instruction stringlengths 48 275 | input stringclasses 1 value | output stringlengths 9 208 |
|---|---|---|
With the given product COc1cccc(C2CC(C)(C)c3cc(C(=O)NS(C)(=O)=O)ccc3N2)c1, suggest some likely reactants that were used in its synthesis. | COc1cccc(C2CC(C)(C)c3cc(C(=O)O)ccc3N2)c1.CS(N)(=O)=O | |
CC(Oc1ccc(C#N)cn1)C1CN(Cc2ccccc2)CC1c1ccc(C#N)cc1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: CC(O)C1CN(Cc2ccccc2)CC1c1ccc(C#N)cc1.N#Cc1ccc(Cl)nc1 . | |
COc1c(C(C)NC(=O)OCc2ccccc2)cc(Cl)c(Cl)c1C1CNC1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: COc1c(C(C)NC(=O)OCc2ccccc2)cc(Cl)c(Cl)c1C1CN(C(=O)OC(C)(C)C)C1 . | |
O=[N+]([O-])c1cc(F)c(Cl)c(Br)c1Cl Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: BrBr.O=[N+]([O-])c1cc(F)c(Cl)cc1Cl . | |
Can you list the reactants that might result in the chemical product O=C(O)c1cnc(N2CC3CN(S(=O)(=O)c4ccc5ccccc5c4)CC3C2)nc1 ? | CCOC(=O)c1cnc(N2CC3CN(S(=O)(=O)c4ccc5ccccc5c4)CC3C2)nc1 | |
To synthesis CCOC(=O)c1csc(N2CCC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2)n1, what are the possible reactants? Write in the SMILES representation. | CC(C)(C)[Si](Cl)(c1ccccc1)c1ccccc1.CCOC(=O)c1csc(N2CCC(O)C2)n1 | |
Can you identify the reactant(s) that might result in the given product CCCCCCCCCCCCCCCCCCCCCC(=O)Nc1ccc([N+](=O)[O-])cc1 ? | CCCCCCCCCCCCCCCCCCCCCC(=O)Cl.Nc1ccc([N+](=O)[O-])cc1 | |
Do retrosynthesis with the product O=C(O)c1cccnc1 . | OK. The reactants may be COC(=O)c1cccnc1 . | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CN(C)C(=O)C(O)c1ccccc1-c1ccc2[nH]c(COc3ccc(C(F)(F)F)cc3)nc2c1 | CNC.O=C(O)C(O)c1ccccc1-c1ccc2[nH]c(COc3ccc(C(F)(F)F)cc3)nc2c1 | |
To synthesis Cc1c(CO)c2cnnc(NCc3ccccc3)c2n1Cc1ccccc1, what are the possible reactants? Write in the SMILES representation. | Cc1c(C=O)c2cnnc(NCc3ccccc3)c2n1Cc1ccccc1 | |
CN1CCC(Sc2cc(F)cc(NC(=O)c3ccc(F)cc3Cl)c2)CC1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: CN1CCC(Sc2cc(N)cc(F)c2)CC1.O=C(Cl)c1ccc(F)cc1Cl . | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. CC(=O)OC(CCc1ccc(-c2ccccc2)cc1)CC(=O)OC(C)(C)C | CC(=O)OC(C)=O.CC(C)(C)OC(=O)CC(O)CCc1ccc(-c2ccccc2)cc1 | |
Identify possible reactants that could have been used to create the specified product. CC(C)COC(=O)NCC1CN=C(c2ccccc2F)c2ccccc2N1C | CC(C)COC(=O)Cl.CN1c2ccccc2C(c2ccccc2F)=NCC1CN | |
Given the following product, please provide possible reactants. CN(c1nnc(C(F)(F)F)s1)C1CCN(Cc2ccc(F)cc2)CC1 | Possible reactant(s): CN(c1nnc(C(F)(F)F)s1)C1CCNCC1.Fc1ccc(CCl)cc1 . | |
To synthesis COC(=O)COc1cccc2c1c1c(C(N)=O)cccc1n2Cc1cccc(C(F)(F)F)c1, what are the possible reactants? Write in the SMILES representation. | COC(=O)CBr.NC(=O)c1cccc2c1c1c(O)cccc1n2Cc1cccc(C(F)(F)F)c1 | |
Given the following product, please provide possible reactants. O=C(O)c1ccc2c(c1)C(NC(=O)c1ccccc1Cl)CCO2 | Possible reactant(s): COC(=O)c1ccc2c(c1)C(NC(=O)c1ccccc1Cl)CCO2 . | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=C(Nc1cccc(-c2cnn(Cc3ccccc3)c2)c1)c1cc2cccc(O)c2oc1=O | Nc1cccc(-c2cnn(Cc3ccccc3)c2)c1.O=C(O)c1cc2cccc(O)c2oc1=O | |
Cc1[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc32)c(C)c1C(=O)NCCN1CCN(C(=O)OC(C)(C)C)CC1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: CC(C)(C)OC(=O)N1CCN(CCN)CC1.Cc1[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc32)c(C)c1C(=O)O . | |
Nc1ccc(-c2nc3ccccc3s2)cc1Br Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: BrBr.Nc1ccc(-c2nc3ccccc3s2)cc1 . | |
Provide the potential reactants that may be used to produce the product Cc1cc(Cl)cc2c1OCCC2=O . | The potential reactants: Cc1cc(Cl)ccc1OCCC(=O)O . | |
Can you list the reactants that might result in the chemical product COC(=O)c1ccc(Cl)c(Br)c1 ? | CO.O=C(O)c1ccc(Cl)c(Br)c1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CC1CCN(C(=O)N2CCOc3ccc(-c4cnc(N)c(N)c4)cc3C2)CC1 | CC1CCN(C(=O)N2CCOc3ccc(-c4cnc(N)c([N+](=O)[O-])c4)cc3C2)CC1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CCOCc1cn(CC(=O)Nc2sc3c(c2C(N)=O)CCCC3)nc1C(F)(F)F | CCI.NC(=O)c1c(NC(=O)Cn2cc(CO)c(C(F)(F)F)n2)sc2c1CCCC2 | |
Can you list the reactants that might result in the chemical product Nc1ncccc1-c1nc2cc(-c3cccnc3)cnc2n1-c1ccc(CNC(=O)c2ccccc2)cc1 ? | NCc1ccc(-n2c(-c3cccnc3N)nc3cc(-c4cccnc4)cnc32)cc1.O=C(O)c1ccccc1 | |
Identify possible reactants that could have been used to create the specified product. O=C(NCC1CC1)c1ccc(OCc2c(-c3ccccc3)noc2C(F)(F)F)nc1 | COC(=O)c1ccc(OCc2c(-c3ccccc3)noc2C(F)(F)F)nc1.NCC1CC1 | |
Identify possible reactants that could have been used to create the specified product. OCc1cc(Cl)c2cn[nH]c2c1 | O=C(O)c1cc(Cl)c2cn[nH]c2c1 | |
Do retrosynthesis with the product CCCCCCCCCCOc1cc(CCl)cc(OCCCCCCCCCC)c1 . | OK. The reactants may be CCCCCCCCCCOc1cc(CO)cc(OCCCCCCCCCC)c1.O=S(Cl)Cl . | |
Given the following product, please provide possible reactants. CCC(=Cc1cccc(OC)c1)C(=O)O | Possible reactant(s): CCOC(=O)C(=Cc1cccc(OC)c1)CC . | |
C=C(C)C(=O)Nc1ccc(C(=O)O)cc1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: C=C(C)C(=O)O.Nc1ccc(C(=O)O)cc1 . | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. Cc1ccc(S(=O)(=O)Oc2ccc(O)c(O)c2)cc1 | Cc1ccc(S(=O)(=O)Cl)cc1.Oc1ccc(O)c(O)c1 | |
With the given product CN1C(=O)N(c2ccccn2)CC1C(=O)NCc1cccc(C(F)(F)F)c1Cl, suggest some likely reactants that were used in its synthesis. | CN1C(=O)N(c2ccccn2)CC1C(=O)O.NCc1cccc(C(F)(F)F)c1Cl | |
CCC(=O)C1=C(O)CC(c2c(C)c(N)c(C)c(C(C)=O)c2C)CC1=O Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: CCC(=O)C1=C(O)CC(c2c(C)c(C(C)=O)c(C)c([N+](=O)[O-])c2C)CC1=O . | |
To synthesis CN1C(=O)CCc2c(OCC3CO3)ccc(OCc3ccccc3)c21, what are the possible reactants? Write in the SMILES representation. | CI.O=C1CCc2c(OCC3CO3)ccc(OCc3ccccc3)c2N1 | |
Can you list the reactants that might result in the chemical product NC(=O)c1ccc(C(=O)O)cc1Br ? | COC(=O)c1ccc(C(N)=O)c(Br)c1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. COc1ccc(COC(C(C)C=O)C(C)CO[Si](C)(C)C(C)(C)C)cc1 | COc1ccc(COC(C(C)CO)C(C)CO[Si](C)(C)C(C)(C)C)cc1 | |
Could you tell which reactants might have been used to generate the following product? NCC(CNS(=O)(=O)c1cccc2cnccc12)c1ccccc1 | NCC(CN)c1ccccc1.O=S(=O)(Cl)c1cccc2cnccc12 | |
With the given product CC(C)(C)[Si](C)(C)OCc1cccc(N)n1, suggest some likely reactants that were used in its synthesis. | CC(C)(C)[Si](C)(C)Cl.Nc1cccc(CO)n1 | |
Given the following product, please provide possible reactants. Cc1nc(N2CCOCC2)c2cccc([N+](=O)[O-])c2n1 | Possible reactant(s): C1COCCN1.Cc1nc(Cl)c2cccc([N+](=O)[O-])c2n1 . | |
With the given product CC(C)(C)c1ccc(S(C)(=O)=O)c(N)c1, suggest some likely reactants that were used in its synthesis. | CC(C)(C)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1 | |
Could you tell which reactants might have been used to generate the following product? CCC(CN1C(=O)c2ccccc2C1=O)Nc1nc(Nc2ccc3ncccc3c2)c(C#N)cc1F | CCC(N)CN1C(=O)c2ccccc2C1=O.N#Cc1cc(F)c(Cl)nc1Nc1ccc2ncccc2c1 | |
Provide the potential reactants that may be used to produce the product COC(=O)c1ccc([N+](=O)[O-])cc1C . | The potential reactants: CO.Cc1cc([N+](=O)[O-])ccc1C(=O)O . | |
Do retrosynthesis with the product COc1ccc(C(F)(F)F)cc1N . | OK. The reactants may be COc1ccc(C(F)(F)F)cc1[N+](=O)[O-] . | |
Could you tell which reactants might have been used to generate the following product? O=C(O)c1cc2ccccc2n1Cc1ccc(F)cc1 | CCOC(=O)c1cc2ccccc2n1Cc1ccc(F)cc1 | |
What reactants could lead to the production of the following product? CC(C)Nc1nc(-n2cc(C(=O)O)c(=O)c3cc(F)c(F)c(Cl)c32)c(F)cc1F | CCOC(=O)c1cn(-c2nc(NC(C)C)c(F)cc2F)c2c(Cl)c(F)c(F)cc2c1=O | |
With the given product CCCC1CCC(c2ccc3cc(OS(=O)(=O)C(F)(F)F)ccc3c2)CC1, suggest some likely reactants that were used in its synthesis. | CCCC1CCC(c2ccc3cc(O)ccc3c2)CC1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F | |
Provide the potential reactants that may be used to produce the product Cc1cc2cccc(Cn3c(=O)n(CCC(=O)O)c4ccccc43)c2n1C . | The potential reactants: COC(=O)CCn1c(=O)n(Cc2cccc3cc(C)n(C)c23)c2ccccc21 . | |
Given the following product, please provide possible reactants. Cc1ccc2c(c1)N(CC(=O)c1ccccc1C)C(=O)C(NC(=O)OC(C)(C)C)CN2C1CCCCC1 | Possible reactant(s): Cc1ccc2c(c1)N(CC(=O)c1ccccc1C)C(=O)C(NC(=O)OC(C)(C)C)CN2C1C=CCCC1 . | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. CSc1c(S(N)(=O)=O)ccn1C | CSc1c(S(=O)(=O)NC(C)(C)C)ccn1C | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=C(CCc1ccccc1)Nc1cc2c3c(c1)c1c(n3CCC2)CCCCC1 | Nc1cc2c3c(c1)c1c(n3CCC2)CCCCC1.O=C(Cl)CCc1ccccc1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=c1nc(N(Cc2nnn[nH]2)c2ccc(Cl)cc2)sc2ncccc12 | N#CCN(c1ccc(Cl)cc1)c1nc(=O)c2cccnc2s1.[N-]=[N+]=[N-] | |
Identify possible reactants that could have been used to create the specified product. Cc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1 | COc1ccc(-c2sc3cc(OC)ccc3c2C(=O)c2ccc(C)cc2)cc1 | |
Could you tell which reactants might have been used to generate the following product? CCN(c1ccc(F)c(C(=O)Nc2cnc3[nH]nc(OC)c3c2)c1F)S(=O)(=O)NC | CCN(c1ccc(F)c(C(=O)O)c1F)S(=O)(=O)NC.COc1n[nH]c2ncc(N)cc12 | |
Provide the potential reactants that may be used to produce the product NC(=O)c1cc(-c2ccc(Cn3ccc4ccccc43)cc2)no1 . | The potential reactants: NC(=O)c1cc(-c2ccc(CBr)cc2)no1.c1ccc2[nH]ccc2c1 . | |
CCCON=C(C(=O)O)c1csc(N)n1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: CCCON=C(C(=O)OCC)c1csc(N)n1 . | |
Given the following product, please provide possible reactants. CN(C)C1CCC(Oc2ncnc3sc4c(c23)C(CC(=O)Nc2ccc(F)cn2)CC4)CC1 | Possible reactant(s): CN(C(=O)OC(C)(C)C)C1CCC(Oc2ncnc3sc4c(c23)C(CC(=O)Nc2ccc(F)cn2)CC4)CC1 . | |
What reactants could lead to the production of the following product? CCc1n[nH]c2cc(C(=O)OC)ccc12 | CCc1n[nH]c2cc(C(=O)O)ccc12.CO | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. N=C(N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(NC=NNCCCCN4CCOCC4)cc3)ccc2c1 | N=C(N)c1ccc2c(CC(N)=O)c(O)ccc2c1.O=C(O)c1ccc(NC=NNCCCCN2CCOCC2)cc1 | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. COC(=O)Cc1cc2ccc(F)cc2c(OS(=O)(=O)C(F)(F)F)c1C | COC(=O)Cc1cc2ccc(F)cc2c(O)c1C.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F | |
Given the following product, please provide possible reactants. O=C(O)C1CCN(c2cccc(Br)c2)C1 | Possible reactant(s): COC(=O)C1CCN(c2cccc(Br)c2)C1 . | |
Identify possible reactants that could have been used to create the specified product. CNc1ccc(C(=O)O)cc1S(=O)(=O)N1CCC1 | C1CNC1.CNc1ccc(C(=O)O)cc1S(=O)(=O)Cl | |
Provide the potential reactants that may be used to produce the product CC(C)(C)C(=O)OCCOc1ccccc1 . | The potential reactants: CC(C)(C)C(=O)Cl.OCCOc1ccccc1 . | |
Identify possible reactants that could have been used to create the specified product. Cc1nc(N2CCN(CC3CC3)C2=O)sc1C(=O)NCc1cccnn1 | Cc1nc(N2CCN(CC3CC3)C2=O)sc1C(=O)O.NCc1cccnn1 | |
Do retrosynthesis with the product COc1ccc(-c2ccc(C#N)cc2)cc1 . | OK. The reactants may be COc1ccc(-c2ccc(C(N)=O)cc2)cc1 . | |
Cc1cccc(-c2nc(C(F)(F)F)ccc2CNC(=O)C(C)c2ccc(C#N)cc2)c1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: CC(C(=O)O)c1ccc(C#N)cc1.Cc1cccc(-c2nc(C(F)(F)F)ccc2CN)c1 . | |
To synthesis COC(=O)Oc1cc(N)c(F)cc1F, what are the possible reactants? Write in the SMILES representation. | COC(=O)Oc1cc([N+](=O)[O-])c(F)cc1F | |
Identify possible reactants that could have been used to create the specified product. CNC(=O)c1cc(Oc2ccc3nc(SC)sc3c2Cl)ccn1 | CNC(=O)c1cc(Cl)ccn1.CSc1nc2ccc(O)c(Cl)c2s1 | |
Identify possible reactants that could have been used to create the specified product. COC(=O)C=Cc1ccc(N)cc1NC(=O)NC(=O)c1cc(F)c(F)cc1Cl | COC(=O)C=Cc1ccc([N+](=O)[O-])cc1NC(=O)NC(=O)c1cc(F)c(F)cc1Cl | |
Could you tell which reactants might have been used to generate the following product? Brc1cnc(N2CCCNCC2)nc1 | C1CNCCNC1.Clc1ncc(Br)cn1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CC(C)(CC(O)(C=O)C(F)(F)F)c1cc(F)ccc1F | CC(C)(CC(O)(CO)C(F)(F)F)c1cc(F)ccc1F | |
Can you list the reactants that might result in the chemical product CCCC(C(=O)OC)c1c(C)nc(N2CC(C)CC(C)C2)nc1-c1ccc(C)cc1 ? | CC1CNCC(C)C1.CCCC(C(=O)OC)c1c(C)nc(Cl)nc1-c1ccc(C)cc1 | |
Identify possible reactants that could have been used to create the specified product. CC(C)(C)OC(=O)NC(CCNS(C)(=O)=O)c1ccc(Cl)cc1 | CC(C)(C)OC(=O)NC(CCN)c1ccc(Cl)cc1.CS(=O)(=O)Cl | |
Can you list the reactants that might result in the chemical product Sc1nnnn1Cc1nnn[nH]1 ? | N#CCn1nnnc1S.[N-]=[N+]=[N-] | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. Cc1cc2c(c3ccc(=O)[nH]c13)OC(CNC(=O)CCNC(=O)OCc1ccccc1)C2 | Cc1cc2c(c3ccc(=O)[nH]c13)OC(CN)C2.O=C(O)CCNC(=O)OCc1ccccc1 | |
COCc1c[nH]c(-c2ccc(O)cc2)n1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: COCc1c[nH]c(-c2ccc(OCc3ccccc3)cc2)n1 . | |
To synthesis CN(C)CC(=O)Nc1ccc2[nH]c(C(=O)NCc3ccc(Cl)c(Oc4cc(Cl)cc(C#N)c4)c3F)cc2c1, what are the possible reactants? Write in the SMILES representation. | CN(C)CC(=O)O.N#Cc1cc(Cl)cc(Oc2c(Cl)ccc(CNC(=O)c3cc4cc(N)ccc4[nH]3)c2F)c1 | |
Given the following product, please provide possible reactants. CC(C)n1cnnc1-c1nc2c(s1)CCOc1cc(C=O)ccc1-2 | Possible reactant(s): CC(C)n1cnnc1-c1nc2c(s1)CCOc1cc(CO)ccc1-2 . | |
Identify possible reactants that could have been used to create the specified product. COC(=O)NCC1Cc2cc(Cl)cc(C3CCCCC3)c2O1 | COC(=O)Cl.NCC1Cc2cc(Cl)cc(C3CCCCC3)c2O1 | |
Could you tell which reactants might have been used to generate the following product? CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])cc2)CC1 | CC(C)(C)OC(=O)N1CCC(O)CC1.O=[N+]([O-])c1ccc(F)cc1 | |
Provide the potential reactants that may be used to produce the product COC(=O)c1cc(C(F)(F)F)cc([N+](=O)[O-])c1C . | The potential reactants: CI.Cc1c(C(=O)O)cc(C(F)(F)F)cc1[N+](=O)[O-] . | |
Could you tell which reactants might have been used to generate the following product? Cc1c(CO)cccc1OCC(=O)OC(C)(C)C | CC(C)(C)OC(=O)CBr.Cc1c(O)cccc1CO | |
To synthesis CC(C)(C)OC(=O)NC(CCCCNS(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O)C(=O)O, what are the possible reactants? Write in the SMILES representation. | CC(C)(C)OC(=O)NC(CCCCNS(=O)(=O)c1c(Cl)ccc(N)c1O)C(=O)O.O=C=Nc1ccccc1Br | |
Can you list the reactants that might result in the chemical product CCNC(=O)c1ccc(C)c(-n2ccc3ccc(OCCN(C)C(C)C)cc3c2=O)c1 ? | CCNC(=O)c1ccc(C)c(-n2ccc3ccc(OCCCl)cc3c2=O)c1.CNC(C)C | |
With the given product Cn1cc(-c2ccnc(N3CCn4c(cc5c4CC(C)(C)C5)C3=O)c2CO)nc(Nc2ccn3ccnc3c2)c1=O, suggest some likely reactants that were used in its synthesis. | Cn1cc(-c2ccnc(N3CCn4c(cc5c4CC(C)(C)C5)C3=O)c2C=O)nc(Nc2ccn3ccnc3c2)c1=O | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. O=C(OCc1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1)C1CC1 | O=C(Cl)C1CC1.OCc1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1 | |
To synthesis CC(c1oc2ccccc2c(=O)c1-c1cccc(F)c1)n1nc(-c2ccc(O)c(F)c2)c2c(N)ncnc21, what are the possible reactants? Write in the SMILES representation. | COc1ccc(-c2nn(C(C)c3oc4ccccc4c(=O)c3-c3cccc(F)c3)c3ncnc(N)c23)cc1F | |
With the given product CCCCc1noc(CO)c1COc1ccc(C(=O)NCC(F)(F)F)cn1, suggest some likely reactants that were used in its synthesis. | CCCCc1noc(CO)c1COc1ccc(C(=O)O)cn1.NCC(F)(F)F | |
What reactants could lead to the production of the following product? Oc1ccc(F)cc1-c1c(Cl)cccc1Cl | COc1ccc(F)cc1-c1c(Cl)cccc1Cl | |
O=C(CC1CCCC1)N1CCN(c2ncccc2C(F)(F)F)CC1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: FC(F)(F)c1cccnc1N1CCNCC1.O=C(O)CC1CCCC1 . | |
Identify possible reactants that could have been used to create the specified product. CCCNC(=O)CCn1ccc(NC(=O)C(CC2CCCC2)c2ccc(S(C)(=O)=O)c(Cl)c2)n1 | CCCN.CS(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)Nc2ccn(CCC(=O)O)n2)cc1Cl | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. O=[N+]([O-])c1cc2c(Nc3cc(Cl)c(Cl)cc3F)ncnc2cc1F | Nc1cc(Cl)c(Cl)cc1F.O=[N+]([O-])c1cc2c(Cl)ncnc2cc1F | |
To synthesis C=C(C)c1cccc(OC(C)=O)c1, what are the possible reactants? Write in the SMILES representation. | C=C(C)c1cccc(O)c1.CC(=O)OC(C)=O | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. N#Cc1nc2ccc(OCc3ccccc3C(F)(F)F)cc2s1 | FC(F)(F)c1ccccc1CBr.N#Cc1nc2ccc(O)cc2s1 | |
What reactants could lead to the production of the following product? COc1c(Cl)ccc(-c2cc(NC(C)=O)ncc2CO)c1F | COc1c(Cl)ccc(-c2cc(NC(C)=O)ncc2C=O)c1F | |
Provide the potential reactants that may be used to produce the product CCOC(=O)COc1ccc2sc(S(N)(=O)=O)cc2c1 . | The potential reactants: CCO.NS(=O)(=O)c1cc2cc(OCC(=O)O)ccc2s1 . | |
With the given product C=CCCCOc1cc(C(=O)O)cc(C(F)(F)F)c1, suggest some likely reactants that were used in its synthesis. | C=CCCCO.O=C(O)c1cc(F)cc(C(F)(F)F)c1 | |
Provide the potential reactants that may be used to produce the product CCOc1ccc(C=C2SC(=O)N(CC(=O)O)C2=O)cc1 . | The potential reactants: CCOc1ccc(C=C2SC(=O)N(CC(=O)OC(C)(C)C)C2=O)cc1 . | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. COC(=O)c1ccc(C(=O)c2ccc(O)cc2)cc1 | COC(=O)c1ccc(C(=O)c2ccc(OC)cc2)cc1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. Cc1ccccc1N1CCOCC1 | C1COCCN1.Cc1ccccc1Br | |
To synthesis COc1cc2c(Nc3ccc4c(c3)NCC4)c(C#N)cnc2cc1O, what are the possible reactants? Write in the SMILES representation. | COc1cc2c(Nc3ccc4c(c3)NCC4)c(C#N)cnc2cc1OCc1ccccc1 | |
COc1cc(Br)c(OC)c(CCl)c1 Given the product provided, propose some possible reactants that could have been employed in its formation. | Here are possible reactants: COc1cc(Br)c(OC)c(CO)c1.O=S(Cl)Cl . |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.