molecules
dict | messages
listlengths 3
3
|
|---|---|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"C=Cc1ccc(COCCCCCCCCCCCCCCCCCCC(=O)Oc2ccc(C=CC(=O)c3ccc(F)cc3)cc2)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a liquid crystal that has an effect on liquid crystal display.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both cardiovascular disease and metabolic syndrome. The molecule is a nutrient that impacts pancreatitis, thyroxine treatment, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both atherosclerosis and pancreatitis. The molecule is a nutrient that impacts metabolic syndrome, thyroxine treatment, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, aging, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC(O)c1ccc(C(=O)O)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a glucagon receptor antagonist and is diabetes treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)CC(=O)CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CC(C)=CNCC(=Nc1cc(C)[nH]n1)N=C(N)c1ccc(C(=CN)CN(C)C)c(CC)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts barth syndrome and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and tangier disease. The molecule is a cholesterol translocation and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a inflammatory and fat storage, affecting cancer, and impacting obesity, metabolic syndrome, and thyroxine treatment. The molecule is a energy storage and membrane stabilizer, and it impacts cardiovascular disease. The molecule is a nutrient and a energy source, impacting both pancreatitis and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"N#Cc1cc(F)c(CN(C2CCCCC2CO)S(=O)(=O)c2ccc(Cl)cc2)cc1F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It impacts alzheimer's treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(Nc1cnco1)OCC1CCCCC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a faah inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCSc1nc(N)c2ncn(C3CCCC3)c2n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is anti bacterial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1nc(N2CCC(N(C)C)CC2)c(C)cc1Nc1ncc(C)c(Nc2cnc3ccccc3c2P(C)(C)=O)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a egfr inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(-c2ccc(C=Cc3nc(-c4ccc(Cl)cc4Cl)cn3Cc3ccc(C(=O)O)cc3)cc2)ccc1NC(=O)NC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a protein tyrosine phosphatase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"COC1CCC(N)(C(=O)O)C(C)C1.Cl"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a acc inhibitor and belongs to the tumour treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis that impacts barth syndrome, aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(O)C(=O)N1CCN(Cc2cn3cc(-c4cnc(N)nc4)nc(N4CCOCC4)c3n2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a pi3k inhibitor, kinase inhibitor, obesity treatment that belongs to the anti tumor agent class of molecules and impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(O)C1CN(Cc2ccc3c(c2)OCCc2c(-c4noc(-c5ccccc5)c4C(F)(F)F)noc2-3)C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a s1p1 agonist.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, a membrane stabilizer, and a emulsifier, and it impacts non-alcoholic fatty liver disease. The molecule is a food additive and a energy source, which impacts both diabetic heart disease and barth syndrome, and is characterized as smooth. The molecule is a surfactant, a nutritional supplement, and a proton trap for oxidative phosphorylation, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, energy storage, stabilizing mitochondrial structure that impacts aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts barth syndrome, tangier disease, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOc1cc(CC)cc(C(Nc2ccc3c(N)nccc3c2)c2nc(-c3ccccc3)cn2CC(=O)N2CCNC(=O)C2)c1F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a factor viia inhibitor and a serine protease inhibitor, belonging to the thrombosis treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a food additive, a cholesterol translocation, and a energy source, and it impacts non-alcoholic fatty liver disease. The molecule is a emulsifier, energy storage, stabilizing mitochondrial structure that impacts diabetic heart disease and aging. The molecule is a apoptosis, a membrane stabilizer, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a nutritional supplement, a surfactant, and a proton trap for oxidative phosphorylation, it impacts tangier disease and is smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage, energy source, inflammatory, nutrient, thyroxine treatment that impacts metabolic syndrome. The molecule is a energy storage and membrane stabilizer, and it impacts atherosclerosis. It impacts pancreatitis, obesity, cardiovascular disease, and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat storage and energy storage, belonging to the thyroxine treatment class of molecules, and impacts cardiovascular disease, pancreatitis, and obesity. The molecule is a membrane stabilizer and nutrient, and it impacts metabolic syndrome. The molecule is a inflammatory and a energy source, impacting both atherosclerosis and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CNC(=O)Cc1cccc2c1CC(Br)C2=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nmda antagonist.",
"role": "assistant"
}
] |
{
"smiles": [
"CNC(CCCCCC(C)=O)(Cc1ccccc1)C(=O)O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a hdac inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCN1c2ccc(CNC(COC)C(=O)O)cc2NC1c1cc(C)c(=O)n(C)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a bromodomain inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a emulsifier, and it impacts diabetic heart disease. The molecule is a surfactant, energy source, apoptosis, membrane stabilizer, and smooth. The molecule is a stabilizing cytochrome oxidase, a food additive, and a nutritional supplement, and it impacts tangier disease. The molecule is a energy storage and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1C(=O)N(c2ccc(SC(F)(F)F)cc2)C(=O)N1Cc1cc(N2CCCCC2)nc2ccccc12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is both a kinase inhibitor and a cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a food additive, energy storage, cholesterol translocation, energy source. The molecule is a stabilizing mitochondrial structure, emulsifier, membrane stabilizer, nutritional supplement that impacts non-alcoholic fatty liver disease. The molecule is a surfactant and a stabilizing cytochrome oxidase, impacting both aging and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a apoptosis, which impacts both tangier disease and diabetic heart disease, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC(O)CCC)COP(=O)(O)OCC(N)C(=O)O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a fat storage and thyroxine treatment, and it impacts atherosclerosis. The molecule is a nutrient that impacts metabolic syndrome, pancreatitis, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, nutrient, membrane stabilizer, energy source and belongs to the thyroxine treatment class of molecules with an effect on cancer. The molecule is a fat storage that impacts both cardiovascular disease and obesity. The molecule is a energy storage that impacts metabolic syndrome, pancreatitis, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CNc1nc2cc(-c3cccc(C(=O)OC)c3)sc2n2c(C)cnc12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a anti inflammatory.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a fat storage, nutrient, energy storage, inflammatory, membrane stabilizer with an effect on cancer. The molecule is a energy source that impacts both metabolic syndrome and cardiovascular disease. The molecule is thyroxine treatment and impacts obesity, pancreatitis, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts diabetic heart disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"Cn1nc2c(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c(=O)n(Cc3ccc(C(F)(F)F)cc3)n2c1=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cannabinoid receptor modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy storage, nutrient, inflammatory, energy source that impacts cancer. It impacts pancreatitis, obesity, and thyroxine treatment. The molecule is a fat storage that impacts cardiovascular disease, metabolic syndrome, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCC=CCCCCCCC(=O)OCC(COC1OC(CS(=O)(=O)O)C(O)C(O)C1O)OC(=O)CCCCCCC=CCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy source, emulsifier, surfactant, energy storage.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CC=CC(=O)CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCCN"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts diabetes mellitus type 2, parkinson's disease, non-alcoholic fatty liver disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts cervical cancer, ulcerative colitis, breast cancer, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"Br"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule has Acrid odor. When heated to decomposition ... it emits toxic and corrosive fumes of hydrogen bromide. The molecule has Fumes have a sour taste.",
"role": "assistant"
}
] |
{
"smiles": [
"CCN(CC)C(=O)c1cc(C(=O)OC(C)C)cc(C(=O)N(CC)CC(C)C)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a anti inflammatory and is anti viral.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)c2ccccc2-c2cc(N(c3cccc(-c4ccc5c(c4)oc4ccccc45)c3)c3ccc4c(c3)-c3ccccc3C4)ccc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a electronic device.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both pancreatitis and cardiovascular disease. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both atherosclerosis and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cnc(NC(=O)OC2CCCCC2)cc1-n1cc(-c2ncn[nH]2)c(-c2ccccc2Cl)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a pi3k inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a fat storage and nutrient, and it impacts cardiovascular disease. The molecule is a thyroxine treatment that impacts pancreatitis, atherosclerosis, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(N2CC3CCCC(C2)N3C)cc1Cl"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a monoamine reuptake inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CC=CC(O)CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts parkinson's disease, non-alcoholic fatty liver disease, alzheimer's disease, and diabetes mellitus type 2.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a emulsifier and a proton trap for oxidative phosphorylation, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a stabilizing cytochrome oxidase, membrane stabilizer, surfactant, apoptosis that impacts diabetic heart disease. The molecule is a energy storage, a nutritional supplement, and a food additive, and it impacts tangier disease. The molecule is a cholesterol translocation, energy source, stabilizing mitochondrial structure that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CC1(C)CC(OC(=O)CSC2CC3CCC(C2)N3C)C2(C)C(C)CCC3(CCC(=O)C32)C(C)C1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to both the anti fungal agent and trypanocidal drug classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(CC)NC(=O)N(N)c1ccc(Oc2ccc(N)c(OC)c2)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts obesity treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CC=CC(O)CCCC(=O)OC(COC(=O)CCCCCCCCCCc1oc(CCC)c(C)c1C)COP(=O)([O-])OCC[N+](C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts cervical cancer, ulcerative colitis, atherosclerosis, and breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(CCNC(=O)OCc1ccccc1)OC(=O)C(F)(F)F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a platelet aggregation inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a energy source, nutrient, membrane stabilizer that impacts cardiovascular disease, atherosclerosis, and obesity. The molecule is a fat storage and a inflammatory, belonging to the thyroxine treatment class of molecules. The molecule is a energy storage that impacts pancreatitis, metabolic syndrome, and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts aging and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCC(C)C1(CC)C(=O)NC(=O)NC1=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a adrenergic uptake inhibitor and is anti depressant. The molecule has Practically odorless. When heated to decomposition it emits toxic fumes of nitric oxide.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCON=C(C(=O)NC1C(=O)N2C(C(=O)OC(C)OC(=O)OC(CC)CC)=C(COC)CSC12)c1csc(N)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is anti bacterial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)(O)OCC(N)C(=O)O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts aging and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure that impacts aging, barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COB(OC)OC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The substance decomposes on heating or on burning producing toxic fumes including boron oxide.",
"role": "assistant"
}
] |
{
"smiles": [
"CCc1cc(Nc2ncc(C3CC3)c(Nc3ccc4nccnc4c3P(C)C)n2)c(OCC(F)(F)F)nc1N1CCC(N2CCN(C)CC2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a egfr inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)NC(C(=O)N1CC=CC1c1ncc(-c2ccc(-c3cc4sc(-c5cnc(C6CCCN6C(=O)C(NC(=O)OC)c6ccccc6)[nH]5)cc4s3)cc2)[nH]1)c1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a ns5a inhibitor and a anti viral compound, belonging to the anti viral class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1nc(-c2ccc(OCc3cc(=O)n4[nH]c(-c5ccccc5)nc4n3)c(F)c2)cs1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to the cardiovascular disease treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"Cl.Cl.c1nc(-c2noc(C3CCCNC3)n2)cs1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a positive allosteric modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(=O)N1CCCC(c2nc(-c3ccc(C(=O)Nc4cc(C5CC5)ccn4)c(C)c3)c3c(N)nccn23)C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a btk inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)NC1CCCC(OP(=O)([O-])OCC[N+](C)(C)C)C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is anti viral.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.