File size: 3,389 Bytes
8af1909 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 |
import pandas as pd
import numpy as np
from rdkit import Chem
from rdkit.Chem import AllChem
import h2o
from h2o.estimators import H2OGradientBoostingEstimator
# Initialize H2O
h2o.init()
def featurize_smiles(smiles):
try:
mol = Chem.MolFromSmiles(smiles)
# Generate a binary Morgan fingerprint with a radius of 2 and 1024 bits
fingerprint = AllChem.GetMorganFingerprintAsBitVect(mol, radius=2, nBits=1024)
features = np.array(fingerprint)
return features
except Exception as e:
print(f"Error featurizing SMILES: {smiles} -> {e}")
return np.zeros(1024) # Return a zero vector if there's an issue
# Specify the input and output column indices
input_column_index = 5 # Replace with your SMILES input column index
output_column_index = 3 # Replace with your output column index
# Prepare a H2OFrame for the first train-test split
file_path = '/Users/colestephens/Desktop/CodeFolders/ML_Dataset_Curation_Project/Split_data/homo_hydrogenation.xlsx'
splits = pd.ExcelFile(file_path)
# Let's use the first split as an example
train_key = 'train_split_0'
test_key = 'test_split_0'
# Read the train and test sets
train_df = pd.read_excel(splits, sheet_name=train_key)
test_df = pd.read_excel(splits, sheet_name=test_key)
# Determine the column names using indices
input_column_name = train_df.columns[input_column_index]
output_column_name = train_df.columns[output_column_index]
# Featurize the SMILES columns
train_features = np.array([featurize_smiles(smiles) for smiles in train_df[input_column_name]])
test_features = np.array([featurize_smiles(smiles) for smiles in test_df[input_column_name]])
# Print message after successful featurization
print("Successfully converted SMILES to Morgan fingerprints for train and test sets.")
# Convert to H2OFrames
train_X = pd.DataFrame(train_features)
test_X = pd.DataFrame(test_features)
# Combine features with the target column
train_h2o = h2o.H2OFrame(pd.concat([train_X, train_df[[output_column_name]]], axis=1))
test_h2o = h2o.H2OFrame(pd.concat([test_X, test_df[[output_column_name]]], axis=1))
# Set the target and features
y = output_column_name
X = train_h2o.columns[:-1] # All columns except the last one
# Initialize and train a Gradient Boosting model
gbm_model = H2OGradientBoostingEstimator(
ntrees=50, # Number of trees
max_depth=6, # Maximum depth
learn_rate=0.1, # Learning rate
seed=1 # For reproducibility
)
gbm_model.train(x=X, y=y, training_frame=train_h2o)
# Function to predict the output from SMILES
def predict_product_from_smiles(smiles_str):
# Featurize the input SMILES string
features = featurize_smiles(smiles_str)
# Convert to a DataFrame
feature_df = pd.DataFrame([features])
# Create H2OFrame from the feature DataFrame
feature_h2o = h2o.H2OFrame(feature_df)
# Predict using the trained model
prediction = gbm_model.predict(feature_h2o)
# Retrieve the first element from the prediction column
predicted_value = prediction.as_data_frame()['predict'][0]
# Print the prediction result
print(f"Predicted output for input SMILES '{smiles_str}': {predicted_value}")
# Example usage
example_smiles = 'C=C(CN1)C2=CC(C)=C(C)C=C2C1=O' # Replace with a SMILES string of your choice
predict_product_from_smiles(example_smiles)
# Shutdown H2O
h2o.shutdown(prompt=False) |