messages listlengths 2 2 | images images listlengths 1 1 |
|---|---|
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=O)(O)[Sn](C(=O)O)(C(=O)O)C(=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)N(C1=C(C1=S)N(C(C)C)C(C)C)C(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C=CC[Sn]O[Sn](CC=C)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1C=CSN=CC1=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1C(=O)NOC1(C(Cl)(Cl)Cl)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(=S)[Se]F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@]1([C@H]2C=CCC[C@H]2C1=O)OC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=CS(=CS1)I"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "P(P(I)I)(I)I"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCOI=CI=NI=IC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "COC(=O)C1=NNC(=N1)CBr"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC[C@@H]1[C@@H]2CCO[C@@]2(C1=O)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(C(=O)P(PP)P(P)P)(O)P(P)P(P)P"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1[C@@H](CO)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@H]([C@@H](C=C)OO)C(=O)OC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CN1C=C(NC=C1Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C123SS1(=N)(S2)S3"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=C=C(F)F)=C(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=NO[Si](=C1)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "N(=P(F)(F)Br)P(=S)(F)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCCCC[C@@H]1[C@H](OC(O1)(C)C)/C=C/C=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=CNC=C1SC#N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[CH2+]CN=S(=N)(O)[O]"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCS[P+](C)(N(C)C)[O-]"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1(/C(=C\\I)/SC(=C)CO1)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCCCNSN(CCCC)N(CCCC)SNCCCC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@]12[C@H](COC1=O)[C@H]3CC[C@@]2(O3)CI"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(C(=O)O)N=C(NNC(=O)N)NNC(=O)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@]1(C[C@@H]2[C@H](N=C(N[C@]23[C@@H](C(=O)O[C@H]1C3O)O)N)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1(C(S1)(SC(Cl)(Cl)Cl)Cl)(SC(Cl)(Cl)Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=C(C(=S)NC(=S)N1N)Br"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=C(C=[In]O1)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[2H]C1(CN(CCO1)N=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=C=C=O)=C=C=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C=C(C(=C)C(=C)N)C(=C)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2N)CC=C4[C@@]3(CC[C@@H](C4)NC)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCOP(=O)(C#N)ON(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=O)(O)P(=O)=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CNN1C=NC(=O)NC1=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=CC=C(C=C1)CN2[C@@H]3[C@H]2C4C5C3C45"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C=C[Tl](C=C)Br"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCN(CC)P(CC)P(CC)N(CC)CC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCOC(=O)[C@H](C=NCCN(C(C)C)C(C)C)C#N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(C(=C=C(B(F)F)B(F)F)B(F)F)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(C(=C(B(F)F)B(F)F)B(F)F)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "COC(=O)[C@H](CS)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1(=N)N(C(=N)N(C(=N)N1O)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCC1C=NC=CN1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "S(=[V]I)(I)I=[Se]"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C([C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)N)O)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=C(C(=O)O)OP(=O)(O)O)C(=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "O=[Mo](=[Mn])=[Co]"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1CSCC(CS1)NS(=O)(=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CS(=O)(=O)OC[C@H]([C@@H](COS(=O)(=O)C)N)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H]1C(=O)O[C@@]([C@]1(C)O)(C)C(=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1[C@@H]2C=C[C@H]1[C@@H]3[C@H]2[C@H]4CO[C@@H](C3=O)O4"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H]1CC[C@H]([C@@H](C1)O)C(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)(C)P(C(C)(C)C)P=C(SC)SC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "P1PPP1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H](C(C1=CC=CC=C1)O)NC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCCCCCCC(=O)OC[C@@H]1C[C@@H]([C@@H]2[C@H]1OC(O2)(C)C)CO"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCC[C@@H]([C@@H](CN[C@@H](C)C(=O)OC)N(CC=C)CC=C)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCSSC(CN=C=S)N=C=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1CC(CCC1N2N(O2)C3CCC(CC3)Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(OOS(OC(F)(F)F)(F)(F)(F)F)(F)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)(C)[Ge](=[Ge](C(C)(C)C)C(C)(C)C)C(C)(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1C23C14N2N34"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=C(/N/C(=N/P(=O)(Cl)Cl)/Cl)\\Cl)\\P(=O)(Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C([C@@H]1[C@H]([C@@H](C(=O)O1)O)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=O)(N(Cl)Cl)OC(Cl)(Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[2H]N([2H])C(CO[2H])(CO[2H])CO[2H]"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CN(N)P(=S)(Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=[As](=C\\Cl)\\Cl)\\Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(/C(=C/Br)/Br)Br"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC12CC3C(C(=C)C1CCC([C@H]2O)O)C(=C)C(=O)O3"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(=O)OB1OB(OB(O1)OB=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC[C@@H]1CCC[C@H]1C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1C(=O)N=[S-](=O)[Se]1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCN(CC)C(=S)SS(=O)(=O)N(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CN1C=NC2=C(C1=N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CS([N-]S(C(F)(F)F)(O)O)(O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(CNC(=S)S)NC(S)S"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC12CCC3C(C1CC[C@@H]2O)CCC4=C3C=CC(=C4)OC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=NP(N=C1)P2C=PPP2"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(N(C(F)F)S(=O)(=O)F)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[N-]=[N+]=N[In]1N=[N+]=N1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=O)(NSNP=S)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1CCC2(C1)[C@H]3CC=CC[C@H]3CO2"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CP(P(=S)(C)C)SC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CO/N=C\\1/SS/C(=N/OC)/S1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=CC=C(C=C1)C#C[C@H](CF)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(P(=O)(CBr)CBr)Br"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=NN=CN=O)NO"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(C[C@@H](C(=O)O)N)CN"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@](CC1=CC=C(C=C1)O)(C(=O)O)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCP(=O)(CCC(=O)Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(C#N)(C(Cl)Cl)C(Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1(C2(P1C)CP2C)C"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.