Datasets:
File size: 16,495 Bytes
b7dd1a0 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 |
[
{
"name": "IChO-2025_7",
"background": {
"context": "The petroleum industry plays an important role in the UAE economy. The oil called 'Dubai Crude' is a benchmark for global oil prices. Crude oil is a complex mixture of organic compounds, mainly hydrocarbons, along with smaller amounts of S, N, and O-containing compounds.\n\nThe hydrocarbon composition of oil is characterised by the PONA number. The abbreviation stands for $P$ - paraffins (alkanes), $O$ - olefins (alkenes), $N$ - naphthenes (cycloalkanes), and $A$ - aromatics (arenes). One method to determine the composition of oil is gas chromatography–mass spectrometry (GC–MS)."
},
"points": 22
},
{
"name": "IChO-2025_7.1",
"modality": "image + text",
"type": "Structure Construction",
"evaluation": "Structure Match",
"points": 8,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Below are mass spectra (electron impact ionisation, $I$ – relative intensity) of four hydrocarbons 1–4 of Dubai Crude oil. They include linear alkane P, linear alkene O (no cis–trans isomers), monosubstituted cycloalkane N, and arene A. 1'–4' are selected fragmentation products. Give the SMILES string** for each compound (1–4) and each main fragment (1'–4'). If you cannot determine 1–4, write letter code (P/O/N/A) and molecular formula. Hint: species $3'$ is formed by a McLafferty rearrangement.",
"requirement": "Your response should list SMILES for 1, 2, 3, 4, 1', 2', 3', and 4'.",
"images": [
"images/7/7.1_1.png",
"images/7/7.1_2.png",
"images/7/7.1_3.png",
"images/7/7.1_4.png"
]
},
"answer": [
{
"step": 1,
"content": "1 = ethylcyclohexane, SMILES: CCC1CCCCC1, class N, formula C8H16",
"points": 1
},
{
"step": 2,
"content": "2 = n-octane, SMILES: CCCCCCCC, class P, formula C8H18",
"points": 1
},
{
"step": 3,
"content": "3 = 1-octene, SMILES: C=CCCCCCC, class O, formula C8H16",
"points": 1
},
{
"step": 4,
"content": "4 = ethylbenzene, SMILES: CCC1=CC=CC=C1, class A, formula C8H10",
"points": 1
},
{
"step": 5,
"content": "1' = cyclohexyl cation fragment, SMILES: C1CCC[CH+]C1, formula C6H11+",
"points": 1
},
{
"step": 6,
"content": "2' = propyl or isopropyl cation, SMILES: CC[CH2+], formula C3H7+",
"alternative_smiles": "C[CH+]C",
"points": 1
},
{
"step": 7,
"content": "3' = allylic McLafferty fragment from oct-1-ene, SMILES: C=CCCC+, formula C4H7+",
"points": 1
},
{
"step": 8,
"content": "4' = benzyl/tropylium cation, SMILES: [CH2+]C1=CC=CC=C1, formula C7H7+",
"alternative_smiles": "C1=CC=CC=C[CH+]1",
"points": 1
}
],
"grading": {
"criteria": {
"for_compounds_1_to_4": {
"full": "1 pt per correct SMILES match.",
"partial": [
{
"condition": "SMILES incorrect but molecular formula correct.",
"points": 0.25
},
{
"condition": "Compound belongs to the same P/O/N/A class.",
"points": 0.25
},
{
"condition": "No SMILES provided but molecular formula given.",
"points": 0.25
},
{
"condition": "Only the correct class letter (P/O/N/A) provided.",
"points": 0.25
}
]
},
"for_fragments_1prime_to_4prime": {
"full": "1 pt per correct SMILES fragment (including ion).",
"partial": [
{
"condition": "SMILES incorrect but molecular formula correct.",
"points": 0.25
},
{
"condition": "Charge (“+” or “·+”) is explicitly indicated even if structure incorrect.",
"points": 0.25
}
]
}
}
}
},
{
"name": "IChO-2025_7.2",
"modality": "image + text",
"type": "Structure Construction",
"evaluation": "Structure Match",
"points": 2,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Two mass spectra of branched alkanes 5 and 6 are shown. Give the SMILES of 5 and 6.",
"images": [
"images/7/7.2_5.png",
"images/7/7.2_6.png"
]
},
"answer": [
{
"step": 1,
"content": "5 = 2-methylbutane (isopentane). SMILES: CC(CC)C",
"formula": "C5H12",
"points": 1
},
{
"step": 2,
"content": "6 = 2,2-dimethylpropane (neopentane). SMILES: CC(C)(C)C",
"formula": "C5H12",
"points": 1
}
],
"grading": {
"per_compound": {
"5": {
"full_credit": "1 pt for correct SMILES (any valid equivalent).",
"partial_credit": [
{
"condition": "Only the correct molecular formula (C5H12) is given.",
"points": 0.5
}
]
},
"6": {
"full_credit": "1 pt for correct SMILES (any valid equivalent).",
"partial_credit": [
{
"condition": "Gives 2,2,3,3-tetramethylbutane instead of 2,2-dimethylpropane.",
"points": 0.5
},
{
"condition": "Only the correct molecular formula (C5H12) is given.",
"points": 0.5
}
]
}
},
"special_case": "If the two structures (5 and 6) are swapped, award a TOTAL of 1 pt."
}
},
{
"name": "IChO-2025_7.3",
"modality": "text",
"type": "Quantitative Calculation",
"evaluation": "Numeric Verification",
"points": 3,
"field": "",
"source": "IChO-2025",
"question": {
"context": "A $V = 115\\,\\mu\\mathrm{L}$ sample of Dubai Crude (density $\\rho = 871\\,\\mathrm{g\\,dm^{-3}}$) is completely burnt. The gases are passed through $\\mathrm{H_2O_2}$ with excess $\\mathrm{Ba(OH)_2}$ to form a white precipitate of mass $m = 1.395\\,\\mathrm{g}$. Upon acidification with $\\mathrm{HNO_3}$ the precipitate mass decreases by $98.95\\%$. Calculate the sulfur content $w(\\mathrm{S})$ (wt%)."
},
"answer": [
{
"step": 1,
"content": "Only $\\mathrm{BaSO_4}$ remains after acidification. $n(\\mathrm{BaSO_4}) = (1 - 0.9895) \\times \\frac{1.395\\,\\mathrm{g}}{233.39\\,\\mathrm{g\\,mol^{-1}}} = 6.276 \\times 10^{-5}\\,\\mathrm{mol}$, hence $n(\\mathrm{S}) = 6.276 \\times 10^{-5}\\,\\mathrm{mol}$.",
"points": 1
},
{
"step": 2,
"content": "Mass of S in sample: $m(\\mathrm{S}) = n \\cdot M(\\mathrm{S}) = 6.276 \\times 10^{-5}\\,\\mathrm{mol} \\times 32.06\\,\\mathrm{g\\,mol^{-1}} = 2.01 \\times 10^{-3}\\,\\mathrm{g}$.",
"points": 1
},
{
"step": 3,
"content": "Sample mass: $m_{\\text{sample}} = 115 \\times 10^{-6}\\,\\mathrm{dm^3} \\times 871\\,\\mathrm{g\\,dm^{-3}} = 0.100\\,\\mathrm{g}$. Therefore $w(\\mathrm{S}) = 2.01\\%$ (sour oil).",
"points": 1
}
]
},
{
"name": "IChO-2025_7.4",
"modality": "multiple choice",
"type": "Qualitative Identification",
"evaluation": "Selection Check",
"points": 1,
"field": "",
"source": "IChO-2025",
"question": {
"context": "In addition to sulfur, crude oil contains trace amounts of selenium, which transfers into the water used during refining. In aqueous solutions, selenium exists as $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$. The concentration of $\\mathrm{SeO_3^{2-}}$ can be determined chromatographically by its selective reaction with diamine **X** under acidic conditions, forming piazoselenol **Y**. This reaction is complete only at the right pH range. X and Y elute at different times (t) on the chromatogram shown below. The absorption spectra (1 mAbs corresponds to absorbance $A = 0.001$ ) of X and Y are also provided.",
"images": [
"images/7/7.4_1.png",
"images/7/7.4_1.png"
],
"reaction_scheme": {
"reactions": [
{
"reactant_name": "X",
"reactant_smiles": "NC1=CC=C(N)C(N)=C1",
"conditions": [
{
"step": 1,
"reagents": [
"H2SeO3",
"H+"
]
}
],
"product_name": "Y",
"product_smiles": "O=[N+](C1=CC2=N[Se]N=C2C=C1)[O-]"
}
]
},
"question_text": "Choose the optimal wavelength $(\\lambda)$ for the absorbance measurements in the chromatogram.",
"options": {
"A": "270 nm",
"B": "300 nm",
"C": "350 nm",
"D": "510 nm"
}
},
"answer": [
{
"correct_option": "C",
"content": "The optimal wavelength for absorbance measurements is **350 nm**, as both X and Y absorb the most light at this wavelength.",
"points": 1
}
]
},
{
"name": "IChO-2025_7.5",
"modality": "text",
"type": "Quantitative Calculation",
"evaluation": "Numeric Verification",
"points": 8,
"field": "",
"source": "IChO-2025",
"question": {
"context": "Acidified water from the refining process, containing $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$ (solution 1), was analysed as follows. A $9.50~\\mathrm{mL}$ sample was mixed with $0.50~\\mathrm{mL}$ of an aqueous solution of X ($300~\\mu\\mathrm{M}$, excess) to form solution 2. The chromatographic peak areas (S) were measured for compounds X and Y, which are proportional to their concentrations. For a blank sample, $S(X) = 0.825$ mAbs·min. For known $\\mathrm{SeO_3^{2-}}$ concentrations, $S(Y) = 1.21 \\times c(\\mathrm{Se})$ (in µM). The ratios $S(X)/S(Y)$ measured at different pH values for four strong acids are given below (assume equilibrium):",
"table": {
"headers": [
"pH",
"HNO3",
"HCl",
"HBr",
"HI"
],
"rows": [
[
"3.0",
"1.523",
"0.634",
"0.523",
"1.722"
],
[
"2.0",
"3.334",
"0.538",
"0.377",
"2.223"
],
[
"1.5",
"5.454",
"0.523",
"0.368",
"5.114"
],
[
"1.0",
"7.783",
"0.523",
"0.368",
"8.123"
],
[
"0",
"10.232",
"0.581",
"0.399",
"11.736"
],
[
"-0.50",
"13.450",
"0.782",
"0.546",
"15.780"
]
]
},
"question_text": "Calculate the concentrations of selenium species ($c_{0}(\\mathrm{SeO_3^{2-}})$, $c_{0}(\\mathrm{SeO_4^{2-}})$ in µM) in solution 1."
},
"answer": [
{
"step": 1,
"content": "At high [H+] (HNO3), $\\mathrm{SeO_3^{2-}}$ is oxidised to $\\mathrm{SeO_4^{2-}}$, leading to a high $S(X)/S(Y)$ ratio (minimal formation of Y). Conversely, HI reduces $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$ to Se, again giving high ratios. HCl and HBr give optimal conditions (1 pt).",
"points": 1
},
{
"step": 2,
"content": "From the blank: $S(X) = 0.825$ mAbs·min for $c(X) = 15.0~\\mu\\mathrm{M}$ (since $300~\\mu\\mathrm{M} \\times 0.50~\\mathrm{mL} / (9.50 + 0.50)~\\mathrm{mL} = 15.0~\\mu\\mathrm{M}$). Therefore, the proportionality constant $k = 0.825 / 15.0 = 0.0550~\\mathrm{mAbs·min·\\mu M^{-1}}$ (1 pt).",
"points": 1
},
{
"step": 3,
"content": "For HCl medium: total Se species $= 15.0~\\mu\\mathrm{M}$.\n$$[X]_{\\mathrm{HCl}} + [\\mathrm{SeO_3^{2-}}] = 15.0$$\n$$0.523 = 0.0550 [X]_{\\mathrm{HCl}} / (1.21 [\\mathrm{SeO_3^{2-}}])$$ (1 pt)",
"points": 1
},
{
"step": 4,
"content": "For HBr medium, both $\\mathrm{SeO_3^{2-}}$ and $\\mathrm{SeO_4^{2-}}$ are present:\n$$[X]_{\\mathrm{HBr}} + [\\mathrm{SeO_3^{2-}}] + [\\mathrm{SeO_4^{2-}}] = 15.0$$\n$$0.368 = 0.0550 [X]_{\\mathrm{HBr}} / (1.21([\\mathrm{SeO_3^{2-}}] + [\\mathrm{SeO_4^{2-}}]))$$ (1 pt)",
"points": 1
},
{
"step": 5,
"content": "Solving these simultaneous equations:\n$$[\\mathrm{SeO_3^{2-}}] = 1.20~\\mu\\mathrm{M}, \\quad [\\mathrm{SeO_4^{2-}}] = 0.45~\\mu\\mathrm{M}.$$ (1 pt)",
"points": 1
},
{
"step": 6,
"content": "Before dilution correction:\n$$c(\\mathrm{SeO_3^{2-}})_0 = 1.20~\\mu\\mathrm{M} \\times 10~\\mathrm{mL}/9.5~\\mathrm{mL} = 1.26~\\mu\\mathrm{M},$$\n$$c(\\mathrm{SeO_4^{2-}})_0 = 0.45~\\mu\\mathrm{M} \\times 10~\\mathrm{mL}/9.5~\\mathrm{mL} = 0.47~\\mu\\mathrm{M}.$$ (1 pt)",
"points": 1
},
{
"step": 7,
"content": "Final result: $c_0(\\mathrm{SeO_3^{2-}}) = 1.26~\\mu\\mathrm{M}$, $c_0(\\mathrm{SeO_4^{2-}}) = 0.47~\\mu\\mathrm{M}$.",
"points": 2
}
]
}
]
|