[
{
"instruction": "Substitute a nitro in the molecule O=C(NCc1cc(=O)[nH]c2ccccc12)c1cc(F)ccc1[N+](=O)[O-] with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208406",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)c(NC2=[NH+]CCCCC2)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146239",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc([C@@H](C)[NH2+]Cc2ccc(F)cc2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](O)CC[NH+](C)Cc1ccn(Cc2ccccc2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](C)NC(=O)c1ccc(CNC(=O)c2ccnc(Cl)c2)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111333",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1ccc(Cn2ccc(C[NH2+]C3CC3)n2)cc1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6833",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C(=O)N(Cc2ccccc2Br)S1(=O)=O by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81689",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CN(CC#N)C(=O)c1sc(-c2ccccc2)cc1OCC(=O)N1CCCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116978",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1noc(C)c1CCC(=O)N[C@@H](c1ccc(Cl)cc1)C(F)(F)F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59518",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[NH2+][C@@H]1[C@@H](CN(CCO)C(C)C)CCC1(C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74057",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](O)C[C@H](C)CNC(=O)COc1cc(Cl)cc(Cl)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128075",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3607",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(C(=O)N(Cc2c(F)cccc2Cl)c2ccccn2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129681",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(c1c(F)cccc1F)N(c1cccc(Cl)c1)[C@H]1C=CS(=O)(=O)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178677",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[S@](=O)c1ccc(CNC(=O)Cc2ccccc2F)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108250",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccccc1Br)N1CCC[C@H](c2nnc3ccccn23)C1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+]CCC(=O)Nc1sccc1C#N)c1ccc(F)cc1F by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246780",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CSC1=[NH+]CCN1)Nc1cccc(Cl)c1N1CCCCC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90996",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1c(Cl)cccc1NC(=O)CNC(=O)CSc1nccn1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203002",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CN2CCCC[C@@H]2CN1S(=O)(=O)CCCCO with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54480",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cccc(F)c1)n2CC with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137690",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CNC(=O)c1ccc(NC(=O)N[C@@H]2CCN(C(=O)C(C)C)C2)c(Cl)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33636",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1nc(C[C@@H]2CCC[NH+](Cc3cccc(O)c3)C2)no1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212371",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1CCN(Cc2nccn2C(F)F)CC[NH+]1Cc1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176920",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C/C(=C/C(=O)N1CCN(Cc2ccco2)CC1)c1ccc(F)cc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49060",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H](O)[C@@H]1CCC[NH+](CC(=O)N(C)CC(=O)NC2CC2)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190324",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Nc1cccnc1SCc1cc(=O)c(O)co1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197359",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCCOc1cc(Br)ccc1OC with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189672",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC[NH2+]CC[C@](C)(O)c1cccc(OCC)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81585",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CSc1ccc2nnc(-c3cccc(F)c3)n2n1)Nc1ccccc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143881",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CSc1ccc(Cl)cc1)Nc1cccc(C(=O)Nc2ccc(C(=O)[O-])cc2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240762",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc([C@H](O)CNC(=O)C2CCCC2)cc1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146639",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c(Cl)cccc1N[C@H](C)c1nc(C(C)C)no1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125801",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1sc(NC(=O)CCCCNC(N)=O)nc1-c1ccc(F)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125828",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(OCc2ccncc2Cl)c(CCl)n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48154",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(Cc2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1cc(C(=O)N2CCC[C@@H](C)C2)c(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1CN(c2nc3ccccc3c3nnc(-c4cccs4)n23)CCN1C(=O)c1ccc(F)cc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10492",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C)cc1NS(=O)(=O)c1cccc(C#N)c1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234004",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1cccc(NC(=O)CCNC(=O)Nc2ccccc2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137017",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1[nH]cnc1C[NH+]1CC[C@@](O)(C2CCOCC2)[C@H](C)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175139",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COCc1cc(N)nc(-c2cncc(Br)c2)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85956",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC(C)[NH+](CCCNc1c(C#N)c(=O)n(C)c(=O)n1C)C(C)C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138944",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1n[nH]c2cc(NC(=O)c3c(O)cc(F)cc3F)ccc12 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51453",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CN1CCN(S(=O)(=O)c2cccc(F)c2)CC1)Nc1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c(C)c1CN(C)Cc1c2cccn(CC(=O)N(C)C)c-2nc1C(F)(F)F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23549",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(Cc1cnn(C)c1)C(=O)CNc1cc2c(cc1Cl)NC(=O)CO2 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142445",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCC[C@@H](C)O)C2 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11326",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule FC(F)(F)c1cccc([C@H]([NH2+]CCn2ccnc2)C2CC2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156554",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C)n(C[C@H](O)COCc2ccccc2)n1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74830",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(-c2nnc(NC(=O)c3ccc(Cl)cc3)o2)nn1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107391",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1ccc(-n2c(C)cc(C(=O)Cn3cnc(C#N)n3)c2C)cc1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC1CCC(C[NH3+])([C@H](O)c2c(F)cccc2F)CC1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10335",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1ccc([N+](=O)[O-])c(N2CCN(S(=O)(=O)Cc3ccon3)CC2)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37064",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C([O-])c1nc(/N=C/c2cccc([N+](=O)[O-])c2)n[nH]1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61642",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(-c2c[nH]c(-c3ccc(O)cc3)[nH+]2)cc1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108504",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1oc(-c2ccccc2)nc1CC(=O)N[C@H]1CCc2c(O)cccc21 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74517",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1ccc(-c2nnc3n2N=C(c2ccccc2)CS3)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172007",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@H](Cc1ccc(F)cc1F)c1c(Cl)cccc1Cl by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168287",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1cc(C(=O)N2CCN([C@H](C#N)c3ccccc3)CC2)nn1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47800",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C(=O)Nc1c(C(=O)Nc2ccccc2F)oc2cccnc12 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230110",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+][C@H]1C[C@@H]1C1CCCCC1)c1ccc(N2CCC(O)CC2)cc1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1C(=O)NCCC(=O)NC1(c2cccc(Cl)c2)CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45486",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(C[NH+]1CCC(c2nnc(C(F)(F)F)o2)CC1)NC[C@@H]1CCCO1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189070",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(CC(=O)C[NH+](C)C)cc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34979",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1[nH]c(CNc2cccc(Cl)c2)nc2scc(-c3ccccc3)c12 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74536",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(OCc2nnc(S)n2C)cc1 by replacing a thiol by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204679",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=c1c2ccccc2[nH]c2ccc(O)cc12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164377",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccc(F)c1)N1CCCN(c2nc3ccccc3c3nnc(-c4cccs4)n23)CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154996",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nccc1CN1C(=O)C[C@@H](Cc2ccc(F)cc2)C1=O by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27873",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCCC[C@](C)(O)C1(C)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178134",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)Nc1ccccc1C[NH+]1CCC[C@H](C(=O)Nc2ccc(Cl)cn2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](C)c1ccccc1Oc1cccc(F)c1C(=O)[O-] by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77160",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@@H]1CN(C(=O)OC(C)(C)C)CCN1c1cnc2cc([N+](=O)[O-])ccc2n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221962",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN/C([O-])=C(\\C#N)C(=O)CCn1nnc2ccccc2c1=O by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43309",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C2CCN(S(=O)(=O)c3cc(-c4noc(C)n4)cs3)CC2)c(Cl)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NNc1ccc(F)cc1)c1cc2ccc(Br)cc2[nH]1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19458",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCc1c(C)nc(SCC(=O)Nc2sc3c(c2C#N)CCC3)c(C#N)c1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(Cc1ccccc1N1CCCC1)S(=O)(=O)c1ccccc1Br with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73529",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cccc(C(=O)N2CCC[C@H]2CC(=O)c2cccs2)c1O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146302",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COCCN1C[C@H](C(=O)N[C@@H](C)c2ccc(C#N)cc2)CC1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49279",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CN(O)[C@H]1CC[C@H](c2ccc(C(C)(C)C)cc2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1c(F)cccc1Cl)C(=O)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71931",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCCN1C(=O)C(O)=C(C(C)=O)[C@H]1c1ccc(O)c(OC)c1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188094",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(S(=O)(=O)/N=c2\\[nH]cc(C)s2)cc1Br with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208458",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)Oc1cccc(-c2ccc(F)c(C[NH3+])c2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C(F)(F)F)cc1NC(=O)C(C)(C(F)(F)F)C(F)(F)F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28062",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCC(CC)CN(CC)C(=O)c1cccc(OC)c1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125869",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@]1(C(=O)NCc2cccnc2-n2cncn2)CC1(Cl)Cl by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24140",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccnc(-c2ccc(NCc3ccc(F)cc3F)cc2)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21937",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cccc(C[S@@](=O)CC(=O)N(C)Cc2ccc(F)cc2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76782",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1onc(-c2c(F)cccc2Cl)c1C(=O)N1CCN(CC(=O)NC2CC2)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213731",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H]1OCC[C@@H]1C(=O)NC[C@@H](c1ccccc1)C(C)(C)CO by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6299",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCC1CCC(C[NH3+])([C@@H](O)c2ccccc2F)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCCCC(=O)[C@H](C#N)c1nc(C)cc(C)n1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163419",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC(C)CN(CCC#N)C(=O)Cc1ccc(F)cc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161183",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)c1ccc(NC(=O)Cn2c(-c3cscn3)nc3ccccc32)cc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173490",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NCC(=O)N(C)C)cc1Cl by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140611",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccccc1-c1n[nH]c(-c2ccco2)n1 by substituting a nitro with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15481",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Nc2cc(C)c3ccc(O)cc3n2)cc1F by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138708",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)(C)OC(=O)C1CCC(NC(=O)[C@]2(C)CC2(Cl)Cl)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CNC(=O)Nc2ccc(C)c(F)c2)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138773",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CC1(C(=O)N2CC[C@@H](C(N)=O)c3ccccc32)CCCCC1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185035",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(I)ccc1NC(=O)COC(=O)CCc1ccccc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102601",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)C(C[C@@]1(c2ccccc2)CC1(Cl)Cl)=C(Cl)Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3512",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCN(CCCl)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142948",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1nnc(COc2ccc(C#N)cc2Cl)o1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139801",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)[C@H](C(=O)N[C@H](C)c1ccc(Cl)cc1)n1cnc2ccccc21 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8794",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[S@](=O)c1ccc(CNC(=O)c2cc(F)cc([N+](=O)[O-])c2N)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H]1CO[C@H](Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@H](O)[C@@H]1O by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198277",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CCc1ccc(C(=O)NC[C@@H]2CCCN(c3ncccn3)C2)cc1[N+](=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71162",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](NC(=O)C1CCC(C[NH3+])CC1)c1ccc(Br)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127592",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(c1ccc(Cl)cc1)c1ccc(C2OCCO2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249023",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]CCC1CC[NH+](Cc2ccc(F)cc2)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124869",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1ccc(OCC(=O)N2CCC[C@@H]2c2ccc(O)cc2)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCOc1ncccc1Cl)c1ccccc1C(F)(F)F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211576",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C2CC2)cc1)c1cc2ncccn2n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88832",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)NC(=O)C(=O)N1CCN(C(=O)c2ccc(Cl)cc2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64715",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)[n+]([O-])c1cc(Cl)ccc1[n+]2[O-] by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42759",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cn2c(=O)cc(COc3cccc(NC(=O)c4ccccc4F)c3)nc2s1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164719",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)Oc1ncc(C(=O)NC[C@@](C)(O)c2ccc(F)cc2)cc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85970",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCCn1ncc2c(NCc3ccc(F)cc3)ncnc21)c1cc(=O)c2ccccc2o1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113075",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#CCCN(Cc1ccco1)C(=O)[C@H]1Cc2cc(Cl)ccc2O1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)c1ccccc1Br by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126080",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#C/C(=C\\c1cccc([N+](=O)[O-])c1)C(=O)NCc1ccccc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134651",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CNC(=O)COc1ccc(C(F)(F)F)cc1)c1ccncc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248196",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCCc1ccc(C(F)(F)F)cc1)NCc1nnc2n1CCC2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61540",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](NC(=O)[C@H](C)CC(=O)c1ccccc1F)c1ccc(F)c(Cl)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1nnc(N(C)C[C@H]2CCC[NH+]2C)c(C#N)c1C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36452",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Br)cn1)c1cccc([N-]S(=O)(=O)c2ccc(F)c(Cl)c2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CS(=O)(=O)N1CCC[C@H](COc2ccc(CC#N)cc2)C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCc2c(c3cc(C(F)(F)F)ccc3n2CCc2ccccc2)C1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)N2CCc3ccc(O)cc3C2)s1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202083",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@H](Oc1ccccc1)C(=O)NNC(=O)c1sc2ccccc2c1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195741",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCN(Cc1cc(Br)ccc1[N+](=O)[O-])[C@@H]1CCS(=O)(=O)C1 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185723",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)Nc1ccc(Nc2nc3ccccc3nc2[N-]S(=O)(=O)c2cccc(Cl)c2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220937",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cc(NC(=O)CCc2ccccc2O)ccc1N1CC[NH+](C)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114241",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1ncccn1)C(=O)Nc1ccc(OC(F)F)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215751",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCc1noc(Cc2ccccc2)n1)c1ccccc1Br by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134806",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#Cc1cccc(S(=O)(=O)[N-]c2cccc(-c3nnc4n3CCCCC4)c2)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4244",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)NC1=C[C@@H]2N=CC=C2C=C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24906",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NCc2c(F)cccc2F)c(C)n1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247095",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC[C@H](c1nnnn1Cc1ccccc1)[NH+]1CCN(c2ccc(F)cc2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200396",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@H](NC(=O)[C@H]2N(C3CC3)C(=O)[C@H]3[C@@H](C(=O)Nc4ccc(Cl)cc4)[C@H]4C=C[C@]32O4)[C@@H]1C by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34352",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccccc1C[NH+]1CCC(c2cc(C(F)(F)F)n3ncnc3n2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37514",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccsc1[C@H]1C[C@H]1C(=O)NCCc1cccc([N+](=O)[O-])c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14823",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC(C)(C)C[NH2+]Cc1cc(C#N)cs1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188325",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOC(=O)C1=C(c2ccccc2)NC(=O)N[C@H]1c1cc(OCC)c(O)cc1Br by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169514",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc([C@@H](C)Cl)n(-c3cnn(C)c3)c2c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216291",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCc1nn2c(c1-c1ccccc1)NC(=O)[C@@H]2CC(=O)Nc1ccc(F)c(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145323",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H](c1ccccc1)c1ccccn1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CCCOc1ccccc1F)N[C@H]1c2ccccc2C[C@@H]1O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166490",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#C[C@@H](c1ccc(F)cc1)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211836",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(Br)ccc1NC(=O)C(=O)N[C@@H](C)CC(C)C by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180388",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)Oc1ccc(F)c(F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87529",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccc(C)c([C@@H](C)NC(=O)c2cccc([N+](=O)[O-])c2C)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171129",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)CCc2ncc(-c3c(F)cccc3F)o2)C[C@H](c2ccccc2)O1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99450",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC1CCC(C[NH3+])([C@@H](O)c2ccccc2Br)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177560",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(-c2ncco2)cc1NC(=O)Cc1c[nH]c2ccc(F)cc12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156682",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1cc([C@@H](C)NC(=O)N2CCC[C@@H]2[C@@H](C#N)c2ccccc2)c(C)o1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159835",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)C1(C(=O)N2CCNC(=O)[C@@H]2c2ccc(F)cc2)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228639",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2ccc(OCC)cc2)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226961",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(Br)c1CN1CCC([NH+]2CCCC2)CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42592",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)N1N=C2CCCC[C@@H]2[C@]1(O)C(F)(F)F with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25849",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N/C(=N\\OCc1ccc(Cl)c(Cl)c1)c1nonc1N with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190848",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1nc(CNS(=O)(=O)c2cccc(Cl)c2)cs1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3027",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccccc1OCC(=O)OCC(=O)NC1CC1 by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148699",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCC(F)(F)F)c1cc(-c2ccc(Cl)s2)on1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230027",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(Cc2c[nH]nc2C(C)(C)C)C[C@H](c2ccc(F)cc2)O1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193132",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1ccccc1C(=O)NC(=S)Nc1ccc(C)c([N+](=O)[O-])c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66519",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218511",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)Cn1ccc(=O)n(C)c1=O by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207251",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nc(C(=O)N[C@H](C)c2ccc(Cl)cc2Cl)n[nH]1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccc(NC(=O)c2cccnc2Cl)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48650",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCC1CCN(CC(F)(F)F)CC1)[C@H]1COc2ccccc2C1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247388",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCCO[C@@H]1C[C@H](NC(=O)c2occc2Br)C1(C)C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21440",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)C(=O)Nc2ccc3c(c2)C[NH+](C)C3)C[C@H]1O by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242908",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]1[NH2+]CC[C@@H]1C(=O)Nc1cc(F)ccc1C(=O)[O-] with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218536",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1cc2oc3c(c(=O)c2cc1C)[C@@]1(C(=O)N(C)c2ccccc21)N(CCO)C3=O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229339",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C/C(=C\\CNc1ncnc2c1ncn2[C@H]1O[C@@H](CO)[C@@H](O)[C@@H]1O)CO with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40580",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C=C(CC)C[C@H](O)[C@](C)(CC)N1CCOCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98271",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](NC(=O)[C@@H]1CCCO1)c1ccc(OC(F)(F)F)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52785",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CS(=O)(=O)N(CC(=O)NC[C@@H]1CCCO1)c1ccc(Cl)cc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2C[C@H](C)N(C(=O)CC3(O)CCCC3)C2)cc1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34556",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@H](c1ccc(Cl)cc1)c1ccccc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117838",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(CCC(F)(F)F)c1nc(C2CC2)ns1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63969",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C(F)F)c(C)c1CC(=O)N[C@H](c1nc(C2CC2)no1)C(C)C by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227101",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1nn(C)c(Cl)c1CNc1cccc(CC[NH+]2CCCC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75714",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule Cc1ncc(C(=O)[O-])cc1C#N with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23307",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cc2c(nc1SCC(=O)Nc1nonc1-n1cccc1)CCCC2 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105140",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1cc([N+](=O)[O-])ccc1NC(=S)NC(=O)c1ccc(OC(C)C)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151363",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@H](C)CN(C)c1cc(Br)ccc1C[NH2+]C(C)C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184050",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cn1cnn(CC(=O)NC[C@@H](O)c2ccc(Cl)s2)c1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192752",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@H](NCCS(=O)(=O)C(C)(C)C)c1ccccc1Br by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(-c2nn(C)c(=O)c3c2CCCC3)cc1S(=O)(=O)N1CCN(c2ccccc2F)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95582",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)c(NC(=O)c2cc3cnn(C(C)C)c3nc2C)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23667",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCc1ccnc(NCCn2cc([N+](=O)[O-])cn2)c1 by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@@H]([NH2+]Cc1ccc(-c2ccccc2C#N)cc1)c1cccs1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237552",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[C@H]1C(=O)N1CCN(C(=O)N[C@@H](c2ccc(F)cc2)C2CCC2)CC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(Cl)cc1N1C[C@@H](C(=O)N2CCSCC2)CC1=O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240149",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(F)cc(CNC(=O)N(C2CC2)[C@H](C)C(C)C)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149466",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCc1ccccc1-c1ccc(Cn2cccn2)cc1)c1ccc(=O)n(-c2ccc(F)cc2)n1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79629",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](c1ccccc1F)N(C)C(=O)c1cn(Cc2cccnc2)nn1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228161",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1ccc(C/[NH+]=C/c2c(CO)cnc(C)c2O)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C[NH2+][C@H](Cc1ccc(F)cc1)c1ccccc1Cl)[S@](C)=O by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCOc1cccc([C@H](O)C(C)(C)N2CCOCC2)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23662",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1ccccc1OC(=O)c1cc([N+](=O)[O-])ccc1Cl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52476",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1ccc(NCc2cccc(Cl)c2)c([N+](=O)[O-])c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NCCn1cnnc1C1CC1)c1ccccc1C(F)(F)F by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@@H](NCc1ccc(OC)c(C#N)c1)c1ccc(F)c(F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188195",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(S(=O)(=O)Nc2ccc3c(c2)C(=O)Nc2ccccc2O3)ccc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCN1C(=O)c2ccc(Cl)cc2N[C@@H]1c1ccc(C#N)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169743",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(Br)c(CC(=O)N2CCNC(=O)C2)cc1OC by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=S)c1[nH+]ccn1CC(=O)Nc1ccc(Br)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166520",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Brc1ccc(C[NH2+]Cc2nc3c(s2)CCC3)s1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135584",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(C(=O)NNC(=O)c2cc3c(C)nn(-c4ccccc4Cl)c3s2)c(C)o1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233696",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Cc1ccc(Cl)cc1)c1cccc(I)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189705",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cn1c(=O)c2cc(F)ccc2n2c(SCC(=O)Nc3ccc(F)cc3)nnc12 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65896",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]([NH3+])[C@@H](N1CCN2C(=O)NC[C@@H]2C1)C(F)(F)F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32355",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule [NH3+][C@H](CC1=c2cccc(O)c2=[NH+]C1)C(=O)[O-] by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127916",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)C(=O)Nc1c2c(nn1-c1cccc(Cl)c1)CSC2)c1ccccc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41743",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1csc(-c2cccc(Br)c2)n1)NC1CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C=CC[NH+]1CCC(N/C(NCc2cc(F)ccc2F)=[NH+]\\C)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175889",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](CC(=O)NCC1CCC1)Cc1ccc(C(F)(F)F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38109",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc([C@@H](C(=O)NC(C)(C)C)N(C(=O)c2csnn2)c2ccc(Cl)cc2)o1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CO)NCc1c[nH+]cn1C1CC1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68551",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc(S(=O)(=O)N2CC[C@H]3CCCC[C@@H]32)sc1Br by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(C[C@H]1CCCO1)N1CCN(C(=O)c2ccccc2O)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27993",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccc(S(=O)(=O)c2cc(NS(=O)(=O)c3ccccc3)cc(C)c2O)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46081",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1cc([N+](=O)[O-])ccc1NC(=O)NCN1C(=O)[C@H]2[C@H]3C=C[C@H](CC3)[C@H]2C1=O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196284",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@H]1NCCc2[nH]c[nH+]c21)N1Cc2cnn(Cc3ccc(F)cc3)c2C1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216128",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cccc(OCCNC(=O)Nc2ccc(OC)cc2Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67809",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=C1/SC(N2CCCC2)=NC1=O)c1ccc(Cl)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](CCCCl)[NH2+]C[C@H]1CCCc2ccccc21 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78767",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCOc1ccc(NC(=O)/C(C#N)=C/c2c(OC)ccc3ccccc23)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230207",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H](c1ccc(Cl)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2F)CC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C[C@H](Cl)c2ccccc2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CCc1ncc(-c2ccccc2F)o1)NNc1cccc(Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194855",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H](C)[C@H](NC(=O)[C@@H](C)Cl)C(=O)Nc1nnc(-c2ccccc2)s1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117198",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(C)cc(OCC(=O)Nc3ccc(OC(F)(F)F)cc3)nc2c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224405",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc2c1NC(=O)/C2=N\\NC(=O)c1ccccc1Cl by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175052",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)N1CCC(Oc2ccc(Cl)cc2C(=O)N2CCCCCCC2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206765",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](SC)C(=O)N[C@H](C)c1ccc(Cl)s1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159207",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1c(-c2ccccc2)cc2nc3ccccc3n2c1N with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201170",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@]1(c2ccc(OC(F)F)cc2)NC(=O)N(C[C@@H](O)c2cccc(F)c2)C1=O by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107569",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccc(/C=N\\NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)o2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231356",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](CO)[NH2+][C@@H](C)c1nc2ccc(Cl)cc2n1C by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19676",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](NCc1cnc(-c2cccnc2)s1)c1ccc(OC(F)F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236405",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)CC(=O)NCCc1ccc(S(=O)(=O)N2CCC(O)CC2)s1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179969",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(C[NH+]2CCCCC[C@@H]2C[C@@H](O)c2ccco2)o1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129574",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)c1cc2ccc(Cl)cc2[nH]1)[C@@H]1CCS(=O)(=O)C1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69294",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH3+])[C@H]1CCCCN1c1cc(Cl)c(Cl)cc1[N+](=O)[O-] by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1nc(-c2ccc(F)cn2)nc(NC)c1I with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH+](Cc1ccccc1Cl)Cn1nc(-c2ccncc2)n(C2CC2)c1=S by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58080",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "836",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1cccc(CSc2nnc(-c3ccccc3F)n2C2CC2)c1)N1CCOCC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173464",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccccc1NC(=O)CCC(F)(F)F)c1ccccc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191863",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1c2ccccc2C[C@@H]1C(=O)NCc1cccc(F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183473",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)c1cccc(NC(=O)NCCc2ccc(F)cc2)c1C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165267",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(N(CC(=O)Nc2ccc(Cl)cc2C)S(C)(=O)=O)cc1OC with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219203",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[S@](=O)[C@@H]1CCC[C@H](NC(=O)NCCC(F)(F)F)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217588",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)[C@H]1CN(C(=O)c2ccncc2F)CCC(=O)N1Cc1ccc(F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172259",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1nn(Cc2ccc(C(=O)N[C@H]3C[C@@H]3C)cc2)c(C)c1[N+](=O)[O-] by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239875",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CC[C@@H](OC(=O)c1cnn2cc(Br)cnc12)C1CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150343",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCO[C@@H](C)C(=O)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192532",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCOc1cccc(CC(=O)Nc2ccc(Cl)c(C#N)c2)c1 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76221",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1noc(C)c1Cc1ccc(C(=O)Nc2ccn(Cc3ccccc3F)n2)o1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243092",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=S1(=O)C[C@H](Cl)[C@H](NC(=S)NC2CCCCC2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114979",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@H]1CCC[C@@H](CC(=O)N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C#N)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117224",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(CN2C(=O)[C@]3(SCCN3C(=O)c3ccco3)c3cc(Cl)ccc32)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83986",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cc2cc(C(=O)N3CCC([C@@H](O)c4ccccc4)CC3)oc2cc1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239549",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(Cc1ccc(Cl)cc1Cl)C(=O)[C@H]1CCCCN1C(=O)OC(C)(C)C by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92133",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(N/N=C/c1ccc([N+](=O)[O-])cc1)/C(=C/c1ccccc1)CCO with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200878",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)N[C@H](c1nc(-c2ccncc2)no1)C(C)C by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20712",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)OCC[C@@H]1CCCC[NH+]1Cc1cnc(Cl)s1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132036",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)C1CCC(C(=O)N[C@@H](CC(F)(F)F)c2ccc(F)cc2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12260",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)Nc1ccc(CNc2ccc(C(F)(F)F)cn2)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169638",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(OCc2ccc(C#N)cc2F)c(OC)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157565",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[NH+]1CCC[C@@H](CNC(=O)N[C@@H](CO)c2ccc(Cl)cc2)C1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246251",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCNc1scc(C)[n+]1/N=C/c1cc(Br)c(O)c(Br)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111156",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)C(=O)N1CCC[C@H]1C(=O)[C@H](C#N)c1ccc(F)cn1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204502",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)CCOc1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113298",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C(=O)NCCN2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243372",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](C(=O)NC[C@H]1CCCO1)n1cc(Br)cn1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8878",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CC[NH2+][C@H](c1cccc(C(F)(F)F)c1)C1CC1)N1CCCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14647",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)[NH+](C)C[C@H]1CN(C(=O)c2ccccc2)C[C@@H]1c1cccc(F)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241441",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2cc(CNC(=O)[C@H](C)NS(=O)(=O)c3cccc(Cl)c3)ccc2c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccccc1/C([O-])=N/c1nnc(CC(=O)N/N=C/c2cc(Br)ccc2O)s1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOc1cc(C(=O)Nc2ccc(C)c(Cl)c2)ccc1OC with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CN(/N=C\\c2ncc(-c3ccc(Br)cc3)o2)C(=O)N1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(-c2noc([C@H](C)[NH+]3CC[C@H](C(N)=O)C3)n2)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59704",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)[C@H](c1ccc(OC)cc1)[C@@H]1C=C[C@@H](NC(=O)c2ccccc2Cl)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42253",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1916",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Br)ccc1N[C@H]1CCOC2(CCC2)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)/C(C#N)=C/c1c(-c2ccccc2)nc2ccccn12 by substituting a nitrile with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123135",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](CNC(=O)N[C@H](C)c1ccc(F)c(F)c1)C[NH+]1CCCC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175336",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)c1nnc2ccc(NCCc3ccccn3)nn12 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCn1c(SCC(=O)Nc2cc(Cl)ccc2Cl)nnc1-c1ccncc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109030",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nnnn1-c1ccc(C(=O)NCCc2cccc(F)c2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166755",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(COCc1ccccc1)Nc1cc(Br)cc(Cl)c1O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59171",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1CCCC[C@H]1NC(=O)CSc1ccc(Cl)cc1N by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216566",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1c(C)cc(/C=C(/C#N)C(=O)N2CCCC[C@@H]2C)c1C by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114307",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)[C@@H](C(=O)N1CCCN(CC(F)(F)F)CC1)c1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109424",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CCCCN1C(=O)[C@@H]1CCC(=O)N(C)[C@@H]1c1ccccc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213805",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)[C@@H]1CN(C(=O)[C@@H]2CCC[NH+]2Cc2ccc(F)cc2)CCO1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN1CCC[C@](O)(CN2CCN(c3nc(C)cc(C)n3)CC2)C1=O by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26801",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CO[C@@H](C(=O)N/N=C(\\C)c1ccc(O)cc1)c1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8604",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1CCC[NH+]1CC(=O)Nc1cccc(OC(F)F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67937",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@](O)(CC(=O)NC[C@@H]1COc2ccccc2O1)C(F)(F)F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cccc(=O)n1CCC(=O)N1CC[C@](C)(O)[C@H](C)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93137",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(N[C@@H]1CCCc2ccc(F)cc21)N1CCC[C@@H]1c1ccc[nH]1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197408",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1c(=O)[nH]c(=O)c2c1nc(N1CCN(Cc3ccccc3)CC1)n2Cc1ccc(Cl)c(Cl)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107017",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1ccn(-c2ccc(NCCc3cccc(O)c3)nn2)n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50287",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(c1ccco1)[C@@H]1[C@@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59679",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](CCn1cncn1)[NH2+][C@@H]1CCCN(CC(F)(F)F)C1=O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30656",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCC[C@H](C(=O)N[C@@H](C)c2cc(F)ccc2N2CCC(O)CC2)C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220301",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(-c2nc3ccc(Br)cc3c(=O)[nH]2)oc2ccccc12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H](C)N1CC[NH+](C)CC1)c1ccc(-c2ccc(F)cc2)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCCCOc1nc(Cl)nc(OCC)n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144482",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)NNC(=O)[C@@H]1CCCO1)c1ccc(Cl)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188089",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule ClCCc1nc2cc(Br)cnc2n1CC1CCCCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccncc1NC(=O)N1CC=C(c2ccccc2Cl)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149650",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Clc1ccc2[nH]c3c(N4CC[NH+](Cc5ccccc5)CC4)ncnc3c2c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14628",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc2[nH]cc(CC(=O)NCc3ccc(F)c(Cl)c3)c2c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43673",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH2+][C@@H](C)c1cc(F)ccc1-n1cc[nH+]c1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139452",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C(=O)NCCN(C)Cc1cc(F)cc(C(F)(F)F)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC(=O)N[C@@H]1CCCN(C(=O)c2cc3cccc(Cl)c3o2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223349",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Br)c([C@H](O)c2cc(C)cc(F)c2)cc1OC by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8117",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)NC(=O)COC(=O)[C@H](C)NC(=O)c1cccc(Cl)c1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214408",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCN(Cc1cccc(F)c1)C(=O)[C@H]1CCC(=O)O1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233676",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule COC(=O)[C@@H](CNC(=O)c1sccc1C#N)Oc1ccc(F)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127713",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C=C(C)COc1ccccc1NC(=O)c1ccc(Cl)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#C/C(C(=O)CCl)=C(/c1ccc(F)cc1)N1CCCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119835",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2177",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H](CCn1cncn1)[NH2+]C[C@H](O)c1ccccc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78097",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)c(NC(=O)NCCC[NH+]2CCC(C)CC2)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67500",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(C[NH+](Cc2c(F)cccc2N2CCCC2)C(C)(C)C)o1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1ccc2nc(N3CC[C@H](c4ccccc4)C3)ccc2c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215298",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(c1cc2c(cc1O)OCO2)N1CCC[C@@H]1c1ccco1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158968",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@]1(C(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)CCCc2ccccc21 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64049",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1C by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19340",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CNS(=O)(=O)c1ccc(NCC(C)(C)C[C@@H](C)O)nc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211820",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@@H]1CCN(C(=O)c2cc([N+](=O)[O-])cc(S(C)(=O)=O)c2)c2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123920",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(C(=O)N(C)CCS(C)(=O)=O)c(C)n1-c1cccc(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120559",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule [NH3+][C@H](C(=O)[O-])c1cc(F)c(Cl)c(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77269",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1ccccc1N1CCN(Cc2nnc(-c3ccccc3Br)o2)CC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H](c1ccc(F)cc1)N1CCOCC1)Nc1cn[nH]c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33644",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(Cc1ccccc1Br)C(=O)CN1CSCC1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221116",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1ccccc1CSC1=N[C@H]2[NH+]=c3ccccc3=C2N=N1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152192",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccc(OC(F)F)cc1)C(=O)Cc1nn(C)c(=O)c2ccccc12 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117654",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([C@@H](C)Nc2snc(C)c2C#N)c(C)s1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231860",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CSC[C@@H](CCO)[NH2+][C@@H]1CCc2[nH]c3ccccc3c2C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141238",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH2+][C@H](c1ccc(Br)o1)[C@H]1CCS(=O)(=O)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102004",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a thiol in the molecule C[NH+](Cc1cccc(C#N)c1)CC1(CS)CCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)CNC(=O)c2ccc(C)o2)cc1Cl by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45291",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a aldehyde in the molecule Cc1cc(O)c(CC=O)c(O)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135730",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)C1=C(C)N(Cc2ccco2)C(=O)/C1=C/c1ccc(Cl)c(Cl)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65800",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCC[C@H]1CN(C(=O)c2cc3cccc(Cl)c3o2)CCO1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208718",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(NC(=S)N2CCn3cccc3[C@@H]2c2ccccc2F)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173597",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCC(=O)Nc1sc(C(=O)Nc2cccc(Cl)c2)c(C)c1C(=O)OC by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(/C=C2\\SC(=O)NC2=O)ccc1OCc1ccccc1Cl by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43784",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule OCc1ccc(OC[C@@H]2C[C@H]3CC[C@@H]2C3)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146350",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COc1ccc(OC)c([C@@H]2c3c(nc(N4CCC(C)CC4)[nH]c3=O)NC(=O)[C@@H]2C#N)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81165",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(N(C)C(=O)C2=CCCCO2)cc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46393",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N[C@]2(C[C@H]3CC[C@@H]2C[C@@H]3C(=O)N2CC[C@]3(O)CCCC[C@@H]3C2)Oc2ccccc21 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201866",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCn1nnnc1-c1cccc(C(=O)N2CCN(Cc3ccccc3F)CC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133285",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OCC[NH+]1CCN(Cc2c[nH]nc2-c2c(F)cccc2F)CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230734",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(-n2nnnc2SCc2ccccc2Cl)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38734",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nc(CC(=O)N2CCCC2)cs1)c1ccc(Cl)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](CC(=O)Nc1cccc(Cl)c1)[NH2+]C[C@@]1(O)CCc2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161740",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc2ncn(C(=O)[C@H]3CC(=O)N(c4ccc(C)c(Cl)c4)C3)c2cc1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25315",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1ccc(F)cc1)N[C@H](c1ccccc1)c1ccccn1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9545",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(C)NC(=O)c1cccc(NC(=O)CNc2ccc(F)cc2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9895",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1ccc(CNC(=O)/C(C#N)=C\\c2ccc(C)o2)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166420",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCC[C@@H](NC(=O)C(=O)Nc1ccc2c(c1)COC2)c1ccc(F)cc1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cnc(S[C@@H](C)C(=O)Nc2cc(Cl)ccc2C)nc1N by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[S@](=O)[C@H]1CCC[C@H](NC(=O)C[C@H](O)c2ccc(Cl)cc2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCCN(c2ccc(C#N)c([N+](=O)[O-])c2)CC1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222805",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COC(=O)/C=C/C[C@@](C#N)(c1ccccc1)c1ccccc1C#N by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94905",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H](C)C[NH2+]CCC(=O)Nc1cccc(Cl)c1C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1cccc(OC[C@H](O)CNC(=O)c2sccc2-c2ccccc2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247199",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(Cc1ccccc1)S(=O)(=O)c1cc(C(=O)Nc2ccc(Br)cc2)ccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](CC)n1c(CCCl)nc2c(OC)ncnc21 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233344",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCN1C(=O)Cc1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49252",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCCc1ccc(NC(=O)[C@H](C)NS(=O)(=O)c2ccccc2F)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186293",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(NCC(=O)N2CCC[C@@H](C(N)=O)C2)c(F)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246170",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C([O-])[C@@H]([C@H](O)c1ccccc1)n1nnc2ccccc21 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73729",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc2nc(C(F)(F)F)c(=O)n(CC(=O)Nc3ccccc3C)c2cc1C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68733",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@]1(CO)CCC[C@H]1NC(=O)NCc1ccc2c(c1)OCO2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157202",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C1N[C@]2(COC3(CCN(C(=O)Cc4ccccc4Cl)CC3)C2)Nc2ccccc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111001",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1nnc(-c2ccc(C(C)(C)C)cc2)n1N)C(=O)Nc1ccc([N+](=O)[O-])cc1 by replacing a nitro by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1/c(=N/C(=O)Cc2ccc3c(c2)OCO3)sc2cccc(Cl)c21 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78895",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CNC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc(O)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40150",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](C#N)CC(=O)c1cccnc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cccc([C@@]2(C)NC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123703",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=Cc1cn2c(nc3ccccc32)s1 by replacing a aldehyde by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241856",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nn(CN2CCN(c3ccccc3F)CC2)c(C)c1[N+](=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN1C(=O)c2ccccc2C(=O)[C@@]2(C)CN(Cc3ccccc3Cl)C[C@@H]12 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71187",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1csc([C@@H](C)NCc2ccc([N+](=O)[O-])c(F)c2)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77481",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@@H]([C@@H](C)NC(=O)CN(C)c1ccccc1[N+](=O)[O-])N1CCOCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209533",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule Cc1cc(=O)n2c3ccccc3n(C[C@@H](O)CNc3ccc(C(C)C)cc3)c2c1C#N with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173342",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)NC(C)(C)c1ccc(Br)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1sc2nc(S[C@H](C)C(=O)Nc3ccccc3[N+](=O)[O-])n(C)c(=O)c2c1C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242096",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1cccnc1C(=O)N[C@H]1CCC[C@@H](C(F)(F)F)C1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2978",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(Cc1ccccc1)C(=O)Nc1ccc(N2CCCC2)c(F)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)OC(=O)N1CCC([NH2+][C@H](C)c2cccc(C(F)(F)F)c2)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCOC(=O)C1=C(C)Nc2nc(-c3ccc(Cl)cc3)nn2[C@H]1c1ccc(O)c(OC)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@H](c1cc(F)cc(F)c1)C1([NH+]2CCCCC2)CCCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36171",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)Nc2ccc(C(F)(F)F)nc2)cnn1C(C)C by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16569",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(c1ccc2cccc(F)c2n1)N1CCC[C@@H]1CO with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239319",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CS(=O)(=O)[N-]c1ccc(CNc2ccc(C#N)cn2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81581",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H]1C(=O)NC(=O)C[C@H]1c1ccc(OC)c(Cl)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213606",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COCCN1C(=O)C(C#N)=C(C)/C(=C\\Nc2ccc(C)c([N+](=O)[O-])c2)C1=O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(N2CC[NH+](CC[C@H](C)NS(=O)(=O)c3ccc(F)cc3)CC2)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC/[NH+]=C(/NCCSc1ccccc1F)N1CCC(O)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232938",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C1C(Br)=C(Br)C(=O)c2cc(Cl)ccc21 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238686",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(CS(=O)(=O)CCCc1ccccc1)Nc1ccccc1O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32026",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)(C)OC(=O)N1CC[C@H](C(=O)NC2(c3cccc(F)c3)CC2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule COCCn1c([O-])c(C(=O)COc2c(C)cccc2C)c(C)c(C#N)c1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC[C@H](C)N(C)c1cc(C)c(F)cc1[C@H](C)[NH3+] by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112253",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCc1ccc(C(=O)NNc2c(Cl)cncc2Cl)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237441",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](Cc1cccc(Cl)c1)NC(=O)c1ccncc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155539",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@](O)(CNC(=O)COc1ccccc1Cl)c1ccc(F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)[C@H]2CCCN2C(=O)c2ccc(Cl)c(Cl)c2)n1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224202",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(N(CCC(N)=O)Cc2ccc(Cl)s2)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138687",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccccc1N(C)S(=O)(=O)c1ccc(C(F)(F)F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182952",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nccc1[C@H]([NH3+])CSc1ccccc1Cl by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45487",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc2ccccc2c1)Nc1cnn(Cc2ccc(Cl)cc2)c1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50749",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1ccc(OC[C@@H](O)CN2CCN(C(=O)[C@@H]3CCCO3)CC2)c(C)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226581",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#CCSc1cccc(C(=O)NNc2ccc(-c3ccccc3)nn2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214480",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)N[C@H](C#N)c1ccc(Cl)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159171",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH3+])C(=O)N[C@@H](C)C(=O)Nc1ccc([N+](=O)[O-])cc1 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205523",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=c2ccccc2=[NH+]C(=O)[C@@H]1Sc1nnc(-c2ccccc2Br)o1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217727",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@H](NC(=O)c1n[nH]c2ccccc12)c1cccc(Cl)c1Cl by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136213",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(C(=O)c1ccc(F)c(F)c1F)c1ccncc1N by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48869",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC(=O)c1c(C)[nH]c(C(=O)N2CCN(Cc3ccc(C#N)cc3)CC2)c1C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](Cc1ccccc1)C[C@@H](C)CS by substituting a thiol with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173109",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=Cc1cccc(OCc2cccc3ccccc23)c1 by substituting a aldehyde with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217086",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCO/C=N/C1=C(C#N)[C@@H](c2ccccc2)c2c(C)nn(-c3ccccc3)c2O1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56353",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(CC1(O)CCCCC1)N1CC[C@@H](c2nnc(-c3cnccn3)o2)C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33821",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)C(=O)NCCCN(C)c2ccccc2F)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14812",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(Cl)cc1NC(=O)[C@H]1CCCN(c2ccc(-c3cccs3)nn2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19958",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1ccc2cc(S(=O)(=O)N3CCC[C@@H](C(=O)NCc4cccc(F)c4)C3)ccc21 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29608",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COc1ccc([C@H]2CCCN2C[C@H](C#N)CCC#N)c(OC)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204143",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1CC[NH+](C)CC1)[C@@H](C[NH3+])c1cc(Cl)cs1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4641",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COc1ccc(/C([O-])=C(\\C#N)C(=O)Nc2ccccc2OC)c(C)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118807",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1ccc(Cl)cc1)Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66752",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c2cc(Cl)cc(Cl)c2ncn1Cc1cc(-c2ccccc2)on1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106892",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc([C@H]2C(N)=NC(=O)N2CC(C)C)cc1Br with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167153",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH+](C)CCn1ccc(NC(=O)Cc2c(F)cccc2F)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247921",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H](C)NC(=O)[C@@H](C)NC(=O)c1nn(-c2ccc(F)cc2)cc1[O-] with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168102",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[NH2+]C[C@H](Cc1nc(C)cs1)c1ccc(Cl)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26736",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Clc1cccc(CNCCc2c[nH]c3ccccc23)c1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132279",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)C1(c2ccc(Cl)cc2)CCCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238221",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(Cl)cccc1-n1c(SCC(=O)c2ccc(Cl)cc2)nc2[nH]ncc2c1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16766",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@H]1C[C@@H](C)CN(c2ccc(C(=O)NC[C@@H]3COCCO3)cc2[N+](=O)[O-])C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57031",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=c1[nH]nc(CCNc2ccc3cc(Br)ccc3n2)[nH]1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC[C@H](NC(=O)Nc1c(C)ccn(C)c1=O)c1ccc(F)c(F)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183244",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)C(C)(C)CNc1ccccc1SC(F)F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60376",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)Nc2cnn(Cc3ccc(Cl)cc3)c2)cc1OC by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Sc1ccccc1C(=O)NNc1cc(C#N)cc(Cl)n1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)C(C)(C)NC(=O)[C@@H](C)NC(=O)c1ccc(Br)s1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122573",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCCN(C(=O)c1csc(-c2ccc(Cl)cc2)n1)C1CCCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105562",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=S(=O)(CCc1ccccc1)[N-]c1cc(Br)ccc1N1CCOCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201968",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc([C@@H](C)NC[C@@H](O)c2cccc(OC(F)F)c2)cc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242825",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(CC[C@H]([NH3+])Cc2ccc(F)cc2F)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65462",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1noc(C)c1C[C@H](C)N[C@H](C)c1nc2cc(Cl)ccc2n1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109794",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COc1ccc(/C=C(/C#N)C(=O)NCCc2nc3ccccc3s2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166835",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CS(=O)(=O)c1cccc(NCCc2ccc(F)cc2)c1[N+](=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58683",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCOc1ccc(NC(=O)N2CC(=O)N3CCc4c(F)cccc4[C@@H]3C2)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38776",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)CN(C)c1ccc(F)cc1[N+](=O)[O-] by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151065",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCC(=O)N1N=C(c2ccc(Br)cc2)C[C@@H]1c1ccccc1O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21955",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C(=O)N(C)C)ccc1NC(=O)NNc1ccc(F)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100138",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Nc1c(Cl)cc(NC(=O)CCn2c(=O)oc3ccccc32)cc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47137",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NC(=S)Nc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1)c1ccco1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62688",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(CC2CC[NH2+]CC2)nc2c(F)cccc21 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92196",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1ccccc1Cl)C(=O)N(C)Cc1ccc(Cl)nc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169401",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H](Oc1ccc(F)cc1Br)C(=O)NCC(C)(C)O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90261",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CCCO1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69954",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@@H](Nc2ccc(Cl)c(Cl)c2)C1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31469",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(C)C(=O)N[C@@H](N1CCCCC1)C(Cl)(Cl)Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56179",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn2c(=O)c(NC(=O)c3ccc(Cl)cc3)cnc2s1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NO)/C(CC(=O)c1ccc(O)cc1)=N/O by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88566",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C(Cn1cc([N+](=O)[O-])ccc1=O)c1ccc2c(c1)OCO2 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOC(=O)c1coc(NC(=O)NCc2ccc(F)cc2)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41176",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([N+](=O)[O-])cc1CSc1nnc(Cc2csc(C)n2)o1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69727",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(NC(=O)NCCNc2ncccc2C(F)(F)F)c1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178527",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCCCn1ccc([C@H](O)C(C)C)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Nc1ccc(SCC(=O)NC(=O)c2ccccc2Cl)cn1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153226",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CCCn1sc2ccccc2c1=O)NCc1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93014",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCn1c(SCC(=O)Nc2ccccc2F)nnc1[C@H]1CCCN1C(=O)c1ccccc1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ccnc(NC(=O)CCc2ccc(Br)cc2)c1=O by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195261",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC[C@H](C#N)OC(=O)c1csc(-c2cnn(-c3ccccc3)c2)n1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218426",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CCN(Cc1ccoc1)C(=O)N[C@H](C)c1cccc([N+](=O)[O-])c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220149",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(-c2nnc(NC(=O)c3ccc(F)cc3)o2)cc1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173804",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3198",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CSc1nc([O-])c(C(=O)Nc2ccc3nc(C4CCC4)[nH]c3c2)cc1C#N with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246443",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccsc1C(=O)NC[C@@H](CCO)c1ccccc1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102868",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCN(C[C@H](C)C(=O)OC)C(=O)c1ncccc1C(F)(F)F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107192",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCCCC(F)(F)F)c1ncn(-c2ccccc2)n1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111461",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#CCCN(CC1=NS(=O)(=O)c2ccccc2N1)CC1CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50623",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1cccc(COc2cccc(NC(=O)C3=NO[C@@H](c4ccccc4)C3)c2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172109",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(C)c1-n1ccn(Cc2nc(-c3cccc(F)c3)no2)c(=O)c1=O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33845",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@H](CNc1ncnc2sc3c(c12)CCNC3)c1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3054",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1nnc(SCC(=O)N2CCCCC2)s1)c1ccccc1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175696",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cccc(CCNCc2c(F)cccc2F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104540",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[NH2+][C@H]1C[C@@H](C)C[C@H](C)[C@@H]1C[NH+](CC)CC(C)(C)O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80705",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc([C@H]2OCC[C@H]2CCl)c(Cl)c1OC with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144987",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CN(C[C@H](O)COc2ccccc2F)C(C)(C)CO1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164307",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCS(=O)(=O)NCCc1cc(F)ccc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147222",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nn(-c2ccccc2)c(NC(=O)c2ccco2)c(-c2ccccc2Cl)c1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186941",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH+](C)[C@H](CNC(=O)CCc1nc2ccccc2s1)c1cccc(F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25322",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccn1)c1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1 by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(-c2nc3cnccn3c2NCc2cccs2)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179040",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCOc1ccccc1/C=C/C(=O)NC[C@@](C)(O)c1ccc(C)o1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145434",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CNC(=O)NC(=O)COc1ccc(C)cc1[N+](=O)[O-] by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66023",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]1N(C(=O)C(F)(F)F)CCN1S(=O)(=O)c1ccccc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124462",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@H]1CCCN(C(=O)Cn2c(=O)n(-c3cc(F)cc(F)c3)c(=O)c3sccc32)C1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119982",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NCCc1cccs1)NC[C@H](O)c1ccc(Cl)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75267",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cccc2c1OCC[C@@H]2[NH2+]CC1(CO)CCOCC1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31636",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc([C@@H](C)NC(=O)[C@H](Oc2cccc(Cl)c2)C(C)C)n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193698",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(Cl)cc1C[NH3+] by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187162",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule N#Cc1ccccc1-c1ccc(CNC(=O)NC[C@@H]2CCC[C@@H]2O)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205496",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1onc(-c2ccccc2)c1C(=O)Nc1nnc(C(F)(F)F)s1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](C)C[C@H]([NH3+])c1ncc(Cl)cc1Cl by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(Cc1cccnc1)C(=O)c1cnn(-c2ccc(F)cc2)n1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(-n2nc(SCC(=O)Nc3ccc(Cl)cc3F)ccc2=O)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cc(OC)cc(C(=O)Nc2ccc(-c3nc4cnccc4o3)c(O)c2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167994",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Brc1cn2c(C[NH2+]C[C@@H]3CCCCO3)cnc2cn1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC1=[NH+]CC2(CCC(C(F)(F)F)CC2)N1c1ccccc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21649",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)CN(C)c1ccc(C(F)(F)F)cc1C#N by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28770",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+]C[C@@H](O)COc1ccccc1Br)c1cnn(C)c1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179940",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(/C(C#N)=C/c2ccc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)o2)nc2ccccc21 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56649",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NNc1ccc(Cl)c(CSC2COC2)n1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCN1CCO[C@H]([C@H]([NH2+]C)c2ccc(F)c(F)c2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39443",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)c1c(C(=O)N2CCN(c3ncccn3)CC2)cnn1-c1cccc(Cl)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226403",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CCBr)c1ccc(F)c(F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226101",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC[NH3+])NC(=O)c1cc(C(F)(F)F)ccc1F by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226743",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(CC(F)(F)F)C(=O)CNC(=O)C(=O)Nc1ccc(CC#N)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule NC(=O)[C@@H]1CN(Cc2ccc(F)cc2C(F)(F)F)CCO1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1F)c1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56280",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[C@](C)(CCO)NC(=O)Nc1cc(COC)ncn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101464",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCC(F)(F)F)N[C@H]1CCN(C(=O)CCc2ccccc2)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21293",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)c1c(C)[nH]c(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5716",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)N[C@@H]1CCS(=O)(=O)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119322",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)c1cccc(NC(=O)[C@@H](C)[NH+](C)CC(=O)Nc2ccc(Cl)c(Cl)c2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116257",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cccc(NC2CCN(C(=O)CC3(O)CCCC3)CC2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@H](c1ccc(Cl)cc1)[C@H](C)NC(=O)N1CCOC[C@@H]1C by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109601",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](C[C@H](O)c1ccc(C)cc1)C1C[C@H](C)O[C@H](C)C1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93497",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)(C)Cc1noc2ncc(C(=O)N[C@H]3CCC[C@H](C(F)(F)F)C3)cc12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217026",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1cccnc1O[C@@H]1CCC[NH2+]C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200275",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CN(C(=O)c1c(O)cc(F)cc1F)C1CCN(c2cccc(F)c2)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164075",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[NH+]1CCC[C@@H]([C@@H](C)Nc2cccc(C(F)(F)F)c2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130837",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1cnc(CNC(=O)C(=O)Nc2ccc(-n3cccn3)c(Cl)c2)n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213677",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(N[C@H](C(=O)[O-])C1CC1)c1ccncc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30932",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nncn1CCNC(=O)C1(c2ccc(F)cc2F)CCCC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91583",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@@H](CO)N1CC[NH+](Cc2coc(-c3cccs3)n2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185055",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccncc1N1CCC(Nc2ccc(F)cc2)CC1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185481",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCCS(=O)(=O)N1CCSCC1)c1cc2ccccc2n1Cc1ccccc1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168786",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(Cc1cccc(F)c1)C(=O)CCCn1ccnn1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119581",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C/c1cccc(Cl)c1)c1ccc(CN2CCc3ccccc3C2)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20336",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(=O)N(CCC(=O)NC[C@]1(O)CCSC1)Cc1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45204",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CSc1ncc(C(=O)NC2CCCC2)c(Cl)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202216",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccc(NC(=O)c2ccncc2Cl)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170727",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nc(Cc2ccc(F)cc2)sc1C(=O)NNC(=O)C[NH+](C)C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H]1CCCN(C(=O)C[NH+](C)Cc2cccc(F)c2Cl)C1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171969",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(OCCNC(=O)c2c[nH]nc2-c2ccc(F)cc2)cc1 by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202235",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)c(NC(=O)C(=O)NCc2cc(C#N)ccc2F)c1 by substituting a nitrile with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162420",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1cc(CNC(=O)[C@H]2C[C@@H]2c2ccccc2Cl)on1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169637",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCc2c(sc3ncn(CCCO)c(=O)c23)C1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64482",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1cc(-c2ccc(Br)cc2)nc2ccccc12 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82436",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CS(=O)(=O)N[C@H](CCO)c1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164542",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc(CSCC(=O)NCCc3ccccc3F)cn2c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196638",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(I)ccc1NC(=O)C[NH+](C)[C@@H]1CCc2ccccc21 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218038",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(CNC(=O)CS(=O)(=O)Cc2ncoc2C(C)C)ccc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211001",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CCO)C[NH2+][C@@H](C)c1ccc(Br)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197624",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39806",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CC1(C)c2ccccc2N2CC(=O)N[C@@]21/C=C/c1ccc([N+](=O)[O-])cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120054",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCN(CCC#N)CC(=O)N1CCO[C@@H](c2ccc(F)cc2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216153",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=c1ccc(C(F)(F)F)cn1Cc1coc(-c2ccccc2)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62131",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)C[NH+]2CCCN(Cc3cccc(Cl)c3)S2(=O)=O)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC1=CC[C@@H]2[C@@](C)(CCC[C@@]2(C)C(=O)[O-])[C@@H]1C[C@]12O[C@H]1[C@@H](O)C(CO)=C[C@H]2O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215014",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Nc1ccc(SCc2nc(-c3ccco3)no2)cc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139022",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc2nc(Cl)c([C@@H]3CC(c4cccc(OC)c4)=NN3C(C)=O)cc2c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127070",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccc(-c2nnc3n2CCCCC3)cc1)c1ccccc1C(F)(F)F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120809",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1cccc(CS(=O)(=O)N2CCC(OC[C@@H]3CCCO3)CC2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42564",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)/C=C/c1ccc(-c2ccccc2Cl)s1)c1ccccn1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46877",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC[C@@H](C)[NH+]1CCN(Cc2ccc(Cl)s2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52603",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cc[n+](/C(C(=O)c2ccc(F)c(F)c2)=C(/[S-])NC)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153177",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COc1ccc([N+](=O)[O-])cc1N/C([O-])=N/S(=O)(=O)c1ccc(C)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163251",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Nc1scc[n+]1Cc1cccc(F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H](C)C(=O)N1CCC[C@H](C(=O)Nc2cc(F)ccc2Cl)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45043",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule S=c1[nH]cc(-c2ccc(Cl)c(Cl)c2)n1-c1ccccc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cccc(C#N)c1)C(=O)N[C@@H]1CCCc2c1cnn2C by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168550",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)CN2CCCCCCC2=O)c(C(F)(F)F)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79874",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(Cl)cc1)N1CCN(C(=O)Cc2ccc[nH]2)CC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Cc1ccccc1F)Nc1ccc2c(c1)CN(C(=O)[C@@H]1C[NH2+]CCO1)CC2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97917",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CCCO)Nc1ccc(C#N)c(N)c1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185506",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H](O)[C@@H]1CCCC[NH+]1Cc1ccccc1OCc1cccnc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13772",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C([O-])C1=Nc2nc3ccccc3n2[C@@H](c2cccc([N+](=O)[O-])c2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162650",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(Cl)sc1C(=O)N1CCC[C@H]([NH+](C)C)C1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167761",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[NH2+]C[C@@H](CC1CCOCC1)c1cccc(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1ccc(NC(=O)c2cnc(Cl)c(Cl)c2)s1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99261",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH+]1[C@H]2CC[C@@H]1CN(S(=O)(=O)c1cc(Cl)sc1Cl)CC2 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103897",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](COc1ccc(F)cc1)NC(=O)[C@@H]1CCCN1c1ncccn1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69721",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)[C@H](C)Sc2nnnn2-c2ccc(Cl)cc2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139718",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(Cc1ccccc1F)C(=O)COC(=O)c1c[nH]c2ccccc12 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@](NC(=O)CSCc1cccs1)(C(=O)[O-])C(F)(F)F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107751",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)n1cc(CCCC(=O)N2CCn3c(nnc3C(F)(F)F)C2)c2ccccc21 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133695",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CO[C@H](C)[C@H](O)c1cc(F)ccc1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37948",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](C)NC(=O)Nc2cc(Cl)ccc2F)cc1F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248229",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCCSCC(=O)NC[C@H](O)c1c(Cl)cccc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124864",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H](O)CC(C)(C)CNC(=O)CC1(O)CCCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175471",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCC[C@@H](C)Nc1nc(Cl)ncc1Cl by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184946",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOC(=O)C[C@@H]1CCCCN1S(=O)(=O)c1c(C)nn(C)c1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75686",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@H](NC(=O)C(=O)c1c(C)nn(-c2ccccc2)c1C)c1ccc(Cl)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122778",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1ccc([C@@H](O)CNc2cnc3ccccc3n2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196310",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOC(=O)c1c(NC(=O)C=Cc2ccccc2Cl)sc2c1CC[NH+](CC)C2 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73791",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CCn1c(S[C@H](C)C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)nc2ccc(Br)cc2c1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78408",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(C(=O)c2ccccc2)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48320",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1noc(C)c1S(=O)(=O)[N-]c1ccc(N2CCOCC2)c(F)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30398",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(c1ccccc1)N1C[C@H]2[C@@H](C1)OC(=O)N2CCc1cccc(Cl)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112766",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1cc(Cl)c([C@H](Cl)[C@@H]2CCO[C@@H]2C)cc1OCC with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94486",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)c1ccc(Cn2c(C=O)nc3ccccc32)cc1 by substituting a aldehyde with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139897",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@H](C[C@H]1CCCO1)[NH2+][C@H](CO)CC(C)(C)C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71806",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCC(C)(C)[C@H]1CCc2c(sc(NC(=O)c3ccoc3C)c2C#N)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147968",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Fc1ccc(/C=N/Nc2cnccn2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cccc([C@@H](CO)NC(=O)c2cnn(C(C)(C)C)c2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111630",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(C)c1OCC(=O)Nc1ccc(N)cc1Br by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58567",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(C[C@H]1CCCO1)c1ccccc1Cl by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96679",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1cccc(NC(=O)c2cccc(Br)c2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40697",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](Cn1cccn1)Nc1cc(Cl)c(Cl)cc1N with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79919",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1sc(-c2cc(C(F)(F)F)on2)cc1S(=O)(=O)N(C)Cc1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75161",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)c1cnn([C@H]2CCCN(C(=O)C(F)(F)c3ccccn3)C2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159048",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)c1cccc(Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110518",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCO[C@H](C[NH2+]CC2CC(Cl)C2)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17352",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Oc1ccc(C#N)cc1)C(=O)NNC(=O)CC1CCCCC1 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6682",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/C=C(/C#N)c2nc(-c3ccc(CC(C)C)cc3)cs2)o1 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121807",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1C[C@H](C)CN(c2cccc(F)c2C(N)=S)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114916",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CS(=O)(=O)N[C@@H]1CC[NH+](Cc2ccc(F)c(C(F)(F)F)c2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141591",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c2cnn(-c3ccc(Br)cc3)c2ncn1CCc1ccccc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150624",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1cc(Br)ccc1NS(=O)(=O)c1cccc(C#N)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82491",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCNC(=O)N1CCC[C@@H]1[C@H]1CCC[C@@H]1O by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81044",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1occc1-c1nnc(SCC(=O)Nc2sc3c(c2C#N)CCCCC3)n1C[C@H]1CCCO1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189732",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH2+][C@H](CCO)c1cccnc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92787",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccc([C@@H]2CSCCN2Cc2c(C)nn(CCO)c2C)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1nccc1NC(=O)[C@H]1CC(=O)N(c2ccc(Br)cc2)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(C[NH+]1CC=C(c2ccccc2)CC1)NCCc1ccc(F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78755",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(F)c(NC(=S)NNC(=O)[C@@H]2C[C@H]3CC[C@@H]2C3)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126055",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC1(CC)CC[NH+](Cc2ccc(OC)c(Br)c2)C1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70811",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(S[C@H]1CS(=O)(=O)C[C@@H]1Cl)c1ccc([N+](=O)[O-])cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13330",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@H](Cc1cccc(F)c1)[C@H]1CSCCO1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70613",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)CNS(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1C by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36403",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCC[NH2+][C@@H](Cc1ncccc1C)c1ccc(Cl)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15905",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C(CSc1nnc(-c2cccnc2)o1)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210917",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@H](C(=O)OCC)[C@H]1c1ccc(Cl)cc1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7035",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(Br)cc1[C@@H]([NH3+])c1ccc(OC)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128220",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CC[C@H](C(=O)N(CC(F)(F)F)C2CCOCC2)N1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14351",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1CCCC1)S(=O)(=O)c1cccc(F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218771",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@@H](Cc1ccsc1)NC(=O)N[C@@](C)(CO)C1CCCCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191727",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)Nc2ccc(C)c(S(C)(=O)=O)c2)cc1F by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154253",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC(=O)Nc1ccc(F)cc1)[NH2+]C[C@@H]1CCN(S(C)(=O)=O)C1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H](NC(=O)Cc1ccc(NC(=O)C2CC2)cc1)c1ccc(C)c(F)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165384",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H]1CN(Cc2cc(F)cc(C#CC[NH3+])c2)CC[NH+]1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27665",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)[C@H](C(=O)N(C)CC(=O)Nc1cccc(Cl)c1)N1CCCC1=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242302",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1S/C(=C\\c2cccc([N+](=O)[O-])c2)C(=O)N1c1cccc(Cl)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219217",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](Cl)c1nc2cccc(Cl)c2n1C[C@@H]1CN(C)CCO1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116417",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)c1nn(-c2cccc(C(F)(F)F)c2)c(=O)nc1[O-] with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1nc(N2CCCCCC2)nc(Nc2ccccc2F)c1[N+](=O)[O-] by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228153",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)Cc1cc(C(=O)N[C@@H](CO)C(N)=O)n(C)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222261",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCNC(=O)NC[C@@H](OC)c1cccc(Cl)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)C(=O)Nc2ccc(Br)cc2F)C1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142478",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(C)C(=O)N1CCN(Cc2cc(Cl)c3c(c2)OCCO3)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248983",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@@](CNC(=O)c2cccc(SCC#N)c2)([NH+](C)C)C1 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10893",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H](NC(=O)CCc1ccccc1)c1nc(-c2ccc(F)cc2)no1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)CCC[C@H]2[NH2+][C@@H](CO)c1cnn(C)c1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164902",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CO[C@H](C)C(=O)Oc1ccc(Br)cc1Br with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10714",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)-c1cc(C)nn1[C@@H](c1ccc(O)cc1)N2 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56037",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CSc1cccc(Br)c1)c1ccc2c(c1)CCO2 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209571",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C[NH+]2CC[C@@H](NC(=O)c3ccc(C=O)cc3)C2)cc(OC)c1 by substituting a aldehyde with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62237",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)[C@@H]1CCC[NH+](CCCNC(=O)C(F)(F)F)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88685",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CNC(=O)[C@@H]1C[C@H]([NH3+])CN1C(=O)c1ccc(C(F)(F)F)nc1[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112857",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule ClCC/C=C/Cc1csc2ccccc12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94881",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1cnn(-c2ccc(Cl)nn2)c1N by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55900",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)C(C)(C)C)cc1NC(=O)CSCC(F)(F)F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133003",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCN(C(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)C[C@@H]1O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69394",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)[C@H](CO)NC(=O)CCOc1cccc(N)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161085",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=[N+]([O-])c1ccc(N2CCN(c3ccccc3Cl)CC2)c(S(=O)(=O)N2CCCC2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98435",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule OC[C@@H]1CCCC[NH+]1Cc1nc(-c2cccc(Cl)c2)no1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126593",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN(Cc1ccccn1)C(=O)Nc1ccc(F)cc1OC(F)F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H]1CN(C(=O)[C@H](C)NC(=O)c2ccccc2Cl)CCO1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36446",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc2nc3n(c(=O)c2c1)CCCCC3)NCCc1ccc(F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26976",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(F)cc(NC(=O)N[C@@H]2COC[C@H]2C(=O)[O-])c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183404",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(CC1CCCCC1)NC[C@H](c1cccc(F)c1)N1CCOCC1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28589",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc(-n2c(=S)[nH]c3cnccc32)c(F)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148853",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1cccc(C(=O)Nc2ccc(Cl)cc2)c1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204416",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC(C)c1cc(C(=O)Nc2ccc(Oc3ccc(C#N)cc3)cc2)n(C)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61461",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CC(=O)C2=C(C1)N[C@H]1N=NC(O)=C1[C@H]2C1[NH+]=c2ccccc2=[NH+]1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44410",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Nc1ccc2c(N[C@H]3CCN(c4ncccc4F)C3)ncnc2n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113743",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(OCC1CC1)c1ccc(Cn2cc(Br)cn2)o1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168152",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a thiol in the molecule CCCc1cc(=O)[nH]c(SC[C@H](CS)C(C)(C)C)n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1ccc(C[NH+]2CCC[C@H]2C[C@@H](O)c2ccco2)c(O)c1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1c(C(=O)NCc2cc(-c3ccc(Cl)cc3)on2)cccc1[N+](=O)[O-] with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CCOc1ccc(NCc2ccc(O)c([N+](=O)[O-])c2)c(C)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124450",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(Cl)c(NC(=O)C(=O)N(C)Cc2ccc(Cl)cc2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1ncnc1C[C@H](O)[C@@](C)(CC)[NH+]1CCCC1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228700",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#C/C(=C/c1ccc(-n2cccn2)cc1)c1nc(-c2ccncc2)cs1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc(F)c(C)c(NC(=O)c2ccccc2-c2cncnc2)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117006",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cnc(N2C(=O)[C@@H]3CC=CC[C@H]3C2=O)s1)Nc1ccc(F)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84197",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(c1cccc([N+](=O)[O-])c1)N(Cc1cccnc1)c1nc2ccc(Br)cc2s1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43769",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCC[NH+]1CCCCC1)c1cc(COc2c(F)cccc2F)on1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242526",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(OC)c(C2=NO[C@@H](C(=O)Nc3cnn(C45CC6CC(CC(C6)C4)C5)c3)C2)cc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233138",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cccc(CN2CCN(c3nc(C)ns3)CC2)c1O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83434",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CNC(=O)Nc2cnn(CC[NH+](C)C)c2)ccc1F by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45231",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C1CN(C(=O)COC(=O)/C=C/c2ccc(OC(F)F)cc2)c2ccccc2N1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54571",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)c1cccc(NC(=O)[C@@]2(C)CC2(Cl)Cl)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108751",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCOc1ccc(NC(=O)N[C@@H]2CCCC[C@@H]2CO)c(C(F)(F)F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224585",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)N(c1nc(CSc2nncn2C)cs1)c1c(C)cc(C)cc1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191333",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OCC(=O)N2CC[NH+](Cc3ccccc3C(F)(F)F)CC2)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231473",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(C(=O)N2CCO[C@@H](c3cccc(OC(F)F)c3)C2)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122871",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=Cc1ccc(O[C@@H](NC(=O)c2ccco2)C(Cl)(Cl)Cl)cc1 by replacing a aldehyde by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1C(=O)c2ccc(-c3nc4cc(Cl)ccc4o3)cc2C1=O by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](CCNCc1cc(C#N)cs1)C1CCCC1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204459",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H]1CCN(c2ccc([N+](=O)[O-])c3cnccc23)C1 by substituting a nitro with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246058",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#CCN(CC(=O)Nc1ccc(C#N)c(Cl)c1)c1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116750",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@]1(C(=O)NCCc2nnc(-c3ccccc3)o2)CC1(Cl)Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125466",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(OCC(=O)NCc2cccc(Cl)c2)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18602",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)c1csc(NC(=O)[C@@H](C)Oc2ccccc2Cl)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151020",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)c1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CN4CCCC4=O)C3)noc2n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc(/C(C#N)=C/c3cc4ccccc4nc3Cl)nc([O-])c2c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174887",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCN(C)c1cccc(NC(=O)N[C@H](CO)c2ccc(Cl)c(F)c2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(C)c(N/C(=N\\C(=O)c2cccc(F)c2)[N-]Cc2c(C)nn(C)c2C)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142084",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1csc(NC(=O)c2csc(C#CCO)c2)n1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139539",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])CNC(=O)C(C)(C)C)cc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220101",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CCc1cc(F)c(OC[C@@H]2CCOC2)c(F)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30018",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)[C@@H]([NH2+]C1CCCC1)c1ccccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CC[C@@H](O)c1ccccc1)N/N=C\\c1cc(Br)cc(Br)c1O by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C([C@H]1C[C@@H]1[N+](=O)[O-])N(Cc1ccccc1F)[C@@H]1CCS(=O)(=O)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cn1cnc([N+](=O)[O-])c1Sc1nnc(-c2ccco2)o1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75775",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1cc(C)c([C@H](C/C(=N/NC(N)=O)c2cccs2)C(C#N)C#N)c(C)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc(SCC[C@@H]2CCC[C@]2(O)C[NH3+])nc1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100289",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc2c(cc1C)O[C@H](C(=O)OCc1c(C)nn(C)c1Cl)C2 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2oc(C(=O)NC[C@@H](O)c3ccc(F)cc3)cc2c1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49449",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCc1ccccc1)c1ccccc1NC(=O)[C@@H]1CC(=O)N(c2ccccc2Cl)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173976",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCOC(=O)CCC(=O)N(C)CC(C)(C)O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule BrCCc1noc2ccccc12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192428",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#CCc1ccc(S(=O)(=O)N[C@H]2CCCCC[C@@H]2[NH3+])cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169418",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1cnnc1CCNC(=O)/C=C/c1ccccc1OC(F)F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104388",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOC(=O)c1c(NC(=O)c2cc(Cl)sc2Cl)sc2c1CCN(C(=O)OCC)C2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79151",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C1CCCN1c1ccc(C[NH2+]Cc2c(F)cccc2F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)NCC[C@@H](O)c2ccccc2)[nH]n1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1c(Cl)cc(C(=O)[O-])cc1NC(=O)C(C)(C)Oc1ccc(Br)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33642",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1nn(C)c(C)c1CCC(=O)N(C)CC(C)(C)O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176046",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CSCc1ccc(Cl)s1)N1CCC[C@@H](c2nnc3ccccn23)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175275",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C=CCN(CC=C)c1nncc(-c2ccc(Cl)cc2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66920",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccn(CC(=O)NCCN2Cc3ccccc3O[C@@H](c3ccccc3F)C2)n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1cc(NC(=O)C2CCN(c3nc4ccsc4c(=O)n3Cc3ccccc3)CC2)ccc1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112295",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](Sc1nnc(C2CC2)n1Cc1ccco1)c1c(F)cccc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245727",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H]1OCC[C@H]1C(=O)N1CCN(CCO)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219069",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCC[C@]1(CO)CCCN(C(=O)CNC(N)=O)C1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79243",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)c1ccc(NC(=O)CN2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1noc(C)c1C[C@H](C)N[C@H](C)c1nc2ccc(Cl)cc2n1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCc1cccc(NC(=O)Cn2cnc3ccc(Cl)cc3c2=O)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155225",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccnc(NC(=O)COc2ccc(Br)cc2Cl)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171364",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C([O-])c1ccc(COc2cccc(Cl)c2Cl)o1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60099",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1nc2n(n1)CCC[C@@H]2NC(=O)N[C@H]1C[C@@H]1c1c(F)cccc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156030",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(C(=O)Cc2ccccc2Br)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76380",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C=O)c1OS(=O)(=O)c1ccc(Cl)cc1C#N by replacing a aldehyde by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198781",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COCCN1C[C@H](C(=O)N[C@@H](C(=O)[O-])[C@@H](C)O)CC1=O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184834",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@H]([C@@H]2NCCC3=c4ccccc4=[NH+][C@@H]32)[C@H](O)N[C@H](S)N1Cc1ccc(F)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195829",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(F)c(NC(=O)c2cccc(OC)c2F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81108",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](C1CC1)N(Cc1ccccc1)C(=O)Nc1cccc(F)c1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77518",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1cc(-c2ccncc2)on1)N1CC=C(c2ccccc2Cl)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147859",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1c(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)cnn1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13976",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](c1ccc(F)cc1)[NH+](C)CC(=O)NNC(=O)c1ccccc1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225527",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COc1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(Cl)ccc1O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216146",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](c1ccccc1Cl)N(C)C(=O)[C@H]1CC[C@H](C[NH3+])O1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128819",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(CNC[C@@H](C)c2cccs2)cc(Br)c1O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242740",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCC[C@@H]([NH3+])C(=O)Nc1cc(CC)ccc1O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13168",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(Nc3ncnc(Nc4ccccc4)c3[N+](=O)[O-])sc2c1 by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77092",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H]2NC(=O)C(C#N)=C([S-])N2c2ccccc2C)c1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36948",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(-c2cccc([N+](=O)[O-])c2)cn2cc(-c3ccc4c(c3)OCO4)nc12 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62577",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC(=O)N1CCC[C@@H](c2nccnc2-c2ccc(F)cc2)C1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93498",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)C(C(=O)OC)=C(F)SCC(C)=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93301",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)Cn2ccccc2=O)c(Br)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69588",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@H]1CCC[C@@H](Oc2ncccc2F)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208887",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccc([C@@H]2C[C@@H]2C(=O)OCCN2CCCCCC2=O)c1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85566",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(F)c(F)c1)Nc1cnn(C[C@@H]2CCCO2)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38340",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule COc1cc(OC)c([N+](=O)[O-])nc1[N+](=O)[O-] with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COC[C@H]1CCCCO1)N1CCCN(c2ccc(F)cc2)CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33745",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCC(F)(F)F)NCC1CCN(C(=O)C(F)(F)F)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157443",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1CN(C(=O)COCC(F)(F)F)[C@H](C)CN1C(=O)OC(C)(C)C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54821",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCN(C)C(=O)c1cccc(S(=O)(=O)[N-]c2ccccc2Cl)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59829",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[NH+]2CCCC[C@@H]2CN1CCC[C@](C)([NH3+])CO by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151650",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule NC(=O)[C@H]1COCCN1C[C@@H](O)COCc1ccccc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@](O)(CNC(=O)[C@@H]1CC(=O)N(c2ccccc2)C1)c1ccc(-c2ccccc2)cc1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153285",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCNC(=O)C1CCN(C(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163117",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1c(Cl)cccc1Cl)N1CCC[C@H](c2[nH]cc[nH+]2)C1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CCC[C@H]1c1ccc2c(c1)OCCO2)Nc1cc(C(F)(F)F)ccc1-n1cncn1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C=CCN(CCO)C(=O)Nc1cc(-c2ncco2)ccc1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60914",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(C(=O)Nc2c(F)cc(F)cc2-c2ccccc2)CC1(Cl)Cl by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243562",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](C#N)N1CCN(C(=O)c2ccnc(C3CC3)n2)CC1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73701",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)NC1=NN(C(C)=O)[C@@]2(S1)C(=O)N(CCOc1ccccc1Cl)c1ccc(C)cc12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31554",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CCc1cc(Cl)cs1)N1CCC[C@H]1c1ccccc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243705",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H]1CCC[C@H](n2cc(C)c(I)n2)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135368",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc([C@H](Cl)[C@]2(C)CCCO2)c(Br)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccccc1[C@@H](C)N[C@H](CC(F)(F)F)c1ccc(F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148187",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1ccnc1-c1nc(Cl)ncc1F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)Oc1cc(C(=O)N2CCC[C@H]2[C@H](C#N)c2ccccc2)ccn1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2oc3c(c(=O)c2cc1C)[C@@H](c1cccc(Cl)c1)N(C[C@@H]1CCCO1)C3=O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214121",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1CN(S(=O)(=O)c2cc(C(=O)Nc3cccc(Cl)c3Cl)ccc2Cl)C[C@@H](C)O1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17882",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CCCC[C@@H]1NC(=O)CN(C)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cccc(C#N)c1)C(=O)c1c[nH]c2cccc(F)c12 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218420",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)CN(C)c1ccc([N+](=O)[O-])c2cnccc12 by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116951",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=[N+]([O-])c1ccc(N2CCOCC2)c(S(=O)(=O)[N-]/N=C/c2ccccc2Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227901",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)Oc1ccc([C@@H](N)C(F)(F)F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17488",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=S(=O)(c1ccccc1Br)N1CCN(Cc2csc3ccccc23)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173624",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1cc([C@H]2NC(=S)NC(C)=C2C(=O)Nc2ccc(C)cc2C)ccc1O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137312",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H]1CN(C(=O)Cc2cccc(F)c2F)CC[C@H]1[NH3+] by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]C[C@@]1([C@]2(O)CCC[C@@H](C3CC3)C2)CCOC1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201255",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]([C@@H](C)O)n1cc(Br)cc([N+](=O)[O-])c1=O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185203",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nnsc1C(=O)N1[C@H](COc2ccc(F)cc2)[C@H]2CC[C@@H]1C2 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149333",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1cc([N+](=O)[O-])cnc1S[C@@H](C)C(C)C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Cn1ncc2c3ccccc3n(Cc3cccc(Cl)c3)c2c1=O)NCc1ccc(F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94237",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](Sc1ccc2nnc(C(F)F)n2n1)c1ccccc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135302",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1ncc2c(S[C@@H]3CCN(c4ccccc4F)C3=O)ncnc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248309",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)NC(=O)N[C@H](C)c1nc(C(C)(C)C)no1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15128",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "689",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)[NH+](C)Cc1ccccc1N1CCCCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35774",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCn1ncc(Cl)c1C(=O)N1CCN(C)C2(CC[NH+](C)CC2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205644",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)cc1C(=O)NC[C@H](CC)CCO by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)N[C@@H]2CCN(c3cccc(Cl)c3)C2)C[C@@H](C)O1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94173",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CSc1ccc(Cl)cc1NC(=O)NCCc1cccc(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202021",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cnc(SC2CCCC2)nc1NC1CC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88614",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)N(C)Cc3ccc(Cl)s3)cc2)C[C@@H](C)O1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96190",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(CNC(=O)C(=O)Nc2ccccc2C)cc1OC(F)F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127950",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)Nc1ccc(F)c(NC(=O)Cc2ccccc2Cl)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107116",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(NC(=O)CN2CCO[C@H](c3ccc(F)cc3)C2)no1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[NH2+][C@@H]1CCC[C@@H]1c1nc(-c2ccc(F)cn2)no1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30197",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1cccc(O)c1)NC[C@]1(O)CCCc2ccccc21 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23060",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)Oc1ccccc1 by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124796",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule SCC1(COC/C=C/c2ccccc2)CCC1 by substituting a thiol with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5373",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cnn(CC[NH2+][C@H](c2ccc(Br)cc2)C2CC2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69802",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC1CCN(C(=O)N[C@@H](Cc2ccc(Cl)cc2)c2ccccc2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106391",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCc1nc2ccc(F)cc2[nH]1)C(=O)[C@@H](C)n1cc[nH+]c1C(C)C by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H](c1cccc(Cl)c1)[NH+]1CCCC1)[C@@H]1CCS(=O)(=O)C1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77734",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule COc1ccc(/C=C/c2nc(C(=O)[O-])ccc2C#N)cc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202025",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)N1CCN(C(=O)c2cccc(OC)c2F)CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34028",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(F)ccc1O[C@H](CCN1CCOCC1)c1ccc(F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87173",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2sccc2c(=O)n1NC(=O)c1cccc(C(F)(F)F)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119205",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)CC[C@@H]1CCCN(C(=O)c2ccc(F)c(Br)c2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccccc1NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1Cl by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105626",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1nc2ccccc2s1)Nc1ccc(F)c(F)c1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63742",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(CC1CC[NH+](CCc2ccc(Cl)cc2)CC1)C(=O)c1n[nH]c2c1CCCC2 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90268",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CCCC[C@H]1OCC(=O)NNc1cc(C#N)cc(Cl)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145652",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H](Sc1nc2ccc(Cl)cc2c(=O)n1CC(C)C)C(N)=O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100750",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H](CN(Cc1ncccc1C(F)(F)F)C1CC1)c1ccccc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cccc2c1CCN(CN1C(=O)C(=O)c3cccc(F)c31)C2 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1c(C(=O)NNC(=O)c2ccco2)cnc2ccc(Cl)cc12 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CN(C(=O)C/C(N)=N/O)CCO1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145604",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2c3oc4c(O)c(O)ccc4c3nc3c2c(=O)[nH]n3C(C)C)c(OC)c1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219341",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OP(=O)(OC(C)C)[C@H](O)c1ccc(C(C)C)cc1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78453",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1sc(C[NH+](C)CC(=O)Nc2cc(C)ccn2)cc1Br by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190585",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COc1cc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2)ccc1O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120950",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCn1c(N/N=C/c2ccc(F)cc2)nc2c1c(=O)[nH]c(=O)n2C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172123",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(=O)[C@@]1(O)CC[C@H]2[C@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217289",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)N(CCO)c1ncnc2c1CCCCC2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccnc2nc(C(=O)N3CCC[NH+](Cc4cn5cc(Cl)ccc5n4)CC3)nn12 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185290",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1[nH]c2scc(-c3ccccc3Cl)c2c(=O)n1-c1ccc(Cl)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205150",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2Nc3c(C(=O)[O-])cccc3[C@H]3[C@H]4CC[C@H](C4)[C@H]32)cc1[N+](=O)[O-] by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCNC(=O)COc1cccc(NC(=O)N(C)[C@@H](C)c2ccccc2F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13776",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCNC(=O)c1ccc(Cl)nn1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5441",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@H]1[C@@H]2CC[C@@](O)(N2)[C@H](O)[C@@H]1O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=C(\\CCC(=O)[O-])c2nc3ccccc3s2)cc1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101293",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Br)c(C(=O)[C@]2(C)CCCO2)s1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCOCCCC(=O)N1CCN(CCO)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2950",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)Nc1ccc(F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35923",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S(=O)(c1ccccc1)N(F)S(=O)(=O)c1ccccc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219677",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C([O-])CCCCN1C(=O)CCc2cc([N+](=O)[O-])ccc21 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143954",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOCCOc1ccc(Cl)cc1NC(=O)N[C@@H]1C[C@H]1C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136605",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nc(-c2ccc(F)cc2)cs1)Nc1ccc(Br)cn1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94536",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1CN(S(=O)(=O)c2cc(Br)ccc2Br)C[C@H](C)O1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2cccc(Cl)c2)c(O)c1/C=N/c1sc2c(c1C#N)CCCC2 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243458",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(C)nc1NC(=O)CCCc1cc(F)ccc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224130",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c2ccccc2c1C(=O)NCCc1c(F)cccc1F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76279",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C#N)ccc1OCC(=O)Nc1ccc(C(C)=O)cc1 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229011",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)NC[C@H](CCO)c1ccccc1)c1ccsc1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203324",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1C[C@@H]([NH3+])CN(c2cccc(F)c2C(N)=O)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128324",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](CNC(=O)c1cnc([C@H]2CCCO2)s1)Oc1ccccc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20928",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(/N=C(\\[O-])c1cn(Cc2ccccc2)nn1)c1ccc(F)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70165",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc(F)c(Cl)c1)NC[C@@H]1CCCN(c2ncccn2)C1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=O)c2ccccc2n2c(CNc3cccc(Br)c3)nnc12 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1nc2cc(Cl)ccc2cc1N by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73611",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1c(NCCc2cccc3cccnc23)ccc2ncccc12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234832",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Nc1cccc2ncccc12)c1ccc(Cl)s1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176024",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1-c1cnc(Br)cn1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217298",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1(C)CCN(C(=O)N[C@@H]2C[C@H]2c2ccccc2F)CC1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94210",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CN1CCO[C@@H](CNC(=O)c2ccc(C#CCCO)s2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[C@@H](CC(=O)Nc1cccc([N+](=O)[O-])c1)[NH2+][C@H]1CCC[C@@H]1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234636",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)cc2)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31450",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4039",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(CN2C(=S)N(C)C(=O)[C@@H]2CC(=O)Nc2ccc(F)cc2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105313",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Brc1ccccc1[C@@H]1CN(Cc2ccon2)CCO1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118111",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc([C@@H](C)N[C@H]2CC[NH+](C3CC3)C2)cc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115394",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(NC(=O)C(=O)NC[C@H](O)C2CCOCC2)c(C)c1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26613",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1ncnc1C[C@@H]([NH2+]CC)c1c(F)cccc1F by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60353",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(CCNC(=O)c2ccc3c(c2)CCN3S(=O)(=O)c2ccc(Cl)cc2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46654",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)[C@H](CO)[NH2+][C@@H]1CCO[C@@H](C(C)C)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H](CO)Cc1c[nH]c2ccccc12)c1ccc2sccc2c1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H](CO)NC(=O)Cc2c(C)nn(C(F)F)c2C)c1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(/C=C/c1ccc(N2CCCC2=O)cc1)N1CCN(CCO)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171519",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)NC(=O)Nc2ccccc2CC(N)=O)cc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36277",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+][C@@H](CCc1ccccc1)Cc1ccc(O)cc1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146332",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1ccc(CNc2ccccc2[NH+]2CCC(O)CC2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203410",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C(=O)N2CCC([NH+]3CCCC3)CC2)c(Cl)n1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142155",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H](NC(=O)c1ccccc1OC1CCN(S(C)(=O)=O)CC1)c1ccc(F)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119071",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@H](C#N)[C@@]1(O)CCCC1(C)C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120778",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1cc(C(=O)[O-])c(-c2ccc(F)cc2O)cn1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51927",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC[C@@H](C[NH3+])[C@H](O)c1ccc(C)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241798",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule N/C(CC(=O)Nc1ccc(Cl)cc1)=N\\OC(=O)c1ccc(C(F)(F)F)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189305",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)C[C@@H]1C=CCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45858",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]1CCCCN1C(=O)C[NH+](C)Cc1ccccc1F by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213823",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1ccc([C@@H](Cl)[C@@H]2COc3ccccc3O2)cc1Br with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64621",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-[n+]2noc([O-])c2C(=O)NCc2ccccc2Cl)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13834",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCC(=O)NCC(=O)N[C@@H]1CCC[C@H]1c1ccccc1C(F)(F)F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248878",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(F)c(NC(=O)C(=O)NC[C@H](C2CCCCC2)[NH+](C)C)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41515",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "914",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCCCOc1cccc(NC(=O)C(=O)NC2CCC(O)CC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184575",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(CCc1ccncc1)c1cnn(C)c(=O)c1Br by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25241",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)(C)OC(=O)N1CC[C@H]([NH+]2C[C@H](O)[C@H](O)C2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134166",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]1NC(=O)[C@H]2CN(C(=O)Oc3ccc(F)cc3)CCN2C1=O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1158",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](Oc1ccc(F)cc1)C(=O)N1CCCC[C@H]1CNS(C)(=O)=O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91469",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[C@@H](O)c1ccc(Cl)cc1)Nc1ccccc1N1CCCC1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56732",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1n[nH]c(N/N=C/c2ccc(O)cc2)n1)N[C@@H]1CCCc2ccccc21 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201673",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C(=O)NC(=O)N1CC(=O)N1CCC[C@H]1c1ccc(F)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108575",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)Nc1ccc(/C=C\\C(=O)c2ccc(Cl)cc2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37960",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Brc1cnc2n1CCCC2 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244580",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCCCNc1cc(-n2cnnn2)ccc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1cccc2[nH]c(CN(C[C@H]3CCCO3)[C@@H]3CCSC3)nc12 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243956",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccccc1NC(=O)CS[C@H]1N=C2N=NC(C)=C2C(=N)N1c1cccc(Cl)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233051",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cc2ncn(C[C@H](O)COc3ccc(C(C)C)cc3)c2cc1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12956",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[S@](=O)c1ccc(C(=O)Nc2cccc(I)c2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179410",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)N(C1CC1)[C@H](C)c1ccco1)c1ccc(F)c(F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134167",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C1[C@@H]2[C@@H]3C=C[C@@H](C3)[C@H]2C(=O)N1CCO with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31377",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCC[C@@H]1CCC[NH+](Cc2ccc([N+](=O)[O-])c(N)c2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96267",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN(CCCO)c1ncc(C)c(C)n1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241685",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccnc1)c1ccc(=O)n(Cc2ccc(F)cc2)n1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202224",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H](CCO)N(Cc1ccccc1)C(=O)c1cc2c([nH]c1=O)CCCC2 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126634",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COCCN1CCC[C@](O)(CN2CCN(c3[nH+]cccc3C)CC2)C1=O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46291",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(/C=C/C(=O)[O-])c(Br)cc1OCC#N by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117468",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H]1C[C@@H](O)[C@@H](CO)C1)c1ccc2c(c1)OCO2 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(NC(=O)c2cc3c(F)cccc3s2)c(OC)cc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51731",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1ccc(-n2c(C)cc(/C=C(\\C#N)C(=O)Nc3cc(C)cc(C)c3)c2C)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98424",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN1CCO[C@@H](COc2ccc(Br)c(F)c2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53515",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(CNc2ccc(C)cc2OC)c([N+](=O)[O-])cc1O by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8127",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCNC(=O)N1CC[C@@H](NC(=O)N[C@@H]2CCCc3ccc(F)cc32)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90652",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC(CC)[C@@H](CNC(=O)Nc1cc(F)ccc1F)N1CCOCC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54343",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(N2C[C@](O)(c3ccc4c(c3)OCCO4)[N+]3=C2CCCCC3)c1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cccc(NC(=O)c2cc(Br)ccc2F)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26348",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C(=O)NO[C@H]2CCCCO2)c(O)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccccc1N[C@H](C)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58407",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1nc2c[nH+]ccc2n1Cc1cc(Br)cs1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169068",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2181",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1ccccc1[C@@H]1C[C@H](C)N(c2ncc([N+](=O)[O-])c(N)n2)C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110142",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(NC(=O)CCN2[C@@H](C)COC[C@@H]2C)c(OC)cc1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192040",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC[NH+]1CCN(c2ncnc(N(CCC#N)CCC#N)c2N)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133509",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nccn1-c1ccc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145713",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCN1C(=O)[C@](C)(C(=O)Nc2ccc(F)cc2)Sc2ccccc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153867",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCOc1ccc(C(F)(F)F)cc1C(=O)NC[C@H]1CCC[C@H]1O by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32503",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCS[C@H]1CC[C@H](NC(=O)c2ccc(N3CCC(O)CC3)cc2)C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule OCc1ccc(Oc2ncc(Br)cn2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55764",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1csc2nc(-c3ccc(F)cc3)cn12)NCCn1nc(-c2cccs2)ccc1=O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234281",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C(=O)N1CC[C@@H](O)C1)c1cccc(C(F)(F)F)c1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182054",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(OCC(=O)Nc2ccccc2C(=O)NCC(C)C)ccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128178",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1cc(CN2CC[NH+](Cc3ccccn3)CC2)cc(OC)c1O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146115",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNS(=O)(=O)c1ccc([C@H](C)NC(=O)/C=C(/C)c2ccc(F)cc2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68158",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1cccc(Br)c1)C1CCN(c2ccc(N3CCOCC3)nn2)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51054",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1csc([C@H](C)NC(=O)c2cccc(Br)n2)n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule Cc1cc(C)c([C@@H]2C(C#N)=C(N)OC3=C2C(=O)CCC3)c(C)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81309",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOC(=O)[C@H]1CCCN(c2nncc(-c3cccc(F)c3)n2)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9910",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C#CCN1CCN(CC(=O)N2CCN(c3cccc(F)c3C#N)CC2)CC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51874",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COCC[C@]1(CO)CCCN(C(=O)CCc2c(C)n[nH]c2C)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](CCO)NC(=O)N[C@@H]1CCC[C@H]([S@@](=O)CC)C1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=C2/N=C(c3ccc(OC)c(Br)c3)OC2=O)c(OC)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149520",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N/C(=N/O)c1ccc(Sc2cccc(F)c2)c(F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174312",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N#Cc1c(NC(=O)c2cc(F)ccc2Br)sc2c1CCC2 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102089",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCc1cccc(C(=O)N2CCN(Cc3ccncc3)CC2)c1O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72997",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(C)cc1NC(=O)C(=O)N/N=C\\c1cc2c(cc1Br)OCO2 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110809",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CC(/C=C/c2cccc([N+](=O)[O-])c2)=Nc2ccccc2N1 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123040",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CNC(=O)[C@H](NC(=O)COc1ccc(C)cc1)c1ccc(F)c(F)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109675",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cccc(C(=O)Nc2ccnn2Cc2ccc(C)cc2)c1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104079",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](C)[C@@H](CNC(=O)Cc1cccc(Cl)c1)c1ccc(F)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67141",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nn(C)c(C)c1C(=O)Nc1ccc(Br)c2cccnc12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11092",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)COc1ccc(NC(=O)c2ccc(Br)o2)cc1Cl by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84860",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(S[C@H](C)C(=O)Nc2ccc(Cl)cc2C(N)=O)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21311",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1OCCN(C)CC#N by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192023",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1noc(CCCC(=O)Nc2cc([N+](=O)[O-])ccc2O)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6173",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1noc(C)c1S(=O)(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7504",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@H]([NH3+])c1cc(F)ccc1OCCCC#N by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115570",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(/C=C/c1ccc(F)cc1)NC(=S)NCCc1ccccc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174400",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC1=C(C(=O)Nc2ccc(C)cc2)[C@H](c2ccc3c(c2)OCCO3)n2nc(CO)nc2N1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C(=O)Nc1ccc(C)c([N+](=O)[O-])c1 by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57453",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS[C@H](C)C(=O)[C@@H](C#N)c1nc(C(C)C)cs1 by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137088",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1cccc(Cl)c1Cl)C(C)(C)C by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23245",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1cccc2cccnc12)Nc1ccc(Br)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134358",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CCC(=O)Nc1ccc(Cl)c(S(=O)(=O)N(C)C)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68644",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCCN(c1nc(Cl)ncc1C)[C@H](C)COC with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11063",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CC[C@H](C)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1OC by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197255",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@H](C)Sc1ccc([N+](=O)[O-])cc1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242299",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC1(C)CC[NH+]([C@@H]2CCCC[C@@H]2C#N)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54307",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCCCCC[C@H](O)c1cscc1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68399",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1ccc(C(=O)NC2CC2)cc1NC(=O)Cc1cccc(OCC#N)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34097",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCOC(OCC)[C@@H](O)Cc1ccccn1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153664",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C)c(OC[C@H](O)CN2CCN(S(C)(=O)=O)CC2)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146887",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CN(Cc1ccccc1O)C(=O)c1cnc([C@H]2CCCO2)s1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145834",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cccc(-n2c([S-])nnc2-c2ccccc2O)c1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9370",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](Cl)c1nc2cc(Br)cnc2n1[C@@H](C)c1ccccc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248804",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCN1C(O)=NC(O)=C2C1=NC1=C(C(=O)c3ccccc31)[C@H]2c1ccc(C(=O)[O-])cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99976",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cccc(F)c1[C@H](C)NC(=O)N(C)[C@H](C)Cc1cccs1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238823",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2cn3nc(N4CCC(C(=O)Nc5ccccc5F)CC4)sc3n2)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1ccc(CSc2ccccn2)cc1)C(F)F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188577",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](c1cc(F)ccc1Br)[C@H](C)c1ccccn1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226655",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC[NH+]1CC[C@@H](C(=O)N2CCC(Oc3ccccc3F)CC2)C1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93962",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)Cn2ncc3cc(-c4ccccc4Cl)ccc32)n(C)n1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)COC(=O)/C=C/c2ccc([N+](=O)[O-])o2)cc1C by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20740",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC1=N[C@@H]2C=CC(C(=O)N3CCC([C@@H](Cc4ccc(F)cc4F)N(C)C(=O)C4CC4)CC3)=CC2=C1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249284",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1cc(C(=O)/C=C/c2ccccc2C)ccc1O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18468",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CCN(C(=O)C2CCN(c3ccc(Cl)nn3)CC2)CC1)Nc1ccc(F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1nn(C)cc1C(=O)N1CCN(C[C@@H](O)c2cccs2)CC1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28785",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)CCC(=O)c3ccc(Br)cc3)CC2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H](C(=O)[O-])[C@@H](C)[NH2+]C[C@@H]1CCCC[C@@H]1CO by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97261",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-c2ccc(C)c(S(=O)(=O)NCc3ccc(Br)cc3)c2)on1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240659",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@](O)(Cc1cccc(O)c1)C1CC1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35150",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nn(C)c(C)c1CCNC(=O)N[C@H](c1cccc(C(F)(F)F)c1)C1CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53043",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)[C@@H](NC(=O)[C@H](C)c1ccc(Br)s1)C(C)(C)C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62185",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(-c2ccc(F)cc2)nc1SCC(=O)Nc1ccccc1F by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCNC(=O)C(=O)Nc1ccc(Cl)cc1C(F)(F)F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32406",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule N#Cc1cc(F)cc(-c2nc(N)ccc2[N+](=O)[O-])c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36841",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(COc1ccc(F)cc1)N1CCN(c2cc(N3CCCCC3)c(F)cc2[N+](=O)[O-])CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141861",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4149",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CCCCl)NNC(=O)c1ccc(Cl)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139047",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCN(c2ccc(-c3ccccn3)nn2)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125189",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCCN(C)C(=O)C(=O)Nc1cc(N2CCCC2=O)ccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176201",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1COCC(=O)N1Cc1nnc(-c2ccc(Cl)cc2Cl)o1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CSc1ccc([C@H](C)[NH2+][C@@H]2CCc3cc(Cl)ccc32)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196502",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1ccccc1I)c1ccc(Cl)c([N+](=O)[O-])c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19335",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(CC(=O)N2CCOCC2)cc1)c1cc(Cl)c[nH]1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71476",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc([C@@H]2[NH+]=C(C(C)C)N(C3CC3)C2=[NH2+])ccc1Br with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69078",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnnn1-c1cc(NC(=O)N[C@@H]2C[C@@H]2C)ccc1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104558",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1ccccc1C#CCN1CCOC[C@@H]1C1CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244972",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)=NNC(=O)Nc1ccc(C)c(Cl)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135609",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)c1ccc(C(=O)[O-])cc1S(=O)(=O)Nc1cccc(Cl)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1Cl)[C@H](C)[C@H](CC(=O)NC1[NH+]=c3ccccc3=[NH+]1)C(=O)O2 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47088",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC[NH+]1CCN(c2ccc(F)cc2[N+](=O)[O-])CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Br)c(/C=C(/C#N)C(=O)NC2CCCCCC2)cc1OC by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103319",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1CCC[C@H](C)N1C(=O)CNS(=O)(=O)c1ccc(Cl)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141941",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(COc1ccc2c(c1)oc(=O)c1ccccc12)Nc1ccc(Br)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26668",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[NH2+][C@@]1(C(N)=O)CCC[C@@H](Sc2ccccc2Br)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37072",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(/C=N/NC(=O)C(O)(c2ccccc2)c2ccccc2)cc1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154957",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CCOc1ccc(N2C(=O)S/C(=C/c3ccccc3[N+](=O)[O-])C2=O)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232206",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(Cl)cc1NC(=O)CN(C)S(=O)(=O)c1ccc2[nH]c3c(c2c1)CCCC3 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27345",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H](CN1CCN(c2ccccc2F)CC1)c1ccc2c(c1)OCCCO2 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#C/C(=C1/SC[C@@H]([C@H]2CC=CC=C2Cl)S1)n1ccnc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](C)CCNC(=O)CN1CCN(c2cccc(Cl)c2)C1=O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161305",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)([N-]c1nnc(C2CC2)s1)c1c(Cl)cccc1Cl by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66238",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(Cc1ccc(C[NH3+])cn1)c1ccc(F)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230778",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cccc2c1OC1(CCN(C(C)=O)CC1)N1N=C(c3ccccc3Cl)C[C@H]21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112539",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOc1ccc(Nc2scc(-c3ccc(Cl)cc3)[n+]2N2CCOCC2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229021",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CN(C[C@@H](O)CN1CCOCC1)C(=O)c1nccc2ccccc12 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(C(=O)Oc2ccccc2F)cn1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)S(=O)(=O)CC(=O)N(C1CC1)[C@H](C)c1ccc(Cl)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216113",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#Cc1c(NC(=O)CCCc2nc(-c3ccccc3)no2)sc2c1CCCC2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221792",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Nc1cccc(Br)c1CO by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76887",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nc(-c2cncc(Br)c2)nc(NN)c1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39784",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(N2CCC[C@H](C[NH+]3CCCC3)C2)c(C(=O)[O-])c1)c1ccccc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31995",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H]1CCC[C@H](NC(=O)C/C(N)=N/O)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC1(C(=O)N2CCCC[C@@H]2CCCl)CCCC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73619",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N#Cc1ccc(F)c(CN[C@H]2CCOc3c(Cl)cccc32)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10200",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(O[C@H](C)CNC(=O)N2CCC[C@@H](CCO)C2)cc1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239860",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CNC(=O)c1cccc(Br)n1)Nc1ccc(F)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(/C=C2\\SC(=O)N(CCOc3ccc(F)cc3)C2=O)c(OC)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135735",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)NC(=O)CN1CCN(c2ccc(O)cc2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107037",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(Cc1cccc(NN)[nH+]1)Cc1cc(Br)cs1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152614",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccc(Br)c(C(F)(F)F)c1)C1CCC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171605",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNC(=O)c1ccc(Cl)cc1NC(=O)[C@H](C)Oc1ccc(C)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134217",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNC(=O)NC(=O)COc1ccc(C#N)cc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C=C(C)n1c(=O)n(C[C@@H]2CC2(Cl)Cl)c2cc(C)c(C)cc21 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@](N)(c1cc(F)cc(F)c1)c1ccccc1C(F)(F)F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70040",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCC1CCN(C(=O)c2ccoc2)CC1)c1ccc(Br)o1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241353",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)[C@@H]1C(=O)NC[C@@H]1c1ccc(Cl)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191679",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](c1ccon1)N(C)C(=O)c1cn(Cc2ccccc2F)nn1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50985",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1cc(Br)cc(CO[C@@H]2CC[NH2+]C2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174856",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Cc1ccccc1Cl)Nc1ccc(NC(=O)c2ccco2)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H](C(=O)Nn1cnc2c(cnn2-c2ccc(F)cc2)c1=O)c1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157145",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cnc(C)c(-c2cc(F)cc3c2O[C@@H](CNC(=O)Cn2nc(C)cc2C)C3)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92419",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(F)c(NC(=O)c2c(C)nn(C)c2C)c1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157131",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(C)[NH2+]C[C@@H](Cc1nccs1)c1ccc(Br)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189602",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)CCn1c(C2CC2)nnc1[S@](=O)Cc1ccc(F)c(F)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118564",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(F)cc1Cl)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102111",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NS(=O)(=O)c1ccc(NC(=O)NCCc2c(F)cccc2F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14580",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc([C@@H](C)CC(=O)NNC(=O)NCC(F)(F)F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146371",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NNC(=O)c1cccnc1OCC(F)(F)F)c1ccc2ccccc2n1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160103",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCC(=O)Oc1cccc([N+](=O)[O-])c1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1cccc([C@H](O)CN[C@@H](C)c2ccc(N3CCOCC3)cc2Cl)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134049",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COCCSc1nnc(NC(=O)c2c(-c3ccccc3Cl)noc2C)s1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102367",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1ncc(Br)cc1S(=O)(=O)N1C[C@H](C)[C@@H](C)C1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198222",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([O-])[C@@H]1CCCN(C(=O)Cc2ccc(F)cc2F)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135560",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[C@H]([NH2+]C[C@H](O)C2CCOCC2)C(C)(C)O1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215769",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccccc1-c1ccccc1C(=O)NCc1ccc(C[NH+]2CCCC2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187453",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc(F)cc1Br)Nc1ccc2c(c1)OCCCO2 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62202",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(CSc1nc2ccc([N+](=O)[O-])cc2s1)NCCc1ccc(Cl)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule OCc1nc2ccc(-c3ccc4c(c3)OCCO4)cc2[nH]1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88851",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C=C(C)Cc1ccccc1Br with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOc1ccc(-c2csc(/C(C#N)=C/Nc3ccccc3F)n2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30265",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CN(C(=O)c1ccc(C#N)cc1)C1Cc2ccccc2C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134755",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccccc1F)NNC(=O)c1c[nH]c2cccc(F)c12 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3017",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C1CCC[C@H]1[C@@H]1CCC[NH+]1Cc1ccc(Cl)cc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186994",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCCCCC(=O)Nc1cc(C(F)(F)F)ccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC#CC[C@H](O)[C@]1([NH+](C)C)CCC[C@H](C)C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67061",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)CNc1cc(N2CCC[C@@H]2CO)ncn1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127965",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](O)[C@@H](C)c1cccc(F)c1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246395",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)N1CCCC[C@H]1C(=O)Nc1ccc(Cl)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79240",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H]1CC[C@H]([NH+]2CCC(C(=O)Nc3ccccc3Br)CC2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207735",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Brc1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccncc1)N2 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164354",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#C[C@@]1(NC2CC2)CC[C@@H](Oc2ccc(F)cc2F)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192791",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C2(O)CCN(C(=O)[C@H](Cc3c[nH]cn3)n3cccc3)CC2)nc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2[nH]c3c(N4CCN(c5cccc(Cl)c5)CC4)ncnc3c2cc1OC by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87384",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1-c1noc([C@H](C)SCC2(CO)COC2)n1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131411",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH2+]C1CCCCC1)Nc1ccc(F)c(Cl)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234614",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C1NC[C@H](C(=O)N2CCc3[nH]c4c(Cl)cccc4c3C2)N1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130271",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CC(=O)NC[C@@](C)(O)C2CC2)cc1OC by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCCN(CCC)c1ccc(C(=O)[O-])cc1[N+](=O)[O-] by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196601",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(CN2C(=O)C[C@@H](C(=O)Nc3ccccc3)S/C2=N\\c2ccc(F)cc2)cc1OC with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44066",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H]1CC(=O)N(S(=O)(=O)c2sc(Cl)nc2C)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158369",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc(N2CCN(C(=O)c3nnn(-c4ccc(Cl)cc4)c3-c3cccnc3)CC2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95505",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCc1nc(-c2ccc(Cl)cc2Cl)cs1)c1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97668",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COCCC(=O)Nc1ccc(Br)c(C(F)(F)F)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91269",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1cccc(-c2cn3ccsc3n2)c1)c1ccccc1I by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165662",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)Oc1cc(Cl)ccc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32609",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(c1cc(F)cc(Br)c1)N1CCCC[C@H]1CCO by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18320",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1CC[C@H](CNC(=O)Cc2ccccc2F)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186529",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(=O)Nc1cc(C(=O)NC[C@](C)(O)c2ccc(F)cc2)ccc1C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150241",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(C[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccc(F)cc1)NC1CCCCCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57025",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule OC[C@@H](Br)C(F)(F)Br with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)CC(C)(C)CNC(=O)c1cccc(-n2cnnn2)c1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219322",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCOC)c1cccc(F)c1C[NH3+] by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112471",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)[C@@H](NC(=O)CS(=O)(=O)[C@@H](C)c1c(F)cccc1F)c1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49861",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(C[NH2+][C@H](C)c2sccc2C)c(OC(F)F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#C/C(=C\\c1ccc(N2CCOCC2)o1)C(=O)NCCc1ccccc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137367",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN(CCCC)c1nc(Cl)ncc1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc(OC(F)(F)F)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45989",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CCOc1ccc2nc(S[C@H](C)C(=O)Nc3cccc([N+](=O)[O-])c3)[nH]c2c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58061",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cccc(C(=O)N[C@H](C)C(=O)N2CCO[C@H](c3ccc(F)cc3)C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128183",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H](NC(=O)NCCC[S@](C)=O)c1ccc(C)c(F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159216",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H](CNC(=O)c2cccc([N+](=O)[O-])c2)[NH+](C)C)cc1 by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77702",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)C(=O)NCC1CCN(c2ncccn2)CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187365",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule NS(=O)(=O)CCN(CCO)Cc1cc(Br)ccc1F by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160211",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C1[C@@H](Oc2ccccc2F)[C@H](c2cccnc2)N1c1ccccc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165655",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N=C([O-])N(c2ccc(Cl)cc2)[C@@H](O)[C@H]1[C@@H]1NCCC2=c3ccccc3=[NH+][C@H]21 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65316",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nn(C(C)(C)C)c2nc(C3CC3)cc(C(=O)Nc3ccc(Cl)nn3)c12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81962",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CONC(=O)N[C@H](C)c1ccc(OCC(F)(F)F)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220596",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)N[C@H]2CCCC[C@@H]2CO)c1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81769",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCC[NH+]1Cc1cc(F)cc(C#CCCO)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239230",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@H]([C@H]1Cc2ccccc2O1)[NH+](C)Cc1ccc(CO)o1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21771",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCN(CC(C)C)S(=O)(=O)c1ccc(C)cc1Br by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181521",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=N\\O)[C@@H]1C[C@@]2(C)CC[C@@H]1C2(C)C by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222707",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a aldehyde in the molecule CCN(CC)C(=O)COC(=O)c1ccc(C=O)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101878",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(C(=O)c2c(F)cccc2F)C[C@H]1O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159309",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccccc1C[C@H](O)C(C)(C)[NH+]1CCCCCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78338",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1Cc1ccccc1)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175081",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cn1cc[nH+]c1C[C@@H](O)c1cccnc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144494",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(/C=C/c1ccc2c(c1)OCO2)C[C@]1(O)C(=O)N(Cc2ccccc2Cl)c2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12368",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCc1ccc(F)cc1)N1CCC[C@@H]1c1nc(-c2ccc(F)cc2F)no1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1c(Cl)ccc2s/c(=N/C(=O)[C@@H]3CCCCN3S(C)(=O)=O)n(C)c12 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89951",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a thiol in the molecule S/C(=N\\N=C\\c1c(Cl)cccc1Cl)Nc1ccccc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141815",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(Cl)ccc1N(CC(=O)Nc1ccccc1C(F)(F)F)S(C)(=O)=O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106107",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1[nH]nc(O)c1CC(=O)N/N=C/c1ccccc1[N+](=O)[O-] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1-c1nnc(NC(=O)c2cc(Cl)ccc2[N+](=O)[O-])o1 by substituting a nitro with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192763",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)(C)[C@H](O)CNC(=O)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192105",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(C)c1NC(=S)N/N=C/c1cccn1Cc1ccccc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51505",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule NC(=O)[C@@H](N[C@@H]1CCc2c(Br)cccc21)c1ccccc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179968",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(C)c(OC(=O)[C@@H]2CCCN(CC(F)(F)F)C2)c([N+](=O)[O-])c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)(O)CC[NH2+]Cc1cccc2c1OCO2 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244955",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H]1CCC[C@H]([NH2+][C@@H]2CCCc3cccnc32)C1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193043",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1nn(CCO)c(C)c1C[NH+]1CC[C@H](C)C[C@H](C)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51861",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](Sc1nc2ccc(Cl)cc2[nH]1)C(=O)N[C@H](C)c1ccc(F)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28495",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc(C(=O)N[C@H](C)c2ccccc2Cl)c1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCc1c(N2CC[C@](O)(CC)[C@H](O)C2)nc(C)[nH+]c1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157860",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCCCN(CCO)C(=O)N[C@H](C)C(C)C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143208",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@]1(c2ccc(NC(=O)C3(C#N)CCCC3)cc2)CCC(=O)NC1=O by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164901",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(F)c([C@H](O)[C@H]2CCCC[C@@H]2C(=O)[O-])cc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172147",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(OCc1nc2cc(Cl)ccc2c(=O)[nH]1)c1cc(C2CC2)nn1-c1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168615",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC[C@@H]1CC[NH+](Cc2cn(C)nc2-c2ccccc2F)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14129",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@H]1CCCCN1C(=O)CN1CC[NH+](CC(=O)Nc2ccccc2SCC#N)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177872",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(F)ccc1CCN1CC(C)(C)[NH2+]C[C@H]1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203259",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)OC1=C(OC(C)C)[C@@]2(O)[C@H](C)CC[C@H]2C1=O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83460",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1297",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nnc2ccc(-c3ccc(NS(=O)(=O)c4ccc(F)cc4F)cc3)nn12 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(S(=O)(=O)NCC2CC[NH+](Cc3ccsc3)CC2)cc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34104",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(CC(=O)[C@@H](C#N)c3ccccn3)coc2c1 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201294",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC[C@@](C)(C#N)NC(=O)Cc1noc2ccccc12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64445",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a aldehyde in the molecule Cc1cccc(CN(C)c2ccc(C=O)s2)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc([C@@H](O)[C@@H](CO)NC(=O)c2ccco2)cc1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181206",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](CC(=O)N1C[C@@H](O)C[C@@H]1c1cc(F)ccc1F)c1cccc(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123176",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCn1nccc1NC(=O)c1ccncc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147984",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCn1c(SCC(=O)N(C)C[C@@H]2COc3ccccc3O2)nnc1-c1cccc(Cl)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)c1ccccc1NC(=S)NNC(=O)c1cccc(C(F)(F)F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241396",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN[C@]1(C#N)CC[C@@H]([NH+]2CCCO[C@H](C)C2)C1 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164545",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([C@H](C[NH3+])S(=O)(=O)c2ccc(F)cc2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29517",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](CCO)N(Cc1ccccc1)C(=O)[C@@H]1C[C@@H]1c1ccc(F)cc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76563",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CN(Cc1ncnn1C)C(=O)COc1ccccc1C#N by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147590",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](C(=O)N(C)Cc1cccc(F)c1)N1CCOC(C)(C)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSCc1csc(NC(=O)c2ccccc2)n1)Nc1ccc(F)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)Nc1ccccc1CO by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69568",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCN(C(=O)c1ccc(Br)cc1F)c1cccc(C)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105279",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)NC(=O)[C@H](C)Sc1ncc(-c2ccc(Cl)cc2)n1Cc1ccccc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81146",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(=O)NC1(c2ccccc2)CC[NH+](C[C@H](O)c2ccc(C(C)(C)C)cc2)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105813",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1[C@H]1N[C@@H](C[NH+]2CCC[C@@H]2c2nc3ccc(F)cc3[nH]2)[C@H](C)O1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6070",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cn1cnc2cc(F)ccc2c1=O)NCCOc1ccc(F)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165458",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2ccccc2n1CC(=O)N[C@@H](CO)Cc1c[nH]c2ccccc12 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232079",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCSc1nnc(CNC(=O)c2ccc(Cl)cc2)n1CC with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc([N+](=O)[O-])cc1)N1CCCSC[C@@H]1C[NH+]1CCCCC1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114761",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nnsc1CN1C[C@@H](C(=O)[O-])[C@H](c2cccc(F)c2)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47997",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(C(=O)CCC(=O)N2CCN(c3ccc(F)cc3)CC2)s1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230266",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(c1csc(C#CCO)c1)N1CC[C@@H]2CCCC[C@@H]2C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70695",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCc1nnc2n1CCN(C(=O)c1csc3c1CCCC3)CC2)c1c(F)cccc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170187",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(Cc1csc(-c2ccc(F)cc2)n1)c1nc2ccccc2[nH]1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166193",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N/C(C[C@H]1CC(c2ccc(F)cc2)=NO1)=N\\O by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235045",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@H]1C(=O)C(=O)N(c2ccccc2)[C@@H]1c1ccc([N+](=O)[O-])cc1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100539",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](C)C(=O)N1CC=C(c2ccccc2Cl)CC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162659",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1cccc(F)c1)N[C@H](CCO)c1ccccc1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47079",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCNC(=O)C(=O)Nc1ccc(F)cc1Br by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128517",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)c([C@@H](C)CC[NH3+])cc1F by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172186",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](Cl)[C@H](C)c1ccc(F)c(Br)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41649",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](Oc1ccc2c(c1)[C@@H](c1cccc(F)c1)N(C(=O)C(C)C)CC2)C(=O)N1CCN(C)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4231",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1nn(C[NH+](C)Cc2ccc(Cl)cc2)c(=O)c2noc(C)c12 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150497",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1c(NC(=O)c2ccccc2I)sc2c1CCCC2 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45891",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H](NC(=O)c1ccc(Br)cc1N)c1ccccc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)c2nnn(-c3cccc(C(F)(F)F)c3)c2C)cc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5174",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnccc1NC(=O)C/C=C/c1ccc(F)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236256",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135946",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#Cc1cccc(NC(=O)COc2ccc3cc(Br)ccc3c2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55361",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC[NH+](CCCC#N)[C@H](C)c1cc2ccccc2o1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79860",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(C(=O)[C@@H]1C[C@@H]1c1ccc(C(F)(F)F)cc1)C1CCOCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98067",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSc1ncc(-c2ccccc2)n1-c1ccc(F)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49809",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c([C@@H](C)NC(=O)C[C@H]2C=CCC2)cnn1-c1ccc(F)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239704",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(F)cc(C(=O)N(C2CC2)[C@H]2CCS(=O)(=O)C2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171559",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)CNc2cc(C(=O)Nc3ccccc3)ccc2C)cc1Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248316",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S(=O)(NCc1ccccc1OC(F)(F)F)c1cccs1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107337",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)N/N=C/c2ccccc2Cl)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64357",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C=CCNc1nc(Cl)cc(COC)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62087",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCn1nc(C(=O)Nc2cc(Cl)ccc2O)ccc1=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20860",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)/C=C/Nc2cc(Cl)ccc2OC)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16250",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCOC(=O)N1CCN(C[C@H](O)CO[C@H]2CCC[C@@H]2C)CC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34970",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1nc2ccc(F)cc2c(-c2ccccc2Cl)[nH]1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC/C(C=O)=C\\c1ccc([N+](=O)[O-])o1 by substituting a aldehyde with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161981",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCCc1ccc([C@H](O)[C@@H]2CN(CC)CCO2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226801",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1ccc(N(CCC#N)C(=O)[C@@H](C)[NH+]2CCC[C@H](C(=O)N(C)C)C2)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116833",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N[C@@H]1CCCN(C(=O)Nc2ccc(F)cc2Cl)C1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202082",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NCC(=O)NCCc2ccccc2[N+](=O)[O-])cc1C by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1ccc(F)cc1S(=O)(=O)N[C@H](C#N)c1ccccc1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218436",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(CNC(=O)NCCCn2cnc3ccccc32)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101844",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([O-])[C@H]1CC=CC[C@@H]1C(=O)N[C@@H]1CCCN(c2ccccc2F)C1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124054",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCN(C)C(=O)Nc1ccc(Br)cc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39825",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C[NH2+][C@@H](C)c2cnn(-c3cccc(F)c3)c2C)c(Cl)cc1O by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65132",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1ncc(-c2cc3ncc(S(=O)(=O)C(C)(C)C)c(N)n3n2)c1C(F)(F)F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240290",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Fc1ccc(OC(F)F)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191420",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cc(CNC(=O)c2ccc(CCC(C)(C)O)cc2)n[nH]1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169467",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1ccccc1OC[C@@H](O)C[NH+]1C[C@H](C)C[C@@H](C)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28367",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Cc1nc2cccc(Cl)c2s1)C(F)(F)F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99276",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)CN(C(=O)c1cnc([C@@H]2CCCO2)s1)c1cccc(F)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89300",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCc1nc(SCCO)c2oc3ccccc3c2n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135611",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCCc1nccs1)N(Cc1ccc(F)cc1F)C1CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28962",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(O[C@H](C)C(=O)Nc2cc(Cl)cc(Cl)c2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46135",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C(CN(Cc1ccco1)C(=O)c1cccc([N+](=O)[O-])c1)Nc1ccccc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8983",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](C)N1C[C@H](C(=O)Nc2cccc(F)c2)CC1=O by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206192",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCc1n[nH]c(=O)[nH]1)c1cccnc1OCC(F)F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200726",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)c1ccnc(NCCc2nccc(-c3ccccc3)n2)n1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148653",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1CCC[C@@H](/C=C/CCl)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174004",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1sc2ncn(CC(=O)Nc3nc(-c4ccc(Br)cc4)cs3)c(=O)c2c1C by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129999",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccsc1[C@@H](O)CNC(=O)NCc1cccc2ccccc12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215490",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CN2C(=O)C(=O)c3cc(Cl)ccc32)sc1C by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85146",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@](O)([C@@H]1CCCC[NH2+]1)C(F)(F)F with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209312",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1ccc(/C([O-])=N/S(=O)(=O)c2ccc(C#N)cc2)s1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182542",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCC1(C)CC[NH+](CC(C)(C)[C@@H](C)O)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCCC[NH+]1CCNC(=O)C1(O)Cc2ccccc2C1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70888",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](NCCc1nc(-c2ccccn2)cs1)c1cccnc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C2=NO[C@@H]([C@H]3C=C(c4ccc(F)cc4)N=N3)N2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22186",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(Br)c([C@H](Cl)[C@@H](C)c2ccccn2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCCCCn1ccccc1=O)N[C@H]1C[C@H]1c1cccc(Cl)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114175",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CS[C@H](c2ccccc2F)N1CC[NH+]1CCCCC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126158",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC(=O)c1ccc(NCCNS(C)(=O)=O)c([N+](=O)[O-])c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136609",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1ccc([C@@H]2c3c(oc4ccc(F)cc4c3=O)C(=O)N2CCCOC)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99557",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1ccc(NS(=O)(=O)c2ccccc2)c([N+](=O)[O-])c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106834",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(Cl)c(NC(=O)Nc2ccccc2F)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38839",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#CC1=C(N)C(C#N)(C#N)[C@@H](c2cccc(Cl)c2Cl)[C@H]2CN(Cc3ccccc3)CC=C12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74479",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1ccc(F)cc1)N1CCN(Cc2nc3ccc(Cl)cc3o2)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43824",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=c1c2ccccc2oc2nc(-c3ccc(F)cc3)n(Cc3ccco3)c(=O)c12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145270",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H](Oc1cccc(C=O)c1)C(=O)N[C@H]1C[C@@H]1c1cccc(Cl)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54779",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1C[C@H](C)NC(=O)N[C@@H](CCO)C1CCCCC1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149860",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](C(=O)N[C@@H](c1ccccc1)C(F)(F)F)c1ccsc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170426",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ccc2nonc12 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233456",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccccc1O)c1ccc(Br)cc1Br with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234631",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](CSC)[NH+](C)Cc1cccc(Cl)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40642",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@@H](C(=O)NC(=O)NC(C)(C)C)N1CCN(c2ncccc2C#N)CC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198111",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCSC[C@@]1(O)c1cccc2ccccc12 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148621",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]([NH2+]CCOc1ccccc1Cl)c1cccc(N2CCOC2=O)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24759",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCc1cc(C[NH+](C)C)c(O)c(C[NH+](C)C)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11070",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1noc2nc(C3CCN(C(=O)CCn4cncn4)CC3)cc(C(F)F)c12 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@]1(C)CC(=O)NC(=O)[C@@H]1c1ccccc1Br by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146763",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1sc(CCNC(=O)c2cccnc2Cl)nc1-c1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196551",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCN1C[C@H](C(=O)Cl)CC1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177278",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1cccc(C)c1OCC(=O)Nc1ccc([N+](=O)[O-])cc1O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167221",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](C(=O)Nc1ccc(Cl)cc1)n1ncc(-c2ccc(Cl)cc2)nc1=O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212185",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#CC1=C(N)C(C#N)(C#N)[C@H](c2cccc(Br)c2)[C@H]2CCCC=C12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199774",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@H]1CCCC[C@@H]1NC(=O)NCc1ccnc(OCC(F)F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56893",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1Cc2ccc(OC(F)(F)F)cc2[C@@H]1[NH3+] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105238",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCN1C(=O)/C(=C(/C#N)C(=O)Nc2cc(C)ccc2C)c2ccccc21 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189626",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccccc1C#CCO)N1CCCC1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148479",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)[C@@]1(F)CCN(Cc2ccc(C(C)(C)C)s2)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201834",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccc(Cl)c1)N(CCN1CCOCC1)c1nc2c(F)cc(F)cc2s1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128945",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1cccc(NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(S(=O)(=O)N2CCCCCC2)ccc1OCC(F)(F)F)[C@H]1CCCO1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46183",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccccc1NC(=O)CN1CCN(c2[nH+]ccn2-c2ccccc2F)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233687",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Clc1ccc([C@H]2NN=C(c3ccccc3)S2)c(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176718",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccccc1Cl)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51096",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nnc(C(F)(F)F)s1)N1CCC(c2ccccc2)CC1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98124",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CCc1nn(C)c(NCc2cccc([C@@]3(C)NC(=O)NC3=O)c2)c1[N+](=O)[O-] with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)[C@](C)(N)C(F)(F)F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "878",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nn(C)cc1[C@@H](C)NC(=O)[C@@H]1CC(=O)N(c2ccc(F)cc2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96698",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cs/c(=N\\S(=O)(=O)c2cc(C)c(Br)s2)[nH]1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110217",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCCCCl)[C@H]1CC(=O)N(CCC2=c3cc(F)ccc3=[NH+]C2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210938",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](CNC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1=O)[NH+](C)C1CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36608",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2c(c1)OCO2)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199558",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCC(=O)N[C@H]1CCCN(c2cc[nH+]cc2Cl)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11944",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](CN1CCCC1=O)NC(=O)N[C@@H]1C[C@@H]1c1ccccc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93392",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCC(=O)NCCNC(=O)c1ccccc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nc(-c2ccccc2F)sc1C(=O)NCc1ccc(C(=O)[O-])cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176357",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cc(Cl)c(Cl)cc1NCCc1cccnc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140588",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@H](CC1CCOCC1)[NH2+][C@H](CO)CC(C)(C)C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171841",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)C(=O)CNC(=O)c1cc(Cl)cc(Cl)c1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86313",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)c1sc(COc2ccc(Cl)c(C)c2)nc1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60444",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2C[C@H](c3ccc(Cl)cc3)N(C(=O)C(C)C)c3ncnn32)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21902",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C)cc1[C@@H](O)CN1CCN(c2nccs2)CC1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)C1CCC1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155229",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COCCN1C(=O)Cc2c1nc(N)c1c(N)nc(N3CCC(C)CC3)c(C#N)c21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142827",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C(=O)NCCN1C(=O)COc1ccc(Cl)cc1Cl by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71257",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CCn1cc(C(=O)Nc2cc([N+](=O)[O-])ccc2OC)c(=O)c2ccc(C)nc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72463",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC[C@@H]1CN(C(=O)c2ccc(Cl)c([N-]S(C)(=O)=O)c2)CCO1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238501",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC1(C)CCCC[C@]1(O)[C@@H]1NCCc2ccccc21 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222119",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)(C)c1cc(C[NH+]2CCC3(CC2)[C@@H]([O-])C[C@H]3O)n[nH]1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116828",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(-c2ccccc2)sc1CN1CC[C@](O)(C(F)(F)F)C1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231583",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(F)cc1)Nc1nc2ccc([N+](=O)[O-])cc2s1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149601",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CSc1ccc2cc(CN3C(=O)N[C@](C)(c4ccco4)C3=O)c(Cl)nc2c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119380",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(F)ccc1NC(=O)[C@H]1CCCN(S(=O)(=O)C2=CN=C(C(=O)N3CCC(C)CC3)C2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228283",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(N2CCN(C(=O)[C@H]3CCCN(c4nc(Cl)nc5[nH]cnc45)C3)CC2)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67992",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H](Nc1nccc(Oc2ccc(F)cc2)n1)c1ccncc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53199",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)Nc1cccc(Cl)c1)[NH+](C)CC(=O)N(C)C by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183645",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H](c1nc(-c2cncc(Br)c2)no1)[C@H](C)[NH3+] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183512",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)c1ccc2cc(C(=O)N(C)Cc3ccc(Br)o3)[nH]c2c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238478",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Oc1ccc(/C=N/N2C(=S)[NH+]=N[C@@H]2c2ccc(F)cc2)cc1O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)c1ccsc1NC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150331",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(Nc2ncnc(NNC(=O)c3ccc(Cl)cc3)c2[N+](=O)[O-])c1 by substituting a nitro with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93360",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCc1sc(/C([O-])=N/S(=O)(=O)c2ccc(C#N)cc2)cc1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43156",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)NC(=O)c2ccc(Cl)s2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161028",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)(C)n1ncc2c1CCC[C@@H]2NC(=O)CN1CCCc2cc(Br)ccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22544",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C/C(=N/Nc1nncc2ccccc12)c1ccc(N2CCCCC2)c(F)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155797",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCN(Cc1cn2c(C)cc(C)nc2n1)C[C@@H](O)c1ccc(C)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111480",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COc1ccc(CN2CCN(CC(=O)NC(C)C)CC2)cc1[N+](=O)[O-] with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138980",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[C@@H](CO)NC(=O)N[C@@H](C)c1ccc(-c2ccccc2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33156",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCn1c2c(=O)[nH]c(=O)n(C)c2n2c(-c3ccc(Cl)cc3)nnc12 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228353",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@H](CCc1ccccc1)Cc1nc(-c2ccc(C#N)cn2)no1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237442",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[NH+](C1CCCCC1)[C@H]1Cc2ccc(OC)cc2[C@@H]1O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133875",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN[C@H]1c2c(F)ccc(F)c2S(=O)(=O)[C@H](C)[C@H]1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230305",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)CCN1C[C@H](C(=O)NNc2ccc(F)cc2)CC1=O by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168671",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCSc1ccc(F)cc1)NNC(=O)NCc1ccncc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99724",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H](C)NC(=O)CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(F)cc12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42415",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1N=NC=C(NCc2ccccc2OC2CCCC2)[C@@H]1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164819",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1OC(=O)c1ccc(C(N)=O)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88869",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(Cl)cc1NC(=O)NC[C@H](c1ccc(F)cc1)N1CCOCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40927",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(S(=O)(=O)[C@@H](CNC(=O)c2ccccc2)c2ccco2)ccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131108",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C/C=C(\\C)[C@@H]1C(C)=C[C@H]2[C@@H](O)CC[C@H](C)[C@H]2[C@@H]1/C=C/C=C/C(=O)[O-] with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179702",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NCC(C)(C)[NH+]1CCN(C)CC1)c1ccc(Cl)s1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160076",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCOC(OCC)[C@H](O)c1cncnc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137630",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(=O)N(C)c1ccc(NC(=O)Cc2ccc(C)c(O)c2)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(-n2c(CN3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)nc3cccnc32)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80174",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1c(C)nc(SCc2nc(-c3cccc(Cl)c3)no2)[nH]c1=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185515",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(F)c(C(=O)N[C@H]2CCC[C@H](SCC)C2)c1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101558",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nscc1C(=O)N1CCN(Cc2ccc(F)cc2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191315",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C/C(N)=C(/C#N)C(=O)CSc1nnc2c(Cl)cc(C(F)(F)F)cn12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173395",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cn1cnnc1S[C@@H]1CCN(c2sccc2C#N)C1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25827",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@@H](C#N)CSc1ccccc1NC(=O)c1cc(F)ccc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32305",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=Cc1ccc(N2CCN(c3ccc(C=O)cc3[N+](=O)[O-])CC2)c([N+](=O)[O-])c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21075",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCNC(=O)c1cccc(NC(=O)CNc2cccc(F)c2C)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36466",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cccc2c1SCC[C@@H]2NCCc1n[nH]c(-c2ccco2)n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191665",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)CSc1nc2ccccc2c(=O)n1-c1cc(C(F)(F)F)ccc1C(F)(F)F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18010",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1ccc([N+](=O)[O-])c(N[C@@H](C[NH3+])CC(C)C)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193512",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)Cn1ccc2cc(NC(=O)C(=O)NC3CCC(O)CC3)ccc21 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65570",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCN1CC[C@@]2(CCC1=O)CN(Cc1ccc(Cl)cc1)CC[NH+]2C by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49381",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1nc(-c2cccc(C(F)(F)F)c2)no1)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156318",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(C(=O)N2CCOC[C@@H]2C2CC2)sc2ccc(F)cc12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108007",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CS(=O)(=O)N1CCC(CNS(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122695",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@@H](C)NC(=O)Nc1ccc(Br)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule [NH3+]CC#Cc1ccc(NC(=O)C[C@@H]2CCCCO2)cc1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215991",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CSc1nc2cc(Cl)ccc2o1)Nc1cc(F)ccc1F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Br)cc1N[C@H](C)C(=O)NC(=O)NC(C)C by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31315",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc([C@H]2C[C@H](C(=O)NCc3ccccc3F)CN(C(=O)C3CCCC3)C2)cc1OC by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223464",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(F)c(NC(=O)N[C@H](c2ncc(C)s2)C2CC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68712",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCc1ccc([C@H]2c3c(O)n[nH]c3C[C@@](C)(O)[C@@H]2C(=O)OC)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CN(CC1CC[NH2+]CC1)c1cc(Cl)ccc1C#N by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90490",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CNC(=O)[C@@H]1COc2ccc(NC(=O)c3cccc(Cl)c3)cc2C1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58137",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(Cl)c1NCC(=O)Nc1ccc(N2CCOCC2)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187047",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)Cn1/c(=N\\C(=O)CCS(=O)(=O)c2ccccc2)sc2ccc(Cl)c(C)c21 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130585",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)[C@@H]2CSCN2C(=O)c2ccc(F)c(C(F)(F)F)c2)cc1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119151",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1ccco1)N1CCN(c2ncc(Cl)cc2F)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224983",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(=O)N2CCN(c3cc(Cl)ncn3)CC2)ccc1C#N by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103931",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)[C@H](CC(=O)Nc2ccccc2F)S/C1=N\\c1cccc(F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13547",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCN1C(=O)CCc2cc(NC(=O)c3ccc(F)nc3)ccc21 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14096",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)C1=C(C)Nc2nc(SCc3ccccc3F)nn2[C@@H]1c1ccc(Br)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148350",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)CNc1nc2c(Br)cccn2n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71140",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cn1ncc([C@H](O)[C@H]2CCC[C@H](S(C)(=O)=O)C2)c1N with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21555",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C=C(C)CN(CC)C(=O)[C@@H]1C[C@@H]1c1ccccc1OC(F)(F)F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H]1CCC[C@]1([NH2+]Cc1ccccc1)c1ccccc1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152592",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCOc1ccc(N[C@@H]2CC[C@H]([NH3+])C2)cc1 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93544",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@](CC(=O)Nc1sc2c(c1C#N)CCC2)(C(=O)[O-])c1ccccc1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44585",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](OC(=O)c1ccc(F)cc1OC(F)F)c1ccccn1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191294",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Nc1ccc(Cl)c(SC[C@@H]2CCCO2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184076",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CSc1ccccc1Cl)Nc1ccc(Cl)cc1NC(=O)c1ccco1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)NCCc1cc(Cl)c2c(c1)OCCO2)n1cncn1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34067",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)CN[C@@H](C1CCCC1)C(F)(F)F)C(=O)N(C)C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94619",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](C)[C@H](CNC(=O)c1ccc(I)cc1)Cc1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100803",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc(C)cc1[C@@H](C)[C@@](O)(C(=O)[O-])C(C)C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1ccccc1C(=O)NCC(=O)NCC[C@@H](O)c1ccccc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223635",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)(c1nnnn1-c1cccc(C(F)(F)F)c1)N1CCOCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89845",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(Cl)Cc1ccccn1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88347",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCn1cc(C(=O)C(F)(F)F)cn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14258",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule NC(=O)c1ccc(NC(=O)[C@H]2CCCC[C@@H]2C(=O)OCC(F)(F)F)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123406",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C)c(NC(=O)[C@H](C)O/N=C/C(=O)Nc2ccc(F)cc2)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212001",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(/C=N/NC(=O)OC)cc([N+](=O)[O-])c1[O-] by substituting a nitro with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28882",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CN1C(=O)/C(=C/c2ccccc2F)Sc2ccccc21)N1CCc2ccccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67945",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCc1nn(C)c(Cl)c1CN(C)[C@@H]1CCCC[C@@H]1S(C)(=O)=O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3011",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ncccc1C[C@@H]1CCCC[C@H]1O by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)N(C)Cc2ccccc2O)nnn1-c1ccc(OC(C)C)cc1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122566",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](CNC(=O)[C@@H]1OCC(=O)N(C)[C@H]1c1cccc(F)c1)c1ccc(F)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163988",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC[C@@H](C)[NH2+]CCn1cc(Cl)c(=O)[nH]c1=O by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45448",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]1CCCC[NH+]1CCNC(=O)C(=O)Nc1ccc(F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243454",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C1NC(=O)N(c2cccc(Cl)c2)C(=O)/C1=C\\Nc1cc(Cl)ccc1O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137283",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule FC(F)(F)c1cccc(CNc2ncc(Cl)cn2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12789",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1cccnc1)c1ccc(F)c(C(F)(F)F)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72845",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1ccc(C2=N[NH+]=C(NCc3ccccc3)SC2)cc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85114",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(Cl)ccc1NC(=O)CSc1nc(-c2ccccc2F)n[nH]1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131365",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CCN1CCO[C@@H](C(F)(F)F)C1)NCc1ccccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120187",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Nc1cc(I)c2ccccc2c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246264",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCc1ccc(F)cc1)C(=O)Nc1c2c(nn1-c1ccc(F)cc1)CS(=O)(=O)C2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18496",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC(=O)Nc1cc(Cl)ccc1N1CC[NH+](C)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195847",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc([C@H](C)N2CC[NH2+]C[C@@H]2C(=O)N(C)C)cc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15343",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#CCCn1cc([C@@H]2Nc3ccccc3C(=O)N2CCc2ccccc2)c2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218843",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=S(=O)(c1cc(F)ccc1F)N1CCN(c2nc3ccccc3n2Cc2ccccc2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139650",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C=CCNC(=O)[C@H](C)Nc1cc(C(F)(F)F)ccc1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10555",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a aldehyde in the molecule O=Cc1ccc(OCC(=O)N2N=C(c3ccccc3Cl)C[C@@H]2c2cccs2)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34094",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@@H](OCC1CC1)C(=O)[C@H](C#N)c1nc2sc3c(c2c(=O)[nH]1)CCCC3 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145724",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CN(CC(C)(C)O)C(=O)[C@@H]1CC(=O)N(CCc2ccccc2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185681",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(CNC(=O)NNc2cccc(F)c2F)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76172",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1nn(C)c2nc(N[C@H](CO)CC(C)C)sc12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126575",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cn1cc(C(=O)Nc2ccc(OC(=O)[C@H]3C[C@@H]3[N+](=O)[O-])cc2)cn1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nn(-c2ccc(F)cc2)c(C)c1C[NH+](C)[C@H]1[C@@H]2CCO[C@@H]2C1(C)C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)N[C@@]1(CCC(=O)N([C@@H](C)C(=O)NCc3ccc(F)cc3)CC1)NC2=O by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201610",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](NC(=O)[C@H](C)c1cccs1)c1ccccc1C(F)(F)F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc([C@@H]2C(C#N)=C(N)OC3=C2S(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc23)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179915",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(C)c1ccc(C(=O)Nc2ccc(F)c(Cl)c2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCc1nc(Cl)c(CN2CC[C@@]3(CCCNC3=O)C2)[nH]1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159479",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule BrC1=C[C@@H](c2noc(CSc3ncn[nH]3)n2)SC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177436",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(C(=O)N2CCCCCCC2)sc1Br with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1cnc(S(=O)(=O)N2CCN(c3nc4ccccc4nc3C(F)(F)F)CC2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239000",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule NC(=O)c1ccc(Sc2nnc(C(F)(F)F)n2N)c([N+](=O)[O-])c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186465",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(N[C@@H]1CCS(=O)(=O)C1)c1ccc(-c2ccc(Cl)cc2)o1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57892",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a aldehyde in the molecule O=Cc1ccc(OCc2ccn(-c3ccccc3)n2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133957",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Oc1cccc(F)c1)C1(c2ccc(F)cc2F)CCOCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42662",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1nc(C)c2c(C)c(C(=O)N(C)Cc3ccccc3F)sc2n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20367",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a aldehyde in the molecule O=Cc1ccc(-c2cc[nH]c(=O)c2)s1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222439",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cccc2c1OCCC[C@H]2[NH2+][C@@H]1CCCN(c2cccnn2)C1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162533",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC[C@@H](CC#N)NC(=O)[C@@]1(C)CCCO1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162393",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[NH+]1CCN(c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CSc1nc([O-])c(C(=O)NCCCc2nc3c(s2)CCCC3)cc1C#N by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159557",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(Cc2ccc(C(=O)Nc3ccc(Cl)c(Cl)c3)cc2)c(C)c1[N+](=O)[O-] by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196497",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1c(C(=O)NNC(=O)NC[C@H]2CCCO2)sc2ccc(F)cc12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159310",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cccc(CNC[C@H]2COc3ccccc32)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169072",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)c1ccc(Cl)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161942",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[C@@H](C(=O)Nc1cccc([N+](=O)[O-])c1)n1nc(-n2cccn2)ccc1=O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131923",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule COCCN1C[C@H](C(=O)N2CCN(c3ncccc3C#N)CC2)CCC1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233857",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](C)CCCNS(=O)(=O)Cc1ccc(Cl)c(Cl)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221070",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCCN(C)S(=O)(=O)C[C@@H](C)CCl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139011",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(OC)c(NC(=O)N[C@@H]2CCc3c(F)cccc32)cc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72568",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(O)c(C[NH+](C)[C@H](C)c2cccc(S(N)(=O)=O)c2)cc1C by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55278",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(N1CCOCC1)N1CCO[C@H](c2ccc(Cl)cc2)C1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](SC1=NC=NC2=NC=N[C@@H]21)C(=O)NCCc1ccc(Cl)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94995",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)C(=O)NC[C@H]2Cc3ccccc32)c(Cl)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226724",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(Cc1ccccc1)c1ncnc(NNC(=O)c2ccccc2Cl)c1[N+](=O)[O-] by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198889",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cccc(CCn2cnc3sc4c(c3c2=O)CC[C@@H](NCc2cccc(F)c2)C4)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8848",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(O)CC([O-])=C(C(=O)Nc2ccccc2)[C@H](c2ccccc2C(=O)[O-])[C@@H]1C(=O)Nc1ccccc1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85919",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC1CCC(CC(=O)N2CCC(O)(C(F)(F)F)CC2)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCCO/C([O-])=C1\\C(C)=NC2=C(C(=O)[C@@H](C(=O)OC)[C@@H](C)C2)[C@@H]1c1ccc(O)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79665",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)[N-]c2cc(C(F)(F)F)ccc2-n2cccn2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55047",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NC[C@@H](c1ccco1)[NH+]1CCCCC1)c1cc2ccc(F)cc2s1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196446",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOc1cc(/C=C2\\SC(=N)NC2=O)cc(Cl)c1OCC by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1=O)[C@@H](C)CO by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4579",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C[NH2+][C@H](c2ccccc2)c2cccc(F)c2)cc1OC with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16797",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1c(NC(=O)CSc2nc3ccccc3o2)sc2c1CCCC2 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160792",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCCO[C@@H](C)C(=O)Nc1cccc(C#N)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183863",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)[C@@H](NC(=O)Nc1ccc(OC(F)F)cc1)c1nc(C2CC2)no1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1ccc(OCCOc2ccccc2Br)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66723",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCCNc1cc(C[NH+]2CCC(O)CC2)ccc1[N+](=O)[O-] by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91894",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CO/N=C1\\CN(c2nc3c(cc2F)c(=O)c(C(=O)[O-])cn3C2CC2)C[C@H]1C[NH3+] by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151680",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1ccc(O)c(C(=O)NNC(=O)c2ccc(C)o2)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)S(=O)(=O)CC(=O)N1CCCc2cc(F)ccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16745",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@H](C)NC(=O)[C@H]1CSCN1C(=O)c1ccc(OCC(F)(F)F)nc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192628",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[P@@]([O-])(O)[C@H](O)c1ccc(-c2ccccc2)cc1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218930",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NN(C)c2cnn(C)c(=O)c2Cl)cc1[N+](=O)[O-] by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120993",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCC(CC)NC(=O)[C@H](C)Sc1nncn1-c1ccc(C)c(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136502",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(Cl)cc1)c1ccncc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244472",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1noc(C)c1C(=O)N[C@H](Cc1cc(=O)n2nc(C)cc2[nH]1)c1ccc(F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51761",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1ccsc1NC(=O)C(=O)NCCc1ccc(F)cc1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190799",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#CCCN(CCC(F)(F)F)C(=O)c1cnc2ccccn2c1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112992",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(C[C@H]1SC(N2CCCCC2)=NC1=O)Nc1ccc(Cl)c(Cl)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64256",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(Br)cc(Cl)cc1S(=O)(=O)Oc1cc(F)ccc1[N+](=O)[O-] by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165670",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COc1ccc(-c2nc(CN3CCN(C(=O)c4ccc([N+](=O)[O-])cc4)CC3)cs2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108493",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H]([NH2+]CC(C)(C)[C@H](O)C(C)C)C1CC1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23980",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3)c(/C=[NH+]\\CCN3CC[NH2+]CC3)c2O)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46120",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CNC(=O)c1cnc2c(c1)NC(=O)CO2)NCc1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98455",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCOc1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175623",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(F)cc1NC(=O)C(=O)N[C@@H]1C[C@](C)(OC)C1(C)C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)N1C=Cc2ccccc2[C@@H]1CC(=O)Nc1ccc(Cl)c2ncccc12 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72873",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=S(=O)(Cc1ccccc1)N1CCC[C@H](c2cccc(Cc3ccc(F)cc3)n2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)COc1ccc(NC(=O)c2ccsc2)cc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88241",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc([C@@H]2c3c(C)nn(C)c3NC(=O)[C@H]2NC(=O)c2ccccc2)cc(Cl)c1OC(C)C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227365",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@H](C(=O)NCC(=O)[O-])N1C(=O)/C(=C/c2ccc(O)cc2)SC1=S with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54347",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COCCCNC(=O)c1ccc2c(c1)NC(=O)/C(=C/c1cccc(Cl)c1)S2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155215",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]([NH2+]Cc1nnc(C(C)(C)C)o1)c1ccccc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167891",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1nc(-c2ccc(Cl)s2)cs1)[C@H]1CCCO1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150364",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@H](CNCc1cnn(-c2ccc(F)cc2)c1)c1cccc(F)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207271",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCOc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)[nH]c(=O)c2C#N)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165700",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCCc1cnn(-c2ccccc2)c1)c1ccc(F)cc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11672",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1nnc(N2CCN(S(C)(=O)=O)CC2)c(C#N)c1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCCCN(C)c1ccc2cc(C#N)ccc2n1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92609",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CS[C@@H]1CCC[C@@H]1NC(=O)c1cc(N2CCCC2=O)ccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100828",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC1CC[NH+](CCOc2ccc(F)cc2Cl)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28468",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(NCCCN1CCOCC1)c1csc(C#CCO)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195826",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1C[C@H]([NH3+])CN(Cc2cc(F)ccc2Br)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60889",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cc(CSc2nnc(N3CCOCC3)n2Cc2ccccc2)cc2c1OCCO2 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247129",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NS(=O)(=O)CCNC(=O)c1ccc(C(F)(F)F)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C[NH+]2CCCCC2)c(Cl)c1OC by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153039",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCc2ccccc2N1S(=O)(=O)c1ccccc1F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36255",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc(F)cc1)Nc1cccc(C(F)(F)F)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144474",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccccc1CN(Cc1ccccn1)C[C@@H]1CCCO1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151274",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CNC(=O)Cc1ccc(NC(=O)/C=C(/C)c2ccc(F)cc2F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93383",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C[C@H](NC(=O)N1CCc2[nH]c[nH+]c2[C@H]1c1ccc(F)c(F)c1F)C(=O)OC by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111964",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1O[C@@]1(c1ccccc1)c1ccc(F)cc1F by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236398",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCCN(CC1CC1)C(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155417",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@@H](Cc1c(F)cccc1F)c1ccc(OC)cc1Cl by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30047",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=c1ccc(I)cn1Cc1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138858",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1nc2ncc(C#N)c([O-])c2s1 by substituting a nitrile with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSc1nc2n(n1)[C@@H](c1ccccc1[N+](=O)[O-])C(C(=O)Nc1cccc(C)c1)=C(C)N2 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182540",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c([C@H]2CCC[NH+]2Cc2cc(C(F)(F)F)ccc2F)cnn1C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5364",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC(=O)N(C)c1ccc(Cl)cn1)c1cccc(F)c1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)CNC(=O)Cn1nnc(-c2ccc(Cl)cc2)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184425",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCC(=O)O[C@@H](C(=O)c1ccccc1)c1ccc(Cl)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204277",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](C(=O)NC[C@@H]1CCCO1)[NH+]1CCC(O)(C(F)(F)F)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39729",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC1(C)[C@]2(C(=O)NCc3ccco3)CC[C@@]1(C)/C(=N/OC(=O)c1ccc([N+](=O)[O-])cc1)C2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159655",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc2ncccc2c(=O)n1-c1cccc(NC(=O)c2cccc(F)c2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80026",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c2ccsc2ncn1Cc1c(F)cccc1Br by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41435",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccc(C(=O)C[C@@]2(O)C(=O)Nc3ccc(C)cc32)cc1OC with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64025",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NC[C@H](O)c1ccccc1F)Nc1ccc2c(c1)OCCO2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138463",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H]1NNC(C(=O)[C@]2(C)CO2)=C1c1cccc([N+](=O)[O-])c1 by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69697",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(/C=C(/CBr)C(C)C)c(Cl)c1OC with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209200",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CS(=O)(=O)Cc1ccc(NC(=O)NNc2ccc(F)cc2)cc1F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102553",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(NC(=O)C(=O)NC[C@@]2(O)CCOc3ccccc32)c1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69195",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)N1CCCC[C@@H]1C(=O)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220924",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H]([NH2+][C@H](CO)c1ccc(Cl)cc1)c1ccc2c(c1)OCCO2 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)NCCSc1ccc(Br)cc1N by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76797",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1ccc(C(F)(F)F)cc1)NC(=O)[C@@H]1CSC(=O)N1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COc1cc(Br)c(O[C@@H](C)C#N)cc1Br by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13936",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NC(=O)Cc2c(F)cccc2F)cc(OC)c1OC by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25468",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCn1/c(=N/C(=O)[C@@H](C)COC)[nH]c2cc(Cl)ccc21 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191036",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)Nc1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90965",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(Cl)ccc1OC(=O)C1CCN(C(=O)c2ccco2)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237280",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN1CC(=O)N2[C@H](Cc3c([nH]c4ccccc34)[C@H]2c2cccc([N+](=O)[O-])c2)C1=O by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)c1cc2c(ccn2C)n1Cc1ccc(Cl)cc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N#C[C@H](c1ccc(Br)cc1)N1CCN([C@H](C#N)c2ccc(Br)cc2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39681",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCOc1cncc(N[C@@](C)(C(=O)[O-])C(F)(F)F)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(C)(C)O)S(=O)(=O)c1ccc(C(=O)[O-])s1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9571",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCOC(=O)C[C@@H](C)N1CCO[C@H](C#N)C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72946",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CSCc1ccc(N[C@H]2CC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28862",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NC1CCCCCCC1)c1ccccc1SC(F)F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58957",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29916",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1csc([C@H](NC(=O)NC[C@H](O)CC(C)C)C2CC2)n1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238461",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cc(F)ccc1S(=O)(=O)NCCC1=c2cccc(Cl)c2=[NH+][C@H]1C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51227",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1Cl)c1c[nH]c2nccc(Cl)c12 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2990",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCC1(c2ccccc2)CCC1)NNC(=O)c1ccc(Cl)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71890",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(S/C=C/C(F)(F)F)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147150",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC[C@H]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211948",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=S(=O)(N[C@H]1CCC[C@@H](O)C1)C1CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175939",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](SC(C)(C)C)C(=O)Nc1ncc(Cl)cc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccn2c(C=O)c(-c3ccc(Cl)cc3)nc2c1 by replacing a aldehyde by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181994",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(/C=C/C(=O)OCC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)o1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198172",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COCc1ccccc1NCc1cccc([N+](=O)[O-])c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182824",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)CCCCNC(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)c2cccc3c2OCCO3)nc2nc(C(F)(F)F)nn12 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89986",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)CNC(=O)Cc1cccc2ccccc12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101407",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccn(Cc2c(Cl)cccc2Cl)c1=O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136704",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(Br)nc1)N1CCC[C@H]1c1cccnc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13085",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2C(=S)CO[C@@H]2c2ccc(Br)cc2)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187764",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC[NH+](CC(=O)NCc1ccccc1[N+](=O)[O-])C1CCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30228",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](NC(=O)[C@@H](C)c1cccs1)c1nc(C(F)(F)F)cs1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247775",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(=O)Nc1c(C)cc(NC(=O)NCC[C@@H](O)C(C)C)cc1C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160992",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)CN2CCN(Cc3cc(-c4ccc(Cl)cc4)no3)CC2)no1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105011",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(/C=C/CC(=O)Nc2cc(-n3nnnc3C)ccc2F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112685",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[C@@H](CO)[NH+]1CCN(Cc2c[nH]nc2-c2ccc(F)cc2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163912",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1c(NC(=O)CC[NH+]2CCC(NC(N)=O)CC2)sc2c1CCC2 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82851",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CCCl)C[NH2+]C[C@@H]1CSc2ccccc21 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38761",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H](NC(=O)C(=O)Nc1cccnc1Cl)c1nc(C)cs1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171542",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1C[C@H]1c1ccc([C@H]2NC(=O)c3c(Cl)cccc3N2)o1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109800",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCc1ccc(O)c(NC(=O)[C@H](C)NC(=O)c2ccoc2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149621",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(COC(=O)/C=C/c1ccc(F)cc1)Nc1ccc2c(c1)OCO2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98710",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1C[NH+]2CCC[C@@H]2CN1CC[C@@H](C)CCCl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99154",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66952",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N/C(=N\\OC(=O)c1cccc(Br)c1)c1ccncc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141851",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule Cc1nc(N2CCCC2)cc([C@H]2CCCN(c3cccc(C#N)n3)C2)[nH+]1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243577",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=c1[nH]c2ccccc2cc1CNC[C@@H](O)c1ccc(F)cc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82071",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1cccc(C(=O)C2=C(O)C(=O)N[C@H]2c2ccc(C(C)C)cc2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176576",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(NC(=O)[C@@H](C)[NH2+][C@@H](C)c2ccc3c(c2)OCO3)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44492",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N/C(N[C@H]1C[C@H]1c1cccc(Cl)c1)=[NH+]\\C1CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186488",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(NO[C@@H]1CCCCO1)c1ccc([N+](=O)[O-])cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11778",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CSCc1nc2ccccc2n1CC(=O)N(C)C[C@@H](O)C1CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209424",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCN(C)c1cccc(NC(=O)N[C@H](COC)c2ccc(F)c(F)c2)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95320",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)Nc2nc(C[NH+]3CCC[C@@H](C)C3)cs2)cc1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222332",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](CO)NC(=O)NC[C@H](c1ccc(C)o1)N1CCOCC1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184664",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNc1cc(C)ccc1C(=O)Nc1ccc(F)c(F)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216401",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a aldehyde in the molecule O=Cc1ccc(C(=O)OCC(=O)Nc2ccc(F)cc2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62853",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H](CO)CSc1ccnc(C(=O)NCc2ccccc2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60744",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)OC(C)C)sc2ncn(Cc3ccccc3Cl)c(=O)c12 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166375",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCC[NH+]1CCC(c2nccnc2Oc2ccccc2F)CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131247",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCCc1nnc2n1CCCCC2)[C@H]1C[C@@H]1c1ccc(F)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102341",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](NC(=O)c1ccncc1)c1ccc(F)c(F)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161451",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)(C(=O)[O-])[C@@H]1CCC[C@@H]1O by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53639",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#CCc1cccc(C(=O)NNC(=O)NCc2cccc(C(F)(F)F)c2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167825",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC1=C(C(=O)Nc2ccccn2)[C@@H](c2ccccc2C(F)(F)F)C2=C(CCCC2=O)N1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119008",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)NC(=O)C(=O)NNC(=O)c1ccc(Br)s1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@@H]2c2ccc(F)cc2)[C@@H](C)N=N1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1nccs1)C1CCN(C(=O)c2ccc(-c3ccccc3F)o2)CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128694",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCCCN1C(=O)c2[nH]nc(-c3ccc(C)cc3)c2[C@@H]1c1ccc(Cl)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95878",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1N[C@]2(CCCc3ccccc32)C(=O)N1CN1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162665",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CNC(=O)[C@H](C)N1CCN(C(=O)c2cccc(O)c2)CC1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235208",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule N#C/C(=C\\c1ccc(-c2ccccc2Br)o1)C(=O)NCc1ccccc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220832",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Oc1ccc(F)cc1Cl)c1cnc2ccccn2c1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215926",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(Cl)c(C)cc1NC(=O)[C@H]1CCCCC[C@@H]1[NH3+] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25132",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1cc(NCCc2n[nH]c(=O)[nH]2)nc2ccc(Cl)cc12 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221370",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@](C)([C@@H](N)c1c(F)cccc1F)[NH+](C)C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216097",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)C[C@H](C)N(C)c1ccc2nnc(C(F)(F)F)n2n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156843",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule C[C@@H](CN1CC[NH+](C)CC1)Nc1ccc2ncccc2c1[N+](=O)[O-] by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186809",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(C(=O)Nc1ccccc1I)C1CCCCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13512",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1ccc(Cl)s1)[C@@H]1CCc2cc(N)ccc21 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240839",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1ccc(/C=C2\\C(=O)Nc3ccc(Cl)cc32)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249015",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H](CN1CCOC[C@@H]1C1CC1)c1ccc(Br)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172626",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)c1ccccc1S(=O)(=O)N1CCN(c2ccccc2F)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100408",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2cc(CN3C[C@@H](CO)OC[C@@H]3C)ccc2c1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229804",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cncc(C(=O)NC[C@H](O)C2CCCC2)c1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73007",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(c2cc(CNc3ccc([N+](=O)[O-])cc3)cc[nH+]2)CCO1 by replacing a nitro by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96658",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(F)c([C@@H](C)NC(=O)Nc2cnccc2C)cc1OC with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Nc1cccc(C(=O)N(C)[C@H](C)c2cc(F)ccc2F)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243364",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule [NH3+][C@H](CC(=O)[O-])c1ccccc1Br by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151975",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCC[C@H](C)[NH+](C)CC(=O)Nc1cc(F)cc(F)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180472",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Nc1c(Nc2cccc(Cl)c2)ncnc1N1CCCCCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112357",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)Nc1cc(NC(=O)C(=O)N2CCc3cc(F)ccc3C2)c(F)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200721",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1F)nc(CCl)n2Cc1cscc1C by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1onc(-c2cccc(F)c2)c1C(=O)Nc1ccc2c(c1)OCCO2 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CCc1ccc(Cl)cc1Cl)OCc1ccccn1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211855",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H](NC(=O)N1CCCCC1)C1CCCCC1 by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203001",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1cc(C(=O)Nc2ccc(C#N)cc2)nn1-c1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240396",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(SCc2cc(=O)c(OC(=O)c3ccc(F)cc3)co2)n1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120545",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85711",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CCCCl)Nc1nnc(-c2ccc(Cl)cc2Cl)s1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174295",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H](NC[C@@H](O)c1ccccc1)c1ccncc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12814",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(=O)ccn(CC(=O)NC2(c3ccc(F)cc3F)CCCC2)c1=O by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226050",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nn(C)c(C)c1C[C@@H](C)NC(=O)CCCc1cc(F)ccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238338",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ncnc1C[NH2+]C/C=C/c1ccc(C#N)cc1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188390",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)cc1OCC(F)F)c1n[nH]cc1[N+](=O)[O-] by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42953",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[NH+](CC)CCN1C2=[NH+][C@H](c3ccc(Cl)cc3)CN2c2ccccc21 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152730",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(CCCS(C)(=O)=O)C(=O)CNC(=O)c1ccc(F)c(F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151303",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@H]1CCCC[C@H]1NS(=O)(=O)Cc1cccc(F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113826",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1ccccc1S(=O)(=O)NCC1CCCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34272",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule C[NH2+][C@@H]1CCC[C@@H]1CCS(=O)(=O)c1ccc([N+](=O)[O-])cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)C(C)(C)F)c1cccc(C#N)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202902",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1nc(CC)oc1NC(=O)/C=C/c1cncc(F)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237084",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(-c2cc3nc(CCNC(=O)c4ccccc4F)nn3cn2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73167",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](CO)[NH+]1CCN([C@@H](C)c2cc(F)ccc2F)CC1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114647",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1c(-c2ccc(Cl)cc2)nnc1S(=O)(=O)C[C@@H]1CCCO1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103025",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@@H](CNC(=O)Nc1ccccc1N1CCCC1)c1ccc(F)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240661",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1ccccc1[C@@H]1CN(Cc2cnn3c2NCCC3)CCO1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206569",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(S(=O)(=O)N(Cc2ccco2)c2ccc(F)cc2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47756",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O[C@H](C[NH2+]CC[C@@H]1C=Nc2ccccc21)Cn1c2ccccc2c2ccccc21 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133195",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#C/C(=C\\c1ccccc1Cl)C(=O)Nc1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1ccc(F)cc1)NCc1cn2ccsc2n1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248733",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](c1cc(F)cc(Br)c1)C(C)(C)C by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185109",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ncc2c1CCC[C@@H]2[NH2+][C@@H]1CCCN(CC(F)(F)F)C1=O by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18388",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CN(Cc1ccccc1F)C1CC1)C2=O by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159926",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCCC[C@@H]1NC(=S)NNC(=O)c1ccccc1F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240772",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1ccc(/C=C2/SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1[N+](=O)[O-] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220630",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C1CCC(C#N)([C@@]2(O)CC[C@H](C)[C@@H](C)C2)CC1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212182",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC/C(Cc1ccccc1)=N\\NC(=O)C(=O)Nc1ccc(Cl)cc1C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190455",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(OCC(F)F)nc1)N1CC[C@@H](Cc2ccccc2)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91884",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CNC(=O)c1ccc(Cl)c(NC(=O)c2cccc3ncccc23)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152462",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1CCC[C@@H](S[C@H](F)C(=O)[O-])C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215040",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1/C(=C/c2ccc(O)cc2)SC(=S)N1[C@H]1CCS(=O)(=O)C1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68837",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCOC(=O)c1sc(NC(=O)/C=C/c2cnn(C)c2)c(C#N)c1C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[C@H]1C[C@H](Nc2nc3ccc([N+](=O)[O-])cc3o2)CC[C@H]1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58513",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccccc1-c1cnnc(NCCc2cscn2)n1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158727",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(C(=O)C2=C([O-])C(=O)N(C)[C@@H]2c2ccc(I)cc2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24059",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(NC[C@@H]1CCC[C@@H](O)C1)C(=O)Nc1ccc2c(c1)C(=O)CCC2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule [NH3+][C@@H](c1cc(Br)ccc1Cl)c1c(F)cc(F)cc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75557",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C#Cc1cc(F)c(NC(=O)CN2C(=O)[C@@H]3[C@H]4CC[C@H](O4)[C@@H]3C2=O)c(F)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165595",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NC(=O)CC1CCN(C(=O)/C=C/c2ccc(Cl)s2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121218",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)[C@H](C#N)c2nc3ccccc3s2)cc1C by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126406",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCCl)C(=O)c1csc(I)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199588",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)CNC(=O)[C@@H](C)Oc1ccc(F)cc1[C@@H](C)O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(C2=Nc3ncnn3/C2=N\\Cc2ccc(F)cc2)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237934",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1nc([C@H](C)NC(=O)[C@@H](C(C)C)n2cnc3cc(F)c(F)cc32)cs1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210511",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C(NC1CC1)[C@@H](c1ccccc1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246131",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CN1C(=O)NC2(CCCC2)C1=O)Nc1nnc(SCc2ccccc2F)s1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12364",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Nc1ccc(C(F)(F)F)cc1C(=O)NCC1CCCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80648",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a carboxyl in the molecule COC(=O)c1ccc(NC(=O)C2CCN(C(=O)O)CC2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120504",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H]1CCC[C@H]1C[NH2+]Cc1cccc(C2CC2)c1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136380",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CSCc1ccc(C(=O)[O-])cc1)Nc1ccc(Cl)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92770",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1nc(CNC(=O)c2cccc(CCC(C)(C)O)c2)no1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231479",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1CCC[C@@]2(C[NH+]=C(N)N2c2ccc(F)cc2)C1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]3CC[C@](O)(C(=O)COS(C)(=O)=O)[C@@]3(C)C[C@@H](O)[C@H]12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCN(CCNC(=O)/C=C/c2ccc(OC)c(F)c2)CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95436",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(Cc1ccc(OC)cc1)C(=O)Nc1ccc(Cl)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12218",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc2cccc(C(=O)Nc3cc(C(N)=O)c(F)cc3F)c2n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177920",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN1CCN(S(=O)(=O)c2cc(C(=O)Nc3ccc(Cl)c(Cl)c3)ccc2F)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1094",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@@](O)(C[NH2+][C@@H]2CCCC2(C)C)C1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186185",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([C@H]1COc2ccccc2O1)N1CCN(c2ccccc2F)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124737",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCC(=O)N1CCCCC[C@@H]2[C@@H]1[C@H](c1cccc(F)c1)C[NH+]2C by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153514",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N1CC[C@@H](NC(=O)N[C@H](c2ccccc2F)C2CCCC2)C1=O by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212127",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(Cl)ccc1C[NH2+][C@@H](C)c1nc2ccccc2n1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194833",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCN(C(=O)Nc2ccc(CCC(F)(F)F)cc2)[C@H]1CO by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(F)c(F)cc1F)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196719",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N=C1NC(=O)/C(=C/c2ccc(OCc3ccccc3Cl)cc2)S1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93142",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1cc2c(cc1C(=O)c1ccccc1F)OCCO2)c1ccc(Br)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219891",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)[C@@H]([NH2+]CCCc1nnc2n1CCCCC2)c1ccccc1Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115610",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)CN1CCN(CC(=O)NCc2ccc(Cl)s2)CC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1cc(CO)oc([C@@H](Nc2ccccn2)c2ccccc2Cl)c1O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228709",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=S(=O)(c1ccc(SCc2ccccc2C(F)(F)F)nc1)N1CCCCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30982",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCCn1ncnc1C[C@]1(C#N)CCCC(C)(C)C1=O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97794",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(CC[NH2+]Cc2ccccc2F)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc(C)c1NC(=O)CSc1nnc(-c2ccc(Br)cc2)n1N by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205187",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1cc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3[nH]c(=S)[nH]c(=O)c32)ccc1O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56066",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1cc(-c2cccs2)on1)c1ccc(Cl)cc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77335",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H]1CCCCN1C(=O)[C@@H](C)Sc1nnc(COc2ccc(F)cc2)n1N with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242422",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]1OCC[C@H]1C(=O)Nc1ncccc1Br with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C1CCCCC1)N1CCN(C[C@@H](O)c2cccc(F)c2)CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242456",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CN(C)c1ccc(-c2n[nH]c(=S)n2/N=C/c2ccccc2[N+](=O)[O-])cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84809",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCC(CC)NC(=O)[C@H](C)Nc1cccc(CO)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50738",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cc1ccccc1)N(CCCn1ccnc1)c1nc2c(F)cccc2s1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1cccc(N2CCc3sc(Br)cc3C2)n1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101140",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CO[C@H]1CCCC[C@H]1NC(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142834",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](CCCc1n[nH]c(N)c1C#N)Cc1cc(Cl)ccc1Cl by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223077",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)c1nn(-c2cc(Cl)ccc2Cl)cc1C=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63735",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@@H]1CCCCN1c1ncnc(NC2CC(C)(C)[NH2+]C(C)(C)C2)c1[N+](=O)[O-] with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242483",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H](C)NC(=O)C1CCN(c2ccc(Sc3cccc(F)c3)nn2)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200385",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(O[C@@H](C)C(=O)NCc2nc(-c3ccc(Cl)cc3)no2)ccc1Cl by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171579",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1ccc([N+](=O)[O-])cn1Cc1ccccc1OCC(F)(F)F by replacing a nitro by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118789",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COC[C@@H]1CCCN(C(=O)Cc2cccc(OCC#N)c2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61936",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CNC(=O)[C@@H]1CCCN1C(=O)c1cccs1)Nc1ccc(F)c(F)c1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202428",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1ccc(C(=O)CSc2cc(C#N)ccn2)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192723",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCC1CCN(C(=O)c2cccnc2)CC1)c1ccccc1C(F)(F)F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)nc(N(C)Cc2ccc(O)cc2)n1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])CCCCCn1cc(Cl)c(I)n1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220256",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cccc1[N+](=O)[O-] by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211252",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)[C@]12CC[C@](C)(/C(=N/O)C1=O)C2(C)C by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23718",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccccc1Cl)C(=O)NC[C@H]1OCCN1S(=O)(=O)c1ccccc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123242",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule N[C@]1(C(=O)[O-])CC[C@@H]([NH+]2CCC(C(F)(F)F)CC2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1ccnc1C[NH+]1CCC[C@H](CCc2ccccc2F)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160498",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(N[C@H]1CCCN(Cc2ccccc2)C1=O)N[C@H](CCO)C1CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23507",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)c1ccc(C(=O)NCCC(=O)Nc2ccc(Br)cc2)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79247",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=c1c2c3c(sc2nc(SCCO)n1Cc1ccco1)CCCC3 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78770",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1C[C@@H](O)CN1Cc1[nH]cc(-c2cccc(Br)c2)[nH+]1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244868",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=c1ccc(-c2ccccc2F)nn1C[NH+]1CCC[C@@H]1Cc1ccccc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@@](CO)(Nc2ccc(Cl)c(Br)c2)C1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213846",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@H](O)C1CCN(C(=O)C(=O)Nc2cnc(C(C)(C)C)nc2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208045",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOc1c(F)cccc1C(=O)N(C)Cc1ccc(C(=O)NC)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCc1ccccc1-n1ccnc1)c1cnc2ccc(F)cc2c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90911",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1ccccc1F)c1cc2ccccc2o1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106604",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(NNC(=O)c1cccc([N+](=O)[O-])c1)N[C@@H](c1ccccc1)C1CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100642",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)N1CCNC(=O)[C@@H]1C by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115683",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule FC(F)(Cl)C(F)(F)C(F)(F)Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29252",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CN[C@H](c1ccc(F)cc1)c1cccs1)NN1C(=O)NC2(CCCCC2)C1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93996",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H]1CN(Cc2coc3ccccc23)CCO1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55716",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Nc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])ccc1[NH+]1CCCC1 by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178050",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1I)c1csc2c1CCCC2 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57459",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH2+]Cc1ccccn1)Nc1ccc([N+](=O)[O-])cc1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66367",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCOc1ncccc1C(=O)Nc1nc2c(cc1C#N)CCC2 by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64110",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1c(C(=O)NCc2ccc(C)cc2)sc2ccc(F)cc12 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165563",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NC(=O)N1CCN(c2ccc(Cl)cn2)CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49545",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc2nc([C@H](C)Cl)n([C@@H](C)C[NH+]3CCCC3)c2c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(NC(=O)CCc2ncc(-c3ccccc3F)o2)s1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21364",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)c1cnc(N(C(=O)c2sc(Cl)nc2C)C2CC2)s1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42052",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[C@@H]([NH2+][C@H](CO)c1cnn(C)c1)C(C)C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218488",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc([C@@H](O)[C@H](C)NC(=O)c2c(F)cccc2F)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68618",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)C(=O)N2CC[C@H](C)[C@H](O)C2)no1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100353",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@]1(c2ccc3c(c2)OCCCO3)NC(=O)N(CC(=O)NCC(F)(F)F)C1=O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82101",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@H]1C[NH+]2CCCC[C@@H]2CN1c1cccc(Cl)c1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)N2CCN(c3ccccc3F)CC2)sc2ncnc(N3CCCC[C@@H]3C)c12 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161603",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCCS[C@H](C)C(=O)Nc1ccccc1C(F)(F)F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50121",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2nc(NC(=O)C3CCCCC3)nn2c(C)c1Cl by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32647",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOC(=O)C1=C(COC(=O)c2oc3c(F)cccc3c2C)NC(=O)N[C@H]1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199401",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1ccc2c(c1)OCCO2)c1nc(Cc2ccc(F)cc2)no1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93727",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CCc1nncn1-c1ccccc1)NCc1cc(F)ccc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194861",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[C@@H](C)C[C@@H](C)NC(=O)N1CCC([C@@H](C)O)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192440",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(Cc1ccc(Cl)s1)C[C@@H](O)c1ccc(F)c(F)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39553",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cc(C[NH+]2CCc3nnc([C@H](C)NC(=O)c4cc(F)ccc4F)n3CC2)cc(OC)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72953",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(/C=N/NC(=O)COc2ccc([N+](=O)[O-])cc2)c(C)c1 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155666",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC[C@@H]1c1ccc2c(c1)OCCCO2 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233289",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#C[C@@H]1C(=N)C(C#N)(C#N)[C@H](c2cc(CN3CCOCC3)cs2)[C@H]2CCCC=C12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217688",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(Br)cc1CNC(=O)CCN1CCCC1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46182",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(F)c(C(=O)NC2(c3noc(C)n3)CCC2)c1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)CCNC(=O)C[C@@H](O)c1ccc(Cl)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37396",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCN(C(=O)c2ccc(-c3ccc(F)cc3)cc2F)C[C@H]1O by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180170",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(OC(F)F)c(C(=O)O[C@@H](C)Cn2cccn2)s1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42183",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)ccc1S(=O)(=O)N1CCC(NC(=O)Oc2ccccc2)CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198982",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H](C[C@H]1CCCCC[NH2+]1)[NH2+]C[C@H](O)C1CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129743",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CCC(=O)N1CC(=O)N(CCCN1CCOCC1)c1nc2ccc(Br)cc2s1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146527",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(Cl)cc1C(=O)[C@@H](C#N)c1nc(-c2ccc(Cl)cc2)cs1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90159",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule FC(F)CN1C[C@@H](C2CCCCC2)[NH2+]Cc2ccccc21 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247099",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc2oc(=O)c(CC(=O)c3ccc(F)cc3)nc2c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142010",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ncnc1NC(=O)NCc1ccc([N+](=O)[O-])cc1 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105003",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cnc2nc(-c3cc(F)c(F)cc3C(=O)[O-])[nH]c2c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216790",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@H](NC[C@@](C)(O)c1ccco1)C1CCCC1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(-c2nn(-c3ccc(F)cc3)cc2C(=O)NCC(C)(C)N2CCOCC2)c1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200949",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNC(=O)c1cc(C)ccc1NC(=O)c1cccc(Br)n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111067",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1CN(C(=O)C2CCN(c3ncccc3F)CC2)C[C@H](C)O1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99039",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule C=CCN(CCc1ccccc1)C(=O)c1ccc([N+](=O)[O-])c(O)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72026",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])c(NCc2ccc(C(=O)[O-])cc2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182304",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2C(C(=O)OC[C@H]3CCCO3)=C(C)NC3=C2C(=O)CCC3)cc1Cl by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103645",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]([NH3+])C(=O)N1CC[C@]2(CC[C@H](CCl)C2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55208",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1cc2cccc(Br)c2o1)N1CC[C@H](O)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)[NH2+][C@]1(CO)CCC[C@@H]1CCSC(C)C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160996",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(C)c1cc(NC(=O)c2ccc(F)cc2)n(-c2ccccc2)n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39890",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1cc2c(cc1Cl)OCCO2)[C@H]1CCCc2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218753",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCc1nc(CNC(=O)N[C@@H]2CCCC[C@H]2CO)cs1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93870",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1nnc(C2=NO[C@H](CNc3[nH+]cc(C(F)(F)F)cc3Cl)C2)s1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60194",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)Nc1cc(NC(=O)NCC(C)(C)c2ccc(Cl)cc2)c(F)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74843",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCC1(C(=O)[C@H](C#N)c2cccc(C)c2)CCCC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212343",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(C)[C@H](CNCc1ccc(F)cc1F)c1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170444",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COC(=O)N1CCN(Cc2cc(C)ccc2O)CC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1nc(N2CCO[C@H](c3ccc(Cl)cc3)C2)ccc1Cl by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47796",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CSc1nc(N2CCOCC2)c2cnn(CCNC(=O)[C@@H]3CC(=O)N(c4ccc(F)cc4)C3)c2n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187170",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC[C@@H](C(=O)[O-])[C@H](O)c1ccc(Br)cc1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236107",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(C(=O)NNC(=O)COc2ccc(Cl)c(C)c2)c(C)o1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35885",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC)Cc1cccc(NC(=O)c2ccc(I)cc2)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCC1(C2CC2)CCC1)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58691",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(NC(=O)CC[S@](=O)Cc2cccc(F)c2)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193193",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NCCc1cccc(O)c1)N1CCn2c(nnc2-c2ccccc2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232019",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](Cc1ccc(C)cc1)NC(=O)c1ccccc1[N+](=O)[O-] by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170601",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(Cl)cc(Cl)c1)[C@H]1CCCN1C(=O)c1ccc[nH]1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143832",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H](CNC(=O)Cn1cccc(C(F)(F)F)c1=O)c1ccccc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](OC(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12)C(N)=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143925",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(C)C)sc1C(=O)NCc1ccc(OC(F)(F)F)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106193",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#Cc1cccc(NC(=O)c2cc(Cl)nc(Cl)n2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27929",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)cc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCN(C(=O)c1cn(-c2ccc(Cl)cc2)nc1C)[C@H](C)c1cccnc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C[C@H](O)C1CC1)C(=O)c1cc(C(C)(C)C)nn1C by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144557",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Nc1nnc(CCCOc2ccc(Cl)cc2Cl)s1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51212",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCn1cc[nH+]c1CCC[C@H](C)Cl by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189766",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(CC(=O)NCc2ccnc(OC(C)(C)C)c2)c(C)c1[N+](=O)[O-] by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52089",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule OCCSc1nc(-c2ccccc2)cs1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26951",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)NCCNC(=O)C(=O)Nc1ccc(I)cc1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188676",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3333",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCC[C@@H]1C[NH2+]CC[C@@H]1c1ccc(Cl)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120691",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Sc2ncn(-c3ccccc3)n2)cc(C#N)cc1[N+](=O)[O-] by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214404",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2[nH]cc(CCNC(=O)c3ccc(F)cc3)c2c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CCc1nc(-c2ccc(Cl)cc2)no1)Nc1cccc(Oc2cnccn2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N[C@@H](CO)c2ccc(Cl)c(F)c2)ncn1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNc1cc(C)[nH+]c(N2CCN(C(=O)Nc3ccccc3F)CC2)n1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43832",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nn(CC(=O)N2CCN(Cc3cccnc3)CC2)c(C)c1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218235",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)Nc2c[nH]cc(Br)c2=O)cn1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(CCC(=O)N1CCC([C@H](O)c2ccccc2)CC1)N1CCOCC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41358",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CC[C@@H]1N=C2c3ccccc3NC(=S)N2C1=O)NCc1ccc(F)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62276",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)NC[C@H]1CCO[C@H]1c1ccccc1 by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249349",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccccc1CCNC(=O)c1cnn(-c2ccc(Br)cc2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67124",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(-c2ocnc2C(=O)Nc2cc(Cl)c(Cl)cn2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188770",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CNC(=O)N(C)Cc1cccs1)Oc1ccccc1F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183622",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H]1CN(C[C@H](O)Cc2ccccc2)C(C)(C)CO1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133087",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Cn1cnc2nc(N3CCOCC3)ncc2c1=O)Nc1ccc(Cl)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](CCC#N)CC(=O)Nc1ccc(Cl)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43835",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCc1ccc(NC(=O)CN2CCN(c3cc(Cl)ncn3)CC2)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156151",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1CC[NH+](Cc2nc(-c3ccsc3)no2)CC1)Nc1ccc(Cl)c(C(F)(F)F)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237630",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CCN(C(=O)c2cc(F)ccc2Br)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231716",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH+](CC(=O)Nc1ccc(C(F)(F)F)cc1N)C1CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@H](C)c1ccccc1OC[C@@H](O)C[NH+]1CCC[C@H](C)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63014",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C[NH+]2CC[C@H](CO)C2)ccc1OC(=O)C1CC1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187254",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)c1cc(C[NH+]2CCC([C@H](O)c3ccc(Cl)cc3)CC2)c[nH]1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211228",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)Oc1ccc([C@H](O)[C@@H](F)C(=O)[O-])cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29657",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCn1c(=O)oc(=O)c2cc(Cl)ccc21 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222287",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CN1CCO[C@H](C[NH2+]C[C@H](O)CO)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69422",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1ccc(Cl)cc1NC(=O)[C@@H]1C[C@@H]1c1ccccc1Cl by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70340",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(N2CCN([C@@H](C(=O)N(C)C)c3ccccc3)CC2)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175266",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1cc(S(=O)(=O)NCC(C)(C)CCO)sc1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188773",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1c(F)cc(NC(=O)N[C@@H]2CCC[C@H](C)C2)cc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77053",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1cccnc1N1CCC2(CC1)c1nc[nH]c1CCN2C(=O)C1CCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35059",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]1c1ccc(C)s1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66731",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1[NH2+]CC[C@H]1CNCc1cc(Br)cs1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(C(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCCC3)c2)cc1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39741",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCN1C(=O)[C@H](CC(=O)Nc2cc(Cl)ccc2C)S/C1=N\\c1ccc(S(N)(=O)=O)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242161",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H](CS)CSCc1ccco1 by substituting a thiol with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221888",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(C(=O)N2CC[C@H](C)C[C@@H]2C)nn1-c1ccccc1Cl by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99438",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc(NC(=O)/C=C/c2c(Cl)cccc2Cl)sc1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32502",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Fc1cccc(SCCCNc2ccccc2)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173047",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC[C@H]([NH2+][C@H](C)C(C)C)c1cccc([N+](=O)[O-])c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139069",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ccc([N+](=O)[O-])cc1)Nc1ccc(I)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175165",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CON(C)C(=O)COc1ccc(F)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198649",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)Nc1ccc(CNC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cnc2ccccc2c1N[C@@H]1c2ccccc2C[C@H]1O by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204529",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@@H](N[C@H]2CCOc3ccccc32)CCN1c1ccc(Cl)c(F)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46501",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)CCc1c(C)nc(C)[nH]c1=O)[C@@H](C)c1ccc(F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC[C@@H](OC(=O)[C@@H]1CCCc2[nH]ncc21)c1cccc([N+](=O)[O-])c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208947",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(Nc1ccnn1C1CCCCC1)N[C@@H](CO)c1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18394",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](Nc1snc(C)c1C#N)C(C)C by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189654",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cc(C[C@@H](C[NH2+]C)c2ccccc2F)n(C)n1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116541",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@]1(Cc2ccc(-c3ccccc3F)cc2)CCCN(C(=O)c2ccccn2)C1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234818",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCS(=O)(=O)c1cccc(F)c1)NC1CC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88801",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](NC(=O)c1ccoc1)C(=O)Nc1ccc(F)cc1OCC1CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97109",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H](COc1ccccc1F)NC(=O)N1CCC(CN2CCOCC2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224155",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CS(=O)(=O)[N-]c1ccc(O)c(C(=O)N(Cc2ccc(Cl)cc2)C2CC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112596",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ncccc1N1CC[C@H](C)[C@@H](O)C1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52911",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)Nc1cccc(OCCNC(=O)N[C@H](C)c2ccc(Cl)c(Cl)c2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150301",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C(=O)NC(=S)NCc1ccc(Cl)cc1Cl by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248022",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)[C@H]1[NH+]=c2ccc(Cl)cc2=C1NC(=O)CN1CCN(c2ccc(OC)cc2)[C@H](C)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234276",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H](CCc1ccccc1)NC(=O)[C@@H](C)O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCc1nn(C)c(C[C@@H]([NH3+])[C@@](C)(CC)N(C)C)c1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103518",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cc(Cl)cc(Cl)c1)C(=O)CCn1ccccc1=O by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82475",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1c[nH]c(C[NH+]2CCCC[C@@H]2CCc2cccc(O)c2)c(C)c1=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244353",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1cnc(Cl)nc1NCc1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124152",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1ccccc1O by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63366",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule [NH3+][C@H](Cc1cccc(F)c1F)c1cc(Cl)sc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7158",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNC(=O)c1ccc(C[S@](=O)[C@H](C)C(=O)Nc2ccccc2F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52360",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccccc1C(=O)N1CCN(c2cccc(Cl)c2C)C(=O)[C@@H]1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1ncc2c(C(=O)Nc3ccc(Br)cc3F)cc(-c3ccccc3)nc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106277",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1ccc(-c2nnc(SCc3ccc([N+](=O)[O-])cc3)o2)cc1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134141",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1[NH2+]CC[C@H]1C(=O)N(C)Cc1cc(C#N)ccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(NS(=O)(=O)c2cnn(C)c2)nc2cc(Cl)ccc21 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49152",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)=C1[C@H]2CC[C@@H]1[C@@H](C(=O)NNC(=O)COc1cc(C)c(Cl)c(C)c1)[C@H]2C(=O)[O-] by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227544",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule Cn1c(=O)/c(=C\\c2ccsc2)s/c1=C(\\C#N)C(=O)c1ccccc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44981",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CSc1sc(C#N)c2c1/C(=N\\OC(=O)c1ccccc1Cl)CCC2 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228370",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)c1ccc(N[C@H]2CCC[C@@]2(C)CO)nc1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166976",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H](C)NC(=O)c1ccc(C)cc1Cl by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131347",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C=C(C)COc1cccc(NC(=O)C(=O)N[C@H]2CCCC[C@@H]2CO)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116526",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(Cl)c(Cl)c1)OCCCc1ccncc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83456",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-n2cc(C(=O)NCc3ccc(Br)cc3)nn2)cc1C by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240684",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC(=O)C1=C([O-])C(=O)N(CC[NH3+])[C@H]1c1ccc(F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241919",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H](CNC(=O)N1CC[C@@H]([N+]2=CCCC2)C1)Oc1cccc(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149533",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1S(=O)(=O)N(C)CC(=O)Nc1c(F)cccc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182553",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CC[C@@H]1CCCO1)N1CCN(Cc2ccc(Cl)cc2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58149",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cn1ccnc1[C@@H](NC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170419",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C[C@H]1CCCC[NH+]1[C@@H]1CCOC2(CCCCC2)C1 by replacing a aldehyde by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129346",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#CCCNC(=O)CSc1nnc(NC2CC2)s1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86573",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C=CCN(CCc1ccco1)C(=O)[C@H]1C[C@H]1c1ccc(F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172858",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cccc(C(F)(F)F)c1)N1CC[C@@](O)(C(F)(F)F)C1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98754",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSc1nnc2c(n1)O[C@@H](c1ccc(C#N)cc1)N(C(C)=O)c1ccc(C)cc1-2 by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7425",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(C(=O)Nc2ccc(Br)c(C)n2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149630",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)CCNC(=O)NC[C@@H](O)c2ccccc2F)c(Cl)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152724",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COCC[C@]1(O)CCN(C(=O)c2cnn(C)c2)C[C@H]1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188932",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1cnns1)N1CC=C(c2cncc(F)c2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170711",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)(C)[NH+](CCS(C)(=O)=O)Cc1cc(F)c(F)cc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117630",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(Cl)ccc1OCC(=O)N(Cc1cccc(F)c1)Cc1ccco1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202494",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cc(N)c(O)cc1C#N by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227742",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c(Br)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232956",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@H](SC[C@@H](O)CO)C(=O)NC1CCCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152236",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc2oc(-c3ccc(F)cc3)nc2c1)c1ccccc1[N+](=O)[O-] by substituting a nitro with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78326",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cccc(O)c1)NNc1ccc(-c2ccccc2)nn1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241510",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CNC(=O)[C@H]1CCC[NH+](C[C@H](O)COCc2ccccc2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221754",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)CCn1c(=O)[nH]c(=O)c2ccccc21)c1cc(F)ccc1N1CC[NH+](C)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=c1c2cc(Cl)ccc2ncn1CN1CCN(c2ncccn2)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118460",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@H](Cc1ccc(C)cn1)c1cccc(F)c1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223565",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Clc1ccc(-c2cnc3ccc(I)cn23)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68732",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CCc1cnc(Cn2cnc(-c3cccc([N+](=O)[O-])c3)n2)o1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180972",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(-c2nsc(SCC(=O)Nc3ccccc3C(F)(F)F)n2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165297",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@@H](C[C@@H](O)[C@@H]1CCOC2(CCC2)C1)c1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38496",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](O)c1ccn(C[C@H]2CCCO2)c1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59701",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H](O)c1ccsc1)c1cc(C2CC2)nc2ccc(F)cc12 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47503",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCc1cccs1)c1c(F)cc(Br)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H](F)c1cc(C)cc(C)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62583",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccccc1NC(=O)[C@@]1(c2ccccc2)CC1(Cl)Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249084",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O[C@](c1nc2ccccc2o1)(c1c[nH]c2ccccc12)C(F)(F)F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79963",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cn1ccccc1=O)Nc1ccc(Oc2ccc(F)cc2)c2ccncc12 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145589",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1[nH+]ccn1CC1(O)CC[NH+](CC2CCCCC2)CC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176423",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[NH+]1CCN2CCN(Cc3ccc(C#CCO)cc3)C[C@@H]2C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118462",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1918",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccc(Br)c1)[C@H]1Cc2[nH+]c[nH]c2CN1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184816",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@H](Cc1ccccc1)C(=O)N[C@@H](C#N)C(C)(C)C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70485",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule C[C@H](Oc1ccc2ccccc2c1)C(=O)N/N=C\\c1cc([N+](=O)[O-])ccc1[O-] by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123811",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(F)cc([N-]S(=O)(=O)c2c[nH+]c[nH]2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17096",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH+](C)CCNC(=O)C(=O)Nc1nnc(Cc2cccc(Cl)c2)s1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231115",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COC[C@]1(O)CCN(C(=O)c2ccccc2-c2ccc(F)cc2)CC1(C)C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15177",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N(Cc2ccc(F)cc2)C[C@H]2CN(Cc3cccnc3)CCN12 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13113",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cc(C(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2O)cc(OC)c1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65467",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccccc1CO/N=C\\C(=O)Nc1ccc(F)cc1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138074",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC(=O)Nc1ccc(F)c(C(=O)N(C)C2(C#N)CCC2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161646",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c(c1)[C@@H](Nc1cc(F)c(F)c(F)c1)CC2 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72300",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)NC[C@H](c1ccc2c(c1)OCO2)N1CCN(c2ccc(F)cc2)CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64079",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(C)[C@H]1CCC(=O)[C@@H]([C@@]2(O)C(=O)Nc3ccc(Br)cc32)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180081",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1cc(Cl)ccc1N1CCCCC1)N1CCCOCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)C2CCN(C(=O)c3ccccc3Cl)CC2)c(C)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(OC)cc([C@@H]2CCN(C(=O)c3cc(F)ccc3OC)C2)c1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59935",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1c(Nc2ncc(C(F)(F)F)cc2Cl)nc[nH+]c1N1CCc2ccccc21 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150585",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(OCC(=O)Nc2ccc(I)cc2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226237",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1c(O)ccc2c1O/C(=C\\c1ccco1)C2=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215699",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1ccc(C(=O)NNC(=O)COc2ccccc2[N+](=O)[O-])cc1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116110",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](CCNc1nnc(Cl)cc1C(N)=O)C1CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180818",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(COC1CCCC1)Nc1cccc(Cl)c1-n1cccn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55075",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1ccc(C(=O)N2CCC[C@@H](CCc3ccccc3C(F)(F)F)C2)n1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3215",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC(=S)Nc1cccc(Cl)c1Cl)c1ccc(Cl)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112379",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCn1c(S[C@H](C)C(=O)Nc2ccc(Cl)cn2)nnc1-c1cccs1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186450",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cn(-c2ccccc2)nc1-c1ccc([N+](=O)[O-])cc1)Nc1[nH+]cccc1[O-] by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9964",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)C[C@]1(C)NC(=O)N(Cc2ccc(Cl)c(Cl)c2)C1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN[C@@]1(C#N)CCC[C@@H]([NH+]2CCC[C@H]3CCC[C@@H]32)C1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34069",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccccc2F)N3)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196128",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=C(Nc1nnc(C2CC2)s1)c1ccccc1[N+](=O)[O-] with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68997",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)CCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)s1 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24558",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC(=O)C1=C(C)OC(N)=C(C#N)[C@@]12C(=O)Nc1ccc(Br)cc12 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5402",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule N#Cc1cccc(CN2C(=O)[C@@](O)(c3cccc(F)c3)c3ccccc32)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177179",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)Nc2ccc(-c3cc[nH]n3)cc2)cc1[N+](=O)[O-] by replacing a nitro by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43616",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H](C)N(C)C(=O)NCc1cc(F)ccc1Br with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155124",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(C(=O)N(C)[C@@H](C)Cc2ccc(Cl)cc2)nn1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155865",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](C#N)CNC(=O)C(=O)Nc1cc(F)ccc1Br with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186883",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C[C@H](C)C#N)C(=O)Nc1cccc(C(=O)Nc2ccccc2)c1C by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173961",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule N#CC1=C(N)Oc2n[nH]c(-c3ccc(F)cc3)c2[C@@H]1c1ccc(Br)s1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188047",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCCOc1cccc(Cl)c1)Cc1nc2c(oc3ccccc32)c(=O)[nH]1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144197",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule OC1(C(F)(F)F)CC[NH+](Cc2ncc(-c3cccc(Cl)c3)o2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168644",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2cc(NC(=O)C(=O)N3CCC[C@@H](O)C3)ccc2o1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229691",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)[NH2+][C@]1(CO)CC[C@@H](Sc2nncs2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245231",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(F)c([C@@H](Br)[C@]2(C)CCCO2)c(F)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196371",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a aldehyde in the molecule O=Cc1sc(Oc2ccccc2)nc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24580",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=c1[nH]c(-c2ccc(F)cc2)nc2ccsc12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18673",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc(C[C@@H]2[NH2+]CCc3cc(O)c(OC)cc32)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43893",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1csc2nc(CNc3ccc(F)c(F)c3F)cc(=O)n12 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151784",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccccc1Nc1ccnc2c(F)cccc12 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77211",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1909",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc([C@H]2CCCN(C(=O)C(=O)Nc3ccc(C#N)cc3)C2)n1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228129",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1ccc(C(=O)Nc2nc(-c3cccc(C(F)(F)F)c3)cs2)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126481",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(/C=N/NC(=O)c2ccc(O)cc2)ccc1OC(=O)c1ccccc1Cl by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209381",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(/N=C/c1ccc([N+](=O)[O-])o1)c1ccccc1 by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202753",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cn1ccnc1C(=O)N[C@H](c1ccc(Cl)cc1)c1ncon1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220087",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NC(=O)c1c(NC(=O)c2cncc(Br)c2)sc2c1CCCCC2 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237906",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)cc1-n1nnc(C(=O)N2CCC[NH+](C)CC2)c1C by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144847",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C/C=C\\c1ccc(OCc2nc3ccc(F)cc3[nH]2)c(OC)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97682",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(O)c(-n2cc3c(c2-c2cccc(Br)c2)c(=O)n(C)c(=O)n3C)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92638",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [S-]c1nnc(COc2ccccc2I)n1-c1ccccc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54456",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OC1=Nc2c(ncn2-c2cccc(Cl)c2)[C@H](c2ccsc2)C1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173622",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH+](CC)CCN1C(=O)c2oc3ccc(F)cc3c(=O)c2[C@H]1c1cccc(Cl)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173938",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H](O)[C@H](C)NC(=O)[C@@H](C)NC(=O)C(C)(C)C)cc1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133437",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule OCCN1CC[NH+](Cc2sccc2Br)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210913",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN([C@@H]2CC[NH+](Cc3ccc(Cl)cc3)C[C@H]2O)CC1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164941",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(C[C@@H]1Sc2ccc(C(F)(F)F)cc2NC1=O)NCCc1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46794",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@@H](C1CCCCCC1)[C@H]1CCO[C@]2(CCOC2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2317",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=[NH2+])c1ccc(OCc2cccc(O)c2)c(Cl)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247860",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CC(=O)N[C@H]1CCC[NH+]([C@@H](C)C(=O)Nc2ccc(C)c([N+](=O)[O-])c2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205098",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1ccc(Br)o1)N(CCO)Cc1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19038",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC1(C)S[C@H](c2ccccc2O)[NH2+][C@H]1C(=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149055",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCC[C@@H]([NH3+])c1ccn(Cc2cccc([N+](=O)[O-])c2C)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173381",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC(=O)Nc1cccc(F)c1)[NH2+][C@H]1CCN(CC(F)(F)F)C1=O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C=CCn1c(C)cc(C(=O)CN2C(=O)N[C@@](C)(c3ccc(Cl)cc3)C2=O)c1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62858",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CSCC[C@@H]1NC(=S)N(c2ccc(F)c(C(F)(F)F)c2)C1=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144177",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(C[NH2+]Cc2ccco2)c(F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158764",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule [NH3+]C[C@H](O)Cn1c(C(F)(F)F)nc2ccccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215244",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cccnc1)N1CCC(c2ccc(C(F)(F)F)cc2)CC1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@](C)([C@H](N)Cc1cccc(O)c1)[NH+]1CCCC1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87516",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@]31CC[NH+](C)C2 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76401",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NC(=O)[C@H]1CCC[C@H]1NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104461",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CSC(C)(C)CNC(=O)c1cc2cccc(F)c2o1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234913",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1Cn1nc(C)c(NC(=O)c2cccc(C#N)c2)c1C by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204475",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=S(=O)(c1cccs1)N1CCN(Cc2nc(-c3ccc(Cl)cc3)no2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149963",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule NS(=O)(=O)CCCC(=O)N1C[C@@H](C[NH+]2CCCC2)[C@@H](CO)C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(Cl)ccc1Cl)[C@H]1Cc2ccccc2O/C1=N\\O by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204637",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1cc(C2CC2)[nH]n1)c1ccc(Br)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62007",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CCOc1ccc(/C=C2\\N=C(c3ccccc3[N+](=O)[O-])OC2=O)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184783",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](NC(=O)c1cc(Cl)ccc1OC1CC[NH+](C2CCCC2)CC1)C(N)=O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168059",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCCCOc1cccc(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92481",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCSc1ccc(Cl)cc1C(=O)NCc1ccc([N+](=O)[O-])cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166637",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCOc1ccc(Cl)cc1C[NH+]1CCC2(CC1)CNC(=O)C2 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143289",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@](C)(C[NH3+])[C@H](O)C1CCCC1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cc(F)cc(Br)c1)c1cnccn1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183836",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC[NH+](C)C)C(=O)CC1(O)CCCCC1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33800",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)c1[nH]c(C)c(C(=O)Nc2ccc(Cl)cc2)c1CC with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21197",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc([C@H](O)[C@H](C[NH3+])c2ccccc2Cl)cc1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70068",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(NC(=O)N2CCCN(C(=O)c3ccsc3)CC2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65597",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1cc(C(=O)Cn2cnc(-c3ccc([N+](=O)[O-])cc3)n2)c(C)n1-c1nccs1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161699",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[NH2+][C@H](C)c1ccnc(N2CCC[C@H](O)C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58852",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H](C)NC(=O)Nc2ccnn2C(C)C)cc1F by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Br)c(NC(=O)/C=C/c2ccccc2)cc1OC by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Nc1ccc([C@@H]2CCC[NH2+]2)cc1OC(F)(F)F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79202",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)c2c(c1)[C@@H]([NH2+]Cc1ncccc1F)CCCO2 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41779",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1cccc(C(F)(F)F)c1)[C@H]1CC=CC[C@@H]1C(=O)N1CCOCC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21081",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@@H](Cc1cc(F)ccc1F)[C@H](C)OC by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166649",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(C(=O)CC[C@H]1CCCO1)[C@H](c1ccccc1)c1ccc(F)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1cc(F)cc(F)c1)[NH+]1CC[C@@H](C(=O)[O-])[C@H]1C by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180370",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nnc(NC(=O)c2ccccc2NC(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)s1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201625",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CS(=O)(=O)c1cccc(C(=O)N(CC#N)C2CC2)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93294",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)cc1C[NH2+]C[C@@]1(O)CCCN(CC(C)(C)C)C1=O by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195036",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c(Cl)cccc1NC(=O)C[C@@H]1S/C(=N\\C2CC2)NC1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38333",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(F)ccc1F)c1ccc(=O)n(Cc2ccccc2F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239899",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)[C@H](C(=O)N1CCOC2(CCCC2)C1)c1ccccc1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128728",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC1(C)Cc2c(sc3c2c(=O)n(CCO)c(=O)n3CC(=O)Nc2nccs2)CO1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156655",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@H](CN1CC[NH+](C/C=C/c2ccccc2)CC1)c1ccc(Cl)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206095",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192236",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1ccc(SCCC[NH2+]Cc2ccc(Cl)nc2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72024",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule N#CCCNC(=O)[C@H]1C[C@H](O)C[NH2+]1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc(CCC(=O)N2CCC(OCc3ccccc3F)CC2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36660",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(C(=O)[O-])c2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25083",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[NH+](CCc1ccc2c(Br)ccc(O)c2n1)C1CCCCC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243295",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C/C(=C\\CC[P@@](=O)([O-])OP(=O)([O-])[O-])CO with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36488",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCOc1cc(/C=C2\\C(=O)N=C(N)N2C)cc(Br)c1O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18389",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ncc(CN(C[C@@H](O)c2ccc(F)cc2)C2CC2)s1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40058",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(N2CC[C@@H](Cc3ccccc3)C2)c(C#N)c1C by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95200",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1nc(CC(=O)N[C@@H](C)c2cccc(C#N)c2)cs1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202481",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(C1=C([O-])C(=O)N(CCN2CCOCC2)[C@@H]1c1cccc(O)c1)c1ccc(Br)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65365",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc([S@@](=O)CC(=O)Nc2ccc(OC(F)F)cc2)nc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120806",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(-n2nc(CC(C)(C)C)c(Cl)c2N)ncn1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183944",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc([C@@H]2C[C@@H]2/C([O-])=N/S(=O)(=O)CCCF)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36163",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCCO)N[C@@H](Cc1ccc(Cl)cc1)c1ccccc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8780",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCc1cccc(C)c1NC(=O)N(C)Cc1ccccc1O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46491",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@H]1CCO[C@]2(CCOC2)C1)[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204777",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@H](CNC(=O)C[C@H](O)c1ccccc1)Oc1ccccc1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236796",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCNC(=O)NCCOc1ccc(Cl)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141239",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(F)c(C[NH2+][C@H]2C[C@H]3C(=O)N[C@H](CC(C)C)C(=O)N3C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75152",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)c1ccc(N2CCC(NC(=O)C(=O)Nc3ccccc3F)CC2)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40361",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)C1CCN(C(=O)Nc2ccc(F)cc2OCC2CC2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29926",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)c2ccc(C(=O)Nc3ccccc3F)o2)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233628",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1c(CC(=O)N2CCC(C(=O)[O-])(c3ccccc3)CC2)c(=O)oc2c(C)c(O)ccc12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126294",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C1CCC(=O)N1CCN1CCN(Cc2cc(Cl)ccc2F)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101043",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Brc1cnc(NC[C@@]2(N3CCOCC3)CCSC2)nc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140003",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NCC(=O)Nc2cccc(C(=O)NC(C)(C)C)c2)cc1Cl by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61083",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCNC(=O)CNC(=O)N[C@@H](c1ccc(F)cc1)c1cccs1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74531",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)CN(C(=O)c1cc(Cl)ccc1OC(C)C)C1CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87430",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(SCc2n[nH]c3c2[C@H](c2cccs2)C(C#N)=C(N)O3)cc1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43596",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](O)[C@H]1C[C@@H]1c1cccc(C(F)(F)F)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14656",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)(C)CC(C)(C)NS(=O)(=O)c1ccc(F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222665",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](OCC1CC1)C(=O)N1CCC(O)(C(F)(F)F)CC1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224731",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cccc(C(=O)N[C@@H](C)c2ccc(OC(F)F)cc2)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66892",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCCCNc1ccccc1C(=O)N1CC[C@H](C)[C@@H](O)C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104554",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#C[C@H](NCc1ccccc1)c1ccc(C2CC2)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156842",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H](c2sc3ncnn3c2O)N2CCN(c3ccccc3F)CC2)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccccc1NC(=O)CSc1ccccc1N by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110097",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1nnc2ccc(N3CCC[C@@H]3c3ccc(F)cc3)nn12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79081",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=S)Nc2cccc(Cl)c2)o1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234033",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CN(CC(C)(C)O)C(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196231",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@H]([NH+]2CCC3(CC2)OCCO3)CCN1c1c(F)cccc1F by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75973",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@@H]1C[C@H](O)CN1C/C=C/c1ccc(F)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102925",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@@H](O)[C@@H](C)NC(=O)CCn2ccccc2=O)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204068",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CS(=O)(=O)c1ncc(C[NH+]2CCC(Oc3ccccc3F)CC2)n1C[C@H]1CCCO1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(OCn2ccc(C(=O)Nc3cccnc3Cl)n2)ccc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80754",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)Cn1nnc(-c2cccc(Cl)c2)n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230467",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(N2CC[NH+](C)CC2)ncc1C(=O)N1CC[C@H](CO)[C@@H](O)C1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)NC(=O)c1ccc(OC[C@@H]2CCCN2C(=O)c2cccc(F)c2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207835",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(Cc2nc(-c3ccc(F)cc3)cs2)cs1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27786",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)NC[C@@H]1CCCO1)[C@@H](c1ccccc1)c1ccc(F)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185566",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cccc(O)c1)C[C@H]1CCC[NH+](CCc2ccc(Cl)cc2)C1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121493",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nn(C)c(C)c1C[NH2+]CCOc1ccc(Cl)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208871",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2nc(C)c(=O)n(CCC(=O)N3CCN(c4ccccc4F)CC3)c2cc1C by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161751",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(N2CCN(C(=O)c3ccc4c(c3)OCCCO4)CC2)nc1 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22143",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccnc(-c2ccccc2)n1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134488",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(C)n(Cc2ccc(C(=O)N3CCC[C@@H](c4nc(C)ncc4-c4ccc(F)cc4)C3)cc2)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147306",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=CN1CCN([C@H](C(=O)NC2CCCCC2)c2cc3c(cc2[N+](=O)[O-])OCO3)CC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193577",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(Cc1ccc(N2CCCC2=O)cc1)N1CCC(O)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113895",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCSc1nnc2c(n1)O[C@H](c1ccc(F)cc1F)N(C(C)=O)c1ccccc1-2 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151649",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C([O-])c1cn(-c2cc(F)cc(F)c2F)c(=O)[nH]c1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195985",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CN(Cc2csc(-c3cccc([N+](=O)[O-])c3)n2)CC[S@@]1=O by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227134",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@](C)(Nc1cc([N+](=O)[O-])ccc1C)C(=O)[O-] by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10552",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(Oc2ccc(Cl)cc2)nc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33348",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@]1(C)C[C@]2(CC[NH2+]C[C@@H]2c2ccccc2F)CCO1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152845",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2CCC[NH+]2C[C@H](O)c2cccs2)c(OC)c1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212308",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#C[C@H]1[C@@H]2CCCC[C@@H]2S[C@H]1NC(=O)CSc1cn[n-]n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(CCS(=O)(=O)OCC(F)(F)C(F)F)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Oc1nc2ccc(-n3cnnn3)cc2nc1O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82128",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1c(Cl)nc2sccn12)NCc1ccccn1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@H](CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C1CC1 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145650",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@H]1CCCC[NH+]1[C@@H](C)C(=O)Nc1ccc(N)cc1Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125477",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](C1CC1)N(C(=O)c1ccc(F)cc1)C1CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64545",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C([C@H](O)c1ccccc1)N1CC2(CC2)c2ccccc21 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195377",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C1C[C@@H](NNc2ccc([N+](=O)[O-])cc2)C(=O)N1c1ccc(Cl)c(C(F)(F)F)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccccc1-c1nnc2sc(NC(=O)c3cccc(Cl)c3)nn12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151443",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(-n2c(C)cc(/C=C/C(=O)N(Cc3nnc(-c4ccccc4Cl)o3)C3CC3)c2C)no1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CN(C)c1ccc(C(=O)NC[C@H](O)c2cccc(OC(F)F)c2)c(F)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141390",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C=CC[NH+](C)C[C@]1(O)CCCN(Cc2cc(OC)ccc2F)C1=O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227038",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc([C@H](CO)[NH2+][C@H](C)c2cc(F)ccc2F)cc1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110098",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)Oc1ccccc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145028",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C[NH2+]Cc2ccc3c(c2)CCC3)cc(C)c1F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208901",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1([N+](=O)[O-])COP(=O)(Nc2cccc(Br)c2)OC1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233876",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(C(=O)N2CCC(NC(=O)c3cc(F)ccc3NC(=O)[C@@H]3C[C@H]3C)CC2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(Nc1ccc(C(=O)N2CCOCC2)cc1)c1cccc([N+](=O)[O-])c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228127",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H]1CCCN(C(=O)Cc2ccc(F)c(F)c2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218430",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(CC#N)Cc1cn(C)nc1-c1ccc2c(c1)OCCCO2 by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124642",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccc(C(=O)N2CCOCC2)cc1 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14250",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)Oc1ccc(Br)cc1/C=N/n1nnnc1N with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177963",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Nn1c(N/N=C/c2cccc([N+](=O)[O-])c2)nnc1SCc1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204933",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(Br)c(C[NH2+]C[C@@H]2CN(Cc3ccccc3)CCO2)cc1O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H](Cc1ccc(O)cc1)NC(=O)C(=O)Nc1ccc2c(c1)Cc1ccccc1-2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107224",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cccc([C@@H](O)C2(N3CCOCC3)CCCC2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1cccc(NCCC(C)(C)O)c1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1C[C@@](O)(c2ccc(F)cc2)[N+]2=C1CCCC2 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23618",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CS(=O)(=O)c1cncnc1[C@@H]1CCCN(C(=O)C2(c3ccc(F)cc3)CCCC2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1nn(C)cc1CCC(=O)N1CC[C@@H](C)[C@H](O)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33447",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Oc1cccc(C(F)(F)F)c1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)cc1F)c1ccc(N2CCCCS2(=O)=O)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=S)/[NH+]=N/c2c(O)[nH]c3ccccc23)cc1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109186",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(Oc2nc(C(F)(F)F)nc3ccccc23)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58124",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1c(C(=O)NC[C@H]2CCCCO2)cccc1C(F)(F)F by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH+](CC)CC(=O)N1N=C(c2cccs2)C[C@@H]1c1ccc(F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83983",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@H]1CN(C/C=C/c2ccccc2[N+](=O)[O-])[C@H](C)CO1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9845",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](C(=O)Nc1ncccn1)[NH+](C)Cc1ccc(F)cc1F by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145437",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)c2cc(S(=O)(=O)NCCc3ccc(Cl)cc3)ccc2F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19563",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(F)cc1C(=O)Nc1cccc(OC[C@@H]2CCCO2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22476",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@H]1CCc2sc(-c3nnc(SCc4nc5ccc(Cl)cc5n4CCO)o3)cc2C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141494",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccccc1COC1CCN(CC(F)(F)F)CC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226236",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(S(=O)(=O)Nc2cccc([N+](=O)[O-])c2)cc1 by substituting a nitro with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201803",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1[C@H](O)CNC(=O)Nc1cnn(-c2ccccc2F)c1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240331",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1csc(C(=O)Nc2cccc(CN3CCCCC3=O)c2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128029",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2nc[nH]n2)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41098",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule COc1ccc2[nH]c3c(=O)n(/N=C/c4cccc([N+](=O)[O-])c4)cnc3c2c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214247",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1N(C)CC[C@@H]1CCC[C@]1([NH3+])CO by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118870",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[NH+]1CC[C@@H](N(C)C(=O)COc2ccc(F)cc2)[C@H](C)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217191",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1CCN1CC[C@H](C)[NH2+]C[C@H](C)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)NNC(=O)c1cccs1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206696",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([N+](=O)[O-])ccc1NC(=O)N(C)CCO by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36238",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](SCc1cc(-c2ccc(Cl)cc2)no1)C(=O)NC(C)(C)C by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2198",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccc(CCC(=O)N2CCc3ccc(Cl)cc3C2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63591",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=O)([S-])O[C@H]2[C@H]1O by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243946",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(F)c(F)c1)N[C@@H]1C[C@@H]1c1c(F)cccc1F by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25493",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Clc1ccc(C[NH2+][C@H](Cn2cncn2)c2ccccc2)o1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1coc(C(=O)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1=O by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54764",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CCc1cccc(F)c1)OCc1ccc(-n2ccnc2)nc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192984",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccccc1C(=O)NC(=S)Nc1ccccc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80333",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CNC(=O)[C@@H]1CCC[NH+](Cc2ccc(-c3ccc(OC)cc3[N+](=O)[O-])o2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243024",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S(=O)(c1cccc2nonc12)N1CCN(Cc2cccc(F)c2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190826",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(C)cc(Nc2c(F)c(F)nc(F)c2F)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)N1CCC[NH+](C2CCOCC2)CC1)c1ccc(Cl)s1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203553",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)Nc1nc2c(s1)CN(C(=O)c1ccc(F)cc1)CC2 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a aldehyde in the molecule Cc1cc(C=O)c(C)n1-c1cc(C(=O)[O-])cc(C(=O)[O-])c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189270",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C/c1cc2ccccc2nc1Cl)c1nc2ccccc2c(=O)[nH]1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(CNC(=O)C2CCN(c3cccc[nH+]3)CC2)cc1F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161513",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(F)cc1NC(=O)C[NH+]1CCC(c2nc(-c3cccs3)no2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157648",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(CCc1ccccc1OC(F)(F)F)N[C@H]1c2ccccc2C[C@@H]1O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232431",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(C)n(-c2ccccc2NC(=O)c2cccnc2Cl)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136707",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc2nc(N[C@@H]3C=CS(=O)(=O)C3)oc2c1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97303",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O[C@@H](Cc1c(F)cccc1F)c1c(F)cc(F)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183496",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)CC[C@](O)(P(=O)([O-])[O-])[P@@](=O)([O-])O by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(c1cnc2n(c1=O)CCS2)N1CCc2cc(F)ccc2C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141114",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCN[C@]1(C#N)CC[C@@H]([NH+]2CCC[C@H](OCC)C2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145504",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@@H](Oc1ccc(C#N)cc1)C(=O)NC[C@H]1CN(Cc2ccccc2)CCO1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21130",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1csc(CN(C)C[C@@]2(O)CCCN(CC(C)(C)C)C2=O)n1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50773",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nccc1C(=O)N1CC[C@H](Oc2ccc(C(F)(F)F)cn2)C1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122126",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1n[nH]c2c1[C@@H](c1cc(OC)ccc1OC)C(C#N)=C(N)O2 by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37867",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ncccc1NC(=O)c1ccccc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247766",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccccc1OCC(=O)N(Cc1ccc(-c2ccc(F)cc2)o1)[C@H]1CCS(=O)(=O)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32146",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(F)ccc1NC(=O)C1CCN(C(=O)c2cc(-c3ccccn3)[nH]n2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167202",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)N(C[C@@H](C)O)C(=O)Nc1ccccc1SCCC#N with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160906",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)cc2sc(N(Cc3ccncc3)C(=O)Cc3ccccc3)nc12 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18428",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [O-]c1nnc(CSc2nc3cc(Cl)ccc3s2)[nH]1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCC[NH2+][C@H](Cc1ccc(C)cn1)c1cc(Cl)ccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7379",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H]1CCCCN1S(=O)(=O)c1ccc(Cl)nc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84533",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ncccc1NC(=O)C(=O)NCCc1c[nH]c2ccc(F)cc12 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197531",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1CN(c2ccc(NC(=O)COc3ccccc3)cc2Cl)CCN1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(C(F)(F)F)nc1NCCC[NH2+]C1CC1 by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31361",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1cnnc1[C@@H]1CCCN(c2ncnc3ccc(F)cc23)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106370",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCCc1cc(NC(=O)N2CCC[C@@H]2C[C@@H](O)c2cccs2)n(C)n1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130103",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ncnc2ccc(Br)cc12)N1CCCCC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)ccc1S(=O)(=O)Oc1cc(Cl)ccc1C(N)=O by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158360",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cccc2c1OCC[C@@H]2[NH2+]C[C@]1(O)CCOC1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162474",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCCNC(=O)c1c(N2CCCC2=O)c2cc(F)ccc2n1C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96951",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C1CCC1)N1CCCC[C@H]1[C@@H]1CCCC[C@H]1O by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24430",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S(=O)(c1ccc(Cl)cc1C(F)(F)F)N1CCC[NH2+]CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244766",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1nn(C[NH+](C)CCc2ccc(F)cc2)c(=O)c2noc(C)c12 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80939",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)C[NH2+]C[C@@]1(CCO)CCOC1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224858",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(F)c(Cl)c2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238537",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCOc1ccccc1C(=O)N1CCN(C(=O)CC2(O)CCCCC2)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(C)c(NC(=O)C[NH+](Cc2ccccc2F)C2CC2)c(C)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210572",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC[C@H]1CCCN(C(=O)c2cc(C)cc(Br)c2O)C1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104017",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[N+](C)=c1ccc2nc3c(C(=O)[O-])cc(O)c(O)c3oc-2c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190644",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(C(=O)c1ccc(F)nc1)c1cccc2ncccc12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11139",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)NC[C@H](O)c2ccc(Cl)cc2)c(C)c1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100026",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](C)[C@H]1CC[C@H](NC(=O)NCCc2ccc(Cl)cc2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90015",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H](N)CC[NH+](C)C[C@@H]2CCCOC2)cc1F by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24903",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C(=O)Nc2nc(-c3ccc(OC)c(OC)c3)ns2)cc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52249",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1ccc(NCc2ccc3c(c2)OCO3)c(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCc2c(F)cccc2[C@H]1NC(=O)c1cc[nH]n1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98274",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CS(=O)(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccc(Cl)c3)cc2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86881",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1070",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1ccc(C(=S)N2CCN(c3ccc(F)cc3)CC2)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16176",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN1/C(=C\\C=N\\NC(=O)COc2ccc(Cl)cc2)C(C)(C)c2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110573",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NC[C@H]1CCCO1)c1cccc2c1N[C@@H](c1ccc(O)cc1O)[C@H]1CC=C[C@H]21 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159513",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc(CNc2ccc(Cl)c(Cl)c2)no1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34397",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)C[NH+]1CCN(C[C@H](O)COc2cc(Cl)ccc2Cl)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107703",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CNC(=O)c1ccccc1Br)Nc1ccc(OCc2ccccc2)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43318",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COC(=O)c1ccc(Cl)c(NC(=O)c2ccc(C#N)cc2)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220606",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)C[C@H](C)NC(=O)C(=O)Nc1ccc(F)c(Cl)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53809",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1/C(=N\\CCCCCl)[C@H](Cl)C(=O)c2ccccc21 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223181",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)[C@H](O)[C@@H](c1ccccc1O)n1nnc2ccccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181034",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NS(=O)(=O)c1ccc(N2CCc3cc(F)ccc3C2)c([N+](=O)[O-])c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26115",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1c(CO[C@H]2CC[C@H]([NH3+])C2)cccc1[N+](=O)[O-] with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99886",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCCCO[C@@H](C)C(=O)c1cccc(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87675",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CO[C@@]1(C)C[C@@H](N(C)C(=O)c2cc(F)ccc2[N+](=O)[O-])C1(C)C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95637",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccc(CN(C)S(=O)(=O)c2ccc(F)c(C)c2)o1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215684",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule NS(=O)(=O)c1ccc(NC(=O)C2=Cc3cc(Br)ccc3OC=C2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52812",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](C[C@@H](O)c1ccccc1)NC(=O)Cc1cccs1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19106",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cc(C(=O)NCc2cccc(NC(=O)C3CC3)c2)cc(OC)c1Br by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108160",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[C@](O)([C@@H]2Cc3ccccc3N2)C(C)(C)O1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228356",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc([C@H](OC(=O)C[C@H](C)c2cccc(F)c2)c2ccccc2)n1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16916",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1[C@@H]2Sc3[nH]c(=O)sc3[C@H](c3ccc(F)cc3)[C@@H]2C(=O)N1c1ccccc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46020",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccnn2Cc2ccccc2Cl)C1=O by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110703",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cccc(COC(=O)Cn2c(=O)sc3cccc(Cl)c32)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37696",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule ClC(Cl)(Cl)[C@@H]1NCCO1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27791",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2C(=O)/C(=C/c3cccc([N+](=O)[O-])c3)SC2=S)c(C)c1 by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158073",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCCn1cccc1)N1CCO[C@@H](c2ccc(Cl)cc2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61581",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule COc1ccc(OCC(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236635",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(c1ccc(F)cc1)N(CCC[NH+]1CCOCC1)c1nc2ccc(Cl)cc2s1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134945",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@@H](C(=O)N(CCC#N)CCC#N)n1cccn1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206258",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCC(CC)(CC(=O)Nc1cccc(C#N)c1)C(=O)[O-] with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C[C@@H](C)C#N)C(=O)Cc1ccc(-c2ccccc2)cc1 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOc1ccc(F)c(C(=O)N2CCN(C)c3ccc(F)cc32)c1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20372",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)Nc1cccc(NC(=O)Nc2ccc(C)c(Cl)c2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189771",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S(=O)([N-]c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccc(Br)s1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125965",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC[C@@H](C)n1ncc(C(=O)[C@H](C#N)c2nc3ccccc3s2)c1C1CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cc(C[NH+]2CCC[C@@H](n3cccn3)C2)ccc1Cl by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113647",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(NC(=O)C(=O)Nc2cc(C(F)(F)F)ccc2C)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10514",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc([N+](=O)[O-])ccc1NC[C@@H]1CN2CCC[C@@H]2CO1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126493",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(Cl)cc(C(=O)N[C@@H](C)c2ccc(-n3cncn3)cc2)cc1Cl by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139265",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N#Cc1nc(NCCNC(=O)CC2CCCC2)ccc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168403",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)NC(=O)c1ccc(NCc2ccc(F)c(Br)c2)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158213",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOCc1noc(-c2ccc(OC)c(O)c2)n1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(C[C@@H](C(=O)[O-])c2cccc(Cl)c2)n(C)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56445",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)c1ccc(N2CCN(C(=O)N[C@@H]3C[C@@H]3c3cccc(F)c3)CC2)c(F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171427",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCOc1cc([C@H]2c3c(n[nH]c3-c3cc(Cl)c(C)cc3O)C(=O)N2Cc2cccnc2)ccc1O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccc(F)c1)N1CCN(c2ccc(-c3noc(C4CC4)n3)cc2)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]2N=C(c3cccc(Br)c3)C[C@@H](c3ccccc3O)[NH2+]2)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18785",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1cnnc1CSCc1noc(-c2ccccc2Cl)n1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138503",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Nc1nc(Cl)cc(Oc2cc(Cl)c(Cl)cc2Cl)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1nn(-c2nc3ccccc3s2)c2c1[C@@H](c1cccc(O)c1)CC(=O)N2 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93663",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCOC(=O)c1ccc(CNC(=O)Nc2ccc(CC#N)cc2)o1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180909",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OCC(=O)N(Cc2ccc(F)cc2)[C@H]2CCS(=O)(=O)C2)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67201",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(CN(C)C(=O)C[NH+]2CCCN(CC(F)(F)F)CC2)cc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211886",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C1ON=C(c2cccc([N+](=O)[O-])c2)/C1=C/c1ccco1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179652",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C)S(=O)(=O)c1ccc(C(=O)N(Cc2ccccn2)c2nc3ccc(F)cc3s2)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50560",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NNC(=S)NCCc1ccc(Cl)cc1)c1ccoc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)Oc1ccc(NC(=O)C(=O)N[C@@H]2CCCC2(C)C)c(F)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214502",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Sc1nnnn1C1CC1)C(=O)Nc1ccccc1OC(F)(F)F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24616",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)[C@H]1CC[C@@H](C)CC1=C(F)C(=O)[O-] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178102",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COC(=O)[C@H](C)NC(=O)c1ccc(N2CC[C@H](C)C[C@H]2C)c([N+](=O)[O-])c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220775",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1nc([O-])c(C#N)cc1C(=O)N1CCC[C@@H](N(C)CC[NH+](C)C)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211376",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])[C@@H](C)NC(=O)C2CCCCC2)c(F)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101505",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Cl)ccc1-c1ccc(=O)[nH]c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134419",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c(C)c1NC(=O)CN(c1ccccc1F)C1CCCC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78923",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[C@H](c1cccc([N+](=O)[O-])c1)N(C)C(=O)Cc1csc(N2CCCC2=O)n1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207906",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H]1CCc2c(F)cccc2[C@H]1NC(=O)NCc1ccccc1OCCO with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N1CC[C@]2(O)CCN(c3ncccn3)C[C@@H]2C1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41516",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ncccc1Oc1cc(Cl)ccc1C(N)=S by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127136",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C1N=CN=C2C1=NCN2[C@@H]1O[C@@H](COC(=O)c2ccccc2)[C@@H](O)[C@@H]1O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCNC(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210386",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCN(CC)c1ccc(/C=C2/NC(=O)N(c3cccc(Cl)c3)C2=O)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)NCCOC(=O)C1(c2cccc(F)c2)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129123",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(NCc2cccc(OCC(F)F)n2)c(F)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211140",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule C[C@@H]1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)C[C@@H](C)O1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87327",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CN(C)C(=O)Sc1ccccc1NC(=O)/C=C/c1ccccc1[N+](=O)[O-] with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90878",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(Cl)c1C[C@@H]1COCC[C@@H]1[NH2+]C1CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23661",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1nc(Cl)cc(NCC[C@H](O)c2ccccc2)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73822",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc(C(F)(F)F)nc1[O-])c1ccc2c(c1)OCCO2 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210017",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(Oc2ccc(F)cc2C[NH2+]C2CC2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124904",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)N2CCN(Cc3ccc(Cl)cc3)CC2)n1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52041",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](C)[NH+](C)CCNC(=O)Nc1c(F)cccc1Br by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145519",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cc(Br)cs1)C[C@H]1CCCC(C)(C)[C@@H]1[NH3+] by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]([NH3+])(Cc1nccs1)c1ccc(Br)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181772",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(COc1ccc(Cl)cc1Cl)NCC[C@@H]1CCCOC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12296",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](C(=O)Nc1ccc(Br)cc1)[N+](C)(C)C1CCCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@](O)(CNC(=O)Cc1ccccc1Cl)c1ccccc1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243730",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2F)[NH+]2CCCC2)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141138",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc([C@H](CO)NC(=O)NCCC(F)(F)F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1c(C[NH+](C)CCN2CCOCC2)cccc1[N+](=O)[O-] with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41009",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NNC(=O)c1cnc([C@H]2CCCO2)s1)c1ccc(F)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8248",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C[NH+](C)Cc2ccc(Br)cc2N)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155908",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C1CCCN1C(=O)Cn1cc([N+](=O)[O-])ccc1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153913",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(COC1CCCC1)NNC(=O)c1ccc(F)cc1Br by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182940",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([O-])[C@H]1COCCN1C(=O)c1ccc(Br)nc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52119",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(CN2COc3ccc4c(c3C2)O/C(=C\\c2ccc(Cl)cc2)C4=O)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8485",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COC(=O)[C@H](NC(=O)Cc1ccc(C)c(O)c1)C(C)(C)C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89487",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1ccc(C(F)(F)F)cn1CCOc1ccc([N+](=O)[O-])cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185770",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CCOCc1ccccc1[N-]S(=O)(=O)c1cc(C)c(C)cc1[N+](=O)[O-] with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114440",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(NCC(=O)NCC(=O)N1CCCC1)c1ccc(F)cc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241697",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)N1CCCN(C(=O)OC(C)(C)C)CC1 by replacing a nitro by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235404",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)[N-]c1ccc(S(=O)(=O)NC[C@H]2CCC[C@H](C)C2)cc1F by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81866",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCOc1ccccc1C(=O)N/N=C/c1ccc([N+](=O)[O-])s1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100957",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)N(C)c1ccc(NC(=O)CNc2ccc(Cl)cc2)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccco1)[NH+](CCC(=O)Nc1cc(N)ccc1F)C1CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158638",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccccc1N1CCCN(C(=O)c2cc3cc(Cl)ccc3[nH]2)CC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119631",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOC(=O)COc1ccc(Br)cc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103882",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cl[C@@H]1CCCC[C@@H]1[C@@H]1CCOC2(CCSCC2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113684",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1cc(C)c(NC(=O)C(=O)NC[C@H]2CCC[C@@H]2O)c(C)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)NC1CCN(C(=O)c2ccc(Cl)cc2)CC1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97461",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)S(=O)(=O)c1ccccc1C(=O)NC[C@H](C)C#N by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225453",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CNC(=O)CCCn1cc(C(=O)[O-])cc1Br by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215583",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cc2ncc([C@@H](C)[NH2+]CC(C)(C)[C@H](O)C(C)C)c(C)n2n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101103",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1ccccc1/[NH+]=c1\\scc(-c2ccc([N+](=O)[O-])cc2)n1CCO with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc(Br)cc1/C=C1\\SC(=O)NC1=O)Nc1ccc2ccccc2c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9091",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](C(=O)Nc1cc(Cl)cc(Cl)c1)N1CCN(C(=O)C2CC2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134088",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CCO[C@@H](CCNC(=O)c2cc(Cl)c[nH]c2=O)C1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60829",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Clc1ccc(CC[NH2+][C@H]2C[C@H]3CC[C@@H]2C3)cn1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31530",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc(C)c(N2CCN(C[C@]3(O)CC[NH2+]C3)CC2)n1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51015",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ncnc2c1nnn2Cc1ccccc1F)c1ccccc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188726",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccsc1[C@@H]1Nc2ccc(F)cc2[C@H]2C=CC[C@@H]21 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151935",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(OCc2ncc(Cl)n2C)c(CO)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222126",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1sc2ncnc(NCc3ccc([N+](=O)[O-])cc3)c2c1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193084",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCn1c(SCC(=O)Nc2ccc(C)c(Cl)c2)nnc1[C@H]1CCCN1C(=O)c1ccc(C)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157063",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cc1ncc(CNc2ccc(S(=O)(=O)C(F)F)cc2)s1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1COC[C@H](C)N1C(=O)c1cc(F)c(F)cc1Cl by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1nc2c(s1)CN(C(=O)c1ccc(Br)o1)CC2)c1cccs1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109150",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cccc(C(C)C)c1NC(=O)CNc1ccc(F)c(Cl)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62707",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@@H](C#N)Sc1nnc(N2CCCCC2)n1-c1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)[NH+]2CCC(CC[NH3+])CC2)cc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109160",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1CCC[C@@H](C)N1C(=O)COc1ccccc1OCC(F)(F)F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55738",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)c1cccc(C(=O)NCc2cc(Br)cs2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129253",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccsc1[C@@](C)(O)c1cc(F)c(Cl)cc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241281",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc(NS(=O)(=O)c2ccc([O-])c([N+](=O)[O-])c2)c(F)cc1F by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Cn1cnc(-c2ccc(F)cc2)cc1=O)Nc1ccc(F)c(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186787",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c([C@@H](O)Cc2ccc(Cl)s2)cnn1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89429",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1406",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)N1CCC(NS(=O)(=O)c2c(C)c(Cl)cc(C)c2Cl)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242609",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N[C@@H]1CCCC[C@@H]1O)c1c(F)cc(Br)cc1F by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173086",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C#CCOc1ccc(F)cc1NC(=O)C(=O)N[C@@H]1[C@H]2CCO[C@@H]2C1(C)C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23917",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H](O)C1CCCC1)NC1CCC([NH+]2CCCCC2)CC1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150920",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1noc([C@H]2CCCN(C(=O)COc3ccccc3F)C2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179506",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)O[C@@]1(C(C)=O)CC[C@H]2[C@H]3C[C@H](Cl)C4=CC(=O)CC[C@@]4(C)[C@H]3CC[C@@]21C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36704",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC(C)N(Cc1ccc(C#N)cc1)C(=O)C=C1CCSCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=Cc1ccc(OCCOc2ccccc2)cn1 by replacing a aldehyde by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73362",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](C(=O)NCc1ccccc1F)N(C)CC[C@@H]1CCCC[NH+]1C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76021",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCn1nc(C)c(NC(=O)Nc2c(F)cccc2Br)c1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182241",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C[C@](C)([NH3+])c1ccccc1Cl by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173236",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@]1(c2ccc(Cl)cc2)NC(=O)N(C[C@@H](O)c2cccc(F)c2)C1=O by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67316",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cc1ccc(F)cc1)NNC(=O)C1(c2ccccc2)CCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#CCC[C@H](C#N)CN1CCc2c(cccc2N2CCOC2=O)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98069",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C(=O)NC(Nc1ccccn1)(C(F)(F)F)C(F)(F)F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248272",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CN(C)C1CC[NH+]([C@H]2CCCC[C@H]2O)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45855",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CCC#N)C(=O)c1occc1Br by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41482",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1cc(C[NH2+]CC2(CO)CC2)ccc1Br by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197297",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[NH2+][C@]1(CO)CC[C@@H]([NH+](C)CCCOC)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183343",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1c(CN2CCCN(c3ncccn3)CC2)cc(C#N)n1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10232",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NCc1cccs1)NCC1(O)CCCC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222075",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC1(C)C[C@H]2[C@@H](O)C3=C(C[C@](C)(O)[C@@H]2C1)C(=O)O[C@H]3O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211089",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@@H](O)C[NH+](CC(F)(F)F)C1CCCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71859",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1[nH+]ccn1CCNC(=O)CN(C)c1nc2c(F)cccc2s1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221357",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@H](O)c1cc[nH+]c(N(C)C[C@@H](C)C#N)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169312",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC1(NC(=O)NCCCc2ccc(O)cc2)Cc2ccccc2C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156266",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(CCN1CCOCC1)C(=O)NCCc1nc(C(F)(F)F)cs1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7726",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@H](Cc1ccc(O)cc1)NC(=O)Nc1ccc(F)c(C#N)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213795",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(CNn2cnnc2)cc(Br)c1OC with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88455",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(=O)N(CCc1ccc(F)cc1)CC1=CCC[NH+](CCO)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22399",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule NC(=O)c1ccccc1OCc1ccc(OCC(F)(F)F)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39960",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H](NC(=O)N1CC[C@H]1c1ccc(Cl)cc1)c1nc(C)cs1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234546",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CS(=O)(=O)[C@@H]1CC[C@@H](OC(=O)/C=C/c2ccc(Cl)c(Cl)c2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51386",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CO[C@@H]1CCCC[C@H]1NC(=O)NNc1cccc([N+](=O)[O-])c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21668",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1[C@@H]1CCN(C(=O)c2ccc(C#N)cc2)C1 by substituting a nitrile with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26457",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(F)cc1NC(=O)NCCCNC(C)=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182318",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule N#C[C@@H]1CNCCN1C(=O)Nc1ccccc1C(F)(F)F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158408",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH2+][C@H](C)c1ccc(N(C)C2CCCC2)c(F)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233361",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)COc1ccccc1CSc1nnnn1C1CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9396",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1c(C)[nH]c(C(=O)COC(=O)c2c(-c3c(F)cccc3Cl)noc2C)c1C by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37610",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#CC(C#N)=c1s/c(=C\\c2ccc(F)cc2)c(=O)n1CCc1cccnc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141260",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)c1ccc(F)c(NC(=O)N2CC[C@H](C)[C@@H](O)C2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16027",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CNS(=O)(=O)c1cc(C(=O)NC2[C@@H](C)CCC[C@@H]2C)ccc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C=C\\c1ccc(OC[C@H](O)CN2C(=O)c3cccc4cccc2c34)c(OC)c1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97257",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H]1OCC[C@@H]1[C@H](O)c1ccc(-c2ccccc2)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244274",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NS(=O)(=O)Cc2ccccc2)ccc1[N+](=O)[O-] by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243319",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule COc1ccc(CC(=O)CC#N)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166842",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C=CC1CC[NH+](Cc2ccc(N(C)CCC#N)cc2)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112514",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule N#Cc1ccc(OCCNC(=O)NCCc2cccc(O)c2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142648",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH2+][C@@H](c1ccc(F)cc1Cl)[C@H](C)c1ccccn1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111886",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc(C[NH+]2CCC[C@@H](CNC(=O)Nc3cccc(F)c3)C2)cs1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93169",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cc(C(=O)OCCOc2cncc(Cl)n2)nn1C by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55179",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)c1ccccc1I by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206841",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@@H](C/N=C/c1ccc(Cl)cc1)c1ccccc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78576",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(C2=N/C(=C\\c3ccc(OC(C)=O)cc3)C(=O)O2)cc1Br by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228630",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CCN(C(=O)c2ccc(NC(=O)N(C)C)cc2Cl)C[C@@H]1O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237176",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(F)ccc1NC(=O)NCc1cn(-c2ccccc2)nn1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)c(NCc2cc(C(N)=O)cs2)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)c(NC(=O)N(C)Cc2ccc(Br)cc2)c1C by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191207",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1c(CC(=O)NNC(=O)c2cc(Cl)c[nH]2)nc2ccccc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@H](C(=O)Nc2cc(Cl)cc(Cl)c2)[NH2+]1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73858",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(NC(=O)Cn2nc3c4scc(-c5ccc(F)cc5)c4ncn3c2=O)c(OC)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162326",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(F)(F)F)n2nc([C@H]3CCC[NH+]3Cc3cn[nH]c3C(C)(C)C)cc2n1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48196",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=S(=O)(NCc1nnc2ccccn12)c1ccc(Cl)c(Cl)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27249",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)(C)CN(C[C@H](O)c1ccccc1)S(=O)(=O)c1cccc2c1COC2=O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16539",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1ccc(O[C@@H](C)C#N)c(C[NH3+])n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165903",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1cc(Cl)cc(Cl)c1)C(=O)NCc1ccc(C#N)cc1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9860",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCCC(=O)N1CCC[C@@H]2CCCC[C@@H]21)S(=O)(=O)c1ccc(F)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223254",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(COC(=O)c2cc(-c3ccc(Br)cc3)n[nH]2)cs1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2553",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(O[C@H](CC)C(=O)[O-])c(Cl)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222996",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCCN(CCO)C(=O)N[C@@H]1C[C@H](C)N(c2ccccc2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103303",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H](Nc1ccc(NC(=O)[C@H]2CCO[C@@H]2C)cc1Cl)c1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139884",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@H]1CN(C(=O)c2nn(-c3cccc(Br)c3)c3c2CCCC3)CCO1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19476",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cccc(OC)c1C(=O)N1CCN(c2nccn2-c2ccccc2F)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207513",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCc1ccc([C@H]2CC(=O)N=C(SCC(=O)OC(C)C)[C@H]2C#N)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229336",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2ccc(OC(C)C)cc2)cc1[N+](=O)[O-] by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47703",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)Nc1nc(COc2ccc(C(C)=O)c(F)c2)cs1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82670",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@]1(c2ccccc2)NC(=O)N(C[C@H](O)c2ccc(F)cc2F)C1=O by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94317",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CCN(c2ccccc2)CC1)Nc1cc(Cl)ccc1Cl by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180800",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H](C)NC(=O)Nc2ccn(C)n2)cc1[N+](=O)[O-] by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197706",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCSc1ncc(Cl)c(C(=O)Nc2ccccc2C(=O)OC)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91699",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(C)c1ccc(N(C)Cc2nc(COc3ccc(F)cc3)no2)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87485",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NC1CCN(c2cccc[nH+]2)CC1)C1(c2ccc(Br)cc2)CCC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41999",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nn(CC(C)C)c(Cl)c1[C@H]1CCCN1C(=O)NCc1ncn(C)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249160",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1cc(Cl)cc(/C=N/NC(=O)[C@@H]2C=C(c3ccccc3)N=N2)c1O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79936",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1nc(N2CCN(c3ccccc3C#N)CC2)c2cc[nH]c2n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150567",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCC[C@H](C)NC(=O)C1CCN(S(=O)(=O)Cc2cccc(Cl)c2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117386",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncccc1C(=O)N1CCCC[C@@H]1C[C@@H](C)O by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61284",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@H]1C[C@@H](C)CN(c2oc(Cc3ccccc3)nc2C#N)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202339",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1nc(C(F)(F)F)nn1CC(=O)Nc1ccc(Oc2ccc(F)cc2)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246340",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](OC(=O)[C@H]1CC(=O)N(C)[C@@H]1c1cccc(Cl)c1)[C@H]1CCCO1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86536",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H](CC[C@@H]1COc2ccccc21)c1ccccc1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92624",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1CCCNc1ccccc1C(=O)N1CCC[C@H]1CO by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200210",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=S1(=O)C[C@H](O)[C@@H](NCC/[NH+]=C/c2ccccc2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54614",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CO[C@H]1CCC[C@@H]1OC(=O)c1cc(Br)ccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171471",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH+](C)Cc1[nH+][nH]c(N)c1-c1ccc(Cl)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143051",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#Cc1c(-c2ccncc2)c2c([nH]c1=S)CCCC2 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244375",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1cccc([C@@H](CBr)CC[C@H]2CCCO2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59973",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cc(C(=O)NC[C@@](C)(O)c2cnn(C)c2)c(C)n1Cc1cccs1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228823",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NC[C@@H](O)c1ccc(F)cc1)N[C@H]1CC(=O)N(C2CC2)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224062",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1onc(-c2ccc(F)cc2)c1C(=O)N[C@H](C)[C@@H]1CCCO1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246688",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(c1cc(F)cc2nccnc12)N1CCc2cc(F)ccc2C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127009",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN(C(=O)NCc1cc(Br)cs1)[C@@H](C)c1cccc(OC)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95302",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(c1c(F)c(F)c(F)c(F)c1F)N1CC[NH+](CCO)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114554",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1cc(F)cc(NNC(=O)C[C@H](O)c2ccccc2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67938",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(OCC)c(NCc2cc(C#N)cs2)c1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37061",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)cc1NC(=O)c1cccc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4845",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CO[C@H](CO)CN1Cc1c(Cl)nc2sccn12 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OCC(=O)NCC[C@H](O)c2ccccc2)ccc1Cl by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161794",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](Oc1ccccc1)C(=O)Nc1ccccc1Br by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135308",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nnc(SCc2ccnc(Cl)c2)n1CC(N)=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24429",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)c1ccccc1NC(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235701",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H]1Cc2ccccc2[C@@H]1[NH2+]Cc1ccc(N2CCCCC2)cc1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCCNC(=O)c1ccc(OC(F)(F)F)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222613",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CO[C@H](CO)CN1C(=O)c1cc(CCc2ccccc2)ccc1O by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97597",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CSc1cccc2sc(N(C[C@@H]3CCCO3)C(=O)c3cccc([N+](=O)[O-])c3)nc12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200942",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C(=O)NNC(=O)c1cc(C)c(-c2ccc(F)cc2)s1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215844",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1nc(=O)[nH]c(C)c1CC(=O)N[C@@H](C)CCCO by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190883",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOC(=O)[C@@H](C)Sc1nnc2n1CCN2c1ccc(F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42578",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1ccc(C(=O)/C=C/c2cnc(-c3cccs3)s2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31689",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(C(=O)Cn2cnc3cccc(Br)c3c2=O)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nccn1-c1ccc(CNC(=O)c2cccc(S(=O)(=O)N3C[C@@H](C)C[C@H](C)C3)c2)cc1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113934",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(CNC(=O)C[C@H](c1ccccc1)C(F)(F)F)c1ccncc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38434",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCCc1ccc(Cl)cc1)C1CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9407",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(F)c(CNC(=O)CCNS(=O)(=O)c2cccnc2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75205",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC1=C2[C@H](c3ccccc3Br)CC(=O)N[C@@H]2N(c2ccc([O-])nn2)N1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209164",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc2c(c1)OCCO2)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71916",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1nn(CN2C[C@H](C)O[C@H](c3ccccc3)C2)c(C)c1[N+](=O)[O-] by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82927",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COc1ccnc(NC(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175795",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H](CN1CCN(c2ccccc2F)CC1)Cn1nnnc1-c1ccccc1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33120",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC(=O)c1ccnc(N2CCO[C@H](C#N)C2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74847",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(S(=O)(=O)[N-]c2ccc3nc([C@H]4CCCO4)[nH]c3c2)ccc1Br by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(=O)O[C@@H]1[C@H](c2ccc(=O)oc2)[C@@]2(C)CC[C@@H]3[C@H](CC[C@@H]4C[C@@H](O)CC[C@@]43C)[C@]23O[C@H]13 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49745",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC(C)(C)[C@H](C#N)NC(=O)c1cnc(-c2ccoc2)s1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93942",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1csc(NC(=O)[C@@H](C)CCc2cccc(F)c2)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89654",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCCc1nn([C@@H]2CCCC[C@H]2O)c(=O)o1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8819",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccccc1F)Nc1c(C(=O)Nc2ccccc2F)oc2ccccc12 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1Cl by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22310",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1ccc(-c2nnc(SCc3cccc([N+](=O)[O-])c3C)n2N)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158326",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(C)c1NC(=O)CN1CCN(C(=O)c2cncc(Br)c2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235716",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCCOc1ccc(/C=C(\\C#N)C(=O)Nc2ccccc2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171497",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cc(Sc2ccc([N+](=O)[O-])cc2)cs1 by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#C[C@@H]1C[NH2+]CCN1Cc1cc(F)ccc1Br by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16534",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Clc1cc(-n2cnnn2)ccc1-c1nc(-c2cnccn2)no1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147324",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(CCNS(=O)(=O)c2cccc(Cl)c2)on1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule C[C@H]1CCC[C@H](C)N1C(=O)[C@@H](C)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157850",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1cccc(Oc2ncnc3cc(Cl)ccc23)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180142",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c([C@@H](O)c2ccc(OC(C)C)cc2)c(C)nn1C by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96737",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC(C)N(Cc1nnc(-c2ccccc2Cl)o1)C(=O)c1ccccc1[N+](=O)[O-] with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225255",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCCCN1c1ccc(C(F)(F)F)cc1NC(=O)c1ccco1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227618",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(F)c(C(=O)c2ccc(F)c(Br)c2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80004",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O[C@@H](COC[C@@H]1CCCO1)C[NH+]1CCC(c2ccc(F)cc2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146229",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCCn1nc(-c2ccc(Cl)cc2)ccc1=O)Nc1ccc2c(c1)OCO2 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150547",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(OC)c(NC(=O)CCC(=O)c2ccc(Br)cc2)cc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54975",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1041",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1ccccc1C(=O)NCCSc1ccc(Cl)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33725",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OCC(=O)N2CCN(c3ccc(-n4ccnc4)nn3)CC2)ccc1Cl by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91426",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc(Cl)cc1)c1ccccc1Cl by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190801",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)Oc1cccc(C[NH2+]Cc2ccc(Cl)o2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81039",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCOc1ccc(C(=O)NC(=S)Nc2c(C)cc(Br)cc2C)cc1[N+](=O)[O-] by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158728",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCCN1CCOCC1)c1ccc(-n2cc(-c3ccc(Cl)cc3)cn2)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148913",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CNC(=O)Cc1cccc(F)c1)NCc1nccc2ccccc12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213056",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@]1(C)C[C@@](Nc2cc(C)cc(F)c2)(C(N)=O)CCO1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242201",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCCc1c(F)cccc1F)Nc1nccs1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104286",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Nc1c(Br)cnn1-c1ncccn1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28757",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)[C@@]1(O)CSCC(C)(C)C1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220560",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)=CC(=O)Nc1cccn(Cc2ccc(F)cc2)c1=O by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101409",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(C)c1ccc(NC(=O)NNc2ccc(F)c(F)c2F)c[nH+]1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223542",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1nc(/C([O-])=N/S(=O)(=O)Cc2ccc(C#N)cc2)ccc1=O by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227483",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCc1cc(C[C@]2(O)CS[C@@H](C)C2)n(CC)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199452",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCCN(C(=O)Cc1cccc(F)c1F)[C@@H]1CCS(=O)(=O)C1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83519",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)Cc1ccccc1NC(=O)c1cccc(C(F)(F)F)c1F by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181818",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccnn1Cc1cccc(Cl)c1Cl)[C@@H]1CCCN(S(=O)(=O)c2ccccc2)C1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2082",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C=C1CCSCC1)N[C@H](c1ccccc1)c1ccc(F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66006",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NC(=O)C2=Cc3cc(Cl)ccc3OC=C2)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98134",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)c2ccc(-n3ccc(C(F)(F)F)n3)cc2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153499",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCC(CC)[C@@H](O)CNc1ccc(-n2ccc(C)n2)nn1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91417",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C([O-])C[C@@H](Cc1ccc(Br)cc1)C(=O)Nc1ccccc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154719",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(C)c(Cn2cnc3c(nnn3-c3ccc(Cl)cc3)c2=O)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148174",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(C(=O)CSc2ncccc2Cl)s1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55547",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H](O)c1cccc(OC(F)F)c1)[C@H]1Cc2ccccc2O1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187791",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(Cl)cc1)N(Cc1ccc(Cl)cc1)Cc1cccnc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236714",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule COc1ccc(-c2c(C(C)=O)c(C)nc3sc(C#N)c(N)c23)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182006",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1nc(/C=C/c2ccc(F)cc2)oc1N1CCN(C(=O)c2cccc(F)c2)CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18704",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccnc([C@@H](O)[C@H]2CCC[C@H](S(C)(=O)=O)C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41520",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Oc1ccc(Cl)cc1N1C(=O)[C@H]2CC=CC[C@@H]2C1=O)c1ccco1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57286",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H](CCCO)NC(=O)N[C@H]1CCCOc2ccccc21 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194143",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](O)c1ccn(CC[C@@H]2CCCO2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183225",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](CCO)CNS(=O)(=O)c1ccc(Cl)nc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51530",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(C[NH2+]CCC(=O)NC2CC2)ccc1Br with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206918",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(N[C@H]1CCC[NH+](Cc2ccc(Cl)cc2)C1)c1ccc[nH]c1=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C=O)ccc1OCc1ccc(SC(F)F)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232574",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1C(=O)N2CCC[C@@H]2C(=O)N1Cc1ccc(Cl)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102742",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCc1cccnc1-n1cncn1)c1cc(-c2ccccc2Cl)[nH]n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161131",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc2[nH+]c(CNc3ccccc3CCC(F)(F)F)cn12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55373",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]C[C@H](C)C(=O)NCC#N by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124385",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccccc1)OCC(=O)c1cccc([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145938",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1[C@@H](C(=O)[O-])CCN1C(=O)c1cc([N+](=O)[O-])ccc1Br with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45753",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H]1CCCN(C(=O)Cc2c(OC)ccc3cc(Br)ccc23)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73514",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1nnc(-c2ccncc2)n1C1CC1)C(=O)N[C@H](C)c1ccc(F)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204741",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(F)c(CNC(=O)NCC[C@H](O)c2ccccc2)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H](COc1ccccc1)CSc1ccc2ccccc2n1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212322",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](NCCc1nnc(-c2ccccc2)o1)c1occc1Br with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94723",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CC[C@@H]4CCCO4)C3)noc2n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249337",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(N2CCN(Cc3ccc(F)cc3)C(=O)C2)[nH+]c(N)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48683",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CCOc1ccccc1[C@@H]1Nc2c(ccc([N+](=O)[O-])c2C)[C@H]2C=CC[C@H]21 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5484",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC1CCN(C(=O)[C@@H]2C[C@@H]2c2ccccc2OC(F)(F)F)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]1c2ccc(F)cc2CCN1C(=O)C[C@H](O)c1cccc(F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61933",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CNC(=O)CN(C)C(=O)c1occc1Br by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210866",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCC(=O)NCCC(=O)N1CCN(c2ccc(F)cc2)CC1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238943",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(N2C(=O)[C@@H]([C@H]3NCCc4c3[nH]c3ccccc43)[C@@H](O)N[C@H]2O)c(C)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10653",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nc2ccccc2n1CCNC(=O)c1cc(F)ccc1[N-]S(C)(=O)=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213457",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nn(-c2ccccc2)c(Cl)c1C(=O)NNc1cccc(Cl)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232745",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(NC(=O)C[NH+]2CCC[C@H](C(=O)NCC(F)(F)F)C2)on1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97800",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O[C@H]1c2ccccc2C[C@H]1C[C@@H]1Cc2ccccc21 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154995",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1ccc(C[NH2+]C[C@H]2CN3CCCC[C@@H]3CO2)o1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(Cc1noc(-c2csc([N+](=O)[O-])c2)n1)NCc1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177417",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1C(=O)Nc1cc([N+](=O)[O-])ccc1C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207056",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ccc(F)cc1F)C(=O)N[C@H](c1ccccc1)c1ccccn1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188737",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1ccc(-c2nnn(C[C@H](O)CO[C@@H](C)c3ccc(Cl)cc3)n2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149071",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)N[C@H](C)c2ccccc2Cl)c(OCC(=O)N(C)C)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N#Cc1ccc(O)cc1C(F)(F)F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109993",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc(C(=O)N(C)[C@@H](C)Cc2cccs2)c1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146252",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C/[NH+]=C(/NCc1cccc(CO)c1)N[C@H]1CCC[C@H](C)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41575",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(OC)cc([C@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC[NH+](C)C)C(=O)c1cc(F)c(Cl)cc1Cl by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46248",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(=O)n(CC(=O)N2CCCC2)c(-c2cccc(Cl)c2)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13257",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(OC[C@@H](O)CN2CCO[C@H]3CCCC[C@@H]32)cc1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176149",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)NC(=S)Nc2ccccc2O)c1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NOCc1ccccc1)c1ccc(=O)n(Cc2ccccc2Cl)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211543",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCNS(=O)(=O)c1ccc(C)c(C(=O)Nc2ccc(F)cc2F)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCn1c(=O)n(CC(=O)Nc2cccc(Cl)c2)c2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71875",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(C)c(-n2cnn(CN3CCN(c4ncc(C(F)(F)F)cc4Cl)CC3)c2=S)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66002",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(-c2nc(CC(=O)Nc3ccc(Cl)nn3)cs2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75805",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC[NH+](CC(N)=O)Cc1cccc(F)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11720",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1C[C@@H](NS(=O)(=O)c2cccc(F)c2)CC[NH+]1Cc1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78625",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(CC(=O)Nc2ccc(OC(F)(F)Cl)cc2)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34867",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule [NH3+]C1CC(OC(=O)Nc2ccccc2C(F)(F)F)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223901",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCCn1c(N)c(C(=O)NCc2ccccc2Cl)c2nc3ccccc3nc21 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78643",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)N(C)[C@H](C)c2ccco2)cc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21911",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1n[nH]c(SCC(=O)N(C)[C@H](c2ccc(F)cc2)C2CC2)n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226913",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1C[S@@](=O)[C@@H](C)C(=O)Nc1cc(C)cc(C)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158303",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CC1=NC(=O)[C@H]2C(=N1)NC(=O)C[C@@H]2c1cccc([N+](=O)[O-])c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78574",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([O-])C1=N[C@H]2NC=NN2[C@@H]([C@H]2C=NN=C2c2ccc(F)cc2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule COc1ccc(C2=NN(C(C)=O)[C@H](c3ccc([N+](=O)[O-])cc3)O2)cc1OC by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30338",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(-c2nc(CC(=O)N3CCN(c4ccccc4F)CC3)cs2)cc1OC with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(O)(CC)CNC(=O)C(=O)Nc1cc(C)on1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173789",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(Cl)cc1NC(=O)CSc1nnc(C)n1-c1ccccc1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217546",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CSC[C@H](C)NS(=O)(=O)Cc1ccccc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37759",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(F)cc1S(=O)(=O)NC[C@@H](c1ccc2c(c1)OCO2)N1CC[NH+](C)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76299",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(/C=N\\N2C(=S)SC(C)(C)[C@H]2N(O)C(=O)Nc2ccccc2)cc1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195651",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C(/C=C/c1ccc(Cl)c([N+](=O)[O-])c1)N1CCN(c2c(Cl)cccc2[N+](=O)[O-])CC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27104",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nc2ccccc2n1CCNC(=O)CNC(=O)c1ccc(F)c(F)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1NC(=O)CNC(=O)c1nccnc1-c1nc2ccccc2s1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a aldehyde in the molecule CC(=O)Nc1ccc(NC(=O)c2oc(COc3ccc(C=O)cc3)cc2C)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211890",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCCN(Cc1ccoc1)S(=O)(=O)c1ccc(Cl)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106403",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1C(=O)/C(=C\\c2cc(Br)c(O)c(OC)c2)C(=O)N(c2ccc(Cl)cc2)C1=S by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197379",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3397",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCn1c(CN2CC[NH+](Cc3ccccc3)CC2)nc2cc(NC(=O)c3ccc(Cl)cc3)ccc21 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100200",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=C(NC[C@@H](c1cccs1)N1CCc2ccccc21)c1ccc(Cl)c([N+](=O)[O-])c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199239",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c([C@@H](C)[NH2+][C@H]2CC=CCC2)cccc1[N+](=O)[O-] by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73470",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CC[C@H](NC(=O)N1CC[NH+](CC2CC2)CC1)c1cccc([N+](=O)[O-])c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCc2c(sc3nc(S)n(C4CCCCC4)c(=O)c23)C1 by substituting a thiol with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155706",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@](C(=O)N(C)Cc1cnccn1)(c1ccccc1)C(F)(F)F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113065",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C/C=C/C=C/C(=O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190733",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Nc1nc2nc(-c3ccc(F)cc3)c(CCN3CCOCC3)cn2n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204709",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(/C=N\\n2cnnc2)cc(Br)c1OCC by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(OCC(=O)N(C)CC(=O)Nc2ccccc2Cl)ccc1[N+](=O)[O-] with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192225",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CNC(=O)N(C)[C@H]1CC[NH+](C)C[C@H]1C)Oc1ccccc1F by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242698",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](N(C)c1cc2c(cc1Br)[C@H](N)C(=O)N2)C(C)(C)C by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16352",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CN(C(=O)c2c(F)cc(F)cc2F)CC[C@@H]1[NH3+] with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@H](CC#N)N(C)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231745",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Cl)c(Br)c1)[C@H]1COCCO1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225964",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc(F)cc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17219",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule NC(=S)[C@H]1CN(Cc2ccc(O)cc2)CCO1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120630",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C/C(=C\\C=C\\c1ccccc1)C(=O)Nc1ccc(F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@H]1CCCN1C(=O)CN1CCN(c2ccccc2F)C1=O by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70351",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cl)Cc1ccc2c(c1)OCO2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)(O)CCc1cccc(C(=O)N(CCO)[C@H]2CCS(=O)(=O)C2)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201015",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccc(N2CCN(C(=O)[C@H](O)c3ccc4ccccc4c3)CC2=O)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12238",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a aldehyde in the molecule O=Cc1ccccc1OC(=O)c1ccco1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1CCCC[C@@H]1[C@H]1CCCCCN1C(=O)c1cc(F)ccc1O by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138513",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(Oc2ncnc(NC3CCCCCC3)c2[N+](=O)[O-])cc1 by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201537",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CO)C[NH2+][C@H]1CC[C@H](NC(=O)OC(C)(C)C)C1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(O)c(-c2cc(C(=O)Nc3cccnc3)n[nH]2)cc1C by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80872",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1cc(OC)c(OC)cc1C(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177180",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)N(C)C1CC[NH+](Cc2ccc(C(=O)OC)c(F)c2)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26421",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#C[C@@H]1CN(C(=O)N[C@@H]2CCCc3ccc(F)cc32)CCO1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115919",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)NC[C@H]1CCC[C@H](O)C1)c1nc(-c2ccccc2)cs1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148018",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CSc1ccccc1[C@@H](O)[C@H](C[NH3+])c1c(F)cccc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177298",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1cccs1)NC[C@@H]1CCN(c2ccc(F)cc2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70223",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(Cc2cc(=O)n3ccsc3[nH+]2)C[C@@H]1O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197235",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1cccc(Cl)c1)c1nnc([C@H]2CCCN(C(=O)c3cccc(F)c3)C2)s1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(S(=O)(=O)c2ccc(F)cc2)cc1)OCc1ccccc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7557",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule COc1cc(C[NH+]2CCC[C@@H](Cn3ccnn3)C2)cc([N+](=O)[O-])c1O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216182",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1nc(-c2nc3ccccc3s2)cs1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142918",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)[C@H](NC(=O)[C@@H](C)Oc1cccc(F)c1)C(C)C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43946",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H](NC[C@H](O)c1ccccc1Cl)c1cccc(-c2ccncc2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83976",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)c1ccc(C[NH+](CC(=O)[O-])CC(F)(F)F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101983",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cc(C[NH2+][C@](C)(CO)C2CC2)cc2c1OCO2 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165228",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)C1CCC1)C(=O)N[C@H]1CC[NH+](C)[C@@H]1c1ccc(Cl)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249392",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1cc(OC2CCN(c3ncc(Cl)cc3F)CC2)ccn1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78921",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(F)c(Cl)c1)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196245",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1cc(NC(=O)N[C@H]2CCCC[C@@H]2C)ccc1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240306",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1sc(/N=C/c2cc(Br)ccc2O)c(C(N)=O)c1C by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCn1nc(C)c(Br)c1C[C@H](O)[C@H]1CSCCS1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)[C@H]1CC[C@@H](NC(=O)[C@H](Oc2ccc(F)c(F)c2)c2ccccc2)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31691",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCc2nc(Nc3ccc(Cl)cc3)ncc2C1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "263",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCC[NH+]1CCCCCC1)c1c[nH]c2cccc(F)c12 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184277",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Cl)c(C)cc1NC(=O)CNc1ccccc1-n1cccn1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69495",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)C1=C(C)N(Cc2cccs2)C(=O)N[C@@H]1c1ccccc1Br by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15393",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)(C)OC(=O)C1CCC([NH2+]Cc2cccc(CO)c2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188612",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCn1/c(=N/C(=O)c2c(C)nn(-c3ccc(Br)cc3)c2C)[nH]c2ccccc21 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224452",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=C1O[C@H](C(=O)NCCc2cccc([N+](=O)[O-])c2)Cc2ccccc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15761",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC[C@@H](C#N)Oc1cccc(CNC(=O)NCC2(C)CCCC2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C(=O)c1cc(Br)ccc1OC by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191474",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](NS(=O)(=O)CC1CCC1)c1ccc(F)cc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124962",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN1C(=O)[C@@]2(c3ccccc31)c1c(oc3ccc(Cl)cc3c1=O)C(=O)N2CCc1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21521",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCS(=O)(=O)N1CCc2ccc(NC(=O)c3ccc(F)cc3)cc2C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246601",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(c1cc(-c2ccc(Br)cc2)nc2ccccc12)N1CCC2(CC1)OCCO2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]([NH2+][C@H](C)c1cccc(NC(C)=O)c1)c1ccc(C)c(F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9230",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1OC)[C@@H](c1cccc(Cl)c1)N(C1CCN(C)CC1)CC2 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36292",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1nc(-c2ccccc2F)n[n-]1)c1[nH]nc(C2CC2)c1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149719",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1cc(C(=O)NCc2ccc(OC(F)(F)F)cc2)cn1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170208",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C=C(Br)COc1cc(F)ccc1[N+](=O)[O-] with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143742",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=[N+]([O-])c1cc(Cl)c(NC2CC2)c([N+](=O)[O-])c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1cccc(F)c1)Cc1ccco1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175010",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)CC[C@H](C)Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205775",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(F)cc1NC[C@H]1Cc2ccccc2S1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200830",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NCC(=O)N2CCC(C)CC2)cc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228461",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1c(C[NH+]2CCCCC2)nc2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc21 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54500",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)[C@H](NS(=O)(=O)c1ccc(C(F)(F)F)cc1)C(C)(C)C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule NC(=O)[C@@H]1Cc2ccccc2CN1Cc1nc(-c2cccc(Cl)c2)no1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98991",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)C[C@@H](C)[NH+](C)Cc1cc(F)cc(C#CC[NH3+])c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154454",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)[C@@H](C)N1CC[S@@](=O)C(C)(C)C1)c1ccc(Cl)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201850",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(Cc2nc(-c3cccc(C(F)(F)F)c3)no2)cs1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121805",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1c(C[C@H](C)Cl)c(=O)oc2cc(O)ccc12 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124398",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1ccc(OC(F)F)c(F)c1)C1CCN(C(=O)OC(C)(C)C)CC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155833",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H](C)[C@@H](NC(N)=O)C(=O)N1CCc2cc(Cl)cc(Cl)c2C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178046",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@@H]([NH2+]Cc2ccc(C(F)(F)F)cc2)C2CCOCC2)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161291",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H]1c2cccn2CCN1S(=O)(=O)c1ccc(Cl)c(Cl)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74723",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Nc1cc(C(F)(F)F)ccc1NC(=O)CSC[C@@H](O)CO with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73310",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc(OC)c1C(=O)Nc1ccc(C#N)c(Cl)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192497",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CO[C@@H](CNC(=O)CCC1CCN(C(C)=O)CC1)c1ccc(F)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17471",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(C[NH+]1CCN(Cc2cc(Cl)c3ccccc3c2O)CC1)N1CCCCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222600",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1ccsc1C(=O)Nc1nc(CCl)cs1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164369",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCOCc1ccc2c(c1)C(O)=C([O-])C(=C1C=CC(=[N+]3CC[NH+](C)CC3)C=C1)O2 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151689",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1ccc(-c2csc(/C(C#N)=C\\c3ccc(O)c([N+](=O)[O-])c3)n2)cc1OC by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)NC[C@H]1CCC[NH+]([C@@H](C)C(=O)Nc2ccc(Cl)cc2Cl)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48951",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1cccc(CNC(=O)[C@H]2COc3ccc(F)cc3C2)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222701",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NCC[C@@H](O)C1CC1)c1cc(=O)c2ccccc2o1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53965",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C/C(=C/c1ccc(-c2cc(C(=O)[O-])ccc2Cl)o1)C(=O)NCCc1c[nH]c2ccccc12 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117505",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1[nH]ncc1C(=O)N[C@@H](c1ccccc1)c1cccc(F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1c(=O)c2sccc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103379",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1ccccc1NC1CCN(C(=O)C[C@@H](O)c2ccccc2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142625",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1nc2ccccc2s1)N1CC[NH+](CC(=O)N(CCC#N)c2ccccc2)CC1 by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234015",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc2oc(-c3cccc(Br)c3)nc2c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50324",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)COc2ccccc2C)cc1[N+](=O)[O-] by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123719",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])c(N[C@H]2CC[NH+]3CCC[C@H]23)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237362",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(CN(C)S(=O)(=O)c2ccc(Cl)s2)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49324",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(NC(=O)Nc2ccn(Cc3ccccc3F)n2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52889",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)Cc1ccc[nH]1)c1ccc(F)cc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238257",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1occc1C(=O)NCC(=O)N1CCCN(c2ccccc2C#N)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C(C)(C)NC(=O)NCCOCC(F)(F)F)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180646",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C(=O)[O-])cc1C(F)(F)F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152077",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(/C=C/C(=O)N2CCC(n3c(=O)oc4c(C)cc(C)cc43)CC2)c(Cl)c1OC by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30352",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1cccc(CNc2ccc(Cl)cn2)c1)[C@@H]1CCCO1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30455",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccccc1NC(=O)C[NH+](CC(F)(F)F)C(C)C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5176",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1cccc(C(C)C)c1NC(=O)[C@H](C)Oc1cccnc1[N+](=O)[O-] by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116811",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[C@@H](Nc1ncnc(NC2CC(C)(C)[NH2+]C(C)(C)C2)c1[N+](=O)[O-])c1ccccc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1cc(F)ccc1F)N(C)C(=O)Nc1ccc(CC#N)cc1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215743",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]nc(Cl)c1Br by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70117",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)[C@H](C#N)c2ccccn2)c(C)s1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187840",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCn1c(C(=O)[C@H](C#N)c2nnc3n2CCCCC3)cc2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71073",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1ccccc1N[C@H](CO)c1ccc(Br)c(C)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186005",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COc1ccc(-c2nc3cc(NC(=O)c4ccc(C)c([N+](=O)[O-])c4)ccc3o2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150606",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#CC1(NC(=O)[C@@H]2Cc3ccccc3O2)CCCCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140464",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc([C@@H](C)N(C)C(=O)CCCc2cc(F)ccc2F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145234",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](CCc1ccccc1)NC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161845",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a aldehyde in the molecule CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)[C@@H](C)Oc1cccc(C=O)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](NC(=O)CNc1cccc(C(=O)N(C)C)c1)c1ccc(Cl)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220297",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](Sc1nc(-c2ccco2)cc(C(F)(F)F)n1)C(=O)N1CCCC[C@H]1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139802",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC1CCN(C(=O)NCCCSc2ccc(F)cc2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154687",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(OC(=O)c2ccc(Cl)cc2)cc2c1C(=O)/C(=C/c1ccccn1)O2 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48212",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(-c2nc3n(n2)[C@@H](c2ccc(F)cc2)C2=C(CCCC2=O)N3)cc(OC)c1OC by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237057",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N/C(=N/OCc1cc(Br)ccc1F)c1cc[nH+]c(N2CCCCC2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29837",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH+](C)Cc1cc(CNC(=O)C[C@@H](O)c2ccccc2)ccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228440",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C=CCCO[C@H](C)C(=O)N1CCN(C)c2ccc(F)cc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120640",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1noc2nc(-c3ccccc3C(F)(F)F)cc(C(=O)NCC(N)=O)c12 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214584",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccsc1N1CC[C@H](Nc2ccc(F)c(F)c2)C1=O by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205102",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)C(=O)N2CCC[C@H](N3CCCC3=O)C2)c(Cl)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101287",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCO[C@@H]([C@H](O)Cc2ccncc2)C1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Cc1csc(SCc2ccccc2F)n1)NC1CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142083",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(C[C@H]1CCC[NH2+]1)c1nc2ccccc2nc1Cl by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156821",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)ccc1S(=O)(=O)N1CCO[C@H](CC(=O)[O-])C1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242657",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(NC(=O)c2cccc(F)c2)ccc1NC(=O)C(C)C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242419",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)CCCNC(=O)CC[C@@H](C)O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108634",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc([C@@H]2CCCN2C(=O)c2cc(-c3ccc(Cl)cc3)on2)no1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131338",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1c(C(F)(F)F)ccn2ccnc12 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCCn1cc(-c2nc(NC)ccc2[N+](=O)[O-])cn1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83574",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCC[C@H](CC)C[C@@H](O)c1cncc(Br)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155782",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Fc1ccc([C@@H](CC(F)(F)F)NCc2ccc3c(c2)CCO3)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30540",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCOc1ccc(/C=C/c2nc(-c3cc4ccccc4o3)no2)cc1 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9584",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cc(NC(=O)[C@H](c2ccccc2)S(=O)(=O)[C@@H](C)[C@@H](C)O)no1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75707",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C[C@@H]1CCC[NH+](CCNC(=O)N2CCN(c3ccccc3[N+](=O)[O-])CC2)C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60183",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@H](CC#N)N(C)C(=O)Nc1ccc(Oc2ccccc2C#N)c(F)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95713",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(C[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccc(Cl)cc1)NCc1ccccc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17727",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)C[C@H](C)NC(=O)[C@@H](c1c(F)cccc1F)N(C)C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136982",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1nc(CC(=O)N2CCN(c3ccccc3F)CC2)cs1)NC1CCCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160670",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)(C)OC(=O)N1CCCC[C@H]1CNCc1nccnc1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204838",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC[C@H](O)[C@](C)(CC)[NH+]1CCCC1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139527",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(CC#N)C(=O)c1cc(Cl)c2ccccc2c1O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239584",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)[C@](O)(c1cc(C)c(O)c(Cl)c1)C(F)(F)F by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7791",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)[C@@H](c1ccc(C#N)cc1)N1CCC(O)(C(F)(F)F)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=S(=O)([O-])c1ccc(/N=C/c2ccc(O)cc2O)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247347",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCCC2)ccc1N1CCCCCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181145",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCC[C@H]1CC[NH2+]C1)c1c(F)cc(Br)cc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144726",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCCc1cc(OCC(=O)[O-])nc(Nc2ccc(C#N)cc2)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@@H]1CCCO1)N1CCN(C(=S)Nc2ccccc2F)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79790",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)N/N=C/c1sc2ccc(Cl)cc2c1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182907",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cccc(F)c1-c1n[nH]cc1CN1CCC[C@@H]([NH+]2CCCC2)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43736",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCn1nc(C(=O)N(Cc2ccc(Cl)cc2)C2CC2)ccc1=O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152465",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(NCc2ccccc2F)c2ccccc2[nH+]1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150515",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1ccc(-c2nnc(SC[C@@H](O)c3ccc(C)cc3C)n2C)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13022",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@]12CC(=O)NC(=O)[C@@H]2c1ccc(F)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52809",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1cc([N+](=O)[O-])c(C(C)(C)C)cc1C(=O)[O-] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59172",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NC(=O)CCNC(=O)N2CC(O)=Nc3ccccc32)cc(OC)c1OC by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206902",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#C[C@H]1C(=N)C(C#N)(C#N)[C@H](c2ccc3ccccc3c2)[C@@H]2CCCC=C21 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8413",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(C)C(=O)NCC(=O)N[C@H]1C[C@@H]1c1cccc(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151169",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccccc1C(=O)N(Cc1ccccn1)c1nc2c(Cl)cccc2s1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145229",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@H]1CCN(C(=O)c2ccc(S(=O)(=O)CCCC#N)cc2)[C@@H](C)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@](C)(NC(=O)CCCOC)/C(N)=N/O by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144431",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(/C(C)=N\\NC(=O)CN(c2cccc(Br)c2)S(C)(=O)=O)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9145",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)OCC(F)(F)F)C2)s1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9169",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1N=C([O-])[C@@]2(Cc3ccccc3N3CCN(c4ccc(Cl)cc4)C[C@@H]32)C(=O)N1c1ccccc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194145",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC[C@@H]1CCN(C(=O)Nc2ccc(F)c(C)c2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138318",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCC[C@@H](C)Nc1ncc([N+](=O)[O-])cc1Br by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56379",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1c(C)nc(Nc2ccc(Cl)cc2Cl)nc1OCC(=O)[O-] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97196",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H](CNC(=O)N[C@@H](c1ccc(F)cc1)[C@@H]1CCCO1)N1CCOCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66580",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule FC(F)Oc1ccccc1[C@H]1CC(c2ccccc2)=Nc2ncnn21 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85076",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1nnc(N[C@H](NC(=O)N(C)C)C(Cl)(Cl)Cl)s1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1ccc(C(=O)N2CCC[C@@H]2[C@H](C#N)c2ccccc2)n1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240786",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(Cc1ccccc1)C(=O)[C@H]1CCC[NH+](Cc2ccc(Cl)cc2)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87010",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC1=NC2=C(C(=O)C[C@H](C)C2)[C@H](c2ccc(Cl)cc2)C1C(=O)Nc1ccc(C)cn1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13640",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](CO)CSc1nc(Cl)ncc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99459",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CSc1ncc2ccccn12)Nc1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6580",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ccccc1F)Nc1ccccc1C(=O)NCc1ccco1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83981",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Cc1ccc(N2CCCC2=O)cc1)Nc1ccc(C(F)(F)F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124963",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCN(CCC#N)[C@H](C)C(=O)N[C@@H](C)c1ccccc1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8944",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1oc2ccc(OCc3ccc(Br)cc3)cc2c1C(=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93748",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](CNC(=O)NCc1ccc(Cl)cc1Cl)CN1CC[NH+](C)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13812",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C([O-])CNC(=O)CN1C(=O)S/C(=C\\c2cccc(F)c2)C1=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152514",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCC[C@H]([NH2+]Cc1cscc1C)c1ccc(F)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77003",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(C[NH+]1CCN(Cc2ccccc2Cl)CC1)NC1CCCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66111",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(CNC(=O)CCCn2c(=O)c3cccn3c3ccc(F)cc32)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241961",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH2+][C@@H](Cc1cc(Cl)ccc1Cl)C(C)(C)OC with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60287",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Nc1ccc(C(=O)Nc2ccccc2SC(F)F)cc1[N+](=O)[O-] by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57681",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1c2n(c(=O)n(CC(=O)Nc3cccc(S(=O)(=O)N4CCCC4)c3)c1=O)CCC2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194934",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCCc1c(F)cccc1F)N1CCN(C(=O)c2ccco2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64097",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc(C)c1[C@H](C)NS(=O)(=O)c1ccc(CO)o1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193326",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](OC(=O)c1cccc(F)c1)[C@@H]1CCOC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52521",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H](CSC)N(C)S(=O)(=O)c1ccc(C)cc1Br with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12877",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)c1c(F)cc(Br)cc1N1C[C@@H]2CC=CC[C@H]2C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221536",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCn1cc(S(=O)(=O)N[C@H](CCl)C(C)C)nc1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84781",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(C(=O)N[C@]2(C)CCS(=O)(=O)C2)cc1NC(=O)c1ccccc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33057",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1csc(CCNc2nc(Br)cs2)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28458",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([C@H](C)Nc2ccc(S(C)(=O)=O)nc2)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75966",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1CNc1ccc(N2C[C@H](C)O[C@H](C)C2)c(F)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63787",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(Nc2cc(Cl)nc(N)n2)ccc1N1CCCC1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181016",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CN1CCS(=O)(=O)CC1)N[C@@H]1CCC[C@@H](C(F)(F)F)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67535",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)C[C@@H]1C[NH2+]CC[C@@]12CCC[C@H](C(F)(F)F)C2 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172367",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1c(=O)n(C)c2cc(Sc3ccccc3)c(NC(=O)c3ccc(Br)cc3)cc21 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84127",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule COC(=O)c1ccc(C(=O)Nc2sc3c(c2C#N)CC[NH+](Cc2ccccc2)C3)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7275",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](O)C[C@@H](C)CNC(=O)N[C@@H]1CCN(c2ccc(Cl)cc2)C1=O by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30901",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(C)[C@H](O)CNC(=O)NC[C@H](c1ccc(Cl)cc1)n1cccn1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105992",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCN(C(=O)CCc1c(C)nc2c(C#N)cnn2c1C)C1CCCC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46746",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCc1ccccc1F)c1ccc(N2CCC([NH2+]Cc3nc4ccccc4s3)CC2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12668",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)CN2C(=O)N[C@@](C)(c3ccco3)C2=O)c(F)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80801",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)NC(=S)Nc1cc(Cl)ccc1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155818",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@](N)(C(=O)N1Cc2ccccc2C1)C(F)(F)F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166857",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC1=NC2=C(C(=O)CC(C)(C)C2)[C@H](c2cccc([N+](=O)[O-])c2)C1C(=O)OC[C@H]1CCCO1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169824",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C(C)=O)ccc1OCc1nc(-c2ccc(C#N)cn2)no1 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC/[NH+]=C(\\NCc1ccc(C)c(F)c1)NC[C@@H]1CCCO1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(S(=O)(=O)c2cc3c(cc2NC(=O)COc2ccc(F)cc2)n(C)c(=O)n3C)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCC[NH+]1[C@H]1CCC[C@@](C#N)(NC2CC2)C1 by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219596",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](Cl)C(=O)NCC#CCOc1cccc2ccccc12 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10956",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC[C@@](C)(C#N)[C@H](O)c1ccccn1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172783",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1nn(-c2nncc(-c3ccccc3)n2)c2c1[C@@H](c1ccc(O)cc1)CC(=O)N2 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106011",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3cccc(OC)c3OC)[C@H]2C1 by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15000",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#C/C(=C\\c1ccc(-c2ccc(F)cc2[N+](=O)[O-])o1)c1nc2ccccc2[nH]1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144667",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](O)[C@H]1CCC[NH+](CC(=O)NCc2ccc3c(c2)OCO3)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224520",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@H](CCO)CNS(N)(=O)=O by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196323",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@](C)([NH3+])C(=O)Nc1ccc(C(F)(F)F)cc1C(=O)[O-] with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60295",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule NC(=O)[C@H]1CCC[NH+]1Cc1cccc(NC(=O)[C@H]2CC(=O)N(c3cccc(Br)c3)C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237037",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C/c1cccc(O)c1)c1ccc2c(c1)OCCO2 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52801",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H](O)[C@@H]1CCC[NH+](Cc2cccc(OC(F)F)c2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176851",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1cccc(C(=O)N2CCC(CNS(=O)(=O)c3ccccc3F)CC2)c1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124476",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccc(F)cc1)N1CCOc2ccccc21 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78930",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)C1CCN(C(=O)Cn2c(=O)n(-c3ccc(Cl)c(Cl)c3)c(=O)c3ccccc32)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202542",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(C)CN(CC)C(=O)CS(=O)(=O)c1ccc(F)c(F)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(C(=O)N2CC[C@@H](C)[C@@H](O)C2)cc1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80101",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)c1cc([C@H]2CCC[NH+]2Cc2cc(F)ccc2F)no1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183950",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1CN(C(=O)NCCc2coc(-c3ccc(F)cc3)n2)C[C@@H](C)S1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243149",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1[C@@H](O)Cc1nccs1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36458",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCOCCCNC(=O)N[C@H]1CCC[C@H]1CO by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97087",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1nc(OC(C)C)cc(N2CCN(C(=O)Nc3ccccc3F)CC2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184111",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Br)cc1[C@H]([NH3+])c1ccc(Br)o1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200860",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1cccc(C2=CCN(C(=O)C(=O)Nc3ccc(C#N)cc3)CC2)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120629",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CNC(=O)CN1c2ccccc2C(=O)N(C)[C@@H]1c1cccc(C#N)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181807",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCC[NH2+]Cc1cc(F)c(O[C@@H](C)[C@H](C)O)c(F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206763",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(C)c1ccc([C@@H]2[NH2+]C[C@H](CSc3ncc(C(F)(F)F)cc3Cl)O2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247853",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Nc1cc(F)c(OCc2ccc(C(=O)[O-])cc2)cc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246107",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC1(C)CCC[C@H]1Nc1cc2c(cc1Br)OCCO2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2noc([C@H]3CCCN(S(=O)(=O)c4cccc(F)c4)C3)n2)cc1OC by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132465",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1ccccc1NC[C@@H](O)Cn1c2ccccc2c2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135925",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)[C@@H]2CCCN(C(=O)c3ccccc3)C2)C[C@@H]1O by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203660",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NC1(c2ccccc2)CC1)[C@H]1CC(Cc2cccc(F)c2)=NO1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107948",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#CCCCCO[C@@H]1CCC[C@H]([NH3+])C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21537",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(C[C@@H](O)c1ccccc1)NCC(=O)OC1CCCCC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53629",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(F)cc(C[NH2+]Cc2ccc(SC)c(OC)c2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C)c1OCCN1C(=O)C(=O)c2cc(Cl)cc(Cl)c21 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30257",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(CNC(=O)Cc2csc3nc(-c4ccc(F)cc4)cn23)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7205",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC(C)(C)OC(=O)N1CCC[C@H]([S@@](=O)c2ncccc2[N+](=O)[O-])C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93721",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](NC(=O)Cn1c(=O)c(C#N)cn(C2CC2)c1=O)c1ccco1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60836",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C([C@@H]1Cc2ccccc2N1C(=O)c1ccccc1)N1CCN(c2ccccc2F)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242581",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COC1CCN(C(=O)c2c(O)cc(Cl)cc2Cl)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76236",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCC1(C(=O)N2CCC[C@H](C#N)C2)CCCC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCCCOc1ccccc1)c1ccccc1Br by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179026",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NC[C@]1(O)CCC[NH2+]CC1)c1ccccc1Cc1ccc(Cl)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161257",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H](NC(=O)c1ccc(O)c(Cl)c1)C(=O)Nc1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193260",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@](O)(CNC(=O)C1=Cc2cc(Cl)ccc2OC1)c1cccs1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143186",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H](NC(=O)Nc1cnn(C)c1)c1ccc(Br)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98507",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCc1nc(CN(c2cccc(C#N)c2)S(C)(=O)=O)no1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32427",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1cc2c(cc1Cl)OCCCO2)c1cn2cccnc2n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nc2c(c(=O)[nH]1)C[NH+](Cc1ccccc1)CC2)Nc1cccc(F)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206178",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(C(F)(F)F)c2c([C@@H]3CCCN(C(=O)CCCn4nc(C)cc4C)C3)noc2n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204716",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)CC[C@@H](CBr)c1ccccc1F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246092",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1c(Cl)cc(Cl)c(OC)c1C(=O)NC(=O)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141803",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C=C(C(=O)OC)[C@@H](O)c1csc(-c2ccc(Cl)cc2)n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2C(=O)C[C@@H](N(CCc3ccccc3)C(=O)c3ccc(F)cc3)C2=O)cc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20226",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1sc2nc([C@H](C)OC(=O)c3cccc(O)c3)[nH]c(=O)c2c1C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156993",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H](C)CN(C)C(=O)Nc1cccc(Cl)c1C by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103961",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC[C@@H]1CC[C@@H](C#N)[C@H]([NH+](C)CCOCC2CC2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123260",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(NCc1ccnc(OCc2ccccc2)c1)N[C@@H]1CCC[C@@H]1CO by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47973",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CN(CC(C)(C)O)C(=O)c1cccc(OC(F)F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126053",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[NH2+][C@H]1CC[C@@H](Cc2ccc(O)cc2)[C@@H]1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20214",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccc([N+](=O)[O-])cc2)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45686",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1cc(-c2nc(-c3ccccc3Br)n[nH]2)ccc1O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242339",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCN(CC)C(=O)CSc1nc(-c2ccc(C)cc2)ccc1C#N by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178033",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(NC[C@H](c1cccs1)[NH+]1CCCC1)N[C@@H]1C=C[C@H](CO)C1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176609",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)c1ccc(NC(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)c(F)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185877",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N[C@@H](c1ccc(F)cc1)c1ccc(Br)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54106",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cscc1C(=O)NO by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60107",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule C=CCNc1ncnc(Oc2ccc(C)c(C)c2)c1[N+](=O)[O-] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152631",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc2ncc(CN3CCN(Cc4ccc(Cl)nc4)CC3)n2c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12501",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1ccccc1[C@H](C)NC(=O)N[C@H](CO)c1ccc(Cl)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212882",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC(C)C[NH+](C(C)C)[C@@H]1CCC[C@@](C#N)(NC2CC2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217011",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule COc1cccc([C@@H]2C(C#N)=C(N)Oc3[nH]nc(-c4ccccn4)c32)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)NC(=O)CN1CCN(C(=O)N[C@@H]2CCN(CC(F)(F)F)C2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100194",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@@H]([NH2+][C@@H](CO)c1ccccc1F)c1cccs1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157057",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C(F)F)cc1S(=O)(=O)N1CCC(c2nnc3n2CCCCC3)CC1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186195",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cccc(C(=O)N2CCC[C@H]2c2ccccc2Cl)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)c(OC)c1CNc1cc(Cl)nc(C)n1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33957",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1CCO[C@@H](CO)C1)Nc1ccc(Cl)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88386",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC1=C(C2[NH+]=c3cc(C)c(C)cc3=[NH+]2)[C@@H](Cl)N(C)N1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34509",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1nc2c(s1)CN(S(=O)(=O)c1ccccc1F)CC2)c1ccccn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68976",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3161",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCN1CCN(CC(=O)N[C@H](C#N)c2ccc(C(C)(C)C)cc2)C(=O)C1=O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74894",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1c(SCn2cc(Br)cn2)nc(C(F)(F)F)c2c1CCC2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194064",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccccc1)Nc1nn2c(-c3cccc(Cl)c3)nnc2s1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138855",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H]1[C@@H](c2ccccc2)[NH2+][C@@H](c2ccccc2)C[C@@]1(O)c1ccc(F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125666",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(F)c(NC(=O)C(=O)N[C@@H]2CC[C@@H]([NH+](C)C)C2)cc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23304",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCOC(=O)[C@H](O)C=C(C)C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242202",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCc1ccc(NC(=O)C(=O)NCC#N)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42594",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[NH+](CCNC(=O)C(=O)Nc2cccc(Cl)c2Cl)C1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152131",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60645",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC[C@H](C#N)OC(=O)CNC(=O)Cc1cccc(F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162332",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1c(NC(=O)CN2Cc3ccccc3C[C@H]2C(N)=O)sc2c1CCC2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226000",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([C@H]1Cc2cc(F)ccc2O1)N1CCC[C@H](c2ccn[nH]2)C1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71193",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(c1cccc(F)c1)N1C[C@H]2CCCN(S(=O)(=O)[C@@H]3CCS(=O)(=O)C3)[C@H]2C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80902",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(N/N=C\\c1ccc([N+](=O)[O-])o1)c1ccccc1[N+](=O)[O-] by replacing a nitro by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233728",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cnc(NC(=O)CCn2cc(Br)ccc2=O)s1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203220",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(C)c(NNC(=O)c2cnn(-c3ccccc3F)c2)c(C)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158607",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1ccc(Cl)nc1)c1nc2ccccc2[nH]1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162129",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN1CCN(C(=O)C2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146075",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H]1C(=O)NCCN1C(=O)Cc1csc(Cc2ccc(F)cc2)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88653",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1NC(=O)CNc1cccc(Cl)c1Cl by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9807",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(C(=O)N/N=C/c2ccc([N+](=O)[O-])s2)cc1I with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29475",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCC[C@@H]1CO[C@](Cn2cnnc2)(c2ccc(Cl)cc2Cl)O1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OC[C@@H](O)CI by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91271",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@@H](C[C@@H](C)CC(C)(C)C)c1ccc(F)c(C)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194680",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc([C@H](C)C(=O)Nc2cc(NC(C)=O)ccc2F)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@H](C)CNC(=O)c1cccc(C(F)(F)F)c1NC with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122151",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O[C@H](c1ccc(F)c(Br)c1)c1c(F)cccc1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143836",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CCc1ccccc1N1C(=O)/C(=C(\\C)c2ccc([N+](=O)[O-])cc2)SC1=S by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240428",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CCC(=O)N(Cc2cccc(Cl)n2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147018",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNC(=O)c1ccccc1Cl)Nc1cccc(C(=O)NC2CC2)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100490",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CC#N)N(C)C[C@@H]1CSc2ccccc21 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107886",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1[nH]c([C@H]2CC(=O)N(C(C)C)C2)[nH+]c1-c1ccccc1F by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238094",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N[C@@H]1CCC[NH+](CCc2ccc(OC(F)(F)F)cc2)C1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47407",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](NC(=S)NC1CC1)c1nc(-c2ccc(F)cc2)no1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241868",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1c(Br)cccc1CNC(=O)N[C@H](C)CC(C)(C)OC by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63346",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1c(C[NH2+][C@@H](C)c2ccccc2)cc(Cl)cc1OC with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147404",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc(OCCCN2CCC[C@H]([NH+]3CCCC3)C2)cc1 by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63526",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@@H](Cc1ccc(O)cc1)Nc1c2ccccc2[nH+]c2ccccc12 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121646",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCOC[C@@H](O)C[C@H]1C[C@H](C(C)(C)C)CCC1=O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57094",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@](C)(NC(=O)Nc1c(C)cccc1Cl)C(=O)[O-] by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175820",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1NC(=O)C2(CCN(C(=O)c3cc(Br)c[nH]3)CC2)N1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199916",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C=CCOc1ccc(/C=N/NC(=O)C(=O)Nc2cccc(Cl)c2C)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14694",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cc(/C=C2\\C(=O)N(c3ccc(Br)cc3)N=C2C)ccc1OCc1ccccc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149716",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NS(=O)(=O)c1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140203",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1c(Nc2ccc3c(c2)OCCO3)nc2ccccn12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78661",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=S(=O)([O-])c1ccc(N/N=C/c2ccccc2O)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229219",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Sc1ccc([N+](=O)[O-])cc1)[C@@H](C)C(=O)[O-] by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143252",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(C)C(=O)CN(C)C(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202776",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(C(=O)CSc1n[nH]c(/C=C/c2ccc(F)cc2)n1)[C@H]1CCCc2ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218578",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc([N+](=O)[O-])c(C(=O)OCc2ccccc2Cl)n1C by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98404",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC/[NH+]=C(/NCc1ccc(Cl)cc1Cl)NCC1([O-])CCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195711",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1nnc(NC(=O)c2ccccc2OCc2ccc(Cl)cc2)o1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159437",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C[C@]1(c2ccc(F)cc2Cl)CCC[C@@H]1C by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28913",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cnnc1C1CCN(C(=O)c2cc([N+](=O)[O-])c(C)s2)CC1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248667",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(C)C[C@@H]([NH3+])c1occc1Br by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192990",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CCS(=O)(=O)c1ccc(Br)cc1)N1CCN(c2ccc(F)cc2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200489",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C(=O)c2ccccc2)c(Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30887",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CS(=O)(=O)c1ccc(C(=O)N2CCC(OCc3ccccc3F)CC2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174778",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)CC(=O)N1CCN(C(=O)Cc2ccccc2F)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205951",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCc1c(C)nn(C(=O)/C(C#N)=N/Nc2ccccc2[N+](=O)[O-])c1C by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225485",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)N1CCN(C(=O)c2ccco2)CC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(COc1ccc(Br)cc1CO)NCc1ccco1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216594",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1cccc1C(=O)Oc1ccc(C(F)(F)F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110026",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1cnn(-c2ccccc2F)c1)N[C@@H](CO)Cc1ccccc1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137389",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1Cc2ccccc2N1C(=O)[C@H](C)[NH+]1CCCN(CC(F)F)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95434",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[NH+](CC)CC[C@@H](O)c1cccnc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100916",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)Nc1ncnc(Nc2ccccc2F)c1[N+](=O)[O-] by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27748",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOc1ccc(NC(=O)C(=O)c2cccn2Cc2ccc(F)cc2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77649",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule [NH3+]CC1([C@H](O)c2cc(Cl)c3c(c2)OCO3)CCOCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212141",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCC[NH2+]C[C@@H](Cc1cscn1)c1ccccc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31713",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)n1cc[nH+]c1[C@H]1CCCN(c2ncc(F)c(N3CCOCC3)n2)C1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cnc2c(S(=O)(=O)N[C@@H](C)c3ccccc3Cl)cccc2c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13952",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc(C2=CCN(C(=O)NCCOCC(F)(F)F)CC2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186333",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[NH+](C)C[C@@H](Cc1ccccc1)NC(=O)N[C@@H]1C=C[C@H](CO)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209097",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(-n3nc(C)c4c3NC(=O)C[C@@H]4c3ccc(F)c(F)c3)sc2c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCC(O)(C2(C#N)CCCC2)CC1 by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94018",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COC[C@@](C)(O)CNC(=O)c1cc(OC)cc(OC)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167953",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Nc1c(Br)cnn1[C@@H]1CCC[C@@H]1O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221484",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(OCc2nnc(NC(=O)c3ccc(Br)cc3)s2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86426",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCC1(O)CCSCC1)N[C@@H]1CCC[C@H](C2CC2)C1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239158",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=[S@](Cc1ccccc1)C(Cl)(Cl)c1ccccc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168337",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](CCO)NC(=O)Nc1ccc(C(=O)N2CCCC[C@H]2C)cc1C by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81154",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Clc1ccc(C[C@H](NCc2cccnc2)c2ccccc2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81425",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1ccc2c(Cl)c3c(nc2c1)CCC3)N1CCCCC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)c2cccc(F)c2)ccn1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145388",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CC1(NC(=O)CN2CCc3ccc(S(N)(=O)=O)cc32)CCCCC1 by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144723",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1C[C@H](C)C[NH+](C[C@@H](C)NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48766",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(NC(=O)COC(=O)c2ccccc2I)c(Cl)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171275",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(c1cnc(N2CCC(O)CC2)c(Cl)c1)N1CCCCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22693",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(CN2CCN(C(=O)c3c[nH]c4cccc(F)c34)CC2)oc1C by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2ccc(Cl)cc2)c(C)c1CCC[NH3+] by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6504",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N#Cc1cc(NC(=O)NCCNC(=O)c2cccnc2)ccc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54752",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1n[nH]c2ncc(C(=O)Nc3n[nH]c4ccc([N+](=O)[O-])cc34)cc12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135792",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N#C/C(=C/c1cc(Cl)cc(Cl)c1Cl)C(=O)NCc1ccccc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134538",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCOc1ccc(N2C(=O)C[C@H]([NH2+]Cc3ccc(F)cc3)C2=O)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule N[C@H](c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)C(F)(F)F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110662",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H](C)NCCc2nc(-c3ccccn3)cs2)cc1[N+](=O)[O-] by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225015",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC[C@H](NC(=O)c1c(O)cc(F)cc1F)C(=O)N1CCOCC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123007",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1ccccc1N1CCN(c2nc3ccccc3[nH]2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11577",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3212",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule FC(F)(F)Cn1ccnc1CN1CCc2ccccc21 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233602",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC(=O)N1CCC[C@H]1C[C@H](C)O by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100347",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCn1c(NNC(=O)CC2(O)CCCCC2)nc2ccccc2c1=O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75408",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1c2ccccc2C(=O)N1N1C(=O)c2ccc(Oc3cccc([N+](=O)[O-])c3)cc2C1=O by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73200",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([C@@H]1Cc2ccccc2N2CCN(c3ccccc3F)C[C@H]12)N1CCOCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101367",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)cc1)c1cccc(S(=O)(=O)N2CCCC2)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51362",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC(C)[C@H](C)NC(=O)CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-] with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112287",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@H]1CC[C@@](C#N)([C@H](O)c2ccoc2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71765",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1cc2c(c(CN3CCN(c4ccccc4)CC3)c1)OCOC2 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCO/C([O-])=C(\\C#N)C(=O)c1ccccc1 by substituting a nitrile with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87954",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(N[C@@H]1CCCC[C@@H]1C(F)(F)F)[C@@H]1CC(=O)N(c2ccc3c(c2)OCO3)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246941",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1nc(C[NH+]2CCC(CNc3ccc(Cl)cn3)CC2)cs1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]1c2nc3ccccc3n2[C@@H](CC(=O)NCc2ccc(F)cc2)C(=O)N1Cc1ccccc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39386",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(Cl)ccc1Nc1ncnc(NNC(=O)c2ccncc2)c1[N+](=O)[O-] by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91967",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)[C@](O)(C/C([O-])=C2/CCc3ccccc3C2=O)c2cc(Cl)ccc21 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248746",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H]1SCCC[C@@]1(O)Cc1ccc(Cl)s1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149817",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=S(=O)([N-]c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1)c1ccc(Cl)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210900",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)[C@@H](O)C[C@@H]1CCCCC[C@@H]1O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22569",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1[C@@H]2CCCCN2C(=O)CCN1CCC(F)(F)F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232567",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)[C@@H](CO)[NH2+]Cc1c(Cl)cccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207506",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1C[NH2+][C@H](c2cc(F)cc(F)c2)CS1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161566",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1923",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=c1c2scc(-c3cccc(F)c3)c2ncn1Cc1ccccn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48662",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C#Cc1cccc(NC(=O)CBr)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103541",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)CCc1noc(COC2CC[NH2+]CC2)n1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105704",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCCCC2)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149451",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)CNC(=O)c1ccccc1Nc1ccc(OC(F)F)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30439",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S1(=O)CCC[C@H]([NH2+][C@H]2CCc3c(Cl)cccc32)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210394",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(c1)c1c(n2C[C@H](O)CN2C(=O)CNC2=O)C(=O)CCC1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176512",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(Br)c(O)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223104",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](Cl)OC(=O)Sc1ccccc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218525",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1noc(-c2ccc(NC(=O)c3ccc(F)cc3)cc2)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98084",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H]1CCC[C@H](NC(=O)C(=O)Nc2ccc(OC(C)C)cc2F)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244446",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOc1ccc(S(=O)(=O)Nc2cccc(C)c2)cc1NC(=O)c1ccccc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36928",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C([O-])c1nnn(-c2ccc(C(F)(F)F)cc2)c1-c1cccc(Cl)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190686",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC[C@@H]1CCCN(C(=O)C(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21380",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCc1cc(OC(=O)CCc2c(C)nc3ncnn3c2C)ccc1Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73962",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1cccc([C@H](O)[C@@H](C)c2ccccn2)c1OC with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144074",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@H](C)NC(=O)c1cc(S(=O)(=O)NC(C)C)ccc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63804",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCn1cc(C[NH+]2CCC(C[NH+]3CCCCC3)CC2)cc1C#N with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135871",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCC1(CC)CC[NH+]([C@@H]2CCC[C@@](C#N)(NC)C2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97242",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c(C(=O)Nc2cc(C(F)(F)F)ccc2-n2cccn2)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205726",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule [NH3+][C@@H](c1c(F)cccc1F)[C@@H]1CCc2cccnc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32321",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)N[C@H](C)C1CCOCC1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169122",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@H]2Nc3ccc(S(=O)(=O)Nc4cccc([N+](=O)[O-])c4)cc3[C@H]3C=CC[C@H]32)cc1 by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217458",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1CC[C@H](C(=O)N2CC[C@H](Oc3ccc(C(F)(F)F)cn3)C2)O1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227985",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NS(=O)(=O)Cc1ccc(NC(=O)Cc2ccc([N+](=O)[O-])cc2)cc1 by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240601",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO/N=C/C(C#N)=C/c1cc(C(=O)c2ccc([N+](=O)[O-])cc2)cn1C by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65503",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(/C=C/C(=O)NNC(=O)COc2ccc(C)cc2Br)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181134",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c2ccccc2n1 by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78686",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/C(O)=C2/C(=O)C(=O)N(CC[NH+](C)C)[C@H]2c2ccc(C)o2)cc1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137723",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)[C@@H](O)CCNC(=O)NC[C@@H]1CCN(c2ccc(F)cc2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199022",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1[C@H]2CC[C@@H]1CN(C1CCC(c3ccc(O)cc3)CC1)CC2 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177014",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N#Cc1ccc(CNC(=O)N2CCC[C@@H]2C[NH+]2CCC[C@@H]2CO)c(F)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121004",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCc2nc([S-])nc(C(F)(F)F)c2C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83055",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)CNC(=O)[C@@H](C)[S@](=O)Cc1ccn(-c2ccc(F)cc2)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196507",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc([C@H]2NC(=O)N(C)C(C)=C2C(=O)OCCC(C)C)cc(Br)c1O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145505",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1cccc([C@@H](O)[C@@]2(C#N)CCOC2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49587",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(-c2ccccc2)c(C)c1N[C@H](C)C(=O)Nc1ccc(F)cc1F by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183094",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3627",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(Nc1ccc(F)c(F)c1F)N[C@H](CO)c1ccc(Cl)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145952",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Oc1ccc(CNc2cc(-c3ccc(F)cc3)nc3ccnn23)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161175",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CNC(=O)[C@@H](C)NC(=O)Nc1ccccc1OCc1cccc(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104224",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(F)cc1NCC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42425",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(CCCNC(=O)c2cc(Cl)ccc2-n2cnnn2)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132699",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH2+][C@@H](CO)c1ccc(Br)c(C)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164693",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1C(=O)[C@](O)(CC(=O)/C=C\\c2ccccc2)c2ccccc21 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1csc(CS(=O)(=O)[C@H](C)c2ccc(F)cc2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26302",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC1=C2C(=O)CCCC2=N[C@@H]1C(=O)N(C)Cc1ccc(OC(F)F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35357",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccsc1C[NH2+]C[C@@H](O)CC by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91428",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(c2ccc(NC(=O)Nc3cnn(CCO)c3)cc2F)C[C@H](C)O1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153855",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](NC(=O)C(=O)Nc1ccc(C#N)cc1)c1ccc2c(c1)CCCC2 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70208",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(C)c1cc(CN2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)cc[nH+]1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190824",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(C#N)ccc1OCC(=O)Nc1ccc(F)c(Cl)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138567",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](NC(=O)Cn1nnc2ccccc2c1=O)c1ccc(Cl)s1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246978",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(NC[C@H](O)COCC1CC1)NC1CCCCCC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150148",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COCCN(C)C(=O)C(=O)Nc1ccc2[nH]c(C(F)F)nc2c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126248",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@H]1CCC[C@](C#N)(NC(=O)CCCc2cc(F)ccc2F)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10240",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(NC(=O)NCc2cccc(OCC(F)F)n2)ccc1C(N)=O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241105",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#Cc1ccc(/C=C/CN2CCO[C@H](c3ccsc3)C2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44677",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCn1c(S[C@H]2CC[C@@](C#N)(NC)C2)n[nH]c1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C[NH2+][C@@H](C)c1cnc(C)s1)Oc1ccccc1F by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](C)C[C@@H]1CN(Cc2ccc(F)c(F)c2)C[C@H]1c1ccnc(N2CCCC2)n1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16478",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)N1c2ccccc2C[C@H]1C(=O)Nc1c(C)cccc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130478",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@H]1C[C@@H]([C@H](O)c2c[nH]nc2-c2ccccc2)CC[C@H]1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111756",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(Cl)cc1C(=O)Nc1ccn(C)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121157",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CCNC(=O)NCc1ccc(Oc2ccc(F)cc2)nc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97875",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1=NCCS1)c1ccccc1OCc1cccc(Br)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145211",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)c1cc(Br)ccc1NC(=O)c1ccoc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199673",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H](OC(=O)c2c3c(nc4ccccc24)/C(=C/c2ccc(O)cc2)CC3)C(=O)O1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147426",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(c1cnc([C@H]2CCCO2)s1)N1CCc2c(Cl)cccc21 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219349",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)C[NH+]1CCC[C@H]1c1cccc(C)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139891",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1CN1CCN([C@@H](C)c2nnc(C)o2)CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67154",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(O)c(NC(=O)c2ccc(Br)s2)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53747",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(F)ccc1OC1(C(=O)[O-])CCN(C(=O)[C@H]2CCOC2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192220",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[NH+]=C(N2CCN(C/C=C/c3ccc(C#N)cc3)CC2)S1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191514",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=[N+]([O-])/C=C\\c1ccc(Sc2ccc(Cl)cc2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1nc2c(s1)CCCC2)C(=O)[C@H]1C[C@H]1c1cccc(Cl)c1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191564",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C([O-])CCCC[C@H](O)c1ccc(F)c(Br)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1ncnn1C)C(=O)Nc1cc(C#N)ccc1OC(F)F by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173021",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](CCCO)Nc1ccccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105850",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)Cn1cc(NC(=O)NNc2ncccc2Cl)cn1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58650",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N1Cc1cccc(Cl)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234508",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ncccc1C(F)(F)F)N1CC[C@H](Oc2cccnc2)C1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134573",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCn1c(Oc2ccc(C=O)cc2OCC)nc2c1c(=O)n(C)c(=O)n2C by substituting a aldehyde with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87410",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#Cc1cc(Cl)nc(NNC(=O)/C=C/c2cccnc2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135430",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Oc1ccc(Br)cc1F)c1ccccn1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181067",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CSCC[C@@H](C)[NH+](C)Cc1cc(F)cc(F)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78051",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-n2c(COc3ccc(C#N)cc3OC)nc3ccccc32)cc1 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10287",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)N1CCC[C@@H](C)CC1)c1cccc(C#N)c1 by substituting a nitrile with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80576",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+]C[C@H](Cc1nccs1)c1ccccc1Br by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnnn1-c1cccc(NC(=O)c2cc(F)cc3[nH]cnc23)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112455",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCC[C@@H]1CC[C@H](C#N)[C@H]([NH+](C)CC)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47969",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C[NH+]1CCCN(C(=O)c2cc(Cl)c3c(c2)OCCCO3)CC1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162536",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(NC(=O)c2cc(F)c(F)c(F)c2F)cc(OC)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75927",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cc(Br)c(/C=C(\\C#N)C(=O)Nc2nccs2)cc1OC by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48857",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)cc(CSC[C@H](C)/C(N)=N/O)c1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236202",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@@H](c3ccccc3)[C@@H]2C1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NCCc2ccc(O)cc2)cc1F by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103167",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)CN(C)C(=O)N[C@@H]1CCCN(c2ccc(OC(F)F)cc2)C1=O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#C[C@@H](NC(=O)c1coc(Br)c1)c1ccc(Cl)c(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72521",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(O)c(NC(=O)[C@@H]2CCCN2C(=O)OCC(F)(F)F)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148884",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(C(=O)N2C[C@@H]3C[C@H](C2)c2ccc(C4CCCCC4)c(=O)n2C3)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189152",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH+](CC)[C@H]1CCC[C@@](CO)([NH2+]CC)C1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17086",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule N#Cc1cc(F)c(CO)c(F)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58053",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#CCNC(=O)CCCNS(=O)(=O)c1ccc2c(c1)CCCC2 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112646",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCN(c2ccc(CNC(=O)NC[C@@H](O)C3CCOCC3)cc2)CC1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195762",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](NS(=O)(=O)c1ccc(F)cc1Cl)C(=O)N1CCOCC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164984",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1Nc1ncnc(Cl)c1N by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119439",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc([C@@H](C)NC(=[NH2+])NC(C)C)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247888",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1ccccc1)c1cc(C(F)(F)F)ccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158058",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1cc(Br)cc(C[NH+]2CCC[C@H]2CCCCl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155214",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)([C@H](N)Cc1cccc(F)c1F)[NH+]1CCCCCC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88943",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc2c(cc1Cl)[C@H](C)[C@H](CC(=O)N=c1[nH]c3ccccc3[nH]1)C(=O)O2 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245435",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CCNC(=O)CCCC(=O)N1CCc2ccc([N+](=O)[O-])cc2C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163908",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N#CN(Cc1ncc(-c2cccc(Cl)c2)o1)c1ccccc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CN(Cc2ccco2)C(=O)c2ccc(Cl)cc2)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139233",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1c(C)nc2ccc(C)cc2c1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177213",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(C(=O)NC(=N)c2ccc(F)c(Cl)c2)cnn1C by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29976",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(c1cnc2nc([O-])[nH]c(=O)c2c1)N1CC=C(c2ccccc2Cl)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61926",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)CC[C@@H](C)NC(=O)CN1CCO[C@H](CO)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158497",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccc(C(=O)N2CCN(Cc3ccccc3CO)CC2)c(F)c1F with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198698",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOC[C@@H]1CCN(C(=O)CSc2cccc(C(F)(F)F)c2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220020",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(N[C@@H]1CCCc2c1cnn2-c1ccc(F)cc1)c1ccncc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190451",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(N2C[C@@H](c3nnc(NC(=O)c4cccc(Cl)c4)s3)CC2=O)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116661",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule [NH3+]CC1([C@@H](O)c2cccs2)CCCCCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72863",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)C(C)(C)C#N)n(-c2cc(C(F)(F)F)ccc2Cl)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111119",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCNC(=O)CN1CCN(C(=O)c2cccc(F)c2Cl)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240925",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(OCc1ccccc1)N1CCC(O)(CNc2ccccc2)CC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)NCCOc2cccc(Br)c2)ccc1[N+](=O)[O-] by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179906",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C)C(=O)CN1CC[NH2+]C[C@@H]1C#N by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31116",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH+](CC)C1([C@H](NC)c2c(F)cccc2F)CCCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20330",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1nn(C)c(Cl)c1[C@@H](O)[C@@H]1CCO[C@]2(CCSC2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26055",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1ccc(Cl)c(NC(=O)OCCO)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142196",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC=CC[C@@H]1COC(=O)c1ncccc1C(F)(F)F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81565",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(Cc1ccc(Cl)cc1)C(=O)c1ccc(OC[C@H]2CCCO2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190980",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCN(Cc1ccsc1)S(=O)(=O)c1ccc(F)cc1F by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42866",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COc1ncnc(OC[C@H]2CCCC[C@H]2C[NH3+])c1[N+](=O)[O-] by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122505",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc2c(c1)OCCO2)N1CCCCC[C@H]1c1ccccc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7130",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](Cc1ccccn1)n1cnc2c(F)cccc2c1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4301",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1c(F)cc(Br)cc1F)c1ccccc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80610",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1ccccc1-c1ccc(C[NH+]2CCN(C3CC[NH+](C)CC3)[C@@H](CCO)C2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143488",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37242",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)C[C@H](C[NH3+])Nc1ccccc1Cl by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219174",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(N[C@@H]1CCN(c2c(F)cccc2F)C1=O)N1CCSCC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182412",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1noc(C)c1S(=O)(=O)Nc1cccc(Br)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128598",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCN(CC(F)F)C(=O)N[C@@H]1CCN(c2ccccc2)C1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1Cc2cc([N-]S(=O)(=O)c3cc(Br)ccc3F)ccc2N1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56850",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1cc(C(F)(F)F)ccc1Cl)[C@H]1CCCC[C@@H]1C(=O)OCCF with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc(C)c1C(=O)NCc1ccnc(OCC(F)(F)F)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181544",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1c(NC(=O)C(=O)NCCO)sc2c1CC(C)(C)OC2 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134935",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ocnc1CNC(=O)N[C@H]1CCOc2c(Cl)cccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4298",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NC(=O)c1cccc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150754",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "320",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](Cc1nccs1)[C@@H](C)Br by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC(C)N(CCCCl)c1nc2cc([N+](=O)[O-])ccc2[nH]1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152824",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+]1CCC[C@@H]1CNC(=O)N[C@@H](C)COc1ccc(F)cc1F by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217622",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@H]1Oc2ccc(NC(=O)c3cc(C#N)cs3)cc2NC1=O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193885",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(Nc1ccc(-c2nc3ccccc3o2)c(O)c1)c1cccnc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130999",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCN(Cc1ccccc1)C(=O)CN1C(=O)N(c2ccc(C)c(Cl)c2)[C@@H]2CS(=O)(=O)C[C@H]21 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141029",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N#CC1=C(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)NC(=O)C[C@H]1c1ccc(F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174755",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(Cl)ccc1OCCCNC(=O)NC[C@@H]1CCC[C@H](O)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103736",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc(F)cc1)c1ccc(-n2cccn2)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207887",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](Oc1ccccc1OC)C(=O)N1CCC[C@@H](c2cc(C(F)F)n3ncnc3n2)C1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64680",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule [NH3+]Cc1cn[nH]c1N1C(=O)c2cc(F)c(F)cc2C1=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221722",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(Br)cc1NC(=O)CCNC(=O)C1=CCCCO1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8012",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cn1cnc2ccc(Cl)cc2c1=O)NCCC1=c2ccccc2=[NH+]C1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199434",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=C1CCCCN1c1ccc(C(=O)N2CCc3c2cccc3[N+](=O)[O-])cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94681",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH2+]Cc1ccc(F)c(Br)c1)NC1CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25240",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1cccc(S(=O)(=O)N(Cc2cccnc2)c2ccc(Cl)cc2)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177657",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1ccc(Cl)cc1NC(=O)NC[C@H](C)C#N by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226031",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1ccccc1OC[C@@H](O)C[NH2+][C@H](C)c1c(C)noc1C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125043",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC1CCC([NH2+]Cc2c(C(=O)[O-])n(Cc3ccccc3F)c3ccccc23)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175853",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cc(F)c([C@H](C)NC(=O)c2c(C)cc(C)cc2C)cc1OC by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42569",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(N2CCc3c2nc2ccc(Br)cc2c3N)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1NC(=O)N(C[C@@H](O)c2cccc(F)c2)C1=O by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72359",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cnn(-c2ccc(C(=O)Nc3cc(C)c(F)cc3C(N)=O)cc2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203329",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)c1nn(C)cc1C[NH2+][C@@H]1CCSc2c(F)cccc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94513",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule [NH3+][C@H]1C=C[C@@H](C(=O)Nc2ccc(Cl)c(F)c2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206853",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](NC(N)=O)C(=O)NCc1cc(Cl)ccc1OC(F)F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186084",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CS(=O)(=O)N1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "74708",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC1=[NH+]C[C@H](c2ccc(F)cc2)N1c1ccc(Cl)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180591",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c(C(=O)Nc2ccc(Cl)c(Cl)c2)nnn1Cc1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36811",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(F)cc(CN2C[C@@H](C[NH+]3CCC(CO)CC3)[C@@H](CO)C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2c(c3c1C(=O)/C(=C/c1ccc(Cl)c(Cl)c1)O3)CN(C1CC1)CO2 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210198",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1ccc(NC[C@@H](O)CN2CCOCC2)c([N+](=O)[O-])c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125073",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCC1(c2cccc(C(F)(F)F)c2)CCCC1)Nc1nncs1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H](C)N(C)C(=O)NC1CC[NH+](Cc2ccc(F)c(F)c2)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188302",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)Cn1c(CN2CCC[C@H](C(F)(F)F)C2)nc2ccccc2c1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19808",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1ccnc2ccccc12)N1CCN(c2ncccc2F)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219340",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(N2/C(=N/C(=O)c3ccc(Br)cc3)S[C@H]3CS(=O)(=O)C[C@H]32)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49200",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(F)ccc1[N-]S(=O)(=O)c1ccc(F)c(F)c1F by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78532",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C/C(C[NH+]1CCCCC1)=N\\O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139411",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](NC(=O)NCCOCC(F)(F)F)c1ccc(Cl)s1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137325",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(F)c(F)c1)N1C[C@@H](C[NH+]2CCC(CO)CC2)[C@@H](CO)C1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18420",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccc(OCc2cc(C(=O)N3CCC([C@@H](O)C(C)C)CC3)no2)cc1C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](NC(=O)C[NH+](CC)[C@@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63484",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C1[C@H]2[C@H](c3ccccc3)OC3(C(=O)c4ccccc4C3=O)[C@@H]2C(=O)N1c1ccc(Cl)c(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202817",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H]1C(=O)NCC[NH+]1Cc1ccc(O)c(Cl)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "25355",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1ncn(CC(=O)NCc2ccco2)n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88762",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1c(C(=O)Nc2ccc(C)c(S(=O)(=O)Nc3ccc(Cl)cc3)c2)cnn1-c1ccccn1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48961",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(/C=C/C(=O)Nc2sc3c(c2C(N)=O)CCCC3)cc(C)c1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112196",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule ON(c1ccccc1)[C@H](Br)[C@@H](Br)c1ccccc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146576",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CC(=O)N1CCC[C@H](COc2ccc(F)cc2)C1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97350",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@H](CNC(=O)OC(C)(C)C)[NH+](C)Cc1ccc(C#N)o1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93923",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncc(Cl)c(C(=O)NN)n1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116087",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2OC)cc1O by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230419",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CCC(=O)Oc1cccc2ccc(/C=C/c3ccccc3[N+](=O)[O-])nc12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1Oc1ccc(NC(=O)N(C)CC[C@@H](C)O)cc1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCN1C(=O)[C@@](O)(CC(=O)c2ccc(OC)c(OC)c2)c2cc(Cl)ccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19264",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@@](C)(O)[C@@H](O)C(=O)OC[C@@H]1CC[N+]2([O-])CCC[C@H]12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(C#N)ccc1OC(=O)Cn1ccccc1=O by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77108",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CS(=O)(=O)CC1(CC(=O)OC[C@@H]2CC2(Cl)Cl)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75286",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)NCCOC(=O)[C@@H]1C[C@@H]1c1ccccc1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222479",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C[C@H](c2ccc([N+](=O)[O-])cc2)[C@@H](C(=O)c2cccnc2)[C@]12C(=O)Nc1ccccc12 by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176994",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COCC(=O)N1CC[C@]2(O)CCN(C(=O)c3ccc(OC)o3)C[C@@H]2C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31589",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cnc([C@H](C)NC(=O)NC[C@H](O)COc2ccc(F)cc2)s1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211629",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(S[C@H](C(N)=O)c2ccc(F)cc2)nc(C)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23748",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Nc1ccc(F)c(S(=O)(=O)NC[C@@H]2CCCO2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160314",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(CNC(=O)[C@H]2C[C@H]3CC[C@@H]2O3)cc1Br by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152768",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC1=C(C(=O)OC(C)C)[C@@H](c2cccc(Br)c2)n2ncnc2N1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57572",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCCC[C@@H](C(=O)[O-])[C@@]1(O)CCC[C@H](CC)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63092",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CNc1ccccc1OC(F)F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177195",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCC1CCC(C#N)(NC(=O)[C@H]2CCO[C@H]2C)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103907",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(Cl)ccc1NC(=O)C(=O)NCc1ccccc1C[NH+](C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92203",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1cc(Cl)ccc1NCC(=O)N(c1ccccc1)C(C)C by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164311",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(/C=C(\\C#N)C(=O)Nc2ccc3c(c2)CCC(=O)N3)cc(C#N)n1C by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201776",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(N[C@H](CO)c1ccccc1F)[C@H]1COc2ccccc2O1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22875",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-n2cnnc2SC(C)C)cc1Cl by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39211",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2c(NC(=O)c3cc(-c4ccccc4Cl)no3)n[nH]c2n1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215424",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C[NH+]1CCC[C@@H]1c1cccs1)N1CCN(c2cccc(Cl)c2)CC1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93733",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)[C@@H](CO)NC(=O)c1ccccc1C(F)(F)F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4942",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)N(c1nc(CSCc2ccccc2)cs1)c1ccccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141320",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@@]1(c2ccccc2)NC(=O)N(C[C@H](O)c2ccccc2)C1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124874",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCC(O)(CSc2ccc(Br)cc2)CC1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83165",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CCc1ccc(C(F)(F)F)cc1)Nc1cccc(S(=O)(=O)/N=C2/CCCN2)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196610",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(C(=O)NNC(=O)c2cn(C)nc2-c2ccc(F)cc2F)o1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule Cn1cc(C#N)cc1C(=O)N1CCC[C@H]2CCCC[C@@H]21 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N1CCN(c2ccc([N+](=O)[O-])c(Sc3ccccn3)c2)CC1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47603",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+][C@H](CO)c1ccccc1F)c1ccsc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ncc(C(=O)N2CCC(c3[nH]ncc3-c3cccc(F)c3)CC2)c(=O)[nH]1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104713",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CN[C@@]1(C#N)CCC[C@@H](Sc2nnnn2C2CCCC2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197504",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)[O-] with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153931",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CCC(=O)c1ccc(F)cc1F)Nc1cccnc1N1CCOCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(Cl)ccc1Nc1ncnc(NNC(=O)c2ccccn2)c1N with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61545",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccccc1F)c1c[nH]nc1-c1ccc(Cl)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37048",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1c(C)c[nH+]c(Cn2ncc(Cl)c(Cl)c2=O)c1C by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81773",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+]Cc1ccccn1)c1cccc(NC(=O)Cc2ccccc2F)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172262",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cc(CN2CCO[C@H]3CCCC[C@@H]32)ccc1N1CCOCC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39097",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](Cc1ccc(C(F)(F)F)cc1)C(=O)N1CCOC[C@H]1C1CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153147",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)NCCSc1cc(Cl)ccc1N by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174452",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](c1ccccc1)N1C[C@@H](C(=O)Nc2ccc(F)cc2Cl)CC1=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8976",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nn(C)c(Cl)c1CSc1ccc(N)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85240",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)c1nnc2ccc(N3CC[C@H](C[NH+]4CCCCC4)C3)nn12 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148962",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)N[C@@H](C)C(=O)N2CCOCC2)cc1C(F)(F)F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15604",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(Br)ccc1NC(=O)CN1C(=O)C(=O)N(Cc2cccs2)C1=O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111881",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(C2=NN=C(C(=O)N/N=C/c3ccccc3Cl)C2)s1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100889",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1c(C(=O)Nc2cc3c(cc2Cl)OCCO3)cnn1C(C)C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57166",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2CC[NH+](Cc3cc4c(cc3O)CCC4)CC2)cc1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22084",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1noc(CCC(=O)N(C)[C@@H](C)c2cc(F)ccc2F)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231077",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCc1ncccc1F)c1ncccc1C(F)(F)F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC[C@@H]1CC[NH+](Cc2cc(C(F)(F)F)ccc2Cl)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184874",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H](C(=O)OCC(=O)Nc1ccc(I)cc1C)c1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCn1ccnc1CNC(=O)c1cn(Cc2ccccc2F)nn1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179824",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOc1c(Cl)cc(C[NH+]2CCC(N3CCCCC3=O)CC2)cc1OC with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48070",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1cc(-c2nc(C(=O)N(CCC#N)CCC#N)cs2)cn1 by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69687",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)Nc1nc(C(=O)Oc2cccc(Br)c2)cs1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107290",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1c([O-])ncnc1Sc1ccc(Cl)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(F)cc1F)N(CC(F)(F)F)c1ccccn1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33904",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N1CCc2c(sc(NC(=O)c3cc(C)no3)c2C#N)C1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170077",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1cccc(CNC(=O)[C@H]2COc3ccc(F)cc3C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217684",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)N1CC[C@@H](C(=O)NCc2cnc(OCC(C)C)c(Cl)c2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111393",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(NC(CO)CO)[C@H]1CC[C@H]2CCCC[C@H]2[NH2+]1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C(=O)NCCOc2ccccc2)nn1-c1ccc(F)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92110",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccncc1NC(=O)Cc1coc(-c2ccc(Cl)cc2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73829",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)(F)Oc1cc(Br)c2nc([S-])sc2c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65070",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN[C@]1(C#N)CCC[C@H](n2cc(Cl)cn2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212457",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(Cc1ccsc1)N1CCC[C@@H](O)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160265",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cccc(OCC(=O)NC[C@@H](O)c2ccc(Cl)cc2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCSCCC(=O)NC1CCN(S(=O)(=O)C(F)(F)F)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113515",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1c(CNC(=O)Nc2cccc(F)c2)nnc1SCc1cccnc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146878",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule [NH3+][C@@H]1CC[C@@H](NS(=O)(=O)c2cc(Cl)c(Cl)s2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72776",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NCc1ccsc1)c1csc(C#CCO)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10469",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[NH+](C)[C@@H](CNC(=O)NNc1cccc(C#N)c1)c1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167094",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([N+](=O)[O-])c(NCCCn2cccn2)c1 by substituting a nitro with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51109",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1ccc(COc2ccc(F)cc2Cl)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191991",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1=C(C)NC([S-])=C(C#N)[C@@H]1c1cccnc1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52762",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](CSC)N(C)C(=O)Nc1c(F)cccc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121972",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)c2ccc3c(c2)ncn3CCNC(=O)NC(C)C)cc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241545",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(C)c1cc(C(=O)NNC(=O)c2cccs2)n(Cc2ccc(F)cc2)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6254",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CC(=O)Nc2cc(C(=O)O[C@@H](C)C(C)(C)C#N)ccc21 by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244050",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCc1cc([C@@H]2CCCN2C(=O)c2c(Cl)cnn2CC)no1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28845",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cccc(C[S@](=O)Cc2c(C)nn(C)c2Cl)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165302",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(CNC(=O)CSc2ccccc2Cl)cc1OC by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183643",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1oc(NC(=O)[C@H](C)N2CC[NH+](C(C)C)CC2)c(C#N)c1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55271",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CSCc1ccc(O)cc1)C(=O)[O-] by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109322",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1cc([C@@H]2Oc3c(OC)cc(/C=C/C(=O)[O-])cc3[C@@H]2CO)ccc1O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102179",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCC[C@@H](O)CNC(=O)Nc1cccc(F)c1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110499",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)Nc2ccccc2)cc1S(=O)(=O)Nc1cc(Br)cc2cccnc12 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18031",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=S1(=O)CC[C@@H](Nc2nccc(Oc3ccc(F)cc3)n2)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147422",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN(CC(=O)Nc1cc(Cl)ccc1C)C(=O)c1sc(-c2ccsc2)nc1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167897",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(F)cccc1NC(=O)NCc1[nH+]ccn1CCc1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98178",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)COc2ncnc3c(Cl)cc(Cl)cc23)c(OC)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54072",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Oc1ccc(C2CCCC2)nc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212342",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a thiol in the molecule Cc1cnc(=O)n(C[C@H](CS)C(C)(C)C)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(F)cc1C[NH+]1CCN(CC(=O)Nc2sccc2C#N)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19683",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cc2ccccc2o1)c1ccccc1OC(F)F by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184754",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H](CCCO)[NH2+]C[C@@H]1COc2ccccc21 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110661",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCN(C(=O)c2ccc(C(=O)Nc3ccccc3)cc2)C[C@@H]1O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124017",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@H](O)CNc1[nH+]c2ccccc2n1Cc1cc(-c2ccccc2)no1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192373",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(OCC(=O)N1CCOCC1)c1ccc(F)c(F)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152671",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)[C@@](NC(=O)Nc1cc(C)on1)(c1ccccc1)C(F)(F)F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185601",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1c(Br)cc(Cl)cc1[C@@H]([NH3+])C1C(C)(C)C1(C)C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39650",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H](NC(=O)N[C@H](C)c1ccc(Cl)s1)[C@@H](C)CO by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188186",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(Nc1cccc2c1CCCC2)c1ccc([N+](=O)[O-])s1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53736",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCn1nc(C)c(CNC(=O)Nc2cccc(Cl)c2-n2cccn2)c1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226232",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H](NC(=O)N(C)[C@H]1CCC[C@H](C)C1)c1nc(C(F)(F)F)cs1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1cc(F)cc(Oc2ncc(Cl)cc2F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98445",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H](COc1ccc(Cl)cc1)C[NH+]1CCN(c2ccc(F)cc2)CC1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12126",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1c(Br)ccc2nc(C3CCCCC3)c(N)n12 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217603",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2)c(OC)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130741",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCc1c(C#N)c(=O)[nH]c(=O)n1-c1ccccc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86320",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)Nc1cccc(F)c1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143902",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1ccc(CNC(=O)c2ccc(F)cc2F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)(C)OC(=O)N1CCC[C@@H](CCOCc2cnc(Cl)s2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168909",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(Br)cc1NC(=O)CC1([NH3+])CCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76367",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule OC[C@H]1CCC[C@@H]1Nc1cc(-n2ccnc2)ncn1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102763",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(/C=c2\\s/c(=C(\\C#N)C(=O)C(C)(C)C)n(C3CC3)c2=O)o1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32234",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule NC(=O)C1(NC(=O)c2cc(Br)c[nH]2)CCCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(=O)Nc2nc3c(s2)CCC[C@@H]3C(=O)Nc2ccc(OC)c(Cl)c2)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237164",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N[C@@H](C)C(=O)Nc2ccc(Cl)cn2)cc1I by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112913",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CN(C1CCCCC1)S(=O)(=O)c1ccc(Cl)cc1)N1CCN(c2ccccc2F)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230901",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCC(CC)(NC(=O)Cc1c(F)cccc1F)/C(N)=N/O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200600",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(N2CCN(c3cc(Cl)nc(N)n3)CC2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53102",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)COc1cncc(N[C@H](C)[C@H](C)CO)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1ccc([C@@H](C)NC(=O)[C@H]2CCO[C@@H]2C)cc1[N+](=O)[O-] with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47783",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CO[C@H](C)CC(=O)NCc1cccc(C#N)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57804",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C[NH2+]C)c1cccc(F)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61217",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](Oc1ccc(Cl)cc1Br)C(=O)NCc1ccc2c(c1)OCO2 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203809",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)c1cccc(-c2ccc(Cl)c(O)c2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CCOC(=O)C1=NN(c2ccccc2Cl)[C@@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@@H]12 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210911",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc2c(c1)OCO2)c1ccc(F)cc1F by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201932",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)c1nc(-c2ccc(Br)cc2)nc2c1[nH]c(=O)n2-c1cccc(Cl)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43678",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)C[NH+]1CCC(C(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32064",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(C)c1ncc(NC(=O)[C@@H]2CS[C@H](Cc3ccccc3F)C(=O)N2)cn1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223462",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cccc(C)c1NC(=O)CSc1nnc([C@@H]2CCCN2C(=O)c2ccccc2Cl)n1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20094",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC1CCC([NH+]2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142232",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCC[C@H]1NC(=O)c1ccc(C#CCO)cn1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12576",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCc1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204025",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@]1(C(=O)NCc2ccccc2)CCC(=O)N1Cc1ccccc1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45742",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Cn1nc2ccc(SC3CCCCC3)nn2c1=O)NCCc1ccc(Cl)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87077",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)[C@@H]2CCC[NH+]2Cc2ccccc2)C[C@@H]1O by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172009",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(O[C@@H](C)C(=O)NNC(=S)Nc2cc(C)ccc2F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86100",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cc(N2CC[C@H](CN3CCOCC3)C2)c2ccccc2n1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23971",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(CSCc1cc(-c2cccs2)on1)NCC1(O)CCOCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84050",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccc2cc(-c3cc(F)cc(F)c3)c(=O)oc2c1)Nc1cccnc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137172",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Nc1c(Nc2cccc(Br)c2)ncnc1N1CCCCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178011",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C#Cc1ccc(OC)c(F)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161249",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CN(C)c1ncc(CN2CCCN(c3ccccc3C#N)CC2)s1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63444",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)N1CCC([NH2+]Cc2ccc(-c3ccccc3F)s2)CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201782",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Fc1cc(C[NH2+][C@H]2CCCc3ccccc32)cc(F)c1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCc1nc(C(=O)N2C[C@H](O)C[C@H]2c2cc(F)ccc2F)c[nH]1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1n[nH]c(C)c1[C@@H]1CCCN1C(=O)Nc1ccc(OC2CCCC2)c(F)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77261",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C#CCOc1ccc(N(C)C(=O)c2cccc(F)c2OCC)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38884",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cn1c(-c2ccccc2)nnc1[C@H](C#N)C(=O)[C@H]1CCC[C@H](C(F)(F)F)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134707",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(NC1CC1)[C@@H]1CCCN1C(=O)CCCCO with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213704",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc([C@H](NC(=O)NC[C@](C)(O)c2ccc(C)o2)C(C)C)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](NC(=O)NCc1ccc(F)cc1)[C@H](O)c1ccc(Cl)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94868",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC(C)Oc1cccc(C[NH+](C)Cc2ccc(C#N)o2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41906",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=C1CCCC2=C1[C@H](c1ccc([N+](=O)[O-])cc1)CC(=O)N2c1ccccc1C(=O)[O-] with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209067",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](NC(=O)[C@@H](C)N1CCO[C@H](c2ccccc2)C1)c1ccc(F)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64121",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1nc(C(=O)NCc2ccc(F)cc2)cc1NC(=O)Cc1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55931",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CCn1cncn1)N[C@H](c1ccccc1F)C1CCCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34499",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@H](O)CNC(=O)c2cc(C(C)C)nc3c2c(C)nn3C(C)(C)C)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177155",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCn1/c(=N/C(=O)c2ccc(Br)o2)sc2cc(S(N)(=O)=O)ccc21 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223463",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1ccc(O)c(NC(=O)c2ccncc2F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41390",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cn1cc(C#N)cc1C(=O)Nc1ccccc1N1CCCCCC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49524",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCCSc1ccc(Br)cc1)c1cnccn1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11893",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1ccc(Cl)nc1)c1c[nH]nc1-c1ccccc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248601",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ncccc1C(F)(F)F)N1CCC(c2nncn2C2CC2)CC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69204",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#CCCn1cc(C[NH+]2CCC[C@@H](CC(N)=O)C2)c(-c2ccccc2)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64682",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1sc(C(=O)N/N=C(/C)c2ccc(N3CCOCC3)c(F)c2)cc1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85261",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1ncnc1CCNC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232392",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC[C@H](NC(=O)CCc1cccc([N+](=O)[O-])c1)c1cc(F)ccc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6540",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1cccnc1NC[C@H]1CN2CCC[C@@H]2CO1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64845",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Oc1ccc(Br)c(CN2CCOC3(CCC3)C2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162344",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)N(C(=O)[C@H](C)c1ccsc1)c1cccc(C#N)c1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39145",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)C1=C(C)N(C)C(=O)N[C@@H]1c1ccccc1OC(F)F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235240",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1nc(N)nc(-c2ccc([N+](=O)[O-])cc2)c1C(=O)N(C)C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207480",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CN(C)C(=O)CNc2cccc(F)c2)c1OC by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47042",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nc2[nH]c(-c3ccc(Br)cc3)nc2cc1Br with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55889",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2csc(C3=C(N)N(NC(=O)c4ccc([N+](=O)[O-])cc4)CC3=O)n2)cc1 by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170439",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1ccc(Cl)c(C(=O)N[C@@H]2CCC[C@@H](S(C)(=O)=O)C2)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115120",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule C[C@@H](Oc1cccnc1[N+](=O)[O-])C(=O)N(CCC#N)c1ccccc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178550",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(C[C@H]([NH3+])Cc2cc(F)ccc2F)cn1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181728",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@@H](CNC(=O)CN(C)C(=O)c1ccccc1)c1cccc(Cl)c1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10589",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc([C@@H](NC(=O)C(=O)Nc2ccc(Cl)cc2)C(C)C)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5812",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=C/C(=O)c2ccc(SC)c(OC)c2)cc1F by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35799",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC(Nc2ccc3cc(C#N)ccc3n2)CC1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115376",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCc1cc(=O)[nH]c(N2c3ccc(F)cc3CC[C@H]2C)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141794",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]1C(=O)OCC(=O)Nc1cc(Cl)ccc1C#N by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197871",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1ccc(F)cc1)[C@H]1CCCN(C(=O)CC2CCC2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99800",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O[C@@H](CNCc1cccnc1)c1ccco1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45905",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=S1(=O)C[C@@H](N2CCN(c3ncnc4c3oc3ccccc34)CC2)[C@@H](O)C1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218099",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](Cc1ccccc1)NC(=O)Nc1cc(NC(C)=O)c(F)cc1F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217400",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)[NH+]1CCN([C@H]2CCN(C(=O)OC(C)(C)C)C2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162107",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1cc(O)c(C(C)C)cc1NC(=O)c1ccc(CNS(C)(=O)=O)o1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178056",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(COc1ccc(F)cc1Br)Nc1cccc(NC(=O)c2ccco2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76618",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1nnc2c(-c3ccc(F)cc3)c(C)nn2c1C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188282",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CSc1ccnc(-c2nc([O-])c3cc(F)c(F)cc3n2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212481",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccccc1CNC(=O)c1cnn2cc(Br)cnc12 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44581",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(Cc1cccc(F)c1)C(=O)CS(=O)(=O)Cc1c(Cl)cccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33438",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(N[C@@H]1CC[NH+](C2CCCC2)C1)c1c(O)cccc1O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142658",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC1=C(C#N)C(=O)N(CCN2CCOCC2)C(=O)/C1=C\\Nc1ccccc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97687",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]1OCC[C@H]1[C@H](Br)Cc1ccccc1[N+](=O)[O-] by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134854",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(C(=O)Nc2nc([C@@H](C)O)cs2)c(F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153810",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(C)N(C(=O)/C=C/c1ccc(OC(F)F)cc1)[C@H]1CCS(=O)(=O)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156289",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCS(=O)(=O)CCN(C)C(=O)CCc1cccc(F)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77645",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Clc1ccc(Cc2nc3ccccc3[nH]2)c(Cl)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C(C)CSc1nc2cc(Cl)ccc2o1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211594",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1csc([C@@H]2CCCN(Cc3cc4cnn(C(C)C)c4nc3Cl)C2)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1ccc(C[NH2+][C@H]2CCOC3(CCSCC3)C2)s1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209444",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)n1ccc(Cn2cc(C(=O)[O-])cc2Br)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210702",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)c(F)c1)C1(c2cc(-c3cccs3)on2)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231430",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)Nc1cc(NCc2c(C)nn(C)c2Cl)ccc1C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119265",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1ccc(O)cc1)c1ccccn1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105234",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@]1(O)C[C@@H](c2ccc(OC)cc2)[NH2+][C@H](c2ccc(OC)cc2)[C@@H]1C by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87906",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cn1c(Cc2ccccc2Cl)nc2ccccc21)Nc1ccc2c(c1)OCO2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244298",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCCN1C(=O)Nc1ccc(F)c(C#N)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195710",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H](CO)[NH2+]Cc1ccc(-n2ccnc2)cc1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145049",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C=CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccccc2)sc2cccc(F)c21 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCC(=O)N1CCc2ccccc2C1)NC1(c2ccccc2F)CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95424",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(NC(=O)C[NH+]2CCC[C@@H](CNC(=O)c3ccc(F)cc3)C2)cnn1C by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93975",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCC1(CC)[C@@H](OC)[C@H](C)[C@H]1/[NH+]=C/c1cccc(OC)c1O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96088",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1[nH]c2ccccc2c1CC(=O)N1CCC(OCc2ccccc2F)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198730",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC(CO)CO)N[C@@H]1CCC[C@@H](C(F)(F)F)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11972",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)Sc1nnc(NC(=O)c2ccccc2F)s1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205373",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(-c2cnc(Br)nc2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22136",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(NC[C@@H](O)c1ccc(Cl)s1)C(=O)NC1CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38551",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(Cl)cc1NC(=O)Cn1nnc(C(=O)Nc2ccc(F)cc2F)c1C by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187652",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1cc(CN2CCO[C@@H](CC(=O)[O-])C2)ccc1O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213370",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1nccc1C(=O)NC1CC[NH+](CC2(c3ccc(Cl)cc3)CCC2)CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152899",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cn1cc(C#N)cc1C(=O)N[C@@H](CC(N)=O)C1CCCCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97590",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C1NC2=C(C(=O)N(CCO)C2)[C@H](c2ccccc2F)N1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232701",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCCC(=[NH2+])Nc1cc(OC)ccc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140484",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc(=O)[nH]c1)c1ccc(F)c(Br)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44584",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)NCCCNC(=O)C1CCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102778",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC[C@@H](Nc1nc(Br)cs1)C(C)C with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCOc1cc(/C=C(\\C#N)c2nc3ccccc3s2)cc(Cl)c1O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189117",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOc1cccc(CNC(=O)[C@H]2CCO[C@H]2C)c1OC(F)F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14016",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1ccc2c(c1)[C@H](O)[C@H](N1CCOCC1(C)C)CC2 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217672",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(F)c(-c2ccc(F)c(C(=O)[O-])c2)cc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241345",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)c1ccc(Cl)cc1NC(=O)C(=O)N[C@H]1CCCC[C@@H]1CO by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241052",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1ccccc1[C@H](C)NC(=O)[C@@H](C)Nc1ccc(CC#N)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42427",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@]1([C@H]([NH3+])c2c(F)cc(F)cc2F)CCCO1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173986",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule C[C@H]1CCC[NH+](C/C([O-])=N/c2nc3ccc([N+](=O)[O-])cc3s2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26149",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)N[C@@H]1CCC[NH+](Cc2c(Cl)cccc2OC)C1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220648",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C([O-])[C@H]1CCCN(C(=O)c2cc(Br)ccc2Cl)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38115",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](c1ccccc1)[S@](=O)CC(=O)Nc1cccc(C#N)c1 by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2491",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3879",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(NC(=O)CN(C)C(=O)[C@@H](C)Oc2ccc(Cl)cc2)c1C by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96510",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C(NCc1cccc([N+](=O)[O-])c1)N[C@@H](CN1CCCC1=O)c1ccccc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197160",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1nc(C[C@@]2(O)CCCOC2)sc1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190149",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1CCN(C[C@H](O)COc2ccc3c(c2)OCO3)CC1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38935",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CC[S@@](=O)[C@@H]1CCCC[C@@H]1/[NH+]=C/c1cc([N+](=O)[O-])ccc1[O-] by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158553",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccccc1OCCNc1cc(Cl)cc(Cl)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108813",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccc(S(N)(=O)=O)cc1)N(C)Cc1sccc1Br by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227256",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H](OC(=O)[C@@H]1CCO[C@@H]1C)c1ccc(F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137685",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)[C@@H]1N=C2c3ccccc3N=C(SCC(=O)Nc3cc(F)ccc3F)N2C1=O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186038",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1NN[C@H](NC(=O)CC2=c3ccc(Cl)cc3=[NH+]C2)S1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113965",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)C1(C)CCN(C(=O)Nc2ccc(OC(F)F)cc2)CC1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1ccc(Cl)cc1)[NH2+]CC/N=C(\\O)c1ncccc1O by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180826",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccc(-c2cccc(C(=O)N3CCOC[C@@](O)(C[NH+]4CCCC4)C3)c2)o1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242891",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Cl)c(C(=O)/C=C/c2cccc(OC)c2OC)cc1OC by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "143695",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COc1ccc(/C=C(\\C#N)C(=O)NCCC2=c3ccccc3=[NH+]C2)cc1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95735",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3953",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCOc1ccccc1F)c1n[nH]c2c1CCC2 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151959",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](Nc1cnn(C)c(=O)c1Cl)c1ccc2c(c1)NC(=O)CO2 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68694",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C#N)CCN1CCOCC1=O by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(C)c1csc(C[C@H]2CC[C@H](Br)C2)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192575",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(CCC(=O)N1CCN(c2ccc(F)cc2)CC1)Cc1cnccn1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227264",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC1CCC(NC(=O)[C@H](C)Sc2ccc(O)cc2)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241820",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1C[C@@H](c2cccs2)CC2=C1[C@H](c1c(Cl)cccc1Cl)n1ncnc1N2 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5480",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCN(CC)C(=O)CN1CCC[NH+](CC(=O)Nc2ccc(F)cc2F)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231272",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1[nH]c2ccccc2c1-c1csc(NC(=O)c2cncn2-c2ccc(F)cc2)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14930",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COC(=O)c1cccc(C(=O)NC(=S)Nc2ccc(C)c([N+](=O)[O-])c2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150755",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)c1c(NC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(F)cc2)sc2c1CC[NH+](C)C2 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160447",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1c(NC(=O)CN2CCOC[C@H]2C#N)sc2c1CCCCC2 by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215845",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1cccc(C(F)(F)F)c1)c1nc(N2CCCC2)ncc1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1cc(C(C)(C)CC(C)(C)C)cc(C[NH+](C)C)c1O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35442",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COc1ccc([N+](=O)[O-])cc1C(N)=[NH2+] with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88831",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule COC(=O)c1occc1Cn1cnc(-c2ccc([N+](=O)[O-])cc2)n1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185349",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1nnc(SCC(=O)Nc2ccc(F)c(Cl)c2)n1-n1cccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105862",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1cccc(C(=O)Nc2ccc(C#N)cc2)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@H]1CCC[C@H]1CNc1nc(Cl)ncc1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103106",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1cc(/C=C/[N+](=O)[O-])ccc1OCc1cccc(F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155477",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(OCC1CCN(CC(F)(F)F)CC1)C1CCN(C(=O)C2CC2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163593",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](NC(=O)NCc1nc(C)c(C)o1)c1ccc(F)c(F)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49525",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(/C=C(/NNC(=O)c1cccc(Br)c1)c1ccccc1)c1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207708",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)CN(Cc1cccc(Cl)c1Cl)CC(F)(F)F by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198109",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc([C@H](N)c2cc(C)c(Br)s2)sc1C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18050",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@H]1[C@H]2C=C[C@H](C2)[C@H]1C(=O)NCc1ccccc1Cl by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215945",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(F)cccc1NC(=O)C(=O)NCc1ccc([N+](=O)[O-])cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173731",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOc1ccccc1NC(=O)n1ncc2cc(Cl)ccc21 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55248",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1C[C@@H]1C(=O)Nc1cccc(Cl)c1-n1cncn1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102451",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](CSC)N(C)C(=O)Nc1cc(Br)ccc1C by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179964",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cc1cccnc1)NNC(=O)N1CC=C(c2ccccc2Cl)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102788",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H](CO)CS[C@H](C)C(=O)c1ccc(F)cc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NN1C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C1=O)c1cccc(Cl)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93903",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCCn1c(N2CCC[C@@H](C)C2)c(/C=C2/SC(=S)N(CC(=O)[O-])C2=O)c(C)c(C#N)c1=O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167375",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N#CCCSc1nnc(-c2ccc(F)cc2)n1-c1ccc(F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91054",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nn(Cc2ccc(C(=O)N3C[C@@H](C)C[C@H](C)C3)cc2)c(C)c1Br by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55704",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Nc1c(C(=O)N2CCO[C@@H]3CCCC[C@H]32)cc(F)cc1[N+](=O)[O-] by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235377",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CS(=O)(=O)[N-]c1cc(C(=O)N[C@H]2C[C@@H]3CCCc4cccc2c43)ccc1F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136177",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(-c2cc(C(=O)NNC=C3C(=O)Nc4ccc(Br)cc43)[nH]n2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3927",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COc1cccc(OCc2nc(C#N)c(NC[C@@H]3CCCO3)o2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80262",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccc(N2CCCC2=O)cc1)c1cc(Cl)ccc1O by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224441",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(CNC(=O)Nc2ccc(-n3ncn(C)c3=O)cc2)ccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83109",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1ccc(C)c([C@@H](O)C[NH+]2CCC(CC(=O)N(C)C(C)C)CC2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18274",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSC[C@@H](C)N(C)C(=O)N[C@H](C)c1ccc(F)c(Cl)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17638",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(Br)cc(/C=N/NC(=O)COc2c(C)cccc2C)c1O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49294",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@@H](C)NC(=O)c2cc3c(F)cc(Br)cc3[nH]2)o1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56968",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1ccsc1NC(=O)Cn1cc(-c2ccccc2)cn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64060",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)c1nc2cccnc2n1C1CCN(C(=O)[C@@H](O)c2ccccc2Cl)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21960",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C#N)NC(=O)c1c(F)ccc([N+](=O)[O-])c1F by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233790",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC(C)(C)CC[C@@H]1NC(=O)C(=O)Nc1cccnc1Cl by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33051",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)N2CCn3cccc3[C@@H]2C(C)C)c(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87715",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2csc3nc(Cn4cc(C(F)(F)F)ccc4=O)[nH]c(=O)c23)s1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12917",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule OCCC[NH+](C1CCSCC1)C(c1ccccc1)c1ccccc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156557",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCC(CC)(CNC(=O)N[C@@H]1CCC[C@]1(C)CO)S(C)(=O)=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173357",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cccc([C@@H](C)S(=O)(=O)c2ccc(Cl)cc2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147620",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#CC(C#N)=CNC1CC[NH+](Cc2ccccc2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188858",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc(CNC(=O)N[C@@H](C)c2ccc(OC(F)F)cc2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176013",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1C(=O)C(=Cc2cc(Br)ccc2OCC#N)C(=O)N(C)C1=S by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197298",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C(=O)Nc2cccnc2Cl)cc(Cl)c1Cl by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91742",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OC[C@@H](O)[C@@H](O)/C=N/N(Cc1ccccc1)c1ccccc1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240613",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1ccc(NC(=O)C(=O)NC[C@@H](O)Cc2ccccc2)c(Cl)n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110294",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccc(CC(=O)N2CCC[C@H](c3cc(C(F)F)n4ncnc4n3)C2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126459",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(/C=C/c1cccc(Cl)c1)OCc1cccc([N+](=O)[O-])c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124197",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(N2CCN(Cn3cc[nH]c3=S)CC2)cc1F with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76949",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cc(NC(=O)C(=O)NC(C)C)ccc1Cl by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80374",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCN(C(=O)N[C@@H]2CCC[C@@H]2c2ccc(F)cc2)C[C@H]1O by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133690",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(C(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(Br)o1)c1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243504",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule COc1cc(CN(C)C2CC[NH+](C)CC2)c([N+](=O)[O-])cc1OC with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140556",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN(C)C(=O)c1ccc(Oc2cc(F)c(N)cc2F)nc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174680",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c(Cl)cccc1S(=O)(=O)N1CCN(c2nc3ccccc3nc2C(F)(F)F)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234971",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCc1cc(NC(=O)N(C)Cc2ccc(Cl)c(Cl)c2)ncn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214896",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCC[C@H]1CCC[NH+](Cc2cccn2Cc2cccs2)C1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112413",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)S(=O)(=O)c1ccccc1C(=O)Nc1ccc(Br)cc1F by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105447",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[NH+](Cc1ccno1)C[C@@]1(O)CCCN(Cc2cccc(F)c2F)C1=O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240916",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCC[C@@H](Cc2cccc(Br)n2)CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92760",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1ccc(C[NH+]2CCCC[C@@H]2c2nnc3n2CCCC3)c(O)c1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167742",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(C(=O)c2cccc(NC(=O)c3ccco3)c2)C[C@H]1O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216391",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(-c2nc(CN3CC[NH+](CC(=O)Nc4cccc(F)c4)CC3)cs2)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202375",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccc(C)c(N2N=C(C(=O)N3CC[C@H](C)[C@@H](O)C3)CCC2=O)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231603",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOC(=O)[C@H]1CCCN(C(=O)[C@@H]2CC(=O)N(c3cccc(F)c3)C2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22667",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCCNC(=O)C1=NN(c2ccc(F)cc2)[C@H](C(N)=O)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178585",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H](O)CNC(=O)C(=O)NCC1(c2ccccc2)CCOCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192493",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCS[C@H]1CC[C@H](NC(=O)Cc2cccc(O)c2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71332",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H]1OCC[C@@H]1C(=O)Nc1cc(C(F)(F)F)ccc1N(C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137579",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C1CN(C(=O)COC(=O)c2cccc(Br)c2)c2ccccc2N1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCC[C@H](O)[C@H]1CCOC2(CCCC2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99167",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@H]1C(=O)NCC[NH+]1CC(=O)Nc1cc(Cl)ccc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38090",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COCCn1ccc2ccc(NC(=O)N3CCC[C@@H](C)[C@H]3CO)cc21 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226975",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN1CCN(C(=O)[C@@H]2CCCN2C(=O)CSCC(F)(F)F)CC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139204",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCNC(=O)CN(c1ccccc1OC)S(=O)(=O)c1cc(Cl)ccc1Cl by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139340",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)NCc1cc2n(n1)CCN(Cc1cccc(Cl)c1Cl)C2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180079",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([O-])[C@H]1C[C@@H](O)CN1C(=O)CCc1ccc(Cl)cc1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87703",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(Br)cc1NC(=O)c1nc[nH]n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38547",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CC(C#N)=NNc1ccc([N+](=O)[O-])cc1O by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202195",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nn(C)c2ncc(NC(=O)N(C)[C@@H](C)c3ccccc3Cl)cc12 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176351",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCn1nc(-c2ccccc2)c2cc(Cl)ccc21)NC1CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12913",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O[C@@H](Cc1cc(Br)cs1)C1([NH+]2CCCC2)CCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154052",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C#CCNC(=O)c1cc([N+](=O)[O-])ccc1I by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238837",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(OC(=O)Cn2ncc3ccccc3c2=O)ccc1Cl by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24842",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](NC(=O)C(=O)Nc1ccc(C#N)cc1)c1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CCCO)NC(=O)N[C@H](C)c1nc(C2CCCC2)no1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120712",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@@H](O)C[NH2+][C@H]2CC[C@H](C)c3ccccc32)cc1OC with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99466",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccccc1NC(=O)Cn1c(-c2ccc(C(F)(F)F)cc2)nc(C)c(CCO)c1=O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131954",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC(=O)Nc1ccc(Sc2ccc([N+](=O)[O-])cc2C#N)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19017",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(Cc2ccccc2NC(=O)c2ccncc2F)C[C@H](C)O1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77881",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(OC[C@@H]2CCCO2)cc1)N1CCC[C@@H](c2nc(-c3ccc(F)cc3)no2)C1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57625",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(OC)c2c1N[C@@H](c1ccc([N+](=O)[O-])cc1)[C@@H]1CC=C[C@@H]21 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43444",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc([C@@H](N)c2ncc(Cl)cc2Cl)ccc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48356",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CNC(=O)CC1CCN(c2ccc([N+](=O)[O-])c(C(=O)OC)c2)CC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223571",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CS(=O)(=O)N1CCC[C@H](c2ccc(C(=O)NCC(F)F)cn2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](Cc1cccnc1OC)[C@@H](C)O by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133157",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)C[C@H](n2nc(O)c3c2NC(=O)CS[C@@H]3c2ccc(Cl)cc2)CCO1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46553",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@H](NC(=O)OCCO)C1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123465",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@@H]2C(C#N)=C(N)O[C@H]3N=NC(C)=C23)ccc1OCc1ccccc1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76304",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@@H](CO)NC(=O)c1cccc(C(F)(F)F)c1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21534",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)N(C)c1ccc(N[C@@H](C)c2ccoc2)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133839",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1cccc(C(=O)N2CCCCC2)c1O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137584",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C=CCOc1ccccc1C(=O)N/N=C(/C)c1cc(O)ccc1O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64639",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule OC[C@]1(CCc2ccccc2)CCC[NH+](C2Cc3ccccc3C2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218849",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@H](O)CN1CCN(C(=O)[C@@H](C)OC[C@@H]2CCCO2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218678",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]([NH2+][C@@H]1CCc2c(F)ccc(Br)c21)[C@@H]1CN(C)CCO1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76058",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6090",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(-c2n[nH]c(S[C@H](C)C#N)n2)cc1 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163413",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H]1CCC[C@H](NC(=O)C(=O)Nc2cc(F)c(OC)c(F)c2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107522",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1cccc(F)c1)C(=O)CSCC(F)(F)F by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34170",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1noc([C@H](C)OC(=O)Cc2c(F)cccc2F)n1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218982",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#Cc1c(-c2ccc(C(F)(F)F)cc2)nn(-c2ccc(C(F)(F)F)cn2)c1N with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89661",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ncccc1C(=O)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145793",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[NH+]1CCC(NCc2ccc(F)cc2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67822",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)C1=C(C)N=C2SC[C@@](O)(N(c3ccccc3)C(C)C)N2[C@H]1c1ccc(OC)cc1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178526",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(F)cc1NC(=O)c1nc(C)c(C)[nH]c1=O with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246654",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+]Cc1ccc(Br)cc1N(C)Cc1ccccc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190987",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cn1c([C@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)nc2ccc(F)cc21 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)c1ccc2c(=O)n3c(nc2c1)CCC3)c1ccccc1Cl by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157963",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)NC(=O)c1cc(=O)c(OCc2ccccc2Cl)c[nH]1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176594",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(C)c(-n2nc(C)c(CN3CCO[C@H](C(N)=O)C3)c2Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240720",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)COc2ccc([N+](=O)[O-])cc2Cl)C[C@H](C)O1 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126210",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule C[C@@H]1CCCC[C@@H]1[NH2+]Cc1ccc([N+](=O)[O-])cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166729",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CN(C)c1nnc(S[C@H]2CCC[C@@]([NH3+])(CO)C2)s1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27920",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1ccc(F)cc1)N1CCCC[C@H]1c1nc(-c2ccccc2)no1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71180",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(NC(=O)N(C)[C@H](C)c2ccccc2F)n(Cc2ccccc2)n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234459",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(CC1CC1)C(=O)c1cccc(OC)c1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239569",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](Oc1c(C)cc(Br)cc1C)C(=O)[O-] by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72360",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(Nc1ccccc1)c1cccc([N+](=O)[O-])c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239508",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a thiol in the molecule C[C@@H](CCS)CC[NH+]1CCC[C@H]1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101867",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1ccccc1O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20753",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(C(=O)Nc2c(F)cccc2F)c(F)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242074",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CCC(Oc2cc(CNc3nccnc3C#N)ccn2)CC1 by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162094",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1nn(-c2ccccc2Cl)c(N)c1I by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169868",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130296",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COc1cc(C[NH+](C)Cc2ccc(O)c([N+](=O)[O-])c2)ccc1SC by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242069",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1cccc(NC(=O)CSc2nc3cc(Cl)ccc3o2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210579",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(NC(=O)[C@@H]2OCC(=O)N(C)[C@H]2c2ccccc2F)cn1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86967",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C[C@@H](Cc1ccc(F)cc1)c1ccccc1Cl by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23494",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule OC[C@@H]1CCC[NH+]1Cc1ncc(-c2cccs2)o1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)N/N=C\\c1ccccc1Br by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156688",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CNC(=O)c1ccc(CNc2cccc(F)c2[N+](=O)[O-])cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228104",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule S=C(Nc1ccccc1)Nc1ccncc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167581",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(S(=O)(=O)[N-]c2cccc(C[S@](C)=O)c2)c(F)cc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223843",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule FC(F)c1[nH]ncc1C[NH2+]C1CC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37002",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCc2c(sc3c2C(O)=N[C@@H](c2ccc(-c4ccccc4[N+](=O)[O-])o2)N3)C1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242819",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(F)c(S(=O)(=O)N2CCC[C@@H]2c2nc3ccccc3[nH]2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cccc([C@H](CO)NC(=O)Cc2csc(C(C)(C)C)n2)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31528",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC1(C)CCC[NH+]1[C@@H]1CC[C@@](CO)([NH2+]C2CC2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171522",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cc(NC(=O)C(=O)NC[C@](C)(O)c2ccsc2)ccc1N(C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151512",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2c(cc1C)N(Cc1cccc(F)c1)[C@@H]([C@@H]1C=CC=NC1=O)N2 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11826",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[NH+](Cc2nc3cc([N+](=O)[O-])ccc3o2)[C@@H]1C by substituting a nitro with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195055",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC[NH+]([C@@H](C)c2ccc(F)cc2)C[C@@H]1O by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198130",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCc1nc(CN2CCN(CC(=O)Nc3cccnc3Cl)CC2)no1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68980",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)[C@H](NS(=O)(=O)c1cccc2nsnc12)C(=O)Nc1ccc(F)c(Cl)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(C(=O)NCc2ccc(F)cc2)nc2ccccc12 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53135",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCc1cc(C(=O)Nc2cccc(-c3nc(C4CC4)n[nH]3)c2)ccc1F by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70120",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(C(=O)NCc2cnn(C)c2)cc(OC)c1OC(F)F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16439",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COc1cccc(OC)c1C(=O)NC(=S)Nc1cccc([N+](=O)[O-])c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86524",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule [NH3+][C@H]1CCOC[C@@H]1Cc1cc(Cl)ccc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41794",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(Cc1[nH+]ccn1C)C(=O)C[C@@H](O)c1ccc(Cl)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187673",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1sc(Br)cc1-c1nn(C)cc1C[NH2+]C(C)(C)C by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63477",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(OCc2cccc(Cl)c2)c(CBr)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190922",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)[NH+](CCNC(=O)N1CCN(c2ncccc2F)CC1)C(C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242114",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1nc(C(=O)N2CCOCC2)c(Cl)c1C(F)(F)F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30997",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c2ccsc2ncn1[C@@H](CO)c1ccccc1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79451",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1cc(-c2noc(-c3ccc4ccc(Cl)cc4n3)n2)cn1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201667",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC[C@H](C)NC(=O)c1cccc([N+](=O)[O-])c1C by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148438",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCOc1ccc([C@H]2C(C#N)=C(N)Oc3cc(OC(=O)[C@@H]4COc5ccccc5O4)ccc32)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58944",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(C)c(NC(=O)CNC(=O)NCc2cc(F)ccc2F)c(C)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120838",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc2nc([C@@H]3CCCN3C(=O)Cc3ccc(O)c(F)c3)[nH]c2c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99843",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CC1C[C@@H]2CC[C@H](C1)[NH2+]2)N1CCC(C(F)(F)F)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C#CCN(C(=O)N[C@@H](C)c1cc(C)c(F)c(C)c1)[C@H]1CCS(=O)(=O)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108486",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)(C)[C@H](NC(=O)N1CCC[C@H](CO)C1)c1cccs1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22361",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1/C(=C/c2ccccc2OCc2ccccc2Cl)SC(=S)N1Cc1ccco1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76994",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Br)cc1)c1ccc(CSC2=NCCS2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180602",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC/[NH+]=C(/NCc1[nH+]ccn1C)N1CC[C@@H](O)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102319",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC(=O)c1csc(NC(=O)c2cnc(-c3ccccc3F)s2)n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241040",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1nncs1)c1cccc(-n2ccc(C(F)(F)F)n2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174974",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CCS(=O)(=O)c1cc2c(cc1Cl)NC(=O)CO2)NCc1ccc2c(c1)OCO2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132243",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCc1cc(Br)ccc1NC(=O)[C@H]1[C@H]2C(=O)O[C@@H]3C[C@H]1C[C@H]23 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4950",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(C2=C3C(=O)N(c4cccc(F)c4)C(=O)[C@H]3N(c3ccccc3)N2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110374",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(Cc1nc2ccccc2s1)C(=O)Cc1c(F)cccc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175140",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNC(=O)NC(=O)[C@H](C)Sc1ncccc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23144",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)Nc1ccc(F)c(C(=O)NC[C@@]2([NH+](C)C)CCC[C@@H](C)C2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101605",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1OCCC(=O)N1C[C@H](c2ccc(F)cc2)C[C@@H]1C by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1CC[NH+](C[C@@H](O)C[NH2+]C/C=C/c2ccccc2)CC1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160562",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule COc1ccc(N[C@@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2)c(OC)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35728",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)Nc1ccc(Cl)cc1)C1CCC([NH3+])CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208301",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCSc1nnc2c(n1)O[C@H](c1ccccc1C(F)(F)F)N(C(C)=O)c1ccccc1-2 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157082",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(C(=O)CCCOc1cccc(F)c1)[C@@H]1CCCC[C@@H]1S(C)(=O)=O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58971",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1cccc(CNC(=O)c2[nH]c3ccc(C)cc3c2NC(=O)c2ccc(Cl)cc2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14142",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CC(C)C(=O)c1c[nH]c2cc([N+](=O)[O-])ccc12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191606",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nn(Cc2ccc(Br)cc2)c(C)c1NC(=O)c1cccnc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193697",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCCN(CCO)C(=O)Nc1nc(C)c(-c2ccccc2)s1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239391",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCC(=O)N/N=C/c1cccc(O)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235740",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1csc2ccccc12)N[C@@H]1C=C[C@H](CO)C1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73534",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)C(=O)CSc1nc2cc(Cl)ccc2c(=O)n1C[C@H]1CCCO1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62733",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1ccc2c(c1)OCCO2)N[C@H]1C[C@@H]1c1cccc(Cl)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115942",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc([C@H](C)[NH2+][C@H]2CC=CCC2)ccc1OC(F)F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7763",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccccn1)N1CCC[C@H]1Cc1cccc(F)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61326",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)[C@@H]([C@H](O)c1ccccc1)N1CC[NH+]2CCC[C@@H]2C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66353",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(=O)n(CC)c2cc(S(=O)(=O)c3ccc(OC)cc3)c([N+](=O)[O-])cc21 by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187052",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(CNC(=O)COc2ccc(Cl)cc2C=O)c1 by substituting a aldehyde with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243341",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2C[C@H](C(=O)Nc3cccnc3Cl)CCC2=O)cc1C by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90100",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O[C@@H]1CCCOC12CCN(c1nccc(C(F)(F)F)n1)CC2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69981",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CN1CCN(C(=O)[C@@H]2C[C@H]3CC[C@@H]2C3)CC1)Nc1ccc(F)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163417",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1cccc(C(=O)N(CCC#N)Cc2ccco2)c1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cl)cc1Nc1ncnc(OC(C)C)c1N by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108833",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C/C(=N\\c1ccccc1O)c1c([O-])n(-c2ccccc2)c2ccccc2c1=O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244389",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CO[C@]1(C)C[C@@H](NC(=O)NC2CCC(O)CC2)C1(C)C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39793",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1c2ccccc2CCN1C(=O)NCc1ccnc(OCC(F)F)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11560",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nn1ccc2c(nnc3c(-c4ccc(F)cc4)cnn32)c1=O)c1ccc(Cl)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171146",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cccs1)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92443",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)N[C@@H]1[C@H](Oc2ccc(Cl)cc2Cl)O[C@H]2COC(C)(C)O[C@@H]2[C@@H]1O[C@@H](C)C(=O)[O-] with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31587",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([C@H](c2ccccc2)N2CCN(C(=O)c3ccccc3F)CC2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127041",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc2oc(=O)cc(C[NH+]3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c2c1 by substituting a nitro with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCn1cnc2ccccc2c1=O)N[C@H]1CCc2c(O)cccc21 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109117",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCC[C@@H](C[NH2+]C2(CO)CCOCC2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146060",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)N(c1ccc(F)cc1)c1nc(CNC2(C)Cc3ccccc3C2)cs1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130059",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCS(=O)(=O)/N=C(\\[O-])c1cc(F)cc(Br)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162212",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccc(O)c([N-]S(=O)(=O)c2c(C)cccc2[N+](=O)[O-])c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241385",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCOC(=O)C1=C(C)Nc2nnnn2[C@@H]1c1ccc(Br)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222904",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@H](NC(=O)c1ccc(=O)n(C)n1)c1ccc(Br)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19358",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)[C@@H]1C[C@@H](NC(=O)c2cc(C)nc3ccccc23)CN1Cc1cccc(C(F)(F)F)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(CN2CC[NH+](C[C@@H]3CCOC3)CC2)sc1Br by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231754",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cccc(C[NH2+]C[C@H]2CCN(CC(F)(F)F)C2)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39700",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule N/C(CN(C[C@H]1Cc2ccccc2S1)C1CCCC1)=N\\O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154541",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=S(=O)(Cc1csc(COc2ccccc2)n1)Cc1ccc(Cl)s1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155450",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC(C)[C@@H](Sc1nc(N)c(C#N)cc1C#N)C(=O)NC(C)(C)C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54757",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nn(-c2ccccc2)c(Cl)c1C(=O)Nc1cccc(Cl)n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169039",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)C[C@@H](C)CNC(=O)NCc1ccc(-n2ccnc2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4478",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(C(=O)[C@H](O)c1ccccc1)[C@H]1CCS(=O)(=O)C1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94225",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN1CCO[C@H]([C@H](O)c2cc(C)c[nH+]c2N)C1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229122",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@]1(CN[C@@H]2CCS(=O)(=O)c3ccc(F)cc32)CCCO1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105465",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CO[C@]1(C)C[C@H]([NH2+]Cc2ccc(Cl)o2)C1(C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88015",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(F)ccc1NC(=O)c1cc(F)ccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184229",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC1CC[NH+]([C@H](CNC(=O)NC[C@H]2CCC[C@@H]2O)c2cccs2)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68721",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H]1C[C@H](NC(=O)Cc2ccccc2O)CC[NH+]1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COCC(=O)NC1CC[NH+](Cc2ccc(Cl)c(Cl)c2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120004",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc([C@H](Cl)C(=O)N(C)C)ccc1Br with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162110",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule NC(=O)CC[C@H](C(=O)[O-])N1C(=O)/C(=C/c2ccc(O)c(O)c2)SC1=S with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a thiol in the molecule CCC(CC)(CS)C[NH+]1CCCCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139929",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@]1(C)CCCN1C(=O)CCn1cnc2ccc(Br)cc2c1=O by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165836",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1ccc(S(=O)(=O)Nc2cc(C)c(O)c(S(=O)(=O)c3ccc(OC)cc3)c2C)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238631",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(C)c1ccc(CNC(=O)c2cc(F)cc3[nH]cnc23)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42146",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c(C#N)c(OCC(=O)c2ccccc2)n1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214241",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)C1CCN(C(=O)CC2(O)CCCCC2)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13167",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1cccnc1N1CCC(CNC(=O)c2cccnc2)CC1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21768",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1ccc(Cl)c(CC)c1NC(=O)NCc1nnc2n1CCCCC2 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202974",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC(C)(C)O)S(=O)(=O)C[C@H](C)CCl by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239493",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cccnc1N1CCC[C@@H](c2[nH]cc[nH+]2)C1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119590",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C([C@H]1COc2ccc(F)cc2C1)N1CCN(c2cc[nH+]cc2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116923",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C1CC[C@@]2(CCCN(c3cc(NCCO)ncn3)C2)CN1CC1CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144251",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(O[C@H](C)[C@@H](C)O)c(C[NH2+]CC(C)C)n1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98383",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CN1CCN(c2ccccc2F)CC1)Nc1ccc([N+](=O)[O-])cc1Br by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45819",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CN(C)c1cccc(C(=O)NC[C@@](C)(O)CSc2ccccc2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28548",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ocnc1C[S@](=O)Cc1cc(=O)n2cc(Cl)ccc2n1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97686",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1sc(NC(=S)NC(=O)c2cccc(Cl)c2)c(C(N)=O)c1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CC)C1(C(=O)Cc2ccc(Br)s2)CCCC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84707",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOc1ccc(N[C@H]2SC(=O)N(CCCl)C2=O)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21895",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@@H](CC#N)N(C)C(=O)c1nc(Cl)ccc1Cl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62815",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)[C@]1([NH2+]C2CC2)CCC[C@@H](OCC(F)(F)F)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1cccc(-c2nnnn2C2CC2)c1)c1cncc(Br)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199067",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C([O-])COc1c(Cl)cc(/C=C2/C(=O)NC(=O)N=C2[O-])cc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76940",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCc2c(sc3nc(S[C@H](C)C(=O)NCC(F)(F)F)n(C[C@@H]4CCCO4)c(=O)c23)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93103",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CC[C@H](Oc1c(-c2ccco2)oc2ccccc2c1=O)C(=O)Nc1oc(C)c(C)c1C#N with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166483",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COc1ccc(NC(C)=O)cc1NC(=O)N(C)Cc1cccc(C#N)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48834",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1-c1cnccn1 by substituting a nitro with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60439",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1ccc(C(=O)Nc2nc3ccc(Cl)cc3s2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13139",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](Cc1ccsc1)N(C)C(=O)C(=O)NCc1ccc(F)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43923",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Oc1ccc(-c2cccc(F)c2F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(NC1CCCCC1)[C@@H]1C[C@H](O)CN1C(=O)Nc1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82974",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccccc1)N(C)C(=O)Nc1cc2c(cc1Cl)OCCCO2 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210750",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C=CCN(CC(F)(F)F)C(=O)c1cncc(Br)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61803",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cc(/N=C/c2ccc(N3CCCC3)c(F)c2)ccc1O by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N=C(c2ccc([N+](=O)[O-])o2)N=C2S[C@@H]3CCCCC3=C12 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131199",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N[C@H]1C[C@H]1C with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190396",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Cn1cnc2cc(F)c(F)cc21)N(C1CCCC1)[C@@H]1CCS(=O)(=O)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63516",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NNC(=O)c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58774",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)c1ccc(N2CCN(CC(=O)NC(=O)NC(C)C)CC2)c(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97988",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[NH+](Cc1csc(Br)c1)C[C@H]1CCC(C)(C)[C@H]1O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94406",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CC(=O)N(C)C)[NH2+][C@@H](c1ccc(F)cc1)C1CC1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36916",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=[N+]([O-])c1cc([C@@H](O)c2ccccc2)ccc1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122094",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCN(c2ccc(C(N)=[NH2+])c(Cl)c2)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101665",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@]1(CNC(=O)c2cc(Br)cnc2NN)CCCO1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229754",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@]1(Cl)C(=O)C[C@H](c2ccccc2)[C@H]1c1ccccc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34996",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1cccc(F)c1)N1CCC[C@H]1c1cccc2c1OCCO2 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179754",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NNc1ccccc1Cl)N[C@@H]1CCC[C@@H](C(F)(F)F)C1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@H]1CCCN(c2nc3c(c(=O)[nH]2)[C@@H](c2cccc(OC)c2)[C@@H](C#N)C(=O)N3)C1 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77042",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule COCCN(C(=O)C(=O)NC[C@H](C)C#N)c1nc2ccccc2s1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107519",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cccc(N2CCN(C(=O)CSc3nnc(-c4ccccc4F)n3C3CC3)CC2)c1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248223",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc(C(=O)N2CCN(c3c(N)cccc3Cl)CC2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49173",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C([C@H](Cc1ccccc1)NS(=O)(=O)c1c(Cl)cccc1Cl)N1CCOCC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227673",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(-n2nnnc2SCC(=O)Nc2ccc(F)cc2)c(OC)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)[C@@H](C)Sc1nnc(-c2ccccc2Cl)n1C)c1ccccc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84905",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule OCC#Cc1cc(F)cc(COC[C@@H]2CCOC2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113324",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]([NH2+][C@H](C)c1nccs1)c1ccc(OCC2CC2)c(F)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57989",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1c2ccccc2nnn1C[C@H](O)COC(c1ccc(F)cc1)c1ccc(F)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97715",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(Br)cc1CNC(=O)c1cccc2cc[nH]c12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213877",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(=O)N[C@H](C)C(=O)N[C@@H](C)CCCO by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241499",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule N#CC(C#N)=Cc1cccc(NC(=O)c2ccccc2Cl)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190627",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1nn(C)c(C[C@@H](O)[C@H]2C[NH+]3CCN2CC3)c1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128416",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOC(=O)[C@@]1(NC)CC[C@H](n2nc(C)c(Cl)c2C)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197756",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCOc1ccc([C@H]2C(C#N)=C(N)OC(C)=C2C(=O)OCc2ccccc2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182070",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)c1cc(NC(=O)NCCOc2cccc(C)c2)ccc1Cl by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5617",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc([C@](C)(O)[C@H]2CCOC3(CCC3)C2)cc1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12965",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1ccncc1)N1CCN(c2cncc(Br)c2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231344",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)NCCc1nc(COc2ccc(Cl)cc2Cl)no1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc2cc(Cl)ccc2o1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225771",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COCCc1nsc(N2CCC(Nc3ccc(F)cc3)CC2)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44190",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(NC(=O)CNC(=O)Cc2ccccc2)c(Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109753",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](Cc1[nH+]ccn1C)c1ccc(F)c(Cl)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110952",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1cccc(N[C@H](C)c2ccc(Cl)s2)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235395",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cncc(Sc2ccc(Cl)cn2)n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95984",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(OC)c(NCc2cnn(-c3ccccc3)c2)cc1F by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135122",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCOC[C@]1(O)C[C@H](C)CC(C)(C)C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176075",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)C[NH+](C)Cc2cccs2)cc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211124",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCO)S(=O)(=O)c1ccc(Br)cc1N by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88974",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C(C#N)C(=O)N(C(C)C)C(=O)/C1=C\\Nc1cccc(Br)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121289",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC1CCN(C(=O)CCNS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110591",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COCc1nn2c(-c3ccccn3)ccnc2c1-c1ccc(Br)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88757",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC[C@H](C)OC(=O)c1cc(N2CCCC2=O)ccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152249",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CNC(=O)/C(=C\\c1ccc(Cl)cc1)NC(=O)c1ccc(C)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222327",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)[C@@H](Nc1ccc(C)cc1)[C@@]1(O)OC(c2ccc(Br)cc2)=CC1=O by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185376",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H]1C[C@H]1c1ccc(CCC(=O)N2CCC[C@H](O)C2)o1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64540",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)c1ccc(Cl)s1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207798",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C[C@@H]2CCC[NH+](Cc3c(Cl)nc4sccn34)C2)no1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48640",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule COc1cccc([C@@H]2CCCN2C(=O)NC[C@@H](CCO)c2ccccc2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6859",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)N[C@H](SC)C(Cl)(Cl)Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108870",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C([O-])Cn1c(O)c(/N=N/C(=O)c2ccc(Cl)cc2Cl)c2ccccc21 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134985",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(=O)OCC(=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]12C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86748",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccc(NC(=O)CSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule COc1cc(C#N)ccc1OCc1cc(Cl)ccn1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78822",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@H]1COCCN1C(=O)c1csc(C#CCO)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139814",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCn1nnc(NCc2ccc(-c3ccccc3Cl)o2)n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57055",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(OC)cc(C(=O)N2CCC[C@@H]2[C@@H](C#N)c2ccccc2)c1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124040",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1ccc(NCC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210128",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(F)c(CN2CCC(=O)NC[C@H]2C)c1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52317",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CS(=O)(=O)c1ccc2nc(NC(=O)c3ccc(-c4ccccc4F)o3)sc2c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49386",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccc(C(=O)N[C@H](C)c2c(C)noc2C)cc1OCCO with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69600",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=[N+]([O-])c1c(NCc2cccnc2)ncnc1Sc1ccccc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224342",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@H](NC(=O)c1cccc(CC#N)c1)C(C)(C)C[NH+](C)C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152550",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(CN2CCN(C(=O)[C@@H](NS(=O)(=O)c3ccc(Cl)cc3)C(C)C)CC2)on1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85791",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(C[NH+](CCO)Cc2cccnc2)c(Br)cc1O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60203",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(CC1CCS(=O)(=O)CC1)N1CCC2(CC1)OCCC[C@@H]2O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141714",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1cccc(-n2c(N)c(C#N)c3c(c2=S)CO[C@H](C(C)C)C3)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9612",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=Cc1ccc(Br)nc1 by substituting a aldehyde with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "229480",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)Nc1ccc(C(=O)N2C[C@H](c3ccc(F)cc3)[C@@H]3[C@H]2CCC[NH+]3C)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196425",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1ccc(Cl)cc1)N1CCC[C@H](OCc2ccc(F)c(F)c2)C1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80121",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncc2c(n1)C[NH+](Cc1cc(Cl)c3c(c1)OCCO3)CC2 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(CC)N(CC[NH3+])c1ncc(Cl)cc1F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22674",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(C[NH+]2CCC[C@@H]2c2nncn2C)ccc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151613",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(Cc1[nH+]ccn1C)S(=O)(=O)c1ccccc1OC(F)(F)F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5761",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@H](NC(N)=O)C(=O)NCCc1ccc(Cl)cc1Cl by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41368",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(C(F)(F)F)cc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106736",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN(CC#N)Cn1ccc(=S)c2ccccc21 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35714",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=Cc1cc(Cl)c2ccccc2c1OCc1nnsc1Cl by substituting a aldehyde with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123153",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCc1nnnn1-c1ccc(F)cc1)[C@H]1CC(=O)N(c2ccccc2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "127209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1nc(Nc2ccc(OC)c(F)c2)ccc1N by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc([C@@H]2[C@H]3CCCC[C@@]3(O)CCN2C(=O)c2cccc(F)c2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170903",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCN/C([S-])=C(/C(=O)c1ccc(Cl)cc1)[n+]1ccccc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)NC(=O)C[C@@H](C#N)NCC(F)(F)F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83733",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc([C@H](C)NC(=O)c2cc(C(C)C)n(C)n2)cc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247067",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c(C(=O)NNC(=O)COc2ccc3cc(Br)ccc3c2)oc2ccccc12 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162038",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c(C(=O)C(F)(F)F)c2ccccc2n1CC(=O)Nc1ccc(Cl)c(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19921",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(OC[C@@H](O)CN2CCN(Cc3[nH+]ccn3C)CC2)c1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187296",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](CS)Cn1cnc2c(cnn2C)c1=O by replacing a thiol by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179178",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1cnn(-c2nc(C3CC3)ns2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220517",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)C(=O)N[C@@H]1CCCN(C(=O)N[C@H]2CCC[C@@H]2c2ccc(F)cc2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64209",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H]2C[C@H](C(F)(F)F)n3nc(C(=O)N4CCCCCC4)cc3N2)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120354",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN[C@@H](c1cc(Cl)ccc1Cl)[C@@H]1CN2CC[NH+]1CC2 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110709",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ncccc1CNC(=O)N[C@@H](C)c1cnn(-c2ccc(F)cc2)c1C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171675",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1OC)[C@H](C)[NH+](CC(=O)Nc1ccc(F)c(F)c1F)CC2 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156768",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(S(=O)(=O)NC2CCCCC2)cc1F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(CS(=O)(=O)c1ccc(O)cc1)N1CCCc2ccccc21 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19120",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cn1nccc1CN1CCO[C@@H](c2cccc(C(F)(F)F)c2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(C)Nc1ncnc(Nc2ccc(F)c(F)c2)c1N by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99208",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOc1ccc(C(=O)N(Cc2ccc(Br)o2)[C@@H]2CCS(=O)(=O)C2)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6763",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[NH+](CC)[C@H](C)CNC(=O)N[C@@H](C)c1ccc(Cl)s1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62930",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1cccc(C[NH+]2CCC[C@@H]2c2cc(C)on2)c1O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180690",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1nc2c(cc1C#N)CCCC2)C(=O)N(C)Cc1ccccc1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71342",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(CNC(=O)Nc2cc(F)ccc2N2CCCCC2)n[nH]c1=S by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111795",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc2cc(C(=O)N3CC(OCc4ccccc4Cl)C3)[nH]c2c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92278",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-n2nnc(C(=O)OCc3cccc(Cl)c3)c2C)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126793",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(SCC(=O)Nc2cc(Cl)cc(Cl)c2)nnc1-c1ccc(F)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214717",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(Cn2nc(C)c(C[NH2+]C(C)C)c2Cl)cc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120523",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COC(O)(OC)c1ccc(C=O)cc1C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165106",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CN(CCC#N)C(=O)CC[NH+]1CCC[C@@H](c2cn[nH]c2)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80271",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule N#C/C(=C/c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1)c1nnc(NC(=O)c2ccccc2)s1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H](O)c1ccn(Cc2cnn(CC)c2)c1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156501",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCn1cc[nH+]c1CNC(=O)[C@@H]1CCC(=O)N(Cc2cccc(C(F)(F)F)c2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187821",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Cc1ccccc1F)NNC(=O)N[C@H]1CCCC[C@@H]1OC1CCCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166491",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CC(=O)c1ccccc1)NCc1ccc(Cl)cc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6997",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3695",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCCN1CCOCC1)c1cccc(C(F)(F)F)c1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cc(Cl)ccc1C[NH2+][C@H](C)c1cnccn1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131343",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C1N[C@H](c2ccc(F)c(-c3cccs3)c2)N2CCOC[C@@H]12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196802",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cccnc1NC(=O)[C@@H]1C[C@H]1c1ccccc1OC(F)(F)F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247848",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](NC(=O)N(C)C[C@H]1CCCO1)c1ccccc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225511",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H]1COC[C@@H]1c1nc(-c2cc(F)cc(Br)c2)no1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212502",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CNS(=O)(=O)c1cccc([C@H](C)NCc2cc(C#N)ccc2F)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230177",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(S(=O)(=O)N(CC(=O)N2CCN(C=O)CC2)c2ccccc2F)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40021",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSCCN(C#N)c1ccc(F)c(Cl)c1 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187477",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COCCN(Cc1cc2ccc(C)c(C)c2nc1Cl)C(=O)C1CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226188",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)[N-]c2cccc(Cl)c2)c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27088",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@@H](CCCO)NC(=O)Nc1cccc(C(=O)NC2CC2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(C)c1OCC(=O)N1CCC(O)CC1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185348",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule Cc1cc(Br)cc([N+](=O)[O-])c1OCCC(=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118811",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CSc1nn(CN2CCCc3cc(C)cc(F)c32)c(=S)s1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(C(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173849",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC1(C)CNCc2ccc(C#N)cc21 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50342",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc(-c2noc(CN(C#N)c3ccc(F)c([N+](=O)[O-])c3)n2)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63662",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=CN1CCN(c2cccc([N+](=O)[O-])c2)CC1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139250",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[C@H](NC(=O)N1CCC(n2cncn2)CC1)c1ccc(Cl)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "214333",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)n1c(S[C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)nc2ccccc2c1=O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242394",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ncccc1C(=O)Nc1cccc(F)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193773",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cccc([C@H](CNC(=O)C(=O)Nc2cc(F)ccc2C)[NH+](C)C)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8559",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1noc(-c2ccccc2C(F)(F)F)n1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "109896",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(Br)cc1C(=O)NC(=S)Nc1cccnc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170716",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2oc(=O)cc(COc3cccc([N+](=O)[O-])c3C)c2cc1Cl by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35797",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1ccc2c(c1)CCC2)Nc1ccccc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196143",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(CNC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)Nc1cccc(O)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70008",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Nc1nc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCC[C@@H](NC(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)[C@@H]1C by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62839",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc2c(c1)C(=O)/C(=C/c1cccc(C(F)(F)F)c1)CO2 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24859",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC[NH2+]CC#CCOC(=O)[C@@](O)(c1ccccc1)C1CCCCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CC(=O)NCC(=O)c1ccc([N+](=O)[O-])cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207280",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(/C=C/c1ccccc1)NC(=S)Nc1ccc(Cl)c([N+](=O)[O-])c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "43629",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(NC(=O)NNc2ccc(Cl)nn2)c2ncccc2c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8930",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)Nc1cccc(-n2ccnn2)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120267",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCCc1nnc(S[C@H](C)C(=O)Nc2ccccc2Cl)n1N with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17176",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC1(C)[C@@H]2C[NH2+]C[C@@H]2CN1c1nc2ccc(Br)cn2n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201951",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCO[C@@H]1CCCN(C(=O)Nc2cnn(-c3ccccc3F)c2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130524",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCc1csc(Br)c1)Nc1ccncc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211313",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C([C@@H]1C[C@@H](O)C[NH2+]1)N1CCc2n[nH]c(-c3ccc(-c4ccccc4)cc3)c2C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113583",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc2c(c1)OCO2)c1c(Cl)ccc(Cl)c1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115299",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CCNC(=O)C1CC[NH+](C[C@H](O)c2cc(C)ccc2C)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91616",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]([NH2+]CC1(CO)CCOCC1)c1ccc(N2CCOCC2)cc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7024",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cccc(Cl)c1)NC[C@H](CCO)c1ccccc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73418",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCC(n2cccc2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114033",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(F)cc1OCC(F)(F)F)N1C[C@H]2CCCC[C@@H]2C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242224",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1C[NH+](CCCCC#N)CCN1C[C@@H](C)O by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169427",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCC(=O)N1CC[C@H](C2CC[NH+](Cc3cccc(F)c3F)CC2)C1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccccc1NC(=O)[C@@](C)(N)C(F)(F)F by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190508",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(=O)Nc1ccc2c(C(=O)[O-])c(C)c(O)nc2n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153188",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[NH+]1CCN(C(=O)c2cccc(O)c2)CC1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52138",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC(C)n1ccnc1SCC(=O)Nc1c(Br)cc([N+](=O)[O-])cc1Br with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247650",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@@H]1CCC[NH+]1[C@@H]1CCC[C@@](CO)([NH2+]C(C)C)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62362",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(NC[C@@H]1CC[NH+](Cc2cccc(O)c2)C1)c1cc2ccccc2[nH]1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6403",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(-c2nnc(-c3ccccc3)o2)nnn1-c1ccc(F)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134223",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Nc1ccc2c(c1)OCCO2)Nc1ccccc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20045",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cccc2cc([C@H]3NC(=O)c4c(sc5c4CCCC5)N3)c(Cl)nc12 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22469",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=NN(Cc2ccccc2Cl)C(=O)[C@]12Cc1c(C)nn(-c3ccccc3)c1N1CCCC[C@@H]12 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19830",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCNC(=S)NNC(=O)c1cc(F)cc(F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccc(F)c(Cl)c1)[C@H]1CC(O)=Nc2nnc(-c3ccco3)n21 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124563",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(-c2n[nH]c(=S)n2/N=C/c2ccccc2Br)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121089",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1nnc(COc2ccccc2Cl)o1)NN1C(=O)NC2(CCCCC2)C1=O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73483",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(c1ccc(F)cc1Cl)N1CCN(Cc2ccc(Cl)cc2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216936",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C/C(=C\\c1ccc(Br)cc1)C[NH2+]C(C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108278",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H](CNC(=O)N1CCC(CO)CC1)Oc1cccc(C(F)(F)F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22394",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(O[C@@H](C)C(=O)N2CC[C@@H](C(N)=O)C2)ccc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151802",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC1CCN(C(=O)N[C@@H]2c3cccc(F)c3CC[C@@H]2C)CC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242697",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccccc1C(=O)N1CCCCC1)c1ccc(C(F)(F)F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51717",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COCCN(Cc1ccco1)C(=O)Nc1ccc(CC#N)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57790",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](C)CCN(Cc1ccc(C#N)cc1)S(=O)(=O)c1ccc(Cl)nc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86912",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule FC1(F)O[C@H]2C=CC=C[C@@H]2OC1(F)F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20738",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule N/C(=N/OCc1c(Cl)cccc1Cl)c1cccs1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223171",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc([C@@H]2C[NH2+]CC[C@@H]2c2c(F)cccc2F)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134733",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1[C@@H](C(=O)[O-])CC[NH+]1Cc1c(F)cccc1Cl by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142748",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccc(NC(=O)C2C(C)(C)C2(C)C)c(O)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCC(=O)N1CCN(c2ncnc3c2nnn3-c2cccc(F)c2)CC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194239",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](C1CCN(C(=O)[C@@H]3C[C@H]3C)CC1)N2 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13888",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1ccc(C[NH+]2CCC(OCCCO)CC2)o1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160079",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc([C@@H](O)c2ccccc2C2CC2)c1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240054",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cccc(-c2ccccc2O)c1C(=O)[O-] with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70532",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1665",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(-c2nnc(S[C@@H](C)C(=O)Nc3nc(-c4ccc(F)c(F)c4)cs3)n2C)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168284",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cccc(N2C(=O)N=C([O-])/C(=C\\c3ccc(OC)c(O)c3)C2=O)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218614",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule COc1ccccc1OCc1ccc([N+](=O)[O-])c(N)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188226",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COc1cc(C(=O)N2CCc3c(sc(N)c3C#N)C2)cc(OC)c1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66105",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)c2ccc(NC(=O)c3ccnc(F)c3)cc2)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87376",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[NH+](C)CCCOc1ccc(NC(=O)c2cc(C#N)cs2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92948",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H]1C[C@](O)(Cc2ccccc2)CS1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(C(=O)c2cc(C(=O)N3CC[NH+](C)CC3)cc([N+](=O)[O-])c2)CC1 by replacing a nitro by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65780",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1C(=O)OCC(=O)NCC(F)(F)F by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112316",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH+](C)[C@H]1CCC[C@@H](NC(=O)c2c(O)cc(Cl)cc2Cl)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114453",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCCNC(=O)c1cccc([N-]S(=O)(=O)c2cccc(C(F)(F)F)c2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49364",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a aldehyde in the molecule Cc1cc(C=O)c(C)n1-c1ccc(OCc2ccccc2)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106975",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C1C2=C3CCC[C@@H]3SC2=NC(=S)N1c1ccc(Cl)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144385",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCc1cc(Cl)no1)N1CCC[C@@](O)(CO)C1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104789",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1cc(Oc2cc(N(C)C)ccc2[N+](=O)[O-])n2ncnc2n1 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121634",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1ccccc1F)N1CCCCCC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58986",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nc(-c2cccc(C[NH2+]Cc3ccc(OC(F)(F)F)cc3)c2)n[nH]1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99260",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[NH+](CCc1ccccc1)Cc1ccccc1-c1nc([O-])cc(C(F)(F)F)n1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2830",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@H](O)Cc1ccccc1)Nc1cnn(-c2ncccn2)c1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55970",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule N#Cc1cccc(NC(=O)NCc2nc(-c3ccc(F)cc3)n[nH]2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56698",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C/C=C/COC(=O)C[C@@H](NC(C)=O)c1ccc(Br)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138098",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC1CC[NH+](CCNC(=O)Nc2cccc(Br)c2C)CC1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a aldehyde in the molecule CC(C)NC(=O)c1ccc(NC(=O)[C@H](C)Oc2cccc(C=O)c2)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54857",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=C(N/N=C/c1ccc(N2CCOCC2)o1)c1cccc([N+](=O)[O-])c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82810",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](CCO)CNc1nnnn1C by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199282",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CC(=O)N1CCc2c(C)c(Br)c(C)c([N+](=O)[O-])c21 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76823",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)Nc1nccn(C)c1=O by substituting a nitro with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248642",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CS[C@H](CO)[C@@H](C)NC(=O)NCc1cc(=O)[nH]c2ccccc12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53161",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(C[C@H]2CCC[NH+](Cc3cc(C(F)(F)F)ccc3F)C2)no1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34012",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H]1CCC[NH+](CCNC(=O)C(=O)Nc2ccc(F)c(Cl)c2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139289",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(NC(=O)N[C@@H]2CCCN(c3ccccc3F)C2=O)on1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119217",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1nccnc1N(CC(=O)[O-])CC(F)(F)F by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238895",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCC(F)(F)F)N1CCC[C@H](c2[nH+]ccn2Cc2ccccn2)C1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4780",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cccc(OCCCC(=O)Nc2cccc(F)c2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50697",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)c1cc(Br)ccc1OS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201651",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1C(=O)N(CC[NH2+]C2CC2)c2c(F)cccc21 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235844",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](C#N)OC(=O)c1ccc([N-]S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CCO)N(Cc1ccccc1)c1ncccc1C#N by substituting a nitrile with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53975",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CCCS(=O)(=O)c1ccc(F)cc1)Nc1cccc(Cl)c1Cl by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72328",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(OCC(=O)OCC(=O)Nc2ccc3c(c2)CCC3)ccc1Cl by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225136",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nc(-c2ccc(C)c(S(=O)(=O)N3CCC[C@H](C(=O)Nc4ccc(F)cc4)C3)c2)no1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14402",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/[NH+]=C(/NCc1cc(C)on1)NCc1cc(Br)cs1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22356",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1NC2(CCCC2)C(=O)N1Cc1noc(-c2ccc(Cl)cc2)n1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196359",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CCc1ccc(N[C@@H]2CCN(C3CC3)C2=O)cc1[N+](=O)[O-] with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123965",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@H]([NH2+]Cc1cc(F)ccc1F)c1ccc(OC)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244425",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(S(=O)(=O)NCCc2csc(-c3cccc(C)c3)n2)cc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245563",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule C[C@H]1C[C@@H](C)C[NH+](Cc2c(O)ccc3c2O/C(=C/c2cccc([N+](=O)[O-])c2)C3=O)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197636",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC[C@H](O)Cn1nc(-c2ccncc2)nc1CCN1Cc2ccccc2C1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61799",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cc(C)c(O)c(C(=O)Nc2ccnn2C(C)C)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157471",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(C[C@H](O)c1ccccc1)Nc1nc(C[NH+]2CCCCC2)cs1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77209",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC(=O)c1cccc(SCc2ccc([N+](=O)[O-])c(F)c2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6598",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+]C[C@H]1CN2CCCC[C@@H]2CO1)c1c[nH]c2cc(Cl)ccc12 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73541",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1CC(C(=O)NC2(c3ccccc3F)CC2)C[C@@H](C)O1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188436",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccc(/C=C/C(=O)Nc2ccc(C)cc2Cl)cc1OCC with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84400",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(N2CCC[C@H](O)C2)[nH+]c1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148219",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCCCN1CCOCC1)C1CCN(C2=NC(Cl)=NC3=NC=N[C@@H]32)CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4770",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H]1C[C@@H](C)CN(c2nc3c(c(=O)[nH]2)[C@@H](c2ccccc2)[C@@H](C#N)C(=O)N3)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193950",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=O)[C@@H](C)[n+]1cccc([O-])c1)c1ccc(Cl)cc1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44277",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc([C@@H](NC(=O)c2ccc(=O)n(C)n2)c2ccccc2F)no1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33314",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1NC(=O)c1ccc(NC(=O)Cc2ccccc2)cc1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34497",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc(C(F)(F)F)nc(N2CCN[C@H](C(=O)NC3CC3)C2)c1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120982",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)COCCNC(=O)N[C@H]1CCCC[C@H]1CO by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141328",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCOc1ccc(C(=S)N2CC[NH+](CCO)CC2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167569",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1nc(CNc2ccc(OC(F)F)cn2)cs1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219844",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccn2cc(CCNC(=O)C[C@H](O)c3cccc(F)c3)[nH+]c12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126560",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Fc1ccc(C[NH+]2CCC(NC3CCSCC3)CC2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98969",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[NH+](CC)CC[C@@H](O)Cc1cccc(Cl)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9296",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc([C@@H]2Oc3nc(SC)nnc3-c3cc(Cl)ccc3N2C(C)=O)c(OC)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73340",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](c1ccccc1)[NH+](C)CC(=O)N(C)CC(=O)Nc1ccccc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173440",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(C(=O)N2CCN(C(=O)[C@H]3CCCO3)CC2)cnn1-c1ccc(F)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201291",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CC1(CNc2ccc([N+](=O)[O-])c(N)n2)CCCC1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134416",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(N2CCN(c3ncnc4c3cnn4-c3ccc(C)c(Cl)c3)CC2)cc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181856",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[S@](=O)CC(=O)N(CC(F)(F)F)C(C)C with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130760",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule Cc1cc(C(=O)NCc2ccc(N3CC[NH+](C)CC3)nc2)c(N)c([N+](=O)[O-])c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16648",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC(C)[C@@H](CO)NS(=O)(=O)c1ccc2c(c1)CCC2 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119153",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)[C@H]([NH3+])[C@@H](C)c1ccc(OC(F)(F)F)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51186",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)N(C)C1(C#N)CCCCC1 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205481",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ncnc(N)c1C[NH+]1CCC[C@H](CNC(=O)Nc2cccc(F)c2)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58268",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NC[C@@H]1CCCO1)N[C@H](c1ccccc1)c1ccc(F)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53372",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)[C@H](C)C[C@@](C)(O)c1ccccc1 by substituting a hydroxyl with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CC(C(=O)N(CC[NH+](C)C)Cc2ccc(C#N)cc2)C[C@H](C)O1 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119325",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)[C@H](C)[NH+]1CCC2(CC1)CC(=O)N(Cc1ccc(F)c(F)c1)C2 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121432",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC[C@H]([NH2+][C@@H](C)[C@H](O)Cc1ccccc1)C(C)C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49098",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CSc1n[nH]c(NN=C2CCCCC2)n1)Nc1ccc(F)c(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170612",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=[N+]([O-])c1cccc(C=C(Cl)Cl)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195817",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1csc(C[C@@H](CO)c2ccccc2Cl)n1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23884",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CCc1nc2n(n1)CCC[C@H]2[NH2+][C@@H](C)C(=O)Nc1cc([N+](=O)[O-])ccc1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71544",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)/C(=C/C=C\\c1ccccc1)NC(=O)c1ccc([N+](=O)[O-])cc1 by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9771",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule Cc1ccc(C)c(-n2nnnc2Sc2cccc(Cl)c2C#N)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193592",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2C[C@@H](N3CCOCC3)C[C@@H](c3ccccc3F)[NH+]12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22487",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@](O)(CCc1ccccc1)CNC(=O)C1(c2cccs2)CCCC1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68386",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])[C@H](c1ccc(O)cc1)[NH+]1CCN(Cc2cccc(Cl)c2)CC1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97725",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC(C)[C@@H](CNC(=O)N(C)Cc1ccc(C#N)cc1)N1CC[NH+](C)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97344",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CSC1=NC(=O)[C@H](/C=C/c2ccccc2)N=N1)Nc1ccc(Cl)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16876",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)c2cc(Cl)c[nH]2)n(Cc2ccccn2)n1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23835",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(C(=O)Nc2ccc(Br)cc2Cl)cc1S(=O)(=O)N1CCOCC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39745",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Brc1ccc(C[NH2+]CCn2cnnc2C2CC2)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171331",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(C)n1-c1nnc(N2CCC[C@@H](C(=O)Nc3ccc(Cl)cc3)C2)s1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CS(=O)(=O)N1CCCc2cc(C(=O)Nc3cc(F)cc(F)c3)ccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39289",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)OCCCNC(=O)N[C@H]1CCCc2ccc(F)cc21 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244253",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COC(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1)Nc1cccc(F)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26803",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)OCC(=O)Nc2c(C)nn(C)c2C)c(O)c1C by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "188626",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(F)c(NC(=O)[C@H](C)n2cc(Br)cn2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36313",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](C)c2ccc(OC)cc2F)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125470",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=c1sc2c(n1Cc1cnc(Cl)s1)CCCCC2 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233318",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C/C(=N/NC(=O)c1c(Br)c(C)nn1C)c1cccc(NC(=O)c2ccccc2F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30617",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)CSC1=N[C@@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Br)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136448",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc2cc(C[NH2+]C[C@@H]3COCCO3)c(OCc3ccccc3Cl)nc2c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150462",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=N/NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)c1cccc(C(F)(F)F)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27987",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(c1ccc(Cl)cn1)N(C[C@H]1CCCO1)[C@@H]1CCSC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135139",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CNC(=O)COC(=O)[C@H](C)Sc1ccccc1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89378",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCC1(O)CCSCC1)[C@H]1CC(=O)N(CC(F)(F)F)C1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21045",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H](CSC)N(C)C(=O)[C@@H]1Cc2cccc(F)c2O1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161941",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)c1ccc(-c2nn(CN(C)CC#N)c(=S)o2)cc1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102789",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccc(Cl)cn1)C1CCN(C(=O)c2ccc3[nH]cnc3c2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232660",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1c(O)ccc2c(CNc3ccc(NC(=O)C4CC4)cc3)cc(=O)oc12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "215093",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1cccc(OC[C@H](O)CNC(=O)c2n[nH]c(=O)c3ccccc23)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[S@@](=O)[C@H]1CCCC[C@@H]1NS(=O)(=O)c1ccc(F)c(Cl)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169442",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C/C(=N\\OC(=O)COc2ccc(Cl)cc2)[C@H](C)C[NH+]1C by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155023",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](N[C@H](C)C(=O)N[C@H](C)c1ccccc1)c1ccc(F)c(F)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(CSc1cccc(F)c1)c1cc(F)ccc1O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153387",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC(=O)Nc1nc2c(OC)cc(NC(=O)Nc3cc(Cl)c(OC)cc3OC)cc2s1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173736",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C=CCOc1ccccc1C(=O)N[C@H](C(=O)[O-])[C@@H](C)O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28129",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccccc1OC(F)F)C(=O)N1CC[C@@H]([NH+]2CCCC2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Oc1ccccc1[N+](=O)[O-])C(=O)Nc1ccc2ccccc2c1 by replacing a nitro by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129581",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C1C(=O)N(CCOCC(F)(F)F)c2cc(F)c(Cl)cc21 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97113",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N(C)[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc(Cl)n1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246014",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CN(C[C@H](O)CN2CCOCC2)CCO1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23758",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cnc(Oc2ccccc2)cn1)N1CCc2ccc(Cl)cc2C1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151982",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](NC(=O)N(C)[C@@H](C)C1CC1)c1ccc(Br)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34606",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(Cl)c(C)cc1NC(=O)C[C@H]1S/C(=N\\N=C(/C)c2ccc(F)cc2)NC1=O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182759",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCc1nn(C)cc1C(=O)N1CCc2sc(Br)cc2C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170376",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(N/N=C/c1ccc(C(F)(F)F)cc1)c1ccccc1O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196387",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H]1CCCN(C(=O)N2CCCC[C@@H]2CCO)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7783",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@H](NC(=O)C(=O)Nc1cccc(C(F)(F)F)c1)c1ccc(C)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59532",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CN(Cc1nc(C(F)(F)F)cs1)Cc1cccc(Br)c1O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9362",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCc1cc(NC(=O)C(=O)NC[C@@](C)(O)[C@H](C)CC)n(C)n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84519",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(Cc2cccc(F)c2)cc([C@H]2CCCN(C(=O)CN3CCOCC3)C2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198872",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN[C@@](C#N)(CN1CC[NH+]2CCC[C@@H]2C1)c1ccccc1 by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186424",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)C1CC[NH+](Cc2nnn(-c3cc(F)cc(F)c3)c2-c2ccncc2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156290",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1noc(C)c1C(=O)Nc1cc(F)ccc1N1CCCCC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237840",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCOc1cccc([C@@H]2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2C[C@@H]2CCCO2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102491",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a thiol in the molecule CC[C@@H]1CCC[NH+](CC2(CS)CCC2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100348",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)CNC(=O)N1CC[C@@](O)(c2ccccc2)[C@@H]2CCCC[C@H]21 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13796",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1cnc(C(=O)O[C@H](C(=O)Nc2ccc([N+](=O)[O-])cc2Br)c2ccccc2)cn1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196303",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CN(C(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)c1cccc(C#N)c1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222483",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1N[C@@](c2ccccn2)(C2CC[NH+](Cc3c(F)cccc3F)CC2)C(=O)N1C[C@H]1CCCO1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104616",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule OCC[C@H]1C[NH+](Cc2cccs2)CCN1Cc1ccccc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113712",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[NH+]1CCN([C@@H](C)C[NH2+][C@@H](C)c2nc3cc(Cl)ccc3n2C)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31059",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[NH2+][C@H](c1ccn(Cc2c(Cl)cccc2Cl)c1)C(C)C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126876",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(/C=C/c1cccc(F)c1)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234322",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@H](NC(=O)c1cccc(SCC#N)c1)C(=O)N1CCCC[C@@H]1C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18679",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=c1c(C[NH+]2CCSCC2)coc2c(Cl)cc(Cl)cc12 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126268",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1occc1C(=O)N/N=C/c1ccc(Cl)c([N+](=O)[O-])c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241952",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OC1(Cc2cc(-c3ccccc3)no2)CC[NH+](CCCC2CCCC2)CC1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126505",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N2CCN(c3nc4nccc(-c5ccc(Cl)c(Cl)c5)n4n3)CC2)cc1C by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205991",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc([C@@H]2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2[C@@H]2CCS(=O)(=O)C2)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175311",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC[C@@H]1CCCC[NH+]1C)C(=O)NCc1ccc(F)c(Cl)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158734",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1nc(CCNC(=O)N2CC[C@H](C)[C@H](O)C2)cs1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228158",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule [NH3+]C[C@@H](Cc1nccs1)c1cccc(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246316",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CN(C)C(=O)CS[C@@H](C)[C@@H](C)O)cc1F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172488",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)CN(C)C(=O)NC[C@@H](C1CCCCC1)[NH+](C)C by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "84003",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CN(C)c1ccc(CCCNC(=O)N[C@H]2CCC[C@@H]2CO)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13977",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C#Cc1cc(F)c(NC(=O)N2CCNC(=O)[C@@H]2c2ccccc2)c(F)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116356",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1[nH]cnc1C[NH+]1CCC(Oc2cccc(F)c2)(C(=O)[O-])CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228475",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOc1c(Cl)cc(Cl)cc1C(=O)NC1=NN(c2ccccc2)C(=O)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154674",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOc1ccc(-c2nnc([S-])n2-c2ccc(Cl)c(C(=O)[O-])c2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61116",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCC[NH2+][C@@H](Cc1ccc(C)cn1)c1c(F)cccc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216958",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)N(C)c1cccc(NC(=O)[C@H]2C[C@H]2c2cccc(Cl)c2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163438",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(NC[C@H](O)c1ccc([N+](=O)[O-])cc1)c1cccc(S(=O)(=O)N2CCOCC2)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150418",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COC(=O)c1[nH]c2cccc(Cl)c2c1NC(=O)C[NH+]1CCC[C@@H](C)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223469",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CCNC(=O)c2nn(-c3ccc(F)cc3)cc2OC)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126043",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cn1c(C(=O)N2CCCC[C@@H]2C[NH+](C)C)cc2cc(C(F)(F)F)ccc21 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228116",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](O)[C@@H]1CCC[NH+]([C@@H](C)C(=O)N2CCC(C(N)=O)CC2)C1 by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225712",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)(C)[C@@H]1OCC[C@@H]1CNC(=O)NC[C@@H]1CCC[C@H](O)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NC[C@@H]1CCCCN1S(=O)(=O)Cc1cccc(F)c1)Nc1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170369",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C/C(=C/c1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "674",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1csc(C(=O)N[C@H](c2cc(F)ccc2F)C2CC2)c1 by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154300",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Oc1nc(Oc2ccc(Br)cc2Cl)ccc1N by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119025",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1cccs1)C(=O)N[C@H](C)c1ccc(Cl)s1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8058",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@H](C)CN(CC)c1ccc(/C=C/C(=O)[O-])cc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166131",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(S(=O)(=O)N(C)c2ccccc2F)c([N+](=O)[O-])c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171431",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[NH+]1CCc2c(sc3c2C(O)=N[C@H](c2cccc(Cl)c2)N3)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)[NH+](C)Cc1ccc(F)c(F)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule [NH3+]CC1CCN(C(=O)Cc2ccc(F)c(F)c2)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "194809",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1cscc1C[NH2+][C@H]1CCCCC[C@@H]1C#N by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165594",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(OCc1nncn1C1CC1)C1(c2ccc(Cl)cc2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "139623",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNc1nc2ccccc2cc1CSC[C@@H](O)CO by substituting a hydroxyl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120204",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+][C@@H](C)C1CCC1)c1cc(F)c(F)c(F)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69309",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C=CCSC1=NC(=O)C[C@H](c2ccc(C(C)C)cc2)[C@@H]1C#N with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70133",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2ccc([C@@H](Nc3cccc[nH+]3)c3ccc(O)cc3)c([O-])c2n1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95045",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(NC(=O)NCCCN2CCOCC2)cc1F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95432",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CCC#N)CC(=O)NC[C@@H]1Cc2ccccc2O1 by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55357",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc([C@H]2C(C(=O)Nc3ccccc3)=C(C)Nc3ncnn32)cc(Cl)c1OC by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189007",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule Cc1ccc(NCCS(=O)(=O)N2C[C@@H](C)O[C@H](C)C2)c([N+](=O)[O-])c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164328",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(C)NC(=S)NC(=O)/C=C/c1ccccc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14793",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CN[C@](C)(C#N)C[C@@H](C)SC[C@@H](C)CO by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182282",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCC[C@H]1C(=O)NCC[NH+]1Cc1cc(Cl)ccc1O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106227",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)NCCO by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230139",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CN(S(=O)(=O)c2ccc(Br)s2)CCS1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216817",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1c2ccc(O)cc2OC(=O)[C@@H]1CC(=O)NCCC1=c2cc(F)ccc2=[NH+]C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "240147",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(CNc1ccc(Cl)cc1F)NC[C@@H]1COc2ccccc2O1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12033",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NC[C@H](c1ccccc1)[NH+]1CCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90762",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(CCCCO)Nc1ccccc1Oc1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11702",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOC(=O)C(=O)NNC(=O)Cn1ccc2ccc(Cl)cc21 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187688",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(Br)cc3)cc2)C[C@@H](C)O1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CCN(C[C@H](C)C#N)C(=O)Nc1ccc2c(c1)NC(=O)[C@@H](C)O2 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172416",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(CNc2c(-c3ccc(O)c(O)c3)nc3cnccn23)cc1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42096",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Fc1cccc(C[NH+]2CCCCC[C@H]2c2ccco2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112043",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](C)NC(=O)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)s1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138184",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc(Br)ccc1NC(=O)c1cccc(NC(C)C)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208058",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[NH2+]CCc1nc2cccc(Cl)c2[nH]1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160878",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule [NH3+][C@@H](CC12CC3CC(CC(C3)C1)C2)c1ccc(Br)s1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172926",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(CNC(=O)C(=O)Nc2ccc(C)nc2Cl)ccn1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62573",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule NC(=O)CCCCNC(=O)c1cc(Cl)ccc1O with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23025",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(C)(C)C)c1nc(Br)cn2ccnc12 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216229",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1c(CN2CC[NH+](C[C@H]3CCOC3)CC2)cc(C#N)n1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7594",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[C@H]1/C([O-])=C(\\C#N)C(=O)NCCc1ccccc1 by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134476",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@H](CSC)N(C)C(=O)c1c(C)nn(CC)c1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157327",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1cc(Cl)c(Cl)cc1S(=O)(=O)N1CCN(CCO)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45200",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule COc1ccc(Nc2cc(C)c([N+](=O)[O-])cn2)cc1OC with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118174",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)Oc1ccc(C[NH+]2CCN(c3ccccc3[C@H](O)c3ccccn3)CC2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55811",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)N1CC[C@H](C(=O)Nc2ccc(Br)c3ccccc23)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29103",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc([C@@H](C)C(=O)N2CCC(n3c(=O)oc4ccc(Cl)cc43)CC2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196324",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1CC[C@H](COC(=O)c2cccc(F)c2)N1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115628",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1O)c1ccc(-c2ccc(F)cc2)o1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23834",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)n2nc(C)c(C(=O)Nc3ccccc3F)c2n1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69170",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1cnnc1[C@H]1CCCN1C(=O)c1c(O)cc(Cl)cc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167421",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)CCC(=O)NCCNS(C)(=O)=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42673",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)n2cc(CN3CCN(c4cccc(Cl)c4)CC3)nc2n1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212618",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](Oc1ccccc1C#N)C(=O)NCC1CCCCC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7157",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](CCl)CSc1ccnc(N(C)C)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241106",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1nc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)sc1C by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCC[NH+](Cc1ncn(-c2ccccc2)n1)[C@@H]1CCCc2ccccc21 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130925",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NC(=O)C1CCN(C(=O)N[C@@H]2CCN(CC(F)(F)F)C2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47529",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(=O)Nc1ccc(S(=O)(=O)NCC2CC[NH+](Cc3ccccc3Cl)CC2)cc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108622",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C(=O)NCCc2nc3ccc(F)cc3[nH]2)ccc1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10754",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(C(=O)Nc2cc(F)c(F)cc2Cl)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166058",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+]1CCN(c2ccc(C(F)(F)F)cc2[N-]S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239244",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule C[C@H](CSC(C)(C)C)[NH2+][C@H]1CCCCC[C@@H]1CO with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242736",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C([C@H]1C[C@@H]1[N+](=O)[O-])N1CCC[C@@H]1c1cccc(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20259",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc([C@](C)([NH3+])c2ccc(C)c(F)c2)cn1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159250",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(=O)Nc1cc(NC(=O)C(=O)N(C)C[C@H](C)c2ccccc2)ccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80104",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CCc1nc(-c2ccc(F)cc2)no1)Oc1cccc(Cl)c1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72458",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(C(=O)N(C)Cc2cccc(F)c2)sc2nc3n(c(=O)c12)CCCCC3 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](C[NH3+])[C@@H](C)N(C)Cc1cccc(Br)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83071",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(NC(=O)c2cc(-c3ccc(F)cc3)oc2C)cc1C by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26123",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=[N+]([O-])c1cccc(-n2cc(-c3ccc(Br)cc3)cn2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(F)cc(C(=O)N2CC=C(c3c[nH]c4ccccc34)CC2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "191827",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCNC(=O)c1cnn2c1N[C@H](c1cccc(OC)c1)C[C@H]2C(F)(F)F by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102555",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Cc1ccsc1CNC(=O)C[NH+]1CCC[C@H](O)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCc1ccc(N2CCCCCC2)[nH+]c1)c1ccccc1Cl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189627",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=C(\\C#N)S(=O)(=O)c2ccc(C)cc2)cc1O by substituting a nitrile with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35255",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+]C[C@H](Cc1csc(C)n1)c1cccc(Cl)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86935",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@H]1CC[C@H](O)[C@H](Cc2cccc(O)c2)C1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117595",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)C[NH2+]Cc1c[nH]nc1-c1ccc(F)c(Br)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32952",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(CC(=O)N[C@H](CO)c2ccccc2F)cn1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209678",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H]1CC[C@@H](C(=O)[O-])O1)c1cc(Cl)ccc1Cl by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179253",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)[C@@H]1SCC(O)=Nc2c1cnn2Cc1ccccc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132793",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1242",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)NC(=O)[C@H]1CCCN(C(=O)c2cnn(-c3ccc(F)cc3)c2-n2cccc2)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162148",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(Cl)cc1NC(=O)C(=O)NC[C@H](c1ccc2c(c1)CCN2C)[NH+]1CCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112116",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc([C@H](C)[NH2+]Cc2ccc(C(=O)N3CCCCC3)cc2)cc1F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150845",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH2+]C1CCC(N(C)C/C(Cl)=C/Cl)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173227",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](Cc1nnc(SCc2cc3c(cc2Br)OCCO3)o1)c1ccccc1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41949",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]CC1CCC(C(=O)Nc2ccc(C(=O)[O-])cc2Br)CC1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29433",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(/C=c2/sc3nnc(-c4ccccc4Cl)n3c2=O)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57186",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(CCC1CCCC1)NC[C@]1(O)CCOc2ccccc21 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120635",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nc2cccnc2n1CCN1CCN(C(=O)Nc2cccc(F)c2)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103262",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)CC1=NN(C(=O)c2cccnc2)[C@@](O)(C(F)(F)F)C1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126237",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)OCCCNC(=O)NNC(=O)c1ccc(Cl)cc1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247233",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](c1ccc(F)cc1)N(C)C(=O)C[NH+](C)Cc1ccc(F)c(F)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21303",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN(C(=O)C[NH2+][C@@](C)(C(=O)[O-])C(F)(F)F)C1CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133557",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN(Cc1c(Cl)cccc1Cl)C(=O)[C@@H]([NH3+])C(C)C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230530",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cn1cc(/C=C/C(=O)Oc2cccc(F)c2)c(=O)n(C)c1=O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1ccccc1NC(=O)COc1ccc2ccccc2c1C=O by substituting a aldehyde with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141933",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCNC(=O)C1CCN(C(=O)Nc2ccc(NC(=O)Nc3ccccc3F)cc2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146720",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cn1c(CCNC(=O)COc2ccc(Cl)cc2)nc2ccccc21 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189386",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc2nc(C)cc(C(=O)N3CC[C@@H]3c3ccc(F)cc3)c2c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "202460",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1CC[NH+](CCCS(=O)(=O)c2ccc(F)cc2)CC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "42229",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC1=C(C(=O)OCCc2ccccc2)[C@H](c2ccc(Br)cc2)NC(=O)N1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49095",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule N#C[C@@H]1COCCN1Cc1cc(O)ccc1[N+](=O)[O-] by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222716",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCC1=NN=C2OC(N)=C(C#N)[C@@H](C3=C(C)NN(c4ccccc4)[C@@H]3Cl)[C@H]12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45837",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[NH+](CCCNC(=O)[C@@H](O)c1ccccc1)C1CCCCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27024",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](NC(=O)c1cc[nH+]cc1[O-])c1ccc(Cl)s1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68989",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CCCC[C@@H]1[NH2+]CCn1ccc2c(Cl)cccc21 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168019",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a aldehyde in the molecule COc1ccc(N2CCN(S(=O)(=O)c3ccccc3C=O)CC2)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45458",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(S(=O)(=O)N2C(=O)CC[C@@H]2c2nc(-c3ccc(Br)cc3)no2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16471",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CC[C@@H](c2nc(=O)c(-c3ccccc3F)c([O-])[nH]2)C1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96374",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)NC(=O)CCCC(=O)Nc1ccc(Br)cc1C(C)C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182126",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1ccc(OCC(=O)NC2CCCCC2)c(Br)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)/C=C/c1ccc(NC(=O)N2CCO[C@@H](c3ccccc3F)C2)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35578",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(C#CC(C)(C)[NH3+])c(F)cc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11041",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](c1nccs1)N(C)C(=O)c1coc(COc2ccccc2F)n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227423",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3203",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C[C@@H]1CN(C[C@](C)(O)c2ccccc2)CCO1)c1cccn[nH+]1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "9105",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C([O-])C1CCN(c2cc(C(F)(F)F)cc(Cl)n2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "18161",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1CCCN(C(=O)C2CC[NH+](Cc3cc(Br)ccc3O)CC2)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243317",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COC(=O)c1cc(C[NH+]2C[C@H](O)[C@H](O)C2)oc1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120471",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C#N)cc1[N-]S(=O)(=O)CCOC(C)C by replacing a nitrile by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234910",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(F)c(CNC(=O)c2ccnc(OCc3ccccc3)c2)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "17980",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1cccc([C@@H]2CC(c3cccc(OC)c3)=N[C@@H](c3ccc(Br)cc3)[NH2+]2)c1O by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115955",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1ccc(OC[C@H](O)C[NH+]2CCCC3(C2)OCCO3)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108767",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc2nc(SCC(=O)Nc3ccc(F)cc3)[nH]c2c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150746",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1OCC[C@H]1C(=O)Nc1cnn(-c2ccccc2Br)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103976",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCOC(=O)/C(C#N)=C\\c1cc(C)c(O)c(C)c1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10569",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCc1nn2c(N3CCC(O)CC3)c3c(nc2c1-c1cccs1)CCC3 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14534",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Fc1ccccc1[C@H]1Oc2ccccc2C2=Nc3nnnn3[C@@H](c3cccnc3)[C@H]21 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178632",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=C1C(=O)O[C@@H]2[C@H]1[C@H](O)C[C@]1(C)[C@@H](O)CC[C@H](C=O)[C@@H]21 by substituting a aldehyde with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131704",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NNC(=O)c1ccc2ccccc2c1)c1ccc(Cl)nc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "192744",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C([O-])CCCc1ccc2c(c1Br)C=CC2 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193859",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+]C[C@H](Cc1ccc(Cl)c(Cl)c1)c1ccccc1F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218336",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C1CCO[P@@](=O)(N(CCCl)CCCl)N1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163631",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule NC(=O)C(=O)N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142418",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1c(-c2ccc(Cl)cc2)nnc1S(=O)(=O)CC(=O)NC1CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140233",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Cc1nc2ccc(C(=O)c3ccccc3)cc2[nH]c1=O)C(=O)Nc1ccc(Br)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196632",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccccc1[N+](=O)[O-])c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132072",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccccc1NC(=O)/C(C#N)=C\\c1ccc(F)c(C)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175288",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCN(C(=O)CCNC(=O)C2CCCCC2)C[C@H]1O by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235450",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CN(C(=O)COC(=O)COc2ccc(Cl)cc2)C[C@@H](C)O1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234550",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(C1=C([O-])C(=O)N(CCCN2CCOCC2)[C@H]1c1ccc(Cl)cc1)c1ccco1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227959",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)NC1CCN(C(=O)Nc2ccc(Cl)c(F)c2)CC1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137737",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCCCCNC(=O)[C@H](C)Nc1ccc(Br)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146120",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC1=C(C(=O)Nc2ccc(C)cc2)[C@H](c2ccccc2F)NC(=O)N1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166267",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1noc(C)c1[C@H](C)NC(=O)c1cc(N)c(F)cc1F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205576",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)[C@@H]1CCC[C@H](C(=O)C(F)(F)F)C1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23898",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCN(C)C(=O)N[C@H](C)c1ccc(Cl)s1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70522",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1953",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)NC(=O)C(=O)Nc1ccc(OC(F)(F)F)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104591",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NC(=O)C1(CNC(=O)c2cc3cc(F)ccc3[nH]2)CCOCC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124968",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc(OC)c2c1CN(C(=O)NCC1CCCCCCC1)C[C@@H]2O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234323",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(C)c(NC(=O)/C=C/c2c(C)nn(CC(C)C)c2Cl)cc1OC with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "130159",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCN[C@H](c1sccc1C)C(F)(F)C(F)F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81803",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@]([NH3+])(C[C@H]1CCCN(S(C)(=O)=O)C1)c1ccc(Cl)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111791",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@H](C(=O)[O-])N1C(=O)/C(=C/c2ccc(-c3ccc(C)cc3Br)o2)SC1=S by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128434",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](c1ccccc1F)N(C)C(=O)CN(C)C(=O)c1ccccc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89866",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(CNC(=S)Nc1ccccc1F)OC by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "164706",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1nc2sc([C@H](c3ccc(F)c(F)c3)[NH+]3CCC(C(N)=O)CC3)c(O)n2n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178489",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(Cl)cc1NCN1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2[C@@H]2C[C@H]12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175304",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C1C(=O)N(CN2CCC(O)(C(F)(F)F)CC2)c2ccccc21 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "29854",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]([NH2+]CCCNC(=O)c1ccc(F)cc1)c1ccc2ccccc2n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157716",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CS(=O)(=O)c1ccc(N[C@@H]2c3ccccc3C[C@H]2O)c([N+](=O)[O-])c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205716",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1cccc(NC(=O)/C(C#N)=C/c2ccc(N3CCOCC3)cc2)c1C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "233300",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#Cc1ccc(NC(=O)C(=O)NCCC2=CCCCC2)cc1C(F)(F)F by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246335",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)c1ccc(S(=O)(=O)NCC(=O)Nc2cccc(F)c2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158061",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)N[C@@H]2CC(=O)N(c3ccc(Cl)cc3)C2)cc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "147104",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCc1cc(C[C@@H](O)c2ccc(Cl)cn2)n(CC)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242884",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)n(-c2ccc(N(C)CCOc3ccccc3F)nn2)n1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153784",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1nnc2n1CCC2)c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181180",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](CNS(=O)(=O)c1c(F)cccc1F)Oc1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "185862",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2cnc(SCC(=O)Nc3ccc(F)c(F)c3)n2C)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "12371",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccccc1[C@@H]1CCN(S(=O)(=O)c2c(F)cccc2F)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178233",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc(NC(=O)CSc2nnc(-c3ccc4ccccc4c3)o2)ccc1Cl by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134354",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccccc1NC(=O)[C@@H]1CCCN1C(=O)OCC(F)(F)F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80769",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2nc(Cl)c([C@H]3NC(=O)c4ccccc4N3)cc2c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "46856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)NS(=O)(=O)c1ccc(OC(F)F)c(Cl)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54242",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCCc1cc(Br)ccc1F)NNC(=O)c1ccccc1O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1noc2nc(-c3ccco3)cc(C(=O)Nc3cccc(Br)c3)c12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96175",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Oc1cc(Cl)c2cn[nH]c2c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22156",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc2c(cc1OC)-c1c(c(C(=O)NCc3ccncc3)nn1-c1ccccc1F)C2 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44157",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccccc1SCC(=O)N[C@H]1CCc2c(O)cccc21 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224184",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1c(N)c(C(=O)COc2cccc(F)c2)c(=O)n(C)c1=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231836",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(-n2ncc3c(=O)[nH]cnc32)cc1)c1ccc(F)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186689",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1C[NH+]2CCCC[C@@H]2CN1C(=O)c1ccc(F)cc1N by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174044",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(NC(=O)C2CCN(C(=O)CCc3ccccc3Cl)CC2)cn1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238306",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc(-c2nc(CN3CCN(S(=O)(=O)c4ccc(Cl)cc4)CC3)cs2)cc1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242266",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1nnc2sc(-c3ccc(CNC(=O)Cc4ccc(Cl)cc4)cc3)nn12 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "35967",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC(C)(C)O)C(=O)c1ccc(F)cc1C#CCCO by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177576",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cn(-c2ccccc2Cl)nc1NC(=O)C(=O)N[C@@H](CO)c1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ncc(-c2ccccn2)c(-c2ccc(CNC(=O)c3ccccc3F)cc2)n1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14536",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1ccc(NC(=O)c2ccccc2)cc1NC(=O)N[C@@H]1C=C[C@H](CO)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "227155",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[C@@H](C[NH3+])Nc1ccc([N+](=O)[O-])cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36584",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](Cc1cccs1)NC(=O)N[C@@H]1CCC[C@H](C(F)(F)F)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57618",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](C(=O)Nc1ccccc1)N1CC[NH+](Cc2cccc(C(F)(F)F)c2)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95106",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]1C[C@@H]1c1ccc(/C=C/C(=O)N(C)CC(=O)Nc2cccc(F)c2)o1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152579",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc(Cl)cc1C(=O)NC[C@@](O)(c1ccco1)C1CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51674",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(NS(=O)(=O)c2ccc(/C=C/c3onc(C)c3[N+](=O)[O-])cc2)cc1Cl by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119048",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@H](C)C[NH2+]C[C@H](O)c1cnn(C)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "31571",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CCCc1n[nH]c2c1[C@@]1(C(=O)Nc3cccc(C)c31)C(C#N)=C(N)O2 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131035",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOC[C@H]1CCN(C(=O)COc2ccccc2Cl)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148836",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)N2CCCC[C@H]2C)c(F)c1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5041",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1nnc(C[NH+](C)[C@H]2CCN(c3sccc3C#N)C2=O)n1C by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166763",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(C)c1ccc(/C=C2/SC(=S)N(c3ccccc3F)C2=O)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190853",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@](O)(CO)CNc1ncc(Cl)cc1F by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220667",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCN(CC(C)(C)O)C(=O)[C@]1(CC)CCC[NH2+]C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96333",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule CC(=O)c1ccnc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186336",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(O)nc(SCC(=O)Nc2ccccc2-c2ccccc2)n1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180441",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](O)CNC(=O)/C=C1/CC(=O)N=C([O-])N1 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62245",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccccc1C(=O)NC[C@H]1Cc2cccc(F)c2O1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28319",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CCOc1cc(/C=N/NC(N)=S)c(Br)c(Br)c1O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6696",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C[NH+]2C[C@@H](C)[C@H]2c2ccccc2)cc(Cl)c1OCC(N)=O by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "21533",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)ccc1NC(=O)CN1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "168635",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule Oc1cccc([C@H]2CN(Cc3cc(F)c(F)cc3F)CCO2)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224303",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cccc(S(=O)(=O)[C@H](C)C(=O)Nc2cc(F)ccc2F)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49946",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC[C@@H](Oc1cccc(C)c1)C(=O)NNC(=O)Cc1ccc(Cl)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159968",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CC(C)[NH+]1C[C@H](C)[C@@H](N[C@@H](C)CO)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26737",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(Cc1ccccc1Cl)C(=O)C[C@H](NC(N)=O)c1ccccc1C by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138957",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C1C(=O)N(CN2CCOCC2)c2ccc([N+](=O)[O-])cc21 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237127",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[S@](=O)c1ccc(CNC(=O)[C@@H]2C[C@@H]2c2c(F)cccc2F)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28144",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCOc1ccc([C@@H]([NH2+]C)c2ccc(C)s2)c(Br)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167892",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[C@](O)(CCN1CCOCC1)c1ccc(OC)cc1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15789",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NC(=O)c1ccc(Cl)cc1)Nc1ccc(Cl)cn1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176876",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)c1ccc(C(=O)Nc2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104700",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1N1C[C@](O)(c2cccs2)[N+]2=C1CCCCC2 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160061",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)c1c(-c2ccco2)csc1NC(=O)Cn1ncc(Cl)c(Cl)c1=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36184",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=S1(=O)C[C@H]2N=C(Nc3cccc(C(F)(F)F)c3)S[C@H]2C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156375",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1NC(=O)N(c2ccc(Br)cc2)C(=O)/C1=C/c1ccc(Cl)s1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208712",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc2[nH+]c(CNCc3ccc(Cl)nc3)cn12 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226036",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN1CCO[C@H](C(=O)c2cc(Cl)cnc2N)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221222",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule NC1=NC(=O)[C@@](Cc2c(F)cccc2Cl)(c2ccccc2)N1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228074",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule O=C(CCc1ncc(-c2ccc(F)cc2)o1)N[C@H]1c2ccccc2C[C@H]1O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193007",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1C[C@@H](C)CN(C(=O)Cn2c(SCC(=O)Nc3cccc(F)c3)nc3ccccc32)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161640",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Cc1ccc(F)cc1F)OCc1nc2ccccc2[nH]1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197277",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)c1ccc2c(c1)[C@H]([NH2+]C[C@H](O)C[NH+](C)C)CCC2 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131917",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C([C@@H](O)c1ccccc1)N1CCC(OCc2ccc(F)cc2)CC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "246729",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[S@](=O)[C@H]1CCC[C@H](NC(=O)N[C@@H](C)CO)C1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110263",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@@](C)([C@@H](O)CCC1CC1)[NH+](C)C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "157280",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccc(F)c(C(F)(F)F)c1)c1ccc(=O)n(Cc2ccccc2)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48722",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC[C@@H]1CC[C@@H](C(=O)[O-])O1)c1cccc(O)c1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75598",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cn1cnc(S(=O)(=O)N2CCC[C@H](c3ncc[nH]3)C2)c1Cl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27633",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CS(=O)(=O)CCN(c1ncnc2ccc(F)cc12)C1CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213807",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Nc1cc(Cl)c(Cl)cc1-n1cccn1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228379",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(C[C@H](O)c1cc(Cl)cc(Cl)c1)NNc1cccc(Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "177808",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Cl)ccc1/C([O-])=N/S(=O)(=O)c1ccc(C#N)c(C(F)(F)F)c1 by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203137",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC(C)[C@@H](C#N)N1CCN(C(=O)[C@@H]2CCCN2C(=O)Cc2ccccc2)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119644",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#CCn1cc(/C=C2\\C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152705",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](C(=O)Nc1ccccc1F)S(=O)(=O)Cc1nccn1C(F)F by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH+](CCO)CCn1c(=O)oc2cccnc21 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247519",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCC[C@H](C)CS(=O)(=O)N[C@H]1CCN(c2c(F)cccc2F)C1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241524",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C)S(=O)(=O)Oc1ccc(Cl)c2cccnc12 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106051",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule Cc1nnc(N/C(=N/O)c2cccc([N+](=O)[O-])c2)s1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176555",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C(COc1ccc(Cl)cc1I)N/N=C/c1cccc([N+](=O)[O-])c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206522",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc(/C=C2\\Oc3c(ccc(O)c3CN3CCN(c4ccccc4)CC3)C2=O)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128584",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NC[C@H]1CCCO1)[C@@H]1CCN(c2ccc(Cl)cc2Cl)C1=O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151223",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(CCC(=O)Nc2ccc(OC(F)F)cc2)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "116567",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(Cc1ccc(Cl)c(Cl)c1)Cc1cc(=O)n2ccccc2[nH+]1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77239",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)n1cnnc1[S@@](=O)Cc1ccc(Cl)cc1Cl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "92199",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C=CCOc1ccc(/C=C2\\SC(=S)N(NC(=O)c3ccccc3Br)C2=O)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52172",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cccc2c1OC[C@H](NC(=O)c1ccc(OCC(F)F)nc1)C2 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66875",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cncc(C(=O)N(Cc2c(F)cccc2F)C2CCCC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107539",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CNc1cc(CN2C[C@@H](C)CC2=O)ccc1[N+](=O)[O-] by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47947",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1noc(NC(=O)C[C@H](C)c2ccc(F)cc2)n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2738",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "324",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H]1CCn1nc(C)c(Cl)c1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27968",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CS(=O)(=O)CCOCCNc1ncc(Cl)cc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58083",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(=O)N[C@@H](C(=O)N[C@H]1CCSc2c(F)cccc21)C1CCCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207283",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1=C2[C@H](c3ccccc3F)CC(=O)N[C@@H]2N(c2ccc([O-])nn2)N1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228793",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH+]1CCCC[C@H]1C(=O)N1CCN(c2cccc(Cl)n2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "103038",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Cc1cc(Cl)c2c(c1)OCCO2)NCCc1ccc(Br)s1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218947",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(C2=NO[C@@H](C(=O)Nc3ccc(C(F)(F)F)cc3)C2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242656",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]([NH3+])c1nc2ccc(Cl)cc2n1Cc1ccccc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13620",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cc([C@@H]2C3=C(Nc4c2c(=O)[nH]c(=O)n4C)c2ccccc2C3=O)ccc1O by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83185",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Cl)c1nc2ccccc2[nH]1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230089",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC[C@@](C)(C#N)[C@H](O)c1cccc(Cl)c1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53956",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC(C)C)c1c(C#N)c(=O)n(C)c(=O)n1C by replacing a nitrile by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105312",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1ccccc1CN1CCCC1=O)N[C@@H]1CCCC[C@H]1CO by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48874",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#C/C(=C\\[C@H]1C=NN=C1c1ccc(F)cc1)C(=O)Nc1ccc(Cl)cc1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93503",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@@H]1CCC[C@H](NC(=O)CSc2nc(N)c(C#N)cc2C#N)[C@@H]1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141365",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1cc(N)c(Cl)cc1C(=O)OCC(=O)NC1CC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32585",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1occc1-c1nnc(SCC(=O)Nc2cccc(I)c2)n1C by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33446",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CN(Cc1ccc(F)cc1)S(=O)(=O)c1cc(Cl)ccc1Cl)N1CCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104448",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NNS(=O)(=O)c1ccc(O)c(C(=O)[O-])c1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198674",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1csc(CCCCNC(=O)C(=O)Nc2ccc(F)cc2F)n1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134688",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(Cc1cccs1)NC[C@@]1(O)CCSC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47394",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C(NCc1ccccc1CN1CCOCC1)N[C@@H]1CCCC[C@@H]1CO by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235465",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCn1c(SCC(=O)NC(=O)NCc2ccccc2)nnc1-c1ccc(Cl)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc2sc(N(CCN3CCOCC3)C(=O)c3cccc(Cl)c3)nc2c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244233",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Fc1ccc2[nH]c([C@@H]3CCC[NH+]3Cc3c[nH+]cn3C3CCCCC3)nc2c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38918",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccc(C[S@](=O)c2ccc(Cl)cc2)cc1)c1ccccc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107338",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Nn1c(Cc2ccccc2)nnc1SCC(=O)Nc1c(Cl)cccc1Cl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "163809",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C/N=c1\\scc(-c2cc3ccccc3o2)n1/N=C/c1cccc(O)c1O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "172270",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CSc1ccc2ccccc2n1)Nc1cc(Cl)cc(Cl)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210768",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Cc1c[nH]c2ccccc12)Nc1cc(Cl)cc(Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "52100",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=N\\OC(=O)c1cc(F)ccc1F)c1ccncc1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28137",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@H](C(=O)c1csc(-c2cccs2)n1)c1ccccn1 by substituting a nitrile with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129260",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C/N=C1\\NC(=O)[C@@H](CC(=O)Nc2cccc(Cl)c2Cl)S1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "13851",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C([O-])C[C@@H](Br)C(=O)c1ccc2c(c1)CCC2 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146379",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](SCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)[C@@H](C)O by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24722",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule O=[N+]([O-])c1cccc(-c2ccc(O)c([N+](=O)[O-])c2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60089",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule COCCOC(=O)/C(C#N)=C\\c1ccc(Cl)cc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73752",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC(C)(O)CC[NH2+][C@@H]1CCCc2sccc21 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209540",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](CC#N)Sc1ccccc1NC(=O)N(C)Cc1ncnn1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120107",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH2+]Cc1ncoc1-c1ccc(Br)cc1F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136154",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C1C[C@H](NS(=O)(=O)N2CCCC2)CN1Cc1ccccc1Cl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166598",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COC(=O)c1ccc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2C)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44861",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)n1cc(Br)cc1C(=O)NCCC(=O)NC1CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86019",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)C[NH+]1CCC(NC(=O)N[C@H]2CCSc3ccc(Cl)cc32)CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "61592",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(NCc1nnc2n1CCCCC2)C(=O)Nc1ccc(F)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132013",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CCNC(=O)[C@H]1C[C@@H]1c1ccc(F)cc1)N[C@@H]1CCS(=O)(=O)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115142",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(-c2ccc(=O)n(CC3CCN(C(=O)c4ccccc4F)CC3)n2)cc1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8249",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)(CNC(=O)c1cccc(F)n1)c1ccncc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "249388",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(NC(=O)c1ccc(I)cc1)c1ccccc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118379",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NCCOc1ccccc1)C1=Cc2cc(F)ccc2OC1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150679",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)N1CCC[C@@H](C[S@@](=O)c2cc(Cl)ncn2)C1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95341",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)[C@H]1CCC([O-])=C(C(=O)C(F)(F)F)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212237",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[NH2+][C@@H](c1cc(C)cc(C)c1)c1ccc(Cl)cn1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212915",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CCCN(C(=O)Nc2cccc(OCCF)c2)[C@H]1CO with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62907",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc(S(=O)(=O)Oc2cccc(Cl)c2Cl)cn1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82152",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCNC(=O)C[S@@](=O)Cc1nc(-c2cccc(Cl)c2)oc1C with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44427",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(COc1ccc2nccnc2c1)Nc1ccccc1Cl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "158561",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)Nc2c3c(nn2-c2cccc(Cl)c2)C[S@@](=O)C3)c1 by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "222749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(C)OC(=O)NC[C@H]1CCC[NH+]1CC(=O)Nc1sccc1C#N by substituting a nitrile with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86581",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cc(Cl)cc(C[NH2+]Cc2cccc(Cn3cncn3)c2)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126091",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(C(=O)NCc2ccc(C(F)(F)F)cc2)cc1F by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75740",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule [NH3+]C[C@@H]1CCC[C@H]1Nc1cc[nH+]cc1Cl with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48370",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1cccc(F)c1)N1C[C@H](C)C[C@@H]([NH3+])C1 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "152066",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CC[C@H](CCO)CNC(=O)[C@H]1CCCC[NH2+]1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244362",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(NC(=O)C(=O)N[C@H](C)c2ccccc2Cl)n(C)n1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70319",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Nc1ccc(Cl)nc1C(=O)OCc1nc(-c2ccsc2)no1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "134251",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](NC(=O)c1cncc(Br)c1)c1ccc(-c2ccccc2)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104771",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)N[C@@H](C(=O)NC[C@](C)(O)c1ccsc1)C1CCCC1 by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174114",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)N1CCC[C@@H](C(=O)[C@H](C#N)c2nc3ccccc3o2)C1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226359",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCC[C@H](CCNC(=O)NC(CO)CO)C1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90658",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C=CCNS(=O)(=O)c1ccc(C(=O)N(C)Cc2cccc(Cl)c2Cl)cc1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69731",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CS(=O)(=O)N1CCC(CNS(=O)(=O)c2ccc(Cl)cc2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69178",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)NC(=O)Cn1ncc2c3ccccc3n(Cc3ccccc3F)c2c1=O by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27532",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1c(-c2ccc(Cl)cc2)c(=O)oc2cc(OCCN3CCOCC3)ccc12 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86108",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@H](C(=O)NC[C@@H](CCO)c1ccccc1)c1ccc2ccccc2c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34095",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H]1CCCN(C(=O)c2ccc(S(=O)(=O)NCCCO)cc2)C1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112996",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CSCc1cc(F)ccc1CNC(=O)C1CCN(C(=O)C2CC2)CC1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218910",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H](CNC(=O)CC1(O)CCCC1)c1ccsc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154255",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1cc(C[NH2+][C@@H]2CCc3c(Br)cccc32)ccc1O by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142119",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NC(=O)[C@@H]1CN(C(=O)N[C@H]2CCN(c3c(F)cccc3F)C2)CCO1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175783",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1c(C(=O)NCc2ccc(Cl)cc2)cc2sccc21 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7649",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)CNS(=O)(=O)Nc1ccccc1C(F)(F)F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239906",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(COc1ccccc1Cl)Nc1ccc(C(=O)NCc2ccco2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102830",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc2cn[nH]c2cc1NC(=O)C(=O)N[C@H]1CCCc2ccc(F)cc21 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77814",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C1O[C@@H](CC(=O)N2CC=C(c3ccc(Cl)cc3)CC2)c2ccccc21 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124099",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(CSC1=NCCS1)Nc1ccc(C(F)(F)F)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "206299",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(NC(=O)Nc2ccc(F)cc2F)n(Cc2ccccc2)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "131222",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1S(=O)(=O)Nc1ccc2c(c1)CCC(=O)N2C by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162453",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCCCO by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26582",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]1CN(C(=O)c2ccn(-c3ccc(Cl)c(Cl)c3)n2)C[C@@H](c2ccccc2)O1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95722",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CSc1nnc2c(n1)[nH]c1ccc(F)cc12)N1CCN(c2ccccc2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "211349",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(C(=O)OC(C)(C)C)C1CC[NH+](Cc2cnn(-c3ccc(F)cc3)c2)CC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123418",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3264",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc([C@@H]2CCCN2C(=O)c2ccc([N+](=O)[O-])cc2F)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119352",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule N#C[C@@H]1CCCCN1Cc1cc(Cl)ccc1[N+](=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154427",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCOc1ccc(S(=O)(=O)N2CCC[C@@H]2c2ccc(Cl)cc2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "183711",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc([N+](=O)[O-])cc1OCC(=O)Nc1cc(Cl)ccc1F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107759",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)CC(=O)N[C@@H](C)c1ccc(Cl)s1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "57914",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc2c(c1)[C@H](O)[C@H](N1CC[NH+](C)[C@@H](C)C1)C2 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98688",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCNC(=O)CCn1ncc2c(Cl)cccc21 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "153815",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1c(C[NH2+]C2CC2)cnn1-c1cccc(Cl)c1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "167253",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nc(CC[NH+]2CCC(Oc3ccc(Cl)cc3)CC2)cs1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112959",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[C@@H](O)Cc1nc2ccccc2[nH]1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "120369",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOC(=O)c1cc2n(n1)C[C@](C)(C(=O)NCc1ccc(F)cc1)N(c1ccc(C)cc1C)C2=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123826",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(C)c(NC(=O)[C@@H](C)N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241337",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1C[C@H]1C(=O)Nc1ccc(F)cc1C(=O)N[C@H]1CCC[C@H]1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184435",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule COc1cccc2sc(NCC(=O)c3ccc([N+](=O)[O-])cc3)nc12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81173",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCS(=O)(=O)c1c(S(=O)(=O)CC)c2c3ccccc3ccn2c1C(=O)c1ccc(Cl)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "199782",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cccc(NC(=O)N2CCC(N3CCO[C@@H](C)C3)CC2)c1Cl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187439",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(CCc1ccccc1)C(=O)NCc1ccccc1Cl with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "175446",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N#CC1=C2CCCN2c2ccc(F)cc2S1(=O)=O with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "219609",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Sc1nnc2ccc(C(F)(F)F)cn12)C(=O)Nc1cccc(Cl)c1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212471",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCn1cc(NC(=O)NCC#Cc2cccc(C(F)(F)F)c2)cn1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141078",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule O=C(N[C@H](Cc1ccccc1)C1CC1)N1CCC[C@@H]1C[NH+]1CCC[C@@H]1CO with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181306",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@H]1CCCN(C(=O)c2ccc(-n3ccnc3)c([N+](=O)[O-])c2)C1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82009",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1ccc(C(C)C)cc1S(=O)(=O)N1CC[C@@H](c2cc3nc(C)cc(O)n3n2)C1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49990",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule OCC/N=C1/CCCc2c1[nH]c1ccccc21 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "190584",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(NC(=O)c2scnc2C2CC2)ccc1Br by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64224",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@H](C)NC(=O)Cn1cnc2onc(-c3ccc(Cl)cc3)c2c1=O by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197345",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)c1cccc(NC(=O)Cn2nc3c(Oc4ccc(F)cc4)nccn3c2=O)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148419",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule O=C1C[C@@H](Cc2ccc(Br)cc2)C(=O)N1c1ccc([N+](=O)[O-])cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "205135",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H](NC(=O)C1(c2cccc(C(F)(F)F)c2)CC1)c1nc[nH]n1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41206",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C1OC(c2cccc(I)c2)=N/C1=C\\c1ccc([N+](=O)[O-])cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60252",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@@H]([NH3+])[C@@H](c1cccs1)N(C)CC(C)(C)O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110710",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCCNC(=O)c1cc(S(=O)(=O)N(C)c2ccc(F)cc2)ccc1Cl by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83426",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a thiol in the molecule C=CC(=O)N(C(=O)C=C)[C@H](CS)C(=O)[O-] by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225140",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1/C(=C/c2ccc(Cl)c(Cl)c2)C([O-])=NC(=S)N1c1ccccc1F by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239718",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H](O)c1ccn(Cc2ccc(Cl)cc2Cl)c1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "44642",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1C(=O)N(C)Cc1[nH+]ccn1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "236531",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc([C@H]2OCCC[C@H]2CCl)c(C)s1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22182",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1CCC[NH+](CCNC(=O)c2cc(Cl)c[nH]2)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8963",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)(C)c1csc(C[C@@H](C[NH3+])c2cccc(Cl)c2)n1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "62831",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule CCC1(C(=O)NC2CCC(O)CC2)CCCC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5404",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC1=C(C(=O)Nc2ccc(C(=O)NCc3ccc(F)cc3)c(Cl)c2)SCCO1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182098",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCC[NH2+][C@H](c1ccncc1)c1ccc(Cl)cc1F by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51340",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]1CCCC[C@@H]1CNc1nc(Cl)ncc1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "72937",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "1390",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ncc(Cl)c(C(=O)NCc2[nH+]ccn2CCc2ccccc2)n1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135548",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(S(=O)(=O)/N=C(\\[O-])N(Cc2ccc(Br)cc2)C[C@@H]2CCCO2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162854",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COC(=O)c1cc2n(n1)C[C@@](C)(C(=O)NC1CCCCCC1)N(c1ccc(F)cc1C)C2=O by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169634",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule N#CCSc1nnc(-c2cccc(S(=O)(=O)N3CCOCC3)c2)n1Cc1ccco1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "128082",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1CN(C(=O)[C@@H]2CC(=O)Nc3ccccc32)c2cc(Cl)ccc2O1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49604",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(CNC(=O)c1ccccc1I)NCCC1=CCCCC1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "55410",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=[N+]([O-])c1ccc(F)cc1C[NH+]1CCC(OCc2ccc(F)cc2)CC1 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155586",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1cc(C)cc(CCNC(=O)NC[C@H]2CCC[C@@H]2O)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187565",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3745",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(CNc1cc(C(F)(F)F)ccc1-n1cccn1)N1CCCCC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64259",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C(=O)[C@H](C)S(=O)(=O)Cc1c(Cl)cccc1Cl)c1ccccc1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37433",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[N+](CC)=C1Nc2ccccc2Oc2ccc(NC(=O)c3ccccc3F)cc21 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "101749",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@H]1CCN(C(=O)c2ccccc2OCC[NH+](C)C)C[C@@H]1O by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16399",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=S(=O)(c1ccc(F)c(F)c1F)N1CCN(C/C=C/c2ccccc2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "108378",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[NH2+][C@]1(CO)CC[C@H](N2CC[C@H]([NH+](C)C)C2)C1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193603",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule FC(F)(F)c1cccc(Nc2nc(Cl)nc(N3CCOCC3)n2)c1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70426",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Clc1ccc(SCCn2cccn2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "91324",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccc([C@@H](O)[C@H](C)NC(=O)c2cccnc2C)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "166274",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc2nc(C[NH+]3CCC(OCc4ccccc4F)CC3)cn12 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "90921",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1c(-c2ccco2)nn(-c2cnccn2)c1N with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85069",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule C[NH+]1CCN(C(=O)C[NH+]2CCCCC[C@@H]2C[C@H](O)c2ccccc2)CC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140016",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC[C@@H]([NH2+]CCC[C@H]1CCCC[C@@H]1O)c1ccc2c(c1)CC(=O)N2C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165924",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1C[C@H](C)CN(C(=O)CCNS(=O)(=O)c2cccc(Br)c2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102958",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(NC(=O)c2cc(N3C(=O)[C@H]4[C@H]5CC[C@H](C5)[C@H]4C3=O)ccc2Cl)c(OC)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "197773",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C/C(=C/c1ccccc1OCc1ccc([N+](=O)[O-])cc1)C(=O)c1ccccc1 by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216358",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cl[C@@H](CC[C@H]1CCOC2(CCOCC2)C1)c1ccccc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218217",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CC[C@@H](C)n1ncc(C(=O)N2CCO[C@H](C#N)C2)c1C1CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170891",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(/C=N/N=C2\\NC(=O)[C@@H](Cc3cccc(Cl)c3)S2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162140",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ncnc2c1nc([C@@H](C)Cl)n2CCc1ccsc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "180341",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)CC(=O)N(Cc1cccc(F)c1)C[C@@H]1CC(c2cccc(F)c2)=NO1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "68316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(c1ccnc(OC2CCC2)c1)N1CCOc2cc(F)ccc21 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "41737",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCC1C[NH+]([C@@H](CC)CC#N)C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122411",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)=C[C@]1(O)CCc2ccccc21 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95552",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCCC[C@H]1NC(=O)COC(=O)C1(O)CCCCC1 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138127",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(Nc1ccnn1C1CC[NH+](Cc2ccccc2OC(F)F)CC1)c1cccc(F)c1 by replacing a halo by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54820",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC[C@@H](C(=O)N1CCC[C@@H](O)C1)c1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20978",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCN(C(=O)c1ccc(Cl)cc1Cl)[C@@H]1CCS(=O)(=O)C1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15624",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(C)NC(=O)[C@H]1CSCN1C(=O)[C@H]1CCC[C@H](C(F)(F)F)C1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232782",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CN1CCO[C@@H]([C@H](NC(=O)N[C@@H]2CC[C@H]([NH+](C)C)C2)c2ccc(Cl)cc2)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141447",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Fc1ccc([C@@H]2C[NH2+]C[C@@H](c3ccccc3)O2)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34332",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@@H](CN4CCN(c5ccc(Cl)cc5)CC4)[C@H]3[C@@H]3O[C@@]132 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "58738",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](CO)NC(=O)Nc1cccc(NC(=O)c2ccccc2)c1 by replacing a hydroxyl by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "26248",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1ccc(Cl)cc1OC(=O)c1csc(C)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162215",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C[C@@H]1COCCN1Cc1ccc(-c2c(F)cccc2F)o1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154972",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(C(=O)NC[C@H](C)N2CCOCC2)c1F by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "221669",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC[C@H](C)NC(=O)Cc1cn(-c2ccccc2)nc1-c1ccc(F)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "235158",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1ccc(C)cc1NC(=O)N[C@H](CCCO)c1ccccc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "93475",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(C)C[C@H](CNC(=O)c1ccc(F)nc1)NC(=O)c1ccc(F)nc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135787",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1NC(=O)C[C@@H]1SC(NC[C@@H]2CCCO2)=NC1=O by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78528",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C=CCCC[C@@H](C)[NH+]1CCN(CC#N)CC1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "122979",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cn1nc(-c2ccccc2F)ccc1=O by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "187964",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H]([NH2+]C1CCN(C(=O)NC2CCCCC2)CC1)c1ccccc1F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129087",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1cccc(S(=O)(=O)Nc2ccccc2-c2ccccc2)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38608",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCCc1cc(OC)cc(O)c1[C@@H]1[NH+]=NC=C1c1ccc2c(c1)OCCO2 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245317",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1ccc(C(=O)NC2(c3ccc(Br)cc3)CC2)cc1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48925",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC(C)(C)[S@@](=O)CCNC(=O)N[C@H](c1ccccc1F)C1CCCC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144650",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1cccc([N+](=O)[O-])c1)c1c[nH]c2ccc([N+](=O)[O-])cc12 by substituting a nitro with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169879",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1CCC[C@@H](NS(=O)(=O)c2ccc(Cl)nc2)[C@@H]1C by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "231739",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Clc1cccc(-n2nnnc2[C@H](c2ccccc2Cl)N2CCOCC2)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114639",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](C)Oc1ccc(NC(=O)C(=O)N[C@H](C)c2cccc(C#N)c2)cc1 by substituting a nitrile with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69037",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)NC[C@H](O)c2ccccc2F)c2ncccc2c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "195608",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]([NH2+]C[C@H]1C[C@@]12CCc1ccccc12)c1ccc(S(C)(=O)=O)c(F)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97877",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(Cl)c(C)cc1NC(=O)CCOc1ccccc1Cl by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78810",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(F)cc1S(=O)(=O)N(C1CC1)[C@@H](C)C(C)C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203292",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1ccc(C(=O)NNC(=O)COc2cc(C)c(Cl)c(C)c2)cc1Br with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38545",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C/C(=N/[NH+]=C(\\N)S[C@@H]1CC(=O)N(c2cc(Cl)ccc2Cl)C1=O)c1cccs1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59136",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=C(Oc1ccc([N+](=O)[O-])cc1)c1cccc([N+](=O)[O-])c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "105908",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC[C@@H](NC(=O)Nc1ccc(C)nc1Cl)c1ccc(F)c(F)c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15285",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOC(=O)c1nn(-c2ccc(Cl)cc2)cc1C(C)=O by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28171",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1ncc([C@@H]2C(C#N)=C(N)OC3=C2C(=O)CC(C)(C)C3)c1C by substituting a nitrile with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "66446",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1ccc(NC(=O)CSc2nc3ccc([N+](=O)[O-])cc3s2)cc1C by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234997",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(CCCCCBr)C[C@H]1CCC[NH+]1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "49421",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H]1CN(C(=O)Cc2ccon2)c2cc(F)ccc2C(=O)N1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "27536",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=S(=O)(N1CCCCC1)N1CCC[C@H]1[C@@H]1CCCC[C@@H]1O by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "133045",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](c1ccc(Cl)cc1)[C@H](C)N(C)C(=O)C1CC1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "78316",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(N[C@H]1c2ccccc2C[C@H]1O)[C@@H]1C[C@H]1c1cccc2ccccc12 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "138495",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cccc(NC(=O)NCC2(c3c(F)cccc3Cl)CCOCC2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "94469",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#Cc1ccnc(N2CCN(C(=O)NCCCn3cncn3)CC2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179265",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule COc1cccc(C(=O)N[C@@](C)(C#N)CCc2ccccc2)c1F by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69043",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(c1ccc(Oc2ccccc2)o1)N1CCC(OCc2ccccc2F)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182534",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(-n2nnc(C(=O)NC3CCCC3)c2N)cc1F with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151285",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)n1cnnc1CNC(=O)c1ccc(SC(F)(F)F)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171120",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)Cc1ccc(S(=O)(=O)N2CCc3ccc(F)cc32)s1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "174720",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(NN1C(=O)/C(=C/C(Cl)=C/c2ccccc2)SC1=S)c1ccccc1O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146815",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@H]1C[C@H](NC(=O)c2cccc(F)c2)CN1c1ccccc1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "121595",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1ccc(O)cc1)c1cc2ccccc2cc1NC(=O)C1CC1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232786",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=c1[nH]cnc2cc(NCCOc3ccc(Cl)cc3)c([N+](=O)[O-])cc12 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "60938",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)(CNC(=O)CCC(F)(F)F)c1ccccc1F by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "63031",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(CCC1CCN(C(=O)CN2CCCC2=O)CC1)NCc1cccc(Cl)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "73834",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule OCc1cc(F)c(OC2CCCC2)c(F)c1 by substituting a halo with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38595",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[C@@](C)(NS(=O)(=O)c1ccc(F)c(Cl)c1)C(=O)[O-] with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "97532",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cc(F)ccc1NC(=O)C(=O)N[C@@H](C[S@@](C)=O)c1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210939",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1ccc(/C=C/S(=O)(=O)[N-]c2cc(Cl)ccn2)cc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210576",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CNC(=O)C(=O)Nc1cc(Br)ccc1N1CCOCC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117677",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CSc1nc(Cl)cc(N(C)C[C@@H]2CCCC[NH2+]2)n1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242748",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(F)ccc1[C@H](O)c1ncc[nH]1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "161118",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H]1CN(S(=O)(=O)c2ccc(NC(=O)COc3ccc(F)cc3Cl)cc2)C[C@@H](C)O1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107972",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule N#CC1(NC(=O)CN2C(=O)N[C@](Cc3ccccc3)(c3ccccc3)C2=O)CCCC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232436",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1ccc(SCCC(=O)Nc2nc3c(F)cccc3s2)cc1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "144805",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule COc1cccc(C[NH+]2CCC([C@@H](O)c3ccc(F)cc3)CC2)c1OC(C)C by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201315",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule N#C/C(=C\\C1=c2ccccc2=[NH+]C1)C(=O)N[C@H]1CCS(=O)(=O)C1 by replacing a nitrile by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "137109",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(N[C@@H]1CCCC[C@@H]1O)c1cc(N2CCCC2=O)ccc1Cl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "176508",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cccn2c(=O)cc(COc3ccc(NC(=O)c4ccc(F)cc4)cc3)nc12 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100429",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccccc1[C@@H](NC(=O)N[C@@H]1CCCC[C@@H]1CO)c1ccccn1 by substituting a hydroxyl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "22753",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COCCCn1cc(C(=O)Nc2ccc(Cl)cc2)c2nn(-c3ccccc3)c(=O)c-2c1 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112788",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC[C@@H](C)NC(=O)CN1CCN(C(=O)Nc2ccc(N3CCCCC3)c(Cl)c2)CC1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28289",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCC1CCN([C@H](C[NH3+])c2ccc(Br)c(C)c2)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "173781",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)c([C@H](C)[NH2+]Cc2cccc(Cl)c2)cc1F by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65454",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule N#C[C@H]1C(=N)C(C#N)(C#N)[C@@H](c2ccc(F)cc2)[C@H]2CSCC=C12 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "14544",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CCc1nn(C)c(OC)c1CNc1c(C#N)c(=O)n(C)c(=O)n1C with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "204570",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H]1CCCN(C(=O)Cn2c3ccc(F)cc3c3ncn(Cc4ccccc4Cl)c(=O)c32)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "34578",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nn(C)c2c1nc(N)n2-c1ccc(Br)cc1Cl with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "189048",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule N/C(=N/O)[C@H]1CN(CCN2CCOCC2)CCO1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89635",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1noc([C@@H](C)N[C@H](Cc2ccc(Cl)cc2)c2ccccc2)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "38961",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NC1C[C@@H]2CC[C@H](C1)[NH+]2C[C@@H]1CCCO1)c1cc(F)ccc1F by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114929",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H](OC(=O)C1CCC(C(N)=O)CC1)c1nc2cc(Cl)ccc2n1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113692",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O=C(Nc1nc[nH]n1)c1ccccc1O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "146038",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC(C)(C)c1cc[n+](C2=C([O-])C(=[OH+])N(Nc3ccccc3)C2=O)cc1 by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16711",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1ccc(Cn2cc(Br)cc([N+](=O)[O-])c2=O)nc1 by substituting a nitro with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218871",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)NNc2ccccc2)C1=O with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110431",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(NCc1ccsc1)N[C@H]1C[C@H]1c1cccc(Cl)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "59824",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccccc1C(=O)NNC(=O)Cc1ccc(F)cc1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64241",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC1(C)CCC[NH+]1CC(=O)N1CCO[C@@H](c2ccc(F)cc2)C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "82790",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule COc1ccc(C[C@@H](C)CNC(=O)c2ccc(O)c(Cl)c2)cc1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "50196",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@@H]2C2CCCCC2)c(Cl)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218847",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(C)cc(O)c1C=O by replacing a aldehyde by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "15106",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccccc1N1CCN(CC(=O)N(C)Cc2ccc(Cl)s2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "10597",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(-c2ccc(=O)n([C@@H](C)C(=O)Nc3c(F)c(F)cc(F)c3F)n2)cc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226805",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CS(=O)(=O)Cc1nc(CN2CCO[C@@H](C#N)C2)cs1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "140871",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule CC[C@@H](CO)NC(=O)NCc1ccc(-n2cncn2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159046",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(c1ccccc1)C1CCN(C(=O)COc2ccc(Br)cc2F)CC1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19599",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CCc1nc(CS(=O)(=O)CC(F)(F)F)cs1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207354",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(CNC(=O)N[C@@H](CO)c2ccc(Cl)c(F)c2)cn1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123819",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cn(-c2ccccc2)nc1[C@@H](O)n1nnc2ccccc21 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160155",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule C[C@H]1CO[C@@H](CO)CN1Cc1cccc(OCCCC#N)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54869",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cccc(CS(=O)(=O)N2CCC(C(=O)Nc3cc(C(F)(F)F)ccc3Cl)CC2)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "179639",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule C[C@H]1CN(c2cc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)ncn2)C[C@@H](C)O1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "178897",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@@H](C[NH2+]Cc1c(Cl)cccc1N1CC[NH+](C)CC1)C[NH+]1CCCC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142286",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3299",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C1OC(c2ccc([N+](=O)[O-])cc2)=N/C1=C\\c1ccc([N+](=O)[O-])cc1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "244271",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CC(C)(C)c1ccc([C@H]2Nc3ccccc3C(=O)N2CC(F)(F)F)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "64774",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)N(C)c1ccc(F)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "234849",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1c(Cl)cccc1N1C(N)=C(C#N)[C@@H](c2ccccc2)C2=C1CCCC2=O by replacing a nitrile by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209407",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule N#C/C(C(=O)N/N=C/c1cccc(O)c1)=C1\\CCc2ccccc21 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "247552",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1nc2cc(NC(=O)CCNC(=O)c3ccccc3Cl)ccc2o1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "184906",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCN1c2cc(Cl)c(Cl)cc2NC(=O)C[C@H]1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162611",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COC(=O)c1cc(O)n(-c2cc(Cl)cc(Cl)c2)n1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171049",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1ccc(/C=N/NC(=O)c2cc(-c3ccc(Br)cc3)n[nH]2)cc1OC by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141028",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule CN(C(=O)CSc1ccc(C#N)cc1)[C@H]1CCc2ccccc2C1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "154716",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a hydroxyl in the molecule C[C@@H](O)CNC1=NC(=O)[C@@H](C)N=[NH+]1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28577",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](CNC(=O)NCCc1cc(F)ccc1F)N1CCOCC1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45941",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1cc(Cl)nc(NNC(=O)c2ccc(F)c(F)c2)c1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "56405",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(NC(=O)N[C@H](CO)c2ccc(Cl)c(F)c2)cc1C(N)=O with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "113263",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule Cc1cc(N[C@@H](C)[C@H](C)CO)nc(-c2ccccn2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4389",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(-c2csc(NC(=O)c3cncc(Br)c3)n2)cc1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11254",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCc1c(NC(=O)N2CC[C@@H](C)[C@H](O)C2)noc1-c1ccc(Cl)s1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118741",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCCNC(=O)N(CC)Cc1ccc(Cl)c(Cl)c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148273",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COCc1cccc(C(=O)N(C)CC(=O)Nc2ccc(Cl)c(Cl)c2)c1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "213363",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[NH+](Cc1ccccc1)C[C@H](O)Cn1cnc2cc(F)c(F)cc21 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19721",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(-c2nc(C(=O)Nc3ccccc3OC)nn2-c2ccc(Cl)cc2)cc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145350",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H]1CN(c2ncnc3cccc(F)c23)C[C@H](c2ccc(F)cc2)O1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "117448",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C=CCOc1cc(Br)c(C(=O)NN)cc1OCC by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "212022",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H]1CCc2c(sc3nc(CCN(C)CCC#N)nc(N)c23)C1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112849",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=S(=O)(CC[C@@H]1CCCO1)N1CCc2cc(F)ccc2C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "224668",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccc(NC(=O)N2CCn3cccc3[C@H]2c2ccccc2F)cc1C by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "145097",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C[NH+]2C[C@@H](C(=O)[O-])[C@@H](C)C2)ccc1Br by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "99318",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCC[C@H](C)Nc1ccc(C#N)c(C(F)(F)F)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "37736",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cccc2[nH]c([C@](C)(N)C(F)(F)F)nc12 by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125724",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Oc1ccc(Cl)cc1CNc1ccccc1 by substituting a hydroxyl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "126502",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COC(=O)c1ccc(N2CCCC2)c(NC(=O)Cc2ccc(Cl)cc2)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "182226",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCCN(C1C[NH2+]C1)S(=O)(=O)c1cc(C)c(Br)s1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186749",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CO[C@@H](C(=O)N[C@H](CO)C(C)C)c1ccccc1 by substituting a hydroxyl with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "228409",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc2nc(N3CC(C(=O)Nc4cccc(C(F)(F)F)c4)C3)sc2c1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "136121",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCCCCCn1ccc([C@H](O)C(C)C)c1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125641",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC[C@@H](C)C[C@@]1(C#N)CCC(C)(C)C1=O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "200188",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)[C@@H](C)Oc1ccc(Cl)c2ccccc12 by replacing a halo by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "67112",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN1C(=O)c2ccc(Cl)cc2N[C@@H]1c1ccc(F)cc1F by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "123962",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#C[C@@H](NC(=O)c1ccoc1)C1CCCCC1 with halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "107108",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(NC(=O)C[C@H](C)c2ccccc2F)c(C(N)=O)cc1F with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16855",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H]1CCN(C(=O)c2cc3cc(F)ccc3o2)C[C@H]1O by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "171042",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1ccc(NC(=O)CS[C@H]2[NH+]=c3cc[nH+]cc3=[NH+]2)cc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "141357",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(Cn1cc(S(=O)(=O)Cc2ccc(Cl)cc2)c2ccccc21)N1CCCCCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "98928",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCN(Cc1nc2cc(Cl)ccc2c(=O)[nH]1)C(=O)c1cc(C)no1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "165657",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(c1ccccc1I)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203499",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(NCc2cn(C)nc2-c2cccnc2)ccc1F with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "160335",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@@H](CNC(=O)C1CC[NH+](C)CC1)Oc1ccc(Cl)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "124368",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC[NH+]1CCC[C@@H]1CN(Cc1cc2cccc(C)c2[nH]c1=O)C(=O)Nc1cccc(Cl)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11517",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(CC)C(=O)c1ccccc1NC(=O)c1cccc(Cl)c1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "87314",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CN(CC1CC[NH+](C)CC1)C(=O)c1ccc(F)cc1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "81819",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1noc(CNC(=O)Cc2csc(NC(=O)c3ccc(F)cc3)n2)n1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47711",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)N[C@H]1c2ccccc2C[C@@H]1O with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "88113",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "958",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4051",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule CCOC(=O)Cc1[nH]nc2c1[C@H](c1ccoc1)C(C#N)=C(N)O2 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "20066",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "604",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CN(C)C(=O)c1cccc(NCc2ncc(-c3ccc(Cl)cc3)o2)c1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "181412",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(=O)c1csc(NC(=O)Cc2cccc(OCC#N)c2)n1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "242015",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule O=C1CCCC2=C1[C@@H](c1ccc3c(c1)OCO3)c1c(nn(-c3ccccc3)c1O)N2 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96224",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CCC[C@H]1CN(Cc2cccc(O)c2)CCO1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "47055",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1cc(N(C)c2cccc(C#N)c2)[nH+]cc1N with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "80346",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Br[C@H](Cc1nc2ccccc2o1)[C@H]1CCOC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "142548",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule Cc1nonc1Cn1ccnc1C#N with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "83973",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cc(/C=C2/C(=N)N3C(c4ccccc4)=CSC3=NC2=O)c(C)n1-c1ccc(F)c(Cl)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225286",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a hydroxyl in the molecule CC[C@@H]1CC[C@@](C[NH3+])([C@H](O)c2ccccc2)C1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3791",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCCCSc1ccc(N)c(F)c1 by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129944",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1cc(/C=C2/C(=O)N(c3ccc(C)c(Cl)c3)C(=O)N=C2[O-])c2ccccc21 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "129152",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CCN(Cc1ccoc1)C(=O)c1ncccc1C(F)(F)F by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "248995",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cc1cc(C)c(CNC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)c(=O)[nH]1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "156632",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@@H](NC1COC1)c1c(F)cccc1F with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "119359",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3200",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule COc1cccc(/C=c2/s/c(=C\\[N+](=O)[O-])n(C)c2=O)c1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "155132",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1cc(N2CCC[C@H](SCc3nccn3C(F)F)C2=O)cn1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "100368",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](Cc1ccc(Cl)cc1)N(C)C(=O)[C@H]1CCOc2ccccc21 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162274",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C[C@H]1CN(CN2C(=O)C(=C(C#N)C#N)c3ccccc32)C[C@@H](C)O1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148127",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(F)cc(CNC(=O)c2cc(C)nc3c2c(=O)[nH]n3C)c1 by replacing a halo by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "75566",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@H](c1ccccn1)N(C)C(=O)Nc1cccnc1Cl by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118860",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule C/C(=C\\C(=O)N(CC#N)C1CCCC1)C(C)(C)C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106747",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(F)ccc1CCNC(=O)CCn1cc([N+](=O)[O-])nc1C by substituting a halo with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "148335",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule CN(C[C@H](O)C1CC1)C(=O)[C@@H]1CSCN1C(=O)c1ccc(Cl)cc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "53907",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CNC(=O)NC1(c2cccc(Cl)c2)CC1)NS(C)(=O)=O by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "23807",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule O=C(COC(=O)c1nc(Cl)ccc1Cl)NC(=O)NC1CCCCC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "150704",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cl[C@@H](Cc1ccc2ccccc2n1)c1ccoc1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "226541",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1ccc(Cl)c(O[C@@H](C)C(=O)NN)c1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51405",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC1(C)O[C@@H]2O[C@@H](C(=O)Nc3ccc(F)cc3F)[C@@H]3OC(C)(C)O[C@H]3[C@H]2O1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "106517",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)N1C(=O)C[C@@H](NC(=O)c2cc(Br)c[nH]2)C1=O by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5919",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C/C(=C/C(=O)NC(C)(C)C)NNC(=O)COc1cc(C)c(Cl)c(C)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132788",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cccc(N2CC[NH+](CCCNc3cnccc3C#N)CC2)c1 by replacing a nitrile by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65029",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COCCn1nc(C)c(Nc2nc(Cl)c(C(=O)OC)s2)c1C with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223474",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NC(=O)[C@]1([NH3+])CCC[C@H]1CCSc1ccc(Br)cc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "159885",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H]1C[C@@H](C)CN(C(=O)CN2CCN(C(=O)CCc3ccccc3Br)CC2)C1 with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "6197",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(-c2noc(Cc3ccc(Cl)nc3)n2)ccn1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "170717",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(CNc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C by replacing a nitro by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "196983",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C#CC[C@@H](OC(=O)[C@H]1C[C@@H]1c1ccccc1F)C1CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "112410",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CC(C)[C@H](NC(=O)Nc1ccc(NC(=O)c2ccco2)c(Cl)c1)c1ccccc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11393",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule CN(C)C(=O)[C@H](Sc1nc2ccccc2n1C(F)F)c1ccccc1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "45413",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CNC(=O)[C@@H](NC(=O)[C@@H]1CCC[NH+](C)C1)c1ccc(F)c(F)c1 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "223765",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule C[C@@H]1CCC[C@](C#N)([C@]2(O)CCCCC2(C)C)C1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "114178",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1c(NC(=O)C2=Cc3cc(F)ccc3OC2)cnn1-c1ccccc1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "115526",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cccc(C(=O)Nc3cccc(C(F)(F)F)c3)c2)c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "16303",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule CCOc1cc(C#N)cc(Cl)c1OC(=O)[C@@H]1Cc2ccccc2O1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "238543",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1ccccc1COC(=O)c1c(Cl)nc2sccn12 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "110044",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CNc1nc(-c2cnn(C)c2C)nc(COC)c1Br by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "96498",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H](O)c1ccn(Cc2cccc3cccnc23)c1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69676",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C([O-])c1cc(-c2ccccn2)nc2ccc(F)cc12 by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "95790",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule [NH3+]C[C@H]1CCCN1c1cnc2cc([N+](=O)[O-])ccc2n1 by replacing a nitro by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "65118",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCn1nc(C)c(NC(=O)N(C)Cc2ccccc2F)c1C by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "36672",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1C[C@@H](NCCc2nc3cc(F)ccc3n2C)C[NH+]1C by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "4474",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule Cn1nccc1CNC(=O)CCl with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71404",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule COC(=O)COc1cc(-c2ccc(C)cc2)nc2ccc([N+](=O)[O-])cc12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "11400",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule CC1(C[NH2+]C/C=C/c2ccc(C#N)cc2)COC1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70051",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule Cc1cc(C(=O)NCc2cc(-c3ccncc3)n(C)n2)ccc1[N+](=O)[O-] by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "89177",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CCC[NH+](C)C[C@H]1CCN(C(=O)c2ccc(Cl)c(Cl)c2)C1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209475",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule Cc1cc(NC(=O)[C@@H]2CSc3nc(C(C)(C)C)cc(=O)n3C2)ccc1Br by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "186574",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a hydroxyl in the molecule COc1ccccc1[C@@H](CNC(=O)N1CCC[C@H](CO)C1)[NH+]1CCCC1 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "201886",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCc1c[nH]c2ccc(Cl)cc12)Nc1ccccc1 by replacing a halo by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70271",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC(=O)[C@H](c1ccc(F)cc1)N(C)CC[C@H]1CCCC[NH+]1C by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "162815",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CCNc1ccc([N+](=O)[O-])c(-c2ccc(OCC)cc2)n1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "232579",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCOc1cccc2ccccc12)N(CCO)C1CC1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210433",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1ccc(C(=O)N/N=C(/C)CC(N)=O)cc1I with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "28895",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc([C@@H](O)CNCc2ccc(C(F)(F)F)cc2)cc1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "111586",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(c1cnccn1)N1C[C@@H]2c3ccccc3OC[C@]2(CO)C1 by replacing a hydroxyl by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220227",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(Nc1ccccc1)c1nc(-n2cnnc2)ccc1Br with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118963",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule CC1(C)CN([C@@H]2CCN(c3ccccc3Cl)C2=O)CC[S@@]1=O with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "2372",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(C1=C([O-])C(=O)N(CC[NH+]2CCCC2)[C@@H]1c1cccc(Cl)c1)c1ccc2c(c1)OCO2 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "24192",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C[C@@H](NC(=S)NNC(=O)Cc1c(F)cccc1Cl)c1ccccc1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "54851",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)Cn1ncc(C(=O)N(C)[C@H]2CC[NH+](C)C[C@@H]2C)c1C(F)F by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "203238",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule C[C@H](NC(=O)CCc1ncc(-c2c(F)cccc2F)o1)C1CC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "76572",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule COCC[C@H](C)C(=O)Nc1sc(-c2ccccc2)cc1C#N with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207772",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule C[C@@H](C#N)CNC(=O)C1C(C)(C)C1(C)C with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "125962",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule CN1C(=O)C(=Cc2ccc(-c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)o2)C(=O)N(C)C1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "245296",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COC1CCN(C(=O)c2cc3ccc(OC(F)(F)F)cc3[nH]2)CC1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "210221",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCN(C)C(=O)C[NH+]1CCC[C@@H](CCc2ccccc2C(F)(F)F)C1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "48639",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(COc1ccc2c(=O)c(Oc3ccc(Cl)cc3)coc2c1)NCc1ccc2c(c1)OCO2 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "51736",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC1(C)CCCN(C(=O)c2ccc(C#N)cn2)c2ccccc21 by replacing a nitrile by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "218467",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COCCn1c(C(=O)N[C@H](CO)c2ccccc2F)cc2ccccc21 by replacing a hydroxyl by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "39587",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCc1nnc2ccc(C(F)(F)F)cn12)C1CCN(C(=O)c2cccs2)CC1 by replacing a halo by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "230392",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule C[S@](=O)c1ccc(C[NH2+][C@H]2CCN(c3cccc(Cl)c3)C2)cc1 with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "5942",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cccc(NC(=O)CCc2ncc(-c3ccc(Cl)cc3Cl)o2)c1 by substituting a halo with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237475",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(COc1ccccc1)Nc1nnc(-c2ccc(Br)o2)o1 by substituting a halo with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "239269",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitro in the molecule CC[NH2+]CC(=O)Nc1ccc([N+](=O)[O-])cc1OC by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "169167",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule COc1cc(F)c([C@H](C)[NH2+]Cc2ccc(-n3ccnc3)nc2)cc1OC with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "104856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(N2CCN(CC(=O)NC3CC3)CC2)nc(-c2ccc([N+](=O)[O-])cc2)n1 by replacing a nitro by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "243503",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CC[NH+]1CCN([C@@H](C)C(=O)Nc2sc3c(c2C#N)CCCCC3)CC1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "77971",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[C@@H](C(=O)N1CC[C@@H](Oc2ccc(C(F)(F)F)cn2)C1)n1cncn1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7273",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule Cc1cccc(NC(=O)C[NH+](C)Cc2cc(Br)ccc2O)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "208865",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule O=C(Nc1ccc(-n2nccc2C(F)(F)F)cc1)c1csc(-c2ccco2)n1 by nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "19763",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitro in the molecule O=[N+]([O-])c1cc(C[NH2+]C2CC2)ccc1OC1CCCC1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "85142",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule C=CCC[C@@H]([NH2+]C[C@@]1(O)CCc2ccccc21)C1CC1 by replacing a hydroxyl by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "70653",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitro in the molecule O=C(C1=C([O-])C(=O)N(CCN2CCOCC2)[C@H]1c1ccc([N+](=O)[O-])cc1)c1cccs1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "207654",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule COc1ccccc1O[C@H](C)CNS(=O)(=O)c1c[nH]c2nccc(Cl)c12 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "71747",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule COc1ccc(Cl)cc1CNC(=O)[C@@H](C)OCc1ccccc1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "225124",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a nitrile in the molecule N#Cc1c(NC(=O)C2(c3ccccc3)CCCC2)sc2c1CCCC2 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "79733",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule NNC(=O)c1cc(-c2ccc(O)cc2)nc2ccccc12 by substituting a hydroxyl with nitro.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "237540",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC[C@@H]1S/C(=N\\N=C\\c2cccc(OS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2)NC1=O by substituting a halo with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "118373",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1C[C@@H](C)C[NH+](Cc2csc(NC(=O)c3cc(F)cc(F)c3)n2)C1 by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "151206",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule COc1cc(CN2CCC([NH+]3CCC[C@@H]3C)CC2)cc([N+](=O)[O-])c1O by replacing a hydroxyl by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "8154",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a hydroxyl in the molecule O[C@@]1(C[NH+]2CCCC2)CCCN(Cc2ccncc2)C1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "135079",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=C(NCC1CCN(c2cc[nH+]cc2)CC1)c1cccnc1C(F)(F)F with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "102567",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitro in the molecule CC(C)CNC(=O)/C=C/c1cccc([N+](=O)[O-])c1 with thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "149217",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule Cc1cncc(NC(=O)NCc2ccccc2OCC(F)(F)F)c1 by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "217835",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule C[C@H]1CC[NH+](Cc2cccc(Br)c2)C[C@@H]1O by hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "69295",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule CN(c1nc(C(F)F)nc2ccccc12)C1CCS(=O)CC1 by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "198251",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a halo in the molecule C[NH+]1CCN(C(C)(C)C(=O)NCc2cccc(C(F)(F)F)c2)CC1 by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "193313",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a nitrile in the molecule Cc1nnc(N2CCC(NC(=O)C3CC3)CC2)c(C#N)c1C by carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "7823",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule O=S1(=O)N=C(SCc2cccc(F)c2)Nc2ccccc21 with aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "33501",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a nitrile in the molecule CN(C)S(=O)(=O)c1ccc(N2CCO[C@@H](C#N)C2)c(N)c1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "40986",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NCCN1C(=O)CCC1=O)c1ncccc1C(F)(F)F by replacing a halo by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "132856",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CCOc1ccc([C@@H](C)[NH2+][C@H]2CCO[C@]3(CCSC3)C2)cc1[N+](=O)[O-] by replacing a nitro by nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "30782",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule Cc1cc(C)c2c(N)c(-c3cc(=O)oc4ccc(O)cc34)sc2n1 by replacing a hydroxyl by halo.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "32685",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule O=C(NNC(=O)[C@H]1CCCO1)N[C@H]1CCCc2ccc(F)cc21 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "216727",
"split": "OpenMolInst"
}
},
{
"instruction": "Modify the molecule CC(C)(O)C(=O)N/N=C/c1cn(Cc2cccc(F)c2)c2ccccc12 by substituting a halo with nitrile.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "209939",
"split": "OpenMolInst"
}
},
{
"instruction": "Please substitute a halo in the molecule COc1ccc(Nc2ncnc3c2cnn3-c2ccc(F)cc2)cc1OC by thiol.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "86793",
"split": "OpenMolInst"
}
},
{
"instruction": "Substitute a halo in the molecule NNC(=O)Cc1cccc(-c2nc3cc(Cl)ccc3o2)c1 with hydroxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "241953",
"split": "OpenMolInst"
}
},
{
"instruction": "Please replace a halo in the molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 with carboxyl.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "3843",
"split": "OpenMolInst"
}
},
{
"instruction": "Replace a nitrile in the molecule Cc1c(NC(=O)c2ccc(C#N)cn2)cccc1N1CCOC1=O by aldehyde.",
"input": "",
"output": "",
"metadata": {
"task": "open_generation",
"sub_task": "sub_component",
"index": "220838",
"split": "OpenMolInst"
}
}
]