2ccco2)s1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34820",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "864",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccccc1NC(=O)c1cc(S(=O)(=O)N2CCCC2)cn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43103",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOC(=O)C1=C(CC)NC2=C(C(=O)CCC2)[C@@H]1c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79488",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cn1cc(C[NH+]2CCC[C@H](O)C2)c(-c2ccccc2F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(OCc2nnc(S)n2C)cc1 by removing a thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NCCCNC(=O)C(C)(C)C)cn1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211949",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC1=CC=CC2=[NH+][C@@H](c3ccc(C)cc3)CN12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129110",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(C(C)=O)c1nc(Cn2nc(C(C)(C)C)ccc2=O)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208864",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](CC(=O)[O-])Sc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule C=CCN(C(=O)Cc1ccc(C)nc1)c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216827",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)Nc1cccc(NC(=O)c2ccc3c(c2)C(=O)N(CCCc2ccccc2)C3=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231358",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCSC[C@H]([NH3+])c1cc(OC)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216266",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule FC(F)(F)CCn1c(=S)[nH]c2cc(Br)cnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84347",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1ccnc1SCc1cccc(NC(=O)OC(C)(C)C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127918",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1COC2(CCN(C(=O)NCC3(c4ccccc4)CCC3)CC2)O1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132090",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)CSc1nnc(-c2ccc(F)cc2)o1)c1ccc2c(c1)CCCC2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12906",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)C(=O)CSc1nnc(-c2ccncc2)n1-c1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58362",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CS[C@H]1CC[C@H](NC(=O)c2ccccc2OC2CCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218097",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc(S[C@@H](C)C(=O)Nc3nccs3)[nH]c2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110659",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](c1nc2ccccc2s1)N1CC[NH+](CC(=O)N2CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52081",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[NH2+][C@]1(C(N)=O)CCC[C@H]1CCSC1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62441",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule c1ccc2c(c1)OC[C@H]2CNCc1cc2c(s1)CCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191276",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccc([C@@H](C)NC(=O)[C@H](C)Oc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237220",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCCn1/c(=N/C(=O)Cc2cccs2)sc2cc(S(N)(=O)=O)ccc21 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240685",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@@H]1CCCN1C1CC[NH+](CCCNC(=O)C(F)(F)F)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1c([C@H](C)[NH2+]Cc2cnn(-c3ccccc3)c2)cnn1-c1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149108",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C)c(S(=O)(=O)NCc2nc(-c3ccccc3)no2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110208",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=S)N2CCN(C/C=C/c3ccccc3)CC2)c(C)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89346",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3520",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COc1ccc(/C=C(\\C#N)C(=O)N(C)C)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136916",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCN(C(=O)[C@H]1C[C@H]2CC[C@@H]1O2)c1ccc(C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N/C(=C\\c2cn(Cc3ccc(F)cc3)c3ccccc23)C(=O)N1Cc1ccccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N1CC[C@H](COc2nc3cc([N+](=O)[O-])ccc3o2)C1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H]2CC(=O)N(Cc3ccco3)C2)nc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131461",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc(C[C@@H](C)NC(=O)c2ccccc2C(C)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110896",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc(N2C(=O)S[C@H](Nc3cccc(F)c3)C2=O)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72728",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1ccc(N2CCCC2=O)cc1)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc(N(C[C@@H]3CCCO3)C(=O)CCS(=O)(=O)c3ccccc3)sc2c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110633",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(/C=C/c1ccc(O)cc1)NC[C@@H]1CC[C@H](C(=O)[O-])O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23946",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN1CCn2c([nH+]c3cc([N-]S(=O)(=O)c4ccc(Cl)cc4)ccc32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186254",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)[C@@H]1CN(C(C)=O)C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37472",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cn2c(N)c3ccccc3nc2=S)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCC(C(=O)N2CCC(c3[nH+]ccn3Cc3ccccn3)CC2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75085",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc2cc(CN3CCn4c(nnc4C(F)(F)F)C3)oc2cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150354",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)[NH2+]Cc1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24244",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(NC(=O)C(=O)N2CCC([NH+]3CCCC3)CC2)c(Cl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)COc1ccccc1F)c1cccc(C#N)c1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138494",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)[C@@H]1CCCN(C(N)=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19342",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1C[C@H](C(=O)Nc2ccc(F)cc2F)[C@@H]2C(=O)N=C(SCc3ccccc3F)N=C2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)COC(=O)c1ccc(NC(=O)[C@H]2[C@@H](C(=O)[O-])[C@@H]3C=C[C@H]2C3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82825",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccc(NC(=O)c2cc(OC)no2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)NS(=O)(=O)c1ccc(NC(=O)c2ccc(C)c(Br)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39461",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)c1cccc(S(=O)(=O)NC2CC2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172472",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(C)c(S(=O)(=O)N2CCC([NH+]3CCCCC3)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58454",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](NC(=O)c1ccc(N)cc1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208313",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(C[C@H]([NH3+])CSc2ccccc2Cl)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246370",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H](CNC(=O)N1CC[C@@H]([N+]2=CCCC2)C1)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222631",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)Cn1cc(Br)c(=O)[nH]c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201378",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(-c2nccs2)cc1)c1ccccc1I by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111072",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCC(C(=O)N2CCOC[C@@H]2C[NH+](C)C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19937",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(Cc1cnn(-c2ccccc2)c1)S(=O)(=O)c1cccc(OC(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38838",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)Cc1noc(-c2coc3ccccc23)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170865",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nc(C)c([C@H](C)OC(=O)Cc2ccc(N3CCCC3=O)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23086",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCC[NH+](C1CC1)C1(CN)CCN(C(C)C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53632",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C[C@H](C)CNC(=O)c2ccc(C(N)=O)cn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202236",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CNC(=O)[C@H]2CCCN(C(=O)NC3CC3)C2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136578",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(N=c1[nH]c2ccccc2[nH]1)c1cc(Cl)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3096",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@@H]1CCC[C@](CO)(Nc2nc3cc(N)ccc3o2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211253",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule NC(=O)N1CCC[C@@H](C(=O)Nc2ccccc2C(=O)NCC(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218387",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC1(C)CC(NC(=O)N2CCN(C(=O)c3ccc(O)cc3)CC2)CC(C)(C)[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24420",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccccc1-n1cc(CN(C)C(=O)[C@H]2CCCCC[NH+]2C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216438",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(-n2c(N)c(C(=O)Nc3cccc(F)c3)sc2=S)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77743",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(C)c(C(=O)Nc2cccc(NC(=O)NCc3ccncc3)c2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241348",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)[C@H](C)c2cccs2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1)c1ccccc1Br by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41279",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1cc[nH+]c1CNC(=O)CCc1cc(Cl)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35500",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(C=O)cc(Cl)c1O[C@@H](C)[C@H](C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(NC(=O)[C@@H]2C[C@@H]2c2ccccc2)n(-c2ccc(F)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C(=O)N2CCCc3cc(NC(=O)C(=O)NCC4(c5cccs5)CCOCC4)cc1c32 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21157",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COCC1CCN(C(=O)N[C@H]2CCCN(c3ccc(C)cc3)C2=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207085",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](C)NC(=O)N1CCN(Cc2cc(OC)cc(OC)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86481",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(N2CCN(C(=O)CCc3n[nH]c4c3CCCC4)CC2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24080",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C\\c1ccccc1Br)c1ccc(O)cc1O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33657",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1ccc(C(=O)Nc2ccnc(C(=O)N(C)C)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117403",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCC(=O)N1CC[C@@H]2CCCC[C@H]21)c1cc2ccccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60726",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSC(=S)N(C)NC(=O)c1ncccn1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191143",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(C(C)(C)C(=O)NCC2(c3ccc(F)cc3)CCC2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[C@@H](C)[C@@](C)(O)C[NH2+]Cc1ncc(-c2ccccc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215593",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(Cl)c(C)cc1NC(=O)N[C@@H]1CC[C@H]([NH+](C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79834",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCc1cc2c(N[C@@H](C)c3cccc(S(=O)(=O)NC)c3)ncnc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54444",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCOCCCC(=O)N1c2ccc(N)cc2C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178302",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCc1nn(C)cc1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59094",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(OCC(=O)Nc2ccc3c(c2)nc(C[NH+]2CCCCC2)n3C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75952",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1nccc(N[C@H](C)CCC[NH3+])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51045",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(CNC(=O)c1ccoc1)Nc1cc(C(F)(F)F)c[nH]c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6391",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1ncnc1-c1c(-c2ccccc2)ncn1[C@@H](C)Cc1cc(C)n[nH]1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97168",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@](O)(CNC(=O)CC1([NH3+])CCC1)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67065",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)C[NH2+][C@@H](C)c3cccc(F)c3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117954",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCN(CC(=O)[O-])C(=O)C1C[NH2+]C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92208",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1[C@H]2C[C@@H](Br)[C@H](Br)C[C@@H]2C(=O)N1c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100696",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc(-n2ncc3c(N4CCCc5ccccc54)ncnc32)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108658",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nn(CC[C@H]2CCC[C@]2(CO)[NH2+]C2CC2)c(C)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61829",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCNc1nc(NCC)nc(Nc2ccc(C)c(C)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9987",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1626",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@H](C)NC(=O)CS(=O)(=O)[C@@H](C)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189635",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1/c(=N/C(=O)c2ccccc2O)[nH]c2cc(Cl)ccc21 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89313",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H](CCl)C[C@H]1COc2ccccc21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203983",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-n2nnc(C(=O)NCc3ccccc3)c2C(C)C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93111",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(C1CCN(C[C@@H]2CCC[NH+]3CCCC[C@@H]23)CC1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21012",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CC[C@H](N(C)Cc2cccc(C(F)(F)F)c2)[C@H](C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52598",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)N[C@@H](CC(=O)N(C)CC(=O)Nc1c(C)cccc1C)c1ccc(C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186516",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H](C)CN(Cc1ccccc1)C(=O)c1ccc2n[nH]c(=O)n2c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229852",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1CC[NH+]([C@H](C)C(=O)Nc2cccc(C#N)c2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161951",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](C)Sc1cccc(F)c1C(N)=[NH2+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171258",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)(C)Oc1ccc(Cl)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88727",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCn1nnc(NCc2ccc(C)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150038",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(-c2nnc(NC(=O)c3ccc(Cl)cc3)o2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72188",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule C[C@H](CC#N)[NH+](C)Cc1ccc(Cl)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117919",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(/C(C#N)=C/c2ccccc2OCC(=O)Nc2ccccc2)n1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccnc(Nc2ccc(N(C)C)[nH+]c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77399",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N[C@H](C)C2CC2)cc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177129",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)NCc2ccccc2S(=O)(=O)N(C)C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38802",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)C(=O)N/N=C/c2cc([N+](=O)[O-])ccc2[O-])c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242184",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Cc1ccc(C[C@@H](C)Nc2ccc([N+](=O)[O-])cc2S(N)(=O)=O)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159594",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)n1cc(CN2CCN(CC#N)CC2)c(-c2ccccc2Cl)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158945",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NC2CC2)cc1NC(=O)c1cc(C)n(C2CC2)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@H](C)OCC(=O)Nc1cn(C)nc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(C(=O)NC[C@H](c2ccc(F)cc2)[NH+](C)C)cn1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219008",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccccc1NCc1cn(-c2ccccc2)nn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccsc1C(=O)N[C@@H](CC(C)C)C(=O)N(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86340",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN(Cc1cnn(C)c1)S(=O)(=O)c1cc(Cl)c(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164156",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCC(=O)N1CCN(c2ccc(NC(=O)COc3ccc(C)cc3)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11262",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)[C@]1(CCN(C(=O)CC(C)C)C1)C(=O)N2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC)c1ccc(NC(=O)[C@H](C)Oc2ccc(C)cc2C)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73855",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](Cc1ccc(C)cc1)N(C)C(=O)Cc1nc2nc(C)cc(C)n2n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6538",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC(C(=O)N2CCCSc3ccc(Cl)cc32)C[C@@H](C)O1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26912",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)CCNC(=O)N[C@@H](c1ccccc1)c1ccccn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81715",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Nc1nc(CCNC(=O)c2ccc(C[NH+]3CCCCC3)cc2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138847",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C[NH+]2C[C@@H]3CC[C@H](C2)N(C(=O)c2oc(C)nc2C)C3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194256",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1cc(NCc2ccc(C(=O)OC)o2)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45504",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule CN(CCc1ccccc1Cl)c1ncc([N+](=O)[O-])s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101414",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)[C@H]2[C@@H]3C(=O)N(c4cc(C)on4)C[C@]34C=C[C@H]2O4)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8747",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)CCN(CC(=O)N1CCNCC1)C(=O)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239180",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cn(-c2ccccc2)nc1C(=O)OCC(=O)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68048",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)OCC(=O)NCc2cccc(C)c2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38874",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC1(CNC(=O)CNC(=O)c2ccc(F)c(F)c2)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137039",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)NCc1cn(-c2ccccc2)nc1-c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cccc(C)c1NC(=O)NCC1CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13859",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H]1CCCCN1C(=O)NCc1ccc(F)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCC(=O)N1CCC(c2nc3ccccc3s2)CC1)c1ccc2ccccc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cc1ccc2c(c1)OCO2)N1CCC[C@H]1c1nc(-c2ccccn2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191684",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(OCCn2cnc3ccc(Cl)cc3c2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105797",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(CC1CCCCC1)NCc1nc2ccccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235339",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule N#Cc1cc([N+](=O)[O-])ccc1Sc1nc(-c2ccccc2F)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21939",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1cnc(-n2nc(C)cc2C)nc1Nc1ccc(C)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96538",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C1[C@@H]2ON(c3ccccc3)[C@@H](c3cccs3)[C@H]2C(=O)N1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204050",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@](C)(CN1C[C@@H]2CCCC[NH+]2C[C@@H]1C)C(N)=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159839",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(=O)N1CCC([NH2+][C@H](CC(F)(F)F)c2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131690",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc(OC)c1C(=O)Nc1ccc(C(=O)NC[C@@H]2CCCO2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17245",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1S(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc3ncn(C)c3c2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)c(NC(=O)[C@@H]2CC(O)=Nc3nncn32)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140597",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(OC)c(NS(=O)(=O)c2cc(C(=O)N3CCC3)ccc2C)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181971",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](NC(=O)NCCS(=O)(=O)C(C)(C)C)c1ccc(C)c(F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242948",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(OC)c(CN2CCN(C(=O)C[C@H](C)c3ccccc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43857",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)N2CCC[C@@H]2c2nnc3ccccn23)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140570",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCc1ccc(C(=O)Nc2nc(-c3cccc(C(F)(F)F)c3)cs2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126481",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1cc(NC(=O)/C=C/c2ccco2)cc(C(=O)[O-])c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71990",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(NC(=O)[C@@H]1CCC(=O)N(C2CCCC2)C1)C12CC3CC(CC(C3)C1)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79050",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)c1ccc(C(=O)Oc2ccc(N3CCCC3)cc2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234522",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(Cl)c1CSC1=N[C@@H]2CCCC[C@@H]2N1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46313",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1ccc(NC(=O)COC(=O)c2c3c(nc4ccccc24)/C(=C/c2ccc(O)cc2)CC3)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77890",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@@H](C)CN(C(=O)C[NH+](CCC#N)CC(C)(C)C)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25236",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(CCS(=O)(=O)c1ccccc1)N1CCN(c2nc3ccc(OC(F)(F)F)cc3s2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120649",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOc1ccc(-n2ncc(C(=O)N[C@H]3CCCCC[C@H]3C(=O)OC)c2C)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120257",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC(NC(=O)CSc2nc([O-])c3cnn(-c4cccc(Cl)c4)c3n2)=NO1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99862",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN1C(=O)COc2ccc(C(=O)Cn3nnc4ccccc43)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166553",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CC[NH+]1CCN(c2ccccc2)CC1)NNC(=O)Nc1cccc(C(F)(F)F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162654",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCC(=CC(=O)Nc1nccs1)CCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56360",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc([C@H]2CCCCN2C(=O)[C@@H]2CCOc3ccccc32)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222333",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[NH+](Cc1ccc(Br)cc1)Cc1nnc(-c2cccs2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56758",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1ncccc1C(F)(F)F)N1CC[C@H](Oc2cccnc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134573",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(/C=N/NC(=O)c2cccc(F)c2)c(Br)c(Br)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78814",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)S(=O)(=O)/N=C(\\[O-])[C@@H]1CCC[C@@H](C(F)(F)F)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/C=C2\\SC(S)=NC2=O)c(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23483",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1[C@@H](C)NC(=O)N1CCC(OCc2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C=C1c2ccccc2C(=O)N1CCC(=O)N1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33920",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CN1CCO[C@@H](CNC(=O)c2ccc[nH]c2=O)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26892",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC1(NC(=O)c2cc3cc(F)ccc3oc2=O)Cc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156757",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+](CCC#N)[C@@H]1CCOC2(CCOCC2)C1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132341",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(c1ccc(CSc2nc3ccncc3n2Cc2ccccc2F)cc1)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157944",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nn(C)c(Cl)c1CS(=O)(=O)c1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8740",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC(C(=O)N[C@@H]2CCCc3nc(-c4cccnc4)ncc32)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33019",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-n2c(C)cc(/C=C/C(=O)N3CCC[C@@H]3c3ccccc3)c2C)no1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29719",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N([C@@H](C)/C(O)=N/C[C@H]2CCCO2)C(=O)[C@@]31C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164587",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccc(Br)cc1CNc1cnccc1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162689",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=S(=O)(c1cccc(C(F)(F)F)c1)N(Cc1ccsc1)Cc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147011",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Fc1ccc2c(c1)[C@@H]([NH2+]Cc1cccc(OCC(F)F)c1)CCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NC(=O)[C@H]1CSCN1C(=O)Cc1ccc2c(c1)CCO2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188512",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccc(N(C)C(=O)[C@@H](C)NC(=O)C(C)(C)C)cc2s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6751",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c(C(=O)C[C@@H]2c3c(cc4c(c3OC)OCO4)CC[NH+]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148356",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(CS/C(N)=[NH+]/C(C)(C)C)cc(=O)oc2c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(CNC(=O)c2ccc(-c3ccccc3)cc2)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19604",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)c(CNC(=O)Nc2ccc(OC(C)C)cc2C)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72048",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)NC(=O)[C@@H](C)N1CCc2onc(-c3ccc(C(F)(F)F)cc3)c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53044",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nn(CCCNC(=O)Nc2ccccc2C(F)(F)F)c(C)c1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104304",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)NC(C)(C)C(=O)NCC[C@H](O)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(OC[C@@H](O)Cn2c([C@@H]3CC(=O)N(c4ccccc4C)C3)nc3ccccc32)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149342",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cn1c(Cc2ccccc2)nn(-c2ccc(Cl)cc2)c1=O)NC1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206596",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1cnc2ccccc2n1)c1cc2cc(F)ccc2oc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51886",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=C(Nc1ccccc1)Nc1ccc(NC(=O)c2cccc([N+](=O)[O-])c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120080",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/C([O-])=N/S(=O)(=O)c2ccc(C#N)cc2)cc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186816",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(NC(=S)N/N=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66330",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc(C[C@H](O)[C@@H]2CCCc3cccnc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166417",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccnc(N[C@@H]2CCc3cc(N)ccc32)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212405",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nc(CN2CCN(c3ncc(Cl)cc3Cl)CC2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131279",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(C)c(C(=O)N2CCc3c([nH]c4ccccc34)C2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule Cc1cc(O)c(C[NH+]2C[C@@H](C)C[C@H](C)C2)c2c1C(=O)/C(=C\\c1ccc([N+](=O)[O-])cc1)O2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227355",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)Nc2cccc3[nH]cnc23)cc1[N+](=O)[O-] by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224844",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CNc1ccc(/C=C/C(=O)c2ccc(SC)c(OC)c2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99515",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C)S(=O)(=O)N1CCN(CC(=O)N2CCCC[C@H]2C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217048",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H]1C[C@H]1Nc1nc(Br)cn2ccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111443",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](C)C(=O)Nc1cccc(NC(=O)c2ccco2)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccn(COc2ccc(Br)cc2)n1)N1CCCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51993",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule COc1ccc(/C=N/NC(=O)COc2ccccc2C)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123719",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1CC[NH+](C[C@@H]2CCCN(C(=O)N[C@H](C)CC(=O)NC(C)C)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247258",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(F)cc1CSCc1nc(CC(C)C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177877",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1c([O-])nc(SCC(=O)Nc2nccs2)n(-c2ccc(F)cc2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99225",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule N[C@]1(C(=O)[O-])CC[C@@H]([NH+]2CCC(C(F)(F)F)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136498",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC1(C)c2[nH]c3ccccc3c2C[C@@H]2C(=O)N(C3CCCC3)CC(=O)N21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74675",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1[C@@H](NC(=O)/C=C/c1cnn(C)c1C)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185507",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(/C=C/c1ccc2c(c1)OCO2)NNC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96474",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1ccc(CC(=O)Nc2ccccc2C2[NH+]=c3ccccc3=[NH+]2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24339",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=Cc1c(C)nn(-c2ccccc2)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120026",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCn1c2ccccc2c2cc(NC(=O)c3ccc(F)c(S(=O)(=O)N4CCOCC4)c3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127469",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule O=C(c1ccccc1Cl)N1N=C(C(F)(F)F)C[C@@]1(O)C1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168412",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC(n2cncn2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95587",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COCCN(Cc1ccccn1)C(=O)[C@H]1C[C@H]1c1ccccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31082",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cccc2c1=[NH+]CC=2/C=C(\\C#N)c1nc2ccccc2[nH]1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16087",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1c(C2CC2)csc1NC(=O)/C=C/c1ccc(C)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220779",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(NC(=O)c2ccc(/C=C3\\SC(=O)N(c4cccc(C(F)(F)F)c4)C3=O)cc2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88187",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=[N+]([O-])c1cccc2c1N[C@H](c1cccc(Cl)c1)[C@@H]1CC=C[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175410",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccsc1CNC(=O)CSc1ncn[nH]1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201619",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1C[C@@H](C(=O)NC[C@H]2CCCN(c3ncccn3)C2)c2ccc(F)cc2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ncn2c1C(=O)N(c1ccc(C)c(F)c1)[C@](C)(C(=O)NCc1ccccc1OC)C2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234008",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule C[C@@H]1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87327",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2C[C@@H](C)N(c3cccc[nH+]3)C2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150068",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCC[C@H](C)NC(=O)[C@H](C)Nc1c(C)nn(-c2ccccc2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145987",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ncnc2sc3c(c12)CCCC3)NC[C@@H]1CCCO1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30138",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1COC[C@@H](C)N1C(=O)CSc1nnnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22525",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](NC(=O)c1ccccc1I)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81971",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a thiol from the molecule SCC1(CSc2nncs2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178196",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@H]1CCN(c2ccc(F)cc2)[C@@H]1c1ccc(C(F)(F)F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(NC(=O)N(C)[C@H](C)c2nc(C)sc2C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157199",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(NC(=O)[C@H](C)Sc2cccc(F)c2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206848",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCCC1CCC(C[NH3+])([C@@H](O)c2cccs2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43377",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c2nc(NC[C@H](c3ccncc3)N3CCOCC3)sc12 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4449",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=S(=O)(NCCCn1ccnc1-c1ccccc1)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241759",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1c(C(=O)Nc2cccc(COCC3CC3)c2)cnn1-c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198348",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(C(=O)N/N=C\\c2ccc(Sc3cccc4cccnc34)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222008",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC[NH+](Cc2ccc([N+](=O)[O-])c(O)c2)C[C@@H]1C by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231015",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1ccc(Br)cc1)c1cccnc1NCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240544",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule COc1cc(/C(C#N)=C/c2cccc3c2OCCCO3)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41223",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)Cc1noc(C[NH2+][C@H](C)c2ccc(Cl)cc2Cl)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191245",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1C(=O)Nc1cccc(C(=O)N2CCC[C@@H]2C(=O)NCCc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201795",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)c1cc(C(=O)NCCNC(=O)c2ccc(Cl)cc2)n(C)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195391",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2CC(O)=Nc3c2c(=O)[nH]n3C(C)C)c(OC)c1OC by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138102",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](Sc1ncc2ccccn12)C(=O)N(Cc1ccccc1)Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72891",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@](C)([NH3+])C(=O)NC[C@H](c1ccccc1)[NH+]1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217739",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(N2C(=O)C[C@H](SCC(=O)Nc3cccc(Cl)c3C)C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18702",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCS(=O)(=O)C[C@@H](C)NC(=O)c1ccc(OC(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9587",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)c1ccc(CC#N)cc1)c1nc2ccc(Cl)cc2n1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50578",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1=C(C(=O)Nc2cc(C)ccn2)[C@H](c2cc([N+](=O)[O-])ccc2Cl)C2=C(CC(C)(C)CC2=O)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54671",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCN[C@]1(C(N)=O)CC[C@H]([NH+]2CCC(C)(C)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238362",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)(C)C[C@H](CO)NC(=O)c1cccnc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24962",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[NH+]1CC[C@H](N(C)C(=O)c2cccc(-n3cccn3)c2)[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178092",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(O)c(C(=O)Nc2cccc(I)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)CSc2nc3ccccc3nc2-c2ccccc2)cc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163983",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](C(N)=O)N1CC[NH+](Cc2ccc3c(c2)CC(C)(C)O3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155145",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nc2cc(NC(=O)C(=O)NCC3(C)CCC3)ccc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205206",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)(C)OC(=O)N1CCC(COc2ccc(OC(F)(F)F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22896",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(CN(C(C)=O)c2c(C)nc3ccccn23)c1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225345",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule [NH3+][C@@H](Cc1ccc(F)c(F)c1)c1ccc(F)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(COc1ccccc1-c1noc(-c2ccc(Cl)cc2)n1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16047",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1ccc(Br)cc1C(=O)[O-])c1ccc(Br)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule COc1ccc(COc2ccc(CO)cc2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88389",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCn1c(C)cc(-c2csc(NC(=O)c3scnc3C)n2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4743",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Nc1cccc2cnccc12)N(Cc1ccccc1F)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5096",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1[C@@H]1CC(=O)C2=C(C1)Nc1ncnn1[C@@H]2c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)c1cnn(-c2nc(Br)cs2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10616",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1c([C@@H]2c3ccccc3C(=O)N2CC(=O)Nc2cccnc2)c2ccccc2n1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53668",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(CSc1cc(-c2ccccc2)ncn1)N1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41909",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H]1CCCO1)c1cccs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57020",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CNC(=O)c1cccc2[nH]ccc12)[NH+]1CCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91042",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1ccccc1)N(C)C(=O)C[NH+]1CCCC[C@@H]1C(=O)N1CCOCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240691",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(CC(=O)OCC(=O)c1ccc(Cl)s1)c1ncccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85564",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc([N-]S(=O)(=O)c2ccc3c(c2)CN(C(=O)C(C)(C)C)CC3)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215683",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ncccc1NC(=O)/C=C(/c1ccccc1)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81232",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc([S@@](=O)/N=C/c2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccnc1OCC(F)(F)F)c1ccc2[nH]cnc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37108",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccc(Oc2nc3ccccn3c(=O)c2/C=C2/SC(=S)N(C[C@@H]3CCCO3)C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162717",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)(C)n1cc(NC(=O)N[C@H]2C[C@H]2c2ccccc2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234858",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule NC(=O)c1ccc(NCc2cccc(Br)c2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239725",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCC(Oc3nc4c(C)cccc4s3)CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137377",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](C)c1ccc([C@@H](O)c2cscc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1nccnc1N1CCC[C@@H](N2CCCC2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20985",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-n2cncn2)ccc1C(=O)Nc1c(C)cccc1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12028",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1c(Cl)cccc1-n1ccnc1S[C@@H](C)C(=O)NC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94487",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1csc(N(C(=O)/C=C/c2ccccc2)c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113918",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)C1CCN(C(=O)COC(=O)c2n[nH]c3ccccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(C)c2sc(N(CC[NH+](C)C)C(=O)c3snnc3C)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125324",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C)c(S(=O)(=O)Nc2ccc3c(c2)CN(C(=O)c2cccs2)CC3)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(F)c(NC(=O)c2cccnc2SC)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4492",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN1C(=O)C(C#N)=C(C)/C(=C/c2ccc(OC)cc2OC)C1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176475",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)N[C@@H]1CCCN(C(=O)c2cccc(N[C@@H](C)C(C)C)c2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59050",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1c(C(=O)N(C)c2ccccc2Cl)oc2c1/C(=N/O)CC(C)(C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92660",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H]2CN(C(=O)CSc3nc(C)n[nH]3)C[C@H]2C(=O)[O-])c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179331",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(NC(=O)[C@@H](O)c2ccccc2)cc1)C1CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(C1=C([O-])C(=O)N(Cc2cccnc2)[C@H]1c1ccc(Cl)cc1)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCC[NH+](C)[C@H](C)C(=O)N1CCC(C(N)=O)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H](O)c1ccccc1)c1cccc(N2CCOC2=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25719",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCc1nccn1-c1cccc([C@@H](C)[NH2+]CC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22846",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCCC(=O)Nc1nnc(CC(=O)N/N=C/c2ccccc2Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242163",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=N/N=C2\\NC(=O)[C@@H](Cc3cccc(Cl)c3)S2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162140",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](C(=O)NCCC1=CCCCC1)N1CCn2c(nnc2C2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160016",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(S(=O)(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)cc1Br by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114019",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CCCCN(C)C(=O)C1CC[NH+](Cc2cn3ccccc3c2C#N)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184085",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1c(=O)[nH]c2cc(C(=O)N[C@@H]3c4ccccc4C[C@@H]3O)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232933",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1C[C@@H](c2ccc(F)cc2)C[NH+]1CC(=O)NNC(=O)C1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223588",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)(O)CSCCNC(=O)N1CC[C@@H]2CCCC[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41585",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)[C@@H]1C[C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141738",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(Cc1ccc(Cl)cc1)N1CCN(CC(F)(F)F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16029",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COC(=O)[C@@H](N)C12CC3CC(CC(C3)C1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29711",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Nc1ccc(Oc2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47198",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C([O-])CSC(=S)Nc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)[C@@H](C)n2c(=O)cc(C)c3cc(C)cc(C)c32)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CN(CC(=O)N(CCC(N)=O)c2ccc(F)cc2)C(C)(C)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9008",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(N2CCN([C@H]3CCC[NH+](Cc4[nH]c5ccccc5c4C)C3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(C)C(=S)SCC(=O)N1c2ccccc2NC(=O)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107964",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncn(-c2cc(N3CCN(C(=O)Cc4ccccc4)CC3)ncn2)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221656",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cccc(Nc2nc3nccc(-c4cccs4)c3c(=O)[nH]2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48533",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COC(=O)C(C)(C)Cn1ccc([C@H](C)O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179993",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(N2C(=O)[C@@H](C)S/C2=C(\\C#N)C(=O)N[C@H](C)c2ccccc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237163",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(C[NH+]2CC[C@@H](NC(=O)c3ccn(C(C)C)n3)C2)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240650",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Cn1ccc(Nc2ccncc2[N+](=O)[O-])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66118",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCC(C)(C)CNc1ncnc2[nH]cnc12 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247386",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@H]1CCC[C@@H]1OC(=O)CCCNC(C)=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103041",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCCn1c(=O)c2ccc(Cl)cc2n2c(SCC(=O)Nc3cccc(C)c3)nnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1NC(=O)NNC(=O)c1cccc(NC(=O)C2CCCCC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190013",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)[C@@H](NC[C@@H]1CCCO1)c1ccc(Br)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227896",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)C2CC2)cc1)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228110",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](O)c1cccn1Cc1cc(Br)ccc1F by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule N#Cc1ccc(NC(=O)N2CCN(C(=O)CCC3CCCCC3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24565",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)N=c1[nH]c2ccccc2[nH]1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200450",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1C[C@H]1CCCN1C(=O)c1cnc([C@H]2CCCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H]1CC[C@H](C[NH3+])CN1[C@@H](C)c1cc(F)cc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22420",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1C[C@H]1c1ccc(CN(C(=O)c2c[nH]c(=O)c(Cl)c2)C2CC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137334",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC[C@H](C)NC(=O)C(=O)Nc1cccc(-c2nc(C3CC3)n[nH]2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35182",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCN(C(=O)c2cc(=O)[nH]c3cc(F)ccc23)C[C@H]1O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198905",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(Cn2nc(C)c(C(=O)N3CCN(CCOc4ccccc4)CC3)c2Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130851",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(C)c(CCC(=O)N[C@@H]3C[C@@H]3C)c(=O)oc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)Nc1ccc(F)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45541",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(-n2nc(C)cc2NC(=O)C(=O)N(C)CC(=O)NC(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82299",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(C)CC(=O)Nc1ccccc1Oc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235201",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C([C@H]1CCC[NH+]1[C@H]1CCC[C@@H](C2CC2)C1)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242827",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(=O)Nc1ccc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120558",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CS(=O)(=O)Cc1noc(-c2ccccc2Cl)n1)NCC1CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181869",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)c1cccc(NC(=O)/C(=C/c2ccco2)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185864",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCN(CC)C(=O)c1ccc([N+](=O)[O-])c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206801",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(CNC(=O)[C@@H]2CSCN2C(=O)OC(C)(C)C)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194608",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](CCO)c1cccnc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92787",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C#CCC[C@@H](O)[C@]1([NH+](C)C)CCC[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149027",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC1CCN(C(=O)[C@@H](C)Sc2nnnn2Cc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197619",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Cc1ccoc1C(=O)OCc1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31084",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule OC1(C(F)(F)F)CC[NH+](Cc2ncc(-c3cccc(Cl)c3)o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168644",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(Cc1ccc(Cl)nc1)C(=O)NCc1ccc(-n2cncn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222627",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1-n1c(SCc2c(C)noc2C)nc2ccsc2c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170677",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1ccsc1)N(C)C(=O)c1ccc(CNS(C)(=O)=O)o1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182393",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(N2C[C@H](c3nc4ccccc4n3C[C@@H](O)COc3ccc(Cl)cc3)CC2=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168698",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[C@@H](C)NC(=O)N1CC[C@H](Oc2ccc(C(F)(F)F)cn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209142",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3807",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(=O)N(CCc1ccccc1)CC(=O)Nc1ccc(C(N)=O)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106584",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)c1ccc(F)c(NC(=O)c2ccnc(Cl)c2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94524",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1c[nH]c(CN(C)C(=O)[C@@]23CNC[C@@H]2C[NH2+]C3)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101365",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H]1c2cccn2CCN1C(=O)CN(C(=O)c1ccco1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32789",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCCOc1ccc(-c2nc(N)ccc2[N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18956",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1c(Br)cccc1CNC(=O)N(C)[C@H](C)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176285",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(NC(=O)c2ccccc2NC(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)s1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201625",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NNC(=O)CCc2c[nH]c3c(C)cccc23)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233705",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN(C)c1nc(N)nc(CN2CC[C@H](c3cccc(F)c3)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179507",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CNC(=O)CCC[NH+]2CCN(c3ccccc3)CC2)on1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)c1ccc(Nc2ccccc2)c(N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36647",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](c1ccccc1OCC)[C@@H](C)c1ccccn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24068",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c2ccccc2c1CC(=O)OCC(=O)N(C(C)C)C(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225306",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cc2nc3ccccc3n2CC(=O)N2CCCC[C@@H]2C)cc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114451",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1ccc(C[NH+]2CCCCC2)c(Cl)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207567",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)[C@H]([NH3+])c1noc(Cc2ccc(F)c(F)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70730",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Nc1ccc2nc(-c3cccc(-c4nc5ccc(N)cc5s4)n3)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85999",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cccc(CN(C)Cc2ncnn2C)c1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9874",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N)nn1Cc1ccc(F)cc1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)n(C[C@@H]2CCC[NH+]2Cc2cnn(-c3ccccc3)n2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199376",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-c2nc3ccccc3c3nnc(S[C@H](C)C(=O)NC[C@@H]4CCCO4)n23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214620",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)S(=O)(=O)c1cc(C(=O)NCc2csc(=O)[nH]2)co1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94637",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[S@](=O)c1ccc(CNC(=O)CCc2c(F)cccc2F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54449",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "959",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1c(C[NH2+]CC(C)C)cnn1-c1ccccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113513",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc(N2CCN(C(=O)c3cccc(OC)c3O)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135573",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1ncnc(-c2cc(Br)ccc2F)c1[N+](=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73681",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nsc(NC(=O)[C@@H]2C=C[C@@H]([NH3+])C2)c1C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCc2nc(C[NH+](C)CC(=O)Nc3ccccc3)sc2C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87312",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC[C@@H](C(=O)NCC(=O)Nc2cccc(F)c2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111949",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(F)cc1NC(=O)[C@@H](C)O/N=C/C(=O)Nc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180668",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)C2CC[NH+](Cc3ccc(-n4cncn4)c(C)c3)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76161",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cn1ccnc1SCC(=O)NCc1coc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131561",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)C(=O)Nc1c(C)cc(C)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53723",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCN(CC(=O)[O-])[C@H](C)c1ccccc1[N+](=O)[O-] by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172485",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)[C@H](C(=O)Oc1cccc(-n2cccn2)c1)N1CCCC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180418",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Br)cc1/C=N/N1C(=S)[NH+]=N[C@@H]1c1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183295",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=C(Nc1cccc2c1CCCC2)c1ccc([N+](=O)[O-])s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53736",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2CCN(C(=O)CN3C(=O)[C@@H]4CC=CC[C@H]4C3=O)CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236718",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CSc1cc2c(cc1NC(=O)c1cccc(F)c1Cl)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39753",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC(=O)N1CC[NH2+]CC1)CC(C)(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171727",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H]2Oc3ccccc3[C@H]2NC(=O)C2=NN=C(c3cc(Cl)ccc3O)C2)cc1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164249",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](NC(=O)c1ccccc1F)C(=O)N1CCOC[C@H]1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174961",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Nc1ccc(S(=O)(=O)N(C(=O)CC)c2ccccc2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109015",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1C[C@H]([NH3+])CN(CC(=O)N2CCC[C@H]3CCCC[C@@H]32)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57102",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H]1CCCO1)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc3ccccc3c1)N2 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100085",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3858",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCC(C)(C)NC(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=O)ccn(CC(=O)NC2(c3ccc(F)cc3F)CCCC2)c1=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226050",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ncc(CN(C)C(=O)c2c[nH]nc2-c2ccc(OC)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45772",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(Cl)cc1NC(=O)CC[C@@H]1CCC[NH+](C2CCOCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132003",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CC2(CO)CCN(c3ccc4ccccc4[nH+]3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(-c2nnc(CN3CCC[C@H]3Cc3cccc(F)c3)o2)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26467",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NC(=O)C(=O)N(C)Cc2cccs2)cc1[N+](=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCc2nc[nH]c2C12CC[NH+](Cc1cnn(-c3ccccc3F)c1)CC2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nn(-c2ccccc2Cl)c(N)c1I by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1ccc(C[NH+]2CCN(C(=O)Cc3ccccc3F)CC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83390",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1c(NC(=O)c2ccc(SC)cc2)sc2c1CC[NH+](CC)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84311",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)[C@@H]2CC(=O)N=C(N3CC[NH+](Cc4ccc5c(c4)OCO5)CC3)N2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc2c1OC[C@@H](C(=O)N1CCC[C@H](c3ccn[nH]3)C1)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44978",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCc1ccc(-n2cccn2)cc1)N1CCC[C@H]1c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187776",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CO[C@H]1C[NH2+][C@H](C(=O)NCCc2ccc(F)cc2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "178449",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nn1cnc2ccccc2c1=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243795",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(-c2ccccc2Cl)nc2sc(C(=O)[O-])c(N)c12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)CONC(=O)[C@H]1CCCc2sccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4010",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NN)c2cccc(OC(F)(F)F)c2[nH+]1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "460",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@H](NC(=O)C1=Cc2cc(Cl)ccc2OC1)c1c(C)nn(C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194062",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccccc1NS(=O)(=O)c1ccc(Cc2cc(C)n[nH]c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ccc2cc(S(=O)(=O)N3CCC[C@H](C(=O)N4CCC5(CC4)OCCO5)C3)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149824",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCc1cccs1)c1ccc([C@H]2Nc3ccccc3S(=O)(=O)N2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "239006",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CNc1ccc(C[NH+]2C[C@H](C)[C@@H](C)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226478",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(CC(F)F)C(=O)C1C[C@H](C)O[C@H](C)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125154",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC[C@H](NC(=O)Cc1coc2cc(C)c(C)cc12)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nn(C)c(Cl)c1CSc1nnnn1C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149126",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule NC(=O)c1cccc(CNC(=O)[C@H]2C[C@H]2c2ccc(F)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168731",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)c1cc(-c2cs/c(=N\\C[C@@H]3CCCO3)n2/N=C/c2ccccn2)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166885",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(-n2nc(N3CCC[C@H](C(=O)Nc4ccc(F)cc4F)C3)ccc2=O)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218331",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CSCCOC(=O)[C@@H](C)Oc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133352",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCCS(C)(=O)=O)C(=O)[C@H]1CCCC[NH+]1Cc1cccnc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127165",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CSc1ccc([C@H](C)[NH2+][C@H](C[C@@H]2CCOC2)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136936",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H]1Sc2nnc(-c3ccncc3)n2N=C1c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42293",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(c1ccc(-c2nc(Cc3ccc(F)cc3)no2)c[nH+]1)C1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188535",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1C[C@@H](N(C)C(=O)c2cc(CCc3ccccc3)ccc2O)CC[NH+]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(CCn1ccc2ccccc21)Nc1ccc2c(c1)CCC(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1cc(Cl)c(OC)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(NC(=O)[C@H](C)Nc2ccc3c(c2)CCN3C(C)=O)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60736",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COCc1ccc(C(=O)NCCC2CCN(c3cc[nH+]cc3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59367",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC(C)=CC(=O)C[C@@](O)(c1ccccc1)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57585",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CNC(=O)CCc1c[nH]c2ccc(C)cc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45916",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1NC(=O)[C@@H](CC(=O)N2CCOCC2)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(Cc1ccco1)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89813",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(S(=O)(=O)N2CCNC(=O)CC2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)c2cc(C)nc3c2c(C)nn3-c2ccc(F)cc2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56915",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2cc(NC(=O)[C@H]3CCCN(c4ccc(-n5ccnc5)nn4)C3)ccc2s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109356",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cl)cc1N1CCN([C@@H](c2ccccc2F)c2nnnn2Cc2ccco2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139750",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C(=O)Nc2ccc3c(c2)OCCCO3)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25598",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccccc1NC(=O)CN(C)C(=O)[C@@H]1CC(=O)N(c2ccccc2CC)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117474",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[NH+](CCNC(=O)N[C@H]1CC(=O)N(C(C)(C)C)C1)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2493",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1OCC[C@H]1C(=O)Nc1ccc2nc(-c3cccs3)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205310",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)[C@](C)(O)[C@@H]1CCC[NH2+]C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C([O-])CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117860",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)N(C)CCOc2ccccc2F)cc1-n1cnnn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@@H](CCO)SCC(=O)c1cc(F)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65251",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[NH2+][C@@H](CC[C@@H]1Cc2ccccc2S1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129199",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H]1CN(C(=O)[C@H]2CC(=O)N(c3ccc4c(c3)OCCO4)C2)c2ccccc2O1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199246",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1c(F)cc(NC(=O)C(=O)N2CC[C@H](OCCC(C)C)C2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219408",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)c1cc(=O)[nH]c(-n2nc(-c3cccs3)cc2NC(=O)Cc2ccc(Cl)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237259",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C1OC(/C=C\\c2ccccc2)=N/C1=C\\c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13468",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]1CN(Cc2ccc(N3CCOCC3)c(F)c2)CC[NH2+]1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132502",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)CNc1nccn(CC(C)C)c1=O by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13492",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@@H](Cc1ccc(O)cc1)NC(=O)Nc1cc(C#N)ccc1OC(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190762",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1cc(C)cc(OC[C@H](O)C[NH+]2CCC[C@@H]2c2cc(C)no2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70993",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(F)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1c(F)cccc1C(=O)NCCC(=O)N1CCCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208985",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H](Cc3ccccc3)NC(=O)c3ccco3)CC2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29307",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1cccc(NC(=O)c2sc3c(c2C)[C@H](c2cccc(O)c2)CC(O)=N3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "41691",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1c(NS(C)(=O)=O)cccc1C(=O)N1CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247442",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@@H]([NH2+]Cc2cccc(Oc3ccccc3)c2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115986",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(C(=O)N[C@H](C)c2cccnc2)sc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88983",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Cn1ccnc1)NCc1ccc(-c2ccc(Cl)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1COCCN1Cc1cc(Cl)c(OC)c(OC)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193701",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1ccc2ccc([C@@H](Nc3cccc[nH+]3)c3ccc(O)cc3)c([O-])c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95045",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1ccc2c(c1)N(C(=O)C1CCCC1)CC2)c1ccc2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36559",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc2c(c1)OCO2)c1cn(C[C@H]2CCCO2)cc2c(=O)n(-c3ccccc3)nc1-2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119364",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)NCC(=O)Nc1cccc(OCc2cccc(F)c2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141530",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(Br)ccc1NC(=O)CCCn1c2ccccc2c(=O)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCN[C@@](C)(C[NH+]1C[C@@H](C)[C@@H](C)C1)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)N[C@H](C)c1ccc(S(N)(=O)=O)cc1)[NH+]1CCC(C)(C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103784",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@@H]1CCCC[C@@H]1N(C)C(=O)Nc1ccc(C(=O)NC)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14069",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H](Oc1ccc([N+](=O)[O-])cc1C=O)C(=O)Nc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5633",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(S(=O)(=O)NCC[NH+]2CCN(c3ccccc3F)CC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89895",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](Sc1ccc(F)cc1)C(=O)Nc1ccc(OC(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168394",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CCO[C@H](c2nc(-c3cccc(C[NH3+])c3)cs2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32186",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCN(CC)S(=O)(=O)c1ccc(NC(=O)Cc2coc3cc(C)c(C)cc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148367",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)[C@@H](C#N)c2nnc3n2CCCCC3)cc1Br by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(CCC(=O)NC2(C(N)=O)CCCC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111720",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCC[C@@]1(C2CCN(C(=O)c3noc4c3CCCC4)CC2)NC(=O)N(CCc2ccccn2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181121",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1c(-c2ccc3c(c2)OCCO3)cnc1S[C@H](C)C(=O)NC(=O)NC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)N[C@@H](c1ccccc1)C(C)(C)C)c1nncn1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144432",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COc1ccc([C@@H]2C(C#N)=C(N)OC3=C2[C@@H](C)N=N3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH2+][C@H](Cc1cc(C)cc(C)c1)[C@@H]1C[NH+]2CCN1CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175576",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C[C@H](NS(C)(=O)=O)C(=O)OC by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238005",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)NCc1ccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15954",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[S@@](=O)CCN1C(=O)NC(C)(C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10481",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(CC(=O)N2CCOc3ccccc32)cc1)C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135868",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)CCn1cc(C(=O)NCc2ccc([S@@](C)=O)cc2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230102",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=c1c([N+](=O)[O-])c(NCc2ccsc2)nc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83776",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCOC(=O)[C@H]1CCCC2=c3cccc(C(N)=O)c3=[NH+][C@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75406",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(NC(=O)[C@H]2COc3ccccc3O2)c2ncccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)C[NH2+][C@H]1CSCCC1(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105401",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)c1csc(-c2cccs2)n1)[C@H]1CCCO1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCCOc1ccc(CN2CCO[C@H](c3nc(C)cs3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104150",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(NC(=O)Cn2c(=O)n(Cc3ccccc3F)c(=O)c3sccc32)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42934",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1N1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77862",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN(C)C(=O)c2cn(Cc3cccnc3)nn2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234024",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N1CCC2(CC1)Oc1ccc(Br)cc1[C@H]1CC(c3ccncc3)=NN12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCOc1ncccc1C(=O)N1CC[S@@](=O)C(C)(C)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CO[C@H](CNC(=O)c1ccoc1C)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1C(=O)N[C@@H](C(=O)N1CCOc2ccccc21)C(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238584",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)C1CCN(C(=O)CC(F)(F)F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37612",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1noc(C)c1CSc1ccccc1C(=O)N1CCO[C@H](c2ccc(F)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142065",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1ccoc1)C(=O)N1CCN(Cc2ccsc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2288",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(N[C@@H]1CCCCC[C@H]1C(=O)[O-])[C@@H]1CCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](Cc1ccco1)NC(=O)c1ccc2nsnc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75060",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1=C(C)N(C)C(=S)N[C@H]1c1cccc(NC(=O)c2ccc(Br)cc2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1CN(C(=O)c1cnn3c(-c4ccccc4)ccnc13)CC2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20624",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O[C@@H](COCc1cccs1)Cn1nnc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70242",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](C(=O)Nc1ccc2c(c1)OCO2)N(Cc1cccnc1)C(=O)Cn1nnc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175845",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)N3CCN(c4ncccn4)CC3)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144596",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)CN2CC[NH+](C[C@@H]3CCCO3)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34875",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(N2C(=O)/C(=C/c3c[nH]c4ccccc34)SC2=S)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174375",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@](C)([NH2+]Cc1ccc(C(N)=O)cc1F)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220349",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cnc(CNC(=O)NNc2ccccc2Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108506",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN[C@]1(C(=O)OC)CC[C@@H](N2CCOC[C@@H]2C)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195113",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[NH+]1CCN(c2ccc(F)cc2[N+](=O)[O-])CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)CSCc1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59564",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C/C(=C/C(=O)OCc1nc(N)c2ccccc2n1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189964",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(CCn1cc[nH+]c1)Nc1cccc(C(=O)N2CCOC[C@@H]2C2CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232002",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1cccc(NCc2cccc(C)n2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10833",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC(C)C[NH+](C1CCCC1)[C@H]1C[C@H](C(C)(C)C)CC[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216640",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(=O)n(-c2ccccc2C)nc1C(=O)Nc1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32675",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOCC1(CNc2nc(C)nc3c2c(C)nn3C)CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186070",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CSCc1nnc(-c2ccccc2F)o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182297",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1cccc(CNC(=O)c2cc(C(N)=O)cn2C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Oc2nccn3c(=O)n(CC(=O)N4CCN(c5ccccc5F)CC4)nc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63254",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(C(=O)c2ccc(Br)o2)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121266",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Clc1ccc(NCc2ccc[nH]2)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164376",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#Cc1ccc(CCC(=O)Oc2ccc(Cl)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76198",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(OC)c(N(CC(=O)N2CCOCC2)S(C)(=O)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148420",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule NC(=O)CCn1nc(-c2ccc(F)cc2)c2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139767",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1c(C(=O)N[C@H]2CCC[C@H](S(C)(=O)=O)C2)cc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Cc1cn2ccccc2[nH+]1)Nc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225319",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(C[C@H]1CCS(=O)(=O)C1)Oc1cccc(Oc2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119625",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)cc1NC(=O)C(=O)NCC1(c2ccccc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87453",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CSc1nccnc1CNC[C@@H]1CCCC[NH2+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183959",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(NC(=O)NCCc2cccc(Cl)c2)cc1NC(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114463",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(OCc1cccc(F)c1)c1ccc(N2CCNC2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79386",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc([N+](=O)[O-])cc1S(=O)(=O)[N-]c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242558",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(NC(=O)CSc2ccc(S(=O)(=O)N3CCCC3)cn2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162515",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)C(=O)NC[C@H]1CCCN(C(=O)c2cc(F)cc(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135481",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(OC)cc(C(=O)Nn2cc(C(=O)NCc3ccccn3)c3ccccc3c2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227144",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1O[C@H](C)CNC(=O)CN1C(=O)c2ccccc2C1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153260",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)N1Cc2cc(C)ccc2OC2(CCN(C(=O)c3cc[nH]n3)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15766",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule S=C1SCCN1CN1CCc2ccc(Cl)cc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193460",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](NC(=O)C(C)(C)NC(=O)Nc1ccccc1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155725",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule NC(=O)[C@H]1CCN(C(=O)[C@H]2C[C@@H]2c2ccccc2Cl)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83527",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](Nc1ccc2nnc(-c3ccccc3F)n2n1)c1noc(C)n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccn2cc(C[S@](=O)[C@H](C)C(=O)NCc3ccccc3)nc12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218086",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#Cc1ccc(CCC(=O)N[C@@H](Cc2ccccc2)C2CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15200",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCNC(=O)NNC(=O)Cc1cccs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233755",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](C)N[C@H]2CCN(CC(F)(F)F)C2=O)c(OC)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11340",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nc(-c2cccc(C[NH2+][C@H](C)c3cnn(C(C)C)c3)c2)n[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185275",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@@H](c1ccn(CCC(F)(F)F)c1)C1CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89840",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1cc[nH+]c(Cn2nccc2C)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(OCC(=O)N/N=C/c2ccc(N3CCOCC3)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192259",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Fc1ccc([C@H]2OCC[C@H]2CCl)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196590",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=C(\\C)c2ccncc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111272",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc([C@H]2[C@@H](C(=O)NCc3ccc(F)cc3)c3ccccc3C(=O)N2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92090",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccc([C@@H]2SCCN2C(=S)Nc2ccc(Cl)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122887",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule NS(=O)(=O)CC1CC[NH+](Cc2ncc(-c3ccccc3Cl)o2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNS(=O)(=O)[C@@H]1CC[NH+](CC(=O)Nc2ccccc2C(C)(C)C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97489",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1[C@H]2[C@H]3C=C[C@H](CC3)[C@H]2C(=O)N1/N=C/c1cn(Cc2ccccc2Cl)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111963",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)Cn1c(=O)n(CCc2ccccc2)c(=O)c2c3c(sc21)COC(C)(C)C3 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96974",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cn1c(CNc2ccc(C(N)=O)c(F)c2)nnc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99146",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@@H](C)N2CCO[C@H](c3ccccc3)C2)c(F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212323",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C)c(NC(=O)N2C[C@@H](C)C[C@@H](C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231545",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C[NH+]1CCCCC1)NC(=O)N1CCC(c2ccc(O)cc2)CC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1c2cc3c(cc2C2(CCCC2)CN1C(=O)c1cccc(C#N)c1)OCCO3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187292",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1OCC[C@@H]1C(=O)N1CCC[NH+](CC(=O)N(C)C)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53305",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(C(=O)NNC(=O)Cc2ccc(-c3ccccc3)cc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19537",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](CC(=O)NN1C(=O)N[C@](C)(c2ccccc2)C1=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6154",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1ccc(CNc2cccc(OCCCC#N)c2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151442",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(C(=O)Nc2cc(Cl)ccc2[N-]S(=O)(=O)c2ccccc2F)cn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150763",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)N[C@@H]1CCN(c2nc(C)nc3c2c(C)nn3C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201939",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cccc(C)c1NC(=O)C[NH+](C)CC(=O)N1CCC[C@H]2CCCC[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62437",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)[C@@H](C[NH2+]CC(=O)N1CCc2ccccc21)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49395",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1CN(C(C)(C)CNC(=O)CSCC(F)(F)F)C[C@@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210665",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](NC(=O)[C@H](C)Oc1ccccc1C(F)(F)F)C(=O)N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOC(=O)[C@@H]1CCCN(C(=O)N[C@@H](C)c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97656",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)OCc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217601",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=C([O-])c1ccc(/N=C\\c2ccccc2O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201961",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COC[C@@](C)(C#N)NC(=O)c1ccc(Br)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153293",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1ccnc1CNC(=O)c1cn(Cc2ccccc2F)nn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179824",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2csc3ncn(CC(=O)Nc4ccc(F)cc4F)c(=O)c23)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150335",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCO)S(C)(=O)=O)c(C3CC3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154548",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule N#Cc1ccc([C@H]2Nc3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64377",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C1=C[C@@H](S(=O)(=O)NC[C@H]2CCCO2)C=N1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127673",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCCNC(=O)C(=O)c1c[nH]c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165405",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule BrCC1(C[C@@H]2C[C@H]3CC[C@@H]2C3)CCCC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98988",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccccc1N1CC[C@@H]([NH2+][C@@H](C)C[C@H]2CCCO2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "234627",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(CCCNC(=O)[C@@H]2CN(C)CCO2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211636",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cc([O-])nc(SCc2ccc(F)cc2)n1)N1CCN(c2cccc[nH+]2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34888",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1C(=O)Nc1cc(NC(=O)c2ccccc2C)cc(C(=O)[O-])c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184353",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule OC[C@@]1([NH2+]C2CC2)CCC[C@H]1CCOC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165736",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC(=O)c1ccc(NCc2cccc([N+](=O)[O-])c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19602",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NC[C@H]1COc2ccccc2C1)[C@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "243958",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=[N+]([O-])c1cnc(NCCCn2cc[nH+]c2)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115081",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(NC(=O)C[S@](=O)[C@H](C)c2ccc(Cl)c(Cl)c2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(CC(=O)N(CCC(F)(F)F)C1CCC1)c1ncnc2[nH]cnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "173716",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)NC(=O)C[NH+](C)Cc1nc2ccc(N)cc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141388",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nc2ccc(NC(=O)C(=O)NC3CC[NH+](CC4CCCCC4)CC3)cc2o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104059",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)N1CCC(CNC(=O)[C@H]2CC(=O)N(c3ccc(C)c(C)c3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48009",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)n1cc(C(=O)Nc2ccc3cc[nH]c3c2)c2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92079",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC(C(=O)N2CCC[C@@H]2C(=O)N2CCN(C)CC2)C[C@@H](C)O1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208881",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccnc1NCc1cnc(-c2ccccn2)s1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35796",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H]1CCCC[C@H]1OC(=O)CCc1cc(Cl)cs1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10915",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cc1cccc2ccccc12)N[C@H](c1ccccc1)c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77724",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "498",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(COC(=O)c1cccs1)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60056",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOc1ccc([C@@H]([NH2+]C)c2c(F)cccc2F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48484",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nc(-c2ccccc2)c[nH]1)N1CCN(c2ccccc2F)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccccc1F)c1ccc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5474",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(C(=O)CSc2nnc(-c3ccccc3)n2N)C[C@@H](C)O1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25846",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)[nH]2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109447",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1CCCC[C@H]1NC(=O)Cc1coc2cc3c(cc12)CCC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100931",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1noc(CN(C)C(=O)Nc2ccc(N3CCO[C@@H](C)C3)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122144",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C)c1OC[C@H](O)Cn1c([C@H]2CC(=O)N(c3ccccc3F)C2)nc2ccccc21 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91803",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#Cc1ccc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210960",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)[C@H](C)SCC(=O)NC1(C#N)CCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30335",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CC(=O)NC[C@H](c2cccs2)[NH+]2CCCCCC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195881",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@H]([NH2+]Cc1cnn(C)c1C)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50591",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@@H](CCCO)NC(=O)N1CCN(c2ncnc3sccc23)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22650",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CSc2ncccc2C(=O)Nc2ccc3oc(C)nc3c2)no1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87977",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(COc1ccc(Oc2ccccc2)cc1)Nc1cc(N2CCCC2=O)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75699",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc2c1C(=O)O[C@H]2S(=O)(=O)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C2(C(=O)N3CCC[C@@H](c4ccn[nH]4)C3)CCCC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176172",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[NH2+][C@H]1c2cc(F)c(F)cc2[S@](=O)[C@@H](C)[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16075",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "539",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Br)c(C(=O)N2CCC3(CC2)OCCN3S(=O)(=O)c2ccccc2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165374",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Nc1ccc(=O)n(CCCN2CCN3C(=O)NC[C@@H]3C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48039",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3375",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)c1cn(C)c2ccccc12)C(=O)Nc1ccc(S(N)(=O)=O)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227309",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH2+][C@H](CCO)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10844",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc(S[C@@H](C(=O)[O-])C2CC2)cc1F by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116944",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)C(=O)NCC(=O)Nc1ccc(OC)c2ncccc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187003",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)([NH2+]CC(=O)Nc1c(C)n[nH]c1C)C(=O)[O-] by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195491",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCCNC(=O)c1ccnc2ncccc12)c1cccc(F)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44420",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H](NC(=O)c1cnc(Oc2ccccc2)cn1)[C@@H]1CCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156349",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1cc(=O)n(CC(=O)Nc2ccc(OC)cc2OC)c(-c2cccc(F)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206280",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CNC(=O)c1ccc(CNC(=O)N[C@@H]2C[C@H](C)CC[C@H]2C(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176923",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C[C@@H]1CC[C@](C#N)(C2(O)CCOCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7835",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCn1c(C[NH+]2CCC(NC(=O)c3ccoc3C)CC2)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148039",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1c(C)[nH]c(C(=O)N[C@@]2(C)CCS(=O)(=O)C2)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2CCN([C@@H]3CC(=O)N(c4ccc(C(F)(F)F)cc4)C3=O)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80831",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)NC(=O)NCc1ccc(C[NH+](C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccccc1[C@H]([NH3+])CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158075",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CN1CCO[C@@H](CNC(=O)CN2CC[S@@](=O)C(C)(C)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9214",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NC1CCCCC1)[C@H]1CC(c2c(F)cccc2Cl)=NO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)N[C@@H]1CCCC[C@@H]1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCCNC(=O)[C@@H]1CC=CCC1)[C@@H]1CC=CCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249128",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CN1CCN(C(=O)Cc2c[nH]c(=O)n(C)c2=O)[C@H](C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111050",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(COC(=O)CCc2nc(-c3ncccn3)no2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171678",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1[nH]nc(C(N)=O)c1NC(=O)[C@H](C)c1ccc(Br)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)CN(C)C(=O)NCCOCC(=O)[O-] by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155275",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N/N=C/c2cccs2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101634",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1Cn1cc(C(=O)N2CCC([C@H](O)CCc3ccccc3)CC2)nn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5987",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H](NC(=O)c1ccccc1Cl)[C@H]1COc2ccccc2O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1ccc2ccc(NC(=O)c3cccc(-n4cnnn4)c3)cc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88185",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN1CCO[C@@H](C(=O)NCc2ccc(Cn3ccccc3=O)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223764",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccnc1)C1CC[NH+](C2CC[NH+](CC3CCCC3)CC2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246624",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1ccc(Cl)cc1F)[C@@H]1CCCN1C(=O)c1cc(Cl)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220927",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc([C@H](CNC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)[NH+](C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45825",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nc(C[NH2+]Cc2ccc(N3CCC[C@H](C(N)=O)C3)cc2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78748",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1cccc(/C=C2/SC(=S)N(c3ccc(Cl)c(Cl)c3)C2=O)c1)C(=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183600",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COC(=O)c1ccc(NC(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185877",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C([O-])c1c(-c2ccc(Cl)cc2)noc1CO[C@@H]1CCCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC1=NN(C(=O)COc2ccc(C(C)(C)c3ccccc3)cc2)[C@@](O)(C(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33001",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nc(CS(=O)(=O)Cc2ccc(F)c(Br)c2)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148846",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCn1ncc(C[NH+]2CCC3(CC2)c2ccccc2[C@@H]([NH+](C)C)[C@@H]3O)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156129",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CN[C@H]1CC[C@H]([NH3+])C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164718",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@H](OC(=O)c1nccnc1N)c1nc(C(C)(C)C)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120380",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2cc(C(=O)N(C)c3ccc(OC)nc3)[nH]c2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6098",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(N(C(=O)c2cc(=O)c3ccccc3o2)C2CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64711",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NC[C@@H](O)c1ccccc1Cl)c1ccc(OC(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188397",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule N#C[C@]1(C2(O)CC[NH2+]CC2)CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20060",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1ccc(NC(=S)NC(=O)C2CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238699",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=C(c1ccccc1NS(=O)(=O)/C=C/c1ccccc1)N1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181679",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)(C)Oc1cc(C(=O)N2CCC(CO)CC2)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34522",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(F)F)C(=O)CCc1ccc(F)cc1F by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16662",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(-c2nn3c(SCC(=O)c4ccc(Cl)cc4)nnc3nc2[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72047",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCN[C@@]1(C(=O)OC)CC[C@@H](OC(C)(C)C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]([C@H](C)C[NH2+]C(C)(C)C)N(C)Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245999",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)Nc1ccc(NC(=O)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49945",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(N2CCn3c2nn(CC(=O)N2CCCCCC2)c(=O)c3=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182163",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CCC[NH+](C(C)(C)CNC(=O)/C=C/c2ccc3c(c2)OCO3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1/c(=N/C(=O)CN2C(=O)CCC2=O)sc2cc(F)cc(F)c21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136893",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CN1CCN(C(=O)CCCN2C(=O)/C(=C/c3cccc(Br)c3)SC2=S)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97434",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO/N=C(/C(=O)Nc1cc(C(N)=O)c(F)cc1F)c1ccco1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101316",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(/N=C2/C(=O)N(CN3CCOCC3)c3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC1=NC(=O)[C@H](c2ccc(Br)cc2)C([O-])=N1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48440",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccccc1NC(=O)c1ccc(NC(=O)C[NH+]2CCC[C@H]2c2ccc3c(c2)OCCO3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242407",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(NC(=O)C(C)C)cc1NCC(=O)N1C[C@@H](C)O[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96234",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCc2c(C(=O)N3CCN(c4cc[nH+]cc4)CC3)csc2C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nn1c(C)cc(CN2CCN(c3[nH+]cccc3C)CC2)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63231",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(O)c(C(=O)NCc2ccc(-c3csc(C)n3)s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131127",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@]1(O)CCOc2ccccc21)C1CCC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21627",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1c(C)nn(CN2CCO[C@@H](c3ccccc3Cl)C2)c1=S by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CO)N(C)C(=O)CCn1cnc2sc3c(c2c1=O)CCCC3 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176082",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cccc(NC(=O)c2cn(-c3ccc(-c4noc(C5CC5)n4)cc3)nc2C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32457",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2csc(Nc3ncccc3C)n2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169324",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC[C@@H](C)CN(CC)c1ncnc2ccc(N)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93493",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1cnc(CCNC(=O)Nc2cc(OC)ccc2F)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187404",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1C[C@]1(O)c1cscn1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200840",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)Nc1ccc(-c2nc(Cn3cccn3)c(C)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79696",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccn2c(=O)c(C(=O)NC[C@@H](C)CN3CCOCC3)cnc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227504",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(C)n2c(CN(CC(F)F)C3CC3)cnc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48366",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1=C(N)OC2=C(C(=O)CC(C)(C)C2)[C@H]1c1c(OCC)ccc2ccccc12 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104181",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc([C@@H]2CC(=O)C(/C=N/C3Cc4ccccc4C3)=C([O-])C2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189984",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC(C(=O)N[C@@H]2CCc3c2ccc(Cl)c3Cl)C[C@@H](C)O1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141677",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1ccccc1CN1CCN(c2cccc3c2C(=O)N(CC2(O)CCCCC2)C3=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66610",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(CC(=O)N2CCN(S(=O)(=O)c3ccc4c(c3)sc(=O)n4C)CC2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8405",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCNC(=O)NNC(=O)[C@H]1CCC(=O)N(c2ccc(C)c(C)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115858",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nnc(C[NH+](Cc2c(F)cccc2N2CCCC2)C(C)(C)C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(-c2n[nH]c(CC(C)C)c2NC(=O)c2cccc(Cl)c2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42730",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1ccccc1OCC(F)(F)F)C(=O)N[C@@H]1CCc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46195",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](NC(=O)C(C)(C)c1ccccc1)c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1nnc(-c2cccc(SC(C)C)c2)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226418",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](NC(=O)N[C@H](C)Cc1c(C)nn(C)c1C)C(C)(C)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1CC[C@H](COC(=O)[C@@H]2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11886",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc([S@@](=O)Cc2nnc(-c3ccccc3C)o2)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180750",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule C=CCN1C(=O)S/C(=C/c2ccccc2[N+](=O)[O-])C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28490",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(C(C)=O)cc1CC(=O)N[C@H](C)c1cn(C)nc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55918",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1sc(NC(=O)c2ccccc2)c(CN2CCc3ccccc3C2)c1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99980",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCCC[C@]1(CO)CCCN(S(=O)(=O)c2ccc(C)c(F)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C1C[C@@H]([NH2+]CCC2=CCCCC2)C(=O)N1c1cccc(Cl)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238047",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1ccc(-c2ccc(Br)cc2)nn1Cc1ccc(F)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16193",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCCN1C(=O)[C@@H](C(=O)Nc2nc3ccccc3[nH]2)[C@H](O)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112110",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(N2CC[NH+](C)[C@@]3(CCNC(=O)CC3)C2)nc(OC)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23491",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC[C@H](C[NH3+])Nc1nc2ccc(Br)cn2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92226",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc2c(c1)[C@H](CC(=O)N(C)Cc1ccno1)C(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211148",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(-n2c(SCC(=O)N[C@@H]3CCS(=O)(=O)C3)nc3sc(C)c(C)c3c2=O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@H](C)NC2CC[NH+](C)CC2)ccc1O by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105300",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC[C@@H](Cl)CN(C)C[C@@H]1COc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165511",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@H](Nc1cnn(C)c(=O)c1Cl)C(=O)Nc1nccs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187732",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)OCC[NH+]1CCC(NC(=O)CN2CCCCC2=O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196674",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](CC(=O)NC(=O)NCc1ccco1)C[C@@H]1COc2ccccc2O1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211293",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCC(=O)N1CCCC1)c1cn(-c2ccccc2)nc1-c1ccc(F)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5892",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](C(=O)Nc1cccc([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22358",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C[C@H](C)C#N)C(=O)Cn1cnc2c(cnn2-c2ccccc2)c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(N2CCC(C(=O)NCc3ccccc3Cl)CC2)nc2cc(S(C)(=O)=O)ccc12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204493",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc2nc(NC(=O)CSc3nnc(Cn4c(=O)sc5ccccc54)n3C)sc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66546",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(-n2nc3ccc(NC(=O)c4cc([N+](=O)[O-])ccc4Br)cc3n2)cc1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44411",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(CN(C)C(=O)c2cnn(-c3nccc(-c4ccco4)n3)c2C)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169801",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@@H](C(=O)Nc1c(C(=O)OC)[nH]c2ccc(C)cc12)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176723",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C=CCN(Cc1cccc(C#N)c1)Cc1c[nH]nc1-c1ccc2c(c1)OCCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52384",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(NCc1cccc(Cl)c1)C(=O)N[C@H]1CCCCNC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58145",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@](C)(NC(=O)CCOC1CCOCC1)c1nccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126141",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OCC(=O)NNC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)ccc1Cl by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176148",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Cc1ccc(-n2cccc2)cc1)NCc1csc(C2CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190315",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1cccc2sc(N3CCN(C(=O)/C=C/c4ccccc4Cl)CC3)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47466",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CCCO)N[C@H]1C[NH+]2CCC1CC2 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71649",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(NCCCCN1CCOCC1)c1csc2c1CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65169",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(C(=O)N2CCCCC2)cc(NC(=O)c2cc(=O)c3ccccc3o2)c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49553",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)[C@@H](O)CNC(=O)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H](C)NC(=O)[C@H](C)SCC(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84799",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(/C=N/NC(=O)CC#N)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134402",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=[S@@](CCN1CCCN(Cc2cccs2)CC1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187285",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule N#Cc1ccc(/C=C\\c2[nH+]ccc3c2[nH]c2ccccc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205982",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1ccccc1)N1C[C@@H]2CC[C@H](C1)N(C(=O)CCc1ccccn1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218437",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#CCCN(Cc1ccccn1)Cc1n[nH]c(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191046",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "304",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2F)N2CCc3ccccc32)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117282",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C([O-])CNC(=O)/C=C/c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21600",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H]1CCC[C@](O)(CNC(=O)Cc2c(F)cccc2F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210050",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C/C(=N\\NC(N)=S)c1ccc(O)cc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162744",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc2c(n1-c1ccc(C(=O)NCc3ccccc3)cc1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49951",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C[C@H]1CCC[NH2+]C1)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147902",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule N#Cc1csc(C[NH2+][C@H]2CCC[C@@H](OCC(F)(F)F)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194241",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1c(C)sc(NC(=S)N2CC[NH+]3CCC[C@H]3C2)c1C(=O)OC by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200930",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O[C@H]1C[C@@H](c2cc(F)ccc2F)N(Cc2cnc(C3CC3)s2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86448",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1csc(C[C@H](O)Cc2nccs2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247401",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(CNC(=O)[C@H](C)Sc2nc(C)nc3ccccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169721",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(N[C@H]1C(=O)N/[N+](=C\\c2ccc(Br)cc2)[C@H]1c1ccccc1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85029",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)NC(=O)c1cccc(NC(=O)[C@H]2CCCC[C@@H]2C(=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136361",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1ccc(NS(=O)(=O)c2ccccc2)cc1)N1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "43131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(C)C[C@@H](C(=O)NNC(=O)c2sccc2C)[C@@H](C(=O)[O-])C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "32348",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ncc(Cl)c(C(=O)N[C@H]2CC[C@H]([NH+](C)C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246693",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Cc1cccs1)NCCOc1ccc2nnc(-c3ccccc3)n2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92630",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCOC(=O)[C@H](C)Nc1cc(-n2ncc(=O)n(C)c2=O)c(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184459",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1ccc(NC(=O)c2ccccc2Cl)cc1)c1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101987",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N/C(CCCSc1ccccc1[N+](=O)[O-])=N\\O by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC1=[NH+]CCC1)C(=O)[O-] by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67827",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule COc1cccc(N2C(=O)c3oc4ccccc4c(=O)c3[C@H]2c2cccc([N+](=O)[O-])c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(S(C)(=O)=O)cc1C(=O)NCCOCC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134741",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(Cl)c(C)cc1NC(=O)[C@H](C)N1CCN(S(=O)(=O)c2c(C)noc2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "449",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCCn1c(NN)nc2c1c(=O)n(C)c(=O)n2C by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51606",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(Nc1ccc(Oc2ccc(Br)cc2)cc1)c1cnc2n(c1=O)CCS2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176348",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NCc2ccccc2C#N)c(OC)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C[NH+]2CCNC(=O)[C@@H]2CC(=O)N2CCNC(=O)C2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226716",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCn1c([C@@H](C)NC[C@@H](C2CC2)[NH+](C)C)nc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Clc1ccc(-c2cnc3cccnc3n2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247113",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCCc1ccc(F)cc1)NC[C@@H]1CC[NH+](C2CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111995",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule NC(=O)c1ccc(CSCCOc2ccc(F)cc2Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187630",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CN1CCN(C(=O)c2cccc(Cl)c2Cl)CC1)NCC1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(N2C(=O)CCC2=O)cc1)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249414",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CN2CCO[C@H](c3nccs3)C2)cc1F by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228977",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=CCOc1cccc(NC(=O)[C@@H](C)Oc2cccc(C)c2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101667",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C#CCn1/c(=N\\C(=O)C2CCN(S(C)(=O)=O)CC2)sc2cc(F)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128964",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccc2nc(/N=C(\\N)NC(=S)Nc3ccc(Cl)cc3)nc(C)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115492",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCCCSc1nc2n(n1)[C@@H](c1sccc1C)C(C(C)=O)=C(C)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100549",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(C2=CC[NH+](C[C@@H](O)COC[C@@H]3CCCO3)CC2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117440",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(C(=O)/C=C/c1cccnc1)c1cccc2ncccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162182",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCn1c(SCc2ccccc2)nnc1-c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N(Cc1ccc(NC(=O)[C@@H]2CCCC[NH+]2C)cc1)C1CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49130",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule c1ccc(-n2cnc(C[NH+]3CC[C@@]4(CCOC4)C3)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199049",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCc1ccc(N2CCOCC2)cc1)Nc1cncc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N2/C(=N/C(=O)CCNC(=O)OC(C)(C)C)S[C@H]3CS(=O)(=O)C[C@@H]32)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95572",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NN1C(SCC(=O)Nc2ccc(Cl)cc2)=NN[C@@H]1[C@@H]1N=NC2=C1CCC2 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89567",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cccc(S(=O)(=O)NCc2csc(C3CC3)n2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120315",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H]([C@@H](C)[NH3+])N2CCN(C)C(=O)C2(C)C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37725",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cn1ncnc1CCNS(=O)(=O)c1cccc(C#N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N[C@H](C#N)c2cccc(Cl)c2Cl)cc1[N-]S(C)(=O)=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83067",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)CSc1ccc([N+](=O)[O-])cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143102",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CC[C@@]2(CCC1=O)CN(C(=O)CCN(C)S(C)(=O)=O)CCN2C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(CNC(=O)N(C)Cc2cn(-c3ccccc3)nc2-c2ccccc2)c(=O)[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCN(C(=O)Cc1cccc(OCC#N)c1)C1CCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65505",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule O=C(Cn1ccc(=O)c2ccccc21)N[C@@H]1c2ccccc2C[C@@H]1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[NH+]1CCC(CC(=O)N[C@H](C(=O)[O-])c2ccc(F)cc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8365",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule C[C@@H](CCO)[NH2+][C@@H]1CCc2[nH]c3ccccc3c2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6653",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CNc1cc[nH+]c(CN2CCC[C@H](C)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17786",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)C[NH+](C)Cc1nc2ccccc2n1C)c1ccco1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "241378",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CC(=O)Nc2nonc2-c2ccc(OC(C)C)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66876",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@](C)(NC(=O)c1ccc2ccccc2c1O)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "14155",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC[NH+](Cc1nc2c(N)cccc2o1)C[C@@H](C)C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158593",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@@H](C)N(CC)C(=O)c1ccccc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "589",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](NC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99115",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(NC(=O)[C@@H](C)n2nc(-c3cc(C)oc3C)cc(N)c2=O)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125694",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CCOC(=O)c1ccc(CN2CCO[C@H](C#N)C2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23931",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCc1ccc(C(=O)N2C[C@@H](C[NH+](C)C)[C@@H](CO)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135941",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CC#N)N1CCc2c(F)ccc(F)c2C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@@H](C)NC(=O)[C@@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52333",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1OCC[C@H]1C(=O)NCc1ccc(C(=O)NCC[NH+](C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(C)c1ccccc1NC(=O)NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169274",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc([C@@H]2CC(=O)NC3=NC(SCc4ccccc4Cl)=NC(=O)[C@H]32)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81887",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CCNC(=O)c1cccn1-c1cccnc1)[NH+]1CCCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111656",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCC1(c2ccccc2Cl)CCOCC1)c1cccc(F)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196786",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule COc1ccc(N(C)C(=O)CCCO)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170191",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)C1(C)CCN(C(=O)c2cc(CC)n[nH]2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "228339",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)cc1NC(=O)[C@@H]1C[C@H]1c1ccc(C)s1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135167",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(Cl)cc1C[C@H](O)[C@@H](C)OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123277",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N1CCC(C(=O)OCc2ccc(-n3cccn3)cc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule C[C@@H]1C[C@](CCO)([C@@H](C)[NH3+])CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86690",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)CN2CCN(C(=O)CCS(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227114",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(-n2ccnc2)c(C(=O)N2CCN(C(=O)[C@H]3C[C@H]3C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194692",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(C)C(=O)CC1CCN(C(=O)C(C)(C)c2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64081",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1CCC[C@@H](OCC(=O)NNc2ccc(-c3ccccc3)nn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OCCn2c([C@@H]3CC(=O)N(Cc4ccccc4)C3)nc3ccccc32)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196859",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC(C)CC[C@@H](O)[C@H]1CCO[C@]2(CCSC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91992",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)[C@@H]1CC(=O)N(CCC2=c3cc(F)ccc3=[NH+]C2)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217902",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@]12CCC(=O)N1[C@H](C(=O)NCc1ccc(Br)cc1F)CS2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96111",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc(C)cc1[C@@H](O)CN1CCN(c2nccs2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([NH+](C)C[C@H]2C[C@@H]2C)cc(C(=O)[O-])c1N by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215139",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1ccc(Oc2cccc(C(=O)[O-])c2)nc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98506",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC(=O)N1CCC[C@@H](c2nc3c(c(C)[nH+]2)CCCN3Cc2ccc(F)cc2)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207664",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC[NH+]1CCN([C@@H](C)C[NH2+][C@@H](C)c2nc3cc(Cl)ccc3n2C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31059",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(C[NH2+][C@H]2CCC(=O)N(C)C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55440",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](Oc1cccc(Cl)c1)C(=O)N[C@H](C)c1ccc(S(N)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174899",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCCC[C@@H](C)NC(=O)NCc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "126338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1CCCC[C@H]1NC(=O)C1CCN(c2ncnc3c2nc2n3CCCCC2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174660",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]([NH2+][C@H]1CC(=O)N(CC(F)(F)F)C1)c1cc(C)ccc1OC by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148843",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC1=C(C(=O)Nc2ccccc2)[C@@H](c2ccc(O)c(O)c2)n2ncnc2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152444",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1CC1)c1ccccc1NC(=O)C1CCOCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140246",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccsc1C(=O)NNS(=O)(=O)c1c(C)cccc1[N+](=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67874",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(C(=O)NCc2ccc(F)cc2)CCCN(C(=O)Nc2ccc(F)c(Cl)c2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170001",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1[C@@H]2CCC[C@@H]2N1C[NH+]1CCC(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42611",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc2[nH]nnc2c1)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61487",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[NH+](Cc1ccc(Br)cc1)[C@H]1CCC[C@@H]1S(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48001",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)C[NH+](C)[C@]1(CN)CCN(Cc2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156782",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(N)cc(C)c1S(=O)(=O)NC[C@@H]1CCC(=O)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145472",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1sc(N2C(=O)C([O-])=C(C(=O)c3ccccc3)[C@@H]2c2ccccc2OC)nc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62541",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]([NH2+]Cc1ccc2c(c1)n(C)c(=O)n2C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208563",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(C)c1noc(CCCC(=O)N[C@@H]2CC[NH+]3CCCC[C@H]23)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53325",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule Cc1cc(C)c2c(=O)cc(CS[C@@H]3NN[C@@H](c4ccco4)[NH+]3C)[nH]c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23528",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCCn1c(=O)c(=O)[nH]c2ccccc21)[C@H]1CCCN(c2ncccn2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122894",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)Oc1ccc(O)c([C@H]2CCC[NH2+]2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(C)n([C@@H](C)C(=O)N2CCc3c([nH+]cn3C3CC3)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144449",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1C[C@@H](C)CN(C(=O)CN2CCN(C(=O)CC(F)(F)F)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCN1CCN(C(=O)c2cccc([N+](=O)[O-])c2)CC1)c1ccc(F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35867",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)CN(C)C(=O)N[C@@H]1C=CCCC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137643",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C=CCN(CC=C)C(=O)[C@@H](C)NC(=O)c1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H](C)CCN1C(=O)C[C@H](O)c1ccc(Cl)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139797",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCNC(=O)C1CN(C(=O)C(=O)Nc2cccc(C[NH+]3CCCCC3)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c([C@@H]2CCC[NH2+]C2)nn(C/C=C/c2ccccc2)c1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(F)cc(CNC(=O)c2sccc2Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88691",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C/c1cnc(-c2cccnc2)nc1C1CCN(C(=O)[C@H](C)Oc2ccccc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132109",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3134",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1CCN(C(=O)c2ccn(C)n2)C[C@@H](Cc2ccc(-c3ccccc3)cc2)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77681",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(=O)NCc1ccc(S(=O)(=O)N/N=C/c2cccc([N+](=O)[O-])c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule CN[C@](C#N)(CSC[C@@H](C)CO)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64604",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOCC(=O)NNC(=O)c1sc2cccc(F)c2c1COC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120959",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cccc1[C@@H](CNC(=O)NCCc1ccccc1)[NH+]1CCCCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59252",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(CNc2ccc(C(=O)[O-])c(F)c2F)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96346",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C([C@H]1Cc2ccccc2O1)N(Cc1cccnc1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186660",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](NC(=O)Cn1nnc(-c2ccsc2)n1)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169430",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)NCC(=O)Nc1nc(-c2ccc3ccccc3c2)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52500",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2csc(NC(=O)CCN3C(=O)[C@@H]4CC[C@](C)(C3=O)C4(C)C)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30950",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)c1ccc(N2C(=O)[C@@H]3CC4=c5ccccc5=[NH+][C@H]4[C@@H](c4cccc(OC)c4)N3C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167719",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Cn1cnc2nc3c(cc2c1=O)CCCC3)NCCC[NH+]1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C[C@@H](NC(=O)c1ccc[n+]([O-])c1)c1ccc(F)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64276",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1n[nH]c(-c2cccc(CNC(=O)[C@H](C)Cc3cccc(Cl)c3)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121276",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccccc1[C@]1(CC(=O)N(C)[C@H](C)c2nccs2)CC(=O)N(Cc2cccnc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95607",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cn1cc(S(=O)(=O)[N-]c2c(F)cc(Cl)cc2F)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19989",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2ocnc2C(=O)NCCCn2ccnc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)[C@@H](CC(C)C)N2Cc3ccccc3C2=O)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238954",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nc(Cc2ccc(F)cc2)sc1C(=O)NNC(=O)C[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222710",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCN(CC)C(=O)Nc1ccc([C@H](C)NC(=O)C2CC=CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "247765",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCC[C@@H](c2cc(CCO)n(C)n2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155198",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1992",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)N1CCc2cc(NC(=O)c3ccccc3Cc3ccccc3)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122666",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)c2cnc3n(c2=O)CCS3)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140513",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C[NH+](C)Cc2c([O-])[nH+]nn2-c2ccccc2)s1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)cc1S(=O)(=O)N1CCc2c(c(COCc3ccc(F)cc3Cl)nn2C)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16702",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C[C@H](O)Cc2ccccc2F)nc2ccccc21 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200632",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)CCC(=O)Nc2ccc(F)c(C(=O)N(C)C)c2)cc1C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Fc1ccc(C(Br)c2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183937",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1c2ccsc2CCN1C(=O)Cn1ccc(=O)c2sccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54550",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cncs1)N1CCC(n2c(CCc3ccccc3)nc3cccnc32)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7447",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1c(N2CCC[C@H](C(=O)NCc3ccco3)C2)cc(=O)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203908",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1nccn1-c1ccc(CNC(=O)[C@@H]2CNC(=O)N2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90181",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(CC(=O)N(C)Cc2ncnn2C)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "33755",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#Cc1ccc(S(=O)(=O)N[C@H](CN2CCOCC2)c2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209513",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(CSc1nc(-c2ccc(Cl)cc2)cs1)Nc1cccc2nsnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10301",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CON(C)C(=O)CN1CCN(Cc2csc(-c3ccccc3)n2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184009",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COCCNC(=O)[C@H](C)OC(=O)c1cc(C)ccc1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8933",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccc2ccccc2c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155210",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNS(=O)(=O)c1ccc2c(c1)OCCO2 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "107258",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=O)n(C)c2cc(NC(=O)CCc3nc4ccccc4s3)ccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccc(-[n+]2noc([O-])c2C[NH2+]Cc2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215961",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)[C@@H]1[C@H](CBr)N1N1C(=O)c2ccccc2C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1cccc2ncccc12)c1cc(-c2ccco2)n([C@H]2CCS(=O)(=O)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(COc2ccc(Br)cc2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nnc(SCCC(=O)Nc2cccc(F)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "249373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule N#Cc1cccc(CNC(=O)Nc2ccc3c4c(cccc24)CC3)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248038",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CC1C[C@@H]2CC[C@H](C1)[NH2+]2)NCCc1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78141",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)C1CCN(c2ccc(N3CCCC3)nn2)CC1)c1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CCCCl)[NH2+]CCC(C)(C)C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103779",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(C(=O)N[C@@H]2CCS(=O)(=O)C2)C[C@H](c2ccc(F)cc2)O1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18326",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)Nn1c(C)c(C(N)=O)c(C(=O)OC)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159687",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H](Cc1nnc(NC(=O)C2CCN(C(=O)[C@H]3CC(=O)N(C(C)(C)C)C3)CC2)s1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229462",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](C(=O)NN)[C@H](C)[NH+](C)C[C@@H]1CCCOC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COC(=O)/C(C#N)=C/c1cccc(OC(=O)c2ccc([N+](=O)[O-])cc2Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74227",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccc(Cl)cc1)NC[C@H]1CN2CCCC[C@@H]2CO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155361",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CS(=O)(=O)[N-]c1cccc(NC(=O)C2(c3cc(-c4ccccc4)on3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84990",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc(/C(Cl)=N/O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195727",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C/C(=C/c1cc2c(cc1[N+](=O)[O-])OCO2)S(=O)(=O)c1ccc(Cl)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175486",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(S(=O)(=O)N2CCOC23CCN(C(=O)C(=O)NCCC(C)C)CC3)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235946",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C#CCNC(=O)COC(=O)c1sc(NC(=O)c2ccco2)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219846",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC(C)(C)O)C(=O)CN1CCCCCC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101768",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=S(=O)(Nc1nc2ccc(Br)cc2s1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@](C)([C@@H](NC)c1ccc(F)c(C)c1)[NH+](C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24308",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COC(=O)c1ccccc1NC(=O)[C@H]1CCCCN1S(=O)(=O)c1ccc(Br)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233267",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)NC(=O)c1ccc(NC(=O)c2cnns2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63678",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)Nc2ccc(C)s2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230090",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(-c2cc(Cl)ncn2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74074",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(Cl)c(OCC(=O)N(C2CCCCC2)[C@H]2CCS(=O)(=O)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112555",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Fc1ccc(Br)c(C[NH+]2CCCNCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H]1CCC[C@@H](O)C1)NCC1(c2ccccc2)CCC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231152",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCC1=c2ccccc2=[NH+]C1)c1ccc2c(c1)[C@H](c1ccccc1)ON2 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6532",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(-n3nc(C)cc3NC(=O)c3ccc([N+](=O)[O-])s3)sc2c1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156855",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC(C)CCN(C(=O)[C@@H](C)/C(N)=N/O)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155007",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(CSc2nnc(C3CC3)n2-c2ccccc2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203272",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(O)c(C(=O)N2CCOC[C@@H]2C#N)c1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C#CCNCC(=O)N[C@@H](C)CS(C)(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62296",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH+](C)[C@@H](CNC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52256",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc2oc(=O)n(C[NH+]3CCC[C@H](NS(C)(=O)=O)C3)c2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163370",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCc1ccc(S(=O)(=O)Nc2cccc(C)c2O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42076",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2189",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](C)NC(=O)[C@H]1CCCN(C(=O)c2cccc3[nH]ccc23)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21425",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216271",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1[C@@H](C)N(C(=O)NCCc2ccc(N(C)C)cc2)CCS1(=O)=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158492",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)c1ccc(NC(=O)c2c(C)cccc2C)c(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246409",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCCc1nc(C)c([C@H](C)[NH2+]Cc2ccccc2C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8538",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(NC(=O)COC(=O)c2ccccc2C(F)(F)F)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168291",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOc1ccc(N2C(=O)C[C@H]([NH2+]Cc3ccc(F)cc3)C2=O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H]([NH2+][C@H](C)[C@@H](C)C(=O)[O-])c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=C(C)COc1cccc(NC(=O)N2CC[C@@H](COCC)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220658",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)(C)OC(=O)N1CC[C@@H](C[S@@](=O)Cc2ccc(Cl)nc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150659",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CNC(=O)C[C@H]2CCCCN2S(=O)(=O)c2ccc(F)cc2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)CCNn1cnnc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "70671",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]1NC(=O)N(C)CCc1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)[C@@H]1C[NH+](C(C)C)CCC(=O)N1Cc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1-c1nnc(CS(=O)(=O)Cc2ccccc2)o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89868",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C/C(=C\\c1cccc(Cl)c1)C(=O)N1CC[C@@H](C)[C@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157479",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1cc(S(=O)(=O)NCC[NH+]2CCN(c3ccccc3)CC2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6410",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOC(=O)c1csc(CNC(=O)/C=C/c2ccnc(Cl)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95275",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@@H](CC12CC3CC(CC(C3)C1)C2)c1ccc(Br)s1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172926",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1cccc1C(=O)NNC(=O)c1ccc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113648",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccc(SC(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C1NCCN1[C@H]1CCC[NH+](C[C@@H]2CC(c3ccc(Cl)cc3)=NO2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17453",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(NC(=O)Cn2cccc(-c3nc(-c4ccc(Cl)cc4)no3)c2=O)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121080",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)[C@@H](Oc1ccccc1C#N)C(=O)N1CCN(C[C@H](C)O)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196158",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC(C)(C)CC(C)(C)NC(=S)N[C@H]1C[C@H]2CC[C@@H]1C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117927",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(CNC(=O)Cn2cnc3c(c(C)c(C)n3-c3ccc(Cl)cc3)c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1OCC[C@H]1C(=O)N[C@@H]1CC(=O)N(CC(F)(F)F)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157681",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1C[C@@H](N(C)C(=O)CSCC(F)(F)F)CC[NH+]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1C(=O)[C@H]2[C@@H]3C=C[C@@H](C3)[C@@H]2C1=O)N1CCN(c2ccccc2Cl)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21467",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1ccc(CNC(=O)N[C@@H](CO)c2ccc(Cl)cc2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209134",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(-n2c(C)cn(CN3CCC(O)(C(F)(F)F)CC3)c2=O)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91242",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CC[C@@H](C)[NH+](CC)[C@@H]1CCc2ccc(OC)cc2[C@@H]1NC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)NC1CCCCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130100",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#CC1=C(N)C(C#N)(C#N)[C@H](c2ccc(COc3ccc(F)cc3F)o2)[C@@H]2CCCC=C12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@H](Cc1cc(=O)[nH]c(-c2ccccn2)n1)c1ccccc1)C1CCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35201",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H]1O[C@H](C)Cn2c(-c3ccccc3)c3c(=O)n(C)c(=O)n(C)c3c21 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "210825",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2[C@@H](C(=O)NCc3ccccn3)c3ccccc3C(=O)N2c2ccc(OC)cc2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149935",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)C[C@@H]1COCCN1C(=O)NNC(=O)Cc1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113709",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COC(=O)c1s/c(=N/C(=O)[C@H]2CC(=O)N(CC(C)C)C2)[nH]c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C[NH+]2CCCCC2)nc2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc21 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54500",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COC(=O)c1ccccc1OS(=O)(=O)c1ccc(C)cc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162986",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)NCC(=O)N1[C@@H](C)[C@@H](c2ccccc2)OC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62452",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(C(N)=O)[C@H](c2ccc(Cl)cc2)n2nc(-c3cccc(Cl)c3)nc2N1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106508",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@@H]1[C@@H](CN(C)c2ccc(OC)cc2)CCC1(C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78175",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN(Cc1ccco1)C(=O)[C@H]1C=C(Cn2cnc3ccccc32)N=N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCN(CCO)c1ncnc2ccc(F)cc12 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194564",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](C)c1ccc(OCc2ccc(C(=O)OC)o2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37421",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule Cn1ccc(-c2cccc(-c3ccc(C#N)cc3)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154245",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CC[C@H](C)NC(=O)Nc2cccnc2-n2cccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209256",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[NH2+]C[C@]1(c2ccc(OCC(C)C)cc2)CC[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180421",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule Cc1nn(-c2ccc(C#N)c(N)c2)c(C)c1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18073",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C/c1cccc2ccccc12)c1ccccc1F by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CC[NH+](CC)C[C@H](C)Nc1cc(C)c([N+](=O)[O-])cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195922",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccc([C@@H](C)NC(=O)C2CCN(S(C)(=O)=O)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152164",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[C@H](O)Cc1ccc(OC)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C1CC1)n1c(N)nc2c[nH+]ccc21 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98838",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@H](Nc1ccc([NH+]2CCCCC2)cc1)C(=O)Nc1cccc([N+](=O)[O-])c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165329",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc([C@@H]2CCCN2S(=O)(=O)N[C@@H](C)c2nncn2C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145858",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C#Cc1cc(F)c(NC(=O)NCCCN2CCCCCC2=O)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@](O)(c1ccccc1)C(F)(F)F)c1ccccc1Cl by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "223990",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CN(C[C@H](O)C1CC1)c1cc(Cl)c(C(F)(F)F)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208815",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](C(=O)N1CCC(OCc2ccccc2C)CC1)c1c(C)noc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21091",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1ccc(CN2C(=O)CCC2=O)cc1)c1cnc(Cl)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196393",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)[C@H]2CC(Cl)=CC[C@@H]2C(=O)[O-])cc1[N+](=O)[O-] by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "154075",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)ccc1N[C@H]1CCCS[C@H]1C by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113001",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(Nc1ccnc(-c2ccccc2)n1)c1cnn(-c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "169493",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCn1c(SCC(=O)Nc2ccc(Cl)cn2)nnc1-c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90688",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)[C@H](OC(=O)[C@H]1CCS(=O)(=O)C1)c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1cc(COc2ccc(NC(=O)c3cccc(C)c3)cc2)on1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110887",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cccc(C(C)C)c1NC(=O)N(CC[NH+](C)C)Cc1cccc(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "81049",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(C(=O)NCc2ccc(Br)cc2F)cc1OCC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214979",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]1CCCCCN1c1ccc(S(N)(=O)=O)c(N)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104028",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCC(=O)NCc1cc2n(n1)CCC[NH+](Cc1ccc3occc3c1)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232057",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C1[NH+]=c2ccc(C(=O)NCc3cccc(Cl)c3)cc2=[NH+]C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194739",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C1NN(c2cccc(Cl)c2)C(=O)/C1=C\\c1ccc(-c2ccccc2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183028",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)Nc1ccccc1C(=O)N1CCC[C@@H]1CO by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208635",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(Nc2ccccc2C(=O)[O-])nc(Nc2ccccc2C(=O)[O-])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187224",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](CCc1ccccc1)NC(=O)Nc1ccc(OC(F)F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120486",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Oc1cccc(N2C(=O)[C@H]3CC=CC[C@@H]3C2=O)c1)c1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10410",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)c1noc2ncc(C(=O)N3CCc4sccc4[C@H]3c3ccccc3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O[C@@H]1CCCC[C@@H]1CC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](C#N)OC(=O)CCOC1CCOCC1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202915",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1ccc(NC(=O)N2CCc3ccc(O)cc3C2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202083",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H]1C(C(=O)OC[C@H]2CCCO2)=C(C)NC2=C1C(=O)CCC2 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)n1cc2cc(NC(=O)C(=O)NCC(C)(C)C(N)=O)ccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(C)C[NH+]1CCC(NC(=O)c2c(O)cc(Cl)cc2Cl)CC1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCCC[C@H]1c1ncc2c(n1)CCN(C(=O)CCC1CCCC1)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159921",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COC(=O)[C@@H]1CCCC[C@@H]1OC(=O)c1ccc(F)c(NC(C)=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108772",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2)cc1[N+](=O)[O-] by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225275",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C1CCCC[C@@H]1[C@H]1CCCCN1C(=O)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10600",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@](C)(NC(=O)Nc1cn[nH]c1)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97845",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cccc2sc(N3CCN(C(=O)[C@@H]4CCCN4S(=O)(=O)c4cccs4)CC3)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "218563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O/N=C1/CCCN(Cc2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79738",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCO)C(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244487",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(C)c(NC(=O)N2CCN(c3ccccc3F)CC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99634",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CS(=O)(=O)N(Cc1ccc(Cl)cc1)c1ccc(C(=O)Nc2ccccc2C(=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "55624",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1cc(NC(=O)c2cc(C)oc2C)cc(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233768",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@H]1c1cccc(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221804",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CNc1ncccc1S(=O)(=O)N1CC[NH+]2CCCC[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240581",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Nc1c(C(=O)c2cccs2)sc2nsc(SCC[NH+]3CCCCC3)c12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5993",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCO[C@H]1C[C@@H]1C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211177",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cn1c(=O)c2c(nc(N/N=C\\C(Br)=C/c3ccccc3)n2Cc2ccccc2)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15978",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule N#Cc1ccccc1OCC(=O)NNC(=O)c1ccc2c(c1)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19272",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CNc1ccc(-c2nnnn2C2CC2)cc1)N1N=C(c2ccc(Cl)cc2)C[C@H]1c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179635",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nc(C)c(C(=O)N2CCC[C@H](NC(=O)c3scnc3C)CC2)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164070",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#Cc1cccc(CSc2nnc(C[C@H]3CCS(=O)(=O)C3)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214215",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232789",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(CNC(=O)[C@H](C)N2Cc3ccccc3C2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181001",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)=C[C@@H]1[C@@H](C(=O)Nc2cc3c(cc2Cl)NC(=O)CO3)C1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83674",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc([C@@H](C)NC(=O)NCC(=O)NC2CCCCC2)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152287",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ccc2c(C(=O)N3CCC[C@H](c4nc[nH]n4)C3)cccc21 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211766",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(CC(=O)Nc2ccc(C)cn2)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "167808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccccc1)N1CCC(NS(=O)(=O)c2ccccc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79466",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc(Br)c(C(=O)N2CCN(CCO)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237270",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule C[C@H](N[C@@H](C)c1nc2c(s1)CCCC2)c1ccc(-n2cncn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201053",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@H](C)[C@@H](NC(=O)[C@@H]1Cc2ccccc2C[NH2+]1)C(=O)NC1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1[C@H](NC(=O)N[C@H](C)c1ccc(C)o1)c1nccn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176441",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule O=[N+]([O-])c1c(Nc2cc(Cl)cc(Cl)c2)ncnc1NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134932",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(=O)N(c1nc(CSCC(C)C)cs1)c1cccc(C)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150527",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)CCCN2S(=O)(=O)c1ccc(C#N)cc1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232363",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule C=C(C)C[NH+](CC)Cc1cc([N+](=O)[O-])cc2c1OCOC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1cccc(Cl)c1)C(=O)N1CCC[C@@H]1C(=O)N(C)C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95196",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CCC[C@@H](C)C[C@H](O)c1ncc[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65278",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3333",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCc1nnc(NC(=O)c2cccc(S(C)(=O)=O)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226506",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(C)[C@H](C)NC(=O)N[C@H](C)c1ccc(F)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100382",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule N#CCC[C@H](C#N)CN1CCc2c(cccc2N2CCOC2=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98069",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)c1sc(=S)n(-c2ccccc2F)c1N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162607",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1[nH+]ccn1CCN1CCN(C(=O)C(C)(C)Oc2ccc(Cl)cc2)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6118",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccnc1NCCNC(=O)c1ccc(F)nc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187848",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(C[NH+](C)CC2CC(Cl)C2)c2ccccc2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150398",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1N(C)CC[C@@H]1CCC[C@]1([NH3+])CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2ccc(NC(=O)c3cccc(CS(C)(=O)=O)c3)cc2o1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211427",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCOC(=O)CS[C@H]1CC(=O)N(c2ccc(O)cc2C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109817",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)c(OCCCCn2cnc3ccccc3c2=O)c(C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64721",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1[C@@H](C)NC(=O)[C@H](C)Sc1cccc2cccnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9313",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCCN1C(=O)CN1CC[NH+](CC(=O)Nc2ccccc2SCC#N)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177872",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=[N+]([O-])c1c(NCCNS(=O)(=O)c2ccccc2)nc2ccccn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150618",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@H]1NC(C(=O)Nc2cnn(C)c2)=NN(c2ccccc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30735",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nccc1CNC(=O)C(=O)Nc1ccc(Oc2ccc(Cl)cc2)nc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19439",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(F)c(NC(=O)N[C@@H](C)c2cc(OC)c(OC)cc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191248",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule N#CC(C#N)=C(N=C(c1ccccc1)c1ccccc1)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245821",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CCc1nc(CNc2ccccc2S[C@H](C)CC#N)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180364",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(/C([O-])=N/S(=O)(=O)c2ccc(C(C)=O)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C/C(C(=O)NC1CCCCC1)=C(\\[O-])c1cccc(-c2ccoc2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194087",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC1CCC(N(C)C(=O)Nc2cc(N3CCCC3=O)ccc2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89950",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1ccc2c(=O)n(C3CCC(O)CC3)cnc2c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113007",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1cn(-c2ccc(F)cc2)nc1C(=O)N1CCC(Cc2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCCNc1ccccc1OC(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48781",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(c1ccco1)N1CCN(c2ncc(Cl)cc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224983",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1csc(C(=O)NCC(=O)OC2CCCCC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc(NC(=O)c2ccc(Cn3nc(-n4cccc4)c4c(C)cc(C)nc43)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155449",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCS[C@@H]1CCC[C@@H](NC(=O)[C@@H]2CCC(=O)O2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68091",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)C[C@@H]2Nc3cc(C)c(C)cc3NC2=O)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15855",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=C1C=C([O-])N2C(=NC(NCCC3=c4cc(OC)ccc4=[NH+]C3)=[NH+][C@@H]2c2ccccc2)N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175289",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/[NH+]=C(/NC[C@H](C)C#N)NC[C@@H]1CCC[NH+](C)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "198116",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)Nc2nc(CN3C[C@H](C)O[C@@H](C)C3)cs2)cc1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180490",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc([C@@H]2C(C#N)=C(N)Oc3[nH]nc(C)c32)ccc1OC(F)F by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)n1cc(C#N)c(NC(=O)C(=O)N2CC[C@H]([N+]3=CCCC3)C2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181752",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(OCC(=O)N2N=C3CCCC[C@@H]3[C@]2(O)C(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201414",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCN(C(=O)C2CCN(S(=O)(=O)c3cccc4nsnc34)CC2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104586",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Fc1ccc2nc(CN3CCC[C@H](c4nncn4C4CC4)C3)oc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134058",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1c(=O)c2ccc(Cl)cc2n2c(SCc3cccc(OC)c3)nnc12 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113187",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(SCC(=O)Nc2cccc(Cl)c2Cl)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52942",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CCc1nn(C)cc1NCc1ccccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106490",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ncccc1C(=O)N[C@@H]1CC(=O)N(C2CCCCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]1Nc2ccc(Br)cc2NC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248633",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "541",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(OCc1cc(=O)oc2cc(O)c(O)cc12)c1nn(-c2ccccc2)c(=O)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230546",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[NH2+][C@H]1CC[C@@H](Cc2cccc(O)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202207",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2c(cc1C)O[C@@H](C(=O)N1CCC[C@@H](CCC(N)=O)C1)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245849",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule NC(=O)c1ccc(C(=O)Nc2ccc(N3CCSCC3)c(Cl)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40155",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccccc1CNC(=O)c1nn2ccccc2c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93725",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=S1(=O)C[C@H]2Sc3nncn3[C@@H]2[C@H]1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200110",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(=O)n(CC(=O)N2CCC(c3[nH+]ccn3C)CC2)c2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](NC(=O)c1c(F)cccc1F)C(=O)NCC[NH+]1CCc2ccccc2C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cc(C(F)(F)F)nc2nc(NC(=O)c3ccco3)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "16908",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1c(C(=O)N2CCCCC[C@H]2C[C@@H](O)c2ccco2)cnn1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)[C@@H](NC(=O)c1ccccc1)C(=O)N1CCCSCC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148093",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN1C(=O)c2oc3cc(C)cc(C)c3c(=O)c2[C@H]1c1cccc(O)c1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180926",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C2=CC[NH+]([C@H](C)c3nnc(C)o3)CC2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18291",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1[C@H]2CC=CC[C@@H]2C(=O)N1CCN1CCCS1(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28410",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN1C(=O)N(CC(=O)[O-])C(=O)C12CCCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule N#Cc1ccc(Oc2ccnc(-c3ccccc3)n2)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "28232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)NCC(=O)N1CCCC[C@@H]1Cc1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(C(=O)Nc2ccc(C(=O)OC(C)(C)C)cc2)c(=O)[nH]c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157048",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(c1ccc(=O)n(-c2ccccc2)n1)N1C[C@H]2CCC[C@@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27580",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1/C=C\\C=c1/sc2nc(-c3ccccc3OC(C)=O)nn2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138224",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccoc1C(=O)OCCCn1nnc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179632",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CNC(=O)N1CCCn1nnc(-c2ccc(Br)cc2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139752",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COCCCNC(=O)c1cccc2c1N[C@H](c1ccccc1Cl)[C@H]1CC=C[C@@H]21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196207",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(CCCc1ccccc1)Nc1c(C(=O)Nc2ccc3c(c2)OCCO3)oc2ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199404",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCCCN(C)c1cc[nH+]c(CN2CCN(C(C)=O)CC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64628",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(OCC(=O)NC2CCOCC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "46410",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1nn(C)c(C)c1NC(=S)NCc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219843",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C=CCC[C@H](C)OC(=O)c1cc(NC(C)=O)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2CCOCC2)c(NC(=O)c2cc(OC)c(OC)c(OC)c2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92510",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]([NH2+]C1CCN(C(=O)[C@@H]2COc3ccccc3O2)CC1)c1ccccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101051",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CC[C@@H]1CCc2nc(NC(=O)c3ccc([N+](=O)[O-])o3)sc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10938",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(C[NH+](C)CC(=O)N[C@H]2CCS(=O)(=O)C2)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "69034",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)CCc2cscn2)[C@H](C)CN1C(=O)OC(C)(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "158024",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccccc1NC(=O)CCN1C[C@H](C(=O)[O-])CC1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "166044",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CSc1ccc(CCNC(=O)c2cc(=O)nc3sc(N4CCCCCC4)nn23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15270",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CNC(SCc1cc2c(cc1Cl)OCO2)=C(C(C)=O)C(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42027",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C[C@H]1CCCC[C@H]1NC(=O)N1CCC[NH+](Cc2ccc(C#N)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215948",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1c(Cl)cc(C[NH+]2CCC(N3CCCCC3=O)CC2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48070",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(F)c(C(=O)N[C@H]2C[C@](C)(OC)C2(C)C)c1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188329",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCN(Cc1cnn(C)c1)S(=O)(=O)c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246917",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccccc1-n1nnnc1SCC(=O)Nc1ccccc1C(=O)NC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181113",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCc1nnc2sc(-c3ccc(OC)c(NC(=O)c4cc(Cl)c(OC)c(Cl)c4)c3)nn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "45650",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@H](CSC)N(C)C(=O)[C@@H]1CN(Cc2ccccc2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200495",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(-c2cc3c(=O)n(CC(=O)Nc4ccc(C(C)C)cc4)ccn3n2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170673",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc(NC(=O)C(F)(F)F)c(Cl)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203367",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COC(=O)CNC(=O)c1cnn(-c2ccc(Cl)cc2)c1-n1cccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108041",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COCCO[C@@H](C)C(=O)Nc1cc(F)c(F)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196929",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1(C)CCN(C(=O)[C@@H]([NH3+])CC(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128241",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nn(C)c2ncc(NC(=O)COc3ccc4ccccc4c3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39225",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=C(NCCC(=O)N1CCCC1)Nc1ccn(Cc2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "102452",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccnc1SC1CCCC1)N1CCC([C@H](O)c2ccccc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75837",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)(CNC(=O)NCc1cccc(Cn2cncn2)c1)c1ccncc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179957",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCn1c(C)nnc1S[C@@H](C(=O)Nc1cccc(F)c1)C(C)C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193543",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC1(C)COC(=O)[C@@H](Br)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152672",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nccc1CNC(=O)c1cccc(C#N)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36799",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOc1cc(C)ccc1NC(=O)N1CCCC[C@@H]1CN1CCCC1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15117",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CS[C@@H](CO)[C@H](C)NC(=O)c1cn(C)nc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20909",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CCC[C@@H](NC(=O)C(=O)Nc2ccc(Oc3ccc(F)cc3)nc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42793",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(=O)[nH]c(C)c1CC(=O)Nc1sccc1C(=O)[O-] by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cn1cc(C(=O)NC[C@@]2(O)CCCc3ccccc32)c(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193267",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC(C)(C)OC(=O)N1CC[NH+](Cc2ccc(Cl)nc2)[C@H](C(=O)[O-])C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](C)c1cnc(-c2cncc(Br)c2)nc1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162417",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]1CCc2cc(F)ccc2N1S(=O)(=O)CCOc1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19613",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C#CCN/C(NCC(C)(C)[NH+]1CCCCC1)=[NH+]/CC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195832",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccn2c(=O)c(C(=O)N3CCOC[C@@H]3C3CC3)cnc2c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "238455",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=C(NCc1c(O)ccc2c1CCCC2)N[C@@H]1CCN(CC(F)(F)F)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51754",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)(C)c1ccc(-c2csc(NC(=O)c3ccccc3OCC(N)=O)n2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule N#C[C@@H]1COCCN1Cc1cc(O)ccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222716",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(CC(=O)NCC[NH+](C)C)S(=O)(=O)c1cc(Cl)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160782",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(F)cc1)N1CCS[C@@H]1c1cccc(F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(C(=O)NCc2ccc(NC(=O)C3CC3)cc2)cc(S(N)(=O)=O)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "212213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule C[C@H]1C[C@H](Nc2ncccc2C#N)C(=O)N1c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215283",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](Cc1ccc(-c2ccccc2OC)cc1)CC(C)(C)O by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180890",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+]Cc1ccc(C(N)=O)o1)c1cc(Br)ccc1F by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1ccc(N(Cc2cc3cc(C)ccc3[nH]c2=O)C(=O)c2ccc([N+](=O)[O-])cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165127",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Nc1c(Nc2nc3ccccc3s2)ncnc1Nc1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CCN(C(=O)[C@@H](C)n2c3ccccc3c3cnn(C)c(=O)c32)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211725",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC[C@@H](C)N[C@@H]1CCCC[C@@H]1[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "101456",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cccc([C@@H]([C@H](C)[NH3+])N(C)C[C@@H]2CCC[NH+]2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199955",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)c1ccc(C(F)(F)F)cc1)[C@@H]1CCCN(c2ccccc2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129516",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(CN(C(=O)c2sc3ccccc3c2Cl)[C@H]2CCS(=O)(=O)C2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145588",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1nc([O-])c(C(=O)N[C@@H](C)c2ccccc2C)cc1C#N by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109196",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(NC(=O)c2noc3c2COc2ccc(C)cc2-3)s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211935",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-n2nc(C(=O)[O-])c3c2CCC3)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37820",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cn1nc(C(=O)Nc2ccccc2C(C)(C)C)ccc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)cc(OC(=O)[C@H](C)S(=O)(=O)c2ccc(F)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106260",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)N1C(=O)C2(CCCC2)NC(=O)C1(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]1Nc2ccc(C(=O)NCc3ccccc3Cl)cc2NC1=O by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203208",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=[N+]([O-])c1ccc(CN2CCN(CCn3cc[nH+]c3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114012",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "968",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1cc2c(cc1/C=C/C(=O)NCC(C)(C)[NH+](C)C)O[C@@H](C)C2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "137518",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[NH2+]C[C@@H](C)C(=O)NCCNC(C)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152538",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1C[C@H](C(=O)Nc2ccc(O)cc2)CC1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COCC(=O)N/N=C/c1cc(Br)ccc1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226174",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)Nc1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190493",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc(C[C@H](O)Cc2ccn(C(C)C)n2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6861",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CSCCOC(=O)C1CCN(C(=O)c2ccc(F)cc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217994",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCNC(=O)c1cc2c([nH]c1=O)CC[C@H](C)C2 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185737",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]([NH2+]CC1(CS(C)(=O)=O)CC1)c1ccc(N2CCCCC2)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83366",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2[C@@H]1c1ccc(OCC(N)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135144",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1)C(=O)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232156",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@H](C)N(C)C(=O)[C@H]1CCC[NH2+][C@@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc([C@@H]2c3c(oc4ccc(C)cc4c3=O)C(=O)N2Cc2ccc(C)cc2)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85217",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(Cc1ccc(F)c(F)c1)C[C@H](O)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "47792",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1C[NH+](C)Cc1c(O)ccc2ccccc12 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCNC(=O)[C@@H]1COc2ccccc2O1)Nc1nc2ccccc2s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "129256",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule OC[C@H](Nc1cccc(Br)c1)c1cccc(C2CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232539",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCn1c(=O)c(N2CCC(C(=O)Nc3cccc(Cl)c3)CC2)c(C)n(-c2ccccc2)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "74504",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1cc(C(=O)NCC(=O)N2CCc3ccccc3C2)no1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240977",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)(C)c1ccc(NC(=O)/C=C/c2ccc(S(C)(=O)=O)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193256",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](NC(=O)C(C)(C)C)c1nc2ccccc2n1CC(=O)N(C)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171420",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[C@H]1CC[C@H]([C@H](O)Cc2cccc(O)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "56137",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C1CSc2ccc(NC(=O)c3cccc4cn[nH]c34)cc2N1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "30536",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@]1([C@@H](O)c2ccc3c(c2)OCCO3)CCOC1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144929",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(-c2nc(C)sc2CC(=O)Nc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182837",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)CCn1ccc(NC(=O)c2ccccc2C)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181972",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N[C@@]2(CCc3ccccc32)C(=O)N1Cc1nnc(-c2ccco2)o1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "123394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(Cc1ccco1)C(=O)Cn1cnc2sc(-c3ccccc3)cc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "65181",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOC(=O)[C@H]1C(=O)N=C(N2CC[NH+](CC)CC2)[N-][C@H]1c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68552",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](C[NH+]1CCCCC1)NC(=O)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40465",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccc([C@H](C)C(=O)N(CCC(N)=O)c2ccc(F)cc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "89622",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](NC(=O)c1ccc(CNC(C)=O)cc1)c1cccc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77428",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1[nH+]ccn1CCN1CCN(C(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "225010",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(CN2CCN(C(=O)Cn3cncn3)CC2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111314",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(CNc2ccc([N+](=O)[O-])c(N)n2)CCCC1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134416",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(=O)N2CCN(C(=O)Nc3cccc(C)c3)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161325",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1nn(C)cc1-c1cc(C(F)(F)F)nc(N2CCC[C@@H]2C(=O)[O-])n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179631",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CN[C@@]1(C(=O)OC)CCC[C@@H]([NH+]2CCC(COC)CC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "204911",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)[C@H](C#N)NC(=O)[C@]1(C)CCCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162366",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccccc1NC(=O)C(=O)NCc1ccccc1Cn1cccn1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170525",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC[C@H]([NH2+]C1CCSCC1)c1ccc(Cl)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "7057",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C1CCCC1)[C@H]1CC[C@]([NH3+])(CO)C1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192128",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCOc1cccc2sc(N(C[C@H]3CCCO3)C(=O)[C@@H]3Oc4ccccc4O[C@H]3C)nc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111284",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCn1cc(-c2c(-c3ccccc3)ncn2CCNC(=O)c2cccnc2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211389",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CNc1ccc(NC(=O)[C@@H]2CCCO2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88105",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)c(=O)c(S(=O)(=O)c1ccccc1)cn2CC(=O)Nc1ccc(C)c(Cl)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "128496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)NCCNC(=O)NCc1ccc(CN2CCc3ccccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229326",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1cc(Cl)c(C)cc1NC(=O)CS(=O)(=O)Cc1cc(C)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116547",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COCC[S@](=O)[C@H](C)C(=O)Nc1ccc(F)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193531",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccncc1)[NH+](C)CC(=O)N[C@@H](c1ccc(F)cc1)C1CCCC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135060",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H](NC(=O)NCC(=O)Nc1ccccc1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40400",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H](O)[C@@H](C)SCC(=O)Nc1ccccc1C(=O)Nc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "98636",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1cc(C(=O)[O-])cc(-c2cc(Cl)ccc2OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "13713",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(C(=O)N[C@@H]2CCCC[C@@H]2C(F)(F)F)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "18965",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNC(=O)N[C@@H]1C[C@H]1c1cccc(Cl)c1)NCc1ccccc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "10545",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCC([NH+]2CCCC[C@@H]2CC(N)=O)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95249",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1ccccc1N1CCCC1)c1ccc(-n2cncn2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "35403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](CC(=O)N(C)[C@H]1CCCC[C@@H]1S(C)(=O)=O)n1cccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "110550",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nc(-c2cccc(OC)c2)nc(CC)c1CC[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "157314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule O=[N+]([O-])c1ccc(S(=O)(=O)NC[C@](O)(c2ccccc2)C(F)(F)F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "161878",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(Nc1nc(-c2ccc(Cl)cc2)cs1)c1cc2c([nH]c1=O)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111711",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OC/C=C(\\Cl)c1ccc(Cl)cc1Cl by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "82715",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCC[NH+]1CCC(CNC(=O)C(=O)Nc2ccc(F)c(C(N)=O)c2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242509",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCCN1C(N)=[NH+]C[C@]12CC(C)(C)OC2(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=C1N[C@@H](C(=O)NC[C@@H](O)c2cc(Cl)cc(Cl)c2)CS1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232277",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CNc1cccc(COc2cncc(Cl)c2)[nH+]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141952",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOc1cc(C=O)cc(Br)c1OC(=O)c1ccccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "214265",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1cccc(NC(=O)CCN2C(=O)[C@@H]3Cc4cc(OC)c(OC)cc4CN3C2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240981",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule N#Cc1ccc(NC(=O)c2c3c(nc4ccccc24)CCC3)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11121",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)[C@@H](CNC(=O)C(=O)Nc1ccccc1)N1CC[NH+](C)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186509",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1nc2ncnn2c(N2CCC(O)(C(F)(F)F)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38200",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc([C@H](C)NC(=O)C2CC=CC2)c(C)o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "26496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccccc1CNC(=O)NCc1ccc(OC(C)C)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215221",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(NC(=O)C[C@@H](NC(C)=O)c2ccc(Cl)cc2)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203226",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(SCc2ccc(Cl)c(Cl)c2)=N[C@@H]2CS(=O)(=O)C[C@H]21 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135649",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1ccc(C#N)cc1)C2=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135961",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H]1CCC[C@@H](NC(=O)c2ccc3c(c2)NC(=O)CO3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227770",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](O)C[NH+]1CCC2(CCC(=O)N(Cc3ccccc3)C2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164491",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)c1ccc(F)cc1F)n1cnc2c1c(=O)n(C)c(=O)n2C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "27378",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(NCc1ccc2c3c(cccc13)C(=O)N2)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37077",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]1C[C@@H]1C(=O)N1CCN(C(=O)CNC(=O)c2ccc(C#N)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9996",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NC[C@@H]1COC2(CCCC2)O1)Nc1c(F)cccc1Oc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc([C@H]2CCCN2C(=O)Nc2ccc(OC)c(C)c2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219022",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCNC(=O)c1cc2cccc(Cl)c2o1)NCc1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34732",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CNc1ccc(CN2CC[C@@H](CN3CCOCC3)C2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "174383",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cn1c(=O)c(=O)n(CC(=O)N2CCC3(CC2)OCCO3)c2cccnc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "345",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(SCCC(=O)Oc2ccc3ccc(=O)oc3c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163982",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC[C@H](CNC(=O)c1ccc([N+](=O)[O-])cc1F)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "222733",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H]1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)CCO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9072",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCNC(=O)CNC(=O)Nc1ccccc1N1CC[NH+](CC)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213306",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)Nc1nc2ccccc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176380",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(/C=N/NC(=O)CSc2nnc(-c3ccncc3)n2N)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106472",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[NH+](CC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)CC(=O)Nc1c(Cl)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181514",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccc(C2=N[NH+]=C(N3CCN(C(=O)C(C)C)CC3)SC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120310",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(NC(=O)[C@@H]2C=C(c3ccncc3)N=N2)cc1N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235767",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC[NH+](C)C1CCCCC1)C(=O)CCn1nnc2ccccc2c1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192424",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nnc(N2C(=O)c3oc4cc(OC)ccc4c(=O)c3[C@H]2c2cccc([N+](=O)[O-])c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203330",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1c(-c2ccc3ccccc3c2)csc1NC(=O)c1cccnc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159447",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N2CCN(c3ccccc3OC)CC2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103915",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule N#Cc1ccc(N2CCC(O)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)C[C@@H]1Oc2ccccc2N(Cc2snnc2C(C)C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245734",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1[nH]nc(C(N)=O)c1NC(=O)CCC(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71099",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C=CCOc1ccc(/C=C(\\C#N)C(=O)c2c[nH]c3ccccc23)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(C2(O)CC[NH+](CC(=O)N3C[C@H](C)O[C@H](C)C3)CC2)nc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "162610",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCN(CC)c1ccc(C(=O)Nc2ccc3oc(COC)nc3c2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52632",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(C1=C([O-])C(=O)N(CC[NH+]2CCCCC2)[C@@H]1c1cccnc1)C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(Cn2cc(-n3c([S-])nnc3[C@@H](C)Cn3nc(C(F)(F)F)cc3C)cn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103266",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2c(N(C)CC(=O)NC(C)(C)C)ncnc2s1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "177142",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H]1CCCN(C(=O)Nc2ccc(F)c(Br)c2)[C@H]1CO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "124601",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CCNc2ncnc3sc(C(=O)[O-])c(C)c23)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164508",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCN1C(=O)c2ccc(C(=O)N(C)[C@H](C)c3ccccc3)cc2S1(=O)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237961",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCOc1ccc([C@H]2C(C#N)=C(N)Oc3cc(OC(=O)[C@@H]4COc5ccccc5O4)ccc32)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "58944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(C)cc(NC(=O)c2ccc(NC(=O)[C@H]3[C@@H]4C[C@@H]5OC(=O)[C@@H]3[C@@H]5C4)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66675",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=S(=O)(N[C@H]1CCCc2ccccc21)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "42218",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1ccccc1NC(=O)Cn1c(C)nc2c(sc3nc(-c4ccccc4)ccc32)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37390",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H]1CCCN(C(=O)c2ccccc2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201612",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1sc2ccccc2c1Br by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231839",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccccc1-c1nc(C[NH2+][C@H](C)C(C)(C)C)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207693",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCOC(=O)[C@@H]1CCCN(C(=O)Nc2ccc(OCC)c(Cl)c2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83603",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@@H](CNC(=O)c1cc(F)ccc1O)Cc1ccc(F)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](O)c1cc2cccc3c2n(c1=O)CCC3 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "152878",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CN1CCN(C(=O)c2cnn(-c3ccccc3)c2)[C@@H](c2ccccc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87568",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Br)cc1-c1nnc2n(Cc3ccccc3)c3c(=O)n(C)c(=O)n(C)c3n12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8009",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule O=C([O-])CCCC(=O)Nc1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)OC[C@H]2COC(C)(C)O2)c(F)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73996",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CNC(=O)c1ccc(CSCc2cccc(NC(C)=O)c2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "87765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@]1(C(=O)Nc2ccc(C#N)cc2)Oc2ccccc2NC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1cncc(NC(=O)C(=O)N[C@@H]2CCCC[C@H]2O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22736",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cccc2c1[nH]c1nc(SCC(=O)Nc3ccc(Cl)cc3)nnc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72565",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(NC(=O)[C@H]2CS[C@@]3(C)CCC(=O)N23)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206552",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cc(Br)c([C@H]2OCC[C@@H]2CO)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36286",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule N#Cc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@@H]2C=C[C@@]3(CO)O2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125055",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCNC(=O)/C(C#N)=C/c1cccc(O)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "401",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cccc(NC[C@H](O)c2ccco2)n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "83201",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1ccc(C(=O)N2CSC[C@H]2C(=O)[O-])o1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "97477",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(C[NH+](C)Cc2nc(-c3ccc(C)s3)oc2C)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187284",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1nn(C2CCC2)c2cc(F)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "179385",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSc1cncc(NCc2scnc2C)n1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211197",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule C/C(=C\\C(=O)NCc1cc(C#N)ccc1F)CCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "105886",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]([NH2+][C@@H](C)c1nc2cc(Cl)ccc2n1C)C(=O)N1CCOCC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171750",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(CN(C(=S)Nc2c(C)cc(C)cc2C)C2CC[NH+](C)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CCC(=O)N1CCN(C(=O)N[C@@H](C)c2ccc(C#N)cc2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)CN(C)C(=O)Cc1coc(-c2ccccc2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1c[nH+]c(NCc2ccc(C#N)cc2)nc1NCc1ccc(C#N)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "200920",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule FC(F)(F)C1(C(F)(F)F)CCN(Cc2cnn3c2NCCC3)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196344",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=S(=O)(/C=C/c1ccc(Cl)cc1)NCc1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1OCC(=O)O[C@H](C)C[NH+]1CCOCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79510",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=c1c2ccccc2ncn1CC(O)Cn1cnc2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226277",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(COc1ccc([N+](=O)[O-])cc1Cl)NC1CCCCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(C[C@@H]1C=NN=C1c1ccccc1)C(=O)c1cccc(C#CC(C)(C)O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "227713",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1cccnc1)c1ccccc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60773",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1ccc(N)cc1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1550",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(C2=CCN(C(=O)c3cnn(C)c3-n3cccc3)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "22494",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COCC[C@@H](C)NC(=O)Nc1cc(F)ccc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130219",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CN1CCO[C@H](COc2ccc(CC(N)=S)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "159867",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](Nc1nnnn1-c1ccccc1)C(=O)NC[C@@H]1CCCO1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183153",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCC[C@H](NC(=O)CSc1nc2ccccc2n(C)c1=O)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "193899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@@H](Nc2ncnc3[nH]cnc23)C1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9240",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cscc1C(=O)Nc1ccc(C#CC[NH3+])cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "34972",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@](N)(C(=O)OCc1ccc(Cl)cc1)C(F)(F)F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "86098",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCCOCC(=O)Nc1cc(C(N)=O)ccc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "113391",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CCC[C@H](C(F)(F)F)C1)Nc1nccs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220037",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCCCc1nc(C)c(C(=O)N(CC(N)=O)C2CCCC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224290",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule N/N=C1\\C[C@@H](c2ccccc2)Oc2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195871",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C(=O)Nc1cc3c(cc1Cl)OCCCO3)CC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119328",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC1(C)C[C@@H](Nc2cc(S(C)(=O)=O)ccc2Cl)C(C)(C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "104665",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=S(=O)(c1cccc(Br)c1)N1CCN(C[C@H](O)c2ccccc2F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118940",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(Br)CN1CCC[C@H]1CN1CCOCC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94135",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C1C[C@@H](C(=O)N2CCC[C@@H](O)C2)CN1CCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9827",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(C)C)cc2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170686",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1csc(N2CCCN(C(=O)[C@@H]3C[C@@H]3c3ccccc3C)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "2468",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(N2C[C@@H](C(=O)N3CCCSC[C@H]3C[NH+](C)C)CC2=O)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216559",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@@H]1CN(C(=O)NCc2ncnn2C)C[C@@H](c2ccccc2)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "144956",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(CCC(=O)c1cccs1)N[C@H]1CCCN(Cc2ccccc2)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1ccc(S(=O)(=O)N2CCc3ccccc3C2)c(Cl)c1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "64531",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(/C=N/NC(=O)CNC(=O)c2ccccc2I)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44767",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1nc(C[C@H](O)CCOc2ccccc2)sc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141568",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cc(C)n(-c2ccc(N3CCN(C(=O)c4ccc(F)cc4F)CC3)nn2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244287",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule c1ccc(-c2nc(SCc3cn4cccnc4n3)oc2-c2ccccc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76494",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCCNC(=O)CN1C(=O)/C(=N\\NC(=O)c2ccccc2Cl)c2ccccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11971",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](Cc1cccc(F)c1)C(=O)NCC(C)(C)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "246749",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc(C(=O)Cn2c(=O)c(C#N)cn(C3CC3)c2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111693",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H]1CN(C(=O)/C=C/c2ccc(N3CCCC3=O)cc2)C(C)(C)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "91267",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C/[NH+]=C(/NCC(=O)Nc1ccc(F)cc1)N[C@@H]1C[C@H]1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240168",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(C(=O)NCc2cccc(OC)c2)ccc1OC by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1ccc(C)c(NC(=O)N[C@@H]2CC(=O)N(c3cccc(F)c3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202987",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)c2ccc(-n3cncn3)nc2)ccc1N(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "156220",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)c(CNS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)s1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61376",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)N[C@@H](c2ccccc2Cl)C2=C1CN(CC(=O)NCc1ccccc1)C2=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15960",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCOc1nnc(CN2CCN(c3ncccc3F)CC2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164353",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(C)c1cc(C(=O)Nc2ccc([S@](C)=O)cc2)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "51821",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1cccc(CN(C)S(=O)(=O)c2ccc(C(C)C)cc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29411",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(/C=C/C1CCOCC1)NC1(c2ccc(F)cc2F)CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108000",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@](C)([C@H](N)Cc1cccc(Br)c1)[NH+]1CCCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CSc1ccc2cc(CN3C(=O)N[C@](C)(c4ccco4)C3=O)c(Cl)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119380",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1C(=O)c2[nH]nc(-c3cc(C)ccc3O)c2[C@@H]1c1ccc(C)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23503",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)c1ccc(-c2nc3cc(NS(=O)(=O)Cc4cccc(F)c4)ccc3n2C)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17624",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cccc(OCc2nnc(SCc3cc(F)cc4cccnc34)o2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "133814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)NC(=S)NC(=O)c1ccc(OC(C)C)c(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164487",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCS(=O)(=O)N1CCC[C@@H](C(=O)NC2CCCCCC2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139612",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule COc1ccc(NC(=S)NC(=O)c2ccccc2Br)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213423",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cn1ccnc1Sc1ccc(N)c(N)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "236197",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule c1cc(CCCNc2ccc(-c3nc(C4CC4)no3)c[nH+]2)ccn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule N/C(=[NH+]\\[N-]S(=O)(=O)c1ccccc1OC(F)(F)F)c1ccc(C(F)(F)F)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "231511",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule Cc1csc([C@@H](C#N)C(=O)c2ccc(F)c(F)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "226748",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@H]1CC(OCc2cc(F)cc(C#CC[NH3+])c2)C[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189255",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COc1ccccc1NC(=O)[C@H](C)Oc1ccccc1C#N .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211036",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1cc(NC(=O)CCc2cnn(C)c2C)ncc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "170177",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1cnc(C(C)(C)NC(=O)CCCOc2ccccc2Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17564",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(-c2cc(N)c(=O)n(CC(=O)N3[C@@H](C)CCC[C@@H]3C)n2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "184207",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@@H](Cn1cncn1)NC(=O)Nc1cc(F)cc(N2CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "242164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229826",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC[C@H](O)C[C@@H](Cc1ccccc1OC)C(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209382",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)(CNC(=O)NC[C@H]1CCN(c2ccccc2)C1)C(N)=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "143109",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule COc1ccc(NC(=O)c2cc(C)cc(OC)c2O)c(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC1CCN(C(=O)/C=C(/C)c2ccccc2OC(F)F)CC1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73774",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@@H]1COc2ccc(F)cc2C1)N1CCC[C@@H]1c1ccccc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C)c(S(=O)(=O)N[C@@H](C#N)c2ccccc2F)cc1OC by removing a nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "23100",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule NC(=O)c1cccc(OCC(=O)N[C@@H](c2ccc3c(c2)CCCC3)c2cccs2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90821",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CSc1ccc(C(=O)NC[C@H]2C[C@@H](O)C[NH+]2Cc2ccccc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127089",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1C(=O)NC(=S)Nc1sc2c(c1C#N)CCCC2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80126",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(/N=C2/S[C@@H](CC(=O)Nc3ccc(C(=O)[O-])cc3)C(=O)N2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "54301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cc(NC(=O)[C@@H](C)N2CCO[C@H](C)C2)ccc1Br .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "187788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nc(COc2ccccc2)sc1C(=O)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5588",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](SCC1=NC(=O)C2=C(c3ccccc3)CSC2=N1)C(=O)N1CCN(c2nccs2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "36098",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[NH+](CC(=O)c1c(C)cc(C)cc1C)CC(C)(C)O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229895",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCC[C@H]1NS(=O)(=O)c1ccc(CC(=O)[O-])cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95726",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CC[S@@](=O)[C@H]1CCCC[C@@H]1NC(=O)NCc1ccc(OC)c(O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "135709",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCc1nnc(NC(=O)c2c(C)c(-c3ccccc3)nc3ccccc23)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]C[C@H](Cc1ccccc1)Cc1cccc(O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189348",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(N[C@@H]1CCCCC[C@H]1C(=O)[O-])C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248830",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule CC(=O)N1c2ccccc2C[C@H]1C(=O)N(Cc1ccccc1)[C@@H](C)CCO .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80131",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc(F)c(N[C@H](C)c2sc(C)nc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "165272",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule CC(C)S(=O)(=O)CC(=O)N1CCN(c2ncccc2C#N)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "3095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CCNC(=O)c1cccc[n+]1[O-])c1cccc(C(F)(F)F)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151507",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)CN1CC[NH2+]CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1noc([C@@H]2CCC(=O)N(CCCN3CCCC3=O)C2)n1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "48859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@]2(C)NC(=O)N(Cc3cccc(F)c3)C2=O)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "181487",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1CN(C(=O)c2ccc(Br)s2)C[C@H]1C by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)cc(C)c1Oc1cc([C@H](C)O)ccn1 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75233",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1cc(C)n(-c2cccc(NC(=O)NC3CCCCCC3)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146025",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccccc1OCC(=O)Nc1cccc(C(=O)N(C)c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29889",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@H]1CCN(C(=O)CCc2nc(-c3ncccn3)no2)[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116194",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cnc(CNC(=O)[C@@H](OC(C)(C)C)c2ccccc2)n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "199131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CC(=O)[O-])N1C(=O)S/C(=C\\c2ccc(Cl)cc2)C1=O by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146330",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@@H](c1cc(F)cc(Br)c1)[C@H]1CCOC2(CCOCC2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "62490",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)C(=O)N1CCc2c(c(C(=O)N3CCC(C(=O)NC4CCCCCC4)CC3)nn2C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "15490",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COC[C@@H](NCc1ccc(OC)c(C#N)c1)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188195",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC[C@H](C(=O)NCc1cc(-c2ccccc2)on1)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "208264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc([C@H](CNS(=O)(=O)c2ccc(C)cc2Cl)N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "145414",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCc1nnc(S[C@@H](CC)C(=O)NCc2ccco2)c2cc3occc3n12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "71679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H](C)Oc1ccc(C[NH2+]C2CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213878",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC1=C/C(=N\\OC(=O)c2ccccc2Cl)C(C(C)C)=CC1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59275",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(C)c(OC2CCN(Cc3scnc3C)CC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84342",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccccc1NC(=O)N(C1CC1)[C@@H](C)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "90011",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H](OCC(F)(F)F)C(=O)N1CCC(c2ccc(F)cc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "244338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@@H]1C[C@@H](C)C[NH+](Cc2ccccc2CNC(=O)N2CCO[C@H](C)C2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "108614",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cc1ccc(-c2ccc(N)cc2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216748",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1cc(N2CCCC2)ncn1)Nc1cccc(Cl)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79908",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(=O)c1c(C)[nH]c(C(=O)NC2CCC(O)CC2)c1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]([NH2+][C@@H](COC)c1ccc(F)c(F)c1)c1cnn(C)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "114102",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(NC(=O)[C@H](C)S(=O)(=O)Cc2c(C)nn(C)c2Cl)cc1C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94699",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1[NH2+]CCC[C@@H]1C(=O)Nc1ccc(CCO)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185291",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule N#Cc1ccccc1/C([O-])=N/S(=O)(=O)N1CCc2ccccc2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "142664",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)NC[C@@H](C)Oc2ccccc2F)s1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220183",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule C[C@H]1CC(C(=O)NCc2ccc(OCc3ccccn3)cc2)C[C@H](C)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12362",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule COc1ccc(-c2cnc(SCC(=O)Nc3ccc(F)c(F)c3)n2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "12371",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(CC(=O)N2CCC[C@H]2Cn2nc(C)cc2C)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "121697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H]1CN([C@H]2CCN(CC(F)(F)F)C2=O)CCO1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CNc2nc(-c3ccccn3)nc3c2CC[NH+](C)CC3)n[nH]1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "93279",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/N=N/c2cc(C)ccc2O)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "132771",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule N[C@H]1CCCn2c1nc1cc([N+](=O)[O-])ccc1c2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117253",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(Cl)c(C(=O)OCc2ccc(Cl)nc2)c1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "21457",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[C@@H](NC(=O)CSc1nnnn1C)c1cc(F)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "139363",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@H](NC(=O)c1cc(-c2cccs2)nc2ccccc12)[C@@H](C)N1CCOCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "195140",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)NCC(=O)N1CC[NH+](C2CCC(C)CC2)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76192",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1ccc(C[NH+]2CCC[C@H]2C[C@@H](O)c2ccco2)c(O)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "164455",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=[N+]2C(=N)/C(=C/c3ccc(-c4cc([N+](=O)[O-])ccc4C)o3)C(=O)N=C2SC1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11633",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])c(NC(=O)[C@@H](C)[NH+]2CCCCCC2)c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "122788",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule COc1cc(OC)cc(-c2cc(N)n(S(=O)(=O)c3ccc(OC)c(OC)c3)n2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209514",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1cc([C@@H]2NC(=O)NC2=N)cc(C)c1O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)N1CCC[C@H](O)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "248049",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule Cc1csc(Cn2ccc([C@@H](O)C(C)C)c2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "116620",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CCn1nc(C(=O)N2CCC(C(N)=O)CC2)ccc1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "117401",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@@H]1[C@H](C[NH+](C)C[C@@H](C)O)CCC1(C)C by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "194065",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@@H](C)c1cccc(O[C@@H]2CCCCNC2=O)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)c2ccc(NC(=O)c3ccccc3Cl)cc2)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "11014",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C[C@@H](C(=O)NC1CCCCC1)[S@@](=O)Cc1nnnn1C1CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52268",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN(Cc1ccccc1)C(=O)CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151283",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(/C=C/c1ccco1)Nc1ccc(NC(=O)c2ccco2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172431",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1nn(Cc2ccccc2)c(C)c1CNc1cncc(C(N)=O)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111261",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule O=[N+]([O-])c1cc(Br)ccc1N1CC[C@H](O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "202606",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CN1C(=O)C([C@@H]2c3c(n(C)c(=O)n(C)c3=O)Oc3ccc4ccccc4c32)C(=O)N(C)C1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160909",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1noc(COCC(=O)N2CCSC[C@@H]2c2ccc(C)o2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119368",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(N/C(=N/C(=O)c2ccc(C)cc2)NC[C@@H]2CCCO2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "52925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C1CC[C@@]2(CCCN(C(=O)c3c[nH]c(=O)cn3)C2)CN1Cc1cccnc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237254",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-c2noc(C[S@@](=O)[C@H](C)c3ccccc3)n2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "67026",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1ncnc(N(C)[C@H]2CCS(=O)(=O)C2)c1N by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[C@@H](C)n1c([C@@H]2CCC[NH2+]2)nc2cc(C(F)(F)F)ccc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134302",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cc(S(N)(=O)=O)ccc1NC[C@@H]1CCC[C@@H]1O by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1cccc(C(N)=O)c1)C(c1ccccc1)c1ccccc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "72817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccon1)N[C@H](c1ccc(F)cc1)[C@H]1CCCO1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201411",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCOC(=O)c1cnc2nc(C)ccc2c1Nc1ccc(S(N)(=O)=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "160269",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)C(=Cc2c(N3CCCCC3)nc3ccccn3c2=O)C(=O)N(C)C1=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235514",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)(C)NC(=O)N1CC[C@@]2(C1)C(=O)Nc1ccccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC1(C)CC(=O)C2=C(C1)OC(/N=C/N1CCCC1)=C(C#N)[C@H]2c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "76762",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Sc2nncn2C)ncc1N by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136540",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(CCC(=O)N1CCN(c2ccccc2F)CC1)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6203",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1=C(C)C[C@H]2C(=O)N(c3ccccc3C)C(=O)[C@H]2C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "44341",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)c1ccsc1NC(=O)c1ccsc1NC(=O)c1cccs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211331",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "1814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitrile from the molecule COc1ccc(C(=O)c2c(C)c(C#N)c(=O)n([C@@H](C)c3ccccc3)c2[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235828",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CC(=O)N1CCCN(C(=O)C(=O)Nc2cccc(Cl)c2Cl)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "224397",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule CCCCN(C)C(=O)N[C@H]1CCCc2ccc(F)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "172210",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1ccc(C(C)(C)C(=O)O[C@H](C)c2ccccn2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "40891",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(N(C(C)=O)c2nc(CSc3nnc(C(F)(F)F)n3N)cs2)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "25218",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=S(=O)([N-]c1nc2ccccc2nc1Cl)c1ccc2ccccc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "207471",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSc1nc(CC(=O)N2CCC3(CC2)OCCC[C@@H]3OC)cs1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168980",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CN1CCc3sccc3C1)C2=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130573",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule NC(=O)[C@@H]1CCC[NH+]1[C@H](C(=O)[O-])c1c[nH]c2cc(NC(=O)c3ccccc3)ccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20167",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCn1cc(CN2CCO[C@H](c3cc(C(=O)NCC(C)C)c4ccccc4n3)C2)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125620",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=NN2C(=N)/C(=C\\c3cc(C)n(-c4ccc(Cl)cc4)c3C)C(=O)N=C2S1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "168709",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitrile from the molecule N#CCc1nc2cc(C(F)(F)F)c(C#N)cc2s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "211104",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule CCc1nn(C)c(OC)c1CN[C@H](C)c1ccnc(Cl)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)[C@H](O)[C@@H]([NH+]1CCCC(C)(C)C1)CC2 by removing a hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "140159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(C[NH2+][C@@H]2CCCC[C@H]2C(F)(F)F)[nH]1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "20890",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCc1ccc(NC(=O)NCc2n[nH]c(=S)n2C(C)C)cc1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "100634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccc(C(=O)N2CCN(Cc3noc(-c4cccc(Cl)c4)n3)CC2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "182021",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(N[C@H]1CCOc2ccccc21)c1cnc([C@@H]2CCCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "141700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N2CCCC[C@@H]2C)n2nc(-c3ccccc3C)nc2n1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31522",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCNC(=O)c1ccc(N(CCC[NH3+])C2CC2)[nH+]n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155577",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCn1c(=O)c2c(nc3n(-c4ccc(C)c(C)c4)c(C)cn23)n(C)c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "125064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1CC[NH+](C)CC1)[C@@H](C[NH3+])c1cc(Cl)cs1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4641",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C([O-])c1ccc2c(c1)[N-]C1=NS(=O)(=O)N=C1N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "192817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1c(S[C@@H](C)C(=O)NC2CC2)nnc1N(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37626",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCS(=O)(=O)c1cccc(C(=O)N(Cc2ccncc2)c2nc3cc(OC)ccc3s2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "150207",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#C/C(=C\\c1ccco1)C(=O)Nc1ncc(Cc2ccc(F)cc2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109777",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)C[NH2+]C1C(C)(C)C1(C)C by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "6034",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCc1ccc([C@@H](O)[C@]2(C)CCCO2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "146076",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CC(=O)N(Cc2ccc(C)o2)c2ccc(F)cc2)no1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "120971",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CO[C@@H]1C=C[C@@](CNC(=O)[C@@H]2CCCN(c3cc(-n4cccn4)ncn3)C2)(OC)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "106244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Nc2nnc(S[C@H]3CC(=O)N(c4cccc(Cl)c4C)C3=O)s2)cc1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Nc1ccccc1F)c1ccc(S(=O)(=O)N[C@H]2CC[NH2+]C2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "9717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CC[NH2+]C[C@@H](Cc1ccc(F)cc1)c1ccccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "197671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule Cc1c(NC(=O)[C@@H](C)Sc2nncs2)cccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "206885",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC[C@@H](C)N(C)C(=O)NCCc1csc(-c2ccccc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78436",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CC(C)(C)c1nc(CCNC(=O)c2c(O)cccc2O)cs1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "134400",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule Cc1ccc(F)cc1[C@@]1(O)CCCC1(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2nc(NC(=O)C3CCN(c4cnccn4)CC3)sc2C)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180139",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amine from the molecule O=S(=O)(NCc1nnnn1-c1ccc(F)c(F)c1)c1cccc(C(F)(F)F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "49291",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule COc1cccc([C@@H](CNC(=O)Nc2ccc([N+](=O)[O-])cc2)[NH+](C)C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "78788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(C)n1nccc1NC(=O)C(=O)N[C@@H]1CCCC[C@H]1OC1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "84062",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+](Cc1ccc([N+](=O)[O-])cc1)CC1CC[NH2+]CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147768",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1cc(F)c([C@@H]2C[S@@](=O)CC(C)(C)N2)cc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "95180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN[C@@H](Cc1ccccc1Cl)C[NH+](C)C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "24980",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(C(=O)Nc2ccccc2N2CCNC(=O)C2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "73090",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule Cc1sc(C[NH3+])nc1-c1ccc(Cl)cc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66957",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@H]1CCCCN1C(=O)[C@H](C)OC(=O)c1ccc2nc(C)c(C)nc2c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68750",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule CC(C)(C)C(=O)NC(=S)Nc1cccc(C(=O)N2CCCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "68112",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1n[nH]c2ncc(C(=O)Nc3nnc(C4CC4)s3)cc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131032",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)Cn1c(C2CCCCC2)nc2ccccc21)C(N)=O by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "88178",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1n[nH]cc1CNC(=O)c1ccncc1C#CC[NH3+] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "190959",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCO[C@@H]1C[C@H]1C(=O)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "5163",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CSCC[C@@H](NC(=O)c1ccccc1Cl)C(=O)N[C@@]1(C)CCS(=O)(=O)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196221",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1ccc(O[C@H](C)C(=O)N/N=C/c2cccnc2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138474",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule CCCc1ccc(C(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19015",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Cc1oc(-c2ccc(C(=O)NC3CCCC3)cc2)nc1C[S@@](=O)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "180868",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule NC(=O)NC(=O)CSc1ncnc2sc3c(c12)CCCC3 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "94544",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[C@H](Sc1ccccc1)c1nc(-c2cnccn2)no1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "240671",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cccc(C(=O)Nc2nc(-c3ccccc3)ns2)c1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "188102",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(C)n1nccc1NC(=O)COc1cc(F)ccc1F .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "216569",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc(NC(=O)N[C@H](C)c2cnn(CC)c2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "176195",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@H](Oc2ccc(C)cc2)C1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "183677",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc([C@H](CNC(=O)c2ccc(-n3cccc3)cc2)N2CCOCC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "196687",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc2c(CCNC(=O)N(C)Cc3ccccc3O)c[nH]c12 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "219290",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)N1CCc2ccccc2C1)[NH+]1CCC[C@H](O)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "186887",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCO[C@@H](C)c1noc(CN2CCN(C(=O)CC(F)(F)F)CC2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "191341",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cccc(C(=O)/N=C(/[N-]Cc2cccnc2)Nc2ccc(Cl)cc2C)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "112066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=C(NC(=S)Nc1cccc(CO)c1)c1ccccc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "203923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccc(S(=O)(=O)Oc2ccc(Cl)cc2)c1)N1CCCC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163942",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCC(=O)N(C)c1ccccc1C(=O)NCC(=O)OC(C)(C)C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "38540",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=Cc1cccc(OCc2cccc3ccccc23)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217086",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nsnc1COc1cccc(C(=O)N[C@@H]2CCS(=O)(=O)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "31294",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1onc(C)c1NC(=O)N(Cc1ccc(Cl)c(Cl)c1)C1CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "59246",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCN(C(=O)c1cc(C2CC2)n(C(C)(C)C)n1)c1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "17484",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@@H](OC(=O)c1ccc2c(c1)CCC(=O)N2)C(=O)Nc1ccc(Cl)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "153060",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1c(C)cccc1C1=N/C(=C\\c2ccc([N+](=O)[O-])cc2)C(=O)O1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "19390",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCN(C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237517",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule C[NH+]1CCC(N(Cc2ccco2)C(=S)Nc2cc(Cl)ccc2C(F)(F)F)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8470",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCOc1ccc([C@H](C)[NH2+]CC(C)(C)N2CCS(=O)CC2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80717",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(CCC(=O)Nc2cccc(-c3n[nH]c(C)n3)c2)c1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "147498",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC(C)CC(C)(C)C(=O)NC1CCN(c2ccccc2)CC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99405",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(COC(=O)c1ccco1)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "155066",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule Nc1cccc(C(=O)/C=C/c2ccccc2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "29606",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[C@@H](C)C[NH+](CCNC(=O)NCc2ccccc2F)C1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "221152",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CC(=O)N1CC[C@@H](NC(=O)NCc2ccc(N3CC[NH+](CC4CC4)CC3)cc2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "232163",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COC(=O)[C@H](CC(C)C)NC(=O)c1cnc2ccc(C)cn12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "220152",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(NC(=O)c2ccc(Cl)c(N)c2)c1 by removing a amine.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "235590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)CC2CCCC2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "66874",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a nitro from the molecule Nc1ccc(C(=O)Nc2ccccc2SC(F)F)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "57681",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC1(C)Cc2c(sc(NC(=O)C(=O)NC[C@@H]3CCCO3)c2C(N)=O)CO1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "118391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=[N+]([O-])[C@H]1C[C@@H]1/C([O-])=N/S(=O)(=O)c1ccc(Cl)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209027",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule O=S(=O)(NC[C@H](c1cccs1)S(=O)(=O)c1ccc(Cl)cc1)c1ccc(F)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "79306",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CCc1nnc(NC(=O)NCc2cccc(C[NH+](C)C)c2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92669",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CC[C@H](Sc1nncn1C(C)(C)C)C(=O)NCc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1nnc(S[C@H](C)C(=O)N(C)c2ccccc2)n1-c1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "61749",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule O=C(NCc1nccc2ccccc12)c1c(Cl)cccc1Cl .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "233334",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(C2=CCN(C(=O)c3ccc(Cl)nc3)CC2)cc1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "115375",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccnc(N2CCc3c(cccc3NC(C)=O)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "37078",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCC([C@H]2CC=CCN(Cc3ccccc3)C2=O)CC1 by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8175",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule C=CCO[C@H](C)C(=O)Oc1ccc2c(c1)CCC(=O)N2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "171564",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a halo from the molecule C[C@H]1CC(Oc2c(F)cc(CC[NH3+])cc2F)C[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "4959",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule O=C(c1cnccn1)N(Cc1ccc2c(c1)OCO2)C1CCCC1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "185293",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule C[C@@H]1CC[C@H](NC(=O)Nc2cc(C(=O)N(C)C)ccc2F)[C@H](C)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "8189",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amine from the molecule Cc1ccc(S(=O)(=O)Nc2ccccc2N2CCCC2)cc1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "111176",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCOc1ccc(NC(=O)N(C)CC[C@@H](C)O)cc1OC .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "163205",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(Nc1cccc(C(=O)Nc2nccs2)c1)c1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "130918",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc([C@@H](OC)[C@@H](C)NC(=O)c2sc(C(C)C)nc2C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "80901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)NC[C@@H](c1ccco1)[NH+](C)C)c1ccc(C(F)(F)F)cc1 by removing a halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "119108",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule CN(C(=O)COCCOc1ccccc1)c1cccc2ncccc12 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "127321",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccccc1Cc1noc(CN2CCC[C@@H](C[NH+]3CCCC[C@@H]3C)C2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "245840",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N[C@@H](c1ccccc1)c1ccco1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "148288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)c2cc(=O)[nH]c3cc(F)ccc23)[C@@H](C)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "230991",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1cccc(C(=O)N2CCC[C@H](Nc3ccc(F)cc3)C2)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "75352",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COc1ccc2[nH]cc(C(=O)N[C@@H](C(=O)Nc3ccc(C)cc3)c3ccccc3)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "50681",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CN(CCO)C(=O)C[C@H]1C(=O)NCCN1Cc1ccc(F)c(F)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "205363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCOC(=O)c1cccc([N+](=O)[O-])c1C by removing a benzene_ring.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "175432",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2c(cnn2C(C)C)cc1C(=O)N1CCC[C@H](c2[nH]cc[nH+]2)C1 by removing a amide.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "85844",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule Cc1cc([C@@H](C)NC(=O)CCCCO)c(C)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "60204",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule Cc1cccc(NC(=O)Cn2ncccc2=O)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "92585",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cn1cc(COC(=O)/C=C/c2ccccc2OC(F)(F)F)cn1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "213680",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1ccc(CCCC(=O)NCc2nc(-c3ccncc3)no2)s1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "136356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a hydroxyl from the molecule O=C(NC[C@@H]1CC[C@H](C(=O)[O-])O1)c1ccc(CO)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "109610",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Oc1cccc(/C=C(\\C#N)C(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])c1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217490",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule O=NNc1nc2ccccc2n1Cc1ccccc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "229756",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule Cc1n[nH]c(-c2ccc(NC(=O)CCC(C)C)cc2)n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "237014",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a nitro from the molecule CNc1ncnc(NC[C@H]2CCCO2)c1[N+](=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "99567",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a amide from the molecule CCCCn1nc(C(=O)N2CCC(C(=O)c3ccc4c(c3)OCCO4)CC2)c2ccccc2c1=O .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "215495",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc(-c2nc(=S)c3c(n2-c2ccccc2)CCCC3)cc1 by removing a nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "103396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule Cc1ccc(-c2nc(C[NH2+]C3CCN(c4cccc(C)[nH+]4)CC3)co2)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "209214",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule COc1ccc([C@@H]2CN(C(=O)c3cccc(Cl)c3)C[C@H]2C(=O)NCCC(C)C)cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "189757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a halo from the molecule O=C(Cc1ccncc1)N1CCC[C@H](c2cccc(Cc3ccccc3F)n2)C1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "151632",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule COc1ccc(/C=C2\\Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c(OC)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "63729",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule CCOCCSc1nc([O-])c2cnn(CCO)c2n1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131873",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule O=C(N/N=C/c1ccccc1F)c1cncc(Br)c1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "149290",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a hydroxyl from the molecule COc1ccc2c(c1)c(C(=O)N/N=C/c1ccc(O)c(O)c1)c(C)n2C .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "77383",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COc1cc(/C=N/NC(=O)c2cc(Cl)ccc2O)ccc1OCC(=O)[O-] .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "131395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule C[C@](O)(CNC(=O)c1n[nH]c2ccccc12)c1ccsc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "96641",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule COCC(=O)N[C@H](C)c1nc2ccccc2[nH]1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "201743",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule CCCNC(=O)[C@@H](C)S(=O)(=O)Cc1cc(-c2ccccc2)on1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "39688",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a amide from the molecule CC(=O)c1cc2c(cc1NC(=O)CCC(C)C)OCO2 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "217104",
"split": "OpenMolInst"
}
},
{
"instruction": "Remove a benzene_ring from the molecule N#C[C@@H](c1ccccc1)[C@@H]1CCCN1c1ccc([N+](=O)[O-])cc1 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "138476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please remove a benzene_ring from the molecule COCCn1ccc2ccc(NC(=O)[C@H](C)c3ccc(OC)cc3)cc21 .",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "delete_component",
"index": "53134",
"split": "OpenMolInst"
}
}
]