Datasets:
File size: 19,807 Bytes
62a9c07 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 440 441 442 443 444 445 446 447 448 449 450 451 452 453 454 455 456 457 458 459 460 461 |
[
{
"name": "IChO-2025_8",
"background": {
"context": "Carbon monoxide is a toxic gas because it binds to haemoglobin and blocks oxygen binding. A major source of CO is incomplete combustion of engine fuel. Therefore, many exhausts are fitted with catalytic converters which remove CO and other hazardous compounds including unburnt hydrocarbons and nitrogen oxides $NO_{x}$, forming mainly water vapour, carbon dioxide, and nitrogen."
},
"points": 35
},
{
"name": "IChO-2025_8.1",
"modality": "text",
"type": "Qualitative Identification",
"evaluation": "Selection Check",
"points": 4,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Write the balanced equation for each conversion that occurs in a catalytic converter. For each row, ALSO choose whether the relevant element (C in (a,b); N in (c)) is oxidised by oxygen ('Ox'), reduced ('Red'), or unchanged ('Same'). Ignore any reactions between different exhaust gases.",
"rows": [
{
"label": "(a)",
"species": "CO"
},
{
"label": "(b)",
"species": "Unburnt hydrocarbon $C_xH_y$"
},
{
"label": "(c)",
"species": "Nitrogen oxides $NO_x$"
}
],
"choice_options": [
"Ox",
"Red",
"Same"
],
"response_format": "For each row, return an object with keys: 'equation' (string) and 'choice' (one of 'Ox'|'Red'|'Same')."
},
"answer": [
{
"step": 1,
"content": {
"equation": "CO + 1/2 O2 -> CO2",
"choice": "Ox"
},
"points": 1.5,
"grading": "0.5 pt for correct equation; 0.5 pt for correct choice here; remaining 0.5 pt is awarded across (b)/(c) per original rubric."
},
{
"step": 2,
"content": {
"equation": "C_xH_y + (x + y/4) O2 -> xCO2 + (y/2) H2O",
"choice": "Ox"
},
"points": 1.5,
"grading": "1.0 pt for correct equation; 0.5 pt for correct choice."
},
{
"step": 3,
"content": {
"equation": "NO_x -> 1/2 N2 + (x/2) O2",
"choice": "Red"
},
"points": 1.0,
"grading": "1.0 pt for correct equation and choice."
}
]
},
{
"name": "IChO-2025_8.2",
"modality": "text",
"type": "Quantitative Calculation",
"evaluation": "Numeric Verification",
"points": 1,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Catalytic converters contain nanoparticles of noble metals immobilised on high-surface-area supports (e.g., $Al_{2}O_3}$). In one experiment, $m(cat.)=0.10 g$ containing $w(Pd)=10%$ was used. CO flows at $v(CO)=10 mL {min}^{-1}$ and is mixed with air (assume $20%,O_{2}, 80% N_{2}$) at $T=273.15 K$ and $p=1.00 atm.",
"question_text": "Calculate the air flow rate $v (in mL min^{-1})$ of air required to be present in a stoichiometric ratio."
},
"answer": [
{
"step": 1,
"content": "Stoichiometry requires 0.5 mol O2 per mol CO → 5 mL O2 per 10 mL CO. Since air is 20% O2, required air flow = 5/0.20 = 25 mL·min⁻¹.",
"points": 1
}
]
},
{
"name": "IChO-2025_8.3",
"modality": "text",
"type": "Quantitative Calculation",
"evaluation": "Numeric Verification",
"points": 6,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Assume 10% of the Pd atoms in the nanoparticles are exposed on the surface. Assume the conversion of CO to $CO_{2}$ was 70%. Calculate the number of CO2 molecules formed after 1 h per surface Pd atom."
},
"answer": [
{
"step": 1,
"content": "Volume of CO in 1 h: 60 min × 0.01 dm^3·min^-1 = 0.6 dm^3.",
"points": 1
},
{
"step": 2,
"content": "Moles CO: $n = \\frac{pV}{RT} = \\frac{101325 \\times 0.6 \\times 10^{-3}}{8.314 \\times 273.15} = 0.02677\\,mol$.",
"points": 1
},
{
"step": 3,
"content": "Moles CO2 formed (70%): $0.02677 \\times 0.7 = 0.01874\\,mol$ → molecules $= 0.01874 \\times 6.022 \\times 10^{23} = 1.128 \\times 10^{22}$.",
"points": 1
},
{
"step": 4,
"content": "Surface Pd mass: total Pd = 0.10 g × 10% = 0.01 g; surface fraction 10% → 0.001 g.",
"points": 1
},
{
"step": 5,
"content": "Surface Pd atoms: $(0.001 / 106.42) \\times 6.022 \\times 10^{23} = 5.659 \\times 10^{18}$.",
"points": 1
},
{
"step": 6,
"content": "CO2 molecules per surface Pd atom: $(1.128 \\times 10^{22}) / (5.659 \\times 10^{18}) = 1.99 \\times 10^{3}$.",
"points": 1
}
]
},
{
"name": "IChO-2025_8.4",
"modality": "image + text",
"type": "Tabular Enumeration",
"evaluation": "Table Validation",
"points": 3,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Ruthenium nanoparticles are efficient catalysts for CO combustion. The bonding interactions between CO molecules and surface Ru atoms are of two types: (1) σ-bonding through a lone pair on the carbon atom; (2) π-interaction through overlap between Ru d-orbitals and CO molecular orbitals.",
"instruction": "Complete the molecular orbital (MO) diagram of CO by assigning electrons and indicate the type (σ or π) of overlap for each MO.",
"table": {
"headers": [
"MO",
"1",
"2",
"3",
"4",
"5",
"6",
"7",
"8"
],
"rows": [
{
"label": "Type of overlap",
"values": [
"",
"",
"",
"",
"",
"",
"",
""
]
}
]
},
"image": "images/8/8.4_mo_diagram.png"
},
"answer": [
{
"content": "MO types of overlap: 1 = σ, 2 = σ, 3 = π, 4 = π, 5 = σ, 6 = π, 7 = π, 8 = σ.",
"points": 1.5,
"grading": "0.25 pt for each correctly assigned σ/π overlap; adding (*) for antibonding not required."
},
{
"content": "Electrons correctly filled in molecular orbitals with spins shown.",
"points": 1.5,
"grading": "1.5 pts for correct filling and spin assignment; if spins missing but electrons correct, 0.5 pt deducted."
}
]
},
{
"name": "IChO-2025_8.5",
"modality": "text",
"type": "Qualitative Identification",
"evaluation": "Selection Check",
"points": 2,
"field": "",
"source": "IChO-2025",
"question": {
"context": "What is the effect of the Ru–CO π-interaction on the Ru–CO and C–O bond strengths? Choose the correct answer for each bond.",
"subquestions": [
{
"id": "8.5a",
"text": "Ru–CO bond strength:",
"options": {
"A": "increases (in)",
"B": "decreases (dec)",
"C": "no change (nc)"
}
},
{
"id": "8.5b",
"text": "C–O bond strength:",
"options": {
"A": "increases (in)",
"B": "decreases (dec)",
"C": "no change (nc)"
}
}
]
},
"answer": [
{
"subquestion": "8.5a",
"correct_option": "A",
"content": "Ru–CO bond strength increases due to π-backbonding from Ru to CO.",
"points": 1
},
{
"subquestion": "8.5b",
"correct_option": "B",
"content": "C–O bond strength decreases because π-backbonding fills antibonding orbitals of CO.",
"points": 1
}
]
},
{
"name": "IChO-2025_8.6",
"modality": "image + text",
"type": "Qualitative Identification",
"evaluation": "Selection Check",
"points": 2,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Adsorbed CO molecules show strong IR absorptions due to C–O stretching vibrations. CO can interact with one or more metal atoms on a surface, forming three adsorption modes (A, B, C). The IR peaks observed for free CO and the three binding modes are at 1850, 1930, 2100, and 2143 cm⁻¹. Assign each wavenumber to the correct adsorption mode.",
"table": {
"headers": [
"",
"1850 cm⁻¹",
"1930 cm⁻¹",
"2100 cm⁻¹",
"2143 cm⁻¹"
],
"rows": [
{
"label": "A",
"values": [
"",
"",
"",
""
]
},
{
"label": "B",
"values": [
"",
"",
"",
""
]
},
{
"label": "C",
"values": [
"",
"",
"",
""
]
},
{
"label": "CO (free)",
"values": [
"",
"",
"",
""
]
}
]
},
"image": "images/8/8.6_adsorption_modes.png"
},
"answer": [
{
"content": "A = 2100 cm⁻¹; B = 1930 cm⁻¹; C = 1850 cm⁻¹; free CO = 2143 cm⁻¹.",
"points": 2,
"grading": "0.5 pt for each correctly assigned wavenumber."
}
]
},
{
"name": "IChO-2025_8.7",
"modality": "text",
"type": "Quantitative Calculation",
"evaluation": "Numeric Verification",
"points": 4,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Dispersion of a metal catalyst refers to the percentage of its atoms exposed on the surface. Dispersion can be determined by pulse chemisorption of CO, since it adsorbs selectively onto surface atoms. Equal pulses of known CO amounts are injected, and the unadsorbed CO from each pulse is detected until saturation. One experiment used 50 µL pulses of 10% CO in He at 25 °C and 100 kPa, with 15 mg catalyst composed of 10 wt% Ni on Al₂O₃. Assume one CO molecule adsorbs per surface Ni atom.",
"table": {
"headers": [
"Pulse #",
"1",
"2",
"3",
"4",
"5",
"6",
"7"
],
"rows": [
{
"label": "% of pulse unadsorbed",
"values": [
"4",
"10",
"20",
"50",
"80",
"100",
"100"
]
}
]
},
"question_text": "Calculate the percentage of Ni atoms exposed on the surface, %Ni."
},
"answer": [
{
"content": "Volume of adsorbed CO = 50~\\mu L \\times 0.1 \\times (0.96 + 0.90 + 0.80 + 0.50 + 0.20) = 16.8~\\mu L.",
"points": 1
},
{
"content": "Molecules of adsorbed CO: $n = \\dfrac{100000 \\times 1.68\\times10^{-8}}{8.314 \\times 298} \\times 6.022\\times10^{23} = 4.08\\times10^{17}$ molecules.",
"points": 1
},
{
"content": "Total Ni atoms = $0.015~\\mathrm{g} \\times 0.1 \\times \\dfrac{6.022\\times10^{23}}{58.69} = 1.54\\times10^{19}$ atoms.",
"points": 1
},
{
"content": "\\% Ni exposed = $\\dfrac{4.08\\times10^{17}}{1.54\\times10^{19}} \\times 100\\% = 2.65\\%.$",
"points": 1
}
]
},
{
"name": "IChO-2025_8.8",
"modality": "text",
"type": "Structure Construction",
"evaluation": "Structure Match",
"points": 8,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Compounds A–D are neutral Mn(I) carbonyl complexes involved in a sequence of reactions starting from Mn2(CO)10 with Br2 and a bidentate nitrogen ligand (L = 2,2'-bipyridine-type). B, C, and D do not contain two CO ligands in a trans arrangement. The IR spectrum of C contains a band at 2042 cm⁻¹ in addition to the CO stretching bands. Table provides %Mn by mass and number of CO stretching bands. Write the SMILES of compounds A–D corresponding to their correct structures.",
"reaction_scheme": [
{
"reactant_name": "$Mn_{2}(CO)_{10}$",
"conditions": "$Br_{2}$",
"product_name": "A"
},
{
"reactant_name": "A",
"conditions": "C1(C2=NC(C3=NC=CC=C3)=CC=C2)=CC=CC=N1",
"product_name": "B"
},
{
"reactant_name": "B",
"conditions": [
"Ag_{+}",
"[O-]S(=O)(C(F)(F)F)=O",
"NaN_{3}"
],
"product_name": "C"
},
{
"reactant_name": "B",
"reactant_smiles": "[Mn](Br)(C#O)(C#O)(C#O)(N1C=CC=NC2=CC=CC=N12)",
"conditions": "$h\\nu$ (photolysis)",
"product_name": "D"
}
]
},
"answer": [
{
"label": "A",
"smiles": "Br[Mn]([C]=O)([C]=O)([C]=O)([C]=O)[C]=O"
},
{
"label": "B",
"smiles": "Br[Mn]1([N]2=C(C3=NC=CC=C3)C=CC=C2C4=[N]1C=CC=C4)([C]=O)([C]=O)[C]=O",
"alternative_smiles": ""
},
{
"label": "C",
"smiles": "[Mn](N=[N+]=[N-])(C#O)(C#O)(C#O)(N1C=CC=NC2=CC=CC=N12)",
"alternative_smiles": ""
},
{
"label": "D",
"smiles": "[Mn](Br)(C#O)(C#O)(N1C=CC=NC2=CC=CC=N12)"
}
],
"grading": {
"criteria": [
"A correct 1 pt (Mn(CO)5Br formula only 0.5 pt).",
"B correct fac configuration 3 pts (unclear geometry 2.0 pts; correct formula only or non-coordinated Br 0.5 pt).",
"C correct fac configuration 2 pts (unclear geometry 1.5 pts; correct formula only or non-coordinated azide 0.5 pt).",
"D correct cis configuration 2 pts (unclear geometry 1.5 pts; correct formula only/trans/five-coordinate with non-coordinated azide 0.5 pt).",
"No credit for structures not matching formula."
]
}
},
{
"name": "IChO-2025_8.9",
"modality": "text",
"type": "Structure Construction",
"evaluation": "Structure Match",
"points": 5,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Compound C reacts with alkynes in an Inorganic Click (iClick) reaction to form triazole products. During the conversion of C to E, the 2042 cm⁻¹ band in the IR spectrum of C disappears, and E shows two new C=O bands in the range 1735–1725 cm⁻¹. After 6 h, E converts to F, which shows only one C=O band in this range. Compound G does not contain manganese and has two planes of symmetry. Draw the structures of compounds E, F, and G (only one enantiomer if chiral). Here, instead of drawing, provide the SMILES of compounds E, F, and G."
},
"answer": [
{
"label": "E",
"content": "[Mn](C#O)(C#O)(C#O)(N1C=CC=NC2=CC=CC=N12)(N3C(C(=O)OC)=C(NN=C3C(=O)OC)C(=O)OC)"
},
{
"label": "F",
"content": "[Mn](C#O)(C#O)(C#O)(N1C=CC=NC2=CC=CC=N12)(N3C(=C(NN=C3C(=O)OC)C(=O)OC)C(=O)OC)"
},
{
"label": "G",
"content": "COC(=O)C1=NN=CN1C(=O)OC"
}
],
"grading": {
"criteria": [
"E correct 2 pts (either enantiomer acceptable; full credit if ligands around Mn same as in C and triazole correctly coordinated through N). Partial credit 1 pt if ligands rearranged but triazole correct. If F drawn here, 1 pt.",
"F correct 2 pts (either enantiomer acceptable; full credit if ligands around Mn same as in C/E and triazole coordinated through correct N). Partial credit 1 pt if ligands rearranged but triazole correct. If E drawn here, 1 pt.",
"G correct 1 pt (correct triazole NH isomer; 0.5 pt if wrong isomer but consistent with F).",
"Total = 5 pts."
]
}
}
]
|