[
{
"instruction": "Please provide the molecular formula for CCCCCCCCCCCC(=O)NCC1=CC=C(C)C(C)=C1 .",
"input": "",
"output": " C21H35NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for I[Fe]I;[Fe] .",
"input": "",
"output": " Fe2I2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC=CC(=O)CC1CCC(C)C(CC(=O)NCC(O)C(C)C(=O)NCCCC2OC3(CCCC(CCC(C)C=C(C)C(C)OC(C)=O)O3)CCC2C)O1 ?",
"input": "",
"output": "Sure. C42H70N2O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCC1=C2N=C(C(=O)[O-])C=C(Cl)C2=CC2=C1OC(C(=O)[O-])=CC2=O ?",
"input": "",
"output": " C17H10ClNO6-2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC2=C(C(OC)=C1OC)C1=C(C=C3OCOC3=C1OC)CC(C)C(C)C2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C23H28O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCN(CCOC(C)=O)C1=CC=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C(C)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H24N6O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(CCCNCCSSCCNCCCC(C)C1CCCCC1)C1CCCCC1;Cl;Cl into molecular formula.",
"input": "",
"output": " C26H54Cl2N2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=P1(C2=CC=CC=C2)NC2=CC=CC=C2N1C1CCCCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H21N2OP ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC(CC2CC3=CC=CC(=O)C(O)=C3C(=O)O2)=CC(OC)=C1OC into molecular formula.",
"input": "",
"output": " C20H20O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN1C(O)CCOP1(=O)N(CCCl)CCCl .",
"input": "",
"output": " C8H17Cl2N2O3P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC(=O)C=C1CCC(C)N2C1=NC=CC2=O into molecular formula.",
"input": "",
"output": " C13H16N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code OC1=C(C=NC=NC2=CC=C3C=CC=CC3=C2O)C=CC2=CC=CC=C12 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H16N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=NC=CC(C(F)(F)F)=C1C(=O)NCC1=CC=C(Cl)C=C1Cl ?",
"input": "",
"output": " C15H11Cl2F3N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC(=O)C1=C(N)OC2=C(C(=O)CCC2)C1C1=CC=CS1 ?",
"input": "",
"output": "Sure. C16H17NO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN1C(=O)C2(C(C#N)=C(N)OC3=C2C(=O)NC(=O)N3)C2=CC=CC=C21 ?",
"input": "",
"output": " C16H11N5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCN1C(=N)C(C(=O)OCC)=CC2=C1N=C1C(C)=CC=CN1C2=O ?",
"input": "",
"output": " C18H20N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC(=O)C(C#N)=CC1=CNC2=CC=CC=C12 .",
"input": "",
"output": " C13H10N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1CCC2=C(C1)SC(N=CC1=CC=C([N+](=O)[O-])C=C1)=C2C#N ?",
"input": "",
"output": "The molecular formula is C17H15N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=NN(C)C(C(=O)NN=CC2=CC=CC=N2)=C1Cl .",
"input": "",
"output": " C12H12ClN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC1=CC(C=NNC(=O)C2=CSC3=CC=CC=C23)=CC=C1O into molecular formula.",
"input": "",
"output": " C18H16N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN1CCN(C(=O)C2=CC=C(CN3CCOCC3)C=C2)CC1 ?",
"input": "",
"output": " C17H25N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(CSC1=NNC(C2=CC=CN=C2)=N1)OC1CCCCC1 ?",
"input": "",
"output": "The molecular formula is C15H18N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C(C2=NOC(C3=CC=C(C)C=C3)=N2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C16H14N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN1C(=O)CC(N2CCN(CC(=O)N3CCCC3)CC2)C1=O . Can you tell me?",
"input": "",
"output": "Sure. It's C15H24N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=C(C)C1CC=C(C)C(=NNC(=O)CC2=CC=CC=C2)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H22N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(=O)NC1=CC=C(C(=O)NN=C(C)C2=CC=C3C=CC=CC3=C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H21N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(C2=NN(C(=O)CCC(=O)O)C(C3=CC=CC=C3Cl)C2)C=C1 ?",
"input": "",
"output": "Sure. C20H19ClN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(NC1=CC(Cl)=CC(Cl)=C1)C1CCCN1S(=O)(=O)C1=CC=C(Cl)C=C1 into molecular formula.",
"input": "",
"output": " C17H15Cl3N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=CC(N2CCN(C(=O)C3=CC(C4=CC=C(Cl)S4)=NC4=CC=CC=C34)CC2)=C1C into molecular formula.",
"input": "",
"output": " C26H24ClN3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(COC1=CC=C(S(=O)(=O)NCCC2=CC=CC=C2)C=C1)NC1=CC=C(F)C=C1F , what would be its molecular formula?",
"input": "",
"output": "It is C22H20F2N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(NN=CC1=CC=CN=C1)C1=CC=C(C(=O)NN=CC2=CC=CN=C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H16N6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC(=O)C1=CC=CC=C1NC=C(C#N)C1=NC(C2=CC=C(C)C(C)=C2)=CS1 .",
"input": "",
"output": " C22H19N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=CC(C2=C3C(=NN2)OC(N)=C(C#N)C3C2=CC=CC(F)=C2)=C1 ?",
"input": "",
"output": " C20H15FN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(C=C(SC2=NNC(C)=N2)C(=O)O)C=C1Br represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H12BrN3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)NC1=CC=C(C(=O)COC2=C(C3=CC=CO3)OC3=C(C)C=C(C)C=C3C2=O)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C25H21NO6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=C(C#N)C2=NC3=CC=CC=C3N2C(N2CCCCC2C)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H20N4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=NC(C)=C(C(=O)N(C2=CC=CC=C2)C(C(=O)NC2CCCCC2)C2=CC=CC=C2)S1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C26H29N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(CSC1=NC=NC2=C1C1=C(CCCC1)S2)NC1=C(Cl)C=CC=C1Cl . Can you tell me?",
"input": "",
"output": "Sure. It's C18H15Cl2N3OS2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC1=CC=C(C(O)=C2C(=O)C(=O)N(CCN(C)C)C2C2=CC=C(C(C)(C)C)C=C2)C(C)=C1 ?",
"input": "",
"output": " C28H36N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(O)C(C1=CC=CC=C1)N1C(=O)C(=CC2=CC=NC=C2)SC1=S , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H12N2O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(C(=O)C2=C(N)C3=C(C4=CC=CC=C4OC)C=C(C4=CC=CS4)N=C3S2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C26H20N2O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=C(C)C2=CC(Cl)=C(OC(=O)C(NC(=O)OC(C)(C)C)C(C)C)C=C2OC1=O ?",
"input": "",
"output": " C21H26ClNO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCCC1=CC(=O)OC2=C(C)C(OC(C)C(=O)NC(C(=O)O)C3=CC=CC=C3)=CC=C12 ?",
"input": "",
"output": "The molecular formula is C25H27NO6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCN1C(SCC(=O)NN=CC2=CC=C(Cl)C(Cl)=C2)=NN=C1C1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C19H17Cl2N5OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CN1CCC2=C(C1)SC1=C2C(=O)N(C2=CC=CC=C2)C(SCCN2CCOCC2)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H26N4O2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN1C(CC2=CC=CS2)=NN=C1SCC(=O)NC1=CC=C(C)C=C1 .",
"input": "",
"output": " C18H20N4OS2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1CCCC(NC2=NC(C3=CNC4=CC=C(F)C=C34)=CS2)C1 into molecular formula.",
"input": "",
"output": " C18H20FN3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(CSC1=NN=C(C2=CC=CC(Cl)=C2)N1C1=CC=CC=C1C(F)(F)F)NCC1=CC=CO1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H16ClF3N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C2NC(=O)CN(C(=O)C=CC3=CC=CC=C3)C(C3=CC=C(F)C=C3)C2=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C25H21FN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCN1C=C(C2CC(=O)N(C3=CC=C4C=CC=CC4=C3)C2=O)C2=CC=CC=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C26H24N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(CSC1=NC(C2=CC=CC([N+](=O)[O-])=C2)=CS1)N1CCCCCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H19N3O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC(=O)C1=C(C)N(CCOC)C(=O)C1=CC1=CC=CC=C1OC ?",
"input": "",
"output": " C19H23NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=[N+]([O-])C1=CC=CC=C1S(=O)(=O)NS(=O)(=O)CCCCCl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H13ClN2O6S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=CC(C=CC(=O)OCC(=O)C2=CC=C(Cl)C=C2Cl)=C1OC ?",
"input": "",
"output": " C19H16Cl2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(Cl)C=C1NS(=O)(=O)C1=CC=C(CNC(C)=O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H17ClN2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(CCNC(=O)C1=CC=CC=C1Cl)NC1=CC=C(Br)C(C(F)(F)F)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H13BrClF3N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC(=O)C1=C(NC(=O)COC(=O)C2=CC=CC=C2F)SC(C)=C1C into molecular formula.",
"input": "",
"output": " C17H16FNO5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN(CC(=O)NC1=CC=C2C=CC=CC2=C1)C1=CC=CC=C1 ?",
"input": "",
"output": " C19H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC1=CC=C2C(COC(=O)C3CC(=O)N(C4=CC=CC=C4OC)C3)=CC(=O)OC2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C24H23NO6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=CC(C=CC(=O)NC2=CC(C)=CC=C2C)=C1OC ?",
"input": "",
"output": " C19H21NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCN1C(=O)C2=CC=C(C(=O)OCC(=O)N(C)C3=CC=CC=C3)C=C2C1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H22N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(=O)NC1=CC=C(S(=O)(=O)N(C)CC(=O)NCC2=CC=C(Cl)C=C2Cl)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H19Cl2N3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(OCC(=O)N1CCN(C(=O)C2=CC=CO2)CC1)C1=CC=C(C2=CC=CC(C(F)(F)F)=C2)O1 .",
"input": "",
"output": " C23H19F3N2O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC(=O)C1=CC=C(C(=O)OC)C(NC(=O)CN(C)CC2=CC=C(OC)C=C2OC)=C1 ?",
"input": "",
"output": " C22H26N2O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(=O)C1=C(C)NC(S)=C(C#N)C1C1=CC=CC=C1Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H13ClN2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(C(CC(=O)C2=CC=C(Br)C=C2)SC2=CC=CC=C2N)C=C1 ?",
"input": "",
"output": " C22H20BrNO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C1NC(=O)C(=CC2=CC=C(I)C=C2)S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H6INO2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC(C(=O)NC1=C(C(N)=O)C2=C(CCC2)S1)C1=CC=CC=C1 ?",
"input": "",
"output": " C18H20N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(C=[N+]([O-])C2=CC=CC=C2)C=C1 .",
"input": "",
"output": " C14H13NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN1N=CSC1=N;I .",
"input": "",
"output": " C3H6IN3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code OC1=CC=C(N=NC2=CC=CC(C(F)(F)F)=C2)C=C1C=NC1=CC=C2OC(C3=CC=CC(I)=C3)=NC2=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C27H16F3IN4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC(NS(=O)(=O)C2=CC=C(NC(=O)C3=CC(Cl)=CC(Cl)=C3)C=C2)=NC=N1 ?",
"input": "",
"output": " C18H14Cl2N4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)C1=C(C)N=C2SCCC(=O)N2C1C1=CC=C(OC(=O)C2=CC=CO2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H18N2O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=C(C(=O)C(F)(F)F)C2=CC=CC=C2N1CC(=O)NC1CCCC1 ?",
"input": "",
"output": " C18H19F3N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(CN(CC2=CC3=CC=C(C)C(C)=C3NC2=O)C(=S)NC(C)C2=CC=CC=C2)C=C1 ?",
"input": "",
"output": "Sure. C29H31N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC1=CC=C(C2=NN(CC(=O)NCCC3=CC=C(OC)C(OC)=C3)N=N2)C=C1OCC .",
"input": "",
"output": " C23H29N5O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C(C(C(=O)NCC2=CC=CO2)N(C(=O)CN2N=NC3=CC=CC=C32)C2=CC=CC=C2F)O1 into molecular formula.",
"input": "",
"output": " C26H22FN5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC1=CC=C(N=C2SC3=NC4=C(C)C=CC=C4C=C3CN2C2CCCCC2)C=C1 ?",
"input": "",
"output": "The molecular formula is C26H29N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)NC1=CC=C(NC(=O)C2=CC(S(=O)(=O)N3CCOCC3)=C(Cl)C=C2Cl)C=C1 ?",
"input": "",
"output": " C19H19Cl2N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C1C2CC=CCC2C(=O)N1CC(=O)N(C1=CC=CC(Cl)=C1)C1=NC2=CC=CC=C2S1 ?",
"input": "",
"output": "The molecular formula is C23H18ClN3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(C)C(CSC2=NCCN2C(=O)C2=CC=C(S(=O)(=O)N3CCCC3)C=C2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C23H27N3O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC(C)=CC(NC(=O)C(OC(=O)COC2=CC=C(Cl)C=C2)C2=CC=CC=C2)=C1 .",
"input": "",
"output": " C24H22ClNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC(C(=O)N(CCC(=O)NCCC2=CC=CC=N2)CC2CCCO2)=C(C)O1 ?",
"input": "",
"output": " C22H29N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC1=CC=C(C2C(=C(O)C3=CC=C(OC)C=C3)C(=O)C(=O)N2C2=NC3=CC=C(OC)C=C3S2)C=C1 ?",
"input": "",
"output": "The molecular formula is C28H24N2O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC(C=CC(=O)OCC(=O)C2=CC=C(F)C(F)=C2)=CC=C1O , what would be its molecular formula?",
"input": "",
"output": "It is C18H14F2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C1CC(C2=CC(Cl)=CC3=C2OCOC3)OC2=CC=C([N+](=O)[O-])C=C12 ?",
"input": "",
"output": "Sure. C17H12ClNO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC(C2C3=CCC4C(=O)N(C5CCCCC5)C(=O)C4C3CC3C(=O)N(C4=CC(C5=C(C)C6=CC(Cl)=CC=C6S5)=NN4C)C(=O)C32C)=CC(C)=C1O . Can you tell me?",
"input": "",
"output": "Sure. It's C42H43ClN4O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(N2CCN(C)CC2)=NC(SC(=O)C2=CC=CC([N+](=O)[O-])=C2)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H19N5O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(OC(=O)C=CC1=CC=C(OCC2=CC=C(Cl)C=C2)C=C1)C(=O)C1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H21ClO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC(C=NNC(=O)CCC(=O)NC2=CC=C(C)C=C2)=CC(Br)=C1OCC1=CC=C(Cl)C=C1Cl ?",
"input": "",
"output": " C26H24BrCl2N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC(Cl)=C1NC(=S)NC1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H13ClN2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=CC(C(=O)NCC(=O)N2CCCN2C(=O)C2=CC(C(C)(C)C)=NN2C)=C1 ?",
"input": "",
"output": "The molecular formula is C22H29N5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(C2=CC=C(NC(=O)C3=CC=C([N+](=O)[O-])C=C3)C(C)=C2)=CC=C1NC(=O)C1=CC=C([N+](=O)[O-])C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C28H22N4O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C(C#N)C2=NC(N)=C(C#N)C(C)=C2C1=CC1=CC=C(OCC2=CC=C(Cl)C=C2Cl)C=C1 .",
"input": "",
"output": " C26H18Cl2N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(NCCC1=CC=CC=N1)NC1=CC=CC(C(F)(F)F)=C1F , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H13F4N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C(C(=O)OCC)C1=NC=NC(N)=C1N , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H16N4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NNC1=CC=CC=C1CC1=CC=CC=C1 ?",
"input": "",
"output": " C13H14N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC(=O)CCC(=O)N1CCCN1C(=O)C1=CC=C(Br)C=C1 .",
"input": "",
"output": " C16H19BrN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(=O)NC(=S)NC1=CC=CC2=NC=CC=C12 .",
"input": "",
"output": " C12H11N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)N(CC(=O)N1CCC2=C(C=CS2)C1C1=CC=C(Cl)C=C1)C(=O)C1CCCCC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C25H31ClN2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NC(=S)N1N=C(CC2=CC=CC=C2F)C2=C1NCCCC2 ?",
"input": "",
"output": " C15H17FN4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC(NC(=O)C2=CC=CC=C2)=C(C)C=C1NC(=O)NC1CCCCC1 ?",
"input": "",
"output": " C22H27N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOCCOC(=O)C(C)SC1=NC=NC2=C1C1=C(CC(C)CC1)S2 ?",
"input": "",
"output": "Sure. C18H24N2O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCC1=CC=C(SCC(NC(C)=O)C(=O)NC(C)(C)C)C=C1 .",
"input": "",
"output": " C19H30N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(C)N(CC(=O)N(CC1=CC=CN1C)C1CC1)C(=O)NC1=CC=CC(C(F)(F)F)=C1 .",
"input": "",
"output": " C23H29F3N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COCCCNC(=O)CN(CC1=CC=C(Cl)C=C1Cl)S(=O)(=O)C1=CC=C(Cl)C=C1 .",
"input": "",
"output": " C19H21Cl3N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC(C)NC(=O)C1=CSC(CN(C(=O)NC2=CC=CC(Cl)=C2)C(C)C)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C19H25ClN4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)CNC(=O)N(CC(=O)N(CC1=CC=C(F)C=C1)CC1=CC=CS1)CC1CCCO1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H30FN3O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCOC1=CC=C(C2C(=C(O)C3=CC(C)=CC=C3C)C(=O)C(=O)N2CCCOC)C=C1 ?",
"input": "",
"output": " C26H31NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC(C=CC(=O)C2=CC=C(Cl)C=C2)=CC=C1OC(=O)C1=C(OC)C=CC=C1OC ?",
"input": "",
"output": "Sure. C25H21ClO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=NNC(=O)C1=CC=C(C(C)C)C=C1)C1=CC=CS1 into molecular formula.",
"input": "",
"output": " C16H18N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(NC1=C2CSCC2=NN1C1=CC=C(F)C=C1)C1=CC=CC=C1 ?",
"input": "",
"output": " C18H14FN3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC(=O)CC(C)=NNC(=O)COC1=CC=CC(C)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C15H20N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1C(NC(=O)COC(=O)C2(C3=CC=C(Cl)C=C3)CCCC2)=CC(=O)N(C)C1=O ?",
"input": "",
"output": "The molecular formula is C20H22ClN3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC1=CC=C(C=C2NC(=S)N(CCOC)C2=O)C=C1OCC ?",
"input": "",
"output": " C17H22N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=NN=C(N2C(=O)C3=C(C(=O)C4=CC(Cl)=CC=C4O3)C2C2=CC=CC(O)=C2)S1 , what would be its molecular formula?",
"input": "",
"output": "It is C20H12ClN3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(C2C3=C(CC(C)(C)OC3)NN2C(C)=O)C=C1 ?",
"input": "",
"output": " C17H22N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC1=CC=C(NC(=O)CN2N=C(C3=CC=CC=C3)N(C3=CC(C)=CC=C3C)C2=S)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C26H26N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=C(OC)C(C[NH+]2CCC([NH+]3CC[NH+](CCO)CC3)CC2)=C1 ?",
"input": "",
"output": " C20H36N3O3+3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=CC(C)=C1NC(=S)NNC(N)=S into molecular formula.",
"input": "",
"output": " C10H14N4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCC1(C2=CC=C(F)C=C2)NC(=O)N(CC(=O)NCC2=CC=C3OCOC3=C2)C1=O into molecular formula.",
"input": "",
"output": " C23H24FN3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)CN1C(SC(C)C(=O)N2CCC3=CC=CC=C32)=NC2=CC=CC=C2C1=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H25N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C2C(=O)OC(C(=O)NC3=CC=C([N+](=O)[O-])C=C3C)CC2=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H16N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(NC(=O)C(=O)NN=CC2=CC=C(OCC3=CC=CC=C3Cl)C=C2)C(OC)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H22ClN3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=NC(NC2CCCCC2)=C2C(C)=C(C)SC2=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H21N3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(C23C(=O)N(NC4=CC=C(Cl)C=C4Cl)C(=O)C2CC2C(=CCC4C(=O)N(C5=CC=C([N+](=O)[O-])C=C5)C(=O)C42)C3C2=CC=CC(O)=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C39H30Cl2N4O8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(CCCCCCC(=O)NN=CC1=CC(Br)=CC=C1O)NN=CC1=CC(Br)=CC=C1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H24Br2N4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCC(=O)OC1=CC=CC(C2=C(NC(C)(C)CC(C)(C)C)N3C=CC=C(C)C3=N2)=C1 ?",
"input": "",
"output": " C27H37N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=CC=C1OCCCOC1=CC=C(C=C2C(=N)N3N=C(CC(=O)N4CCCC4)SC3=NC2=O)C=C1 .",
"input": "",
"output": " C28H29N5O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=NNC(=O)C(C)N1N=C(C)C([N+](=O)[O-])=C1C)C1=CC=C(OC(=O)C2=CC=CC=C2)C=C1 ?",
"input": "",
"output": " C23H23N5O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C[Si](C)(C)N=P(CC1=CC=CC(CP(=N[Si](C)(C)C)(C2CCCCC2)C2CCCCC2)=C1)(C1CCCCC1)C1CCCCC1 ?",
"input": "",
"output": " C38H70N2P2Si2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C1OC(C2=CC=CC=C2)C(=C(O)C2=CC=C(Br)C=C2)C1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H11BrO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C1C(OC2=CC=CC=C2Br)=C(C(F)(F)F)OC2=C(CN3CCCCCC3)C(O)=CC=C12 ?",
"input": "",
"output": " C23H21BrF3NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC1=CC=C(C=NNC(=O)C2=CNC3=CC=CC=C23)S1 ?",
"input": "",
"output": "The molecular formula is C16H15N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(=NNC1=CC=CC=C1)C1=CC=CC=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H13N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC12CCCCN1C=CC1=C(CC2)NC2=CC=CC=C12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C19H24N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(NN=CC1=CC=C(C2=CC=C(F)C=C2)O1)C1=CC2=C(C=CC3=CC=CC=C32)O1 ?",
"input": "",
"output": " C24H15FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(C(O)=C2C(=O)C(=O)N(CC3=CC=CN=C3)C2C2=CC=C(C(C)(C)C)C=C2)C(C)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C29H30N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(C=C(C#N)C2=NC(C3=CC4=CC=CC=C4OC3=O)=CS2)C=C1OCC1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C29H20N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)C1=C(C)N=C(NN=CC2=CC=CC=C2[N+](=O)[O-])S1 ?",
"input": "",
"output": " C13H12N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN(CC)CCN1C(=O)C(=O)C(=C(O)C2=CC=C(OC(C)C)C=C2)C1C1=CC=C(Cl)C(Cl)=C1 .",
"input": "",
"output": " C26H30Cl2N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=CC(C)[N+]1=O;CC1=CC=CC(C)[N+]1=O;O=[N+]([O-])O;O=[N+]([O-])O;[Cu] .",
"input": "",
"output": " C14H22CuN4O8+2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(C=NO)C1=CC=CC=C1[N+](=O)[O-] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C8H6N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(O)C=CC(=O)O;O=C1NC2=CC=C(Cl)C=C2C(=O)N1CCCCN1CCN(C2=CC=CC=C2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C26H29ClN4O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(OC)C(CC(NC(C)=O)C(=O)NC2CCN(C(=O)C3=CC=CC(C)=C3)CC2)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C26H33N3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C1C2C(C(=O)N1CC1=CC=CO1)C1C=CC2C12CC2 into molecular formula.",
"input": "",
"output": " C16H15NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(=O)C1=NN(C(C)=O)C2C(=O)N(C3=CC=CC=C3)C(=O)C12 ?",
"input": "",
"output": "Sure. C15H13N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(C23C(=O)N(NC4=CC=C(Cl)C=C4Cl)C(=O)C2CC2C(=CCC4C(=O)N(C5=CC=CC=C5)C(=O)C42)C3C2=CC=C(O)C=C2Cl)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C39H30Cl3N3O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC=CC(C=NNC(=O)CN2N=C(C)C=C2C)=C1 into molecular formula.",
"input": "",
"output": " C15H18N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC1OC2=CC=C(C)C=C2C(=O)C1=CNC1=NC2=CC=C(Cl)C=C2S1 ?",
"input": "",
"output": "The molecular formula is C20H17ClN2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC(=O)CN1C(=NC(=O)C2=CC=CC(OC)=C2)SC2=CC=CC(OC)=C21 ?",
"input": "",
"output": " C19H18N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)C1OCC2(COC(=O)NC3=CC=CC=C3)COC(C(C)C)N12 ?",
"input": "",
"output": " C19H28N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC(C2C3CCCCC3(O)CC[NH+]2CC#N)=CC(OC)=C1OC ?",
"input": "",
"output": "Sure. C20H29N2O4+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOCCCN1C(=O)C2=CC=CC=C2C1NC1=CC=CC(C(=O)NCC(C)C)=C1 into molecular formula.",
"input": "",
"output": " C24H31N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(NS(=O)(=O)C2=CC(C(=O)N3CC[NH+](C)CC3)=CC=C2C)C=C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C21H28N3O3S+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(C1=CC=CO1)N1CC[NH+](C2CC(=O)N(C3=CC=C(F)C=C3)C2=O)CC1 ?",
"input": "",
"output": "The molecular formula is C19H19FN3O4+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=NCCC1=CN=CN1)C1C(=O)N(C2=CC=CC=C2)N=C1C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C22H21N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)OC1=CC=C(C(=O)NCC(C2=CC=C(N(C)C)C=C2)[NH+]2CCOCC2)C=C1 ?",
"input": "",
"output": " C24H34N3O3+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C2C(CC(=O)OCC(=O)NC3=CC=CC=C3[N+](=O)[O-])=COC2=C1C ?",
"input": "",
"output": " C20H18N2O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(OC(=O)C1=CC2=C(CCCCC2)S1)C(=O)NC1=CC=C(C#N)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H20N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(NC(=O)COC(=O)C1=NN(C)C(=O)C2=CC=CC=C12)C1=CC=C(F)C=C1F ?",
"input": "",
"output": " C20H17F2N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCN(CC)S(=O)(=O)C1=CC=C(F)C(C(=O)NC2=CC=C(OC)C=C2OC)=C1 ?",
"input": "",
"output": "The molecular formula is C19H23FN2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(OC(=O)CC1CCCC1)C(=O)NC1=CC=C(F)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H20FNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=O)C1=CC=CC(NC(=O)C(C)SC2=CC=C3C=CC=CC3=N2)=C1 ?",
"input": "",
"output": " C20H18N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC(=O)C1=C(COC(=O)C2=CC=C([N+](=O)[O-])C(C)=C2)NC(=O)NC1C .",
"input": "",
"output": " C17H19N3O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCN(C(=O)COC(=O)C=CC1=C(C)N(C)N=C1C)C1CCS(=O)(=O)C1 into molecular formula.",
"input": "",
"output": " C17H25N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(CC)NC(=O)CSC1=NN=C(C2=CC=C(Cl)C=C2)N1CC1CCCO1 .",
"input": "",
"output": " C20H27ClN4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC=CC=C1CN(C)C(=O)CN1C=NC2=C(C3=C(CC(C)CC3)S2)C1=O into molecular formula.",
"input": "",
"output": " C22H25N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=CC=C1NCC(=O)NN=C(CC1=CC=CC=C1)CC1=CC=CC=C1 .",
"input": "",
"output": " C24H25N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC1=NN(C(=O)C2=CC=C(C(C)(C)C)C=C2)C(O)(C2=CC=C(Br)C=C2)C1 into molecular formula.",
"input": "",
"output": " C22H25BrN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC1CCCCN1CC(O)COC1=CC=CC(C(=O)OC)=C1 ?",
"input": "",
"output": " C18H27NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(CSC1=CC=CC=C1F)NN=CC1=CC=C(C(F)(F)F)C=C1 ?",
"input": "",
"output": " C16H12F4N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(CN(CC2CCCO2)C(=O)C(C)C)C=C1OS(=O)(=O)C(C)C ?",
"input": "",
"output": "The molecular formula is C20H31NO6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(NC(=O)C1CC1)C1C2=CC(OC)=C(OC)C=C2CCN1CC1=CC=C(F)C=C1 ?",
"input": "",
"output": "Sure. C25H31FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C=CCNC(=S)NN=C1CC2C=CCC12 ?",
"input": "",
"output": "Sure. C11H15N3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)NC(=O)NC(=O)COC(=O)C1=CC(Cl)=CC=C1N ?",
"input": "",
"output": " C13H16ClN3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)NC1=CC=C(NC(=O)C(C)OC(=O)C2CCCO2)C=C1 ?",
"input": "",
"output": " C16H20N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COCCNC(=O)C(C)OC(=O)CCNS(=O)(=O)C1=CC=C(Cl)C=C1 into molecular formula.",
"input": "",
"output": " C15H21ClN2O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=CC=C1N1CCN(CC(=O)N(C)CC(=O)NC(C)(C)C)CC1 .",
"input": "",
"output": " C20H32N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of N#CC1=CC=C(C=CC(=O)OCC(=O)NCC2=CC=CC(Cl)=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C19H15ClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(NC(=O)C(C)OC(=O)C(C)NC(=O)C2=CC=CC=C2)C=C1Cl ?",
"input": "",
"output": " C20H21ClN2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)C1=CC=CC(C(C)C)=C1NC(=O)CN1CCCSC2=CC=CC=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C23H30N2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC(=O)NC(=O)C(C)[NH+](C)CC1=CC=CS1 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H17N2O3S+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NC(=O)C1CCCN(C(=O)COC(=O)C=CC2=CC(Cl)=C3OCCCOC3=C2)C1 , what would be its molecular formula?",
"input": "",
"output": "It is C20H23ClN2O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCNC(=O)NC(=O)CSC1=NNC(=O)N1CCC is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H21N5O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C(O)C=CC2=C1OC(=O)C=C2CNC(C)C1=CC=C(Cl)C=C1 .",
"input": "",
"output": " C19H18ClNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC1=CC=CC(C=C2OC3=CC(OCC)=CC=C3C2=O)=C1 .",
"input": "",
"output": " C19H18O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCN(CC(=O)NC1=CC=CC=C1OC)C(=O)CN1C(=O)C2=CC=CC=C2C1=O . Can you tell me?",
"input": "",
"output": "Sure. It's C22H23N3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC(=O)C1=CC=C(OCC2=C(C)ON=C2C)C(OC)=C1 ?",
"input": "",
"output": " C15H17NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NNS(=O)(=O)C1=CC=C(C(F)(F)F)C=C1)C1=CC=CO1 ?",
"input": "",
"output": "The molecular formula is C12H9F3N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC(NC(C)C(=O)NC(=O)OC)C1=CC=C(Br)C=C1 into molecular formula.",
"input": "",
"output": " C14H19BrN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(NC(=O)CN1CCN(C2=CC=CC=C2Cl)CC1)C1=CC=C2OCOC2=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H24ClN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(OC(=O)CCNC(=O)OC(C)(C)C)C(=O)N1CCC2=CC=CC=C21 .",
"input": "",
"output": " C19H26N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=NN(C2=CC=CC=C2Cl)C(Cl)=C1C=C(C#N)C(=O)N1CCCC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H16Cl2N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=C(C(=O)N(CC2=NC(C3=CC=CC=C3)=NO2)C2CCCCC2)C=C1Cl .",
"input": "",
"output": " C23H24ClN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1CN(CC(=O)NC(C)C2=CC=C(Br)C=C2)CC(C)O1 .",
"input": "",
"output": " C16H23BrN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCNC(=O)C(C)OC(=O)CN1C=NC2=C(C(C3=CC=C(F)C=C3)=CS2)C1=O .",
"input": "",
"output": " C19H18FN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN(CC)CC1=CC=C(CNC(=O)CC2SC3=CC=CC=C3NC2=O)C=C1 .",
"input": "",
"output": " C22H27N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(C2=CSC(N3CCN(C)CC3)=N2)=C(C)N1CC1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C21H26N4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)CNC(=O)C(C)OC(=O)C1=CC=CC=C1CSC1=NC2=CC=CC=C2O1 .",
"input": "",
"output": " C22H24N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC([N+](=O)[O-])=CC=C1NC(=O)C(C)OC(=O)C1=CC=C(COC(C)C)C=C1 ?",
"input": "",
"output": " C21H24N2O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=C(S(=O)(=O)N2CC(C3=CC=CC=C3)C(=O)C2=O)C=C1 ?",
"input": "",
"output": " C17H15NO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation N#CC(=CC1=CN(C2=CC=CC=C2)N=C1)C(=O)NC1=CC=CC=C1Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C19H13ClN4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of N#CCOC1=CC=C(C=C(Cl)C2=NC(C3=CC=C(F)C=C3)=NO2)C=C1 ?",
"input": "",
"output": "Sure. C18H11ClFN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(NC(=O)C[NH+](C)CC(=O)NC1=CC=CC=C1Cl)C1=CC=C2CCCCC2=C1 ?",
"input": "",
"output": "The molecular formula is C23H29ClN3O2+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC([NH2+]C(C1=CC=CC=C1)C1=CC=CS1)C(=O)NC1=CC=C(F)C=C1Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H19ClFN2OS+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC(C(=O)OC(C)C(=O)NC2=C(C#N)C=CS2)=C(C)N1CC1=CC=CC=C1 .",
"input": "",
"output": " C22H21N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(Cl)C=C1C[NH+](C)C(C)C(=O)NC1=CC([N+](=O)[O-])=CC=C1OC is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H23ClN3O5+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=C(C(CN2CCOCC2)NC(=O)C=CC2=CC=CC=C2Cl)C=C1 ?",
"input": "",
"output": " C22H25ClN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C[NH+](C)CC[NH+]1CCN(C(=O)CC2=COC3=CC=C4C=CC=CC4=C23)CC1 .",
"input": "",
"output": " C22H29N3O2+2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(C(=O)NNC(=O)CC2=CC=C(F)C=C2)C=C1Br represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H14BrFN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C1N(C[NH+]2CCC3=CC=CC=C3C2)N=NN1C1=CC=CS1 .",
"input": "",
"output": " C15H16N5OS+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CCC1=CC=CC=C1OC1=CC=C(S(=O)(=O)N2CCN(C)CC2)C=C1[N+](=O)[O-] ?",
"input": "",
"output": " C20H23N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCCCNC(=O)CSC1=NC2=CC=C(C)C=C2N1 ?",
"input": "",
"output": "The molecular formula is C15H21N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(NC(=O)CNC(=O)C1=CC=CO1)C1=CC=CC=C1Br , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H15BrN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCN1C(SCC(=O)N2CCN(CC3=CC=NC=C3)CC2)=NN=C1C1=CC=CO1 ?",
"input": "",
"output": "Sure. C20H24N6O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOC(=O)C1=CC(C(=O)N2CCN(C3=CC=[NH+]C=C3)CC2)=CC([N+](=O)[O-])=C1 ?",
"input": "",
"output": " C19H21N4O5+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(SC1=NN=C(C(F)(F)F)N1N)C(=O)NCCC1=CC=C(F)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H15F4N5OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCN1C(C2=CC=CC=C2)=NN(CN2CCN(CC(=O)NC3CC3)CC2)C1=S is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H28N6OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCN1C(N)=C(N2CCOCC2)C(=O)N(CC(=O)N2CCCC2)C1=O ?",
"input": "",
"output": " C17H27N5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(=O)NC(C(=O)N1CCN(S(=O)(=O)C2=CC=CC(F)=C2)CC1)C(C)C ?",
"input": "",
"output": " C17H24FN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(NCC(=O)NC1CCCC2=CC=CC=C21)C1=CC=C(F)C=C1F ?",
"input": "",
"output": " C20H22F2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=C(S(=O)(=O)NC2=CC=CC=C2F)C=C1C(=O)OC(C)C(=O)N(C)C ?",
"input": "",
"output": "The molecular formula is C19H21FN2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CSC2=NC(C[NH+]3CCC(N4C(=O)NC5=CC=CC=C54)CC3)=CC(=O)N12 .",
"input": "",
"output": " C20H22N5O2S+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C1=CC=CC=C1)N(C)C(=O)C1=CSC(C2=CC=C(F)C=C2)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H17FN2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(NC(CC1=CC=CC=C1)C(=O)NCCSC1=CC=CC=C1)OCC1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H26N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC .",
"input": "",
"output": " C62H104O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(OC1=CC=C(Br)C=C1C=NNC(=O)C(OC1=CC=CC=C1)OC1=CC=CC=C1)C1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C28H21BrN2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC1=CC(C=NNC(=O)C2=CC=C(NS(=O)(=O)C3=CC=C(C)C=C3)C=C2)=CC=C1OC(=O)C1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C30H27N3O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)NC1=CC=CN=C1N1CCN(C(=O)C2=CC=C(C(=O)NC(CO)CO)C=N2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C22H30N6O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1CC(CN2CC(=O)NC(=O)C2)CC2C3=CC=CC4=C3C(CN4)CC21 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H26N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC(C)C(=NOC)C(=NN=C(C)C1=CC=CC=C1N(OC)C(=O)OC)C1CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H30N4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1CNCCN1C1=NC=CN=C1OCCOC1=CC=CC2=CC=C(N)N=C12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H24N6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(NC1=CC=CC(C2=NC3=CC=C(C(=O)NC4=CC=C(S(=O)(=O)[O-])C5=CC(S(=O)(=O)[O-])=CC(S(=O)(=O)[O-])=C45)C=C3N2)=C1)NC1=CC=CC(C2=NC3=CC=C(C(=O)NC4=CC=C(S(=O)(=O)[O-])C5=CC(S(=O)(=O)[O-])=CC(S(=O)(=O)[O-])=C45)C=C3N2)=C1;[Na+];[Na+];[Na+];[Na+];[Na+];[Na+] . Can you tell me?",
"input": "",
"output": "Sure. It's C49H28N8Na6O21S6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC=CCC(=O)CCCC#N ?",
"input": "",
"output": "The molecular formula is C9H13NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC(=O)CCCC1OC1COCC1=CC=CC=C1 ?",
"input": "",
"output": " C15H20O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(S(=O)(=O)NC2=C(C(=O)NO)C=NC3=C2C(C)=NN3CC2=CC=CC=C2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H21N5O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC(CC(=O)NC(CC(C)C)C2=CC(CC(C)C(=O)O)=NS2)=CC=C1NC(=O)NC1=CC=CC=C1C , what would be its molecular formula?",
"input": "",
"output": "It is C29H36N4O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOP(=O)(C=C1CCC2C(C1)CC(C(=O)OC)N2C(=O)OC(C)(C)C)OCC ?",
"input": "",
"output": "Sure. C20H34NO7P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)C1=CC=C(CNC(=S)NCC2=CC=C(NS(C)(=O)=O)C(F)=C2)C=C1 ?",
"input": "",
"output": "Sure. C20H26FN3O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC(OCC)P(=O)(O)CC(O)CNC(C)C1=CC=CC(C(=O)O)=C1 into molecular formula.",
"input": "",
"output": " C17H28NO7P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(O)CC1=CC=C2C(=O)CC3=CC=CC=C3C(=O)C2=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H12O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C1C2=CC=CC=C2C2C(C(=O)O)C(C(=O)O)C2C2=CC=CC=C12 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H14O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC(=O)NC1=CC=C(S(=O)(=O)C2=CC=C(CCNCC(O)C3=CC=CC(Cl)=C3)C=C2)C=C1C(=O)O ?",
"input": "",
"output": " C26H27ClN2O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NC1=NC(=O)N(C2OC(CO)(CF)C(O)C2O)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H14FN3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(N(N=CC(=O)O)C2=CC=C(OC)C=C2)C=C1 ?",
"input": "",
"output": " C16H16N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation ClC1=CC=CC2=C1C(OCC1=C(Cl)SC=C1)C(CN1C=CN=C1)S2 , what would be its molecular formula?",
"input": "",
"output": "It is C17H14Cl2N2OS2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN1CCCC1C(=O)NC1=CC=CN=C1 ?",
"input": "",
"output": " C11H15N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(O)C1=C2CCCCC2=C(Br)O1 ?",
"input": "",
"output": "The molecular formula is C9H9BrO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)(C)[Si](C)(C)N1C(=O)C(CC#CCCOC2CCCCO2)C1CC#C[Si](C)(C)C ?",
"input": "",
"output": " C25H43NO3Si2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC(=O)C(C(SC(C1=CC=CC=C1)C(O)C1=CC=CC=C1F)C(C)C)P(=O)(OCC)OCC , what would be its molecular formula?",
"input": "",
"output": "It is C26H36FO6PS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC(OC)=C(C(=O)C=C(C)C2=COC(C3=C(OC)C=C(OC)C=C3OC)=C2)C(OC)=C1 .",
"input": "",
"output": " C26H28O8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(C2C(C(=O)C3=CC=CC=C3)C(N)=C(C#N)C2(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C32H26N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC(Br)=C2NC3C4=C(SCC3C(C)(C)C2=C1)N(C1=CC=CC=C1)N=C4C1=CC=CC=C1 ?",
"input": "",
"output": " C28H26BrN3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCOC(=O)C(CC=CC(C)O[Si](C)(C)C(C)(C)C)NC(C1=CC=CC=C1)C1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C30H45NO3Si .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC[Si](CC)(CC)N=CC1=CC=CC=C1 ?",
"input": "",
"output": " C13H21NSi ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(CCCOC1=CC=CC(Cl)=C1C1=C2C=CC(=C(C3=CC(Cl)=CC(Cl)=C3)C3=CC=C(N3)C(C3=C(Cl)C=CC=C3Cl)=C3C=CC(=N3)C(C3=C(Cl)C=CC=C3Cl)=C3C=CC1=N3)N2)(C(=O)O)C1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C56H37Cl7N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCB(CC)C1C(C)=CCC2C1C2(C)C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H25B ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CNC(=O)CN(CC(OC)OC)C(=S)NC1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H21N3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)N1C(=O)CN(CC2=CC=CC=C2)C(=O)C1CC1=CN(C)C2=CC=CC=C12 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C23H23N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=C(C2=CC=CC=C2OC(O)=C[N+]#N)C2=CC(C)=CC=C2O1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H15N2O4+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=NC=CC=C1C1=CC=C(N)N=C1C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H13N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCC(O)C(CNCC1=CC=C(C)C=C1C)NC(=O)CC(=O)NC1=CC(NC)=CC(C(F)(F)F)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C26H35F3N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(COCC2=C(Br)C(O[Si](C)(C)C(C)(C)C)CCC2(C)C)C=C1OC ?",
"input": "",
"output": "Sure. C24H39BrO4Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=CC2=C1C(=O)OC(CC#C[Si](C(C)C)(C(C)C)C(C)C)CCCCC=CC2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C28H42O3Si .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CON(C)C(=O)C(C)(C)N ?",
"input": "",
"output": "The molecular formula is C6H14N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC2=C(C=C1OC)C1=CC3=C(CCCC3)C(=O)N1CC2 ?",
"input": "",
"output": " C19H21NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC(=O)CNC1=CC=C(CN)C=C1F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H13FN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CCOC(=O)NC(COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C(=O)OC ?",
"input": "",
"output": " C20H33NO15 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(CCN(CCCNC(=O)OC(C)(C)C)S(=O)(=O)C1=CC=CC=C1[N+](=O)[O-])N(CCCCN)S(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] .",
"input": "",
"output": " C28H42N6O10S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(S(=O)(=O)NCCCOS(C)(=O)=O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H17NO5S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COCCNC(=O)C1C[NH+]2CCC1CC2CN1C=C(C[NH3+])N=N1 ?",
"input": "",
"output": "The molecular formula is C15H28N6O2+2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COCOC(C1SCCCS1)C1(C)OC(CCO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC1OCC1=CC=C(OC)C=C1 ?",
"input": "",
"output": " C35H64O7S2Si2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)C1=NOC(O)(C(Cl)(Cl)Cl)C1 ?",
"input": "",
"output": " C7H10Cl3NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(O)C1(O)C(=O)C=CC1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C8H10O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(C2=NC(C)(C)CO2)C(C=O)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H15NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C1CCC2=CC=CC(OCC3CO3)=C12 ?",
"input": "",
"output": "The molecular formula is C12H12O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(CC2=CC=CN=C2)C=C1 ?",
"input": "",
"output": " C13H13N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation OCC1CCCC(O)C1O , what would be its molecular formula?",
"input": "",
"output": "It is C7H14O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOP(=O)(OCC)C1=CN=CN=C1OC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C9H15N2O4P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(C2=NC3=CC=NC=C3N2)C=C1;Cl .",
"input": "",
"output": " C13H12ClN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=C(C2=CC=CC=C2)C(=O)CC1C , what would be its molecular formula?",
"input": "",
"output": "It is C13H14O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC=C1CCC2=C(C3=CC=CC=C3)C=C(C3=CC=CC=C3)[O+]=C12 .",
"input": "",
"output": " C23H21O2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C1=CC=C(SC2=CC=C(SC3=CC=CC=C3)N2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H13NS2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC(=O)C1=C(C)NCN1 . Can you tell me?",
"input": "",
"output": "Sure. It's C7H12N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code FC(C(F)(F)F)C(F)(C1CCCO1)C(F)(F)F , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C8H8F8O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C2C(Cl)=C(C=O)C(C)(C)OC2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H13ClO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=C1CC1)C(C)O . Can you tell me?",
"input": "",
"output": "Sure. It's C7H12O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=C(C2=C(C3=CC=C(OC)C=C3)SC(C)C(C=O)=C2)C=C1 ?",
"input": "",
"output": " C21H20O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C1=C2C=C3CC3=CC2=CO1 ?",
"input": "",
"output": "Sure. C9H6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C[N+]1([O-])CCC2=CC3=C(OCO3)C3=C2C1C(O)C1=CC=CC=C13 ?",
"input": "",
"output": " C18H17NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(CC2=CC(C(C)=O)=C(O)C(CC3=CC=C(OC)C=C3)=C2O)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C24H24O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C(CCNCCCN2C(=O)C3=CC(OC)=C(OC)C=C3C(C)(C)C2=O)C=C1OC , what would be its molecular formula?",
"input": "",
"output": "It is C26H34N2O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC1=NN(C)C(C(=O)NCC2=CC=C(C(C)(C)C)C=C2)=C1Br . Can you tell me?",
"input": "",
"output": "Sure. It's C18H24BrN3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " OC1CCCC1C1=NNC(=S)N1C1=CC=CC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H15N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)C1=C(S(=O)(=O)C2=CC=C(OCCCN(C)C3CCCC4=CC=CC=C43)C=C2)N=CO1 ?",
"input": "",
"output": " C26H32N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1CCC2=C(C(=O)O)N(C)N=C21 .",
"input": "",
"output": " C9H12N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)OC(=O)C(CCC1=CC=C([N+](=O)[O-])C=C1)N1CCNCCNCCNCC1 ?",
"input": "",
"output": " C22H37N5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCC1=NC2=CC=CC(C(=O)OCC3=CC=NC=C3)=C2N1CC1=CC=C(C2=CC=CC=C2C2=NNN=N2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C32H29N7O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=C(C)C(=O)OCCS(=O)(=O)C(C)(C)C .",
"input": "",
"output": " C10H18O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(CN1CCN(C2=CC=C(F)C=C2)CC1)NC1=NC2=CC3=C(C=C2S1)SC(NC(=O)CN1CCN(C2=CC=C(F)C=C2)CC1)=N3 ?",
"input": "",
"output": " C32H32F2N8O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(CO)C1=CC=C(F)C=C1F into molecular formula.",
"input": "",
"output": " C8H6F2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=CC(N=C2SCC(=O)N2CC2=CC=CC=C2)=N1 ?",
"input": "",
"output": "The molecular formula is C16H15N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC(=O)C1NN=C(C(=O)NS(=O)(=O)C2=CC=C([N+](=O)[O-])C=C2)C2=CC=CC=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C17H14N4O7S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(C)C(=P)C1=CC=CC=C1 .",
"input": "",
"output": " C9H12NP ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=CCC1C(CC)CCCC1(O)CC=C ?",
"input": "",
"output": " C14H24O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of N#CC(CO)(CC1=CC=CC=C1)CC1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C17H17NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C1N=CC(Cl)=CN1COCC1=CC=CC2=CC=CC=C12 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H13ClN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=C(C(=O)O)C(C)(C)CCC1O .",
"input": "",
"output": " C10H16O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(C1=CC=CC2C1=NC1=CC=CC=C1C2NCCC1=CNC2=CC=CC=C12)N1CCOCC1 ?",
"input": "",
"output": " C28H28N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC(CN2C3=C(CC4(O)C5CC6=CC=C(O)C7=C6C4(CCN5CC4CC4)C3O7)C3=CC=CC(C)=C32)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C35H36N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC1=CC=C(N(C2=NC(C3=CC=C(OC)C(OC)=C3)=NO2)C2=NC(C3=CC=C(OC)C(OC)=C3)=NO2)C=C1 ?",
"input": "",
"output": " C28H27N5O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC(=O)C1CCN(S(=O)(=O)C2=CC3=C4C(=C2)C(C)C(=O)N4CCC3)CC1 into molecular formula.",
"input": "",
"output": " C19H24N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1C2OP(=O)(O)OCC2OC1N1C(SC)=NC2=C(N)N=CN=C21 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H16N5O6PS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=C(OC)C(C=CC2=NC=CC(OC)=C2OC)=C1 ?",
"input": "",
"output": " C17H19NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)(C)OC(=O)NCC(=O)NCC(=O)NCCNC1=CC=C([N+](=O)[O-])C=C1[N+](=O)[O-] ?",
"input": "",
"output": " C17H24N6O8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(C)C(NC(=O)C(C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(=O)O)NC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(C)NC(=O)C(CCC(=O)O)NC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(NC(=O)C(N)C(C)O)C(C)O)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CC1=CC=C(O)C=C1)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(C(=O)NC(CCC(=O)O)C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(N)=O)C(=O)NC(CCC(N)=O)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)NC(CCC(=O)O)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CC(C)C)C(=O)O)C(C)CC)C(C)CC ?",
"input": "",
"output": "Sure. C193H304N54O62 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(NC1=CC=CC=C1C(=O)N1CCCCC1)C1=CC=C2C(=O)OC(C3=CC=CC=C3)CC2=C1 ?",
"input": "",
"output": " C28H26N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=CCN1C(SCC(=O)C2=C(C)N(C3=NOC(C)=C3)C(C)=C2)=NN=C1C1=C(C)OC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H23N5O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(CN1N=C(C2=CC=CS2)OC1=O)NC1=CC(C(F)(F)F)=CC=C1N1CCOCC1 ?",
"input": "",
"output": "The molecular formula is C19H17F3N4O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(NC(=O)CC2=NC(CSC3=NN=C(CC4CCS(=O)(=O)C4)O3)=CS2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C20H22N4O4S3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN1C=CN=C1C(NC(=O)C1=CC2=C(CCCC2)S1)C1=CC=C(Cl)C=C1 into molecular formula.",
"input": "",
"output": " C20H20ClN3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCN1C(N)=C(N(CC2=CC=CC=C2)C(=O)CN2N=NC(C3=CC=CC=C3C)=N2)C(=O)NC1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C25H28N8O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(OCCCC(=O)N2CCCC3=CC(S(=O)(=O)N4CCOCC4)=CC=C32)=CC=C1Cl , what would be its molecular formula?",
"input": "",
"output": "It is C24H29ClN2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1(C)OC2OC(C(=O)OC3=C(Br)C=C(Br)C=C3Br)C3OC(C)(C)OC3C2O1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H19Br3O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CN=C(C(=O)OCC(=O)NNC(=O)C2=CC=C(F)C=C2)C=N1 ?",
"input": "",
"output": "The molecular formula is C15H13FN4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(C(=O)NCC(=O)OCC(=O)N(CC2=CC=CC=C2)C2=NC(C3=CC=C(Cl)C=C3)=CS2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C28H24ClN3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCN1C(=O)C(CC(=O)NC2=CC=CC(Cl)=C2)SC1=NC1=CC=C(C)C=C1 ?",
"input": "",
"output": " C21H22ClN3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(OCC(=O)OC(C(N)=O)C2=CC=CC=C2)=CC=C1Cl ?",
"input": "",
"output": "The molecular formula is C17H16ClNO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=C(CNC(=O)CCNC(=O)NC2CCCCC2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H27N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN1CC2CC(C1)C1=CC=CC(=O)N1C2 ?",
"input": "",
"output": " C13H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(NC1=NC(C2=CC=NC=C2)=CS1)C1=CC=C(NS(=O)(=O)C2=CC=C(F)C=C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C21H15FN4O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(S(=O)(=O)CC(=O)N(CCCN(C)C)C2=NC3=C(C)C=C(Cl)C=C3S2)C=C1;Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H27Cl2N3O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC(=O)C1=CC=CC=C1C(=O)NCC1=NOC(C2=CC=C(C)C=C2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C20H18N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC1=CC=C(C(=O)NCCCC2=CC=C(N3CCCC3)C=C2)C=C1 ?",
"input": "",
"output": " C22H28N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCCCCCOC1=CC=C(C(=O)N(CC2=CC=C(Cl)C=C2Cl)C2CCS(=O)(=O)C2)C=C1 .",
"input": "",
"output": " C25H31Cl2NO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C(C2=NN(C3=CC=CC(F)=C3)C(C3=CC=C(C)C(C)=C3)=C2)C=C1C into molecular formula.",
"input": "",
"output": " C25H23FN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(NC(=S)NC1=CC=CC=C1OCCOC1=CC=CC=C1)C1=CC=C(OCCOC2=CC=CC=C2)C=C1 ?",
"input": "",
"output": " C30H28N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(CC(=O)NC2=CC=CC=C2OCC2CCCO2)C=C1 ?",
"input": "",
"output": "Sure. C20H23NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCN1CCCC1CNCCC1=CC=CC=C1;Cl;Cl ?",
"input": "",
"output": "Sure. C15H26Cl2N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC1=NN=C(NC(=O)C2=CC=CC=C2NC(=O)CCS(=O)(=O)CC2=CC=CC=C2)S1 .",
"input": "",
"output": " C21H22N4O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CCNC(=S)NC(C)(C)C .",
"input": "",
"output": " C8H16N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(=O)C1=CC=CC(NC(=O)CC2=CSC(C3=CC=CS3)=N2)=C1 ?",
"input": "",
"output": "Sure. C17H14N2O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN(CC(=O)NC1=CC=C(N2CCOCC2)C=C1)C(=O)C=CC1=CC2=CC=CC=C2O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H25N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC(=O)C1=C(CSC2=NN=C(NC3=C(C)C=CC=C3C)S2)NC(=O)NC1C1=CC=CO1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H23N5O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=NN(C)C(Cl)=C1C(=O)N1CCN(C(C(N)=O)C2=CC=C(Cl)C=C2)CC1 .",
"input": "",
"output": " C18H21Cl2N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(C)N1C(=O)C(=CC2=C(N3CC(C)CC(C)C3)N=C3C=CC=CN3C2=O)SC1=S , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C23H28N4O2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC(CNS(=O)(=O)CC2=CC=CC=C2C)=CC=C1OC(C)C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H25NO4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COCN1C=CC2=C(N3CCN(C(C(=O)C4CCCCC4)C4CCC5=CC=CC=C5N4)CC3)C=CC=C21 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C31H40N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(C1=CC=C(Cl)C=C1)N1CCCCC1C1=NC2=CC=CC=C2S1 ?",
"input": "",
"output": "The molecular formula is C19H17ClN2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(C)C=C1C(=O)CCC(=O)NC1=NC(C)=CS1 .",
"input": "",
"output": " C16H18N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)C(NCC(=O)NCC1=CC=CC=C1)C1=CC=C(Cl)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C19H23ClN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(SC1=NNC(C(C)(C)C)=N1)C(=O)NC(=O)NC1=CC=CC=C1 .",
"input": "",
"output": " C16H21N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C(C(=O)OCC2=CC(=O)N3C=C(Cl)C=CC3=N2)C(C)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H15ClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(C)(C)N(C(=O)C(CC1=CC=CC=C1)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)C1=CC=CC=C1 ?",
"input": "",
"output": "Sure. C33H47N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(O)C(NC(=O)C(CC1=CC=C(O)C=C1)NC(=O)C(N)CC1=CN=CN1)C(=O)O , what would be its molecular formula?",
"input": "",
"output": "It is C19H25N5O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(=O)C1=CC=C(NC(=O)C2=CC=CC=C2OCC2=CN3C=CC=CC3=N2)C=C1 .",
"input": "",
"output": " C23H19N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCCN1C=NC2=C(OCC)N=C(NC3=CC=CC=C3)N=C21 ?",
"input": "",
"output": " C18H23N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for NCC(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)O .",
"input": "",
"output": " C20H31N7O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NCC(=O)NC(CC1=CC=C(O)C=C1)C(=O)NC(CC(N)=O)C(=O)NC(CS)C(=O)O ?",
"input": "",
"output": " C18H25N5O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)OC1=CC=C(N2CC(C(=O)NCC(C)C3=CC=CC=C3)CC2=O)C=C1 ?",
"input": "",
"output": " C23H28N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of N#CC1=CC=CC(C2=CN=C(C(=O)NC3CC4CCC3N4)O2)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H16N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=S(=O)(C1=CC=C2OCCOC2=C1)N1CCN2C=CC=C2C1C1=CC=C(Cl)C=C1Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H18Cl2N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(N2N=NC3=C(N4CCN(C(=O)C=CC5=CC=C6OCOC6=C5)CC4)N=CN=C32)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H23N7O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(=O)NC1=CC=CC(C2=CC=C(C(C)(O)C3=CN=CN3)C=C2)=C1 .",
"input": "",
"output": " C19H19N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC(C2=C(C3=CC=C(S(N)(=O)=O)C=C3)N=C(CC3=CC=CC=C3)O2)=CC=C1Cl ?",
"input": "",
"output": "Sure. C23H19ClN2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC(C)C1=CC=CC=C1[N+](=O)[O-] , what would be its molecular formula?",
"input": "",
"output": "It is C9H11NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=C([N+](=O)[O-])C=C1NC(=O)C(SC1=CC=CC(NC(=O)CCC(=O)O)=C1)C1=CC=CC=C1 ?",
"input": "",
"output": " C25H23N3O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(SC1=CC=CC(NC(=O)C2=CC=C(OC)C=C2)=C1)C(=O)NC1=CC(Cl)=CC=C1Cl .",
"input": "",
"output": " C24H22Cl2N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC1=CC2=C(S1)N1C(C)=NN=C1C(NC(=O)NC1=CC=CC=C1)N=C2C1=CC=CC=C1Cl ?",
"input": "",
"output": " C24H21ClN6OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " OC1=C(C2=CC=CC=C2)C=C(CCCCCC2=CC(C3=CC=CC=C3)=C(O)C(C3=CC=CC=C3)=C2)C=C1C1=CC=CC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C41H36O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(O)C(=O)C1=CC=C(OCCCC(O)C2=CC=C3C=CC=CC3=C2)C=C1 ?",
"input": "",
"output": "Sure. C22H20O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCCCCCCCCC[NH2+]C(CC)S(=O)(=O)[O-] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H37NO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCCOC1=CC=C(C=C2C(=O)N(CCC3=CC=CC=C3)C(=O)C(C#N)=C2C)C=C1OCC is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C29H32N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC1=CC=C(C=C(NC(=O)C2=CC=CC=C2)C(=O)NC2=CC=CC(SC(C)C(=O)NC3=CC(C(=O)O)=CC=C3Cl)=C2)C=C1 .",
"input": "",
"output": " C34H30ClN3O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(O)C1=CN(C2=CC=C(F)C=C2F)C2=NC(Cl)=CC=C2C1=O .",
"input": "",
"output": " C15H7ClF2N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(=O)CC(=O)C(=O)[O-];CC(=O)CC(=O)C(=O)[O-];[Zn+2] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H10O8Zn .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCN1C=CC(CN(C)C(=O)C2=CC=C(COC3=C(C)C=CC=C3C)C=C2)=N1 ?",
"input": "",
"output": "The molecular formula is C23H27N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOCC1=CC(C=CC(=O)C2=NN(C)C=C2)=CC=C1OC ?",
"input": "",
"output": " C17H20N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(C=CC(=O)C2=CC=C(N3C=CN=C3)C=C2)C=C1OC ?",
"input": "",
"output": "Sure. C20H18N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCN1C(SCC(=O)NC2=NC(C3=CC=C(Cl)C=C3)=CS2)=NN=C1C(C)OC1=CC=C(F)C=C1Cl into molecular formula.",
"input": "",
"output": " C23H20Cl2FN5O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN1C(SCC(=O)NC2=CC=C(C)C=C2)=NN=C1C(C)OC1=CC=C(C)C=C1C .",
"input": "",
"output": " C23H28N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C1=C(NC(=O)C(=O)NN=CC2=CC=CC(Cl)=C2Cl)SC2=C1CCCCC2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C21H21Cl2N3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC1=CC(C=C2N=C(C3=CC=C(C4=CC=CC=C4)C=C3)OC2=O)=CC(Cl)=C1OCCC1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C32H26ClNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CSC1=CC=C(CCCC(SCCC(=O)O)C2=CC=C(OCC3=CC=C4C=CC=CC4=N3)C=C2)C=C1 ?",
"input": "",
"output": "Sure. C30H31NO3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCOC(=O)C1=NC=CC=C1CBr is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H12BrNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CS(=O)(=O)OCCC1=CSC2=CC(OS(C)(=O)=O)=CC=C12 ?",
"input": "",
"output": " C12H14O6S3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COCCOCCOCCC(CCOCCOCCOC)(C(=O)O)C(=O)O;NCCN is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H40N2O10 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(C)C1=CC=C(C(C)(C(=O)O)C2=CC=C(N3CCOCC3)C=C2)C=C1 ?",
"input": "",
"output": " C21H26N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCOC1=C(C)C(OC(=O)CC)=C2C=CC=CC2=C1O ?",
"input": "",
"output": " C17H20O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(S(=O)(=O)N(C)C2CCCCC2O)C=C1C(=O)N1CCCC1 ?",
"input": "",
"output": " C19H28N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COCC1=C(OC)N=C(C(C)C)C(C=CC=O)=C1C1=CC=C(F)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C20H22FNO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NC(=O)CC(NC(=O)C(CC1=CN=CN1)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(N)CC1=CNC2=CC=CC=C12)C(=O)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C30H34N8O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C(F)=C(C)N , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C6H10FNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)C(N)C(=O)NC(CC(N)=O)C(=O)NC(CC1=CC=CC=C1)C(=O)N1CCCC1C(=O)O . Can you tell me?",
"input": "",
"output": "Sure. It's C23H33N5O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)C1=C(O)C(=O)N(CCO)C1C1=CC=CC(O)=C1 ?",
"input": "",
"output": " C14H15NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCCCCCCOC(=O)C1=CC=C(C2=CC=C(C(=O)[O-])C(C3=CC=C(C(=O)OCCCCCCCC)C=C3)=C2C(=O)[O-])C=C1 ?",
"input": "",
"output": "Sure. C38H44O8-2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC1=C(N)CCCC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C8H15N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCC1COC(C2=CC=C(C3=CC=C(CCC)N=C3)S2)OC1 .",
"input": "",
"output": " C20H27NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(CS(=O)C2=NC3=CC=C(OC(F)F)C=C3N2)N=C1 ?",
"input": "",
"output": " C15H13F2N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(=CCN1C=CN=C1)C1=CC=C(C2=CC=CC=C2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H18N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COP(=O)(O)C(C=O)C1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C9H11O4P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCCCCCCCCC1(CCN2C=CN=C2)SCCC(CC)S1 into molecular formula.",
"input": "",
"output": " C23H42N2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(O)C1CCC(CNCC2=CC=C(O)C=C2)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C15H21NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C[N+](C)(C)CC(=O)[O-];O=S(=O)(O)CC1CC[NH2+]C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H23N2O5S+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=NOC(C)=C1C(O)C(C1=CC=CC=N1)C(NC1=CC=CC=N1)C1=CC=CC=C1NC(=O)CCCCCCCCCCCNC(=O)C(O)C(O)C(O)C(O)CO .",
"input": "",
"output": " C42H58N6O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)OC1C2=CC(NCC3=CC=CC(Cl)=C3)=CC=C2OC(C)(C)C1OCC1=CC=C2C=CC=CC2=C1 ?",
"input": "",
"output": "The molecular formula is C32H34ClNO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC(OS(=O)[O-])=CC=C1S(=O)(=O)[O-];[Na+];[Na+] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C7H6Na2O6S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=C(C(=O)NCCC2=CCCCC2)OC2=CC=C3OC(C)(C)CC(=O)C3=C12 ?",
"input": "",
"output": "The molecular formula is C23H27NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC1=CC(NC2=NC=NC3=C2C(C)=C(C(=O)OCCOC)S3)=C(OCC)C=C1NC(=O)C1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C28H30N4O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(=O)N1CN(C(N)=O)C2=CC=C(N3C(C)=NC(OCC4=CC=C(F)C=C4F)=C(Cl)C3=O)C=C21 ?",
"input": "",
"output": "The molecular formula is C22H18ClF2N5O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(OC1=CC(C2=CC=C(C(=O)N3CCCC3)C=C2)=CN=C1N)C1=C(Cl)C=CC(F)=C1Cl .",
"input": "",
"output": " C24H22Cl2FN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=C(C2=CC=C(C=CC(=O)NC(=S)NC3=CC=CC(NC(=O)C4=CC=C(Cl)C=C4Cl)=C3)O2)C=C1Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C28H20Cl3N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCCCCCCCC1=CC=CC=C1;[Na+];[Na+] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H30Na2+2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC1=CC=C(C2(CCCC3=CC=C(F)C(OC4=CC=CC=C4)=C3)CCCC2)C=C1 .",
"input": "",
"output": " C28H31FO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCN1C(SCC2=CC=CC3=CC=CC=C23)=NN=C1C1=CC=C(N2C(=O)C3=CC=CC=C3C2=O)C=C1 ?",
"input": "",
"output": " C29H22N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(SC1=CC=C(NC(=O)C(=CC2=CC=CC=C2[N+](=O)[O-])NC(=O)C2=CC=CC=C2)C=C1)C(=O)NC1=CC=C(OC2=CC=CC=C2)C=C1 ?",
"input": "",
"output": " C37H30N4O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NC(=NC1CC2C=CC1C2)NC1=CC=NC=C1 ?",
"input": "",
"output": "Sure. C13H16N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(NCCCCCCCNC(=O)C1=CC=C(OCC=C(F)F)C=C1)C1=CC=C(OCC=C(F)F)C=C1 ?",
"input": "",
"output": " C27H30F4N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(F)C=C1C1(C)CCC(=O)CC1 ?",
"input": "",
"output": "Sure. C14H17FO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC=CCCC(CC)CCCC(=O)O ?",
"input": "",
"output": "Sure. C12H22O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(NC2=CC(C)=NC3=CC=C4NC(=O)NC4=C23)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H16N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCOC1N(C2=CC=C(C)C=C2)NC(=O)C1(C)C into molecular formula.",
"input": "",
"output": " C16H24N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCCCCC([O-])=NC1=C(C#N)N=CN1CC1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C19H23N4O- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC[NH+](CC)CC[NH2+]C1=NC=CC2=C(C)C3=C(C4=CN=CC=C4[NH2+]3)C(C)=C12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H30N5+3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C1NC(CC2=CC=C(O)C=C2)C(=O)N2CCCC2C(=O)N2CCCC2C(=O)NC1CC1=CC=C(O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C28H32N4O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1(C)C=CC2=CC3=C(C=C2O1)OCCOCCOCCOCCOCCO3 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H30O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(O)C(=O)C=CC1=CC=CN=C1 ?",
"input": "",
"output": "The molecular formula is C11H13NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=C(C=O)C(C)=C(Cl)C2=C1C=CC(C)(CCC=C(C)C)O2 .",
"input": "",
"output": " C19H23ClO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(O)CCNC(=O)C[N+]1=CC=C(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)CSC4=CC(Cl)=CC=C4Cl)C3SC2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C26H25Cl2N4O7S3+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCC1CCC2C3=CC(F)=CC(F)=C3CCC2C1C1=CC=C(Cl)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C23H25ClF2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)C1=C(SC2=CC=CC=C2)N(CC2=CC=CC=N2)C(CCN=[N+]=[N-])=N1 ?",
"input": "",
"output": " C20H22N6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CS(=O)(=O)NC1=CC=CC=C1C1CCNCC1 .",
"input": "",
"output": " C12H18N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(CC1(C2=CC=C(C3=CC=C(C4=CN=CO4)C=C3)S2)CCN(C(=O)C2=CNN=C2)CCS1(=O)=O)NO ?",
"input": "",
"output": " C24H23N5O6S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCSC12N=CN(C3OC(CO)C(O)C3O)C1=NCN=C2N ?",
"input": "",
"output": "The molecular formula is C13H21N5O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC1(CC)CC(OC(=O)C2=CC=CC=C2)CC(C)(C)N1OC(C)C1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C26H35NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CCC1COC(C2CCC(C3=CC=C(C#N)C=C3)CC2)OC1C . Can you tell me?",
"input": "",
"output": "Sure. It's C21H27NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NC1=NC=C(O)C=C1Cl ?",
"input": "",
"output": "Sure. C5H5ClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C2N=CC(N(C)C)=C(CCCC3(C(=O)NO)CCN(CC#CC4=CC(F)=CC(F)=C4F)CC3)C2=C1 ?",
"input": "",
"output": " C30H33F3N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NCCCC(=O)N1CCN(C(=O)C2=CC=CO2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H19N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule FC1=CC=C(OCCCN2CCC3C(C2)C2=CC=CC4=C2N3CCO4)C=C1 .",
"input": "",
"output": " C22H25FN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=CC(CN2C=NC(NS(=O)(=O)C3=CC=CC=C3)=N2)=C1 ?",
"input": "",
"output": "The molecular formula is C16H16N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC(=O)C1=CC=C(NS(=O)(=O)C2=CC=CC3=NON=C23)C=C1 into molecular formula.",
"input": "",
"output": " C15H13N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=CC1NCC(=S)C1C(=O)C1CCCN1C(=O)CCCCCC1=CC2=CC=CC=C2C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C25H30N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCCCCCCCCCCCOC(=O)NC(CCCCN)C(=O)O ?",
"input": "",
"output": " C21H42N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN(C)C(=O)OC1=CC=C(CC(NC2=NC=NC(NCC3=CC=CN=C3)=N2)C(=O)O)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H23N7O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1(C(=O)O)CCC(C(=O)NC(CC2=CC=C(OCC3=C(Cl)C=CC=C3Cl)C(Cl)=N2)C(=O)O)C1(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C25H27Cl3N2O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1(C)CC=CCN(S(=O)(=O)C2=CC=CC=N2)C1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H18N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=CC(C)CCC(C(O)N1C2=CC=CC=C2OCC1C1=CC=C(OC)C=C1)N(CC)CC represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C27H38N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=CC=C1C(=O)COC(=O)C1=CC=C(N2C(=O)CC(SC3=CC=C(N)C=C3)C2=O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C26H22N2O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)N(C1=CC=CC=C1)S(=O)(=O)C1=CC=C(Cl)C(N2C(=O)NC3=CC=CC=C3C2=O)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C23H20ClN3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(NC1=CC=C(F)C=C1)N1CC(N(CCO)CCO)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H20FN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC(N2CCN(CC3CC3)CC2)=C(C2CCC(C(C)(C)C)CC2)C=C1N1CCC(OC)CC1;Cl . Can you tell me?",
"input": "",
"output": "Sure. It's C31H52ClN3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1=C(O)C=C(O)C(C2=CC=CC(N)=C2)=C1CCOCC(O)CO ?",
"input": "",
"output": "Sure. C19H25NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(=O)N(C(C)=O)C1=CCCCCC1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C11H15NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=CC(=O)NCS(=O)(=O)CCC into molecular formula.",
"input": "",
"output": " C7H13NO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1CC=C(C2=CN(S(=O)(=O)C3=CC=C(C(C)(C)C)C=C3)C3=CC=C(C(F)(F)F)C=C23)CC1;Cl ?",
"input": "",
"output": "The molecular formula is C25H28ClF3N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1CC23CCC4C(C)(C)CCCC4(C)C2CCC1C3 ?",
"input": "",
"output": " C20H34 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1CCC(NC(=O)CC2=CC=C3SC=NC3=C2)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C15H19N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for FP123N4CCCN1CCN2CCCN3CC4 .",
"input": "",
"output": " C10H20FN4P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN1C=CN=C1SC1=CC=C(NC2=C(C#N)C=NC3=CC(C4=CC=C(CNCCO)S4)=CC=C23)C=C1Cl ?",
"input": "",
"output": " C27H23ClN6OS2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=CC(C2=C3CN(C)CCC3=NC3=C2C(N)=C(C(=O)C2=CC=C(Cl)C=C2)S3)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C25H22ClN3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC(=O)C1=CC=CC=C1NC1=NC=NC(NC2=CC=CC=C2C(F)(F)F)=C1[N+](=O)[O-] ?",
"input": "",
"output": "Sure. C20H16F3N5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=CC(N(C2=CC=CC(C)=C2)C2=CC3=C4C=CC=CC4=CC=C3C3=CC=CC=C23)=C1 .",
"input": "",
"output": " C32H25N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(I)=CC=C1N1COC(=O)C2=CC(C(=O)N3CCSC3)=C(F)C(F)=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C19H15F2IN2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC1=CC=C(C2(O)CSC3=C(C#N)C(C4=CC=C(O)C(OCC)=C4)CC(=O)N32)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C24H24N2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1(C)CC(=O)C2=C(C1)N=C1SC(=CC3=CC=C4C=CN=CC4=C3)C(=O)N1C2C1=CC=C(Cl)C=C1 ?",
"input": "",
"output": "The molecular formula is C28H22ClN3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC1=CC=C(NC(=O)C2C3SC4(CC3Br)C2C(=O)N(C(C)CO)C4C(=O)NCCN2CCOCC2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C27H37BrN4O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=CC(C(O)CCC(=CC1=CC=C(O)C=C1Cl)CCC)C(O)COCC1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C26H33ClO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCN1C(=O)C2CC(CO[Si](C3=CC=CC=C3)(C3=CC=CC=C3)C(C)(C)C)=C3C(CCC(=CC4=CC=C(O)C5=CC=CC=C45)CC)OB(O)CC3C2C1=O ?",
"input": "",
"output": " C46H54BNO6Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(C)=CC(NC(=O)C(C)SC2=NC3=CC=CC=C3N2)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H19N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1C(CCC2=CC=CC(N3CCCCC3=O)=C2)OC(CCN2C=C(C(CO)C3=CC=CC=C3)N=N2)C1[Si](C)(C)F ?",
"input": "",
"output": "Sure. C32H43FN4O3Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(N2C(=O)CC(N(C(=O)CC3=CC=C(Cl)C=C3)C3CCCC3)C2=O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H25ClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCCN1CC=CC23SC4C=CCN(C5=CC=C(OCC)C=C5)C(=O)C4C2C(=O)N(CCO)C3C1=O ?",
"input": "",
"output": "Sure. C28H35N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C(OCC(O)CN(CC2=CC=CO2)CC2=CC=CC=C2OC)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C23H27NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC(C)=CC(OCC(O)CN(CC2=CC=CC=C2F)C2CCS(=O)(=O)C2)=C1 into molecular formula.",
"input": "",
"output": " C22H28FNO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=C(C(=O)NCC(=O)O)N=NN1C1=CC=CC(C(F)(F)F)=C1 ?",
"input": "",
"output": "Sure. C13H11F3N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(F)C=C1NC(=O)COC(=O)C1=CC=CC(S(=O)(=O)N2CCC3=CC=CC=C3C2)=C1 ?",
"input": "",
"output": "Sure. C25H23FN2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)CN1C(SCC(=O)NC2=C(F)C=CC=C2F)=NC2=C(C3=C(CC(C)CC3)S2)C1=O .",
"input": "",
"output": " C23H25F2N3O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=C(NC(=O)NC(=O)COC(=O)C2=CC(S(=O)(=O)NCC3=CC=CO3)=CC=C2C)C(C)=C1 .",
"input": "",
"output": " C24H25N3O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(CCNC(=O)C1=CC=CC=C1Cl)NC1=CC=CC=C1C(=O)NC1CCCC1 ?",
"input": "",
"output": "The molecular formula is C22H24ClN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(NC(=O)C(C#N)=CC2=CC=C(OC(=O)C3=CC=CC=C3Cl)C(OC)=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C25H19ClN2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=S(=O)(NC1=NC2=C(C=CC3=CC=CC=C32)S1)C1=CC=C2OCCCOC2=C1 ?",
"input": "",
"output": "The molecular formula is C20H16N2O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(C(C)=NNC(=O)C2COC3=CC=CC=C3O2)C=C1OC ?",
"input": "",
"output": " C19H20N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)NC(=O)CN1CCN(CN2N=C(C3=CC=CO3)N(C)C2=S)CC1 .",
"input": "",
"output": " C17H26N6O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(N(CCC#N)C(=O)COC(=O)C2=CC=C(S(C)(=O)=O)C([N+](=O)[O-])=C2)=CC=C1Cl , what would be its molecular formula?",
"input": "",
"output": "It is C20H18ClN3O7S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(C(NC(=O)CN2N=NN(C3=CC=CS3)C2=O)C2=CC=CC=C2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C21H19N5O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(NCC1=COC(C2=CC=CS2)=N1)C1CC(=O)N(CC2=CC=CC=C2Cl)C1 ?",
"input": "",
"output": " C20H18ClN3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)CC1=CC=C(C2=CN=C(CCC(=O)NCC3=CC=C(CS(=O)(=O)NC(C)C)C=C3)O2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C27H35N3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for NCCCNC(=O)C1=C(F)C=CC=C1Cl .",
"input": "",
"output": " C10H12ClFN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCNC(=O)C1=C(C(=O)NCCCC)C(CSC2=CC=CC=N2)=NO1 ?",
"input": "",
"output": " C19H26N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCC[Sn](CCCC)(CCCC)C1=CC(C2=CC=CC=C2)=NC(C2=CC=CC=N2)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C28H38N2Sn .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)N1C(=O)N(CC2CCOCC2)CC12CC1CCC(C2)N1CCC(NC(=O)C(F)(F)F)C1=CC=CC=C1;Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C29H42ClF3N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC(=O)C1(CC2=CC=C(OCCC3=CC=C4C=CC=CC4=C3)C=C2)CC1C(=O)NO , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C25H25NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=CCC1(C)C(=O)C2CC1C(C)CC2OCC1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C20H26O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN1N=C(C)C(CN2CCC(OC3=CC=C(C(=O)N4CCCC4)C=C3)CC2)=C1C .",
"input": "",
"output": " C24H34N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NC(CC(=O)O)C(C(=O)OCC1C2=CC=CC=C2C2=CC=CC=C21)C1=CC=C(Cl)C=C1Cl . Can you tell me?",
"input": "",
"output": "Sure. It's C25H21Cl2NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC2=NC=NC(N3CCNC(C4=CC=C(Cl)C=C4Cl)C3)=C2C=C1OC ?",
"input": "",
"output": "The molecular formula is C20H20Cl2N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN(C)CCCN(C(=O)C1=CC=C(S(=O)(=O)N2CCC3=CC=CC=C32)C=C1)C1=NC2=CC=C(Cl)C=C2S1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C27H27ClN4O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NC1=CC=NC=C1)N1CCNC(COCC2=CC=CC=C2)C1 ?",
"input": "",
"output": "The molecular formula is C18H22N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NC1=NC(NC2=CC=C(OCCN3CCCC3)C=C2)=NN1C1=NC(C(F)(F)F)=NC2=CC=CC=C12 , what would be its molecular formula?",
"input": "",
"output": "It is C23H23F3N8O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=CC(OC)=C1CNC1=CC=C2C(NCC3=CC=CN=C3)=CC=CC2=N1 ?",
"input": "",
"output": "Sure. C24H24N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(C)CC1NC(C(=O)NCC(CCO)CCO)C(C2=CC=C(F)C(Cl)=C2)C12C(=O)NC1=CC(Cl)=C(F)C=C12 ?",
"input": "",
"output": "The molecular formula is C29H35Cl2F2N3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCNC(=O)NS(=O)(=O)C1=CC=C(NC(=O)C(C)N2C=CC3=C(F)C=CC=C32)C=C1 ?",
"input": "",
"output": " C22H25FN4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=CC(C2OCC3OC(OC4C(N)CC(N)C(O)C4OC4OC(CO)C(OC5OC(CN)C(O)C(O)C5N)C4O)C(N)C(O)C3O2)=C1 ?",
"input": "",
"output": "Sure. C31H51N5O15 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCN(CC)CC1=CC=CC=C1[Se][Se]C1=CC=CC=C1CN(CC)CC into molecular formula.",
"input": "",
"output": " C22H32N2Se2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCC1C2=C3C(CCC3N=C(N)N2)CC1CCC .",
"input": "",
"output": " C17H29N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1(CCC2=C(CCCl)C3=CC=CC=C3N2)CCCNC1=O ?",
"input": "",
"output": " C19H25ClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(NC1=CC(C(F)(F)F)=CC=C1N1CCCCCC1)C1CCS(=O)(=O)C1 into molecular formula.",
"input": "",
"output": " C18H23F3N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C(S(=O)(=O)NC(CC2=CC=CC=C2)C(=O)OC2=CC=C3C4=C(CCC4)C(=O)OC3=C2C)C=C1 into molecular formula.",
"input": "",
"output": " C29H27NO6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C1NCCN(C2CCCC2)C1CC(=O)N1CCCN(C2CCCCC2)CC1 ?",
"input": "",
"output": " C22H38N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)(C)C1=CC=C(C2=CSC(CN3C(=O)C4=CC=CC=C4S3(=O)=O)=N2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H20N2O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(C1=NN=NN1C1CCCCC1)N(CC1=CC=CO1)CC1=CC2=C(C)C=CC(C)=C2NC1=O ?",
"input": "",
"output": "Sure. C27H34N6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COCC(C)N1C(C)=CC(C(=O)CN2C(=O)NC(C)(C3=CC(F)=CC=C3F)C2=O)=C1C ?",
"input": "",
"output": " C22H25F2N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC(=O)C1=CC=C(OCC(=O)NCC2CN(CC3=CC=CC=C3)CCO2)C=C1 into molecular formula.",
"input": "",
"output": " C21H25N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC(C)=C(C2=CSC(NC(=O)C3=CC(S(=O)(=O)N4CCCC4)=CC=C3Cl)=N2)C=C1C .",
"input": "",
"output": " C23H24ClN3O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC(=O)N2CCN(CC3=NC(C4=CC=CC=C4)=CS3)CCC2=C1C(=O)N1CCCC(O)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C26H30N4O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=CC=C1CCC1=NN=C(CCC(=O)N2CCCC2C2=CC=C(F)C=C2)O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H26FN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=C(C(=O)NCC(=O)NCCC(C2=CC=CC=C2)C2=CC=CC=C2)C=C1OC ?",
"input": "",
"output": " C26H28N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC(=O)CN(C1=CC=C(C)C=C1)S(=O)(=O)C1=C(C(=O)OC)SC=C1C1=CC=CC=C1 ?",
"input": "",
"output": " C22H21NO6S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(NCCCC1=CC=CC=C1)C1=CC(C2=CC=CC=N2)=NC2=CC=CC=C12 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H21N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=C(C(=O)NNC(=O)C2=CC=C(Br)O2)OC2=CC=CC=C12 ?",
"input": "",
"output": " C15H11BrN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(C1=CC(=O)C2=CC=CC=C2O1)N1CCN(S(=O)(=O)C2=CC=CC=C2Cl)CC1 ?",
"input": "",
"output": " C20H17ClN2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(NC(=O)COC(=O)C2=CC(Cl)=CC=C2F)C=C1S(=O)(=O)N1CCOCC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C20H20ClFN2O7S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(COC1=CC=C(Cl)C=C1)NCCCN1CCNCC1 ?",
"input": "",
"output": " C15H22ClN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NC1=CC=CC(C(=O)CN2CCOCC2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H16N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(OC1=CC=CC=C1)C(=O)NC1=CC=C(Cl)C(C(N)=O)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H15ClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC(=O)C1C(=O)NC(N2CCN(C3=CC=C(Cl)C=C3)CC2)=NC1C1=CC=C(OC)C(OC)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H29ClN4O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)N1CCN(CC2=CC=CC(C(=O)[O-])=C2)CC1 ?",
"input": "",
"output": " C14H17N2O3- ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=CC=C1C(C)NC(=O)CN(CCC1=CC=CC=C1)S(=O)(=O)C1=CC=C(Cl)C=C1 ?",
"input": "",
"output": " C25H27ClN2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)C1=CC=C(C(=O)NC2=CC=C(C3=CC=C(CO)O3)C=C2)C=C1 ?",
"input": "",
"output": " C22H23NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN1C(CN2CCN(S(C)(=O)=O)CC2)=NC2=CC(NC(=O)C3CCCCC3)=CC=C21 .",
"input": "",
"output": " C22H33N5O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=NN(CCCNC(=O)CC2OC3=CC=CC=C3NC2=O)C(C)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H22N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC(=O)COC(=O)C=CC1=CC=C(OCC2=C(C)ON=C2C)C(OC)=C1 .",
"input": "",
"output": " C19H21NO7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(S(=O)(=O)N(C)C)C=C1NC(=O)C(C)OC(=O)C1=CC=C(Cl)C=C1Cl ?",
"input": "",
"output": "Sure. C19H20Cl2N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(Cl)C=C1NC(=O)C(=O)NCCC1=CC=C(S(=O)(=O)NC2CCCCC2)C=C1 ?",
"input": "",
"output": " C23H28ClN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=CC=C1CNC(=O)CN1CCN(CC2=CC(C)=NO2)CC1 ?",
"input": "",
"output": " C19H26N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC1=CC=CC2=C1OC(=O)C(C(=O)NCCOC1=CC=CC=C1)=C2 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H19NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(S(=O)(=O)NCC2(C3=CC=CS3)CCOCC2)C=C1C ?",
"input": "",
"output": " C18H23NO4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)(C)SCC(=O)NC1=CC=CC=C1C(=O)NC1CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C16H22N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCOC(=O)C1=C(NC(=O)COC(=O)C=CC2=C(Cl)C=CC=C2Cl)SC(C(=O)NC)=C1C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H20Cl2N2O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCNC(=O)NC(=O)C(C)SC1=NC(N)=C(C2=CC=C(Cl)C=C2)C(CC)=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C18H22ClN5O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C(C(=O)COC(=O)C2=NN(CC3=CC=CC=C3)C(=O)C3=CC=CC=C23)S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H18N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=C(C)CN(CC)C(=O)CNC1=CC(S(=O)(=O)N(C)C)=CC=C1C .",
"input": "",
"output": " C17H27N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COCC1=CC=CC(NC(=O)C2=CC=C([N+](=O)[O-])O2)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H12N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CONC(=O)COC1=CC=C(C)C(C)=C1 .",
"input": "",
"output": " C11H15NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(NC(=O)C2=CC=CC=C2)=CC=C1NC(=O)C1=CC=CC(S(C)(=O)=O)=C1 ?",
"input": "",
"output": "The molecular formula is C22H20N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC(=O)C1=CC([N+](=O)[O-])=CN(CC2=COC(C3=CC=CC(F)=C3)=N2)C1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H12FN3O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CSC1=CC=C(NC(=O)C2=CC=C(OCC3=C(C)ON=C3C)C=C2)C=C1 ?",
"input": "",
"output": " C20H20N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC1=CC(C(=O)NC2=CC=C(N3CCCCC3)C=C2)=CC=C1OCC1=CC=CN=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C26H29N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C(N(C)S(=O)(=O)C2=CC=C(Cl)C(C(=O)NCC3=CC=CN=C3OC)=C2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H22ClN3O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(C1=CC(C2=CC=C(Br)C=C2)=NN1)N1CCOCC1 .",
"input": "",
"output": " C14H14BrN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC(N2CCN(CCC(N)=O)CC2)=C2C=CC=CC2=N1 ?",
"input": "",
"output": " C17H22N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC(CC(=O)NC2=CC=C(N3CCCC3=O)C=C2)=CC(OC)=C1OC into molecular formula.",
"input": "",
"output": " C21H24N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC(=O)C1=C(NC(=O)C2=CC=CO2)C=C(C2=CC=C3OCOC3=C2)S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H15NO6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=CC(NC(=O)C(NC2CCN(C(=O)C3=CC=CO3)CC2)C2=CC=CC=C2)=C1 .",
"input": "",
"output": " C25H27N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=C(C(=O)N2CCN(C3=CC=C([N+](=O)[O-])N=C3)CC2)SC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H16N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=[N+]([O-])C1=CC(C2=NC3=NC4=CC=CC=C4N=C3N2CC2CCCO2)=CC([N+](=O)[O-])=C1 ?",
"input": "",
"output": "Sure. C20H16N6O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C#CCNC(=O)COC1=CC=C(C)C=C1[N+](=O)[O-] ?",
"input": "",
"output": "The molecular formula is C12H12N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(C2NN3C(=NN=C3C3=CC=CC=C3)SC2C(=O)NC2=CC=C(F)C=C2)C=C1Cl .",
"input": "",
"output": " C24H19ClFN5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1=CC=CC2=C1N(C)C(=NC(=O)C1=CC=CC(Cl)=C1)S2 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H15ClN2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(C2=NN=C(NC(=O)CCCS(=O)(=O)C3=CC=C(OC)C=C3)O2)C=C1 ?",
"input": "",
"output": "The molecular formula is C20H21N3O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(C2=CC=C(SCC(=O)NC3=CC(C(F)(F)F)=CC=C3Cl)N=N2)C=C1OC .",
"input": "",
"output": " C21H17ClF3N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(F)=CC=C1NC(=O)CC1=CSC2=NC(C3=CC=C(F)C=C3)=CN12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H15F2N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=CC=C1N1C(C)=NN=C1SCC(=O)NC1=CC=C(Cl)C(C(F)(F)F)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C19H16ClF3N4OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCOC(=O)C1=C(NC(=O)CSC2=NC=CC=N2)SC(C(=O)NC2=CC=CC=C2)=C1C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H20N4O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=C2N=C(NC(=O)CC(NC(C)=O)C3=CC=C(C)C=C3)SC2=C1 ?",
"input": "",
"output": " C20H21N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN1N=C2N=C(NCCOC3=CC=CC=C3)N=C(C3=CC=C(F)C(Cl)=C3)C2=C1N ?",
"input": "",
"output": "Sure. C20H18ClFN6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=NC(C(=O)NCCN2CCOCC2)=NN1C1=CC=CC=C1 ?",
"input": "",
"output": " C16H21N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=C(C(=O)N2CCN(C(=O)C(NC(=O)C3=CC=CC(C(F)(F)F)=C3)C(C)C)CC2C)C=C1 .",
"input": "",
"output": " C26H30F3N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCNC(=O)N(CC(=O)N(CCC1=CNC2=CC=CC=C12)CC1=CC=C(C(F)(F)F)C=C1)C(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C26H31F3N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NC1=C2C(C3=CC=CO3)=NC(NC3CC3)=NC2=NN1C1=CC=CC(F)=C1 ?",
"input": "",
"output": " C18H15FN6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NCC1=CC=CC=C1)C1=COC(COC2=CC=C3CCN(CC4=CC=CC=C4F)C(C4=CC=CC=C4)C3=C2)=N1 ?",
"input": "",
"output": "The molecular formula is C34H30FN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(C2CCCCCN2S(=O)(=O)N2CCCCCC2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H30N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(CCCN1C(=O)OC2=CC=CC=C21)N1CCN(CC2=CC=C(Cl)C=C2)CC1 into molecular formula.",
"input": "",
"output": " C22H24ClN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOC(=O)C1=C(C)NC(C(=O)N2CCN(CC3=CC=NC=C3)CC2)=C1C ?",
"input": "",
"output": " C20H26N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCS(=O)(=O)N1CCC(NC(=S)NC2=CC=C(Cl)C=C2Cl)CC1 ?",
"input": "",
"output": "The molecular formula is C15H21Cl2N3O2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)CC(C)NCCC1=CC=C(Cl)C=C1Cl ?",
"input": "",
"output": " C14H21Cl2N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC1=CC=CC=C1NC(CC)C1=CC=CC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H21NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(C)C=C1C(C)NC1=CC(C)=CC=C1C ?",
"input": "",
"output": " C18H23NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCC1=CC=C(NC2CCS(=O)(=O)C2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H19NO2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)C1CCC(C#N)C(OC2=CC=CC=C2Cl)C1 ?",
"input": "",
"output": " C17H22ClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC1=CC=C(SCC2=NOC(C3=CC=CS3)=C2)C(F)=C1 ?",
"input": "",
"output": " C14H11FN2OS2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCN(C)C(=O)CNC1CN2CCC1CC2 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H23N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(OCC(=O)NC2=CC=C(O)C(C(=O)O)=C2)=NO1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H12N2O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC1=CC=C(OCCOCCC2=CC=CC=N2)C=C1 ?",
"input": "",
"output": " C15H18N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCN(CC1=CC=C(N)C=C1)C(=O)C1=CC=CC(Br)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H19BrN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)C(NCCC(=O)NC1=CC=CC=C1)C(=O)O ?",
"input": "",
"output": " C14H20N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCOC1=CC=C(C(=O)O)C(OCC)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H16O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(O)CCC1=CC=C(OCC2=C(Cl)C=CC=C2Cl)C=C1 .",
"input": "",
"output": " C17H18Cl2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1C=C(NCC2=CC=C(OCC(N)=O)C=C2)C=N1 ?",
"input": "",
"output": "The molecular formula is C13H16N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C1=CC=CC(N)=C1)N(C)C(=O)C1=CC=C(Cl)C=C1F ?",
"input": "",
"output": " C16H16ClFN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(C(=O)NC2=CN=CC=N2)C=C1N ?",
"input": "",
"output": " C12H12N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule N=C(N)C1=CC=C(OC2=CC=CC(C(F)(F)F)=C2)C(F)=C1 ?",
"input": "",
"output": " C14H10F4N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCN1CCC(NC2=CC(C(=O)N(C)C)=CC=C2C)CC1 ?",
"input": "",
"output": "The molecular formula is C17H27N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(Cl)C(=O)NC(C)C1=CC=C(C(C)(C)C)C=C1 ?",
"input": "",
"output": "The molecular formula is C15H22ClNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=[N+]([O-])C1=CC=CC(CNC2=CC=C(Cl)C(F)=C2)=C1 ?",
"input": "",
"output": "The molecular formula is C13H10ClFN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of FC1=CC(NC2CCSC3=CC=CC=C32)=CC=C1Cl . Can you tell me?",
"input": "",
"output": "Sure. It's C15H13ClFNS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(NC(C)C2=CC=CC(C)=C2)C=C1F ?",
"input": "",
"output": " C16H18FNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CN1C=C(NC2CSCC3=CC=CC=C32)C=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H15N3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(NC(=O)CN2C(C)=CC(=O)C3=CC=CC(F)=C32)C=C1OC ?",
"input": "",
"output": " C20H19FN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(O)CCCN1C(=O)C(CC(=O)O)SC1=S into molecular formula.",
"input": "",
"output": " C9H11NO5S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=CC=C1N1C(=O)SC(CC(=O)NC2=CC(C(=O)O)=CC=C2C(=O)O)C1=O ?",
"input": "",
"output": " C20H16N2O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=CCN1C(SCC(=O)C2=CC=C(Br)C=C2)=NN=C1C(C)OC1=CC=CC=C1Cl ?",
"input": "",
"output": "The molecular formula is C21H19BrClN3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(NC(=S)NC(=O)C1=CC=C(C)C(Br)=C1)C1=CC=CC=C1 .",
"input": "",
"output": " C18H19BrN2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CS(=O)(=O)N1CCCCC1C(=O)NC1=NC2=CC=C(S(N)(=O)=O)C=C2S1 ?",
"input": "",
"output": " C14H18N4O5S3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)OC1=CC=C(C2=NOC(C3CC(=O)N(C4=CC=CC5=C4CCCC5)C3)=N2)C=C1 .",
"input": "",
"output": " C25H27N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCOC(=O)NS(=O)(=O)C1=CC=CC=C1C1=CC=C(CN(C(=O)CCC)C2CC(C(=O)O)N(C(=O)C3=CC=NC=C3)C2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C33H38N4O8S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=CC2=C1OC(=C(C1=CC=CC=C1)P1(=O)OCC(C)(C)CO1)C=C2 ?",
"input": "",
"output": " C22H23O5P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC2=C(C(O)=C1OC)C(=O)C=C(C1=C(O)C=CC=C1OC1OC(CO)C(O)C(O)C1O)O2 .",
"input": "",
"output": " C23H24O12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN(CC1=CC=NC2=CC=CC=C12)C1CCN(C(=O)C2=CC(Cl)=CC(Cl)=C2)C(CC2=CC=CC=C2)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C30H29Cl2N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1(CS(=O)(=O)C2=CC=CC=C2)OOC2CC1CC(OC(=O)C1=CC=CC=C1)C2(C)O ?",
"input": "",
"output": " C23H26O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCC(C)CC1=C(CC)C(C(=O)C(N)=O)=C2C(OCC(=O)O)=CC=CN12 ?",
"input": "",
"output": " C20H26N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC(=O)C(C1=CC=CC=C1)N1CCC2=C(C=CS2)C1;O=[N+]([O-])[O-] , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H17N2O5S- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC(C2CCN(C(=O)C3COCCN3)CC2)=C(C)C=C1NC1=NC2=CC=NN2C(NC2=CC=CC=C2S(=O)(=O)C(C)C)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C32H40N8O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN(CC)C1=CC=C(C=NNC(=O)C(NC(=O)C2=CC=C([N+](=O)[O-])C=C2)C23CC4CC(CC(C4)C2)C3)C=C1 .",
"input": "",
"output": " C30H37N5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=C(C(=O)NC2=CC=CC=C2F)C(C2=CC=CC=C2C)C2=C(CC(C3=CC=CC=C3)CC2=O)N1;CCO into molecular formula.",
"input": "",
"output": " C32H33FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=CC1(C(=O)OC)CC1C#N ?",
"input": "",
"output": " C8H9NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC1=CC(C2C(=C(O)C3=CC=C4OC(C)CC4=C3)C(=O)C(=O)N2C2=NC(C)=C(C(=O)OC)S2)=CC=C1OCC1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C35H32N2O8S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NC1=NC=CS1)C1=C([P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)SC(C2=CC=CC=C2)=N1 ?",
"input": "",
"output": "The molecular formula is C31H23N3OPS2+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCN(CC1CCCO1)C(=O)C1=CSC2=NC(C3=CC=CC=C3)=CN12 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H21N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC1=CC(C(=O)N2CCC(C3(C4=CC=CN=C4)NC(=O)N(CCC4=CC=CS4)C3=O)CC2)=NO1 ?",
"input": "",
"output": " C25H27N5O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(O)C1=CC=C(Cl)C(NS(=O)(=O)C2=CC=CC=C2[N+](=O)[O-])=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H9ClN2O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=NOC(NC(=O)CSC2=NC(=O)N(CCCN3CCOCC3)C3=C2CCC3)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H27N5O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC1=CC=C2C=CC=CC2=C1C(=O)NC1=NN=C(C2=NN(C(C)C)C=C2)O1 ?",
"input": "",
"output": "Sure. C21H21N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=C(NC2=NC(C(=O)NCC3CCCCC3)=CS2)C(C)=C1 .",
"input": "",
"output": " C19H25N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOC1=CC=C(NC(=O)CN2CCC(CN3C(C)=NC4=CC=CC=C43)CC2)C=C1 ?",
"input": "",
"output": " C24H30N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(C2(CNC(=O)CC(C3=CC=CC=C3)C3=CC=CC=C3)CCCC2)C=C1 ?",
"input": "",
"output": " C28H31NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(NCC1=CC=CN=C1N1C=NC2=CC=CC=C21)C1COC2=CC=CC=C2C1 ?",
"input": "",
"output": " C23H20N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCCC(C)NC(=O)C=CC1=CC(OC)=C(OC)C(OC)=C1 ?",
"input": "",
"output": " C19H29NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=NC=CN1CCCNC(=O)C=CC1=CC=CC([N+](=O)[O-])=C1 ?",
"input": "",
"output": " C16H18N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCS(=O)(=O)N1CCCC(C(=O)NCCOC2=CC=C(F)C=C2)C1 ?",
"input": "",
"output": " C17H25FN2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=CC=C1C(=O)NNC(=O)C1=CC=C(COC2=CC=CC(Br)=C2)O1 .",
"input": "",
"output": " C20H17BrN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)N(CC(=O)N1CCSC1C1=CC=CC=C1Cl)CC1=CC=CC(Cl)=C1 ?",
"input": "",
"output": "The molecular formula is C21H24Cl2N2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C(C(=O)OC(C)C)C(C2=CC=C(Cl)C=C2)N2C(CC(=O)NCCN3CCOCC3)=CSC2=N1 .",
"input": "",
"output": " C25H31ClN4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(C2=CC=C(N3CCCN(C(=O)CN(C(=O)C4=CC=C5OCOC5=C4)C(C)C)CC3)N=N2)C=C1OC ?",
"input": "",
"output": " C30H35N5O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(N(C(=O)C2=CC=CC=C2)C2CCN(CC3=CC=CS3)CC2)C=C1 ?",
"input": "",
"output": " C24H26N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=CC=C1CN1CCCN(C2=CC=C(NC(=O)C3=CC=CC=C3)C=C2)C1=O ?",
"input": "",
"output": "The molecular formula is C25H25N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)C(C)C1(C)CCC2(C)C3CCC4C5(COCC4(C)C(OCC(C)(N(C)C)C(C)(C)C)C(N4N=CN=C4C4=CC=NC=C4)C5)C3=CCC2(C)C1C(=O)O .",
"input": "",
"output": " C46H71N5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)CNC(CO)CC1=CNC2=CC=CC=C12 ?",
"input": "",
"output": " C15H22N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of ClC1=CC=C(N2CCN(C3=NN4N=NN=C4C4=CC=CC=C34)CC2)C=C1 ?",
"input": "",
"output": " C18H16ClN7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=CCN1C=C(C(=O)NCCC2=CC=C(OCC)C(OCC)=C2)C(=O)C2=CC(S(=O)(=O)N(CC)CC)=CC=C21 ?",
"input": "",
"output": " C29H37N3O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC(=O)NC1=NC2=C(C)C=C(NC(=O)CC(C)C)C=C2S1 into molecular formula.",
"input": "",
"output": " C16H21N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC1=CC=C(S(=O)(=O)NC2=CC(C(=O)O)=CC=C2N2CCN(C3=CC=C(OC)C=C3)CC2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C26H29N3O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(CCCC1=NN=C(C(=O)NC2=CC=CC(F)=C2)S1)NCC1=CC=CC(Cl)=C1 ?",
"input": "",
"output": " C20H18ClFN4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=C(C2=CC(C(=O)NCC(C)C3=CC=CC=C3)=C3C=CC=CC3=N2)C=NN1C1=CC=C(C(C)C)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C32H32N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(CNC(=O)C2=CC=CC(NC(=O)C3=NN=C(CC(C)C)S3)=C2)C(OC)=C1 ?",
"input": "",
"output": "The molecular formula is C23H26N4O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC1=CC=CC=C1CNC(=O)C1CCN(C2=C(NC(=O)CC)C(C)=NN2C2=CC=CC=C2)CC1 ?",
"input": "",
"output": " C28H35N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC(=NC2CCCCC2)N(C(=O)CN2C=NC3=C(C)C=CC=C3C2=O)C=C1 ?",
"input": "",
"output": " C23H26N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=S(=O)(CC1=CC=C(F)C=C1)N1CCN(C2=CC=CC=C2Cl)CC1 into molecular formula.",
"input": "",
"output": " C17H18ClFN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)NCCNC(=O)C1CC(=O)N(C2=CC=C3OCCOC3=C2)C1 ?",
"input": "",
"output": " C17H21N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC(=O)C1=C(NC(=O)CCNC(=O)NC2=CC=C(OC)C=C2)SC=C1C1=CC=CS1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H23N3O5S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NCCC(O)C(=O)NC1CC(N)C(OC2OC(CN)C(O)C(O)C2O)C(O)C1OC1OC(CO)C(O)C(N)C1O;O=S(=O)(O)O;O=S(=O)(O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H47N5O21S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation Cl;NC1=CC=C(S(=O)(=O)N2CCCC2C(=O)O)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C11H15ClN2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=C(OC2=CC=NC(C3=NSC(N)=N3)=C2)C=C1 ?",
"input": "",
"output": " C14H12N4OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCNC(CS(C)=O)C1=CC=C(C2=CC=C3N=CN=C(NC4=CC=C(OCC5=CC=CC(F)=C5)C(Cl)=C4)C3=C2)O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C30H28ClFN4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of FC1(F)CC2CC(N3C=NC4=C(Cl)N=CN=C43)C1C2 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H11ClF2N4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CSC1=CC=C(C2=NOC(CN3CCN(CC(=O)NC4=CC=C(C)C=C4)CC3)=N2)C=C1 .",
"input": "",
"output": " C23H27N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCN1N=C(C(=O)NC2=CN(CCN(CC)CC)N=C2)C=CC1=O ?",
"input": "",
"output": " C18H28N6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(CNCC2=CC=CC=C2S(=O)(=O)NC(C)(C)C)C=C1OC ?",
"input": "",
"output": " C20H28N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(OCC1CCCO1)C(=O)NC(C)C1=CC=C(OC(F)F)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H23F2NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC(C)=NC(N=C(N)NC2=CC=NC3=CC=CC=C23)=N1 into molecular formula.",
"input": "",
"output": " C16H16N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule OC1=CC=C(C=CC2=CC(O)=C3C(=C2)OC(C2=CC=C(O)C=C2O)C3C2=CC(O)=CC(O)=C2)C=C1 .",
"input": "",
"output": " C28H22O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN(C)CCCCC(=O)NC1=CC=C(NC(=S)NC(=O)C2=CC=C(C(F)(F)F)C=C2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C22H25F3N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NCCCCCC1=NC2=CC=CC=C2N1;[Cl-];[Cl-] ?",
"input": "",
"output": "Sure. C12H17Cl2N3-2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC(N(C)C(=O)CSC2=NN=C3C4=CC=CC=C4N=C(C4=CC=CO4)N23)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C23H19N5O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=CCN1C(C(=O)NCCC2=CC=CS2)=CC2=CC(S(=O)(=O)N(C)C)=CC=C21 .",
"input": "",
"output": " C20H23N3O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOC(=O)C1=C(C)C(CCC(=O)NC2=CC=C(C)C(F)=C2)=C(C)N1 ?",
"input": "",
"output": " C19H23FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC(CN(C)CC1=CC=CC=C1)NC(=O)CN(C1=CC=CC=C1)S(=O)(=O)N(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H32N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCN1C2=CC(OC)=C(C=C3SC(=O)N(CC4=CC=CC=C4Cl)C3=O)C=C2C(C)CC1(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C27H31ClN2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by N#C[S-];N#C[S-];N#C[S-];[OH+]=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1;[OH+]=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1;[Sn+3]C1=CC=CC=C1 ?",
"input": "",
"output": " C45H37N3O2P2S3Sn+2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1(C)CN(CC(=O)NC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)C(=O)CN1 ?",
"input": "",
"output": "The molecular formula is C16H17F6N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C1C(=CC2=CC=CN=C2)COC2=C(F)C=CC=C12 ?",
"input": "",
"output": " C15H10FNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=S(=O)(NC1CCCCCC1)C1=CC=C(S(=O)(=O)NC2CC2)C=C1 ?",
"input": "",
"output": "The molecular formula is C16H24N2O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC=C(CN(C)C(=O)C2CCCN2C(=O)C2=CC=CS2)C(OC)=C1 into molecular formula.",
"input": "",
"output": " C20H24N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(CC1=CC=C2OCCC2=C1)NC1=CC=CC=C1SC(F)F into molecular formula.",
"input": "",
"output": " C17H15F2NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C2C(=C1)C=CC1C3C(=O)N(C4CCCCC4)C(=O)C3C(C(=O)C(C)(C)C)N21 ?",
"input": "",
"output": "Sure. C26H32N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(C2=CC(C(=O)N3CCC(C(N)=O)CC3)=NN2C2CCS(=O)(=O)C2)C=C1 ?",
"input": "",
"output": " C21H26N4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=CC(C2CCCN2C(=O)C2=CC=C(F)C=C2)=C1 ?",
"input": "",
"output": " C18H18FNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=NSC(C)=C1NC(=O)CCN1N=CC2=CC=CC=C21 ?",
"input": "",
"output": " C15H16N4OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCN(C(=O)C1=CC2=C(C=CO2)N1CC1=CC=CC(F)=C1)C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C22H19FN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(OC1=CC=C(C(=O)NC2=CC=CC3=C2NN=C3)C=N1)C1=CC=CC=C1 .",
"input": "",
"output": " C21H18N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCC(=O)NC1=CC(NC(=O)C(C)NS(C)(=O)=O)=CC=C1OC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H25N3O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CN=C(C(=O)NCC2(C3=CC=CC=C3)CCC2)C=N1 ?",
"input": "",
"output": " C17H19N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCN1N=C(C(=O)N(C2CC2)C(C)C2=CC=CC(C(F)(F)F)=C2)C=CC1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H22F3N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1CN(C(=O)CCOC2=CC=CC=C2)CCO1 ?",
"input": "",
"output": " C14H19NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(NC1=CC=C(F)C=C1)C1=NN=C(C2CCCN2C(=O)C2=CC=C(Br)O2)S1 ?",
"input": "",
"output": " C18H14BrFN4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(=O)NC1=C(C(=O)NCC2=CC=C(C)O2)SN=C1C1=CC=CC=N1 ?",
"input": "",
"output": "Sure. C17H16N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(NC1CC1)C1=CC=C(OCC2CCN(C(=O)C3=CC=CC(Cl)=C3)CC2)C=C1 .",
"input": "",
"output": " C23H25ClN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(C)C(C2=NN3C=CN(CC4=NOC(C5=CC=CC=C5C)=N4)C(=O)C3=C2)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H21N5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC1=NN(CC)C(=O)C2=CC(S(=O)(=O)NC3=CC=CC=C3F)=CN12 ?",
"input": "",
"output": " C16H17FN4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code N#CC1=C(NC(=O)C2=NC=CN=C2C(=O)O)SC2=C1CCN(CC1=CC=CC=C1)C2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C21H17N5O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(SC1=NC(N)=C(C#N)C(C2=[N+](C)NOC2=O)=C1C#N)C(=O)NC1=CC=C(Br)C=C1F ?",
"input": "",
"output": "The molecular formula is C19H14BrFN7O3S+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC(C2C3=CC4=C(C=C3CC3COC(=O)C32)OCO4)=CC(OC)=C1OC(=O)N1CCN(C2=CC=C(F)C=C2)CC1 ?",
"input": "",
"output": " C32H31FN2O8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)OCC(O)CN1CCN(CCN2CCCC2)CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H33N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC(=O)C1=CC=C(OCCCN2CCC3=CC(OC)=C(OC)C=C3C2)C=C1;Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H30ClNO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)CCN1CCCCC1=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H19NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1(C)OCC(C2C(=O)N(C3=CC=C(F)C=C3)C2C2=CC=C(OCC3=CC=CC=C3)C=C2)O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C27H26FNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)CN1CC(C(=O)NCCNC(=O)C2=CC=CC=C2)CC1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H25N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1CC(C(=O)NC(C2=CC=C(Cl)C=C2)C2=NC=CN2C)CC1=O ?",
"input": "",
"output": "The molecular formula is C17H19ClN4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN(CC(N)=O)C(=O)C1=CN(C)N=C1C1=CC=C2OCCCOC2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H20N4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC(=O)C1CCN(C2=CC=C(S(=O)(=O)N3CCCCC3)C=N2)C1 ?",
"input": "",
"output": " C15H22N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by N#CC1=CC=C(N2CCCC2C2=CC=C3OCOC3=C2)N=C1 ?",
"input": "",
"output": " C17H15N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC1=CC=CC=C1NC(=O)NC(CC1=CC=CC=C1)C(=O)N(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H25N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC1=C(N)N(C(=O)C2=CC=CC=C2C)N=C1C1=CC=NC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C18H18N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(C(F)(F)C(F)F)C(F)(F)C(F)F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C6H6F8O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule OCC=CC1=CN(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=N1 into molecular formula.",
"input": "",
"output": " C25H22N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CN(C2CC(C=CC3=CC=CC=C3)C(CO)O2)C(=O)N=C1N is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H21N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(C)OC[Si](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H38O4Si .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C2C(=C1OC)C(=O)N(CC1=CC=CC=C1)C(=O)[N+]2(C)CCC(=O)O .",
"input": "",
"output": " C21H23N2O6+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCCCSC(CSCC1=C(C)C=C(C)C=C1C)CN1C=CN=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C21H32N2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=CC=CC=CCCCCCCCCCCCCCCCCCCCCCC represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C28H52 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCOC1=CC(C(=O)NC(CSC)CC2=CC=C(O)C=C2)=CC=C1OC into molecular formula.",
"input": "",
"output": " C23H31NO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCC(=O)C1=CC(C(=O)C(=O)OC(=O)C(=O)C2=CC(C(=O)CCC)=C(C)C=C2N)=C(N)C=C1C ?",
"input": "",
"output": " C26H28N2O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC#CC1=CC(N2CCCNCC2)=CN=C1Cl ?",
"input": "",
"output": "Sure. C14H18ClN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC(=O)C(C)CSC(=O)CC1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C13H16O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule [C-]#[N+]CSC1=CC=C(C)C=C1C1=CC=C(Cl)C(Cl)=C1 .",
"input": "",
"output": " C15H11Cl2NS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(C1=CC=C(C(F)(F)F)C=C1[N+](=O)[O-])C1=C(C2CC2)ON=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H9F3N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=O)N(CCC1CCCC2=C(OCC(=O)O)C=CC=C21)N(C1=CC=CC=C1)C1=CC=CN=C1 ?",
"input": "",
"output": " C27H29N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCC1=NC(Cl)=C(C=O)N1C1=CC=C([N+](=O)[O-])C=C1 into molecular formula.",
"input": "",
"output": " C14H14ClN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(O)C1=CC=CC(Br)=C1N .",
"input": "",
"output": " C9H12BrNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(=O)NC1=CC=C2OCC(C)N(C(=O)C3=CN=CC=N3)CC(C)C(OC)CN(C)C(=O)C2=C1 .",
"input": "",
"output": " C25H33N5O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)CCC(SC1=CC=CC=C1)C1=C(O)C=C(C2=CC=CC=C2)OC1=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H24O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC(=O)C1=CC=C(C=C2C=C(C3=CC=CC=C3)N(C3=CC=C([O-])C(C(=O)O)=C3)C2=O)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C27H20NO6- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCNC(=O)C1=CC=CC(NC(=S)NC(=O)C(C)C2=CC=C(CC(C)C)C=C2)=C1 .",
"input": "",
"output": " C23H29N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(NC(=O)C2=CC=CC(OCCC3=CC=CC=C3)=C2)C(Br)=C1 ?",
"input": "",
"output": " C22H20BrNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(NCC(=O)NCC2=CC=C(OC(C)C)C=C2)C=C1 ?",
"input": "",
"output": "Sure. C19H24N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCN(CCO)C1=CC=C2N=CC=CC2=C1N , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C13H17N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC(=O)C(CC(C)C)NC1=CC=CC=C1OC .",
"input": "",
"output": " C15H23NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(C)C1=CC=CC=C1OC1=NSN=C1Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H13ClN2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(NC(=O)COC2=CC=CC(N)=C2)=NO1 ?",
"input": "",
"output": "The molecular formula is C12H13N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of FC(F)(F)C1=CN2C(CCNC3CC3)=NN=C2C=C1 ?",
"input": "",
"output": "Sure. C12H13F3N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(C)C1=CC=C(NS(=O)(=O)CCCN)C=C1 ?",
"input": "",
"output": "The molecular formula is C13H22N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(Cl)C(=O)NC(=O)NC(C)C1=CC=CC(Cl)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H14Cl2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(=NO)C1=CC=CC=C1OCC1CCCO1 ?",
"input": "",
"output": "Sure. C14H19NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(CC(=O)NCCCN)(C(=O)O)C1=CC=CC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H20N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=NNC(C)=C1CNC1=CC(F)=C(F)C=C1F , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H12F3N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN1CCC(NC2=CC=CC3=C(O)C=CC=C23)C1 .",
"input": "",
"output": " C15H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(O)C1=CC(F)=CC=C1N1CCNC(=O)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H17FN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(N)C1=CC=CC=C1OCCOCC(F)(F)F .",
"input": "",
"output": " C13H18F3NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1CC(C)CN(S(=O)(=O)C2=CC=CC(C(=O)OC(C)C(=O)NCCC3=CC=C(F)C=C3)=C2)C1 ?",
"input": "",
"output": " C25H31FN2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(NNC1=CC=CC=C1[N+](=O)[O-])C1=CC=C(Cl)C(S(=O)(=O)N2CCCCC2)=C1 ?",
"input": "",
"output": " C18H19ClN4O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCNC(=O)CN1CCN(S(=O)(=O)C2=CC(C(F)(F)F)=CC=C2Cl)CC1 .",
"input": "",
"output": " C16H21ClF3N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1=NC(SCC2=NN=C(C(=O)NCC3=CC=CC=C3)S2)=NN1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H16N6OS2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(NC1=C(C2=NC3=CC=CC=C3N2)C2=C(CCCC2)S1)C1=CN(CC2=CC=CC=C2)N=N1 .",
"input": "",
"output": " C25H22N6OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(CN1CCCC1C(=O)NCC1=CC=CO1)NC1=CC=CC=C1C(=O)NC1=CC=CC=C1 .",
"input": "",
"output": " C25H26N4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(OCCN(C)C(=O)CCCOC2=CC=C3NC(=O)CCC3=C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C23H28N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCN(C(=O)CN(C)CC1=C(C)ON=C1C)C1=C(N)N(CCC)C(=O)NC1=O ?",
"input": "",
"output": " C20H32N6O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC(=O)C1=CC=C(C(=O)NC2=CC(Cl)=CC=C2N2CCN(CC)CC2)N=C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C22H27ClN4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(C(=O)CCCC1=NC(C(C)(C)C)=NO1)C1=C(N)N(CC2=CC=CC=C2)C(=O)NC1=O ?",
"input": "",
"output": " C22H28N6O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " N#CC1=CC=C(N2CCCN(C(=O)C3=C(C4CC4)N(C4=CC=C(Cl)C=C4Cl)N=C3)CC2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C25H23Cl2N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN1CCN(C2=CC=C(CNC(=O)C3=C(C)N(C4=CC=C(C(F)(F)F)C=N4)N=C3)C=N2)CC1 ?",
"input": "",
"output": " C23H26F3N7O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(C=CC1=CC=C(C2=CC=CC=C2)S1)N1CCC(CN2CCOCC2)CC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H28N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC1=CC=CC=C1N1CC(C(=O)NC(CC(C)C)C(=O)NC)CC1=O ?",
"input": "",
"output": "Sure. C20H29N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOCCCNC(=O)C1=CC=CC(NC(=O)C=CC2=CC(Cl)=C3OCOC3=C2)=C1 .",
"input": "",
"output": " C22H23ClN2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(NC(=O)C2=CC=CC(NC(=O)C3=CC=CO3)=C2)C=C1OCC1=CC=NC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C25H21N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN(CC(=O)NC1=CC=C(N2CCOCC2)C=C1)C(=O)C1=CC=CC2=C1OCO2 .",
"input": "",
"output": " C22H25N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COCCN(C(=O)CN1N=C(C2=CC=CC=C2)C=CC1=O)C1=C(N)N(CC(C)C)C(=O)NC1=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H28N6O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(N2CCCN(C(=O)C3=CC=CC(CS(=O)(=O)C4=CC=CC=C4)=C3)CC2)C=C1 ?",
"input": "",
"output": " C26H28N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=CC(N2N=NC(C(=O)N3CCN(S(=O)(=O)C4=CNC5=NC=CC=C45)CC3)=C2C)=C1 ?",
"input": "",
"output": " C22H23N7O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=C(C)C2=C(N=CN(CCC(=O)N(CCN(C)C)CC3=CC=CC=C3F)C2=O)S1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H27FN4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=O)N1CCN(S(=O)(=O)C2=CC=C(C(=O)NC3=CC=CC(C4=NC=CS4)=C3)C=C2)CC1 ?",
"input": "",
"output": " C22H22N4O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CS(=O)(=O)C1=CC=C(NCCNC(=O)C2=CC=NC(OCC3=CC=CC=C3)=C2)C([N+](=O)[O-])=C1 ?",
"input": "",
"output": " C22H22N4O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1CC(C)CN(CC(C)NC(=O)C2=CC=C(CN3CCCC3=O)C=C2)C1 ?",
"input": "",
"output": "The molecular formula is C22H33N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1CN(CC2CCCN2C(=O)C2=CC=C(F)C(S(=O)(=O)N3CCCCC3)=C2)CC(C)O1 .",
"input": "",
"output": " C23H34FN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC(F)=C(S(=O)(=O)N(CC2=CSC=C2)C2CC2)C=C1OC . Can you tell me?",
"input": "",
"output": "Sure. It's C16H18FNO4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCC1=NC2=CC=C(NC(=O)C3=CC=CC=C3SCC(=O)NC(C)C)C=C2N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H28N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(Br)C(C(=O)NCC(=O)NC2=CC=C(C)C=C2Cl)=C1 ?",
"input": "",
"output": "The molecular formula is C17H16BrClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(C2=NC(C(=O)NC3=CC(NC(=O)C4CC4)=CC=C3C)=CS2)C(C)=C1 ?",
"input": "",
"output": " C23H23N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC1=NC(C)=C(C(=O)NCCS(=O)(=O)NCC2=CC=CC=C2)S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H21N3O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCN(CC)CCOC1=CC(NC(=O)C2=CC(S(=O)(=O)N(CC)CC)=CC=C2C)=CC=C1OC ?",
"input": "",
"output": "The molecular formula is C25H37N3O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN(CC)C(CNS(=O)(=O)C1=CC=C2C(=O)N(C)C(=O)C2=C1)C1=CC=CO1 ?",
"input": "",
"output": " C19H23N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(C)=CC(OCCN(C)C(=O)C2=CC=CC(F)=C2F)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H19F2NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=CC=C1C1=NOC(=O)N1CC1=NN=NN1C1=CC=C(S(C)(=O)=O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H16N6O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=NN(C2=CC=C(Br)C=C2)C(C)=C1C(=O)N1CCCN(C(=O)OCC(C)C)CC1 ?",
"input": "",
"output": "Sure. C22H29BrN4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC(C(=O)NC(CC(C)C)C2=CC=CC(C(F)(F)F)=C2)=CC(Cl)=C1OCC(N)=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H24ClF3N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(NCCC(=O)N1CCN(C2=NC=CC=N2)CC1)NC1=CC=CC=C1N1CCCC1=O into molecular formula.",
"input": "",
"output": " C22H27N7O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN(C)C(=O)C1=CC=CC(NC(=O)CN2CCCCC2C2=CC=C(C(F)(F)F)C=C2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C23H26F3N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1(C2=CC=C(Br)S2)NC(=O)N(CCCN2CCOC2=O)C1=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H16BrN3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN1CCN(C2=CC=CC=C2CNC(=O)CSC2=CC=C(C(F)(F)F)C=N2)CC1 .",
"input": "",
"output": " C20H23F3N4OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN(CC1=CC=C(OC(F)(F)F)C=C1)C(=O)C(C1=CC=CC=C1)N1CCCCC1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H23F3N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCOC1=CC=C(NC(=O)NC(C2=CC=CC=C2)C2=NNC(C)=N2)C=C1OCCC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C23H29N5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CN(C)C1CC(C)(C)C(CC(Br)(Br)Br)O1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H18Br3NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CNC(=O)C1CC(N)CN1C(=O)C1=CC=CC=C1NC(=O)C(C)C ?",
"input": "",
"output": "Sure. C17H24N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=NC2=C(CN3CCCC(CN4C=CN=C4)C3)C=NN2C(C)=C1 .",
"input": "",
"output": " C18H24N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=NOC(C)=C1CN(C)C(=O)C1=C(O)C=CC=C1O , what would be its molecular formula?",
"input": "",
"output": "It is C14H16N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(O)C1=CC=CC(C2=CC=C(C(=O)N3CCCN(C4=NC=CC=N4)CC3)C=N2)=C1 ?",
"input": "",
"output": " C22H21N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC1=CC(C2CC(=O)NC3=C2N=C2CCCCN23)=CC=C1OC . Can you tell me?",
"input": "",
"output": "Sure. It's C19H23N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(C)C1=CC=CC(CN2C=C([N+](=O)[O-])C=N2)=C1 ?",
"input": "",
"output": " C12H14N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1=NC(C2CN(C)CC2C(=O)N2CC(CO)CC(CO)C2)=C(C)N1 ?",
"input": "",
"output": "Sure. C19H32N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC=CC(=O)CCC[Si](OC)(OC)OC ?",
"input": "",
"output": "The molecular formula is C10H20O4Si .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(O)C1=CC=CC(OCCCS(=O)(=O)C2=CC=C(OCCCCCCCCO)C=C2)=C1O ?",
"input": "",
"output": " C24H32O8S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCCCCCCC=CC=CC(SCCC(=O)O)C(O)C1=CC=C(C2=NNN=N2)S1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C23H34N4O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COCCC(O)N1C2=CC=CC=C2C2=C1SC(C(=O)OC)=C2 ?",
"input": "",
"output": " C16H17NO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(N(C)CCOC2=CC=C(CC(NC(=O)OC(C)(C)C)C(O)CNCC(O)C(CC3=CC=CC=C3)N(C(=O)O)C(C)(C)C)C=C2)C=C1 ?",
"input": "",
"output": "Sure. C40H58N4O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(C(N)=NN)=NC(C2=CC(C)=CC(C(N)=NN)=N2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H18N8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NC(N)=NS(=O)(=O)C1=CC=C(NC(=O)C2=CC=C(F)C=C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H13FN4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=CC=C1OCC(=O)NC1=CC=C(S(=O)(=O)N=C(N)N)C=C1 into molecular formula.",
"input": "",
"output": " C16H18N4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule ClC1=CC=C(CNC2=CC=CC(C3=CNC4=NC=C(Cl)C=C34)=N2)C(Cl)=C1 .",
"input": "",
"output": " C19H13Cl3N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)=C(C)CC=NCCCN=CCC(C)=C(C)C .",
"input": "",
"output": " C17H30N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(NC1=CN=C(CBr)C=N1)C(=NOC1CCCC1)C1=CC=C(S(=O)(=O)C2CC2)C=C1 ?",
"input": "",
"output": " C21H23BrN4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by ClC1=CC=C2CCNCCC2=C1NCC1=CC=C(SC2CCCC2)C=C1 ?",
"input": "",
"output": " C22H27ClN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=CC1=CC(OC2=CC=CC=C2)=NC=C1[N+](=O)[O-] , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H8N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCCCCN(CCCCCCCC)C1=CC=C2C=C(C(=O)OC)C(=O)OC2=C1 into molecular formula.",
"input": "",
"output": " C27H41NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=CCOC1CC(N2C=C(I)C(=O)NC2=O)OC1CO[Si](C)(C)C(C)(C)C ?",
"input": "",
"output": " C18H29IN2O5Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=C(N=CC1=CC(Cl)=CC=C1OC1CCC(O[Si](C)(C)C(C)(C)C)CC1)O[Si](C)(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C24H40ClNO3Si2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1(COC2=C(N3CCN(S(=O)(=O)CC4=CNN=C4)CC3)C=NN(C3=CC(F)=CC(F)=C3)C2=O)CC1 ?",
"input": "",
"output": "Sure. C23H26F2N6O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(C2=NC3=C(C(=O)N4CCN(C(CO)C5=CN=C(OC)N=C5)CC4C)C=NN3C(C(F)(F)F)=C2C)C=C1 .",
"input": "",
"output": " C28H30F3N7O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCCCCN1CC2N(C(=O)CN(C)N2C(=O)NCC2=CC=CC=C2)C(CCC)C1=O , what would be its molecular formula?",
"input": "",
"output": "It is C25H39N5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN(C(=O)C1=CC2=C(S1)C1=CC(C(=O)N3CCC(O)C3)=CC=C1OC2)C1=CC=C(F)C=C1F ?",
"input": "",
"output": "Sure. C24H20F2N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1(C)CCC(C2=CC=C(Cl)C(F)=C2)N(CC(=O)NC2=CC=C3CC4(CC3=C2)C(=O)NC2=NC=CC=C24)C1=O .",
"input": "",
"output": " C30H28ClFN4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(NC1CCCC1)C1=CN=C(NC2=CC=CC(Cl)=C2Cl)N=C1C(F)(F)F .",
"input": "",
"output": " C17H15Cl2F3N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC(=O)CC1=NC(OC)=CC=C1C(=O)OCC ?",
"input": "",
"output": " C13H17NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(C(O)=C2C(=O)C(=O)N(C3=CC=C(C(F)(F)F)C=C3)C2C2=CC=C(C(=O)O)C=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C26H18F3NO6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CNCCC(OC1=CC=C(C(F)(F)F)C=C1)C1=CC=CC=C1 .",
"input": "",
"output": " C17H18F3NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CN=C2C(=C1)C1=C(O)C(C#N)=NC=C1N2P . Can you tell me?",
"input": "",
"output": "Sure. It's C12H9N4OP .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=CC1=CC=C(N(C2=CC=C(CO)C=C2)C2=CC=C(CO)C=C2)C=C1 ?",
"input": "",
"output": " C21H19NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=C(N2N=C(C3(O)CCC4(CC3)OCCO4)C=C2C2=CC=C(CO)C=C2)C=C1 .",
"input": "",
"output": " C25H28N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC(F)=CC=C1C1=CC(C)OC2=CC=C(C(=O)O)C=C12 .",
"input": "",
"output": " C18H15FO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC(=O)C(C)CC1=CC=C(O)C(O)=C1 into molecular formula.",
"input": "",
"output": " C11H14O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=S1(=O)CC2=CC=C(Br)C=C2C(N)=N1 into molecular formula.",
"input": "",
"output": " C9H9BrN2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(O)CC1CC2CCC1C2 ?",
"input": "",
"output": " C10H18O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(N)(C(=O)O)C12C3C4C1C1C2C3C41C(=O)O , what would be its molecular formula?",
"input": "",
"output": "It is C12H13NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " OC1CNC2CC[N-]C12;[CH3-];[U];[V];[W];[Y] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C7H14N2OUVWY-2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(NC1=CC(C)=NN1C)N1N=NC2=CC=CC=C21 ?",
"input": "",
"output": "Sure. C14H18N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)[C-](F)F;[W] ?",
"input": "",
"output": "The molecular formula is C4H5F2O2W- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)=C(N)C(CCC(=O)O)C(C)(CC(=O)O)C(C)C1N=C(C(C)=C2N=C(C=C3N=CC(C)(CC(=O)O)C3CCC(=O)O)C(C)(C)C2CCC(=O)O)C(C)(CCC(=O)O)C1CC(=O)O ?",
"input": "",
"output": "The molecular formula is C46H66N4O14 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)N1CCN(C(=O)C2=CC=C(NC3=NC=CC(C4=CC=C(S(=O)(=O)N5CCOCC5)C=C4)=N3)C=C2)CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C27H30N6O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=C(C(CC(C)C)O[Si](C)(C)C(C)(C)C)C=CC2=C1C(=O)OCC1=CC(CBr)=CC(OCCC(C)C)=C1O2 ?",
"input": "",
"output": " C32H47BrO6Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CSC(=N)C1=CC=NC(Cl)=C1 ?",
"input": "",
"output": "Sure. C7H7ClN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=C(CNC(=O)C2=CC(NC(=O)C3=CC(F)=C(F)C=C3Cl)=NN2)SC=N1 ?",
"input": "",
"output": "Sure. C16H12ClF2N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCC1=CC=C(C2=CC3=C(C=C2C)OC2=CC(C)=C(C4=CC=C(CCCC)C=C4)C=C23)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C34H36O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)C[N+]1(CC(C)C)CC2=C(C3=CC(F)=C(F)C(F)=C3)C=C3C=CC=CC3=C2C2=C(C1)C(C1=CC(F)=C(F)C(F)=C1)=CC1=CC=CC=C21 . Can you tell me?",
"input": "",
"output": "Sure. It's C42H36F6N+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(C)C1=CC2=C(C=C1SSO)NC(=O)N2 .",
"input": "",
"output": " C11H14N2O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of NC1CCN(C2=NC3=C(C=C2F)C(=O)NC(=O)N3C2CCC2)C1 ?",
"input": "",
"output": "The molecular formula is C15H18FN5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)(C)OC(=O)NC1CCC(NC2=CC=CC=C2[N+](=O)[O-])CC1 ?",
"input": "",
"output": " C17H25N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(C(C)C2=CC(C)=C(O)C=C2O)=C(O)C=C1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H18O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCCCCCCCC=CCC(C)CCC ?",
"input": "",
"output": " C18H36 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC(C)=CC(C2=C3C=NC4=CC=CC=C4C3=C(C3=CC=C4C=CC=CC4=C3)C3=CC=CC=C23)=C1 into molecular formula.",
"input": "",
"output": " C35H25N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CB(O)NC(CC(C)C)C(C)=O ?",
"input": "",
"output": " C8H18BNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCN(C)C1=NC(S(C)(=O)=O)=NC(N)=C1[N+](=O)[O-] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C8H13N5O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(C)OC(=O)NC1=CC=C(NC(=O)NC2=NOC(C(C)(C)C)=C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H26N4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(=O)C1=CNC2=C(F)C(F)=C(F)C=C2C1=O ?",
"input": "",
"output": " C11H6F3NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C1C(CN2CCC3=C2C=CC(F)=C3Cl)CCN1C1=CC=C(S(=O)(=O)NC2=NC=CS2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H20ClFN4O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CON1CC(=O)CC(NP)C1=O ?",
"input": "",
"output": " C6H11N2O3P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=C(C)C(=O)OC(C)(C)CCOC(=O)C1=CC=CC=C1 .",
"input": "",
"output": " C16H20O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(CCC1=CC=C(NC2=NC=C3CC(C4=CC=C(Br)C=C4)C4=CC=CC=C4C3=N2)C=C1)C1CCCCC1 .",
"input": "",
"output": " C33H35BrN4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1(C(=O)C2=CNC3=NC=C(C4=CC=CC(NC5CCCC5)=C4)N=C23)CCCCC1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H30N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC(=O)CC(N)C(=O)N1CCC(CCN2C(SC3=CC4=C(C=C3Br)OCO4)=NC3=C(N)N=CN=C32)CC1 ?",
"input": "",
"output": " C23H27BrN8O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC(=O)NC(C(=O)N1CCCC1C1=NC=C(C2=CC=C3C=C(C4=CC=C(C5=CN=C(C6CCCN6C(=O)OC(C)(C)C)C5)C=C4)C=CC3=C2)N1)C(C)C .",
"input": "",
"output": " C43H50N6O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(NC1CCCCC1)N1CCC2=CC(OCCCN3CCCCC3)=CC=C2C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H37N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1CN(CC2(CO)CC2)CCN1S(=O)(=O)C1=CC=C(C(C)(O)C(F)(F)F)C=C1 .",
"input": "",
"output": " C19H27F3N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1NC(=O)C(C)N(C)C(=O)C2CCCN2C(=O)C(NC(=O)C(CC2=CC(F)=CC(F)=C2)NC(=O)CCC2CCCCC2)COC(=O)C2CC(N)CN2C1=O ?",
"input": "",
"output": "The molecular formula is C38H53F2N7O8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC1=NC(N)=C2C=NN(C3=CC=NC=C3)C2=N1 ?",
"input": "",
"output": " C12H12N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(C#CC2=CC=C(C#CC3=CC=CC=C3)C(F)=C2)C=C1F ?",
"input": "",
"output": "Sure. C23H14F2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=NN(C2=CC(SOOO)=CC=C2S(=O)(=O)O)C(=O)C1=CC1=C(C)NN(C2=CC(SOOO)=CC=C2S(=O)(=O)O)C1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C21H18N4O14S4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(=O)NCC1C[N+](C2=CC=C(C3=CC=C(CNC(=O)C4=CC=CC=C4C(=O)O)C=C3)N=C2)=CO1 ?",
"input": "",
"output": " C26H25N4O5+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CCC1=C(OCC2=CC=CC=C2)C=CC=C1C(O)C#CCCC(CCCCCCC)OC1CCCCO1 .",
"input": "",
"output": " C34H46O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=C1C2CC(OC(C)=O)C3C4(CCCC(C)(C)C4C=O)COC(=O)C3(C2)C1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H30O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)C(C)NC(=O)C1CCN(CN2N=CC3=CC=CC=C3C2=O)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H28N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(=O)NC1=CC=C(C)C=C1OCC(=O)NC1=CC=C(C)C=C1Cl ?",
"input": "",
"output": "Sure. C18H19ClN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1CCCN(CC2=CC=C(CNC(=O)C3=CC=CC=C3CSC3=NC=NN3)C=C2)C1 into molecular formula.",
"input": "",
"output": " C24H29N5OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=CC(CCCOC(=O)C2=CC=C3OCOC3=C2)=N1 ?",
"input": "",
"output": " C17H17NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COCCN1C=C(NC(=O)C2CCN(C(=O)N(C)C)CC2)C=N1 .",
"input": "",
"output": " C15H25N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)C(=O)N1CCN(CCC(=O)NC2=CC=C(Br)C=C2)CC1 ?",
"input": "",
"output": "Sure. C18H26BrN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=CC(C(=O)NCC(=O)NC2=CC=C(Br)C=C2O)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H15BrN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(NC(=O)CC1=C(Cl)C=CC=C1Cl)C1=CC=CC=C1OCC(=O)N(C)C .",
"input": "",
"output": " C21H24Cl2N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)NC(=O)NCCN(C)CC1=CC=CC=C1 ?",
"input": "",
"output": " C14H23N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(Cl)C=C1NC(=O)CN1CCC(NC(=O)NC2=CC=CC=C2)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C21H25ClN4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN(CC1CCCO1)S(=O)(=O)C1=CC=CC=C1C(F)(F)F .",
"input": "",
"output": " C14H18F3NO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=CC(SCC(=O)NC2=CC=C(S(N)(=O)=O)C=C2)=C1 ?",
"input": "",
"output": " C15H16N2O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCOC1=CC=CC=C1NC(=O)C(C)(C)C ?",
"input": "",
"output": " C14H21NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC(=O)NC1=CC(C(N)=O)=CC(C(N)=O)=C1 ?",
"input": "",
"output": " C11H13N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC1=CC=C(SCC(=O)N2CCOCC2)C=C1 ?",
"input": "",
"output": " C14H19NO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C1CCN(C2=CC=CC(Cl)=C2C#N)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H17ClN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(C(C)NCC2=CSC=N2)C=C1Br .",
"input": "",
"output": " C13H15BrN2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)C1=NOC(CSC2=CC=C(O)C=C2)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H14N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(NCC1=CC=C([N+](=O)[O-])C=C1)C1=CC=CC=C1O into molecular formula.",
"input": "",
"output": " C15H16N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1CCCCC1N(C)C(=O)C(C)(N)C1CC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H26N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code N#CC(NC1=CC=CC=C1)C1=CC=C(SC(F)(F)F)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H11F3N2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=NC=CC(CNCC2CC2)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H15N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CNCC1=CC=CC=C1C1=CC=C(F)C=C1F .",
"input": "",
"output": " C14H13F2N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN1CCCN(S(=O)(=O)C2=CSC(C(=O)O)=C2)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H16N2O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of FC1=CC=CC(CNC2=CC=CC(F)=C2F)=C1 ?",
"input": "",
"output": "The molecular formula is C13H10F3N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1C=C(S(=O)(=O)N2CCCC(NS(C)(=O)=O)C2)C(N)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C10H19N5O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)C(NC(=O)NC1=CC=CC(F)=C1F)C(=O)O ?",
"input": "",
"output": "The molecular formula is C12H14F2N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=S(=O)(NCCN1CCCCCC1)C1=CN=C(Cl)S1 ?",
"input": "",
"output": " C11H18ClN3O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCNCC1=CN(C2=CC(C)=CC(C)=C2)N=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H19N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)NCC(=O)OCCOC(C)C ?",
"input": "",
"output": "Sure. C10H21NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=NC(CNC2CC3CC=CC32)=CS1 ?",
"input": "",
"output": "The molecular formula is C12H16N2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CNC(C1=CC=C(F)C(F)=C1)C1=NC=CS1 ?",
"input": "",
"output": "Sure. C11H10F2N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COCCCNC(=O)C(C)N(C)C1=CC=NC=C1N ?",
"input": "",
"output": "The molecular formula is C13H22N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCC(=O)CC(=O)C1=CC=CC2=CC=CC=C12 ?",
"input": "",
"output": " C16H16O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CSC1=CC=C(C(=O)CN(C)CC2CCCCO2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C16H23NO2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCC(C)(N)CNCCC1=CC=CO1 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H22N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of FC(F)(F)COCCNCC1CCOC1 ?",
"input": "",
"output": " C9H16F3NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)N(CCC#N)CCOCCO , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H20N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CNS(=O)(=O)C1=CN(C)C(C(=O)N(C)CC(C)C(=O)O)=C1 ?",
"input": "",
"output": " C12H19N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)N(CCCOC1=CC=CC=C1CN)CC(F)(F)F ?",
"input": "",
"output": " C15H23F3N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(N)C(C1=CC=C(OC)C=C1)N1N=C(C)N=C1C ?",
"input": "",
"output": "Sure. C15H22N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(N)C(OCC1=CC=CC=C1)C1=CC=C(F)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H20FNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCN1CCN(C(C2=CC(Br)=CS2)C(C)N)CC1 ?",
"input": "",
"output": " C13H22BrN3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCN(CCCC(=O)N(C)C)CC1=CC=CC(N)=C1 ?",
"input": "",
"output": "The molecular formula is C16H27N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC1=CC=C(C(O)CN2CCOC(C)(C)C2)C=C1 .",
"input": "",
"output": " C16H25NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C=C1C2=CC=CC=C2C(=O)N1CC1CCCNC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCNC(C)(C#N)CCN(C)C(CC)CC ?",
"input": "",
"output": " C14H29N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=CC(SCC(N)C(N)=O)=C1 ?",
"input": "",
"output": " C10H14N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC1CCN(C2=CC(C(=O)O)=C(N)C=C2F)CC1 ?",
"input": "",
"output": "The molecular formula is C14H19FN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC(=O)CCN(C)CC1=CN2C=C(C)C=CC2=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H19N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCC(=O)CSC1=NC2=CC=CC=C2N1 ?",
"input": "",
"output": " C12H14N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CNCC1=CC=C([N+](=O)[O-])C(OCC(=O)NC(C)(C)C)=C1 ?",
"input": "",
"output": " C14H21N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCNCCC1=NN=C(C2=CC=CC(C)=C2[N+](=O)[O-])O1 ?",
"input": "",
"output": " C14H18N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)N(CC1CC1)C1=NC=C(Br)C=C1CN , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C13H20BrN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=CC(CNC(=O)C2CC(O)CN2)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H17N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C1CNCCN1CC1=CC(F)=CC=C1Br into molecular formula.",
"input": "",
"output": " C11H12BrFN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=CC(CC(=O)N(C)C2=CC=C(N)C=C2)=C1 ?",
"input": "",
"output": "Sure. C16H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CNC1=NC(C(=O)NC2CCC2)=CC2=CC=CC=C12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H17N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=C(COC2=CC=C(F)C=C2)C=C(CN)O1 into molecular formula.",
"input": "",
"output": " C13H14FNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCNC(=O)CCNC1=CC=C(Cl)C=C1C(N)=S .",
"input": "",
"output": " C13H18ClN3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(SCCNC2CCS(=O)(=O)C2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H19NO3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COCCNCCN(C)C1=CC=C(F)C=N1 .",
"input": "",
"output": " C11H18FN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of OCCC1CCCCN1CCC(O)C1=CC=CC=C1Cl ?",
"input": "",
"output": "The molecular formula is C16H24ClNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(C)N(CCOC)CC(=O)N1CCC(C(=O)O)CC1 .",
"input": "",
"output": " C15H28N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(NC1=NNC2=CC=CC=C12)C1=CC(Cl)=CN1C1CC1 ?",
"input": "",
"output": "Sure. C15H13ClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCN1C=NN=C1CCCNC1=CC=CC=C1 ?",
"input": "",
"output": "Sure. C13H18N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CSC(NC(=O)C(C)CCl)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C8H11ClN2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for NC1=NNC(C(=O)NCC2=NC3=CC=CC=C3S2)=N1 .",
"input": "",
"output": " C11H10N6OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(NC1=CC(F)=C(F)C=C1F)C1=CC=C(Br)C=C1O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H7BrF3NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COCCN(C)CCNC(=O)C1CCCC(N)C1C ?",
"input": "",
"output": " C14H29N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCNCC(C)C(=O)NCCCN(C)C1=CC=CC=C1 ?",
"input": "",
"output": " C16H27N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN1C(SC2=CC=CC(F)=N2)=NNC1=O .",
"input": "",
"output": " C9H9FN4OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC(NC1=CC=CC2=CC=CC=C12)C(N)=O ?",
"input": "",
"output": " C14H16N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCN1C=CN=C1CNC1=CC(Cl)=CC(Br)=C1OCC into molecular formula.",
"input": "",
"output": " C15H19BrClN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(C1=CC=C(CN)C=C1)C1=NC=CC=C1F ?",
"input": "",
"output": " C13H14FN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN(C1=CC=C(C#N)C=C1)S(=O)(=O)C1=CC(Cl)=CC=C1Cl ?",
"input": "",
"output": "The molecular formula is C14H10Cl2N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NNC1=CC=C(C(=O)N2CCN3C=CN=C3C2)C=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H14N6O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(O)COC1=C(Br)C=CC=C1CNC(C)(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C15H24BrNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(C)CNCC1=CC2=C(C=C1OCC(C)(C)O)OCO2 into molecular formula.",
"input": "",
"output": " C16H25NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCN(CC)C(=O)COC1=CC=CC2=C1CCC2O . Can you tell me?",
"input": "",
"output": "Sure. It's C15H21NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C=C(Cl)CN1CCCC(C)(C(=O)O)C1 ?",
"input": "",
"output": "Sure. C10H16ClNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C1=CC=C(C2(CN3CCSCC3)CCNCC2)C=C1 ?",
"input": "",
"output": "The molecular formula is C16H24N2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1(C)CCN(C(=O)C2=CC(N)=C(Cl)C(Cl)=C2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H20Cl2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC(CN)CCN1CCC(N(C)C)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H27N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN(C(=N)C1CCCCC1)C1=CC=CC=C1F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H19FN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN(C)CCC1=NC(C2CCCNC2)=NO1 ?",
"input": "",
"output": "Sure. C11H20N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NCCNC(=O)C1CCCN(CC2=CC=CC=N2)C1 ?",
"input": "",
"output": "Sure. C14H22N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(O)C1=C(OCCN2C=CC=N2)C=CS1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H10N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCNC(C)CC1=NC(C(C)(C)C)=NO1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H23N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(N)C1=C(F)C=CC=C1OC1=CC=C(Cl)C(Cl)=C1 .",
"input": "",
"output": " C14H12Cl2FNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCC1=CC=C(CC2=C(CCC)N=C(N)S2)C=C1 ?",
"input": "",
"output": " C17H24N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCC1CCC(NC)C(CCCOC2=CC=CC=C2)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H31NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1CC2=CC=CC=C2N(CC(=O)NCCO)C1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H20N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCN(CC1CC(C(C)(C)C)CCC1O)C1CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H35NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(C)C1CCC(C(=O)C2=CC=C(Br)C=C2)CC1 ?",
"input": "",
"output": "The molecular formula is C17H23BrO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(C)N(CC)C1=CC(OC(F)F)=C(F)C=C1N ?",
"input": "",
"output": "The molecular formula is C13H19F3N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C(CCN(C)CC1CCCC1)NC1CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H30N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN(CCNS(=O)(=O)CCl)C1CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C7H15ClN2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)NC(C)(C#N)CCCCN(C)CC1CCCOC1 ?",
"input": "",
"output": " C17H33N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1CCN(C(=O)C(CN)CC2CCCOC2)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H27N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(CCN(C)C)NCC1CCCOC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H26N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)CC(CN)NS(=O)(=O)C1=CC=CC(Cl)=C1F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H18ClFN2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(N)(CC1=CC=CO1)C(F)(F)F ?",
"input": "",
"output": "The molecular formula is C8H10F3NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of OC1(CNCC2=CC=C(C3=CC=CC=C3)S2)CCCC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H21NOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=C(C)C(C(O)COCC2=CC=CC=C2F)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H19FO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(CCC1CCCCO1)CC1=CC=CC=C1Cl , what would be its molecular formula?",
"input": "",
"output": "It is C15H19ClO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC(N)C1=CC=CC=C1OCC1=CC=CC(OC)=N1 into molecular formula.",
"input": "",
"output": " C16H20N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(C(O)CN2CCCC(C)(C)C2)C=C1 ?",
"input": "",
"output": " C16H25NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=CC(C(=O)NC(C#N)C2CC2)=C1C ?",
"input": "",
"output": "The molecular formula is C14H16N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(C(=O)N2CCC(CN)C2)=NN1 ?",
"input": "",
"output": "The molecular formula is C10H16N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCNCC1=CC(C)=NC(C2CC3CCC2O3)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H23N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule N#CCSC1=CC=CC=C1C(=O)N1CC(C(=O)O)C1 .",
"input": "",
"output": " C13H12N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(O)C1CN(C(=O)CC2=CC=CC=C2Cl)C1 into molecular formula.",
"input": "",
"output": " C12H12ClNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=C(C(=O)O)SC(SCC2OCCC3=CC=CC=C32)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H15NO3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C1CCN(C(=O)C(F)(F)F)C2=CC=CC=C12 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H8F3NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(COC)NC1=CC=CC=C1OC(F)F . Can you tell me?",
"input": "",
"output": "Sure. It's C12H17F2NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation NC1=NC=CC=C1S(=O)(=O)NCC1CCC(=O)N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H14N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCN1C=CN=C(OCC(N)(CC)CC)C1=O , what would be its molecular formula?",
"input": "",
"output": "It is C12H21N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCN(C1=CC=CC(C(N)=S)=N1)C(C)CC into molecular formula.",
"input": "",
"output": " C14H23N3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(O)CC1CN(C(=O)N(CC2CC2)CC2CC2)C1 .",
"input": "",
"output": " C14H22N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CNC(CS(=O)C1=CC=CC(C)=C1)C1=CC=C(C)C=C1C ?",
"input": "",
"output": " C18H23NOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1CC(C)CC(OCCNCC(F)(F)F)C1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H22F3NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1CCC(NC(=O)C2=NC(N)=NN2)CC1C ?",
"input": "",
"output": " C11H19N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCNC(=O)C1=CC=CC(NC2CC(C)CC(C)C2)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H28N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC1=CC=CC(N2C(C(C)C)=CNC2=S)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H18N2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1(C)CN(CCC2=CSC=C2)C2(CCCC2)CN1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H28N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCN1C(=O)C(CC)(CC)NC(=O)C1C into molecular formula.",
"input": "",
"output": " C12H22N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCC1C(=O)NC(C)(CC)C(=O)N1CC1=CC=C(Br)S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H21BrN2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1CNC(CC(C)C)CN1C1=C(F)C=CC=C1F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H24F2N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC1=CC=C(CNC2(CCl)CCCC2)C=C1 ?",
"input": "",
"output": "The molecular formula is C15H22ClN .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCOC1=CC=C(NC2CCCOCC2)C=C1Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H22ClNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CC(C)OC1=CC=CN=C1Cl ?",
"input": "",
"output": " C9H10ClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(C(O)CCC2=CSC=C2)C(C)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C15H18OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=NN(C)C=C1C1=CSC(CNC(C)(C)C)=N1 .",
"input": "",
"output": " C13H20N4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COCCOCCNC(=O)NCC(C(=O)O)C(C)C ?",
"input": "",
"output": " C12H24N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=C(C)SC(CNC2=CC=C(N)C=C2)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C13H16N2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(CC#N)N(C)CCC(C)(C)C#N ?",
"input": "",
"output": "The molecular formula is C11H19N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(Br)=C(C(N)CC2(CC(N)=O)CCCC2)S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H21BrN2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=C(C(=O)NCCC(C)(C)CCC(=O)O)C(C)=C1 .",
"input": "",
"output": " C17H25NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(CN1C=C(Br)C=CC1=O)NC(CO)CO ?",
"input": "",
"output": " C10H13BrN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOCOC1=CC=C(CC(=N)N)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H16N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1CC(CN)(NC2=CC=CC=C2Br)CCO1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H19BrN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(CCN(C)C)NS(=O)(=O)C1CCNC1 , what would be its molecular formula?",
"input": "",
"output": "It is C10H23N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1CN(CC2(CC#N)CC2)CC(C)(C)O1 ?",
"input": "",
"output": " C13H22N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN(CCC(F)(F)F)C1=CC=CC(Cl)=C1C(=O)O ?",
"input": "",
"output": " C11H11ClF3NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=C(Br)C=CC=C1C(=O)NCC1CCCCC1O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H20BrNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(CC1=NC=NN1C)C(C)Cl .",
"input": "",
"output": " C9H16ClN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN1N=CN=C1CN1N=CN=C1CNC1CC1 .",
"input": "",
"output": " C11H17N7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(NCCO)C1=CC=NC(Cl)=C1[N+](=O)[O-] ?",
"input": "",
"output": "Sure. C8H8ClN3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(Br)C=C1C1=NN=C(CNC(C)C)S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H16BrN3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=S(=O)(C1=CNC(CCl)=C1)N1CCN(C2=NC=CS2)CC1 ?",
"input": "",
"output": "Sure. C12H15ClN4O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCNCC1=CC(S(=O)(=O)N(C)C(C)C2CC2)=C(C)O1 .",
"input": "",
"output": " C15H26N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=NN(C)C(CN2CCN(CC(N)=S)CC2)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H21N5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=NN(CC2=CC(C)=NN2C)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C10H14N4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=NN(C)C(CN2C=C(CNCC(C)C)C=N2)=C1Br into molecular formula.",
"input": "",
"output": " C14H22BrN5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NCC1CCCC1COC1=CC=NC=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H18N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCC1(O)CN(S(=O)(=O)C2=CC=CC(C(=O)OC)=C2)C1 ?",
"input": "",
"output": " C14H19NO5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)CC(C)(O)CNC(=O)C1=CC([N+](=O)[O-])=CC=C1Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H19ClN2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CNS(=O)(=O)C1=CC=C(N(C)C2CNC2)C=C1 ?",
"input": "",
"output": " C11H17N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN(CC)CCSC1=CC=C(Cl)C=N1 .",
"input": "",
"output": " C11H17ClN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC1=CC=C(NC(=O)C2COCC2N)C=C1Cl ?",
"input": "",
"output": "The molecular formula is C13H17ClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCNC1COCC1C(=O)NC1=CC(OC)=CC(OC)=C1 ?",
"input": "",
"output": " C15H22N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCNCC1=CC(C2=CN=CC=C2C)=CC=C1F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H19FN2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(NC1=NNC(N)=N1)C1=NN=CN1C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C7H12N8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCNC1=NC(C2CCCC(C)C2)=NC(CC)=C1Br , what would be its molecular formula?",
"input": "",
"output": "It is C15H24BrN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC1CC(OC2=CC=C(C3=CC=CC=C3)C=C2)C1 ?",
"input": "",
"output": " C16H17NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CNCC1=CC=CN1CC1=CC=C(Cl)C(Cl)=C1 .",
"input": "",
"output": " C13H14Cl2N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=C2N=CC=C(Br)C2=C1Cl ?",
"input": "",
"output": "The molecular formula is C10H7BrClN .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCOC1=CC(CNCCCOC)=C(Br)C=C1OCC1=CC=C(F)C=C1Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H24BrClFNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC12C=CC(=O)C=C1C(F)CC1C3CC4CN(C5=CC=CC(F)=C5)OC4(C(=O)SCF)C3(C)CC(O)C12F ?",
"input": "",
"output": "The molecular formula is C28H29F4NO4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(NC1=CC=CC2=C1C=NN2)NC1CCC(C2=CC=CC=N2)C1 ?",
"input": "",
"output": "Sure. C18H19N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COCCOC1(C(=O)O)CCC(C2=NC3=CC=NN3C(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)=C2)CC1 .",
"input": "",
"output": " C28H50N4O6Si2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CCC(=O)C1CCCN1 .",
"input": "",
"output": " C8H13NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(CC(=O)NC1CCCC(N2CCC(N(C)C)CC2)C1)C1C2=CC=CN2CCN1S(=O)(=O)C1=CC=CC(C(F)(F)F)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C31H44F3N5O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(COC2=CC=CC3=C2C(NC2=NC(SC)=NC=C2C(=O)O)=NN3C2=CC=CC=N2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C26H22N6O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)C1(O)CC2=C(O)C3=C(C(=O)C4=CC=CC=C4C3=O)C(O)=C2C(OC2CC(N)C(O)C(C)O2)C1;O=P1(NCCCl)OCCCN1CCCl ?",
"input": "",
"output": " C33H42Cl2N3O11P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(NC(=O)N1CCNCC1COC1=CC=CN=C1)C1=CC=CC=C1 ?",
"input": "",
"output": " C19H24N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)(C)OC(=O)C1(CCl)CNCCO1 .",
"input": "",
"output": " C10H18ClNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCN1CCCC1CNC(=O)CC1=NNC(=O)C2=C1CCCC2;Cl . Can you tell me?",
"input": "",
"output": "Sure. It's C17H27ClN4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN(C)C(=O)C1CNCCOC1C1=CC=C(Cl)C(Cl)=C1;Cl ?",
"input": "",
"output": "The molecular formula is C14H19Cl3N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of OCC1(F)CCN(CC2=CC=CC=C2)CC1 ?",
"input": "",
"output": " C13H18FNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)C(N(C)C)C12CC3=C(C=C1CCN(S(=O)(=O)C1=CC=C(C(C)(C)C)C=C1)C2)NN=C3 . Can you tell me?",
"input": "",
"output": "Sure. It's C26H38N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)(C)C(=O)NC1=CN=CC=C1C(O)C1=CC=C(F)C=C1Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H18ClFN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC12CCCCC1=CCC1C2CCC2(C)C1CC(=O)C2(O)O ?",
"input": "",
"output": " C19H28O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NC1=CC=CC(C2=C(C3=CC=NC=C3)C=NN2)=C1)C1CC1 ?",
"input": "",
"output": "The molecular formula is C18H16N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC(=O)CC1CCCC2=C1C=C1C=C(O)C=CN21 .",
"input": "",
"output": " C16H19NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC=C1OC(=O)OCCCCC1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C18H20O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CSC1=CC(N)=NC(CO)=C1 ?",
"input": "",
"output": " C7H10N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(C)C(CNC(=O)NC1=CC=NC=C1)NC(=O)C1(NC(=O)C(NC(=O)CC2=CC=CC=C2F)C(C)CC)CCC2=C(C1)C1=CC=CC(C(F)(F)F)=C1N2 .",
"input": "",
"output": " C40H47F4N7O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C2C=CC(S(=O)(=O)NC3CCN(CC4=CC=CC(C(=N)N)=C4)C3=O)=CC2=N1;O=C(O)C(F)(F)F .",
"input": "",
"output": " C24H24F3N5O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC1=CC(CN2CCC(NC3=CC=C(OCCCO)C=N3)CC2)=CC(OCC)=C1C1=CC=C(F)C=C1 into molecular formula.",
"input": "",
"output": " C30H38FN3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCN(CC)CCNC(=O)C1=CN2C=C(I)C=CC2=N1;Cl;Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H21Cl2IN4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=C(OCC2=CC=CC(N)=C2C)C=C(C2=CN=C3C=CC=CN23)S1 ?",
"input": "",
"output": " C20H19N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC(=O)C1CCC(O)(C2=NC=C(C3=CC(C)=CC(NC4=NC=CC(C5CCC5)=N4)=C3)S2)CC1(C)C ?",
"input": "",
"output": " C28H34N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(O)N(C1=CC=CC=C1)C1=NC2=CC=C(SC3=CN=C4N=CC=CN34)C=C2S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H13N5O2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC(C1=NC=NN1)S(C)=O;O=[P+](O)O ?",
"input": "",
"output": " C6H13N3O4PS+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)C1=CC(C2=CC=CC(OCC3=CC=NC=C3)=C2)=CC(C(C)C)=C1NC(=O)N(C1=CC2=CC=CN=C2NC1=O)C(C)C ?",
"input": "",
"output": "Sure. C36H39N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)CC(NCCC1=CC=CC=C1)C(N)=O;Cl , what would be its molecular formula?",
"input": "",
"output": "It is C14H23ClN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1CC2C3CCC4N(C)C(=O)CCC4(C)C3CCC2(C)C1C(C)OC(N)=O ?",
"input": "",
"output": "Sure. C23H38N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=NC=C([N+](=O)[O-])N1CCO;[Cl-] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C6H9ClN3O3- ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(NC1CNCCCC1OCC1=CC(O)=C(C(=O)C2CCCCC2C(=O)O)C(O)=C1)C1=CC=C(O)C=C1;O=C(O)C(F)(F)F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C30H35F3N2O10 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CNCCCC1(NC2=CC=CC=C2)CC2=C(C=C1NC1=CC=CC=C1)C(=O)NC2=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H26N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C1CCC2(C=CC3=CC=CC=C3O2)C1 .",
"input": "",
"output": " C13H12O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1(C2=NC(C3=C4C(=O)N(C5(C)CCCO5)C5=C(F)C=CC=C5N4C=N3)=NO2)CC1 ?",
"input": "",
"output": "The molecular formula is C21H20FN5O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation OCC1CCN2CCN(C3=NOC4=CC=CC=C34)CC2C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H21N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(C)OC(=O)NCC(O)C(=O)NC1=CC=CC(C2=CC=C(OC3=CC=C(F)C=C3)C=C2)=N1 ?",
"input": "",
"output": "The molecular formula is C25H26FN3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule NC1=NC(C2=C3C=C(F)C=NC3=NN2)=NC=C1F .",
"input": "",
"output": " C10H6F2N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC(=O)NC1=NC2=CC=CC=C2N1C(=N)OC1=CC=C(C2=CC=CC=C2)C=C1 into molecular formula.",
"input": "",
"output": " C23H20N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COCOC1=CC2=C(C(=O)OC(C)(C)C2)C(OCOC)=C1C ?",
"input": "",
"output": " C16H22O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(NC(=O)OCC1C=CC=CC1)C(=O)NCC(=O)C1=CC=C(Br)C=C1 ?",
"input": "",
"output": " C19H21BrN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CNC1C(O)C(OC2C(NC(=O)C(O)CC(O)CN)CC(N)C(OC3OC(CNCCO)CCC3N)C2O)OCC1(C)O , what would be its molecular formula?",
"input": "",
"output": "It is C26H52N6O11 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(=O)NC1CCN(C(=O)C2CC3=NC=CC(OC4=CC=C(NC(=O)NC5CC5)C=C4F)=C3S2)C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H26FN5O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)NC1C(N=C(N)N)C=C(C(=O)O)OC1C(OC(C)=O)C(COC(C)=O)OC(C)=O ?",
"input": "",
"output": " C18H26N4O10 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(=O)CNC(=O)C1COCCCCOCC(NC(=O)C2CCCN2C(=O)C2CCCN2C(=O)OC(C)(C)C)C(=O)NC(C(C)C)C(=O)NC(C(C)C)C(=O)N1 ?",
"input": "",
"output": "Sure. C38H63N7O12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(C2=CC3=NC(CN4CCOCC4)=NN3C(NCCNC3=CC=C(C#N)C=N3)=N2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H27N9O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C2SCC=NCC2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C10H11NOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(C1=NC(C2=CC=CC(Cl)=C2)=C2N=CC=CN12)N1CCC(O)(C2=CC=CC=C2)C2CCCCC21 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C28H27ClN4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC1=CC(OC)=C(F)C(C(NC2=CC=C3C(N)=NC=CC3=C2)C(=O)N2CCC(C(=O)O)C2C2=CC=CC=C2S(=O)(=O)CC)=C1;O=C(O)C(F)(F)F . Can you tell me?",
"input": "",
"output": "Sure. It's C35H36F4N4O8S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NC1=CN=CC=C1CN1CC(=O)N(C2=CC=C(S(=O)(=O)C(F)(F)F)C=C2)C1=O)C1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C23H17F3N4O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(=O)OCC1OC(C2=CC(CC3=CC=C(OCC4=CC=CC=C4)C=C3)=CC=C2CO)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O .",
"input": "",
"output": " C35H38O11 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=CC=C1C1=CSC(N2CCC(S(=O)(=O)C3=CC=C(Cl)C(Cl)=C3)CC2)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H20Cl2N2O2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1CN2C3=CC=C(C(=O)O)C=C3C(=O)C3(CNC(=O)NC3=O)C2C(C)O1 ?",
"input": "",
"output": " C18H19N3O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN(CC1=CC=CC(OC)=C1)C(=O)NC1=CC=C(C2=CNN=C2)C=C1N(C)CCN .",
"input": "",
"output": " C23H30N6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule OC1=CN=CC(C2CC2COC2=CC=CC=C2)=C1 .",
"input": "",
"output": " C15H15NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1C(Cl)=CC=C1OC(=O)NC1CCCC(O)(C#CC2=CC=CC(Cl)=C2)C1 , what would be its molecular formula?",
"input": "",
"output": "It is C20H20Cl2N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(NC12CC3CC(CC(C3)C1)C2)N1CCN(C2=CC=C(C3=CC=CC=N3)C=C2)C2=CC=CC=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C30H32N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)NC(C(=O)N1CCCC1C1=NC2=CC=C(C3CCC(C4=CC=C5N=C(C6CCCN6C(=O)C(NC(=O)O)C(C)C)NC5=C4)N3C3=CC=C(C(F)(F)F)C=C3)C=C2N1)C(C)C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C46H54F3N9O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NC1=CC=C(NC2=CC3=C(C=N2)C=NN3C2CCC3=CC=CC=C32)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C21H19N5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN=C1SC(CN2CCN(C(=O)O)CC2)=C(C)N1C ?",
"input": "",
"output": " C12H20N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C[Si](C)(C1=CC=CC=C1)C1CC(N2C=NC3=C(OCC4=CC=CC=C4)N=C(N)N=C32)C(O)(CO)C1COCC1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C34H39N5O4Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NCC1CC(NS(=O)(=O)C2=CC(Cl)=CC=C2Cl)CN1C(=O)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H15Cl2N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CNC(=O)COCC#CC1=CC(Cl)=C(N)C2=C1OCO2 ?",
"input": "",
"output": " C13H13ClN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC1=CC(F)=CC(C)=C1C(=O)NC(CC1=CC=C(C2=CN=C(CNC3=NC4=CC=CC=C4N3)N2)C=C1)C(=O)O ?",
"input": "",
"output": "The molecular formula is C30H29FN6O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(=O)N1CCN(C2=CC=C(C3=CC(C(=O)NCC4CCC(CNC(=O)O)CC4)=C4C=CC=CC4=N3)C=N2)CC1 ?",
"input": "",
"output": "The molecular formula is C30H36N6O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCN1C=NC2=C3C1=C1CN4C(=CC5=C(COC(=O)C5(CC)OC(C)=O)C4=O)C1=NC3=CC=C2 ?",
"input": "",
"output": "The molecular formula is C26H24N4O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC(=O)COC1=CC=C2C=C(CNC(=O)C3=C(C(F)(F)F)OC(C4=CC=C(Cl)C=C4)=C3)C=CC2=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C26H19ClF3NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CCSC1=CC=C(C=C(C(N)=O)C2=NC(C3=CC=C(OC)C=C3)=CS2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C22H20N2O2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CN=C(CCC#N)N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C7H9N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NCCCCC(NC(=O)C(N)CC1=CNC2=CC=CC=C12)C(=O)NC1=CC=C(CC2(C(N)=O)CCCCC2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C31H42N6O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NC(=O)C1=C(N)C2=C(OC3=CC=CN=C3)N=C(NC3CC3)N=C2S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H14N6O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC(OC)=C2C=NC(NC3=NNC(C)=C3)=CC2=C1 .",
"input": "",
"output": " C15H16N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCC1N(N)C(=O)C2(CCN(C3CCC(C(C)C)CC3)CC2)N1C1=CC=CC=C1 ?",
"input": "",
"output": "Sure. C25H40N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COCCNC(=O)CC1=CC=C(N)C=C1N .",
"input": "",
"output": " C11H17N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=CC=C1S(=O)(=O)NCC1=CC=CC=C1C1=CC=C(C(N)=O)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C21H20N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(CC(=O)N2CCN(C3=CC(C(C)C)=NC(N4C=CN=C4)=N3)C(CC(=O)NC(C)C3=CC=C(OC)C(OC)=C3)C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C35H43N7O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C1=CC=C2NC=CC2=C1;C1=CC=C2NC=NC2=C1;C1=CC=C2OC=CC2=C1;C1=CC=C2SC=CC2=C1 ?",
"input": "",
"output": " C31H25N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(O)C(=O)C1=C(CCCCNC(=O)C2=CC=CC=C2O)C2=CC(C3=CC=C(Cl)C=C3)=C(C3=CC=CC=C3Cl)N=C2O1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C34H30Cl2N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=NC2=C3OC(C4=CC=CC=C4)C(O)C(=O)C3=CC=C2N1C1CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H18N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCCC(CC)C1=CSC(N(CC2=CC=C(F)C=C2F)C(=O)O)=C1C ?",
"input": "",
"output": " C21H27F2NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC(=O)C1CC1C1=CC=C(OCC2=CC=CC=C2)C=C1C ?",
"input": "",
"output": " C19H20O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC(=O)CCC(C)CC1=CC=C(N)C=C1 ?",
"input": "",
"output": " C14H21NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C2C3=CN(C2=C1)S(=O)(=O)C1=CC(CCN(C)C)=C(C)C=C13 .",
"input": "",
"output": " C20H22N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of N#CC1=CC=CC(C(F)(F)F)=C1N1C=CC=CC1 ?",
"input": "",
"output": "The molecular formula is C13H9F3N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(C2=CC3=NN=CC=C3N2)C=C1C(N)=O .",
"input": "",
"output": " C14H12N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=C(N)C=CC(C(=O)N2CCCCC3=C2C=CS3)=C1C .",
"input": "",
"output": " C17H20N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=CCCC(=O)O)C1=CC=C(Br)S1 ?",
"input": "",
"output": " C10H11BrO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1C2=CC=C(NC(=O)C(Br)C3=CC=CC=C3)C(O)=C2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21 ?",
"input": "",
"output": " C30H30BrN3O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCCN1C(=O)C(CC2(O)CCCCC2)NC(=O)C12CCN(CC1=C(C)N(C3=CC=C(S(=O)(=O)NCCN4CCOCC4)C=C3)N=C1C)CC2;Cl ?",
"input": "",
"output": "Sure. C37H58ClN7O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1C(C)C(C)C(CC2=CC=C3C=CC=CC3=N2)C1C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H25N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCSCCC(N)C(O)C(=O)C1=C(C(=O)NN)C=CO1 ?",
"input": "",
"output": "Sure. C12H19N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule N#CC1=CC=C(CN2C=NC=C2CN(C(=O)CC2=CC=CC3=CC=CC=C23)C2=CC=C(N3CCN(C(=O)C4=CC=C(Cl)S4)CC3)C=C2)C=C1;O=C(O)C1CC1C1=CC=CC=C1 ?",
"input": "",
"output": " C49H43ClN6O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(CCOC1=CC=C(CC(NC(=O)OCC2=CC=CC=C2)C(=O)O)C=C1)C1=CC=CC=N1 ?",
"input": "",
"output": " C25H27N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)CC1(OC(=O)C(F)(F)F)C2=CC=C(NC(=O)C3=CC=C4C=C(C(=N)N)C=CC4=C3)C=C2CCN1C(=O)OC(C)(C)C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C32H35F3N4O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CCCNCC1(C(C)(O)C2=CC=C(Br)C=C2)C=CC(C2=CC=CC=C2)=CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C25H28BrNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C2=CNC3=NC=C(CCCN4CCCC4)C=C23)=C1F ?",
"input": "",
"output": " C24H28F2N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCN(CCCCCCC1=CC=CC=C1)C1CCC2(O)C3CC4=CC=C(OC(C)=O)C5=C4C2(CCN3CC2CC2)C1O5 ?",
"input": "",
"output": "The molecular formula is C36H48N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C1=CC=C(C2=CC=CC=C2)C=C1;OCCOCCO ?",
"input": "",
"output": "The molecular formula is C16H20O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)OCC(C)N1C=NC2=CN=C3C=CC=CC3=C21 ?",
"input": "",
"output": " C15H15N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(CSCCCC(Cl)(Br)C(=O)O)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H16BrClO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule NC(=O)CC1=NC=CN1C1=CC=CC=C1 .",
"input": "",
"output": " C11H11N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C1=CC2=CCC3=C(CCCC3)C3=CNCC(=C23)C1 .",
"input": "",
"output": " C17H19N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCC(O)CN1C=C(NC(=O)C2=C3N=CC=CN3N=C2)C(C2=CC(Cl)=CC=C2OC)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H23ClN6O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=CC(Br)C1=COC2=CC=CC=C2O1 ?",
"input": "",
"output": "The molecular formula is C11H9BrO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CON1NC(C)=C(C2=CC=CC=C2)C1=O . Can you tell me?",
"input": "",
"output": "Sure. It's C11H12N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCN1C=C(C(=O)O)C([N+](=O)[O-])=N1;Cl . Can you tell me?",
"input": "",
"output": "Sure. It's C6H8ClN3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for NCC1=CN=C(I)S1 .",
"input": "",
"output": " C4H5IN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC=C(C2=CN(C3CN4CCC3CC4)N=N2)C=C1 into molecular formula.",
"input": "",
"output": " C16H20N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC2CC3=NC4=CC(Cl)=CC=C4C(NCCCN(C)CCCNC4=C5CCCCC5=NC5=CC(Cl)=CC=C45)=C3C(C1)C2;Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C37H44Cl3N5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C1C(O)=C(C2=CC=C(O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=C(CC3=CC=C(O)C=C3)C(O)=C12 .",
"input": "",
"output": " C28H26O13 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1C(NC(=O)CN2N=C(C)C(C)=C2C)C2=CC=CC=C2C12CCNCC2 ?",
"input": "",
"output": "Sure. C22H30N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)CN1CCN2N=C(CNC(=O)CC3CCCCC3)C=C2C1 ?",
"input": "",
"output": "The molecular formula is C19H32N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C(C(C)NC(=O)C2=CNC3=CC=CC=C23)N=C1 into molecular formula.",
"input": "",
"output": " C17H17N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=CC(CN2N(C3CCC4CC5CC3CC45)C(=O)C2(C)C)=C1C ?",
"input": "",
"output": " C23H32N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=CC(OC2=CC=C(NC3=NC=NC4=C3N(CCNC(=O)CC(C)(C)O)C=C4)C=C2C)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C27H31N5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COCCCOC1=CC(C(=O)N(C(C)C)C2CCC(CCN(C(=O)C3=CC=CC=C3)C3CC3)NC2)=CC=C1OC ?",
"input": "",
"output": " C32H45N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1CCC(COC(=O)N2CCC(CCCC3=NC(N)=C4N=CN(C5OC(C(=O)NC6CC6)C(O)C5O)C4=N3)CC2)C1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C28H40N8O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCNS(=O)(=O)C1=CC(C(=O)CC)=C(F)C=C1F . Can you tell me?",
"input": "",
"output": "Sure. It's C11H13F2NO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN1C(=O)NC2=C(N3CCC(NC(=O)OC(C)(C)C)C3)C=CN=C21 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H23N5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC(NC(=O)C2=CN=CC(F)=C2C)=NC=C1C1=CC(OC2CC2)=CC=C1F into molecular formula.",
"input": "",
"output": " C22H19F2N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(S(=O)(=O)N2C(C)CN(C(=O)CC3=CC=C(C(F)(F)F)C=C3)CC2C)C=C1CC(=O)O ?",
"input": "",
"output": " C24H27F3N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(C)CCCCNC(=O)C1=CN2C3=CC4=C(C=C3OC3=C2C(=CC(F)=C3NCCN2CCCC2)C1=O)OCC1=CC=CC=C14 .",
"input": "",
"output": " C35H38FN5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCOC(O)CC1CC2CC1C(C)C2C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H28O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC(=O)C1CCCN1C1=NC2=C(Br)C=NN2C(NCC2=CC=C[N+](OC)=C2)=C1 .",
"input": "",
"output": " C19H22BrN6O3+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN1N=CC=C1C(=O)N(C1=CC=C(F)C=C1)C1=CC=C(C2CNCCO2)C=C1 ?",
"input": "",
"output": " C21H21FN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)C1=CC2=NC(C(C)(C)C)CN2C=C1 ?",
"input": "",
"output": "The molecular formula is C14H20N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CNC(CC1=CN=C(SCC(N)C(=O)O)N1)C(=O)O ?",
"input": "",
"output": " C10H16N4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CNC1=NC=CC(C2=C(N3CCN(C)CC3)NNC2(C)C2=CC=C(F)C=C2)=N1 .",
"input": "",
"output": " C20H26FN7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C1NC(SCC2=CN3C=CN=C3C=C2)=NC=C1O .",
"input": "",
"output": " C12H10N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCN(CC=CC(=O)N1CCC(N2N=C(C3=CC=C(OC4=CC=CC=C4)C=C3)C3=C(N)N=CN=C32)C1)C1CCC1 into molecular formula.",
"input": "",
"output": " C31H35N7O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of N#CC1=CC(COC2=NC(=O)N3CCNC3=C2)=CC=C1OC1=CC(F)=CC(C(F)(F)F)=C1 ?",
"input": "",
"output": "The molecular formula is C21H14F4N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN(C)CCC(C1=CSC=N1)N1C=C(NC(=O)C2=NNC3=CC(C4=CNN=C4)=CC=C23)C=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H23N9OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)(C)OC(=O)N1CCCC2=NC(C(F)(F)F)=CC=C21 ?",
"input": "",
"output": " C14H17F3N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(NC(=O)C2=CC=CC=C2NS(=O)(=O)CC2=CC=C(Br)C=C2)C(OC)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H21BrN2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for [Nb];[Nb];[Nb];[Nb];[Nb];[Nb];[Ni];[Ni];[Ni];[Ni];[Ni];[Ni];[Ni] .",
"input": "",
"output": " Nb6Ni7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(C)(C)C1=CC=C(O)C=C1;CC(C)(C)C1=CC=C(O)C=C1;O=C(O)O into molecular formula.",
"input": "",
"output": " C21H30O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC(NC(C)=S)=CC=C1C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H13NOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(C1=CC=C(NS(=O)(=O)C2=CC=C(Cl)S2)C=C1)C1=CC2=CC=C(O)C=C2OC1=O , what would be its molecular formula?",
"input": "",
"output": "It is C20H12ClNO6S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(O)CCC(=O)NC(CCC1=CC=CC=C1C(=O)O)C1=CC=CC(C=CC2=CC=C3C=CC(Cl)=CC3=N2)=C1 ?",
"input": "",
"output": " C31H27ClN2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=C(C)C1=NN(CC2=CC=C(C3=CC=CC=C3C(=O)O)C=C2)C2=CC=C(C(=O)NCCOC)C=C12 , what would be its molecular formula?",
"input": "",
"output": "It is C28H27N3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCN1C=NN=C1CNC(=O)N1CCCC(NS(C)(=O)=O)C1 ?",
"input": "",
"output": "Sure. C12H22N6O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(S(=O)(=O)C(F)(F)F)C=C1NC(=O)C1=NOC(C)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H11F3N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1CCN(CCCS(C)(=O)=O)C2=CC(F)=CC=C21 ?",
"input": "",
"output": "The molecular formula is C13H19FN2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(C1=CC=NC=C1)N(C)C(=O)NCC1=CC=CC(OC(C)C)=C1 ?",
"input": "",
"output": "Sure. C20H27N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C(=CC1=NNC2=C1CN(C1=CC(N3C=CC=N3)=NC=N1)CC2)C1=CC=CC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H19N7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(OC)C(C=C(NC(=O)C2=CC=CC=C2)C(=O)NN=CC2=CC=CC=C2OC)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C26H25N3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC(N2CCOCC2)=CC(C(C)C)=C1C(=O)NCC1=CC=C(OC(F)(F)F)C=C1 ?",
"input": "",
"output": " C23H27F3N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule FC(F)(F)C1=C(OC2CC2)C=CN=C1I .",
"input": "",
"output": " C9H7F3INO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCN1C(=CC=C2CCC(C=CC3=[N+](CCC)C4=CC=C5C=CC=CC5=C4C3(C)C)=C2N(C2=CC=CC=C2)C2=CC=CC=C2)C(C)(C)C2=C1C=CC1=CC=CC=C21 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C55H56N3+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=CCC1=CC(NC(=O)C(N)CCCCN)=C(O)C(C2=CC(CC=C)=CC(NC(=O)C(N)CCCCN)=C2O)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C30H44N6O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)C(CCN)NC(=O)N(C)CC1=CSC(C(C)C)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H24N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CSCCCN1CCCN2N=C(CCC(=O)N3CCOCC3)C=C2C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H30N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(N)C(=O)N(CCCN(C)C)CC1CCN(C2CC3=CC=CC=C3C2)CC1 ?",
"input": "",
"output": "The molecular formula is C23H38N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=NC2=CC(OCC3=NC(C(=O)NCC(C)CN(C)C)=CO3)=CC=C2S1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H24N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C1=CN=C(N2CCN(C3=NN=C(C4CC4)O3)CC2)C=N1 .",
"input": "",
"output": " C13H16N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CSCCCN1CC(NC(=O)CN2CCCCC2=O)C(C(C)C)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H33N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=CC(OCCCN(C)C2=NC3=C(S2)C(C)=NN3C)=C1 ?",
"input": "",
"output": "Sure. C17H22N4OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(NC(=O)CNC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(=O)NC(CO)C(=O)N1CCCC1C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCN=C(N)N)C(=O)O ?",
"input": "",
"output": "Sure. C44H69N15O11 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC(=O)NCCS;Cl .",
"input": "",
"output": " C5H12ClNO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(O)C(C=CC1=CC=CC=C1)NC(C(=O)O)C1=CC=CC=C1 ?",
"input": "",
"output": " C18H17NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC1=CC=CC=C1NC(=O)CN1C(=O)N(CCC2=CC=CC=C2)C(=O)C2CCCNC21 ?",
"input": "",
"output": " C25H30N4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC(=O)C(CC1=CN(C(=O)OC(C)(C)C)C2=CC=CC=C12)NC(=O)C(O)C1=CC=C(C(F)(F)F)C=C1 .",
"input": "",
"output": " C26H27F3N2O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCC(NC(=O)CC1=CC(F)=CC(F)=C1)C(N)=O .",
"input": "",
"output": " C14H18F2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C1CC(CN2CCCCC2)NC(=O)N1 , what would be its molecular formula?",
"input": "",
"output": "It is C10H17N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(=O)C(C)=C(C)NCC1CCCCC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C13H23NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=C(Br)C(Br)=C(Br)C(C=CN(C)C(=O)C2CCCN2C)=C1OC , what would be its molecular formula?",
"input": "",
"output": "It is C17H21Br3N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(C2=CN=CC(C(=O)N3CCCC3)=N2)=NN1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H15N5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCN(CC)C(=O)C(NC(=O)C1=CC=C2C(=C1)CCN2C(=O)C1=CC=CC=C1C1=CC=C(C(F)(F)F)C=C1)C1=CC=CC=C1 .",
"input": "",
"output": " C36H34F3N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C(=O)NCC1CCC1)N1C=CC(C(F)(F)F)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H16F3N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of FC(F)(F)COC1=CC(Cl)=CC=C1NCC1=NOC(C2CC2)=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H13ClF3N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC(=O)C(N)C1=CC=C(OC)C(O)=C1;Cl ?",
"input": "",
"output": " C10H14ClNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CCCC(=O)NC1=CN=CC(Cl)=C1Cl ?",
"input": "",
"output": " C10H10Cl2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=NN(C)C(C)=C1CNC(=O)CC1OC2=CC=CC=C2NC1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H20N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)C(NC(=O)C1=CNC2=NC=C(C3CC3)N=C12)C(=O)N1CCCC1 ?",
"input": "",
"output": "Sure. C19H25N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)COC1=CC=C(C2CC(C3=CC=CC=C3N)NN2)C=C1 .",
"input": "",
"output": " C19H25N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NCC1=NC(=O)C2CCCCC2=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C9H13N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCN(CCC)C1CCC2=CC=C3NC(C#N)=CC3=C2C1;Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H26ClN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN1C(=O)C2C(=NC=[N+]2C)N(CCO)C1=O .",
"input": "",
"output": " C9H13N4O3+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C#N)=C(Cl)C1=CC=CC(Cl)=C1Cl ?",
"input": "",
"output": "Sure. C10H6Cl3N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(CC1=CN(C)N=C1)C1=CC=C(C(N)=NO)C=C1Cl .",
"input": "",
"output": " C13H16ClN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC(CC(N)=NO)NCC1=CC=C(F)C=C1F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H17F2N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCNCC1=CC=CC=C1C(N)=NO ?",
"input": "",
"output": " C11H17N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(CC(N)=NO)NCC1=CC=CC2=C1OCO2 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H19N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(CC1=CC=CC=C1F)C(N)=NN .",
"input": "",
"output": " C9H13FN4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CSCCCNCCC(C)(C)C(N)=NO . Can you tell me?",
"input": "",
"output": "Sure. It's C10H23N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NC(=NO)C(C(=O)N1CC2CCC(C1)O2)C1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H19N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(O)C1CCCN1C(=O)C1=CN=C2C=CC=CC2=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H14N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCC1(C(=O)OC)CCCN1 ?",
"input": "",
"output": " C9H17NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCN1C(=CC=C2CCCC(C=CC3N(CCC)C4=CC=CC=C4C3(C)C)=C2C2=CC=CC(F)=C2F)C(C)(C)C2=CC=CC=C21 ?",
"input": "",
"output": " C42H48F2N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(C1=CC=C(C(F)(F)F)C=C1N1N=CC=N1)N1CCOCC1CC1=CC=CC(C2=NOC=N2)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C23H19F3N6O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)N1C=C(C(=O)N2CCC3(O)CCCCC3C2)C2=CC=CC=C2C1=O ?",
"input": "",
"output": "The molecular formula is C22H28N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)C1=CC=CC(NC(=O)C(C)SC2=NN=C(C(C)(C)C)N2N)=C1 ?",
"input": "",
"output": " C17H23N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCN(CCO)C(=O)C1=CSC([N+](=O)[O-])=C1 ?",
"input": "",
"output": " C9H12N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule ClC1=CC=C(Cl)C(OCCN2C=CN=C2)=C1 into molecular formula.",
"input": "",
"output": " C11H10Cl2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for NC1=CC=C(C(=O)N2CCCC2C(=O)O)C=C1Br .",
"input": "",
"output": " C12H13BrN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(CCO)NCC1=CC=C(OCC(N)=O)C=C1 ?",
"input": "",
"output": " C13H20N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC(CC)(C(N)CCCS(C)(=O)=O)N(C)C ?",
"input": "",
"output": " C12H28N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(CC)(C(N)CC1=CC=CN=C1N)N(C)C ?",
"input": "",
"output": "The molecular formula is C14H26N4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCN(C(=O)CC1=C(C)ON=C1C)C1CCC(N)CC1 ?",
"input": "",
"output": "Sure. C15H25N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(C1CCC(=O)CC1)S(=O)(=O)C1=CC=CC=C1Br .",
"input": "",
"output": " C13H16BrNO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=CC(SCC(=O)N2CCCC(C(N)=O)C2)=C1N is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H21N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)=CC1(O)CCCC(C)(C)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H22O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCNC(C)CC(C)(C)CCSC1=CC=CC=C1 .",
"input": "",
"output": " C16H27NS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCNC1=CC=CC(CN2C=NC(C)=C(Br)C2=O)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H15BrN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1CCCC1CN(C)S(=O)(=O)C1=CN=CC=C1N is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H20N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN(CCNC1CC1)CC1CCCN1C . Can you tell me?",
"input": "",
"output": "Sure. It's C12H25N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1=CC=C(NC2CCC3=CC=C(OC)C=C32)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H21NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(O)C(CC1=CON=C1)C1=CC=C(Cl)C=C1 ?",
"input": "",
"output": "The molecular formula is C12H10ClNO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)CCCN1N=NN=C1N , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C7H13N5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC(=O)C1=NN=NN1CC1CC2CCC1C2 ?",
"input": "",
"output": " C12H18N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)OC1=CC=CC=C1CC(C)C(=O)O ?",
"input": "",
"output": " C13H18O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NCCCOC1CCN(C2CCCCC2O)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H28N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC1=CC=C2NC(C3=CC=C(Cl)S3)=NC2=N1 ?",
"input": "",
"output": " C12H10ClN3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN(CCS(C)(=O)=O)S(=O)(=O)N1CCCC(CN)C1 ?",
"input": "",
"output": " C10H23N3O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCC(C)NCCN1C(=O)C(C)(C)S1(=O)=O ?",
"input": "",
"output": " C11H22N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(COC)NC1CCOC2(CCSC2)C1 ?",
"input": "",
"output": "Sure. C13H25NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCSCC(O)C1=CC(OC)=CC(OC)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H20O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCC1(C(=O)NCC2(C)CCCO2)CCCNC1 ?",
"input": "",
"output": " C15H28N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(F)C=C1C(C)(N)C1=CC(F)=CC(F)=C1 ?",
"input": "",
"output": " C15H14F3N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(F)C(NC2=CC=C(N)C(N)=N2)=C1 ?",
"input": "",
"output": "Sure. C12H13FN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCC1=C(Cl)N=C(C2=CC=C(Cl)C=N2)N=C1Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H10Cl3N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN(CC1(CBr)CCOCC1)C1CCC(C)(C)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H30BrNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C(C(=O)C2=CC=C(OC(C)C)C=C2)C(F)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H17FO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(CCCN)NC(=O)C(C)(C)C ?",
"input": "",
"output": " C10H22N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(C(C)N2CC(=O)CC2=O)C=C1F , what would be its molecular formula?",
"input": "",
"output": "It is C13H14FNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COCCCC(=O)NC1=CC=C(C(=O)O)C=C1N ?",
"input": "",
"output": " C12H16N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1=NC(C(=O)NCC2CCCC2C(=O)O)=NN1 ?",
"input": "",
"output": "Sure. C12H18N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=NC(C(=O)NCC2=CC=CC=C2Cl)=NN1 ?",
"input": "",
"output": " C11H11ClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCN(CC)CC(C)NC1=CC(OC)=CC=C1N ?",
"input": "",
"output": "The molecular formula is C14H25N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC1=CC=CC=C1CC1=NN=C(N)N1N ?",
"input": "",
"output": " C9H12N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCC(C(=O)OCC)C1=NN=C(N)N1N , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C9H17N5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN1CCN(S(=O)(=O)C2=C(F)C=CC=C2F)C(CN)C1 ?",
"input": "",
"output": "Sure. C12H17F2N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC(C2=C(C3=CC=CC=N3)C(N)=NO2)=C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C16H15N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C2C=C(C(=O)C3=CC(Br)=C(Br)S3)C=CC2=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H10Br2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for OC1CCCC(NCC2CCCNC2)C1 .",
"input": "",
"output": " C12H24N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN(CC1=CNN=C1)C1=NC=C(C(=O)O)S1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C9H10N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(NC(=O)C2=NN=C(Cl)S2)=CC=C1[N+](=O)[O-] , what would be its molecular formula?",
"input": "",
"output": "It is C10H7ClN4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN(C1=CC=C(C=O)C=N1)C1CCCC1 ?",
"input": "",
"output": " C13H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(C1CCCCC1)N1CCN(CCBr)CC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H23BrN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC(N)=CC(NCC(C)CO)=C1 ?",
"input": "",
"output": " C11H18N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCNC1=NC=CC(N2CCC(C(C)(C)C)CC2)=N1 .",
"input": "",
"output": " C16H28N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC(COC)NC1=NC(NC)=NC(N2C=CC=N2)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H19N7O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)C1=C(N)N=CN=C1OCC1=CC=C(Cl)C=C1 .",
"input": "",
"output": " C14H16ClN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC1=NC(NC)=C(C)C(N2CCC(N(C)C)CC2)=N1 into molecular formula.",
"input": "",
"output": " C15H27N5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)CCN(C)C1CCC1CN . Can you tell me?",
"input": "",
"output": "Sure. It's C11H24N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCNCCC1=CSC2=CC(F)=C(F)C=C12 ?",
"input": "",
"output": " C12H13F2NS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCNCCCNC(=O)NC(COC)C(=O)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H21N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C([N+](=O)[O-])C(NCC2=CC=C(F)C=C2)=N1 ?",
"input": "",
"output": " C13H12FN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC1(C(=O)N2CCCC2C2=CC=CC=C2Cl)CCC1 into molecular formula.",
"input": "",
"output": " C15H19ClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNCC1=CC=C(Br)C=C1N1CC(CO)OCC1C into molecular formula.",
"input": "",
"output": " C14H21BrN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for OC(C1=CC=CC2=NC=CC=C12)C1CCC2=CC=CC=C21 .",
"input": "",
"output": " C19H17NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(C)CC(C)NC(=O)C1=CN=C(C)C=C1NN .",
"input": "",
"output": " C14H24N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC1=CC(Br)=CC2=C(NN)C=C(C3CC3)N=C12 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H16BrN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(CCC1=CC=CN=C1)NOCC(F)(F)F .",
"input": "",
"output": " C10H11F3N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCN(C(=O)CN1CCCC1CNC)C1CC1 ?",
"input": "",
"output": " C13H25N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(C)C(N)CCN(C)CC1=CC(F)=CC(Br)=C1 into molecular formula.",
"input": "",
"output": " C14H22BrFN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CNC1=NC(C2CC2)=NC(OC2=CC(F)=CC=C2Br)=C1C ?",
"input": "",
"output": "The molecular formula is C15H15BrFN3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=C(C)CN(CC)C(=O)NC1=C(F)C=CC=C1C(=O)O ?",
"input": "",
"output": " C14H17FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1=NN(CC2=CC(F)=CC(C(N)=NO)=C2)C(CC)=N1 ?",
"input": "",
"output": " C14H18FN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1CC(CN)(N2CCC(C)(C)CC2)CCN1C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H31N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CNCC1=CC=C(N2N=C(C)C(C)=C2C)C=C1C(F)(F)F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H18F3N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C1=CC=CC(N)=C1)N(C)CCCN1C=CN=C1 .",
"input": "",
"output": " C15H22N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC(Br)C(=O)NC1=CC=CC(C)=C1Br , what would be its molecular formula?",
"input": "",
"output": "It is C11H13Br2NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCNC(COC(C)C)C1=CC=C(OC)C(C)=C1 ?",
"input": "",
"output": "Sure. C16H27NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(O)CCC1CCN(C(=O)NC2CCC(=O)NC2)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H21N3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by N#CC1=C(F)C=CC=C1NC(=O)CCC1CCNC1 ?",
"input": "",
"output": " C14H16FN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=NC2=CC(OC3=CC=C(F)C(C)=C3)=C(N)C=C2S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H13FN2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CCN(CCC)C(=O)C1CCCCCC1N . Can you tell me?",
"input": "",
"output": "Sure. It's C14H26N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=CCN(C(=O)NC(C)(C(=O)O)C1CC1)C(C)(C)C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H24N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=CCN(CCC)S(=O)(=O)N1CCCCC1CO represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H24N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(C)(CN)C(=O)N1CCNCC1 .",
"input": "",
"output": " C10H21N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COCC(N)C1=CC=C2OCC(=O)N(CCO)C2=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C13H18N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=CC=C1C1=NN=C2C(N)=C(C)C=CN12 ?",
"input": "",
"output": " C14H14N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COCC1=NC2=C(N)C=CC=C2N1CC(O)CO represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H17N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCOC1=CC(C(=O)NCCN(CC)CC)=CC=C1N .",
"input": "",
"output": " C16H27N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCSC1=CC=C(C(O)CCN2CC(C)CC(C)C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H31NOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(C(=O)C(C)NCCCO)C=C1OC is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H21NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of NCCNCCC1=NC(C2=CC=CN=C2)=CS1 ?",
"input": "",
"output": "The molecular formula is C12H16N4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of N#CCCC(=O)OC1=CC=C(Cl)C(Cl)=C1 ?",
"input": "",
"output": " C10H7Cl2NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation N#CCSC1=NC=CN1C1=CC=CC=C1Br represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C11H8BrN3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)C1=CC=C(CN2N=NC(CO)=C2C2CCC2)C=C1 ?",
"input": "",
"output": "Sure. C18H25N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCC1=NC2=CC(C3=CC=C(F)C=C3)=NN2C(Cl)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H13ClFN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC1=CC=C(C)C=C1C1=C(N)SC(C)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H17NOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code N#CC1=C(C(=O)O)C2=C(CCNC2)NC1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H9N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CN1C=NN=C1C(CN)C(=O)O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C6H10N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=C(Cl)C=CC=C1N1N=C(CCl)C(=O)C=C1C ?",
"input": "",
"output": " C13H12Cl2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC1=CC=CC2=C(CNC(C)CC)C=C(C(C)C)N=C12 ?",
"input": "",
"output": " C19H28N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(C)=C2N=C(C)C=C(CNCC(C)C)C2=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H24N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=CC1=CC=CN1CC(=O)N1CCNCC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H15N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NC1=NC(C2=CSC(CN3CCCCCC3)=N2)=CS1 ?",
"input": "",
"output": " C13H18N4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC(C)=C(C(=O)C2CCCNC2)C=C1Cl ?",
"input": "",
"output": " C14H18ClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CNCCCN1C=CN=C1C1=CC=CC(NC(C)=O)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H20N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule N#CC1=CC=C(CNC2CCCC3=C2C=C(Cl)S3)C=C1 ?",
"input": "",
"output": " C16H15ClN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(C)C1=NC(Cl)=NC(NC2=CC=C(Br)C=C2C#N)=N1 .",
"input": "",
"output": " C12H10BrClN6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(CC1=CC=C(CN)O1)C1CCOC1 .",
"input": "",
"output": " C11H18N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1OCCC1N(C)C1=CC=C(N)C=C1F ?",
"input": "",
"output": " C12H17FN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(N)C=C1CN1C=CC2=C(F)C=CC=C21 ?",
"input": "",
"output": " C16H15FN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1(C(=O)NC2CCC(C(F)(F)F)NC2)CCCO1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H19F3N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC(Br)=CC(NC(=O)CC(C)(C)CC(=O)O)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H18BrNO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC(Br)=CC(NC(C)C2=CC(O)=CC=C2O)=C1 .",
"input": "",
"output": " C15H16BrNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(C(=O)NC2=CC(Cl)=C(O)C(Cl)=C2)C=C1Cl ?",
"input": "",
"output": " C14H10Cl3NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1CCN(CCSCC(NC=O)C(=O)O)CC1 ?",
"input": "",
"output": "The molecular formula is C11H21N3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(O)CC1=CC=C(CNC2=CC=C(O)C(F)=C2)S1 ?",
"input": "",
"output": "The molecular formula is C13H12FNO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)CN(CC(N)=O)C(C)C1=CC(Cl)=CC=C1O ?",
"input": "",
"output": " C14H21ClN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1(C(=O)O)CCCN1C(=O)NC1=CC=C(Br)C=C1 ?",
"input": "",
"output": "Sure. C14H17BrN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of FC1=CC=C(C2CNC3=CC(Cl)=CC=C3O2)N=C1 ?",
"input": "",
"output": " C13H10ClFN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for OC1=CC=C(C2CCC3=CC=CN=C32)C=C1 .",
"input": "",
"output": " C14H13NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=C(C(=O)N2CCCC(C(C)(C)C(=O)O)C2)SC=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H20N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCN1C(=O)C(CC(C)C)NC1C ?",
"input": "",
"output": " C10H20N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=C(CC(=N)N)C(C)=C(Cl)O1 into molecular formula.",
"input": "",
"output": " C8H11ClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(C)C(C(=O)O)C1=CN=C2C(F)=CC=CN12 into molecular formula.",
"input": "",
"output": " C12H13FN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)C1=CN(C(C)C)C2=C(C(=O)O)C=C(C(C)C)C=C12 ?",
"input": "",
"output": " C17H21NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)SCC1=CC=C(NCC2=CC=CN=C2)C=C1 .",
"input": "",
"output": " C16H20N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=C(C=O)SC(CN2CCCC2)=N1 ?",
"input": "",
"output": " C10H14N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C(C)C=C1C1=NC=CC(NN)=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H14N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)CN1CCC2(CC1)CN(CCC(=O)O)C2 .",
"input": "",
"output": " C14H26N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(O)CC1NCCCN(CC2=CC=CC=N2)C1=O . Can you tell me?",
"input": "",
"output": "Sure. It's C13H17N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC(=O)C1=CSC2=NC(Cl)=NC(NC3=CC=CC=C3C#N)=C12 ?",
"input": "",
"output": "Sure. C16H11ClN4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC(=O)NC1=CC(C)=C(C)S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C9H13NOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC(=O)C(C)CN(C(=O)NC1CCCCC1)C(C)C1=CC=CC=C1 ?",
"input": "",
"output": " C20H30N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCCCCN1C(=O)C(C2=CC=CC=C2)OC2=CC=C([N+](=O)[O-])N=C21 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H21N3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(OC)C(C2=CSC(NC(=O)CCC3CCCCC3)=N2)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H26N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=CC2=C1NC(=O)C(C)S2 .",
"input": "",
"output": " C10H11NOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=CC2=C1CNCCC2(C)F .",
"input": "",
"output": " C12H16FN ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=CC(Br)=C1CCCN is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H14BrN ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(OC2C=CC(OC(C)=O)C(COC(C)=O)O2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H20O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)C1CC(O)CC(C(C)C)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H24O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(CCC(F)(F)Cl)N1CCCCC1 ?",
"input": "",
"output": "Sure. C9H14ClF2NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation N#CC1=CC=C(OC(=O)C2=CC=C(C3CCCC3)C=C2)C=C1F , what would be its molecular formula?",
"input": "",
"output": "It is C19H16FNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=[N+]([O-])C1=CC=CC=C1COC=C(C1=CC=CC=C1)C1=CC=CC=C1 ?",
"input": "",
"output": "Sure. C21H17NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code BrC1=CC=C2OC(C3=CC=CC4=CC=CC=C34)=NC2=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H10BrNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCC(CCC)C1=CC=CC(C)=C1 .",
"input": "",
"output": " C14H22 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)N(CC#CCC(O)(C1=CC=CC=C1)C1CCCC1)CC1=CC=CC=C1 ?",
"input": "",
"output": " C27H35NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC(OC)=CC(OC2=CC(=O)C3=CC(CCCC(C)C)=CC=C3C2=O)=C1 into molecular formula.",
"input": "",
"output": " C24H26O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NO)C1=CC=C(CN(C(=O)N2CCCCC2)C2=CC=CC(C(F)(F)F)=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C21H22F3N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(CCN)CC1=C(C2CCC(N3CCOCC3)CC2)C=NN1 ?",
"input": "",
"output": " C17H31N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for Cl;NC(C1=CC=CC=C1)C1=NC=CN=C1Cl .",
"input": "",
"output": " C11H11Cl2N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOC(=O)C(C)SC1=CN=C(NC(=O)N(CC2CCCC2)C2=CC=CC(C(=O)NC)=C2)S1 ?",
"input": "",
"output": " C23H30N4O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(C(NN2C(=O)C=CC3=CC=CC=C32)C2(C(F)(F)F)CO2)C(F)=C1 ?",
"input": "",
"output": "The molecular formula is C20H16F4N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(C)OC(=O)NCC1=CC(OC2CCCC2)=CC=C1[N+](=O)[O-] .",
"input": "",
"output": " C17H24N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC(F)=C(N2N=C(OC(F)(F)C(F)OC(F)(F)F)C=C2CF)C=C1S(=O)CC(F)(F)F . Can you tell me?",
"input": "",
"output": "Sure. It's C16H11F11N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1(CC2=CC=C(C#N)C=C2)C(=O)N(C2=CC(Cl)=CC(Cl)=C2)C2=NC=C(C(=O)NC3(C(=O)NC4(C5=CC(CN)=CC=N5)CC4)CC3)N21;Cl;Cl ?",
"input": "",
"output": "The molecular formula is C34H32Cl4N8O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1(C)OC2=C(F)C=C(N)C=C2N2N=NN=C21 . Can you tell me?",
"input": "",
"output": "Sure. It's C10H10FN5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1(C)CC(=O)C(C(=O)NCC2=CC=CO2)C(=O)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H17NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)(C)C(CO)NC(=O)NC1=C(F)C=C(F)C=C1Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H17ClF2N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCN1C=C(C(=O)N(CC(=O)NC2=CC=C(F)C=C2)C(C)(C)C)C=N1 ?",
"input": "",
"output": " C18H23FN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(CC(F)(F)F)N1CCN(C(=O)NCC2=CC=NC(OC3CCCCC3)=C2)CC1 ?",
"input": "",
"output": " C20H27F3N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCN(CC)S(=O)(=O)CCNC(=O)C1=NN(C2=CC=C(F)C=C2)C=C1Br ?",
"input": "",
"output": " C16H20BrFN4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(=O)NC1=CC=C(F)C(NC(=O)C(=O)NCC2=CC=C(Cl)C=C2Cl)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H14Cl2FN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOC(=O)C1=C(C)N(C(N)=O)C(C=C2C(=O)NC3=CC(OC4=CC=CC(NC(=O)C5=CC=CC(C(F)(F)F)=C5)=C4)=CC=C23)=C1C ?",
"input": "",
"output": " C33H27F3N4O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCC(CC)COC(=O)C(=CC(=O)O)CC(CC)CCCC .",
"input": "",
"output": " C20H36O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CC(=O)N(C(CC)CCCCC)C(CC)CCCCC .",
"input": "",
"output": " C19H37NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=CCC1=CC=C(N2CCC(C(=O)N3CC(CCOC4=CC=C(Cl)C=N4)C(C4=CC=C(Cl)C=C4)C3)CC2)C=C1 ?",
"input": "",
"output": " C31H33Cl2N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNC(=O)C1CCCC1NC1=NC(Cl)=NC=C1Cl into molecular formula.",
"input": "",
"output": " C11H14Cl2N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNC(=O)CCCCC1CCSS1 ?",
"input": "",
"output": " C32H50N2O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)(CCC=NS(=O)C(C)(C)C)C(=O)O . Can you tell me?",
"input": "",
"output": "Sure. It's C11H21NO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)CC(C)NC(=S)N1CCC2(CC1)NC(CCSC)C(=O)N2C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H32N4O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CNS(=O)(=O)C1=CC=CC=C1NC1=NC(Br)=NC=C1Cl .",
"input": "",
"output": " C11H10BrClN4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC1=NC(C(=NOCC(=O)O)C(=O)NC2C(=O)N3C(C(=O)O)=C(C=CC4=CC=CC=C4[N+](=O)[O-])CSC23)=CS1 ?",
"input": "",
"output": " C22H18N6O9S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1(C=O)CCC2(C)CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 .",
"input": "",
"output": " C30H46O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C[NH+]1CCC[NH+](CCNC(=O)NCCC2=CNC3=CC=C4C(=O)NCCC4=C23)CC1;O=C([O-])C(F)(F)F;O=C([O-])C(F)(F)F .",
"input": "",
"output": " C26H34F6N6O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C2CC(C)(C)NC(=CC(=O)C3=CC=C(NC(=O)C4=C(Cl)C=CC=C4Cl)C=C3)C2=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C27H24Cl2N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCCCC(OCCCCC)C1CO1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H28O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(C2=C(C3=CC=CC=C3S(N)(=O)=O)OC(CC(=O)N(C)O)=N2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H19N3O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(N2N=C(C(=O)N(C)OC)N=C2C2=CC=C(OCCN)C=C2)C=N1 ?",
"input": "",
"output": "Sure. C19H22N6O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CC1=CC=C(C(=CC2=CC=CC=C2)S(=O)(=O)O)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H14O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C=C(C)C#C[Se]C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1OCOC;COCOC1=C([Se]C#CC(C)=CC(=O)O)C=C(C(C)(C)C)C=C1C(C)(C)C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C46H64O8Se2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(O)C(Br)CC1=CC=C(OC2=CC=C(O)C=C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H13BrO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(=O)NC1=CC=C(NC(=S)NC2=CC=C(N(CC3=CC=CC=C3)C3CCNCC3)C(Cl)=C2)C=C1 .",
"input": "",
"output": " C27H30ClN5OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(CCl)CC1=NC=CO1 .",
"input": "",
"output": " C6H6ClNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule [CH2-]CCCO;[CH2-]CCCO;[CH2-]CCCO;[CH2-]CCCO;[Ti+4] ?",
"input": "",
"output": " C16H36O4Ti ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCON(CC1=CC=CC=C1Cl)NC;Cl;Cl ?",
"input": "",
"output": "Sure. C11H19Cl3N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C2NC(C)=C(CCON=C3CCSCC3)C2=C1CC1=CC=CC=C1Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H27ClN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule N#[N+]C1(N)CC=CC2=C1C(=O)C1=CC=CC=C1C2=O into molecular formula.",
"input": "",
"output": " C14H10N3O2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation OCC#CC=C1CCC=C1C#CCO represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H12O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)OC(=O)NCCCON=C(C(=O)O)C1=NSC(N)=N1 ?",
"input": "",
"output": " C12H19N5O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=CC[N+](=CC(=O)OCC)CC=CC ?",
"input": "",
"output": " C11H18NO2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(C)S(=O)(=O)C1=CC([N+](=O)[O-])=C(Cl)C([N+](=O)[O-])=C1 .",
"input": "",
"output": " C8H8ClN3O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCC(=O)OC1(C(=O)COS(=O)(=O)C2=CC=C(C)C=C2)CCC2C3=C(C(O)CC21C)C1(C)C=CC(=O)C=C1CC3 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C33H40O8S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(OC1=CC=C(COC2=CC=CC=C2Cl)C=C1)C(=O)ON(C(C)O)C(C)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H24ClNO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C#CCOC(=O)C(C#N)=C1NOC2=CC=CC=C12 ?",
"input": "",
"output": "The molecular formula is C13H8N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCCCCCCCCNCCNC(O)CC into molecular formula.",
"input": "",
"output": " C17H38N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule [C-]#[N+]C1=CC=C(N2C(=O)C3(CCC3)N(C3=CC=C(C(=O)NC)C=C3)C2=S)C=C1C ?",
"input": "",
"output": " C22H20N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NC(N)=NCCCC1NC(=O)C(CCCCNC(=O)CN2CCCN3CCCN(CCCN(CC(=O)O)CC3)CC2)NC(=O)C(CC2=CC=C(O)C=C2)NC(=O)C(CC(=O)O)NC(=O)CNC1=O , what would be its molecular formula?",
"input": "",
"output": "It is C44H71N13O11 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CNC(C)C(=O)NC(C(=O)N1CC(NC(=O)C2=CC=CC(C(=O)NCCCCC(NC(=O)C(NC(=O)C(CO)NC)C(C)(C)C)C(=O)NC(C)C(C)C)=C2)CC1C(=O)NC1CCC2=CC=CC=C2C1)C(C)(C)C .",
"input": "",
"output": " C54H84N10O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC=C1CC2C=NC3=CC(OCC4=CC(OCCN(C)CC(C)(C)S)=CC(COC5=CC6=C(C=C5OC)C(=O)N5CC(=CC)CC5C=N6)=N4)=C(OC)C=C3C(=O)N2C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C44H52N6O7S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=C(C)SC(NC(=O)C2=CC=C3C=CC=C(C4=CC=CC(C(F)(F)F)=C4)C3=N2)=N1 ?",
"input": "",
"output": "Sure. C22H16F3N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COPC(SC1=CC(C=CC2=CC=C(N(C)C)C=C2)=CC=C1N)C1=CC=CC=C1 .",
"input": "",
"output": " C24H27N2OPS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=COCCC1CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C7H12O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C(=O)N(C)CC(O)CO)C(C)(C)C ?",
"input": "",
"output": "The molecular formula is C11H23NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)(C)N1OCCC2=NC=CC=C21 .",
"input": "",
"output": " C11H16N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=CC(=O)NC1CC(C)(C)N(S(=O)(=O)C2=CC=C(NC(=O)C3=CC=CO3)C=C2)C(C)(C)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H29N3O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(C)S(=O)(=O)C1=CC=C(CN2C(C(=O)NOCCO)=C(NC3=CC=C(I)C=C3F)C3=CN=CC=C32)C=C1 .",
"input": "",
"output": " C25H25FIN5O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CNC(=O)CC1=NC2=CC=CC=C2O1 ?",
"input": "",
"output": "The molecular formula is C10H10N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC1=CC=C(N=C2C=CC(=C(C3=CC=C(NC(CC)C4=CC=CC(S(=O)(=O)O)=C4)C=C3C)C3=CC=C(N(CC)CC4=CC=CC(S(=O)(=O)O)=C4)C=C3C)C=C2)C=C1 ?",
"input": "",
"output": "Sure. C47H49N3O7S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCN(C=O)CC1=CC=CC=C1N ?",
"input": "",
"output": " C12H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(C2=CC=C(C)P2)O1 ?",
"input": "",
"output": " C10H11OP ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC(=N)C(OCCCl)C1=CC=CC(F)=C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C13H17ClFNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C#CC(O)(C1=CC(Cl)=CC(Cl)=C1)C(F)(F)F ?",
"input": "",
"output": "The molecular formula is C10H5Cl2F3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=NN(C2CCCCC2)C2SC(C(=O)NC3=CC=C(N4CCN(C)CC4)C(Cl)=C3)=CC12C ?",
"input": "",
"output": " C25H34ClN5OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCN1C=NC2=CC(NC(=O)OCC3=C(C)N=C(C4=CC=CO4)S3)=CC=C21 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C19H18N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of N#CC1CC(O)CCC1N1C=C(C(N)=O)C(NC2=CC=C(OC(F)(F)F)C=C2)=N1 ?",
"input": "",
"output": "Sure. C18H18F3N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C[Si](C)(C)C#CC1=CC=CC(CC(CO)NC(=O)O)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H21NO3Si .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C[N+]1(C2=CC=C(F)C=C2)C=CCN2C=C(C3=CC=C(O)C(F)=C3)N=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C19H16F2N3O+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(C1=CCC(C2CCCCC2[N+](=O)[O-])O1)N(C1CC1)C1CCC2=C(C=NN2)C1 ?",
"input": "",
"output": " C21H28N4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1C=C(CNCC2CCN(C3=NC=C(C4=NOC(C(F)(F)F)=N4)C=N3)CC2)C2=CC=CC(F)=C21 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C23H23F4N7O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC1=CC(C(C)=O)=CC=C1Br ?",
"input": "",
"output": " C10H11BrO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCOC(=O)C1(C)OC12CCCCC2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H26O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(N2N=C(C3=CN=C4C=CC=CC4=C3)C=C2CCCCC(=O)NC(CC2=CC=C(O)C=C2)C(N)=O)C=C1 ?",
"input": "",
"output": " C33H33N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC(=O)C1(NC(=O)CCCCCNC(=O)OCC2=CC=CC=C2)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O1 into molecular formula.",
"input": "",
"output": " C26H39N3O11 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1(C)C2=CC=CC=C2C2=CC=C(C3=CC=C4C(=C3)C3(C)CCCCCCC3(C)N4C3=CC=CC=C3)C=C21 ?",
"input": "",
"output": "Sure. C37H39N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(C)(C)ONCCC1=CC=CC=C1 .",
"input": "",
"output": " C13H21NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=NC=C1C1=CCC2C3CCC4CNC(=O)CCC4(C)C3CCC12C . Can you tell me?",
"input": "",
"output": "Sure. It's C25H34N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(=O)SCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)NCCOCCOCC(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(C(=O)NC(CO)C(=O)N1CCCC1C(=O)NC(CC1=CNC2=CC=CC=C12)C(=O)NC(CC1=CC=C(O)C=C1)C(=O)O)C(C)C)C(C)O ?",
"input": "",
"output": " C78H125N9O28S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C1=C2NCCCN2NCC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C7H13N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C1C=C(OCC2=CC=C(Cl)C=N2)C=CN1C1=CC2=CC=C(CNC3CCS(O)(O)C4=CC=CC=C43)C=C2CC1 into molecular formula.",
"input": "",
"output": " C31H30ClN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(CN2N=NC3=C2C2(CCC3)CO2)C=C1 ?",
"input": "",
"output": " C15H17N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=CC=C1C1=CC=CC2=C1OC1=C(N(C3=CC=CC=C3)C3=CC=C4C=C5C6=CC7=CC=C(N(C8=CC=CC=C8)C8=CC=CC9=C8OC8=C(C%10=CC=CC=C%10C)C=CC=C89)C=C7C=C6C(C)(C)C5=CC4=C3)C=CC=C12 into molecular formula.",
"input": "",
"output": " C73H52N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCCCCCCCCCCCCCCCN(CC)C(CC=O)(CCC=CCC1C(Cl)CC(O)C1C=CCC(O)C1(CC)CCC1)C(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C44H78ClNO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)C(C)(C)CC1CCCN1 ?",
"input": "",
"output": " C10H19NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=S(=O)(C1=CC=C(Cl)C(Cl)=C1)N1C=CC2=C(N3CCNCC3)N=C3C=CC=CC3=C21 into molecular formula.",
"input": "",
"output": " C21H18Cl2N4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CN1N=C(C(=O)N2CCOCC2)C=C1C(=O)N1CCN(CC2=CC=C(F)C=C2Cl)CC1;Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H26Cl2FN5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=CC(NC(=O)C2CCCN(C3=CC=C(N4C=CC=N4)N=N3)C2)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H22N6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CSC1=CC=CC(NC(=O)C(=O)NCC2(SC3=CC=CC=C3)CCOCC2)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C21H24N2O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C(Cl)C=CC=C1S(=O)(=O)NC1CCN(C2=CC=CC=N2)C1 .",
"input": "",
"output": " C16H18ClN3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)C1=CC=C(C(=O)N2CCC(OC3=CC=C(C)N=N3)C2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H19N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN(CC)C1=CC=C2C(C3=CC=C(S(=O)(=O)NCCCCC(NC(=O)CC4=CSC(=N)N4C)C(=O)NC(CC4=C[N+](CC5=CC=CC=C5)=CN4C)C(=O)NC4CCN(CC5=CC=CC=C5)CC4)C=C3S(=O)(=O)O)=C3C=CC(=[N+](CC)CC)C=C3OC2=C1 ?",
"input": "",
"output": " C65H81N11O9S3+2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C2CC(CC3(C4=CC5=NC=CC=C5O4)CCCC(=O)NC3)=CC(=O)C2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H24N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C1NC(=O)C(CN2C=C3C=C(OCC4=CC=NC(Cl)=C4)C=CC3=C2O)(C2=CC=C(F)C=C2)N1 , what would be its molecular formula?",
"input": "",
"output": "It is C24H18ClFN4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CON=C(C(=O)O)C1=CC=CC=C1COC1=CC(Cl)=C(OC(C)C)C(Cl)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H19Cl2NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(CCCC(C(=O)NC(C(=O)NC2=CC=CN=C2)C(C)(C)C)C(C)N(O)C=O)C=C1 ?",
"input": "",
"output": " C26H36N4O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation OCC(O)CO represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C3H8O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NC(CC1CCCCC1)C(=O)N1CCCC1)OCCCC(=O)C1=NC2=CC=CC(F)=C2O1 ?",
"input": "",
"output": "The molecular formula is C25H32FN3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCCCCCCCCCCCCC1=CC=CC(OCCCCCCCCCCC(=O)OC2(C(N)=O)CC2)=C1 ?",
"input": "",
"output": " C36H61NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC(S)NN=C1C=CSC2=C1C=CS2 ?",
"input": "",
"output": " C8H9N3S3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C1=CC=C(C2=CC=CC3=NON=C23)C=C1 .",
"input": "",
"output": " C12H8N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CSC1=C2OC=CC2=CC(C(=O)NC2CC3CCC2N3)=N1 ?",
"input": "",
"output": " C15H17N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=C(C)OC(=O)CCNC(=O)OCCOC=CC;CCO[Si](CCCNC(=O)OCCO)(OCC)OCC .",
"input": "",
"output": " C24H46N2O11Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1CCC(CC(C)(C)C)CC(C)C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H28 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(=NCC(F)=CCCC(N)C(=O)O)NO , what would be its molecular formula?",
"input": "",
"output": "It is C9H16FN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCN(N)C(=O)N1CCCC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C7H15N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(O)CC(O)(C(=O)CCO)C(O)C(O)C(O)CO ?",
"input": "",
"output": " C10H18O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1=C(N2CCN(C)CC2)C=C(N2CC3=CC(C4CCN(C(=O)OC)CC4)=CC=C3CC2C)N=C1N is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C29H42N6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=O)OCC1OC(N2C3=NC=CC=C3C3=C4C(=O)N(COCC5=CC=CC=C5)C(=O)C4=C4C5=CC=CC=C5NC4=C32)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O into molecular formula.",
"input": "",
"output": " C41H36N4O12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=[N+]([O-])C1=CC=C(OC2=CC=C3OCCCC3=C2)N=C1 .",
"input": "",
"output": " C14H12N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=CC1(N)CC1(C(=O)C1CCCN1)C(=O)N(C(=O)CCC)S(=O)(=O)C1=CC=C(OC2=CC(C3=CC=CC=C3)=NC3=CC(OC)=CC=C23)C=C1 into molecular formula.",
"input": "",
"output": " C37H38N4O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC(=O)C=CC1=CC=CC=C1SC1=CC=C(C)C=C1C ?",
"input": "",
"output": " C19H20O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC(C2=C(S(C)(=O)=O)C=CC(C(=O)O)=C2Cl)=NO1 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H10ClNO6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NS(=O)(=O)C1=CC=CC(COC2=CC=C(Cl)C(C3=NC=NC4=C(C(F)(F)F)C=CC=C34)=C2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H15ClF3N3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(C=CC1=CC=CO1)NCC1=CC(Cl)=C(C(=O)NC(CNC(=O)C2CSCN2)C(=O)O)C(Cl)=C1 ?",
"input": "",
"output": " C22H22Cl2N4O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(NCC1=CC=CN=C1C1=CSC=C1)NCC1=CC=CC2=CC=CC=C12 into molecular formula.",
"input": "",
"output": " C22H19N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=C(C)C#CC(O[Si](C)(C)OC(C#CC(=C)C)C(C)CCC)C(C)CCC , what would be its molecular formula?",
"input": "",
"output": "It is C24H40O2Si .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCCCCCCCCCCCOC(=O)C(C(C)C)N(C)C(=O)OCCCCCC ?",
"input": "",
"output": " C27H53NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COCC1=NC(CNC(=O)C2=CC3=CC(Cl)=CC=C3N2)=NO1 ?",
"input": "",
"output": " C14H13ClN4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=C(C(=O)NCCOC2=CC=CC3=CC=CN=C23)C2=C(CCCC2=O)N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C21H21N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CN2C=C(C(=O)NC3CCOCC3OCC3=CSC=N3)N=C2C=C1 ?",
"input": "",
"output": "The molecular formula is C18H20N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCC#CC1=CC=CC=C1C#N .",
"input": "",
"output": " C12H11N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C1NCC(NCCC2=CC=C(Cl)C=C2)N2N=C(C3=CC=CS3)C=C12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H17ClN4OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1C(=O)NC(=O)C2=C1N=C(Br)N2CCN=NC1=CC=CC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H13BrN6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC(=O)N(CC(=O)NC2=CC(Cl)=CC=C2C)C(N(C)CC2=CC=CC=C2)=N1 .",
"input": "",
"output": " C22H23ClN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COCC1CN(C(=O)C2=CC=C(Br)C=C2)CC12CCNCC2 ?",
"input": "",
"output": "Sure. C17H23BrN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(NCCCC1=CON=C1)C1COC2=CC=CC=C2O1 .",
"input": "",
"output": " C15H16N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(OC2CCN(C(=O)CC3=CC=C(SC(C)C)C=C3)C2)N=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C21H26N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(C=CC1=CC=CO1)N1CCCC(CC2=NC(C3=CN=CC=N3)=NO2)C1 ?",
"input": "",
"output": " C19H19N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(O)C1CCC(C(=O)O)SS1 into molecular formula.",
"input": "",
"output": " C6H8O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1CCC2CC(=O)C(Br)CC2(C)C1C ?",
"input": "",
"output": " C13H21BrO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC1=CC=CC(NC(=O)C2CCCN(C3=NC=NC4=C3C(C3=CC=C(F)C=C3)=NO4)C2)=C1 into molecular formula.",
"input": "",
"output": " C25H24FN5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=O)N1C2=CC=C(S(=O)(=O)N3CCC4=CC(C(=O)O)=CC=C43)C=C2CC1C into molecular formula.",
"input": "",
"output": " C20H20N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(OC1=CC=CC=C1)C(=O)NC1=CC=C(C2=CC=C3C=CC=CC3=N2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H20N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC(CC)C(=O)NC1CCN(CC2=CC(C3=CC=C(F)C=C3)=NN2C)CC1 ?",
"input": "",
"output": " C22H31FN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN(C)C1=NC=C(C2=CC=CC(F)=C2)C(C2CCN(S(=O)(=O)C3=CC=CC=C3)CC2)=N1 ?",
"input": "",
"output": " C23H25FN4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC(=O)C1=C(NC(=O)C2=CC=C(N(C)S(=O)(=O)N(C)C)C=C2)SC2=C1CCCC2 ?",
"input": "",
"output": " C21H27N3O5S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC1=CC=C(C2=NC(C3=CC=CC=C3Cl)NC(C3=CC(Cl)=CC=C3O)C2)C=C1 into molecular formula.",
"input": "",
"output": " C24H22Cl2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)(C)N(CC(=O)N(CC1=CC=CO1)CC1CCCO1)C(=O)C1=CC=C(F)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C23H29FN2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(NCC1=CC=CN=C1)C1CC2=CC([N+](=O)[O-])=CC=C2N2CCN(C3=CC=CC=N3)CC12 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H24N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COCCNC(=O)C1=COC(CN(CC2=CC=CC=C2C)C(C)C2=CC=CC=C2)=N1 .",
"input": "",
"output": " C24H29N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(NC(=O)N(CCC(C)C)CC(=O)N2CCC3=C(C=CS3)C2COC2=CC=CC=C2C)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C30H37N3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=CC(C(=O)N2CCC(C(NC(=O)C3=CC=C(F)C=C3)C(=O)NC(C)C)CC2)=C1 ?",
"input": "",
"output": "Sure. C25H30FN3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(NC(C)C1=CC=C(Br)C=C1)C(=O)N1CCOCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H21BrN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC(=O)NC1=CC=CC(N2CC(C(=O)O)CC2=O)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H16N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(C)C1=NC(CN2CCCC(N3CCCC3)C2)=NO1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H28N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCN(CC(=O)NC(=O)NC)C1CCN(C(C)C2=CC=CC=C2)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H28N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(NC1=CC=CC(F)=C1)C1=NN=C(C2CCCN2S(=O)(=O)CC2=CC=CC=C2)S1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C20H19FN4O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(O)C1=CC=C2C(=C1)N(CCCN(C)C)C1=CC=CC=C1S2=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C19H24N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC1=CC=C(N(C(C)C(N)=O)S(C)(=O)=O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H18N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCC1(C2CCN(C(=O)C3=CC4=NNN=C4C=C3)CC2)NC(=O)NC1=O ?",
"input": "",
"output": " C18H22N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=NN(C)C(C)=C1CCC(=O)N1CCCC(N2C=CN=C2)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H25N5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COCCN1CCN(CCS(=O)(=O)C(F)(F)F)CC1C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H21F3N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(O)CCN(CCCCOC1=CC=CC=C1)C1=NN=CS1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H19N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCCCC(C)(NCC1=NN=C(C2CC2)N1C)C(=O)OCC ?",
"input": "",
"output": " C18H32N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=CC(CC2=CC=CC(C3CCCN(C(=O)CC4=CC=CN=C4)C3)=N2)=C1 ?",
"input": "",
"output": "Sure. C25H27N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(SC2=NC=CN3C(=O)N(CC4=CC=C5OCOC5=C4)N=C23)C(C)=C1 ?",
"input": "",
"output": " C21H18N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=CC(C2=NOC(CN3C(=O)N(C4=CC=C(C)C=C4)S(=O)(=O)C4=CC=CC=C43)=N2)=C1OC , what would be its molecular formula?",
"input": "",
"output": "It is C25H22N4O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(O)(CNC(=O)NCCOCC1CC1)C1=CSC=C1 ?",
"input": "",
"output": " C14H22N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C1=CC=C2C(=C1)CCCC2SC1=NN=C2CCCCCN21 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H21N3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1CN(C(=O)NCC2=CC=CC(COC(C)(C)C)=C2)CCO1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H28N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(C(C)(C)C)C=C1CCN1CCC(=O)CC1 ?",
"input": "",
"output": " C18H27NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CS(=O)CCNC(=O)C1=C(N2C=CC=C2)SC2=C1CCSC2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H18N2O2S3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=C(C(=O)NC2CC3=CC=CC=C3C2O)C=NN1C1=CC=C(Br)C=C1 ?",
"input": "",
"output": " C20H18BrN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(C1=CN2C=CN=C2C=C1)N1CCCCC1CCC1=CC=C(O)C=C1 ?",
"input": "",
"output": "Sure. C21H23N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(=O)C1(F)CCN(CC2=NC(C3=CC=CC=C3)=CS2)C1 ?",
"input": "",
"output": "Sure. C16H17FN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(C)(C)OC(=O)NCC1CCN(C2=CC=C(Cl)N=N2)C1 into molecular formula.",
"input": "",
"output": " C14H21ClN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=S(=O)(CCC1CCCO1)N1CC=C(C2=CC=CC=C2)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H23NO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(C1=COC=C1)N1CCC2(CC1)COC(COCC1=CC=NC=C1)C2 into molecular formula.",
"input": "",
"output": " C20H24N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(NCC1CCCS1(=O)=O)N1CCCC1C1CCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H24N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C1=NN(CC2=NC(C3CCOC3)=NN2C2CCCCC2)N=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H22N6O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C(OC)C(C2C(=C(O)C3=CC=C(OC(C)C)C(F)=C3)C(=O)C(=O)N2CCCN2CCOCC2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C29H35FN2O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(C1=CC=C(Cl)C([N+](=O)[O-])=C1)N1N=C2C(=CC3=CC=C(Br)C=C3)CCCC2C1C1=CC=C(Br)C=C1 ?",
"input": "",
"output": " C27H20Br2ClN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(C)C2=C1N=C(N(CC1=CC=CC=N1)C(=O)C1CCCN1S(=O)(=O)C1=CC=CS1)S2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C24H24N4O4S3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1C2C=CC1C(C1=C3C=CC(=O)C(O)=C3OC3=C(O)C(O)=CC=C13)C2C(=O)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C22H18O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)C1=CC=CC(N(C(=O)CN2N=NC3=CC=CC=C32)C(C(=O)NCCC(C)C)C2=CC=CS2)=C1 ?",
"input": "",
"output": "The molecular formula is C28H31N5O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC2(NC3=CC(C(C)(C)C)=CC(Br)=C3O2)C(=C(C)O)C(=O)O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H20BrNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN1CCCC1CNC(=O)C1=CC=C2SC3=CC=CC=C3C(=O)N(CC3=CC=C(C(F)(F)F)C=C3)C2=C1 ?",
"input": "",
"output": " C29H28F3N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C1C(=O)N(CC2CCCO2)C(C2=CC=C(Br)C=C2)C1=C(O)C1=CC=C(Cl)C=C1 into molecular formula.",
"input": "",
"output": " C22H19BrClNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C1COC2=CC=C(S(=O)(=O)NCC3CC4CCC3C4)C=C2N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H20N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(CSC(=S)N1CC2CC(C1)C1=CC=CC(=O)N1C2)NCN1C(=O)C2=CC=CC=C2C1=O ?",
"input": "",
"output": " C23H22N4O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN(C)S(=O)(=O)CCCNC1CCCCC1(C)C ?",
"input": "",
"output": "The molecular formula is C13H28N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC(=O)C(C)C1CCC2C3CCC4CC(O)CCC4(C)C3C(=O)CC12C ?",
"input": "",
"output": " C23H36O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(CC(C)NC(=O)C(F)(F)Cl)C=C1OC . Can you tell me?",
"input": "",
"output": "Sure. It's C13H16ClF2NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCS(=O)(=O)C1=CC=C(N2CCC3CCC(C2)N3C(C)C)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H28N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COCCCN1C(=O)C2=CC=CC=C2N2C(SCCNC(C)C)=NN=C12 ?",
"input": "",
"output": " C18H25N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(=O)C1=CC=CC(OCC2=NC=C(C(=O)O)C(=O)N2)=C1 ?",
"input": "",
"output": " C14H12N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC(N2CC34C=CC(O3)C(C(=O)NCCC3=CNC5=CC=CC=C35)C4C2=O)=NO1 ?",
"input": "",
"output": " C23H22N4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)CC(NC(=O)C1CC(=O)N(C)C1)C1=NC2=CC=CC=C2N1C ?",
"input": "",
"output": "Sure. C19H26N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=S(=O)(NC(C1=CC=CS1)C1CC(O)C1)C1=CC=C(Cl)S1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C13H14ClNO3S3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC(NC(=O)C(C)OC1=CC=CC=C1C)C1=CC=C(S(C)(=O)=O)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H25NO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(OC(C)C(=O)NC(C)C2=CC=C(N3CCC(C)CC3)C=C2)C(C)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C25H34N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CNC(=O)C(C)N(CC1=CC=C(F)C=C1)C(=O)COC1=CC=C(F)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H20F2N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC(C(=O)NC(C)C1=CC=C2CCCCC2=C1)N(C1=CC=C(F)C(Cl)=C1)S(C)(=O)=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C23H28ClFN2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule OC1=CC=C(N2C=CC=C2C2C(C3=CC=CC=N3)NC(=S)N2C2=CC=C(N3CCOCC3)C=C2)C=C1 ?",
"input": "",
"output": " C28H27N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C(S(=O)(=O)N2CCCCCC2)C=C1C(=O)NCCOC1=CC=C(F)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H27FN2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCNC(=O)C(CC1=CC=CC=C1)N(CC1=CC=C(Cl)C=C1)C(=O)CN(C1=CC=CC(Cl)=C1C)S(C)(=O)=O ?",
"input": "",
"output": "The molecular formula is C29H33Cl2N3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(C(=O)NCCOC1=CC=C(S(=O)(=O)N2CCCCC2)C=C1)N(C1=CC(Cl)=CC=C1Cl)S(C)(=O)=O .",
"input": "",
"output": " C24H31Cl2N3O6S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1=CC=CC=C1NC(=O)C1=CC=C(OC)C(COCC2=CC=CC=C2)=C1 ?",
"input": "",
"output": "Sure. C24H25NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C2C(=C1)OC(C(=O)NCC(C)C1=CC=CC=C1)CN2S(=O)(=O)C1=CC=CC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C25H26N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=CC(OCCNC(=O)C2=C(C3=CC=CC=C3)C3=CC(Cl)=CC=C3N(C)S2(=O)=O)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C25H23ClN2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(CN(C(=O)CCCN(C2=CC=CC=C2F)S(C)(=O)=O)C(CC2=CC=CC=C2)C(=O)NC(C)C)C=C1 ?",
"input": "",
"output": " C31H38FN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CNC(=O)C(C)N(CC1=CC=CC=C1)C(=O)CN(C1=CC=C(Cl)C=C1)S(C)(=O)=O ?",
"input": "",
"output": " C20H24ClN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC(C)NC(=O)C(C)N(CC1=C(Cl)C=CC=C1Cl)C(=O)CN(C1=CC=CC=C1)S(=O)(=O)C1=CC=C(OC)C=C1 ?",
"input": "",
"output": " C29H33Cl2N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCCNC(=O)C(CC1=CC=CC=C1)N(CC1=CC=C(Br)C=C1)C(=O)CN(C1=CC=C(F)C=C1)S(=O)(=O)C1=CC=C(OC)C(OC)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C36H39BrFN3O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CNC(=O)C(CC1=CC=CC=C1)N(CC1=CC=CC(Cl)=C1)C(=O)CN(C1=CC=CC(C)=C1)S(=O)(=O)C1=CC=C(Cl)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C32H31Cl2N3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC(=O)C1=CC=CC=C1N1C=CC=C1C1C(C2=CC=CC=N2)NC(=S)N1CCC(=O)NC1=CC=CC=C1C ?",
"input": "",
"output": " C30H29N5O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(S(=O)(=O)N2CCC(C(=O)NCCSC3=NNC(C)=N3)CC2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H25N5O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1C(C2=CC=CC=C2)NC(C2=CC=CC=C2)C(C)C1(O)C#N ?",
"input": "",
"output": " C20H22N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(N2C(=O)C3C4CC5C(OC2(C(C)C)C53)C4O)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H23NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CCOCCOC1=CC=C(C2=CC=C(C(=O)OC3=CC=C(C(=O)OC(C)CCCCCC)C=C3)C=C2)C=C1 .",
"input": "",
"output": " C33H38O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C1OC2(CCCCC2)N2OC3C4CC(C5CC=CC54)C3C12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H23NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)C1=CC(C(C)C)=C(C(=O)OC2CCC3=CC=CC=C32)C(C(C)C)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C25H32O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(C)[Si](C)(C)OCC1CCC(CO[Si](C)(C)C(C)(C)C)N1CC1=CC=CC=N1 .",
"input": "",
"output": " C24H46N2O2Si2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1CC2(CC(C3=CC=C(Br)C=C3)N1)OCCCO2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H20BrNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of N=C1C2=C(N=CN1CC1=CC(Br)=C(OCC3=CC=CC=C3)C(Br)=C1)N(C1OC(CO)C(O)C1O)C(=O)N2 ?",
"input": "",
"output": "The molecular formula is C24H23Br2N5O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)CC(NC(=O)C(CC1=C(F)C=C(F)C=C1F)NC(=O)C(N)CO)C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)N1CCCC1C(=O)O ?",
"input": "",
"output": "The molecular formula is C39H60F3N11O10 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)[Si](C)(C)OC1=CC(CCC2C=C(O[Si](C)(C)C(C)(C)C)C3=CC=CC=C32)C2=CC=CC=C12 ?",
"input": "",
"output": "Sure. C32H46O2Si2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=C2N=C(C=C3NC(=C(C)C4=NC(C)(C5N=C1C(C)(CCC(=O)NCC(C)OP(=O)(O)OCC1OC(N6C=NC7=C(N)N=CN=C76)C(O)C1O)C5CC(N)=O)C(C)(CC(N)=O)C4CCC(N)=O)C(C)(CC(N)=O)C3CCC(N)=O)C(C)(C)C2CCC(N)=O ?",
"input": "",
"output": " C58H85N16O14P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCO[S+](C1=CC=CC=C1)C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C14H15OS+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CNC(=O)C1N=C(C)C1C1=CC=CC(C(F)(F)F)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H13F3N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCCCCCCCCCCCC1=CC=C(C2=CC=C(C(=O)OC3=CC=C(C(=O)OC4=CC=CC(C(=O)OC5=CC=C(C(=O)OC6=CC=C(C#N)C=C6)C=C5)=C4)C=C3)C=C2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C57H57NO8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation NC(=C(Cl)C(=O)C1=CC=CC=C1)C1=CC=CC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H12ClNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(=O)C(C(C)=O)C1=C(SC2=CC=CC=C2)C=CC2=C1C(CC1=CC=CC=C1)=CN2S(=O)(=O)C1=CC=C(C)C=C1 ?",
"input": "",
"output": " C33H29NO4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CC(=O)OCCOC(=O)NCCCCCCNC(=O)OC(COC(=O)C=C)COC1=CC=CC=C1 ?",
"input": "",
"output": " C25H34N2O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C=CC=C(C)C1=CC=C2SC(C)(C)CC(C)(C)C2=C1)=CC(=O)O ?",
"input": "",
"output": " C22H28O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(C2OC(C3=CC=CC=C3)C(C)[N+]2(C)C)C=C1 ?",
"input": "",
"output": " C19H24NO2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN(C)SC(=O)SCC(=O)C1=CC=C2OC(=O)N(C)C2=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H14N2O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CSC1=NC=C(C2=CC=CC=C2)N2C=CC(=O)N12 into molecular formula.",
"input": "",
"output": " C13H11N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(C)C1=CC=C(C(=C2C=CC(=[N+](C)C)C=C2)C2=CC=CC(N=NC3=CC=CC([C-](C4=CC=C(N(C)C)C=C4)C4=CC=C(N(C)C)C=C4)=C3)=C2)C=C1 .",
"input": "",
"output": " C46H48N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC(C2OC3=CC(C=CCO)=CC(OC)=C3OC2C)=CC(OC)=C1OC ?",
"input": "",
"output": " C22H26O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC(OC)=C2C=C1C(CC[N+]1=CC=CC=C1)C1=CC(=C(OC)C=C1OC)C(CC[N+]1=CC=CC=C1)C1=C(OC)C=C(OC)C(=C1)C(CC[N+]1=CC=CC=C1)C1=C(OC)C=C(OC)C(=C1)C2CC[N+]1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C64H72N4O8+4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC(=O)C1=C(C)N=C(C[N+]2=CNC=C2)C(=C([O-])OCC)C1C1=CC=CC([N+](=O)[O-])=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H24N4O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN(C)CCCOC1=C(Br)C=C(CC[N+](C)(C)[O-])C=C1Br into molecular formula.",
"input": "",
"output": " C15H24Br2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCC1CCC(C(=O)OC2=C(C#N)C(C#N)=C(OC(=O)C3CCC(CCCCC)CC3)C3=CC=CC=C23)CC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C36H46N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[N+]3=CC=C(C4CCCC4)C=C3)CSC12)C1=CSC(N)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C24H27N6O5S2+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NCC1=CC=C(CCC2=CC=C(CN)C=C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H20N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCCCCCN1C2=CC=C(C3=C4OCCOC4=CS3)C=C2C(=O)C2=CC(C3=C4OCCOC4=CS3)=CC=C21 into molecular formula.",
"input": "",
"output": " C34H35NO5S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=CCN(C(=O)OCC1=CC=CC=C1)C(CCl)CS(=O)(=O)C1=CC=CC=C1 .",
"input": "",
"output": " C20H22ClNO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C[OH+]P1C(C2=CC=CC=C2)CCC1C1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H20OP+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C=CC1=CC(=O)N(CC2=CC=CC=C2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H15NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(=O)OCC1(F)C(=O)CC2CCC1O2 ?",
"input": "",
"output": " C10H13FO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C#CC1(C(=O)NC2=CC=C(SC(F)(F)F)C=C2)CC2=CC=CC=C2C1=O into molecular formula.",
"input": "",
"output": " C19H12F3NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of [O-][P+]1(OC2=CC=CC=C2)OCC2CCCCC2N1CC1=CC=CC=C1 ?",
"input": "",
"output": " C20H24NO3P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C(S(=O)(=O)N2CC3=CC=C4C=C(C5=CCCCC5)OC4=C3C2)C=C1 into molecular formula.",
"input": "",
"output": " C23H23NO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC(=O)C1=C(C)NN=C1CC(C)C .",
"input": "",
"output": " C11H18N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)C(N)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O .",
"input": "",
"output": " C18H31NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC(OCC2=CC=C(C#N)C=C2Cl)=C(C)C=C1N ?",
"input": "",
"output": " C16H15ClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C(C(=O)O)C=C(CN2C=NC3=C(SC=C3C)C2=O)O1 .",
"input": "",
"output": " C14H12N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCNCC1=CC=C(CN(C)CC2CCCC2)C(Br)=C1 ?",
"input": "",
"output": " C17H27BrN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1CN(C2=NNC(C3CCS(=O)(=O)C3)=N2)CCN1 into molecular formula.",
"input": "",
"output": " C11H19N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCNC(C1=CN=CC=C1C(F)(F)F)C1=CN(C)N=C1C ?",
"input": "",
"output": "Sure. C14H17F3N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of N#CC1=CC(F)=CC(N2CCCC(O)C2)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H13FN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=C(Br)C=C(CNC2=CC=C(Cl)N=C2)S1 ?",
"input": "",
"output": " C11H10BrClN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CNCC1CCN(C)C1C1=CC(Br)=C(Br)S1 .",
"input": "",
"output": " C11H16Br2N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CNC(CC1=CC=CC(Cl)=C1F)C1=CC=CC(Br)=C1Cl ?",
"input": "",
"output": " C15H13BrCl2FN ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCNCC1=NC(CCOCCOC)=NO1 .",
"input": "",
"output": " C10H19N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(NCCOC1=CC=CC=C1)C1=CSC(Cl)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H16ClNOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN1C=CC(C(=O)N(CCCC(=O)O)C2=CC=CC=C2)=N1 ?",
"input": "",
"output": "Sure. C15H17N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC(CNC(=O)CCC1=CC=CC(Br)=C1)CC(=O)O .",
"input": "",
"output": " C14H18BrNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCNC(C)C1=CC=CC=C1N1CCCC(C(=O)NC)C1 .",
"input": "",
"output": " C17H27N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCN(C)C(=O)C(C)NC1=CC=CC(C)=C1[N+](=O)[O-] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H19N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by N#CC1=CC=C(NS(=O)(=O)C2=CC=C(F)C(F)=C2)C(Br)=C1 ?",
"input": "",
"output": " C13H7BrF2N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC(=O)C1CCCN(C2=NC3=CC=C(F)C=C3N2)C1 .",
"input": "",
"output": " C15H18FN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CNC1=NC(N2C=CC=N2)=C2C=CSC2=N1 ?",
"input": "",
"output": "The molecular formula is C10H9N5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " N=C(N)C(CSCC1=CC=C(Cl)C=C1)C(F)(F)F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C11H12ClF3N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(C(NN)C2CCOC3(CCC3)C2)N=N1 .",
"input": "",
"output": " C14H22N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COCCOCCCOC1=CC(C(=O)N(C)C)=CC=C1N ?",
"input": "",
"output": " C15H24N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCNCCNS(=O)(=O)C1=CN=C(C)S1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C9H17N3O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC(N2C(=O)C(C)NC(=O)C2C)=C(Br)C=C1Br .",
"input": "",
"output": " C13H14Br2N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CNC(=O)C1=C(N)C(C(=O)NC)=C(NCC2=CNN=C2)S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H16N6O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(=O)C(I)CNCC1=NC=NN1C ?",
"input": "",
"output": "Sure. C8H13IN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN1C=C(CNC2=CC=C3C=NNC3=C2)C=N1 .",
"input": "",
"output": " C13H15N5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC(NCC2=CC(Br)=CC=C2F)=C(N)C=C1F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H13BrF2N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1CN(C2=NC=CN=C2N)CC1C ?",
"input": "",
"output": "Sure. C10H16N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=C(NCC2=NOC(C)=N2)C([N+](=O)[O-])=C1 ?",
"input": "",
"output": "The molecular formula is C11H12N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(NCC1=NC2=CC=CC=C2N1)C1=CC=NC(Br)=C1 ?",
"input": "",
"output": " C14H11BrN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(C1=CC=C(Br)C=C1Br)N1CC(O)C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H9Br2NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=[N+]([O-])C1=CC=CC=C1NCCC1CCCCO1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H18N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(C)C1=NN=C(S(N)(=O)=O)N1CC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C8H16N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CSC1CCCCC1NC(=O)C1=CC=C(O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H19NO2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C#CCCCOCCNC(C)C ?",
"input": "",
"output": "Sure. C10H19NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation ClC1=CC(Cl)=CC(CNC2=CC=C(Br)C3=CC=CC=C23)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H12BrCl2N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCS(=O)(=O)CCCN1CC(O)C(O)C1 , what would be its molecular formula?",
"input": "",
"output": "It is C9H19NO4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC(CC(O)C2=CC(Br)=CC=C2C)=NC=N1 ?",
"input": "",
"output": "The molecular formula is C14H15BrN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(CC1=CC=NC=C1)C1=NC=C(Br)C=C1Br , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H8Br2N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COCC1=NC(NN)=CC(NC2=CC=C(OC)C(Cl)=C2)=N1 into molecular formula.",
"input": "",
"output": " C13H16ClN5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COCC1=NC(NN)=CC(N2CCN3C(=O)CCC3C2)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H20N6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation FC1=CC=C(CNCCNC2CC2)C=C1C(F)(F)F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H16F4N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1OCCC1(C)NC1=CC=CC=C1[N+](=O)[O-] . Can you tell me?",
"input": "",
"output": "Sure. It's C12H16N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CSCCCCCCNS(=O)(=O)C1=CC=C(C)C=C1Br . Can you tell me?",
"input": "",
"output": "Sure. It's C14H22BrNO2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CSC(C2=CC=C(Cl)C=C2F)=N1 ?",
"input": "",
"output": " C10H7ClFNS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC(CC1=C(F)C=CC=C1F)C1CCCCC1C(F)(F)F into molecular formula.",
"input": "",
"output": " C15H18F5N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(O)C(CC1=NC2=CC=CC=C2S1)C1=CC=CC(Br)=C1 ?",
"input": "",
"output": " C16H12BrNO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCNC1=CC=C(C(=O)N(C)C(C)CC)N=C1 ?",
"input": "",
"output": " C14H23N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCNCC1=CC(Cl)=CC(OC)=C1OCCC(C)C ?",
"input": "",
"output": " C16H26ClNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1CCCCCN1S(=O)(=O)C1=CC(Cl)=CC=C1N ?",
"input": "",
"output": "Sure. C14H21ClN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC1CCCCCN1CC1CC(C)(C)CCC1O . Can you tell me?",
"input": "",
"output": "Sure. It's C17H33NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of ClCC1=NN=NN1CC1=CC(Br)=CC2=C1OCC2 ?",
"input": "",
"output": "Sure. C11H10BrClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)OCCNCC1CCC(C)O1 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H23NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOCC(C)NC1=CC=CC(Cl)=C1N , what would be its molecular formula?",
"input": "",
"output": "It is C11H17ClN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCN=C(NN)NCCS(C)(=O)=O , what would be its molecular formula?",
"input": "",
"output": "It is C7H18N4O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NC(CC1=CC=CC=C1)C1=NC(N2CCCC2)=NO1 ?",
"input": "",
"output": " C14H18N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCN1N=C(CC(N)C2=CC=C(Br)O2)C2=CC=CC=C21 ?",
"input": "",
"output": "Sure. C15H16BrN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCN1N=CC(Cl)=C1C(NCC)C1=CC=CC(F)=C1Br ?",
"input": "",
"output": "The molecular formula is C15H18BrClFN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCC(=O)C1=CN=C(C)C=N1 ?",
"input": "",
"output": " C10H14N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCNC(C1=CC=C(F)C(F)=C1)C1=CSN=N1 .",
"input": "",
"output": " C11H11F2N3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNC(CCCC1=CC=CS1)C1=COCCC1 into molecular formula.",
"input": "",
"output": " C14H21NOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CNC(C1=CC=NN=C1)C1=C(Br)C=NN1CCOC .",
"input": "",
"output": " C12H16BrN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCNC(C1=CC=CC2=C1OCCO2)C(C)CCOC . Can you tell me?",
"input": "",
"output": "Sure. It's C17H27NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC(C)=CC(CC(CC2CCCC2)NN)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H26N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOC1=CC=CC=C1C(NN)C1=CC=NC=C1F ?",
"input": "",
"output": " C14H16FN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NNC(CC1=CC(F)=CC=C1Br)C1=CC=C(I)C=C1 ?",
"input": "",
"output": " C14H13BrFIN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)C(SC1=CC=C(F)C=N1)C(=O)O .",
"input": "",
"output": " C10H12FNO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(F)C=C1CC(O)CSC(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C13H19FOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C2C=C(CN3CCNC(C)C3)C=CC2=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H21N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=C2C=C(C(=O)C(C)CC(=O)O)C=CC2=N1 .",
"input": "",
"output": " C15H15NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=C(CCC2(N)CC2)OC=N1 ?",
"input": "",
"output": " C9H14N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCCC1(C(=O)OC)COCCCN1 ?",
"input": "",
"output": "Sure. C11H21NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NC1=CC2=C(N=CN2)C(C2CCCCC2)=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H16N4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC(=O)C(N)C(F)C1=CC=CC(Cl)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C10H11ClFNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation NC1=CC(Cl)=CC=C1C(=O)CC1CCNC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H15ClN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)CCC1CS(=O)(=O)CC1F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C8H13FO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)(C)OC(=O)NCC1CN(C(=O)OC(C)(C)C)CC1CN ?",
"input": "",
"output": " C16H31N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1CN(C(=O)NCCC(C)S(C)=O)CC1C(=O)O ?",
"input": "",
"output": "Sure. C12H22N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCN1N=C(C)C(N)=C1C(=O)N1CCN(C)CC1C ?",
"input": "",
"output": " C13H23N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCN(C(=O)C1CCCCC1C(=O)O)C1=CC=C(C)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H23NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CN=CC=C1NCC(C)(C)CCCO .",
"input": "",
"output": " C13H22N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(C)(OC)C(=O)N1CCC(C(C)O)C1 ?",
"input": "",
"output": "The molecular formula is C12H23NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1(CNC2=CC(F)=C(Br)C=C2N)CCCCC1 .",
"input": "",
"output": " C14H20BrFN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COCCOCCCNC(=O)N(CC(=O)O)C1CCCC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H26N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCOCC(C(C)C)N1C(CO)=NC2=CC(N)=CC=C21 ?",
"input": "",
"output": " C15H23N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCN=C(NN)NC(COCC)C(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C11H26N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1CC(N2C=NC=C2CNC(C)C)C1 ?",
"input": "",
"output": " C12H21N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=C(CNS(=O)(=O)C2=CN(C)C(CO)=C2)C=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H17N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCNC1=NC=CC=C1C(=O)NCC1=C(C)N(C)N=C1 .",
"input": "",
"output": " C15H21N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(NS(=O)(=O)N(C)CCCNC)C1=NC=CN1 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H23N5O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1C=CC(CCN2C(CO)=NNC2=S)=N1 ?",
"input": "",
"output": "The molecular formula is C9H13N5OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCC(CCO)CNC1=NC(NN)=NC(OCC)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H24N6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN1C=CC(C(=O)NCC(C)(C)CCCN)=N1 ?",
"input": "",
"output": " C12H22N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC1=CC=C(S(=O)(=O)NCC(O)C(N)=O)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H16N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=C(N(C)CC2=C(F)C=CC(Br)=C2F)C(C)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H16BrF2N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCC(C)(O)CNC(=O)C1=CC(N)=CC=C1Cl .",
"input": "",
"output": " C13H19ClN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCNC1=CC(NCCS(=O)(=O)NC)=NC(N)=N1 ?",
"input": "",
"output": " C9H18N6O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1C=CC=C1CNC(=O)CCOC1CCNCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H23N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCOCCNCCBr .",
"input": "",
"output": " C7H16BrNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CNC(C1=CC=CC(C)=C1C)C1=C(Br)N=NN1C ?",
"input": "",
"output": "The molecular formula is C13H17BrN4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1N=NC(Br)=C1C(NN)C1=NC2=CC=CC=C2C=C1Br is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H12Br2N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=CC=C1C(CN)(CC1CC1)C(=O)O .",
"input": "",
"output": " C14H19NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=CC2=C(N(C)CCCN)N=CC=C12 .",
"input": "",
"output": " C14H19N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COCCCN1C=C(C)N=C1NC1(C)CCCC1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H25N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)C1CCCCC1(O)CCC1CC1 ?",
"input": "",
"output": " C15H28O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1(C)OCC(NCC2(CO)CCCCC2)CO1 ?",
"input": "",
"output": " C14H27NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule ClC1=CC(Cl)=CC(NC2CCN(C3=CC=CC=C3)CC2)=C1 into molecular formula.",
"input": "",
"output": " C17H18Cl2N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC1CC(CN)(N(C)C2CCCN(C)C2)C1 .",
"input": "",
"output": " C14H29N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCSC1=CC=C(C(O)CC2=CC=CC(OC)=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C17H20O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(C(=O)N(C)CCC(N)=NO)C(Cl)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H16ClN3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C(CC(O)C2(C3=CC=CC=C3)CCC2)C(Cl)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C19H21ClO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for OC1(COCC2CCCNC2)CCCC1 .",
"input": "",
"output": " C12H23NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC(=O)C1=CC=C(N)C=C1OCC1=NC(C)=C(C)S1 ?",
"input": "",
"output": " C14H16N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)C1(C(=O)NC2CCS(=O)(=O)CC2)CCNC1 ?",
"input": "",
"output": " C13H24N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C([N+](=O)[O-])C(N2CCC(C(=O)O)(C(C)C)C2)=C1 ?",
"input": "",
"output": "Sure. C15H20N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NCC1=CC=NC(N2CCN(C3=CC=CC=N3)CC2)=C1Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H18ClN5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CN=CC(C(NN)C2CCN(C(=O)OC(C)(C)C)C2)=C1 ?",
"input": "",
"output": "Sure. C16H26N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)CCNC(=O)C(C)OC1=CC(Br)=CC(F)=C1F .",
"input": "",
"output": " C14H18BrF2NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)CC(O)CNCCC1=CC=C([N+](=O)[O-])C=C1 .",
"input": "",
"output": " C14H22N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1(C(N)=NO)CCN(CC2=CC=C(Cl)C=C2F)CC1 ?",
"input": "",
"output": " C14H19ClFN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCCNCCN(C(=O)OC(C)(C)C)C1CC1 .",
"input": "",
"output": " C15H30N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC(C(CC2=CC=CC(Cl)=C2Cl)NN)=C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C16H18Cl2N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCS(=O)(=O)CCOC1=CC=CC([N+](=O)[O-])=C1C(=O)O ?",
"input": "",
"output": " C12H15NO7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)COCCNS(=O)(=O)C1=CC=C(F)C(N)=C1F , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H18F2N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCCCCCOCC1=CC=CC([N+](=O)[O-])=C1NN ?",
"input": "",
"output": " C15H25N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(OC1=CN=C2C=CC=CC2=C1)C(=O)N1CCCC1 ?",
"input": "",
"output": " C16H18N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1CN(C(=O)CC2CCCO2)C2=CC=CC=C2CN1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H22N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1(C)CCCN(CC2=CC=C(F)C=C2C(=O)O)C1 .",
"input": "",
"output": " C15H20FNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1(N2C(=O)NNC2=O)CCNCC1 .",
"input": "",
"output": " C8H14N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1(C)CCN(C2=CC=C(C(N)=S)C=N2)CCS1 ?",
"input": "",
"output": " C13H19N3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C(=O)N1CCSC(C)(C)CC1)C(N)=NO . Can you tell me?",
"input": "",
"output": "Sure. It's C11H21N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CNC(C1=CC(C)=CC=C1F)C1=CC(F)=C(F)C=C1Cl ?",
"input": "",
"output": "Sure. C15H13ClF3N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC1=CN2C=CN=C2C(NC2=CC(F)=CC=C2Cl)=N1 into molecular formula.",
"input": "",
"output": " C12H9ClFN5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NC1=CN=C(NC2=CC(F)=CC=C2Br)C=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H8BrFN4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(O)C(NC1=CC=C(F)C=C1)C1=CC(F)=CC=C1O ?",
"input": "",
"output": " C14H11F2NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCN(C(=O)CNC1=CC=CC=C1)C1=CC(O)=CC=C1C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H20N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(C)CS(=O)(=O)C(C)C(=O)NC1=CC=CC(C#N)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H20N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for NC(=S)C1=CC=C(NC(=O)C2=CC=CC=C2Br)C(Cl)=C1 .",
"input": "",
"output": " C14H10BrClN2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C(N)C=C(Br)C=C1C(=O)N1CC(C)N(C)C(C)C1 .",
"input": "",
"output": " C15H22BrN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=C(N)C=CC=C1CN1C=CC2=CC=C(C#N)C=C21 ?",
"input": "",
"output": " C17H15N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)=CC(NN)C1=CC=CC(C)=C1Br .",
"input": "",
"output": " C12H17BrN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C1=CC=CC=C1)C(N)C1=CC=C(F)C(C(F)(F)F)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H15F4N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(NC1CCCC1Br)C1=CC=C(F)C=C1I is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H12BrFINO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCN=C(NN)C1=CN=CS1 ?",
"input": "",
"output": " C6H10N4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCN1C=C(C(NCC)C2=C(C)N=C(C)S2)C=N1 ?",
"input": "",
"output": " C14H22N4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(CCC1CCNC1)NC1=CC(C(F)(F)F)=CC=C1Br into molecular formula.",
"input": "",
"output": " C14H16BrF3N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C(C(C)NC2=CN=C(Br)C(C)=C2)C=C1[N+](=O)[O-] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H16BrN3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(C)=C(C(=O)NC2=C(C)C=CN=C2Cl)C(C)=C1 ?",
"input": "",
"output": "The molecular formula is C16H17ClN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCNCC1=CC(C)=CC=C1N1CCC(N(CC)CC)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H31N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC(=O)C(C)(O)C1=CC=CC(F)=C1F .",
"input": "",
"output": " C11H12F2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CNCC1=CC(Br)=CC=C1OC1=CC=CC=C1OC .",
"input": "",
"output": " C15H16BrNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(C)NCC1=CC=C(N(CC(N)=O)CC(N)=O)C(Br)=C1 into molecular formula.",
"input": "",
"output": " C14H21BrN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COCCNCC1=CC=C(N2C=C(C(N)=O)C=N2)C(Br)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H17BrN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)NCC1=CC=C(N(C)CC2=COC=C2)C=C1Cl .",
"input": "",
"output": " C16H21ClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1(C)CC2=CC=CC(OC3=C(Cl)C=CC=C3CCl)=C2O1 .",
"input": "",
"output": " C17H16Cl2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCNC1=CC([N+](=O)[O-])=CC(NCC(O)C(C)C)=N1 ?",
"input": "",
"output": " C12H20N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(O)CCC(CC1=CC(F)=CC=C1Br)NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C21 ?",
"input": "",
"output": " C26H23BrFNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=CC=C1C1=C(NC2=CC=C(Cl)C=C2C)C(=O)N(CC2=CC=CC=C2Cl)C1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C25H20Cl2N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " N#CC1=CC=C(NC(=O)C(=O)NC2=CC=C(N)C=C2Cl)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H11ClN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=C(CCC(=O)NC2CCN(C(=O)C(C)OC3=CC=C(Cl)C=C3)CC2)C=C1 .",
"input": "",
"output": " C24H29ClN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCN(CC)CCN1C(=O)C(=O)C(=C(O)C2=CC=CC(OC)=C2)C1C1=CC=CC=C1OC . Can you tell me?",
"input": "",
"output": "Sure. It's C25H30N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=C(O)C(N2C(=O)C(=O)C(=C(O)C3=CC=C(F)C(C)=C3)C2C2=CC=CC=N2)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H19FN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCN1C(=O)C(O)=C(C(=O)C2=CC=CO2)C1C1=CC=C(Cl)C(Cl)=C1 into molecular formula.",
"input": "",
"output": " C18H15Cl2NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC1=CC=C(C2C(=C(O)C3=CC=CC(OCC(C)C)=C3)C(=O)C(=O)N2C2=CC=CC(NC(C)=O)=C2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C31H32N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC(=O)C1=CC=C(CN2C(=O)C(=O)C(=C(O)C3=CC=C(Cl)C(OC)=C3)C2C2=CC=CC=C2)C=C1 ?",
"input": "",
"output": "Sure. C28H24ClNO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=CC(CN2C(=O)C(O)=CC2(C(=O)C2=CC(OC)=C(Cl)C=C2OC)C2=CC=C(OC)C(OC)=C2)=C1 ?",
"input": "",
"output": "The molecular formula is C29H28ClNO8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=O)C1=C(C)OC(NC(=O)C2=CC=CC=C2Cl)=C1C(N)=O into molecular formula.",
"input": "",
"output": " C15H13ClN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(=O)OC1=CC=CC(C(=O)NCC2=CSC(C3=CC=CN=C3)=N2)=C1 .",
"input": "",
"output": " C18H15N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(CNC(=O)C2=C(C)N(C3=CC=C4C=CC=CC4=N3)N=C2)C=C1 ?",
"input": "",
"output": "Sure. C22H20N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(NCCCN1C(=O)C2=CC=C([N+](=O)[O-])C=C2C1=O)NCC1=CC=C2OCOC2=C1 ?",
"input": "",
"output": " C20H18N4O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC1=CC=C(CCNC(=O)NCCC2=CC=C(C)C=C2)C=C1OCC .",
"input": "",
"output": " C22H30N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(C)OC(=O)NCCC(=O)NCCCNC(=O)C1=CC=CC=C1C(F)(F)F , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H26F3N3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=CC(NC(=O)CC(=O)NC2=CC(C)=C(Cl)C=C2OC)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H19ClN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of N#CC1=CC=CC=C1NC(=O)C(=O)NCCC1=CC=C(Cl)C=C1Cl ?",
"input": "",
"output": " C17H13Cl2N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=C(CNC(=O)CNC2=CC=C(C)C(Cl)=C2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H19ClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC1=CC=C(NC(=O)CNCCC2=CNC3=CC=CC=C23)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H23N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C(CCNC(=O)CCNC2=C(F)C=CC=C2F)C=C1OC ?",
"input": "",
"output": " C19H22F2N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCNC(=O)C1=CC(C(=O)NC2=CC=C(Br)C(C)=C2)=CC=N1 ?",
"input": "",
"output": " C18H20BrN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=CC(N2CCN(C(=O)C3CC3C(=O)N3CCOCC3)CC2)=C1C ?",
"input": "",
"output": "The molecular formula is C21H29N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC(=O)C1=CC=CC=C1NC(=O)C1CC1C(=O)NC1=CC=CC=C1C(=O)OC ?",
"input": "",
"output": " C21H20N2O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC(NC(=O)C2=CC(NCC3=CC=CC=N3)=CC=N2)=C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C20H20N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(NC1=CC=C(F)C=C1)C1=CN=CC(N2CCC3=CC=CC=C32)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H16FN3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN(C1=CC=CC=C1)C1=NC=CC(C(=O)NC2=CC=C(N3CCCC3)C=C2)=N1 ?",
"input": "",
"output": " C22H23N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCNC(=NCC(=O)NCC1=CC=C(OC)C=C1)NC1CCN(C2=CC=CC(Cl)=C2)C1;I . Can you tell me?",
"input": "",
"output": "Sure. It's C23H31ClIN5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCC(O)(CCC)CN=C(NCC)NCCC(=O)OC ?",
"input": "",
"output": "The molecular formula is C15H31N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN=C(NCC(C)C1=CC=CS1)N1CCC(CC(=O)NC)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H28N4OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC1=NSC(N2CCN(C(=NC)NCC3CN(C)CCN3C)CC2)=N1 ?",
"input": "",
"output": " C17H32N8S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCNC(=NCC1=CC=C(C)C=C1OCC(F)(F)F)NCCCF .",
"input": "",
"output": " C16H23F4N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCNC(=NCC1(C2CC2)CC1)N1CC(C)C(C(=O)OC)C1 ?",
"input": "",
"output": "The molecular formula is C17H29N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN=C(NCC1=CC=C(OC2=CC=CN=C2)C(F)=C1)N1CCC2(CCOC2)C1 into molecular formula.",
"input": "",
"output": " C21H25FN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN=C(NCC1CCN(C2=CC=CC(OC)=C2)C1)N(C)CC1=CC(Cl)=CN1C into molecular formula.",
"input": "",
"output": " C21H30ClN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN=C(NCCC1=CC=C(Cl)N=C1)NCC1CCCOC1C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C21H27ClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=NN=C(CN=C(NCC2CCCO2)NC2CC2C)N1C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H26N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(C(O)C(C)NC(=O)C2=CN=C(C(C)(C)C)S2)C=C1 .",
"input": "",
"output": " C18H24N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CSCC(CCO)NC(=O)C1=CN=CC(C2=CC=C(C)C=C2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H22N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(NCCO)NCC1=CC=C(N2CCN(CC3CC3)CC2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H28N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(CO)NC(=O)NC1=CC=C2N=C(C(F)F)NC2=C1 ?",
"input": "",
"output": " C12H14F2N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(NC(CO)C1=CC=C(Cl)C=C1)C1=CSC=C1 ?",
"input": "",
"output": " C14H16ClNOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(O)CC(C)(C)CNC(=O)NC1=C(F)C=C(Cl)C=C1F .",
"input": "",
"output": " C14H19ClF2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(C)C1=CC=C(CNC(=O)NCCC2=CC=C(CO)C=C2)C=C1F .",
"input": "",
"output": " C19H24FN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=O)N1C2=CC=CC=C2CC1C(=O)N1CCCC1CCCO ?",
"input": "",
"output": " C18H24N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)(C)OC(=O)N1CC=CCC2=CC=CC=C2OCC(=O)OCC1CC1=CC=CC=C1 .",
"input": "",
"output": " C26H31NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(NC1CCCC1)C1=CC=C2OCCOCCN(CC3=CC=CC=N3)CC3=CC(=CC=C3)CC2=C1 into molecular formula.",
"input": "",
"output": " C30H35N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(CCCN1C2=CC=CC=C2CCC2=CC=CC=C21)CC(O)CN;O;O=C(O)C(=O)O ?",
"input": "",
"output": " C23H33N3O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of FC1(F)CNC(C2=NC(C3=CC=NC=C3)=NO2)C1 ?",
"input": "",
"output": "The molecular formula is C11H10F2N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCOC1=CC=C(CC(=O)NCC2=NC(C3=CC=CS3)=NO2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H17N3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCC(=O)NCCC1=NOC(C(C)(C)C)=N1 .",
"input": "",
"output": " C12H21N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC(=O)NCCC1=NN=C(C2=CC=CC(OC)=C2)O1 .",
"input": "",
"output": " C14H17N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(OC1=CC=CC=C1)N(CC1=CC=CN=C1)C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C19H16N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(C2CN(C(=O)CC3=CC=CS3)CC(C)O2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H21NO2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COCCOCCS(=O)(=O)N1CCN(C2=NC=CC=N2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H22N4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=CC2=C1OCCCC2NC(=O)CCCO represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H21NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C1C2=CC=CC=C2C(=O)N1CCC(=O)N1CCC(O)C2=CC=CC=C21 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H18N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(CC(=O)NC2=CC=C3C(=C2)OCCN3C(C)=O)C=C1 ?",
"input": "",
"output": " C19H20N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(COC1=CC=C(Cl)C=C1)NC1=CC=C(N2CCCNC2=O)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H18ClN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=C(C(=O)N(C)C2CCS(=O)(=O)C2)C2=CC=CC=C2N1 ?",
"input": "",
"output": "Sure. C15H18N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(CNC(=O)C(C)C)C=C1NC(C)=O ?",
"input": "",
"output": " C14H20N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(NC(C)=O)C=C1CNS(=O)(=O)CC1=CC=CC=C1 .",
"input": "",
"output": " C17H20N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(NCCC1=CC=C2OCCC2=C1)C1=CC=NC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H16N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC(=O)C(CC)N1C(=O)C(CC)OC2=CC=C([N+](=O)[O-])N=C21 ?",
"input": "",
"output": " C15H19N3O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)C1=C(C2=CC=C(OC)C=C2)NC(=O)NC1C1=CC=CC=C1OCC ?",
"input": "",
"output": "The molecular formula is C22H24N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CON=C1C(=O)NC1CCCCCC1 ?",
"input": "",
"output": " C12H18N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=NN(CC2=CC=CC=C2)C(C)=C1CNCC(O)CN1CCCC1 ?",
"input": "",
"output": "Sure. C20H30N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCNC(=NCCCC1=CC=C(OC)C=C1)NCCCOC;I into molecular formula.",
"input": "",
"output": " C17H30IN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NC(=NCCOC1=CC=C(Cl)C=C1)N1CCOCC1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H18ClN3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)(C)C1=NC(CN=C(N)NCC2CCC2)=CS1 ?",
"input": "",
"output": " C14H24N4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)C1=NN=C(CN2CCC(C(O)C3=CC=C(F)C=C3)CC2)N1C . Can you tell me?",
"input": "",
"output": "Sure. It's C19H27FN4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(CC1CCCC1)NC1CCN(CCCCCO)CC1 ?",
"input": "",
"output": "Sure. C17H32N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(CC1=CC=C(OCC2=CC=CC(F)=C2F)C=C1)NCCO is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H17F2NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN=C(NCC(C)N1CCC2=C(C=CS2)C1)N1CCCC(C)C1;I ?",
"input": "",
"output": " C18H31IN4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCNC(=NCC1=CC=CC(Cl)=C1)NCCC1=CC=C(NC(C)=O)C=C1 .",
"input": "",
"output": " C20H25ClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCNC(=NCC1=CC=CS1)NCCN(C(=O)OC(C)(C)C)C1CC1;I is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H31IN4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCNC(=NCC1=CC(OC)=C(OC)C(OC)=C1)NCCOC1=CC=CC(F)=C1 ?",
"input": "",
"output": " C21H28FN3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN1C=C(C(C)(O)CNCC2=CC=CC(Cl)=C2Cl)C=N1 .",
"input": "",
"output": " C14H17Cl2N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)C(O)CCNC(=O)C1=CC=CC=C1NC(=O)C1=CC=CC=C1 ?",
"input": "",
"output": " C20H24N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CN=C(CN=C(N)NCC2CCCO2)S1 ?",
"input": "",
"output": " C11H18N4OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(CNC(=O)CC1(O)CCCC1)C1=CSC=C1 ?",
"input": "",
"output": " C14H21NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN=C(NCCCC1=NC(C(C)C)=NO1)NCCC1=CC=CC(C(=O)N(C)C)=C1;I ?",
"input": "",
"output": "The molecular formula is C21H33IN6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCNC(=NCC(=O)N1CCCC1)NCCOC1=CC=CC2=C1OC(C)(C)C2 .",
"input": "",
"output": " C21H32N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCNC(=NCC(CC(C)C)N1CCOCC1)NCCCN1N=C2CCCCN2C1=O ?",
"input": "",
"output": "The molecular formula is C22H41N7O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOCCCNC(=NCC1=NN=C(C)N1C)NC1CC1C ?",
"input": "",
"output": " C15H28N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCNC(=NCCCCCOC)NCCC1=CNC2=CC(C)=CC=C12;I . Can you tell me?",
"input": "",
"output": "Sure. It's C20H33IN4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCOCCOCCNC(=NCC(C)CN1CCOCC1)NCC .",
"input": "",
"output": " C19H40N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCNC(=NCCC1=CC=C(C)N=C1)N1CCN(CC(=O)NC2CC2)CC1;I into molecular formula.",
"input": "",
"output": " C20H33IN6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN=C(NCCCC(C)C)NCCC1=CC=C(C)N=C1 ?",
"input": "",
"output": "Sure. C16H28N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN=C(NCCOC1=CC=C(S(C)(=O)=O)C=C1)NCC1=CC=CC(C)=C1;I ?",
"input": "",
"output": "Sure. C19H26IN3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCNC(=NCC1=CC=C(C#N)C=C1)NC1CCN(CC2=CC=C(F)C(F)=C2)CC1 ?",
"input": "",
"output": " C23H27F2N5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN=C(NCC1=NC=NN1C)NCC1(N2CCSCC2)CCCCC1;I ?",
"input": "",
"output": "The molecular formula is C17H32IN7S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCC(CCO)CNC(=NCC1=CC=C(F)C(CN(C)C)=C1)NCC ?",
"input": "",
"output": " C20H35FN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COCCNC(=NCC(=O)N(C)C)NCC1(C2=CC=CS2)CCCCC1;I ?",
"input": "",
"output": " C19H33IN4O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCNC(=NCC1(C2=CC=CC(F)=C2)CC1)N1CCN(CC2=NOC(C)=C2)CC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H30FN5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN=C(NCC1=CSC(N(C)C)=N1)NC1CCCC(C(F)(F)F)C1 .",
"input": "",
"output": " C15H24F3N5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(CCC1=CC=CC=C1)NC(CCO)C1CC1 ?",
"input": "",
"output": "The molecular formula is C15H21NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for OC1CCN(CC2=CC=CC=C2NCC2=CN=C3C=NC=CN23)CC1 .",
"input": "",
"output": " C19H23N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC(S(=O)(=O)NCC(O)C2=CC=C(F)C=C2)=CC=C1F .",
"input": "",
"output": " C15H15F2NO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(C)=CC(OCCCC(C#N)C2=CC(C)=CC=C2C)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H25NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC(C)=C(C(N)=NO)C(N2C=C(Br)C=N2)=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H12BrN5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of NC1=CC=NC=C1C1(F)CC2CCC(C1)N2 ?",
"input": "",
"output": "The molecular formula is C12H16FN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of BrCC(CBr)(CC1=CC=CO1)C1CCCC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H18Br2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=C(CCOC2=NC=CC=C2S(N)(=O)=O)SC=N1 .",
"input": "",
"output": " C11H13N3O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(C)OCC(=O)N1CCCC2CCCC21 ?",
"input": "",
"output": "The molecular formula is C14H25NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(N)(CC1=CC=CC=C1)CC1=CC=CC(F)=C1Cl into molecular formula.",
"input": "",
"output": " C16H17ClFN ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC12CCC(=O)N1C(C(=O)NC1=CC=C(C3=NC4=CC=CC=C4S3)C=N1)CS2 ?",
"input": "",
"output": "The molecular formula is C20H18N4O2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(NC1=CC=C(C2=NC3=CC=CC=C3S2)C=N1)C1=CC=C(Br)S1 .",
"input": "",
"output": " C17H10BrN3OS2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC1=CC=CC=C1NC1=NN=C(SCCCCC#N)S1 into molecular formula.",
"input": "",
"output": " C15H18N4OS2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=C(C)C=C1NC1=CC=NC(NCCC2=CC=CC=C2F)=N1 ?",
"input": "",
"output": " C20H21FN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC(=O)C1=CC=C(NC2=NC(C)=CC(NCC3=CC=CC=C3Cl)=N2)C=C1 ?",
"input": "",
"output": " C20H19ClN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CS(=O)(=O)NC1=CC=C(N2CCN(C3=CC=CC=N3)CC2)C=N1 into molecular formula.",
"input": "",
"output": " C15H19N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)C1=CC=C(NC2=CC=C(NC(=O)NC3CC3)N=N2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H21N5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=O)N(CCNS(=O)(=O)C1=CC=CC(C)=C1)CC1=CC=C(Cl)C=C1 ?",
"input": "",
"output": " C18H21ClN2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CS(=O)(=O)N(CCC(=O)NC1CCS(=O)(=O)C1)C1CCCCC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H26N2O5S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CS(=O)(=O)N(CCC(=O)NCCCC1=CC=CC=C1)CC1=CC=CO1 ?",
"input": "",
"output": " C18H24N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCCNC(=O)CN(C1=CC=CC(F)=C1)S(C)(=O)=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H21FN2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(N2CCN(C(=O)C(=O)C3=CNC4=CC=C(F)C=C34)CC2)C=C1 .",
"input": "",
"output": " C21H20FN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1CC(C)CN(C(=O)C2=CC(O)=CC=C2O)C1 .",
"input": "",
"output": " C14H19NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=C(CN(C)C(=O)C2=CC=CN=C2Br)SC=N1 .",
"input": "",
"output": " C12H12BrN3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC(Cl)=CC=C1C(=O)NCC1(C)COC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H16ClNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CS(=O)(=O)NCCCNC(=O)C1CNCCO1 .",
"input": "",
"output": " C9H19N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC(=O)C1=CSC(NC2=CC(C#N)=CC=C2Cl)=N1 ?",
"input": "",
"output": "The molecular formula is C12H8ClN3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC(C(=O)N2CCCC(C(=O)O)C2)=CC=C1Br ?",
"input": "",
"output": "Sure. C14H16BrNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(CC)C(C)NC1=CC(C#N)=CC=C1N , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H21N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC1=NC(N)=C(C)C(N(CCO)CCOC)=N1 .",
"input": "",
"output": " C12H22N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(NC1=CC=C([N+](=O)[O-])C(F)=C1)C1CCOC1 ?",
"input": "",
"output": "The molecular formula is C12H15FN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC(CSCC2CCCC2)=CC=C1C(=O)O .",
"input": "",
"output": " C15H20O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC(=O)CC(C)N1CCC(C(C)O)CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H25NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NC1(C2=NC(C3=CC=C(F)C=C3Br)=NO2)CCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H11BrFN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1CCC(CNC2=CC(F)=CC([N+](=O)[O-])=C2)O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H15FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(CCC1=CC=CS1)C1=NC=CC(C(=O)O)=N1 ?",
"input": "",
"output": " C12H13N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(CC)N1C=CC(CC(NN)C2=CN(C)C=N2)=N1 .",
"input": "",
"output": " C14H24N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NC1=CC=CC=C1CNC1=CN=C(Cl)C(Br)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H11BrClN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)C(C(=O)NCC1CC1(C)C)C(N)=NO .",
"input": "",
"output": " C12H23N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(Cl)CCCNC(=O)C1=CC2=C(CCCC2)S1 ?",
"input": "",
"output": " C14H20ClNOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C#CC(CC)NS(=O)(=O)C1=CC(Cl)=CC(N)=C1C ?",
"input": "",
"output": " C12H15ClN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCC1=NC(Cl)=CC(NC(C(N)=O)C(C)C)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H19ClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCNC1=CC(=O)N(CCCC(C)(C)C)N=C1 ?",
"input": "",
"output": " C13H23N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(CCNC(=O)NC1CCOCC1C)C(=O)O ?",
"input": "",
"output": " C12H22N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=CC=C1CC(=O)N(C)CCOCCN represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H22N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCNC1=C(C)C(C)=NC2=CC=C(COC)C=C12 ?",
"input": "",
"output": " C15H20N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=CC(NS(=O)(=O)CCCCO)=C1F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C11H16FNO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=S(=O)(NCC1CCCC1CBr)C1=CC=C(F)C(F)=C1 ?",
"input": "",
"output": "Sure. C13H16BrF2NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCNC(=O)C(C)NS(=O)(=O)C1=CC(Cl)=CC(N)=C1C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H20ClN3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC(C)=C(C(=O)NCC(F)(F)CN)C(C)=C1 ?",
"input": "",
"output": " C13H18F2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(N)C1=CN(CC2=NN=C(C3=CC=CO3)O2)N=N1 ?",
"input": "",
"output": " C11H12N6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCNC(CCC1=NC=CN1C)C1=CC=C(C)C=C1 ?",
"input": "",
"output": "Sure. C17H25N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCNC(CC1=CC=CC=C1)C1=C(Cl)C=NN1C ?",
"input": "",
"output": " C15H20ClN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC(C)=CC(C(N)CCN2CCC(O)C(C)C2)=C1 ?",
"input": "",
"output": "Sure. C17H28N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C1=CC=CC=C1Cl)N1C=NC=C1C(N)C1CCOC1 .",
"input": "",
"output": " C16H20ClN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCNS(=O)(=O)NC1=CC=C(C#CCO)C(C)=C1 ?",
"input": "",
"output": " C12H16N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCNC(C)(CC1=CC=CC(F)=C1)C1=NC(C)=C(C)S1 .",
"input": "",
"output": " C16H21FN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1=NN(C)C=C1C(O)CCCOC ?",
"input": "",
"output": " C11H20N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN1C=C(N)C=C1C(=O)OCC1=CC=C(Cl)C=C1F ?",
"input": "",
"output": " C13H12ClFN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation N#CC1(CC2=CC=C(Cl)C=C2F)CCCC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H13ClFN .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN(CC1(O)CCOCC1)C(=O)C1=CC=C2NN=CC2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C15H19N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule OCCC1=NC(C2=CC=CO2)=NO1 into molecular formula.",
"input": "",
"output": " C8H8N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC(=O)C1(CN(C)C2=CC=CC=C2OC)COC1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H19NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=NC2=CC=C(CNCNN)C=C2O1 .",
"input": "",
"output": " C10H14N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN1CCC(CCNCNN)CC1 ?",
"input": "",
"output": " C9H22N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)CCCC(C)NC1=CC=C(C#N)C(F)=C1 .",
"input": "",
"output": " C15H21FN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CSC1=NN=C(SC2=CC(C(N)=O)=CC=C2N)S1 ?",
"input": "",
"output": "Sure. C10H10N4OS3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN1C(C2=CC=C(F)C(C(F)(F)F)=C2)=NNC1=S ?",
"input": "",
"output": " C10H7F4N3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(NCC(F)F)C1CCOC2=CC=C(S(=O)(=O)Cl)C=C21 ?",
"input": "",
"output": " C12H12ClF2NO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1CCC(CNC2=NC3=CC=CC=C3S2)(C(=O)O)CC1 .",
"input": "",
"output": " C16H20N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(=O)CC1=CC=CC=C1CN1CCC(N)C1 ?",
"input": "",
"output": "Sure. C14H20N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1C(=O)CC(NCC2=CC=C(C(F)F)C=C2)C1=O ?",
"input": "",
"output": "The molecular formula is C13H14F2N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation NC(=O)C1=CC=CC(OCC2CCCCO2)=C1N represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H18N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=CC([N+](=O)[O-])=C1NC(C(=O)O)C1=CN(C)N=C1 ?",
"input": "",
"output": " C13H14N4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1(C)NC2=C(C)C=CC=C2NC1=O ?",
"input": "",
"output": " C12H16N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NC1=CC(C(=O)O)=CC=C1S(=O)(=O)N1CC2CCCC2C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H18N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNC(C1=CC=C(Cl)C(Br)=C1)C1=CC=CC=C1OC into molecular formula.",
"input": "",
"output": " C15H15BrClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCN1CCOC(CN=C(N)NC2CC2)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C11H22N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=CCC(C)NC(=O)C1=CC=C(F)C=C1C ?",
"input": "",
"output": "The molecular formula is C13H16FNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COCC(C)CNCC1=CC(Cl)=CC=C1F . Can you tell me?",
"input": "",
"output": "Sure. It's C12H17ClFNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CNC(C1=CC=CC(OC)=C1)C1=CC=C(Br)C=C1Cl ?",
"input": "",
"output": " C15H15BrClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(CSC)NC(=O)C1=CC(F)=CC=C1O ?",
"input": "",
"output": "The molecular formula is C12H16FNO2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COCC(C)(C)NC(C)CN1C=C(Br)C=N1 .",
"input": "",
"output": " C11H20BrN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(O)C1=CC=NC2=C1NC(C1=CC(F)=CC=C1Br)=N2 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H7BrFN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=CC(CNC2CC2)=C1OCCC1=CC=NC=C1 .",
"input": "",
"output": " C18H22N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC#CCNCC1=CC=C(OCCCCC)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C16H23NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=NN(C)C2=C1N=C(CCCl)N2C1CC(C)C1 ?",
"input": "",
"output": " C13H19ClN4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by ClCC1CC(C2=CN=CC(Br)=C2)=NO1 ?",
"input": "",
"output": " C9H8BrClN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule NCC(NC1CC=CC1)C1=CC=C(Cl)C=C1 .",
"input": "",
"output": " C13H17ClN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC(C(O)C(N)CO)=CC2=C1OCO2 , what would be its molecular formula?",
"input": "",
"output": "It is C11H15NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCCOCCCN1C(CC)=NC2=CC(N)=CC=C21 .",
"input": "",
"output": " C16H25N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC(Br)C1=CN(CCSC)N=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C8H14BrN3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC1CCCC12CC(O)CCO2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H20O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(CO)C(C)NCC1=CC=C(O)C(Br)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H18BrNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1(NC(=O)CCC2CCCNC2)CCOCC1 .",
"input": "",
"output": " C14H26N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCC1C(=O)NC(=O)N(C2(C)CCOCC2)C1=O ?",
"input": "",
"output": " C13H20N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC(NC2CCCSC2)=NC=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H15N3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCC1CCCC(NCCCC2=NC=CN2)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H29N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1(C)CN(C(=O)CNC(=O)C2=CC=C(N)C=C2)CCS1 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H21N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CNC1=NC(C2=CC=C(Br)C=C2Cl)=NC(C(C)(C)C)=C1Br is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H16Br2ClN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CN=CC(C(=O)C(N)CC(C)C)=C1 ?",
"input": "",
"output": "Sure. C12H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COCCOC1=CC=CC=C1C(=O)C1CCCC(N)C1 ?",
"input": "",
"output": "The molecular formula is C16H23NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(=O)C1=CN(CCN)N=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C6H10N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of OC1=CC=CC(CN2C=CC3=C(Br)C=CC=C32)=C1 ?",
"input": "",
"output": "Sure. C15H12BrNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)NC(=O)NC12CC3CC(C)(CC(C)(C3)C1)C2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H28N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCNC(C1=CC=CN=C1)C1(OCC)CCCC1 ?",
"input": "",
"output": "Sure. C16H26N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(O)C=CC=CC1=COC2=CC=CC=C12 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H10O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=CC=C1C1=CSC(CC(N)=S)=N1 .",
"input": "",
"output": " C12H12N2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=C(C2=CC=NC(C3(CO)COC3)=N2)SC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H14N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC(C1=CC=C2CCCCC2=C1)N(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C14H21NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code N#CCNC1=NC=C(C2=CC(Cl)=CC=C2F)C=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H8ClFN4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C(CN1CCNCC1)CN1CCN2CCCC2C1 ?",
"input": "",
"output": " C14H28N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=CC(N2CCCCNCC2=O)=C1 ?",
"input": "",
"output": "Sure. C13H18N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C1CNCCCCN1C1=CC=CC(Br)=C1 ?",
"input": "",
"output": "The molecular formula is C12H15BrN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(CC(=O)O)N(C)C1=CC(Br)=CC=C1F , what would be its molecular formula?",
"input": "",
"output": "It is C11H13BrFNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=C(C(=O)O)C=C1OC1CCCNCC1 ?",
"input": "",
"output": " C14H19NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C1(C#N)C(C2=CC=C(OC)C=C2)C1(C)C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H19NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC(NC2=NC(NCCN3CCOCC3)=NC3=C2NC=N3)=CC(OC)=C1OC represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H27N7O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(C)C1=NC(Cl)=C2CNCCC2=N1 .",
"input": "",
"output": " C9H13ClN4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(C2CCOCC2)C(O)=C1 ?",
"input": "",
"output": " C12H16O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC(C)CCC1=CC=C(C2CCNCC2)C=C1 ?",
"input": "",
"output": "The molecular formula is C16H25NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=C(CC2=NN=C3C=C(CN)C=CN23)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H16N4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)N1C(CN(C)C)=CC2=CC=CC(F)=C21 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H19FN2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC(N2N=CC(OC3CCCC3)=C2C(=O)O)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H18N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(O)C1=CC2=NC(COC3=CC=CC=C3Cl)=CN2C=C1 ?",
"input": "",
"output": " C15H11ClN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC(S(C)(=O)=O)=CC(CC#N)=C1C into molecular formula.",
"input": "",
"output": " C11H13NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC(C(=O)CN)=C(OC)C=C1CF is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C11H14FNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC1=CC=C(C(C)C)C(C2CCNCC2)=C1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H25NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(O)C1(C2=CC3=C(C=C2F)OC=C3)CCCC1 ?",
"input": "",
"output": "Sure. C14H13FO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(C)CC1=CC=C(C2(C)CCCN2)C=C1Cl ?",
"input": "",
"output": " C14H21ClN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC=C2OCCCOC2=C1C1(C(=O)O)CC1 into molecular formula.",
"input": "",
"output": " C14H16O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=C(CC(C)(C)N)C=C(Br)C=C1C(C)(C)C .",
"input": "",
"output": " C15H24BrNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC(C(C)CC=O)=C(Br)C=C1OCC1CC1 ?",
"input": "",
"output": " C15H19BrO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN(CCO)C1CCCN(CC2CCCCC2)C1 ?",
"input": "",
"output": " C15H30N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC(CO)C(=O)NC1=CC=C(Cl)C=C1 into molecular formula.",
"input": "",
"output": " C11H14ClNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(NC1=CC=CC(F)=C1)ON1CCC2(CC1)CC(C1=CC=CC=C1)=NO2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H20FN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN(CCN)CC1=C(C2=CC=C(OC3=CC=CC=C3F)C=C2)NN=C1 ?",
"input": "",
"output": "Sure. C19H21FN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CSSC(CCC(N)C(=O)O)CNC(=O)OCC1=CC=CC=C1N=[N+]=[N-] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H21N5O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(N)C1=NC2=CC=CC(C(F)(F)F)=C2C(=O)N1C1=CC=CN=C1 ?",
"input": "",
"output": " C16H13F3N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN(CCCN(C)C(=O)C1=CC=C(NC2=NC(NC3(C4=CC=C(Cl)C=C4)CC3)=NC(OCC(F)(F)F)=N2)C=C1)C(=O)C(=O)NC1=CC(F)=CC(F)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C34H32ClF5N8O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=C(NC(C)C1=CC2=CC=CC(Cl)=C2C(=O)N1C1=CC=CC=C1)C1=CC=CC(C)=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C25H22ClN3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of [Cl-];[NH3+]CC(=CC1=CC=C(O)C(O)=C1)C(=O)O ?",
"input": "",
"output": " C10H12ClNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC1CN(S(C)(=O)=O)CC1NC1=C(C(N)=O)C=NN2C=C(C3=CN(C)N=C3)C=C12 ?",
"input": "",
"output": " C19H25N7O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC=C1CCC2C3CCC4CC(C)(O)CCC4(CO)C3CCC12C ?",
"input": "",
"output": "The molecular formula is C22H36O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)CCCCCCCCOC(=O)C(C)CCCCCCCCCCCO is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H46O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CCN1C(=O)N(C(C)C2=CC=C(C3=CC=C(F)C=C3)C=C2)CCC1C1=CC=C(F)C=C1 ?",
"input": "",
"output": " C27H26F2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=CC=CC=C(C)OC(F)(F)F .",
"input": "",
"output": " C8H9F3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1C=C(C2=CC(N)=CC=C2F)C2=CC=CC=C2C1=O;Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H14ClFN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC12CCC(C(CC(=O)NN)C1=O)C2(C)C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H20N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)NC1C(OCCOP(=O)(O)OCOCC(COCOP(=O)(O)OCCOC2OC(CO)C(O)C(O)C2C)(COCOP(=O)(O)OCCOC2OC(CO)C(O)C(O)C2C)COP(=O)(O)OCOCC(CO)COCOP(=O)(O)OC2CC(N3C=NC4=C(N)N=CN=C43)OC2COP(=O)(O)C(C)C)OC(CO)C(O)C1O . Can you tell me?",
"input": "",
"output": "Sure. It's C55H102N6O46P6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCS(=O)(=O)NC1=CC=C(C2=CC=C3C(=C2)N(C(=O)C2CC2)CC(C)N3C(C)=O)C=C1 ?",
"input": "",
"output": " C23H27N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CC(=O)NC1=CC(NC2=NC=C(Cl)C(NC3=CC=CC=C3P(C)(C)=O)=N2)=C(OC)C=C1OCCN1CCCCC1 ?",
"input": "",
"output": " C29H36ClN6O4P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1(C)CC(O)(C2=CN=CN2)CCC1OC(=O)C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C18H22N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(NC(=O)C(O)CC(N)=O)C1=CC=CC=C1 ?",
"input": "",
"output": " C12H16N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=NN(C)C(NC(=O)C2=CC=CC(C3CC3NCC3CC3)=C2)=C1 ?",
"input": "",
"output": " C19H24N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=CC=C1NC(=O)NC1=CC=CC(S(C)=O)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H16N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C1CC(C2=CSC=C2)(C2=CC=CC(NC3=CC=C(F)C=C3Cl)=N2)NC(=O)C1SC1=CC=CC=C1Cl ?",
"input": "",
"output": "Sure. C26H18Cl2FN3O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C1=CC=C(C2=CC=C(N(C3=CC=C(C4=CC=CC=C4)C=C3)C3=CC=C(N4C5=CC=CC=C5C5=CC(C6=CC=C(C7=CC=CC8=C7OC7=CC=CC=C78)C=C6)=CC=C54)C=C3)C=C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C60H40N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(O)C1=CC=C(N2C=NC(C3=CC=C4OCOC4=C3)=C2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H12N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C1=CC=C(N2C3=CC=CC=C3N(C3=CC=C(N4N=C5C=CC(N6C7=CC=CC=C7N(C7=CC=CC=C7)C7=CC=CC=C76)=CC5=N4)C=C3)C3=CC=CC=C32)C=C1 ?",
"input": "",
"output": "The molecular formula is C48H33N7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCN1CCN(CC2=CC=C(NC(=O)CC3=CC=C(F)C(C#CC4=CN=C(N(C)C(C)=O)N=C4C4=CC5=C(CCN(C(=O)OC(C)(C)C)C5=O)N4C)=C3)C=C2C(F)(F)F)CC1 ?",
"input": "",
"output": " C45H50F4N8O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCCCCCCCCCCCCCCCC(CCC)[N+](C)(C)OC1=CC=CC=C1C(=O)C1=CC=CC=C1;[I-] .",
"input": "",
"output": " C36H58INO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C=C(C(N)=O)C(C)C(C)CC ?",
"input": "",
"output": "Sure. C9H17NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=S(=O)(Cl)C1=CC=C(N2CCNS2(=O)=O)C=C1 ?",
"input": "",
"output": " C8H9ClN2O4S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation FC(F)(F)C1=CC=C(OC(CCCCN2CCCC2)C2=CC=CC=C2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H26F3NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C1=CC=C(N2C3=CC=C(C4=CC=C(C5=CC=CC6=C5OC5=CC=CC=C56)C=C4)C=C3C3=CC=C4C(=C32)C2=CC=CC=C2C42C3=CC=CC=C3C3=CC=CC=C32)C=C1 ?",
"input": "",
"output": " C55H33NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC(N(C)C(=O)N3CCOCC3)C2O)C(C)(OC)CC(C)C(=O)C(C)C(C(SCCN(CC2=C(Cl)C=NC=C2Cl)C2=CC=C(OC)C(OC3CCCC3)=C2)C(=O)O)C1C , what would be its molecular formula?",
"input": "",
"output": "It is C64H98Cl2N4O17S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC(C(F)(F)F)=CC=C1C(=O)C=C(C=CNS(=O)(=O)C1=CC=C(C)C=C1)N1C=CC=C1CO , what would be its molecular formula?",
"input": "",
"output": "It is C25H23F3N2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=CCC#CC(CC)OP(=O)(O)O ?",
"input": "",
"output": " C8H13O4P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(C(=O)N2CCC3(CC2)CC(C2=CC=CN=C2)C(=O)N3C)=NO1 ?",
"input": "",
"output": "The molecular formula is C19H22N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOCCCNC(=O)C1=CC=C(C2=CC(Cl)=CC=C2O)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C18H20ClNO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=[N+]([O-])C1=NC=C(CO)C(C(F)F)=C1I ?",
"input": "",
"output": "Sure. C7H5F2IN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(C)NC(=O)N1CCC2=C(C3=CC=CC(OC(F)(F)F)=C3)C=CC(C(=O)NCC3=NN=C4CCCN43)=C2C1 .",
"input": "",
"output": " C28H31F3N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCN1N=CC(C=NNC(=O)C2=CC(C(F)(F)F)=NN2C)=C1F ?",
"input": "",
"output": " C12H12F4N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=C(C)CN1CCC(NCC2=CC=C(F)C(C)=C2)CC1 .",
"input": "",
"output": " C17H25FN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC(=O)C1CCN(C(=O)C2CCC(C3=CC=CC=C3)CC2)CC1 ?",
"input": "",
"output": " C19H26N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CN=C(NCC1=CC=NC(C)=N1)NCC(O)C1=CC=C(Cl)S1 ?",
"input": "",
"output": " C14H18ClN5OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(O)C1=CC=CC(C(=O)NC2CCN(C(=O)C3=COC=C3)CC2)=N1 .",
"input": "",
"output": " C17H17N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COCC1=CC=C(C(=O)NC(CC(C)C)C(=O)O)O1 .",
"input": "",
"output": " C13H19NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(C1=CC=C(O)C=C1)N1CCN(C(=O)C2CC3CCCCC3N2)CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H27N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for NCC(=O)NCC1=CC=CC(NC(=O)C2CCCCC2)=C1 .",
"input": "",
"output": " C16H23N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)C1CCCCN1C(=O)C1CCCNC1;Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H27ClN2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCNC(=O)N1CCC2=CC=C(NC(=O)C3CCCCN3)C=C21 ?",
"input": "",
"output": " C17H24N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COCC1=CC=C(C(=O)N2CCC(C(=O)O)C2)O1 ?",
"input": "",
"output": " C12H15NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCC1=C(C(=O)N2CCCC(N)C2)NC(C)=C1C(C)=O ?",
"input": "",
"output": "The molecular formula is C16H25N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC(C)NS(=O)(=O)C1=CC=C(C(=O)NCCCNC)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H25N3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(N)C1CCCCN1C(=O)C1=CC=C2C(=O)N(C(C)C)S(=O)(=O)C2=C1 ?",
"input": "",
"output": " C18H25N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN(C(=O)CN1C(=O)COC2=CC(Br)=CC=C21)C1CCNC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H18BrN3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1OC2=CC=CC=C2N(CCC(=O)N(C)C2CCNC2)C1=O;Cl .",
"input": "",
"output": " C17H24ClN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=NC2=C(C(=O)NCCC3CCCNC3)C=NN2C=C1;Cl ?",
"input": "",
"output": " C15H22ClN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(CN)(NC(=O)CCCOC1=CC=C(F)C=C1F)C1CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H22F2N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)CC(CN)NC(=O)CS(=O)(=O)CC1=CC=C(Br)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H23BrN2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of Cl;NCC(NC(=O)C1=CC(Br)=C2OCCOC2=C1)C1CC1 ?",
"input": "",
"output": "The molecular formula is C14H18BrClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code Cl;Cl;O=C(C1CCCN1)N1CCCN(C2CCCC2)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H29Cl2N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " I;NC(=NCCOC1=NC=CC=C1F)N1CCN(C2=NC=CC=N2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H21FIN7O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCN(C1CCNCC1)S(=O)(=O)C1=CC=CC=C1C1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C20H26N2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCOC1=CC=C(CNC(=O)C(CC)(CC)CN)C=C1OC ?",
"input": "",
"output": " C18H30N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(C(=O)C1=CC=C2C(=C1)CCCN2S(C)(=O)=O)C1CC2CCC(C1)N2 .",
"input": "",
"output": " C19H27N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(NCC1CCCN(C(=O)C(F)(F)C2=CC=CC=C2)C1)C1CCCN1 ?",
"input": "",
"output": "The molecular formula is C19H25F2N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)SC1=CC=CC=C1NC(=O)CCC1CCNC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H24N2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1CNCCN1C(=O)C1=CC(N2CCCC2=O)=CC(C(F)(F)F)=C1 ?",
"input": "",
"output": " C17H20F3N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)C(N)C(=O)NCC(=O)N1CCN(C2=CC=CC(C(F)(F)F)=C2)CC1 ?",
"input": "",
"output": " C18H25F3N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CNCCN(C)C(=O)CCC1=CC=C(Cl)C(Cl)=C1 ?",
"input": "",
"output": "The molecular formula is C13H18Cl2N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1(C(=O)O)CCN(C(=O)C2=CC=CC(N3C=CC(C(F)(F)F)=N3)=C2)C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H16F3N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCS(=O)(=O)CC(=O)NC1CCCCCCC1C(=O)O ?",
"input": "",
"output": " C14H25NO5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC(CC)(CNC(=O)C1=CC(F)=CC(C)=C1[N+](=O)[O-])C(=O)O ?",
"input": "",
"output": " C15H19FN2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CNC1CCN(S(=O)(=O)C2=CC=CC(S(=O)(=O)NC3CC3)=C2)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C15H23N3O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=C(C(=O)N2CC3CCC(N)C3C2)C(=O)OC2=CC=CC=C12 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H20N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1=CC(C)=C(C(=O)NCC2CCOC2C2=CC=C(F)C=C2)O1 ?",
"input": "",
"output": "Sure. C19H22FNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC(Br)=CC=C1CC(=O)NC(CC(C)C)C(=O)O .",
"input": "",
"output": " C15H20BrNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(CC(=O)NCC(C(=O)O)C1=CC=CC=C1)CC1=CC=C(Cl)C=C1 ?",
"input": "",
"output": " C20H22ClNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(CCC1=NC(C2CCCC2)=NO1)NCC1(C(=O)O)CCCCC1 .",
"input": "",
"output": " C18H27N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCOC1=CC(C(=O)NCC2CCC3=CC=CC=C32)=CC=C1OCC(=O)O . Can you tell me?",
"input": "",
"output": "Sure. It's C21H23NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC(S(=O)(=O)N2C(C(=O)O)CC3CCCCC32)=CC=C1C#N ?",
"input": "",
"output": " C17H20N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1CC(NC(=O)C2=CC=C3OCCCOC3=C2)CCN1;Cl ?",
"input": "",
"output": "Sure. C16H23ClN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(CC)C(=O)NC1=CC(C(=O)O)=CC(OC)=C1OC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H21NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1CC(C(=O)NCC2=CSC=C2)CCN1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H18N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(N)C=C1C(=O)NCCC1CCOCC1 ?",
"input": "",
"output": " C15H22N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1CC(C(=O)N=C2C=CC=CN2CC2=CC=CC=C2)CCN1 ?",
"input": "",
"output": "The molecular formula is C19H23N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NC(C(=O)N1CCC(C2=NC=CS2)CC1)C1CCOCC1 ?",
"input": "",
"output": " C15H23N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of FC1=CC=CC=C1OC1=CC=C(CNC2CCCC2C2COCCN2)C=C1F ?",
"input": "",
"output": "Sure. C22H26F2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NCC1(C(=O)NC2=CC=C(OC(F)F)C(Cl)=C2)CCOCC1 ?",
"input": "",
"output": "Sure. C14H17ClF2N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule Cl;O=C(NCC1CNCC1O)C1=CSC2=CC=CC=C12 ?",
"input": "",
"output": " C14H17ClN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCOCC(=O)NCC1CNCC1O;Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H21ClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN(CC1=CC=C(OC)C(OC)=C1)C(=O)C(N)COC;Cl ?",
"input": "",
"output": " C15H25ClN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(C=CS(=O)(=O)N2CCC(N3N=NC4=C(SC=C4)C3=O)CC2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H20N4O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(Cl)C=C1NC(=O)C1=CNC(=O)N(CC2=CC=C3OCOC3=C2)C1=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H16ClN3O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(C2=NN(CCNC(=O)NC3=CC=C(OC)C(OC)=C3)C(=O)N2C)C=C1 .",
"input": "",
"output": " C21H25N5O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(C1=CC(Cl)=CC=C1Cl)N1CC2CC(C1)C1=CC=CC(=O)N1C2 ?",
"input": "",
"output": "The molecular formula is C18H16Cl2N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC2=C(OCOC2)C2=C1C(=O)OC2 .",
"input": "",
"output": " C11H10O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COCC(N)CC1=CC2=CC=CC=C2S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C12H15NOS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CSCN1NN=C2C(C3=NC(C4=CC=CS4)=CS3)=NCN2C1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H12N6OS3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(OCC1=CC=CC=C1)N1CC2(CC(NC(=O)C3(C4=CC=C5OC(F)(F)OC5=C4)CC3)C3=CC=C(F)C=C3O2)C1 .",
"input": "",
"output": " C30H25F3N2O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(N)C(=O)N1C=C(C2=CC=C(Cl)C(Cl)=C2)C2=CC(Cl)=CC=C21;CS(=O)(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H19Cl3N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=NC=C(CN2C(=O)NC3=CC=CC=C3C2=O)S1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C13H11N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C#CC1C(N2C=CC(=O)NC2=O)OC(CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O , what would be its molecular formula?",
"input": "",
"output": "It is C12H16FN2O14P3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C1=CC=C(C2=CC=C(N(C3=CC=C(C4=CC=CC5=C4OC4=CC=CC=C45)C=C3)C3=CC=CC4=C3C3(C5=CC=CC=C5C5=CC6=C(C=C53)OC3=CC=CC=C36)C3=CC=CC=C43)C=C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C61H37NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NC(=O)C1CCC(C(=O)N2CCCCC2)CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H22N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC(COC2=CC3=C(C=C2C)C(=O)N2CC4=CC=CC=C4CC2C=N3)=NC(COC2=CC3=C(C=C2OC)C(=O)N2CC4=CC=CC=C4CC2C=N3)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C44H39N5O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C(C#N)C(N2CCCC(C3=NNC(C)=C3)C2)=N1 into molecular formula.",
"input": "",
"output": " C16H19N5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(NC(=O)CC1=CC=CC([N+](=O)[O-])=C1)C(C1=CC=CC=C1Cl)N1C=CC=N1 into molecular formula.",
"input": "",
"output": " C20H19ClN4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by Cl;O=C(C=CC1=C(F)C=CC=C1F)N1CCNCC1 ?",
"input": "",
"output": " C13H15ClF2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN(CC(=O)OC(C)(C)C)C(=O)C1=CC=C(O)C(Cl)=C1 into molecular formula.",
"input": "",
"output": " C14H18ClNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(CO)NC(=O)NC1=NC(C)=CC(N(C)C)=N1 ?",
"input": "",
"output": "The molecular formula is C12H21N5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)N1C=C2CCC(NC(=O)C3CCCC3CN)CC2=N1;Cl ?",
"input": "",
"output": " C17H29ClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(O)C1CCCN(CC2=CC(Br)=CC=C2OC(F)F)C1 .",
"input": "",
"output": " C14H16BrF2NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C=CCCC(NC(=O)C1=CC(Br)=C2OCOC2=C1)C(=O)O ?",
"input": "",
"output": "Sure. C14H14BrNO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=C(Cl)C=CC=C1NC(=O)CN1CCCC1C(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H17ClN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(C(=O)NCCC(=O)O)C(OCC(C)C)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H21NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(=O)C1=CC=C(OCCCC(=O)N2CCC(CN)CC2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H26N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC(=O)C1=C(C)OC(CNCCC(C)(C)C(=O)O)=C1 ?",
"input": "",
"output": " C14H21NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(CC)(CNCC1=CC=CN=C1C)C(=O)O .",
"input": "",
"output": " C14H22N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC=CC(C2SCC(=O)N2N2C(C3=CC=CC=C3)=NC3=CC=CC=C3C2=O)=C1 ?",
"input": "",
"output": " C24H19N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=C(C)N(C2=CC=C(OC3=CC=C(NC(=O)C4=CC=C(OC5=CC=CC=C5)C=C4)C=C3)N=N2)C=N1 ?",
"input": "",
"output": "The molecular formula is C28H23N5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCNC1=NC(C)=CC(NCCNC(=O)C2=CC=C(F)C(F)=C2)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C16H19F2N5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC(=O)C1(C)N=C(C(Cl)(Cl)Cl)OC1C=CCOCOCC1=CC=CC=C1 ?",
"input": "",
"output": " C18H20Cl3NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(OC(C)=O)OC(=O)C1=CC=C(OC)C=C1 ?",
"input": "",
"output": "Sure. C13H16O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1C(C)N2N=CC(N3CCCC3=O)=C2CN1CC1=CC=CC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H24N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=CC(C(C)NCC2=CC(C3=CC=C(OC)C(C(=O)O)=C3)=C3C=CC=CC3=C2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C28H27NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of NCCOCCOCCNC(=O)C1=CC=C(CN2C(C3=CC=C(C(F)(F)F)C=C3)=NC(C3=CC=C(F)C=C3)=C2C2=CC=C(F)C=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C36H33F5N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN1CCC(OC(=O)C(O)(C2=CC=CC=C2)C2=CC=CC(OCCCCCNCC(O)C3=CC=C(O)C4=C3C=CC(=O)N4)=C2)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C35H41N3O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC(=O)N(CC1=CC(N)CC(C(F)(F)F)=C1)CC1=CC(C(F)(F)F)=CC=C1C1=CC(C(C)C)=CC=C1OC into molecular formula.",
"input": "",
"output": " C28H30F6N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CS(=O)(=O)N1C(=O)C=C(C2=CC=C(OC(F)F)C=C2)CC1(C1=CC=C(OCCCCCC(F)(F)F)C=C1)C(F)(F)F ?",
"input": "",
"output": " C26H25F8NO5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CC(O)=C(C)C=CC .",
"input": "",
"output": " C8H12O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1OC(C(C)C)C(C)C(C)C1C ?",
"input": "",
"output": "Sure. C13H26O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation Cl;[N-]=[N+]=NC1=CC=C(COC(=O)NC(CCCCN)C(=O)O)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H20ClN5O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC1=C(C(=O)NC2=CC=C(OC3=CC=NC4=CC(OC)=C(OC)C=C34)C=N2)N(C2=CC=C(C(F)(F)F)C=C2C)N=C1 ?",
"input": "",
"output": "Sure. C30H26F3N5O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)CC(C)OP(=S)(OC(C)CC(C)C)SCC(C)OP(=S)(OC(C)CSP(=S)(OC(C)CC(C)C)OC(C)CC(C)C)SCC(C)O ?",
"input": "",
"output": " C33H71O7P3S6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C2CC3N(CC4CC4)CCC4(CC(O)C(C)CC34O)C2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H31NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN1C(C2=CC=C(C3=CC=C(C(F)(F)F)C(S(N)(=O)=O)=C3C3=NNN=N3)C=C2)=CN=C1N ?",
"input": "",
"output": "The molecular formula is C18H15F3N8O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCOC(C)(C)C#CCO ?",
"input": "",
"output": " C10H18O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=C(NC1=CN(CC(=O)N2CC3CN(CCCO)CC3C2)N=C1C1=CC(Cl)=CC=C1OC(F)F)C1=C2N=CC=CN2N=C1 ?",
"input": "",
"output": " C28H29ClF2N8O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN1CCC(N=O)C2=C1OC(C1=CN=C(C3=CC=CN=C3)S1)=N2 into molecular formula.",
"input": "",
"output": " C15H13N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=C(C(=N)C2=CN=C3NC=C(C(=O)NC4(C#N)CC4)C3=N2)C(N)=C1 .",
"input": "",
"output": " C19H17N7O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC(=O)NC(C(=O)N1CCCC1C1=NC=C(C2=CC=C3OC(C4=CC=C(C5=CN=C(C6CCCN6C(=O)C(C)NC(=O)OC(C)(C)C)N5)C=C4)=NC3=C2)N1)C(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C42H51N9O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1(C)CC(=O)C2C(=NC3=NNC(C(F)(F)F)=C3C2C2=CC(F)=CC=C2C(F)(F)F)C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C20H16F7N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CNC(C)C(=O)NC(C(C)C)C(O)N1C2=NC=CC=C2CC1C(=O)NC1=CC=CC=C1C1=CC=CC=C1 ?",
"input": "",
"output": " C29H35N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)OC(=O)NC(CC1=CC=C(F)C=C1)C(=O)NCC1=CC=CC2=CC=CC=C12 ?",
"input": "",
"output": " C25H27FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC1(C)C2=C3C(=CC=C2)OC(=O)C2=C3[N+](=CC=C2)C1(CC)CC ?",
"input": "",
"output": " C21H24NO2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(C)C1=CC=C(C2=CC=CC(C3=CC=C(C(C)(C)C)C=C3)=C2C2=CC=C3C4=CC=C(C5=C(C6=CC=C(C(C)(C)C)C=C6)C=CC=C5C5=CC=C(C(C)(C)C)C=C5)C=C4C4=CC=CC=C4C3=C2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C70H68 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(Cl)OCC1=CC=CC=C1;O=C(O)C1CC2CCCC2C1;O=C(O)C1CC2CCCC2N1C(=O)OCC1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C33H40ClNO8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN1C=C(N2C(CCN)=NC3=CC=C(F)C=C32)C=N1 into molecular formula.",
"input": "",
"output": " C13H14FN5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for [C-]#[N+]C1=CC2(C)C(CCC3(C)C2CC(=O)C2C4CC(C)(C)CCC4(C(=O)O)CCC23C)C(C)(C)C1=O .",
"input": "",
"output": " C31H43NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCN(C(=O)C1=CC=C(C2=NC3=CC=CC=C3O2)C=C1)C1CCC(NC(=O)C2CCCO2)C1 ?",
"input": "",
"output": "Sure. C26H29N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=C(C2SC2C)C2=C1N(C1=NC(C3=CC=CC=C3)=NC3=CC=CC=C13)C1=CC=CC=C21 ?",
"input": "",
"output": " C30H23N3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(NC1=NC(NC(C(F)(F)F)C(F)(F)F)=NC(C2=CC=CC(Cl)=N2)=N1)C(F)(F)F . Can you tell me?",
"input": "",
"output": "Sure. It's C14H10ClF9N6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C1=C2C(CCC1)CCCC2NC1=CC=CC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H21N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(C2=C(C3=CC=C(C#CC4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)C=C3)C(=O)C(C3=CC=C(C#CC4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)C=C3)=C2C2=CC=C(C(C3=CC=C(F)C=C3)(C3=CC=C(C4=C(C5=CC=C(C#CC6=CC(C)=CC(C(F)(F)F)=C6)C=C5)C(=O)C(C5=CC=C(C#CC6=CC(C(F)(F)F)=CC(C(F)(F)F)=C6)C=C5)=C4C4=CC=C(C(F)(F)F)C=C4)C=C3)C(F)(F)F)C=C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C108H54F28O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCC(CCCCC)CCOC(=O)CCCCCCCCC(CCCCCCCCC(=O)OCCC(CCCCC)CCCCC)OCCCN into molecular formula.",
"input": "",
"output": " C48H95NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC(C)CC(C)(C)C(C)(C)C1CC1C ?",
"input": "",
"output": " C15H30 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C1=CC=C(C2=CC(C3=CC=CC(N4C5=CC=CC=C5C5=C(C6=CC=CC=C64)N(C4=CC=CC=C4)C4=C(C6=CC=CC=C6)C=CC=C54)=C3)=CC(C3=CC=CC=C3)=N2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C55H37N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCOC1=NN=C(C(=O)O)C=C1OC .",
"input": "",
"output": " C10H14N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(F)(F)N1N=CC2=CN=C(C(=O)NC3COC4=CC=CC=C4N(C)C3=O)C=C21 ?",
"input": "",
"output": "Sure. C20H19F2N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=S1(=O)C2=CC=C(C3=COC=C3)C=C2C2CN(CC3=CC=CN=C3)CC21 ?",
"input": "",
"output": "The molecular formula is C20H18N2O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=C(NC2=CC(C3CC3)=NC(NC(C)(C)C)=N2)C=CC=C1[N+](=O)[O-] ?",
"input": "",
"output": " C18H23N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COCC1=CC=C(C(=O)NC2=CN=C3CCCCC3=N2)C=C1 ?",
"input": "",
"output": "Sure. C17H19N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(S(=O)(=O)N(CC(=O)NCC2=CC=C3OCOC3=C2)C2=CC=C(C(C)C)C=C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C26H28N2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)NC(C)C(O)COC1=CC=C(CC(N)=O)C=C1 ?",
"input": "",
"output": " C15H24N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of N#CC(=CC1=CC=C(OCC2=CC=C([N+](=O)[O-])C=C2)C=C1)C1=CC=C2C=CC=CC2=C1 ?",
"input": "",
"output": "Sure. C26H18N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN(CCC(O)C1=CC=CC=C1)CC(F)(F)F .",
"input": "",
"output": " C12H16F3NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=[N+]([O-])C1=CC=C(Cl)C2=C1C1C=CCC1C(C1=CC=C(Cl)C=C1)N2 ?",
"input": "",
"output": " C18H14Cl2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC(C=NC2=CC=CC(C(C)=O)=C2)=CC=C1OCC1=CC=CC(C(=O)O)=C1 ?",
"input": "",
"output": "The molecular formula is C24H21NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1C(=O)CCC(N)C1C1=CC=NN1C , what would be its molecular formula?",
"input": "",
"output": "It is C10H16N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)C1=CC=C(N2CCCC2CC(O)C2=CC=C(F)C=C2)N=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H21FN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC(C)NC(=O)CN1CCN(CC(O)C(C)(C)C)CC1 ?",
"input": "",
"output": " C16H33N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC(=O)C1CC2(C)C(CCC2(OC(C)=O)C(=O)COC(C)=O)C2CCC3=CC(=O)C=CC3(C)C12F . Can you tell me?",
"input": "",
"output": "Sure. It's C27H33FO8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN(C)C1=CC(C2CCCN2C(=O)C2=CN=CS2)=CC=N1 ?",
"input": "",
"output": "Sure. C15H18N4OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CNC1=NC(C2CCOC2)=CC(N(C)CCC2=C(C)N=CS2)=N1 ?",
"input": "",
"output": "The molecular formula is C16H23N5OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC(Cl)=C2NC(=O)C3(NC(C(C)C)C4C(=O)N(CCC5=CC=CC=C5)C(=O)C43)C2=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C25H26ClN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CN(C(C)CNC(=O)C2(CO)CC2)N=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H19N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C1NCCN(C(=O)NCC2(CN3C=CC=N3)CC2)C1C1=CC=C(F)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H22FN5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN(C)C(C)CCNC(=O)N(C)CC1=C(C2=CC=C(F)C=C2)NN=C1 ?",
"input": "",
"output": " C19H28FN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCOC(=O)C1=CC=CC=C1N1CCNCC1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H20N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=O)NC1=CC=CC(NC(=O)COC2=CC=C(S(=O)(=O)N3CCC4=CC=CC=C43)C=C2Cl)=C1 into molecular formula.",
"input": "",
"output": " C24H22ClN3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)COC1=CC=C(C(=O)NCC2=CC=C(C3=NC4=CC=CC=C4O3)C=C2)C=C1 .",
"input": "",
"output": " C25H24N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC(C)C1=CC=CC=C1OC(=O)C1CC(=O)N(C2=CC=CC=C2C)C1 ?",
"input": "",
"output": " C22H25NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(CCNC(=O)C2=CC=C(OC)C(S(=O)(=O)NC3CCCCC3)=C2)C=C1 ?",
"input": "",
"output": "Sure. C23H30N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(NS(=O)(=O)C2=CC=C(NC(=O)CCCN(C3=CC=CC=C3)S(C)(=O)=O)C=C2)C(OC)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C25H29N3O7S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(NC1=CC=C(S(=O)(=O)NC2=CC=C(Br)C=C2)C=C1)C1=CC=C(C2SCC(=O)N2CC2=CC=C(Cl)C=C2)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C29H23BrClN3O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=C(C=NNC(=O)CSCC2=CC=CC=C2Cl)C=C1[N+](=O)[O-] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H16ClN3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(NN=CC1=CC(Br)=C(OCC2=CC=CC3=CC=CC=C23)C(Br)=C1)C1=CC=C(Cl)C(Cl)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C25H16Br2Cl2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(C=C2C(=O)NC(=O)N(C3=CC=C(F)C=C3)C2=O)C=C1Br ?",
"input": "",
"output": "Sure. C18H12BrFN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)=CC(Br)=C1OCC1=CC=CC2=CC=CC=C12 ?",
"input": "",
"output": "The molecular formula is C31H27BrO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC(=O)C1=CC=C(COC2=C(Br)C=C(Cl)C=C2C=NNC(O)COC2=CC=C(C3NC(=O)NC(C)=C3C(=O)OC)C=C2OCC)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C34H36BrClN4O9 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC(C=NNC(=O)C2CCN(C(=O)C3=CC=C(Cl)C=C3Cl)CC2)=CC=C1OCC1=CC=CC=C1 ?",
"input": "",
"output": " C28H27Cl2N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC(C=NC2=CC=C([N+](=O)[O-])C=C2)=CC(Br)=C1OCC(=O)NC1=CC=CC=C1 ?",
"input": "",
"output": "Sure. C22H18BrN3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)(C)C1CCC2=C(C1)SC(N=CC1=CC=C(OCC3=CC=CC=C3C#N)C=C1)=C2C(=O)NCC1=CC=CO1 , what would be its molecular formula?",
"input": "",
"output": "It is C33H33N3O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=C([N+](=O)[O-])C=C1NC(=O)CN(C1=CC=CC([N+](=O)[O-])=C1)S(=O)(=O)C1=CC=CC=C1 ?",
"input": "",
"output": " C21H18N4O8S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(OC)C(N(CC(=O)NN=CC2=C(C)N(C3=CC=C(Br)C=C3)C(C)=C2)S(=O)(=O)C2=CC=C(OC)C(OC)=C2)=C1 ?",
"input": "",
"output": "The molecular formula is C31H33BrN4O7S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCOC1=CC=C(C(=O)NN=CC2=CC=CC(OCC3=CC=CC=C3Cl)=C2)C=C1OC .",
"input": "",
"output": " C25H25ClN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC1=CC(C=NN2C(C3CCCCC3)=NC3=CC=C(Br)C=C3C2=O)=C(Br)C=C1OCC1=CC=C(Cl)C(Cl)=C1 .",
"input": "",
"output": " C30H27Br2Cl2N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC1=CC(C=C2C(=O)NC(=S)N(C3=CC=C(CC)C=C3)C2=O)=CC(Br)=C1OCC1=CC=CC([N+](=O)[O-])=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C28H24BrN3O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCN(CC)CCNC(=O)CC1=C(C)N2N=C(C)C(C3=CC=CC=C3)=C2N=C1C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C23H31N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=CCNC(=O)C1=C(C2=CC=CC=C2)N=C2C=C(C)C=CN12 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H17N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN1C=C2C=C(NC(=O)C3=CC=NC(N4CCC(O)C4)=N3)C(N3CCCCC3)=CC2=N1 ?",
"input": "",
"output": " C22H27N7O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C#CCOC1=CN=C(C(=O)NC2=CC(F)=C(F)C(C3(C)N=C(N)SC4C(C)C43)=C2)C=N1 ?",
"input": "",
"output": " C21H19F2N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)CC1COC(CC2=CC=CC=C2)C(=O)N(C)C(CC(C)C)C(=O)OC(C)C(=O)N(C)C(CC(C)C)C(=O)OC(CC2=CC=C(OCC3=NN=NN3C)C=C2)C(=O)N(C)C(CC(C)C)C(=O)OC(C)C(=O)N1C ?",
"input": "",
"output": " C55H82N8O12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CN=C2C(C)=CC=CC2=C1OC(F)F . Can you tell me?",
"input": "",
"output": "Sure. It's C12H11F2NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C1CSC2=NC=C(CNCC3CCN(CCN4C(=O)C=NC5=CC=C(F)C=C54)C3)N=C2N1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H24FN7O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC=C(O)C(O)C(N)=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C5H9NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(=O)C=CCOC1=CC(Cl)=CN=C1I ?",
"input": "",
"output": "Sure. C10H9ClINO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=NC(OCC(F)(C(F)(F)F)C(F)(F)F)=C(F)C=C1CNC(=O)C1CCCN1 ?",
"input": "",
"output": " C16H17F8N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code N#CC1=CC=C(N2CCC3=C(C2)N=CN=C3NC2=CC=C(N(CC(F)(F)F)C(=O)O)C=N2)C=C1C(F)(F)F , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C23H17F6N7O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule OCCN1CCCC1C1=CC=CC(F)=C1 .",
"input": "",
"output": " C12H16FNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)N1CCC(NC2=NN=C(C3=CC=CC(N(C)C)=C3)O2)CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H23N5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN1C=CN2C(CN3CCCC3C3=NC4=CC=CC=C4C(=O)N3C)=NN=C2C1=O ?",
"input": "",
"output": "Sure. C20H21N7O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1(C)CN(CC2=CC=CC(Cl)=N2)C1 .",
"input": "",
"output": " C11H15ClN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CC1OCCCC1NC(=O)C1=NN(C)C(C)=C1Cl .",
"input": "",
"output": " C13H18ClN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1=NC=C(C(=O)NC2CCCN(C3=NC=CN(C)C3=O)C2)S1 ?",
"input": "",
"output": " C16H21N5O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC1=NC=NC(Cl)=C1OCCCNC(=O)O into molecular formula.",
"input": "",
"output": " C8H11ClN4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1COC(=O)CCCCCCCC(=O)O1 ?",
"input": "",
"output": " C12H20O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCOOC1=CC=C(F)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H13FO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=CC(=O)NC1COC(C2CCCC2)C1NC1=NC=C2C=C(C3=CC(OC)=CC(OC)=C3)C(=O)N(C)C2=N1 into molecular formula.",
"input": "",
"output": " C28H33N5O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=C(CS(=O)(=O)C1=CC=C(C)C=C1)C(=O)O;C=C(CS(=O)(=O)C1=CC=C(C)C=C1)C(=O)O;OCCOCCOCCO , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C28H38O12S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1(OCC2=CC=CC=C2Cl)C=CC(NC2=C(C#N)C=NC3=CC(OC4CCOC4)=C(NC(=O)C=C4CCNCC4)C=C23)=CC1F ?",
"input": "",
"output": " C35H35ClFN5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCCCCCC(CCCCCCCCOO)S(=O)O .",
"input": "",
"output": " C17H36O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1OC(OC)CC(O)C1OC ?",
"input": "",
"output": "Sure. C9H18O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(C=CC(C)N)=C1CC(CC)=C(C)N1 ?",
"input": "",
"output": "The molecular formula is C14H24N2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=NC(CN(N)C2=C(C(=S)NC3=CC=CC=C3)C(=O)CN(C(=O)OC(C)(C)C)C2)C=CN1 . Can you tell me?",
"input": "",
"output": "Sure. It's C23H30N6O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1(C)CC2(CC3CCC2C(OC(=O)CCl)C3)C(=O)O1 ?",
"input": "",
"output": " C15H21ClO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1CCCC1C1COCCN1CC1=NC=NN1C(C)(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C17H30N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(NC(=O)C1CCCS1)C(C)(F)F ?",
"input": "",
"output": "Sure. C9H15F2NOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=O)N1CCC(OC(CO)C2=CC=CC=C2)CC1 ?",
"input": "",
"output": " C15H21NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CNCC1CC2=CC=CC(C3=CC=CC(Cl)=C3)=C2O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C16H16ClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)CC1OCCC(C)(C)O1 .",
"input": "",
"output": " C10H20O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(C1=CC=CC=C1SC(F)F)N1CCCC(OC2=CC=NC=C2Cl)C1 into molecular formula.",
"input": "",
"output": " C18H17ClF2N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)NC(=O)C1=CN2CCN(C(=O)C3=CN(C)C=N3)C(C)C2=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H22N6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)CC(=O)NCC1CCCC2=NC3=C(CN(C(=O)C4=CC=CS4)CC3)C(=O)N21 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H28N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC(C)=NC(OC2CCCN(C(=O)C3=CC=C(C(F)(F)F)N=C3)C2)=N1 ?",
"input": "",
"output": " C18H19F3N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=[N+]([O-])C1=C(F)C=CC=C1SC(F)(F)F .",
"input": "",
"output": " C7H3F4NO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN(C)CCN1CC(C(=O)NCC2=CC=C(C3=NOC=N3)C=C2)CC1=O into molecular formula.",
"input": "",
"output": " C18H23N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=C(N)C=CC=C1OC1=C([N+](=O)[O-])C=C([N+](=O)[O-])C=C1[N+](=O)[O-] .",
"input": "",
"output": " C13H10N4O8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation N=NN;O=C1C=CC(=O)N1;O=C1C=CC(=O)N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C8H9N5O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1(C)CCCC2(C)C1CCC13CC(CCC12)C(C)(O)C3 ?",
"input": "",
"output": "Sure. C20H34O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O;O;O;O;O;O;[Ru] , what would be its molecular formula?",
"input": "",
"output": "It is H12O6Ru .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O=C(C(Cl)=CCl)C(Cl)(Cl)Cl , what would be its molecular formula?",
"input": "",
"output": "It is C4HCl5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCC1=CC(C(=O)O)=C(SCC)O1 .",
"input": "",
"output": " C10H14O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(CCN1C=C(C=C([Si](C)(C)C)[Si](C)(C)C)N=N1)N1C=C(C=C([Si](C)(C)C)[Si](C)(C)C)N=N1 .",
"input": "",
"output": " C24H48N6Si4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1(C)C=C2C3=C(C1)N=C1C=CC=CC1=C3C(=O)N2C1=CC=C(N2C(=O)C3=C4C2=CC(C)(C)CC4=NC2=CC=CC=C32)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C38H30N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C1CC2CCCCC(C2)N1 .",
"input": "",
"output": " C9H15NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC(=O)C1CON=C1C=O . Can you tell me?",
"input": "",
"output": "Sure. It's C6H7NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of FC(F)C1=C(CCl)N=CC(I)=C1Cl ?",
"input": "",
"output": "Sure. C7H4Cl2F2IN ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NC1=CC(C(F)F)=CNC1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C6H6F2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC(C(=O)O)C1=CC(O)=CC=C1Br ?",
"input": "",
"output": "Sure. C10H11BrO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN1C(=O)C2=CC(NC(=O)C3CCCC3NC(=O)C3=CC=C(C#N)C(F)=C3)=CC=C2N(CC)C1=O .",
"input": "",
"output": " C26H26FN5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C1=CNC(SC2=NC=NC3=C2OC=C3)=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C9H6N4OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC(=O)C1=CC=C2NC(C)=C(C3=CC=CC(S(=O)(=O)N(C)CC4=CC=C(OC)C=C4)=C3)C2=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C27H28N2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CNC(=O)C(CCC=O)N1CC2=C(OCC3=CC=C(CN4CCN(C(C)=O)CC4)C=C3)C=CC=C2C1=O .",
"input": "",
"output": " C28H34N4O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(NC(=O)C1=CC=CC(C(C2=CC=CC=C2)N(C(=N)N)C(=O)CC(C)C(C)C)=C1)C1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C30H36N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1CN(CC2=CC=CN=C2)CC1NC(=O)C1=NOC(C2CC2)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C18H22N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C=C(N)C(C)N1CC2=C(C=CN=C2C(=O)OC2=CC=CC=C2)C1=O)=C(N)OCC(F)(F)F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C23H23F3N4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN1CC(COC2=CC3=C(C=C(C(=O)NC4(C5=CC=C(C(=O)O)C=C5)CCOC4)N3C)C(Cl)=C2Cl)OC1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C26H25Cl2N3O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule ClCC1=CN=C(N2CCC2)N=C1 .",
"input": "",
"output": " C8H10ClN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN(C)C(=O)OC1=CC(N)=CC=C1Cl is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C9H11ClN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C#CC(C)N(C)CC1=NN=C(C)O1 ?",
"input": "",
"output": " C9H13N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(O)C12C=CC(CC1O)C2 ?",
"input": "",
"output": " C8H10O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=NC(C(F)CC(C)(C)N)=CS1 ?",
"input": "",
"output": "The molecular formula is C9H15FN2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1CSCC1N1C=NC(CBr)=C1 ?",
"input": "",
"output": "Sure. C9H13BrN2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=C(C2CN(C)CC2CI)SC=C1 ?",
"input": "",
"output": " C11H16INS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NCC1=CC(N)=CC(C(F)(F)F)=C1F ?",
"input": "",
"output": " C8H8F4N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC .",
"input": "",
"output": " C84H164O17P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(NC1=CC=C2CCNCCC2=C1)C1=CC=C(C2=CNN=C2)C=C1OCC1=CC=CC=C1 .",
"input": "",
"output": " C27H26N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C57H110O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C48H92O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCC(C)=C(C(C)=NC)C1=CC2=C(C=C1OC)C1=C(C3=CC(CC)=NC4=CC=CC=C34)N=C(C)N=C1N2 into molecular formula.",
"input": "",
"output": " C32H35N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C([N+]2=CC=C(C3=CC=[N+](C)C=C3)C(C)=C2)C=C1 ?",
"input": "",
"output": "Sure. C19H20N2+2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NC(=O)C1=NN2CCC3(CCOCC3)C2=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H14N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=C(C)OCC1=CC=C(NC(=O)C(CCC(=O)O)NC(=O)C(NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C30H40N4O8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCCCC=CCC=CCC=CCC , what would be its molecular formula?",
"input": "",
"output": "It is C51H84O15 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCS(=O)(=O)N1CCCC(C2=NN=C3CN(C(=O)CC4=CC=C(OC)C=C4)CCN32)C1 into molecular formula.",
"input": "",
"output": " C21H29N5O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(C(=O)N2CCC(CCN3C(C)=CN=C3C3CCC3)CC2)C(OC)=N1 .",
"input": "",
"output": " C23H32N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COCCC1(C2=NOC(C3=CC=C(F)C=C3)=N2)CCCN(C(=O)C2=CN(C)N=C2C)C1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H26FN5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC(N)=CC=C1N1C(=O)C2C3C4=CC5=CC=CC=C5C=C4C(C4=CC5=CC=CC=C5C=C43)C2C1=O .",
"input": "",
"output": " C33H24N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)[Si](C#CC1=CC=C(C#CC2=CC=C(N)C=C2)C=C1)(C(C)C)C(C)C ?",
"input": "",
"output": " C25H31NSi ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC(C(=O)NC(C)(C)C)N(CCC1=CC=CC=C1)C(=O)CN(C1=CC=C(F)C=C1)S(=O)(=O)C1=CC=C(OC)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C31H38FN3O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1CCCN(CC2=CC=C(C(=O)N(C)CC3=NC(C4=CC=CC=C4)=NO3)C=C2)C1 .",
"input": "",
"output": " C24H28N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC(C(=O)NC)N(CC1=CC=C(Cl)C(Cl)=C1)C(=O)CN(C1=CC=C(C(C)(C)C)C=C1)S(C)(=O)=O ?",
"input": "",
"output": " C25H33Cl2N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(C(=O)NC(C)(C)C)N(CC1=CC=C(F)C=C1)C(=O)CCC1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C24H31FN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(C(=O)NCC(C)C)N(CC1=CC=CC(OC)=C1)C(=O)CSCC1=C(Cl)C=CC=C1Cl .",
"input": "",
"output": " C25H32Cl2N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCNC(=O)C(CC)N(CC1=CC=C(C)C=C1)C(=O)CN(C1=CC=C(Cl)C=C1)S(=O)(=O)C1=CC=C(C)C=C1 ?",
"input": "",
"output": " C31H38ClN3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=CC1=NC=C(C2=CC(Cl)=CC=C2Cl)C=C1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H7Cl2NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC1=CC=C(C(C)NC(=O)C2=CC(S(=O)(=O)N3CCOCC3)=CC=C2C)C=C1 .",
"input": "",
"output": " C22H28N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=CC=CC=C1CSCC(=O)NC(C)C1=CC=C2OCCOC2=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H23NO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1=CC=C(S(=O)(=O)N2CC(C(=O)NCC3CCCCC3)OC3=CC=C(Cl)C=C32)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C23H27ClN2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCN1CCN(C2CCN(C3=CC(C)=NC(C4=CC=CN=C4)=N3)C2)CC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H28N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of O=[N+]([O-])C1=CC(S(=O)(=O)C(F)F)=CC=C1NCC1=CC(F)=CC=C1Br ?",
"input": "",
"output": " C14H10BrF3N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=C(C)CN(C)C1=CC(CC)=NC2=NC=NN12 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C12H17N5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=NC(NCC(=O)NCC2CC2)=CC=C1Br ?",
"input": "",
"output": "Sure. C12H16BrN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1CN(C2=CN=CC(SCC3=CC=CC=C3)=N2)CCC1C . Can you tell me?",
"input": "",
"output": "Sure. It's C18H23N3OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)CC(C)(CN)NC(=O)C1NNC(C2=CC=CC=C2)C1Br .",
"input": "",
"output": " C17H27BrN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCOC1=CC=C(C2C3C(NNC3C3=CC=CC=C3O)C(=O)N2CC2=CC=CN=C2)C=C1 .",
"input": "",
"output": " C26H28N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1=NN2C(=N)C(=CC3=CC(Cl)=C(OCCOC4=CC=CC(OC)=C4)C(Cl)=C3)C(=O)N=C2S1 ?",
"input": "",
"output": " C23H20Cl2N4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)N(C)CCCCNC(=O)NC1=CC(C(F)(F)F)=CC=C1N(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C18H29F3N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1CC(OC)C(N=[N+]=[N-])C(C)O1 ?",
"input": "",
"output": " C8H15N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation OB(O)C1=CC2=C(C=C1Cl)C(Cl)=CS2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C8H5BCl2O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(COCC1=CC=CC=C1)NNC(=O)C1=CC(C2=CC=CO2)=NC2=CC=CC=C12 ?",
"input": "",
"output": "Sure. C23H19N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)N=C1C=CC=CN1C(=O)C1COC2=CC=CC=C2C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C18H20N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCNC(=O)C1CCN(CC(=O)NC(=O)NCC(C)C)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C16H30N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C1CCCCCN1CCCNC(=O)C1(C2=CC=CC(Cl)=C2)CC1 .",
"input": "",
"output": " C19H25ClN2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN(C)C(=O)C1=CC=C(CN2C(=O)NC(C)(C3=CC=C(Cl)C=C3Cl)C2=O)C=C1 ?",
"input": "",
"output": "Sure. C20H19Cl2N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(CN1C=NC2=CC=C(Br)C=C2C1=O)NC(=O)NCCC1=CC=CS1 ?",
"input": "",
"output": " C17H15BrN4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(NC(=O)C1=C(S(=O)(=O)N2CCCCC2)C=CS1)C1=CC=CC(C(F)(F)F)=C1 ?",
"input": "",
"output": "The molecular formula is C19H21F3N2O3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(NCCC(=O)N1CCCC(C2=NN=C3C=CC(C(F)(F)F)=CN23)C1)C1=CC=CS1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H20F3N5O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(CCNCC2=CC=C(N3C=CN=C3)C=C2)C=C1OC .",
"input": "",
"output": " C20H23N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C(NC1CC(CC2CCCCC2)NN1)C1=CC=CC(CS(=O)(=O)C2=CC=CC=C2)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H31N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCN(C(=O)C1=CC=CC(Cl)=C1)C1CCCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C14H18ClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C(C(=O)N2CCCC3(COCCN(C4=NC=CC=N4)C3)C2)C=NO1 .",
"input": "",
"output": " C18H23N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=NN=C(C2=CC=CC=C2)C(CC(=O)O)CO1 ?",
"input": "",
"output": " C13H14N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(=O)C1=C(O)C(C)=C(O)C2=C1OC1=CC(O)=C(C(N)=O)C(=O)C12C ?",
"input": "",
"output": "Sure. C17H15NO7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=S(=O)([O-])CC(F)CCCCCCF;[Li+] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C8H15F2LiO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)(C)C1=CC=C2CCC3=CC=CC=C3OC2=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H20O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C1=CC(C2=NC(N3CCNCC3)=C3C(C4CC4)=CN=CC3=N2)=CC(NC2=CC3=CC=C2O3)=N1 ?",
"input": "",
"output": "Sure. C25H23N7O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCN1N=CC2=C(F)C=C(C3=CC=C(C4(C)C(=O)NCCC45CC=CC(N4N=CC6=C(F)C=C(C7=CC=C(C8(C)CCCNC8=O)C(=O)N7)C=C64)C5)C(=O)N3)C=C21 . Can you tell me?",
"input": "",
"output": "Sure. It's C43H42F2N8O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=C1C2CCC(O)C23CCC(C3)C1(C)C ?",
"input": "",
"output": "The molecular formula is C14H22O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCN(CC12CCC(C(=CC(=N)C3=C(F)C=CC=C3F)C1=N)C2(C)C)C(=O)C1=NC(C)=CO1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C25H28F2N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNCC1=CC(F)=C(C2=CC3=C(C)NN=C3C=N2)C(F)=C1 into molecular formula.",
"input": "",
"output": " C15H14F2N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC1CCN(C2=NC3=NNC(C4=CC=CC=C4Cl)=C3N=C2)CC1O ?",
"input": "",
"output": " C16H17ClN6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=C(CC)C1=CCC(C2CCC(C)CN2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C16H25N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C1NC2=C(F)C=CC=C2C(C2=CC=CC=C2)=NC1NC1=NN=C(C2=NC=C(C(F)(F)F)C=C2N2CCOCC2)O1 ?",
"input": "",
"output": "The molecular formula is C27H21F4N7O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC(C)(CC(C)(CCC(=O)NC(C)(C)CS(=O)(=O)O)C(=O)O)C(=O)OC(C)CC(C)(O)C(F)(F)F ?",
"input": "",
"output": " C22H38F3NO9S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COCCCN1N=C(C2=CC=C(NC(O)N3CC4=CC=NC=C4C3)C=C2)CC(C)(C)C1=O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C24H31N5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(C2=NN(C3=CC=C(F)C=C3)C3=CC(C(=O)NC4(C)CCS(O)(O)C4)=CC=C23)C=N1 .",
"input": "",
"output": " C25H25FN4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC(N)=NC1=CC=C(C(=O)OC2=CC=C3C(=C2)COC3CC(=O)N(CC(=O)O)CC2=CC=CC(C(=O)O)=C2)C=C1 ?",
"input": "",
"output": " C28H26N4O8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=[N+]([O-])C1=CC=C(C2=C(Cl)C=C(Cl)C=C2Cl)C=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H5Cl3N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)CCC1=CC=C(Cl)C=C1O ?",
"input": "",
"output": "The molecular formula is C11H13ClO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCOC(=O)C1=CC(CN)=C(C(F)F)C(N)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H13F2N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCCCCCCCCCCC=CC(O)C(COC1OC(CO)C(O)C(O)C1O)NC(=O)CCCCCCCCCCCCCCCCCCCCCCCC .",
"input": "",
"output": " C47H91NO8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COC1OC(CS(=O)(=O)O)C(O)C(O)C1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C51H92O12S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCCCCCCCCCCCCCC=CCCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O ?",
"input": "",
"output": " C60H113O13P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCCCCC=CCCCCCCCCCC(=O)OCC(COC1OC(CS(=O)(=O)O)C(O)C(O)C1O)OC(=O)CCCCCCCCCCCCCCCC ?",
"input": "",
"output": "The molecular formula is C44H82O12S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(CC1=CC=CC=C1)N1CC2=CC=CC=C2CC2(CCCCN2CC2=CC=CC=N2)C1 ?",
"input": "",
"output": " C28H31N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(O)C(NC(=O)CNC(=O)C(NC(=O)C1CCCN1C(=O)CN)C(C)O)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)NC(CS)C(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C36H61N11O16S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOP(=O)(OCC)C1C(OC(C)=O)CCP1(=O)OC .",
"input": "",
"output": " C11H22O7P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCNC(=O)C1CCC(=O)N1C1(C(=O)NCC2=CC=CC=C2)CCNCC1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H28N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C(C=C(CC(O)C1=CC=CC=C1)N1CCCC1)C1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C21H23NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC(=O)C1=C(O)C2=CC(F)=C(F)C(F)=C2N2C1C(C(=O)OC)CN2C ?",
"input": "",
"output": " C17H17F3N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C=CCCC1=CC=CC(C)=C1C(=O)N(CC)CC;[C-]#[O+];[C-]#[O+];[C-]#[O+];[Cr] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H23CrNO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCCC=C(Br)[B-](C#CCCCCC)(OC(C)C)C(C)(C)C(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C22H41BBrO- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCSC1(C)CCCCC1(C)C into molecular formula.",
"input": "",
"output": " C13H26S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C1=CC=C(N2C3=CC=CC=C3C3=CC=C(C4=CC=C5C=CC6=C(C7=CC=CN=C7)C=CC7=CC=C4C5=C76)C=C32)C=C1 ?",
"input": "",
"output": " C39H24N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=C(C2=NC3=CC(CN4CCC(C(=O)O)C4)=CC(C#N)=C3O2)C=CC=C1C1=CC=CC(C2=NC3=C(CN(C(=O)C=O)C3)S2)=C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C35H29N5O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC(C(=O)NCC2=CC=NC=C2)=NN=C1Cl into molecular formula.",
"input": "",
"output": " C12H11ClN4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(=O)NC1C(OCCOCCN2C=C(CN(CCCCC(N(CC3=CN(CCOCCOC4CC(O)C(O)C(CO)O4)N=N3)CC3=CN(CCOCCOC4CC(O)C(O)C(CO)O4)N=N3)C(C)(C)C)CC3=CN(CCOCCOC4OC(CO)C(O)C(O)C4NC(C)=O)N=N3)N=N2)OC(CO)C(O)C1O ?",
"input": "",
"output": " C65H112N16O26 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC=NC=C(C)C1=CC=CC(F)=C1C(C)CC(=O)C(C=C(C)C)=C(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C23H30FNO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC(N2CCS(=O)(=O)CC2)=CN=C1Cl .",
"input": "",
"output": " C10H13ClN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCC1=NC2(CCCC2)C(O)N1CC1=CC=C(C2=CC=CC=C2C2=NNN=N2)C=C1 ?",
"input": "",
"output": " C25H30N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CNC(=O)CC1=C(F)C=C(OC2=NC3=CC=C(F)C=C3S2)C=C1F ?",
"input": "",
"output": " C16H11F3N2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of FC1=CC=CC(OC(F)F)=C1C1(NC2=NC=C(C3=NN=C(C(F)F)O3)C=N2)CC1 ?",
"input": "",
"output": " C17H12F5N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC(C2=NN=C3C4=CC=CC=C4C(OCC4=CC=C(C(=O)NN5CCOCC5)C=N4)=NN23)=NO1 ?",
"input": "",
"output": " C24H22N8O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=NN(CC2(COS(C)(=O)=O)CC2)C=C1[N+](=O)[O-] ?",
"input": "",
"output": " C10H15N3O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=NN(C2=CC=C(C)C=C2)C(=O)C1=CC1=C(O)N(C2=CC=C(Br)C(C)=C2)C(=O)NC1=O ?",
"input": "",
"output": "Sure. C23H19BrN4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=NO)C1=CC(CN(C(C)C)C(C)C)=CC=C1O . Can you tell me?",
"input": "",
"output": "Sure. It's C15H24N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NC1=CC=C2C=C(S(=O)(=O)O)C(N=NC3=CC=C(C=CC4=CC=C(N=NC5=C(S(=O)(=O)O)C=C6C=C(S(=O)(=O)O)C=C(N)C6=C5O)C=C4S(=O)(=O)O)C(S(=O)(=O)O)=C3)=C(O)C2=C1 ?",
"input": "",
"output": " C34H26N6O17S5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOC(=O)C1=C(C)N=C(NN=CC2=CC(Br)=CC(Br)=C2O)S1 into molecular formula.",
"input": "",
"output": " C14H13Br2N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=C(C=NNC(=O)C2=CN=CC(Br)=C2)C2=CC=CC=C2N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H13BrN4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC(=O)C=CC(CCC(N)=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)C1=CC=C(C2=CC(C)=NO2)N1 ?",
"input": "",
"output": "Sure. C27H31N5O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(NC(=O)C[NH+](C)CC2=NC3=CC=CC=C3C(=O)N2)C=C1 ?",
"input": "",
"output": " C19H21N4O2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=CCOC(=O)C1=C(C)NC2=NN=NN2C1C1=CC=C(OCC2=C(Cl)C=CC=C2Cl)C(OC)=C1 into molecular formula.",
"input": "",
"output": " C23H21Cl2N5O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=C1NC(Cl)=NC2=C1N=CN2C1OC(COP(=O)(O)O)C(O)C1O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H12ClN4O8P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=NC2=C(CN(CC3=CC=C(C4=CC=C(Cl)C=C4)O3)CC2)C(=O)N1 , what would be its molecular formula?",
"input": "",
"output": "It is C19H18ClN3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=COC(CN=CC2=C(O)NC(=O)C3=CC=C(N4C=CC=C4)C=C23)=CC1=O ?",
"input": "",
"output": " C21H17N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC=C1C(C)=C(C)C(O)=C2C1=NC(=CCCC)N2CC1=CC=CC=C1C1=CC=CC=C1C1=NNN=N1 .",
"input": "",
"output": " C29H30N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(CC2=NOC(C3=NC=CC=C3O)=N2)C=C1C ?",
"input": "",
"output": "Sure. C16H15N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN(CC)C(CNC1=NC2=C(C=NN2C)C(=O)N1)C1=CC=CC=C1 .",
"input": "",
"output": " C18H24N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCOC1=CC=C(C(=O)OC(C)C2=NC3=CC=CC=C3C(=O)N2)C=C1OCC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C22H24N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=C(N2N=C3NC(=O)C(=CC=CC4=C(O)NC5=NN(C6=CC=C(S(=O)(=O)O)C=C6)C(=O)C5=C4C)C(C)=C3C2=O)C=C1 .",
"input": "",
"output": " C30H24N6O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule OC1=CC=C(N(C2=CC=CC=C2)C2=CC=CC=C2)C=C1C=NC1=CC=CC=C1C1=CC=CC=C1N=CC1=CC(N(C2=CC=CC=C2)C2=CC=CC=C2)=CC=C1O ?",
"input": "",
"output": " C50H38N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=NO)C1=NC2=CC=NN2C(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H37N5O3Si2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1C(NC(=O)C(=NOC(C)(C)C(=O)NN=CC2=CC=C(O)C(O)=C2)C2=CSC(N)=N2)C(=O)N1S(=O)(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C20H23N7O9S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NC(C(=O)COC1=CC=C2C=CC=CC2=C1N1C=CN=C1)[C+](C=O)C(=O)[O-] ?",
"input": "",
"output": "Sure. C19H15N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(C)(C)N1N=CNC1=O ?",
"input": "",
"output": "The molecular formula is C7H13N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCNC1=NN=C(C2=CC=CC=C2)C(=O)N1 ?",
"input": "",
"output": " C12H14N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(C1=CC=CC=C1)C1=CC([NH+]=C(O)C=CC2=[O+]C(=C3C=CC(=[N+]([O-])[O-])C=C3)C=C2)=CC=C1N=C(O)C1=CC=CC2=CC=CC=C12 ?",
"input": "",
"output": " C37H26N3O6+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC1(C)CSC(=NCC2(C(C)C)CC2)N1 , what would be its molecular formula?",
"input": "",
"output": "It is C13H24N2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)C1=NN2C(=C1Br)NCCC2C1CC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H18BrN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC1=CC=CC(C=NC2=CC=C(C(=O)O)C=C2N=CC2=CC=CC(OCC)=C2O)=C1O ?",
"input": "",
"output": "Sure. C25H24N2O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(O)C1=CC=C(N=NC2=CC=C(O)C(C=NC3=CC=CC(N=CC4=CC(N=NC5=CC=C(C(=O)O)C=C5)=CC=C4O)=N3)=C2)C=C1 .",
"input": "",
"output": " C33H23N7O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCC1=C2N=C(CC3=CC(S(=O)(=O)N4CCC(=O)C(=CC5=CC=CC=C5)C4)=CC=C3OCC)NC(=O)C2=NN1 ?",
"input": "",
"output": "The molecular formula is C29H31N5O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)NC(=O)CCNC1=C(N)C(=O)NC=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H17N5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(C)CC(=O)NC1=CN=CC(C2=CC=C3NN=C(C4=NC5=CC=NC=C5N4)C3=N2)=C1 ?",
"input": "",
"output": "The molecular formula is C23H22N8O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=CC(C=NNC(=O)CC2=CC=CC=C2[N+](=O)[O-])=C1O ?",
"input": "",
"output": " C16H15N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC(OC)=CC(C(=O)NN=CC2=CC(Br)=CC(OC)=C2O)=C1 ?",
"input": "",
"output": " C17H17BrN2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1=CC(C2=NNC(=S)N2C2=CC=C(OCN3NC(C4=CC(CC)=C(O)C=C4O)=[N+](C4=CC=CC5=C4N=CN5CCN4NC(C5=CC(CC)=C(O)C=C5C)=[N+](C5=CC=C6NC(C)=C(C)C6=C5)C4=S)C3=S)C3=C2C=CN3C(C)C)=C(C)C=C1O ?",
"input": "",
"output": "Sure. C63H65N13O5S3+2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(C)C(=O)NCCNC1=NC(C)=CC(=O)N1 ?",
"input": "",
"output": "The molecular formula is C12H20N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(C)C1=NC2=C(C=CN2)C(=O)N1 ?",
"input": "",
"output": "The molecular formula is C10H13N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(=O)C1=CC=C(N2C(=O)C3C4CC(C5C(C)=NOC45)C3C2=O)C=C1 ?",
"input": "",
"output": "Sure. C19H18N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COCC(C)NC1=NC=C2C(OC3CCOCC3)=NC=C(C3=CC=C(N4CCN(C)CC4)C=C3)C2=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C27H36N6O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CN=C(C(C)CCC2=C(C)SC(C(C)C)=N2)S1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C15H22N2S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(N2CCC(OC3=CC=C(NC(=O)C4CCCCN4C(C)=O)C=C3Cl)CC2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C26H32ClN3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCCCCCCC(=O)OC1=CC=C(OP(=O)(CC2=CC=CC=C2)OCC)C=C1 .",
"input": "",
"output": " C23H31O5P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC(C)=C2C(N)=C(C(=O)NC3COC4=CC(N5CC6CNCC5CO6)=CC=C4C3)SC2=N1 ?",
"input": "",
"output": "Sure. C25H29N5O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=C(NC1=C(C)C=CC=C1C)C1=CC=CC1 ?",
"input": "",
"output": " C15H17N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(=O)NC1=CC(C2=CC(OC(C)(C)C)=NC(N3CCCCC3C(F)(F)F)=C2)=CC=N1 ?",
"input": "",
"output": "Sure. C22H27F3N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C1C2=CC=CC=C2C(=O)C2=C(N=CC3=C(O)N(C4=CC=C([N+](=O)[O-])C=C4)C(=O)NC3=O)C=CC=C12 ?",
"input": "",
"output": "Sure. C25H14N4O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN1CCC(O)(CNC(=O)C2=CC3=CC=CN=C3S2)C1 .",
"input": "",
"output": " C14H17N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(C1CCOCC1)N1CCCC(S(=O)(=O)F)C1 ?",
"input": "",
"output": "Sure. C11H18FNO4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1(C)C=C(C(=O)NC2=CC=C(CN3C=NC=N3)C=C2)C1 ?",
"input": "",
"output": "Sure. C16H18N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC=CC=CC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CC=CC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC .",
"input": "",
"output": " C54H88O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCCCCCC=CCCCCCCCCCCCC(=O)OCC(O)COCCC(C(=O)[O-])[N+](C)(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C34H65NO6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCC)OC(=O)CCCCCCCC=CCC=CCC=CCC ?",
"input": "",
"output": "Sure. C81H138O17P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCCCCCCCCCCCCCCCC=CCCC=CCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCCCCCCCCCCCCCCCCCCC . Can you tell me?",
"input": "",
"output": "Sure. It's C60H117N2O6P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCCC=CCC=CCCCCCCCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)C=CCCC=CCCCCCCCCCCCC , what would be its molecular formula?",
"input": "",
"output": "It is C46H87N2O6P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=C1OCC(OC2COC(=O)C2(O)C=CC(C)C)=C1C=CC(C)C into molecular formula.",
"input": "",
"output": " C19H26O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=C1NCCCC=CC2=C1C=CCC2 , what would be its molecular formula?",
"input": "",
"output": "It is C13H17N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CN(C1=NC2=NNC(C3=CC=NC(Cl)=C3F)=C2N=C1)C1CCCCC1N ?",
"input": "",
"output": "The molecular formula is C17H19ClFN7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1C=CC2=C(C3=C4C(=CC2CS(C)(=O)=O)CN(C2=CC=C(F)C=C2F)C4C(CCC(=O)N2CCNCC2)CN3)C1=O , what would be its molecular formula?",
"input": "",
"output": "It is C30H35F2N5O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=NC(C)=CN(C)C1=CC=NC2=C1NC(C1=NNC3=CC=C(C4=CN=CC(CN5CCCC5)=C4)C(F)=C13)=N2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C28H28FN9 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC(C2=NC3=CC=C(OCCCN(C)CCN(C)CCNC(=O)C4=CC=C(N)C(N)=C4)C=C3N2)=C(OC)C=C1C=O . Can you tell me?",
"input": "",
"output": "Sure. It's C32H41N7O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(O)(C(F)F)C(NC(=O)C1=CC=C(C#CC#CC(F)F)C=C1)C(=O)NO , what would be its molecular formula?",
"input": "",
"output": "It is C17H14F4N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation ClC(Cl)(Cl)C1=NC(C2=CC=C3C=CC4=CC=CC5=CC=C2C3=C45)=NC(C(Cl)(Cl)Cl)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H9Cl6N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC1OC(C2=CC=CC=C2)C2=CC=CC=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C15H14O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CNC(=O)C1=CC=CC(CCNC(=O)CN2C=C(C3=CC=CC=C3)C(C)=N2)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C22H24N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC(C)N(CC(=O)O)C(=O)CNC(=O)C1=CC2=C(CCCC2)S1 ?",
"input": "",
"output": " C17H24N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation O;O=C1CC2OCC=C3C[NH+]4CCC56C7=CC=CC=C7N1C5C2C3CC46;[O-][Cl+3]([O-])([O-])[O-] , what would be its molecular formula?",
"input": "",
"output": "It is C21H25ClN2O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCOC(=O)C1C2CC3=C(CC(C(=O)O)C3)CC21 ?",
"input": "",
"output": " C14H18O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C=C(C)NC1CCCCC1NC(C)=CC(=O)OCC;CCOC(=O)C=C(C)NC1CCCCC1NC(C)=CC(=O)OCC , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C36H60N4O8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=NC(=NC=C(C)OCC1=CC(OC)=CC=C1F)NC1=CC=C(N2CCNCC2)C(OC)=C1 ?",
"input": "",
"output": " C24H30FN5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C1=CC=C(C2=CC=CC(N(C3=CC=C4C(=C3)SC3=CC=C(N(C5=CC=CC=C5)C5=CC=CC=C5)C=C34)C3=CC=C4OC5=CC=CC=C5C4=C3)=C2)C=C1 .",
"input": "",
"output": " C48H32N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)CC1=CC=C(OCC2(CNC(=O)OC(C)(C)C)CCCC3=CC=C(Cl)C=C32)C(Br)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C26H31BrClNO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)(C)CC(C)(C)NC(=O)OCN1C(=O)OC2=C(N3CCN(CC4=CC=CC(C5=CC=CC=C5)=C4)CC3)C=CC=C21 .",
"input": "",
"output": " C34H42N4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1(C)C2=CC=CC=C2C2=C(N(C3=CC=C(C4=CC=CC=C4)C=C3)C3=CC=C(C4=CC=C5C6=CC=CC=C6C6=C5C4=CC=C6)C4=C3OC3=CC=CC=C34)C=CC=C21 into molecular formula.",
"input": "",
"output": " C55H37NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC(C(N)=O)=CC(C)=C1CC(CN1C(=O)C2=CC=CC=C2C1=O)NC(=O)OC(C)(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C25H29N3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=CC(C)=[N+]1C;CC1=CC=CC(C)=[N+]1C;O=S(=O)([O-])[O-] ?",
"input": "",
"output": " C16H24N2O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC , what would be its molecular formula?",
"input": "",
"output": "It is C48H96O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCOC(=O)C(SC1=CC(C(=O)Cl)=C(F)C=C1Br)C(C)C ?",
"input": "",
"output": "Sure. C15H17BrClFO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCN(C(=O)CC)C1=CC=C(Cl)C(Cl)=C1 ?",
"input": "",
"output": "Sure. C12H15Cl2NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCCCCCCCCCCCCCN(CCCCCCCCCCCCCCC)C(C)(C)CCCCCCCCCCC . Can you tell me?",
"input": "",
"output": "Sure. It's C44H91N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(=O)C1=[N+](CC2=CC=CC=C2)C2=CC=CC=C2S1;FC(F)(F)C1=CC(C(F)(F)F)=CC([B-](C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)(C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)=C1 .",
"input": "",
"output": " C48H26BF24NOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCC1C2=CC(C)=CC(C(C)(C)C)=C2OP(OC2=C(C(C)(C)C)C=C(C)C=C2CC2=CC(C)=CC(C(C)(C)C)=C2O)OC2=C1C=C(C)C=C2C(C)(C)C ?",
"input": "",
"output": " C49H67O4P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C1CN(CCSC2=CC=CC=N2)C2=CC=CC=C2C(=O)C1=C1SC=CS1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H16N2O2S3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C2N=C3CCCCCN3C2=C1 into molecular formula.",
"input": "",
"output": " C13H16N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCCC(C)(C)C1=CC(CN2C(=O)N(CC3=CC(C(C)(C)C)=C(O)C(C(C)(C)CCCCC)=C3)C(=O)N(CC3=CC(C(C)(C)C)=C(O)C(C(C)(C)CCCCC)=C3)C2=O)=CC(C(C)(C)C)=C1O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C60H93N3O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C1=CC=C(C(C2=CC=CC=C2)N2CCN(CCOCCC3=CC=CC4=CC=CC=C34)CC2)C=C1 .",
"input": "",
"output": " C31H34N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1CCCC(C(=O)OC2CCC(C)(C)CC2)C1C(=O)O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H28O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C1CC(C(=O)O)NCC1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C6H9NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(C)OC(=O)NCCCCNC(=O)C1=CC([N+](=O)[O-])=CC=C1Cl .",
"input": "",
"output": " C16H22ClN3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(C(CC[S+](C)C)=NOC(C)=O)C=C1 ?",
"input": "",
"output": "The molecular formula is C14H20NO3S+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(SOC2=CC=C(C)C=C2[N+](=O)[O-])C=C1 ?",
"input": "",
"output": "Sure. C14H13NO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=CC(=O)OCCCCCCCCOP(=O)(OCCCCCCCCOC(=O)C=C)OCC1=CC=CC=C1C ?",
"input": "",
"output": " C30H47O8P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCC(=O)N(CCNC(=O)C(CS)CC1=CC=CC(F)=C1)CC1=CC=C(C2=CC=CC=C2S(=O)(=O)NC(C)=O)C(Cl)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C31H35ClFN3O5S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=C(C)C(=O)OCC(CCCCCCCCC(C)CCCCCCC)CCCCCCC(C)CCCCCCC ?",
"input": "",
"output": " C38H74O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN=C(NCCN(C)C)N(C)C;Cl , what would be its molecular formula?",
"input": "",
"output": "It is C8H21ClN4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCC(CC)COC(=O)CCN1C(=O)NC(=CC2=CC=C(CC(=O)N(CCO)CCO)C=C2)C1=O ?",
"input": "",
"output": " C27H39N3O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(=O)C1=CC=C(OC(Cl)CN2CCCCC2)C=C1 ?",
"input": "",
"output": "The molecular formula is C16H22ClNO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(=O)OC12CCC(N(CC(C)C)C(=O)C#CC3=CC=C(C(F)(F)F)C=C3)C3OC4=C(O)C=CC5=C4C31CCN(CC1CC1)C2C5 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C36H39F3N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " O=C1OP(C2=CC=CC=C2)(C2=CC=CC=C2)(C2=CC=CC=C2)CCCCCCCP(C2=CC=CC=C2)(C2=CC=CC=C2)(C2=CC=CC=C2)OC1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C45H44O4P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(O)C([O-])CSC1=CC=CC=C1 ?",
"input": "",
"output": "Sure. C24H37N2O3S- ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)(C)NC1CCC(N2CCC(C3=NC=CC(C(N)=O)=N3)C2=O)C(NS(C)(=O)=O)C1 ?",
"input": "",
"output": "The molecular formula is C20H32N6O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1CN(CC2=CC=CC(C3=CC(CNC(=O)C4=CC=CC(C[N+]5(C)CCOCC5)=C4)=CC=C3F)=C2)CCN1;O=C([O-])C(F)(F)F ?",
"input": "",
"output": "The molecular formula is C34H40F4N4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CS(=O)(=O)N1C(=O)C(C(F)(F)F)C1C1=NN(C(=O)C2=CC=CO2)C(SCC2=CC=C(Cl)S2)=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H12ClF3N4O5S3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)(C)C1=CC=C(C2=NC(C3=CC=C(C4=CN=C(C5=[C-]C=C6C(=C5)C(C)(C)C(F)(F)C6(C)C)C5=CC=CC=C45)C=C3)=NC(C3=CC=C(C(C)(C)C)C=C3)=N2)C=C1;[Ir] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C51H49F2IrN4- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C#CCC(NC(=O)OC(C)(C)C)C(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C10H15NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC(CCC1=CC=CC=C1)ON1C(=O)C(CS)C2=CC=CC(F)=C21 ?",
"input": "",
"output": " C18H19FN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN(CC)CCOC1=CC=C(CC(C)C(N)=O)C=C1 .",
"input": "",
"output": " C16H26N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1=NN(C2CCCC2)C2=CC(C3CCC(C#N)(C(=O)OC)CC3)=CC=C12 ?",
"input": "",
"output": " C23H29N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=P#CCC1CC2=CC=CC=C2C(=O)N1O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H10NO3P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C1=CC=C(C2=CC=C3N=C(C4CC5=CC=CC=C5O4)C(C4=CC5=CC=CC=C5O4)=C(C4=CC5=CC=CC=C5N4)C3=C2C2=CC=CC3=CC=CC=C23)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C49H32N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCN1CC2(CCC1=O)C(=O)NC1=CC=CC=C12 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H18N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of FC(F)(F)C1=CC=C(OC2=CC=C(CN(CC3CO3)CC3CO3)C=C2)C=C1 ?",
"input": "",
"output": " C20H20F3NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=CC(=O)OCC(CC)[Si]([Si](C)(C)OC)([Si](C)(C)OC)[Si](C)(C)OC ?",
"input": "",
"output": "The molecular formula is C16H38O5Si4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=CC1=C(Cl)C2=CC(Cl)=CC(Cl)=C2SC1 .",
"input": "",
"output": " C10H5Cl3OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC1=CC2(CN1)C1=CC=NC=C1OC1=CC=C(C3=CC=CN=C3)C=C12 ?",
"input": "",
"output": " C20H16N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC1=CC=C(C2=CC=NN2)C=C1[N+](=O)[O-] ?",
"input": "",
"output": " C11H11N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(NC=O)(OC=O)C1=CC=NN1 into molecular formula.",
"input": "",
"output": " C7H9N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NCCNCC1=CC=CC(CCS(=O)(=O)[O-])=N1;[Na+] . Can you tell me?",
"input": "",
"output": "Sure. It's C10H16N3NaO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCCCCCC=CCCCCCCCCNC(C1=CC=CC=C1)C1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C31H47N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(O)C1=CC=CC=C1C1=C(C2=CC=CC=C2C(=O)O)C(C2CCCC2)=CC=C1C1CCCCC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C31H32O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C(O)N1CCC(OC2CCC(OC3=CC=C(Br)N=C3)CC2)CC1 ?",
"input": "",
"output": "Sure. C17H23BrN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN(C)CCN1C=C(C2C=CC(Cl)=CC2(C)S(=O)(=O)N2C=CC3=C(C4=CN=C(C5(O)CCC5)S4)C=CN=C32)C=N1 ?",
"input": "",
"output": "Sure. C28H31ClN6O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C=C(C(=O)OC)C1=CC=CC=C1COOCC1=CC=CC=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H18O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN1N=NC(C2=CC=C(C3=CC=C(N4C=C(COC(=O)C5CCCN5)OC4)C=C3F)C=N2)=N1 ?",
"input": "",
"output": " C22H22FN7O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC1OCC2=CC=C(OC3=CC=C(N4C(=O)NC(C)(C)C4=O)C=N3)C=C21 ?",
"input": "",
"output": "The molecular formula is C20H21N3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN1CCN(C2=CC=C(NC3=CC4=C(N5CCCC5)N=C(OCC5CCCCC5)N=C4C=N3)N=C2)CC1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C28H38N8O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(CC1=CC=CC=C1)C1=NC=CS1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C(=O)OCC1=CC=C(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCOCCOCCOCCOCCNC(=O)CCN2C(=O)C=CC2=O)C(C)C)C=C1)C(C)C ?",
"input": "",
"output": " C78H119N13O19S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for [C-]#[N+]C1=CC=C(N2C(=O)N(C3=CC=CC=C3)C3(CCC3)C2=O)C=C1 .",
"input": "",
"output": " C19H15N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(C1=CC=C(Cl)C=C1)C1=CC=CC=C1N(CCO)CCO .",
"input": "",
"output": " C17H18ClNO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(O)NCC1=CC=C(C2CC2)C(C(=O)C2CCC(C3=CC=C(F)C4=CC=CC=C34)CC2)=N1 . Can you tell me?",
"input": "",
"output": "Sure. It's C27H27FN2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(OC1=CC=C(OCC2=CC=CC=C2)C=C1)C(=O)OCC1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C23H22O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)=CCCC(C)=CCN(CCCO)CCCC(C)C .",
"input": "",
"output": " C19H37NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC(F)=C(C2=CC=C(C3CCC(C)CC3)C=C2F)C=C1F ?",
"input": "",
"output": "The molecular formula is C20H21F3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1(C)C2CCC1(CS(=O)(=O)N1CCC3(CCC4=CC=CC=C43)CC1)C(N)C2;CCC(C)N ?",
"input": "",
"output": " C27H45N3O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC;NC1=CC=CC(CC2=C(O)CC(CCC3=CC=C(F)C=C3)(CCC3=CC=C(F)C=C3)OC2=O)=C1 ?",
"input": "",
"output": " C30H33F2NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(O)O;CC(C)NC(=O)C1CCC(NC2=CC(Cl)=NC=N2)C1 ?",
"input": "",
"output": " C16H27ClN4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of NC(=O)NC1CCCCC1CCN1CCC(CC2C=CCCC2)CC1 ?",
"input": "",
"output": " C21H37N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C#CC;CC;CC;CCC=CC=NC represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C13H27N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCC(CCC)NC1=CC(C)=C(COC)C=C1[N+](=O)[O-] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C16H26N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of Cl;NC(=O)C1=NC2=C(CCCC2)S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C8H11ClN2OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)C1=CC=C2C(=C1)NC(=O)N2I ?",
"input": "",
"output": " C10H11IN2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COCC(=O)N(CC1=CC=C(C2CCCCC2)C=C1)C1=CC=C(C2=CSC(N(C)CC3=CC=C(C=O)C=C3)=N2)C=C1 ?",
"input": "",
"output": " C34H37N3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC2=NC(C3=CN=CN3)=CC(C=CC3=CC=NN3C)=C2C=C1CCC#N ?",
"input": "",
"output": " C22H20N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C1=CC=C(C2=CC(C3=CC=CC=C3)=NC(C3=C4SC5=CC=CC=C5C4=CC=C3C3=CC=C4C5=CC=CC=C5C5(C6=CC=CC=C6C6=CC=CC=C65)C4=C3)=N2)C=C1 ?",
"input": "",
"output": " C53H32N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)C(N)CCCCN;CCC;CCC . Can you tell me?",
"input": "",
"output": "Sure. It's C13H32N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C1=CC=C(C2=NC(C3=CC=C4C(=C3)C3=CC=CC=C3N4C3=CC=CC=C3)=NC(C3=CC=CC4=C3C3=CC=C(C5=NC(C6=CC=CC=C6)=NC6=C5OC5=CC=CC=C56)C=C3O4)=N2)C=C1;CC=CC into molecular formula.",
"input": "",
"output": " C59H40N6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCN(CCC=C(CC)C(=O)CCCO)C(=O)C1=CC=C(C2=CC=C3N=CNC3=C2)C=C1;[HH] ?",
"input": "",
"output": " C27H35N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule FC1=CC=C(C2CCC(C3CCCC[Si]3(C3=CC=CC=C3)C3=CC=CC=C3)CC2)C=C1F ?",
"input": "",
"output": " C29H32F2Si ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CS(=O)(=O)C1=CC=C(C2=C(C3=CC=C4OCCOC4=C3)C(=O)C3=CC=CC=C3S2)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H18O5S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(CC1=CC=CC=C1)C1=CC=CC(CP(C(C)(C)C)C(C)(C)C)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C24H35P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=CC=C(C=C)C(CS(=O)(=O)N1CCC(OCC2=CC=CC=C2C)CC1)N(O)C=O ?",
"input": "",
"output": " C22H30N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC;CC;CC;CC1(C)CC=CC2=C(CCC(=O)CC2)C1;CC=CC(C)=C(C)C=CC(C)=O;CCC is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C34H62O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CC(=C(OOSC1=CC=C(C)C=C1)C(=CC)C[N+](=O)[O-])[N+](=O)[O-] .",
"input": "",
"output": " C15H16N2O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCC(C)CC(C(=O)NC1=CN=C(CCCO)C=N1)C1=CC=C(S(C)=O)C(Cl)=C1 into molecular formula.",
"input": "",
"output": " C24H34ClN3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation N=C(N)C1=CC=C2C(=C1)C1=CC=CC=C1N2CC1=CC=CC(F)=C1;NN represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H20FN5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=CC(CN2CS2)=C1 .",
"input": "",
"output": " C9H11NOS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CC=C(C(=C)O)C(=O)NCCCC . Can you tell me?",
"input": "",
"output": "Sure. It's C11H17NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C=CC1=C(C=C)C(C)CCC1 ?",
"input": "",
"output": "Sure. C11H16 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(=O)OC1CC2(C)C(CCC3C2CCC2CCCCC23C)C1=C(CCC=C(C)C)C(C)=O , what would be its molecular formula?",
"input": "",
"output": "It is C30H46O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)NS(O)([OH2+])C1=CC=C(C#CC2=CC=C(N)C=C2)C=C1 ?",
"input": "",
"output": " C17H21N2O2S+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C=CCOC1=C(C)C(C)=C2OC(C)(C)CCC2=C1C ?",
"input": "",
"output": "Sure. C17H24O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CSNC(=NCCCNC(=O)C1=CC=C(C2=CC=CC([N+](=O)[O-])=C2)O1)C1=CC=CC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H22N4O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=CC=C(C=C)CC(C)C(N)=O .",
"input": "",
"output": " C10H15NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C#CCCC(NC(=O)C1CC(C(C)C)CN1C(=O)C(NC(=O)NC(CN1CC2=CC=CC=C2S1(=O)=O)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NCC=C .",
"input": "",
"output": " C40H58N6O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=C(C#N)C=CCCCCC1C(=C)CCC1C#CCCC1=CC=CC=C1C .",
"input": "",
"output": " C26H31N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C=CC(F)=CC=C(Cl)CN(N)C(=NN)C1=CC(C2=CC=C(NC(C)=O)C=C2)=CN=C1N ?",
"input": "",
"output": " C21H23ClFN7O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC(=O)CC(C)CC1CC(O)CC(CO)O1;OCC1OC(O)CC(O)C1O .",
"input": "",
"output": " C19H36O10 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=C(NC1=CC=C(C)C(NC2=CC(C(=O)NC)=NN2C2=CC(NCCN3CCOCC3)=NC=N2)=C1)C1=CC=C(N2C=CC=N2)N=C1 into molecular formula.",
"input": "",
"output": " C32H36N12O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=C1C=CC(C2=CNN=C2)=NN1C(=NC)SC1=CC=C2N=CC=CC2=C1N .",
"input": "",
"output": " C19H17N7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1CC2CC(C1)CC(C)C(C)C2 into molecular formula.",
"input": "",
"output": " C13H24 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC(OC(=O)C2=CC=CO2)=CC=C1C1=CC=C2NC(C)(C)C=C(C)C2=C1COC1=CC=CC=C1C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C32H31NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(NC(=O)OCCC2=CC=C(C(NC3=CC=C4C=CNC(=O)C4=C3)C(=O)O)C=C2)C=C1CN(C)C(=O)OC(C)(C)C;CCCO;CO , what would be its molecular formula?",
"input": "",
"output": "It is C38H50N4O9 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CONC1=C(O)C2=C(C(=O)C=CC2=O)C(O)=C1NCCC[N+](C)(C)O into molecular formula.",
"input": "",
"output": " C16H22N3O6+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(CCCNC=O)C1OC(CO)CC1F;CO .",
"input": "",
"output": " C11H23FN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC;CC1=NNC(=S)N1C , what would be its molecular formula?",
"input": "",
"output": "It is C6H13N3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C#CO;C=O;CC1=CC=C(Cl)C=C1;CNC(CCC(F)(F)F)C(N)=O ?",
"input": "",
"output": "The molecular formula is C16H22ClF3N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC;[CH-]=CC=[C-]C;[W+2] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C7H12W ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C;CC(C=O)NC1CCC(C2=CN=C3C=NC4=C(C=CN4)N23)C1;CC1=C(C)C(C)=C2OC(C)(C)CC2=C1C;[HH];[HH] ?",
"input": "",
"output": " C31H47N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=C(C=CC)C(C)=CC;CC;CC1=CC=C(C2=CC=C3C=CC4=C(C5=CC=CC(C6=CC=C7CC8=CC=CC=C8C7=C6)=C5)C=CC5=CC=C2C3=C54)C=C1;CC=C(C)C ?",
"input": "",
"output": "The molecular formula is C58H58 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation COC(=O)CC1=C(C(=O)OC)SC(N(CC(=O)O)CC(=O)O)=C1N=O , what would be its molecular formula?",
"input": "",
"output": "It is C13H14N2O9S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=C1C(=CC=C2CCCC3(C)C(CCC4CCC(=O)N4CCC4=CC=C5C=CC=CC5=C4)CCC23)CCC(CCCO)C1O ?",
"input": "",
"output": " C40H53NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C1=CC=C2C3=CC=C(C4=C=CC5=CC=CC=C5C=C4)C=C=C3C(C)(C)C2=C1)C(CC1C=C(C2=CCCCC(C3C=CC=CC3)=C2)C=CC1)CC1C=C(C2=CC=CC(C3=CC=CC=C3)=C2)C=CC1 .",
"input": "",
"output": " C69H64 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C#C;C=CC(CC=CC(CC)CNC)C1=CC=CC=C1CCNC(=O)CO;CC=CC=C(F)C=CF ?",
"input": "",
"output": "The molecular formula is C30H42F2N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNCCCCCCC(C)C;O=CC1=CC=C(C2=C3C=C(F)C(=O)C=C3OC3=CC(O)=C(F)C=C23)C(C(=O)O)=C1 into molecular formula.",
"input": "",
"output": " C31H33F2NO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(=O)C1CCC(NC2=CC(C3=CCC=CC(C)=N3)=C(Cl)C=N2)C1 .",
"input": "",
"output": " C19H22ClN3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C1NC(=O)C(CC2=CC=C(OCC(CO)C3=CC=CC=C3F)C=C2)S1 ?",
"input": "",
"output": "The molecular formula is C19H18FNO4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC;CC1=CC2=C(C=C1C1=CC=C(NC(=O)C3=CC=CC=C3F)N=C1)C(=O)CCO2 .",
"input": "",
"output": " C24H23FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)C1=NC2=NN(C3=CC=CC=C3)C(OS(=O)(=O)C(F)(F)F)=C2C=N1 ?",
"input": "",
"output": "The molecular formula is C15H11F3N4O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)OC1=CC=C(N=C2NC(=O)N(C(C)(C)C)C(=O)[NH+]2C(C)C2=CC=C(F)C=C2)C=C1 .",
"input": "",
"output": " C24H30FN4O3+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code [O-]N([O-])C1=C(Cl)C=CC=C1Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C6H3Cl2NO2-2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC;CCC(CC(C)(C)C)C(=O)OCCOC1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H32O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COCC(C)N(C)C1CCC(NC2=CC(C3=CC=CC(NCC4(C#N)CCOCC4)=N3)=C(F)C=N2)CC1 ?",
"input": "",
"output": "The molecular formula is C28H39FN6O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=CC=C1C(CCCC(=O)C1=CC=C(OCC(O)C(C)(C)C)C(C2=CC=CC=C2)=N1)CC(=O)O .",
"input": "",
"output": " C31H37NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC(C)COC1=CC(C)=CC=C1C=CC1=CC=C(C)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C21H26O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(C)OC(=O)NC(COCC1=CC=CC=C1)C(=O)N1CCN(C2=CC=CC=C2)CC1 .",
"input": "",
"output": " C25H33N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC;O=C(C1=CC=CC=C1)C1CCCC1C1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C20H24O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C=C(CCCC)NC1=CC=NC=C1C(F)(F)F ?",
"input": "",
"output": "Sure. C12H15F3N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC;CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C4=CC=CN=C4)=CCC32)C1 ?",
"input": "",
"output": " C28H39NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCC1=CN=C(NSC2=CC=C3CCN(C(C)C4=CC(F)=CC(F)=C4)CC3=C2)C=N1 ?",
"input": "",
"output": " C24H26F2N4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C=C(Br)C=CC(=C)C(=C)NC(=NC)C1CCCCN1;CC is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H28BrN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC(C2=CC=CC=C2)=CC(CO)=C1O ?",
"input": "",
"output": " C14H14O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=C(C2=CC=NN2C)C=C(C(=O)NCCOCCOCCNC(=O)NCCCCNC(=O)NCCOCCOCCNC(=O)C2=CC(C3=CC=NN3C)=C(C)N(C3=CC=CC(C(F)(F)F)=C3)C2=O)C(=O)N1C1=CC#CC(C(F)(F)F)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C54H62F6N12O10 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC(C2=CC=C(C#N)C=C2)=C(C2=CC=C(C)C=C2)N2C(=O)N(CC3CCCC3)N=C12 ?",
"input": "",
"output": " C27H26N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=NC(C)=NCCC1CCOC1 ?",
"input": "",
"output": " C9H16N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=C1C2=CC=CC=C2C=CN(C2=CC=C(C)C=C2)C2=CC=C3C=CC=CC3=C12 ?",
"input": "",
"output": "The molecular formula is C27H21N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C;C=C(C1CCC2C3CCC4CC(O)CCC4C3CCC12C)C(C)(C)O;N , what would be its molecular formula?",
"input": "",
"output": "It is C24H45NO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=CC(=CC)CC=CC=CN;CC ?",
"input": "",
"output": " C12H21N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC;CC1NCCC2=C1SC(N)=C2C1=NC2=CC=CC=C2S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C17H21N3S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C1=CC=C(C2=CC(C3=CC=CC=C3)=CC(N3C4=CC=C(C5=CC=C6C(=C5)C5=CC=CC=C5N6C5=CC=CC=C5)C=C4C4=CC=C(C5=CC=CC=C5)C=C43)=C2)C=C1 ?",
"input": "",
"output": "Sure. C54H36N2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCN1CCC2=CC3=C(C=C2C2C(OC(=O)C(C)OCCC(C)(C)O)C(OC)=CC21)OCO3 , what would be its molecular formula?",
"input": "",
"output": "It is C25H35NO7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC(C)(CCO)OC1=CC(C(=O)O)=CC(C(=O)O)=C1 ?",
"input": "",
"output": " C14H18O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCN(C)CCC(C)(CCCC)NC1CCCCC1N(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C21H45N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCNC1=CC(OC)=C(Cl)C=C1Cl ?",
"input": "",
"output": " C9H11Cl2NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=C(C(=O)OC(C)CC(C)(C)OC(=O)C2=CC=C(C(=O)OC(C)CC(C)(C)OC(=O)C3=CC=C(C)C=C3)C=C2)C=C1 ?",
"input": "",
"output": " C36H42O8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(C)NC1=CC(N2CCNCC2)=C(F)C=C1C1=NN(C2=CC=CC=C2)C(=O)C1 ?",
"input": "",
"output": "The molecular formula is C22H26FN5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCCCCCCCC(CCCCCC)C(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H46 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=NC2=CC=C(C3=CC(=O)N4C=C(C5=CCNCC5)N=CC4P3)C=C2O1 . Can you tell me?",
"input": "",
"output": "Sure. It's C20H19N4O2P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COCCCOC1=C(OC)C(C(C)C)=CC(CCCCCCCC(N)=O)=C1C(C)C ?",
"input": "",
"output": " C25H43NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C=C1CCNC2=C1C=C(C)O2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C9H11NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1(C)C2=CC(C#N)=CC=C2C2=CC=C(C3C4=CCC=CC=C4C(C4=CC=C(C5=CC=CC=C5)C=C4)=C4C=CC=CC43)C=C21 ?",
"input": "",
"output": " C43H33N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(CCN2C=CC3=C(C(=O)OC4=CC=CC=C43)C2=N)C=C1OC ?",
"input": "",
"output": "Sure. C22H20N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=C(CCN2CCC(C3=NOC4=CC(F)=CC=C34)CC2)C(=O)N2CCCC(=NO)C2=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C23H26FN5O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=CC1=CC=C2C(=C1)C1=CC(Br)=CC=C1N2C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C19H12BrNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCO[Si](OCC)(OCC)OCC1=CC=C2C(=C1)C1=CC(N(C3=CC=CC=C3)C3=CC=C(C4=CC=C(N(C5=CC=CC=C5)C5=CC=C6C(=C5)C5=CC(CO[Si](OCC)(OCC)OCC)=CC=C5N6C5=CC=CC=C5)C=C4)C=C3)=CC=C1N2C1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C74H74N4O8Si2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C1=CC(C2=CC3=C4B5C6=C(C=CC=C6OC4=C2)SC2=CC=CC(=C52)O3)=CC(C2=CC3=C4B5C6=C(C=NC=C6SC4=C2)OC2=C5C(=CN=C2)S3)=C1 ?",
"input": "",
"output": "The molecular formula is C40H18B2N2O3S3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)N1C=C(C2=CC=CC=C2)N(CC(=O)NC(CC2=CC=CC=C2)C(=O)C(=O)OC(C)C)C(=O)C1C(C)C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C31H37N3O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C1=CCCCC=CC=CCCCC=C1 ?",
"input": "",
"output": " C14H20 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COC1=CC=CC=C1OCC1=NC2=CC=C(I)C=C2C(COC2=CC=CC=C2OC)=C1C(=O)O ?",
"input": "",
"output": " C26H22INO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC12CCC(O)CC1CCC1C2CCC2(C)C1CCC21CN=C(NC2CCCCC2)O1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C27H44N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(C1=CC(CC2=NNC(=O)C3=CC=CC=C23)=CC=C1F)N1CCC2(CNC2)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H21FN4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C(CS)NC(=O)C=CC1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C14H17NO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=NC=C(C2=CC=C(OCCC3=CC=CC(Cl)=C3F)C=N2)C(N2CCC(C)(C)CC2)=C1C(OC(C)(C)C)C(=O)O . Can you tell me?",
"input": "",
"output": "Sure. It's C32H39ClFN3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCCCCC#CC1=CC=C(SC)C=C1 ?",
"input": "",
"output": "The molecular formula is C15H20S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=NC=CC(S(=O)[O-])=N1;[Li+] ?",
"input": "",
"output": " C5H5LiN2O2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1(C)CC(=O)C(C2C=CNC3=C(C(=O)C4=CC=CC=C4)ON=C32)C(=O)C1 ?",
"input": "",
"output": " C21H20N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN(C)CC=CC(=O)NCC1=NN(C2=CC=CC=C2)C2=C1CCC2 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H24N4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(O)CN(CC1=CC=CC=C1Br)S(=O)(=O)N1CCOCC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C13H17BrN2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(O)C1=CN=C(C2CCCN2CC2=CN(C3=CC=CC=C3)N=C2)N=C1 ?",
"input": "",
"output": " C19H19N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCN(CC)S(=O)(=O)C1=CC=CC(C(=O)NCC(=O)NC2=CC=CC(N3CCCCCC3)=C2)=C1 ?",
"input": "",
"output": " C25H34N4O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1=CC=C(C2=CC=CC2=C([O-])N(C(C)C)C(C)C)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C19H24NO2- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=CC(=O)OC(C)CCCOP(=O)(O)OP(=O)(O)O , what would be its molecular formula?",
"input": "",
"output": "It is C8H16O9P2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCN1CCC2C(C)C(=O)C(I)=CC2(C2=CC=CC=C2)C1=O .",
"input": "",
"output": " C18H20INO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCCCCCCCCCC(=O)NC(C)C(=O)CC(C)C(O)OC ?",
"input": "",
"output": "The molecular formula is C20H39NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCOCC1=C2N=C(N3CCCC3C3=CC(F)=CN=C3CCN(CC)NC(=O)OC(C)(C)C)C=CN2N=C1 into molecular formula.",
"input": "",
"output": " C27H38FN7O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC(=O)CNC(=O)C1=C(C)C(Cl)=C(Cl)S1 .",
"input": "",
"output": " C10H11Cl2NO3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC(C#N)=CC(C)=C1OC1=NC(NC2CCN(CC3=CC=CC(S(N)(=O)=O)=C3)CC2)=NC2=C1SCCC2 .",
"input": "",
"output": " C28H32N6O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=C(C=C(OC)C(=CC)NC(=C)OC1=C(C)CC#CCC(C)C1C)NC ?",
"input": "",
"output": "The molecular formula is C22H32N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=NC=C([N+]#N)C=C1Cl . Can you tell me?",
"input": "",
"output": "Sure. It's C6H5ClN3+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)(C)NC(=O)N1OC1C1=CC=C(OC2=CC=CC=C2)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C18H20N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CN=CC(C2=CC=C3C(=C2)C=C(C2=CC=NC(C)=C2)N3CC2=CC=CC=C2)=C1 ?",
"input": "",
"output": "Sure. C27H23N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCCC(C)(CCCC)C1CCN(C)C1 into molecular formula.",
"input": "",
"output": " C17H35N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)OC(=O)C(C)CCOP1(=O)OCC2OC(N3C=C(F)C4=C(N)N=CN=C43)C(C)(Cl)C2O1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C20H27ClFN4O7P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule N#CC1=CC=C2C3=CC=CC=C3N(C3=CC=CC4=C3SC3=C(C5=CC=CC=C5)C=C(C5=CC=C6C(=C5)OC5=CC=CC=C56)C=C34)C2=C1 into molecular formula.",
"input": "",
"output": " C43H24N2OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C1=NC(N2CCNCC2)=NC=C1N1CCCCC1 ?",
"input": "",
"output": "The molecular formula is C13H21N5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COCC1CCC2(CC2)O1 ?",
"input": "",
"output": " C8H14O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=CC=C1C(=O)NCC1=CC=C(C2=NN(C3CCC(C)C3)C(N)=C2C=O)C=C1 ?",
"input": "",
"output": "Sure. C25H28N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C1=CC=C(C2=NC3=CC=CC=C3N=C2C2=CC=C(C3=CC=C4C(=C3)C3=C5C6=C4C4=CC=CC=C4N6C4=CC=CC=C4N5C4=CC=CC=C34)C3=CC=CC=C23)C=C1 .",
"input": "",
"output": " C52H30N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC(=O)CC1COC2=CC(CCC3=CC=CC(C4=C(C)C=CC=C4C)=C3Cl)=CC=C21 ?",
"input": "",
"output": " C27H27ClO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)(C)N1CCCC([NH3+])C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C9H21N2+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC(C=CC(=O)N2CCCC=C(Br)C2=O)=CC(OC)=C1OC .",
"input": "",
"output": " C18H20BrNO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNCC(COC(C)C)OC into molecular formula.",
"input": "",
"output": " C8H19NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule NC(=O)C1=NN(CC(=O)N2CC(F)CC2C(=O)NC2=CN=CC(C3=NC=NC4=C3C=CC4)=C2)C2=CC=C(C3=CC=NN=C3)C=C12 .",
"input": "",
"output": " C31H25FN10O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CO[Si]1(CCCI)OCCSCCO1 ?",
"input": "",
"output": " C8H17IO3SSi ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation [SiH3]O[SiH2]O[SiH](C1=CC=CC=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C19H22O2Si3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC(C(=O)C=CC(=O)O)C(=O)NCCN(CCNC(=O)C(N)C(=O)C=CC(=O)O)CCNC(=O)C(N)C(=O)C=CC(=O)O ?",
"input": "",
"output": " C24H33N7O12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1(C)C(C2=CC=CC=C2)C1C1=NC(C2(C(F)(F)F)CC2)=NO1 , what would be its molecular formula?",
"input": "",
"output": "It is C17H17F3N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN1N=C(C2=C([N+](=O)[O-])C(N)=NN2)C=C1OC(F)F , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C8H8F2N6O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C#CC1=CC(C(=O)N(CCC)CCC)(C(CC2=CC(F)=CC(F)=C2)C(O)CNCC2=CC=CC(C#C)=C2)CC(C(N)=O)=C1 ?",
"input": "",
"output": " C35H39F2N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCSCN1C2=CC=CC=C2C(=O)N(C(C)C)S1(=O)=O ?",
"input": "",
"output": " C14H20N2O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC(=O)C(CC1=CC=CC=C1)NC1=CC(C2=CC=C(C=NOC3=CC=CC=C3)C=C2)=NC=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C27H24N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(ON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[N+]3=CC=C4N=C(N)OC4=C3)CSC12)C1=C(Cl)SC(N)=N1)C(=O)O ?",
"input": "",
"output": "Sure. C22H20ClN8O8S2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(=O)CCCC(=O)N(C)N , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C7H14N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=C(C2CN(C(C)C(=O)O)C(=O)C2CC(=O)CC2=CC=C(F)C=C2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C23H24FNO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=NC(=N)C1=CC=CC(C(F)(F)F)=C1)NC(=O)C1=CC(N2CCCCC2)=CC=C1NC(=O)C1=CC=CC(C(=O)N(C)CCN2CCOCC2)=C1 into molecular formula.",
"input": "",
"output": " C37H42F3N7O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)N1C=CC2=C1[NH+]=C(N)NC2=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C9H13N4O+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC(CN(C)C)=CC=C1NC1=NC=C(Cl)C(NC2=CC=CC=C2P(C)(C)=O)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C22H27ClN5O2P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1CC(OC2CC(OC(C)(C)C)C2)CCN1CCOC(C)(C)C into molecular formula.",
"input": "",
"output": " C20H39NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=C(F)C1=C(C=CC)CN(C(C(=O)N2CCCC2C=O)C(C)C)C1=O ?",
"input": "",
"output": " C19H25FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CC(=O)OCOC(CCOC1=CC=C2C=C(C3=CC=C(CCCCC)C=C3C(F)(F)F)C(=O)OC2=C1)CCOC1=CC=C2C=C(C3=CC=C(CCCCC)C=C3C(F)(F)F)C(=O)OC2=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C51H50F6O9 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN;NC1=NC(C2=C(C(F)F)NN=C2)=CC(N2CCCC2)=N1 ?",
"input": "",
"output": "Sure. C13H19F2N7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=C;OC1CCOCC1 ?",
"input": "",
"output": "The molecular formula is C7H14O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation N#CC(CBr)S(=O)(=O)C1=CC=C(I)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C9H7BrINO2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1=C(C)C(C)=C(N(OC(C)C)P(O)(O)=S)S1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H18NO3PS2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule COCN(C)S(N)(=O)=O ?",
"input": "",
"output": " C3H10N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)SCC1=C(C(=O)O)N2C(=O)C(NC(=O)CC3=CC=CC=C3)C2SC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C18H18N2O5S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCNC(=O)C1=CC=CC(CNC)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C12H18N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(C)OC(=O)NCC(=O)NC(C)(NS(=O)(=O)C1=CC=CC=C1)C(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H23N3O7S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation NCCCCC(Cl)C(=O)Cl represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C6H11Cl2NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCCCCCCCC=CC(CC)(CC(N)=O)C(=O)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H33NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC1=CC2=C(C3=CC=CC4=CC=CC=C34)C=CC=C2[CH-]1;[CH2-]CCC;[CH2-]CCC;[Ti+3] ?",
"input": "",
"output": "The molecular formula is C29H35Ti .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " N=C(N)N(N=C(N)N)OS(=O)(O)=S is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C2H8N6O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCOC(O)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO ?",
"input": "",
"output": " C44H90O22 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C=C(CSC#N)SC#N is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C5H4N2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code OCC1=CC2=C(C=N1)OC=CO2 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C8H7NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CP(=O)(O)OOC1=CC=CC=C1CO ?",
"input": "",
"output": " C8H11O5P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(C1=CC=CC=C1)C1(C(=O)C2=CC=CC=C2)C=CC=CC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H16O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN1CCN(C2=CC=C(N3CN=C(Cl)C4=C3C=CS4)C=C2)CC1 .",
"input": "",
"output": " C17H19ClN4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCOC(=O)C1=C(C(N)=O)CCCC1 .",
"input": "",
"output": " C10H15NO3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=C(O)C1=CC(SC2=CC=CC=C2)=C(C(=O)O)C=C1NC1=CC=C(Cl)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H14ClNO4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=S(=O)(OC1=CC=C2N=CNC2=C1)C1=CC=C(N2C=CN=C2)C=C1 ?",
"input": "",
"output": "Sure. C16H12N4O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1(N)C=CC(CC)(NN(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 ?",
"input": "",
"output": "Sure. C22H27N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCC(=CCC(C)C)C(C)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C ?",
"input": "",
"output": "The molecular formula is C29H46O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=CC=C(S(=O)(=O)OC2=CC(C)=NN2C2=CC=C(C(=O)O)C=C2)C=C1 ?",
"input": "",
"output": " C18H16N2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCC1=NC2=C(N)N=C(C)C=C2N1CCOCCC(C)(C)C(N)=O ?",
"input": "",
"output": " C18H29N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCC1(C(OC)(C(=O)[O-])C(F)(F)F)C=CCC(C)(C)C1SC1=NC(OC)=CC(OC)=N1 ?",
"input": "",
"output": " C22H30F3N2O5S- ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCCCOOC(C)(CCC(=O)[O-])C(C)(C)C(=O)[O-] ?",
"input": "",
"output": " C13H22O6-2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COC1=CC=C(CC2=C(CC3=CC=C(OC)C=C3)N3C(OC(C)C)=CSC3=N2)C=C1 .",
"input": "",
"output": " C24H26N2O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(NCCO)C1=CC2=CC=CC=C2N1S(=O)(=O)NC1CC1 into molecular formula.",
"input": "",
"output": " C14H17N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)S(=O)(=O)C1=CC2=C(C=NN2)C=C1C1(N)C=CNC(N)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C14H18N6O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC(=O)NC1CCC(Cl)C1Cl ?",
"input": "",
"output": " C6H10Cl2N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC1=CC=C(N2C3=CC=CC=C3C3=CC(N)=C(C)N=C32)C(C)=C1 into molecular formula.",
"input": "",
"output": " C20H19N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC=COOC=C([O-])O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C5H7O4- .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC(=O)C1C(OCC2=CC=CC=C2)CC(C)N1C(=O)OCC1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C22H25NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code NC1=NC=CC(SC2=CN=C(OC3CCC(N)C3)N3C=CN=C23)=C1Cl , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H17ClN6OS .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1CN(C(C)COC2=CC=C(N3C=CC(NC(=O)N4CCN(C(=O)C(C)(C)N)CC4)=NC3=O)C=C2)CC1CN . Can you tell me?",
"input": "",
"output": "Sure. It's C28H42N8O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCCCCCCOC1=CC=CC=C1C(=O)NC1=CC=C(C(=O)OCC[N+]2(C)CCCC2)C=C1 ?",
"input": "",
"output": "The molecular formula is C29H41N2O4+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)C1=CC=C(OP(N2C=CC=C2)N2C=CC=C2)C(C2=C(C(C)(C)C)C(C(C)(C)C)=CC=C2OP(N2C=CC=C2)N2C=CC=C2)=C1C(C)(C)C ?",
"input": "",
"output": "Sure. C44H56N4O2P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN1CCN(C2=CC(C(=O)NC3CCC4=NC=CN4C3)=CC=N2)CC1 ?",
"input": "",
"output": "Sure. C18H24N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1CC(NC(=O)NCC(=O)NC(C)(C)C)=NO1 , what would be its molecular formula?",
"input": "",
"output": "It is C11H20N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for O=C(CC1CCCCC1)N1CCC23OCC(C4=CC=CC=C4)N2C(=O)CC13 .",
"input": "",
"output": " C22H28N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN(C)C1=CC(C(N)=O)=C2C=CC=CC2=N1;O=CO , what would be its molecular formula?",
"input": "",
"output": "It is C13H15N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC=CC=CN(C)SC into molecular formula.",
"input": "",
"output": " C7H13NS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC(=O)C1CN(C(=O)C2CCN(C(=O)C3=CC=C(NC4=NC=CN5C(I)=CN=C45)C=C3Cl)CC2)CCN1C(=O)OC(C)(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C30H35ClIN7O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC(N2N=CN=C2C)=C2C=CC=C(OCC3=C(Cl)C=C(F)C=C3C(C)N)C2=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C22H21ClFN5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC(=O)C1=CC=C2C(=C1)N=C(NC1=NC3=CC(F)=C(C(F)(F)F)C=C3O1)N2C ?",
"input": "",
"output": " C19H14F4N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CC=C(C2=CN3C=C(F)C=NC3=N2)C=C1NC(=O)C1=CC=CC=C1C , what would be its molecular formula?",
"input": "",
"output": "It is C21H17FN4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(C1CCCO1)N1CCC2=C(C1)C1=CC=C(Cl)C(Cl)=C1N2 ?",
"input": "",
"output": " C16H16Cl2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCC1CC2=CC(OC)=CC=C2C(C2=NN(C)C=C2)=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C18H23N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)(C)OC(=O)NC1CCC2=CC=CC3=C2N(C1=O)C(C(=O)NC(CCC(N)=O)COC1=CC=CC(CCCC(N)=O)=C1Cl)C3 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C33H42ClN5O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC1=CC=C(N2CCC3(CCNC3=O)CC2)C=N1 ?",
"input": "",
"output": " C13H18N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " [N-]=[N+]=NCCOCCOCCOCCNC(=O)C1=CC=C(C2=C3C=C4CCC[N+]5=C4C(=C3OC3=C2C=C2CCCN4CCCC3=C24)CCC5)C(C(=O)[O-])=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C41H46N6O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C1=CCC2=C(C3=CC=CC=C3)C(C3=CC=CC(C4=CC=CC(C5=NC(C6=CC=C(C7=CC=CC=C7)C=C6)=NC(C6=CC=C(C7=CC=CC=C7)C=C6)=N5)=C4)=C3)=NC(=C2)C=C1 .",
"input": "",
"output": " C55H38N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC=C(C)C(N(C2=CC=C3C=C4C(=CC3=C2)OC2=C4C=C(C(C)C)C3=C2OC2=CC4=CC(N(C5=CC=CC=C5C)C5=CC(C)=CC=C5C)=CC=C4C=C23)C2=CC=CC=C2C)=C1 .",
"input": "",
"output": " C59H50N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CN(C)C1=CC(NC2=NC=C3C(=O)N4CC=CCCCN5C(=O)COC6=CC=C(C=C65)N4C3=N2)=CC2=C1C=CN2C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C30H30N8O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1CCC2(CC(OC(=O)C3=CC=CC=C3)C2)O1 ?",
"input": "",
"output": "The molecular formula is C15H18O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC(C)(C)OC(=O)NCC1CNCC1CNC(=O)OC(C)(C)C ?",
"input": "",
"output": " C16H31N3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(C1=CC=NN1)N1CCOC(CN2CCC(O)CC2)C1C1=CC=CC=C1 ?",
"input": "",
"output": " C20H26N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)CCCC(C)CCOC1=CC=C[N+](CC(O)(P(=O)([O-])O)P(=O)(O)O)=C1 .",
"input": "",
"output": " C17H31NO8P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC1=NC(NCCC2=CC=C(OC3=CC=CC=C3)C=C2)=NC(C2=CC(Cl)=CC=C2CO)=N1 into molecular formula.",
"input": "",
"output": " C24H22ClN5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(=O)NC(CS)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(CC1=CNC2=CC=CC=C12)C(=O)NC(C(=O)NC(CS)C(=O)NC(CC1=CC=C(O)C=C1)C(=O)NC(CC1=CNC2=CC=CC=C12)C(=O)NC(CC1=CN=CN1)C(=O)NC(C(=O)NC(CC1=CC=CC=C1)C(=O)NCC(=O)NCCC(=O)NC(CCCCNC(=O)COCC(=O)NCCCCC(NC(=O)CCNC(=O)CNC(=O)C(CC1=CC=CC=C1)NC(=O)C(NC(=O)C(CC1=CN=CN1)NC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(CC1=CC=C(O)C=C1)NC(=O)C(CS)NC(=O)C(NC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(CS)NC(C)=O)C(C)C)C(C)O)C(=O)O)C(=O)O)C(C)O)C(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C166H212N38O43S4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)C1=CC=C2CC3(C)CCCC4C3C(CCC4(C)C)C2=C1 ?",
"input": "",
"output": "Sure. C24H36 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(CN(N)C2=CC(C)=CC(B(O)O)=N2)C=C1 .",
"input": "",
"output": " C14H18BN3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(C)(C)C1=CC=CC(C2COC2)=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H17NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of Cl;O=C(O)CC1CCNCC1C1CC1 ?",
"input": "",
"output": "Sure. C10H18ClNO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(C1=CSC=N1)N1CCOC2(CCN(CC3CCCC3)CC2)C1;O=C(O)C(F)(F)F into molecular formula.",
"input": "",
"output": " C20H28F3N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCN(C)C(=O)C1=CN=C(C2=NOC3=CC(C4=CC=CN=C4)=CC=C23)S1;O=C(O)C(F)(F)F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C21H17F3N4O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COCCC1(C(=O)NC2CCOCC2)CNC(=O)CCCN(CC=C(C)C)CCCNC(=O)COC2=CC=C(C=C2)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C32H50N4O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCC1(CO)CCN(C2=CC(OC)=NC(N)=N2)CC1O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H24N4O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)CC(NC(=O)C(CCC(N)=O)NC(=O)C1=CC=C(Cl)C=C1OCC(N)CC1=CC=CC=C1)C(=O)O ?",
"input": "",
"output": " C27H35ClN4O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CNCC(C2CCN(C)CC2)=N1 .",
"input": "",
"output": " C11H19N3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)C1C(=O)NCC12CCC2 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H17NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(=O)N1C(=O)C(=COC2OC(=O)C(C)=C2C)C2C3=CC=CC=C3CC21 .",
"input": "",
"output": " C20H19NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC(S(C)(=O)=O)=CC=C1NCC#CC1=CC2=C(NC3CCN(CC(O)COCF)CC3)C=CC=C2N1CC(F)(F)F ?",
"input": "",
"output": " C30H36F4N4O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C1=CC(C2=CC=C(C3=CC=C(N(C4=CC=C(C5=CC=CC(N6C7=CC=CC=C7C7=CC=CC=C76)=C5)C=C4)C4=CC=C(C5=CC=CC6=C5C5=CC=CC=C5O6)C=C4)C=C3)C=C2)=CC(C2=CC=C3C=CC=CC3=C2)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C70H46N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COC1=CC=C2CN(C(=O)C(OC3CCCCC3)C3=CC=CC=C3)CCC2=C1OCC1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C31H35NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COCOC1=CC(C2CC3(O)N=C(SC)NC(=O)C3CO2)=C2C(Br)=CC=CC2=C1 ?",
"input": "",
"output": " C20H21BrN2O5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC=C(C2=CCN(C3=C(C#N)C(O)N(C)C4=CC=CC=C34)CC2)C=C1OC .",
"input": "",
"output": " C24H25N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN(CC)CCN1C=C(CNC)C=N1 .",
"input": "",
"output": " C11H22N4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)(C)OC(=O)NC1CCCN(C2=CC=CN=N2)C1;Cl;NC1CCCN(C2=CC=CN=N2)C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C23H37ClN8O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COCC(C)C1=CC(C2=CC=NN2)=CC2=NC(N)=NC(N)=C12 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H18N6O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=CC=CC(=C(OC)C(C)CC)C(C)NC(=C)C=CN1N=CC(C(=O)OCC)=C1CCC . Can you tell me?",
"input": "",
"output": "Sure. It's C26H39N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CN(C1=CC=CC(F)=C1)C1=NC(Cl)=NC2=CC([N+](=O)[O-])=CC=C12 . Can you tell me?",
"input": "",
"output": "Sure. It's C15H10ClFN4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(CNC2=NC(C3=CC=CN=C3)=NC3=C2C=NN3C)C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H18N6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)C=CC1=CC=C(O)C2=C1C(C(=O)OC(CC1=CC=C(O)C(O)=C1)C(=O)O)C(C1=CC=C(O)C(O)=C1)O2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C37H32O16 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCCCCCC1=NC2=CC=CC=C2[NH2+]1 into molecular formula.",
"input": "",
"output": " C16H25N2+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(CCCCCN1C(=O)C2=CC=CC=C2C1=O)[N+](=O)[O-] ?",
"input": "",
"output": "Sure. C16H20N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NC1=NC=C(C2=CC=NC(C(=O)O)=C2)C=N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C10H8N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NC(=O)C1=C(F)C=CC(OC(COC(=O)C2=CC=CC=C2)C(=O)CO)=C1F ?",
"input": "",
"output": "Sure. C18H15F2NO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCC(O[Si](CC)(CC)CC)C(C)C1OC1CC(C)(C=CC=C(C)C1OC(=O)CC(O[Si](CC)(CC)CC)CCC(C)(OC)C(OC(=O)N2CCNCC2)C=CC1C)O[Si](CC)(CC)CC ?",
"input": "",
"output": " C52H98N2O9Si3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC2=NN(C3=CC4=C(C=C3O)OC(C)(C)O4)N=C2C=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H15N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule NNC(=O)CC1=CC=C(C(F)F)C=N1 .",
"input": "",
"output": " C8H9F2N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC;CN1C(=O)C(NC(=O)C2=NC=C(Cl)C(C3=CC=C(F)C=C3F)=N2)COC2=CC=C(C3=CNN=C3)C=C21 ?",
"input": "",
"output": "Sure. C26H23ClF2N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CC(=C)C1=CC(C)=NC=C1F;CC .",
"input": "",
"output": " C12H16FN ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(N(N)CCC2=CC=CC=C2)C=C1;Cl ?",
"input": "",
"output": " C15H19ClN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule NC=C(N)C1=CC=CC=C1F ?",
"input": "",
"output": " C8H9FN2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C1NC2(CO1)CC(C(=O)N1CCC(C3=CC=C4C=CC=CC4=C3)CC1)C2 . Can you tell me?",
"input": "",
"output": "Sure. It's C22H24N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C ?",
"input": "",
"output": " C73H142O17P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C into molecular formula.",
"input": "",
"output": " C80H156O17P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC ?",
"input": "",
"output": " C85H166O17P2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=C(CCCCCCCC=CCCCCCCCC)OC(C)C(=O)OC(C)C(=O)OC1=CCC2(O)C3CC4=CC=C(CO)C5=C4C2(CCN3C)C1O5;CC(=O)C(C)OC(=O)CCC(=O)OC1=CCC2(O)C3CC4=CC=C(CO)C5=C4C2(CCN3C)C1O5;CC(=O)CC(OC(=O)CCC(=O)OC1=CCC2(O)C3CC4=CC=C(CO)C5=C4C2(CCN3C)C1O5)C(=O)O;O=CC(F)(F)F;O=CC(F)(F)F;O=CC(F)(F)F .",
"input": "",
"output": " C102H128F9N3O29 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)(C)OCC1(CO)COC1;CC(C)(C)OCC1(O)COC1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H34O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(OC1=CC=C([S+](C2=CC=C(C(C)(C)C)C=C2)C2=CC=C(C(C)(OCCC34CC5CC(C3)C(=O)C(C5)C4)OCCC34CC5CC(C3)C(=O)C(C5)C4)C=C2)C=C1)C(F)(F)S(=O)(=O)[O-];CC(OC1=CC=C([S+](C2=CC=C(C(C)(C)C)C=C2)C2=CC=C(C(C)(OCCC34CC5CC(C3)C(O)C(C5)C4)OCCC34CC5CC(C3)C(O)C(C5)C4)C=C2)C=C1)C(F)(F)S(=O)(=O)[O-];CC(OC1=CC=C([S+](C2=CC=C(C(C)(C)C)C=C2)C2=CC=C(C(C)(OCCC34CC5CC(CC(O)(C5)C3)C4)OCCC34CC5CC(CC(O)(C5)C3)C4)C=C2)C=C1)C(F)(F)S(=O)(=O)[O-];CC1(C)COC(C)(C2=CC=C([S+](C3=CC=CC=C3)C3=CC=C(OC(=O)C(F)(F)S(=O)(=O)[O-])C=C3)C=C2)O1;CC1(C2=CC=C([S+](C3=CC=CC=C3)C3=CC=C(OC(=O)C(F)(F)S(=O)(=O)[O-])C=C3)C=C2)OCCO1 .",
"input": "",
"output": " C203H238F10O38S10 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CNC(=O)C1=CC(OC)=CC(N(CCN2C(=O)C3=CC=CC=C3C2=O)C2=CC=C3N=CC(C4=CN(C)N=C4)=NC3=C2)=C1;COC1=CC(OC)=CC(N(CC2=CC=CC(Cl)=C2)C2=CC=C3N=CC(C4=CN(C)N=C4)=NC3=C2)=C1;COC1=CC(OC)=CC(N(CC2=CC=CC=C2Cl)C2=CC=C3N=CC(C4=CN(C)N=C4)=NC3=C2)=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C85H75Cl2N17O8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CS(=O)(=O)OC1CCCC1OS(C)(=O)=O;Cl;Cl;NC1CCCC1N;OC1CCCC1O;[N-]=[N+]=NC1CCCC1N=[N+]=[N-] .",
"input": "",
"output": " C22H46Cl2N8O8S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CN(CCC(=O)NC(CC1=CC=C(OCC2=CC=CC=C2)C=C1)C1=CC=CC=C1)C(=O)OC(C)(C)C into molecular formula.",
"input": "",
"output": " C30H36N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C1=CC=C(C2=CC=C(C3=C4C(C5=CC=CC=C5)=C5C=C(C6=CC=CC=C6)C=CC5=C(C5=CC=C(C6=CC=CC=C6)C=C5)C4=C(C4=CC=CC=C4)C4=CC(C5=CC=CC=C5)=CC=C34)C=C2)C=C1;CF;CF;CF;CF;FC1=CC=C(C2=CC=C(C3=C4C(C5=CC=CC=C5)=C5C=C(C6=CC=C(F)C=C6F)C=CC5=C(C5=CC=C(C6=CC=C(F)C=C6F)C=C5)C4=C(C4=CC=CC=C4)C4=CC(C5=CC=C(F)C=C5F)=CC=C34)C=C2)C(F)=C1;FF;FF;FF;FF;FF;FF;FF;FF , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C136H92F28 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation NC(=NN1CCCC1)NC(=O)C1=CC=C(Cl)C=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C12H15ClN4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C)(C)C1=CC=C2C=CCC2=N1 ?",
"input": "",
"output": " C12H15N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule BrC1=C2C=CC=CC2CC=C1C#CC1=CC=C2C=CC=CC2=C1;C1=CC=C2C=C(C3=C4C(=C(C5=CC=CC6=CC=CC=C56)C5=CC=C6C=CC=CC6=C45)C4=C3C=CC3=CC=CC=C43)C=CC2=C1;CC1=C(C#CC2=CC=CC3=CC=CC=C23)C=CC2=CC=CC=C12 ?",
"input": "",
"output": " C89H57Br ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule O=C(CC1=CC=C(NC(=O)C2=C(C(=O)NCC3CCCO3)NC=N2)C=C1)C1=CC=C(F)C=C1Cl into molecular formula.",
"input": "",
"output": " C24H22ClFN4O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of ClC1=CC=CC2=C1C1=C(C3=CC=C4C5=CC=CC=C5C5=CC=CC=C5C4=C3)C=CC=C1O2;O=S(=O)(OC1=CC=CC2=C1C1=C(Cl)C=CC=C1O2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F;[W];[W] . Can you tell me?",
"input": "",
"output": "Sure. It's C46H23Cl2F9O5SW2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C1=CC=C([S+](C2=CC=CC=C2)C2=CC=CC=C2)C=C1;ClC1=CC=C([S+](C2=CC=CC=C2)C2=CC=CC=C2)C=C1;O=C(OCCCCCl)C(F)(F)S(=O)(=O)[O-];O=C(OCCCCCl)C(F)(F)S(=O)(=O)[O-] into molecular formula.",
"input": "",
"output": " C48H45Cl3F4O10S4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC1OC(C)(C)OC1C(OC)C(O)C1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H24O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C1=CC=C(C2=CC=C3C=C4C5=C(C=CC4=CC3=C2)CC2=CC=CC=C25)C=C1 into molecular formula.",
"input": "",
"output": " C27H18 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of O=C(CCC1=CC=C(COC2=CC=CC=C2Cl)C=C1)C1CCCN1S(=O)(=O)C1=CC=C(Cl)S1 . Can you tell me?",
"input": "",
"output": "Sure. It's C24H23Cl2NO4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(O)C1=CC=C(CC2(C3=CC4=CC=CC=C4C3)CC3=CC=CC=C3C2O)C=C1;O=C(O)C1=CC=C(CC2(C3=CC4=CC=CC=C4C3)CC3=CC=CC=C3C2O)C=C1 ?",
"input": "",
"output": "The molecular formula is C52H44O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC=C(CC(=O)CC2=CC=CC3=CN=CN23)C=C1 ?",
"input": "",
"output": "The molecular formula is C17H16N2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C=CCCC(=O)N1CC(OC(=O)N2CC3=CC=CC=C3C2)CC1C(=O)O;C=CCCCCCCC(NC(=O)C1CC(OC(=O)N2CC3=CC=CC=C3C2)CN1C(=O)CCC=C)B1OC2CC3CC(C3(C)C)C2(C)O1 ?",
"input": "",
"output": "The molecular formula is C57H76BN5O11 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C1=CCC=C1;Cl[W]Cl ?",
"input": "",
"output": " C5H6Cl2W ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C1=CC2=C3SC4=[N+](CC5=CC=NC=C54)C3=CN2N=C1 ?",
"input": "",
"output": " C14H9N4S+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CN1C=C(C2=CC=C3C=NC(CC(=O)C4CCN(C5CCC5)C4)=CC3=C2)C=N1 .",
"input": "",
"output": " C23H26N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC1OC(N2C=C(SC)C3=CC=CC=C32)C(C)C(C)C1C;CCC1OC(N2C=CC3=CC=CC=C32)C(C)C(C)C1C;CSCl ?",
"input": "",
"output": " C38H55ClN2O2S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C1=CC=C(C2=NC(C3=CC=CC4=CC=CC=C34)=C3C4=CC=C(C5=CC=C(C6=CC=C7C=CC=CC7=C6)C=C5)C=C4C4(C5=CC=CC=C5C5=CC=CC=C54)C3=N2)C=C1;C1=CC=C(C2=NC3=C(C(C4=CC=CC5=CC=CC=C45)=N2)C2(C4=CC=CC=C4C4=CC=CC=C42)C2=CC(C4=CC=C(C5=CC=C6C=CC=CC6=C5)C=C4)=CC=C23)C=C1;O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C2C3=CC=CC=C3C3(C2=C1)C1=CC=CC=C1C1=C(C2=CC=CC=C2)N=C(C2=CC=CC=C2)N=C13;O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C2C3=CC=CC=C3C3(C2=C1)C1=CC=CC=C1C1=NC(C2=CC=CC=C2)=NC(C2=CC=CC4=CC=CC=C24)=C13;O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C2C3=CC=CC=C3C3(C2=C1)C1=CC=CC=C1C1=NC(C2=CC=CC=C2)=NC(C2=CC=CC=C2)=C13 .",
"input": "",
"output": " C255H163N10O3P3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC(CC1=CNC2=CC=CC=C12)C(=O)O;O=C(O)C1CC2=C(NC3=CC=CC=C23)C(C2=CC=C([N+](=O)[O-])C=C2)N1;O=CC1=CC=C([N+](=O)[O-])C=C1 into molecular formula.",
"input": "",
"output": " C36H32N6O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of C1=CSC([I+]C2=CC=CC3=CC=CC=C23)=C1 ?",
"input": "",
"output": "The molecular formula is C14H10IS+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC(O)CC1=C(C2=CC=CC=C2)N=CN1CC1=CC=C2CC(=O)CC2=C1;CC(O)CC1=C(C2=CC=CC=C2)N=CN1CC1=CC=CC2=C1NC(=O)C2;NC(=O)CC1=C(CC2=CC=CC=C2)N=CN1CC1=CC=C2CC(=O)NC2=C1;NC(=O)CC1=C(CC2=CC=CC=C2)N=CN1CC1=CC=CC2=C1CC(=O)C2;NC(=O)CC1=C(CC2=CC=CC=C2)N=CN1CC1=CC=CC2=C1OC(=O)N2;NC(=O)CCC1CN(C2=CC=CC=C2)CCN1C1=CC=C2CC(=O)NC2=C1;NC(=O)CCC1CN(C2=CC=CC=C2)CCN1C1=CC=C2NC(=O)CC2=C1;NC(=O)CCC1CN(C2=CC=CC=C2)CCN1C1=CC=CC2=C1CC(=O)C2 ?",
"input": "",
"output": "The molecular formula is C170H175N27O17 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CN(CC1CC2=C(C=CC=C2N2CC3CCN(C)C3C2)CN1)C1CCCC2=CC=CN=C21;CN(CC1CC2=C(C=CC=C2N2CC3CCN(C)C3C2)CN1)C1CCCC2=CC=CN=C21;CN(CC1CC2=C(C=CC=C2N2CC3CCN(C)C3C2)CN1)C1CCCC2=CC=CN=C21;CN1CC2CN(C3=CC=CC4=C3CC(CN(C)C3CCCC5=CC=CN=C53)NC4)CC2C1;CN1CC2CN(C3=CC=CC4=C3CC(CN(C)C3CCCC5=CC=CN=C53)NC4)CC2C1 ?",
"input": "",
"output": " C135H185N25 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC#CC1(O)C2CC2C2C3C4CC4C4=CC(=O)CCC4(C)C3CCC21C into molecular formula.",
"input": "",
"output": " C24H30O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C1=CC=C(C2=CC=C(C3=CC=C4C(=C3)C3=C5C=CC=CC5=CC=C3N4C3=CC=C(C4=CC=CN=C4)C=N3)C=N2)N=C1;C1=CN=CC(C2=CC=C(C3=CC=C4C(=C3)C3=C5C=CC=CC5=CC=C3N4C3=CC=C(C4=CC=CN=C4)C=N3)N=C2)=C1;C1=CN=CC(C2=CC=C(N3C4=CC=C(C5=CC=C6C=CC=CC6=N5)C=C4C4=C5C=CC=CC5=CC=C43)N=C2)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C107H68N14 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1(OC(=O)COC(=O)C2=CC=C(C)C([S+]3C4=CC=CC=C4C4=CC=CC=C43)=C2)CCCC1 ?",
"input": "",
"output": "Sure. C29H29O4S+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=CC(=O)CC1=CC=CC(C)=C1NC1=CC2=C(NCC3=CN(C)N=C3)N=C(C3=C(Cl)C(OC)=CC(OC)=C3Cl)C=C2C=N1 ?",
"input": "",
"output": " C32H30Cl2N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCN(CC)C(=O)N1CCN(CCN2CCC3=CC=CC=C32)CC1;CCN(CC)S(=O)(=O)N1CCN(CCN2CCC3=CC=CC=C32)CC1;O=S(=O)(C1=CC=C(OC(F)(F)F)C=C1)N1CCN(CCN2CCC3=CC=CC=C32)CC1 .",
"input": "",
"output": " C58H84F3N11O6S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of N=C(N)C1=CC=C2C=C(C(=O)NC3=CC=C(NCC(=NC=O)C(=O)O)C=C3)N=CC2=C1 ?",
"input": "",
"output": "Sure. C21H18N6O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C=C(C)C(=O)OC1(C(C)(C)C)CCC(C)(O)CC1;C=C(C)C(=O)OC1(C(C)(C)CC)CCC(C)(O)CC1;C=C(C)C(=O)OC1(CC)CCC(C)(O)CC1;C=C(C)C(=O)OCC(=O)OC1(C)C=CC(C)(O)CC1;C=CC1(OC(=O)COC(=O)C(=C)C)CCC(C)(O)CC1 ?",
"input": "",
"output": " C73H118O19 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC(=O)ON1C(=O)CCC1=O;CC(=O)ON1C(=O)CCC1=O;CC(=O)ON1C(=O)CCC1=O;CC(=O)ON1C(=O)CCC1=O;CC(=O)ON1C(=O)CCC1=O;CC(=O)ON1C(=O)CCC1=O;CNC(=O)CCNC(=O)C(C)(C)C1CN(C)CCN1C;CNC(=O)CCNC(=O)C(C)(C)C1CN(C)CCN1C;CNC(=O)CCNC(=O)C(C)(C)C1CN(C)CCN1C;CNC(=O)CCNC(=O)C(C)(C)C1CN(C)CCN1C;CNC(=O)CCNC(=O)C(C)(C)C1CN(C)CCN1C;CNC(=O)CCNC(=O)C(C)(C)C1CN(C)CCN1C into molecular formula.",
"input": "",
"output": " C120H210N30O36 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(CCCCNC(=O)COCCOCCNC(=O)COCCOCCCC(=O)CCC(NC(=O)CCCCCCCCCCCCCCCCC(N)=O)C(=O)O)C(C)=O . Can you tell me?",
"input": "",
"output": "Sure. It's C45H82N4O12 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1C=CC2=C(COCC[Si](C)(C)C)C=C(C(=O)O)C=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C16H23NO3Si .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C;CC(=O)C1=C(C)N(C)N=C1C;CC(=O)C1=C(C)N(C)N=C1C , what would be its molecular formula?",
"input": "",
"output": "It is C17H28N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)C(NC(=O)OCC1=CC=CC=C1)C(=O)CC1CC2=CN(CCNC(=O)C1=O)N=N2 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C22H27N5O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C1=CC=C(C2=NC(C3=CC=CC=C3)=NC(N3C4=CC=CC=C4C4=CC(C5=CC=C6C(=C5)C5=CC=CC=C5N6C5=CC=CC=C5)=CC=C43)=N2)C=C1;FC1=C(F)C(F)=C(C2=CC(C3=CC=CC=C3)=CC(N3C4=CC=CC=C4C4=CC(C5=CC=C6C(=C5)C5=CC=CC=C5N6C5=CC=CC=C5)=CC=C43)=C2)C(F)=C1F;N#CC1=CC=CC=C1C1=CC(C2=CC=CC=C2C#N)=CC(N2C3=CC=CC=C3C3=CC(C4=CC=C5C(=C4)C4=CC=CC=C4N5C4=CC=CC=C4)=CC=C32)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C143H86F5N11 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code N#CC1=CC=C2C3=CC=CC=C3C3(C2=C1)C1=CC=CC=C1C1=C3C=C(C2=CC=C(C3=NC(C4=CC=CC=C4)=NC(C4=CC=CC=C4)=N3)C=C2)C2=CC=CC=C12 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C51H30N4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)C1=NC(CN(C)C(=O)NC(C(=O)CC(CCC(CC2=CC=CC=C2)NC(=O)OCC2=CN=CS2)CC2=CC=CC=C2)C(C)O)=CS1;CC(C)C1=NC(CN(C)C(=O)NC(C(=O)CC(CCC(CC2=CC=CC=C2)NC(=O)OCC2=CN=CS2)CC2=CC=CC=C2)C(C)OC(C)(C)C)=CS1;CC(C)C1=NC(CN(C)C(=O)NCCC(=O)CC(CCC(CC2=CC=CC=C2)NC(=O)OCC2=CN=CS2)CC2=CC=CC=C2)=CS1;CC(C)C1=NC(CNC(=O)N(C)C(C(=O)CC(CCC(CC2=CC=CC=C2)NC(=O)OCC2=CN=CS2)CC2=CC=CC=C2)C(C)C)=CS1;CCC(NC(=O)N(C)CC1=CSC(C(C)C)=N1)C(=O)CC(CCC(CC1=CC=CC=C1)NC(=O)OCC1=CN=CS1)CC1=CC=CC=C1;O=C(CC(CCC(CC1=CC=CC=C1)NC(=O)OCC1=CN=CS1)CC1=CC=CC=C1)OCC1=CN=CS1 ?",
"input": "",
"output": " C218H274N28O26S12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COCC1=NN=C2C3=CC(C)=CC=C3N3C=NC(C#CC4=CC=C(OC)C(C)=N4)=C3CN12 ?",
"input": "",
"output": " C24H22N6O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C;C;CC(=CCO)C1=CC=C2C(=C1)C(C)=CCC2(C)C;CC(C=CC1CC1(C)C1=CC=C2C(=C1)C(C)=CCC2(C)C)=CC(=O)O;CC1(C)CCC(=O)C2=CC(Br)=CC=C21;CC1=CCC(C)(C)C2=CC=C(Br)C=C12;CC1=CCC(C)(C)C2=CC=C(C3(C)CC3C=O)C=C12;CC1=CCC(C)(C)C2=CC=C(C3(C)CC3CO)C=C12;CC1=CCC(C)(C)C2=CC=C(C3(C)CC3CO)C=C12;CC1OCOC1C;CC=C(C)C=CC1CC1(C)C1=CC=C2C(=C1)C(C)=CCC2(C)C;CC=C(C)CC;[Na+];[OH-] .",
"input": "",
"output": " C155H209Br2NaO10 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CN1CCN(CCCC(=O)C2=CC=C(C(=O)NC3=CC(C4=CC=CN=C4)=CC=C3N)C=C2)CC1;CN1CCN(CCCC(=O)C2=CC=C(C(=O)NC3=CC(C4=CC=CN=C4)=CC=C3NC(=O)OC(C)(C)C)C=C2)CC1 ?",
"input": "",
"output": " C59H70N10O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=NN(C2=CC(Cl)=C(S(=O)(=O)O)C=C2Cl)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O;CC1=NN(C2=CC=C(S(=O)(=O)CCO)C=C2)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O;CC1=NN(C2=CC=C(S(=O)(=O)O)C=C2)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O;CC1=NN(C2=CC=C(S(N)(=O)=O)C=C2)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O;CC1=NN(C2=CC=CC(Cl)=C2)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O;CC1=NN(C2=CC=CC=C2)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O;CC1=NN(C2=CC=CC=C2Cl)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O;O=C(O)C1=NN(C2=CC=C(S(=O)(=O)O)C=C2)C(=O)C1N=NC1=CC2=C(S(=O)(=O)O)C=C(SOOO)C=C2C=C1S(=O)(=O)O , what would be its molecular formula?",
"input": "",
"output": "It is C162H127Cl4N33O96S29 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C=CC1(O)C(C)(C)CCCC1(C)O)=CC(=O)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C15H24O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC1=CC=NC=C1;CCC1=CC=NC=C1;CCC1=CC=NC=C1;CCC1=CC=NC=C1;[Ni] represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C28H36N4Ni .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC#CC(CC(=O)O)C1=CC=C(OCC2=CC=C(OC)C=C2)C=C1;S .",
"input": "",
"output": " C20H22O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC;CC;CC;CC;CC;CC;CC1C[SiH](C)O[Si](C)(CCCCOCC2CO2)O[SiH](CC[SiH2]O[SiH2]O[SiH2]CC[SiH]2OC(C)C[Si](C)(CC[SiH2]O[SiH2]O[SiH2]CC[SiH]3OC(C)C[SiH](C)O[Si](C)(CCCCOCC4CO4)O3)O[Si](C)(CCCCOCC3CO3)O2)O1 ?",
"input": "",
"output": " C56H144O19Si15 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)C1=CC2=CC(Cl)=CC=C2O1;CC(C)C1=CC=C(C(C)(C)C)C=C1;CC(C)C1=CC=C(C(F)(F)F)C=C1;CC(C)C1=CC=C(C(F)(F)F)S1;CC(C)C1=CC=C(C2CCCO2)S1;CC(C)C1=CC=C(Cl)C=C1;CC(C)C1=CC=C(Cl)S1;CC(C)C1=CC=C(Cl)S1;CC(C)C1=CC=C(F)C=C1;CC(C)C1=CC=C(OC(F)(F)F)C=C1;CC(C)C1=CC=C(OS(=O)(=O)C(F)(F)F)N=C1;CC(C)C1=CC=CC(C(F)(F)F)=C1;CC(C)C1=CN=C(C(F)(F)F)S1;CC(C)C1=CSC(C(C)C)=N1;CC(C)C1=CSC(C(F)(F)F)=N1;CC(C)C1CCN(C(C)C)C1;CC(C)C1COC(C(C)C)C1;CC(C)N1C=C2C=CC=CC2=N1;CC(C)N1C=CC(C(F)(F)F)=N1;CC(C)N1C=CC(C2CCCCC2)=N1;CC1=CSC(C(C)C)=C1;CC1=NC(C(C)C)=CC=C1F ?",
"input": "",
"output": " C203H276Cl4F26N12O7S9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCCCCCCCCCCCCCCCCC(=O)C1=CSC2=CC=C(OCC)C=C12 , what would be its molecular formula?",
"input": "",
"output": "It is C30H48O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(C)(C)C(=O)OCCCS(=O)(=O)O;CCC(C)(C)C(=O)OCCCS(=O)(=O)[O-];CCC(C)C(=O)NC(C)(C)CS(=O)(=O)O;CCC(C)C(=O)NC(C)(C)CS(=O)(=O)[O-];CCC(C)C(=O)NC(C)(C)CS(=O)(=O)[O-];CCC(C)C(=O)OCCS(=O)(=O)O;CCC(C)C(=O)OCCS(=O)(=O)[O-];CCC(C)C1=CC=C(CS(=O)(=O)O)C=C1;CCC(C)C1=CC=C(CS(=O)(=O)[O-])C=C1;CCC(C)C1=CC=C(S(=O)(=O)O)C=C1;CCC(C)C1=CC=C(S(=O)(=O)[O-])C=C1;CCC(C)COCC(O)CS(=O)(=O)O;CCC(C)COCC(O)CS(=O)(=O)[O-];CCC(C)CS(=O)(=O)[O-];CCC(C)S(=O)(=O)[O-];[K+];[K+];[Na+];[Na+];[Na+];[Na+];[Na+];[Na+];[Na+] . Can you tell me?",
"input": "",
"output": "Sure. It's C126H230K2N3Na7O60S15 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCCCCCCCCCC1=CC=C([I+]C2=CC=CC=C2)C=C1;FP(F)(F)(F)F;[F-] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H34F6IP ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O;O;O;O=[N+]([O-])[O-];O=[N+]([O-])[O-];O=[N+]([O-])[O-];[Bi+3] , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be BiH6N3O12 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(=O)OC12COC1CC(C)C1(C)C(O)C(C)C3=C(C)C(O)CC(O)(C(OC(=O)C4=CC=CC=C4)C21)C3(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C31H42O8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCCC(CC(=O)C1CC(OCC2=CC=CC=C2)CN1C(=O)C(CC(=O)C1=CC=CC=C1[N+](=O)[O-])C1CCCCC1)C(=O)C(=O)CCC(=O)NC(C(=O)O)C1=CC=CC=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C46H53N3O11 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C;C;C=CCBr;C=CCC1=CC(C2=CC=C(O)C(CC=C)=C2)=CC=C1O;C=CCOC1=CC=C(C2=CC=C(OCC=C)C(CC=C)=C2)C=C1CC=C;O=CO[O-];[H-];[K+];[K+] ?",
"input": "",
"output": "Sure. C48H59BrK2O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCCCCCCCCCC(OCC1=CC=CC=C1)C(OCC1=CC=CC=C1)C(COC1OC(COCC2=CC=CC=C2)C(C)C(C)C1C)N=[N+]=[N-];CCCCCCCCCCCCCCC(OCC1=CC=CC=C1)C(OCC1=CC=CC=C1)C(COC1OC(COCC2=CC=CC=C2)C(C)C(C)C1C)NC(=O)CCCCCCCCCC(=O)C(F)(F)F;O=C(O)CCC(=O)C(F)(F)F represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C113H166F6N4O15 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C;CN(C(=O)C1=CC=CC=C1)S(C)(=O)=O;CN(C=O)S(C)(=O)=O;COC(=O)CC(C)CC(=O)OC;CS(=O)(=O)N1CCC(=O)CC1;CS(=O)(=O)N1CCCC1=O;CS(=O)(=O)N1CCN(CC=CC2=CC=CC=C2)CC1;O=CN(C1=CC=CC=C1)S(=O)[O-] ?",
"input": "",
"output": " C53H82N7O21S6- ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1C=C2C=CC(C)C(CCC(O)CC(O)CC(=O)ON)C2C(O)C1;CC1C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C2C(O)C1;CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(O)CC(=O)ON)C21;CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C21;CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(O)CC(=O)ON)C21;[H+] is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C112H178N3O26+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C;C=CC(=O)OC1=CC=C(C2COC(OCOC3=CC=C(OC(=O)C4OCC(C5=CC=C(OC(=O)C=C)C=C5)CO4)C=C3C(F)(F)F)OC2)C=C1;C=CC(=O)OC1CC=C(C2=CC=C(OCOC3=CC=C(OC(=O)C4=CC=C(C5=CCC(OC(=O)C=C)CC5)C=C4)C=C3C(F)(F)F)C=C2)CC1;C=CC(=O)OC1CCC(C2=CC=C(OCOC3=CC=C(OC(=O)C4=CC=C(C5CCC(OC(=O)C=C)CC5)C=C4)C=C3C(F)(F)F)C=C2)CC1;C=CC(=O)OCOC1=CC=C(C=CC(=O)OC2=CC=C(OC(=O)C=CC3=CC=C(OCOC(=O)C=C)C=C3)C(C(F)(F)F)=C2)C=C1;C=CC(=O)OCOC1=CC=C(C=CC(=O)OC2=CC=C(OC(=O)C=CC3=CC=C(OCOC(=O)C=C)C=C3)C(C(F)F)=C2)C=C1;C=CC(=O)OCOC1=CC=C(C=CC(=O)OC2=CC=C(OC(=O)C=CC3=CC=C(OCOC(=O)C=C)C=C3F)C(C(F)(F)F)=C2)C(F)=C1;C=CC(=O)OCOC1=CC=C(C=CC(=O)OC2=CC=C(OC(=O)C=CC3=CC=C(OCOC(=O)C=C)C=C3F)C(C(F)F)=C2)C(F)=C1;C=CC(=O)OCOC1=CC=C(CCC(=O)OC2=CC=C(OC(=O)C(C)C3=CC=C(OCOC(=O)C=C)C=C3)C(C(F)(F)F)=C2)C=C1;C=CC(=O)OCOC1=CC=C(CCC(=O)OC2=CC=C(OC(=O)C(C)C3=CC=C(OCOC(=O)C=C)C=C3F)C(C(F)(F)F)=C2)C(F)=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C335H355F31O88 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C;C1=CC(C2=CC=C(C3=CC=C4N=C(C5CCCN5)CC4=C3)C3=C2C2(CCCC2)CC3)=CC=C1C1=CN=C(C2CCCN2)N1;CC(C)(C)OC(=O)N1CCCC1C1=NC2=CC=C(C3=CC=C(C4=CC=C(C5=CN=C(C6CCCC6)N5)C=C4)C4=C3CCC43CCCC3)C=C2C1;CC1(C)OC(C2=CC=C3N=C(C4CCCC4)NC3=C2)OC1(C)C;CC1=CC=C(C2=CC=C(C3=CN=C(C4CCCC4)N3)C=C2)C2=C1CCC21CCCC1;COC(=O)NC(C(=O)N1CCCC1C1=NC=C(C2=CC=C(C3=CC=C(C4=CC=C5N=C(C6CCCN6C(=O)C(NC(=O)OC)C6=CC=CC=C6)NC5=C4)C4=C3C3(CCCC3)CC4)C=C2)N1)C1=CC=CC=C1;COC(=O)NC(C(=O)O)C1=CC=CC=C1 into molecular formula.",
"input": "",
"output": " C197H222N22O14 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C=S1(=O)CCC(C(=O)N2CCN(C3=NC=C(C(F)(F)F)C=N3)CC2C2=CC=C(F)S2)CC1;C=S1(=O)CCC(C(=O)N2CCN(C3=NC=C(C)C=N3)CC2C2=CC=C(F)S2)CC1;C=S1(=O)CCC(C(=O)N2CCN(C3=NN=C(C(F)(F)F)S3)CC2C2=CC=C(F)S2)CC1 , what would be its molecular formula?",
"input": "",
"output": "It is C58H67F9N12O6S7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC1=CC=C(NC2=CC(Cl)=NN=C2C(N)=O)N=C1C(C)C;COC1=CC=C(NC2=CC(NCCN)=NN=C2C(N)=O)N=C1C(C)C ?",
"input": "",
"output": "Sure. C30H39ClN12O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(=O)N1CC(CC2=CC=C(Cl)C=C2)N(C2CCN(C3=NN=C(N)C3)CC2)CC1C;CC1CN(C2CCN(C3=NN=C(N)C3)CC2)C(CC2=CC=C(Cl)C=C2)CN1CC(=O)O;CC1CN(C2CCN(C3=NN=C(N)C3)CC2)C(CC2=CC=C(Cl)C=C2)CN1S(C)(=O)=O;COC(=O)CN1CC(CC2=CC=C(Cl)C=C2)N(C2CCN(C3=NN=C(N)C3)CC2)CC1C;COC(=O)N1CC(CC2=CC=C(Cl)C=C2)N(C2CCN(C3=NN=C(N)C3)CC2)CC1C;CS(=O)(=O)N1CC(CC2=CC=C(Cl)C=C2)N(C2CCN(C3=NN=C(N)C3)CC2)CC1CC1=CC=C(Cl)C=C1 .",
"input": "",
"output": " C137H191Cl7N36O11S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC(=O)OCOC1=C2C(=O)N3CCC(C)(F)CC3N(C3C4=CC=CC=C4C4=C(N=CS4)C4=C3C=CC(F)=C4F)N2C=CC1=O . Can you tell me?",
"input": "",
"output": "Sure. It's C31H25F3N4O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation FC1=CC=CC(N2C3=CC=CC=C3C3=CC=C(N(C4=CC=C5C(=C4)SC4=CC=CC=C45)C4=CC=CC5=C4N(C4=CC=CC=C4)C4=CC=CC=C54)C=C32)=C1;FC1=CC=CC(N2C3=CC=CC=C3C3=CC=C(N(C4=CC=C5SC6=CC=CC=C6C5=C4)C4=CC=CC5=C4N(C4=CC=CC=C4)C4=CC=CC=C54)C=C32)=C1;FC1=CC=CC(N2C3=CC=CC=C3C3=CC=CC(N(C4=CC=C5C(=C4)SC4=CC=CC=C45)C4=CC=C5C6=CC=CC=C6N(C6=CC=CC=C6)C5=C4)=C32)=C1;FC1=CC=CC(N2C3=CC=CC=C3C3=CC=CC(N(C4=CC=C5SC6=CC=CC=C6C5=C4)C4=CC=C5C6=CC=CC=C6N(C6=CC=CC=C6)C5=C4)=C32)=C1 , what would be its molecular formula?",
"input": "",
"output": "It is C192H120F4N12S4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCN1CCCC(OC2=CC=C(CC(C)C)C=C2)C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C17H27NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCC=CCCCC(=O)OCC(COC(=O)CCCC=CCCCC)OC(=O)CC(C)CCCCCCC(C)O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C35H62O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C;CCC(C)C(=O)NCCO into molecular formula.",
"input": "",
"output": " C8H19NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC;CC;CSCCC(NC(=O)C(C)NC(=O)C1CCCN1C(=O)C(CC(N)=O)NC(=O)C(CO)NC(=O)C(CC(N)=O)NC(=O)C(C)NC(=O)C(CS)NC(=O)CCCCN=[N+]=[N-])C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(CCCNC(=N)N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCCN)C(=O)NC(C)C(=O)NCC(=O)NC(CS)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC1=CNC2=CC=CC=C12)C(=O)NC(CCCCN)C(=O)NC(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(C(=O)NC(CO)C(=O)NC(C=O)CS)C(C)O)C(C)O .",
"input": "",
"output": " C146H228N44O38S4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=NN1C1=CC=CN=C1;CC1=NN(C2=CC=CN=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C18H18N6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)C1=CC=CC=C1S(=O)(=O)CCOP(=O)(O)OP(C)(=O)O;CC1(C)OC2=CC3=C(C=C2O1)CC(S(=O)(=O)CCOP(=O)(O)OP(C)(=O)O)=C3;CN1C=CC(S(=O)(=O)CCOP(=O)(O)OP(C)(=O)O)=C1;CN1C=CC=C1S(=O)(=O)CCOP(=O)(O)OP(C)(=O)O;CP(=O)(O)OP(=O)(O)OCCS(=O)(=O)C1=CC2=CC=CC=C2C1;CP(=O)(O)OP(=O)(O)OCCS(=O)(=O)C1=CC=CO1;CP(=O)(O)OP(=O)(O)OCCS(=O)(=O)C1=CC=CS1;CP(=O)(O)OP(=O)(O)OCCS(=O)(=O)C1=CNC2=CC=CC=C12;CP(=O)(O)OP(=O)(O)OCCS(=O)(=O)C1=COC=C1;CP(=O)(O)OP(=O)(O)OCCS(=O)(=O)C1=CSC=C1 .",
"input": "",
"output": " C94H149N3O84P20S12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C#CC1(O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC1N1C=NC2=C(N)C=CN=C21;C=C1NC(=O)C=CN1C1OC(CN=[N+]=[N-])(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1(C)O;C=CC1(O)C(N2C=CC(=O)NC2=C)OC(CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O;C=CCC1(O)C(N2C=CC(=O)NC2=O)OC(CCl)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O;CC#CC1(O)C(N2C=CC(=O)NC2=O)OC(CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O;CC1=NC2=C(N=CN2C2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2(C)Cl)C(=O)N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C76H113Cl2F2N19O84P18 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule COC1=CC(C)=C(CC2=CC=CC(Cl)=C2F)C=C1C(C)=O;COC1=CC=C(CC2=CC=CC(Cl)=C2F)C(C)=C1 into molecular formula.",
"input": "",
"output": " C32H30Cl2F2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(CC(=O)C(CC1=NC=NN1)NC(C1=CC=C(F)C(OC2CCC2)=C1)C(C)(F)F)C(=O)C(=O)CC1CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C28H35F3N4O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)(C(=O)O)S(=O)(=O)C1=CC=C(C(F)(F)F)C=C1;CC(C)(C)C1=CC(CC(=O)C(C)(C)S(=O)(=O)C2=CC=C(C(F)(F)F)C=C2)=NO1;CCOC(=O)C(C)(C)Br;CCOC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C(F)(F)F)C=C1;CCOC(=O)C(C)(C)SC1=CC=C(C(F)(F)F)C=C1;FC(F)(F)C1=CC=C(S)C=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C69H79BrF15NO16S5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C;C;C;C;C;C;CCCCCCCC(=O)C(C)(N)C(O)OC;CCCCCCCCC(=O)C(C)(N)C(O)OC;CCCCCCCCCC(=O)C(C)(N)C(O)OC ?",
"input": "",
"output": " C45H105N3O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)COC(=O)Cl;CC(C)COC(=O)OC(=O)C=CN1C=NC(C2=CC=CC(Cl)=C2)=N1;CC(C)OC(=O)C=CN1C=NC(C2=CC=CC(Cl)=C2)=N1;ClC1=CC=CC(C2=NN(C=CC3=NN=CO3)C=N2)=C1;NN;NNC(=O)C=CN1C=NC(C2=CC=CC(Cl)=C2)=N1;O;O=C(O)C=CN1C=NC(C2=CC=CC(Cl)=C2)=N1;O=C(O)C=CN1C=NC(C2=CC=CC(Cl)=C2)=N1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C80H79Cl7N24O15 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(=O)OC(CC(=O)OC1CCC(CC2=CC(N3N=C(C)C4=C3CCCC4=O)=CC=C2C(N)=O)CC1)C[N+](C)(C)C represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C31H43N4O6+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=[NH+]C1=CC2=C(C=C1C=C1C(=O)NN(C3=CC=CC(Cl)=C3)C1=O)OCO2;[OH-] , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H12ClN3O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule [CH2-]C1=CC=CC=C1[CH-]C1=CC=CC=C1[PH+](CC(C)C)CC(C)C;[CH2-]C1=CC=CC=C1[N-]C1=CC=CC=C1[PH+](CC(C)C)CC(C)C;[Cu+];[Cu] into molecular formula.",
"input": "",
"output": " C43H59Cu2NP2- ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(COC2=CC=C(C(C)C3=CC=C(C)C=C3C)C=C2)C=C1;P ?",
"input": "",
"output": "Sure. C24H29OP ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=CC1=CC=CC=C1CN(CC1=CC=CC=C1)CC1=CC=CS1;CCC1=CC=CC(CC)=C1N1[CH-]C(C)(C2=CC=CC=C2)CC1(C)C;CCC1=CC=CC(CC)=C1N1[CH-]C(C)(C2=CC=CC=C2)CC1(C)C;CCC1=CC=CC(CC)=C1N1[CH-]C(C)(C2=CC=CC=C2)CC1(C)C;Cl[Ru](Cl)=C1C=C(C2=CC=CC=C2)C2=CC=CC=C12;Cl[Ru](Cl)=CC1=CC=CC=C1CN(CC1=CC=CC=C1)CC1=CC=CS1 ?",
"input": "",
"output": " C125H140Cl4N5Ru2S2-3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CS(=O)(=O)[O-];CS(=O)(=O)[O-];ClC1=CC=C([S+](C2=CC=C(Cl)C=C2)C2=CC=C(Br)C=C2)C=C1;ClC1=CC=C([S+](C2=CC=C(Cl)C=C2)C2=CC=C(Cl)C=C2)C=C1;ClC1=CC=C([S+](C2=CC=C(Cl)C=C2)C2=CC=C(Cl)C=C2)C=C1;FC1=CC=C([S+](C2=CC=C(F)C=C2)C2=CC=C(F)C=C2)C=C1;O=S(=O)([O-])C(F)(F)F;O=S(=O)([O-])C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 into molecular formula.",
"input": "",
"output": " C83H57BrCl8F12O12S8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C;C;CN=P(C)(OC1=CC=C(C2=CC=C(C(=O)O)C=C2)C=C1)OC1=CC=C(C2=CC=C(C(=O)O)C=C2)C=C1 ?",
"input": "",
"output": " C30H32NO6P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CC=C(CC2=CC(C3=CC(F)=CC=C3OC)=NC=N2)C=C1O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H17FN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(NC1=NCC2=CC=C(C(=O)NC3(C4=CC=CC=N4)CC3)C=C12)C1=CC=C(F)C=C1 ?",
"input": "",
"output": " C24H19FN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=C2CC=CC3=CC(C)=C4C=CC=C(C1)C4=C23;CC1=CC2=C3C=CC=C(C)C3=CC=C2C2=CC=CC=C12;CC1=CC=CC=N1;CC1=CC=CN=C1;CC1=CC=NC=C1;CC1=CC=NC=N1;CC1=NC=CC=N1 .",
"input": "",
"output": " C66H65N7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=CC=CC=N1;O=C(NC1=CC(C(F)(F)F)=CC=N1)C1=CC=CC=C1 ?",
"input": "",
"output": "The molecular formula is C19H16F3N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=CC=C(CC2CN(C(=O)OCC3=CC(C)=CC(C(F)(F)F)=C3)C3CN(CC4=CC=CC=C4)C(=O)C(CN)N3C2=O)C=C1;CC1=CC=C(CC2CN(C(=O)OCC3=CC(C)=CC(C(F)(F)F)=C3)C3CN(CC4=CC=CC=C4)C(=O)C(CN)N3C2=O)C=C1;CCCC1CN(C(=O)OCC2=CC(C)=CC(C(F)(F)F)=C2)C2CN(CC3=CC=CC=C3)C(=O)C(CC3=CN=CN3)N2C1=O;COC1=CC=C(CC2CN(C(=O)OCC3=CC(C)=CC(C(F)(F)F)=C3)C3CN(CC4=CC=CC=C4)C(=O)C(CN)N3C2=O)C=C1 .",
"input": "",
"output": " C130H139F12N17O17 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(C2=CC(F)=C(C(F)(F)OC3=CC(F)=C(S(F)(F)(F)(F)F)C(F)=C3)C(F)=C2)C=C1;CC1=CC=C(C2=CC(F)=C(C(F)(F)OC3=CC=C(S(F)(F)(F)(F)F)C(F)=C3)C(F)=C2)C=C1;CC1=CC=C(C2=CC(F)=C(C(F)(F)OC3=CC=C(S(F)(F)(F)(F)F)C=C3)C(F)=C2)C=C1;CC1=CC=C(C2=CC=C(C(F)(F)OC3=CC(F)=C(S(F)(F)(F)(F)F)C(F)=C3)C(F)=C2)C=C1;CC1=CC=C(C2=CC=C(C(F)(F)OC3=CC(F)=C(S(F)(F)(F)(F)F)C(F)=C3)C=C2)C=C1;CC1=CC=C(C2=CC=C(C(F)(F)OC3=CC=C(S(F)(F)(F)(F)F)C(F)=C3)C(F)=C2)C=C1;CC1=CC=C(C2=CC=C(C(F)(F)OC3=CC=C(S(F)(F)(F)(F)F)C(F)=C3F)C(F)=C2)C=C1;CC1=CC=C(C2=CC=C(C(F)(F)OC3=CC=C(S(F)(F)(F)(F)F)C(F)=C3F)C=C2)C=C1;CC1=CC=C(C2=CC=C(C(F)(F)OC3=CC=C(S(F)(F)(F)(F)F)C=C3)C(F)=C2)C=C1 ?",
"input": "",
"output": "Sure. C180H113F85O9S9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of C1=CC=C2C(N3C4=CC=CC=C4C4=CC5=C(C=C43)C3=CC=CC=C3N5C3=CC=CC4=CC=CC=C34)=CC=CC2=C1;CCC1(CC)C2=CC=CC=C2C2=CC=C(N(C3=CC=CC=C3)C3=CC=C4C(=C3)C3=CC(N(C5=CC=CC=C5)C5=CC=C6C7=CC=CC=C7C(CC)(CC)C6=C5)=CC=C3N4C3=CC=CC=C3)C=C21;CCN1C2=CC=C(N(C3=CC=CC=C3)C3=CC=CC4=CC=CC=C34)C=C2C2=CC(N(C3=CC=CC=C3)C3=CC=C4C=CC5=CC=CC6=CC=C3C4=C56)=CC=C21;CCN1C2=CC=CC=C2C2=CC(N(C3=CC=CC=C3)C3=CC=C4C(=C3)C3=CC(N(C5=CC=CC=C5)C5=CC=C6C(=C5)C5=CC=CC=C5N6CC)=CC=C3N4C3=CC=CC=C3)=CC=C21 ?",
"input": "",
"output": "Sure. C212H161N13 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by C1=CC=C2CCCC2=C1;CC(=CC(C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCCC1C(=O)O;CC(C)N1CCCCC1;CCC ?",
"input": "",
"output": " C37H62N4O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C1=CC=C([S+](C2=CC=CC=C2)C2=CC=CC(CN3CCOCC3)=C2)C=C1;C1=CC=C([S+](C2=CC=CC=C2)C2=CC=CC=C2CN2CCOCC2)C=C1;CCCN(CCOC)CC1=CC=CC([S+](C2=CC=CC=C2)C2=CC=CC=C2)=C1;COCCN(CCOC)CC1=CC=C([S+](C2=CC=CC=C2)C2=CC=CC=C2)C=C1 .",
"input": "",
"output": " C96H108N4O5S4+4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)N1CCC(C(=O)N(C)C2CCN(C)CC2)CC1;CC(C)N1CCC(C(=O)N(C)CCN(C)C)CC1;CC(C)N1CCC(C(=O)N2CCC(N3CCCC3)CC2)CC1;CC(C)N1CCC(C(=O)N2CCN(C)CC2)CC1;CC(C)N1CCC(C(=O)N2CCN(CC3=CC=CC=C3)CC2)CC1;CC(C)N1CCC(C(=O)NCCC2CCCN2C)CC1;CC(C)N1CCC(C(=O)NCCCN(C)C)CC1;CC(C)N1CCC(C(=O)NCCN(C)C)CC1 .",
"input": "",
"output": " C125H238N24O8 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCC(C)C1=CC=C(O)C=C1;CCC(C)C1=CC=C(O)C=C1;CCC(C)C1=CC=C(O)C=C1;CCC(C)C1=CC=C(O)C=C1;CCC(C)C1=CC=C(OC(OC)C2CCSC3=CC=CC=C32)C=C1;CCC(C)C1=CC=C(OC(OC23CC4CC(CC(C4)C2)C3)C2CCCC3=CC=CC=C32)C=C1;CCC(C)C1=CC=C(OC(OC2CCCCC2)C2CCSC3=CC=CC=C32)C=C1;CCC(C)C1=CC=C(OC(OCCOC2=CC=C(C3CCCCC3)C=C2)C2CCCC3=CC=CC=C32)C=C1 .",
"input": "",
"output": " C153H200O13S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC(C)C(NC(=O)C(CCCNC(=N)N)CC(=O)C(CCC(C)=O)NC(=O)C(CC(=O)C(CCCNC(N)N)NC(=O)C(CCCCCCCN1CC(CCCC(=O)CC(CCCCCCCCN2CC(CC(C(=O)CC(CNC(CCC3=CC=CC=C3)C(=O)CC(CC3=CC=CC=C3)C(=O)NC(CC(C)C)C(=O)CC(CCCNC(=N)N)C(=O)NCC(N)=O)CC3=CC=CC=C3)C(=O)C(C)=O)NN2)C(=O)NC(C(C)=O)C(=O)CC(CC2=CC=CC=C2)C(=O)NC(CC2=CC=C(O)C=C2)C(=O)CC(CCCNC(=N)N)C(=O)NC(CC(C)C)C(=O)CCC(=O)NC(CC2=CC=C(O)C=C2)C(=O)CCCNC(=O)CCCCC2CCC3CC(=O)CC23)NN1)CC(C)=O)CC1=CN=CC1)C(N)=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C179H268N32O30 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCC1=C(C2=CC=C3C4=C(CCN(C)C4)CC3=C2)N=C(OCC2=CC=CC=C2)C(C(=O)OCC2=CC=CC=C2)=C1OCC1=CC=CC=C1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C42H40N2O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of FCF;O=S(=O)([N-]C1=NN=C(F)S1)C(F)(F)F;[H-];[Li+] ?",
"input": "",
"output": "Sure. C4H3F6LiN3O2S2- ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for OC1=C(C2=NCCOC2)C2=CC(CCC3CCOC3)=CC=C2N1C1CCOCC1 .",
"input": "",
"output": " C23H30N2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of COC1=CC2=C(C=C1OC)C1(CCC3C(COC(=O)C(C)(C)C)C31)C(OC(C)=O)C2CC1C(C)CCCC1(C)C ?",
"input": "",
"output": " C34H50O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1(C)CC2(C=C(C#N)C(=O)CC2)OC1=O , what would be its molecular formula?",
"input": "",
"output": "It is C12H13NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation N=C(N)C1=CSC(NC(=O)C2CC3(CN2C(=O)CNC(=O)C2=CC=C(OC4=CC=CC=C4)C=C2)OCCO3)=C1 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C27H27N5O6S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule C=C(C#N)CNC1=C(OC)C=CC2=CC=C(C3=CC=C(F)C(C=O)=N3)C=C12 .",
"input": "",
"output": " C21H16FN3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CNC(CC1=CC=CC=C1)C(=O)C(F)(F)F ?",
"input": "",
"output": " C11H12F3NO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule N#CC1=CC=C(NC(=O)C2=C3NC3=NCC3=CC=C(C4=CN=CC(CN5CCC(F)(F)C5)=C4)C=C23)C=N1 ?",
"input": "",
"output": " C27H21F2N7O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCC(C)OC1=CC=C(N2C=NC(C(=O)O)=C2)C=C1C#N represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C15H15N3O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1=CC2C(O)C(C)=C(C)C3C(CC(C)C)NC(=O)C23C(=O)CC(O)C(O)CCC1 .",
"input": "",
"output": " C24H37NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule COC1=CC(OC)=C2C(=O)C3(OC2=C1Cl)C(=O)C=C(N1CCN(C2=NC=CC=C2C#N)CC1)CC3C .",
"input": "",
"output": " C26H25ClN4O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1CCC2C(C)(C)C(CO)C3CCC12C3 .",
"input": "",
"output": " C15H26O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC=C(C)C(=O)OC1C(OC(=O)C(C)=CC)C23C(O)OC4(CCC5C6(C)CCC(OC7OC(C(=O)O)C(O)C(OC8OC(CO)C(O)C(O)C8OC8OC(C)C(O)C(O)C8O)C7OC7OC(CO)C(O)C(O)C7O)C(C)(C)C6CCC5(C)C4(C)CC2OC(C)=O)C3CC1(C)C ?",
"input": "",
"output": "The molecular formula is C66H102O29 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC=C(C)C(=O)OC1C2(C)CC3(O)C1(OC(C)=O)C1OC4(C(C)CC)OC15C1=CC(=O)OC(C6=COC=C6)C1(C)CCC5(O4)C3(C)C2CC(=O)OC ?",
"input": "",
"output": " C39H48O13 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1C=C(C2=NC(C)(C(=O)NC(C(=O)NC(C)(CO)C(=O)O)C3CCCN3)CO2)C2=C(O)C=C(Cl)C=C21 , what would be its molecular formula?",
"input": "",
"output": "It is C24H30ClN5O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule ON(O)C1=CNC(Cl)=C1Cl into molecular formula.",
"input": "",
"output": " C4H4Cl2N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)OCCC(=O)C1C2CCC(C)C(O)C2C(Cl)C(O)C1(C)O ?",
"input": "",
"output": " C17H27ClO6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)CC1CCC2(C1)CC1C(C3CCC(N)NC3)C3CCCC4CCC5C(C43)C1C(C2)C12CC3(N)C(CO)CCC(C3C(C)(C)O1)C52 ?",
"input": "",
"output": "Sure. C43H71N3O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCC1C#CCC(C(O)CCC2=CC=C(O)C(OC3C(O)C(O)CCC3C(CC3=CC=CN3)C3=CCNC(N)=C3)=C2)C(OCCO)CCCC1 ?",
"input": "",
"output": "Sure. C40H57N3O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule C=C1C(=O)OC2C=C(C)C3(O)CC(O)C(C)(CC(OC(=O)C(C)C)C12)O3 into molecular formula.",
"input": "",
"output": " C19H26O7 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CC=CC(C)=C1C1=CC2=NC(=N1)NS(=N)(=O)C1=CC(=CC=C1)C(=O)N1CCNCC(C1)O2 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H26N6O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C1NC2(CCC1N1C(=O)C3=C4C1=CC=CC4=C(Br)C=C3)COC2 ?",
"input": "",
"output": "Sure. C18H15BrN2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(=O)N1CCCCC1C;CCC , what would be its molecular formula?",
"input": "",
"output": "It is C11H23NO .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCOC(=O)CC1=CC=CC=C1OCC1=CC(C2=CC=NC(CNS(=O)C(C)(C)C)=C2)=C2OC(COC3=CC=CC=C3CC(=O)OCC)=CC2=C1 ?",
"input": "",
"output": "Sure. C40H44N2O8S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CC;CC;CC1=CC=C(CC2CCNCC2)C([N-]C2=CC=C(N)C=C2C)=C1;[K+] into molecular formula.",
"input": "",
"output": " C24H38KN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC(C)CC(NC(=O)C1(CC2=CC=CC=C2)CC(CNC(=O)C2CCCC3=CC=CC=C32)=NO1)B(O)O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C28H36BN3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of OC1(C2=NC=CC=C2C2=CC=C(Cl)C=C2)C2=CC=CC=C2C2=CC=CC=C21 ?",
"input": "",
"output": " C24H16ClNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1(C)C2=CC=C(C3=CC=CC(C4=CC=CC=C4)=C3)C=C2C2=CC=C(C3=NC(C4=CC=CC=C4)=NC(C4=CC=C5C=CC=CC5=C4)=N3)C=C2C1(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C49H39N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(C)(C)C1=CC=C(N2C(=[Pt])N(C3=[C-]C(B(C4=[C-]C(C5=CC=CC=N5)=CC=C4)C4=C(C5=CC=CC=C5)C=CC=C4C4=CC=CC=C4)=CC=C3)C3=CC=CC=C32)C=C1;CN(C)C1=CC=C(N2C(=[Pt])N(C3=[C-]C(B(C4=[C-]C(C5=CC=CC=N5)=CC=C4)C4=C(C5=CC=CC=C5)C=CC=C4C4=CC=CC=C4)=CC=C3)C3=CC=CC=C32)C=C1;FC(F)(F)C1=CC=C(N2C(=[Pt])N(C3=[C-]C(B(C4=[C-]C(C5=CC=CC=N5)=CC=C4)C4=C(C5=CC=CC=C5)C=CC=C4C4=CC=CC=C4)=CC=C3)C3=CC=CC=C32)C=C1 ?",
"input": "",
"output": " C151H108B3F3N10Pt3-6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1=CN=CC(C(CC2=CC=C(Cl)C=C2)C(C)N2C=C(C(F)(F)F)C=CC2OC(C)(C)C)=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C26H30ClF3N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)OC(C)OP(=O)(NC(C)C(=O)OC(C)C)OCC1OC(N2C=CC(N)=NC2=O)C(O)C1O ?",
"input": "",
"output": "The molecular formula is C20H33N4O12P .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1(O)C(O)C(CO)OCC1N1C=C(C#N)C2=C(N)N=CN=C21 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C14H17N5O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC1=CC=C(C2=CSC(NC(=O)CC3=CC=CC(OCCCN4CCCCC4)=C3)=N2)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C27H33N3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCN1NN=C(C)C1=O ?",
"input": "",
"output": "Sure. C6H11N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=CC(C)C2=CC=CC(C3=CC=CC=C3)=C2OC1 ?",
"input": "",
"output": " C20H20O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CCCCN1CC(=O)N(C)C(CC2=CC=CC=C2)C(=O)N(C)C(C(C)C)C(=O)NC(COC(C)(C)C)C(=O)N(C)C(CC(C)C)C(=O)NC(C(=O)N2CCCCC2)CC(=O)N(C)CC(=O)N(C)C(CC2=CC=CC(Cl)=C2)C(=O)NC(COCC(C)(C)CO)C(=O)N(C)C(CC(C)C)C(=O)NC(C(C)O)C1=O ?",
"input": "",
"output": " C77H123ClN12O16 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC(C)C(C(CC(C)=O)OC)N(C)C(=O)C(CC(=O)C(C(C)C)N(C)C(=O)CCOCCCP(=O)(NNC(=O)C=CC(=O)O)NNC(=O)C=CC(=O)O)C(C)C into molecular formula.",
"input": "",
"output": " C37H63N6O13P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCOCC1=CC(OC)=C(C2=CC=C(CC(NC(=O)C3=C(C(C)=O)C4=CC=CC=C4N3)C(=O)O)C=C2)C(OC)C1;CCOCC1=CC(OC)=C(C2=CC=C(CC(NC(=O)C3=C(C)C4=CC=CC=C4N3)C(=O)O)C=C2)C(OC)C1;CCOCC1=CC(OC)=C(C2=CC=C(CC(NC(=O)C3=C(C)C4=CC=CC=C4N3)C(=O)O)C=C2)C(OC)C1;CCOCC1=CC(OC)=C(C2=CC=C(CC(NC(=O)C3=C(CO)C4=CC=CC=C4N3)C(=O)O)C=C2)C(OC)C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C121H136N8O26 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC(C)(C(C(=O)ON1C(=O)CCC1=O)S(=O)(=O)O)C(C)(C)N1C(=O)C=CC1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C16H20N2O9S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for SSCC1=CSC2=NSC=C12 .",
"input": "",
"output": " C6H5NS4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of NC1=CC=NC(CN(CC2=CC=CC=N2)CC(O)CN(CC2=CC=CC=N2)CC2C=CC=CN2)=C1 ?",
"input": "",
"output": "The molecular formula is C27H33N7O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by COC1=CC=C(C2C=NC(NC3=CC=CC(C(=O)N4CCN(CC(=O)N(C)C)CC4)=C3)=NC2)C=C1 ?",
"input": "",
"output": " C26H32N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=C(C)C1CCC2(CNC3(CN(CC)CC)CC3)CCC3C(CCC4C3(C)CCC3C(C)(C)C(C5=CC=C(C(=O)O)C=C5C(C)C)=CCC34C)C12 .",
"input": "",
"output": " C47H72N2O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC(C)(C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)C;CCC(C)C1=CC=C(C(=O)[N-]S(=O)(=O)C(F)(F)F)C=C1;CCOCCOCCOC(=O)C(C)CC;[K+] ?",
"input": "",
"output": " C37H67F3KNO10SSi2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CN1CC2(C)C=CC12 , what would be its molecular formula?",
"input": "",
"output": "It is C7H11N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1C=N;COC1=CC=CC(C(CCO)NC(=O)C2=CC=CC(Br)=C2)=C1;COC1=CC=CC(C(CCO)NC(=O)C2=CC=CC(C3=CC=C4NN=CC4=C3)=C2)=C1;COC1=CC=CC(C(N)CCO)=C1;O=C(O)C1=CC=CC(Br)=C1 ?",
"input": "",
"output": " C72H81BBr2N6O12 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NNCCCCNO . Can you tell me?",
"input": "",
"output": "Sure. It's C4H13N3O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation O=CCCC12COC3(I)CCC13C2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C10H13IO2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(=O)NC=CC1CC(N2C=C(C3=CC=CC(OCC4=CC=CC=C4)=C3)C3=C(N)N=CN=C32)C1 ?",
"input": "",
"output": " C27H27N5O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=C(C)N(C2=CC=CC=C2C)C(C2=C(C)C=CC=C2C)N1C1=CC=CC=C1;CC1=C(C2=CC=CC=C2)N(C2=CC=CC=C2)C(C2=C(C)C=CC=C2C)N1C1=CC=CC=C1C;CC1=C(C2CCCC2)N(C2=CC=CC=C2)C(C2=C(C)C=CC=C2C)N1C1=CC=CC=C1C;CC1=C(C2CCCCC2)N(C2=CC=CC=C2)C(C2=C(C)C=CC=C2C)N1C1=CC=CC=C1C;CC1=C2C=CC(C)(C)N2C(C)N1C1=CC=CC=C1C ?",
"input": "",
"output": "Sure. C135H150N10 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC1=NOC(C2CCCN2C(=O)C2=CC3=C(S2)C2(CCNCC2)OCC3)=C1;Cl .",
"input": "",
"output": " C20H26ClN3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCCCCCCC=CCCCCCCCC(=O)OC(CCCCCC)CCCCCC(=O)NC(CCCN)C(=O)O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C36H68N2O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCCCCCC=CCC=CCC=CCCCCCCC ?",
"input": "",
"output": " C53H94NO8P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCCCCCCCCCC=CCCCCCCCC(=O)OC(CCCCCCCCCCCC)CC(=O)NC(CO)C(O)CCCCCCCCCCCCCCCCCC ?",
"input": "",
"output": " C57H111NO5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCCCCCCC=CCC=CCCCCCCCCCCCCCCCCCC(=O)NC(CO)C(O)CCCCCCCCCCCCCCCCC , what would be its molecular formula?",
"input": "",
"output": "It is C50H97NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCC=CCC=CCC=CCC=CCC=CCC=CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C into molecular formula.",
"input": "",
"output": " C66H120NO8P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC=CCC=CCC=CCC=CCC=CCCCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC=CCC=CCCCCCCC)COC(OCC[N+](C)(C)C)C(=O)O , what would be its molecular formula?",
"input": "",
"output": "It is C84H152NO8+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCC=CCC=CCC=CCC=CCC=CCC=CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC[N+](C)(C)C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C92H165NO8P+ ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCC=CCCC ?",
"input": "",
"output": " C50H80O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CCCCCCCCCC=CCCCCCCCCCC(=O)OC(CCCCCC)CCCCCCC(=O)NCC(=O)O represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C37H69NO5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CCC=CCC=CCC=CCC=CCC=CCC=CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCC=CCC ?",
"input": "",
"output": " C72H122O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCCCCCC=CCC=CCCCCCCCC(=O)NC(CO)C(O)C=CCCC=CCCCCCCCCCCCCCCCCCCCCCCCC ?",
"input": "",
"output": "The molecular formula is C52H97NO3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CC1=CC=C(OC2=CC=C(C(=O)NC3=NC4=CC=C(F)C=C4N3)C=C2)N=N1 , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C19H14FN5O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C#CCN1C=NC2=C(C3=NC4=C(Cl)C=C(OC)C=C4S3)C=C(C)C=C2C1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C20H14ClN3O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NCC1CCN(CC2=CC(=O)NC(C3=CN=CC=N3)=N2)CC1 into molecular formula.",
"input": "",
"output": " C15H20N6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for OC1=CC=C2C=C1CCC1=CC3=C(C=C1CCCN(CC1=NC4=CC=CC=C4N1)CC2)OCO3 .",
"input": "",
"output": " C28H29N3O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation [C-]1=C(OC2=[C-]C3=C(C=C2)C2=CC=CC=C2N2C=C(C4=CC=CC=C4)N=C32)C=CC2=C1C1=NC=CN1C1=CC=CC=C21;[Pd+2] , what would be its molecular formula?",
"input": "",
"output": "It is C36H20N4OPd .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by S=C1C2=CC=CC=C2N2C3=CC=C(C4=CC5=C6C(=C4)C(=S)C4=CC=CC=C4N6C4=CC=CC=C4C5=S)C=C3C(=S)C3=C2C1=CC=C3 ?",
"input": "",
"output": " C40H20N2S4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC1=NC(N2CCC(N3CC4=CC=CC=C4CC3=O)C2)=NC2=CC=C(C3=CC=CC4=C3OCCO4)C=C12 ?",
"input": "",
"output": " C30H28N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(C)(C)C1=CC2=C3B(C4=CC=CC=C4N2C2=CC=CC=C2)C2=CC4=C(C=C2N(C2C(C5CCCCC5)CCCC2C2CCCCC2)C3=C1)OC1=CC2=C(C=C1C41C3=CC=CC=C3C3=CC=CC=C31)B1C3=CC=CC=C3OC3=C1C(=CC(N(C1=CC=CC=C1)C1=CC=CC=C1)=C3)N2C1=CC=CC=C1 .",
"input": "",
"output": " C95H84B2N4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C1=CC=C2C=C(C3=CC=C4C(=C3)C3=CC(C5=CC=C6C=CC=CC6=C5)=CC=C3N4C3=CC=CC4=CC=CC=C34)C=CC2=C1 ?",
"input": "",
"output": " C42H27N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC1=CN=C2NC=C(C(=O)C3=CC=C(OC4=CC=CC=C4F)C=C3F)C2=C1NC12COC(CO)C1C2 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C27H23F2N3O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CCCCC1=NC2=C(N)N=NC(OC(C)C)=C2N1CCCCN(C(C)=O)C1CS(=O)(=O)C1 ?",
"input": "",
"output": "Sure. C21H34N6O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC1=CC=C2NC(C(F)(F)F)=NC2=C1C(=O)NC1CCC(=O)NC1=O into molecular formula.",
"input": "",
"output": " C14H12F3N5O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C1=CC=C(C2=NC(C3=CC4=C(C=C3)C3=CC=CC=C3O4)=NC(N3C4=CC=C(C5=CC=C6C(=C5)C5=CC=CC=C5C65C6CC7CC(C6)CC5C7)C=C4C4=CC=C5C=CC=CC5=C43)=N2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C59H42N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code O=S(=O)([O-])CCSSCCS(=O)(=O)O;[Na+];[Na+] , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C4H9Na2O6S4+ .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC(=O)C1=CC=C(OC(C)C)C=C1N;CC(C)C(=O)OC1=C(F)C(F)=CC(F)=C1F;CC(C)C(=O)ON1C(=O)CCC1=O;CC(C)NC(=O)ON1C(=O)CCC1=O;CC(C)OC1=CC=C(C(=O)C2=CC=CC=C2)C(N)=C1;CC(C)OC1=CC=C(C=O)C(N)=C1;CC1=C(F)C(F)=C(OC(=O)C(C)C)C(F)=C1F;CC1=NC=NC2=C1N=CN2C1OC(COP(=O)(O)OP(=O)(O)OCC(C)(C)C(O)C(=O)CCCC(=O)CCC(C)C)C(OP(=O)(O)O)C1O;CC1=NC=NC2=C1N=CN2C1OC(COP(=O)(O)OP(=O)(O)OCC(C)(C)C(O)C(=O)CCCC(=O)CCCC(C)C)C(OP(=O)(O)O)C1O;CC1=NC=NC2=C1N=CN2C1OC(COP(=O)(O)OP(=O)(O)OCC(C)(C)C(O)C(=O)CCCC(C)C)C(OP(=O)(O)O)C1O .",
"input": "",
"output": " C150H213F8N18O65P9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1(C)C2=CC=CC=C2C2=CC=C(N(C3=CC=CC4C=CC=CC34)C3=CC=C4C(=C3)OC3=CC=C5OC6=C(C=CC7=C6C6=CC=C(N(C8=CC=C9C%10=CC=CC=C%10C(C)(C)C9=C8)C8=CC=CC9=CC=CC=C89)C=C6O7)C5=C34)C=C21 . Can you tell me?",
"input": "",
"output": "Sure. It's C74H52N2O3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation C;C;CNC(COP(=O)([O-])O)COP(=O)([O-])OCCOP(C)(=O)[O-] , what would be its molecular formula?",
"input": "",
"output": "It is C9H25NO11P3-3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C;CC(C)(C)OC(=O)NC1CN(C2=CC=NC(CC(=O)NC3=CC=C(C4=CC5=C(C4)N=CN=C5N4CCOCC4)C=C3)=C2)C1;CC(C)(C)OC(=O)NC1CN(C2=CC=NC(CC(=O)O)=C2)C1;NC1=CC=C(C2=CC3=C(C2)N=CN=C3N2CCOCC2)C=C1 .",
"input": "",
"output": " C65H80N14O9 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule C[Al](C)C;[F-];[F-];[F-] ?",
"input": "",
"output": " C3H9AlF3-3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(OC1=CC(C2=CN(C)N=C2)=CC2=NC=NC(NC3=CC=C4N=CC=CC4=C3F)=C12)C1COCCN1 , what would be its molecular formula?",
"input": "",
"output": "It is C27H26FN7O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(O)COCCCS(=O)(=O)NC1=CC=CC(C2=CC=C3NN=C(C4=CN=CC(O)=C4)C3=C2)=C1[N+](=O)[O-] .",
"input": "",
"output": " C23H21N5O8S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCCCCCCC=CCC=CCC=CCCCCCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCCCCCCCCC=CCC=CCCCCCCC is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C56H103O9P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CS(=N)(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 ?",
"input": "",
"output": " C14H14BrNO2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(=O)N1CC2CN(C(=O)C3=CC=C(F)C=C3Cl)CC2(CCC2=CC=CC=C2)C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C23H24ClFN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation N#CC1=CC(C2=COC=C2)=CC=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C10H6N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CCC(=O)NC1CCC(C)(N)CC1 .",
"input": "",
"output": " C10H20N2O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CCCC(C)C1=NC2=CC(C)=C(CC)C(=O)N2N1 into molecular formula.",
"input": "",
"output": " C14H21N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule NC1=CN(COC2CCCCC2)C=N1 .",
"input": "",
"output": " C10H17N3O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=C(C(=O)NC(CO)C(=O)O)SC(NC(=O)OCC2C3=CC=CC=C3C3=CC=CC=C32)=N1 ?",
"input": "",
"output": "Sure. C23H21N3O6S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CC1(C)C(CN)C1C1=C(F)C=CC=C1F .",
"input": "",
"output": " C12H15F2N ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)N1N=CC=C1CCCS .",
"input": "",
"output": " C9H16N2S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of NC1=CC(C2=CN=CO2)=NO1 . Can you tell me?",
"input": "",
"output": "Sure. It's C6H5N3O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=C(C)C1(N)CC1(C)C . Can you tell me?",
"input": "",
"output": "Sure. It's C8H15N .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of CC1=NN(C)C(Cl)=C1C(C)CN ?",
"input": "",
"output": " C8H14ClN3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC(C)(C)OC(=O)NC1CCC(C(=O)ON2C(=O)C3=CC=CC=C3C2=O)C2=CC=CC=C21 ?",
"input": "",
"output": "Sure. C24H24N2O6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CN1C=C(Br)N=C1C1(OCC(=O)OC(C)(C)C)CCONC1 ?",
"input": "",
"output": "Sure. C14H22BrN3O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule [N-]=[N+]=NCC12CC(C(=O)O)(C1)C1(CCNCC1)O2 into molecular formula.",
"input": "",
"output": " C11H16N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CC1=C(CN=[N+]=[N-])C=C(OS(=O)(=O)F)C(C)=C1S(=O)(=O)Cl ?",
"input": "",
"output": "The molecular formula is C9H9ClFN3O5S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC(N2CCCCS2(=O)=O)=CC(C)=C1S(=O)(=O)F . Can you tell me?",
"input": "",
"output": "Sure. It's C12H16FNO4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC(C)(C)OC(=O)NC1=NC(Br)=CC2=CC=CC=C12 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H15BrN2O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCOC(=O)C1=C(CC)N(N)C(CC)=C1S(N)(=O)=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C11H19N3O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code C1CCNC1;CC(C)CCC(CCNC=O)C1=CC(CCC(CCNC=O)OC2=CC(F)=CC(N3CCNCC3)=C2)=CC=C1O;CO;CO , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C37H62FN5O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC;COCCNC1=CC(C(=O)OC(C)(C)C)=CC=C1N ?",
"input": "",
"output": " C16H28N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by NC1=NC=C(C2=CC=C(N3CCCC3)C(F)=C2F)C=C1C1=CC=C2C(=O)NCCC2=C1 ?",
"input": "",
"output": " C24H22F2N4O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCOC(=O)C1=C(NC(=O)C(C)SC2=NN=C(COC3=CC=CC=C3C3=CC=CC=C3)N2C2=CC=CC=C2OC)SC2=C1CCN(CC1=CC=CC=C1)C2 ?",
"input": "",
"output": " C42H41N5O5S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CN(C)CC1=C(C(=O)NCC2=NC3=CC=CC(Cl)=C3N2C)OC2=CC=CC=C12 .",
"input": "",
"output": " C21H21ClN4O2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CS(=O)(=O)C1=CC=C(C(O)COC2=CC=C3C=CC=NC3=C2)C=C1 ?",
"input": "",
"output": "The molecular formula is C18H17NO4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CCCN(C(=O)CNC(=O)C1=NC=CC=C1O)C1CCNC1 ?",
"input": "",
"output": " C15H22N4O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1(C)CN(C(=O)OCC(F)(F)F)C2COCC2O1 . Can you tell me?",
"input": "",
"output": "Sure. It's C11H16F3NO4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of O=C1CCC(N2CC3=CC(N4C=C(CN5CCN(C6=CC=CC=C6)CC5)N=N4)=CC=C3C2=O)C(=O)N1 ?",
"input": "",
"output": "Sure. C26H27N7O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation CC1CC1C(=O)NC1CCCCC12CCN(C(=O)CCC1=CC=NN1)C2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C20H30N4O2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)(C)OC(=O)C1(N(NC(=O)OCC2=CC=CC=C2)C(=O)OCC2=CC=CC=C2)CC2=C(C=CS2)C1=O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C28H28N2O7S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of CC1=CC=C(C2=CC=C(NS(=O)(=O)C3=CC4=C(C=C3C)NC(=O)C(=O)N4)C=C2)C=C1 ?",
"input": "",
"output": "Sure. C22H19N3O4S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for COCCCN1C=C(C2=CC=C(C3=CN=C(C(=O)NC4=CC=C(C(=O)N5CCN(C(=O)CCC(O)CN(C)C)CC5)C(Cl)=C4)N3C)C(F)=C2F)C(C)=N1 .",
"input": "",
"output": " C37H45ClF2N8O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " NC1=CC=CC(N2CCC3=C(SC(C4=CN=C(N5CCCC(F)C5)N=C4)=N3)C2=O)=C1F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C21H20F2N6OS ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1(C(N)=O)CCCC1O is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C7H13NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule CC(C)C1=CC=NC(C2=[C-]C=CC3=C2OC2=CC(C4=CC=CC(C5=CC=CC=C5)=C4)=CC=C23)=C1;C[Si](C)(C)C1=CC=C(C2=[C-]C=CC=C2)N=C1;[Ir] .",
"input": "",
"output": " C46H40IrN2OSi-2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by O=C(C1=CC=CC(Cl)=C1Cl)N1CCC(O)C2(CCCNC2=O)C1;O=CO ?",
"input": "",
"output": " C17H20Cl2N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=NN(C2=CC=C(F)C=C2I)C=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C9H7FIN3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=CCCCCCN(O)C(=O)C=CC1=CC=C(Cl)C=C1Cl .",
"input": "",
"output": " C16H19Cl2NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CN(CC(C)(C)F)C(=O)C1N=C(C2CC3(N(CC4=CC=C(Cl)C(F)=C4)S(=O)(=O)C4=CC=CC=C4)CCC23)NC1(C)C , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C30H37ClF2N4O3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)CC1N=C(C2=CC=C(Cl)C=C2)C2=C(SC(C(=O)C34CC3CC(S(=O)(=O)NCC3=CC(C(CC(=O)O)C5=CC(OC)=C6C(=C5)N=NN6C)=CC=C3C)C4)=C2C)N2C=NN=C12 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C44H43ClN8O8S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(C)CCCCC(C(=O)N1CCC(O)C1)C(C)(C)C is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C17H33NO2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of COC(CC1=CC=CC(Cl)=C1)C(=O)NCC=CCNC(=O)O ?",
"input": "",
"output": "Sure. C15H19ClN2O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you tell me the molecular formula of C=CC=C(C)C1OC2CC3C4CCC5=CC(=O)C=CC5(C)C4(F)C(O)CC3(C)C2(C(=C)C)O1 ?",
"input": "",
"output": " C28H35FO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC(C)CC1=C(F)C=CC=C1OCC(F)(F)F , what would be its molecular formula?",
"input": "",
"output": "It is C13H16F4O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for C=COC1=CC(CCCCC)=C(C(=O)OC)C(O)=C1C1C=C(C)CCC1 .",
"input": "",
"output": " C22H30O4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule CC(C1=CC=CO1)P(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 ?",
"input": "",
"output": " C18H17O4P ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C1CC(NS(=O)(=O)C2CC2)C(C2=CC=C(Cl)S2)N1 ?",
"input": "",
"output": " C11H13ClN2O3S2 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CNCCNC(=O)C1=CC=C(C(C)N=[N+]=[N-])C=C1 into molecular formula.",
"input": "",
"output": " C12H17N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of O=C(OCC1=CC=CC=C1)C1(C(=O)OCC2=CC=CC=C2)C2=C(SC(C=C3C(=S)C4=CC=CC=C4C3=S)=C2)C2=C1C1=C(S2)C2=C(C=C(C=C3C(=S)C4=CC=CC=C4C3S)S2)S1 ?",
"input": "",
"output": "The molecular formula is C49H28O4S8 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC(CO)NCC1=CC(Cl)=C(CNC2=CC=CC(C3=CC=CC(C4=CC=C(CN(C)CCO)C=C4)=C3Cl)=C2C=N)C=C1OCC1=CN=CC(C#N)=C1 ?",
"input": "",
"output": " C41H42Cl2N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C1=CC=C(C2(C3=CC=CC=C3)C3=CC=CC=C3C3=CC=C(N(C4=CC=C(N5C6=CC=CC=C6C6=CC=CC=C65)C=C4)C4=CC=C5C(=C4)OC4=C6C=CC=CC6=CC=C54)C=C32)C=C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C59H38N2O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C(CN1C=NC(C2=CC=CC=C2)=C1C1=CC=NC=C1)N1CCNCC1 .",
"input": "",
"output": " C20H21N5O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the formula of the molecule O=C(CN1C=CN=C1)N1C2CCC1CN(C1=NC(OCC34CCCN3CCC4)=NC3=C(F)C(C4=CC(O)=CC5=CC=CC=C45)=CC=C13)C2 ?",
"input": "",
"output": " C37H38FN7O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC1=CC(C(=O)O)=C(F)C=C1NSC1=CSC(C2=CC=C(C3=CC(F)=C(C(F)(F)F)C(F)=C3)C(O)=C2F)=N1 ?",
"input": "",
"output": "The molecular formula is C24H13F7N2O4S2 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC1CN(C2=CC=C(C(=O)NC3=CC(F)=C4N=CC=CC4=C3)C3=NC=CN=C23)CC(C)N1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H23FN6O ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of NC(=CC=S)C1=CNC2=NC=CC(N3CCCC4(CCCCN4)C3)=C12 ?",
"input": "",
"output": "Sure. C19H25N5S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula for the molecule denoted by CC1=CC=C(C2=C(C)N(C)N=C2C)C=C1N(C)C1=CC=C(C#N)C(Br)=C1;CC1=CC=C(C2=C(C)N(C)N=C2C)C=C1N(C)C1=CC=C(C#N)C(C(F)(F)F)=C1;CCN1N=C(C)C(C2=CC=C(C)C(N(C)C3=CC=C(C#N)C(Br)=C3)=C2)=C1C;CCN1N=C(C)C(C2=CC=C(C)C(N(C)C3=CC=C(C#N)C(C(F)(F)F)=C3)=C2)=C1C ?",
"input": "",
"output": " C88H88Br2F6N16 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CC(N)COC1=CC=C(C2=CN=C(N)C(C(=O)CC3=CN=CC=C3N3CCOCC3)=N2)C=C1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C24H28N6O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=C(OC2=CC=CC=C2)C=CC(N)=C1N1CCOC(CN(C)C(=O)OC(C)(C)C)C1 . Can you tell me?",
"input": "",
"output": "Sure. It's C24H33N3O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " COC(=O)CCCCCC1=CC(F)=CC(OCC(C)CCC(N)=O)=C1F is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C19H27F2NO4 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code CCCC1CC2CCC1N2C1=NC2=C(C(Br)=NN2C2CCCCO2)C(=O)N1C;CN1C(N2C3CCC2C(NC(=O)OC(C)(C)C)C3)=NC2=C(C(Br)=NN2C2CCCCO2)C1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C42H59Br2N11O6 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please write the molecular formula of the molecule O=C1NCCC2=CC=C([B-](F)(F)F)C=C12;[K+] .",
"input": "",
"output": " C9H8BF3KNO ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " C[Si](C)(C)OC1=CC=CC2=C1CCC2N is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H19NOSi ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation C=C(C)C1=CC2=C(C=C1C)NC(N)=N2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C11H13N3 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Considering the SMILES code COCCN1CC(=O)N(C2CC(=O)N(C3=CC=CC(OC)=C3)C2)C1=O , can you determine the corresponding molecular formula?",
"input": "",
"output": "It would be C17H21N3O5 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of CCOC(=O)C1CCN(S(=O)(=O)C2=CN=C3C=CC=CC3=C2)C2=CC=CC=C21 ?",
"input": "",
"output": "The molecular formula is C21H20N2O4S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of COC1CCN(S(=O)(=O)NC(C(=O)O)C2=CC=C(F)C=C2)CC1 . Can you tell me?",
"input": "",
"output": "Sure. It's C14H19FN2O5S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CCC1=NC=CN1CC1CCCN1C(=O)C1=CC2=CC=CN2C=N1 , what would be its molecular formula?",
"input": "",
"output": "It is C18H21N5O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC(=O)OC1CC(COC(=O)C2=CC=CC=C2)OC1N1CC(C)C(=O)NC1=O , what would be its molecular formula?",
"input": "",
"output": "It is C19H22N2O7 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Given the SMILES representation CC1=CN=C(N2CC3CN(S(C)(=O)=O)C(C4=CC=CC=C4)C3C2)N=C1N(C)C , what would be its molecular formula?",
"input": "",
"output": "It is C20H27N5O2S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "The SMILES representation COC1=CC=CC2=C1C=C(C(=O)NC(CC1CC1)C(=O)NC(C#N)CC1C(=O)NC3=CC=CC(C)=C31)N2 represents a specific molecule. Can you reveal its molecular formula?",
"input": "",
"output": "Sure. It's C28H29N5O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CC1=CC=CC2=C(C3=[C-]C(OC4=[C-]C(C5=NC6=CC=CC=C6[Se]5)=CC=C4)=CC=C3)N=CN=C12;[Pt+2] . Can you tell me?",
"input": "",
"output": "Sure. It's C28H17N3OPtSe .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of CCC(=O)C(C)C=C(C)C1C(C)=CC(C)=CC1(C)C1OC(OC)C(C)C(=O)C1C . Can you tell me?",
"input": "",
"output": "Sure. It's C25H38O4 .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule CSC1=NC2=C(F)C(Br)=C(C)C=C2C(NC2CCN(C(=O)OC(C)(C)C)C2)=C1C=O into molecular formula.",
"input": "",
"output": " C21H25BrFN3O3S ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Can you give the molecular molecular formula of N=C(O)CC(N=C(O)C1CCC(O)=N1)C(O)=NC1CSSCC2N=C(O)C(CC3=CNC4=CC=CC=C34)N=C(O)C(CCCCN)N=C(O)C(CO)N=C(O)C(CO)N=C(O)C3CSSCC(C(=N)O)N=C(O)C(CSSCC(N=C1O)C(O)=NC(CC(=N)O)C(O)=N3)N=C(O)C(CCCNC(=N)N)N=C(O)C(CO)N=C(O)C(CC1=CN=CN1)N=C(O)C(CC(=O)O)N=C(O)C(CCCNC(=N)N)N=C2O ?",
"input": "",
"output": "Sure. C79H117N31O26S6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "I'd like to know the molecular formula of C=C1N(C)C2=CN=C(NC3=CN4N=CN=C4C=C3Cl)N=C2N1C12CC3CC(CC(CO)(C3)C1)C2 . Can you tell me?",
"input": "",
"output": "Sure. It's C24H27ClN8O .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Please provide the molecular formula for CCOC(=O)CCN1C=CC=[N+]1CC(=O)CC1=C(C)C=CC=C1C;[O-][OH+][CH-]C(F)(F)F .",
"input": "",
"output": " C21H27F3N2O5 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": " CCOC(=O)C1=NC(C2=CC=C(Cl)C(C(F)(F)F)=C2)=NO1 is the SMILES representation of a molecule. What is its molecular formula?",
"input": "",
"output": " C12H8ClF3N2O3 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "What is the molecular formula of COC(=O)C1=C(N2CC(CCl)CC2=O)SC(C)=C1C ?",
"input": "",
"output": "The molecular formula is C13H16ClNO3S .",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
},
{
"instruction": "Convert the SMILES representation of a molecule NC(N)=NC(N)=NC1=CC=CC(C2CCNCC2)=C1 into molecular formula.",
"input": "",
"output": " C13H20N6 ",
"metadata": {
"task": "name_conversion-s2f",
"split": "SMolInstruct"
}
}
]