messages
listlengths
2
2
images
images listlengths
1
1
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)C1=NC/C(=C/COCC2=CC=CC=C2)/S1" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(CO[Si](C)(C)C)(C#N)N=NC(C)(CO[Si](C)(C)C)C#N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C/C=C/C(=C)P(C)C(C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "B(O[C@H]([C@@H](COCC1=CC=CC=C1)C(C)C)N([Si](C)(C)C)[Si](C)(C)C)(O[C@H]([C@@H](COCC2=CC=CC=C2)C(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H]([C@@H](COCC3=CC=CC=C3)C(C)C)N([Si](C)(C)C)[Si](C)(C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C/C=C(\\C(C(C)CCl)O)/Br" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1=C(C(=O)CC2(C1)CCCC2)N=NC3=NC=NS3" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(=O)OC(C)(C)C(C)(C)C(CBr)Br" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CI(C)(C)(C)OI" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C#N)(C(=O)Cl)F" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CN(C)CCCNCC(=N)C#N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(C([N+](=O)[O-])(F)F)OC1=NC(=NC(=N1)OCC([N+](=O)[O-])(F)F)OCC([N+](=O)[O-])(F)F" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C[Si](C)(C)/C=C/[Ge](C)(C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(=O)(C(F)(F)F)NN(N=[N+]=[N-])O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(CN1C(=O)C=C(N1)Cl)OC2=CC=CC=C2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)(C(=O)OCC[Si](C)(C)CCC1=CC=C(C=C1)C[N+](C)(C)C)Br" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1=CC=C2C(=C1)C3=CC=CC=C3[Te]N2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CN(C)N1C=CC=C1SC" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCN(CC)C(=O)SCC1(CC=CC=C1)Cl" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C=C/C=C(/C=N/NC(=O)N)\\OC[N+](=O)[O-]" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CN1C(=O)CC#CN=C1N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)N1C=C(N=C1SC2=NC(=CN2C(C)C)C(C)(C)C)C(C)(C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)P(O)(O)(OCl)Cl" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1C[C@H](OC1)CNC(=O)CSC2=NC=NC=C2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1C(=C=N)C(=CC=N1)SC" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "[2H]C(C(CC)C(=O)OP(=O)(O)ON)O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)(C)[Sn]C1=CN=C(S1)[Si](C)(C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1=NC(=CN=O)N=C1" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1COCC(N1[N+](=O)[O-])C(=O)COC2=CC=CC=C2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)(C)NCOOC" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1C(=C(C(=N)CO1)C#N)N=N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC[Si](CC)(CC)/C(=C/CO[Si](C(C)C)(C(C)C)C(C)C)/C=O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1=COC=C1N(CCl)O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1COCC(N1)CSC2=CC=C(S2)Br" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "[B]PCC#C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CN1C(=O)N(N=N1)CC2=C(C=CC(=C2F)C(=O)O)Cl" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C1=CC=CC=C1Cl)(F)P" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(=O)(NC(O)(O)O)O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(CONC(CS)C(=O)O)C(=O)NCC(C(=O)O)S" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)C(=C)CCCCP(=C)(CCCCC(=C)C(=C)C)CCCOC(=C)C(=C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1(C2C(O2)(N=N1)C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCC(N)OP(=O)(OC(=O)CC1=CC=C(C=C1)OC2=CC=CC=C2)OS(=O)(=O)C3=CC=C(C=C3)Cl" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1=C(N=C(NC1=O)SCC(=O)N)N2SS2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(=O)OC(C)(C)C(=C=C)OC" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(NC(=S)N(CO)N)N(C(=S)N)N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C[C@@H]([Si](C)(C)C)[Ge](C)(C)F" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1=NN=C(O1)CN2CCCN(CC2)S(=O)(=O)N3CCCC3" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1C=C(C(=C1N=O)C=O)O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(C(C(C(F)(F)F)(F)F)F)(C(F)(F)F)N(O)P" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1=CC=C(C=C1)C(=NO[P@@](=O)(N)N(CCCl)CCCl)C2=CC=CC=C2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(=O)NOI" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CS(=O)(=O)O[P+](=O)OC=C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1=C(C=C(C(=C1Cl)OBr)C(OBr)(OBr)OBr)Cl" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCCCNCCC(C)(C)COC(=O)OO" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)(C)SC1=CC(=S)NN=C1C2=CC=CC=C2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCCCCCCC=CC(=O)C#CC#CC(C=C)O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)N(C(C)C)P(N1C=NC(=C1C#N)C#N)OCC[N+]#[C-]" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1CCCC(C1)SCC2=CC(=NC=C2)C#N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)(C)CC1=CI=C(C=C1)N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCP(=[Se])(CC)[Se][Na]" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1=CC(=CC=C1CN2C(=O)N=C(C=N2)Cl)Cl" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "[2H]/C(=C(\\[C@H](C=O)O)/[C@@H]([C@@H](CO)O)O)/F" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C(=O)OCC=C)SSP(=O)(O)O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1=CC(=C(S1)C)CS(=O)(=O)CC2=NC(=NO2)C(C)(C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(=C/C=C(/N)\\N=N)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1CC=C(C1)C2=NSCC2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1=CC=C(C=C1)C#[N+][C-](C(F)(F)F)C(F)(F)F" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1CN(CC2C1CNC2)/N=C(\\C3=C(NC=C3)N)/N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1CN(CCN1)NC(C#N)N=O" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CN=C1C2CN2C(N1)Cl" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCP(=S)(CC)SCSCC" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "COC(=O)NC1=NC=C(N1)SC2=CC=CC=N2" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCCC[Sn](CCCC)(CCCC)NC(=O)OCC" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(#N)NNC(=O)N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCSCOP(=O)(N)N" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1=NN(C(C(=O)N1N)C(C)(C)C)S" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(CN(C(=O)N)O)SC1=CC=CC=N1" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C/C=C/SO[C@@H]1C(C([C@@H](S1)O)C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CS/N=C/C=N/SC" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C(C(COC(=O)N)N=[N+]=[N-])N=[N+]=[N-]" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC(C)N(C(C)C)P1(=CC(C)(C)C)N(P(=CC(C)(C)C)(N1C(C)(C)C)N(C(C)C)C(C)C)C(C)(C)C" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CNS(=O)(=O)CCNS(=O)(=O)C1=CC=CC=C1C#CCN" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CN1C(=NN=N1)ON" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CC1(CC[N+]2=C1C(CC2)C=C)CI" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCN(CC)S(C)(CC)S" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCCON(C)[SiH3]" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C1C(N(N=N1)C2=CC=CO2)[N+](=O)[O-]" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "CCC1=CC(=C([CH+]C(=NC2=C(C=NC=C2C)C)N)N)[CH+]C=C1" } ]
[ { "role": "user", "content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: " }, { "role": "assistant", "content": "C=CCN=C(N)SN" } ]