[ { "instruction": "Substitute a nitro in the molecule O=C(NCc1cc(=O)[nH]c2ccccc12)c1cc(F)ccc1[N+](=O)[O-] with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208406", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(F)c(NC2=[NH+]CCCCC2)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146239", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc([C@@H](C)[NH2+]Cc2ccc(F)cc2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41592", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](O)CC[NH+](C)Cc1ccn(Cc2ccccc2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181147", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](C)NC(=O)c1ccc(CNC(=O)c2ccnc(Cl)c2)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111333", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Oc1ccc(Cn2ccc(C[NH2+]C3CC3)n2)cc1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6833", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C(=O)N(Cc2ccccc2Br)S1(=O)=O by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81689", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CN(CC#N)C(=O)c1sc(-c2ccccc2)cc1OCC(=O)N1CCCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116978", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1noc(C)c1CCC(=O)N[C@@H](c1ccc(Cl)cc1)C(F)(F)F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59518", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[NH2+][C@@H]1[C@@H](CN(CCO)C(C)C)CCC1(C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74057", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](O)C[C@H](C)CNC(=O)COc1cc(Cl)cc(Cl)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128075", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3607", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(C(=O)N(Cc2c(F)cccc2Cl)c2ccccn2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129681", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(c1c(F)cccc1F)N(c1cccc(Cl)c1)[C@H]1C=CS(=O)(=O)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178677", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[S@](=O)c1ccc(CNC(=O)Cc2ccccc2F)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108250", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccccc1Br)N1CCC[C@H](c2nnc3ccccn23)C1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101372", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]([NH2+]CCC(=O)Nc1sccc1C#N)c1ccc(F)cc1F by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246780", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CSC1=[NH+]CCN1)Nc1cccc(Cl)c1N1CCCCC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90996", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1c(Cl)cccc1NC(=O)CNC(=O)CSc1nccn1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203002", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CN2CCCC[C@@H]2CN1S(=O)(=O)CCCCO with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54480", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cccc(F)c1)n2CC with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137690", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CNC(=O)c1ccc(NC(=O)N[C@@H]2CCN(C(=O)C(C)C)C2)c(Cl)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33636", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1nc(C[C@@H]2CCC[NH+](Cc3cccc(O)c3)C2)no1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212371", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1CCN(Cc2nccn2C(F)F)CC[NH+]1Cc1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176920", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C/C(=C/C(=O)N1CCN(Cc2ccco2)CC1)c1ccc(F)cc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49060", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H](O)[C@@H]1CCC[NH+](CC(=O)N(C)CC(=O)NC2CC2)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190324", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Nc1cccnc1SCc1cc(=O)c(O)co1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197359", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCCOc1cc(Br)ccc1OC with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189672", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC[NH2+]CC[C@](C)(O)c1cccc(OCC)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81585", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CSc1ccc2nnc(-c3cccc(F)c3)n2n1)Nc1ccccc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143881", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CSc1ccc(Cl)cc1)Nc1cccc(C(=O)Nc2ccc(C(=O)[O-])cc2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240762", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccc([C@H](O)CNC(=O)C2CCCC2)cc1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146639", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c(Cl)cccc1N[C@H](C)c1nc(C(C)C)no1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125801", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1sc(NC(=O)CCCCNC(N)=O)nc1-c1ccc(F)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125828", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(OCc2ccncc2Cl)c(CCl)n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48154", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(Cc2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1cc(C(=O)N2CCC[C@@H](C)C2)c(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103151", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1CN(c2nc3ccccc3c3nnc(-c4cccs4)n23)CCN1C(=O)c1ccc(F)cc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10492", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C)cc1NS(=O)(=O)c1cccc(C#N)c1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234004", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1cccc(NC(=O)CCNC(=O)Nc2ccccc2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137017", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1[nH]cnc1C[NH+]1CC[C@@](O)(C2CCOCC2)[C@H](C)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175139", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COCc1cc(N)nc(-c2cncc(Br)c2)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85956", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC(C)[NH+](CCCNc1c(C#N)c(=O)n(C)c(=O)n1C)C(C)C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138944", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1n[nH]c2cc(NC(=O)c3c(O)cc(F)cc3F)ccc12 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51453", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CN1CCN(S(=O)(=O)c2cccc(F)c2)CC1)Nc1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49164", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C)c(C)c1CN(C)Cc1c2cccn(CC(=O)N(C)C)c-2nc1C(F)(F)F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23549", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(Cc1cnn(C)c1)C(=O)CNc1cc2c(cc1Cl)NC(=O)CO2 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142445", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCC[C@@H](C)O)C2 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11326", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule FC(F)(F)c1cccc([C@H]([NH2+]CCn2ccnc2)C2CC2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156554", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C)n(C[C@H](O)COCc2ccccc2)n1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74830", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(-c2nnc(NC(=O)c3ccc(Cl)cc3)o2)nn1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107391", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1ccc(-n2c(C)cc(C(=O)Cn3cnc(C#N)n3)c2C)cc1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180679", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC1CCC(C[NH3+])([C@H](O)c2c(F)cccc2F)CC1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10335", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1ccc([N+](=O)[O-])c(N2CCN(S(=O)(=O)Cc3ccon3)CC2)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37064", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C([O-])c1nc(/N=C/c2cccc([N+](=O)[O-])c2)n[nH]1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61642", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(-c2c[nH]c(-c3ccc(O)cc3)[nH+]2)cc1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108504", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1oc(-c2ccccc2)nc1CC(=O)N[C@H]1CCc2c(O)cccc21 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74517", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1ccc(-c2nnc3n2N=C(c2ccccc2)CS3)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172007", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@H](Cc1ccc(F)cc1F)c1c(Cl)cccc1Cl by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168287", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1cc(C(=O)N2CCN([C@H](C#N)c3ccccc3)CC2)nn1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47800", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C(=O)Nc1c(C(=O)Nc2ccccc2F)oc2cccnc12 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230110", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]([NH2+][C@H]1C[C@@H]1C1CCCCC1)c1ccc(N2CCC(O)CC2)cc1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59653", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1C(=O)NCCC(=O)NC1(c2cccc(Cl)c2)CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45486", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(C[NH+]1CCC(c2nnc(C(F)(F)F)o2)CC1)NC[C@@H]1CCCO1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189070", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(CC(=O)C[NH+](C)C)cc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34979", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1[nH]c(CNc2cccc(Cl)c2)nc2scc(-c3ccccc3)c12 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74536", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc(OCc2nnc(S)n2C)cc1 by replacing a thiol by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204679", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=c1c2ccccc2[nH]c2ccc(O)cc12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164377", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cccc(F)c1)N1CCCN(c2nc3ccccc3c3nnc(-c4cccs4)n23)CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154996", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1nccc1CN1C(=O)C[C@@H](Cc2ccc(F)cc2)C1=O by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27873", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCCC[C@](C)(O)C1(C)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178134", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)Nc1ccccc1C[NH+]1CCC[C@H](C(=O)Nc2ccc(Cl)cn2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168033", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](C)c1ccccc1Oc1cccc(F)c1C(=O)[O-] by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77160", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@@H]1CN(C(=O)OC(C)(C)C)CCN1c1cnc2cc([N+](=O)[O-])ccc2n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221962", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN/C([O-])=C(\\C#N)C(=O)CCn1nnc2ccccc2c1=O by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43309", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C2CCN(S(=O)(=O)c3cc(-c4noc(C)n4)cs3)CC2)c(Cl)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55451", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NNc1ccc(F)cc1)c1cc2ccc(Br)cc2[nH]1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19458", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCc1c(C)nc(SCC(=O)Nc2sc3c(c2C#N)CCC3)c(C#N)c1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162595", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(Cc1ccccc1N1CCCC1)S(=O)(=O)c1ccccc1Br with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73529", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cccc(C(=O)N2CCC[C@H]2CC(=O)c2cccs2)c1O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146302", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COCCN1C[C@H](C(=O)N[C@@H](C)c2ccc(C#N)cc2)CC1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49279", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CN(O)[C@H]1CC[C@H](c2ccc(C(C)(C)C)cc2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1c(F)cccc1Cl)C(=O)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71931", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCCN1C(=O)C(O)=C(C(C)=O)[C@H]1c1ccc(O)c(OC)c1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188094", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(S(=O)(=O)/N=c2\\[nH]cc(C)s2)cc1Br with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208458", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)Oc1cccc(-c2ccc(F)c(C[NH3+])c2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132282", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C(F)(F)F)cc1NC(=O)C(C)(C(F)(F)F)C(F)(F)F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28062", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCC(CC)CN(CC)C(=O)c1cccc(OC)c1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125869", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@]1(C(=O)NCc2cccnc2-n2cncn2)CC1(Cl)Cl by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24140", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccnc(-c2ccc(NCc3ccc(F)cc3F)cc2)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21937", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cccc(C[S@@](=O)CC(=O)N(C)Cc2ccc(F)cc2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76782", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1onc(-c2c(F)cccc2Cl)c1C(=O)N1CCN(CC(=O)NC2CC2)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213731", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H]1OCC[C@@H]1C(=O)NC[C@@H](c1ccccc1)C(C)(C)CO by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6299", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCC1CCC(C[NH3+])([C@@H](O)c2ccccc2F)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77709", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOCCCC(=O)[C@H](C#N)c1nc(C)cc(C)n1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163419", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC(C)CN(CCC#N)C(=O)Cc1ccc(F)cc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161183", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)c1ccc(NC(=O)Cn2c(-c3cscn3)nc3ccccc32)cc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173490", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NCC(=O)N(C)C)cc1Cl by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140611", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccccc1-c1n[nH]c(-c2ccco2)n1 by substituting a nitro with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15481", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Nc2cc(C)c3ccc(O)cc3n2)cc1F by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138708", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)(C)OC(=O)C1CCC(NC(=O)[C@]2(C)CC2(Cl)Cl)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57059", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CNC(=O)Nc2ccc(C)c(F)c2)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138773", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CC1(C(=O)N2CC[C@@H](C(N)=O)c3ccccc32)CCCCC1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185035", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(I)ccc1NC(=O)COC(=O)CCc1ccccc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102601", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)C(C[C@@]1(c2ccccc2)CC1(Cl)Cl)=C(Cl)Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231551", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3512", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CCN(CCCl)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142948", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1nnc(COc2ccc(C#N)cc2Cl)o1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139801", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)[C@H](C(=O)N[C@H](C)c1ccc(Cl)cc1)n1cnc2ccccc21 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8794", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[S@](=O)c1ccc(CNC(=O)c2cc(F)cc([N+](=O)[O-])c2N)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H]1CO[C@H](Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@H](O)[C@@H]1O by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198277", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CCc1ccc(C(=O)NC[C@@H]2CCCN(c3ncccn3)C2)cc1[N+](=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71162", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](NC(=O)C1CCC(C[NH3+])CC1)c1ccc(Br)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127592", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(c1ccc(Cl)cc1)c1ccc(C2OCCO2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249023", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+]CCC1CC[NH+](Cc2ccc(F)cc2)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124869", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1ccc(OCC(=O)N2CCC[C@@H]2c2ccc(O)cc2)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111051", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCOc1ncccc1Cl)c1ccccc1C(F)(F)F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211576", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C2CC2)cc1)c1cc2ncccn2n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88832", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)NC(=O)C(=O)N1CCN(C(=O)c2ccc(Cl)cc2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64715", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(c1)[n+]([O-])c1cc(Cl)ccc1[n+]2[O-] by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42759", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cn2c(=O)cc(COc3cccc(NC(=O)c4ccccc4F)c3)nc2s1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164719", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)Oc1ncc(C(=O)NC[C@@](C)(O)c2ccc(F)cc2)cc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85970", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCCn1ncc2c(NCc3ccc(F)cc3)ncnc21)c1cc(=O)c2ccccc2o1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113075", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#CCCN(Cc1ccco1)C(=O)[C@H]1Cc2cc(Cl)ccc2O1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25338", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)c1ccccc1Br by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126080", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#C/C(=C\\c1cccc([N+](=O)[O-])c1)C(=O)NCc1ccccc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134651", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(CNC(=O)COc1ccc(C(F)(F)F)cc1)c1ccncc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248196", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCCc1ccc(C(F)(F)F)cc1)NCc1nnc2n1CCC2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61540", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](NC(=O)[C@H](C)CC(=O)c1ccccc1F)c1ccc(F)c(Cl)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44629", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1nnc(N(C)C[C@H]2CCC[NH+]2C)c(C#N)c1C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36452", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Br)cn1)c1cccc([N-]S(=O)(=O)c2ccc(F)c(Cl)c2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129482", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CS(=O)(=O)N1CCC[C@H](COc2ccc(CC#N)cc2)C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167697", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1CCc2c(c3cc(C(F)(F)F)ccc3n2CCc2ccccc2)C1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)N2CCc3ccc(O)cc3C2)s1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202083", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@H](Oc1ccccc1)C(=O)NNC(=O)c1sc2ccccc2c1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195741", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CCN(Cc1cc(Br)ccc1[N+](=O)[O-])[C@@H]1CCS(=O)(=O)C1 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185723", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)Nc1ccc(Nc2nc3ccccc3nc2[N-]S(=O)(=O)c2cccc(Cl)c2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220937", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cc(NC(=O)CCc2ccccc2O)ccc1N1CC[NH+](C)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114241", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Sc1ncccn1)C(=O)Nc1ccc(OC(F)F)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215751", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCc1noc(Cc2ccccc2)n1)c1ccccc1Br by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134806", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#Cc1cccc(S(=O)(=O)[N-]c2cccc(-c3nnc4n3CCCCC4)c2)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4244", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)NC1=C[C@@H]2N=CC=C2C=C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24906", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NCc2c(F)cccc2F)c(C)n1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247095", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC[C@H](c1nnnn1Cc1ccccc1)[NH+]1CCN(c2ccc(F)cc2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200396", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[C@H](NC(=O)[C@H]2N(C3CC3)C(=O)[C@H]3[C@@H](C(=O)Nc4ccc(Cl)cc4)[C@H]4C=C[C@]32O4)[C@@H]1C by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34352", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccccc1C[NH+]1CCC(c2cc(C(F)(F)F)n3ncnc3n2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37514", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccsc1[C@H]1C[C@H]1C(=O)NCCc1cccc([N+](=O)[O-])c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14823", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC(C)(C)C[NH2+]Cc1cc(C#N)cs1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188325", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOC(=O)C1=C(c2ccccc2)NC(=O)N[C@H]1c1cc(OCC)c(O)cc1Br by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169514", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132815", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2nc([C@@H](C)Cl)n(-c3cnn(C)c3)c2c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216291", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCc1nn2c(c1-c1ccccc1)NC(=O)[C@@H]2CC(=O)Nc1ccc(F)c(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145323", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@@H](c1ccccc1)c1ccccn1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14622", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CCCOc1ccccc1F)N[C@H]1c2ccccc2C[C@@H]1O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166490", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#C[C@@H](c1ccc(F)cc1)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211836", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(Br)ccc1NC(=O)C(=O)N[C@@H](C)CC(C)C by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180388", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)Oc1ccc(F)c(F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87529", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccc(C)c([C@@H](C)NC(=O)c2cccc([N+](=O)[O-])c2C)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171129", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(C(=O)CCc2ncc(-c3c(F)cccc3F)o2)C[C@H](c2ccccc2)O1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99450", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC1CCC(C[NH3+])([C@@H](O)c2ccccc2Br)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177560", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(-c2ncco2)cc1NC(=O)Cc1c[nH]c2ccc(F)cc12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156682", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1cc([C@@H](C)NC(=O)N2CCC[C@@H]2[C@@H](C#N)c2ccccc2)c(C)o1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159835", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)C1(C(=O)N2CCNC(=O)[C@@H]2c2ccc(F)cc2)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228639", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2ccc(OCC)cc2)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226961", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cccc(Br)c1CN1CCC([NH+]2CCCC2)CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42592", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)N1N=C2CCCC[C@@H]2[C@]1(O)C(F)(F)F with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25849", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N/C(=N\\OCc1ccc(Cl)c(Cl)c1)c1nonc1N with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190848", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1nc(CNS(=O)(=O)c2cccc(Cl)c2)cs1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3027", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccccc1OCC(=O)OCC(=O)NC1CC1 by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148699", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCC(F)(F)F)c1cc(-c2ccc(Cl)s2)on1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230027", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CN(Cc2c[nH]nc2C(C)(C)C)C[C@H](c2ccc(F)cc2)O1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193132", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1ccccc1C(=O)NC(=S)Nc1ccc(C)c([N+](=O)[O-])c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66519", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218511", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)Cn1ccc(=O)n(C)c1=O by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207251", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nc(C(=O)N[C@H](C)c2ccc(Cl)cc2Cl)n[nH]1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17561", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)c2cccnc2Cl)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48650", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(OCC1CCN(CC(F)(F)F)CC1)[C@H]1COc2ccccc2C1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247388", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCCO[C@@H]1C[C@H](NC(=O)c2occc2Br)C1(C)C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21440", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCN(C(=O)C(=O)Nc2ccc3c(c2)C[NH+](C)C3)C[C@H]1O by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242908", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]1[NH2+]CC[C@@H]1C(=O)Nc1cc(F)ccc1C(=O)[O-] with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218536", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1cc2oc3c(c(=O)c2cc1C)[C@@]1(C(=O)N(C)c2ccccc21)N(CCO)C3=O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229339", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C/C(=C\\CNc1ncnc2c1ncn2[C@H]1O[C@@H](CO)[C@@H](O)[C@@H]1O)CO with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40580", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C=C(CC)C[C@H](O)[C@](C)(CC)N1CCOCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98271", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](NC(=O)[C@@H]1CCCO1)c1ccc(OC(F)(F)F)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52785", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CS(=O)(=O)N(CC(=O)NC[C@@H]1CCCO1)c1ccc(Cl)cc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2C[C@H](C)N(C(=O)CC3(O)CCCC3)C2)cc1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34556", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@H](c1ccc(Cl)cc1)c1ccccc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117838", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(CCC(F)(F)F)c1nc(C2CC2)ns1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63969", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C(F)F)c(C)c1CC(=O)N[C@H](c1nc(C2CC2)no1)C(C)C by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227101", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1nn(C)c(Cl)c1CNc1cccc(CC[NH+]2CCCC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75714", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule Cc1ncc(C(=O)[O-])cc1C#N with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23307", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cc2c(nc1SCC(=O)Nc1nonc1-n1cccc1)CCCC2 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105140", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1cc([N+](=O)[O-])ccc1NC(=S)NC(=O)c1ccc(OC(C)C)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151363", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@H](C)CN(C)c1cc(Br)ccc1C[NH2+]C(C)C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184050", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cn1cnn(CC(=O)NC[C@@H](O)c2ccc(Cl)s2)c1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192752", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@H](NCCS(=O)(=O)C(C)(C)C)c1ccccc1Br by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22220", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(-c2nn(C)c(=O)c3c2CCCC3)cc1S(=O)(=O)N1CCN(c2ccccc2F)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95582", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)c(NC(=O)c2cc3cnn(C(C)C)c3nc2C)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23667", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSCc1ccnc(NCCn2cc([N+](=O)[O-])cn2)c1 by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36859", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@@H]([NH2+]Cc1ccc(-c2ccccc2C#N)cc1)c1cccs1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237552", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C[C@H]1C(=O)N1CCN(C(=O)N[C@@H](c2ccc(F)cc2)C2CCC2)CC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179572", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(Cl)cc1N1C[C@@H](C(=O)N2CCSCC2)CC1=O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240149", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(F)cc(CNC(=O)N(C2CC2)[C@H](C)C(C)C)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149466", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCc1ccccc1-c1ccc(Cn2cccn2)cc1)c1ccc(=O)n(-c2ccc(F)cc2)n1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79629", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](c1ccccc1F)N(C)C(=O)c1cn(Cc2cccnc2)nn1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228161", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1ccc(C/[NH+]=C/c2c(CO)cnc(C)c2O)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C[NH2+][C@H](Cc1ccc(F)cc1)c1ccccc1Cl)[S@](C)=O by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95747", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCOc1cccc([C@H](O)C(C)(C)N2CCOCC2)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23662", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1ccccc1OC(=O)c1cc([N+](=O)[O-])ccc1Cl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52476", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNS(=O)(=O)c1ccc(NCc2cccc(Cl)c2)c([N+](=O)[O-])c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84624", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NCCn1cnnc1C1CC1)c1ccccc1C(F)(F)F by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70029", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@@H](NCc1ccc(OC)c(C#N)c1)c1ccc(F)c(F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188195", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(S(=O)(=O)Nc2ccc3c(c2)C(=O)Nc2ccccc2O3)ccc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216970", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCN1C(=O)c2ccc(Cl)cc2N[C@@H]1c1ccc(C#N)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169743", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(Br)c(CC(=O)N2CCNC(=O)C2)cc1OC by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186106", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=S)c1[nH+]ccn1CC(=O)Nc1ccc(Br)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166520", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Brc1ccc(C[NH2+]Cc2nc3c(s2)CCC3)s1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135584", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(C(=O)NNC(=O)c2cc3c(C)nn(-c4ccccc4Cl)c3s2)c(C)o1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233696", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Cc1ccc(Cl)cc1)c1cccc(I)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189705", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Cn1c(=O)c2cc(F)ccc2n2c(SCC(=O)Nc3ccc(F)cc3)nnc12 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65896", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]([NH3+])[C@@H](N1CCN2C(=O)NC[C@@H]2C1)C(F)(F)F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32355", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule [NH3+][C@H](CC1=c2cccc(O)c2=[NH+]C1)C(=O)[O-] by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127916", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)C(=O)Nc1c2c(nn1-c1cccc(Cl)c1)CSC2)c1ccccc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41743", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1csc(-c2cccc(Br)c2)n1)NC1CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18672", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C=CC[NH+]1CCC(N/C(NCc2cc(F)ccc2F)=[NH+]\\C)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175889", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](CC(=O)NCC1CCC1)Cc1ccc(C(F)(F)F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38109", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc([C@@H](C(=O)NC(C)(C)C)N(C(=O)c2csnn2)c2ccc(Cl)cc2)o1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CO)NCc1c[nH+]cn1C1CC1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68551", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc(S(=O)(=O)N2CC[C@H]3CCCC[C@@H]32)sc1Br by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200944", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(C[C@H]1CCCO1)N1CCN(C(=O)c2ccccc2O)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27993", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccc(S(=O)(=O)c2cc(NS(=O)(=O)c3ccccc3)cc(C)c2O)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46081", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1cc([N+](=O)[O-])ccc1NC(=O)NCN1C(=O)[C@H]2[C@H]3C=C[C@H](CC3)[C@H]2C1=O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196284", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@H]1NCCc2[nH]c[nH+]c21)N1Cc2cnn(Cc3ccc(F)cc3)c2C1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216128", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cccc(OCCNC(=O)Nc2ccc(OC)cc2Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67809", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C(=C1/SC(N2CCCC2)=NC1=O)c1ccc(Cl)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13016", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](CCCCl)[NH2+]C[C@H]1CCCc2ccccc21 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78767", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCOc1ccc(NC(=O)/C(C#N)=C/c2c(OC)ccc3ccccc23)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230207", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H](c1ccc(Cl)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2F)CC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105595", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C[C@H](Cl)c2ccccc2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102622", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CCc1ncc(-c2ccccc2F)o1)NNc1cccc(Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194855", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H](C)[C@H](NC(=O)[C@@H](C)Cl)C(=O)Nc1nnc(-c2ccccc2)s1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117198", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(C)cc(OCC(=O)Nc3ccc(OC(F)(F)F)cc3)nc2c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224405", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc2c1NC(=O)/C2=N\\NC(=O)c1ccccc1Cl by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175052", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)N1CCC(Oc2ccc(Cl)cc2C(=O)N2CCCCCCC2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206765", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](SC)C(=O)N[C@H](C)c1ccc(Cl)s1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159207", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1c(-c2ccccc2)cc2nc3ccccc3n2c1N with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201170", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@]1(c2ccc(OC(F)F)cc2)NC(=O)N(C[C@@H](O)c2cccc(F)c2)C1=O by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107569", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccc(/C=N\\NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)o2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231356", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](CO)[NH2+][C@@H](C)c1nc2ccc(Cl)cc2n1C by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19676", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](NCc1cnc(-c2cccnc2)s1)c1ccc(OC(F)F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236405", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)CC(=O)NCCc1ccc(S(=O)(=O)N2CCC(O)CC2)s1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179969", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(C[NH+]2CCCCC[C@@H]2C[C@@H](O)c2ccco2)o1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129574", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)c1cc2ccc(Cl)cc2[nH]1)[C@@H]1CCS(=O)(=O)C1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69294", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]([NH3+])[C@H]1CCCCN1c1cc(Cl)c(Cl)cc1[N+](=O)[O-] by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222859", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1nc(-c2ccc(F)cn2)nc(NC)c1I with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87590", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH+](Cc1ccccc1Cl)Cn1nc(-c2ccncc2)n(C2CC2)c1=S by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58080", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "836", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(c1cccc(CSc2nnc(-c3ccccc3F)n2C2CC2)c1)N1CCOCC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173464", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Oc1ccccc1NC(=O)CCC(F)(F)F)c1ccccc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191863", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1c2ccccc2C[C@@H]1C(=O)NCc1cccc(F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183473", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)c1cccc(NC(=O)NCCc2ccc(F)cc2)c1C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165267", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(N(CC(=O)Nc2ccc(Cl)cc2C)S(C)(=O)=O)cc1OC with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219203", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[S@](=O)[C@@H]1CCC[C@H](NC(=O)NCCC(F)(F)F)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217588", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)[C@H]1CN(C(=O)c2ccncc2F)CCC(=O)N1Cc1ccc(F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172259", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1nn(Cc2ccc(C(=O)N[C@H]3C[C@@H]3C)cc2)c(C)c1[N+](=O)[O-] by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239875", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CC[C@@H](OC(=O)c1cnn2cc(Br)cnc12)C1CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150343", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCO[C@@H](C)C(=O)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192532", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CCOc1cccc(CC(=O)Nc2ccc(Cl)c(C#N)c2)c1 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76221", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1noc(C)c1Cc1ccc(C(=O)Nc2ccn(Cc3ccccc3F)n2)o1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243092", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=S1(=O)C[C@H](Cl)[C@H](NC(=S)NC2CCCCC2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114979", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@H]1CCC[C@@H](CC(=O)N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C#N)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117224", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(CN2C(=O)[C@]3(SCCN3C(=O)c3ccco3)c3cc(Cl)ccc32)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83986", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cc2cc(C(=O)N3CCC([C@@H](O)c4ccccc4)CC3)oc2cc1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239549", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(Cc1ccc(Cl)cc1Cl)C(=O)[C@H]1CCCCN1C(=O)OC(C)(C)C by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92133", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(N/N=C/c1ccc([N+](=O)[O-])cc1)/C(=C/c1ccccc1)CCO with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200878", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)N[C@H](c1nc(-c2ccncc2)no1)C(C)C by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20712", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)OCC[C@@H]1CCCC[NH+]1Cc1cnc(Cl)s1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132036", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)C1CCC(C(=O)N[C@@H](CC(F)(F)F)c2ccc(F)cc2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12260", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)Nc1ccc(CNc2ccc(C(F)(F)F)cn2)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169638", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(OCc2ccc(C#N)cc2F)c(OC)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157565", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[NH+]1CCC[C@@H](CNC(=O)N[C@@H](CO)c2ccc(Cl)cc2)C1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246251", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCNc1scc(C)[n+]1/N=C/c1cc(Br)c(O)c(Br)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111156", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)C(=O)N1CCC[C@H]1C(=O)[C@H](C#N)c1ccc(F)cn1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204502", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)CCOc1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113298", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C(=O)NCCN2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243372", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](C(=O)NC[C@H]1CCCO1)n1cc(Br)cn1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8878", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CC[NH2+][C@H](c1cccc(C(F)(F)F)c1)C1CC1)N1CCCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14647", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)[NH+](C)C[C@H]1CN(C(=O)c2ccccc2)C[C@@H]1c1cccc(F)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241441", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2cc(CNC(=O)[C@H](C)NS(=O)(=O)c3cccc(Cl)c3)ccc2c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50922", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccccc1/C([O-])=N/c1nnc(CC(=O)N/N=C/c2cc(Br)ccc2O)s1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62924", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOc1cc(C(=O)Nc2ccc(C)c(Cl)c2)ccc1OC with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CN(/N=C\\c2ncc(-c3ccc(Br)cc3)o2)C(=O)N1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159482", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(-c2noc([C@H](C)[NH+]3CC[C@H](C(N)=O)C3)n2)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59704", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)[C@H](c1ccc(OC)cc1)[C@@H]1C=C[C@@H](NC(=O)c2ccccc2Cl)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42253", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1916", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Br)ccc1N[C@H]1CCOC2(CCC2)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38758", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)/C(C#N)=C/c1c(-c2ccccc2)nc2ccccn12 by substituting a nitrile with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123135", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](CNC(=O)N[C@H](C)c1ccc(F)c(F)c1)C[NH+]1CCCC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175336", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)(F)c1nnc2ccc(NCCc3ccccn3)nn12 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219451", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCn1c(SCC(=O)Nc2cc(Cl)ccc2Cl)nnc1-c1ccncc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109030", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nnnn1-c1ccc(C(=O)NCCc2cccc(F)c2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166755", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(COCc1ccccc1)Nc1cc(Br)cc(Cl)c1O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59171", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1CCCC[C@H]1NC(=O)CSc1ccc(Cl)cc1N by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216566", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCn1c(C)cc(/C=C(/C#N)C(=O)N2CCCC[C@@H]2C)c1C by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114307", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)[C@@H](C(=O)N1CCCN(CC(F)(F)F)CC1)c1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109424", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CCCCN1C(=O)[C@@H]1CCC(=O)N(C)[C@@H]1c1ccccc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213805", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)[C@@H]1CN(C(=O)[C@@H]2CCC[NH+]2Cc2ccc(F)cc2)CCO1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213350", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN1CCC[C@](O)(CN2CCN(c3nc(C)cc(C)n3)CC2)C1=O by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26801", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CO[C@@H](C(=O)N/N=C(\\C)c1ccc(O)cc1)c1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8604", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1CCC[NH+]1CC(=O)Nc1cccc(OC(F)F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67937", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@](O)(CC(=O)NC[C@@H]1COc2ccccc2O1)C(F)(F)F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77914", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cccc(=O)n1CCC(=O)N1CC[C@](C)(O)[C@H](C)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93137", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(N[C@@H]1CCCc2ccc(F)cc21)N1CCC[C@@H]1c1ccc[nH]1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197408", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1c(=O)[nH]c(=O)c2c1nc(N1CCN(Cc3ccccc3)CC1)n2Cc1ccc(Cl)c(Cl)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107017", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1ccn(-c2ccc(NCCc3cccc(O)c3)nn2)n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50287", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(c1ccco1)[C@@H]1[C@@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59679", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](CCn1cncn1)[NH2+][C@@H]1CCCN(CC(F)(F)F)C1=O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30656", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCC[C@H](C(=O)N[C@@H](C)c2cc(F)ccc2N2CCC(O)CC2)C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220301", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(-c2nc3ccc(Br)cc3c(=O)[nH]2)oc2ccccc12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H](C)N1CC[NH+](C)CC1)c1ccc(-c2ccc(F)cc2)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23817", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCCCOc1nc(Cl)nc(OCC)n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144482", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)NNC(=O)[C@@H]1CCCO1)c1ccc(Cl)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188089", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule ClCCc1nc2cc(Br)cnc2n1CC1CCCCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137718", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccncc1NC(=O)N1CC=C(c2ccccc2Cl)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149650", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Clc1ccc2[nH]c3c(N4CC[NH+](Cc5ccccc5)CC4)ncnc3c2c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14628", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc2[nH]cc(CC(=O)NCc3ccc(F)c(Cl)c3)c2c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43673", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH2+][C@@H](C)c1cc(F)ccc1-n1cc[nH+]c1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139452", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C(=O)NCCN(C)Cc1cc(F)cc(C(F)(F)F)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172278", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC(=O)N[C@@H]1CCCN(C(=O)c2cc3cccc(Cl)c3o2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223349", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Br)c([C@H](O)c2cc(C)cc(F)c2)cc1OC by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8117", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)NC(=O)COC(=O)[C@H](C)NC(=O)c1cccc(Cl)c1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214408", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCN(Cc1cccc(F)c1)C(=O)[C@H]1CCC(=O)O1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233676", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule COC(=O)[C@@H](CNC(=O)c1sccc1C#N)Oc1ccc(F)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127713", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C=C(C)COc1ccccc1NC(=O)c1ccc(Cl)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115572", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#C/C(C(=O)CCl)=C(/c1ccc(F)cc1)N1CCCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119835", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2177", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H](CCn1cncn1)[NH2+]C[C@H](O)c1ccccc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78097", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(F)c(NC(=O)NCCC[NH+]2CCC(C)CC2)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67500", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc(C[NH+](Cc2c(F)cccc2N2CCCC2)C(C)(C)C)o1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118526", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1ccc2nc(N3CC[C@H](c4ccccc4)C3)ccc2c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215298", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(c1cc2c(cc1O)OCO2)N1CCC[C@@H]1c1ccco1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158968", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@]1(C(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)CCCc2ccccc21 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64049", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1C by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19340", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CNS(=O)(=O)c1ccc(NCC(C)(C)C[C@@H](C)O)nc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211820", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@@H]1CCN(C(=O)c2cc([N+](=O)[O-])cc(S(C)(=O)=O)c2)c2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123920", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(C(=O)N(C)CCS(C)(=O)=O)c(C)n1-c1cccc(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120559", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule [NH3+][C@H](C(=O)[O-])c1cc(F)c(Cl)c(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77269", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1ccccc1N1CCN(Cc2nnc(-c3ccccc3Br)o2)CC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8946", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H](c1ccc(F)cc1)N1CCOCC1)Nc1cn[nH]c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33644", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(Cc1ccccc1Br)C(=O)CN1CSCC1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221116", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1ccccc1CSC1=N[C@H]2[NH+]=c3ccccc3=C2N=N1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152192", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1ccc(OC(F)F)cc1)C(=O)Cc1nn(C)c(=O)c2ccccc12 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117654", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([C@@H](C)Nc2snc(C)c2C#N)c(C)s1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231860", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CSC[C@@H](CCO)[NH2+][C@@H]1CCc2[nH]c3ccccc3c2C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141238", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH2+][C@H](c1ccc(Br)o1)[C@H]1CCS(=O)(=O)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102004", "split": "OpenMolInst" } }, { "instruction": "Please substitute a thiol in the molecule C[NH+](Cc1cccc(C#N)c1)CC1(CS)CCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51617", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)CNC(=O)c2ccc(C)o2)cc1Cl by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45291", "split": "OpenMolInst" } }, { "instruction": "Substitute a aldehyde in the molecule Cc1cc(O)c(CC=O)c(O)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135730", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)C1=C(C)N(Cc2ccco2)C(=O)/C1=C/c1ccc(Cl)c(Cl)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65800", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCC[C@H]1CN(C(=O)c2cc3cccc(Cl)c3o2)CCO1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208718", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(NC(=S)N2CCn3cccc3[C@@H]2c2ccccc2F)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173597", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCC(=O)Nc1sc(C(=O)Nc2cccc(Cl)c2)c(C)c1C(=O)OC by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224387", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(/C=C2\\SC(=O)NC2=O)ccc1OCc1ccccc1Cl by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43784", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule OCc1ccc(OC[C@@H]2C[C@H]3CC[C@@H]2C3)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146350", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COc1ccc(OC)c([C@@H]2c3c(nc(N4CCC(C)CC4)[nH]c3=O)NC(=O)[C@@H]2C#N)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81165", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(N(C)C(=O)C2=CCCCO2)cc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46393", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N[C@]2(C[C@H]3CC[C@@H]2C[C@@H]3C(=O)N2CC[C@]3(O)CCCC[C@@H]3C2)Oc2ccccc21 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201866", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCn1nnnc1-c1cccc(C(=O)N2CCN(Cc3ccccc3F)CC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133285", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)OCC[NH+]1CCN(Cc2c[nH]nc2-c2c(F)cccc2F)CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230734", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(-n2nnnc2SCc2ccccc2Cl)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38734", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1nc(CC(=O)N2CCCC2)cs1)c1ccc(Cl)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39016", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](CC(=O)Nc1cccc(Cl)c1)[NH2+]C[C@@]1(O)CCc2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161740", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc2ncn(C(=O)[C@H]3CC(=O)N(c4ccc(C)c(Cl)c4)C3)c2cc1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25315", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1ccc(F)cc1)N[C@H](c1ccccc1)c1ccccn1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9545", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(C)NC(=O)c1cccc(NC(=O)CNc2ccc(F)cc2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9895", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1ccc(CNC(=O)/C(C#N)=C\\c2ccc(C)o2)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166420", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCC[C@@H](NC(=O)C(=O)Nc1ccc2c(c1)COC2)c1ccc(F)cc1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62910", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1cnc(S[C@@H](C)C(=O)Nc2cc(Cl)ccc2C)nc1N by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198785", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[S@](=O)[C@H]1CCC[C@H](NC(=O)C[C@H](O)c2ccc(Cl)cc2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCCN(c2ccc(C#N)c([N+](=O)[O-])c2)CC1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222805", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COC(=O)/C=C/C[C@@](C#N)(c1ccccc1)c1ccccc1C#N by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94905", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H](C)C[NH2+]CCC(=O)Nc1cccc(Cl)c1C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52105", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1cccc(OC[C@H](O)CNC(=O)c2sccc2-c2ccccc2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247199", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(Cc1ccccc1)S(=O)(=O)c1cc(C(=O)Nc2ccc(Br)cc2)ccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232970", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H](CC)n1c(CCCl)nc2c(OC)ncnc21 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233344", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCN1C(=O)Cc1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49252", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCCc1ccc(NC(=O)[C@H](C)NS(=O)(=O)c2ccccc2F)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186293", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(NCC(=O)N2CCC[C@@H](C(N)=O)C2)c(F)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246170", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C([O-])[C@@H]([C@H](O)c1ccccc1)n1nnc2ccccc21 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73729", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc2nc(C(F)(F)F)c(=O)n(CC(=O)Nc3ccccc3C)c2cc1C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68733", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@]1(CO)CCC[C@H]1NC(=O)NCc1ccc2c(c1)OCO2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157202", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C1N[C@]2(COC3(CCN(C(=O)Cc4ccccc4Cl)CC3)C2)Nc2ccccc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111001", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Sc1nnc(-c2ccc(C(C)(C)C)cc2)n1N)C(=O)Nc1ccc([N+](=O)[O-])cc1 by replacing a nitro by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1/c(=N/C(=O)Cc2ccc3c(c2)OCO3)sc2cccc(Cl)c21 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78895", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CNC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc(O)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40150", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](C#N)CC(=O)c1cccnc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159396", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cccc([C@@]2(C)NC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123703", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=Cc1cn2c(nc3ccccc32)s1 by replacing a aldehyde by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241856", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nn(CN2CCN(c3ccccc3F)CC2)c(C)c1[N+](=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189924", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN1C(=O)c2ccccc2C(=O)[C@@]2(C)CN(Cc3ccccc3Cl)C[C@@H]12 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71187", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1csc([C@@H](C)NCc2ccc([N+](=O)[O-])c(F)c2)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77481", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@@H]([C@@H](C)NC(=O)CN(C)c1ccccc1[N+](=O)[O-])N1CCOCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209533", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule Cc1cc(=O)n2c3ccccc3n(C[C@@H](O)CNc3ccc(C(C)C)cc3)c2c1C#N with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173342", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)NC(C)(C)c1ccc(Br)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123629", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1sc2nc(S[C@H](C)C(=O)Nc3ccccc3[N+](=O)[O-])n(C)c(=O)c2c1C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242096", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Oc1cccnc1C(=O)N[C@H]1CCC[C@@H](C(F)(F)F)C1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2978", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(Cc1ccccc1)C(=O)Nc1ccc(N2CCCC2)c(F)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40301", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)OC(=O)N1CCC([NH2+][C@H](C)c2cccc(C(F)(F)F)c2)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37756", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCOC(=O)C1=C(C)Nc2nc(-c3ccc(Cl)cc3)nn2[C@H]1c1ccc(O)c(OC)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199534", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@H](c1cc(F)cc(F)c1)C1([NH+]2CCCCC2)CCCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36171", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C(=O)Nc2ccc(C(F)(F)F)nc2)cnn1C(C)C by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16569", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(c1ccc2cccc(F)c2n1)N1CCC[C@@H]1CO with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239319", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CS(=O)(=O)[N-]c1ccc(CNc2ccc(C#N)cn2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81581", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H]1C(=O)NC(=O)C[C@H]1c1ccc(OC)c(Cl)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213606", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COCCN1C(=O)C(C#N)=C(C)/C(=C\\Nc2ccc(C)c([N+](=O)[O-])c2)C1=O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5106", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(N2CC[NH+](CC[C@H](C)NS(=O)(=O)c3ccc(F)cc3)CC2)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181157", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC/[NH+]=C(/NCCSc1ccccc1F)N1CCC(O)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232938", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C1C(Br)=C(Br)C(=O)c2cc(Cl)ccc21 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238686", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(CS(=O)(=O)CCCc1ccccc1)Nc1ccccc1O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32026", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)(C)OC(=O)N1CC[C@H](C(=O)NC2(c3cccc(F)c3)CC2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68747", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule COCCn1c([O-])c(C(=O)COc2c(C)cccc2C)c(C)c(C#N)c1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10220", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC[C@H](C)N(C)c1cc(C)c(F)cc1[C@H](C)[NH3+] by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112253", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCc1ccc(C(=O)NNc2c(Cl)cncc2Cl)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237441", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](Cc1cccc(Cl)c1)NC(=O)c1ccncc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155539", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@](O)(CNC(=O)COc1ccccc1Cl)c1ccc(F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4986", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(NC(=O)[C@H]2CCCN2C(=O)c2ccc(Cl)c(Cl)c2)n1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224202", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(N(CCC(N)=O)Cc2ccc(Cl)s2)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138687", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccccc1N(C)S(=O)(=O)c1ccc(C(F)(F)F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182952", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nccc1[C@H]([NH3+])CSc1ccccc1Cl by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45487", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccc2ccccc2c1)Nc1cnn(Cc2ccc(Cl)cc2)c1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50749", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1ccc(OC[C@@H](O)CN2CCN(C(=O)[C@@H]3CCCO3)CC2)c(C)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226581", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#CCSc1cccc(C(=O)NNc2ccc(-c3ccccc3)nn2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214480", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)N[C@H](C#N)c1ccc(Cl)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159171", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH3+])C(=O)N[C@@H](C)C(=O)Nc1ccc([N+](=O)[O-])cc1 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205523", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=c2ccccc2=[NH+]C(=O)[C@@H]1Sc1nnc(-c2ccccc2Br)o1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217727", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@H](NC(=O)c1n[nH]c2ccccc12)c1cccc(Cl)c1Cl by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136213", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(C(=O)c1ccc(F)c(F)c1F)c1ccncc1N by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48869", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC(=O)c1c(C)[nH]c(C(=O)N2CCN(Cc3ccc(C#N)cc3)CC2)c1C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](Cc1ccccc1)C[C@@H](C)CS by substituting a thiol with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173109", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=Cc1cccc(OCc2cccc3ccccc23)c1 by substituting a aldehyde with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217086", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCO/C=N/C1=C(C#N)[C@@H](c2ccccc2)c2c(C)nn(-c3ccccc3)c2O1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56353", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(CC1(O)CCCCC1)N1CC[C@@H](c2nnc(-c3cnccn3)o2)C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33821", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)C(=O)NCCCN(C)c2ccccc2F)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14812", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(Cl)cc1NC(=O)[C@H]1CCCN(c2ccc(-c3cccs3)nn2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19958", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1ccc2cc(S(=O)(=O)N3CCC[C@@H](C(=O)NCc4cccc(F)c4)C3)ccc21 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29608", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COc1ccc([C@H]2CCCN2C[C@H](C#N)CCC#N)c(OC)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204143", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC1CC[NH+](C)CC1)[C@@H](C[NH3+])c1cc(Cl)cs1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4641", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COc1ccc(/C([O-])=C(\\C#N)C(=O)Nc2ccccc2OC)c(C)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118807", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](Cc1ccc(Cl)cc1)Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66752", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1c2cc(Cl)cc(Cl)c2ncn1Cc1cc(-c2ccccc2)on1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106892", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc([C@H]2C(N)=NC(=O)N2CC(C)C)cc1Br with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167153", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH+](C)CCn1ccc(NC(=O)Cc2c(F)cccc2F)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247921", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H](C)NC(=O)[C@@H](C)NC(=O)c1nn(-c2ccc(F)cc2)cc1[O-] with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168102", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[NH2+]C[C@H](Cc1nc(C)cs1)c1ccc(Cl)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26736", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Clc1cccc(CNCCc2c[nH]c3ccccc23)c1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132279", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)C1(c2ccc(Cl)cc2)CCCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238221", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(Cl)cccc1-n1c(SCC(=O)c2ccc(Cl)cc2)nc2[nH]ncc2c1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16766", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@H]1C[C@@H](C)CN(c2ccc(C(=O)NC[C@@H]3COCCO3)cc2[N+](=O)[O-])C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57031", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=c1[nH]nc(CCNc2ccc3cc(Br)ccc3n2)[nH]1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141391", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC[C@H](NC(=O)Nc1c(C)ccn(C)c1=O)c1ccc(F)c(F)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183244", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)C(C)(C)CNc1ccccc1SC(F)F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60376", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)Nc2cnn(Cc3ccc(Cl)cc3)c2)cc1OC by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147862", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Sc1ccccc1C(=O)NNc1cc(C#N)cc(Cl)n1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24082", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)C(C)(C)NC(=O)[C@@H](C)NC(=O)c1ccc(Br)s1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122573", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCCN(C(=O)c1csc(-c2ccc(Cl)cc2)n1)C1CCCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105562", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=S(=O)(CCc1ccccc1)[N-]c1cc(Br)ccc1N1CCOCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201968", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc([C@@H](C)NC[C@@H](O)c2cccc(OC(F)F)c2)cc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242825", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(CC[C@H]([NH3+])Cc2ccc(F)cc2F)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65462", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1noc(C)c1C[C@H](C)N[C@H](C)c1nc2cc(Cl)ccc2n1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109794", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COc1ccc(/C=C(/C#N)C(=O)NCCc2nc3ccccc3s2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166835", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CS(=O)(=O)c1cccc(NCCc2ccc(F)cc2)c1[N+](=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58683", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCOc1ccc(NC(=O)N2CC(=O)N3CCc4c(F)cccc4[C@@H]3C2)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38776", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)CN(C)c1ccc(F)cc1[N+](=O)[O-] by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151065", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCC(=O)N1N=C(c2ccc(Br)cc2)C[C@@H]1c1ccccc1O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21955", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C(=O)N(C)C)ccc1NC(=O)NNc1ccc(F)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100138", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Nc1c(Cl)cc(NC(=O)CCn2c(=O)oc3ccccc32)cc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47137", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NC(=S)Nc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1)c1ccco1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62688", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(CC2CC[NH2+]CC2)nc2c(F)cccc21 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92196", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1ccccc1Cl)C(=O)N(C)Cc1ccc(Cl)nc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169401", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H](Oc1ccc(F)cc1Br)C(=O)NCC(C)(C)O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90261", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CCCO1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69954", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@@H](Nc2ccc(Cl)c(Cl)c2)C1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31469", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(C)C(=O)N[C@@H](N1CCCCC1)C(Cl)(Cl)Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56179", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn2c(=O)c(NC(=O)c3ccc(Cl)cc3)cnc2s1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111018", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NO)/C(CC(=O)c1ccc(O)cc1)=N/O by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88566", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C(Cn1cc([N+](=O)[O-])ccc1=O)c1ccc2c(c1)OCO2 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125847", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOC(=O)c1coc(NC(=O)NCc2ccc(F)cc2)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41176", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([N+](=O)[O-])cc1CSc1nnc(Cc2csc(C)n2)o1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69727", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(NC(=O)NCCNc2ncccc2C(F)(F)F)c1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178527", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCCCn1ccc([C@H](O)C(C)C)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210928", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Nc1ccc(SCC(=O)NC(=O)c2ccccc2Cl)cn1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153226", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CCCn1sc2ccccc2c1=O)NCc1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93014", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCn1c(SCC(=O)Nc2ccccc2F)nnc1[C@H]1CCCN1C(=O)c1ccccc1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197771", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ccnc(NC(=O)CCc2ccc(Br)cc2)c1=O by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195261", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC[C@H](C#N)OC(=O)c1csc(-c2cnn(-c3ccccc3)c2)n1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218426", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CCN(Cc1ccoc1)C(=O)N[C@H](C)c1cccc([N+](=O)[O-])c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220149", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(-c2nnc(NC(=O)c3ccc(F)cc3)o2)cc1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173804", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3198", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CSc1nc([O-])c(C(=O)Nc2ccc3nc(C4CCC4)[nH]c3c2)cc1C#N with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246443", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccsc1C(=O)NC[C@@H](CCO)c1ccccc1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102868", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCN(C[C@H](C)C(=O)OC)C(=O)c1ncccc1C(F)(F)F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107192", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(OCCCC(F)(F)F)c1ncn(-c2ccccc2)n1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111461", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#CCCN(CC1=NS(=O)(=O)c2ccccc2N1)CC1CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50623", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1cccc(COc2cccc(NC(=O)C3=NO[C@@H](c4ccccc4)C3)c2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172109", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(C)c1-n1ccn(Cc2nc(-c3cccc(F)c3)no2)c(=O)c1=O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33845", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@H](CNc1ncnc2sc3c(c12)CCNC3)c1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3054", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1nnc(SCC(=O)N2CCCCC2)s1)c1ccccc1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175696", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cccc(CCNCc2c(F)cccc2F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104540", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[NH2+][C@H]1C[C@@H](C)C[C@H](C)[C@@H]1C[NH+](CC)CC(C)(C)O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80705", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc([C@H]2OCC[C@H]2CCl)c(Cl)c1OC with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144987", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CN(C[C@H](O)COc2ccccc2F)C(C)(C)CO1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164307", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCS(=O)(=O)NCCc1cc(F)ccc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147222", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nn(-c2ccccc2)c(NC(=O)c2ccco2)c(-c2ccccc2Cl)c1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186941", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH+](C)[C@H](CNC(=O)CCc1nc2ccccc2s1)c1cccc(F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25322", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccn1)c1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1 by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162956", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cccc(-c2nc3cnccn3c2NCc2cccs2)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179040", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCOc1ccccc1/C=C/C(=O)NC[C@@](C)(O)c1ccc(C)o1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145434", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CNC(=O)NC(=O)COc1ccc(C)cc1[N+](=O)[O-] by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66023", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H]1N(C(=O)C(F)(F)F)CCN1S(=O)(=O)c1ccccc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124462", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@H]1CCCN(C(=O)Cn2c(=O)n(-c3cc(F)cc(F)c3)c(=O)c3sccc32)C1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119982", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NCCc1cccs1)NC[C@H](O)c1ccc(Cl)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75267", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1cccc2c1OCC[C@@H]2[NH2+]CC1(CO)CCOCC1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31636", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc([C@@H](C)NC(=O)[C@H](Oc2cccc(Cl)c2)C(C)C)n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193698", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(Cl)cc1C[NH3+] by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187162", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule N#Cc1ccccc1-c1ccc(CNC(=O)NC[C@@H]2CCC[C@@H]2O)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205496", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1onc(-c2ccccc2)c1C(=O)Nc1nnc(C(F)(F)F)s1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183563", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H](C)C[C@H]([NH3+])c1ncc(Cl)cc1Cl by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN(Cc1cccnc1)C(=O)c1cnn(-c2ccc(F)cc2)n1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158912", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(-n2nc(SCC(=O)Nc3ccc(Cl)cc3F)ccc2=O)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5914", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cc(OC)cc(C(=O)Nc2ccc(-c3nc4cnccc4o3)c(O)c2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167994", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Brc1cn2c(C[NH2+]C[C@@H]3CCCCO3)cnc2cn1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC1=[NH+]CC2(CCC(C(F)(F)F)CC2)N1c1ccccc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21649", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)CN(C)c1ccc(C(F)(F)F)cc1C#N by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28770", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+]C[C@@H](O)COc1ccccc1Br)c1cnn(C)c1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179940", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(/C(C#N)=C/c2ccc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)o2)nc2ccccc21 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56649", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NNc1ccc(Cl)c(CSC2COC2)n1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203033", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCN1CCO[C@H]([C@H]([NH2+]C)c2ccc(F)c(F)c2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39443", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)c1c(C(=O)N2CCN(c3ncccn3)CC2)cnn1-c1cccc(Cl)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226403", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(CCBr)c1ccc(F)c(F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226101", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CC[NH3+])NC(=O)c1cc(C(F)(F)F)ccc1F by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226743", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(CC(F)(F)F)C(=O)CNC(=O)C(=O)Nc1ccc(CC#N)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131082", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule NC(=O)[C@@H]1CN(Cc2ccc(F)cc2C(F)(F)F)CCO1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1F)c1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56280", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[C@](C)(CCO)NC(=O)Nc1cc(COC)ncn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101464", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCC(F)(F)F)N[C@H]1CCN(C(=O)CCc2ccccc2)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21293", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)c1c(C)[nH]c(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5716", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)N[C@@H]1CCS(=O)(=O)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119322", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)c1cccc(NC(=O)[C@@H](C)[NH+](C)CC(=O)Nc2ccc(Cl)c(Cl)c2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116257", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cccc(NC2CCN(C(=O)CC3(O)CCCC3)CC2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO[C@H](c1ccc(Cl)cc1)[C@H](C)NC(=O)N1CCOC[C@@H]1C by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109601", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](C[C@H](O)c1ccc(C)cc1)C1C[C@H](C)O[C@H](C)C1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93497", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)(C)Cc1noc2ncc(C(=O)N[C@H]3CCC[C@H](C(F)(F)F)C3)cc12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217026", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1cccnc1O[C@@H]1CCC[NH2+]C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200275", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CN(C(=O)c1c(O)cc(F)cc1F)C1CCN(c2cccc(F)c2)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164075", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[NH+]1CCC[C@@H]([C@@H](C)Nc2cccc(C(F)(F)F)c2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130837", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1cnc(CNC(=O)C(=O)Nc2ccc(-n3cccn3)c(Cl)c2)n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213677", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(N[C@H](C(=O)[O-])C1CC1)c1ccncc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30932", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nncn1CCNC(=O)C1(c2ccc(F)cc2F)CCCC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91583", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@@H](CO)N1CC[NH+](Cc2coc(-c3cccs3)n2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185055", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccncc1N1CCC(Nc2ccc(F)cc2)CC1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185481", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCCS(=O)(=O)N1CCSCC1)c1cc2ccccc2n1Cc1ccccc1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168786", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(Cc1cccc(F)c1)C(=O)CCCn1ccnn1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119581", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N/N=C/c1cccc(Cl)c1)c1ccc(CN2CCc3ccccc3C2)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20336", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(=O)N(CCC(=O)NC[C@]1(O)CCSC1)Cc1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45204", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CSc1ncc(C(=O)NC2CCCC2)c(Cl)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202216", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccc(NC(=O)c2ccncc2Cl)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170727", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nc(Cc2ccc(F)cc2)sc1C(=O)NNC(=O)C[NH+](C)C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@H]1CCCN(C(=O)C[NH+](C)Cc2cccc(F)c2Cl)C1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171969", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(OCCNC(=O)c2c[nH]nc2-c2ccc(F)cc2)cc1 by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202235", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(F)c(NC(=O)C(=O)NCc2cc(C#N)ccc2F)c1 by substituting a nitrile with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162420", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1cc(CNC(=O)[C@H]2C[C@@H]2c2ccccc2Cl)on1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169637", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCc2c(sc3ncn(CCCO)c(=O)c23)C1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64482", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1cc(-c2ccc(Br)cc2)nc2ccccc12 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82436", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CS(=O)(=O)N[C@H](CCO)c1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164542", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2nc(CSCC(=O)NCCc3ccccc3F)cn2c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196638", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(I)ccc1NC(=O)C[NH+](C)[C@@H]1CCc2ccccc21 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218038", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(CNC(=O)CS(=O)(=O)Cc2ncoc2C(C)C)ccc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211001", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CCO)C[NH2+][C@@H](C)c1ccc(Br)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197624", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39806", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CC1(C)c2ccccc2N2CC(=O)N[C@@]21/C=C/c1ccc([N+](=O)[O-])cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120054", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCN(CCC#N)CC(=O)N1CCO[C@@H](c2ccc(F)cc2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216153", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=c1ccc(C(F)(F)F)cn1Cc1coc(-c2ccccc2)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62131", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)C[NH+]2CCCN(Cc3cccc(Cl)c3)S2(=O)=O)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187810", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC1=CC[C@@H]2[C@@](C)(CCC[C@@]2(C)C(=O)[O-])[C@@H]1C[C@]12O[C@H]1[C@@H](O)C(CO)=C[C@H]2O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215014", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Nc1ccc(SCc2nc(-c3ccco3)no2)cc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139022", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc2nc(Cl)c([C@@H]3CC(c4cccc(OC)c4)=NN3C(C)=O)cc2c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127070", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccc(-c2nnc3n2CCCCC3)cc1)c1ccccc1C(F)(F)F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120809", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1cccc(CS(=O)(=O)N2CCC(OC[C@@H]3CCCO3)CC2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42564", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)/C=C/c1ccc(-c2ccccc2Cl)s1)c1ccccn1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46877", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC[C@@H](C)[NH+]1CCN(Cc2ccc(Cl)s2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52603", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cc[n+](/C(C(=O)c2ccc(F)c(F)c2)=C(/[S-])NC)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153177", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COc1ccc([N+](=O)[O-])cc1N/C([O-])=N/S(=O)(=O)c1ccc(C)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163251", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Nc1scc[n+]1Cc1cccc(F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20433", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H](C)C(=O)N1CCC[C@H](C(=O)Nc2cc(F)ccc2Cl)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45043", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule S=c1[nH]cc(-c2ccc(Cl)c(Cl)c2)n1-c1ccccc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cccc(C#N)c1)C(=O)N[C@@H]1CCCc2c1cnn2C by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168550", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)CN2CCCCCCC2=O)c(C(F)(F)F)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79874", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(Cl)cc1)N1CCN(C(=O)Cc2ccc[nH]2)CC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95847", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Cc1ccccc1F)Nc1ccc2c(c1)CN(C(=O)[C@@H]1C[NH2+]CCO1)CC2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97917", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CCCO)Nc1ccc(C#N)c(N)c1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185506", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H](O)[C@@H]1CCCC[NH+]1Cc1ccccc1OCc1cccnc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13772", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C([O-])C1=Nc2nc3ccccc3n2[C@@H](c2cccc([N+](=O)[O-])c2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162650", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(Cl)sc1C(=O)N1CCC[C@H]([NH+](C)C)C1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167761", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[NH2+]C[C@@H](CC1CCOCC1)c1cccc(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89674", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1ccc(NC(=O)c2cnc(Cl)c(Cl)c2)s1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99261", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH+]1[C@H]2CC[C@@H]1CN(S(=O)(=O)c1cc(Cl)sc1Cl)CC2 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103897", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](COc1ccc(F)cc1)NC(=O)[C@@H]1CCCN1c1ncccn1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69721", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)[C@H](C)Sc2nnnn2-c2ccc(Cl)cc2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139718", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(Cc1ccccc1F)C(=O)COC(=O)c1c[nH]c2ccccc12 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28787", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@](NC(=O)CSCc1cccs1)(C(=O)[O-])C(F)(F)F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107751", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)n1cc(CCCC(=O)N2CCn3c(nnc3C(F)(F)F)C2)c2ccccc21 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133695", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CO[C@H](C)[C@H](O)c1cc(F)ccc1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37948", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H](C)NC(=O)Nc2cc(Cl)ccc2F)cc1F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248229", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCCSCC(=O)NC[C@H](O)c1c(Cl)cccc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124864", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H](O)CC(C)(C)CNC(=O)CC1(O)CCCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175471", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCC[C@@H](C)Nc1nc(Cl)ncc1Cl by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184946", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOC(=O)C[C@@H]1CCCCN1S(=O)(=O)c1c(C)nn(C)c1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75686", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@H](NC(=O)C(=O)c1c(C)nn(-c2ccccc2)c1C)c1ccc(Cl)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122778", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1ccc([C@@H](O)CNc2cnc3ccccc3n2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196310", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOC(=O)c1c(NC(=O)C=Cc2ccccc2Cl)sc2c1CC[NH+](CC)C2 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73791", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CCn1c(S[C@H](C)C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)nc2ccc(Br)cc2c1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78408", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(C(=O)c2ccccc2)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48320", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1noc(C)c1S(=O)(=O)[N-]c1ccc(N2CCOCC2)c(F)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30398", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(c1ccccc1)N1C[C@H]2[C@@H](C1)OC(=O)N2CCc1cccc(Cl)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112766", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1cc(Cl)c([C@H](Cl)[C@@H]2CCO[C@@H]2C)cc1OCC with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94486", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)c1ccc(Cn2c(C=O)nc3ccccc32)cc1 by substituting a aldehyde with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139897", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@H](C[C@H]1CCCO1)[NH2+][C@H](CO)CC(C)(C)C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71806", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCC(C)(C)[C@H]1CCc2c(sc(NC(=O)c3ccoc3C)c2C#N)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147968", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Fc1ccc(/C=N/Nc2cnccn2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225157", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cccc([C@@H](CO)NC(=O)c2cnn(C(C)(C)C)c2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111630", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(C)c1OCC(=O)Nc1ccc(N)cc1Br by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58567", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(C[C@H]1CCCO1)c1ccccc1Cl by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96679", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1cccc(NC(=O)c2cccc(Br)c2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40697", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](Cn1cccn1)Nc1cc(Cl)c(Cl)cc1N with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79919", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1sc(-c2cc(C(F)(F)F)on2)cc1S(=O)(=O)N(C)Cc1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75161", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)c1cnn([C@H]2CCCN(C(=O)C(F)(F)c3ccccn3)C2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159048", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)c1cccc(Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110518", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1CCO[C@H](C[NH2+]CC2CC(Cl)C2)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17352", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Oc1ccc(C#N)cc1)C(=O)NNC(=O)CC1CCCCC1 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6682", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(/C=C(/C#N)c2nc(-c3ccc(CC(C)C)cc3)cs2)o1 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121807", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1C[C@H](C)CN(c2cccc(F)c2C(N)=S)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114916", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CS(=O)(=O)N[C@@H]1CC[NH+](Cc2ccc(F)c(C(F)(F)F)c2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141591", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1c2cnn(-c3ccc(Br)cc3)c2ncn1CCc1ccccc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150624", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1cc(Br)ccc1NS(=O)(=O)c1cccc(C#N)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82491", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCNC(=O)N1CCC[C@@H]1[C@H]1CCC[C@@H]1O by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81044", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1occc1-c1nnc(SCC(=O)Nc2sc3c(c2C#N)CCCCC3)n1C[C@H]1CCCO1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189732", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH2+][C@H](CCO)c1cccnc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92787", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccc([C@@H]2CSCCN2Cc2c(C)nn(CCO)c2C)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6707", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)n1nccc1NC(=O)[C@H]1CC(=O)N(c2ccc(Br)cc2)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239922", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(C[NH+]1CC=C(c2ccccc2)CC1)NCCc1ccc(F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78755", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(F)c(NC(=S)NNC(=O)[C@@H]2C[C@H]3CC[C@@H]2C3)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126055", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC1(CC)CC[NH+](Cc2ccc(OC)c(Br)c2)C1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70811", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(S[C@H]1CS(=O)(=O)C[C@@H]1Cl)c1ccc([N+](=O)[O-])cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13330", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@H](Cc1cccc(F)c1)[C@H]1CSCCO1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70613", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)CNS(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1C by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36403", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCC[NH2+][C@@H](Cc1ncccc1C)c1ccc(Cl)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15905", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C(CSc1nnc(-c2cccnc2)o1)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210917", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@H](C(=O)OCC)[C@H]1c1ccc(Cl)cc1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7035", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(Br)cc1[C@@H]([NH3+])c1ccc(OC)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128220", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CC[C@H](C(=O)N(CC(F)(F)F)C2CCOCC2)N1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14351", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC1CCCC1)S(=O)(=O)c1cccc(F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218771", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@@H](Cc1ccsc1)NC(=O)N[C@@](C)(CO)C1CCCCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191727", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)Nc2ccc(C)c(S(C)(=O)=O)c2)cc1F by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154253", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CC(=O)Nc1ccc(F)cc1)[NH2+]C[C@@H]1CCN(S(C)(=O)=O)C1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138925", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H](NC(=O)Cc1ccc(NC(=O)C2CC2)cc1)c1ccc(C)c(F)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165384", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H]1CN(Cc2cc(F)cc(C#CC[NH3+])c2)CC[NH+]1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27665", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)[C@H](C(=O)N(C)CC(=O)Nc1cccc(Cl)c1)N1CCCC1=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242302", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1S/C(=C\\c2cccc([N+](=O)[O-])c2)C(=O)N1c1cccc(Cl)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219217", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](Cl)c1nc2cccc(Cl)c2n1C[C@@H]1CN(C)CCO1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116417", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)c1nn(-c2cccc(C(F)(F)F)c2)c(=O)nc1[O-] with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23017", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1nc(N2CCCCCC2)nc(Nc2ccccc2F)c1[N+](=O)[O-] by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228153", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)Cc1cc(C(=O)N[C@@H](CO)C(N)=O)n(C)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222261", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCNC(=O)NC[C@@H](OC)c1cccc(Cl)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7575", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)C(=O)Nc2ccc(Br)cc2F)C1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142478", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(C)C(=O)N1CCN(Cc2cc(Cl)c3c(c2)OCCO3)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248983", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@@](CNC(=O)c2cccc(SCC#N)c2)([NH+](C)C)C1 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10893", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H](NC(=O)CCc1ccccc1)c1nc(-c2ccc(F)cc2)no1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(c1)CCC[C@H]2[NH2+][C@@H](CO)c1cnn(C)c1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164902", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CO[C@H](C)C(=O)Oc1ccc(Br)cc1Br with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10714", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(c1)-c1cc(C)nn1[C@@H](c1ccc(O)cc1)N2 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56037", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CSc1cccc(Br)c1)c1ccc2c(c1)CCO2 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209571", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C[NH+]2CC[C@@H](NC(=O)c3ccc(C=O)cc3)C2)cc(OC)c1 by substituting a aldehyde with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62237", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)[C@@H]1CCC[NH+](CCCNC(=O)C(F)(F)F)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88685", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CNC(=O)[C@@H]1C[C@H]([NH3+])CN1C(=O)c1ccc(C(F)(F)F)nc1[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112857", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule ClCC/C=C/Cc1csc2ccccc12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94881", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1cnn(-c2ccc(Cl)nn2)c1N by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55900", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)C(C)(C)C)cc1NC(=O)CSCC(F)(F)F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133003", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCN(C(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)C[C@@H]1O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69394", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)[C@H](CO)NC(=O)CCOc1cccc(N)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161085", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=[N+]([O-])c1ccc(N2CCN(c3ccccc3Cl)CC2)c(S(=O)(=O)N2CCCC2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98435", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule OC[C@@H]1CCCC[NH+]1Cc1nc(-c2cccc(Cl)c2)no1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126593", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN(Cc1ccccn1)C(=O)Nc1ccc(F)cc1OC(F)F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154788", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H]1CN(C(=O)[C@H](C)NC(=O)c2ccccc2Cl)CCO1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36446", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccc2nc3n(c(=O)c2c1)CCCCC3)NCCc1ccc(F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26976", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(F)cc(NC(=O)N[C@@H]2COC[C@H]2C(=O)[O-])c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183404", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(CC1CCCCC1)NC[C@H](c1cccc(F)c1)N1CCOCC1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28589", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccc(-n2c(=S)[nH]c3cnccc32)c(F)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148853", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1cccc(C(=O)Nc2ccc(Cl)cc2)c1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204416", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC(C)c1cc(C(=O)Nc2ccc(Oc3ccc(C#N)cc3)cc2)n(C)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61461", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CC(=O)C2=C(C1)N[C@H]1N=NC(O)=C1[C@H]2C1[NH+]=c2ccccc2=[NH+]1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44410", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Nc1ccc2c(N[C@H]3CCN(c4ncccc4F)C3)ncnc2n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113743", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(OCC1CC1)c1ccc(Cn2cc(Br)cn2)o1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168152", "split": "OpenMolInst" } }, { "instruction": "Replace a thiol in the molecule CCCc1cc(=O)[nH]c(SC[C@H](CS)C(C)(C)C)n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232059", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Oc1ccc(C[NH+]2CCC[C@H]2C[C@@H](O)c2ccco2)c(O)c1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164455", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1c(C(=O)NCc2cc(-c3ccc(Cl)cc3)on2)cccc1[N+](=O)[O-] with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211822", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CCOc1ccc(NCc2ccc(O)c([N+](=O)[O-])c2)c(C)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124450", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(Cl)c(NC(=O)C(=O)N(C)Cc2ccc(Cl)cc2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195321", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1ncnc1C[C@H](O)[C@@](C)(CC)[NH+]1CCCC1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228700", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#C/C(=C/c1ccc(-n2cccn2)cc1)c1nc(-c2ccncc2)cs1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233155", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cc(F)c(C)c(NC(=O)c2ccccc2-c2cncnc2)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117006", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cnc(N2C(=O)[C@@H]3CC=CC[C@H]3C2=O)s1)Nc1ccc(F)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84197", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(c1cccc([N+](=O)[O-])c1)N(Cc1cccnc1)c1nc2ccc(Br)cc2s1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43769", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCC[NH+]1CCCCC1)c1cc(COc2c(F)cccc2F)on1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242526", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(OC)c(C2=NO[C@@H](C(=O)Nc3cnn(C45CC6CC(CC(C6)C4)C5)c3)C2)cc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233138", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cccc(CN2CCN(c3nc(C)ns3)CC2)c1O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83434", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CNC(=O)Nc2cnn(CC[NH+](C)C)c2)ccc1F by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45231", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C1CN(C(=O)COC(=O)/C=C/c2ccc(OC(F)F)cc2)c2ccccc2N1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54571", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)c1cccc(NC(=O)[C@@]2(C)CC2(Cl)Cl)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108751", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCOc1ccc(NC(=O)N[C@@H]2CCCC[C@@H]2CO)c(C(F)(F)F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224585", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)N(c1nc(CSc2nncn2C)cs1)c1c(C)cc(C)cc1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191333", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(OCC(=O)N2CC[NH+](Cc3ccccc3C(F)(F)F)CC2)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231473", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(C(=O)N2CCO[C@@H](c3cccc(OC(F)F)c3)C2)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122871", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=Cc1ccc(O[C@@H](NC(=O)c2ccco2)C(Cl)(Cl)Cl)cc1 by replacing a aldehyde by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1C(=O)c2ccc(-c3nc4cc(Cl)ccc4o3)cc2C1=O by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](CCNCc1cc(C#N)cs1)C1CCCC1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204459", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@@H]1CCN(c2ccc([N+](=O)[O-])c3cnccc23)C1 by substituting a nitro with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246058", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#CCN(CC(=O)Nc1ccc(C#N)c(Cl)c1)c1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116750", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@]1(C(=O)NCCc2nnc(-c3ccccc3)o2)CC1(Cl)Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125466", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(OCC(=O)NCc2cccc(Cl)c2)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18602", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)c1csc(NC(=O)[C@@H](C)Oc2ccccc2Cl)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151020", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)c1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CN4CCCC4=O)C3)noc2n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2nc(/C(C#N)=C/c3cc4ccccc4nc3Cl)nc([O-])c2c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174887", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCN(C)c1cccc(NC(=O)N[C@H](CO)c2ccc(Cl)c(F)c2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15304", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(C)c(N/C(=N\\C(=O)c2cccc(F)c2)[N-]Cc2c(C)nn(C)c2C)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142084", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1csc(NC(=O)c2csc(C#CCO)c2)n1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139539", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])CNC(=O)C(C)(C)C)cc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220101", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]CCc1cc(F)c(OC[C@@H]2CCOC2)c(F)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30018", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)[C@@H]([NH2+]C1CCCC1)c1ccccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CC[C@@H](O)c1ccccc1)N/N=C\\c1cc(Br)cc(Br)c1O by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203733", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C([C@H]1C[C@@H]1[N+](=O)[O-])N(Cc1ccccc1F)[C@@H]1CCS(=O)(=O)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170757", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cn1cnc([N+](=O)[O-])c1Sc1nnc(-c2ccco2)o1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75775", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1cc(C)c([C@H](C/C(=N/NC(N)=O)c2cccs2)C(C#N)C#N)c(C)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2071", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnc(SCC[C@@H]2CCC[C@]2(O)C[NH3+])nc1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100289", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc2c(cc1C)O[C@H](C(=O)OCc1c(C)nn(C)c1Cl)C2 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140017", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2oc(C(=O)NC[C@@H](O)c3ccc(F)cc3)cc2c1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49449", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCc1ccccc1)c1ccccc1NC(=O)[C@@H]1CC(=O)N(c2ccccc2Cl)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173976", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCOC(=O)CCC(=O)N(C)CC(C)(C)O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164433", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule BrCCc1noc2ccccc12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192428", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#CCc1ccc(S(=O)(=O)N[C@H]2CCCCC[C@@H]2[NH3+])cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169418", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1cnnc1CCNC(=O)/C=C/c1ccccc1OC(F)F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104388", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOC(=O)c1c(NC(=O)c2cc(Cl)sc2Cl)sc2c1CCN(C(=O)OCC)C2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79151", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C1CCCN1c1ccc(C[NH2+]Cc2c(F)cccc2F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60465", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C(=O)NCC[C@@H](O)c2ccccc2)[nH]n1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147774", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1c(Cl)cc(C(=O)[O-])cc1NC(=O)C(C)(C)Oc1ccc(Br)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33642", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1nn(C)c(C)c1CCC(=O)N(C)CC(C)(C)O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176046", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CSCc1ccc(Cl)s1)N1CCC[C@@H](c2nnc3ccccn23)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175275", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C=CCN(CC=C)c1nncc(-c2ccc(Cl)cc2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66920", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccn(CC(=O)NCCN2Cc3ccccc3O[C@@H](c3ccccc3F)C2)n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145294", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1cc(NC(=O)C2CCN(c3nc4ccsc4c(=O)n3Cc3ccccc3)CC2)ccc1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112295", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](Sc1nnc(C2CC2)n1Cc1ccco1)c1c(F)cccc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245727", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H]1OCC[C@H]1C(=O)N1CCN(CCO)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219069", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCC[C@]1(CO)CCCN(C(=O)CNC(N)=O)C1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79243", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)c1ccc(NC(=O)CN2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190537", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1noc(C)c1C[C@H](C)N[C@H](C)c1nc2ccc(Cl)cc2n1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236495", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCc1cccc(NC(=O)Cn2cnc3ccc(Cl)cc3c2=O)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155225", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccnc(NC(=O)COc2ccc(Br)cc2Cl)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171364", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C([O-])c1ccc(COc2cccc(Cl)c2Cl)o1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60099", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1nc2n(n1)CCC[C@@H]2NC(=O)N[C@H]1C[C@@H]1c1c(F)cccc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156030", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(C(=O)Cc2ccccc2Br)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76380", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C=O)c1OS(=O)(=O)c1ccc(Cl)cc1C#N by replacing a aldehyde by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198781", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COCCN1C[C@H](C(=O)N[C@@H](C(=O)[O-])[C@@H](C)O)CC1=O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184834", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1[C@H]([C@@H]2NCCC3=c4ccccc4=[NH+][C@@H]32)[C@H](O)N[C@H](S)N1Cc1ccc(F)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195829", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(F)c(NC(=O)c2cccc(OC)c2F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81108", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](C1CC1)N(Cc1ccccc1)C(=O)Nc1cccc(F)c1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77518", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1cc(-c2ccncc2)on1)N1CC=C(c2ccccc2Cl)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147859", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1c(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)cnn1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13976", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](c1ccc(F)cc1)[NH+](C)CC(=O)NNC(=O)c1ccccc1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225527", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COc1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(Cl)ccc1O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216146", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](c1ccccc1Cl)N(C)C(=O)[C@H]1CC[C@H](C[NH3+])O1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128819", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(CNC[C@@H](C)c2cccs2)cc(Br)c1O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242740", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCC[C@@H]([NH3+])C(=O)Nc1cc(CC)ccc1O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13168", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2nc(Nc3ncnc(Nc4ccccc4)c3[N+](=O)[O-])sc2c1 by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77092", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@@H]2NC(=O)C(C#N)=C([S-])N2c2ccccc2C)c1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36948", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(-c2cccc([N+](=O)[O-])c2)cn2cc(-c3ccc4c(c3)OCO4)nc12 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62577", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC(=O)N1CCC[C@@H](c2nccnc2-c2ccc(F)cc2)C1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93498", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)C(C(=O)OC)=C(F)SCC(C)=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93301", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)Cn2ccccc2=O)c(Br)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69588", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@H]1CCC[C@@H](Oc2ncccc2F)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208887", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccc([C@@H]2C[C@@H]2C(=O)OCCN2CCCCCC2=O)c1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85566", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(F)c(F)c1)Nc1cnn(C[C@@H]2CCCO2)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38340", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule COc1cc(OC)c([N+](=O)[O-])nc1[N+](=O)[O-] with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105817", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COC[C@H]1CCCCO1)N1CCCN(c2ccc(F)cc2)CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33745", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCC(F)(F)F)NCC1CCN(C(=O)C(F)(F)F)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157443", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1CN(C(=O)COCC(F)(F)F)[C@H](C)CN1C(=O)OC(C)(C)C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54821", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCN(C)C(=O)c1cccc(S(=O)(=O)[N-]c2ccccc2Cl)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59829", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[NH+]2CCCC[C@@H]2CN1CCC[C@](C)([NH3+])CO by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151650", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule NC(=O)[C@H]1COCCN1C[C@@H](O)COCc1ccccc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243316", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@](O)(CNC(=O)[C@@H]1CC(=O)N(c2ccccc2)C1)c1ccc(-c2ccccc2)cc1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153285", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCNC(=O)C1CCN(C(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163117", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1c(Cl)cccc1Cl)N1CCC[C@H](c2[nH]cc[nH+]2)C1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH+]1CCC[C@H]1c1ccc2c(c1)OCCO2)Nc1cc(C(F)(F)F)ccc1-n1cncn1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198894", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C=CCN(CCO)C(=O)Nc1cc(-c2ncco2)ccc1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60914", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@]1(C(=O)Nc2c(F)cc(F)cc2-c2ccccc2)CC1(Cl)Cl by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243562", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@H](C#N)N1CCN(C(=O)c2ccnc(C3CC3)n2)CC1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73701", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)NC1=NN(C(C)=O)[C@@]2(S1)C(=O)N(CCOc1ccccc1Cl)c1ccc(C)cc12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31554", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CCc1cc(Cl)cs1)N1CCC[C@H]1c1ccccc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243705", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H]1CCC[C@H](n2cc(C)c(I)n2)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135368", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc([C@H](Cl)[C@]2(C)CCCO2)c(Br)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194016", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccccc1[C@@H](C)N[C@H](CC(F)(F)F)c1ccc(F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148187", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1ccnc1-c1nc(Cl)ncc1F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172876", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)Oc1cc(C(=O)N2CCC[C@H]2[C@H](C#N)c2ccccc2)ccn1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120768", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2oc3c(c(=O)c2cc1C)[C@@H](c1cccc(Cl)c1)N(C[C@@H]1CCCO1)C3=O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214121", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1CN(S(=O)(=O)c2cc(C(=O)Nc3cccc(Cl)c3Cl)ccc2Cl)C[C@@H](C)O1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17882", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CCCC[C@@H]1NC(=O)CN(C)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130775", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cccc(C#N)c1)C(=O)c1c[nH]c2cccc(F)c12 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218420", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)CN(C)c1ccc([N+](=O)[O-])c2cnccc12 by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116951", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=[N+]([O-])c1ccc(N2CCOCC2)c(S(=O)(=O)[N-]/N=C/c2ccccc2Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227901", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)Oc1ccc([C@@H](N)C(F)(F)F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17488", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=S(=O)(c1ccccc1Br)N1CCN(Cc2csc3ccccc23)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173624", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1cc([C@H]2NC(=S)NC(C)=C2C(=O)Nc2ccc(C)cc2C)ccc1O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137312", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H]1CN(C(=O)Cc2cccc(F)c2F)CC[C@H]1[NH3+] by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243470", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]C[C@@]1([C@]2(O)CCC[C@@H](C3CC3)C2)CCOC1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201255", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]([C@@H](C)O)n1cc(Br)cc([N+](=O)[O-])c1=O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185203", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nnsc1C(=O)N1[C@H](COc2ccc(F)cc2)[C@H]2CC[C@@H]1C2 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149333", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1cc([N+](=O)[O-])cnc1S[C@@H](C)C(C)C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137907", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Cn1ncc2c3ccccc3n(Cc3cccc(Cl)c3)c2c1=O)NCc1ccc(F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94237", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](Sc1ccc2nnc(C(F)F)n2n1)c1ccccc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135302", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1ncc2c(S[C@@H]3CCN(c4ccccc4F)C3=O)ncnc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248309", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)NC(=O)N[C@H](C)c1nc(C(C)(C)C)no1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15128", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "689", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)[NH+](C)Cc1ccccc1N1CCCCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35774", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCn1ncc(Cl)c1C(=O)N1CCN(C)C2(CC[NH+](C)CC2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205644", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nn(C)cc1C(=O)NC[C@H](CC)CCO by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197575", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(C(=O)N[C@@H]2CCN(c3cccc(Cl)c3)C2)C[C@@H](C)O1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94173", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CSc1ccc(Cl)cc1NC(=O)NCCc1cccc(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202021", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cnc(SC2CCCC2)nc1NC1CC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88614", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)N(C)Cc3ccc(Cl)s3)cc2)C[C@@H](C)O1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96190", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(CNC(=O)C(=O)Nc2ccccc2C)cc1OC(F)F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127950", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)Nc1ccc(F)c(NC(=O)Cc2ccccc2Cl)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107116", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(NC(=O)CN2CCO[C@H](c3ccc(F)cc3)C2)no1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124822", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[NH2+][C@@H]1CCC[C@@H]1c1nc(-c2ccc(F)cn2)no1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30197", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1cccc(O)c1)NC[C@]1(O)CCCc2ccccc21 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23060", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)Oc1ccccc1 by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124796", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule SCC1(COC/C=C/c2ccccc2)CCC1 by substituting a thiol with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5373", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cnn(CC[NH2+][C@H](c2ccc(Br)cc2)C2CC2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69802", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC1CCN(C(=O)N[C@@H](Cc2ccc(Cl)cc2)c2ccccc2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106391", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CCc1nc2ccc(F)cc2[nH]1)C(=O)[C@@H](C)n1cc[nH+]c1C(C)C by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166872", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H](c1cccc(Cl)c1)[NH+]1CCCC1)[C@@H]1CCS(=O)(=O)C1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77734", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule COc1ccc(/C=C/c2nc(C(=O)[O-])ccc2C#N)cc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202025", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)N1CCN(C(=O)c2cccc(OC)c2F)CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34028", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(F)ccc1O[C@H](CCN1CCOCC1)c1ccc(F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87173", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2sccc2c(=O)n1NC(=O)c1cccc(C(F)(F)F)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119205", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)CC[C@@H]1CCCN(C(=O)c2ccc(F)c(Br)c2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162653", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccccc1NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1Cl by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105626", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1nc2ccccc2s1)Nc1ccc(F)c(F)c1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63742", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(CC1CC[NH+](CCc2ccc(Cl)cc2)CC1)C(=O)c1n[nH]c2c1CCCC2 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90268", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CCCC[C@H]1OCC(=O)NNc1cc(C#N)cc(Cl)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145652", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H](Sc1nc2ccc(Cl)cc2c(=O)n1CC(C)C)C(N)=O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100750", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H](CN(Cc1ncccc1C(F)(F)F)C1CC1)c1ccccc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1cccc2c1CCN(CN1C(=O)C(=O)c3cccc(F)c31)C2 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230849", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1c(C(=O)NNC(=O)c2ccco2)cnc2ccc(Cl)cc12 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CN(C(=O)C/C(N)=N/O)CCO1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145604", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2c3oc4c(O)c(O)ccc4c3nc3c2c(=O)[nH]n3C(C)C)c(OC)c1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219341", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)OP(=O)(OC(C)C)[C@H](O)c1ccc(C(C)C)cc1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78453", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1sc(C[NH+](C)CC(=O)Nc2cc(C)ccn2)cc1Br by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190585", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COc1cc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2)ccc1O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120950", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCn1c(N/N=C/c2ccc(F)cc2)nc2c1c(=O)[nH]c(=O)n2C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172123", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(=O)[C@@]1(O)CC[C@H]2[C@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217289", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)N(CCO)c1ncnc2c1CCCCC2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137122", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccnc2nc(C(=O)N3CCC[NH+](Cc4cn5cc(Cl)ccc5n4)CC3)nn12 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185290", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1[nH]c2scc(-c3ccccc3Cl)c2c(=O)n1-c1ccc(Cl)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205150", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2Nc3c(C(=O)[O-])cccc3[C@H]3[C@H]4CC[C@H](C4)[C@H]32)cc1[N+](=O)[O-] by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80944", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCNC(=O)COc1cccc(NC(=O)N(C)[C@@H](C)c2ccccc2F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13776", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCNC(=O)c1ccc(Cl)nn1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5441", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@H]1[C@@H]2CC[C@@](O)(N2)[C@H](O)[C@@H]1O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=C(\\CCC(=O)[O-])c2nc3ccccc3s2)cc1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101293", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Br)c(C(=O)[C@]2(C)CCCO2)s1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126970", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCOCCCC(=O)N1CCN(CCO)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2950", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)Nc1ccc(F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35923", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S(=O)(c1ccccc1)N(F)S(=O)(=O)c1ccccc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219677", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C([O-])CCCCN1C(=O)CCc2cc([N+](=O)[O-])ccc21 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143954", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOCCOc1ccc(Cl)cc1NC(=O)N[C@@H]1C[C@H]1C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136605", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1nc(-c2ccc(F)cc2)cs1)Nc1ccc(Br)cn1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94536", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1CN(S(=O)(=O)c2cc(Br)ccc2Br)C[C@H](C)O1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11119", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(-c2cccc(Cl)c2)c(O)c1/C=N/c1sc2c(c1C#N)CCCC2 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243458", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(C)nc1NC(=O)CCCc1cc(F)ccc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224130", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1[nH]c2ccccc2c1C(=O)NCCc1c(F)cccc1F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76279", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C#N)ccc1OCC(=O)Nc1ccc(C(C)=O)cc1 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229011", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)NC[C@H](CCO)c1ccccc1)c1ccsc1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203324", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1C[C@@H]([NH3+])CN(c2cccc(F)c2C(N)=O)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128324", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](CNC(=O)c1cnc([C@H]2CCCO2)s1)Oc1ccccc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20928", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(/N=C(\\[O-])c1cn(Cc2ccccc2)nn1)c1ccc(F)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70165", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc(F)c(Cl)c1)NC[C@@H]1CCCN(c2ncccn2)C1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6684", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=O)c2ccccc2n2c(CNc3cccc(Br)c3)nnc12 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32282", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1nc2cc(Cl)ccc2cc1N by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73611", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1c(NCCc2cccc3cccnc23)ccc2ncccc12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234832", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Nc1cccc2ncccc12)c1ccc(Cl)s1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176024", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1-c1cnc(Br)cn1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217298", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1(C)CCN(C(=O)N[C@@H]2C[C@H]2c2ccccc2F)CC1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94210", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CN1CCO[C@@H](CNC(=O)c2ccc(C#CCCO)s2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208572", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[C@@H](CC(=O)Nc1cccc([N+](=O)[O-])c1)[NH2+][C@H]1CCC[C@@H]1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234636", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)cc2)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31450", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4039", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(CN2C(=S)N(C)C(=O)[C@@H]2CC(=O)Nc2ccc(F)cc2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105313", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Brc1ccccc1[C@@H]1CN(Cc2ccon2)CCO1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118111", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc([C@@H](C)N[C@H]2CC[NH+](C3CC3)C2)cc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115394", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(NC(=O)C(=O)NC[C@H](O)C2CCOCC2)c(C)c1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26613", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1ncnc1C[C@@H]([NH2+]CC)c1c(F)cccc1F by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60353", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(CCNC(=O)c2ccc3c(c2)CCN3S(=O)(=O)c2ccc(Cl)cc2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46654", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)[C@H](CO)[NH2+][C@@H]1CCO[C@@H](C(C)C)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102946", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@@H](CO)Cc1c[nH]c2ccccc12)c1ccc2sccc2c1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99788", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@@H](CO)NC(=O)Cc2c(C)nn(C(F)F)c2C)c1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42914", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(/C=C/c1ccc(N2CCCC2=O)cc1)N1CCN(CCO)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171519", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)NC(=O)Nc2ccccc2CC(N)=O)cc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36277", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+][C@@H](CCc1ccccc1)Cc1ccc(O)cc1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146332", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1ccc(CNc2ccccc2[NH+]2CCC(O)CC2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203410", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C(=O)N2CCC([NH+]3CCCC3)CC2)c(Cl)n1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142155", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H](NC(=O)c1ccccc1OC1CCN(S(C)(=O)=O)CC1)c1ccc(F)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119071", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@H](C#N)[C@@]1(O)CCCC1(C)C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120778", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1cc(C(=O)[O-])c(-c2ccc(F)cc2O)cn1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51927", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC[C@@H](C[NH3+])[C@H](O)c1ccc(C)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241798", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule N/C(CC(=O)Nc1ccc(Cl)cc1)=N\\OC(=O)c1ccc(C(F)(F)F)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189305", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)C[C@@H]1C=CCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45858", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]1CCCCN1C(=O)C[NH+](C)Cc1ccccc1F by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213823", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1ccc([C@@H](Cl)[C@@H]2COc3ccccc3O2)cc1Br with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64621", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-[n+]2noc([O-])c2C(=O)NCc2ccccc2Cl)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13834", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCC(=O)NCC(=O)N[C@@H]1CCC[C@H]1c1ccccc1C(F)(F)F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248878", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(F)c(NC(=O)C(=O)NC[C@H](C2CCCCC2)[NH+](C)C)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41515", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "914", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCCCOc1cccc(NC(=O)C(=O)NC2CCC(O)CC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184575", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(CCc1ccncc1)c1cnn(C)c(=O)c1Br by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25241", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)(C)OC(=O)N1CC[C@H]([NH+]2C[C@H](O)[C@H](O)C2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134166", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H]1NC(=O)[C@H]2CN(C(=O)Oc3ccc(F)cc3)CCN2C1=O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41451", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1158", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](Oc1ccc(F)cc1)C(=O)N1CCCC[C@H]1CNS(C)(=O)=O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91469", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[C@@H](O)c1ccc(Cl)cc1)Nc1ccccc1N1CCCC1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56732", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1n[nH]c(N/N=C/c2ccc(O)cc2)n1)N[C@@H]1CCCc2ccccc21 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201673", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C(=O)NC(=O)N1CC(=O)N1CCC[C@H]1c1ccc(F)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108575", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)Nc1ccc(/C=C\\C(=O)c2ccc(Cl)cc2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37960", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Brc1cnc2n1CCCC2 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244580", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCCCNc1cc(-n2cnnn2)ccc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116280", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1cccc2[nH]c(CN(C[C@H]3CCCO3)[C@@H]3CCSC3)nc12 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243956", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccccc1NC(=O)CS[C@H]1N=C2N=NC(C)=C2C(=N)N1c1cccc(Cl)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233051", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cc2ncn(C[C@H](O)COc3ccc(C(C)C)cc3)c2cc1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12956", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[S@](=O)c1ccc(C(=O)Nc2cccc(I)c2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179410", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)N(C1CC1)[C@H](C)c1ccco1)c1ccc(F)c(F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134167", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C1[C@@H]2[C@@H]3C=C[C@@H](C3)[C@H]2C(=O)N1CCO with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31377", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCC[C@@H]1CCC[NH+](Cc2ccc([N+](=O)[O-])c(N)c2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96267", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN(CCCO)c1ncc(C)c(C)n1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241685", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccnc1)c1ccc(=O)n(Cc2ccc(F)cc2)n1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202224", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H](CCO)N(Cc1ccccc1)C(=O)c1cc2c([nH]c1=O)CCCC2 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126634", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COCCN1CCC[C@](O)(CN2CCN(c3[nH+]cccc3C)CC2)C1=O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46291", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(/C=C/C(=O)[O-])c(Br)cc1OCC#N by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117468", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@@H]1C[C@@H](O)[C@@H](CO)C1)c1ccc2c(c1)OCO2 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216294", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(NC(=O)c2cc3c(F)cccc3s2)c(OC)cc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51731", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1ccc(-n2c(C)cc(/C=C(\\C#N)C(=O)Nc3cc(C)cc(C)c3)c2C)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98424", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN1CCO[C@@H](COc2ccc(Br)c(F)c2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53515", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(CNc2ccc(C)cc2OC)c([N+](=O)[O-])cc1O by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8127", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCNC(=O)N1CC[C@@H](NC(=O)N[C@@H]2CCCc3ccc(F)cc32)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90652", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC(CC)[C@@H](CNC(=O)Nc1cc(F)ccc1F)N1CCOCC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54343", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c(N2C[C@](O)(c3ccc4c(c3)OCCO4)[N+]3=C2CCCCC3)c1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cccc(NC(=O)c2cc(Br)ccc2F)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26348", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C(=O)NO[C@H]2CCCCO2)c(O)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189082", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccccc1N[C@H](C)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58407", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1nc2c[nH+]ccc2n1Cc1cc(Br)cs1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169068", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2181", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1ccccc1[C@@H]1C[C@H](C)N(c2ncc([N+](=O)[O-])c(N)n2)C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110142", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(NC(=O)CCN2[C@@H](C)COC[C@@H]2C)c(OC)cc1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192040", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC[NH+]1CCN(c2ncnc(N(CCC#N)CCC#N)c2N)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133509", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nccn1-c1ccc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145713", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCN1C(=O)[C@](C)(C(=O)Nc2ccc(F)cc2)Sc2ccccc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153867", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCOc1ccc(C(F)(F)F)cc1C(=O)NC[C@H]1CCC[C@H]1O by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32503", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCS[C@H]1CC[C@H](NC(=O)c2ccc(N3CCC(O)CC3)cc2)C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194925", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule OCc1ccc(Oc2ncc(Br)cn2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55764", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1csc2nc(-c3ccc(F)cc3)cn12)NCCn1nc(-c2cccs2)ccc1=O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234281", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C(=O)N1CC[C@@H](O)C1)c1cccc(C(F)(F)F)c1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182054", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(OCC(=O)Nc2ccccc2C(=O)NCC(C)C)ccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128178", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1cc(CN2CC[NH+](Cc3ccccn3)CC2)cc(OC)c1O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146115", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNS(=O)(=O)c1ccc([C@H](C)NC(=O)/C=C(/C)c2ccc(F)cc2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68158", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1cccc(Br)c1)C1CCN(c2ccc(N3CCOCC3)nn2)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51054", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1csc([C@H](C)NC(=O)c2cccc(Br)n2)n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29747", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule Cc1cc(C)c([C@@H]2C(C#N)=C(N)OC3=C2C(=O)CCC3)c(C)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81309", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOC(=O)[C@H]1CCCN(c2nncc(-c3cccc(F)c3)n2)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9910", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C#CCN1CCN(CC(=O)N2CCN(c3cccc(F)c3C#N)CC2)CC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51874", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COCC[C@]1(CO)CCCN(C(=O)CCc2c(C)n[nH]c2C)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239551", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](CCO)NC(=O)N[C@@H]1CCC[C@H]([S@@](=O)CC)C1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=C2/N=C(c3ccc(OC)c(Br)c3)OC2=O)c(OC)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149520", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N/C(=N/O)c1ccc(Sc2cccc(F)c2)c(F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174312", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N#Cc1c(NC(=O)c2cc(F)ccc2Br)sc2c1CCC2 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102089", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCc1cccc(C(=O)N2CCN(Cc3ccncc3)CC2)c1O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72997", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(C)cc1NC(=O)C(=O)N/N=C\\c1cc2c(cc1Br)OCO2 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110809", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CC(/C=C/c2cccc([N+](=O)[O-])c2)=Nc2ccccc2N1 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123040", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CNC(=O)[C@H](NC(=O)COc1ccc(C)cc1)c1ccc(F)c(F)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109675", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cccc(C(=O)Nc2ccnn2Cc2ccc(C)cc2)c1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104079", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](C)[C@@H](CNC(=O)Cc1cccc(Cl)c1)c1ccc(F)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67141", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nn(C)c(C)c1C(=O)Nc1ccc(Br)c2cccnc12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11092", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)COc1ccc(NC(=O)c2ccc(Br)o2)cc1Cl by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84860", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(S[C@H](C)C(=O)Nc2ccc(Cl)cc2C(N)=O)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21311", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccccc1OCCN(C)CC#N by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192023", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1noc(CCCC(=O)Nc2cc([N+](=O)[O-])ccc2O)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6173", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1noc(C)c1S(=O)(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7504", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@H]([NH3+])c1cc(F)ccc1OCCCC#N by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115570", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(/C=C/c1ccc(F)cc1)NC(=S)NCCc1ccccc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174400", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC1=C(C(=O)Nc2ccc(C)cc2)[C@H](c2ccc3c(c2)OCCO3)n2nc(CO)nc2N1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72431", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C(=O)Nc1ccc(C)c([N+](=O)[O-])c1 by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57453", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS[C@H](C)C(=O)[C@@H](C#N)c1nc(C(C)C)cs1 by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137088", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1cccc(Cl)c1Cl)C(C)(C)C by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23245", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1cccc2cccnc12)Nc1ccc(Br)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134358", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CCC(=O)Nc1ccc(Cl)c(S(=O)(=O)N(C)C)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68644", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCCN(c1nc(Cl)ncc1C)[C@H](C)COC with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11063", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CC[C@H](C)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1OC by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197255", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@H](C)Sc1ccc([N+](=O)[O-])cc1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242299", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC1(C)CC[NH+]([C@@H]2CCCC[C@@H]2C#N)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54307", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCCCCC[C@H](O)c1cscc1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68399", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1ccc(C(=O)NC2CC2)cc1NC(=O)Cc1cccc(OCC#N)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34097", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCOC(OCC)[C@@H](O)Cc1ccccn1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153664", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C)c(OC[C@H](O)CN2CCN(S(C)(=O)=O)CC2)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146887", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CN(Cc1ccccc1O)C(=O)c1cnc([C@H]2CCCO2)s1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145834", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cccc(-n2c([S-])nnc2-c2ccccc2O)c1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9370", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](Cl)c1nc2cc(Br)cnc2n1[C@@H](C)c1ccccc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248804", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCN1C(O)=NC(O)=C2C1=NC1=C(C(=O)c3ccccc31)[C@H]2c1ccc(C(=O)[O-])cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99976", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cccc(F)c1[C@H](C)NC(=O)N(C)[C@H](C)Cc1cccs1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238823", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2cn3nc(N4CCC(C(=O)Nc5ccccc5F)CC4)sc3n2)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55321", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(c1ccc(CSc2ccccn2)cc1)C(F)F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188577", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@@H](c1cc(F)ccc1Br)[C@H](C)c1ccccn1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226655", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC[NH+]1CC[C@@H](C(=O)N2CCC(Oc3ccccc3F)CC2)C1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93962", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NC(=O)Cn2ncc3cc(-c4ccccc4Cl)ccc32)n(C)n1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)COC(=O)/C=C/c2ccc([N+](=O)[O-])o2)cc1C by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20740", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC1=N[C@@H]2C=CC(C(=O)N3CCC([C@@H](Cc4ccc(F)cc4F)N(C)C(=O)C4CC4)CC3)=CC2=C1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249284", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1cc(C(=O)/C=C/c2ccccc2C)ccc1O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18468", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH+]1CCN(C(=O)C2CCN(c3ccc(Cl)nn3)CC2)CC1)Nc1ccc(F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1nn(C)cc1C(=O)N1CCN(C[C@@H](O)c2cccs2)CC1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28785", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)CCC(=O)c3ccc(Br)cc3)CC2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64147", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H](C(=O)[O-])[C@@H](C)[NH2+]C[C@@H]1CCCC[C@@H]1CO by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97261", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(-c2ccc(C)c(S(=O)(=O)NCc3ccc(Br)cc3)c2)on1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240659", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@](O)(Cc1cccc(O)c1)C1CC1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35150", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nn(C)c(C)c1CCNC(=O)N[C@H](c1cccc(C(F)(F)F)c1)C1CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53043", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)[C@@H](NC(=O)[C@H](C)c1ccc(Br)s1)C(C)(C)C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62185", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(-c2ccc(F)cc2)nc1SCC(=O)Nc1ccccc1F by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169496", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCNC(=O)C(=O)Nc1ccc(Cl)cc1C(F)(F)F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32406", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule N#Cc1cc(F)cc(-c2nc(N)ccc2[N+](=O)[O-])c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36841", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(COc1ccc(F)cc1)N1CCN(c2cc(N3CCCCC3)c(F)cc2[N+](=O)[O-])CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141861", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4149", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CCCCl)NNC(=O)c1ccc(Cl)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139047", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCN(c2ccc(-c3ccccn3)nn2)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125189", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCCN(C)C(=O)C(=O)Nc1cc(N2CCCC2=O)ccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176201", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1COCC(=O)N1Cc1nnc(-c2ccc(Cl)cc2Cl)o1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138413", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CSc1ccc([C@H](C)[NH2+][C@@H]2CCc3cc(Cl)ccc32)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196502", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1ccccc1I)c1ccc(Cl)c([N+](=O)[O-])c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19335", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(CC(=O)N2CCOCC2)cc1)c1cc(Cl)c[nH]1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71476", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc([C@@H]2[NH+]=C(C(C)C)N(C3CC3)C2=[NH2+])ccc1Br with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69078", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnnn1-c1cc(NC(=O)N[C@@H]2C[C@@H]2C)ccc1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104558", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1ccccc1C#CCN1CCOC[C@@H]1C1CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244972", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)=NNC(=O)Nc1ccc(C)c(Cl)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135609", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)c1ccc(C(=O)[O-])cc1S(=O)(=O)Nc1cccc(Cl)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189427", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc2c(cc1Cl)[C@H](C)[C@H](CC(=O)NC1[NH+]=c3ccccc3=[NH+]1)C(=O)O2 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47088", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC[NH+]1CCN(c2ccc(F)cc2[N+](=O)[O-])CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Br)c(/C=C(/C#N)C(=O)NC2CCCCCC2)cc1OC by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103319", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1CCC[C@H](C)N1C(=O)CNS(=O)(=O)c1ccc(Cl)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141941", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(COc1ccc2c(c1)oc(=O)c1ccccc12)Nc1ccc(Br)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26668", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[NH2+][C@@]1(C(N)=O)CCC[C@@H](Sc2ccccc2Br)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37072", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(/C=N/NC(=O)C(O)(c2ccccc2)c2ccccc2)cc1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154957", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CCOc1ccc(N2C(=O)S/C(=C/c3ccccc3[N+](=O)[O-])C2=O)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232206", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(Cl)cc1NC(=O)CN(C)S(=O)(=O)c1ccc2[nH]c3c(c2c1)CCCC3 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27345", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H](CN1CCN(c2ccccc2F)CC1)c1ccc2c(c1)OCCCO2 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133413", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#C/C(=C1/SC[C@@H]([C@H]2CC=CC=C2Cl)S1)n1ccnc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165395", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](C)CCNC(=O)CN1CCN(c2cccc(Cl)c2)C1=O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161305", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)([N-]c1nnc(C2CC2)s1)c1c(Cl)cccc1Cl by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66238", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(Cc1ccc(C[NH3+])cn1)c1ccc(F)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230778", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cccc2c1OC1(CCN(C(C)=O)CC1)N1N=C(c3ccccc3Cl)C[C@H]21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112539", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOc1ccc(Nc2scc(-c3ccc(Cl)cc3)[n+]2N2CCOCC2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229021", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CN(C[C@@H](O)CN1CCOCC1)C(=O)c1nccc2ccccc12 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205973", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc(C(=O)Oc2ccccc2F)cn1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24264", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)S(=O)(=O)CC(=O)N(C1CC1)[C@H](C)c1ccc(Cl)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216113", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#Cc1c(NC(=O)CCCc2nc(-c3ccccc3)no2)sc2c1CCCC2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221792", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Nc1cccc(Br)c1CO by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76887", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nc(-c2cncc(Br)c2)nc(NN)c1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39784", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(N2CCC[C@H](C[NH+]3CCCC3)C2)c(C(=O)[O-])c1)c1ccccc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31995", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H]1CCC[C@H](NC(=O)C/C(N)=N/O)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163756", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC1(C(=O)N2CCCC[C@@H]2CCCl)CCCC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73619", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N#Cc1ccc(F)c(CN[C@H]2CCOc3c(Cl)cccc32)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10200", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(O[C@H](C)CNC(=O)N2CCC[C@@H](CCO)C2)cc1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239860", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CNC(=O)c1cccc(Br)n1)Nc1ccc(F)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203537", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(/C=C2\\SC(=O)N(CCOc3ccc(F)cc3)C2=O)c(OC)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135735", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)NC(=O)CN1CCN(c2ccc(O)cc2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107037", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(Cc1cccc(NN)[nH+]1)Cc1cc(Br)cs1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152614", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccc(Br)c(C(F)(F)F)c1)C1CCC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171605", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNC(=O)c1ccc(Cl)cc1NC(=O)[C@H](C)Oc1ccc(C)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134217", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNC(=O)NC(=O)COc1ccc(C#N)cc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4926", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C=C(C)n1c(=O)n(C[C@@H]2CC2(Cl)Cl)c2cc(C)c(C)cc21 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66404", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@](N)(c1cc(F)cc(F)c1)c1ccccc1C(F)(F)F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70040", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCC1CCN(C(=O)c2ccoc2)CC1)c1ccc(Br)o1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241353", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)[C@@H]1C(=O)NC[C@@H]1c1ccc(Cl)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191679", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](c1ccon1)N(C)C(=O)c1cn(Cc2ccccc2F)nn1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50985", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1cc(Br)cc(CO[C@@H]2CC[NH2+]C2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174856", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Cc1ccccc1Cl)Nc1ccc(NC(=O)c2ccco2)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88902", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H](C(=O)Nn1cnc2c(cnn2-c2ccc(F)cc2)c1=O)c1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157145", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cnc(C)c(-c2cc(F)cc3c2O[C@@H](CNC(=O)Cn2nc(C)cc2C)C3)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92419", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1ccc(F)c(NC(=O)c2c(C)nn(C)c2C)c1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157131", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(C)[NH2+]C[C@@H](Cc1nccs1)c1ccc(Br)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189602", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)CCn1c(C2CC2)nnc1[S@](=O)Cc1ccc(F)c(F)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118564", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(F)cc1Cl)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102111", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NS(=O)(=O)c1ccc(NC(=O)NCCc2c(F)cccc2F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14580", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc([C@@H](C)CC(=O)NNC(=O)NCC(F)(F)F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146371", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NNC(=O)c1cccnc1OCC(F)(F)F)c1ccc2ccccc2n1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160103", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCC(=O)Oc1cccc([N+](=O)[O-])c1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27304", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1cccc([C@H](O)CN[C@@H](C)c2ccc(N3CCOCC3)cc2Cl)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134049", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COCCSc1nnc(NC(=O)c2c(-c3ccccc3Cl)noc2C)s1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102367", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNc1ncc(Br)cc1S(=O)(=O)N1C[C@H](C)[C@@H](C)C1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198222", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([O-])[C@@H]1CCCN(C(=O)Cc2ccc(F)cc2F)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135560", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C[C@H]([NH2+]C[C@H](O)C2CCOCC2)C(C)(C)O1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215769", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccccc1-c1ccccc1C(=O)NCc1ccc(C[NH+]2CCCC2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187453", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccc(F)cc1Br)Nc1ccc2c(c1)OCCCO2 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62202", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(CSc1nc2ccc([N+](=O)[O-])cc2s1)NCCc1ccc(Cl)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141396", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule OCc1nc2ccc(-c3ccc4c(c3)OCCO4)cc2[nH]1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88851", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C=C(C)Cc1ccccc1Br with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229563", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOc1ccc(-c2csc(/C(C#N)=C/Nc3ccccc3F)n2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30265", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CN(C(=O)c1ccc(C#N)cc1)C1Cc2ccccc2C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134755", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccccc1F)NNC(=O)c1c[nH]c2cccc(F)c12 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3017", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C1CCC[C@H]1[C@@H]1CCC[NH+]1Cc1ccc(Cl)cc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186994", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCCCCC(=O)Nc1cc(C(F)(F)F)ccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193537", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC#CC[C@H](O)[C@]1([NH+](C)C)CCC[C@H](C)C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67061", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)CNc1cc(N2CCC[C@@H]2CO)ncn1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127965", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H](O)[C@@H](C)c1cccc(F)c1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246395", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)N1CCCC[C@H]1C(=O)Nc1ccc(Cl)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79240", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H]1CC[C@H]([NH+]2CCC(C(=O)Nc3ccccc3Br)CC2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207735", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Brc1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccncc1)N2 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164354", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#C[C@@]1(NC2CC2)CC[C@@H](Oc2ccc(F)cc2F)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192791", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C2(O)CCN(C(=O)[C@H](Cc3c[nH]cn3)n3cccc3)CC2)nc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116206", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc2[nH]c3c(N4CCN(c5cccc(Cl)c5)CC4)ncnc3c2cc1OC by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87384", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1-c1noc([C@H](C)SCC2(CO)COC2)n1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131411", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH2+]C1CCCCC1)Nc1ccc(F)c(Cl)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234614", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C1NC[C@H](C(=O)N2CCc3[nH]c4c(Cl)cccc4c3C2)N1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130271", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CC(=O)NC[C@@](C)(O)C2CC2)cc1OC by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101537", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCCN(CCC)c1ccc(C(=O)[O-])cc1[N+](=O)[O-] by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196601", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(CN2C(=O)C[C@@H](C(=O)Nc3ccccc3)S/C2=N\\c2ccc(F)cc2)cc1OC with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44066", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H]1CC(=O)N(S(=O)(=O)c2sc(Cl)nc2C)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158369", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc(N2CCN(C(=O)c3nnn(-c4ccc(Cl)cc4)c3-c3cccnc3)CC2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95505", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCc1nc(-c2ccc(Cl)cc2Cl)cs1)c1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97668", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COCCC(=O)Nc1ccc(Br)c(C(F)(F)F)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91269", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1cccc(-c2cn3ccsc3n2)c1)c1ccccc1I by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165662", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)Oc1cc(Cl)ccc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32609", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(c1cc(F)cc(Br)c1)N1CCCC[C@H]1CCO by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18320", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1N1CC[C@H](CNC(=O)Cc2ccccc2F)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186529", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(=O)Nc1cc(C(=O)NC[C@](C)(O)c2ccc(F)cc2)ccc1C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150241", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(C[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccc(F)cc1)NC1CCCCCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57025", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule OC[C@@H](Br)C(F)(F)Br with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4465", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)CC(C)(C)CNC(=O)c1cccc(-n2cnnn2)c1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219322", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CCOC)c1cccc(F)c1C[NH3+] by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112471", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)[C@@H](NC(=O)CS(=O)(=O)[C@@H](C)c1c(F)cccc1F)c1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49861", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(C[NH2+][C@H](C)c2sccc2C)c(OC(F)F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126476", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#C/C(=C\\c1ccc(N2CCOCC2)o1)C(=O)NCCc1ccccc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137367", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN(CCCC)c1nc(Cl)ncc1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204986", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc(OC(F)(F)F)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45989", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CCOc1ccc2nc(S[C@H](C)C(=O)Nc3cccc([N+](=O)[O-])c3)[nH]c2c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58061", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cccc(C(=O)N[C@H](C)C(=O)N2CCO[C@H](c3ccc(F)cc3)C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128183", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H](NC(=O)NCCC[S@](C)=O)c1ccc(C)c(F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159216", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@H](CNC(=O)c2cccc([N+](=O)[O-])c2)[NH+](C)C)cc1 by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77702", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)C(=O)NCC1CCN(c2ncccn2)CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187365", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule NS(=O)(=O)CCN(CCO)Cc1cc(Br)ccc1F by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160211", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C1[C@@H](Oc2ccccc2F)[C@H](c2cccnc2)N1c1ccccc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165655", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N=C([O-])N(c2ccc(Cl)cc2)[C@@H](O)[C@H]1[C@@H]1NCCC2=c3ccccc3=[NH+][C@H]21 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65316", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nn(C(C)(C)C)c2nc(C3CC3)cc(C(=O)Nc3ccc(Cl)nn3)c12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81962", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CONC(=O)N[C@H](C)c1ccc(OCC(F)(F)F)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220596", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)N[C@H]2CCCC[C@@H]2CO)c1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81769", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCC[NH+]1Cc1cc(F)cc(C#CCCO)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239230", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@H]([C@H]1Cc2ccccc2O1)[NH+](C)Cc1ccc(CO)o1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21771", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCN(CC(C)C)S(=O)(=O)c1ccc(C)cc1Br by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181521", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C(=N\\O)[C@@H]1C[C@@]2(C)CC[C@@H]1C2(C)C by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222707", "split": "OpenMolInst" } }, { "instruction": "Substitute a aldehyde in the molecule CCN(CC)C(=O)COC(=O)c1ccc(C=O)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101878", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(C(=O)c2c(F)cccc2F)C[C@H]1O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159309", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccccc1C[C@H](O)C(C)(C)[NH+]1CCCCCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78338", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1Cc1ccccc1)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175081", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cn1cc[nH+]c1C[C@@H](O)c1cccnc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144494", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(/C=C/c1ccc2c(c1)OCO2)C[C@]1(O)C(=O)N(Cc2ccccc2Cl)c2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12368", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCc1ccc(F)cc1)N1CCC[C@@H]1c1nc(-c2ccc(F)cc2F)no1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64082", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1c(Cl)ccc2s/c(=N/C(=O)[C@@H]3CCCCN3S(C)(=O)=O)n(C)c12 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89951", "split": "OpenMolInst" } }, { "instruction": "Substitute a thiol in the molecule S/C(=N\\N=C\\c1c(Cl)cccc1Cl)Nc1ccccc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141815", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(Cl)ccc1N(CC(=O)Nc1ccccc1C(F)(F)F)S(C)(=O)=O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106107", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1[nH]nc(O)c1CC(=O)N/N=C/c1ccccc1[N+](=O)[O-] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1-c1nnc(NC(=O)c2cc(Cl)ccc2[N+](=O)[O-])o1 by substituting a nitro with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192763", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)(C)[C@H](O)CNC(=O)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192105", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(C)c1NC(=S)N/N=C/c1cccn1Cc1ccccc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51505", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule NC(=O)[C@@H](N[C@@H]1CCc2c(Br)cccc21)c1ccccc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179968", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(C)c(OC(=O)[C@@H]2CCCN(CC(F)(F)F)C2)c([N+](=O)[O-])c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213141", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)(O)CC[NH2+]Cc1cccc2c1OCO2 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244955", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H]1CCC[C@H]([NH2+][C@@H]2CCCc3cccnc32)C1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193043", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1nn(CCO)c(C)c1C[NH+]1CC[C@H](C)C[C@H](C)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51861", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](Sc1nc2ccc(Cl)cc2[nH]1)C(=O)N[C@H](C)c1ccc(F)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28495", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc(C(=O)N[C@H](C)c2ccccc2Cl)c1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67373", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCc1c(N2CC[C@](O)(CC)[C@H](O)C2)nc(C)[nH+]c1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157860", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCCCN(CCO)C(=O)N[C@H](C)C(C)C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143208", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@]1(c2ccc(NC(=O)C3(C#N)CCCC3)cc2)CCC(=O)NC1=O by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164901", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(F)c([C@H](O)[C@H]2CCCC[C@@H]2C(=O)[O-])cc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172147", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(OCc1nc2cc(Cl)ccc2c(=O)[nH]1)c1cc(C2CC2)nn1-c1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168615", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC[C@@H]1CC[NH+](Cc2cn(C)nc2-c2ccccc2F)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14129", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@H]1CCCCN1C(=O)CN1CC[NH+](CC(=O)Nc2ccccc2SCC#N)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177872", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(F)ccc1CCN1CC(C)(C)[NH2+]C[C@H]1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203259", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)OC1=C(OC(C)C)[C@@]2(O)[C@H](C)CC[C@H]2C1=O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83460", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1297", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nnc2ccc(-c3ccc(NS(=O)(=O)c4ccc(F)cc4F)cc3)nn12 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123876", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(S(=O)(=O)NCC2CC[NH+](Cc3ccsc3)CC2)cc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34104", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(CC(=O)[C@@H](C#N)c3ccccn3)coc2c1 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201294", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC[C@@](C)(C#N)NC(=O)Cc1noc2ccccc12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64445", "split": "OpenMolInst" } }, { "instruction": "Substitute a aldehyde in the molecule Cc1cccc(CN(C)c2ccc(C=O)s2)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1ccc([C@@H](O)[C@@H](CO)NC(=O)c2ccco2)cc1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181206", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](CC(=O)N1C[C@@H](O)C[C@@H]1c1cc(F)ccc1F)c1cccc(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123176", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCn1nccc1NC(=O)c1ccncc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147984", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCn1c(SCC(=O)N(C)C[C@@H]2COc3ccccc3O2)nnc1-c1cccc(Cl)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178829", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)c1ccccc1NC(=S)NNC(=O)c1cccc(C(F)(F)F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241396", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN[C@]1(C#N)CC[C@@H]([NH+]2CCCO[C@H](C)C2)C1 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164545", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([C@H](C[NH3+])S(=O)(=O)c2ccc(F)cc2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29517", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](CCO)N(Cc1ccccc1)C(=O)[C@@H]1C[C@@H]1c1ccc(F)cc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76563", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CN(Cc1ncnn1C)C(=O)COc1ccccc1C#N by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147590", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](C(=O)N(C)Cc1cccc(F)c1)N1CCOC(C)(C)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65771", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSCc1csc(NC(=O)c2ccccc2)n1)Nc1ccc(F)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139709", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)Nc1ccccc1CO by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69568", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCN(C(=O)c1ccc(Br)cc1F)c1cccc(C)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105279", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)NC(=O)[C@H](C)Sc1ncc(-c2ccc(Cl)cc2)n1Cc1ccccc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81146", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(=O)NC1(c2ccccc2)CC[NH+](C[C@H](O)c2ccc(C(C)(C)C)cc2)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105813", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccccc1[C@H]1N[C@@H](C[NH+]2CCC[C@@H]2c2nc3ccc(F)cc3[nH]2)[C@H](C)O1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6070", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cn1cnc2cc(F)ccc2c1=O)NCCOc1ccc(F)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165458", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2ccccc2n1CC(=O)N[C@@H](CO)Cc1c[nH]c2ccccc12 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232079", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCSc1nnc(CNC(=O)c2ccc(Cl)cc2)n1CC with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215768", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc([N+](=O)[O-])cc1)N1CCCSC[C@@H]1C[NH+]1CCCCC1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114761", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nnsc1CN1C[C@@H](C(=O)[O-])[C@H](c2cccc(F)c2)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47997", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(C(=O)CCC(=O)N2CCN(c3ccc(F)cc3)CC2)s1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230266", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(c1csc(C#CCO)c1)N1CC[C@@H]2CCCC[C@@H]2C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70695", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCc1nnc2n1CCN(C(=O)c1csc3c1CCCC3)CC2)c1c(F)cccc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170187", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(Cc1csc(-c2ccc(F)cc2)n1)c1nc2ccccc2[nH]1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166193", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N/C(C[C@H]1CC(c2ccc(F)cc2)=NO1)=N\\O by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235045", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@H]1C(=O)C(=O)N(c2ccccc2)[C@@H]1c1ccc([N+](=O)[O-])cc1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100539", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H](C)C(=O)N1CC=C(c2ccccc2Cl)CC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162659", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1cccc(F)c1)N[C@H](CCO)c1ccccc1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47079", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCNC(=O)C(=O)Nc1ccc(F)cc1Br by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128517", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)c([C@@H](C)CC[NH3+])cc1F by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172186", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](Cl)[C@H](C)c1ccc(F)c(Br)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41649", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](Oc1ccc2c(c1)[C@@H](c1cccc(F)c1)N(C(=O)C(C)C)CC2)C(=O)N1CCN(C)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4231", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1nn(C[NH+](C)Cc2ccc(Cl)cc2)c(=O)c2noc(C)c12 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150497", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1c(NC(=O)c2ccccc2I)sc2c1CCCC2 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45891", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H](NC(=O)c1ccc(Br)cc1N)c1ccccc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231157", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)c2nnn(-c3cccc(C(F)(F)F)c3)c2C)cc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5174", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnccc1NC(=O)C/C=C/c1ccc(F)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236256", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135946", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#Cc1cccc(NC(=O)COc2ccc3cc(Br)ccc3c2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55361", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC[NH+](CCCC#N)[C@H](C)c1cc2ccccc2o1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79860", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(C(=O)[C@@H]1C[C@@H]1c1ccc(C(F)(F)F)cc1)C1CCOCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98067", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCSc1ncc(-c2ccccc2)n1-c1ccc(F)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49809", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c([C@@H](C)NC(=O)C[C@H]2C=CCC2)cnn1-c1ccc(F)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239704", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(F)cc(C(=O)N(C2CC2)[C@H]2CCS(=O)(=O)C2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171559", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)CNc2cc(C(=O)Nc3ccccc3)ccc2C)cc1Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248316", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S(=O)(NCc1ccccc1OC(F)(F)F)c1cccs1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107337", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)N/N=C/c2ccccc2Cl)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64357", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C=CCNc1nc(Cl)cc(COC)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62087", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCn1nc(C(=O)Nc2cc(Cl)ccc2O)ccc1=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20860", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)/C=C/Nc2cc(Cl)ccc2OC)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16250", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCOC(=O)N1CCN(C[C@H](O)CO[C@H]2CCC[C@@H]2C)CC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34970", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1nc2ccc(F)cc2c(-c2ccccc2Cl)[nH]1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156856", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC/C(C=O)=C\\c1ccc([N+](=O)[O-])o1 by substituting a aldehyde with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161981", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCCc1ccc([C@H](O)[C@@H]2CN(CC)CCO2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226801", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1ccc(N(CCC#N)C(=O)[C@@H](C)[NH+]2CCC[C@H](C(=O)N(C)C)C2)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116833", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N[C@@H]1CCCN(C(=O)Nc2ccc(F)cc2Cl)C1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202082", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)NCC(=O)NCCc2ccccc2[N+](=O)[O-])cc1C by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235020", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1ccc(F)cc1S(=O)(=O)N[C@H](C#N)c1ccccc1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218436", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(CNC(=O)NCCCn2cnc3ccccc32)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101844", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([O-])[C@H]1CC=CC[C@@H]1C(=O)N[C@@H]1CCCN(c2ccccc2F)C1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124054", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCN(C)C(=O)Nc1ccc(Br)cc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39825", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C[NH2+][C@@H](C)c2cnn(-c3cccc(F)c3)c2C)c(Cl)cc1O by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65132", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1ncc(-c2cc3ncc(S(=O)(=O)C(C)(C)C)c(N)n3n2)c1C(F)(F)F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240290", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Fc1ccc(OC(F)F)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191420", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cc(CNC(=O)c2ccc(CCC(C)(C)O)cc2)n[nH]1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169467", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1ccccc1OC[C@@H](O)C[NH+]1C[C@H](C)C[C@@H](C)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28367", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Cc1nc2cccc(Cl)c2s1)C(F)(F)F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99276", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)CN(C(=O)c1cnc([C@@H]2CCCO2)s1)c1cccc(F)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89300", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCc1nc(SCCO)c2oc3ccccc3c2n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135611", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCCc1nccs1)N(Cc1ccc(F)cc1F)C1CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28962", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(O[C@H](C)C(=O)Nc2cc(Cl)cc(Cl)c2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46135", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C(CN(Cc1ccco1)C(=O)c1cccc([N+](=O)[O-])c1)Nc1ccccc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8983", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H](C)N1C[C@H](C(=O)Nc2cccc(F)c2)CC1=O by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206192", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCc1n[nH]c(=O)[nH]1)c1cccnc1OCC(F)F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200726", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)(F)c1ccnc(NCCc2nccc(-c3ccccc3)n2)n1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148653", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1CCC[C@@H](/C=C/CCl)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174004", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1sc2ncn(CC(=O)Nc3nc(-c4ccc(Br)cc4)cs3)c(=O)c2c1C by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129999", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccsc1[C@@H](O)CNC(=O)NCc1cccc2ccccc12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215490", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(CN2C(=O)C(=O)c3cc(Cl)ccc32)sc1C by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85146", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@](O)([C@@H]1CCCC[NH2+]1)C(F)(F)F with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209312", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1ccc(/C([O-])=N/S(=O)(=O)c2ccc(C#N)cc2)s1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182542", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCC1(C)CC[NH+](CC(C)(C)[C@@H](C)O)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111775", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCCC[NH+]1CCNC(=O)C1(O)Cc2ccccc2C1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70888", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](NCCc1nc(-c2ccccn2)cs1)c1cccnc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238042", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C2=NO[C@@H]([C@H]3C=C(c4ccc(F)cc4)N=N3)N2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22186", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(Br)c([C@H](Cl)[C@@H](C)c2ccccn2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108928", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCCCCn1ccccc1=O)N[C@H]1C[C@H]1c1cccc(Cl)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114175", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CS[C@H](c2ccccc2F)N1CC[NH+]1CCCCC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126158", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC(=O)c1ccc(NCCNS(C)(=O)=O)c([N+](=O)[O-])c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136609", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1ccc([C@@H]2c3c(oc4ccc(F)cc4c3=O)C(=O)N2CCCOC)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99557", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1ccc(NS(=O)(=O)c2ccccc2)c([N+](=O)[O-])c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106834", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(Cl)c(NC(=O)Nc2ccccc2F)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38839", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#CC1=C(N)C(C#N)(C#N)[C@@H](c2cccc(Cl)c2Cl)[C@H]2CN(Cc3ccccc3)CC=C12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74479", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(c1ccc(F)cc1)N1CCN(Cc2nc3ccc(Cl)cc3o2)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43824", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=c1c2ccccc2oc2nc(-c3ccc(F)cc3)n(Cc3ccco3)c(=O)c12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145270", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H](Oc1cccc(C=O)c1)C(=O)N[C@H]1C[C@@H]1c1cccc(Cl)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54779", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1C[C@H](C)NC(=O)N[C@@H](CCO)C1CCCCC1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149860", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](C(=O)N[C@@H](c1ccccc1)C(F)(F)F)c1ccsc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170426", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ccc2nonc12 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233456", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccccc1O)c1ccc(Br)cc1Br with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234631", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](CSC)[NH+](C)Cc1cccc(Cl)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40642", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@@H](C(=O)NC(=O)NC(C)(C)C)N1CCN(c2ncccc2C#N)CC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198111", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCSC[C@@]1(O)c1cccc2ccccc12 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148621", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]([NH2+]CCOc1ccccc1Cl)c1cccc(N2CCOC2=O)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24759", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCc1cc(C[NH+](C)C)c(O)c(C[NH+](C)C)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11070", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1noc2nc(C3CCN(C(=O)CCn4cncn4)CC3)cc(C(F)F)c12 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141698", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@]1(C)CC(=O)NC(=O)[C@@H]1c1ccccc1Br by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146763", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1sc(CCNC(=O)c2cccnc2Cl)nc1-c1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196551", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCN1C[C@H](C(=O)Cl)CC1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177278", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1cccc(C)c1OCC(=O)Nc1ccc([N+](=O)[O-])cc1O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167221", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](C(=O)Nc1ccc(Cl)cc1)n1ncc(-c2ccc(Cl)cc2)nc1=O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212185", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#CC1=C(N)C(C#N)(C#N)[C@H](c2cccc(Br)c2)[C@H]2CCCC=C12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199774", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@H]1CCCC[C@@H]1NC(=O)NCc1ccnc(OCC(F)F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56893", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1Cc2ccc(OC(F)(F)F)cc2[C@@H]1[NH3+] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105238", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCN1C(=O)/C(=C(/C#N)C(=O)Nc2cc(C)ccc2C)c2ccccc21 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189626", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccccc1C#CCO)N1CCCC1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148479", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)[C@@]1(F)CCN(Cc2ccc(C(C)(C)C)s2)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201834", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cccc(Cl)c1)N(CCN1CCOCC1)c1nc2c(F)cc(F)cc2s1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128945", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(S(=O)(=O)N2CCCCCC2)ccc1OCC(F)(F)F)[C@H]1CCCO1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46183", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccccc1NC(=O)CN1CCN(c2[nH+]ccn2-c2ccccc2F)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233687", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Clc1ccc([C@H]2NN=C(c3ccccc3)S2)c(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176718", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccccc1Cl)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51096", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1nnc(C(F)(F)F)s1)N1CCC(c2ccccc2)CC1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98124", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CCc1nn(C)c(NCc2cccc([C@@]3(C)NC(=O)NC3=O)c2)c1[N+](=O)[O-] with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)[C@](C)(N)C(F)(F)F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "878", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nn(C)cc1[C@@H](C)NC(=O)[C@@H]1CC(=O)N(c2ccc(F)cc2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96698", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cs/c(=N\\S(=O)(=O)c2cc(C)c(Br)s2)[nH]1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110217", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCCCCl)[C@H]1CC(=O)N(CCC2=c3cc(F)ccc3=[NH+]C2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210938", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](CNC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1=O)[NH+](C)C1CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36608", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc2c(c1)OCO2)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199558", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCC(=O)N[C@H]1CCCN(c2cc[nH+]cc2Cl)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11944", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](CN1CCCC1=O)NC(=O)N[C@@H]1C[C@@H]1c1ccccc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93392", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCC(=O)NCCNC(=O)c1ccccc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94394", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nc(-c2ccccc2F)sc1C(=O)NCc1ccc(C(=O)[O-])cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176357", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cc(Cl)c(Cl)cc1NCCc1cccnc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140588", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@H](CC1CCOCC1)[NH2+][C@H](CO)CC(C)(C)C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171841", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)C(=O)CNC(=O)c1cc(Cl)cc(Cl)c1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86313", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)c1sc(COc2ccc(Cl)c(C)c2)nc1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60444", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2C[C@H](c3ccc(Cl)cc3)N(C(=O)C(C)C)c3ncnn32)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21902", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C)cc1[C@@H](O)CN1CCN(c2nccs2)CC1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)C1CCC1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155229", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COCCN1C(=O)Cc2c1nc(N)c1c(N)nc(N3CCC(C)CC3)c(C#N)c21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142827", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C(=O)NCCN1C(=O)COc1ccc(Cl)cc1Cl by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71257", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CCn1cc(C(=O)Nc2cc([N+](=O)[O-])ccc2OC)c(=O)c2ccc(C)nc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72463", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC[C@@H]1CN(C(=O)c2ccc(Cl)c([N-]S(C)(=O)=O)c2)CCO1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238501", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC1(C)CCCC[C@]1(O)[C@@H]1NCCc2ccccc21 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222119", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)(C)c1cc(C[NH+]2CCC3(CC2)[C@@H]([O-])C[C@H]3O)n[nH]1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116828", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(-c2ccccc2)sc1CN1CC[C@](O)(C(F)(F)F)C1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231583", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(F)cc1)Nc1nc2ccc([N+](=O)[O-])cc2s1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149601", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CSc1ccc2cc(CN3C(=O)N[C@](C)(c4ccco4)C3=O)c(Cl)nc2c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119380", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(F)ccc1NC(=O)[C@H]1CCCN(S(=O)(=O)C2=CN=C(C(=O)N3CCC(C)CC3)C2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228283", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(N2CCN(C(=O)[C@H]3CCCN(c4nc(Cl)nc5[nH]cnc45)C3)CC2)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67992", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H](Nc1nccc(Oc2ccc(F)cc2)n1)c1ccncc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53199", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C(=O)Nc1cccc(Cl)c1)[NH+](C)CC(=O)N(C)C by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183645", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H](c1nc(-c2cncc(Br)c2)no1)[C@H](C)[NH3+] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183512", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)c1ccc2cc(C(=O)N(C)Cc3ccc(Br)o3)[nH]c2c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238478", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Oc1ccc(/C=N/N2C(=S)[NH+]=N[C@@H]2c2ccc(F)cc2)cc1O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193717", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)c1ccsc1NC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150331", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C)c(Nc2ncnc(NNC(=O)c3ccc(Cl)cc3)c2[N+](=O)[O-])c1 by substituting a nitro with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93360", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCc1sc(/C([O-])=N/S(=O)(=O)c2ccc(C#N)cc2)cc1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43156", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)NC(=O)c2ccc(Cl)s2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161028", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)(C)n1ncc2c1CCC[C@@H]2NC(=O)CN1CCCc2cc(Br)ccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22544", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C/C(=N/Nc1nncc2ccccc12)c1ccc(N2CCCCC2)c(F)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155797", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCN(Cc1cn2c(C)cc(C)nc2n1)C[C@@H](O)c1ccc(C)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111480", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COc1ccc(CN2CCN(CC(=O)NC(C)C)CC2)cc1[N+](=O)[O-] with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138980", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[C@@H](CO)NC(=O)N[C@@H](C)c1ccc(-c2ccccc2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33156", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCn1c2c(=O)[nH]c(=O)n(C)c2n2c(-c3ccc(Cl)cc3)nnc12 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228353", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@H](CCc1ccccc1)Cc1nc(-c2ccc(C#N)cn2)no1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237442", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[NH+](C1CCCCC1)[C@H]1Cc2ccc(OC)cc2[C@@H]1O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133875", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN[C@H]1c2c(F)ccc(F)c2S(=O)(=O)[C@H](C)[C@H]1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230305", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)CCN1C[C@H](C(=O)NNc2ccc(F)cc2)CC1=O by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168671", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCSc1ccc(F)cc1)NNC(=O)NCc1ccncc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99724", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H](C)NC(=O)CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(F)cc12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42415", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1N=NC=C(NCc2ccccc2OC2CCCC2)[C@@H]1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164819", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1OC(=O)c1ccc(C(N)=O)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88869", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(Cl)cc1NC(=O)NC[C@H](c1ccc(F)cc1)N1CCOCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40927", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(S(=O)(=O)[C@@H](CNC(=O)c2ccccc2)c2ccco2)ccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131108", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C/C=C(\\C)[C@@H]1C(C)=C[C@H]2[C@@H](O)CC[C@H](C)[C@H]2[C@@H]1/C=C/C=C/C(=O)[O-] with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179702", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NCC(C)(C)[NH+]1CCN(C)CC1)c1ccc(Cl)s1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160076", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCOC(OCC)[C@H](O)c1cncnc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137630", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(=O)N(C)c1ccc(NC(=O)Cc2ccc(C)c(O)c2)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30902", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(-n2c(CN3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)nc3cccnc32)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80174", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1c(C)nc(SCc2nc(-c3cccc(Cl)c3)no2)[nH]c1=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185515", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(F)c(C(=O)N[C@H]2CCC[C@H](SCC)C2)c1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101558", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nscc1C(=O)N1CCN(Cc2ccc(F)cc2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191315", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C/C(N)=C(/C#N)C(=O)CSc1nnc2c(Cl)cc(C(F)(F)F)cn12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173395", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cn1cnnc1S[C@@H]1CCN(c2sccc2C#N)C1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25827", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@@H](C#N)CSc1ccccc1NC(=O)c1cc(F)ccc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32305", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=Cc1ccc(N2CCN(c3ccc(C=O)cc3[N+](=O)[O-])CC2)c([N+](=O)[O-])c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21075", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCNC(=O)c1cccc(NC(=O)CNc2cccc(F)c2C)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36466", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1cccc2c1SCC[C@@H]2NCCc1n[nH]c(-c2ccco2)n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191665", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)CSc1nc2ccccc2c(=O)n1-c1cc(C(F)(F)F)ccc1C(F)(F)F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18010", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1ccc([N+](=O)[O-])c(N[C@@H](C[NH3+])CC(C)C)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193512", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)Cn1ccc2cc(NC(=O)C(=O)NC3CCC(O)CC3)ccc21 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65570", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCN1CC[C@@]2(CCC1=O)CN(Cc1ccc(Cl)cc1)CC[NH+]2C by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49381", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](c1nc(-c2cccc(C(F)(F)F)c2)no1)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156318", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(C(=O)N2CCOC[C@@H]2C2CC2)sc2ccc(F)cc12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108007", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CS(=O)(=O)N1CCC(CNS(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122695", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@@H](C)NC(=O)Nc1ccc(Br)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219082", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule [NH3+]CC#Cc1ccc(NC(=O)C[C@@H]2CCCCO2)cc1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215991", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CSc1nc2cc(Cl)ccc2o1)Nc1cc(F)ccc1F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237899", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Br)cc1N[C@H](C)C(=O)NC(=O)NC(C)C by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31315", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc([C@H]2C[C@H](C(=O)NCc3ccccc3F)CN(C(=O)C3CCCC3)C2)cc1OC by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223464", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(F)c(NC(=O)N[C@H](c2ncc(C)s2)C2CC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68712", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCc1ccc([C@H]2c3c(O)n[nH]c3C[C@@](C)(O)[C@@H]2C(=O)OC)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88907", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CN(CC1CC[NH2+]CC1)c1cc(Cl)ccc1C#N by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90490", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)CNC(=O)[C@@H]1COc2ccc(NC(=O)c3cccc(Cl)c3)cc2C1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58137", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(Cl)c1NCC(=O)Nc1ccc(N2CCOCC2)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187047", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)Cn1/c(=N\\C(=O)CCS(=O)(=O)c2ccccc2)sc2ccc(Cl)c(C)c21 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130585", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)[C@@H]2CSCN2C(=O)c2ccc(F)c(C(F)(F)F)c2)cc1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119151", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1ccco1)N1CCN(c2ncc(Cl)cc2F)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224983", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C(=O)N2CCN(c3cc(Cl)ncn3)CC2)ccc1C#N by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103931", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(=O)[C@H](CC(=O)Nc2ccccc2F)S/C1=N\\c1cccc(F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13547", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCN1C(=O)CCc2cc(NC(=O)c3ccc(F)nc3)ccc21 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14096", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)C1=C(C)Nc2nc(SCc3ccccc3F)nn2[C@@H]1c1ccc(Br)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148350", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)CNc1nc2c(Br)cccn2n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71140", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cn1ncc([C@H](O)[C@H]2CCC[C@H](S(C)(=O)=O)C2)c1N with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21555", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C=C(C)CN(CC)C(=O)[C@@H]1C[C@@H]1c1ccccc1OC(F)(F)F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122379", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H]1CCC[C@]1([NH2+]Cc1ccccc1)c1ccccc1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152592", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CCOc1ccc(N[C@@H]2CC[C@H]([NH3+])C2)cc1 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93544", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@](CC(=O)Nc1sc2c(c1C#N)CCC2)(C(=O)[O-])c1ccccc1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44585", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](OC(=O)c1ccc(F)cc1OC(F)F)c1ccccn1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191294", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Nc1ccc(Cl)c(SC[C@@H]2CCCO2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184076", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CSc1ccccc1Cl)Nc1ccc(Cl)cc1NC(=O)c1ccco1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C(=O)NCCc1cc(Cl)c2c(c1)OCCO2)n1cncn1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34067", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)CN[C@@H](C1CCCC1)C(F)(F)F)C(=O)N(C)C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94619", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](C)[C@H](CNC(=O)c1ccc(I)cc1)Cc1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100803", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc(C)cc1[C@@H](C)[C@@](O)(C(=O)[O-])C(C)C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145674", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1ccccc1C(=O)NCC(=O)NCC[C@@H](O)c1ccccc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223635", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)(c1nnnn1-c1cccc(C(F)(F)F)c1)N1CCOCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89845", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=C(Cl)Cc1ccccn1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88347", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCn1cc(C(=O)C(F)(F)F)cn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14258", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule NC(=O)c1ccc(NC(=O)[C@H]2CCCC[C@@H]2C(=O)OCC(F)(F)F)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123406", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)[C@H](C)O/N=C/C(=O)Nc2ccc(F)cc2)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212001", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(/C=N/NC(=O)OC)cc([N+](=O)[O-])c1[O-] by substituting a nitro with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28882", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CN1C(=O)/C(=C/c2ccccc2F)Sc2ccccc21)N1CCc2ccccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67945", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCc1nn(C)c(Cl)c1CN(C)[C@@H]1CCCC[C@@H]1S(C)(=O)=O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3011", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ncccc1C[C@@H]1CCCC[C@H]1O by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C(=O)N(C)Cc2ccccc2O)nnn1-c1ccc(OC(C)C)cc1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122566", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](CNC(=O)[C@@H]1OCC(=O)N(C)[C@H]1c1cccc(F)c1)c1ccc(F)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163988", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC[C@@H](C)[NH2+]CCn1cc(Cl)c(=O)[nH]c1=O by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45448", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]1CCCC[NH+]1CCNC(=O)C(=O)Nc1ccc(F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243454", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C1NC(=O)N(c2cccc(Cl)c2)C(=O)/C1=C\\Nc1cc(Cl)ccc1O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137283", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule FC(F)(F)c1cccc(CNc2ncc(Cl)cn2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12789", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1cccnc1)c1ccc(F)c(C(F)(F)F)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72845", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1ccc(C2=N[NH+]=C(NCc3ccccc3)SC2)cc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85114", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(Cl)ccc1NC(=O)CSc1nc(-c2ccccc2F)n[nH]1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131365", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CCN1CCO[C@@H](C(F)(F)F)C1)NCc1ccccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120187", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Nc1cc(I)c2ccccc2c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246264", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCc1ccc(F)cc1)C(=O)Nc1c2c(nn1-c1ccc(F)cc1)CS(=O)(=O)C2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18496", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC(=O)Nc1cc(Cl)ccc1N1CC[NH+](C)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195847", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc([C@H](C)N2CC[NH2+]C[C@@H]2C(=O)N(C)C)cc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15343", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#CCCn1cc([C@@H]2Nc3ccccc3C(=O)N2CCc2ccccc2)c2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218843", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=S(=O)(c1cc(F)ccc1F)N1CCN(c2nc3ccccc3n2Cc2ccccc2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139650", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C=CCNC(=O)[C@H](C)Nc1cc(C(F)(F)F)ccc1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10555", "split": "OpenMolInst" } }, { "instruction": "Substitute a aldehyde in the molecule O=Cc1ccc(OCC(=O)N2N=C(c3ccccc3Cl)C[C@@H]2c2cccs2)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34094", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@@H](OCC1CC1)C(=O)[C@H](C#N)c1nc2sc3c(c2c(=O)[nH]1)CCCC3 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145724", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CN(CC(C)(C)O)C(=O)[C@@H]1CC(=O)N(CCc2ccccc2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185681", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(CNC(=O)NNc2cccc(F)c2F)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76172", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1nn(C)c2nc(N[C@H](CO)CC(C)C)sc12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126575", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cn1cc(C(=O)Nc2ccc(OC(=O)[C@H]3C[C@@H]3[N+](=O)[O-])cc2)cn1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180141", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nn(-c2ccc(F)cc2)c(C)c1C[NH+](C)[C@H]1[C@@H]2CCO[C@@H]2C1(C)C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186771", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(c1)N[C@@]1(CCC(=O)N([C@@H](C)C(=O)NCc3ccc(F)cc3)CC1)NC2=O by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201610", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](NC(=O)[C@H](C)c1cccs1)c1ccccc1C(F)(F)F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174455", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc([C@@H]2C(C#N)=C(N)OC3=C2S(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc23)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179915", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(C)c1ccc(C(=O)Nc2ccc(F)c(Cl)c2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCc1nc(Cl)c(CN2CC[C@@]3(CCCNC3=O)C2)[nH]1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159479", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule BrC1=C[C@@H](c2noc(CSc3ncn[nH]3)n2)SC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177436", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(C(=O)N2CCCCCCC2)sc1Br with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102209", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1cnc(S(=O)(=O)N2CCN(c3nc4ccccc4nc3C(F)(F)F)CC2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239000", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule NC(=O)c1ccc(Sc2nnc(C(F)(F)F)n2N)c([N+](=O)[O-])c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186465", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(N[C@@H]1CCS(=O)(=O)C1)c1ccc(-c2ccc(Cl)cc2)o1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57892", "split": "OpenMolInst" } }, { "instruction": "Substitute a aldehyde in the molecule O=Cc1ccc(OCc2ccn(-c3ccccc3)n2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133957", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Oc1cccc(F)c1)C1(c2ccc(F)cc2F)CCOCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42662", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1nc(C)c2c(C)c(C(=O)N(C)Cc3ccccc3F)sc2n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20367", "split": "OpenMolInst" } }, { "instruction": "Replace a aldehyde in the molecule O=Cc1ccc(-c2cc[nH]c(=O)c2)s1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222439", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1cccc2c1OCCC[C@H]2[NH2+][C@@H]1CCCN(c2cccnn2)C1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162533", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC[C@@H](CC#N)NC(=O)[C@@]1(C)CCCO1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162393", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[NH+]1CCN(c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171278", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CSc1nc([O-])c(C(=O)NCCCc2nc3c(s2)CCCC3)cc1C#N by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159557", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(Cc2ccc(C(=O)Nc3ccc(Cl)c(Cl)c3)cc2)c(C)c1[N+](=O)[O-] by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196497", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1c(C(=O)NNC(=O)NC[C@H]2CCCO2)sc2ccc(F)cc12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159310", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cccc(CNC[C@H]2COc3ccccc32)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169072", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)c1ccc(Cl)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161942", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[C@@H](C(=O)Nc1cccc([N+](=O)[O-])c1)n1nc(-n2cccn2)ccc1=O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131923", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule COCCN1C[C@H](C(=O)N2CCN(c3ncccc3C#N)CC2)CCC1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233857", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](C)CCCNS(=O)(=O)Cc1ccc(Cl)c(Cl)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221070", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCCN(C)S(=O)(=O)C[C@@H](C)CCl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139011", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(OC)c(NC(=O)N[C@@H]2CCc3c(F)cccc32)cc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72568", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(O)c(C[NH+](C)[C@H](C)c2cccc(S(N)(=O)=O)c2)cc1C by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55278", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(N1CCOCC1)N1CCO[C@H](c2ccc(Cl)cc2)C1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](SC1=NC=NC2=NC=N[C@@H]21)C(=O)NCCc1ccc(Cl)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94995", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)C(=O)NC[C@H]2Cc3ccccc32)c(Cl)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226724", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(Cc1ccccc1)c1ncnc(NNC(=O)c2ccccc2Cl)c1[N+](=O)[O-] by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198889", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cccc(CCn2cnc3sc4c(c3c2=O)CC[C@@H](NCc2cccc(F)c2)C4)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8848", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@]1(O)CC([O-])=C(C(=O)Nc2ccccc2)[C@H](c2ccccc2C(=O)[O-])[C@@H]1C(=O)Nc1ccccc1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85919", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC1CCC(CC(=O)N2CCC(O)(C(F)(F)F)CC2)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10774", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCCO/C([O-])=C1\\C(C)=NC2=C(C(=O)[C@@H](C(=O)OC)[C@@H](C)C2)[C@@H]1c1ccc(O)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79665", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)[N-]c2cc(C(F)(F)F)ccc2-n2cccn2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55047", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NC[C@@H](c1ccco1)[NH+]1CCCCC1)c1cc2ccc(F)cc2s1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196446", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOc1cc(/C=C2\\SC(=N)NC2=O)cc(Cl)c1OCC by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177829", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1=O)[C@@H](C)CO by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4579", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C[NH2+][C@H](c2ccccc2)c2cccc(F)c2)cc1OC with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16797", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1c(NC(=O)CSc2nc3ccccc3o2)sc2c1CCCC2 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160792", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCCO[C@@H](C)C(=O)Nc1cccc(C#N)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183863", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)[C@@H](NC(=O)Nc1ccc(OC(F)F)cc1)c1nc(C2CC2)no1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60304", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1ccc(OCCOc2ccccc2Br)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66723", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCCNc1cc(C[NH+]2CCC(O)CC2)ccc1[N+](=O)[O-] by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91894", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CO/N=C1\\CN(c2nc3c(cc2F)c(=O)c(C(=O)[O-])cn3C2CC2)C[C@H]1C[NH3+] by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151680", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1ccc(O)c(C(=O)NNC(=O)c2ccc(C)o2)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48220", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)S(=O)(=O)CC(=O)N1CCCc2cc(F)ccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16745", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@H](C)NC(=O)[C@H]1CSCN1C(=O)c1ccc(OCC(F)(F)F)nc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192628", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[P@@]([O-])(O)[C@H](O)c1ccc(-c2ccccc2)cc1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218930", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)NN(C)c2cnn(C)c(=O)c2Cl)cc1[N+](=O)[O-] by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120993", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCC(CC)NC(=O)[C@H](C)Sc1nncn1-c1ccc(C)c(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136502", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(Cl)cc1)c1ccncc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244472", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1noc(C)c1C(=O)N[C@H](Cc1cc(=O)n2nc(C)cc2[nH]1)c1ccc(F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51761", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1ccsc1NC(=O)C(=O)NCCc1ccc(F)cc1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190799", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#CCCN(CCC(F)(F)F)C(=O)c1cnc2ccccn2c1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112992", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(C[C@H]1SC(N2CCCCC2)=NC1=O)Nc1ccc(Cl)c(Cl)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64256", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c(Br)cc(Cl)cc1S(=O)(=O)Oc1cc(F)ccc1[N+](=O)[O-] by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165670", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COc1ccc(-c2nc(CN3CCN(C(=O)c4ccc([N+](=O)[O-])cc4)CC3)cs2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108493", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H]([NH2+]CC(C)(C)[C@H](O)C(C)C)C1CC1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23980", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3)c(/C=[NH+]\\CCN3CC[NH2+]CC3)c2O)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46120", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CNC(=O)c1cnc2c(c1)NC(=O)CO2)NCc1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98455", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCOc1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175623", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(F)cc1NC(=O)C(=O)N[C@@H]1C[C@](C)(OC)C1(C)C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24136", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)N1C=Cc2ccccc2[C@@H]1CC(=O)Nc1ccc(Cl)c2ncccc12 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72873", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=S(=O)(Cc1ccccc1)N1CCC[C@H](c2cccc(Cc3ccc(F)cc3)n2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47828", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)COc1ccc(NC(=O)c2ccsc2)cc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88241", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc([C@@H]2c3c(C)nn(C)c3NC(=O)[C@H]2NC(=O)c2ccccc2)cc(Cl)c1OC(C)C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227365", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@H](C(=O)NCC(=O)[O-])N1C(=O)/C(=C/c2ccc(O)cc2)SC1=S with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54347", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COCCCNC(=O)c1ccc2c(c1)NC(=O)/C(=C/c1cccc(Cl)c1)S2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155215", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]([NH2+]Cc1nnc(C(C)(C)C)o1)c1ccccc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167891", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1nc(-c2ccc(Cl)s2)cs1)[C@H]1CCCO1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150364", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)[C@H](CNCc1cnn(-c2ccc(F)cc2)c1)c1cccc(F)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207271", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCOc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)[nH]c(=O)c2C#N)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165700", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCCc1cnn(-c2ccccc2)c1)c1ccc(F)cc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11672", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1nnc(N2CCN(S(C)(=O)=O)CC2)c(C#N)c1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88749", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCCCN(C)c1ccc2cc(C#N)ccc2n1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92609", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CS[C@@H]1CCC[C@@H]1NC(=O)c1cc(N2CCCC2=O)ccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100828", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC1CC[NH+](CCOc2ccc(F)cc2Cl)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28468", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(NCCCN1CCOCC1)c1csc(C#CCO)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195826", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1C[C@H]([NH3+])CN(Cc2cc(F)ccc2Br)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60889", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1cc(CSc2nnc(N3CCOCC3)n2Cc2ccccc2)cc2c1OCCO2 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247129", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NS(=O)(=O)CCNC(=O)c1ccc(C(F)(F)F)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173119", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C[NH+]2CCCCC2)c(Cl)c1OC by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153039", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCc2ccccc2N1S(=O)(=O)c1ccccc1F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36255", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc(F)cc1)Nc1cccc(C(F)(F)F)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144474", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccccc1CN(Cc1ccccn1)C[C@@H]1CCCO1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151274", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CNC(=O)Cc1ccc(NC(=O)/C=C(/C)c2ccc(F)cc2F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93383", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C[C@H](NC(=O)N1CCc2[nH]c[nH+]c2[C@H]1c1ccc(F)c(F)c1F)C(=O)OC by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111964", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1O[C@@]1(c1ccccc1)c1ccc(F)cc1F by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236398", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCCN(CC1CC1)C(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155417", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@@H](Cc1c(F)cccc1F)c1ccc(OC)cc1Cl by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30047", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=c1ccc(I)cn1Cc1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138858", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1nc2ncc(C#N)c([O-])c2s1 by substituting a nitrile with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207316", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCSc1nc2n(n1)[C@@H](c1ccccc1[N+](=O)[O-])C(C(=O)Nc1cccc(C)c1)=C(C)N2 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182540", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c([C@H]2CCC[NH+]2Cc2cc(C(F)(F)F)ccc2F)cnn1C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5364", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CC(=O)N(C)c1ccc(Cl)cn1)c1cccc(F)c1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210926", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)CNC(=O)Cn1nnc(-c2ccc(Cl)cc2)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184425", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)NCC(=O)O[C@@H](C(=O)c1ccccc1)c1ccc(Cl)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204277", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](C(=O)NC[C@@H]1CCCO1)[NH+]1CCC(O)(C(F)(F)F)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39729", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC1(C)[C@]2(C(=O)NCc3ccco3)CC[C@@]1(C)/C(=N/OC(=O)c1ccc([N+](=O)[O-])cc1)C2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159655", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc2ncccc2c(=O)n1-c1cccc(NC(=O)c2cccc(F)c2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80026", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1c2ccsc2ncn1Cc1c(F)cccc1Br by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41435", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccc(C(=O)C[C@@]2(O)C(=O)Nc3ccc(C)cc32)cc1OC with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64025", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NC[C@H](O)c1ccccc1F)Nc1ccc2c(c1)OCCO2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138463", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@H]1NNC(C(=O)[C@]2(C)CO2)=C1c1cccc([N+](=O)[O-])c1 by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69697", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(/C=C(/CBr)C(C)C)c(Cl)c1OC with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209200", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CS(=O)(=O)Cc1ccc(NC(=O)NNc2ccc(F)cc2)cc1F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102553", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)C(=O)NC[C@@]2(O)CCOc3ccccc32)c1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69195", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)N1CCCC[C@@H]1C(=O)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220924", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H]([NH2+][C@H](CO)c1ccc(Cl)cc1)c1ccc2c(c1)OCCO2 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113282", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)NCCSc1ccc(Br)cc1N by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76797", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Cc1ccc(C(F)(F)F)cc1)NC(=O)[C@@H]1CSC(=O)N1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242209", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COc1cc(Br)c(O[C@@H](C)C#N)cc1Br by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13936", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(NC(=O)Cc2c(F)cccc2F)cc(OC)c1OC by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25468", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCn1/c(=N/C(=O)[C@@H](C)COC)[nH]c2cc(Cl)ccc21 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191036", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)Nc1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90965", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(Cl)ccc1OC(=O)C1CCN(C(=O)c2ccco2)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237280", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN1CC(=O)N2[C@H](Cc3c([nH]c4ccccc34)[C@H]2c2cccc([N+](=O)[O-])c2)C1=O by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26020", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)c1cc2c(ccn2C)n1Cc1ccc(Cl)cc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39035", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N#C[C@H](c1ccc(Br)cc1)N1CCN([C@H](C#N)c2ccc(Br)cc2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39681", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCOc1cncc(N[C@@](C)(C(=O)[O-])C(F)(F)F)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC(C)(C)O)S(=O)(=O)c1ccc(C(=O)[O-])s1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9571", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCOC(=O)C[C@@H](C)N1CCO[C@H](C#N)C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72946", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CSCc1ccc(N[C@H]2CC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28862", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NC1CCCCCCC1)c1ccccc1SC(F)F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58957", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29916", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1csc([C@H](NC(=O)NC[C@H](O)CC(C)C)C2CC2)n1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238461", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cc(F)ccc1S(=O)(=O)NCCC1=c2cccc(Cl)c2=[NH+][C@H]1C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51227", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1Cl)c1c[nH]c2nccc(Cl)c12 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2990", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCC1(c2ccccc2)CCC1)NNC(=O)c1ccc(Cl)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71890", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(S/C=C/C(F)(F)F)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147150", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC[C@H]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211948", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=S(=O)(N[C@H]1CCC[C@@H](O)C1)C1CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175939", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](SC(C)(C)C)C(=O)Nc1ncc(Cl)cc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119849", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccn2c(C=O)c(-c3ccc(Cl)cc3)nc2c1 by replacing a aldehyde by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181994", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(/C=C/C(=O)OCC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)o1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198172", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COCc1ccccc1NCc1cccc([N+](=O)[O-])c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182824", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)CCCCNC(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212071", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NC(=O)c2cccc3c2OCCO3)nc2nc(C(F)(F)F)nn12 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89986", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)CNC(=O)Cc1cccc2ccccc12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101407", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccn(Cc2c(Cl)cccc2Cl)c1=O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136704", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc(Br)nc1)N1CCC[C@H]1c1cccnc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13085", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2C(=S)CO[C@@H]2c2ccc(Br)cc2)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187764", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC[NH+](CC(=O)NCc1ccccc1[N+](=O)[O-])C1CCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30228", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](NC(=O)[C@@H](C)c1cccs1)c1nc(C(F)(F)F)cs1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247775", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(=O)Nc1c(C)cc(NC(=O)NCC[C@@H](O)C(C)C)cc1C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160992", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NC(=O)CN2CCN(Cc3cc(-c4ccc(Cl)cc4)no3)CC2)no1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105011", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(/C=C/CC(=O)Nc2cc(-n3nnnc3C)ccc2F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112685", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[C@@H](CO)[NH+]1CCN(Cc2c[nH]nc2-c2ccc(F)cc2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163912", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1c(NC(=O)CC[NH+]2CCC(NC(N)=O)CC2)sc2c1CCC2 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82851", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CCCl)C[NH2+]C[C@@H]1CSc2ccccc21 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38761", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H](NC(=O)C(=O)Nc1cccnc1Cl)c1nc(C)cs1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171542", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1C[C@H]1c1ccc([C@H]2NC(=O)c3c(Cl)cccc3N2)o1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109800", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCc1ccc(O)c(NC(=O)[C@H](C)NC(=O)c2ccoc2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149621", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(COC(=O)/C=C/c1ccc(F)cc1)Nc1ccc2c(c1)OCO2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98710", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1C[NH+]2CCC[C@@H]2CN1CC[C@@H](C)CCCl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99154", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66952", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N/C(=N\\OC(=O)c1cccc(Br)c1)c1ccncc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141851", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule Cc1nc(N2CCCC2)cc([C@H]2CCCN(c3cccc(C#N)n3)C2)[nH+]1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243577", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=c1[nH]c2ccccc2cc1CNC[C@@H](O)c1ccc(F)cc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82071", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1cccc(C(=O)C2=C(O)C(=O)N[C@H]2c2ccc(C(C)C)cc2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176576", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(NC(=O)[C@@H](C)[NH2+][C@@H](C)c2ccc3c(c2)OCO3)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44492", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N/C(N[C@H]1C[C@H]1c1cccc(Cl)c1)=[NH+]\\C1CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186488", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(NO[C@@H]1CCCCO1)c1ccc([N+](=O)[O-])cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11778", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CSCc1nc2ccccc2n1CC(=O)N(C)C[C@@H](O)C1CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209424", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCN(C)c1cccc(NC(=O)N[C@H](COC)c2ccc(F)c(F)c2)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95320", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)Nc2nc(C[NH+]3CCC[C@@H](C)C3)cs2)cc1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222332", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](CO)NC(=O)NC[C@H](c1ccc(C)o1)N1CCOCC1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184664", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNc1cc(C)ccc1C(=O)Nc1ccc(F)c(F)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216401", "split": "OpenMolInst" } }, { "instruction": "Please substitute a aldehyde in the molecule O=Cc1ccc(C(=O)OCC(=O)Nc2ccc(F)cc2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62853", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H](CO)CSc1ccnc(C(=O)NCc2ccccc2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60744", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C(=O)OC(C)C)sc2ncn(Cc3ccccc3Cl)c(=O)c12 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166375", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCC[NH+]1CCC(c2nccnc2Oc2ccccc2F)CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131247", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCCc1nnc2n1CCCCC2)[C@H]1C[C@@H]1c1ccc(F)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102341", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@H](NC(=O)c1ccncc1)c1ccc(F)c(F)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161451", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@](C)(C(=O)[O-])[C@@H]1CCC[C@@H]1O by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53639", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#CCc1cccc(C(=O)NNC(=O)NCc2cccc(C(F)(F)F)c2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167825", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC1=C(C(=O)Nc2ccccn2)[C@@H](c2ccccc2C(F)(F)F)C2=C(CCCC2=O)N1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119008", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(CC)NC(=O)C(=O)NNC(=O)c1ccc(Br)s1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223749", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@@H]2c2ccc(F)cc2)[C@@H](C)N=N1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240017", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1nccs1)C1CCN(C(=O)c2ccc(-c3ccccc3F)o2)CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128694", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCCCN1C(=O)c2[nH]nc(-c3ccc(C)cc3)c2[C@@H]1c1ccc(Cl)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95878", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1N[C@]2(CCCc3ccccc32)C(=O)N1CN1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162665", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CNC(=O)[C@H](C)N1CCN(C(=O)c2cccc(O)c2)CC1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235208", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule N#C/C(=C\\c1ccc(-c2ccccc2Br)o1)C(=O)NCc1ccccc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220832", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Oc1ccc(F)cc1Cl)c1cnc2ccccn2c1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215926", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(Cl)c(C)cc1NC(=O)[C@H]1CCCCC[C@@H]1[NH3+] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25132", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1cc(NCCc2n[nH]c(=O)[nH]2)nc2ccc(Cl)cc12 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221370", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@](C)([C@@H](N)c1c(F)cccc1F)[NH+](C)C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216097", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)C[C@H](C)N(C)c1ccc2nnc(C(F)(F)F)n2n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156843", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule C[C@@H](CN1CC[NH+](C)CC1)Nc1ccc2ncccc2c1[N+](=O)[O-] by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186809", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(C(=O)Nc1ccccc1I)C1CCCCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13512", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](Cc1ccc(Cl)s1)[C@@H]1CCc2cc(N)ccc21 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240839", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1ccc(/C=C2\\C(=O)Nc3ccc(Cl)cc32)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249015", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H](CN1CCOC[C@@H]1C1CC1)c1ccc(Br)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172626", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)c1ccccc1S(=O)(=O)N1CCN(c2ccccc2F)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100408", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2cc(CN3C[C@@H](CO)OC[C@@H]3C)ccc2c1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229804", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cncc(C(=O)NC[C@H](O)C2CCCC2)c1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73007", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CN(c2cc(CNc3ccc([N+](=O)[O-])cc3)cc[nH+]2)CCO1 by replacing a nitro by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96658", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(F)c([C@@H](C)NC(=O)Nc2cnccc2C)cc1OC with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)Nc1cccc(C(=O)N(C)[C@H](C)c2cc(F)ccc2F)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243364", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule [NH3+][C@H](CC(=O)[O-])c1ccccc1Br by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151975", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCC[C@H](C)[NH+](C)CC(=O)Nc1cc(F)cc(F)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180472", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Nc1c(Nc2cccc(Cl)c2)ncnc1N1CCCCCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112357", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)Nc1cc(NC(=O)C(=O)N2CCc3cc(F)ccc3C2)c(F)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200721", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc2c(cc1F)nc(CCl)n2Cc1cscc1C by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19928", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1onc(-c2cccc(F)c2)c1C(=O)Nc1ccc2c(c1)OCCO2 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72884", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CCc1ccc(Cl)cc1Cl)OCc1ccccn1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211855", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H](NC(=O)N1CCCCC1)C1CCCCC1 by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203001", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1cc(C(=O)Nc2ccc(C#N)cc2)nn1-c1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240396", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc(SCc2cc(=O)c(OC(=O)c3ccc(F)cc3)co2)n1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120545", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85711", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CCCCl)Nc1nnc(-c2ccc(Cl)cc2Cl)s1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174295", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H](NC[C@@H](O)c1ccccc1)c1ccncc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12814", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(=O)ccn(CC(=O)NC2(c3ccc(F)cc3F)CCCC2)c1=O by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226050", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nn(C)c(C)c1C[C@@H](C)NC(=O)CCCc1cc(F)ccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238338", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ncnc1C[NH2+]C/C=C/c1ccc(C#N)cc1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188390", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)cc1OCC(F)F)c1n[nH]cc1[N+](=O)[O-] by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42953", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[NH+](CC)CCN1C2=[NH+][C@H](c3ccc(Cl)cc3)CN2c2ccccc21 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152730", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(CCCS(C)(=O)=O)C(=O)CNC(=O)c1ccc(F)c(F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151303", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@H]1CCCC[C@H]1NS(=O)(=O)Cc1cccc(F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113826", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1ccccc1S(=O)(=O)NCC1CCCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34272", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule C[NH2+][C@@H]1CCC[C@@H]1CCS(=O)(=O)c1ccc([N+](=O)[O-])cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68758", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](OC(=O)C(C)(C)F)c1cccc(C#N)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202902", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1nc(CC)oc1NC(=O)/C=C/c1cncc(F)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237084", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(-c2cc3nc(CCNC(=O)c4ccccc4F)nn3cn2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73167", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](CO)[NH+]1CCN([C@@H](C)c2cc(F)ccc2F)CC1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114647", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1c(-c2ccc(Cl)cc2)nnc1S(=O)(=O)C[C@@H]1CCCO1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103025", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)[C@@H](CNC(=O)Nc1ccccc1N1CCCC1)c1ccc(F)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240661", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1ccccc1[C@@H]1CN(Cc2cnn3c2NCCC3)CCO1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206569", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(S(=O)(=O)N(Cc2ccco2)c2ccc(F)cc2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47756", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O[C@H](C[NH2+]CC[C@@H]1C=Nc2ccccc21)Cn1c2ccccc2c2ccccc21 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133195", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#C/C(=C\\c1ccccc1Cl)C(=O)Nc1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63639", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1ccc(F)cc1)NCc1cn2ccsc2n1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248733", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@@H](c1cc(F)cc(Br)c1)C(C)(C)C by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185109", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ncc2c1CCC[C@@H]2[NH2+][C@@H]1CCCN(CC(F)(F)F)C1=O by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18388", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CN(Cc1ccccc1F)C1CC1)C2=O by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159926", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCCC[C@@H]1NC(=S)NNC(=O)c1ccccc1F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240772", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1ccc(/C=C2/SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1[N+](=O)[O-] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220630", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C1CCC(C#N)([C@@]2(O)CC[C@H](C)[C@@H](C)C2)CC1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212182", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC/C(Cc1ccccc1)=N\\NC(=O)C(=O)Nc1ccc(Cl)cc1C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190455", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc(OCC(F)F)nc1)N1CC[C@@H](Cc2ccccc2)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91884", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CNC(=O)c1ccc(Cl)c(NC(=O)c2cccc3ncccc23)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152462", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1CCC[C@@H](S[C@H](F)C(=O)[O-])C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215040", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1/C(=C/c2ccc(O)cc2)SC(=S)N1[C@H]1CCS(=O)(=O)C1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68837", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCOC(=O)c1sc(NC(=O)/C=C/c2cnn(C)c2)c(C#N)c1C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33404", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[C@H]1C[C@H](Nc2nc3ccc([N+](=O)[O-])cc3o2)CC[C@H]1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58513", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccccc1-c1cnnc(NCCc2cscn2)n1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158727", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(C(=O)C2=C([O-])C(=O)N(C)[C@@H]2c2ccc(I)cc2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24059", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(NC[C@@H]1CCC[C@@H](O)C1)C(=O)Nc1ccc2c(c1)C(=O)CCC2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107219", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule [NH3+][C@@H](c1cc(Br)ccc1Cl)c1c(F)cc(F)cc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75557", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C#Cc1cc(F)c(NC(=O)CN2C(=O)[C@@H]3[C@H]4CC[C@H](O4)[C@@H]3C2=O)c(F)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165595", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NC(=O)CC1CCN(C(=O)/C=C/c2ccc(Cl)s2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121218", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)[C@H](C#N)c2nc3ccccc3s2)cc1C by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126406", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CCCl)C(=O)c1csc(I)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199588", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)CNC(=O)[C@@H](C)Oc1ccc(F)cc1[C@@H](C)O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5264", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc(C2=Nc3ncnn3/C2=N\\Cc2ccc(F)cc2)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237934", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1nc([C@H](C)NC(=O)[C@@H](C(C)C)n2cnc3cc(F)c(F)cc32)cs1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210511", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C(NC1CC1)[C@@H](c1ccccc1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246131", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CN1C(=O)NC2(CCCC2)C1=O)Nc1nnc(SCc2ccccc2F)s1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12364", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Nc1ccc(C(F)(F)F)cc1C(=O)NCC1CCCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80648", "split": "OpenMolInst" } }, { "instruction": "Substitute a carboxyl in the molecule COC(=O)c1ccc(NC(=O)C2CCN(C(=O)O)CC2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120504", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H]1CCC[C@H]1C[NH2+]Cc1cccc(C2CC2)c1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136380", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CSCc1ccc(C(=O)[O-])cc1)Nc1ccc(Cl)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92770", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1nc(CNC(=O)c2cccc(CCC(C)(C)O)c2)no1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231479", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1CCC[C@@]2(C[NH+]=C(N)N2c2ccc(F)cc2)C1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35678", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]3CC[C@](O)(C(=O)COS(C)(=O)=O)[C@@]3(C)C[C@@H](O)[C@H]12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CCN(CCNC(=O)/C=C/c2ccc(OC)c(F)c2)CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95436", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN(Cc1ccc(OC)cc1)C(=O)Nc1ccc(Cl)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12218", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc2cccc(C(=O)Nc3cc(C(N)=O)c(F)cc3F)c2n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177920", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN1CCN(S(=O)(=O)c2cc(C(=O)Nc3ccc(Cl)c(Cl)c3)ccc2F)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1094", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@@](O)(C[NH2+][C@@H]2CCCC2(C)C)C1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186185", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([C@H]1COc2ccccc2O1)N1CCN(c2ccccc2F)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124737", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCC(=O)N1CCCCC[C@@H]2[C@@H]1[C@H](c1cccc(F)c1)C[NH+]2C by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153514", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N1CC[C@@H](NC(=O)N[C@H](c2ccccc2F)C2CCCC2)C1=O by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212127", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(Cl)ccc1C[NH2+][C@@H](C)c1nc2ccccc2n1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194833", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCN(C(=O)Nc2ccc(CCC(F)(F)F)cc2)[C@H]1CO by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(F)c(F)cc1F)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196719", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N=C1NC(=O)/C(=C/c2ccc(OCc3ccccc3Cl)cc2)S1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93142", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1cc2c(cc1C(=O)c1ccccc1F)OCCO2)c1ccc(Br)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219891", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)[C@@H]([NH2+]CCCc1nnc2n1CCCCC2)c1ccccc1Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115610", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)CN1CCN(CC(=O)NCc2ccc(Cl)s2)CC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119973", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1cc(CO)oc([C@@H](Nc2ccccn2)c2ccccc2Cl)c1O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228709", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=S(=O)(c1ccc(SCc2ccccc2C(F)(F)F)nc1)N1CCCCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30982", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCCn1ncnc1C[C@]1(C#N)CCCC(C)(C)C1=O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97794", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(CC[NH2+]Cc2ccccc2F)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80157", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc(C)c1NC(=O)CSc1nnc(-c2ccc(Br)cc2)n1N by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205187", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1cc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3[nH]c(=S)[nH]c(=O)c32)ccc1O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56066", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1cc(-c2cccs2)on1)c1ccc(Cl)cc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77335", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H]1CCCCN1C(=O)[C@@H](C)Sc1nnc(COc2ccc(F)cc2)n1N with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242422", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]1OCC[C@H]1C(=O)Nc1ncccc1Br with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174551", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C1CCCCC1)N1CCN(C[C@@H](O)c2cccc(F)c2)CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242456", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CN(C)c1ccc(-c2n[nH]c(=S)n2/N=C/c2ccccc2[N+](=O)[O-])cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84809", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCC(CC)NC(=O)[C@H](C)Nc1cccc(CO)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50738", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cc1ccccc1)N(CCCn1ccnc1)c1nc2c(F)cccc2s1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11029", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1cccc(N2CCc3sc(Br)cc3C2)n1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101140", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CO[C@H]1CCCC[C@H]1NC(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142834", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](CCCc1n[nH]c(N)c1C#N)Cc1cc(Cl)ccc1Cl by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223077", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)c1nn(-c2cc(Cl)ccc2Cl)cc1C=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63735", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@@H]1CCCCN1c1ncnc(NC2CC(C)(C)[NH2+]C(C)(C)C2)c1[N+](=O)[O-] with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242483", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H](C)NC(=O)C1CCN(c2ccc(Sc3cccc(F)c3)nn2)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200385", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(O[C@@H](C)C(=O)NCc2nc(-c3ccc(Cl)cc3)no2)ccc1Cl by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171579", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1ccc([N+](=O)[O-])cn1Cc1ccccc1OCC(F)(F)F by replacing a nitro by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118789", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COC[C@@H]1CCCN(C(=O)Cc2cccc(OCC#N)c2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61936", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CNC(=O)[C@@H]1CCCN1C(=O)c1cccs1)Nc1ccc(F)c(F)c1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202428", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1ccc(C(=O)CSc2cc(C#N)ccn2)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192723", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCC1CCN(C(=O)c2cccnc2)CC1)c1ccccc1C(F)(F)F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)nc(N(C)Cc2ccc(O)cc2)n1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176768", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])CCCCCn1cc(Cl)c(I)n1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220256", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C(=O)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cccc1[N+](=O)[O-] by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211252", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)[C@]12CC[C@](C)(/C(=N/O)C1=O)C2(C)C by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23718", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccccc1Cl)C(=O)NC[C@H]1OCCN1S(=O)(=O)c1ccccc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123242", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule N[C@]1(C(=O)[O-])CC[C@@H]([NH+]2CCC(C(F)(F)F)CC2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136498", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1ccnc1C[NH+]1CCC[C@H](CCc2ccccc2F)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160498", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(N[C@H]1CCCN(Cc2ccccc2)C1=O)N[C@H](CCO)C1CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23507", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)c1ccc(C(=O)NCCC(=O)Nc2ccc(Br)cc2)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79247", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=c1c2c3c(sc2nc(SCCO)n1Cc1ccco1)CCCC3 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78770", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@H]1C[C@@H](O)CN1Cc1[nH]cc(-c2cccc(Br)c2)[nH+]1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244868", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=c1ccc(-c2ccccc2F)nn1C[NH+]1CCC[C@@H]1Cc1ccccc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[C@@](CO)(Nc2ccc(Cl)c(Br)c2)C1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213846", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@H](O)C1CCN(C(=O)C(=O)Nc2cnc(C(C)(C)C)nc2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208045", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOc1c(F)cccc1C(=O)N(C)Cc1ccc(C(=O)NC)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20280", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCc1ccccc1-n1ccnc1)c1cnc2ccc(F)cc2c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90911", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1ccccc1F)c1cc2ccccc2o1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106604", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(NNC(=O)c1cccc([N+](=O)[O-])c1)N[C@@H](c1ccccc1)C1CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100642", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)N1CCNC(=O)[C@@H]1C by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115683", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule FC(F)(Cl)C(F)(F)C(F)(F)Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29252", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CN[C@H](c1ccc(F)cc1)c1cccs1)NN1C(=O)NC2(CCCCC2)C1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93996", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H]1CN(Cc2coc3ccccc23)CCO1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55716", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Nc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])ccc1[NH+]1CCCC1 by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178050", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1I)c1csc2c1CCCC2 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57459", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH2+]Cc1ccccn1)Nc1ccc([N+](=O)[O-])cc1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66367", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCOc1ncccc1C(=O)Nc1nc2c(cc1C#N)CCC2 by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64110", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1c(C(=O)NCc2ccc(C)cc2)sc2ccc(F)cc12 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165563", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NC(=O)N1CCN(c2ccc(Cl)cn2)CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49545", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc2nc([C@H](C)Cl)n([C@@H](C)C[NH+]3CCCC3)c2c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54017", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc(NC(=O)CCc2ncc(-c3ccccc3F)o2)s1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21364", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)c1cnc(N(C(=O)c2sc(Cl)nc2C)C2CC2)s1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42052", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[C@@H]([NH2+][C@H](CO)c1cnn(C)c1)C(C)C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218488", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc([C@@H](O)[C@H](C)NC(=O)c2c(F)cccc2F)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68618", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NC(=O)C(=O)N2CC[C@H](C)[C@H](O)C2)no1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100353", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@]1(c2ccc3c(c2)OCCCO3)NC(=O)N(CC(=O)NCC(F)(F)F)C1=O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82101", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@H]1C[NH+]2CCCC[C@@H]2CN1c1cccc(Cl)c1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108288", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C(=O)N2CCN(c3ccccc3F)CC2)sc2ncnc(N3CCCC[C@@H]3C)c12 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161603", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCCS[C@H](C)C(=O)Nc1ccccc1C(F)(F)F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50121", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2nc(NC(=O)C3CCCCC3)nn2c(C)c1Cl by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32647", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOC(=O)C1=C(COC(=O)c2oc3c(F)cccc3c2C)NC(=O)N[C@H]1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199401", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](c1ccc2c(c1)OCCO2)c1nc(Cc2ccc(F)cc2)no1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93727", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CCc1nncn1-c1ccccc1)NCc1cc(F)ccc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194861", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[C@@H](C)C[C@@H](C)NC(=O)N1CCC([C@@H](C)O)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192440", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(Cc1ccc(Cl)s1)C[C@@H](O)c1ccc(F)c(F)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39553", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cc(C[NH+]2CCc3nnc([C@H](C)NC(=O)c4cc(F)ccc4F)n3CC2)cc(OC)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72953", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(/C=N/NC(=O)COc2ccc([N+](=O)[O-])cc2)c(C)c1 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155666", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC[C@@H]1c1ccc2c(c1)OCCCO2 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233289", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#C[C@@H]1C(=N)C(C#N)(C#N)[C@H](c2cc(CN3CCOCC3)cs2)[C@H]2CCCC=C12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217688", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(Br)cc1CNC(=O)CCN1CCCC1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46182", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(F)c(C(=O)NC2(c3noc(C)n3)CCC2)c1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)CCNC(=O)C[C@@H](O)c1ccc(Cl)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37396", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCN(C(=O)c2ccc(-c3ccc(F)cc3)cc2F)C[C@H]1O by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180170", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(OC(F)F)c(C(=O)O[C@@H](C)Cn2cccn2)s1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42183", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)ccc1S(=O)(=O)N1CCC(NC(=O)Oc2ccccc2)CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198982", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H](C[C@H]1CCCCC[NH2+]1)[NH2+]C[C@H](O)C1CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129743", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CCC(=O)N1CC(=O)N(CCCN1CCOCC1)c1nc2ccc(Br)cc2s1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146527", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(Cl)cc1C(=O)[C@@H](C#N)c1nc(-c2ccc(Cl)cc2)cs1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90159", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule FC(F)CN1C[C@@H](C2CCCCC2)[NH2+]Cc2ccccc21 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247099", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc2oc(=O)c(CC(=O)c3ccc(F)cc3)nc2c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142010", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ncnc1NC(=O)NCc1ccc([N+](=O)[O-])cc1 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105003", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cnc2nc(-c3cc(F)c(F)cc3C(=O)[O-])[nH]c2c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216790", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@H](NC[C@@](C)(O)c1ccco1)C1CCCC1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(-c2nn(-c3ccc(F)cc3)cc2C(=O)NCC(C)(C)N2CCOCC2)c1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200949", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNC(=O)c1cc(C)ccc1NC(=O)c1cccc(Br)n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111067", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1CN(C(=O)C2CCN(c3ncccc3F)CC2)C[C@H](C)O1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99039", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule C=CCN(CCc1ccccc1)C(=O)c1ccc([N+](=O)[O-])c(O)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72026", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])c(NCc2ccc(C(=O)[O-])cc2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182304", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H]2C(C(=O)OC[C@H]3CCCO3)=C(C)NC3=C2C(=O)CCC3)cc1Cl by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103645", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]([NH3+])C(=O)N1CC[C@]2(CC[C@H](CCl)C2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55208", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1cc2cccc(Br)c2o1)N1CC[C@H](O)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125822", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)[NH2+][C@]1(CO)CCC[C@@H]1CCSC(C)C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160996", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(C)c1cc(NC(=O)c2ccc(F)cc2)n(-c2ccccc2)n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39890", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1cc2c(cc1Cl)OCCO2)[C@H]1CCCc2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218753", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCc1nc(CNC(=O)N[C@@H]2CCCC[C@H]2CO)cs1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93870", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNc1nnc(C2=NO[C@H](CNc3[nH+]cc(C(F)(F)F)cc3Cl)C2)s1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60194", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)Nc1cc(NC(=O)NCC(C)(C)c2ccc(Cl)cc2)c(F)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74843", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCC1(C(=O)[C@H](C#N)c2cccc(C)c2)CCCC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212343", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(C)[C@H](CNCc1ccc(F)cc1F)c1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170444", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COC(=O)N1CCN(Cc2cc(C)ccc2O)CC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1nc(N2CCO[C@H](c3ccc(Cl)cc3)C2)ccc1Cl by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47796", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CSc1nc(N2CCOCC2)c2cnn(CCNC(=O)[C@@H]3CC(=O)N(c4ccc(F)cc4)C3)c2n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187170", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC[C@@H](C(=O)[O-])[C@H](O)c1ccc(Br)cc1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236107", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(C(=O)NNC(=O)COc2ccc(Cl)c(C)c2)c(C)o1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35885", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](CC)Cc1cccc(NC(=O)c2ccc(I)cc2)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129314", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCC1(C2CC2)CCC1)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58691", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(NC(=O)CC[S@](=O)Cc2cccc(F)c2)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193193", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NCCc1cccc(O)c1)N1CCn2c(nnc2-c2ccccc2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232019", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](Cc1ccc(C)cc1)NC(=O)c1ccccc1[N+](=O)[O-] by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170601", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(Cl)cc(Cl)c1)[C@H]1CCCN1C(=O)c1ccc[nH]1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143832", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H](CNC(=O)Cn1cccc(C(F)(F)F)c1=O)c1ccccc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133455", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](OC(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12)C(N)=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143925", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C(C)C)sc1C(=O)NCc1ccc(OC(F)(F)F)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106193", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#Cc1cccc(NC(=O)c2cc(Cl)nc(Cl)n2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27929", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)cc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170657", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCN(C(=O)c1cn(-c2ccc(Cl)cc2)nc1C)[C@H](C)c1cccnc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214698", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C[C@H](O)C1CC1)C(=O)c1cc(C(C)(C)C)nn1C by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144557", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Nc1nnc(CCCOc2ccc(Cl)cc2Cl)s1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51212", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCn1cc[nH+]c1CCC[C@H](C)Cl by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189766", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(CC(=O)NCc2ccnc(OC(C)(C)C)c2)c(C)c1[N+](=O)[O-] by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52089", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule OCCSc1nc(-c2ccccc2)cs1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26951", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)NCCNC(=O)C(=O)Nc1ccc(I)cc1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188676", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3333", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCC[C@@H]1C[NH2+]CC[C@@H]1c1ccc(Cl)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120691", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Sc2ncn(-c3ccccc3)n2)cc(C#N)cc1[N+](=O)[O-] by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214404", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2[nH]cc(CCNC(=O)c3ccc(F)cc3)c2c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38974", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CCc1nc(-c2ccc(Cl)cc2)no1)Nc1cccc(Oc2cnccn2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84372", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N[C@@H](CO)c2ccc(Cl)c(F)c2)ncn1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182575", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNc1cc(C)[nH+]c(N2CCN(C(=O)Nc3ccccc3F)CC2)n1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43832", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nn(CC(=O)N2CCN(Cc3cccnc3)CC2)c(C)c1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218235", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)Nc2c[nH]cc(Br)c2=O)cn1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55592", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(CCC(=O)N1CCC([C@H](O)c2ccccc2)CC1)N1CCOCC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41358", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CC[C@@H]1N=C2c3ccccc3NC(=S)N2C1=O)NCc1ccc(F)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62276", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)NC[C@H]1CCO[C@H]1c1ccccc1 by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249349", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccccc1CCNC(=O)c1cnn(-c2ccc(Br)cc2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67124", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(-c2ocnc2C(=O)Nc2cc(Cl)c(Cl)cn2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188770", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CNC(=O)N(C)Cc1cccs1)Oc1ccccc1F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183622", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H]1CN(C[C@H](O)Cc2ccccc2)C(C)(C)CO1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133087", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Cn1cnc2nc(N3CCOCC3)ncc2c1=O)Nc1ccc(Cl)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](CCC#N)CC(=O)Nc1ccc(Cl)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43835", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCc1ccc(NC(=O)CN2CCN(c3cc(Cl)ncn3)CC2)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156151", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CN1CC[NH+](Cc2nc(-c3ccsc3)no2)CC1)Nc1ccc(Cl)c(C(F)(F)F)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237630", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH+]1CCN(C(=O)c2cc(F)ccc2Br)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231716", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH+](CC(=O)Nc1ccc(C(F)(F)F)cc1N)C1CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199974", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@H](C)c1ccccc1OC[C@@H](O)C[NH+]1CCC[C@H](C)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63014", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C[NH+]2CC[C@H](CO)C2)ccc1OC(=O)C1CC1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187254", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)c1cc(C[NH+]2CCC([C@H](O)c3ccc(Cl)cc3)CC2)c[nH]1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211228", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)Oc1ccc([C@H](O)[C@@H](F)C(=O)[O-])cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29657", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCCn1c(=O)oc(=O)c2cc(Cl)ccc21 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222287", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CN1CCO[C@H](C[NH2+]C[C@H](O)CO)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69422", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1ccc(Cl)cc1NC(=O)[C@@H]1C[C@@H]1c1ccccc1Cl by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70340", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(N2CCN([C@@H](C(=O)N(C)C)c3ccccc3)CC2)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175266", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1cc(S(=O)(=O)NCC(C)(C)CCO)sc1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188773", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1c(F)cc(NC(=O)N[C@@H]2CCC[C@H](C)C2)cc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77053", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1cccnc1N1CCC2(CC1)c1nc[nH]c1CCN2C(=O)C1CCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35059", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]1c1ccc(C)s1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66731", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1[NH2+]CC[C@H]1CNCc1cc(Br)cs1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133043", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(C(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCCC3)c2)cc1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39741", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCN1C(=O)[C@H](CC(=O)Nc2cc(Cl)ccc2C)S/C1=N\\c1ccc(S(N)(=O)=O)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242161", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H](CS)CSCc1ccco1 by substituting a thiol with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221888", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc(C(=O)N2CC[C@H](C)C[C@@H]2C)nn1-c1ccccc1Cl by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99438", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc(NC(=O)/C=C/c2c(Cl)cccc2Cl)sc1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32502", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Fc1cccc(SCCCNc2ccccc2)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173047", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC[C@H]([NH2+][C@H](C)C(C)C)c1cccc([N+](=O)[O-])c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139069", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ccc([N+](=O)[O-])cc1)Nc1ccc(I)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175165", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CON(C)C(=O)COc1ccc(F)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198649", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)Nc1ccc(CNC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120624", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cnc2ccccc2c1N[C@@H]1c2ccccc2C[C@H]1O by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204529", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1[C@@H](N[C@H]2CCOc3ccccc32)CCN1c1ccc(Cl)c(F)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46501", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C(=O)CCc1c(C)nc(C)[nH]c1=O)[C@@H](C)c1ccc(F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70678", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC[C@@H](OC(=O)[C@@H]1CCCc2[nH]ncc21)c1cccc([N+](=O)[O-])c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208947", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(Nc1ccnn1C1CCCCC1)N[C@@H](CO)c1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18394", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@H](Nc1snc(C)c1C#N)C(C)C by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189654", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cc(C[C@@H](C[NH2+]C)c2ccccc2F)n(C)n1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116541", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@]1(Cc2ccc(-c3ccccc3F)cc2)CCCN(C(=O)c2ccccn2)C1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234818", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCS(=O)(=O)c1cccc(F)c1)NC1CC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88801", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](NC(=O)c1ccoc1)C(=O)Nc1ccc(F)cc1OCC1CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97109", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H](COc1ccccc1F)NC(=O)N1CCC(CN2CCOCC2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224155", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CS(=O)(=O)[N-]c1ccc(O)c(C(=O)N(Cc2ccc(Cl)cc2)C2CC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112596", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ncccc1N1CC[C@H](C)[C@@H](O)C1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52911", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)Nc1cccc(OCCNC(=O)N[C@H](C)c2ccc(Cl)c(Cl)c2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150301", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C(=O)NC(=S)NCc1ccc(Cl)cc1Cl by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248022", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)[C@H]1[NH+]=c2ccc(Cl)cc2=C1NC(=O)CN1CCN(c2ccc(OC)cc2)[C@H](C)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234276", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H](CCc1ccccc1)NC(=O)[C@@H](C)O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229066", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCc1nn(C)c(C[C@@H]([NH3+])[C@@](C)(CC)N(C)C)c1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103518", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cc(Cl)cc(Cl)c1)C(=O)CCn1ccccc1=O by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82475", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1c[nH]c(C[NH+]2CCCC[C@@H]2CCc2cccc(O)c2)c(C)c1=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244353", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1cnc(Cl)nc1NCc1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124152", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1ccccc1O by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63366", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule [NH3+][C@H](Cc1cccc(F)c1F)c1cc(Cl)sc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7158", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNC(=O)c1ccc(C[S@](=O)[C@H](C)C(=O)Nc2ccccc2F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52360", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccccc1C(=O)N1CCN(c2cccc(Cl)c2C)C(=O)[C@@H]1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205534", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1ncc2c(C(=O)Nc3ccc(Br)cc3F)cc(-c3ccccc3)nc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106277", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1ccc(-c2nnc(SCc3ccc([N+](=O)[O-])cc3)o2)cc1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134141", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1[NH2+]CC[C@H]1C(=O)N(C)Cc1cc(C#N)ccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128206", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(NS(=O)(=O)c2cnn(C)c2)nc2cc(Cl)ccc21 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49152", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)=C1[C@H]2CC[C@@H]1[C@@H](C(=O)NNC(=O)COc1cc(C)c(Cl)c(C)c1)[C@H]2C(=O)[O-] by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227544", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule Cn1c(=O)/c(=C\\c2ccsc2)s/c1=C(\\C#N)C(=O)c1ccccc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44981", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CSc1sc(C#N)c2c1/C(=N\\OC(=O)c1ccccc1Cl)CCC2 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228370", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)c1ccc(N[C@H]2CCC[C@@]2(C)CO)nc1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166976", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H](C)NC(=O)c1ccc(C)cc1Cl by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131347", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C=C(C)COc1cccc(NC(=O)C(=O)N[C@H]2CCCC[C@@H]2CO)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116526", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(Cl)c(Cl)c1)OCCCc1ccncc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83456", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-n2cc(C(=O)NCc3ccc(Br)cc3)nn2)cc1C by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240684", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC(=O)C1=C([O-])C(=O)N(CC[NH3+])[C@H]1c1ccc(F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241919", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H](CNC(=O)N1CC[C@@H]([N+]2=CCCC2)C1)Oc1cccc(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149533", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1S(=O)(=O)N(C)CC(=O)Nc1c(F)cccc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182553", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CC[C@@H]1CCCO1)N1CCN(Cc2ccc(Cl)cc2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58149", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cn1ccnc1[C@@H](NC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170419", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C[C@H]1CCCC[NH+]1[C@@H]1CCOC2(CCCCC2)C1 by replacing a aldehyde by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129346", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#CCCNC(=O)CSc1nnc(NC2CC2)s1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86573", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C=CCN(CCc1ccco1)C(=O)[C@H]1C[C@H]1c1ccc(F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172858", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cccc(C(F)(F)F)c1)N1CC[C@@](O)(C(F)(F)F)C1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98754", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCSc1nnc2c(n1)O[C@@H](c1ccc(C#N)cc1)N(C(C)=O)c1ccc(C)cc1-2 by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7425", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(C(=O)Nc2ccc(Br)c(C)n2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149630", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)CCNC(=O)NC[C@@H](O)c2ccccc2F)c(Cl)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152724", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COCC[C@]1(O)CCN(C(=O)c2cnn(C)c2)C[C@H]1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188932", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1cnns1)N1CC=C(c2cncc(F)c2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170711", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)(C)[NH+](CCS(C)(=O)=O)Cc1cc(F)c(F)cc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117630", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(Cl)ccc1OCC(=O)N(Cc1cccc(F)c1)Cc1ccco1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202494", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cc(N)c(O)cc1C#N by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227742", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c(Br)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232956", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@H](SC[C@@H](O)CO)C(=O)NC1CCCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152236", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc2oc(-c3ccc(F)cc3)nc2c1)c1ccccc1[N+](=O)[O-] by substituting a nitro with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78326", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cccc(O)c1)NNc1ccc(-c2ccccc2)nn1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241510", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CNC(=O)[C@H]1CCC[NH+](C[C@H](O)COCc2ccccc2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221754", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)CCn1c(=O)[nH]c(=O)c2ccccc21)c1cc(F)ccc1N1CC[NH+](C)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86810", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=c1c2cc(Cl)ccc2ncn1CN1CCN(c2ncccn2)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118460", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+][C@H](Cc1ccc(C)cn1)c1cccc(F)c1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223565", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Clc1ccc(-c2cnc3ccc(I)cn23)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68732", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CCc1cnc(Cn2cnc(-c3cccc([N+](=O)[O-])c3)n2)o1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180972", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(-c2nsc(SCC(=O)Nc3ccccc3C(F)(F)F)n2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165297", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@@H](C[C@@H](O)[C@@H]1CCOC2(CCC2)C1)c1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38496", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](O)c1ccn(C[C@H]2CCCO2)c1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59701", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H](O)c1ccsc1)c1cc(C2CC2)nc2ccc(F)cc12 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47503", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCc1cccs1)c1c(F)cc(Br)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196760", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@H](F)c1cc(C)cc(C)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62583", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccccc1NC(=O)[C@@]1(c2ccccc2)CC1(Cl)Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249084", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O[C@](c1nc2ccccc2o1)(c1c[nH]c2ccccc12)C(F)(F)F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79963", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cn1ccccc1=O)Nc1ccc(Oc2ccc(F)cc2)c2ccncc12 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145589", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1[nH+]ccn1CC1(O)CC[NH+](CC2CCCCC2)CC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176423", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[NH+]1CCN2CCN(Cc3ccc(C#CCO)cc3)C[C@@H]2C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118462", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1918", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccc(Br)c1)[C@H]1Cc2[nH+]c[nH]c2CN1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184816", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@H](Cc1ccccc1)C(=O)N[C@@H](C#N)C(C)(C)C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70485", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule C[C@H](Oc1ccc2ccccc2c1)C(=O)N/N=C\\c1cc([N+](=O)[O-])ccc1[O-] by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123811", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(F)cc([N-]S(=O)(=O)c2c[nH+]c[nH]2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17096", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH+](C)CCNC(=O)C(=O)Nc1nnc(Cc2cccc(Cl)c2)s1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231115", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COC[C@]1(O)CCN(C(=O)c2ccccc2-c2ccc(F)cc2)CC1(C)C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15177", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N(Cc2ccc(F)cc2)C[C@H]2CN(Cc3cccnc3)CCN12 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13113", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cc(C(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2O)cc(OC)c1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65467", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccccc1CO/N=C\\C(=O)Nc1ccc(F)cc1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138074", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC(=O)Nc1ccc(F)c(C(=O)N(C)C2(C#N)CCC2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161646", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c(c1)[C@@H](Nc1cc(F)c(F)c(F)c1)CC2 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72300", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)NC[C@H](c1ccc2c(c1)OCO2)N1CCN(c2ccc(F)cc2)CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64079", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(C)[C@H]1CCC(=O)[C@@H]([C@@]2(O)C(=O)Nc3ccc(Br)cc32)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180081", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1cc(Cl)ccc1N1CCCCC1)N1CCCOCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131901", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)C2CCN(C(=O)c3ccccc3Cl)CC2)c(C)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101617", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(OC)cc([C@@H]2CCN(C(=O)c3cc(F)ccc3OC)C2)c1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59935", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1c(Nc2ncc(C(F)(F)F)cc2Cl)nc[nH+]c1N1CCc2ccccc21 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150585", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(OCC(=O)Nc2ccc(I)cc2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226237", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1c(O)ccc2c1O/C(=C\\c1ccco1)C2=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215699", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1ccc(C(=O)NNC(=O)COc2ccccc2[N+](=O)[O-])cc1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116110", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](CCNc1nnc(Cl)cc1C(N)=O)C1CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180818", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(COC1CCCC1)Nc1cccc(Cl)c1-n1cccn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55075", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1ccc(C(=O)N2CCC[C@@H](CCc3ccccc3C(F)(F)F)C2)n1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10903", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3215", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC(=S)Nc1cccc(Cl)c1Cl)c1ccc(Cl)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112379", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCn1c(S[C@H](C)C(=O)Nc2ccc(Cl)cn2)nnc1-c1cccs1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186450", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cn(-c2ccccc2)nc1-c1ccc([N+](=O)[O-])cc1)Nc1[nH+]cccc1[O-] by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9964", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)C[C@]1(C)NC(=O)N(Cc2ccc(Cl)c(Cl)c2)C1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20810", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN[C@@]1(C#N)CCC[C@@H]([NH+]2CCC[C@H]3CCC[C@@H]32)C1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34069", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccccc2F)N3)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196128", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=C(Nc1nnc(C2CC2)s1)c1ccccc1[N+](=O)[O-] with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68997", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)CCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)s1 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24558", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC(=O)C1=C(C)OC(N)=C(C#N)[C@@]12C(=O)Nc1ccc(Br)cc12 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5402", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule N#Cc1cccc(CN2C(=O)[C@@](O)(c3cccc(F)c3)c3ccccc32)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177179", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)Nc2ccc(-c3cc[nH]n3)cc2)cc1[N+](=O)[O-] by replacing a nitro by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43616", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H](C)N(C)C(=O)NCc1cc(F)ccc1Br with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155124", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(C(=O)N(C)[C@@H](C)Cc2ccc(Cl)cc2)nn1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155865", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](C#N)CNC(=O)C(=O)Nc1cc(F)ccc1Br with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186883", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C[C@H](C)C#N)C(=O)Nc1cccc(C(=O)Nc2ccccc2)c1C by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173961", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule N#CC1=C(N)Oc2n[nH]c(-c3ccc(F)cc3)c2[C@@H]1c1ccc(Br)s1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188047", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCCOc1cccc(Cl)c1)Cc1nc2c(oc3ccccc32)c(=O)[nH]1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144197", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule OC1(C(F)(F)F)CC[NH+](Cc2ncc(-c3cccc(Cl)c3)o2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168644", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2cc(NC(=O)C(=O)N3CCC[C@@H](O)C3)ccc2o1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229691", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)[NH2+][C@]1(CO)CC[C@@H](Sc2nncs2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245231", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(F)c([C@@H](Br)[C@]2(C)CCCO2)c(F)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196371", "split": "OpenMolInst" } }, { "instruction": "Please substitute a aldehyde in the molecule O=Cc1sc(Oc2ccccc2)nc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24580", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=c1[nH]c(-c2ccc(F)cc2)nc2ccsc12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18673", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc(C[C@@H]2[NH2+]CCc3cc(O)c(OC)cc32)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43893", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1csc2nc(CNc3ccc(F)c(F)c3F)cc(=O)n12 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151784", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccccc1Nc1ccnc2c(F)cccc12 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77211", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1909", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc([C@H]2CCCN(C(=O)C(=O)Nc3ccc(C#N)cc3)C2)n1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228129", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCc1ccc(C(=O)Nc2nc(-c3cccc(C(F)(F)F)c3)cs2)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126481", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(/C=N/NC(=O)c2ccc(O)cc2)ccc1OC(=O)c1ccccc1Cl by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209381", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(/N=C/c1ccc([N+](=O)[O-])o1)c1ccccc1 by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202753", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cn1ccnc1C(=O)N[C@H](c1ccc(Cl)cc1)c1ncon1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220087", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NC(=O)c1c(NC(=O)c2cncc(Br)c2)sc2c1CCCCC2 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237906", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(F)cc1-n1nnc(C(=O)N2CCC[NH+](C)CC2)c1C by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144847", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C/C=C\\c1ccc(OCc2nc3ccc(F)cc3[nH]2)c(OC)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97682", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(O)c(-n2cc3c(c2-c2cccc(Br)c2)c(=O)n(C)c(=O)n3C)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92638", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [S-]c1nnc(COc2ccccc2I)n1-c1ccccc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54456", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OC1=Nc2c(ncn2-c2cccc(Cl)c2)[C@H](c2ccsc2)C1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173622", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH+](CC)CCN1C(=O)c2oc3ccc(F)cc3c(=O)c2[C@H]1c1cccc(Cl)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173938", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H](O)[C@H](C)NC(=O)[C@@H](C)NC(=O)C(C)(C)C)cc1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133437", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule OCCN1CC[NH+](Cc2sccc2Br)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210913", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCN([C@@H]2CC[NH+](Cc3ccc(Cl)cc3)C[C@H]2O)CC1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164941", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(C[C@@H]1Sc2ccc(C(F)(F)F)cc2NC1=O)NCCc1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46794", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@@H](C1CCCCCC1)[C@H]1CCO[C@]2(CCOC2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2317", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=[NH2+])c1ccc(OCc2cccc(O)c2)c(Cl)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247860", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CC(=O)N[C@H]1CCC[NH+]([C@@H](C)C(=O)Nc2ccc(C)c([N+](=O)[O-])c2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205098", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1ccc(Br)o1)N(CCO)Cc1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19038", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC1(C)S[C@H](c2ccccc2O)[NH2+][C@H]1C(=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149055", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCC[C@@H]([NH3+])c1ccn(Cc2cccc([N+](=O)[O-])c2C)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173381", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CC(=O)Nc1cccc(F)c1)[NH2+][C@H]1CCN(CC(F)(F)F)C1=O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239926", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C=CCn1c(C)cc(C(=O)CN2C(=O)N[C@@](C)(c3ccc(Cl)cc3)C2=O)c1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62858", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CSCC[C@@H]1NC(=S)N(c2ccc(F)c(C(F)(F)F)c2)C1=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144177", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(C[NH2+]Cc2ccco2)c(F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158764", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule [NH3+]C[C@H](O)Cn1c(C(F)(F)F)nc2ccccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215244", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cccnc1)N1CCC(c2ccc(C(F)(F)F)cc2)CC1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169697", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@](C)([C@H](N)Cc1cccc(O)c1)[NH+]1CCCC1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87516", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@]31CC[NH+](C)C2 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76401", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NC(=O)[C@H]1CCC[C@H]1NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104461", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CSC(C)(C)CNC(=O)c1cc2cccc(F)c2o1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234913", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1Cn1nc(C)c(NC(=O)c2cccc(C#N)c2)c1C by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204475", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=S(=O)(c1cccs1)N1CCN(Cc2nc(-c3ccc(Cl)cc3)no2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149963", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule NS(=O)(=O)CCCC(=O)N1C[C@@H](C[NH+]2CCCC2)[C@@H](CO)C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220698", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(Cl)ccc1Cl)[C@H]1Cc2ccccc2O/C1=N\\O by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204637", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1cc(C2CC2)[nH]n1)c1ccc(Br)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62007", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CCOc1ccc(/C=C2\\N=C(c3ccccc3[N+](=O)[O-])OC2=O)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184783", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](NC(=O)c1cc(Cl)ccc1OC1CC[NH+](C2CCCC2)CC1)C(N)=O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168059", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCCCOc1cccc(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92481", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCSc1ccc(Cl)cc1C(=O)NCc1ccc([N+](=O)[O-])cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166637", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCOc1ccc(Cl)cc1C[NH+]1CCC2(CC1)CNC(=O)C2 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143289", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@](C)(C[NH3+])[C@H](O)C1CCCC1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44694", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cc(F)cc(Br)c1)c1cnccn1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183836", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC[NH+](C)C)C(=O)CC1(O)CCCCC1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33800", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)c1[nH]c(C)c(C(=O)Nc2ccc(Cl)cc2)c1CC with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21197", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc([C@H](O)[C@H](C[NH3+])c2ccccc2Cl)cc1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70068", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(NC(=O)N2CCCN(C(=O)c3ccsc3)CC2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65597", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1cc(C(=O)Cn2cnc(-c3ccc([N+](=O)[O-])cc3)n2)c(C)n1-c1nccs1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161699", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[NH2+][C@H](C)c1ccnc(N2CCC[C@H](O)C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58852", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H](C)NC(=O)Nc2ccnn2C(C)C)cc1F by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129427", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Br)c(NC(=O)/C=C/c2ccccc2)cc1OC by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136974", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Nc1ccc([C@@H]2CCC[NH2+]2)cc1OC(F)(F)F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79202", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Cl)c2c(c1)[C@@H]([NH2+]Cc1ncccc1F)CCCO2 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41779", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1cccc(C(F)(F)F)c1)[C@H]1CC=CC[C@@H]1C(=O)N1CCOCC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21081", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@@H](Cc1cc(F)ccc1F)[C@H](C)OC by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166649", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(C(=O)CC[C@H]1CCCO1)[C@H](c1ccccc1)c1ccc(F)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55868", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](c1cc(F)cc(F)c1)[NH+]1CC[C@@H](C(=O)[O-])[C@H]1C by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180370", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nnc(NC(=O)c2ccccc2NC(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)s1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201625", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CS(=O)(=O)c1cccc(C(=O)N(CC#N)C2CC2)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93294", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(F)cc1C[NH2+]C[C@@]1(O)CCCN(CC(C)(C)C)C1=O by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195036", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c(Cl)cccc1NC(=O)C[C@@H]1S/C(=N\\C2CC2)NC1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38333", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(F)ccc1F)c1ccc(=O)n(Cc2ccccc2F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239899", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)[C@H](C(=O)N1CCOC2(CCCC2)C1)c1ccccc1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128728", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC1(C)Cc2c(sc3c2c(=O)n(CCO)c(=O)n3CC(=O)Nc2nccs2)CO1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156655", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@H](CN1CC[NH+](C/C=C/c2ccccc2)CC1)c1ccc(Cl)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206095", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192236", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1ccc(SCCC[NH2+]Cc2ccc(Cl)nc2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72024", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule N#CCCNC(=O)[C@H]1C[C@H](O)C[NH2+]1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105773", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc(CCC(=O)N2CCC(OCc3ccccc3F)CC2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36660", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(C(=O)[O-])c2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25083", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[NH+](CCc1ccc2c(Br)ccc(O)c2n1)C1CCCCC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243295", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C/C(=C\\CC[P@@](=O)([O-])OP(=O)([O-])[O-])CO with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36488", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCOc1cc(/C=C2\\C(=O)N=C(N)N2C)cc(Br)c1O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18389", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ncc(CN(C[C@@H](O)c2ccc(F)cc2)C2CC2)s1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40058", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc(N2CC[C@@H](Cc3ccccc3)C2)c(C#N)c1C by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95200", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1nc(CC(=O)N[C@@H](C)c2cccc(C#N)c2)cs1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202481", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(C1=C([O-])C(=O)N(CCN2CCOCC2)[C@@H]1c1cccc(O)c1)c1ccc(Br)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65365", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc([S@@](=O)CC(=O)Nc2ccc(OC(F)F)cc2)nc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120806", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(-n2nc(CC(C)(C)C)c(Cl)c2N)ncn1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183944", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc([C@@H]2C[C@@H]2/C([O-])=N/S(=O)(=O)CCCF)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36163", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCCO)N[C@@H](Cc1ccc(Cl)cc1)c1ccccc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8780", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCc1cccc(C)c1NC(=O)N(C)Cc1ccccc1O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46491", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@H]1CCO[C@]2(CCOC2)C1)[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204777", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@H](CNC(=O)C[C@H](O)c1ccccc1)Oc1ccccc1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236796", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCNC(=O)NCCOc1ccc(Cl)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141239", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(F)c(C[NH2+][C@H]2C[C@H]3C(=O)N[C@H](CC(C)C)C(=O)N3C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75152", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)c1ccc(N2CCC(NC(=O)C(=O)Nc3ccccc3F)CC2)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40361", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)C1CCN(C(=O)Nc2ccc(F)cc2OCC2CC2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29926", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)c2ccc(C(=O)Nc3ccccc3F)o2)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233628", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1c(CC(=O)N2CCC(C(=O)[O-])(c3ccccc3)CC2)c(=O)oc2c(C)c(O)ccc12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126294", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C1CCC(=O)N1CCN1CCN(Cc2cc(Cl)ccc2F)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101043", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Brc1cnc(NC[C@@]2(N3CCOCC3)CCSC2)nc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140003", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NCC(=O)Nc2cccc(C(=O)NC(C)(C)C)c2)cc1Cl by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61083", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCNC(=O)CNC(=O)N[C@@H](c1ccc(F)cc1)c1cccs1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74531", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)CN(C(=O)c1cc(Cl)ccc1OC(C)C)C1CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87430", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(SCc2n[nH]c3c2[C@H](c2cccs2)C(C#N)=C(N)O3)cc1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43596", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](O)[C@H]1C[C@@H]1c1cccc(C(F)(F)F)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14656", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)(C)CC(C)(C)NS(=O)(=O)c1ccc(F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222665", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](OCC1CC1)C(=O)N1CCC(O)(C(F)(F)F)CC1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224731", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cccc(C(=O)N[C@@H](C)c2ccc(OC(F)F)cc2)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66892", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCCCNc1ccccc1C(=O)N1CC[C@H](C)[C@@H](O)C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104554", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#C[C@H](NCc1ccccc1)c1ccc(C2CC2)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156842", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@@H](c2sc3ncnn3c2O)N2CCN(c3ccccc3F)CC2)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13074", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccccc1NC(=O)CSc1ccccc1N by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110097", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1nnc2ccc(N3CCC[C@@H]3c3ccc(F)cc3)nn12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79081", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=S)Nc2cccc(Cl)c2)o1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234033", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CN(CC(C)(C)O)C(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196231", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1[C@H]([NH+]2CCC3(CC2)OCCO3)CCN1c1c(F)cccc1F by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75973", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@@H]1C[C@H](O)CN1C/C=C/c1ccc(F)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102925", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@@H](O)[C@@H](C)NC(=O)CCn2ccccc2=O)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204068", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CS(=O)(=O)c1ncc(C[NH+]2CCC(Oc3ccccc3F)CC2)n1C[C@H]1CCCO1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221805", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(OCn2ccc(C(=O)Nc3cccnc3Cl)n2)ccc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80754", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)Cn1nnc(-c2cccc(Cl)c2)n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230467", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(N2CC[NH+](C)CC2)ncc1C(=O)N1CC[C@H](CO)[C@@H](O)C1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131563", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)NC(=O)c1ccc(OC[C@@H]2CCCN2C(=O)c2cccc(F)c2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207835", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(Cc2nc(-c3ccc(F)cc3)cs2)cs1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27786", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)NC[C@@H]1CCCO1)[C@@H](c1ccccc1)c1ccc(F)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185566", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cccc(O)c1)C[C@H]1CCC[NH+](CCc2ccc(Cl)cc2)C1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121493", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nn(C)c(C)c1C[NH2+]CCOc1ccc(Cl)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208871", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2nc(C)c(=O)n(CCC(=O)N3CCN(c4ccccc4F)CC3)c2cc1C by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161751", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(N2CCN(C(=O)c3ccc4c(c3)OCCCO4)CC2)nc1 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22143", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccnc(-c2ccccc2)n1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134488", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(C)n(Cc2ccc(C(=O)N3CCC[C@@H](c4nc(C)ncc4-c4ccc(F)cc4)C3)cc2)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147306", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=CN1CCN([C@H](C(=O)NC2CCCCC2)c2cc3c(cc2[N+](=O)[O-])OCO3)CC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193577", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(Cc1ccc(N2CCCC2=O)cc1)N1CCC(O)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113895", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCSc1nnc2c(n1)O[C@H](c1ccc(F)cc1F)N(C(C)=O)c1ccccc1-2 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151649", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C([O-])c1cn(-c2cc(F)cc(F)c2F)c(=O)[nH]c1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195985", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CN(Cc2csc(-c3cccc([N+](=O)[O-])c3)n2)CC[S@@]1=O by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227134", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@](C)(Nc1cc([N+](=O)[O-])ccc1C)C(=O)[O-] by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10552", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(Oc2ccc(Cl)cc2)nc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33348", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@]1(C)C[C@]2(CC[NH2+]C[C@@H]2c2ccccc2F)CCO1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152845", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H]2CCC[NH+]2C[C@H](O)c2cccs2)c(OC)c1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212308", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#C[C@H]1[C@@H]2CCCC[C@@H]2S[C@H]1NC(=O)CSc1cn[n-]n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147929", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCN(CCS(=O)(=O)OCC(F)(F)C(F)F)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144905", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Oc1nc2ccc(-n3cnnn3)cc2nc1O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82128", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1c(Cl)nc2sccn12)NCc1ccccn1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173319", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)[C@H](CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C1CC1 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145650", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@H]1CCCC[NH+]1[C@@H](C)C(=O)Nc1ccc(N)cc1Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125477", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](C1CC1)N(C(=O)c1ccc(F)cc1)C1CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64545", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C([C@H](O)c1ccccc1)N1CC2(CC2)c2ccccc21 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195377", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C1C[C@@H](NNc2ccc([N+](=O)[O-])cc2)C(=O)N1c1ccc(Cl)c(C(F)(F)F)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207629", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccccc1-c1nnc2sc(NC(=O)c3cccc(Cl)c3)nn12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151443", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(-n2c(C)cc(/C=C/C(=O)N(Cc3nnc(-c4ccccc4Cl)o3)C3CC3)c2C)no1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100670", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CN(C)c1ccc(C(=O)NC[C@H](O)c2cccc(OC(F)F)c2)c(F)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141390", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C=CC[NH+](C)C[C@]1(O)CCCN(Cc2cc(OC)ccc2F)C1=O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227038", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc([C@H](CO)[NH2+][C@H](C)c2cc(F)ccc2F)cc1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110098", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)Oc1ccccc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145028", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C[NH2+]Cc2ccc3c(c2)CCC3)cc(C)c1F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208901", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1([N+](=O)[O-])COP(=O)(Nc2cccc(Br)c2)OC1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233876", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(C(=O)N2CCC(NC(=O)c3cc(F)ccc3NC(=O)[C@@H]3C[C@H]3C)CC2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111924", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(Nc1ccc(C(=O)N2CCOCC2)cc1)c1cccc([N+](=O)[O-])c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228127", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H]1CCCN(C(=O)Cc2ccc(F)c(F)c2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218430", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN(CC#N)Cc1cn(C)nc1-c1ccc2c(c1)OCCCO2 by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124642", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccc(C(=O)N2CCOCC2)cc1 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14250", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)Oc1ccc(Br)cc1/C=N/n1nnnc1N with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177963", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Nn1c(N/N=C/c2cccc([N+](=O)[O-])c2)nnc1SCc1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204933", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(Br)c(C[NH2+]C[C@@H]2CN(Cc3ccccc3)CCO2)cc1O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201756", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H](Cc1ccc(O)cc1)NC(=O)C(=O)Nc1ccc2c(c1)Cc1ccccc1-2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107224", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cccc([C@@H](O)C2(N3CCOCC3)CCCC2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4206", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1cccc(NCCC(C)(C)O)c1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221029", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1N1C[C@@](O)(c2ccc(F)cc2)[N+]2=C1CCCC2 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23618", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CS(=O)(=O)c1cncnc1[C@@H]1CCCN(C(=O)C2(c3ccc(F)cc3)CCCC2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134148", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1nn(C)cc1CCC(=O)N1CC[C@@H](C)[C@H](O)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33447", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Oc1cccc(C(F)(F)F)c1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237868", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)cc1F)c1ccc(N2CCCCS2(=O)=O)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=S)/[NH+]=N/c2c(O)[nH]c3ccccc23)cc1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109186", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(Oc2nc(C(F)(F)F)nc3ccccc23)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58124", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1c(C(=O)NC[C@H]2CCCCO2)cccc1C(F)(F)F by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165433", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH+](CC)CC(=O)N1N=C(c2cccs2)C[C@@H]1c1ccc(F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83983", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@H]1CN(C/C=C/c2ccccc2[N+](=O)[O-])[C@H](C)CO1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9845", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](C(=O)Nc1ncccn1)[NH+](C)Cc1ccc(F)cc1F by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145437", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)c2cc(S(=O)(=O)NCCc3ccc(Cl)cc3)ccc2F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19563", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(F)cc1C(=O)Nc1cccc(OC[C@@H]2CCCO2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22476", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@H]1CCc2sc(-c3nnc(SCc4nc5ccc(Cl)cc5n4CCO)o3)cc2C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141494", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccccc1COC1CCN(CC(F)(F)F)CC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226236", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(S(=O)(=O)Nc2cccc([N+](=O)[O-])c2)cc1 by substituting a nitro with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201803", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1[C@H](O)CNC(=O)Nc1cnn(-c2ccccc2F)c1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240331", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1csc(C(=O)Nc2cccc(CN3CCCCC3=O)c2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128029", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2nc[nH]n2)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41098", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule COc1ccc2[nH]c3c(=O)n(/N=C/c4cccc([N+](=O)[O-])c4)cnc3c2c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214247", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1N(C)CC[C@@H]1CCC[C@]1([NH3+])CO by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118870", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[NH+]1CC[C@@H](N(C)C(=O)COc2ccc(F)cc2)[C@H](C)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217191", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1CCN1CC[C@H](C)[NH2+]C[C@H](C)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)NNC(=O)c1cccs1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206696", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([N+](=O)[O-])ccc1NC(=O)N(C)CCO by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36238", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](SCc1cc(-c2ccc(Cl)cc2)no1)C(=O)NC(C)(C)C by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2198", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccc(CCC(=O)N2CCc3ccc(Cl)cc3C2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63591", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=O)([S-])O[C@H]2[C@H]1O by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243946", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(F)c(F)c1)N[C@@H]1C[C@@H]1c1c(F)cccc1F by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25493", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Clc1ccc(C[NH2+][C@H](Cn2cncn2)c2ccccc2)o1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106911", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1coc(C(=O)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1=O by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54764", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CCc1cccc(F)c1)OCc1ccc(-n2ccnc2)nc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192984", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccccc1C(=O)NC(=S)Nc1ccccc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80333", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CNC(=O)[C@@H]1CCC[NH+](Cc2ccc(-c3ccc(OC)cc3[N+](=O)[O-])o2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243024", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S(=O)(c1cccc2nonc12)N1CCN(Cc2cccc(F)c2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190826", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(C)cc(Nc2c(F)c(F)nc(F)c2F)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35498", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)N1CCC[NH+](C2CCOCC2)CC1)c1ccc(Cl)s1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203553", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)Nc1nc2c(s1)CN(C(=O)c1ccc(F)cc1)CC2 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205670", "split": "OpenMolInst" } }, { "instruction": "Please replace a aldehyde in the molecule Cc1cc(C=O)c(C)n1-c1cc(C(=O)[O-])cc(C(=O)[O-])c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189270", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N/N=C/c1cc2ccccc2nc1Cl)c1nc2ccccc2c(=O)[nH]1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(CNC(=O)C2CCN(c3cccc[nH+]3)CC2)cc1F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161513", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(F)cc1NC(=O)C[NH+]1CCC(c2nc(-c3cccs3)no2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157648", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(CCc1ccccc1OC(F)(F)F)N[C@H]1c2ccccc2C[C@@H]1O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232431", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(C)n(-c2ccccc2NC(=O)c2cccnc2Cl)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136707", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccc2nc(N[C@@H]3C=CS(=O)(=O)C3)oc2c1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97303", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O[C@@H](Cc1c(F)cccc1F)c1c(F)cc(F)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183496", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)CC[C@](O)(P(=O)([O-])[O-])[P@@](=O)([O-])O by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136837", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(c1cnc2n(c1=O)CCS2)N1CCc2cc(F)ccc2C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141114", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCN[C@]1(C#N)CC[C@@H]([NH+]2CCC[C@H](OCC)C2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145504", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@@H](Oc1ccc(C#N)cc1)C(=O)NC[C@H]1CN(Cc2ccccc2)CCO1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21130", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1csc(CN(C)C[C@@]2(O)CCCN(CC(C)(C)C)C2=O)n1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50773", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1nccc1C(=O)N1CC[C@H](Oc2ccc(C(F)(F)F)cn2)C1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122126", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCc1n[nH]c2c1[C@@H](c1cc(OC)ccc1OC)C(C#N)=C(N)O2 by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37867", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ncccc1NC(=O)c1ccccc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247766", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccccc1OCC(=O)N(Cc1ccc(-c2ccc(F)cc2)o1)[C@H]1CCS(=O)(=O)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32146", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(F)ccc1NC(=O)C1CCN(C(=O)c2cc(-c3ccccn3)[nH]n2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167202", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)N(C[C@@H](C)O)C(=O)Nc1ccccc1SCCC#N with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160906", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Cl)cc2sc(N(Cc3ccncc3)C(=O)Cc3ccccc3)nc12 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18428", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [O-]c1nnc(CSc2nc3cc(Cl)ccc3s2)[nH]1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184629", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCC[NH2+][C@H](Cc1ccc(C)cn1)c1cc(Cl)ccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7379", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H]1CCCCN1S(=O)(=O)c1ccc(Cl)nc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84533", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ncccc1NC(=O)C(=O)NCCc1c[nH]c2ccc(F)cc12 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197531", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1CN(c2ccc(NC(=O)COc3ccccc3)cc2Cl)CCN1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(C(F)(F)F)nc1NCCC[NH2+]C1CC1 by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31361", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1cnnc1[C@@H]1CCCN(c2ncnc3ccc(F)cc23)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106370", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCCc1cc(NC(=O)N2CCC[C@@H]2C[C@@H](O)c2cccs2)n(C)n1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130103", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ncnc2ccc(Br)cc12)N1CCCCC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232862", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Cl)ccc1S(=O)(=O)Oc1cc(Cl)ccc1C(N)=O by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158360", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1cccc2c1OCC[C@@H]2[NH2+]C[C@]1(O)CCOC1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162474", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCCNC(=O)c1c(N2CCCC2=O)c2cc(F)ccc2n1C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96951", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C1CCC1)N1CCCC[C@H]1[C@@H]1CCCC[C@H]1O by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24430", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S(=O)(c1ccc(Cl)cc1C(F)(F)F)N1CCC[NH2+]CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244766", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1nn(C[NH+](C)CCc2ccc(F)cc2)c(=O)c2noc(C)c12 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80939", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)C[NH2+]C[C@@]1(CCO)CCOC1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224858", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(F)c(Cl)c2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238537", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCOc1ccccc1C(=O)N1CCN(C(=O)CC2(O)CCCCC2)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61914", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(C)c(NC(=O)C[NH+](Cc2ccccc2F)C2CC2)c(C)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210572", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC[C@H]1CCCN(C(=O)c2cc(C)cc(Br)c2O)C1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104017", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[N+](C)=c1ccc2nc3c(C(=O)[O-])cc(O)c(O)c3oc-2c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190644", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(C(=O)c1ccc(F)nc1)c1cccc2ncccc12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11139", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)NC[C@H](O)c2ccc(Cl)cc2)c(C)c1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100026", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](C)[C@H]1CC[C@H](NC(=O)NCCc2ccc(Cl)cc2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90015", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@@H](N)CC[NH+](C)C[C@@H]2CCCOC2)cc1F by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24903", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C(=O)Nc2nc(-c3ccc(OC)c(OC)c3)ns2)cc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52249", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1ccc(NCc2ccc3c(c2)OCO3)c(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197318", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCc2c(F)cccc2[C@H]1NC(=O)c1cc[nH]n1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98274", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CS(=O)(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccc(Cl)c3)cc2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86881", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1070", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1ccc(C(=S)N2CCN(c3ccc(F)cc3)CC2)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16176", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN1/C(=C\\C=N\\NC(=O)COc2ccc(Cl)cc2)C(C)(C)c2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110573", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NC[C@H]1CCCO1)c1cccc2c1N[C@@H](c1ccc(O)cc1O)[C@H]1CC=C[C@H]21 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159513", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc(CNc2ccc(Cl)c(Cl)c2)no1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34397", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)C[NH+]1CCN(C[C@H](O)COc2cc(Cl)ccc2Cl)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107703", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CNC(=O)c1ccccc1Br)Nc1ccc(OCc2ccccc2)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43318", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COC(=O)c1ccc(Cl)c(NC(=O)c2ccc(C#N)cc2)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220606", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)C[C@H](C)NC(=O)C(=O)Nc1ccc(F)c(Cl)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53809", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1/C(=N\\CCCCCl)[C@H](Cl)C(=O)c2ccccc21 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223181", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)[C@H](O)[C@@H](c1ccccc1O)n1nnc2ccccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181034", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NS(=O)(=O)c1ccc(N2CCc3cc(F)ccc3C2)c([N+](=O)[O-])c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26115", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1c(CO[C@H]2CC[C@H]([NH3+])C2)cccc1[N+](=O)[O-] with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99886", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCCCO[C@@H](C)C(=O)c1cccc(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87675", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CO[C@@]1(C)C[C@@H](N(C)C(=O)c2cc(F)ccc2[N+](=O)[O-])C1(C)C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95637", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1ccc(CN(C)S(=O)(=O)c2ccc(F)c(C)c2)o1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215684", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule NS(=O)(=O)c1ccc(NC(=O)C2=Cc3cc(Br)ccc3OC=C2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52812", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](C[C@@H](O)c1ccccc1)NC(=O)Cc1cccs1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19106", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cc(C(=O)NCc2cccc(NC(=O)C3CC3)c2)cc(OC)c1Br by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108160", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C[C@](O)([C@@H]2Cc3ccccc3N2)C(C)(C)O1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228356", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc([C@H](OC(=O)C[C@H](C)c2cccc(F)c2)c2ccccc2)n1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16916", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1[C@@H]2Sc3[nH]c(=O)sc3[C@H](c3ccc(F)cc3)[C@@H]2C(=O)N1c1ccccc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46020", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccnn2Cc2ccccc2Cl)C1=O by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110703", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cccc(COC(=O)Cn2c(=O)sc3cccc(Cl)c32)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37696", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule ClC(Cl)(Cl)[C@@H]1NCCO1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27791", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N2C(=O)/C(=C/c3cccc([N+](=O)[O-])c3)SC2=S)c(C)c1 by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158073", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCCn1cccc1)N1CCO[C@@H](c2ccc(Cl)cc2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61581", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule COc1ccc(OCC(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236635", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(c1ccc(F)cc1)N(CCC[NH+]1CCOCC1)c1nc2ccc(Cl)cc2s1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134945", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@@H](C(=O)N(CCC#N)CCC#N)n1cccn1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206258", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCC(CC)(CC(=O)Nc1cccc(C#N)c1)C(=O)[O-] with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C[C@@H](C)C#N)C(=O)Cc1ccc(-c2ccccc2)cc1 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24669", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOc1ccc(F)c(C(=O)N2CCN(C)c3ccc(F)cc32)c1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20372", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)Nc1cccc(NC(=O)Nc2ccc(C)c(Cl)c2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189771", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S(=O)([N-]c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccc(Br)s1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125965", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC[C@@H](C)n1ncc(C(=O)[C@H](C#N)c2nc3ccccc3s2)c1C1CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22095", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cc(C[NH+]2CCC[C@@H](n3cccn3)C2)ccc1Cl by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113647", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(NC(=O)C(=O)Nc2cc(C(F)(F)F)ccc2C)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10514", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc([N+](=O)[O-])ccc1NC[C@@H]1CN2CCC[C@@H]2CO1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126493", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c(Cl)cc(C(=O)N[C@@H](C)c2ccc(-n3cncn3)cc2)cc1Cl by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139265", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N#Cc1nc(NCCNC(=O)CC2CCCC2)ccc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168403", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)NC(=O)c1ccc(NCc2ccc(F)c(Br)c2)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158213", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOCc1noc(-c2ccc(OC)c(O)c2)n1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163219", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(C[C@@H](C(=O)[O-])c2cccc(Cl)c2)n(C)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56445", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)c1ccc(N2CCN(C(=O)N[C@@H]3C[C@@H]3c3cccc(F)c3)CC2)c(F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171427", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCOc1cc([C@H]2c3c(n[nH]c3-c3cc(Cl)c(C)cc3O)C(=O)N2Cc2cccnc2)ccc1O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197876", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cccc(F)c1)N1CCN(c2ccc(-c3noc(C4CC4)n3)cc2)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49147", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]2N=C(c3cccc(Br)c3)C[C@@H](c3ccccc3O)[NH2+]2)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18785", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1cnnc1CSCc1noc(-c2ccccc2Cl)n1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138503", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Nc1nc(Cl)cc(Oc2cc(Cl)c(Cl)cc2Cl)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124209", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1nn(-c2nc3ccccc3s2)c2c1[C@@H](c1cccc(O)c1)CC(=O)N2 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93663", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCOC(=O)c1ccc(CNC(=O)Nc2ccc(CC#N)cc2)o1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180909", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OCC(=O)N(Cc2ccc(F)cc2)[C@H]2CCS(=O)(=O)C2)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67201", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(CN(C)C(=O)C[NH+]2CCCN(CC(F)(F)F)CC2)cc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211886", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C1ON=C(c2cccc([N+](=O)[O-])c2)/C1=C/c1ccco1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179652", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(C)S(=O)(=O)c1ccc(C(=O)N(Cc2ccccn2)c2nc3ccc(F)cc3s2)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50560", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "595", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NNC(=S)NCCc1ccc(Cl)cc1)c1ccoc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216924", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)Oc1ccc(NC(=O)C(=O)N[C@@H]2CCCC2(C)C)c(F)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214502", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Sc1nnnn1C1CC1)C(=O)Nc1ccccc1OC(F)(F)F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24616", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)[C@H]1CC[C@@H](C)CC1=C(F)C(=O)[O-] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178102", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COC(=O)[C@H](C)NC(=O)c1ccc(N2CC[C@H](C)C[C@H]2C)c([N+](=O)[O-])c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220775", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1nc([O-])c(C#N)cc1C(=O)N1CCC[C@@H](N(C)CC[NH+](C)C)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211376", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])[C@@H](C)NC(=O)C2CCCCC2)c(F)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101505", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Cl)ccc1-c1ccc(=O)[nH]c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134419", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C)c(C)c1NC(=O)CN(c1ccccc1F)C1CCCC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78923", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[C@H](c1cccc([N+](=O)[O-])c1)N(C)C(=O)Cc1csc(N2CCCC2=O)n1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207906", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H]1CCc2c(F)cccc2[C@H]1NC(=O)NCc1ccccc1OCCO with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37788", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N1CC[C@]2(O)CCN(c3ncccn3)C[C@@H]2C1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41516", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ncccc1Oc1cc(Cl)ccc1C(N)=S by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127136", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C1N=CN=C2C1=NCN2[C@@H]1O[C@@H](COC(=O)c2ccccc2)[C@@H](O)[C@@H]1O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214718", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCNC(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210386", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCN(CC)c1ccc(/C=C2/NC(=O)N(c3cccc(Cl)c3)C2=O)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)NCCOC(=O)C1(c2cccc(F)c2)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129123", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(NCc2cccc(OCC(F)F)n2)c(F)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211140", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule C[C@@H]1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)C[C@@H](C)O1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87327", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CN(C)C(=O)Sc1ccccc1NC(=O)/C=C/c1ccccc1[N+](=O)[O-] with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90878", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cccc(Cl)c1C[C@@H]1COCC[C@@H]1[NH2+]C1CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23661", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1nc(Cl)cc(NCC[C@H](O)c2ccccc2)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73822", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc(C(F)(F)F)nc1[O-])c1ccc2c(c1)OCCO2 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210017", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(Oc2ccc(F)cc2C[NH2+]C2CC2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124904", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C(=O)N2CCN(Cc3ccc(Cl)cc3)CC2)n1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52041", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](C)[NH+](C)CCNC(=O)Nc1c(F)cccc1Br by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145519", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cc(Br)cs1)C[C@H]1CCCC(C)(C)[C@@H]1[NH3+] by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124363", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@]([NH3+])(Cc1nccs1)c1ccc(Br)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181772", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(COc1ccc(Cl)cc1Cl)NCC[C@@H]1CCCOC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12296", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](C(=O)Nc1ccc(Br)cc1)[N+](C)(C)C1CCCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@](O)(CNC(=O)Cc1ccccc1Cl)c1ccccc1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243730", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2F)[NH+]2CCCC2)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141138", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc([C@H](CO)NC(=O)NCCC(F)(F)F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31136", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1c(C[NH+](C)CCN2CCOCC2)cccc1[N+](=O)[O-] with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41009", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NNC(=O)c1cnc([C@H]2CCCO2)s1)c1ccc(F)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8248", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C[NH+](C)Cc2ccc(Br)cc2N)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155908", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C1CCCN1C(=O)Cn1cc([N+](=O)[O-])ccc1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153913", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(COC1CCCC1)NNC(=O)c1ccc(F)cc1Br by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182940", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([O-])[C@H]1COCCN1C(=O)c1ccc(Br)nc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52119", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(CN2COc3ccc4c(c3C2)O/C(=C\\c2ccc(Cl)cc2)C4=O)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8485", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COC(=O)[C@H](NC(=O)Cc1ccc(C)c(O)c1)C(C)(C)C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89487", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1ccc(C(F)(F)F)cn1CCOc1ccc([N+](=O)[O-])cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185770", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CCOCc1ccccc1[N-]S(=O)(=O)c1cc(C)c(C)cc1[N+](=O)[O-] with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114440", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(NCC(=O)NCC(=O)N1CCCC1)c1ccc(F)cc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241697", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)N1CCCN(C(=O)OC(C)(C)C)CC1 by replacing a nitro by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235404", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)[N-]c1ccc(S(=O)(=O)NC[C@H]2CCC[C@H](C)C2)cc1F by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81866", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCOc1ccccc1C(=O)N/N=C/c1ccc([N+](=O)[O-])s1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100957", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)N(C)c1ccc(NC(=O)CNc2ccc(Cl)cc2)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225595", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1ccco1)[NH+](CCC(=O)Nc1cc(N)ccc1F)C1CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158638", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccccc1N1CCCN(C(=O)c2cc3cc(Cl)ccc3[nH]2)CC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119631", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOC(=O)COc1ccc(Br)cc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103882", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cl[C@@H]1CCCC[C@@H]1[C@@H]1CCOC2(CCSCC2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113684", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1cc(C)c(NC(=O)C(=O)NC[C@H]2CCC[C@@H]2O)c(C)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33074", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)NC1CCN(C(=O)c2ccc(Cl)cc2)CC1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97461", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)S(=O)(=O)c1ccccc1C(=O)NC[C@H](C)C#N by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225453", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CNC(=O)CCCn1cc(C(=O)[O-])cc1Br by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215583", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cc2ncc([C@@H](C)[NH2+]CC(C)(C)[C@H](O)C(C)C)c(C)n2n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101103", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1ccccc1/[NH+]=c1\\scc(-c2ccc([N+](=O)[O-])cc2)n1CCO with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136849", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccc(Br)cc1/C=C1\\SC(=O)NC1=O)Nc1ccc2ccccc2c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9091", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](C(=O)Nc1cc(Cl)cc(Cl)c1)N1CCN(C(=O)C2CC2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134088", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CCO[C@@H](CCNC(=O)c2cc(Cl)c[nH]c2=O)C1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60829", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Clc1ccc(CC[NH2+][C@H]2C[C@H]3CC[C@@H]2C3)cn1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31530", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnc(C)c(N2CCN(C[C@]3(O)CC[NH2+]C3)CC2)n1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51015", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ncnc2c1nnn2Cc1ccccc1F)c1ccccc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188726", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccsc1[C@@H]1Nc2ccc(F)cc2[C@H]2C=CC[C@@H]21 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151935", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(OCc2ncc(Cl)n2C)c(CO)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222126", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1sc2ncnc(NCc3ccc([N+](=O)[O-])cc3)c2c1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193084", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCn1c(SCC(=O)Nc2ccc(C)c(Cl)c2)nnc1[C@H]1CCCN1C(=O)c1ccc(C)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157063", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Cc1ncc(CNc2ccc(S(=O)(=O)C(F)F)cc2)s1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221363", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1COC[C@H](C)N1C(=O)c1cc(F)c(F)cc1Cl by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129774", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1nc2c(s1)CN(C(=O)c1ccc(Br)o1)CC2)c1cccs1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109150", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1cccc(C(C)C)c1NC(=O)CNc1ccc(F)c(Cl)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62707", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@@H](C#N)Sc1nnc(N2CCCCC2)n1-c1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168396", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)[NH+]2CCC(CC[NH3+])CC2)cc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109160", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1CCC[C@@H](C)N1C(=O)COc1ccccc1OCC(F)(F)F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55738", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)c1cccc(C(=O)NCc2cc(Br)cs2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129253", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccsc1[C@@](C)(O)c1cc(F)c(Cl)cc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241281", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cc(NS(=O)(=O)c2ccc([O-])c([N+](=O)[O-])c2)c(F)cc1F by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102717", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Cn1cnc(-c2ccc(F)cc2)cc1=O)Nc1ccc(F)c(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186787", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c([C@@H](O)Cc2ccc(Cl)s2)cnn1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89429", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1406", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)N1CCC(NS(=O)(=O)c2c(C)c(Cl)cc(C)c2Cl)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242609", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N[C@@H]1CCCC[C@@H]1O)c1c(F)cc(Br)cc1F by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173086", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C#CCOc1ccc(F)cc1NC(=O)C(=O)N[C@@H]1[C@H]2CCO[C@@H]2C1(C)C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23917", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H](O)C1CCCC1)NC1CCC([NH+]2CCCCC2)CC1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150920", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1noc([C@H]2CCCN(C(=O)COc3ccccc3F)C2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179506", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)O[C@@]1(C(C)=O)CC[C@H]2[C@H]3C[C@H](Cl)C4=CC(=O)CC[C@@]4(C)[C@H]3CC[C@@]21C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36704", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC(C)N(Cc1ccc(C#N)cc1)C(=O)C=C1CCSCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=Cc1ccc(OCCOc2ccccc2)cn1 by replacing a aldehyde by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73362", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](C(=O)NCc1ccccc1F)N(C)CC[C@@H]1CCCC[NH+]1C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76021", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCn1nc(C)c(NC(=O)Nc2c(F)cccc2Br)c1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182241", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C[C@](C)([NH3+])c1ccccc1Cl by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173236", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@]1(c2ccc(Cl)cc2)NC(=O)N(C[C@@H](O)c2cccc(F)c2)C1=O by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67316", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cc1ccc(F)cc1)NNC(=O)C1(c2ccccc2)CCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16780", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#CCC[C@H](C#N)CN1CCc2c(cccc2N2CCOC2=O)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98069", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C(=O)NC(Nc1ccccn1)(C(F)(F)F)C(F)(F)F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248272", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CN(C)C1CC[NH+]([C@H]2CCCC[C@H]2O)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45855", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CCC#N)C(=O)c1occc1Br by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41482", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1cc(C[NH2+]CC2(CO)CC2)ccc1Br by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197297", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[NH2+][C@]1(CO)CC[C@@H]([NH+](C)CCCOC)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183343", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1c(CN2CCCN(c3ncccn3)CC2)cc(C#N)n1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10232", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NCc1cccs1)NCC1(O)CCCC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222075", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC1(C)C[C@H]2[C@@H](O)C3=C(C[C@](C)(O)[C@@H]2C1)C(=O)O[C@H]3O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211089", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@@H](O)C[NH+](CC(F)(F)F)C1CCCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71859", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1[nH+]ccn1CCNC(=O)CN(C)c1nc2c(F)cccc2s1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221357", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@H](O)c1cc[nH+]c(N(C)C[C@@H](C)C#N)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169312", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC1(NC(=O)NCCCc2ccc(O)cc2)Cc2ccccc2C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156266", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(CCN1CCOCC1)C(=O)NCCc1nc(C(F)(F)F)cs1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7726", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@H](Cc1ccc(O)cc1)NC(=O)Nc1ccc(F)c(C#N)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213795", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(CNn2cnnc2)cc(Br)c1OC with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88455", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(=O)N(CCc1ccc(F)cc1)CC1=CCC[NH+](CCO)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22399", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule NC(=O)c1ccccc1OCc1ccc(OCC(F)(F)F)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39960", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H](NC(=O)N1CC[C@H]1c1ccc(Cl)cc1)c1nc(C)cs1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234546", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CS(=O)(=O)[C@@H]1CC[C@@H](OC(=O)/C=C/c2ccc(Cl)c(Cl)c2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51386", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CO[C@@H]1CCCC[C@H]1NC(=O)NNc1cccc([N+](=O)[O-])c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21668", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1[C@@H]1CCN(C(=O)c2ccc(C#N)cc2)C1 by substituting a nitrile with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26457", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(F)cc1NC(=O)NCCCNC(C)=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182318", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule N#C[C@@H]1CNCCN1C(=O)Nc1ccccc1C(F)(F)F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158408", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH2+][C@H](C)c1ccc(N(C)C2CCCC2)c(F)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233361", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)(F)COc1ccccc1CSc1nnnn1C1CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9396", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1c(C)[nH]c(C(=O)COC(=O)c2c(-c3c(F)cccc3Cl)noc2C)c1C by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37610", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#CC(C#N)=c1s/c(=C\\c2ccc(F)cc2)c(=O)n1CCc1cccnc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141260", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)c1ccc(F)c(NC(=O)N2CC[C@H](C)[C@@H](O)C2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16027", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CNS(=O)(=O)c1cc(C(=O)NC2[C@@H](C)CCC[C@@H]2C)ccc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201498", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C=C\\c1ccc(OC[C@H](O)CN2C(=O)c3cccc4cccc2c34)c(OC)c1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97257", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H]1OCC[C@@H]1[C@H](O)c1ccc(-c2ccccc2)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244274", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NS(=O)(=O)Cc2ccccc2)ccc1[N+](=O)[O-] by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243319", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule COc1ccc(CC(=O)CC#N)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166842", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C=CC1CC[NH+](Cc2ccc(N(C)CCC#N)cc2)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112514", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule N#Cc1ccc(OCCNC(=O)NCCc2cccc(O)c2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142648", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH2+][C@@H](c1ccc(F)cc1Cl)[C@H](C)c1ccccn1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111886", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc(C[NH+]2CCC[C@@H](CNC(=O)Nc3cccc(F)c3)C2)cs1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93169", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1cc(C(=O)OCCOc2cncc(Cl)n2)nn1C by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55179", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)c1ccccc1I by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206841", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@@H](C/N=C/c1ccc(Cl)cc1)c1ccccc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78576", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(C2=N/C(=C\\c3ccc(OC(C)=O)cc3)C(=O)O2)cc1Br by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228630", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CCN(C(=O)c2ccc(NC(=O)N(C)C)cc2Cl)C[C@@H]1O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237176", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(F)ccc1NC(=O)NCc1cn(-c2ccccc2)nn1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175147", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(F)c(NCc2cc(C(N)=O)cs2)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216043", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nc(C)c(NC(=O)N(C)Cc2ccc(Br)cc2)c1C by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191207", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1c(CC(=O)NNC(=O)c2cc(Cl)c[nH]2)nc2ccccc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[C@H](C(=O)Nc2cc(Cl)cc(Cl)c2)[NH2+]1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73858", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(NC(=O)Cn2nc3c4scc(-c5ccc(F)cc5)c4ncn3c2=O)c(OC)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162326", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C(F)(F)F)n2nc([C@H]3CCC[NH+]3Cc3cn[nH]c3C(C)(C)C)cc2n1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48196", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=S(=O)(NCc1nnc2ccccn12)c1ccc(Cl)c(Cl)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27249", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)(C)CN(C[C@H](O)c1ccccc1)S(=O)(=O)c1cccc2c1COC2=O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16539", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1ccc(O[C@@H](C)C#N)c(C[NH3+])n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165903", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1cc(Cl)cc(Cl)c1)C(=O)NCc1ccc(C#N)cc1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9860", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCCC(=O)N1CCC[C@@H]2CCCC[C@@H]21)S(=O)(=O)c1ccc(F)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223254", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc(COC(=O)c2cc(-c3ccc(Br)cc3)n[nH]2)cs1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2553", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(O[C@H](CC)C(=O)[O-])c(Cl)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222996", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCCN(CCO)C(=O)N[C@@H]1C[C@H](C)N(c2ccccc2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103303", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H](Nc1ccc(NC(=O)[C@H]2CCO[C@@H]2C)cc1Cl)c1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139884", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)[C@H]1CN(C(=O)c2nn(-c3cccc(Br)c3)c3c2CCCC3)CCO1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19476", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cccc(OC)c1C(=O)N1CCN(c2nccn2-c2ccccc2F)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207513", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCc1ccc([C@H]2CC(=O)N=C(SCC(=O)OC(C)C)[C@H]2C#N)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229336", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2ccc(OC(C)C)cc2)cc1[N+](=O)[O-] by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47703", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)Nc1nc(COc2ccc(C(C)=O)c(F)c2)cs1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82670", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@]1(c2ccccc2)NC(=O)N(C[C@H](O)c2ccc(F)cc2F)C1=O by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94317", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH+]1CCN(c2ccccc2)CC1)Nc1cc(Cl)ccc1Cl by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180800", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@H](C)NC(=O)Nc2ccn(C)n2)cc1[N+](=O)[O-] by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197706", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCSc1ncc(Cl)c(C(=O)Nc2ccccc2C(=O)OC)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91699", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(C)c1ccc(N(C)Cc2nc(COc3ccc(F)cc3)no2)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87485", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NC1CCN(c2cccc[nH+]2)CC1)C1(c2ccc(Br)cc2)CCC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41999", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nn(CC(C)C)c(Cl)c1[C@H]1CCCN1C(=O)NCc1ncn(C)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249160", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1cc(Cl)cc(/C=N/NC(=O)[C@@H]2C=C(c3ccccc3)N=N2)c1O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79936", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1nc(N2CCN(c3ccccc3C#N)CC2)c2cc[nH]c2n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150567", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCC[C@H](C)NC(=O)C1CCN(S(=O)(=O)Cc2cccc(Cl)c2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117386", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncccc1C(=O)N1CCCC[C@@H]1C[C@@H](C)O by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61284", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@H]1C[C@@H](C)CN(c2oc(Cc3ccccc3)nc2C#N)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202339", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1nc(C(F)(F)F)nn1CC(=O)Nc1ccc(Oc2ccc(F)cc2)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246340", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](OC(=O)[C@H]1CC(=O)N(C)[C@@H]1c1cccc(Cl)c1)[C@H]1CCCO1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86536", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H](CC[C@@H]1COc2ccccc21)c1ccccc1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92624", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1CCCNc1ccccc1C(=O)N1CCC[C@H]1CO by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200210", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=S1(=O)C[C@H](O)[C@@H](NCC/[NH+]=C/c2ccccc2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54614", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CO[C@H]1CCC[C@@H]1OC(=O)c1cc(Br)ccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171471", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH+](C)Cc1[nH+][nH]c(N)c1-c1ccc(Cl)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143051", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#Cc1c(-c2ccncc2)c2c([nH]c1=S)CCCC2 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244375", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1cccc([C@@H](CBr)CC[C@H]2CCCO2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59973", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cc(C(=O)NC[C@@](C)(O)c2cnn(C)c2)c(C)n1Cc1cccs1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228823", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NC[C@@H](O)c1ccc(F)cc1)N[C@H]1CC(=O)N(C2CC2)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224062", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1onc(-c2ccc(F)cc2)c1C(=O)N[C@H](C)[C@@H]1CCCO1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246688", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(c1cc(F)cc2nccnc12)N1CCc2cc(F)ccc2C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127009", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN(C(=O)NCc1cc(Br)cs1)[C@@H](C)c1cccc(OC)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95302", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(c1c(F)c(F)c(F)c(F)c1F)N1CC[NH+](CCO)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114554", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1cc(F)cc(NNC(=O)C[C@H](O)c2ccccc2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67938", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(OCC)c(NCc2cc(C#N)cs2)c1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37061", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(F)cc1NC(=O)c1cccc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4845", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CO[C@H](CO)CN1Cc1c(Cl)nc2sccn12 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227921", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(OCC(=O)NCC[C@H](O)c2ccccc2)ccc1Cl by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161794", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](Oc1ccccc1)C(=O)Nc1ccccc1Br by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135308", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nnc(SCc2ccnc(Cl)c2)n1CC(N)=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24429", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)c1ccccc1NC(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235701", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H]1Cc2ccccc2[C@@H]1[NH2+]Cc1ccc(N2CCCCC2)cc1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)NCCNC(=O)c1ccc(OC(F)(F)F)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222613", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CO[C@H](CO)CN1C(=O)c1cc(CCc2ccccc2)ccc1O by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97597", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CSc1cccc2sc(N(C[C@@H]3CCCO3)C(=O)c3cccc([N+](=O)[O-])c3)nc12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200942", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C(=O)NNC(=O)c1cc(C)c(-c2ccc(F)cc2)s1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215844", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1nc(=O)[nH]c(C)c1CC(=O)N[C@@H](C)CCCO by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190883", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOC(=O)[C@@H](C)Sc1nnc2n1CCN2c1ccc(F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42578", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1ccc(C(=O)/C=C/c2cnc(-c3cccs3)s2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31689", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(C(=O)Cn2cnc3cccc(Br)c3c2=O)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nccn1-c1ccc(CNC(=O)c2cccc(S(=O)(=O)N3C[C@@H](C)C[C@H](C)C3)c2)cc1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113934", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(CNC(=O)C[C@H](c1ccccc1)C(F)(F)F)c1ccncc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38434", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCCc1ccc(Cl)cc1)C1CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9407", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(F)c(CNC(=O)CCNS(=O)(=O)c2cccnc2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75205", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC1=C2[C@H](c3ccccc3Br)CC(=O)N[C@@H]2N(c2ccc([O-])nn2)N1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209164", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc2c(c1)OCCO2)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71916", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1nn(CN2C[C@H](C)O[C@H](c3ccccc3)C2)c(C)c1[N+](=O)[O-] by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82927", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COc1ccnc(NC(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175795", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H](CN1CCN(c2ccccc2F)CC1)Cn1nnnc1-c1ccccc1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33120", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC(=O)c1ccnc(N2CCO[C@H](C#N)C2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74847", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(S(=O)(=O)[N-]c2ccc3nc([C@H]4CCCO4)[nH]c3c2)ccc1Br by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232837", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(=O)O[C@@H]1[C@H](c2ccc(=O)oc2)[C@@]2(C)CC[C@@H]3[C@H](CC[C@@H]4C[C@@H](O)CC[C@@]43C)[C@]23O[C@H]13 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49745", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC(C)(C)[C@H](C#N)NC(=O)c1cnc(-c2ccoc2)s1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93942", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1csc(NC(=O)[C@@H](C)CCc2cccc(F)c2)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89654", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCCc1nn([C@@H]2CCCC[C@H]2O)c(=O)o1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8819", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccccc1F)Nc1c(C(=O)Nc2ccccc2F)oc2ccccc12 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1Cl by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22310", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1ccc(-c2nnc(SCc3cccc([N+](=O)[O-])c3C)n2N)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158326", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(C)c1NC(=O)CN1CCN(C(=O)c2cncc(Br)c2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235716", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCCOc1ccc(/C=C(\\C#N)C(=O)Nc2ccccc2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171497", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1cc(Sc2ccc([N+](=O)[O-])cc2)cs1 by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105702", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#C[C@@H]1C[NH2+]CCN1Cc1cc(F)ccc1Br by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16534", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Clc1cc(-n2cnnn2)ccc1-c1nc(-c2cnccn2)no1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147324", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(CCNS(=O)(=O)c2cccc(Cl)c2)on1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164413", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule C[C@H]1CCC[C@H](C)N1C(=O)[C@@H](C)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157850", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1cccc(Oc2ncnc3cc(Cl)ccc23)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180142", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c([C@@H](O)c2ccc(OC(C)C)cc2)c(C)nn1C by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96737", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC(C)N(Cc1nnc(-c2ccccc2Cl)o1)C(=O)c1ccccc1[N+](=O)[O-] with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225255", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCCCN1c1ccc(C(F)(F)F)cc1NC(=O)c1ccco1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227618", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(F)c(C(=O)c2ccc(F)c(Br)c2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80004", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O[C@@H](COC[C@@H]1CCCO1)C[NH+]1CCC(c2ccc(F)cc2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146229", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCCn1nc(-c2ccc(Cl)cc2)ccc1=O)Nc1ccc2c(c1)OCO2 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150547", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(OC)c(NC(=O)CCC(=O)c2ccc(Br)cc2)cc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54975", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1041", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1ccccc1C(=O)NCCSc1ccc(Cl)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33725", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(OCC(=O)N2CCN(c3ccc(-n4ccnc4)nn3)CC2)ccc1Cl by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91426", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc(Cl)cc1)c1ccccc1Cl by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190801", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)Oc1cccc(C[NH2+]Cc2ccc(Cl)o2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81039", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCOc1ccc(C(=O)NC(=S)Nc2c(C)cc(Br)cc2C)cc1[N+](=O)[O-] by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158728", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCCN1CCOCC1)c1ccc(-n2cc(-c3ccc(Cl)cc3)cn2)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148913", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CNC(=O)Cc1cccc(F)c1)NCc1nccc2ccccc12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213056", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@]1(C)C[C@@](Nc2cc(C)cc(F)c2)(C(N)=O)CCO1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242201", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCCc1c(F)cccc1F)Nc1nccs1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104286", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Nc1c(Br)cnn1-c1ncccn1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28757", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)[C@@]1(O)CSCC(C)(C)C1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220560", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)=CC(=O)Nc1cccn(Cc2ccc(F)cc2)c1=O by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101409", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(C)c1ccc(NC(=O)NNc2ccc(F)c(F)c2F)c[nH+]1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223542", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCn1nc(/C([O-])=N/S(=O)(=O)Cc2ccc(C#N)cc2)ccc1=O by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227483", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCc1cc(C[C@]2(O)CS[C@@H](C)C2)n(CC)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199452", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCCN(C(=O)Cc1cccc(F)c1F)[C@@H]1CCS(=O)(=O)C1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83519", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)Cc1ccccc1NC(=O)c1cccc(C(F)(F)F)c1F by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181818", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccnn1Cc1cccc(Cl)c1Cl)[C@@H]1CCCN(S(=O)(=O)c2ccccc2)C1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2082", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C=C1CCSCC1)N[C@H](c1ccccc1)c1ccc(F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66006", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NC(=O)C2=Cc3cc(Cl)ccc3OC=C2)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98134", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)c2ccc(-n3ccc(C(F)(F)F)n3)cc2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153499", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCC(CC)[C@@H](O)CNc1ccc(-n2ccc(C)n2)nn1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91417", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C([O-])C[C@@H](Cc1ccc(Br)cc1)C(=O)Nc1ccccc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154719", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(C)c(Cn2cnc3c(nnn3-c3ccc(Cl)cc3)c2=O)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148174", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(C(=O)CSc2ncccc2Cl)s1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55547", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H](O)c1cccc(OC(F)F)c1)[C@H]1Cc2ccccc2O1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187791", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(Cl)cc1)N(Cc1ccc(Cl)cc1)Cc1cccnc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236714", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule COc1ccc(-c2c(C(C)=O)c(C)nc3sc(C#N)c(N)c23)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182006", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1nc(/C=C/c2ccc(F)cc2)oc1N1CCN(C(=O)c2cccc(F)c2)CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18704", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccnc([C@@H](O)[C@H]2CCC[C@H](S(C)(=O)=O)C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41520", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Oc1ccc(Cl)cc1N1C(=O)[C@H]2CC=CC[C@@H]2C1=O)c1ccco1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57286", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H](CCCO)NC(=O)N[C@H]1CCCOc2ccccc21 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194143", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](O)c1ccn(CC[C@@H]2CCCO2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183225", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](CCO)CNS(=O)(=O)c1ccc(Cl)nc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51530", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(C[NH2+]CCC(=O)NC2CC2)ccc1Br with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206918", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(N[C@H]1CCC[NH+](Cc2ccc(Cl)cc2)C1)c1ccc[nH]c1=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C=O)ccc1OCc1ccc(SC(F)F)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232574", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1C(=O)N2CCC[C@@H]2C(=O)N1Cc1ccc(Cl)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102742", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCc1cccnc1-n1cncn1)c1cc(-c2ccccc2Cl)[nH]n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161131", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc2[nH+]c(CNc3ccccc3CCC(F)(F)F)cn12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55373", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+]C[C@H](C)C(=O)NCC#N by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124385", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccccc1)OCC(=O)c1cccc([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145938", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1[C@@H](C(=O)[O-])CCN1C(=O)c1cc([N+](=O)[O-])ccc1Br with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45753", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@H]1CCCN(C(=O)Cc2c(OC)ccc3cc(Br)ccc23)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73514", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Sc1nnc(-c2ccncc2)n1C1CC1)C(=O)N[C@H](C)c1ccc(F)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204741", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(F)c(CNC(=O)NCC[C@H](O)c2ccccc2)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51288", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H](COc1ccccc1)CSc1ccc2ccccc2n1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212322", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](NCCc1nnc(-c2ccccc2)o1)c1occc1Br with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94723", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CC[C@@H]4CCCO4)C3)noc2n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249337", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(N2CCN(Cc3ccc(F)cc3)C(=O)C2)[nH+]c(N)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48683", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CCOc1ccccc1[C@@H]1Nc2c(ccc([N+](=O)[O-])c2C)[C@H]2C=CC[C@H]21 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5484", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC1CCN(C(=O)[C@@H]2C[C@@H]2c2ccccc2OC(F)(F)F)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64814", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]1c2ccc(F)cc2CCN1C(=O)C[C@H](O)c1cccc(F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61933", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CNC(=O)CN(C)C(=O)c1occc1Br by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210866", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSCC(=O)NCCC(=O)N1CCN(c2ccc(F)cc2)CC1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238943", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(N2C(=O)[C@@H]([C@H]3NCCc4c3[nH]c3ccccc43)[C@@H](O)N[C@H]2O)c(C)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10653", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nc2ccccc2n1CCNC(=O)c1cc(F)ccc1[N-]S(C)(=O)=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213457", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nn(-c2ccccc2)c(Cl)c1C(=O)NNc1cccc(Cl)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232745", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(NC(=O)C[NH+]2CCC[C@H](C(=O)NCC(F)(F)F)C2)on1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97800", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O[C@H]1c2ccccc2C[C@H]1C[C@@H]1Cc2ccccc21 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154995", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1ccc(C[NH2+]C[C@H]2CN3CCCC[C@@H]3CO2)o1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169316", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(Cc1noc(-c2csc([N+](=O)[O-])c2)n1)NCc1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177417", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1C(=O)Nc1cc([N+](=O)[O-])ccc1C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207056", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1ccc(F)cc1F)C(=O)N[C@H](c1ccccc1)c1ccccn1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188737", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1ccc(-c2nnn(C[C@H](O)CO[C@@H](C)c3ccc(Cl)cc3)n2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149071", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)N[C@H](C)c2ccccc2Cl)c(OCC(=O)N(C)C)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159733", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N#Cc1ccc(O)cc1C(F)(F)F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109993", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc(C(=O)N(C)[C@@H](C)Cc2cccs2)c1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146252", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C/[NH+]=C(/NCc1cccc(CO)c1)N[C@H]1CCC[C@H](C)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41575", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(OC)cc([C@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC[NH+](C)C)C(=O)c1cc(F)c(Cl)cc1Cl by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46248", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(=O)n(CC(=O)N2CCCC2)c(-c2cccc(Cl)c2)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13257", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(OC[C@@H](O)CN2CCO[C@H]3CCCC[C@@H]32)cc1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176149", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C(=O)NC(=S)Nc2ccccc2O)c1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169379", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NOCc1ccccc1)c1ccc(=O)n(Cc2ccccc2Cl)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211543", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCNS(=O)(=O)c1ccc(C)c(C(=O)Nc2ccc(F)cc2F)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74413", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCn1c(=O)n(CC(=O)Nc2cccc(Cl)c2)c2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71875", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(C)c(-n2cnn(CN3CCN(c4ncc(C(F)(F)F)cc4Cl)CC3)c2=S)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66002", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(-c2nc(CC(=O)Nc3ccc(Cl)nn3)cs2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75805", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC[NH+](CC(N)=O)Cc1cccc(F)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11720", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1C[C@@H](NS(=O)(=O)c2cccc(F)c2)CC[NH+]1Cc1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78625", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCN(CC(=O)Nc2ccc(OC(F)(F)Cl)cc2)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34867", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule [NH3+]C1CC(OC(=O)Nc2ccccc2C(F)(F)F)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223901", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCCn1c(N)c(C(=O)NCc2ccccc2Cl)c2nc3ccccc3nc21 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78643", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)N(C)[C@H](C)c2ccco2)cc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21911", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1n[nH]c(SCC(=O)N(C)[C@H](c2ccc(F)cc2)C2CC2)n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226913", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1C[S@@](=O)[C@@H](C)C(=O)Nc1cc(C)cc(C)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158303", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CC1=NC(=O)[C@H]2C(=N1)NC(=O)C[C@@H]2c1cccc([N+](=O)[O-])c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78574", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([O-])C1=N[C@H]2NC=NN2[C@@H]([C@H]2C=NN=C2c2ccc(F)cc2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245884", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule COc1ccc(C2=NN(C(C)=O)[C@H](c3ccc([N+](=O)[O-])cc3)O2)cc1OC by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30338", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(-c2nc(CC(=O)N3CCN(c4ccccc4F)CC3)cs2)cc1OC with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66122", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(O)(CC)CNC(=O)C(=O)Nc1cc(C)on1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173789", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(Cl)cc1NC(=O)CSc1nnc(C)n1-c1ccccc1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217546", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CSC[C@H](C)NS(=O)(=O)Cc1ccccc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37759", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(F)cc1S(=O)(=O)NC[C@@H](c1ccc2c(c1)OCO2)N1CC[NH+](C)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76299", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc(/C=N\\N2C(=S)SC(C)(C)[C@H]2N(O)C(=O)Nc2ccccc2)cc1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195651", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C(/C=C/c1ccc(Cl)c([N+](=O)[O-])c1)N1CCN(c2c(Cl)cccc2[N+](=O)[O-])CC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27104", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nc2ccccc2n1CCNC(=O)CNC(=O)c1ccc(F)c(F)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50862", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1NC(=O)CNC(=O)c1nccnc1-c1nc2ccccc2s1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87848", "split": "OpenMolInst" } }, { "instruction": "Please replace a aldehyde in the molecule CC(=O)Nc1ccc(NC(=O)c2oc(COc3ccc(C=O)cc3)cc2C)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211890", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCCN(Cc1ccoc1)S(=O)(=O)c1ccc(Cl)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106403", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1C(=O)/C(=C\\c2cc(Br)c(O)c(OC)c2)C(=O)N(c2ccc(Cl)cc2)C1=S by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197379", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3397", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCn1c(CN2CC[NH+](Cc3ccccc3)CC2)nc2cc(NC(=O)c3ccc(Cl)cc3)ccc21 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100200", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=C(NC[C@@H](c1cccs1)N1CCc2ccccc21)c1ccc(Cl)c([N+](=O)[O-])c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199239", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c([C@@H](C)[NH2+][C@H]2CC=CCC2)cccc1[N+](=O)[O-] by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73470", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CC[C@H](NC(=O)N1CC[NH+](CC2CC2)CC1)c1cccc([N+](=O)[O-])c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31431", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCc2c(sc3nc(S)n(C4CCCCC4)c(=O)c23)C1 by substituting a thiol with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155706", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO[C@](C(=O)N(C)Cc1cnccn1)(c1ccccc1)C(F)(F)F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113065", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C/C=C/C=C/C(=O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190733", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Nc1nc2nc(-c3ccc(F)cc3)c(CCN3CCOCC3)cn2n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204709", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(/C=N\\n2cnnc2)cc(Br)c1OCC by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104837", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(OCC(=O)N(C)CC(=O)Nc2ccccc2Cl)ccc1[N+](=O)[O-] with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192225", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CNC(=O)N(C)[C@H]1CC[NH+](C)C[C@H]1C)Oc1ccccc1F by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242698", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](N(C)c1cc2c(cc1Br)[C@H](N)C(=O)N2)C(C)(C)C by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16352", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CN(C(=O)c2c(F)cc(F)cc2F)CC[C@@H]1[NH3+] with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248674", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@H](CC#N)N(C)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231745", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Cl)c(Br)c1)[C@H]1COCCO1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225964", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc(F)cc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17219", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule NC(=S)[C@H]1CN(Cc2ccc(O)cc2)CCO1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120630", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C/C(=C\\C=C\\c1ccccc1)C(=O)Nc1ccc(F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@H]1CCCN1C(=O)CN1CCN(c2ccccc2F)C1=O by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70351", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cl)Cc1ccc2c(c1)OCO2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220521", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)(O)CCc1cccc(C(=O)N(CCO)[C@H]2CCS(=O)(=O)C2)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201015", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccc(N2CCN(C(=O)[C@H](O)c3ccc4ccccc4c3)CC2=O)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12238", "split": "OpenMolInst" } }, { "instruction": "Replace a aldehyde in the molecule O=Cc1ccccc1OC(=O)c1ccco1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35676", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1CCCC[C@@H]1[C@H]1CCCCCN1C(=O)c1cc(F)ccc1O by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138513", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(Oc2ncnc(NC3CCCCCC3)c2[N+](=O)[O-])cc1 by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201537", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CO)C[NH2+][C@H]1CC[C@H](NC(=O)OC(C)(C)C)C1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67337", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(O)c(-c2cc(C(=O)Nc3cccnc3)n[nH]2)cc1C by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80872", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1cc(OC)c(OC)cc1C(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177180", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)N(C)C1CC[NH+](Cc2ccc(C(=O)OC)c(F)c2)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26421", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#C[C@@H]1CN(C(=O)N[C@@H]2CCCc3ccc(F)cc32)CCO1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115919", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)NC[C@H]1CCC[C@H](O)C1)c1nc(-c2ccccc2)cs1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148018", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CSc1ccccc1[C@@H](O)[C@H](C[NH3+])c1c(F)cccc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177298", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1cccs1)NC[C@@H]1CCN(c2ccc(F)cc2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70223", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(Cc2cc(=O)n3ccsc3[nH+]2)C[C@@H]1O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197235", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1cccc(Cl)c1)c1nnc([C@H]2CCCN(C(=O)c3cccc(F)c3)C2)s1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(S(=O)(=O)c2ccc(F)cc2)cc1)OCc1ccccc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7557", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule COc1cc(C[NH+]2CCC[C@@H](Cn3ccnn3)C2)cc([N+](=O)[O-])c1O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216182", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1nc(-c2nc3ccccc3s2)cs1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142918", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)[C@H](NC(=O)[C@@H](C)Oc1cccc(F)c1)C(C)C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43946", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H](NC[C@H](O)c1ccccc1Cl)c1cccc(-c2ccncc2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83976", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)c1ccc(C[NH+](CC(=O)[O-])CC(F)(F)F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101983", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cc(C[NH2+][C@](C)(CO)C2CC2)cc2c1OCO2 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165228", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)C1CCC1)C(=O)N[C@H]1CC[NH+](C)[C@@H]1c1ccc(Cl)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249392", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1cc(OC2CCN(c3ncc(Cl)cc3F)CC2)ccn1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78921", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(F)c(Cl)c1)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196245", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1cc(NC(=O)N[C@H]2CCCC[C@@H]2C)ccc1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240306", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1sc(/N=C/c2cc(Br)ccc2O)c(C(N)=O)c1C by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21718", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCn1nc(C)c(Br)c1C[C@H](O)[C@H]1CSCCS1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183911", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)[C@H](Oc2ccc(F)c(F)c2)c2ccccc2)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31691", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCc2nc(Nc3ccc(Cl)cc3)ncc2C1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65629", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "263", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCC[NH+]1CCCCCC1)c1c[nH]c2cccc(F)c12 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184277", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Cl)c(C)cc1NC(=O)CNc1ccccc1-n1cccn1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69495", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)C1=C(C)N(Cc2cccs2)C(=O)N[C@@H]1c1ccccc1Br by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15393", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)(C)OC(=O)C1CCC([NH2+]Cc2cccc(CO)c2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188612", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCn1/c(=N/C(=O)c2c(C)nn(-c3ccc(Br)cc3)c2C)[nH]c2ccccc21 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224452", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=C1O[C@H](C(=O)NCCc2cccc([N+](=O)[O-])c2)Cc2ccccc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15761", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC[C@@H](C#N)Oc1cccc(CNC(=O)NCC2(C)CCCC2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C(=O)c1cc(Br)ccc1OC by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191474", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](NS(=O)(=O)CC1CCC1)c1ccc(F)cc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124962", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN1C(=O)[C@@]2(c3ccccc31)c1c(oc3ccc(Cl)cc3c1=O)C(=O)N2CCc1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21521", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCS(=O)(=O)N1CCc2ccc(NC(=O)c3ccc(F)cc3)cc2C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246601", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(c1cc(-c2ccc(Br)cc2)nc2ccccc12)N1CCC2(CC1)OCCO2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168372", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]([NH2+][C@H](C)c1cccc(NC(C)=O)c1)c1ccc(C)c(F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9230", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc2c(cc1OC)[C@@H](c1cccc(Cl)c1)N(C1CCN(C)CC1)CC2 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36292", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1nc(-c2ccccc2F)n[n-]1)c1[nH]nc(C2CC2)c1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149719", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1cc(C(=O)NCc2ccc(OC(F)(F)F)cc2)cn1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170208", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C=C(Br)COc1cc(F)ccc1[N+](=O)[O-] with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143742", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=[N+]([O-])c1cc(Cl)c(NC2CC2)c([N+](=O)[O-])c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](Cc1cccc(F)c1)Cc1ccco1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175010", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)CC[C@H](C)Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205775", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(F)cc1NC[C@H]1Cc2ccccc2S1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200830", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NCC(=O)N2CCC(C)CC2)cc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228461", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1c(C[NH+]2CCCCC2)nc2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc21 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54500", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)[C@H](NS(=O)(=O)c1ccc(C(F)(F)F)cc1)C(C)(C)C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133805", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule NC(=O)[C@@H]1Cc2ccccc2CN1Cc1nc(-c2cccc(Cl)c2)no1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98991", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)C[C@@H](C)[NH+](C)Cc1cc(F)cc(C#CC[NH3+])c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154454", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)[C@@H](C)N1CC[S@@](=O)C(C)(C)C1)c1ccc(Cl)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201850", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(Cc2nc(-c3cccc(C(F)(F)F)c3)no2)cs1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121805", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3670", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1c(C[C@H](C)Cl)c(=O)oc2cc(O)ccc12 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124398", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](Cc1ccc(OC(F)F)c(F)c1)C1CCN(C(=O)OC(C)(C)C)CC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155833", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H](C)[C@@H](NC(N)=O)C(=O)N1CCc2cc(Cl)cc(Cl)c2C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178046", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@@H]([NH2+]Cc2ccc(C(F)(F)F)cc2)C2CCOCC2)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161291", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H]1c2cccn2CCN1S(=O)(=O)c1ccc(Cl)c(Cl)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74723", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Nc1cc(C(F)(F)F)ccc1NC(=O)CSC[C@@H](O)CO with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73310", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc(OC)c1C(=O)Nc1ccc(C#N)c(Cl)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192497", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CO[C@@H](CNC(=O)CCC1CCN(C(C)=O)CC1)c1ccc(F)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17471", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(C[NH+]1CCN(Cc2cc(Cl)c3ccccc3c2O)CC1)N1CCCCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222600", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1ccsc1C(=O)Nc1nc(CCl)cs1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164369", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCOCc1ccc2c(c1)C(O)=C([O-])C(=C1C=CC(=[N+]3CC[NH+](C)CC3)C=C1)O2 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151689", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1ccc(-c2csc(/C(C#N)=C\\c3ccc(O)c([N+](=O)[O-])c3)n2)cc1OC by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232219", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)NC[C@H]1CCC[NH+]([C@@H](C)C(=O)Nc2ccc(Cl)cc2Cl)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48951", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1cccc(CNC(=O)[C@H]2COc3ccc(F)cc3C2)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222701", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NCC[C@@H](O)C1CC1)c1cc(=O)c2ccccc2o1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53965", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C/C(=C/c1ccc(-c2cc(C(=O)[O-])ccc2Cl)o1)C(=O)NCCc1c[nH]c2ccccc12 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117505", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1[nH]ncc1C(=O)N[C@@H](c1ccccc1)c1cccc(F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91922", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1c(=O)c2sccc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103379", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1ccccc1NC1CCN(C(=O)C[C@@H](O)c2ccccc2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142625", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1nc2ccccc2s1)N1CC[NH+](CC(=O)N(CCC#N)c2ccccc2)CC1 by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234015", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc2oc(-c3cccc(Br)c3)nc2c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50324", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)COc2ccccc2C)cc1[N+](=O)[O-] by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123719", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])c(N[C@H]2CC[NH+]3CCC[C@H]23)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237362", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(CN(C)S(=O)(=O)c2ccc(Cl)s2)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49324", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(NC(=O)Nc2ccn(Cc3ccccc3F)n2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52889", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)Cc1ccc[nH]1)c1ccc(F)cc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238257", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1occc1C(=O)NCC(=O)N1CCCN(c2ccccc2C#N)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C(C)(C)NC(=O)NCCOCC(F)(F)F)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180646", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C(=O)[O-])cc1C(F)(F)F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152077", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(/C=C/C(=O)N2CCC(n3c(=O)oc4c(C)cc(C)cc43)CC2)c(Cl)c1OC by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30352", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1cccc(CNc2ccc(Cl)cn2)c1)[C@@H]1CCCO1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30455", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccccc1NC(=O)C[NH+](CC(F)(F)F)C(C)C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5176", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1cccc(C(C)C)c1NC(=O)[C@H](C)Oc1cccnc1[N+](=O)[O-] by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116811", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[C@@H](Nc1ncnc(NC2CC(C)(C)[NH2+]C(C)(C)C2)c1[N+](=O)[O-])c1ccccc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1cc(F)ccc1F)N(C)C(=O)Nc1ccc(CC#N)cc1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215743", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1[nH]nc(Cl)c1Br by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70117", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C(=O)[C@H](C#N)c2ccccn2)c(C)s1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187840", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCn1c(C(=O)[C@H](C#N)c2nnc3n2CCCCC3)cc2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71073", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1ccccc1N[C@H](CO)c1ccc(Br)c(C)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186005", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COc1ccc(-c2nc3cc(NC(=O)c4ccc(C)c([N+](=O)[O-])c4)ccc3o2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150606", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#CC1(NC(=O)[C@@H]2Cc3ccccc3O2)CCCCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140464", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc([C@@H](C)N(C)C(=O)CCCc2cc(F)ccc2F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145234", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](CCc1ccccc1)NC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161845", "split": "OpenMolInst" } }, { "instruction": "Replace a aldehyde in the molecule CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)[C@@H](C)Oc1cccc(C=O)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](NC(=O)CNc1cccc(C(=O)N(C)C)c1)c1ccc(Cl)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220297", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](Sc1nc(-c2ccco2)cc(C(F)(F)F)n1)C(=O)N1CCCC[C@H]1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139802", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC1CCN(C(=O)NCCCSc2ccc(F)cc2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154687", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(OC(=O)c2ccc(Cl)cc2)cc2c1C(=O)/C(=C/c1ccccn1)O2 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48212", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(-c2nc3n(n2)[C@@H](c2ccc(F)cc2)C2=C(CCCC2=O)N3)cc(OC)c1OC by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237057", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N/C(=N/OCc1cc(Br)ccc1F)c1cc[nH+]c(N2CCCCC2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29837", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH+](C)Cc1cc(CNC(=O)C[C@@H](O)c2ccccc2)ccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228440", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C=CCCO[C@H](C)C(=O)N1CCN(C)c2ccc(F)cc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120640", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1noc2nc(-c3ccccc3C(F)(F)F)cc(C(=O)NCC(N)=O)c12 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214584", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccsc1N1CC[C@H](Nc2ccc(F)c(F)c2)C1=O by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205102", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)C(=O)N2CCC[C@H](N3CCCC3=O)C2)c(Cl)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101287", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1CCO[C@@H]([C@H](O)Cc2ccncc2)C1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58678", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Cc1csc(SCc2ccccc2F)n1)NC1CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142083", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(C[C@H]1CCC[NH2+]1)c1nc2ccccc2nc1Cl by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156821", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Cl)ccc1S(=O)(=O)N1CCO[C@H](CC(=O)[O-])C1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242657", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(NC(=O)c2cccc(F)c2)ccc1NC(=O)C(C)C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242419", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)CCCNC(=O)CC[C@@H](C)O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108634", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc([C@@H]2CCCN2C(=O)c2cc(-c3ccc(Cl)cc3)on2)no1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131338", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1c(C(F)(F)F)ccn2ccnc12 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24783", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCCn1cc(-c2nc(NC)ccc2[N+](=O)[O-])cn1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83574", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCC[C@H](CC)C[C@@H](O)c1cncc(Br)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155782", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Fc1ccc([C@@H](CC(F)(F)F)NCc2ccc3c(c2)CCO3)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30540", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CCOc1ccc(/C=C/c2nc(-c3cc4ccccc4o3)no2)cc1 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9584", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cc(NC(=O)[C@H](c2ccccc2)S(=O)(=O)[C@@H](C)[C@@H](C)O)no1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75707", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C[C@@H]1CCC[NH+](CCNC(=O)N2CCN(c3ccccc3[N+](=O)[O-])CC2)C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60183", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@H](CC#N)N(C)C(=O)Nc1ccc(Oc2ccccc2C#N)c(F)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95713", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(C[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccc(Cl)cc1)NCc1ccccc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17727", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)C[C@H](C)NC(=O)[C@@H](c1c(F)cccc1F)N(C)C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136982", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1nc(CC(=O)N2CCN(c3ccccc3F)CC2)cs1)NC1CCCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160670", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)(C)OC(=O)N1CCCC[C@H]1CNCc1nccnc1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204838", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC[C@H](O)[C@](C)(CC)[NH+]1CCCC1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139527", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(CC#N)C(=O)c1cc(Cl)c2ccccc2c1O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239584", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)[C@](O)(c1cc(C)c(O)c(Cl)c1)C(F)(F)F by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7791", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)[C@@H](c1ccc(C#N)cc1)N1CCC(O)(C(F)(F)F)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217595", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=S(=O)([O-])c1ccc(/N=C/c2ccc(O)cc2O)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247347", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCCC2)ccc1N1CCCCCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181145", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCC[C@H]1CC[NH2+]C1)c1c(F)cc(Br)cc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144726", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCCc1cc(OCC(=O)[O-])nc(Nc2ccc(C#N)cc2)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98232", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@@H]1CCCO1)N1CCN(C(=S)Nc2ccccc2F)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79790", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)N/N=C/c1sc2ccc(Cl)cc2c1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182907", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cccc(F)c1-c1n[nH]cc1CN1CCC[C@@H]([NH+]2CCCC2)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43736", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCn1nc(C(=O)N(Cc2ccc(Cl)cc2)C2CC2)ccc1=O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152465", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(NCc2ccccc2F)c2ccccc2[nH+]1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150515", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1ccc(-c2nnc(SC[C@@H](O)c3ccc(C)cc3C)n2C)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13022", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[C@]12CC(=O)NC(=O)[C@@H]2c1ccc(F)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52809", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1cc([N+](=O)[O-])c(C(C)(C)C)cc1C(=O)[O-] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59172", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(NC(=O)CCNC(=O)N2CC(O)=Nc3ccccc32)cc(OC)c1OC by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206902", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#C[C@H]1C(=N)C(C#N)(C#N)[C@H](c2ccc3ccccc3c2)[C@@H]2CCCC=C21 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8413", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(C)C(=O)NCC(=O)N[C@H]1C[C@@H]1c1cccc(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151169", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccccc1C(=O)N(Cc1ccccn1)c1nc2c(Cl)cccc2s1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145229", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@H]1CCN(C(=O)c2ccc(S(=O)(=O)CCCC#N)cc2)[C@@H](C)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197702", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@](C)(NC(=O)CCCOC)/C(N)=N/O by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144431", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(/C(C)=N\\NC(=O)CN(c2cccc(Br)c2)S(C)(=O)=O)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9145", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)OCC(F)(F)F)C2)s1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9169", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1N=C([O-])[C@@]2(Cc3ccccc3N3CCN(c4ccc(Cl)cc4)C[C@@H]32)C(=O)N1c1ccccc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194145", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC[C@@H]1CCN(C(=O)Nc2ccc(F)c(C)c2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138318", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCC[C@@H](C)Nc1ncc([N+](=O)[O-])cc1Br by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56379", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1c(C)nc(Nc2ccc(Cl)cc2Cl)nc1OCC(=O)[O-] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97196", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H](CNC(=O)N[C@@H](c1ccc(F)cc1)[C@@H]1CCCO1)N1CCOCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66580", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule FC(F)Oc1ccccc1[C@H]1CC(c2ccccc2)=Nc2ncnn21 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85076", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1nnc(N[C@H](NC(=O)N(C)C)C(Cl)(Cl)Cl)s1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45288", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)n1ccc(C(=O)N2CCC[C@@H]2[C@H](C#N)c2ccccc2)n1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240786", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(Cc1ccccc1)C(=O)[C@H]1CCC[NH+](Cc2ccc(Cl)cc2)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87010", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC1=NC2=C(C(=O)C[C@H](C)C2)[C@H](c2ccc(Cl)cc2)C1C(=O)Nc1ccc(C)cn1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13640", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](CO)CSc1nc(Cl)ncc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99459", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CSc1ncc2ccccn12)Nc1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6580", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ccccc1F)Nc1ccccc1C(=O)NCc1ccco1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83981", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Cc1ccc(N2CCCC2=O)cc1)Nc1ccc(C(F)(F)F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124963", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCN(CCC#N)[C@H](C)C(=O)N[C@@H](C)c1ccccc1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8944", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1oc2ccc(OCc3ccc(Br)cc3)cc2c1C(=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93748", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](CNC(=O)NCc1ccc(Cl)cc1Cl)CN1CC[NH+](C)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13812", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C([O-])CNC(=O)CN1C(=O)S/C(=C\\c2cccc(F)c2)C1=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152514", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCC[C@H]([NH2+]Cc1cscc1C)c1ccc(F)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77003", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(C[NH+]1CCN(Cc2ccccc2Cl)CC1)NC1CCCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66111", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(CNC(=O)CCCn2c(=O)c3cccn3c3ccc(F)cc32)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241961", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH2+][C@@H](Cc1cc(Cl)ccc1Cl)C(C)(C)OC with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60287", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Nc1ccc(C(=O)Nc2ccccc2SC(F)F)cc1[N+](=O)[O-] by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57681", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1c2n(c(=O)n(CC(=O)Nc3cccc(S(=O)(=O)N4CCCC4)c3)c1=O)CCC2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194934", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCCc1c(F)cccc1F)N1CCN(C(=O)c2ccco2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64097", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NS(=O)(=O)c1ccc(CO)o1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193326", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](OC(=O)c1cccc(F)c1)[C@@H]1CCOC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52521", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H](CSC)N(C)S(=O)(=O)c1ccc(C)cc1Br with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12877", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)c1c(F)cc(Br)cc1N1C[C@@H]2CC=CC[C@H]2C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221536", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCn1cc(S(=O)(=O)N[C@H](CCl)C(C)C)nc1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84781", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(C(=O)N[C@]2(C)CCS(=O)(=O)C2)cc1NC(=O)c1ccccc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33057", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1csc(CCNc2nc(Br)cs2)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28458", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([C@H](C)Nc2ccc(S(C)(=O)=O)nc2)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75966", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1CNc1ccc(N2C[C@H](C)O[C@H](C)C2)c(F)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63787", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(Nc2cc(Cl)nc(N)n2)ccc1N1CCCC1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181016", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CN1CCS(=O)(=O)CC1)N[C@@H]1CCC[C@@H](C(F)(F)F)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67535", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)C[C@@H]1C[NH2+]CC[C@@]12CCC[C@H](C(F)(F)F)C2 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172367", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1c(=O)n(C)c2cc(Sc3ccccc3)c(NC(=O)c3ccc(Br)cc3)cc21 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84127", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule COC(=O)c1ccc(C(=O)Nc2sc3c(c2C#N)CC[NH+](Cc2ccccc2)C3)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7275", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](O)C[C@@H](C)CNC(=O)N[C@@H]1CCN(c2ccc(Cl)cc2)C1=O by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30901", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(C)[C@H](O)CNC(=O)NC[C@H](c1ccc(Cl)cc1)n1cccn1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105992", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCN(C(=O)CCc1c(C)nc2c(C#N)cnn2c1C)C1CCCC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46746", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCc1ccccc1F)c1ccc(N2CCC([NH2+]Cc3nc4ccccc4s3)CC2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12668", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)CN2C(=O)N[C@@](C)(c3ccco3)C2=O)c(F)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80801", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)NC(=S)Nc1cc(Cl)ccc1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155818", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@](N)(C(=O)N1Cc2ccccc2C1)C(F)(F)F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166857", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC1=NC2=C(C(=O)CC(C)(C)C2)[C@H](c2cccc([N+](=O)[O-])c2)C1C(=O)OC[C@H]1CCCO1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169824", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C(C)=O)ccc1OCc1nc(-c2ccc(C#N)cn2)no1 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193316", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC/[NH+]=C(\\NCc1ccc(C)c(F)c1)NC[C@@H]1CCCO1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86066", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(S(=O)(=O)c2cc3c(cc2NC(=O)COc2ccc(F)cc2)n(C)c(=O)n3C)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCC[NH+]1[C@H]1CCC[C@@](C#N)(NC2CC2)C1 by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219596", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](Cl)C(=O)NCC#CCOc1cccc2ccccc12 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10956", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC[C@@](C)(C#N)[C@H](O)c1ccccn1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172783", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1nn(-c2nncc(-c3ccccc3)n2)c2c1[C@@H](c1ccc(O)cc1)CC(=O)N2 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106011", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3cccc(OC)c3OC)[C@H]2C1 by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15000", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#C/C(=C\\c1ccc(-c2ccc(F)cc2[N+](=O)[O-])o1)c1nc2ccccc2[nH]1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144667", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](O)[C@H]1CCC[NH+](CC(=O)NCc2ccc3c(c2)OCO3)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224520", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[C@H](CCO)CNS(N)(=O)=O by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196323", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@](C)([NH3+])C(=O)Nc1ccc(C(F)(F)F)cc1C(=O)[O-] with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60295", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule NC(=O)[C@H]1CCC[NH+]1Cc1cccc(NC(=O)[C@H]2CC(=O)N(c3cccc(Br)c3)C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237037", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N/N=C/c1cccc(O)c1)c1ccc2c(c1)OCCO2 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52801", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H](O)[C@@H]1CCC[NH+](Cc2cccc(OC(F)F)c2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176851", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1cccc(C(=O)N2CCC(CNS(=O)(=O)c3ccccc3F)CC2)c1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124476", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccc(F)cc1)N1CCOc2ccccc21 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78930", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)C1CCN(C(=O)Cn2c(=O)n(-c3ccc(Cl)c(Cl)c3)c(=O)c3ccccc32)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202542", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=C(C)CN(CC)C(=O)CS(=O)(=O)c1ccc(F)c(F)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(C(=O)N2CC[C@@H](C)[C@@H](O)C2)cc1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80101", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)c1cc([C@H]2CCC[NH+]2Cc2cc(F)ccc2F)no1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183950", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1CN(C(=O)NCCc2coc(-c3ccc(F)cc3)n2)C[C@@H](C)S1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243149", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1[C@@H](O)Cc1nccs1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36458", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCOCCCNC(=O)N[C@H]1CCC[C@H]1CO by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97087", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1nc(OC(C)C)cc(N2CCN(C(=O)Nc3ccccc3F)CC2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184111", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Br)cc1[C@H]([NH3+])c1ccc(Br)o1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200860", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1cccc(C2=CCN(C(=O)C(=O)Nc3ccc(C#N)cc3)CC2)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120629", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CNC(=O)CN1c2ccccc2C(=O)N(C)[C@@H]1c1cccc(C#N)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181807", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCC[NH2+]Cc1cc(F)c(O[C@@H](C)[C@H](C)O)c(F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206763", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(C)c1ccc([C@@H]2[NH2+]C[C@H](CSc3ncc(C(F)(F)F)cc3Cl)O2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247853", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Nc1cc(F)c(OCc2ccc(C(=O)[O-])cc2)cc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246107", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC1(C)CCC[C@H]1Nc1cc2c(cc1Br)OCCO2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80319", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2noc([C@H]3CCCN(S(=O)(=O)c4cccc(F)c4)C3)n2)cc1OC by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132465", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1ccccc1NC[C@@H](O)Cn1c2ccccc2c2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135925", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCN(C(=O)[C@@H]2CCCN(C(=O)c3ccccc3)C2)C[C@@H]1O by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203660", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NC1(c2ccccc2)CC1)[C@H]1CC(Cc2cccc(F)c2)=NO1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107948", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#CCCCCO[C@@H]1CCC[C@H]([NH3+])C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21537", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(C[C@@H](O)c1ccccc1)NCC(=O)OC1CCCCC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53629", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(F)cc(C[NH2+]Cc2ccc(SC)c(OC)c2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158788", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C)c1OCCN1C(=O)C(=O)c2cc(Cl)cc(Cl)c21 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30257", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(CNC(=O)Cc2csc3nc(-c4ccc(F)cc4)cn23)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7205", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC(C)(C)OC(=O)N1CCC[C@H]([S@@](=O)c2ncccc2[N+](=O)[O-])C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93721", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](NC(=O)Cn1c(=O)c(C#N)cn(C2CC2)c1=O)c1ccco1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60836", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C([C@@H]1Cc2ccccc2N1C(=O)c1ccccc1)N1CCN(c2ccccc2F)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242581", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COC1CCN(C(=O)c2c(O)cc(Cl)cc2Cl)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76236", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCC1(C(=O)N2CCC[C@H](C#N)C2)CCCC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112018", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCCCOc1ccccc1)c1ccccc1Br by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179026", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NC[C@]1(O)CCC[NH2+]CC1)c1ccccc1Cc1ccc(Cl)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161257", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H](NC(=O)c1ccc(O)c(Cl)c1)C(=O)Nc1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193260", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@](O)(CNC(=O)C1=Cc2cc(Cl)ccc2OC1)c1cccs1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143186", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H](NC(=O)Nc1cnn(C)c1)c1ccc(Br)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98507", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCc1nc(CN(c2cccc(C#N)c2)S(C)(=O)=O)no1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32427", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1cc2c(cc1Cl)OCCCO2)c1cn2cccnc2n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60622", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1nc2c(c(=O)[nH]1)C[NH+](Cc1ccccc1)CC2)Nc1cccc(F)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206178", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CCCn4nc(C)cc4C)C3)noc2n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204716", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)CC[C@@H](CBr)c1ccccc1F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246092", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1c(Cl)cc(Cl)c(OC)c1C(=O)NC(=O)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141803", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C=C(C(=O)OC)[C@@H](O)c1csc(-c2ccc(Cl)cc2)n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2C(=O)C[C@@H](N(CCc3ccccc3)C(=O)c3ccc(F)cc3)C2=O)cc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20226", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1sc2nc([C@H](C)OC(=O)c3cccc(O)c3)[nH]c(=O)c2c1C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156993", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@@H](C)CN(C)C(=O)Nc1cccc(Cl)c1C by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103961", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC[C@@H]1CC[C@@H](C#N)[C@H]([NH+](C)CCOCC2CC2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123260", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(NCc1ccnc(OCc2ccccc2)c1)N[C@@H]1CCC[C@@H]1CO by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47973", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CN(CC(C)(C)O)C(=O)c1cccc(OC(F)F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126053", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[NH2+][C@H]1CC[C@@H](Cc2ccc(O)cc2)[C@@H]1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20214", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccc([N+](=O)[O-])cc2)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45686", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1cc(-c2nc(-c3ccccc3Br)n[nH]2)ccc1O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242339", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCN(CC)C(=O)CSc1nc(-c2ccc(C)cc2)ccc1C#N by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178033", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(NC[C@H](c1cccs1)[NH+]1CCCC1)N[C@@H]1C=C[C@H](CO)C1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176609", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)c1ccc(NC(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)c(F)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185877", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N[C@@H](c1ccc(F)cc1)c1ccc(Br)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54106", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cscc1C(=O)NO by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60107", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule C=CCNc1ncnc(Oc2ccc(C)c(C)c2)c1[N+](=O)[O-] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152631", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc2ncc(CN3CCN(Cc4ccc(Cl)nc4)CC3)n2c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12501", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1ccccc1[C@H](C)NC(=O)N[C@H](CO)c1ccc(Cl)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212882", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC(C)C[NH+](C(C)C)[C@@H]1CCC[C@@](C#N)(NC2CC2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217011", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule COc1cccc([C@@H]2C(C#N)=C(N)Oc3[nH]nc(-c4ccccn4)c32)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242783", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)NC(=O)CN1CCN(C(=O)N[C@@H]2CCN(CC(F)(F)F)C2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100194", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@@H]([NH2+][C@@H](CO)c1ccccc1F)c1cccs1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157057", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C(F)F)cc1S(=O)(=O)N1CCC(c2nnc3n2CCCCC3)CC1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186195", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cccc(C(=O)N2CCC[C@H]2c2ccccc2Cl)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138164", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nn(C)c(OC)c1CNc1cc(Cl)nc(C)n1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33957", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CN1CCO[C@@H](CO)C1)Nc1ccc(Cl)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88386", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC1=C(C2[NH+]=c3cc(C)c(C)cc3=[NH+]2)[C@@H](Cl)N(C)N1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34509", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1nc2c(s1)CN(S(=O)(=O)c1ccccc1F)CC2)c1ccccn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68976", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3161", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCN1CCN(CC(=O)N[C@H](C#N)c2ccc(C(C)(C)C)cc2)C(=O)C1=O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74894", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1c(SCn2cc(Br)cn2)nc(C(F)(F)F)c2c1CCC2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194064", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccccc1)Nc1nn2c(-c3cccc(Cl)c3)nnc2s1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138855", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H]1[C@@H](c2ccccc2)[NH2+][C@@H](c2ccccc2)C[C@@]1(O)c1ccc(F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125666", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(F)c(NC(=O)C(=O)N[C@@H]2CC[C@@H]([NH+](C)C)C2)cc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23304", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCOC(=O)[C@H](O)C=C(C)C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242202", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCc1ccc(NC(=O)C(=O)NCC#N)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42594", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[NH+](CCNC(=O)C(=O)Nc2cccc(Cl)c2Cl)C1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152131", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60645", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC[C@H](C#N)OC(=O)CNC(=O)Cc1cccc(F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162332", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1c(NC(=O)CN2Cc3ccccc3C[C@H]2C(N)=O)sc2c1CCC2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226000", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([C@H]1Cc2cc(F)ccc2O1)N1CCC[C@H](c2ccn[nH]2)C1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71193", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(c1cccc(F)c1)N1C[C@H]2CCCN(S(=O)(=O)[C@@H]3CCS(=O)(=O)C3)[C@H]2C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80902", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(N/N=C\\c1ccc([N+](=O)[O-])o1)c1ccccc1[N+](=O)[O-] by replacing a nitro by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233728", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cnc(NC(=O)CCn2cc(Br)ccc2=O)s1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203220", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(C)c(NNC(=O)c2cnn(-c3ccccc3F)c2)c(C)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158607", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1ccc(Cl)nc1)c1nc2ccccc2[nH]1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162129", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN1CCN(C(=O)C2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146075", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H]1C(=O)NCCN1C(=O)Cc1csc(Cc2ccc(F)cc2)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88653", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1NC(=O)CNc1cccc(Cl)c1Cl by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9807", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(C(=O)N/N=C/c2ccc([N+](=O)[O-])s2)cc1I with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29475", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCC[C@@H]1CO[C@](Cn2cnnc2)(c2ccc(Cl)cc2Cl)O1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99921", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)OC[C@@H](O)CI by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91271", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@@H](C[C@@H](C)CC(C)(C)C)c1ccc(F)c(C)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194680", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc([C@H](C)C(=O)Nc2cc(NC(C)=O)ccc2F)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226922", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@H](C)CNC(=O)c1cccc(C(F)(F)F)c1NC with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122151", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O[C@H](c1ccc(F)c(Br)c1)c1c(F)cccc1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143836", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CCc1ccccc1N1C(=O)/C(=C(\\C)c2ccc([N+](=O)[O-])cc2)SC1=S by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240428", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CCC(=O)N(Cc2cccc(Cl)n2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147018", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CNC(=O)c1ccccc1Cl)Nc1cccc(C(=O)NC2CC2)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100490", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CC#N)N(C)C[C@@H]1CSc2ccccc21 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107886", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1[nH]c([C@H]2CC(=O)N(C(C)C)C2)[nH+]c1-c1ccccc1F by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238094", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N[C@@H]1CCC[NH+](CCc2ccc(OC(F)(F)F)cc2)C1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47407", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](NC(=S)NC1CC1)c1nc(-c2ccc(F)cc2)no1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241868", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1c(Br)cccc1CNC(=O)N[C@H](C)CC(C)(C)OC by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63346", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1c(C[NH2+][C@@H](C)c2ccccc2)cc(Cl)cc1OC with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147404", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccc(OCCCN2CCC[C@H]([NH+]3CCCC3)C2)cc1 by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63526", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])[C@@H](Cc1ccc(O)cc1)Nc1c2ccccc2[nH+]c2ccccc12 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121646", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCOC[C@@H](O)C[C@H]1C[C@H](C(C)(C)C)CCC1=O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57094", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@](C)(NC(=O)Nc1c(C)cccc1Cl)C(=O)[O-] by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175820", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1NC(=O)C2(CCN(C(=O)c3cc(Br)c[nH]3)CC2)N1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199916", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C=CCOc1ccc(/C=N/NC(=O)C(=O)Nc2cccc(Cl)c2C)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14694", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cc(/C=C2\\C(=O)N(c3ccc(Br)cc3)N=C2C)ccc1OCc1ccccc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149716", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NS(=O)(=O)c1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140203", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1c(Nc2ccc3c(c2)OCCO3)nc2ccccn12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78661", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=S(=O)([O-])c1ccc(N/N=C/c2ccccc2O)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229219", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Sc1ccc([N+](=O)[O-])cc1)[C@@H](C)C(=O)[O-] by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143252", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(C)C(=O)CN(C)C(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202776", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(C(=O)CSc1n[nH]c(/C=C/c2ccc(F)cc2)n1)[C@H]1CCCc2ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218578", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc([N+](=O)[O-])c(C(=O)OCc2ccccc2Cl)n1C by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98404", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC/[NH+]=C(/NCc1ccc(Cl)cc1Cl)NCC1([O-])CCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195711", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1nnc(NC(=O)c2ccccc2OCc2ccc(Cl)cc2)o1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159437", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+]C[C@]1(c2ccc(F)cc2Cl)CCC[C@@H]1C by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28913", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cnnc1C1CCN(C(=O)c2cc([N+](=O)[O-])c(C)s2)CC1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248667", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(C)C[C@@H]([NH3+])c1occc1Br by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192990", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CCS(=O)(=O)c1ccc(Br)cc1)N1CCN(c2ccc(F)cc2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200489", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C(=O)c2ccccc2)c(Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30887", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CS(=O)(=O)c1ccc(C(=O)N2CCC(OCc3ccccc3F)CC2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174778", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)CC(=O)N1CCN(C(=O)Cc2ccccc2F)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205951", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCc1c(C)nn(C(=O)/C(C#N)=N/Nc2ccccc2[N+](=O)[O-])c1C by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225485", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)N1CCN(C(=O)c2ccco2)CC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160066", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(COc1ccc(Br)cc1CO)NCc1ccco1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216594", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1cccc1C(=O)Oc1ccc(C(F)(F)F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110026", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1cnn(-c2ccccc2F)c1)N[C@@H](CO)Cc1ccccc1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137389", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1Cc2ccccc2N1C(=O)[C@H](C)[NH+]1CCCN(CC(F)F)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95434", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[NH+](CC)CC[C@@H](O)c1cccnc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100916", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)Nc1ncnc(Nc2ccccc2F)c1[N+](=O)[O-] by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27748", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOc1ccc(NC(=O)C(=O)c2cccn2Cc2ccc(F)cc2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77649", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule [NH3+]CC1([C@H](O)c2cc(Cl)c3c(c2)OCO3)CCOCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212141", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCC[NH2+]C[C@@H](Cc1cscn1)c1ccccc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31713", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)n1cc[nH+]c1[C@H]1CCCN(c2ncc(F)c(N3CCOCC3)n2)C1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144321", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cnc2c(S(=O)(=O)N[C@@H](C)c3ccccc3Cl)cccc2c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13952", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc(C2=CCN(C(=O)NCCOCC(F)(F)F)CC2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186333", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[NH+](C)C[C@@H](Cc1ccccc1)NC(=O)N[C@@H]1C=C[C@H](CO)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209097", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2nc(-n3nc(C)c4c3NC(=O)C[C@@H]4c3ccc(F)c(F)c3)sc2c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34634", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CCC(O)(C2(C#N)CCCC2)CC1 by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94018", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COC[C@@](C)(O)CNC(=O)c1cc(OC)cc(OC)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167953", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Nc1c(Br)cnn1[C@@H]1CCC[C@@H]1O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221484", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(OCc2nnc(NC(=O)c3ccc(Br)cc3)s2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86426", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCC1(O)CCSCC1)N[C@@H]1CCC[C@H](C2CC2)C1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239158", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=[S@](Cc1ccccc1)C(Cl)(Cl)c1ccccc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168337", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](CCO)NC(=O)Nc1ccc(C(=O)N2CCCC[C@H]2C)cc1C by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81154", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Clc1ccc(C[C@H](NCc2cccnc2)c2ccccc2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81425", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1ccc2c(Cl)c3c(nc2c1)CCC3)N1CCCCC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NC(=O)c2cccc(F)c2)ccn1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145388", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CC1(NC(=O)CN2CCc3ccc(S(N)(=O)=O)cc32)CCCCC1 by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144723", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1C[C@H](C)C[NH+](C[C@@H](C)NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48766", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(NC(=O)COC(=O)c2ccccc2I)c(Cl)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171275", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(c1cnc(N2CCC(O)CC2)c(Cl)c1)N1CCCCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22693", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(CN2CCN(C(=O)c3c[nH]c4cccc(F)c34)CC2)oc1C by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(-c2ccc(Cl)cc2)c(C)c1CCC[NH3+] by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6504", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N#Cc1cc(NC(=O)NCCNC(=O)c2cccnc2)ccc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54752", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1n[nH]c2ncc(C(=O)Nc3n[nH]c4ccc([N+](=O)[O-])cc34)cc12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135792", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N#C/C(=C/c1cc(Cl)cc(Cl)c1Cl)C(=O)NCc1ccccc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134538", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCOc1ccc(N2C(=O)C[C@H]([NH2+]Cc3ccc(F)cc3)C2=O)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34278", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule N[C@H](c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)C(F)(F)F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110662", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@@H](C)NCCc2nc(-c3ccccn3)cs2)cc1[N+](=O)[O-] by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225015", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC[C@H](NC(=O)c1c(O)cc(F)cc1F)C(=O)N1CCOCC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123007", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1ccccc1N1CCN(c2nc3ccccc3[nH]2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11577", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3212", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule FC(F)(F)Cn1ccnc1CN1CCc2ccccc21 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233602", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC(=O)N1CCC[C@H]1C[C@H](C)O by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100347", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCn1c(NNC(=O)CC2(O)CCCCC2)nc2ccccc2c1=O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75408", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1c2ccccc2C(=O)N1N1C(=O)c2ccc(Oc3cccc([N+](=O)[O-])c3)cc2C1=O by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73200", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([C@@H]1Cc2ccccc2N2CCN(c3ccccc3F)C[C@H]12)N1CCOCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101367", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)cc1)c1cccc(S(=O)(=O)N2CCCC2)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51362", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC(C)[C@H](C)NC(=O)CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-] with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112287", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@H]1CC[C@@](C#N)([C@H](O)c2ccoc2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71765", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1cc2c(c(CN3CCN(c4ccccc4)CC3)c1)OCOC2 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCO/C([O-])=C(\\C#N)C(=O)c1ccccc1 by substituting a nitrile with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87954", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(N[C@@H]1CCCC[C@@H]1C(F)(F)F)[C@@H]1CC(=O)N(c2ccc3c(c2)OCO3)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246941", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1nc(C[NH+]2CCC(CNc3ccc(Cl)cn3)CC2)cs1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249356", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]1c2nc3ccccc3n2[C@@H](CC(=O)NCc2ccc(F)cc2)C(=O)N1Cc1ccccc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39386", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(Cl)ccc1Nc1ncnc(NNC(=O)c2ccncc2)c1[N+](=O)[O-] by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91967", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(=O)[C@](O)(C/C([O-])=C2/CCc3ccccc3C2=O)c2cc(Cl)ccc21 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248746", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H]1SCCC[C@@]1(O)Cc1ccc(Cl)s1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149817", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=S(=O)([N-]c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1)c1ccc(Cl)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210900", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)[C@@H](O)C[C@@H]1CCCCC[C@@H]1O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22569", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1[C@@H]2CCCCN2C(=O)CCN1CCC(F)(F)F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232567", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)[C@@H](CO)[NH2+]Cc1c(Cl)cccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207506", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1C[NH2+][C@H](c2cc(F)cc(F)c2)CS1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161566", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1923", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=c1c2scc(-c3cccc(F)c3)c2ncn1Cc1ccccn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48662", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C#Cc1cccc(NC(=O)CBr)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103541", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)(F)CCc1noc(COC2CC[NH2+]CC2)n1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105704", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCCCC2)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149451", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)CNC(=O)c1ccccc1Nc1ccc(OC(F)F)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30439", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S1(=O)CCC[C@H]([NH2+][C@H]2CCc3c(Cl)cccc32)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210394", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(c1)c1c(n2C[C@H](O)CN2C(=O)CNC2=O)C(=O)CCC1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176512", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(Br)c(O)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223104", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](Cl)OC(=O)Sc1ccccc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218525", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1noc(-c2ccc(NC(=O)c3ccc(F)cc3)cc2)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98084", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H]1CCC[C@H](NC(=O)C(=O)Nc2ccc(OC(C)C)cc2F)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244446", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOc1ccc(S(=O)(=O)Nc2cccc(C)c2)cc1NC(=O)c1ccccc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36928", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C([O-])c1nnn(-c2ccc(C(F)(F)F)cc2)c1-c1cccc(Cl)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190686", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC[C@@H]1CCCN(C(=O)C(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21380", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCc1cc(OC(=O)CCc2c(C)nc3ncnn3c2C)ccc1Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73962", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1cccc([C@H](O)[C@@H](C)c2ccccn2)c1OC with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144074", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@H](C)NC(=O)c1cc(S(=O)(=O)NC(C)C)ccc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63804", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCn1cc(C[NH+]2CCC(C[NH+]3CCCCC3)CC2)cc1C#N with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135871", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCC1(CC)CC[NH+]([C@@H]2CCC[C@@](C#N)(NC)C2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97242", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c(C(=O)Nc2cc(C(F)(F)F)ccc2-n2cccn2)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205726", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule [NH3+][C@@H](c1c(F)cccc1F)[C@@H]1CCc2cccnc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32321", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)N[C@H](C)C1CCOCC1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169122", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@H]2Nc3ccc(S(=O)(=O)Nc4cccc([N+](=O)[O-])c4)cc3[C@H]3C=CC[C@H]32)cc1 by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217458", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1CC[C@H](C(=O)N2CC[C@H](Oc3ccc(C(F)(F)F)cn3)C2)O1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227985", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NS(=O)(=O)Cc1ccc(NC(=O)Cc2ccc([N+](=O)[O-])cc2)cc1 by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240601", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO/N=C/C(C#N)=C/c1cc(C(=O)c2ccc([N+](=O)[O-])cc2)cn1C by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65503", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(/C=C/C(=O)NNC(=O)COc2ccc(C)cc2Br)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181134", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c2ccccc2n1 by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78686", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(/C(O)=C2/C(=O)C(=O)N(CC[NH+](C)C)[C@H]2c2ccc(C)o2)cc1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137723", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)[C@@H](O)CCNC(=O)NC[C@@H]1CCN(c2ccc(F)cc2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199022", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C1CCC(c3ccc(O)cc3)CC1)CC2 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177014", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N#Cc1ccc(CNC(=O)N2CCC[C@@H]2C[NH+]2CCC[C@@H]2CO)c(F)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121004", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCc2nc([S-])nc(C(F)(F)F)c2C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83055", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)CNC(=O)[C@@H](C)[S@](=O)Cc1ccn(-c2ccc(F)cc2)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196507", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc([C@H]2NC(=O)N(C)C(C)=C2C(=O)OCCC(C)C)cc(Br)c1O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145505", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1cccc([C@@H](O)[C@@]2(C#N)CCOC2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49587", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(-c2ccccc2)c(C)c1N[C@H](C)C(=O)Nc1ccc(F)cc1F by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183094", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3627", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(Nc1ccc(F)c(F)c1F)N[C@H](CO)c1ccc(Cl)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145952", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Oc1ccc(CNc2cc(-c3ccc(F)cc3)nc3ccnn23)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161175", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CNC(=O)[C@@H](C)NC(=O)Nc1ccccc1OCc1cccc(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104224", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(F)cc1NCC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42425", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccc(CCCNC(=O)c2cc(Cl)ccc2-n2cnnn2)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132699", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH2+][C@@H](CO)c1ccc(Br)c(C)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164693", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN1C(=O)[C@](O)(CC(=O)/C=C\\c2ccccc2)c2ccccc21 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81970", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1csc(CS(=O)(=O)[C@H](C)c2ccc(F)cc2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26302", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC1=C2C(=O)CCCC2=N[C@@H]1C(=O)N(C)Cc1ccc(OC(F)F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35357", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccsc1C[NH2+]C[C@@H](O)CC by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91428", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(c2ccc(NC(=O)Nc3cnn(CCO)c3)cc2F)C[C@H](C)O1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153855", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](NC(=O)C(=O)Nc1ccc(C#N)cc1)c1ccc2c(c1)CCCC2 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70208", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(C)c1cc(CN2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)cc[nH+]1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190824", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(C#N)ccc1OCC(=O)Nc1ccc(F)c(Cl)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138567", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)Cn1nnc2ccccc2c1=O)c1ccc(Cl)s1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246978", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(NC[C@H](O)COCC1CC1)NC1CCCCCC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150148", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COCCN(C)C(=O)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126248", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@H]1CCC[C@](C#N)(NC(=O)CCCc2cc(F)ccc2F)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10240", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(NC(=O)NCc2cccc(OCC(F)F)n2)ccc1C(N)=O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241105", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#Cc1ccc(/C=C/CN2CCO[C@H](c3ccsc3)C2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44677", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCn1c(S[C@H]2CC[C@@](C#N)(NC)C2)n[nH]c1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203119", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C[NH2+][C@@H](C)c1cnc(C)s1)Oc1ccccc1F by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188470", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](C)C[C@@H]1CN(Cc2ccc(F)c(F)c2)C[C@H]1c1ccnc(N2CCCC2)n1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16478", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)N1c2ccccc2C[C@H]1C(=O)Nc1c(C)cccc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130478", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@H]1C[C@@H]([C@H](O)c2c[nH]nc2-c2ccccc2)CC[C@H]1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111756", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(Cl)cc1C(=O)Nc1ccn(C)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121157", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CCNC(=O)NCc1ccc(Oc2ccc(F)cc2)nc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97875", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC1=NCCS1)c1ccccc1OCc1cccc(Br)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145211", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)c1cc(Br)ccc1NC(=O)c1ccoc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199673", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H](OC(=O)c2c3c(nc4ccccc24)/C(=C/c2ccc(O)cc2)CC3)C(=O)O1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147426", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(c1cnc([C@H]2CCCO2)s1)N1CCc2c(Cl)cccc21 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219349", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)C[NH+]1CCC[C@H]1c1cccc(C)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139891", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1CN1CCN([C@@H](C)c2nnc(C)o2)CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67154", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(O)c(NC(=O)c2ccc(Br)s2)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53747", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(F)ccc1OC1(C(=O)[O-])CCN(C(=O)[C@H]2CCOC2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192220", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C[NH+]=C(N2CCN(C/C=C/c3ccc(C#N)cc3)CC2)S1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191514", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=[N+]([O-])/C=C\\c1ccc(Sc2ccc(Cl)cc2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212986", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1nc2c(s1)CCCC2)C(=O)[C@H]1C[C@H]1c1cccc(Cl)c1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191564", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C([O-])CCCC[C@H](O)c1ccc(F)c(Br)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212206", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1ncnn1C)C(=O)Nc1cc(C#N)ccc1OC(F)F by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173021", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](CCCO)Nc1ccccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105850", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)Cn1cc(NC(=O)NNc2ncccc2Cl)cn1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58650", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N1Cc1cccc(Cl)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234508", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ncccc1C(F)(F)F)N1CC[C@H](Oc2cccnc2)C1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134573", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCn1c(Oc2ccc(C=O)cc2OCC)nc2c1c(=O)n(C)c(=O)n2C by substituting a aldehyde with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87410", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#Cc1cc(Cl)nc(NNC(=O)/C=C/c2cccnc2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135430", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Oc1ccc(Br)cc1F)c1ccccn1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181067", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CSCC[C@@H](C)[NH+](C)Cc1cc(F)cc(F)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78051", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-n2c(COc3ccc(C#N)cc3OC)nc3ccccc32)cc1 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10287", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)N1CCC[C@@H](C)CC1)c1cccc(C#N)c1 by substituting a nitrile with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80576", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+]C[C@H](Cc1nccs1)c1ccccc1Br by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228986", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnnn1-c1cccc(NC(=O)c2cc(F)cc3[nH]cnc23)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112455", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCC[C@@H]1CC[C@H](C#N)[C@H]([NH+](C)CC)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47969", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C[NH+]1CCCN(C(=O)c2cc(Cl)c3c(c2)OCCCO3)CC1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162536", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(NC(=O)c2cc(F)c(F)c(F)c2F)cc(OC)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75927", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cc(Br)c(/C=C(\\C#N)C(=O)Nc2nccs2)cc1OC by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48857", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)cc(CSC[C@H](C)/C(N)=N/O)c1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236202", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@@H](c3ccccc3)[C@@H]2C1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)NCCc2ccc(O)cc2)cc1F by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103167", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)CN(C)C(=O)N[C@@H]1CCCN(c2ccc(OC(F)F)cc2)C1=O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103902", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#C[C@@H](NC(=O)c1coc(Br)c1)c1ccc(Cl)c(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72521", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(O)c(NC(=O)[C@@H]2CCCN2C(=O)OCC(F)(F)F)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148884", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(C(=O)N2C[C@@H]3C[C@H](C2)c2ccc(C4CCCCC4)c(=O)n2C3)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189152", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH+](CC)[C@H]1CCC[C@@](CO)([NH2+]CC)C1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17086", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule N#Cc1cc(F)c(CO)c(F)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58053", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#CCNC(=O)CCCNS(=O)(=O)c1ccc2c(c1)CCCC2 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112646", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1CCN(c2ccc(CNC(=O)NC[C@@H](O)C3CCOCC3)cc2)CC1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195762", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](NS(=O)(=O)c1ccc(F)cc1Cl)C(=O)N1CCOCC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164984", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1Nc1ncnc(Cl)c1N by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119439", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc([C@@H](C)NC(=[NH2+])NC(C)C)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247888", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1ccccc1)c1cc(C(F)(F)F)ccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158058", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1cc(Br)cc(C[NH+]2CCC[C@H]2CCCCl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155214", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)([C@H](N)Cc1cccc(F)c1F)[NH+]1CCCCCC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88943", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc2c(cc1Cl)[C@H](C)[C@H](CC(=O)N=c1[nH]c3ccccc3[nH]1)C(=O)O2 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245435", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CCNC(=O)CCCC(=O)N1CCc2ccc([N+](=O)[O-])cc2C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163908", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N#CN(Cc1ncc(-c2cccc(Cl)c2)o1)c1ccccc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120747", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CN(Cc2ccco2)C(=O)c2ccc(Cl)cc2)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139233", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1c(C)nc2ccc(C)cc2c1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177213", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(C(=O)NC(=N)c2ccc(F)c(Cl)c2)cnn1C by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29976", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(c1cnc2nc([O-])[nH]c(=O)c2c1)N1CC=C(c2ccccc2Cl)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61926", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)CC[C@@H](C)NC(=O)CN1CCO[C@H](CO)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158497", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccc(C(=O)N2CCN(Cc3ccccc3CO)CC2)c(F)c1F with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198698", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOC[C@@H]1CCN(C(=O)CSc2cccc(C(F)(F)F)c2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220020", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(N[C@@H]1CCCc2c1cnn2-c1ccc(F)cc1)c1ccncc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190451", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(N2C[C@@H](c3nnc(NC(=O)c4cccc(Cl)c4)s3)CC2=O)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116661", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule [NH3+]CC1([C@@H](O)c2cccs2)CCCCCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72863", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)C(C)(C)C#N)n(-c2cc(C(F)(F)F)ccc2Cl)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111119", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCNC(=O)CN1CCN(C(=O)c2cccc(F)c2Cl)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240925", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(OCc1ccccc1)N1CCC(O)(CNc2ccccc2)CC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C(=O)NCCOc2cccc(Br)c2)ccc1[N+](=O)[O-] by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179906", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(C)C(=O)CN1CC[NH2+]C[C@@H]1C#N by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31116", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH+](CC)C1([C@H](NC)c2c(F)cccc2F)CCCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20330", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1nn(C)c(Cl)c1[C@@H](O)[C@@H]1CCO[C@]2(CCSC2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26055", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1ccc(Cl)c(NC(=O)OCCO)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142196", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CC=CC[C@@H]1COC(=O)c1ncccc1C(F)(F)F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81565", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(Cc1ccc(Cl)cc1)C(=O)c1ccc(OC[C@H]2CCCO2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190980", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCN(Cc1ccsc1)S(=O)(=O)c1ccc(F)cc1F by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42866", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COc1ncnc(OC[C@H]2CCCC[C@H]2C[NH3+])c1[N+](=O)[O-] by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122505", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc2c(c1)OCCO2)N1CCCCC[C@H]1c1ccccc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7130", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](Cc1ccccn1)n1cnc2c(F)cccc2c1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4301", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1c(F)cc(Br)cc1F)c1ccccc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80610", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1ccccc1-c1ccc(C[NH+]2CCN(C3CC[NH+](C)CC3)[C@@H](CCO)C2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143488", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37242", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)C[C@H](C[NH3+])Nc1ccccc1Cl by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219174", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(N[C@@H]1CCN(c2c(F)cccc2F)C1=O)N1CCSCC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182412", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1noc(C)c1S(=O)(=O)Nc1cccc(Br)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128598", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCN(CC(F)F)C(=O)N[C@@H]1CCN(c2ccccc2)C1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74476", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1Cc2cc([N-]S(=O)(=O)c3cc(Br)ccc3F)ccc2N1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56850", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1cc(C(F)(F)F)ccc1Cl)[C@H]1CCCC[C@@H]1C(=O)OCCF with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100720", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc(C)c1C(=O)NCc1ccnc(OCC(F)(F)F)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181544", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1c(NC(=O)C(=O)NCCO)sc2c1CC(C)(C)OC2 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134935", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ocnc1CNC(=O)N[C@H]1CCOc2c(Cl)cccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4298", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)NC(=O)c1cccc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150754", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "320", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H](Cc1nccs1)[C@@H](C)Br by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161586", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC(C)N(CCCCl)c1nc2cc([N+](=O)[O-])ccc2[nH]1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152824", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+]1CCC[C@@H]1CNC(=O)N[C@@H](C)COc1ccc(F)cc1F by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217622", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@H]1Oc2ccc(NC(=O)c3cc(C#N)cs3)cc2NC1=O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193885", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(Nc1ccc(-c2nc3ccccc3o2)c(O)c1)c1cccnc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130999", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCN(Cc1ccccc1)C(=O)CN1C(=O)N(c2ccc(C)c(Cl)c2)[C@@H]2CS(=O)(=O)C[C@H]21 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141029", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N#CC1=C(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)NC(=O)C[C@H]1c1ccc(F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174755", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(Cl)ccc1OCCCNC(=O)NC[C@@H]1CCC[C@H](O)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103736", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc(F)cc1)c1ccc(-n2cccn2)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207887", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](Oc1ccccc1OC)C(=O)N1CCC[C@@H](c2cc(C(F)F)n3ncnc3n2)C1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64680", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule [NH3+]Cc1cn[nH]c1N1C(=O)c2cc(F)c(F)cc2C1=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221722", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(Br)cc1NC(=O)CCNC(=O)C1=CCCCO1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8012", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cn1cnc2ccc(Cl)cc2c1=O)NCCC1=c2ccccc2=[NH+]C1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199434", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=C1CCCCN1c1ccc(C(=O)N2CCc3c2cccc3[N+](=O)[O-])cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94681", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH2+]Cc1ccc(F)c(Br)c1)NC1CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25240", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1cccc(S(=O)(=O)N(Cc2cccnc2)c2ccc(Cl)cc2)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177657", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1ccc(Cl)cc1NC(=O)NC[C@H](C)C#N by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226031", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1ccccc1OC[C@@H](O)C[NH2+][C@H](C)c1c(C)noc1C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125043", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC1CCC([NH2+]Cc2c(C(=O)[O-])n(Cc3ccccc3F)c3ccccc23)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175853", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cc(F)c([C@H](C)NC(=O)c2c(C)cc(C)cc2C)cc1OC by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42569", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(N2CCc3c2nc2ccc(Br)cc2c3N)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H]1NC(=O)N(C[C@@H](O)c2cccc(F)c2)C1=O by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72359", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cnn(-c2ccc(C(=O)Nc3cc(C)c(F)cc3C(N)=O)cc2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203329", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)c1nn(C)cc1C[NH2+][C@@H]1CCSc2c(F)cccc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94513", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule [NH3+][C@H]1C=C[C@@H](C(=O)Nc2ccc(Cl)c(F)c2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206853", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](NC(N)=O)C(=O)NCc1cc(Cl)ccc1OC(F)F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186084", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CS(=O)(=O)N1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "74708", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC1=[NH+]C[C@H](c2ccc(F)cc2)N1c1ccc(Cl)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180591", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c(C(=O)Nc2ccc(Cl)c(Cl)c2)nnn1Cc1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36811", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(F)cc(CN2C[C@@H](C[NH+]3CCC(CO)CC3)[C@@H](CO)C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163872", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2c(c3c1C(=O)/C(=C/c1ccc(Cl)c(Cl)c1)O3)CN(C1CC1)CO2 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210198", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1ccc(NC[C@@H](O)CN2CCOCC2)c([N+](=O)[O-])c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125073", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCC1(c2cccc(C(F)(F)F)c2)CCCC1)Nc1nncs1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101476", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H](C)N(C)C(=O)NC1CC[NH+](Cc2ccc(F)c(F)c2)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188302", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)Cn1c(CN2CCC[C@H](C(F)(F)F)C2)nc2ccccc2c1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19808", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1ccnc2ccccc12)N1CCN(c2ncccc2F)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219340", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(N2/C(=N/C(=O)c3ccc(Br)cc3)S[C@H]3CS(=O)(=O)C[C@H]32)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49200", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(F)ccc1[N-]S(=O)(=O)c1ccc(F)c(F)c1F by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78532", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C/C(C[NH+]1CCCCC1)=N\\O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139411", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](NC(=O)NCCOCC(F)(F)F)c1ccc(Cl)s1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137325", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc(F)c(F)c1)N1C[C@@H](C[NH+]2CCC(CO)CC2)[C@@H](CO)C1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18420", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccc(OCc2cc(C(=O)N3CCC([C@@H](O)C(C)C)CC3)no2)cc1C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171815", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](NC(=O)C[NH+](CC)[C@@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63484", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C1[C@H]2[C@H](c3ccccc3)OC3(C(=O)c4ccccc4C3=O)[C@@H]2C(=O)N1c1ccc(Cl)c(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202817", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H]1C(=O)NCC[NH+]1Cc1ccc(O)c(Cl)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "25355", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1ncn(CC(=O)NCc2ccco2)n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88762", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1c(C(=O)Nc2ccc(C)c(S(=O)(=O)Nc3ccc(Cl)cc3)c2)cnn1-c1ccccn1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48961", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(/C=C/C(=O)Nc2sc3c(c2C(N)=O)CCCC3)cc(C)c1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112196", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule ON(c1ccccc1)[C@H](Br)[C@@H](Br)c1ccccc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146576", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]CC(=O)N1CCC[C@H](COc2ccc(F)cc2)C1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97350", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@H](CNC(=O)OC(C)(C)C)[NH+](C)Cc1ccc(C#N)o1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93923", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncc(Cl)c(C(=O)NN)n1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116087", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2OC)cc1O by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230419", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CCC(=O)Oc1cccc2ccc(/C=C/c3ccccc3[N+](=O)[O-])nc12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20043", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1Oc1ccc(NC(=O)N(C)CC[C@@H](C)O)cc1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174835", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCN1C(=O)[C@@](O)(CC(=O)c2ccc(OC)c(OC)c2)c2cc(Cl)ccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19264", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@@](C)(O)[C@@H](O)C(=O)OC[C@@H]1CC[N+]2([O-])CCC[C@H]12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244470", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(C#N)ccc1OC(=O)Cn1ccccc1=O by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77108", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CS(=O)(=O)CC1(CC(=O)OC[C@@H]2CC2(Cl)Cl)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75286", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)NCCOC(=O)[C@@H]1C[C@@H]1c1ccccc1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222479", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C[C@H](c2ccc([N+](=O)[O-])cc2)[C@@H](C(=O)c2cccnc2)[C@]12C(=O)Nc1ccccc12 by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176994", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COCC(=O)N1CC[C@]2(O)CCN(C(=O)c3ccc(OC)o3)C[C@@H]2C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31589", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cnc([C@H](C)NC(=O)NC[C@H](O)COc2ccc(F)cc2)s1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211629", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(S[C@H](C(N)=O)c2ccc(F)cc2)nc(C)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23748", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Nc1ccc(F)c(S(=O)(=O)NC[C@@H]2CCCO2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160314", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(CNC(=O)[C@H]2C[C@H]3CC[C@@H]2O3)cc1Br by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152768", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC1=C(C(=O)OC(C)C)[C@@H](c2cccc(Br)c2)n2ncnc2N1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57572", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCCC[C@@H](C(=O)[O-])[C@@]1(O)CCC[C@H](CC)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63092", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CNc1ccccc1OC(F)F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177195", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCC1CCC(C#N)(NC(=O)[C@H]2CCO[C@H]2C)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103907", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(Cl)ccc1NC(=O)C(=O)NCc1ccccc1C[NH+](C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92203", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1cc(Cl)ccc1NCC(=O)N(c1ccccc1)C(C)C by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164311", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(/C=C(\\C#N)C(=O)Nc2ccc3c(c2)CCC(=O)N3)cc(C#N)n1C by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201776", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(N[C@H](CO)c1ccccc1F)[C@H]1COc2ccccc2O1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22875", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-n2cnnc2SC(C)C)cc1Cl by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39211", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2c(NC(=O)c3cc(-c4ccccc4Cl)no3)n[nH]c2n1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215424", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C[NH+]1CCC[C@@H]1c1cccs1)N1CCN(c2cccc(Cl)c2)CC1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93733", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)[C@@H](CO)NC(=O)c1ccccc1C(F)(F)F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4942", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)N(c1nc(CSCc2ccccc2)cs1)c1ccccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141320", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@@]1(c2ccccc2)NC(=O)N(C[C@H](O)c2ccccc2)C1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124874", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCC(O)(CSc2ccc(Br)cc2)CC1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83165", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CCc1ccc(C(F)(F)F)cc1)Nc1cccc(S(=O)(=O)/N=C2/CCCN2)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196610", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(C(=O)NNC(=O)c2cn(C)nc2-c2ccc(F)cc2F)o1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100810", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule Cn1cc(C#N)cc1C(=O)N1CCC[C@H]2CCCC[C@@H]21 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N1CCN(c2ccc([N+](=O)[O-])c(Sc3ccccn3)c2)CC1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47603", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]([NH2+][C@H](CO)c1ccccc1F)c1ccsc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226280", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ncc(C(=O)N2CCC(c3[nH]ncc3-c3cccc(F)c3)CC2)c(=O)[nH]1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104713", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CN[C@@]1(C#N)CCC[C@@H](Sc2nnnn2C2CCCC2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197504", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)[O-] with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153931", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CCC(=O)c1ccc(F)cc1F)Nc1cccnc1N1CCOCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197814", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(Cl)ccc1Nc1ncnc(NNC(=O)c2ccccn2)c1N with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61545", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccccc1F)c1c[nH]nc1-c1ccc(Cl)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37048", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1c(C)c[nH+]c(Cn2ncc(Cl)c(Cl)c2=O)c1C by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81773", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+]Cc1ccccn1)c1cccc(NC(=O)Cc2ccccc2F)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172262", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cc(CN2CCO[C@H]3CCCC[C@@H]32)ccc1N1CCOCC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39097", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](Cc1ccc(C(F)(F)F)cc1)C(=O)N1CCOC[C@H]1C1CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153147", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)NCCSc1cc(Cl)ccc1N by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174452", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](c1ccccc1)N1C[C@@H](C(=O)Nc2ccc(F)cc2Cl)CC1=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8976", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nn(C)c(Cl)c1CSc1ccc(N)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85240", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)c1nnc2ccc(N3CC[C@H](C[NH+]4CCCCC4)C3)nn12 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148962", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)N[C@@H](C)C(=O)N2CCOCC2)cc1C(F)(F)F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15604", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(Br)ccc1NC(=O)CN1C(=O)C(=O)N(Cc2cccs2)C1=O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111881", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(C2=NN=C(C(=O)N/N=C/c3ccccc3Cl)C2)s1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100889", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1c(C(=O)Nc2cc3c(cc2Cl)OCCO3)cnn1C(C)C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57166", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2CC[NH+](Cc3cc4c(cc3O)CCC4)CC2)cc1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22084", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1noc(CCC(=O)N(C)[C@@H](C)c2cc(F)ccc2F)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231077", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCc1ncccc1F)c1ncccc1C(F)(F)F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66771", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC[C@@H]1CC[NH+](Cc2cc(C(F)(F)F)ccc2Cl)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184874", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H](C(=O)OCC(=O)Nc1ccc(I)cc1C)c1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72069", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCn1ccnc1CNC(=O)c1cn(Cc2ccccc2F)nn1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179824", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOc1c(Cl)cc(C[NH+]2CCC(N3CCCCC3=O)CC2)cc1OC with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48070", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1cc(-c2nc(C(=O)N(CCC#N)CCC#N)cs2)cn1 by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69687", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)Nc1nc(C(=O)Oc2cccc(Br)c2)cs1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107290", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1c([O-])ncnc1Sc1ccc(Cl)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172788", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc(F)cc1F)N(CC(F)(F)F)c1ccccn1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33904", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N1CCc2c(sc(NC(=O)c3cc(C)no3)c2C#N)C1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170077", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1cccc(CNC(=O)[C@H]2COc3ccc(F)cc3C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217684", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)N1CC[C@@H](C(=O)NCc2cnc(OCC(C)C)c(Cl)c2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111393", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(NC(CO)CO)[C@H]1CC[C@H]2CCCC[C@H]2[NH2+]1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C(=O)NCCOc2ccccc2)nn1-c1ccc(F)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92110", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccncc1NC(=O)Cc1coc(-c2ccc(Cl)cc2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73829", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)(F)Oc1cc(Br)c2nc([S-])sc2c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65070", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN[C@]1(C#N)CCC[C@H](n2cc(Cl)cn2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212457", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(Cc1ccsc1)N1CCC[C@@H](O)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160265", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cccc(OCC(=O)NC[C@@H](O)c2ccc(Cl)cc2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34788", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCSCCC(=O)NC1CCN(S(=O)(=O)C(F)(F)F)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113515", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1c(CNC(=O)Nc2cccc(F)c2)nnc1SCc1cccnc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146878", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule [NH3+][C@@H]1CC[C@@H](NS(=O)(=O)c2cc(Cl)c(Cl)s2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72776", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NCc1ccsc1)c1csc(C#CCO)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10469", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[NH+](C)[C@@H](CNC(=O)NNc1cccc(C#N)c1)c1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167094", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])c(NCCCn2cccn2)c1 by substituting a nitro with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51109", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1ccc(COc2ccc(F)cc2Cl)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191991", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1=C(C)NC([S-])=C(C#N)[C@@H]1c1cccnc1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52762", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](CSC)N(C)C(=O)Nc1c(F)cccc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121972", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)c2ccc3c(c2)ncn3CCNC(=O)NC(C)C)cc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241545", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(C)c1cc(C(=O)NNC(=O)c2cccs2)n(Cc2ccc(F)cc2)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6254", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CC(=O)Nc2cc(C(=O)O[C@@H](C)C(C)(C)C#N)ccc21 by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244050", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCc1cc([C@@H]2CCCN2C(=O)c2c(Cl)cnn2CC)no1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28845", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cccc(C[S@](=O)Cc2c(C)nn(C)c2Cl)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165302", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(CNC(=O)CSc2ccccc2Cl)cc1OC by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183643", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1oc(NC(=O)[C@H](C)N2CC[NH+](C(C)C)CC2)c(C#N)c1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55271", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CSCc1ccc(O)cc1)C(=O)[O-] by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109322", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1cc([C@@H]2Oc3c(OC)cc(/C=C/C(=O)[O-])cc3[C@@H]2CO)ccc1O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102179", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCC[C@@H](O)CNC(=O)Nc1cccc(F)c1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110499", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)Nc2ccccc2)cc1S(=O)(=O)Nc1cc(Br)cc2cccnc12 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18031", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=S1(=O)CC[C@@H](Nc2nccc(Oc3ccc(F)cc3)n2)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147422", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN(CC(=O)Nc1cc(Cl)ccc1C)C(=O)c1sc(-c2ccsc2)nc1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167897", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(F)cccc1NC(=O)NCc1[nH+]ccn1CCc1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98178", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)COc2ncnc3c(Cl)cc(Cl)cc23)c(OC)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54072", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Oc1ccc(C2CCCC2)nc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212342", "split": "OpenMolInst" } }, { "instruction": "Please replace a thiol in the molecule Cc1cnc(=O)n(C[C@H](CS)C(C)(C)C)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147316", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(F)cc1C[NH+]1CCN(CC(=O)Nc2sccc2C#N)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19683", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cc2ccccc2o1)c1ccccc1OC(F)F by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184754", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H](CCCO)[NH2+]C[C@@H]1COc2ccccc21 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110661", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCN(C(=O)c2ccc(C(=O)Nc3ccccc3)cc2)C[C@@H]1O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124017", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@H](O)CNc1[nH+]c2ccccc2n1Cc1cc(-c2ccccc2)no1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192373", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(OCC(=O)N1CCOCC1)c1ccc(F)c(F)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152671", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)[C@@](NC(=O)Nc1cc(C)on1)(c1ccccc1)C(F)(F)F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185601", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1c(Br)cc(Cl)cc1[C@@H]([NH3+])C1C(C)(C)C1(C)C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39650", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H](NC(=O)N[C@H](C)c1ccc(Cl)s1)[C@@H](C)CO by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188186", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(Nc1cccc2c1CCCC2)c1ccc([N+](=O)[O-])s1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53736", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCn1nc(C)c(CNC(=O)Nc2cccc(Cl)c2-n2cccn2)c1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226232", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H](NC(=O)N(C)[C@H]1CCC[C@H](C)C1)c1nc(C(F)(F)F)cs1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141465", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1cc(F)cc(Oc2ncc(Cl)cc2F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98445", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H](COc1ccc(Cl)cc1)C[NH+]1CCN(c2ccc(F)cc2)CC1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12126", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1c(Br)ccc2nc(C3CCCCC3)c(N)n12 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217603", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2)c(OC)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130741", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCc1c(C#N)c(=O)[nH]c(=O)n1-c1ccccc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86320", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)Nc1cccc(F)c1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143902", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1ccc(CNC(=O)c2ccc(F)cc2F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153413", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)(C)OC(=O)N1CCC[C@@H](CCOCc2cnc(Cl)s2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168909", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(Br)cc1NC(=O)CC1([NH3+])CCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76367", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule OC[C@H]1CCC[C@@H]1Nc1cc(-n2ccnc2)ncn1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102763", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(/C=c2\\s/c(=C(\\C#N)C(=O)C(C)(C)C)n(C3CC3)c2=O)o1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32234", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule NC(=O)C1(NC(=O)c2cc(Br)c[nH]2)CCCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215017", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(=O)Nc2nc3c(s2)CCC[C@@H]3C(=O)Nc2ccc(OC)c(Cl)c2)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237164", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N[C@@H](C)C(=O)Nc2ccc(Cl)cn2)cc1I by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112913", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CN(C1CCCCC1)S(=O)(=O)c1ccc(Cl)cc1)N1CCN(c2ccccc2F)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230901", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCC(CC)(NC(=O)Cc1c(F)cccc1F)/C(N)=N/O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200600", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(N2CCN(c3cc(Cl)nc(N)n3)CC2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53102", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)COc1cncc(N[C@H](C)[C@H](C)CO)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231105", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1ccc([C@@H](C)NC(=O)[C@H]2CCO[C@@H]2C)cc1[N+](=O)[O-] with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47783", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CO[C@H](C)CC(=O)NCc1cccc(C#N)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57804", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C[NH2+]C)c1cccc(F)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61217", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](Oc1ccc(Cl)cc1Br)C(=O)NCc1ccc2c(c1)OCO2 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203809", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)c1cccc(-c2ccc(Cl)c(O)c2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218876", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CCOC(=O)C1=NN(c2ccccc2Cl)[C@@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@@H]12 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210911", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc2c(c1)OCO2)c1ccc(F)cc1F by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201932", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)c1nc(-c2ccc(Br)cc2)nc2c1[nH]c(=O)n2-c1cccc(Cl)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43678", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)C[NH+]1CCC(C(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32064", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(C)c1ncc(NC(=O)[C@@H]2CS[C@H](Cc3ccccc3F)C(=O)N2)cn1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223462", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cccc(C)c1NC(=O)CSc1nnc([C@@H]2CCCN2C(=O)c2ccccc2Cl)n1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20094", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC1CCC([NH+]2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142232", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCC[C@H]1NC(=O)c1ccc(C#CCO)cn1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12576", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCc1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204025", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@]1(C(=O)NCc2ccccc2)CCC(=O)N1Cc1ccccc1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45742", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Cn1nc2ccc(SC3CCCCC3)nn2c1=O)NCCc1ccc(Cl)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87077", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCN(C(=O)[C@@H]2CCC[NH+]2Cc2ccccc2)C[C@@H]1O by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172009", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(O[C@@H](C)C(=O)NNC(=S)Nc2cc(C)ccc2F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86100", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cc(N2CC[C@H](CN3CCOCC3)C2)c2ccccc2n1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23971", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(CSCc1cc(-c2cccs2)on1)NCC1(O)CCOCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84050", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccc2cc(-c3cc(F)cc(F)c3)c(=O)oc2c1)Nc1cccnc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137172", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Nc1c(Nc2cccc(Br)c2)ncnc1N1CCCCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178011", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C#Cc1ccc(OC)c(F)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161249", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CN(C)c1ncc(CN2CCCN(c3ccccc3C#N)CC2)s1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63444", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)N1CCC([NH2+]Cc2ccc(-c3ccccc3F)s2)CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201782", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Fc1cc(C[NH2+][C@H]2CCCc3ccccc32)cc(F)c1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37720", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCc1nc(C(=O)N2C[C@H](O)C[C@H]2c2cc(F)ccc2F)c[nH]1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126470", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1n[nH]c(C)c1[C@@H]1CCCN1C(=O)Nc1ccc(OC2CCCC2)c(F)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77261", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C#CCOc1ccc(N(C)C(=O)c2cccc(F)c2OCC)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38884", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cn1c(-c2ccccc2)nnc1[C@H](C#N)C(=O)[C@H]1CCC[C@H](C(F)(F)F)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134707", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(NC1CC1)[C@@H]1CCCN1C(=O)CCCCO with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213704", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc([C@H](NC(=O)NC[C@](C)(O)c2ccc(C)o2)C(C)C)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214136", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](NC(=O)NCc1ccc(F)cc1)[C@H](O)c1ccc(Cl)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94868", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC(C)Oc1cccc(C[NH+](C)Cc2ccc(C#N)o2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41906", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=C1CCCC2=C1[C@H](c1ccc([N+](=O)[O-])cc1)CC(=O)N2c1ccccc1C(=O)[O-] with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209067", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](NC(=O)[C@@H](C)N1CCO[C@H](c2ccccc2)C1)c1ccc(F)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64121", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1nc(C(=O)NCc2ccc(F)cc2)cc1NC(=O)Cc1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55931", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CCn1cncn1)N[C@H](c1ccccc1F)C1CCCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34499", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@H](O)CNC(=O)c2cc(C(C)C)nc3c2c(C)nn3C(C)(C)C)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177155", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CCn1/c(=N/C(=O)c2ccc(Br)o2)sc2cc(S(N)(=O)=O)ccc21 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223463", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1ccc(O)c(NC(=O)c2ccncc2F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41390", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cn1cc(C#N)cc1C(=O)Nc1ccccc1N1CCCCCC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49524", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCCSc1ccc(Br)cc1)c1cnccn1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11893", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1ccc(Cl)nc1)c1c[nH]nc1-c1ccccc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248601", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ncccc1C(F)(F)F)N1CCC(c2nncn2C2CC2)CC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69204", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#CCCn1cc(C[NH+]2CCC[C@@H](CC(N)=O)C2)c(-c2ccccc2)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64682", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1sc(C(=O)N/N=C(/C)c2ccc(N3CCOCC3)c(F)c2)cc1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85261", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1ncnc1CCNC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232392", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC[C@H](NC(=O)CCc1cccc([N+](=O)[O-])c1)c1cc(F)ccc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6540", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1cccnc1NC[C@H]1CN2CCC[C@@H]2CO1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64845", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Oc1ccc(Br)c(CN2CCOC3(CCC3)C2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162344", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)N(C(=O)[C@H](C)c1ccsc1)c1cccc(C#N)c1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39145", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)C1=C(C)N(C)C(=O)N[C@@H]1c1ccccc1OC(F)F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235240", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1nc(N)nc(-c2ccc([N+](=O)[O-])cc2)c1C(=O)N(C)C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207480", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(CN(C)C(=O)CNc2cccc(F)c2)c1OC by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47042", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nc2[nH]c(-c3ccc(Br)cc3)nc2cc1Br with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55889", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2csc(C3=C(N)N(NC(=O)c4ccc([N+](=O)[O-])cc4)CC3=O)n2)cc1 by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170439", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1ccc(Cl)c(C(=O)N[C@@H]2CCC[C@@H](S(C)(=O)=O)C2)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115120", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule C[C@@H](Oc1cccnc1[N+](=O)[O-])C(=O)N(CCC#N)c1ccccc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178550", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(C[C@H]([NH3+])Cc2cc(F)ccc2F)cn1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181728", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO[C@@H](CNC(=O)CN(C)C(=O)c1ccccc1)c1cccc(Cl)c1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10589", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc([C@@H](NC(=O)C(=O)Nc2ccc(Cl)cc2)C(C)C)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5812", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=C/C(=O)c2ccc(SC)c(OC)c2)cc1F by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35799", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCC(Nc2ccc3cc(C#N)ccc3n2)CC1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115376", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCc1cc(=O)[nH]c(N2c3ccc(F)cc3CC[C@H]2C)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141794", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H]1C(=O)OCC(=O)Nc1cc(Cl)ccc1C#N by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197871", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1ccc(F)cc1)[C@H]1CCCN(C(=O)CC2CCC2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99800", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O[C@@H](CNCc1cccnc1)c1ccco1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45905", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=S1(=O)C[C@@H](N2CCN(c3ncnc4c3oc3ccccc34)CC2)[C@@H](O)C1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218099", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](Cc1ccccc1)NC(=O)Nc1cc(NC(C)=O)c(F)cc1F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217400", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)[NH+]1CCN([C@H]2CCN(C(=O)OC(C)(C)C)C2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162107", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1cc(O)c(C(C)C)cc1NC(=O)c1ccc(CNS(C)(=O)=O)o1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178056", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(COc1ccc(F)cc1Br)Nc1cccc(NC(=O)c2ccco2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76618", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1nnc2c(-c3ccc(F)cc3)c(C)nn2c1C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188282", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CSc1ccnc(-c2nc([O-])c3cc(F)c(F)cc3n2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212481", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccccc1CNC(=O)c1cnn2cc(Br)cnc12 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44581", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(Cc1cccc(F)c1)C(=O)CS(=O)(=O)Cc1c(Cl)cccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33438", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(N[C@@H]1CC[NH+](C2CCCC2)C1)c1c(O)cccc1O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142658", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC1=C(C#N)C(=O)N(CCN2CCOCC2)C(=O)/C1=C\\Nc1ccccc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97687", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]1OCC[C@H]1[C@H](Br)Cc1ccccc1[N+](=O)[O-] by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134854", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C(=O)Nc2nc([C@@H](C)O)cs2)c(F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153810", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(C)N(C(=O)/C=C/c1ccc(OC(F)F)cc1)[C@H]1CCS(=O)(=O)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156289", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCS(=O)(=O)CCN(C)C(=O)CCc1cccc(F)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77645", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Clc1ccc(Cc2nc3ccccc3[nH]2)c(Cl)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183872", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=C(C)CSc1nc2cc(Cl)ccc2o1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211594", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1csc([C@@H]2CCCN(Cc3cc4cnn(C(C)C)c4nc3Cl)C2)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229288", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1ccc(C[NH2+][C@H]2CCOC3(CCSCC3)C2)s1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209444", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)n1ccc(Cn2cc(C(=O)[O-])cc2Br)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210702", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1)C1(c2cc(-c3cccs3)on2)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231430", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)Nc1cc(NCc2c(C)nn(C)c2Cl)ccc1C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119265", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1ccc(O)cc1)c1ccccn1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105234", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@]1(O)C[C@@H](c2ccc(OC)cc2)[NH2+][C@H](c2ccc(OC)cc2)[C@@H]1C by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87906", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cn1c(Cc2ccccc2Cl)nc2ccccc21)Nc1ccc2c(c1)OCO2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244298", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCCN1C(=O)Nc1ccc(F)c(C#N)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195710", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@H](CO)[NH2+]Cc1ccc(-n2ccnc2)cc1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145049", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C=CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccccc2)sc2cccc(F)c21 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28760", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCC(=O)N1CCc2ccccc2C1)NC1(c2ccccc2F)CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95424", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(NC(=O)C[NH+]2CCC[C@@H](CNC(=O)c3ccc(F)cc3)C2)cnn1C by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93975", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCC1(CC)[C@@H](OC)[C@H](C)[C@H]1/[NH+]=C/c1cccc(OC)c1O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96088", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1[nH]c2ccccc2c1CC(=O)N1CCC(OCc2ccccc2F)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198730", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC(CO)CO)N[C@@H]1CCC[C@@H](C(F)(F)F)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11972", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)Sc1nnc(NC(=O)c2ccccc2F)s1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205373", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(-c2cnc(Br)nc2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22136", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(NC[C@@H](O)c1ccc(Cl)s1)C(=O)NC1CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38551", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)Cn1nnc(C(=O)Nc2ccc(F)cc2F)c1C by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187652", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1cc(CN2CCO[C@@H](CC(=O)[O-])C2)ccc1O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213370", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1nccc1C(=O)NC1CC[NH+](CC2(c3ccc(Cl)cc3)CCC2)CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152899", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cn1cc(C#N)cc1C(=O)N[C@@H](CC(N)=O)C1CCCCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97590", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C1NC2=C(C(=O)N(CCO)C2)[C@H](c2ccccc2F)N1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232701", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCCC(=[NH2+])Nc1cc(OC)ccc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140484", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc(=O)[nH]c1)c1ccc(F)c(Br)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44584", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)NCCCNC(=O)C1CCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102778", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC[C@@H](Nc1nc(Br)cs1)C(C)C with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118638", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCOc1cc(/C=C(\\C#N)c2nc3ccccc3s2)cc(Cl)c1O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189117", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOc1cccc(CNC(=O)[C@H]2CCO[C@H]2C)c1OC(F)F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14016", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1ccc2c(c1)[C@H](O)[C@H](N1CCOCC1(C)C)CC2 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217672", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(F)c(-c2ccc(F)c(C(=O)[O-])c2)cc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241345", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)c1ccc(Cl)cc1NC(=O)C(=O)N[C@H]1CCCC[C@@H]1CO by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241052", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1ccccc1[C@H](C)NC(=O)[C@@H](C)Nc1ccc(CC#N)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42427", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@]1([C@H]([NH3+])c2c(F)cc(F)cc2F)CCCO1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173986", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule C[C@H]1CCC[NH+](C/C([O-])=N/c2nc3ccc([N+](=O)[O-])cc3s2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26149", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)N[C@@H]1CCC[NH+](Cc2c(Cl)cccc2OC)C1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220648", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C([O-])[C@H]1CCCN(C(=O)c2cc(Br)ccc2Cl)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38115", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](c1ccccc1)[S@](=O)CC(=O)Nc1cccc(C#N)c1 by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2491", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3879", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(NC(=O)CN(C)C(=O)[C@@H](C)Oc2ccc(Cl)cc2)c1C by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96510", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C(NCc1cccc([N+](=O)[O-])c1)N[C@@H](CN1CCCC1=O)c1ccccc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197160", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1nc(C[C@@]2(O)CCCOC2)sc1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190149", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1N1CCN(C[C@H](O)COc2ccc3c(c2)OCO3)CC1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38935", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CC[S@@](=O)[C@@H]1CCCC[C@@H]1/[NH+]=C/c1cc([N+](=O)[O-])ccc1[O-] by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158553", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccccc1OCCNc1cc(Cl)cc(Cl)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108813", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1ccc(S(N)(=O)=O)cc1)N(C)Cc1sccc1Br by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227256", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H](OC(=O)[C@@H]1CCO[C@@H]1C)c1ccc(F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137685", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)[C@@H]1N=C2c3ccccc3N=C(SCC(=O)Nc3cc(F)ccc3F)N2C1=O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186038", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1NN[C@H](NC(=O)CC2=c3ccc(Cl)cc3=[NH+]C2)S1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113965", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)C1(C)CCN(C(=O)Nc2ccc(OC(F)F)cc2)CC1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Cc1ccc(Cl)cc1)[NH2+]CC/N=C(\\O)c1ncccc1O by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180826", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccc(-c2cccc(C(=O)N3CCOC[C@@](O)(C[NH+]4CCCC4)C3)c2)o1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242891", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Cl)c(C(=O)/C=C/c2cccc(OC)c2OC)cc1OC by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "143695", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COc1ccc(/C=C(\\C#N)C(=O)NCCC2=c3ccccc3=[NH+]C2)cc1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95735", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3953", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCOc1ccccc1F)c1n[nH]c2c1CCC2 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151959", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](Nc1cnn(C)c(=O)c1Cl)c1ccc2c(c1)NC(=O)CO2 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68694", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C#N)CCN1CCOCC1=O by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1702", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(C)c1csc(C[C@H]2CC[C@H](Br)C2)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192575", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(CCC(=O)N1CCN(c2ccc(F)cc2)CC1)Cc1cnccn1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227264", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC1CCC(NC(=O)[C@H](C)Sc2ccc(O)cc2)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241820", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1C[C@@H](c2cccs2)CC2=C1[C@H](c1c(Cl)cccc1Cl)n1ncnc1N2 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5480", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCN(CC)C(=O)CN1CCC[NH+](CC(=O)Nc2ccc(F)cc2F)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231272", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1[nH]c2ccccc2c1-c1csc(NC(=O)c2cncn2-c2ccc(F)cc2)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14930", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COC(=O)c1cccc(C(=O)NC(=S)Nc2ccc(C)c([N+](=O)[O-])c2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150755", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)c1c(NC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(F)cc2)sc2c1CC[NH+](C)C2 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160447", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1c(NC(=O)CN2CCOC[C@H]2C#N)sc2c1CCCCC2 by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215845", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1cccc(C(F)(F)F)c1)c1nc(N2CCCC2)ncc1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59273", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1cc(C(C)(C)CC(C)(C)C)cc(C[NH+](C)C)c1O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35442", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COc1ccc([N+](=O)[O-])cc1C(N)=[NH2+] with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88831", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule COC(=O)c1occc1Cn1cnc(-c2ccc([N+](=O)[O-])cc2)n1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185349", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1nnc(SCC(=O)Nc2ccc(F)c(Cl)c2)n1-n1cccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105862", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1cccc(C(=O)Nc2ccc(C#N)cc2)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@H]1CCC[C@H]1CNc1nc(Cl)ncc1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103106", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1cc(/C=C/[N+](=O)[O-])ccc1OCc1cccc(F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155477", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(OCC1CCN(CC(F)(F)F)CC1)C1CCN(C(=O)C2CC2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163593", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@H](NC(=O)NCc1nc(C)c(C)o1)c1ccc(F)c(F)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49525", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(/C=C(/NNC(=O)c1cccc(Br)c1)c1ccccc1)c1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207708", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)CN(Cc1cccc(Cl)c1Cl)CC(F)(F)F by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198109", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc([C@H](N)c2cc(C)c(Br)s2)sc1C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18050", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])[C@H]1[C@H]2C=C[C@H](C2)[C@H]1C(=O)NCc1ccccc1Cl by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215945", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(F)cccc1NC(=O)C(=O)NCc1ccc([N+](=O)[O-])cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173731", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOc1ccccc1NC(=O)n1ncc2cc(Cl)ccc21 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55248", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1C[C@@H]1C(=O)Nc1cccc(Cl)c1-n1cncn1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102451", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](CSC)N(C)C(=O)Nc1cc(Br)ccc1C by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179964", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cc1cccnc1)NNC(=O)N1CC=C(c2ccccc2Cl)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102788", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H](CO)CS[C@H](C)C(=O)c1ccc(F)cc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217956", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NN1C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C1=O)c1cccc(Cl)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93903", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCCn1c(N2CCC[C@@H](C)C2)c(/C=C2/SC(=S)N(CC(=O)[O-])C2=O)c(C)c(C#N)c1=O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167375", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N#CCCSc1nnc(-c2ccc(F)cc2)n1-c1ccc(F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91054", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nn(Cc2ccc(C(=O)N3C[C@@H](C)C[C@H](C)C3)cc2)c(C)c1Br by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55704", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Nc1c(C(=O)N2CCO[C@@H]3CCCC[C@H]32)cc(F)cc1[N+](=O)[O-] by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235377", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CS(=O)(=O)[N-]c1cc(C(=O)N[C@H]2C[C@@H]3CCCc4cccc2c43)ccc1F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136177", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(-c2cc(C(=O)NNC=C3C(=O)Nc4ccc(Br)cc43)[nH]n2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41788", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3927", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COc1cccc(OCc2nc(C#N)c(NC[C@@H]3CCCO3)o2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80262", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccc(N2CCCC2=O)cc1)c1cc(Cl)ccc1O by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224441", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(CNC(=O)Nc2ccc(-n3ncn(C)c3=O)cc2)ccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83109", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1ccc(C)c([C@@H](O)C[NH+]2CCC(CC(=O)N(C)C(C)C)CC2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18274", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSC[C@@H](C)N(C)C(=O)N[C@H](C)c1ccc(F)c(Cl)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17638", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(Br)cc(/C=N/NC(=O)COc2c(C)cccc2C)c1O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49294", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@@H](C)NC(=O)c2cc3c(F)cc(Br)cc3[nH]2)o1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56968", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1ccsc1NC(=O)Cn1cc(-c2ccccc2)cn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64060", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)c1nc2cccnc2n1C1CCN(C(=O)[C@@H](O)c2ccccc2Cl)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21960", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C#N)NC(=O)c1c(F)ccc([N+](=O)[O-])c1F by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233790", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC(C)(C)CC[C@@H]1NC(=O)C(=O)Nc1cccnc1Cl by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33051", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)N2CCn3cccc3[C@@H]2C(C)C)c(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87715", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2csc3nc(Cn4cc(C(F)(F)F)ccc4=O)[nH]c(=O)c23)s1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12917", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule OCCC[NH+](C1CCSCC1)C(c1ccccc1)c1ccccc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156557", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCC(CC)(CNC(=O)N[C@@H]1CCC[C@]1(C)CO)S(C)(=O)=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173357", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cccc([C@@H](C)S(=O)(=O)c2ccc(Cl)cc2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147620", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#CC(C#N)=CNC1CC[NH+](Cc2ccccc2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188858", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc(CNC(=O)N[C@@H](C)c2ccc(OC(F)F)cc2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176013", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1C(=O)C(=Cc2cc(Br)ccc2OCC#N)C(=O)N(C)C1=S by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197298", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(C(=O)Nc2cccnc2Cl)cc(Cl)c1Cl by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91742", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OC[C@@H](O)[C@@H](O)/C=N/N(Cc1ccccc1)c1ccccc1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240613", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1ccc(NC(=O)C(=O)NC[C@@H](O)Cc2ccccc2)c(Cl)n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110294", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccc(CC(=O)N2CCC[C@H](c3cc(C(F)F)n4ncnc4n3)C2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126459", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(/C=C/c1cccc(Cl)c1)OCc1cccc([N+](=O)[O-])c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124197", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(N2CCN(Cn3cc[nH]c3=S)CC2)cc1F with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76949", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1cc(NC(=O)C(=O)NC(C)C)ccc1Cl by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80374", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCN(C(=O)N[C@@H]2CCC[C@@H]2c2ccc(F)cc2)C[C@H]1O by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133690", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(C(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(Br)o1)c1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243504", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule COc1cc(CN(C)C2CC[NH+](C)CC2)c([N+](=O)[O-])cc1OC with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140556", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN(C)C(=O)c1ccc(Oc2cc(F)c(N)cc2F)nc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174680", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c(Cl)cccc1S(=O)(=O)N1CCN(c2nc3ccccc3nc2C(F)(F)F)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234971", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCc1cc(NC(=O)N(C)Cc2ccc(Cl)c(Cl)c2)ncn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214896", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCC[C@H]1CCC[NH+](Cc2cccn2Cc2cccs2)C1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112413", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)S(=O)(=O)c1ccccc1C(=O)Nc1ccc(Br)cc1F by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105447", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[NH+](Cc1ccno1)C[C@@]1(O)CCCN(Cc2cccc(F)c2F)C1=O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240916", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCC[C@@H](Cc2cccc(Br)n2)CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92760", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Oc1ccc(C[NH+]2CCCC[C@@H]2c2nnc3n2CCCC3)c(O)c1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167742", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(C(=O)c2cccc(NC(=O)c3ccco3)c2)C[C@H]1O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216391", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(-c2nc(CN3CC[NH+](CC(=O)Nc4cccc(F)c4)CC3)cs2)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202375", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccc(C)c(N2N=C(C(=O)N3CC[C@H](C)[C@@H](O)C3)CCC2=O)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231603", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOC(=O)[C@H]1CCCN(C(=O)[C@@H]2CC(=O)N(c3cccc(F)c3)C2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22667", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCCNC(=O)C1=NN(c2ccc(F)cc2)[C@H](C(N)=O)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178585", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H](O)CNC(=O)C(=O)NCC1(c2ccccc2)CCOCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192493", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCS[C@H]1CC[C@H](NC(=O)Cc2cccc(O)c2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71332", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H]1OCC[C@@H]1C(=O)Nc1cc(C(F)(F)F)ccc1N(C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137579", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C1CN(C(=O)COC(=O)c2cccc(Br)c2)c2ccccc2N1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28147", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCC[C@H](O)[C@H]1CCOC2(CCCC2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99167", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@H]1C(=O)NCC[NH+]1CC(=O)Nc1cc(Cl)ccc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38090", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COCCn1ccc2ccc(NC(=O)N3CCC[C@@H](C)[C@H]3CO)cc21 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226975", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN1CCN(C(=O)[C@@H]2CCCN2C(=O)CSCC(F)(F)F)CC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139204", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCNC(=O)CN(c1ccccc1OC)S(=O)(=O)c1cc(Cl)ccc1Cl by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139340", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)NCc1cc2n(n1)CCN(Cc1cccc(Cl)c1Cl)C2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180079", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([O-])[C@H]1C[C@@H](O)CN1C(=O)CCc1ccc(Cl)cc1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87703", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(Br)cc1NC(=O)c1nc[nH]n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38547", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CC(C#N)=NNc1ccc([N+](=O)[O-])cc1O by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202195", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nn(C)c2ncc(NC(=O)N(C)[C@@H](C)c3ccccc3Cl)cc12 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176351", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCCn1nc(-c2ccccc2)c2cc(Cl)ccc21)NC1CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12913", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O[C@@H](Cc1cc(Br)cs1)C1([NH+]2CCCC2)CCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154052", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C#CCNC(=O)c1cc([N+](=O)[O-])ccc1I by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238837", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(OC(=O)Cn2ncc3ccccc3c2=O)ccc1Cl by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24842", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](NC(=O)C(=O)Nc1ccc(C#N)cc1)c1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CCCO)NC(=O)N[C@H](C)c1nc(C2CCCC2)no1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120712", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@@H](O)C[NH2+][C@H]2CC[C@H](C)c3ccccc32)cc1OC with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99466", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccccc1NC(=O)Cn1c(-c2ccc(C(F)(F)F)cc2)nc(C)c(CCO)c1=O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131954", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC(=O)Nc1ccc(Sc2ccc([N+](=O)[O-])cc2C#N)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19017", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(Cc2ccccc2NC(=O)c2ccncc2F)C[C@H](C)O1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77881", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc(OC[C@@H]2CCCO2)cc1)N1CCC[C@@H](c2nc(-c3ccc(F)cc3)no2)C1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57625", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(OC)c2c1N[C@@H](c1ccc([N+](=O)[O-])cc1)[C@@H]1CC=C[C@@H]21 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43444", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc([C@@H](N)c2ncc(Cl)cc2Cl)ccc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48356", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CNC(=O)CC1CCN(c2ccc([N+](=O)[O-])c(C(=O)OC)c2)CC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223571", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CS(=O)(=O)N1CCC[C@H](c2ccc(C(=O)NCC(F)F)cn2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106910", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](Cc1cccnc1OC)[C@@H](C)O by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133157", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)C[C@H](n2nc(O)c3c2NC(=O)CS[C@@H]3c2ccc(Cl)cc2)CCO1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46553", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[C@H](NC(=O)OCCO)C1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123465", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc([C@@H]2C(C#N)=C(N)O[C@H]3N=NC(C)=C23)ccc1OCc1ccccc1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76304", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@@H](CO)NC(=O)c1cccc(C(F)(F)F)c1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21534", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)N(C)c1ccc(N[C@@H](C)c2ccoc2)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133839", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1cccc(C(=O)N2CCCCC2)c1O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137584", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C=CCOc1ccccc1C(=O)N/N=C(/C)c1cc(O)ccc1O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64639", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule OC[C@]1(CCc2ccccc2)CCC[NH+](C2Cc3ccccc3C2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218849", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@H](O)CN1CCN(C(=O)[C@@H](C)OC[C@@H]2CCCO2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218678", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]([NH2+][C@@H]1CCc2c(F)ccc(Br)c21)[C@@H]1CN(C)CCO1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76058", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6090", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(-c2n[nH]c(S[C@H](C)C#N)n2)cc1 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163413", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H]1CCC[C@H](NC(=O)C(=O)Nc2cc(F)c(OC)c(F)c2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107522", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1cccc(F)c1)C(=O)CSCC(F)(F)F by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34170", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1noc([C@H](C)OC(=O)Cc2c(F)cccc2F)n1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218982", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#Cc1c(-c2ccc(C(F)(F)F)cc2)nn(-c2ccc(C(F)(F)F)cn2)c1N with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89661", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ncccc1C(=O)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145793", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[NH+]1CCC(NCc2ccc(F)cc2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67822", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)C1=C(C)N=C2SC[C@@](O)(N(c3ccccc3)C(C)C)N2[C@H]1c1ccc(OC)cc1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178526", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(F)cc1NC(=O)c1nc(C)c(C)[nH]c1=O with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246654", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+]Cc1ccc(Br)cc1N(C)Cc1ccccc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190987", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cn1c([C@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)nc2ccc(F)cc21 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245676", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc2c(=O)n3c(nc2c1)CCC3)c1ccccc1Cl by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157963", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)NC(=O)c1cc(=O)c(OCc2ccccc2Cl)c[nH]1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176594", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(C)c(-n2nc(C)c(CN3CCO[C@H](C(N)=O)C3)c2Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240720", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(C(=O)COc2ccc([N+](=O)[O-])cc2Cl)C[C@H](C)O1 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126210", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule C[C@@H]1CCCC[C@@H]1[NH2+]Cc1ccc([N+](=O)[O-])cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166729", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CN(C)c1nnc(S[C@H]2CCC[C@@]([NH3+])(CO)C2)s1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27920", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1ccc(F)cc1)N1CCCC[C@H]1c1nc(-c2ccccc2)no1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71180", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(NC(=O)N(C)[C@H](C)c2ccccc2F)n(Cc2ccccc2)n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234459", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN(CC1CC1)C(=O)c1cccc(OC)c1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239569", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](Oc1c(C)cc(Br)cc1C)C(=O)[O-] by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72360", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(Nc1ccccc1)c1cccc([N+](=O)[O-])c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239508", "split": "OpenMolInst" } }, { "instruction": "Substitute a thiol in the molecule C[C@@H](CCS)CC[NH+]1CCC[C@H]1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101867", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1ccccc1O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20753", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(C(=O)Nc2c(F)cccc2F)c(F)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242074", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1CCC(Oc2cc(CNc3nccnc3C#N)ccn2)CC1 by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162094", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1nn(-c2ccccc2Cl)c(N)c1I by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169868", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130296", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COc1cc(C[NH+](C)Cc2ccc(O)c([N+](=O)[O-])c2)ccc1SC by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242069", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1cccc(NC(=O)CSc2nc3cc(Cl)ccc3o2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210579", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc(NC(=O)[C@@H]2OCC(=O)N(C)[C@H]2c2ccccc2F)cn1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86967", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+]C[C@@H](Cc1ccc(F)cc1)c1ccccc1Cl by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23494", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule OC[C@@H]1CCC[NH+]1Cc1ncc(-c2cccs2)o1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)N/N=C\\c1ccccc1Br by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156688", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CNC(=O)c1ccc(CNc2cccc(F)c2[N+](=O)[O-])cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228104", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule S=C(Nc1ccccc1)Nc1ccncc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167581", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(S(=O)(=O)[N-]c2cccc(C[S@](C)=O)c2)c(F)cc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223843", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule FC(F)c1[nH]ncc1C[NH2+]C1CC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37002", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCc2c(sc3c2C(O)=N[C@@H](c2ccc(-c4ccccc4[N+](=O)[O-])o2)N3)C1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242819", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(F)c(S(=O)(=O)N2CCC[C@@H]2c2nc3ccccc3[nH]2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4356", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cccc([C@H](CO)NC(=O)Cc2csc(C(C)(C)C)n2)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31528", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC1(C)CCC[NH+]1[C@@H]1CC[C@@](CO)([NH2+]C2CC2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171522", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cc(NC(=O)C(=O)NC[C@](C)(O)c2ccsc2)ccc1N(C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151512", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2c(cc1C)N(Cc1cccc(F)c1)[C@@H]([C@@H]1C=CC=NC1=O)N2 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11826", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[NH+](Cc2nc3cc([N+](=O)[O-])ccc3o2)[C@@H]1C by substituting a nitro with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195055", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC[NH+]([C@@H](C)c2ccc(F)cc2)C[C@@H]1O by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198130", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCc1nc(CN2CCN(CC(=O)Nc3cccnc3Cl)CC2)no1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68980", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)[C@H](NS(=O)(=O)c1cccc2nsnc12)C(=O)Nc1ccc(F)c(Cl)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31572", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(C(=O)NCc2ccc(F)cc2)nc2ccccc12 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53135", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCc1cc(C(=O)Nc2cccc(-c3nc(C4CC4)n[nH]3)c2)ccc1F by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70120", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(C(=O)NCc2cnn(C)c2)cc(OC)c1OC(F)F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16439", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COc1cccc(OC)c1C(=O)NC(=S)Nc1cccc([N+](=O)[O-])c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86524", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule [NH3+][C@H]1CCOC[C@@H]1Cc1cc(Cl)ccc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41794", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(Cc1[nH+]ccn1C)C(=O)C[C@@H](O)c1ccc(Cl)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187673", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1sc(Br)cc1-c1nn(C)cc1C[NH2+]C(C)(C)C by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63477", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(OCc2cccc(Cl)c2)c(CBr)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190922", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)[NH+](CCNC(=O)N1CCN(c2ncccc2F)CC1)C(C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242114", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1nc(C(=O)N2CCOCC2)c(Cl)c1C(F)(F)F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30997", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1c2ccsc2ncn1[C@@H](CO)c1ccccc1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79451", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1cc(-c2noc(-c3ccc4ccc(Cl)cc4n3)n2)cn1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201667", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC[C@H](C)NC(=O)c1cccc([N+](=O)[O-])c1C by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148438", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCOc1ccc([C@H]2C(C#N)=C(N)Oc3cc(OC(=O)[C@@H]4COc5ccccc5O4)ccc32)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58944", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(C)c(NC(=O)CNC(=O)NCc2cc(F)ccc2F)c(C)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120838", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc2nc([C@@H]3CCCN3C(=O)Cc3ccc(O)c(F)c3)[nH]c2c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99843", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CC1C[C@@H]2CC[C@H](C1)[NH2+]2)N1CCC(C(F)(F)F)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208810", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C#CCN(C(=O)N[C@@H](C)c1cc(C)c(F)c(C)c1)[C@H]1CCS(=O)(=O)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108486", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)(C)[C@H](NC(=O)N1CCC[C@H](CO)C1)c1cccs1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22361", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1/C(=C/c2ccccc2OCc2ccccc2Cl)SC(=S)N1Cc1ccco1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76994", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Br)cc1)c1ccc(CSC2=NCCS2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180602", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC/[NH+]=C(/NCc1[nH+]ccn1C)N1CC[C@@H](O)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102319", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC(=O)c1csc(NC(=O)c2cnc(-c3ccccc3F)s2)n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241040", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1nncs1)c1cccc(-n2ccc(C(F)(F)F)n2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174974", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CCS(=O)(=O)c1cc2c(cc1Cl)NC(=O)CO2)NCc1ccc2c(c1)OCO2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132243", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCc1cc(Br)ccc1NC(=O)[C@H]1[C@H]2C(=O)O[C@@H]3C[C@H]1C[C@H]23 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4950", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(C2=C3C(=O)N(c4cccc(F)c4)C(=O)[C@H]3N(c3ccccc3)N2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110374", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(Cc1nc2ccccc2s1)C(=O)Cc1c(F)cccc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175140", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNC(=O)NC(=O)[C@H](C)Sc1ncccc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23144", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)Nc1ccc(F)c(C(=O)NC[C@@]2([NH+](C)C)CCC[C@@H](C)C2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101605", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1OCCC(=O)N1C[C@H](c2ccc(F)cc2)C[C@@H]1C by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236595", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1CC[NH+](C[C@@H](O)C[NH2+]C/C=C/c2ccccc2)CC1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160562", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule COc1ccc(N[C@@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2)c(OC)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35728", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)Nc1ccc(Cl)cc1)C1CCC([NH3+])CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208301", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCSc1nnc2c(n1)O[C@H](c1ccccc1C(F)(F)F)N(C(C)=O)c1ccccc1-2 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157082", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(C(=O)CCCOc1cccc(F)c1)[C@@H]1CCCC[C@@H]1S(C)(=O)=O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58971", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1cccc(CNC(=O)c2[nH]c3ccc(C)cc3c2NC(=O)c2ccc(Cl)cc2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14142", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CC(C)C(=O)c1c[nH]c2cc([N+](=O)[O-])ccc12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191606", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nn(Cc2ccc(Br)cc2)c(C)c1NC(=O)c1cccnc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193697", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCCN(CCO)C(=O)Nc1nc(C)c(-c2ccccc2)s1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239391", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCC(=O)N/N=C/c1cccc(O)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235740", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1csc2ccccc12)N[C@@H]1C=C[C@H](CO)C1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73534", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)C(=O)CSc1nc2cc(Cl)ccc2c(=O)n1C[C@H]1CCCO1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62733", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1ccc2c(c1)OCCO2)N[C@H]1C[C@@H]1c1cccc(Cl)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115942", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc([C@H](C)[NH2+][C@H]2CC=CCC2)ccc1OC(F)F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7763", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccccn1)N1CCC[C@H]1Cc1cccc(F)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61326", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)[C@@H]([C@H](O)c1ccccc1)N1CC[NH+]2CCC[C@@H]2C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66353", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(=O)n(CC)c2cc(S(=O)(=O)c3ccc(OC)cc3)c([N+](=O)[O-])cc21 by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187052", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(CNC(=O)COc2ccc(Cl)cc2C=O)c1 by substituting a aldehyde with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243341", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N2C[C@H](C(=O)Nc3cccnc3Cl)CCC2=O)cc1C by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90100", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O[C@@H]1CCCOC12CCN(c1nccc(C(F)(F)F)n1)CC2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69981", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CN1CCN(C(=O)[C@@H]2C[C@H]3CC[C@@H]2C3)CC1)Nc1ccc(F)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163417", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1cccc(C(=O)N(CCC#N)Cc2ccco2)c1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127758", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Cl)cc1Nc1ncnc(OC(C)C)c1N by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108833", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C/C(=N\\c1ccccc1O)c1c([O-])n(-c2ccccc2)c2ccccc2c1=O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244389", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CO[C@]1(C)C[C@@H](NC(=O)NC2CCC(O)CC2)C1(C)C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39793", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1c2ccccc2CCN1C(=O)NCc1ccnc(OCC(F)F)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11560", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nn1ccc2c(nnc3c(-c4ccc(F)cc4)cnn32)c1=O)c1ccc(Cl)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171146", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cccs1)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92443", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)N[C@@H]1[C@H](Oc2ccc(Cl)cc2Cl)O[C@H]2COC(C)(C)O[C@@H]2[C@@H]1O[C@@H](C)C(=O)[O-] with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31587", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([C@H](c2ccccc2)N2CCN(C(=O)c3ccccc3F)CC2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127041", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc2oc(=O)cc(C[NH+]3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c2c1 by substituting a nitro with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCn1cnc2ccccc2c1=O)N[C@H]1CCc2c(O)cccc21 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109117", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCC[C@@H](C[NH2+]C2(CO)CCOCC2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146060", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)N(c1ccc(F)cc1)c1nc(CNC2(C)Cc3ccccc3C2)cs1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130059", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCS(=O)(=O)/N=C(\\[O-])c1cc(F)cc(Br)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162212", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccc(O)c([N-]S(=O)(=O)c2c(C)cccc2[N+](=O)[O-])c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241385", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCOC(=O)C1=C(C)Nc2nnnn2[C@@H]1c1ccc(Br)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222904", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@H](NC(=O)c1ccc(=O)n(C)n1)c1ccc(Br)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19358", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)[C@@H]1C[C@@H](NC(=O)c2cc(C)nc3ccccc23)CN1Cc1cccc(C(F)(F)F)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150043", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(CN2CC[NH+](C[C@@H]3CCOC3)CC2)sc1Br by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231754", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cccc(C[NH2+]C[C@H]2CCN(CC(F)(F)F)C2)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39700", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule N/C(CN(C[C@H]1Cc2ccccc2S1)C1CCCC1)=N\\O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154541", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=S(=O)(Cc1csc(COc2ccccc2)n1)Cc1ccc(Cl)s1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155450", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC(C)[C@@H](Sc1nc(N)c(C#N)cc1C#N)C(=O)NC(C)(C)C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54757", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nn(-c2ccccc2)c(Cl)c1C(=O)Nc1cccc(Cl)n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169039", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)C[C@@H](C)CNC(=O)NCc1ccc(-n2ccnc2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4478", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN(C(=O)[C@H](O)c1ccccc1)[C@H]1CCS(=O)(=O)C1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94225", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN1CCO[C@H]([C@H](O)c2cc(C)c[nH+]c2N)C1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229122", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@]1(CN[C@@H]2CCS(=O)(=O)c3ccc(F)cc32)CCCO1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105465", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CO[C@]1(C)C[C@H]([NH2+]Cc2ccc(Cl)o2)C1(C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88015", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(F)ccc1NC(=O)c1cc(F)ccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184229", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC1CC[NH+]([C@H](CNC(=O)NC[C@H]2CCC[C@@H]2O)c2cccs2)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68721", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H]1C[C@H](NC(=O)Cc2ccccc2O)CC[NH+]1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217433", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COCC(=O)NC1CC[NH+](Cc2ccc(Cl)c(Cl)c2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120004", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc([C@H](Cl)C(=O)N(C)C)ccc1Br with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162110", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule NC(=O)CC[C@H](C(=O)[O-])N1C(=O)/C(=C/c2ccc(O)c(O)c2)SC1=S with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142105", "split": "OpenMolInst" } }, { "instruction": "Please replace a thiol in the molecule CCC(CC)(CS)C[NH+]1CCCCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139929", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@]1(C)CCCN1C(=O)CCn1cnc2ccc(Br)cc2c1=O by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165836", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1ccc(S(=O)(=O)Nc2cc(C)c(O)c(S(=O)(=O)c3ccc(OC)cc3)c2C)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238631", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(C)c1ccc(CNC(=O)c2cc(F)cc3[nH]cnc23)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42146", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c(C#N)c(OCC(=O)c2ccccc2)n1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214241", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)C1CCN(C(=O)CC2(O)CCCCC2)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13167", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1cccnc1N1CCC(CNC(=O)c2cccnc2)CC1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21768", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1ccc(Cl)c(CC)c1NC(=O)NCc1nnc2n1CCCCC2 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202974", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC(C)(C)O)S(=O)(=O)C[C@H](C)CCl by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239493", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1cccnc1N1CCC[C@@H](c2[nH]cc[nH+]2)C1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119590", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C([C@H]1COc2ccc(F)cc2C1)N1CCN(c2cc[nH+]cc2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116923", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C1CC[C@@]2(CCCN(c3cc(NCCO)ncn3)C2)CN1CC1CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144251", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(O[C@H](C)[C@@H](C)O)c(C[NH2+]CC(C)C)n1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98383", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CN1CCN(c2ccccc2F)CC1)Nc1ccc([N+](=O)[O-])cc1Br by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45819", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CN(C)c1cccc(C(=O)NC[C@@](C)(O)CSc2ccccc2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28548", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ocnc1C[S@](=O)Cc1cc(=O)n2cc(Cl)ccc2n1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97686", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1sc(NC(=S)NC(=O)c2cccc(Cl)c2)c(C(N)=O)c1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](CC)C1(C(=O)Cc2ccc(Br)s2)CCCC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84707", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOc1ccc(N[C@H]2SC(=O)N(CCCl)C2=O)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21895", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@@H](CC#N)N(C)C(=O)c1nc(Cl)ccc1Cl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62815", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)[C@]1([NH2+]C2CC2)CCC[C@@H](OCC(F)(F)F)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185066", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1cccc(-c2nnnn2C2CC2)c1)c1cncc(Br)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199067", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C([O-])COc1c(Cl)cc(/C=C2/C(=O)NC(=O)N=C2[O-])cc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76940", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCc2c(sc3nc(S[C@H](C)C(=O)NCC(F)(F)F)n(C[C@@H]4CCCO4)c(=O)c23)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93103", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CC[C@H](Oc1c(-c2ccco2)oc2ccccc2c1=O)C(=O)Nc1oc(C)c(C)c1C#N with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166483", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COc1ccc(NC(C)=O)cc1NC(=O)N(C)Cc1cccc(C#N)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48834", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1-c1cnccn1 by substituting a nitro with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60439", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1ccc(C(=O)Nc2nc3ccc(Cl)cc3s2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13139", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](Cc1ccsc1)N(C)C(=O)C(=O)NCc1ccc(F)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43923", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Oc1ccc(-c2cccc(F)c2F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248780", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(NC1CCCCC1)[C@@H]1C[C@H](O)CN1C(=O)Nc1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82974", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1ccccc1)N(C)C(=O)Nc1cc2c(cc1Cl)OCCCO2 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210750", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C=CCN(CC(F)(F)F)C(=O)c1cncc(Br)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61803", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1cc(/N=C/c2ccc(N3CCCC3)c(F)c2)ccc1O by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75862", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N=C(c2ccc([N+](=O)[O-])o2)N=C2S[C@@H]3CCCCC3=C12 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131199", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N[C@H]1C[C@H]1C with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190396", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Cn1cnc2cc(F)c(F)cc21)N(C1CCCC1)[C@@H]1CCS(=O)(=O)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63516", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NNC(=O)c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58774", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)c1ccc(N2CCN(CC(=O)NC(=O)NC(C)C)CC2)c(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97988", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[NH+](Cc1csc(Br)c1)C[C@H]1CCC(C)(C)[C@H]1O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94406", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CC(=O)N(C)C)[NH2+][C@@H](c1ccc(F)cc1)C1CC1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36916", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1cc([C@@H](O)c2ccccc2)ccc1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122094", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCN(c2ccc(C(N)=[NH2+])c(Cl)c2)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101665", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@]1(CNC(=O)c2cc(Br)cnc2NN)CCCO1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229754", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@]1(Cl)C(=O)C[C@H](c2ccccc2)[C@H]1c1ccccc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34996", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1cccc(F)c1)N1CCC[C@H]1c1cccc2c1OCCO2 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179754", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NNc1ccccc1Cl)N[C@@H]1CCC[C@@H](C(F)(F)F)C1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184106", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@H]1CCCN(c2nc3c(c(=O)[nH]2)[C@@H](c2cccc(OC)c2)[C@@H](C#N)C(=O)N3)C1 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77042", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule COCCN(C(=O)C(=O)NC[C@H](C)C#N)c1nc2ccccc2s1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107519", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cccc(N2CCN(C(=O)CSc3nnc(-c4ccccc4F)n3C3CC3)CC2)c1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248223", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc(C(=O)N2CCN(c3c(N)cccc3Cl)CC2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49173", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C([C@H](Cc1ccccc1)NS(=O)(=O)c1c(Cl)cccc1Cl)N1CCOCC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227673", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(-n2nnnc2SCC(=O)Nc2ccc(F)cc2)c(OC)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157849", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C(=O)[C@@H](C)Sc1nnc(-c2ccccc2Cl)n1C)c1ccccc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84905", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule OCC#Cc1cc(F)cc(COC[C@@H]2CCOC2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113324", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]([NH2+][C@H](C)c1nccs1)c1ccc(OCC2CC2)c(F)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57989", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1c2ccccc2nnn1C[C@H](O)COC(c1ccc(F)cc1)c1ccc(F)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97715", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(Br)cc1CNC(=O)c1cccc2cc[nH]c12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213877", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(=O)N[C@H](C)C(=O)N[C@@H](C)CCCO by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241499", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule N#CC(C#N)=Cc1cccc(NC(=O)c2ccccc2Cl)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190627", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1nn(C)c(C[C@@H](O)[C@H]2C[NH+]3CCN2CC3)c1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128416", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOC(=O)[C@@]1(NC)CC[C@H](n2nc(C)c(Cl)c2C)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197756", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCOc1ccc([C@H]2C(C#N)=C(N)OC(C)=C2C(=O)OCc2ccccc2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182070", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)c1cc(NC(=O)NCCOc2cccc(C)c2)ccc1Cl by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5617", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc([C@](C)(O)[C@H]2CCOC3(CCC3)C2)cc1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12965", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1ccncc1)N1CCN(c2cncc(Br)c2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231344", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)NCCc1nc(COc2ccc(Cl)cc2Cl)no1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc2cc(Cl)ccc2o1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225771", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COCCc1nsc(N2CCC(Nc3ccc(F)cc3)CC2)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44190", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(NC(=O)CNC(=O)Cc2ccccc2)c(Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109753", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H](Cc1[nH+]ccn1C)c1ccc(F)c(Cl)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110952", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1cccc(N[C@H](C)c2ccc(Cl)s2)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235395", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1cncc(Sc2ccc(Cl)cn2)n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95984", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(OC)c(NCc2cnn(-c3ccccc3)c2)cc1F by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135122", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCOC[C@]1(O)C[C@H](C)CC(C)(C)C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176075", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)C[NH+](C)Cc2cccs2)cc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211124", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCO)S(=O)(=O)c1ccc(Br)cc1N by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88974", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=C(C#N)C(=O)N(C(C)C)C(=O)/C1=C\\Nc1cccc(Br)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121289", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC1CCN(C(=O)CCNS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110591", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COCc1nn2c(-c3ccccn3)ccnc2c1-c1ccc(Br)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88757", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC[C@H](C)OC(=O)c1cc(N2CCCC2=O)ccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152249", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CNC(=O)/C(=C\\c1ccc(Cl)cc1)NC(=O)c1ccc(C)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222327", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)[C@@H](Nc1ccc(C)cc1)[C@@]1(O)OC(c2ccc(Br)cc2)=CC1=O by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185376", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H]1C[C@H]1c1ccc(CCC(=O)N2CCC[C@H](O)C2)o1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64540", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)c1ccc(Cl)s1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207798", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C[C@@H]2CCC[NH+](Cc3c(Cl)nc4sccn34)C2)no1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48640", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule COc1cccc([C@@H]2CCCN2C(=O)NC[C@@H](CCO)c2ccccc2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6859", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)N[C@H](SC)C(Cl)(Cl)Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108870", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C([O-])Cn1c(O)c(/N=N/C(=O)c2ccc(Cl)cc2Cl)c2ccccc21 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134985", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(=O)OCC(=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]12C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86748", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(NC(=O)CSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37280", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule COc1cc(C#N)ccc1OCc1cc(Cl)ccn1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78822", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@H]1COCCN1C(=O)c1csc(C#CCO)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139814", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCn1nnc(NCc2ccc(-c3ccccc3Cl)o2)n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57055", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(OC)cc(C(=O)N2CCC[C@@H]2[C@@H](C#N)c2ccccc2)c1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124040", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1ccc(NCC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210128", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(F)c(CN2CCC(=O)NC[C@H]2C)c1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52317", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CS(=O)(=O)c1ccc2nc(NC(=O)c3ccc(-c4ccccc4F)o3)sc2c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49386", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccc(C(=O)N[C@H](C)c2c(C)noc2C)cc1OCCO with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69600", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=[N+]([O-])c1c(NCc2cccnc2)ncnc1Sc1ccccc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224342", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@H](NC(=O)c1cccc(CC#N)c1)C(C)(C)C[NH+](C)C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152550", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(CN2CCN(C(=O)[C@@H](NS(=O)(=O)c3ccc(Cl)cc3)C(C)C)CC2)on1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85791", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(C[NH+](CCO)Cc2cccnc2)c(Br)cc1O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60203", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(CC1CCS(=O)(=O)CC1)N1CCC2(CC1)OCCC[C@@H]2O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141714", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1cccc(-n2c(N)c(C#N)c3c(c2=S)CO[C@H](C(C)C)C3)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9612", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=Cc1ccc(Br)nc1 by substituting a aldehyde with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "229480", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)Nc1ccc(C(=O)N2C[C@H](c3ccc(F)cc3)[C@@H]3[C@H]2CCC[NH+]3C)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196425", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1ccc(Cl)cc1)N1CCC[C@H](OCc2ccc(F)c(F)c2)C1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80121", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncc2c(n1)C[NH+](Cc1cc(Cl)c3c(c1)OCCO3)CC2 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(CC)N(CC[NH3+])c1ncc(Cl)cc1F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22674", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(C[NH+]2CCC[C@@H]2c2nncn2C)ccc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151613", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(Cc1[nH+]ccn1C)S(=O)(=O)c1ccccc1OC(F)(F)F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5761", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[C@H](NC(N)=O)C(=O)NCCc1ccc(Cl)cc1Cl by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41368", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(C(F)(F)F)cc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106736", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN(CC#N)Cn1ccc(=S)c2ccccc21 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35714", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=Cc1cc(Cl)c2ccccc2c1OCc1nnsc1Cl by substituting a aldehyde with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123153", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCc1nnnn1-c1ccc(F)cc1)[C@H]1CC(=O)N(c2ccccc2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "127209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1nc(Nc2ccc(OC)c(F)c2)ccc1N by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77563", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc([C@@H]2[C@H]3CCCC[C@@]3(O)CCN2C(=O)c2cccc(F)c2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170903", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCN/C([S-])=C(/C(=O)c1ccc(Cl)cc1)[n+]1ccccc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)NC(=O)C[C@@H](C#N)NCC(F)(F)F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83733", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc([C@H](C)NC(=O)c2cc(C(C)C)n(C)n2)cc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247067", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c(C(=O)NNC(=O)COc2ccc3cc(Br)ccc3c2)oc2ccccc12 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162038", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c(C(=O)C(F)(F)F)c2ccccc2n1CC(=O)Nc1ccc(Cl)c(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19921", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(OC[C@@H](O)CN2CCN(Cc3[nH+]ccn3C)CC2)c1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187296", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](CS)Cn1cnc2c(cnn2C)c1=O by replacing a thiol by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179178", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1cnn(-c2nc(C3CC3)ns2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220517", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)C(=O)N[C@@H]1CCCN(C(=O)N[C@H]2CCC[C@@H]2c2ccc(F)cc2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64209", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@H]2C[C@H](C(F)(F)F)n3nc(C(=O)N4CCCCCC4)cc3N2)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120354", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN[C@@H](c1cc(Cl)ccc1Cl)[C@@H]1CN2CC[NH+]1CC2 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110709", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ncccc1CNC(=O)N[C@@H](C)c1cnn(-c2ccc(F)cc2)c1C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171675", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc2c(cc1OC)[C@H](C)[NH+](CC(=O)Nc1ccc(F)c(F)c1F)CC2 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156768", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(S(=O)(=O)NC2CCCCC2)cc1F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191394", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(CS(=O)(=O)c1ccc(O)cc1)N1CCCc2ccccc21 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19120", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cn1nccc1CN1CCO[C@@H](c2cccc(C(F)(F)F)c2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104876", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(C)Nc1ncnc(Nc2ccc(F)c(F)c2)c1N by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99208", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOc1ccc(C(=O)N(Cc2ccc(Br)o2)[C@@H]2CCS(=O)(=O)C2)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6763", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[NH+](CC)[C@H](C)CNC(=O)N[C@@H](C)c1ccc(Cl)s1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62930", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1cccc(C[NH+]2CCC[C@@H]2c2cc(C)on2)c1O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180690", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Sc1nc2c(cc1C#N)CCCC2)C(=O)N(C)Cc1ccccc1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71342", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(CNC(=O)Nc2cc(F)ccc2N2CCCCC2)n[nH]c1=S by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111795", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc2cc(C(=O)N3CC(OCc4ccccc4Cl)C3)[nH]c2c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92278", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-n2nnc(C(=O)OCc3cccc(Cl)c3)c2C)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126793", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(SCC(=O)Nc2cc(Cl)cc(Cl)c2)nnc1-c1ccc(F)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214717", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(Cn2nc(C)c(C[NH2+]C(C)C)c2Cl)cc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120523", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COC(O)(OC)c1ccc(C=O)cc1C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165106", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CN(CCC#N)C(=O)CC[NH+]1CCC[C@@H](c2cn[nH]c2)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80271", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule N#C/C(=C/c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1)c1nnc(NC(=O)c2ccccc2)s1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H](O)c1ccn(Cc2cnn(CC)c2)c1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156501", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCn1cc[nH+]c1CNC(=O)[C@@H]1CCC(=O)N(Cc2cccc(C(F)(F)F)c2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187821", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Cc1ccccc1F)NNC(=O)N[C@H]1CCCC[C@@H]1OC1CCCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166491", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CC(=O)c1ccccc1)NCc1ccc(Cl)cc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6997", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3695", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCCN1CCOCC1)c1cccc(C(F)(F)F)c1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cc(Cl)ccc1C[NH2+][C@H](C)c1cnccn1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131343", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C1N[C@H](c2ccc(F)c(-c3cccs3)c2)N2CCOC[C@@H]12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196802", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cccnc1NC(=O)[C@@H]1C[C@H]1c1ccccc1OC(F)(F)F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247848", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)N(C)C[C@H]1CCCO1)c1ccccc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225511", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H]1COC[C@@H]1c1nc(-c2cc(F)cc(Br)c2)no1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212502", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CNS(=O)(=O)c1cccc([C@H](C)NCc2cc(C#N)ccc2F)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230177", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(S(=O)(=O)N(CC(=O)N2CCN(C=O)CC2)c2ccccc2F)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40021", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSCCN(C#N)c1ccc(F)c(Cl)c1 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187477", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COCCN(Cc1cc2ccc(C)c(C)c2nc1Cl)C(=O)C1CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226188", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)[N-]c2cccc(Cl)c2)c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27088", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@@H](CCCO)NC(=O)Nc1cccc(C(=O)NC2CC2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156071", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(C)c1OCC(=O)N1CCC(O)CC1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185348", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule Cc1cc(Br)cc([N+](=O)[O-])c1OCCC(=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118811", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CSc1nn(CN2CCCc3cc(C)cc(F)c32)c(=S)s1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180876", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(C(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173849", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC1(C)CNCc2ccc(C#N)cc21 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50342", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc(-c2noc(CN(C#N)c3ccc(F)c([N+](=O)[O-])c3)n2)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63662", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=CN1CCN(c2cccc([N+](=O)[O-])c2)CC1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139250", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[C@H](NC(=O)N1CCC(n2cncn2)CC1)c1ccc(Cl)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "214333", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)n1c(S[C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)nc2ccccc2c1=O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242394", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ncccc1C(=O)Nc1cccc(F)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193773", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cccc([C@H](CNC(=O)C(=O)Nc2cc(F)ccc2C)[NH+](C)C)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8559", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1noc(-c2ccccc2C(F)(F)F)n1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "109896", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(Br)cc1C(=O)NC(=S)Nc1cccnc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170716", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2oc(=O)cc(COc3cccc([N+](=O)[O-])c3C)c2cc1Cl by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35797", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1ccc2c(c1)CCC2)Nc1ccccc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196143", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(CNC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)Nc1cccc(O)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70008", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Nc1nc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCC[C@@H](NC(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)[C@@H]1C by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62839", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc2c(c1)C(=O)/C(=C/c1cccc(C(F)(F)F)c1)CO2 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24859", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC[NH2+]CC#CCOC(=O)[C@@](O)(c1ccccc1)C1CCCCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58702", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CC(=O)NCC(=O)c1ccc([N+](=O)[O-])cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207280", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(/C=C/c1ccccc1)NC(=S)Nc1ccc(Cl)c([N+](=O)[O-])c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "43629", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(NC(=O)NNc2ccc(Cl)nn2)c2ncccc2c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8930", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)Nc1cccc(-n2ccnn2)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120267", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCCc1nnc(S[C@H](C)C(=O)Nc2ccccc2Cl)n1N with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17176", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC1(C)[C@@H]2C[NH2+]C[C@@H]2CN1c1nc2ccc(Br)cn2n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201951", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCO[C@@H]1CCCN(C(=O)Nc2cnn(-c3ccccc3F)c2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130524", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCc1csc(Br)c1)Nc1ccncc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211313", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C([C@@H]1C[C@@H](O)C[NH2+]1)N1CCc2n[nH]c(-c3ccc(-c4ccccc4)cc3)c2C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113583", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc2c(c1)OCO2)c1c(Cl)ccc(Cl)c1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115299", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CCNC(=O)C1CC[NH+](C[C@H](O)c2cc(C)ccc2C)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91616", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]([NH2+]CC1(CO)CCOCC1)c1ccc(N2CCOCC2)cc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7024", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cccc(Cl)c1)NC[C@H](CCO)c1ccccc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73418", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCC(n2cccc2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114033", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(F)cc1OCC(F)(F)F)N1C[C@H]2CCCC[C@@H]2C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242224", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1C[NH+](CCCCC#N)CCN1C[C@@H](C)O by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169427", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCC(=O)N1CC[C@H](C2CC[NH+](Cc3cccc(F)c3F)CC2)C1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21747", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccccc1NC(=O)[C@@](C)(N)C(F)(F)F by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190508", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(=O)Nc1ccc2c(C(=O)[O-])c(C)c(O)nc2n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153188", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[NH+]1CCN(C(=O)c2cccc(O)c2)CC1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52138", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC(C)n1ccnc1SCC(=O)Nc1c(Br)cc([N+](=O)[O-])cc1Br with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247650", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@@H]1CCC[NH+]1[C@@H]1CCC[C@@](CO)([NH2+]C(C)C)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62362", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(NC[C@@H]1CC[NH+](Cc2cccc(O)c2)C1)c1cc2ccccc2[nH]1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6403", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(-c2nnc(-c3ccccc3)o2)nnn1-c1ccc(F)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134223", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Nc1ccc2c(c1)OCCO2)Nc1ccccc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20045", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cccc2cc([C@H]3NC(=O)c4c(sc5c4CCCC5)N3)c(Cl)nc12 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22469", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=NN(Cc2ccccc2Cl)C(=O)[C@]12Cc1c(C)nn(-c3ccccc3)c1N1CCCC[C@@H]12 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19830", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCNC(=S)NNC(=O)c1cc(F)cc(F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccc(F)c(Cl)c1)[C@H]1CC(O)=Nc2nnc(-c3ccco3)n21 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124563", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(-c2n[nH]c(=S)n2/N=C/c2ccccc2Br)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121089", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1nnc(COc2ccccc2Cl)o1)NN1C(=O)NC2(CCCCC2)C1=O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73483", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(c1ccc(F)cc1Cl)N1CCN(Cc2ccc(Cl)cc2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216936", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C/C(=C\\c1ccc(Br)cc1)C[NH2+]C(C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108278", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H](CNC(=O)N1CCC(CO)CC1)Oc1cccc(C(F)(F)F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22394", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(O[C@@H](C)C(=O)N2CC[C@@H](C(N)=O)C2)ccc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151802", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC1CCN(C(=O)N[C@@H]2c3cccc(F)c3CC[C@@H]2C)CC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242697", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccccc1C(=O)N1CCCCC1)c1ccc(C(F)(F)F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51717", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COCCN(Cc1ccco1)C(=O)Nc1ccc(CC#N)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57790", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](C)CCN(Cc1ccc(C#N)cc1)S(=O)(=O)c1ccc(Cl)nc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86912", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule FC1(F)O[C@H]2C=CC=C[C@@H]2OC1(F)F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20738", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule N/C(=N/OCc1c(Cl)cccc1Cl)c1cccs1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223171", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc([C@@H]2C[NH2+]CC[C@@H]2c2c(F)cccc2F)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134733", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1[C@@H](C(=O)[O-])CC[NH+]1Cc1c(F)cccc1Cl by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142748", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccc(NC(=O)C2C(C)(C)C2(C)C)c(O)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179910", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCC(=O)N1CCN(c2ncnc3c2nnn3-c2cccc(F)c2)CC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194239", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](C1CCN(C(=O)[C@@H]3C[C@H]3C)CC1)N2 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13888", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1ccc(C[NH+]2CCC(OCCCO)CC2)o1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160079", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc([C@@H](O)c2ccccc2C2CC2)c1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240054", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cccc(-c2ccccc2O)c1C(=O)[O-] with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70532", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1665", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(-c2nnc(S[C@@H](C)C(=O)Nc3nc(-c4ccc(F)c(F)c4)cs3)n2C)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168284", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cccc(N2C(=O)N=C([O-])/C(=C\\c3ccc(OC)c(O)c3)C2=O)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218614", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule COc1ccccc1OCc1ccc([N+](=O)[O-])c(N)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188226", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COc1cc(C(=O)N2CCc3c(sc(N)c3C#N)C2)cc(OC)c1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66105", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)c2ccc(NC(=O)c3ccnc(F)c3)cc2)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87376", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[NH+](C)CCCOc1ccc(NC(=O)c2cc(C#N)cs2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92948", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H]1C[C@](O)(Cc2ccccc2)CS1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239771", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCN(C(=O)c2cc(C(=O)N3CC[NH+](C)CC3)cc([N+](=O)[O-])c2)CC1 by replacing a nitro by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65780", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1C(=O)OCC(=O)NCC(F)(F)F by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112316", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH+](C)[C@H]1CCC[C@@H](NC(=O)c2c(O)cc(Cl)cc2Cl)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114453", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCCNC(=O)c1cccc([N-]S(=O)(=O)c2cccc(C(F)(F)F)c2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49364", "split": "OpenMolInst" } }, { "instruction": "Please substitute a aldehyde in the molecule Cc1cc(C=O)c(C)n1-c1ccc(OCc2ccccc2)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106975", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C1C2=C3CCC[C@@H]3SC2=NC(=S)N1c1ccc(Cl)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144385", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCc1cc(Cl)no1)N1CCC[C@@](O)(CO)C1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104789", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1cc(Oc2cc(N(C)C)ccc2[N+](=O)[O-])n2ncnc2n1 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121634", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1ccccc1F)N1CCCCCC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58986", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nc(-c2cccc(C[NH2+]Cc3ccc(OC(F)(F)F)cc3)c2)n[nH]1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99260", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[NH+](CCc1ccccc1)Cc1ccccc1-c1nc([O-])cc(C(F)(F)F)n1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2830", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@H](O)Cc1ccccc1)Nc1cnn(-c2ncccn2)c1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55970", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule N#Cc1cccc(NC(=O)NCc2nc(-c3ccc(F)cc3)n[nH]2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56698", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C/C=C/COC(=O)C[C@@H](NC(C)=O)c1ccc(Br)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138098", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC1CC[NH+](CCNC(=O)Nc2cccc(Br)c2C)CC1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87595", "split": "OpenMolInst" } }, { "instruction": "Please replace a aldehyde in the molecule CC(C)NC(=O)c1ccc(NC(=O)[C@H](C)Oc2cccc(C=O)c2)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54857", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=C(N/N=C/c1ccc(N2CCOCC2)o1)c1cccc([N+](=O)[O-])c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82810", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](CCO)CNc1nnnn1C by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199282", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CC(=O)N1CCc2c(C)c(Br)c(C)c([N+](=O)[O-])c21 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76823", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)Nc1nccn(C)c1=O by substituting a nitro with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248642", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CS[C@H](CO)[C@@H](C)NC(=O)NCc1cc(=O)[nH]c2ccccc12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53161", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(C[C@H]2CCC[NH+](Cc3cc(C(F)(F)F)ccc3F)C2)no1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34012", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H]1CCC[NH+](CCNC(=O)C(=O)Nc2ccc(F)c(Cl)c2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139289", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(NC(=O)N[C@@H]2CCCN(c3ccccc3F)C2=O)on1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119217", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1nccnc1N(CC(=O)[O-])CC(F)(F)F by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238895", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCC(F)(F)F)N1CCC[C@H](c2[nH+]ccn2Cc2ccccn2)C1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4780", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cccc(OCCCC(=O)Nc2cccc(F)c2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50697", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)c1cc(Br)ccc1OS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201651", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1C(=O)N(CC[NH2+]C2CC2)c2c(F)cccc21 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235844", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](C#N)OC(=O)c1ccc([N-]S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CCO)N(Cc1ccccc1)c1ncccc1C#N by substituting a nitrile with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53975", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CCCS(=O)(=O)c1ccc(F)cc1)Nc1cccc(Cl)c1Cl by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72328", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(OCC(=O)OCC(=O)Nc2ccc3c(c2)CCC3)ccc1Cl by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225136", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nc(-c2ccc(C)c(S(=O)(=O)N3CCC[C@H](C(=O)Nc4ccc(F)cc4)C3)c2)no1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14402", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/[NH+]=C(/NCc1cc(C)on1)NCc1cc(Br)cs1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22356", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1NC2(CCCC2)C(=O)N1Cc1noc(-c2ccc(Cl)cc2)n1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196359", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CCc1ccc(N[C@@H]2CCN(C3CC3)C2=O)cc1[N+](=O)[O-] with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123965", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@H]([NH2+]Cc1cc(F)ccc1F)c1ccc(OC)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244425", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(S(=O)(=O)NCCc2csc(-c3cccc(C)c3)n2)cc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245563", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule C[C@H]1C[C@@H](C)C[NH+](Cc2c(O)ccc3c2O/C(=C/c2cccc([N+](=O)[O-])c2)C3=O)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197636", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC[C@H](O)Cn1nc(-c2ccncc2)nc1CCN1Cc2ccccc2C1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61799", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cc(C)c(O)c(C(=O)Nc2ccnn2C(C)C)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157471", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(C[C@H](O)c1ccccc1)Nc1nc(C[NH+]2CCCCC2)cs1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77209", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC(=O)c1cccc(SCc2ccc([N+](=O)[O-])c(F)c2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6598", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+]C[C@H]1CN2CCCC[C@@H]2CO1)c1c[nH]c2cc(Cl)ccc12 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73541", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1CC(C(=O)NC2(c3ccccc3F)CC2)C[C@@H](C)O1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188436", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccc(/C=C/C(=O)Nc2ccc(C)cc2Cl)cc1OCC with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84400", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(N2CCC[C@H](O)C2)[nH+]c1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148219", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCCCN1CCOCC1)C1CCN(C2=NC(Cl)=NC3=NC=N[C@@H]32)CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4770", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H]1C[C@@H](C)CN(c2nc3c(c(=O)[nH]2)[C@@H](c2ccccc2)[C@@H](C#N)C(=O)N3)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193950", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H](C)[n+]1cccc([O-])c1)c1ccc(Cl)cc1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44277", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc([C@@H](NC(=O)c2ccc(=O)n(C)n2)c2ccccc2F)no1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33314", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1NC(=O)c1ccc(NC(=O)Cc2ccccc2)cc1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34497", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc(C(F)(F)F)nc(N2CCN[C@H](C(=O)NC3CC3)C2)c1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120982", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)COCCNC(=O)N[C@H]1CCCC[C@H]1CO by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141328", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCOc1ccc(C(=S)N2CC[NH+](CCO)CC2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167569", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNc1nc(CNc2ccc(OC(F)F)cn2)cs1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219844", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccn2cc(CCNC(=O)C[C@H](O)c3cccc(F)c3)[nH+]c12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126560", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Fc1ccc(C[NH+]2CCC(NC3CCSCC3)CC2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98969", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[NH+](CC)CC[C@@H](O)Cc1cccc(Cl)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9296", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc([C@@H]2Oc3nc(SC)nnc3-c3cc(Cl)ccc3N2C(C)=O)c(OC)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73340", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](c1ccccc1)[NH+](C)CC(=O)N(C)CC(=O)Nc1ccccc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173440", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(C(=O)N2CCN(C(=O)[C@H]3CCCO3)CC2)cnn1-c1ccc(F)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201291", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CC1(CNc2ccc([N+](=O)[O-])c(N)n2)CCCC1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134416", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(N2CCN(c3ncnc4c3cnn4-c3ccc(C)c(Cl)c3)CC2)cc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181856", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[S@](=O)CC(=O)N(CC(F)(F)F)C(C)C with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130760", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule Cc1cc(C(=O)NCc2ccc(N3CC[NH+](C)CC3)nc2)c(N)c([N+](=O)[O-])c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16648", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC(C)[C@@H](CO)NS(=O)(=O)c1ccc2c(c1)CCC2 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119153", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)[C@H]([NH3+])[C@@H](C)c1ccc(OC(F)(F)F)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51186", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)N(C)C1(C#N)CCCCC1 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205481", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ncnc(N)c1C[NH+]1CCC[C@H](CNC(=O)Nc2cccc(F)c2)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58268", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NC[C@@H]1CCCO1)N[C@H](c1ccccc1)c1ccc(F)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53372", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)[C@H](C)C[C@@](C)(O)c1ccccc1 by substituting a hydroxyl with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148622", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CC(C(=O)N(CC[NH+](C)C)Cc2ccc(C#N)cc2)C[C@H](C)O1 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119325", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)[C@H](C)[NH+]1CCC2(CC1)CC(=O)N(Cc1ccc(F)c(F)c1)C2 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121432", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC[C@H]([NH2+][C@@H](C)[C@H](O)Cc1ccccc1)C(C)C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49098", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CSc1n[nH]c(NN=C2CCCCC2)n1)Nc1ccc(F)c(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170612", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=[N+]([O-])c1cccc(C=C(Cl)Cl)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195817", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1csc(C[C@@H](CO)c2ccccc2Cl)n1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23884", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CCc1nc2n(n1)CCC[C@H]2[NH2+][C@@H](C)C(=O)Nc1cc([N+](=O)[O-])ccc1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71544", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)/C(=C/C=C\\c1ccccc1)NC(=O)c1ccc([N+](=O)[O-])cc1 by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9771", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule Cc1ccc(C)c(-n2nnnc2Sc2cccc(Cl)c2C#N)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193592", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2C[C@@H](N3CCOCC3)C[C@@H](c3ccccc3F)[NH+]12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22487", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@](O)(CCc1ccccc1)CNC(=O)C1(c2cccs2)CCCC1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68386", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])[C@H](c1ccc(O)cc1)[NH+]1CCN(Cc2cccc(Cl)c2)CC1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97725", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC(C)[C@@H](CNC(=O)N(C)Cc1ccc(C#N)cc1)N1CC[NH+](C)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97344", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CSC1=NC(=O)[C@H](/C=C/c2ccccc2)N=N1)Nc1ccc(Cl)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16876", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)c2cc(Cl)c[nH]2)n(Cc2ccccn2)n1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23835", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(C(=O)Nc2ccc(Br)cc2Cl)cc1S(=O)(=O)N1CCOCC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39745", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Brc1ccc(C[NH2+]CCn2cnnc2C2CC2)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171331", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(C)n1-c1nnc(N2CCC[C@@H](C(=O)Nc3ccc(Cl)cc3)C2)s1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162273", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CS(=O)(=O)N1CCCc2cc(C(=O)Nc3cc(F)cc(F)c3)ccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39289", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)OCCCNC(=O)N[C@H]1CCCc2ccc(F)cc21 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244253", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COC(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1)Nc1cccc(F)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26803", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)OCC(=O)Nc2c(C)nn(C)c2C)c(O)c1C by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "188626", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(F)c(NC(=O)[C@H](C)n2cc(Br)cn2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36313", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](C)c2ccc(OC)cc2F)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125470", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=c1sc2c(n1Cc1cnc(Cl)s1)CCCCC2 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233318", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C/C(=N/NC(=O)c1c(Br)c(C)nn1C)c1cccc(NC(=O)c2ccccc2F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30617", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)CSC1=N[C@@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Br)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136448", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccc2cc(C[NH2+]C[C@@H]3COCCO3)c(OCc3ccccc3Cl)nc2c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150462", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C(=N/NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)c1cccc(C(F)(F)F)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27987", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(c1ccc(Cl)cn1)N(C[C@H]1CCCO1)[C@@H]1CCSC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135139", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CNC(=O)COC(=O)[C@H](C)Sc1ccccc1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89378", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCC1(O)CCSCC1)[C@H]1CC(=O)N(CC(F)(F)F)C1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21045", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H](CSC)N(C)C(=O)[C@@H]1Cc2cccc(F)c2O1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161941", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)c1ccc(-c2nn(CN(C)CC#N)c(=S)o2)cc1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102789", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Cl)cn1)C1CCN(C(=O)c2ccc3[nH]cnc3c2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232660", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1c(O)ccc2c(CNc3ccc(NC(=O)C4CC4)cc3)cc(=O)oc12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "215093", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1cccc(OC[C@H](O)CNC(=O)c2n[nH]c(=O)c3ccccc23)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42105", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[S@@](=O)[C@H]1CCCC[C@@H]1NS(=O)(=O)c1ccc(F)c(Cl)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169442", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C/C(=N\\OC(=O)COc2ccc(Cl)cc2)[C@H](C)C[NH+]1C by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155023", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](N[C@H](C)C(=O)N[C@H](C)c1ccccc1)c1ccc(F)c(F)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101136", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(CSc1cccc(F)c1)c1cc(F)ccc1O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153387", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC(=O)Nc1nc2c(OC)cc(NC(=O)Nc3cc(Cl)c(OC)cc3OC)cc2s1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173736", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C=CCOc1ccccc1C(=O)N[C@H](C(=O)[O-])[C@@H](C)O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28129", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccccc1OC(F)F)C(=O)N1CC[C@@H]([NH+]2CCCC2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Oc1ccccc1[N+](=O)[O-])C(=O)Nc1ccc2ccccc2c1 by replacing a nitro by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129581", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C1C(=O)N(CCOCC(F)(F)F)c2cc(F)c(Cl)cc21 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97113", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N(C)[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc(Cl)n1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246014", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CN(C[C@H](O)CN2CCOCC2)CCO1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23758", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cnc(Oc2ccccc2)cn1)N1CCc2ccc(Cl)cc2C1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151982", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](NC(=O)N(C)[C@@H](C)C1CC1)c1ccc(Br)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34606", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(Cl)c(C)cc1NC(=O)C[C@H]1S/C(=N\\N=C(/C)c2ccc(F)cc2)NC1=O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182759", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCc1nn(C)cc1C(=O)N1CCc2sc(Br)cc2C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170376", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(N/N=C/c1ccc(C(F)(F)F)cc1)c1ccccc1O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196387", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCCN(C(=O)N2CCCC[C@@H]2CCO)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7783", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@H](NC(=O)C(=O)Nc1cccc(C(F)(F)F)c1)c1ccc(C)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59532", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CN(Cc1nc(C(F)(F)F)cs1)Cc1cccc(Br)c1O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9362", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCc1cc(NC(=O)C(=O)NC[C@@](C)(O)[C@H](C)CC)n(C)n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84519", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(Cc2cccc(F)c2)cc([C@H]2CCCN(C(=O)CN3CCOCC3)C2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198872", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN[C@@](C#N)(CN1CC[NH+]2CCC[C@@H]2C1)c1ccccc1 by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186424", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)C1CC[NH+](Cc2nnn(-c3cc(F)cc(F)c3)c2-c2ccncc2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156290", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1noc(C)c1C(=O)Nc1cc(F)ccc1N1CCCCC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237840", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCOc1cccc([C@@H]2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2C[C@@H]2CCCO2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102491", "split": "OpenMolInst" } }, { "instruction": "Please substitute a thiol in the molecule CC[C@@H]1CCC[NH+](CC2(CS)CCC2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100348", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)CNC(=O)N1CC[C@@](O)(c2ccccc2)[C@@H]2CCCC[C@H]21 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13796", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1cnc(C(=O)O[C@H](C(=O)Nc2ccc([N+](=O)[O-])cc2Br)c2ccccc2)cn1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196303", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CN(C(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)c1cccc(C#N)c1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222483", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1N[C@@](c2ccccn2)(C2CC[NH+](Cc3c(F)cccc3F)CC2)C(=O)N1C[C@H]1CCCO1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104616", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule OCC[C@H]1C[NH+](Cc2cccs2)CCN1Cc1ccccc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113712", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[NH+]1CCN([C@@H](C)C[NH2+][C@@H](C)c2nc3cc(Cl)ccc3n2C)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31059", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[NH2+][C@H](c1ccn(Cc2c(Cl)cccc2Cl)c1)C(C)C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126876", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(/C=C/c1cccc(F)c1)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234322", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@H](NC(=O)c1cccc(SCC#N)c1)C(=O)N1CCCC[C@@H]1C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18679", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=c1c(C[NH+]2CCSCC2)coc2c(Cl)cc(Cl)cc12 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126268", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1occc1C(=O)N/N=C/c1ccc(Cl)c([N+](=O)[O-])c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241952", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OC1(Cc2cc(-c3ccccc3)no2)CC[NH+](CCCC2CCCC2)CC1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126505", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)N2CCN(c3nc4nccc(-c5ccc(Cl)c(Cl)c5)n4n3)CC2)cc1C by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205991", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc([C@@H]2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2[C@@H]2CCS(=O)(=O)C2)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175311", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC[C@@H]1CCCC[NH+]1C)C(=O)NCc1ccc(F)c(Cl)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158734", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1nc(CCNC(=O)N2CC[C@H](C)[C@H](O)C2)cs1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228158", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule [NH3+]C[C@@H](Cc1nccs1)c1cccc(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246316", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CN(C)C(=O)CS[C@@H](C)[C@@H](C)O)cc1F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172488", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)CN(C)C(=O)NC[C@@H](C1CCCCC1)[NH+](C)C by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "84003", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CN(C)c1ccc(CCCNC(=O)N[C@H]2CCC[C@@H]2CO)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13977", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C#Cc1cc(F)c(NC(=O)N2CCNC(=O)[C@@H]2c2ccccc2)c(F)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116356", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1[nH]cnc1C[NH+]1CCC(Oc2cccc(F)c2)(C(=O)[O-])CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228475", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOc1c(Cl)cc(Cl)cc1C(=O)NC1=NN(c2ccccc2)C(=O)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154674", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOc1ccc(-c2nnc([S-])n2-c2ccc(Cl)c(C(=O)[O-])c2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61116", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCC[NH2+][C@@H](Cc1ccc(C)cn1)c1c(F)cccc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216958", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)N(C)c1cccc(NC(=O)[C@H]2C[C@H]2c2cccc(Cl)c2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163438", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(NC[C@H](O)c1ccc([N+](=O)[O-])cc1)c1cccc(S(=O)(=O)N2CCOCC2)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150418", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COC(=O)c1[nH]c2cccc(Cl)c2c1NC(=O)C[NH+]1CCC[C@@H](C)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223469", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CCNC(=O)c2nn(-c3ccc(F)cc3)cc2OC)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126043", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cn1c(C(=O)N2CCCC[C@@H]2C[NH+](C)C)cc2cc(C(F)(F)F)ccc21 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228116", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](O)[C@@H]1CCC[NH+]([C@@H](C)C(=O)N2CCC(C(N)=O)CC2)C1 by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225712", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)(C)[C@@H]1OCC[C@@H]1CNC(=O)NC[C@@H]1CCC[C@H](O)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176595", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NC[C@@H]1CCCCN1S(=O)(=O)Cc1cccc(F)c1)Nc1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170369", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C/C(=C/c1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "674", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1csc(C(=O)N[C@H](c2cc(F)ccc2F)C2CC2)c1 by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154300", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Oc1nc(Oc2ccc(Br)cc2Cl)ccc1N by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119025", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1cccs1)C(=O)N[C@H](C)c1ccc(Cl)s1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8058", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@H](C)CN(CC)c1ccc(/C=C/C(=O)[O-])cc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166131", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(S(=O)(=O)N(C)c2ccccc2F)c([N+](=O)[O-])c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171431", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[NH+]1CCc2c(sc3c2C(O)=N[C@H](c2cccc(Cl)c2)N3)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202928", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)[NH+](C)Cc1ccc(F)c(F)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62035", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule [NH3+]CC1CCN(C(=O)Cc2ccc(F)c(F)c2)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "194809", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1cscc1C[NH2+][C@H]1CCCCC[C@@H]1C#N by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165594", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(OCc1nncn1C1CC1)C1(c2ccc(Cl)cc2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "139623", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNc1nc2ccccc2cc1CSC[C@@H](O)CO by substituting a hydroxyl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120204", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+][C@@H](C)C1CCC1)c1cc(F)c(F)c(F)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69309", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C=CCSC1=NC(=O)C[C@H](c2ccc(C(C)C)cc2)[C@@H]1C#N with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70133", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2ccc([C@@H](Nc3cccc[nH+]3)c3ccc(O)cc3)c([O-])c2n1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95045", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(NC(=O)NCCCN2CCOCC2)cc1F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95432", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CCC#N)CC(=O)NC[C@@H]1Cc2ccccc2O1 by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55357", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc([C@H]2C(C(=O)Nc3ccccc3)=C(C)Nc3ncnn32)cc(Cl)c1OC by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189007", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule Cc1ccc(NCCS(=O)(=O)N2C[C@@H](C)O[C@H](C)C2)c([N+](=O)[O-])c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164328", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(C)NC(=S)NC(=O)/C=C/c1ccccc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14793", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CN[C@](C)(C#N)C[C@@H](C)SC[C@@H](C)CO by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182282", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCC[C@H]1C(=O)NCC[NH+]1Cc1cc(Cl)ccc1O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106227", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)NCCO by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230139", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CN(S(=O)(=O)c2ccc(Br)s2)CCS1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216817", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1c2ccc(O)cc2OC(=O)[C@@H]1CC(=O)NCCC1=c2cc(F)ccc2=[NH+]C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "240147", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(CNc1ccc(Cl)cc1F)NC[C@@H]1COc2ccccc2O1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12033", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NC[C@H](c1ccccc1)[NH+]1CCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90762", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(CCCCO)Nc1ccccc1Oc1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11702", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOC(=O)C(=O)NNC(=O)Cn1ccc2ccc(Cl)cc21 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187688", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(Br)cc3)cc2)C[C@@H](C)O1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121814", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CCN(C[C@H](C)C#N)C(=O)Nc1ccc2c(c1)NC(=O)[C@@H](C)O2 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172416", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(CNc2c(-c3ccc(O)c(O)c3)nc3cnccn23)cc1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42096", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Fc1cccc(C[NH+]2CCCCC[C@H]2c2ccco2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112043", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](C)NC(=O)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)s1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138184", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc(Br)ccc1NC(=O)c1cccc(NC(C)C)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208058", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[NH2+]CCc1nc2cccc(Cl)c2[nH]1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160878", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule [NH3+][C@@H](CC12CC3CC(CC(C3)C1)C2)c1ccc(Br)s1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172926", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(CNC(=O)C(=O)Nc2ccc(C)nc2Cl)ccn1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62573", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule NC(=O)CCCCNC(=O)c1cc(Cl)ccc1O with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23025", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC(C)(C)C)c1nc(Br)cn2ccnc12 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216229", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1c(CN2CC[NH+](C[C@H]3CCOC3)CC2)cc(C#N)n1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7594", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[C@H]1/C([O-])=C(\\C#N)C(=O)NCCc1ccccc1 by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134476", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@H](CSC)N(C)C(=O)c1c(C)nn(CC)c1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157327", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1cc(Cl)c(Cl)cc1S(=O)(=O)N1CCN(CCO)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45200", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule COc1ccc(Nc2cc(C)c([N+](=O)[O-])cn2)cc1OC with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118174", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)Oc1ccc(C[NH+]2CCN(c3ccccc3[C@H](O)c3ccccn3)CC2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55811", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)N1CC[C@H](C(=O)Nc2ccc(Br)c3ccccc23)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29103", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)C(=O)N2CCC(n3c(=O)oc4ccc(Cl)cc43)CC2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196324", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1CC[C@H](COC(=O)c2cccc(F)c2)N1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115628", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1O)c1ccc(-c2ccc(F)cc2)o1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23834", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)n2nc(C)c(C(=O)Nc3ccccc3F)c2n1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69170", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1cnnc1[C@H]1CCCN1C(=O)c1c(O)cc(Cl)cc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167421", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)CCC(=O)NCCNS(C)(=O)=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42673", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)n2cc(CN3CCN(c4cccc(Cl)c4)CC3)nc2n1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212618", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](Oc1ccccc1C#N)C(=O)NCC1CCCCC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7157", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](CCl)CSc1ccnc(N(C)C)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241106", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1nc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)sc1C by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121676", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCC[NH+](Cc1ncn(-c2ccccc2)n1)[C@@H]1CCCc2ccccc21 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130925", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NC(=O)C1CCN(C(=O)N[C@@H]2CCN(CC(F)(F)F)C2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47529", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(=O)Nc1ccc(S(=O)(=O)NCC2CC[NH+](Cc3ccccc3Cl)CC2)cc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108622", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C(=O)NCCc2nc3ccc(F)cc3[nH]2)ccc1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10754", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(C(=O)Nc2cc(F)c(F)cc2Cl)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166058", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+]1CCN(c2ccc(C(F)(F)F)cc2[N-]S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239244", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule C[C@H](CSC(C)(C)C)[NH2+][C@H]1CCCCC[C@@H]1CO with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242736", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C([C@H]1C[C@@H]1[N+](=O)[O-])N1CCC[C@@H]1c1cccc(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20259", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc([C@](C)([NH3+])c2ccc(C)c(F)c2)cn1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159250", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(=O)Nc1cc(NC(=O)C(=O)N(C)C[C@H](C)c2ccccc2)ccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80104", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CCc1nc(-c2ccc(F)cc2)no1)Oc1cccc(Cl)c1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72458", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(C(=O)N(C)Cc2cccc(F)c2)sc2nc3n(c(=O)c12)CCCCC3 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132534", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](C[NH3+])[C@@H](C)N(C)Cc1cccc(Br)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83071", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(NC(=O)c2cc(-c3ccc(F)cc3)oc2C)cc1C by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26123", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=[N+]([O-])c1cccc(-n2cc(-c3ccc(Br)cc3)cn2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72669", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(F)cc(C(=O)N2CC=C(c3c[nH]c4ccccc34)CC2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "191827", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCNC(=O)c1cnn2c1N[C@H](c1cccc(OC)c1)C[C@H]2C(F)(F)F by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102555", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Cc1ccsc1CNC(=O)C[NH+]1CCC[C@H](O)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62805", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCc1ccc(N2CCCCCC2)[nH+]c1)c1ccccc1Cl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189627", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=C(\\C#N)S(=O)(=O)c2ccc(C)cc2)cc1O by substituting a nitrile with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35255", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+]C[C@H](Cc1csc(C)n1)c1cccc(Cl)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86935", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@H]1CC[C@H](O)[C@H](Cc2cccc(O)c2)C1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117595", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)C[NH2+]Cc1c[nH]nc1-c1ccc(F)c(Br)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32952", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(CC(=O)N[C@H](CO)c2ccccc2F)cn1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209678", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H]1CC[C@@H](C(=O)[O-])O1)c1cc(Cl)ccc1Cl by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179253", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)[C@@H]1SCC(O)=Nc2c1cnn2Cc1ccccc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132793", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1242", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)NC(=O)[C@H]1CCCN(C(=O)c2cnn(-c3ccc(F)cc3)c2-n2cccc2)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162148", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(Cl)cc1NC(=O)C(=O)NC[C@H](c1ccc2c(c1)CCN2C)[NH+]1CCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112116", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc([C@H](C)[NH2+]Cc2ccc(C(=O)N3CCCCC3)cc2)cc1F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150845", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH2+]C1CCC(N(C)C/C(Cl)=C/Cl)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173227", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](Cc1nnc(SCc2cc3c(cc2Br)OCCO3)o1)c1ccccc1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41949", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]CC1CCC(C(=O)Nc2ccc(C(=O)[O-])cc2Br)CC1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29433", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(/C=c2/sc3nnc(-c4ccccc4Cl)n3c2=O)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57186", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(CCC1CCCC1)NC[C@]1(O)CCOc2ccccc21 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120635", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nc2cccnc2n1CCN1CCN(C(=O)Nc2cccc(F)c2)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103262", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)CC1=NN(C(=O)c2cccnc2)[C@@](O)(C(F)(F)F)C1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126237", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)OCCCNC(=O)NNC(=O)c1ccc(Cl)cc1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247233", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](c1ccc(F)cc1)N(C)C(=O)C[NH+](C)Cc1ccc(F)c(F)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21303", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN(C(=O)C[NH2+][C@@](C)(C(=O)[O-])C(F)(F)F)C1CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133557", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN(Cc1c(Cl)cccc1Cl)C(=O)[C@@H]([NH3+])C(C)C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230530", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cn1cc(/C=C/C(=O)Oc2cccc(F)c2)c(=O)n(C)c1=O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1ccccc1NC(=O)COc1ccc2ccccc2c1C=O by substituting a aldehyde with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141933", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCNC(=O)C1CCN(C(=O)Nc2ccc(NC(=O)Nc3ccccc3F)cc2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146720", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cn1c(CCNC(=O)COc2ccc(Cl)cc2)nc2ccccc21 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189386", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc2nc(C)cc(C(=O)N3CC[C@@H]3c3ccc(F)cc3)c2c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "202460", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1N1CC[NH+](CCCS(=O)(=O)c2ccc(F)cc2)CC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "42229", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC1=C(C(=O)OCCc2ccccc2)[C@H](c2ccc(Br)cc2)NC(=O)N1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49095", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule N#C[C@@H]1COCCN1Cc1cc(O)ccc1[N+](=O)[O-] by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222716", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCC1=NN=C2OC(N)=C(C#N)[C@@H](C3=C(C)NN(c4ccccc4)[C@@H]3Cl)[C@H]12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45837", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[NH+](CCCNC(=O)[C@@H](O)c1ccccc1)C1CCCCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27024", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](NC(=O)c1cc[nH+]cc1[O-])c1ccc(Cl)s1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68989", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CCCC[C@@H]1[NH2+]CCn1ccc2c(Cl)cccc21 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168019", "split": "OpenMolInst" } }, { "instruction": "Please substitute a aldehyde in the molecule COc1ccc(N2CCN(S(=O)(=O)c3ccccc3C=O)CC2)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45458", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(S(=O)(=O)N2C(=O)CC[C@@H]2c2nc(-c3ccc(Br)cc3)no2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16471", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CC[C@@H](c2nc(=O)c(-c3ccccc3F)c([O-])[nH]2)C1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96374", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)NC(=O)CCCC(=O)Nc1ccc(Br)cc1C(C)C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182126", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1ccc(OCC(=O)NC2CCCCC2)c(Br)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121808", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)/C=C/c1ccc(NC(=O)N2CCO[C@@H](c3ccccc3F)C2)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35578", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(C#CC(C)(C)[NH3+])c(F)cc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11041", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](c1nccs1)N(C)C(=O)c1coc(COc2ccccc2F)n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227423", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3203", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C[C@@H]1CN(C[C@](C)(O)c2ccccc2)CCO1)c1cccn[nH+]1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "9105", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C([O-])C1CCN(c2cc(C(F)(F)F)cc(Cl)n2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "18161", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1CCCN(C(=O)C2CC[NH+](Cc3cc(Br)ccc3O)CC2)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243317", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COC(=O)c1cc(C[NH+]2C[C@H](O)[C@H](O)C2)oc1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120471", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C#N)cc1[N-]S(=O)(=O)CCOC(C)C by replacing a nitrile by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234910", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(F)c(CNC(=O)c2ccnc(OCc3ccccc3)c2)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "17980", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1cccc([C@@H]2CC(c3cccc(OC)c3)=N[C@@H](c3ccc(Br)cc3)[NH2+]2)c1O by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115955", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1ccc(OC[C@H](O)C[NH+]2CCCC3(C2)OCCO3)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108767", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc2nc(SCC(=O)Nc3ccc(F)cc3)[nH]c2c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150746", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1OCC[C@H]1C(=O)Nc1cnn(-c2ccccc2Br)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103976", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCOC(=O)/C(C#N)=C\\c1cc(C)c(O)c(C)c1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10569", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCc1nn2c(N3CCC(O)CC3)c3c(nc2c1-c1cccs1)CCC3 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14534", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Fc1ccccc1[C@H]1Oc2ccccc2C2=Nc3nnnn3[C@@H](c3cccnc3)[C@H]21 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178632", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=C1C(=O)O[C@@H]2[C@H]1[C@H](O)C[C@]1(C)[C@@H](O)CC[C@H](C=O)[C@@H]21 by substituting a aldehyde with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131704", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NNC(=O)c1ccc2ccccc2c1)c1ccc(Cl)nc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "192744", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C([O-])CCCc1ccc2c(c1Br)C=CC2 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193859", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+]C[C@H](Cc1ccc(Cl)c(Cl)c1)c1ccccc1F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218336", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C1CCO[P@@](=O)(N(CCCl)CCCl)N1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163631", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule NC(=O)C(=O)N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142418", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1c(-c2ccc(Cl)cc2)nnc1S(=O)(=O)CC(=O)NC1CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140233", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Cc1nc2ccc(C(=O)c3ccccc3)cc2[nH]c1=O)C(=O)Nc1ccc(Br)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196632", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccccc1[N+](=O)[O-])c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132072", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccccc1NC(=O)/C(C#N)=C\\c1ccc(F)c(C)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175288", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCN(C(=O)CCNC(=O)C2CCCCC2)C[C@H]1O by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235450", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CN(C(=O)COC(=O)COc2ccc(Cl)cc2)C[C@@H](C)O1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234550", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(C1=C([O-])C(=O)N(CCCN2CCOCC2)[C@H]1c1ccc(Cl)cc1)c1ccco1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227959", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)NC1CCN(C(=O)Nc2ccc(Cl)c(F)c2)CC1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137737", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCCCCNC(=O)[C@H](C)Nc1ccc(Br)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146120", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC1=C(C(=O)Nc2ccc(C)cc2)[C@H](c2ccccc2F)NC(=O)N1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166267", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1noc(C)c1[C@H](C)NC(=O)c1cc(N)c(F)cc1F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205576", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@H](C(=O)C(F)(F)F)C1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23898", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCN(C)C(=O)N[C@H](C)c1ccc(Cl)s1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70522", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1953", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)NC(=O)C(=O)Nc1ccc(OC(F)(F)F)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104591", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NC(=O)C1(CNC(=O)c2cc3cc(F)ccc3[nH]2)CCOCC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124968", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc(OC)c2c1CN(C(=O)NCC1CCCCCCC1)C[C@@H]2O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234323", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(C)c(NC(=O)/C=C/c2c(C)nn(CC(C)C)c2Cl)cc1OC with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "130159", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCN[C@H](c1sccc1C)C(F)(F)C(F)F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81803", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@]([NH3+])(C[C@H]1CCCN(S(C)(=O)=O)C1)c1ccc(Cl)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111791", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@H](C(=O)[O-])N1C(=O)/C(=C/c2ccc(-c3ccc(C)cc3Br)o2)SC1=S by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128434", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](c1ccccc1F)N(C)C(=O)CN(C)C(=O)c1ccccc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89866", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(CNC(=S)Nc1ccccc1F)OC by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "164706", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1nc2sc([C@H](c3ccc(F)c(F)c3)[NH+]3CCC(C(N)=O)CC3)c(O)n2n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178489", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(Cl)cc1NCN1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2[C@@H]2C[C@H]12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175304", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C1C(=O)N(CN2CCC(O)(C(F)(F)F)CC2)c2ccccc21 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "29854", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]([NH2+]CCCNC(=O)c1ccc(F)cc1)c1ccc2ccccc2n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157716", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CS(=O)(=O)c1ccc(N[C@@H]2c3ccccc3C[C@H]2O)c([N+](=O)[O-])c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205716", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1cccc(NC(=O)/C(C#N)=C/c2ccc(N3CCOCC3)cc2)c1C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "233300", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#Cc1ccc(NC(=O)C(=O)NCCC2=CCCCC2)cc1C(F)(F)F by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246335", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)c1ccc(S(=O)(=O)NCC(=O)Nc2cccc(F)c2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158061", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)N[C@@H]2CC(=O)N(c3ccc(Cl)cc3)C2)cc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "147104", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCc1cc(C[C@@H](O)c2ccc(Cl)cn2)n(CC)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242884", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)n(-c2ccc(N(C)CCOc3ccccc3F)nn2)n1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153784", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1nnc2n1CCC2)c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181180", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](CNS(=O)(=O)c1c(F)cccc1F)Oc1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "185862", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2cnc(SCC(=O)Nc3ccc(F)c(F)c3)n2C)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "12371", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccccc1[C@@H]1CCN(S(=O)(=O)c2c(F)cccc2F)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178233", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cc(NC(=O)CSc2nnc(-c3ccc4ccccc4c3)o2)ccc1Cl by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134354", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccccc1NC(=O)[C@@H]1CCCN1C(=O)OCC(F)(F)F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80769", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2nc(Cl)c([C@H]3NC(=O)c4ccccc4N3)cc2c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "46856", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)NS(=O)(=O)c1ccc(OC(F)F)c(Cl)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54242", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCCc1cc(Br)ccc1F)NNC(=O)c1ccccc1O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36674", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1noc2nc(-c3ccco3)cc(C(=O)Nc3cccc(Br)c3)c12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96175", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Oc1cc(Cl)c2cn[nH]c2c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22156", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc2c(cc1OC)-c1c(c(C(=O)NCc3ccncc3)nn1-c1ccccc1F)C2 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44157", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccccc1SCC(=O)N[C@H]1CCc2c(O)cccc21 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224184", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1c(N)c(C(=O)COc2cccc(F)c2)c(=O)n(C)c1=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231836", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(-n2ncc3c(=O)[nH]cnc32)cc1)c1ccc(F)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186689", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1C[NH+]2CCCC[C@@H]2CN1C(=O)c1ccc(F)cc1N by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174044", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc(NC(=O)C2CCN(C(=O)CCc3ccccc3Cl)CC2)cn1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238306", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc(-c2nc(CN3CCN(S(=O)(=O)c4ccc(Cl)cc4)CC3)cs2)cc1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242266", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1nnc2sc(-c3ccc(CNC(=O)Cc4ccc(Cl)cc4)cc3)nn12 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "35967", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC(C)(C)O)C(=O)c1ccc(F)cc1C#CCCO by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177576", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cn(-c2ccccc2Cl)nc1NC(=O)C(=O)N[C@@H](CO)c1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239747", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ncc(-c2ccccn2)c(-c2ccc(CNC(=O)c3ccccc3F)cc2)n1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14536", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(NC(=O)c2ccccc2)cc1NC(=O)N[C@@H]1C=C[C@H](CO)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "227155", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[C@@H](C[NH3+])Nc1ccc([N+](=O)[O-])cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36584", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](Cc1cccs1)NC(=O)N[C@@H]1CCC[C@H](C(F)(F)F)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57618", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](C(=O)Nc1ccccc1)N1CC[NH+](Cc2cccc(C(F)(F)F)c2)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95106", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]1C[C@@H]1c1ccc(/C=C/C(=O)N(C)CC(=O)Nc2cccc(F)c2)o1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152579", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc(Cl)cc1C(=O)NC[C@@](O)(c1ccco1)C1CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51674", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(NS(=O)(=O)c2ccc(/C=C/c3onc(C)c3[N+](=O)[O-])cc2)cc1Cl by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119048", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@H](C)C[NH2+]C[C@H](O)c1cnn(C)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "31571", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CCCc1n[nH]c2c1[C@@]1(C(=O)Nc3cccc(C)c31)C(C#N)=C(N)O2 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131035", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOC[C@H]1CCN(C(=O)COc2ccccc2Cl)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148836", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)N2CCCC[C@H]2C)c(F)c1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5041", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1nnc(C[NH+](C)[C@H]2CCN(c3sccc3C#N)C2=O)n1C by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166763", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(C)c1ccc(/C=C2/SC(=S)N(c3ccccc3F)C2=O)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190853", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@](O)(CO)CNc1ncc(Cl)cc1F by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220667", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCN(CC(C)(C)O)C(=O)[C@]1(CC)CCC[NH2+]C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96333", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule CC(=O)c1ccnc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186336", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(O)nc(SCC(=O)Nc2ccccc2-c2ccccc2)n1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180441", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](O)CNC(=O)/C=C1/CC(=O)N=C([O-])N1 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62245", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccccc1C(=O)NC[C@H]1Cc2cccc(F)c2O1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28319", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CCOc1cc(/C=N/NC(N)=S)c(Br)c(Br)c1O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6696", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C[NH+]2C[C@@H](C)[C@H]2c2ccccc2)cc(Cl)c1OCC(N)=O by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "21533", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Cl)ccc1NC(=O)CN1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "168635", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule Oc1cccc([C@H]2CN(Cc3cc(F)c(F)cc3F)CCO2)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224303", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cccc(S(=O)(=O)[C@H](C)C(=O)Nc2cc(F)ccc2F)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49946", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC[C@@H](Oc1cccc(C)c1)C(=O)NNC(=O)Cc1ccc(Cl)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159968", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CC(C)[NH+]1C[C@H](C)[C@@H](N[C@@H](C)CO)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26737", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(Cc1ccccc1Cl)C(=O)C[C@H](NC(N)=O)c1ccccc1C by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138957", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C1C(=O)N(CN2CCOCC2)c2ccc([N+](=O)[O-])cc21 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237127", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[S@](=O)c1ccc(CNC(=O)[C@@H]2C[C@@H]2c2c(F)cccc2F)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28144", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCOc1ccc([C@@H]([NH2+]C)c2ccc(C)s2)c(Br)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167892", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[C@](O)(CCN1CCOCC1)c1ccc(OC)cc1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15789", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NC(=O)c1ccc(Cl)cc1)Nc1ccc(Cl)cn1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176876", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)c1ccc(C(=O)Nc2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104700", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1N1C[C@](O)(c2cccs2)[N+]2=C1CCCCC2 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160061", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)c1c(-c2ccco2)csc1NC(=O)Cn1ncc(Cl)c(Cl)c1=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36184", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=S1(=O)C[C@H]2N=C(Nc3cccc(C(F)(F)F)c3)S[C@H]2C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156375", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1NC(=O)N(c2ccc(Br)cc2)C(=O)/C1=C/c1ccc(Cl)s1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208712", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc2[nH+]c(CNCc3ccc(Cl)nc3)cn12 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226036", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN1CCO[C@H](C(=O)c2cc(Cl)cnc2N)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221222", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule NC1=NC(=O)[C@@](Cc2c(F)cccc2Cl)(c2ccccc2)N1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228074", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule O=C(CCc1ncc(-c2ccc(F)cc2)o1)N[C@H]1c2ccccc2C[C@H]1O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193007", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1C[C@@H](C)CN(C(=O)Cn2c(SCC(=O)Nc3cccc(F)c3)nc3ccccc32)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161640", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Cc1ccc(F)cc1F)OCc1nc2ccccc2[nH]1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197277", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)c1ccc2c(c1)[C@H]([NH2+]C[C@H](O)C[NH+](C)C)CCC2 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131917", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C([C@@H](O)c1ccccc1)N1CCC(OCc2ccc(F)cc2)CC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "246729", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[S@](=O)[C@H]1CCC[C@H](NC(=O)N[C@@H](C)CO)C1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110263", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@@](C)([C@@H](O)CCC1CC1)[NH+](C)C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "157280", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccc(F)c(C(F)(F)F)c1)c1ccc(=O)n(Cc2ccccc2)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48722", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC[C@@H]1CC[C@@H](C(=O)[O-])O1)c1cccc(O)c1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75598", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cn1cnc(S(=O)(=O)N2CCC[C@H](c3ncc[nH]3)C2)c1Cl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27633", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CS(=O)(=O)CCN(c1ncnc2ccc(F)cc12)C1CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213807", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Nc1cc(Cl)c(Cl)cc1-n1cccn1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228379", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(C[C@H](O)c1cc(Cl)cc(Cl)c1)NNc1cccc(Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "177808", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Cl)ccc1/C([O-])=N/S(=O)(=O)c1ccc(C#N)c(C(F)(F)F)c1 by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203137", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC(C)[C@@H](C#N)N1CCN(C(=O)[C@@H]2CCCN2C(=O)Cc2ccccc2)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119644", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#CCn1cc(/C=C2\\C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152705", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccccc1F)S(=O)(=O)Cc1nccn1C(F)F by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131318", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH+](CCO)CCn1c(=O)oc2cccnc21 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247519", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCC[C@H](C)CS(=O)(=O)N[C@H]1CCN(c2c(F)cccc2F)C1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241524", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C)S(=O)(=O)Oc1ccc(Cl)c2cccnc12 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106051", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule Cc1nnc(N/C(=N/O)c2cccc([N+](=O)[O-])c2)s1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176555", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C(COc1ccc(Cl)cc1I)N/N=C/c1cccc([N+](=O)[O-])c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206522", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc(/C=C2\\Oc3c(ccc(O)c3CN3CCN(c4ccccc4)CC3)C2=O)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128584", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NC[C@H]1CCCO1)[C@@H]1CCN(c2ccc(Cl)cc2Cl)C1=O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151223", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(CCC(=O)Nc2ccc(OC(F)F)cc2)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "116567", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(Cc1ccc(Cl)c(Cl)c1)Cc1cc(=O)n2ccccc2[nH+]1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77239", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)n1cnnc1[S@@](=O)Cc1ccc(Cl)cc1Cl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "92199", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C=CCOc1ccc(/C=C2\\SC(=S)N(NC(=O)c3ccccc3Br)C2=O)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52172", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cccc2c1OC[C@H](NC(=O)c1ccc(OCC(F)F)nc1)C2 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66875", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cncc(C(=O)N(Cc2c(F)cccc2F)C2CCCC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107539", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CNc1cc(CN2C[C@@H](C)CC2=O)ccc1[N+](=O)[O-] by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47947", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1noc(NC(=O)C[C@H](C)c2ccc(F)cc2)n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2738", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "324", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H]1CCn1nc(C)c(Cl)c1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27968", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CS(=O)(=O)CCOCCNc1ncc(Cl)cc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58083", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(=O)N[C@@H](C(=O)N[C@H]1CCSc2c(F)cccc21)C1CCCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207283", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1=C2[C@H](c3ccccc3F)CC(=O)N[C@@H]2N(c2ccc([O-])nn2)N1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228793", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH+]1CCCC[C@H]1C(=O)N1CCN(c2cccc(Cl)n2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "103038", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Cc1cc(Cl)c2c(c1)OCCO2)NCCc1ccc(Br)s1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218947", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(C2=NO[C@@H](C(=O)Nc3ccc(C(F)(F)F)cc3)C2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242656", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]([NH3+])c1nc2ccc(Cl)cc2n1Cc1ccccc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13620", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cc([C@@H]2C3=C(Nc4c2c(=O)[nH]c(=O)n4C)c2ccccc2C3=O)ccc1O by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83185", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Cl)c1nc2ccccc2[nH]1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230089", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC[C@@](C)(C#N)[C@H](O)c1cccc(Cl)c1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53956", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC(C)C)c1c(C#N)c(=O)n(C)c(=O)n1C by replacing a nitrile by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105312", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1ccccc1CN1CCCC1=O)N[C@@H]1CCCC[C@H]1CO by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48874", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#C/C(=C\\[C@H]1C=NN=C1c1ccc(F)cc1)C(=O)Nc1ccc(Cl)cc1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93503", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@@H]1CCC[C@H](NC(=O)CSc2nc(N)c(C#N)cc2C#N)[C@@H]1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141365", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1cc(N)c(Cl)cc1C(=O)OCC(=O)NC1CC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32585", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1occc1-c1nnc(SCC(=O)Nc2cccc(I)c2)n1C by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33446", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CN(Cc1ccc(F)cc1)S(=O)(=O)c1cc(Cl)ccc1Cl)N1CCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104448", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NNS(=O)(=O)c1ccc(O)c(C(=O)[O-])c1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198674", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1csc(CCCCNC(=O)C(=O)Nc2ccc(F)cc2F)n1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134688", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(Cc1cccs1)NC[C@@]1(O)CCSC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47394", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C(NCc1ccccc1CN1CCOCC1)N[C@@H]1CCCC[C@@H]1CO by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235465", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCn1c(SCC(=O)NC(=O)NCc2ccccc2)nnc1-c1ccc(Cl)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165676", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc2sc(N(CCN3CCOCC3)C(=O)c3cccc(Cl)c3)nc2c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244233", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Fc1ccc2[nH]c([C@@H]3CCC[NH+]3Cc3c[nH+]cn3C3CCCCC3)nc2c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38918", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccc(C[S@](=O)c2ccc(Cl)cc2)cc1)c1ccccc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107338", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Nn1c(Cc2ccccc2)nnc1SCC(=O)Nc1c(Cl)cccc1Cl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "163809", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C/N=c1\\scc(-c2cc3ccccc3o2)n1/N=C/c1cccc(O)c1O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "172270", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CSc1ccc2ccccc2n1)Nc1cc(Cl)cc(Cl)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210768", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Cc1c[nH]c2ccccc12)Nc1cc(Cl)cc(Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "52100", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C(=N\\OC(=O)c1cc(F)ccc1F)c1ccncc1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28137", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@H](C(=O)c1csc(-c2cccs2)n1)c1ccccn1 by substituting a nitrile with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129260", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C/N=C1\\NC(=O)[C@@H](CC(=O)Nc2cccc(Cl)c2Cl)S1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "13851", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C([O-])C[C@@H](Br)C(=O)c1ccc2c(c1)CCC2 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146379", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](SCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)[C@@H](C)O by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24722", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cccc(-c2ccc(O)c([N+](=O)[O-])c2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60089", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule COCCOC(=O)/C(C#N)=C\\c1ccc(Cl)cc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73752", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC(C)(O)CC[NH2+][C@@H]1CCCc2sccc21 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209540", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](CC#N)Sc1ccccc1NC(=O)N(C)Cc1ncnn1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120107", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH2+]Cc1ncoc1-c1ccc(Br)cc1F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136154", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C1C[C@H](NS(=O)(=O)N2CCCC2)CN1Cc1ccccc1Cl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166598", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COC(=O)c1ccc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2C)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44861", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)n1cc(Br)cc1C(=O)NCCC(=O)NC1CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86019", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)C[NH+]1CCC(NC(=O)N[C@H]2CCSc3ccc(Cl)cc32)CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "61592", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(NCc1nnc2n1CCCCC2)C(=O)Nc1ccc(F)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132013", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CCNC(=O)[C@H]1C[C@@H]1c1ccc(F)cc1)N[C@@H]1CCS(=O)(=O)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115142", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(-c2ccc(=O)n(CC3CCN(C(=O)c4ccccc4F)CC3)n2)cc1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8249", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)(CNC(=O)c1cccc(F)n1)c1ccncc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "249388", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(NC(=O)c1ccc(I)cc1)c1ccccc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118379", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NCCOc1ccccc1)C1=Cc2cc(F)ccc2OC1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150679", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)N1CCC[C@@H](C[S@@](=O)c2cc(Cl)ncn2)C1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95341", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)[C@H]1CCC([O-])=C(C(=O)C(F)(F)F)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212237", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[NH2+][C@@H](c1cc(C)cc(C)c1)c1ccc(Cl)cn1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212915", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CCCN(C(=O)Nc2cccc(OCCF)c2)[C@H]1CO with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62907", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc(S(=O)(=O)Oc2cccc(Cl)c2Cl)cn1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82152", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCNC(=O)C[S@@](=O)Cc1nc(-c2cccc(Cl)c2)oc1C with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44427", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(COc1ccc2nccnc2c1)Nc1ccccc1Cl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "158561", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C(=O)Nc2c3c(nn2-c2cccc(Cl)c2)C[S@@](=O)C3)c1 by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "222749", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(C)OC(=O)NC[C@H]1CCC[NH+]1CC(=O)Nc1sccc1C#N by substituting a nitrile with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86581", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1cc(Cl)cc(C[NH2+]Cc2cccc(Cn3cncn3)c2)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126091", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(C(=O)NCc2ccc(C(F)(F)F)cc2)cc1F by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75740", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule [NH3+]C[C@@H]1CCC[C@H]1Nc1cc[nH+]cc1Cl with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48370", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](c1cccc(F)c1)N1C[C@H](C)C[C@@H]([NH3+])C1 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "152066", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CC[C@H](CCO)CNC(=O)[C@H]1CCCC[NH2+]1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244362", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(NC(=O)C(=O)N[C@H](C)c2ccccc2Cl)n(C)n1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70319", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Nc1ccc(Cl)nc1C(=O)OCc1nc(-c2ccsc2)no1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "134251", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](NC(=O)c1cncc(Br)c1)c1ccc(-c2ccccc2)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104771", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)N[C@@H](C(=O)NC[C@](C)(O)c1ccsc1)C1CCCC1 by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174114", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)N1CCC[C@@H](C(=O)[C@H](C#N)c2nc3ccccc3o2)C1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226359", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCC[C@H](CCNC(=O)NC(CO)CO)C1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90658", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C=CCNS(=O)(=O)c1ccc(C(=O)N(C)Cc2cccc(Cl)c2Cl)cc1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69731", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CS(=O)(=O)N1CCC(CNS(=O)(=O)c2ccc(Cl)cc2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69178", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)NC(=O)Cn1ncc2c3ccccc3n(Cc3ccccc3F)c2c1=O by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27532", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1c(-c2ccc(Cl)cc2)c(=O)oc2cc(OCCN3CCOCC3)ccc12 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86108", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@H](C(=O)NC[C@@H](CCO)c1ccccc1)c1ccc2ccccc2c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34095", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H]1CCCN(C(=O)c2ccc(S(=O)(=O)NCCCO)cc2)C1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112996", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CSCc1cc(F)ccc1CNC(=O)C1CCN(C(=O)C2CC2)CC1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218910", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H](CNC(=O)CC1(O)CCCC1)c1ccsc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154255", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1cc(C[NH2+][C@@H]2CCc3c(Br)cccc32)ccc1O by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142119", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NC(=O)[C@@H]1CN(C(=O)N[C@H]2CCN(c3c(F)cccc3F)C2)CCO1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175783", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1c(C(=O)NCc2ccc(Cl)cc2)cc2sccc21 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7649", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)CNS(=O)(=O)Nc1ccccc1C(F)(F)F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239906", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(COc1ccccc1Cl)Nc1ccc(C(=O)NCc2ccco2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102830", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc2cn[nH]c2cc1NC(=O)C(=O)N[C@H]1CCCc2ccc(F)cc21 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77814", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C1O[C@@H](CC(=O)N2CC=C(c3ccc(Cl)cc3)CC2)c2ccccc21 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124099", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(CSC1=NCCS1)Nc1ccc(C(F)(F)F)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "206299", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(NC(=O)Nc2ccc(F)cc2F)n(Cc2ccccc2)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "131222", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1S(=O)(=O)Nc1ccc2c(c1)CCC(=O)N2C by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162453", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCCCO by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26582", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]1CN(C(=O)c2ccn(-c3ccc(Cl)c(Cl)c3)n2)C[C@@H](c2ccccc2)O1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95722", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CSc1nnc2c(n1)[nH]c1ccc(F)cc12)N1CCN(c2ccccc2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "211349", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(C(=O)OC(C)(C)C)C1CC[NH+](Cc2cnn(-c3ccc(F)cc3)c2)CC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123418", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3264", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc([C@@H]2CCCN2C(=O)c2ccc([N+](=O)[O-])cc2F)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119352", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule N#C[C@@H]1CCCCN1Cc1cc(Cl)ccc1[N+](=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154427", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCOc1ccc(S(=O)(=O)N2CCC[C@@H]2c2ccc(Cl)cc2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "183711", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc([N+](=O)[O-])cc1OCC(=O)Nc1cc(Cl)ccc1F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107759", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)CC(=O)N[C@@H](C)c1ccc(Cl)s1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "57914", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc2c(c1)[C@H](O)[C@H](N1CC[NH+](C)[C@@H](C)C1)C2 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98688", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCNC(=O)CCn1ncc2c(Cl)cccc21 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "153815", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1c(C[NH2+]C2CC2)cnn1-c1cccc(Cl)c1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "167253", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nc(CC[NH+]2CCC(Oc3ccc(Cl)cc3)CC2)cs1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112959", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[C@@H](O)Cc1nc2ccccc2[nH]1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "120369", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOC(=O)c1cc2n(n1)C[C@](C)(C(=O)NCc1ccc(F)cc1)N(c1ccc(C)cc1C)C2=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123826", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(C)c(NC(=O)[C@@H](C)N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241337", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1C[C@H]1C(=O)Nc1ccc(F)cc1C(=O)N[C@H]1CCC[C@H]1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184435", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule COc1cccc2sc(NCC(=O)c3ccc([N+](=O)[O-])cc3)nc12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81173", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCS(=O)(=O)c1c(S(=O)(=O)CC)c2c3ccccc3ccn2c1C(=O)c1ccc(Cl)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "199782", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cccc(NC(=O)N2CCC(N3CCO[C@@H](C)C3)CC2)c1Cl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187439", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(CCc1ccccc1)C(=O)NCc1ccccc1Cl with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "175446", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N#CC1=C2CCCN2c2ccc(F)cc2S1(=O)=O with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "219609", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Sc1nnc2ccc(C(F)(F)F)cn12)C(=O)Nc1cccc(Cl)c1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212471", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCn1cc(NC(=O)NCC#Cc2cccc(C(F)(F)F)c2)cn1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141078", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule O=C(N[C@H](Cc1ccccc1)C1CC1)N1CCC[C@@H]1C[NH+]1CCC[C@@H]1CO with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181306", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO[C@H]1CCCN(C(=O)c2ccc(-n3ccnc3)c([N+](=O)[O-])c2)C1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82009", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1ccc(C(C)C)cc1S(=O)(=O)N1CC[C@@H](c2cc3nc(C)cc(O)n3n2)C1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49990", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule OCC/N=C1/CCCc2c1[nH]c1ccccc21 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "190584", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(NC(=O)c2scnc2C2CC2)ccc1Br by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64224", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@H](C)NC(=O)Cn1cnc2onc(-c3ccc(Cl)cc3)c2c1=O by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197345", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)c1cccc(NC(=O)Cn2nc3c(Oc4ccc(F)cc4)nccn3c2=O)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148419", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule O=C1C[C@@H](Cc2ccc(Br)cc2)C(=O)N1c1ccc([N+](=O)[O-])cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "205135", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H](NC(=O)C1(c2cccc(C(F)(F)F)c2)CC1)c1nc[nH]n1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41206", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C1OC(c2cccc(I)c2)=N/C1=C\\c1ccc([N+](=O)[O-])cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60252", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@@H]([NH3+])[C@@H](c1cccs1)N(C)CC(C)(C)O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110710", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCCNC(=O)c1cc(S(=O)(=O)N(C)c2ccc(F)cc2)ccc1Cl by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83426", "split": "OpenMolInst" } }, { "instruction": "Please substitute a thiol in the molecule C=CC(=O)N(C(=O)C=C)[C@H](CS)C(=O)[O-] by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225140", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1/C(=C/c2ccc(Cl)c(Cl)c2)C([O-])=NC(=S)N1c1ccccc1F by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239718", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H](O)c1ccn(Cc2ccc(Cl)cc2Cl)c1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "44642", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1C(=O)N(C)Cc1[nH+]ccn1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "236531", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc([C@H]2OCCC[C@H]2CCl)c(C)s1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22182", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1CCC[NH+](CCNC(=O)c2cc(Cl)c[nH]2)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8963", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)(C)c1csc(C[C@@H](C[NH3+])c2cccc(Cl)c2)n1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "62831", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule CCC1(C(=O)NC2CCC(O)CC2)CCCC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5404", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC1=C(C(=O)Nc2ccc(C(=O)NCc3ccc(F)cc3)c(Cl)c2)SCCO1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182098", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCC[NH2+][C@H](c1ccncc1)c1ccc(Cl)cc1F by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51340", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1CNc1nc(Cl)ncc1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "72937", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "1390", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ncc(Cl)c(C(=O)NCc2[nH+]ccn2CCc2ccccc2)n1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135548", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])N(Cc2ccc(Br)cc2)C[C@@H]2CCCO2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162854", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COC(=O)c1cc2n(n1)C[C@@](C)(C(=O)NC1CCCCCC1)N(c1ccc(F)cc1C)C2=O by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169634", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule N#CCSc1nnc(-c2cccc(S(=O)(=O)N3CCOCC3)c2)n1Cc1ccco1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "128082", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1CN(C(=O)[C@@H]2CC(=O)Nc3ccccc32)c2cc(Cl)ccc2O1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49604", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(CNC(=O)c1ccccc1I)NCCC1=CCCCC1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "55410", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=[N+]([O-])c1ccc(F)cc1C[NH+]1CCC(OCc2ccc(F)cc2)CC1 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155586", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1cc(C)cc(CCNC(=O)NC[C@H]2CCC[C@@H]2O)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187565", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3745", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(CNc1cc(C(F)(F)F)ccc1-n1cccn1)N1CCCCC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64259", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C(=O)[C@H](C)S(=O)(=O)Cc1c(Cl)cccc1Cl)c1ccccc1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37433", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[N+](CC)=C1Nc2ccccc2Oc2ccc(NC(=O)c3ccccc3F)cc21 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "101749", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(C(=O)c2ccccc2OCC[NH+](C)C)C[C@@H]1O by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16399", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=S(=O)(c1ccc(F)c(F)c1F)N1CCN(C/C=C/c2ccccc2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "108378", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[NH2+][C@]1(CO)CC[C@H](N2CC[C@H]([NH+](C)C)C2)C1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193603", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule FC(F)(F)c1cccc(Nc2nc(Cl)nc(N3CCOCC3)n2)c1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70426", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Clc1ccc(SCCn2cccn2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "91324", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@@H](O)[C@H](C)NC(=O)c2cccnc2C)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "166274", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc2nc(C[NH+]3CCC(OCc4ccccc4F)CC3)cn12 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "90921", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1c(-c2ccco2)nn(-c2cnccn2)c1N with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85069", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule C[NH+]1CCN(C(=O)C[NH+]2CCCCC[C@@H]2C[C@H](O)c2ccccc2)CC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140016", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC[C@@H]([NH2+]CCC[C@H]1CCCC[C@@H]1O)c1ccc2c(c1)CC(=O)N2C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165924", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1C[C@H](C)CN(C(=O)CCNS(=O)(=O)c2cccc(Br)c2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102958", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(NC(=O)c2cc(N3C(=O)[C@H]4[C@H]5CC[C@H](C5)[C@H]4C3=O)ccc2Cl)c(OC)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "197773", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C/C(=C/c1ccccc1OCc1ccc([N+](=O)[O-])cc1)C(=O)c1ccccc1 by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216358", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cl[C@@H](CC[C@H]1CCOC2(CCOCC2)C1)c1ccccc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218217", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CC[C@@H](C)n1ncc(C(=O)N2CCO[C@H](C#N)C2)c1C1CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170891", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(/C=N/N=C2\\NC(=O)[C@@H](Cc3cccc(Cl)c3)S2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162140", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ncnc2c1nc([C@@H](C)Cl)n2CCc1ccsc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "180341", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)CC(=O)N(Cc1cccc(F)c1)C[C@@H]1CC(c2cccc(F)c2)=NO1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "68316", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(c1ccnc(OC2CCC2)c1)N1CCOc2cc(F)ccc21 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "41737", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCC1C[NH+]([C@@H](CC)CC#N)C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122411", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)=C[C@]1(O)CCc2ccccc21 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95552", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCCC[C@H]1NC(=O)COC(=O)C1(O)CCCCC1 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138127", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(Nc1ccnn1C1CC[NH+](Cc2ccccc2OC(F)F)CC1)c1cccc(F)c1 by replacing a halo by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54820", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC[C@@H](C(=O)N1CCC[C@@H](O)C1)c1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20978", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCN(C(=O)c1ccc(Cl)cc1Cl)[C@@H]1CCS(=O)(=O)C1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15624", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(C)NC(=O)[C@H]1CSCN1C(=O)[C@H]1CCC[C@H](C(F)(F)F)C1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232782", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CN1CCO[C@@H]([C@H](NC(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)c2ccc(Cl)cc2)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141447", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Fc1ccc([C@@H]2C[NH2+]C[C@@H](c3ccccc3)O2)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34332", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@@H](CN4CCN(c5ccc(Cl)cc5)CC4)[C@H]3[C@@H]3O[C@@]132 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "58738", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](CO)NC(=O)Nc1cccc(NC(=O)c2ccccc2)c1 by replacing a hydroxyl by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "26248", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1ccc(Cl)cc1OC(=O)c1csc(C)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162215", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C[C@@H]1COCCN1Cc1ccc(-c2c(F)cccc2F)o1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154972", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(C(=O)NC[C@H](C)N2CCOCC2)c1F by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "221669", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC[C@H](C)NC(=O)Cc1cn(-c2ccccc2)nc1-c1ccc(F)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "235158", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1ccc(C)cc1NC(=O)N[C@H](CCCO)c1ccccc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "93475", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(C)C[C@H](CNC(=O)c1ccc(F)nc1)NC(=O)c1ccc(F)nc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135787", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1NC(=O)C[C@@H]1SC(NC[C@@H]2CCCO2)=NC1=O by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78528", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C=CCCC[C@@H](C)[NH+]1CCN(CC#N)CC1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "122979", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Cn1nc(-c2ccccc2F)ccc1=O by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "187964", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H]([NH2+]C1CCN(C(=O)NC2CCCCC2)CC1)c1ccccc1F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129087", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1cccc(S(=O)(=O)Nc2ccccc2-c2ccccc2)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38608", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCCc1cc(OC)cc(O)c1[C@@H]1[NH+]=NC=C1c1ccc2c(c1)OCCO2 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245317", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1ccc(C(=O)NC2(c3ccc(Br)cc3)CC2)cc1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48925", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC(C)(C)[S@@](=O)CCNC(=O)N[C@H](c1ccccc1F)C1CCCC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144650", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1cccc([N+](=O)[O-])c1)c1c[nH]c2ccc([N+](=O)[O-])cc12 by substituting a nitro with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169879", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1CCC[C@@H](NS(=O)(=O)c2ccc(Cl)nc2)[C@@H]1C by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "231739", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Clc1cccc(-n2nnnc2[C@H](c2ccccc2Cl)N2CCOCC2)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114639", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](C)Oc1ccc(NC(=O)C(=O)N[C@H](C)c2cccc(C#N)c2)cc1 by substituting a nitrile with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69037", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)NC[C@H](O)c2ccccc2F)c2ncccc2c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "195608", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]([NH2+]C[C@H]1C[C@@]12CCc1ccccc12)c1ccc(S(C)(=O)=O)c(F)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97877", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(Cl)c(C)cc1NC(=O)CCOc1ccccc1Cl by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78810", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(F)cc1S(=O)(=O)N(C1CC1)[C@@H](C)C(C)C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203292", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)NNC(=O)COc2cc(C)c(Cl)c(C)c2)cc1Br with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38545", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C/C(=N/[NH+]=C(\\N)S[C@@H]1CC(=O)N(c2cc(Cl)ccc2Cl)C1=O)c1cccs1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59136", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=C(Oc1ccc([N+](=O)[O-])cc1)c1cccc([N+](=O)[O-])c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "105908", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC[C@@H](NC(=O)Nc1ccc(C)nc1Cl)c1ccc(F)c(F)c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15285", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOC(=O)c1nn(-c2ccc(Cl)cc2)cc1C(C)=O by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28171", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1ncc([C@@H]2C(C#N)=C(N)OC3=C2C(=O)CC(C)(C)C3)c1C by substituting a nitrile with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "66446", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1ccc(NC(=O)CSc2nc3ccc([N+](=O)[O-])cc3s2)cc1C by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234997", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(CCCCCBr)C[C@H]1CCC[NH+]1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "49421", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H]1CN(C(=O)Cc2ccon2)c2cc(F)ccc2C(=O)N1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "27536", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=S(=O)(N1CCCCC1)N1CCC[C@H]1[C@@H]1CCCC[C@@H]1O by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "133045", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](c1ccc(Cl)cc1)[C@H](C)N(C)C(=O)C1CC1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "78316", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(N[C@H]1c2ccccc2C[C@H]1O)[C@@H]1C[C@H]1c1cccc2ccccc12 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "138495", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cccc(NC(=O)NCC2(c3c(F)cccc3Cl)CCOCC2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "94469", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#Cc1ccnc(N2CCN(C(=O)NCCCn3cncn3)CC2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179265", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule COc1cccc(C(=O)N[C@@](C)(C#N)CCc2ccccc2)c1F by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69043", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(c1ccc(Oc2ccccc2)o1)N1CCC(OCc2ccccc2F)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182534", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(-n2nnc(C(=O)NC3CCCC3)c2N)cc1F with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151285", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)n1cnnc1CNC(=O)c1ccc(SC(F)(F)F)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171120", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)Cc1ccc(S(=O)(=O)N2CCc3ccc(F)cc32)s1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "174720", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(NN1C(=O)/C(=C/C(Cl)=C/c2ccccc2)SC1=S)c1ccccc1O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146815", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@H]1C[C@H](NC(=O)c2cccc(F)c2)CN1c1ccccc1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "121595", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1ccc(O)cc1)c1cc2ccccc2cc1NC(=O)C1CC1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232786", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=c1[nH]cnc2cc(NCCOc3ccc(Cl)cc3)c([N+](=O)[O-])cc12 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "60938", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)(CNC(=O)CCC(F)(F)F)c1ccccc1F by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "63031", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(CCC1CCN(C(=O)CN2CCCC2=O)CC1)NCc1cccc(Cl)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "73834", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule OCc1cc(F)c(OC2CCCC2)c(F)c1 by substituting a halo with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38595", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[C@@](C)(NS(=O)(=O)c1ccc(F)c(Cl)c1)C(=O)[O-] with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "97532", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cc(F)ccc1NC(=O)C(=O)N[C@@H](C[S@@](C)=O)c1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210939", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1ccc(/C=C/S(=O)(=O)[N-]c2cc(Cl)ccn2)cc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210576", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CNC(=O)C(=O)Nc1cc(Br)ccc1N1CCOCC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117677", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CSc1nc(Cl)cc(N(C)C[C@@H]2CCCC[NH2+]2)n1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242748", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1[C@H](O)c1ncc[nH]1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "161118", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H]1CN(S(=O)(=O)c2ccc(NC(=O)COc3ccc(F)cc3Cl)cc2)C[C@@H](C)O1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107972", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule N#CC1(NC(=O)CN2C(=O)N[C@](Cc3ccccc3)(c3ccccc3)C2=O)CCCC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232436", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1ccc(SCCC(=O)Nc2nc3c(F)cccc3s2)cc1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "144805", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule COc1cccc(C[NH+]2CCC([C@@H](O)c3ccc(F)cc3)CC2)c1OC(C)C by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201315", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule N#C/C(=C\\C1=c2ccccc2=[NH+]C1)C(=O)N[C@H]1CCS(=O)(=O)C1 by replacing a nitrile by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "137109", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(N[C@@H]1CCCC[C@@H]1O)c1cc(N2CCCC2=O)ccc1Cl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "176508", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cccn2c(=O)cc(COc3ccc(NC(=O)c4ccc(F)cc4)cc3)nc12 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100429", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccccc1[C@@H](NC(=O)N[C@@H]1CCCC[C@@H]1CO)c1ccccn1 by substituting a hydroxyl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "22753", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COCCCn1cc(C(=O)Nc2ccc(Cl)cc2)c2nn(-c3ccccc3)c(=O)c-2c1 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112788", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC[C@@H](C)NC(=O)CN1CCN(C(=O)Nc2ccc(N3CCCCC3)c(Cl)c2)CC1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28289", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCC1CCN([C@H](C[NH3+])c2ccc(Br)c(C)c2)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "173781", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)c([C@H](C)[NH2+]Cc2cccc(Cl)c2)cc1F by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65454", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule N#C[C@H]1C(=N)C(C#N)(C#N)[C@@H](c2ccc(F)cc2)[C@H]2CSCC=C12 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "14544", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CCc1nn(C)c(OC)c1CNc1c(C#N)c(=O)n(C)c(=O)n1C with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "204570", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H]1CCCN(C(=O)Cn2c3ccc(F)cc3c3ncn(Cc4ccccc4Cl)c(=O)c32)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "34578", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nn(C)c2c1nc(N)n2-c1ccc(Br)cc1Cl with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "189048", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule N/C(=N/O)[C@H]1CN(CCN2CCOCC2)CCO1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89635", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1noc([C@@H](C)N[C@H](Cc2ccc(Cl)cc2)c2ccccc2)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "38961", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NC1C[C@@H]2CC[C@H](C1)[NH+]2C[C@@H]1CCCO1)c1cc(F)ccc1F by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114929", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H](OC(=O)C1CCC(C(N)=O)CC1)c1nc2cc(Cl)ccc2n1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113692", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O=C(Nc1nc[nH]n1)c1ccccc1O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "146038", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC(C)(C)c1cc[n+](C2=C([O-])C(=[OH+])N(Nc3ccccc3)C2=O)cc1 by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16711", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1ccc(Cn2cc(Br)cc([N+](=O)[O-])c2=O)nc1 by substituting a nitro with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218871", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)NNc2ccccc2)C1=O with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110431", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(NCc1ccsc1)N[C@H]1C[C@H]1c1cccc(Cl)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "59824", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccccc1C(=O)NNC(=O)Cc1ccc(F)cc1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64241", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC1(C)CCC[NH+]1CC(=O)N1CCO[C@@H](c2ccc(F)cc2)C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "82790", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule COc1ccc(C[C@@H](C)CNC(=O)c2ccc(O)c(Cl)c2)cc1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "50196", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@@H]2C2CCCCC2)c(Cl)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218847", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(C)cc(O)c1C=O by replacing a aldehyde by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "15106", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccccc1N1CCN(CC(=O)N(C)Cc2ccc(Cl)s2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "10597", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(-c2ccc(=O)n([C@@H](C)C(=O)Nc3c(F)c(F)cc(F)c3F)n2)cc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226805", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CS(=O)(=O)Cc1nc(CN2CCO[C@@H](C#N)C2)cs1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "140871", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)NC(=O)NCc1ccc(-n2cncn2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159046", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(c1ccccc1)C1CCN(C(=O)COc2ccc(Br)cc2F)CC1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19599", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CCc1nc(CS(=O)(=O)CC(F)(F)F)cs1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207354", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(CNC(=O)N[C@@H](CO)c2ccc(Cl)c(F)c2)cn1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123819", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cn(-c2ccccc2)nc1[C@@H](O)n1nnc2ccccc21 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160155", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule C[C@H]1CO[C@@H](CO)CN1Cc1cccc(OCCCC#N)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54869", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cccc(CS(=O)(=O)N2CCC(C(=O)Nc3cc(C(F)(F)F)ccc3Cl)CC2)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "179639", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule C[C@H]1CN(c2cc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)ncn2)C[C@@H](C)O1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "178897", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@@H](C[NH2+]Cc1c(Cl)cccc1N1CC[NH+](C)CC1)C[NH+]1CCCC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142286", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3299", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C1OC(c2ccc([N+](=O)[O-])cc2)=N/C1=C\\c1ccc([N+](=O)[O-])cc1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "244271", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CC(C)(C)c1ccc([C@H]2Nc3ccccc3C(=O)N2CC(F)(F)F)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "64774", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)N(C)c1ccc(F)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "234849", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1c(Cl)cccc1N1C(N)=C(C#N)[C@@H](c2ccccc2)C2=C1CCCC2=O by replacing a nitrile by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209407", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule N#C/C(C(=O)N/N=C/c1cccc(O)c1)=C1\\CCc2ccccc21 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "247552", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1nc2cc(NC(=O)CCNC(=O)c3ccccc3Cl)ccc2o1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "184906", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCN1c2cc(Cl)c(Cl)cc2NC(=O)C[C@H]1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162611", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COC(=O)c1cc(O)n(-c2cc(Cl)cc(Cl)c2)n1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171049", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)c2cc(-c3ccc(Br)cc3)n[nH]2)cc1OC by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141028", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule CN(C(=O)CSc1ccc(C#N)cc1)[C@H]1CCc2ccccc2C1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "154716", "split": "OpenMolInst" } }, { "instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)CNC1=NC(=O)[C@@H](C)N=[NH+]1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28577", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](CNC(=O)NCCc1cc(F)ccc1F)N1CCOCC1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45941", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1cc(Cl)nc(NNC(=O)c2ccc(F)c(F)c2)c1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "56405", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)N[C@H](CO)c2ccc(Cl)c(F)c2)cc1C(N)=O with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "113263", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule Cc1cc(N[C@@H](C)[C@H](C)CO)nc(-c2ccccn2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4389", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(-c2csc(NC(=O)c3cncc(Br)c3)n2)cc1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11254", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCc1c(NC(=O)N2CC[C@@H](C)[C@H](O)C2)noc1-c1ccc(Cl)s1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118741", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCCNC(=O)N(CC)Cc1ccc(Cl)c(Cl)c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148273", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COCc1cccc(C(=O)N(C)CC(=O)Nc2ccc(Cl)c(Cl)c2)c1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "213363", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[NH+](Cc1ccccc1)C[C@H](O)Cn1cnc2cc(F)c(F)cc21 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19721", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(-c2nc(C(=O)Nc3ccccc3OC)nn2-c2ccc(Cl)cc2)cc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145350", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H]1CN(c2ncnc3cccc(F)c23)C[C@H](c2ccc(F)cc2)O1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "117448", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C=CCOc1cc(Br)c(C(=O)NN)cc1OCC by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "212022", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H]1CCc2c(sc3nc(CCN(C)CCC#N)nc(N)c23)C1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112849", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=S(=O)(CC[C@@H]1CCCO1)N1CCc2cc(F)ccc2C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "224668", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccc(NC(=O)N2CCn3cccc3[C@H]2c2ccccc2F)cc1C by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "145097", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C[NH+]2C[C@@H](C(=O)[O-])[C@@H](C)C2)ccc1Br by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "99318", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCC[C@H](C)Nc1ccc(C#N)c(C(F)(F)F)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "37736", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cccc2[nH]c([C@](C)(N)C(F)(F)F)nc12 by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125724", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Oc1ccc(Cl)cc1CNc1ccccc1 by substituting a hydroxyl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "126502", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COC(=O)c1ccc(N2CCCC2)c(NC(=O)Cc2ccc(Cl)cc2)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "182226", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCCN(C1C[NH2+]C1)S(=O)(=O)c1cc(C)c(Br)s1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186749", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CO[C@@H](C(=O)N[C@H](CO)C(C)C)c1ccccc1 by substituting a hydroxyl with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "228409", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc2nc(N3CC(C(=O)Nc4cccc(C(F)(F)F)c4)C3)sc2c1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "136121", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCCCCCn1ccc([C@H](O)C(C)C)c1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125641", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC[C@@H](C)C[C@@]1(C#N)CCC(C)(C)C1=O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "200188", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)[C@@H](C)Oc1ccc(Cl)c2ccccc12 by replacing a halo by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "67112", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN1C(=O)c2ccc(Cl)cc2N[C@@H]1c1ccc(F)cc1F by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "123962", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#C[C@@H](NC(=O)c1ccoc1)C1CCCCC1 with halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "107108", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)C[C@H](C)c2ccccc2F)c(C(N)=O)cc1F with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16855", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H]1CCN(C(=O)c2cc3cc(F)ccc3o2)C[C@H]1O by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "171042", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)CS[C@H]2[NH+]=c3cc[nH+]cc3=[NH+]2)cc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "141357", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(Cn1cc(S(=O)(=O)Cc2ccc(Cl)cc2)c2ccccc21)N1CCCCCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "98928", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCN(Cc1nc2cc(Cl)ccc2c(=O)[nH]1)C(=O)c1cc(C)no1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "165657", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(c1ccccc1I)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203499", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(NCc2cn(C)nc2-c2cccnc2)ccc1F with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "160335", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@@H](CNC(=O)C1CC[NH+](C)CC1)Oc1ccc(Cl)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "124368", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC[NH+]1CCC[C@@H]1CN(Cc1cc2cccc(C)c2[nH]c1=O)C(=O)Nc1cccc(Cl)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11517", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(CC)C(=O)c1ccccc1NC(=O)c1cccc(Cl)c1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "87314", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CN(CC1CC[NH+](C)CC1)C(=O)c1ccc(F)cc1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "81819", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1noc(CNC(=O)Cc2csc(NC(=O)c3ccc(F)cc3)n2)n1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47711", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)N[C@H]1c2ccccc2C[C@@H]1O with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "88113", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "958", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4051", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule CCOC(=O)Cc1[nH]nc2c1[C@H](c1ccoc1)C(C#N)=C(N)O2 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "20066", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "604", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CN(C)C(=O)c1cccc(NCc2ncc(-c3ccc(Cl)cc3)o2)c1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "181412", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(=O)c1csc(NC(=O)Cc2cccc(OCC#N)c2)n1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "242015", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule O=C1CCCC2=C1[C@@H](c1ccc3c(c1)OCO3)c1c(nn(-c3ccccc3)c1O)N2 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96224", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CCC[C@H]1CN(Cc2cccc(O)c2)CCO1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "47055", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1cc(N(C)c2cccc(C#N)c2)[nH+]cc1N with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "80346", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Br[C@H](Cc1nc2ccccc2o1)[C@H]1CCOC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "142548", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule Cc1nonc1Cn1ccnc1C#N with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "83973", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cc(/C=C2/C(=N)N3C(c4ccccc4)=CSC3=NC2=O)c(C)n1-c1ccc(F)c(Cl)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225286", "split": "OpenMolInst" } }, { "instruction": "Replace a hydroxyl in the molecule CC[C@@H]1CC[C@@](C[NH3+])([C@H](O)c2ccccc2)C1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3791", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCCCSc1ccc(N)c(F)c1 by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129944", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1cc(/C=C2/C(=O)N(c3ccc(C)c(Cl)c3)C(=O)N=C2[O-])c2ccccc21 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "129152", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CCN(Cc1ccoc1)C(=O)c1ncccc1C(F)(F)F by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "248995", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cc1cc(C)c(CNC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)c(=O)[nH]1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "156632", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@@H](NC1COC1)c1c(F)cccc1F with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "119359", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3200", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule COc1cccc(/C=c2/s/c(=C\\[N+](=O)[O-])n(C)c2=O)c1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "155132", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1cc(N2CCC[C@H](SCc3nccn3C(F)F)C2=O)cn1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "100368", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](Cc1ccc(Cl)cc1)N(C)C(=O)[C@H]1CCOc2ccccc21 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162274", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C[C@H]1CN(CN2C(=O)C(=C(C#N)C#N)c3ccccc32)C[C@@H](C)O1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148127", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(F)cc(CNC(=O)c2cc(C)nc3c2c(=O)[nH]n3C)c1 by replacing a halo by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "75566", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@H](c1ccccn1)N(C)C(=O)Nc1cccnc1Cl by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118860", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule C/C(=C\\C(=O)N(CC#N)C1CCCC1)C(C)(C)C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106747", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(F)ccc1CCNC(=O)CCn1cc([N+](=O)[O-])nc1C by substituting a halo with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "148335", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule CN(C[C@H](O)C1CC1)C(=O)[C@@H]1CSCN1C(=O)c1ccc(Cl)cc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "53907", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(CNC(=O)NC1(c2cccc(Cl)c2)CC1)NS(C)(=O)=O by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "23807", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule O=C(COC(=O)c1nc(Cl)ccc1Cl)NC(=O)NC1CCCCC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "150704", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cl[C@@H](Cc1ccc2ccccc2n1)c1ccoc1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "226541", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1ccc(Cl)c(O[C@@H](C)C(=O)NN)c1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51405", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC1(C)O[C@@H]2O[C@@H](C(=O)Nc3ccc(F)cc3F)[C@@H]3OC(C)(C)O[C@H]3[C@H]2O1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "106517", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)N1C(=O)C[C@@H](NC(=O)c2cc(Br)c[nH]2)C1=O by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5919", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C/C(=C/C(=O)NC(C)(C)C)NNC(=O)COc1cc(C)c(Cl)c(C)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132788", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cccc(N2CC[NH+](CCCNc3cnccc3C#N)CC2)c1 by replacing a nitrile by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65029", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COCCn1nc(C)c(Nc2nc(Cl)c(C(=O)OC)s2)c1C with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223474", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NC(=O)[C@]1([NH3+])CCC[C@H]1CCSc1ccc(Br)cc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "159885", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H]1C[C@@H](C)CN(C(=O)CN2CCN(C(=O)CCc3ccccc3Br)CC2)C1 with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "6197", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(-c2noc(Cc3ccc(Cl)nc3)n2)ccn1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "170717", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(CNc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C by replacing a nitro by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "196983", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C#CC[C@@H](OC(=O)[C@H]1C[C@@H]1c1ccccc1F)C1CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "112410", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CC(C)[C@H](NC(=O)Nc1ccc(NC(=O)c2ccco2)c(Cl)c1)c1ccccc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11393", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule CN(C)C(=O)[C@H](Sc1nc2ccccc2n1C(F)F)c1ccccc1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "45413", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CNC(=O)[C@@H](NC(=O)[C@@H]1CCC[NH+](C)C1)c1ccc(F)c(F)c1 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "223765", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CCC[C@](C#N)([C@]2(O)CCCCC2(C)C)C1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "114178", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1c(NC(=O)C2=Cc3cc(F)ccc3OC2)cnn1-c1ccccc1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "115526", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cccc(C(=O)Nc3cccc(C(F)(F)F)c3)c2)c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "16303", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule CCOc1cc(C#N)cc(Cl)c1OC(=O)[C@@H]1Cc2ccccc2O1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "238543", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1ccccc1COC(=O)c1c(Cl)nc2sccn12 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "110044", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CNc1nc(-c2cnn(C)c2C)nc(COC)c1Br by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "96498", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H](O)c1ccn(Cc2cccc3cccnc23)c1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69676", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C([O-])c1cc(-c2ccccn2)nc2ccc(F)cc12 by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "95790", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule [NH3+]C[C@H]1CCCN1c1cnc2cc([N+](=O)[O-])ccc2n1 by replacing a nitro by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "65118", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCn1nc(C)c(NC(=O)N(C)Cc2ccccc2F)c1C by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "36672", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1C[C@@H](NCCc2nc3cc(F)ccc3n2C)C[NH+]1C by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "4474", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule Cn1nccc1CNC(=O)CCl with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71404", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule COC(=O)COc1cc(-c2ccc(C)cc2)nc2ccc([N+](=O)[O-])cc12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "11400", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule CC1(C[NH2+]C/C=C/c2ccc(C#N)cc2)COC1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70051", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule Cc1cc(C(=O)NCc2cc(-c3ccncc3)n(C)n2)ccc1[N+](=O)[O-] by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "89177", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CCC[NH+](C)C[C@H]1CCN(C(=O)c2ccc(Cl)c(Cl)c2)C1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209475", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule Cc1cc(NC(=O)[C@@H]2CSc3nc(C(C)(C)C)cc(=O)n3C2)ccc1Br by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "186574", "split": "OpenMolInst" } }, { "instruction": "Substitute a hydroxyl in the molecule COc1ccccc1[C@@H](CNC(=O)N1CCC[C@H](CO)C1)[NH+]1CCCC1 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "201886", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCc1c[nH]c2ccc(Cl)cc12)Nc1ccccc1 by replacing a halo by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70271", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC(=O)[C@H](c1ccc(F)cc1)N(C)CC[C@H]1CCCC[NH+]1C by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "162815", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CCNc1ccc([N+](=O)[O-])c(-c2ccc(OCC)cc2)n1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "232579", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCOc1cccc2ccccc12)N(CCO)C1CC1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210433", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1ccc(C(=O)N/N=C(/C)CC(N)=O)cc1I with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "28895", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc([C@@H](O)CNCc2ccc(C(F)(F)F)cc2)cc1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "111586", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(c1cnccn1)N1C[C@@H]2c3ccccc3OC[C@]2(CO)C1 by replacing a hydroxyl by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220227", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(Nc1ccccc1)c1nc(-n2cnnc2)ccc1Br with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118963", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule CC1(C)CN([C@@H]2CCN(c3ccccc3Cl)C2=O)CC[S@@]1=O with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "2372", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(C1=C([O-])C(=O)N(CC[NH+]2CCCC2)[C@@H]1c1cccc(Cl)c1)c1ccc2c(c1)OCO2 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "24192", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C[C@@H](NC(=S)NNC(=O)Cc1c(F)cccc1Cl)c1ccccc1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "54851", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)Cn1ncc(C(=O)N(C)[C@H]2CC[NH+](C)C[C@@H]2C)c1C(F)F by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "203238", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule C[C@H](NC(=O)CCc1ncc(-c2c(F)cccc2F)o1)C1CC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "76572", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule COCC[C@H](C)C(=O)Nc1sc(-c2ccccc2)cc1C#N with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207772", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule C[C@@H](C#N)CNC(=O)C1C(C)(C)C1(C)C with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "125962", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule CN1C(=O)C(=Cc2ccc(-c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)o2)C(=O)N(C)C1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "245296", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COC1CCN(C(=O)c2cc3ccc(OC(F)(F)F)cc3[nH]2)CC1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "210221", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCN(C)C(=O)C[NH+]1CCC[C@@H](CCc2ccccc2C(F)(F)F)C1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "48639", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(COc1ccc2c(=O)c(Oc3ccc(Cl)cc3)coc2c1)NCc1ccc2c(c1)OCO2 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "51736", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC1(C)CCCN(C(=O)c2ccc(C#N)cn2)c2ccccc21 by replacing a nitrile by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "218467", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COCCn1c(C(=O)N[C@H](CO)c2ccccc2F)cc2ccccc21 by replacing a hydroxyl by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "39587", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCc1nnc2ccc(C(F)(F)F)cn12)C1CCN(C(=O)c2cccs2)CC1 by replacing a halo by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "230392", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule C[S@](=O)c1ccc(C[NH2+][C@H]2CCN(c3cccc(Cl)c3)C2)cc1 with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "5942", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cccc(NC(=O)CCc2ncc(-c3ccc(Cl)cc3Cl)o2)c1 by substituting a halo with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237475", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(COc1ccccc1)Nc1nnc(-c2ccc(Br)o2)o1 by substituting a halo with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "239269", "split": "OpenMolInst" } }, { "instruction": "Replace a nitro in the molecule CC[NH2+]CC(=O)Nc1ccc([N+](=O)[O-])cc1OC by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "169167", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule COc1cc(F)c([C@H](C)[NH2+]Cc2ccc(-n3ccnc3)nc2)cc1OC with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "104856", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(N2CCN(CC(=O)NC3CC3)CC2)nc(-c2ccc([N+](=O)[O-])cc2)n1 by replacing a nitro by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "243503", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CC[NH+]1CCN([C@@H](C)C(=O)Nc2sc3c(c2C#N)CCCCC3)CC1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "77971", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[C@@H](C(=O)N1CC[C@@H](Oc2ccc(C(F)(F)F)cn2)C1)n1cncn1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7273", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule Cc1cccc(NC(=O)C[NH+](C)Cc2cc(Br)ccc2O)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "208865", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(-n2nccc2C(F)(F)F)cc1)c1csc(-c2ccco2)n1 by nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "19763", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1cc(C[NH2+]C2CC2)ccc1OC1CCCC1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "85142", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule C=CCC[C@@H]([NH2+]C[C@@]1(O)CCc2ccccc21)C1CC1 by replacing a hydroxyl by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "70653", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitro in the molecule O=C(C1=C([O-])C(=O)N(CCN2CCOCC2)[C@H]1c1ccc([N+](=O)[O-])cc1)c1cccs1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "207654", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule COc1ccccc1O[C@H](C)CNS(=O)(=O)c1c[nH]c2nccc(Cl)c12 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "71747", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1CNC(=O)[C@@H](C)OCc1ccccc1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "225124", "split": "OpenMolInst" } }, { "instruction": "Please replace a nitrile in the molecule N#Cc1c(NC(=O)C2(c3ccccc3)CCCC2)sc2c1CCCC2 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "79733", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule NNC(=O)c1cc(-c2ccc(O)cc2)nc2ccccc12 by substituting a hydroxyl with nitro.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "237540", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC[C@@H]1S/C(=N\\N=C\\c2cccc(OS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2)NC1=O by substituting a halo with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "118373", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1C[C@@H](C)C[NH+](Cc2csc(NC(=O)c3cc(F)cc(F)c3)n2)C1 by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "151206", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule COc1cc(CN2CCC([NH+]3CCC[C@@H]3C)CC2)cc([N+](=O)[O-])c1O by replacing a hydroxyl by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "8154", "split": "OpenMolInst" } }, { "instruction": "Please replace a hydroxyl in the molecule O[C@@]1(C[NH+]2CCCC2)CCCN(Cc2ccncc2)C1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "135079", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=C(NCC1CCN(c2cc[nH+]cc2)CC1)c1cccnc1C(F)(F)F with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "102567", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitro in the molecule CC(C)CNC(=O)/C=C/c1cccc([N+](=O)[O-])c1 with thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "149217", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule Cc1cncc(NC(=O)NCc2ccccc2OCC(F)(F)F)c1 by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "217835", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule C[C@H]1CC[NH+](Cc2cccc(Br)c2)C[C@@H]1O by hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "69295", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule CN(c1nc(C(F)F)nc2ccccc12)C1CCS(=O)CC1 by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "198251", "split": "OpenMolInst" } }, { "instruction": "Replace a halo in the molecule C[NH+]1CCN(C(C)(C)C(=O)NCc2cccc(C(F)(F)F)c2)CC1 by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "193313", "split": "OpenMolInst" } }, { "instruction": "Please substitute a nitrile in the molecule Cc1nnc(N2CCC(NC(=O)C3CC3)CC2)c(C#N)c1C by carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "7823", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule O=S1(=O)N=C(SCc2cccc(F)c2)Nc2ccccc21 with aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "33501", "split": "OpenMolInst" } }, { "instruction": "Substitute a nitrile in the molecule CN(C)S(=O)(=O)c1ccc(N2CCO[C@@H](C#N)C2)c(N)c1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "40986", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NCCN1C(=O)CCC1=O)c1ncccc1C(F)(F)F by replacing a halo by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "132856", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CCOc1ccc([C@@H](C)[NH2+][C@H]2CCO[C@]3(CCSC3)C2)cc1[N+](=O)[O-] by replacing a nitro by nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "30782", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule Cc1cc(C)c2c(N)c(-c3cc(=O)oc4ccc(O)cc34)sc2n1 by replacing a hydroxyl by halo.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "32685", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule O=C(NNC(=O)[C@H]1CCCO1)N[C@H]1CCCc2ccc(F)cc21 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "216727", "split": "OpenMolInst" } }, { "instruction": "Modify the molecule CC(C)(O)C(=O)N/N=C/c1cn(Cc2cccc(F)c2)c2ccccc12 by substituting a halo with nitrile.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "209939", "split": "OpenMolInst" } }, { "instruction": "Please substitute a halo in the molecule COc1ccc(Nc2ncnc3c2cnn3-c2ccc(F)cc2)cc1OC by thiol.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "86793", "split": "OpenMolInst" } }, { "instruction": "Substitute a halo in the molecule NNC(=O)Cc1cccc(-c2nc3cc(Cl)ccc3o2)c1 with hydroxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "241953", "split": "OpenMolInst" } }, { "instruction": "Please replace a halo in the molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 with carboxyl.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "3843", "split": "OpenMolInst" } }, { "instruction": "Replace a nitrile in the molecule Cc1c(NC(=O)c2ccc(C#N)cn2)cccc1N1CCOC1=O by aldehyde.", "input": "", "output": "", "metadata": { "task": "open_generation", "sub_task": "sub_component", "index": "220838", "split": "OpenMolInst" } } ]