File size: 13,519 Bytes
c5ceab1 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 |
---
tags:
- chemistry
- cheminformatics
- drug-discovery
- organic-chemistry
- molecular-generation
- small-molecules
- SAVI
- huggingscience
- science
pretty_name: Synthetically Accessible Virtual Inventory (SAVI) 2020
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
dataset_info:
features:
- name: product_name
dtype: string
- name: product_hashisy
dtype: string
- name: product_smiles
dtype: string
- name: formula
dtype: string
- name: weight
dtype: float64
- name: rotbonds
dtype: int64
- name: h_donors
dtype: int64
- name: h_acceptors
dtype: int64
- name: e_tpsa
dtype: float64
- name: fsp3
dtype: float64
- name: complexity
dtype: float64
- name: product_qed_score
dtype: float64
- name: benzenoid_index
dtype: float64
- name: charged_group_counts
dtype: string
- name: hydrogen_bond_center_count
dtype: int64
- name: heavy_atoms
dtype: int64
- name: stereo_count
dtype: string
- name: ring_system_count
dtype: int64
- name: e_nesssr
dtype: int64
- name: e_nsssr
dtype: int64
- name: product_aroring_count
dtype: int64
- name: product_aliring_count
dtype: int64
- name: stdinchi
dtype: string
- name: stdinchikey
dtype: string
- name: product_stereo_tauto_hash
dtype: string
- name: ro5_violations
dtype: float64
- name: ro3_violations
dtype: float64
- name: pains_filter_match_count
dtype: int64
- name: pains_filter_match_name
dtype: string
- name: genotoxic_alerts
dtype: string
- name: xlogp2
dtype: float64
- name: xlogp
dtype: float64
- name: bw_demerit_score
dtype: int64
- name: bw_demerit_components
dtype: string
- name: reaction_hashisy
dtype: string
- name: reaction_smiles
dtype: string
- name: transform_name
dtype: string
- name: transform_id
dtype: int64
- name: lhasa_score
dtype: int64
- name: min_delta
dtype: int64
- name: lhasa_scoring_history
dtype: string
- name: lhasa_reaction_conditions
dtype: string
- name: lhasa_reaction_actual_conditions
dtype: string
- name: lhasa_reaction_warnings
dtype: string
- name: reaction_delta_ring_count
dtype: int64
- name: reaction_delta_aroring_count
dtype: int64
- name: reaction_delta_aliring_count
dtype: int64
- name: rinchi
dtype: string
- name: rinchikey_long
dtype: string
- name: rinchikey_short
dtype: string
- name: rinchikey_web
dtype: string
- name: r1_hashisy
dtype: string
- name: r1_smiles
dtype: string
- name: r1_bbsource
dtype: string
- name: r1_ident
dtype: string
- name: r1_inchi
dtype: string
- name: r1_inchikey
dtype: string
- name: r1_protection_required
dtype: int64
- name: r1_protected
dtype: int64
- name: r1_url
dtype: string
- name: r2_hashisy
dtype: string
- name: r2_smiles
dtype: string
- name: r2_bbsource
dtype: string
- name: r2_ident
dtype: string
- name: r2_inchi
dtype: string
- name: r2_inchikey
dtype: string
- name: r2_protection_required
dtype: int64
- name: r2_protected
dtype: int64
- name: r2_url
dtype: string
- name: fmt_chunkid
dtype: int64
- name: score_class
dtype: string
- name: record_number
dtype: int64
splits:
- name: train
num_examples: 1526316392
download_size: 178348923000
dataset_size: 250000000000
size_categories:
- 1B<n<10B
---
# Synthetically Accessible Virtual Inventory (SAVI) 2020
## Dataset Description
### Dataset Summary
The Synthetically Accessible Virtual Inventory (SAVI) 2020 dataset is a comprehensive collection of over 1.5 billion computationally generated organic compounds designed to be easily and practically synthesizable. Created through expert-system type rules derived from established organic chemistry knowledge, SAVI represents one of the largest publicly available databases of synthetically accessible virtual compounds for drug discovery and chemical research.
The database was generated using 53 carefully selected chemical transformation rules encoded in the CHMTRN/PATRAN programming languages, originally developed for the LHASA (Logic and Heuristics Applied to Synthetic Analysis) retrosynthetic analysis system. These transforms were applied to approximately 152,532 commercially available building blocks from Enamine to create molecules through single-step, two-reactant synthesis pathways.
SAVI compounds are particularly valuable for virtual screening, drug discovery, and computational chemistry applications because each molecule comes with:
- A proposed single-step synthetic route
- Predicted synthetic accessibility scores
- Comprehensive molecular property annotations
- Quality assessments based on drug-likeness criteria
### Supported Tasks
- **Virtual Screening**: High-throughput computational screening of large chemical libraries for drug discovery
- **Chemical Space Exploration**: Systematic exploration of synthetically accessible chemical space
- **Lead Optimization**: Structure-activity relationship (SAR) studies using built-in compound series
- **Synthetic Route Planning**: Each compound includes reactants and transformation information for synthesis planning
- **Property Prediction**: Training machine learning models for molecular property prediction using the extensive annotations
## Getting Started
### Quick Start
```python
from datasets import load_dataset
# Load the dataset
dataset = load_dataset("Metanova/SAVI-2020")
# View basic information
print(f"Dataset size: {len(dataset['train'])}")
print(f"Features: {dataset['train'].features}")
# Examine first few examples
print(dataset["train"][:5])
```
## Dataset Structure
### Data Instances
Each instance represents a computationally generated compound with comprehensive annotations:
```json
{
"product_name": "61A77BD3826E0AD0_554BFAE008D564C8_6031_UN",
"product_hashisy": "61A77BD3826E0AD0",
"product_smiles": "O(C(=O)C1=C(OC=N1)C2=CC=CS2)CCC3OCCC3C",
"formula": "C15H17NO4S",
"weight": 307.3636,
"rotbonds": 6,
"h_donors": 0,
"h_acceptors": 6,
"e_tpsa": 89.8,
"fsp3": 0.4667,
"complexity": 367.5828,
"product_qed_score": 0.7358,
"pains_filter_match_count": 0,
"bw_demerit_score": 35,
"transform_name": "Mitsunobu Reaction",
"transform_id": 6031,
"r1_smiles": "OC(=O)C1=C(OC=N1)C2=CC=CS2",
"r1_ident": "EN300-72222",
"r2_smiles": "CC1CCOC1CCO",
"r2_ident": "EN300-6499501",
"score_class": "plus",
"stdinchi": "InChI=1S/C15H17NO4S/c1-10-4-6-18-11(10)5-7-19-15(17)13-14(20-9-16-13)12-3-2-8-21-12/h2-3,8-11H,4-7H2,1H3",
"stdinchikey": "InChIKey=FPQADJBFVMQUTQ-UHFFFAOYSA-N"
}
```
### Data Fields
| Field Name | Type | Description |
|------------|------|-------------|
| **Product Information** |
| `product_name` | `string` | Unique SAVI identifier with hash and transform information |
| `product_hashisy` | `string` | Hash identifier for the product structure |
| `product_smiles` | `string` | SMILES representation of the generated product |
| `formula` | `string` | Molecular formula (e.g., "C15H17NO4S") |
| `weight` | `float64` | Molecular weight in Daltons |
| `stdinchi` | `string` | Standard International Chemical Identifier |
| `stdinchikey` | `string` | Standard InChI Key for database searching |
| `product_stereo_tauto_hash` | `string` | Hash considering stereochemistry and tautomers |
| **Molecular Properties** |
| `rotbonds` | `int64` | Number of rotatable bonds (flexibility measure) |
| `h_donors` | `int64` | Number of hydrogen bond donors |
| `h_acceptors` | `int64` | Number of hydrogen bond acceptors |
| `e_tpsa` | `float64` | Topological Polar Surface Area in Ų |
| `fsp3` | `float64` | Fraction of sp³ hybridized carbons (3D character) |
| `complexity` | `float64` | Bertz/Hendrickson molecular complexity score |
| `heavy_atoms` | `int64` | Total number of non-hydrogen atoms |
| `hydrogen_bond_center_count` | `int64` | Count of hydrogen bonding centers |
| **Drug-likeness & Quality** |
| `product_qed_score` | `float64` | Quantitative Estimate of Drug-likeness (0-1, higher better) |
| `ro5_violations` | `float64` | Number of Lipinski's Rule of Five violations |
| `ro3_violations` | `float64` | Number of Rule of Three violations |
| `pains_filter_match_count` | `int64` | Number of PAINS (Pan Assay Interference) alerts |
| `pains_filter_match_name` | `string` | Names of matching PAINS patterns |
| `bw_demerit_score` | `int64` | Bruns & Watson demerits (lower better) |
| `bw_demerit_components` | `string` | Components contributing to B&W demerits |
| `genotoxic_alerts` | `string` | Genotoxic structural alerts |
| **Lipophilicity** |
| `xlogp2` | `float64` | Predicted partition coefficient (lipophilicity) |
| `xlogp` | `float64` | Alternative XlogP calculation |
| **Ring Analysis** |
| `ring_system_count` | `int64` | Number of ring systems |
| `product_aroring_count` | `int64` | Number of aromatic rings |
| `product_aliring_count` | `int64` | Number of aliphatic rings |
| `e_nesssr` | `int64` | Number of rings in smallest set of smallest rings |
| `e_nsssr` | `int64` | Number of smallest set of smallest rings |
| `benzenoid_index` | `float64` | Measure of benzenoid character |
| **Stereochemistry** |
| `stereo_count` | `string` | Stereochemistry counts (format: "chiral_centers undefined_stereo defined_stereo etc.") |
| `charged_group_counts` | `string` | Count of charged groups |
| **Reaction Information** |
| `reaction_hashisy` | `string` | Hash identifier for the reaction |
| `reaction_smiles` | `string` | Reaction SMILES showing transformation |
| `transform_name` | `string` | Name of the chemical transformation (e.g., "Mitsunobu Reaction") |
| `transform_id` | `int64` | Numerical identifier for the transformation |
| `lhasa_score` | `int64` | LHASA expert system score for reaction feasibility |
| `lhasa_scoring_history` | `string` | Detailed scoring breakdown |
| `lhasa_reaction_conditions` | `string` | Recommended reaction conditions |
| `lhasa_reaction_actual_conditions` | `string` | Actual conditions used in computation |
| `lhasa_reaction_warnings` | `string` | Any warnings about the reaction |
| `min_delta` | `int64` | Minimum score delta |
| `score_class` | `string` | Reaction success class ("plus", "neg0", "neg10", "neg20", "neg30") |
| **Ring Formation Analysis** |
| `reaction_delta_ring_count` | `int64` | Change in total ring count |
| `reaction_delta_aroring_count` | `int64` | Change in aromatic ring count |
| `reaction_delta_aliring_count` | `int64` | Change in aliphatic ring count |
| **Reaction Identifiers** |
| `rinchi` | `string` | Reaction InChI identifier |
| `rinchikey_long` | `string` | Long format Reaction InChI Key |
| `rinchikey_short` | `string` | Short format Reaction InChI Key |
| `rinchikey_web` | `string` | Web format Reaction InChI Key |
| **Reactant 1 (R1) Information** |
| `r1_hashisy` | `string` | Hash identifier for first reactant |
| `r1_smiles` | `string` | SMILES of first building block |
| `r1_bbsource` | `string` | Source of building block (e.g., "ENAMINE2019Q4") |
| `r1_ident` | `string` | Building block catalog identifier |
| `r1_inchi` | `string` | InChI of first reactant |
| `r1_inchikey` | `string` | InChI Key of first reactant |
| `r1_protection_required` | `int64` | Whether protecting groups were required (0/1) |
| `r1_protected` | `int64` | Whether reactant was protected (0/1) |
| `r1_url` | `string` | URL to purchase building block |
| **Reactant 2 (R2) Information** |
| `r2_hashisy` | `string` | Hash identifier for second reactant |
| `r2_smiles` | `string` | SMILES of second building block |
| `r2_bbsource` | `string` | Source of building block |
| `r2_ident` | `string` | Building block catalog identifier |
| `r2_inchi` | `string` | InChI of second reactant |
| `r2_inchikey` | `string` | InChI Key of second reactant |
| `r2_protection_required` | `int64` | Whether protecting groups were required (0/1) |
| `r2_protected` | `int64` | Whether reactant was protected (0/1) |
| `r2_url` | `string` | URL to purchase building block |
| **Technical Fields** |
| `fmt_chunkid` | `int64` | Data chunk identifier for processing |
| `record_number` | `int64` | Record number within dataset |
### Data Splits
The dataset contains approximately 1.53 billion unique compounds in a single training split.
## Applications and Use Cases
### Drug Discovery
- **Virtual Screening**: Large-scale computational screening for hit identification
- **Lead Optimization**: SAR exploration using built-in compound series
- **Chemical Space Navigation**: Systematic exploration of accessible chemical space
### Computational Chemistry
- **Property Prediction**: Training datasets for QSAR and machine learning models
- **Synthetic Route Planning**: Integration with retrosynthetic analysis tools
- **Chemical Space Analysis**: Diversity and novelty assessment studies
### Academic Research
- **Method Development**: Benchmarking virtual screening and ML approaches
- **Chemical Education**: Examples of structure-property relationships
- **Open Science**: Publicly available alternative to proprietary chemical libraries
**Original Paper:**
```
Patel, H., Ihlenfeldt, W.D., Judson, P.N. et al.
SAVI, in silico generation of billions of easily synthesizable compounds through expert-system type rules.
Sci Data 7, 384 (2020).
https://doi.org/10.1038/s41597-020-00727-4
``` |