Update README.md
Browse files
README.md
CHANGED
|
@@ -2,12 +2,16 @@
|
|
| 2 |
license: cc-by-4.0
|
| 3 |
---
|
| 4 |
# Synthetic mass spectra dataset No. 1
|
| 5 |
-
This is the first variant of the GC-EI-MS synthetic dataset generated by NEIMS and RASSP models from 4.8 million structures downloaded from ZINC
|
| 6 |
The overlap with version 2 is approximately 8k structures (negligible), so it's usable as an extension to synth2. If you're choosing between synth1
|
| 7 |
-
and synth2, see section Dataset choice.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 8 |
|
| 9 |
-
For generating this dataset, we used the original NEIMS model downloaded from the official [NEIMS] repository. Since the [RASSP] model is not publicly available,
|
| 10 |
-
we trained our own.
|
| 11 |
|
| 12 |
## Dataset creation
|
| 13 |
|
|
@@ -26,16 +30,22 @@ Lastly, we split each synthetic dataset into training, validation, and test sets
|
|
| 26 |
## Size
|
| 27 |
|
| 28 |
```text
|
| 29 |
-
train.jsonl
|
| 30 |
-
valid.jsonl
|
| 31 |
-
test.jsonl
|
| 32 |
-
TOTAL
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 33 |
```
|
| 34 |
|
| 35 |
|
| 36 |
## Dataset choice
|
| 37 |
-
If you're choosing between synth1 and synth2 (and don't need both), choose synth2.
|
| 38 |
-
|
|
|
|
| 39 |
|
| 40 |
|
| 41 |
## Data format
|
|
@@ -48,10 +58,14 @@ Each line of every file is a `json` comprising three items:
|
|
| 48 |
"smiles":"CCC(C)C1CCCCN1C(=O)CNc1cccc(C#N)c1"}
|
| 49 |
```
|
| 50 |
|
|
|
|
|
|
|
|
|
|
| 51 |
Our [preprint] (TODO) provides more information about the task background, the final finetuned model, and the experiments.
|
| 52 |
|
| 53 |
|
| 54 |
|
| 55 |
[NEIMS]: https://github.com/brain-research/deep-molecular-massspec
|
| 56 |
[RASSP]: https://github.com/thejonaslab/rassp-public
|
|
|
|
| 57 |
[GitHub repository]: TODO
|
|
|
|
| 2 |
license: cc-by-4.0
|
| 3 |
---
|
| 4 |
# Synthetic mass spectra dataset No. 1
|
| 5 |
+
This is the first variant of the GC-EI-MS synthetic dataset generated by [NEIMS] and [RASSP] models from 4.8 million structures downloaded from [ZINC 20].
|
| 6 |
The overlap with version 2 is approximately 8k structures (negligible), so it's usable as an extension to synth2. If you're choosing between synth1
|
| 7 |
+
and synth2, see section Dataset choice.
|
| 8 |
+
|
| 9 |
+
|
| 10 |
+
## Spectra generators
|
| 11 |
+
For generating this dataset, we used custom-trained NEIMS and RASSP models. We did this step because RASSP model is not publicly available and we wanted to
|
| 12 |
+
have more control over potential dataleaks in the context of further models stemming from this dataset. For better reproducibility we make the NIST splits
|
| 13 |
+
used for training NEIMS and RASSP models available in our [GitHub repository] (#TODO)
|
| 14 |
|
|
|
|
|
|
|
| 15 |
|
| 16 |
## Dataset creation
|
| 17 |
|
|
|
|
| 30 |
## Size
|
| 31 |
|
| 32 |
```text
|
| 33 |
+
rassp_custom_gen/train.jsonl 4364744
|
| 34 |
+
rassp_custom_gen/valid.jsonl 242486
|
| 35 |
+
rassp_custom_gen/test.jsonl 242486
|
| 36 |
+
TOTAL 4849716
|
| 37 |
+
|
| 38 |
+
neims_custom_gen/train.jsonl 4364748
|
| 39 |
+
neims_custom_gen/valid.jsonl 242483
|
| 40 |
+
neims_custom_gen/test.jsonl 242485
|
| 41 |
+
TOTAL 4849716
|
| 42 |
```
|
| 43 |
|
| 44 |
|
| 45 |
## Dataset choice
|
| 46 |
+
If you're choosing between synth1 and synth2 (and don't need both), choose synth2. The origin of synth2 is better documented in the 3_datapreprocessing.ipynb notebook in our [GitHub repository],
|
| 47 |
+
even though the creation process is in essence the same for both datasets. There are the same compound in the splits of both RASSP and NEIMS generated datasets but some
|
| 48 |
+
duplicities emerged, so the sets are not identical (!the scale of the leak is less than 10 compounds in over 2M set, so we call it negligible!)
|
| 49 |
|
| 50 |
|
| 51 |
## Data format
|
|
|
|
| 58 |
"smiles":"CCC(C)C1CCCCN1C(=O)CNc1cccc(C#N)c1"}
|
| 59 |
```
|
| 60 |
|
| 61 |
+
From the nature of the NEIMS spectra predictor, all NEIMS-generated peak intensities are in 2 decimals precision. RASSP generated intensities are not restricted in this way,
|
| 62 |
+
so to save storage we rounded them up to 6 decimal places which is beyond recognition for our model in the downstream task.
|
| 63 |
+
|
| 64 |
Our [preprint] (TODO) provides more information about the task background, the final finetuned model, and the experiments.
|
| 65 |
|
| 66 |
|
| 67 |
|
| 68 |
[NEIMS]: https://github.com/brain-research/deep-molecular-massspec
|
| 69 |
[RASSP]: https://github.com/thejonaslab/rassp-public
|
| 70 |
+
[ZINC 20]: https://zinc20.docking.org/
|
| 71 |
[GitHub repository]: TODO
|