text
string
size
int64
token_count
int64
from server import crud def test_filter(product_1, product_2): result, content_range = crud.product_crud.get_multi(filter_parameters=["name:duct 1"], sort_parameters=[]) assert len(result) == 1 assert content_range == "products 0-100/1" # Will not filter but return all results result, content_range = crud.product_crud.get_multi(filter_parameters=["NONEXISITANT:0"], sort_parameters=[]) assert len(result) == 2 assert content_range == "products 0-100/2" # Wild card match on all tables result, content_range = crud.product_crud.get_multi(filter_parameters=["Product 1"], sort_parameters=[]) assert len(result) == 1 assert content_range == "products 0-100/1" def test_sort(product_1, product_2): result, content_range = crud.product_crud.get_multi(filter_parameters=[], sort_parameters=["name:ASC"]) assert len(result) == 2 assert content_range == "products 0-100/2" assert result[0].name == "Product 1" result, content_range = crud.product_crud.get_multi(filter_parameters=[], sort_parameters=["name:DESC"]) assert len(result) == 2 assert content_range == "products 0-100/2" assert result[0].name == "Product 2" # No Sort order result, content_range = crud.product_crud.get_multi(filter_parameters=[], sort_parameters=["name"]) assert len(result) == 2 assert content_range == "products 0-100/2" assert result[0].name == "Product 1" # Non existant column impossible to sort result, content_range = crud.product_crud.get_multi(filter_parameters=[], sort_parameters=["NONTRUE"]) assert len(result) == 2 assert content_range == "products 0-100/2" # Non existant column impossible to sort on nonexistant method result, content_range = crud.product_crud.get_multi(filter_parameters=[], sort_parameters=["NONTRUE:NONTRUE"]) assert len(result) == 2 assert content_range == "products 0-100/2"
1,926
646
import numpy as np import trimesh try: from Satellite_Panel_Solar import Panel_Solar from SatelitteActitud import SatelitteActitud except: from src.data.Satellite_Panel_Solar import Panel_Solar from src.data.SatelitteActitud import SatelitteActitud # noinspection SpellCheckingInspection """Satelitte Solar Power System Es una clase donde se incluye todo el sistema de potencia del satelitte, permite incluir un modelo en CAD y realizar su analisis de potencia dependiento de un vector utilizado como la direccion del sol hacia el satelite Example: Para llamar a esta clase solo hace falta, una linea como la de abajo: $ Sat = SatelitteSolarPowerSystem(direccion='models/12U.stl') Esta clase tiene varios atributos incluidos como la caracteristica de cada panel solar para ello solo se necesita llamar a la clase con: $ from Satellite_Panel_Solar import Panel_Solar $ Sat.caracteristicas_panel_solar=[Panel_solar()] Para ver como se configura cada Panel_solar hay que remitirse a su documentacion Finalmente notar que el atributo mesh incluye todos aquellos del paquete trimesh """ class SatelitteSolarPowerSystem(object): def __init__(self, direccion, SatelitteActitud, panel_despegable_dual=True, Despegables_orientables=False): """Se inicia la clase con el analisis de la figura para encontrar paneles despegables, sombra, etc. Args: direccion: string con la direcion del archivo y con el tipo del archivo Ex. .STL, .OBJ, .PLY panel_despegable_dual: Default(True) """ self.mesh = self.cargar_modelo(direccion) self.numero_caras = len(self.mesh.facets) # Normales de las caras en el momento 0 self.Normales_caras = self.mesh.facets_normal self.Area_caras = self.mesh.facets_area self.caracteristicas_panel_solar = [ Panel_Solar('Estandar')] * self.numero_caras self.Caras_Despegables = self.caras_despegables() self.sombra = self.posible_sombra() self.mesh.vertices -= self.mesh.centroid self.sun_plane = self.puntos_sol() self.panel_despegable_dual = panel_despegable_dual self.name = self.nombrar_caras() self.actitud = SatelitteActitud self.Despegables_orientables = Despegables_orientables def cargar_modelo(self, direccion): """ cargar_modelo Args: direccion: string con la direcion del y con el tipo del archivo Ex. .STL, .OBJ, .PLY Returns: trimesh.mesh """ return trimesh.load_mesh(direccion) def nombrar_caras(self): """ nombrar_caras Nombra las caras del modelo para poder utilizarlas se realiza al principio porque si se gira cambiara Simplemente nombra las caras con X, Y, Z Returns: name: devuelve el nombre de las caras de manera X, Y, Z """ name = [] j = 0 o = 0 for i in self.mesh.facets_normal: i = np.round(i) if (i == [1, 0, 0]).all(): name.append('X+') elif (i == [-1, 0, 0]).all(): name.append('X-') elif (i == [0, 1, 0]).all(): name.append('Y+') elif (i == [0, -1, 0]).all(): name.append('Y-') elif (i == [0, 0, -1]).all(): name.append('Z-') elif (i == [0, 0, 1]).all(): name.append('Z+') else: name.append(f'Panel direction {i}') if j in self.Caras_Despegables: name[j] = name[j] + f' Panel Despegable {o}' o += 1 j += 1 return name def caras_despegables(self): """ caras_despegables Localiza los paneles despegables, es un metodo bastante dificil Returns: caras_despeables: es el numero de las caras """ caras_despegables = [] # si las caras se encuentran con otras sin volumen como los paneles, # esta las toman como rotas por trimesh por lo que se pueden localizar for i in np.arange(0, len(trimesh.repair.broken_faces(self.mesh))): caras_despegables.append( np.array(np.where(self.mesh.facets == trimesh.repair.broken_faces(self.mesh)[i])).flatten()[0]) # se encuentran las caras que son despegables # elimina las repetidas caras_despegables = list(set(caras_despegables)) return caras_despegables def posible_sombra(self): """ posible_sombra buscar la cara mas cercana a los paneles que puede dar sombra Returns: sombra:numero de las caras que pueden tener sombra """ sombra = np.array( np.where(self.mesh.facets_on_hull == False)).flatten() return sombra def puntos_sol(self): """ puntos_sol Crea un conjunto de puntos de aquellos que darian sombra con los centros de los paneles Returns: trimesh.mesh : Plano de puntos """ p = self.mesh.facets[self.sombra].flatten() sun_plane = self.mesh.triangles_center[p] return sun_plane def celdas_activas(self, sun_vector): """ celdas_activas Localiza las celdas activas de un mallado al buscarse los puntos donde golpearia un rayo en la malla des los puntos_sol Args: sun_vector (array(,3)) : Vector sol Returns: index_tri [array(n)]: El numero de triangulo que esta activo al ser golpeado por el sol """ sun_planeAux = self.puntos_sol()+5000*sun_vector ray_origins = sun_planeAux ray_directions = np.array([-sun_vector] * len(sun_planeAux)) if trimesh.ray.has_embree: # Hay una libreria que es embree solo funciona en linux pero va 50x mas rapido index_tri = self.mesh.ray.intersects_first( ray_origins=ray_origins, ray_directions=ray_directions) else: locations, index_ray, index_tri = self.mesh.ray.intersects_location(ray_origins=ray_origins, ray_directions=ray_directions, multiple_hits=False) index_tri = list(set(index_tri)) return index_tri def Add_prop_Panel(self, e): """ Add_prop_Panel Añade propiedades al panel Args: e (Panel_Solar): Panel Solar """ self.caracteristicas_panel_solar.append(e) def power_panel_solar(self, index_tri, Sun_vector, WSun): """ power_panel_solar Obtiene la potencia producida por el satelite con actitud fija Args: index_tri (array(,:)): Celdas activas por el rayo Sun_vector (array(,3)): Vector sol en LVLH WSun (float): Potencia irradiada por el sol Returns: W (array(,n)) : Potencia generada area_potencia (array(,n)) : Areas que generan potencia ang (array(,n)) : Angulo de incidencia del vector sol con las caras n : numero de caras """ # Producto escalar ang = list(map(Sun_vector.dot, self.mesh.facets_normal)) # Se inicializan las variables area_potencia = [] W = [] for i in np.arange(0, len(self.mesh.facets)): # Esto es para si consideramos que if (i in self.Caras_Despegables) & (self.panel_despegable_dual == True) & (ang[i] < 0): ang_inc = -ang[i] else: ang_inc = ang[i] # Buscar en las zonas donde es posible la sombra el valor propocional de area en los que incide la luz if i in self.sombra: o = np.isin(index_tri, self.mesh.facets[i]) o = o[o == True] area = ( len(o) / len(self.mesh.facets[i])) * self.mesh.facets_area[i] / (1000 ** 2) area_potencia.append(area) else: area = self.mesh.facets_area[i] / (1000 ** 2) # esta en mm^2 area_potencia.append(area) # Esto es para eliminar las areas que no cumplen la ley de que menos de 15 grados no producen energia if (ang_inc >= 0) & (ang_inc > (np.cos((np.pi / 180) * 75))): W.append( area * self.caracteristicas_panel_solar[i].psolar_rendimiento * WSun * ang_inc) else: W.append(0.) return W, area_potencia, ang def power_panel_con_actitud(self, Sun_vector, WSun): """ power_panel_con_actitud Obtiene la potencia producida por el satelite con actitud apuntando al sol Args: Sun_vector (array(,3)): Vector sol en LVLH WSun (float): Potencia irradiada por el sol Returns: W (array(,n)) : Potencia generada area_potencia (array(,n)) : Areas que generan potencia ang (array(,n)) : Angulo de incidencia del vector sol con las caras angulo_giro (array(,n)) : Angulo de giro del satelite n : numero de caras """ # Si los paneles son fijos al satelite if self.Despegables_orientables == False: if self.actitud.apuntado_sol == True: # aqui empieza la magia # la intencion era formar dos planos entre el eje de spin y el vector sol y otro # con el eje de spin y una direccion principal de los paneles solares # para poder calcular el angulo que deberia girarse entre los dos planos direcion_principal = self.mesh.facets_normal[self.Caras_Despegables[0]] plano0 = np.cross(Sun_vector, self.actitud.eje_de_spin) plano0 = plano0/np.linalg.norm(plano0) plano1 = np.cross(direcion_principal, self.actitud.eje_de_spin) plano1 = plano1/np.linalg.norm(plano1) angulo_giro = np.arccos(np.absolute( np.dot(plano0, plano1)))/(np.linalg.norm(plano0)*np.linalg.norm(plano1)) if np.isnan(angulo_giro): angulo_giro = 0.0 if angulo_giro == 0: pass else: # Comprueba si la transformacion produciria que fuesen iguales los giros prim = trimesh.transform_points(plano1.reshape(1, 3), trimesh.transformations.rotation_matrix( angulo_giro, self.actitud.eje_de_spin, [0, 0, 0])) if not np.allclose(prim, plano0): angulo_giro = -angulo_giro self.mesh = self.mesh.apply_transform(trimesh.transformations.rotation_matrix( angulo_giro, self.actitud.eje_de_spin, [0, 0, 0])) else: angulo_giro = 0.0 index_tri = self.celdas_activas(Sun_vector) W, area_potencia, ang = self.power_panel_solar( index_tri, Sun_vector, WSun) return W, area_potencia, ang, angulo_giro else: if self.actitud.apuntado_sol == True: # mas magia por aqui # pero ahora con lo de la proyeccion en unos ejes para poder utilizar el giro # esto funciona bastante bien el problema es cuando se pasa el ecuador direcion_principal = self.mesh.facets_normal[self.Caras_Despegables[0]] direcion_principal = np.round( direcion_principal/np.linalg.norm(direcion_principal), 5) matrix_projection = trimesh.transformations.projection_matrix( [0, 0, 0], self.actitud.eje_de_spin)[0:3, 0:3] proyeccion = np.dot(matrix_projection, Sun_vector) proyeccion = proyeccion/np.linalg.norm(proyeccion) ver = np.arccos(np.dot(proyeccion, direcion_principal)) if np.isnan(ver): ver = 0.0 if ver < 0.1e-4: angulo_giro = 0.0 pass else: # print("proyeccion",proyeccion) # print("direprinci",direcion_principal) #angulo_giro=np.arccos(np.absolute(np.dot(direcion_principal, proyeccion)))/(np.linalg.norm(direcion_principal)*np.linalg.norm(proyeccion)) transforma = trimesh.geometry.align_vectors( direcion_principal, proyeccion) # posicion_eje=np.array(np.where(np.array(self.actitud.eje_de_spin)==1)).flatten().max() angulo_giro = trimesh.transformations.rotation_from_matrix(transforma)[ 0] dir = trimesh.transform_points( direcion_principal.reshape(1, 3), transforma) if np.absolute(angulo_giro) > 0.05: transforma2 = np.round(trimesh.geometry.align_vectors( direcion_principal, -proyeccion), 5) angulo_giro2 = trimesh.transformations.rotation_from_matrix(transforma2)[ 0] dir = trimesh.transform_points( direcion_principal.reshape(1, 3), transforma) if np.absolute(angulo_giro2) < np.absolute(angulo_giro): transforma = transforma2 angulo_giro = angulo_giro2 else: pass # if plano1[posicion_eje]==0: # angulo_giro=0.0 if np.isnan(angulo_giro): angulo_giro = 0.0 pass else: self.mesh.apply_transform(transforma) else: angulo_giro = 0.0 ang = list(map(Sun_vector.dot, self.mesh.facets_normal)) area_potencia = [] W = [] angulo_giro = [angulo_giro] for i in np.arange(0, len(self.mesh.facets)): area = self.mesh.facets_area[i] / (1000 ** 2) area_potencia.append(area) if (i in self.Caras_Despegables): angulo_giro.append(np.arccos(ang[i])) ang[i] = 1 if (ang[i] >= 0) & (ang[i] > (np.cos((np.pi / 180) * 75))): W.append( area * self.caracteristicas_panel_solar[i].psolar_rendimiento * WSun * ang[i]) else: W.append(0.) return W, area_potencia, ang, angulo_giro def Calculo_potencia(self, Sun_vector, WSun=1310): """ Calculo_potencia Funcion general para llamar a las distintas funciones para calcular la potencia Args: Sun_vector ([type]): [description] WSun (int, optional): [description]. Defaults to 1310. Returns: W (array(,n)) : Potencia generada area_potencia (array(,n)) : Areas que generan potencia ang (array(,n)) : Angulo de incidencia del vector sol con las caras angulo_giro (array(,n)) : Angulo de giro del satelite n : numero de caras """ if self.actitud.control_en_actitud == False: index_tri = self.celdas_activas(Sun_vector) W, area_potencia, ang = self.power_panel_solar( index_tri, Sun_vector, WSun) angulo_giro = [] # Ya que no hay giro pero nos lo piden habra que crearlo [angulo_giro.append(np.NaN) for i in len(self.Caras_Despegables)] else: W, area_potencia, ang, angulo_giro = self.power_panel_con_actitud( Sun_vector, WSun) return W, area_potencia, ang, angulo_giro def apply_transform(self, matrix): """ apply_transform creada para hacer coincidir correctamente las caras aplica una transformacion al satelite y reinicia los nombres Args: matrix (array(4,4)): matriz de transformacion """ self.mesh = self.mesh.apply_transform(matrix) self.name = [] self.name = self.nombrar_caras() self.Normales_caras = np.round(self.mesh.facets_normal) def visual(self): """ visual Crea una imagen visual del satelite con unos ejes funciona muy bien en notebook y en linux tambien deberia de poder funcionar Returns: (scene): retoma una escena con los ejes """ ax = trimesh.creation.axis(axis_radius=25, axis_length=200) scene = trimesh.Scene([self.mesh.apply_scale(1), ax]) return scene.show() def separar_satelite(self): """ separar_satelite Separa el satelite en mallas Returns: [type]: [description] """ y = np.array( np.where(np.isin(self.sombra, self.Caras_Despegables) == False)).flatten() despiece = [] despiece.append(self.mesh.split()[0]) for i in self.sombra[y]: normal = self.mesh.facets_normal[i] despiece.append(trimesh.intersections.slice_mesh_plane(self.mesh, self.mesh.facets_normal[i], self.mesh.facets_origin[i]+0.0001*self.mesh.facets_normal[i])) return despiece if __name__ == '__main__': filename = '12Unuv.stl' actitud = SatelitteActitud(eje_de_spin=[0, 1, 0], control=True) d = SatelitteSolarPowerSystem( filename, actitud, Despegables_orientables=True) d.apply_transform(trimesh.transformations.rotation_matrix( np.pi/2, [0, 1, 0], [0, 0, 0])) Sun_vector = np.array([-0.10486044, 0.91244007, 0.39554696]) print(d.mesh.facets_normal) W, area_potencia, ang, angulo_giro = d.power_panel_con_actitud( Sun_vector, 1)
18,815
6,272
# -*- coding: utf-8 -*- # Part of Odoo. See LICENSE file for full copyright and licensing details. from odoo import api, fields, models, _ from odoo.exceptions import ValidationError class ResPartner(models.Model): _inherit = 'res.partner' # Use in view attrs. Need to required state_id if Country is India. l10n_in_country_code = fields.Char(related="country_id.code", string="Country code") @api.constrains('vat', 'country_id') def l10n_in_check_vat(self): for partner in self.filtered(lambda p: p.commercial_partner_id.country_id.code == 'IN' and p.vat and len(p.vat) != 15): raise ValidationError(_('The GSTIN [%s] for partner [%s] should be 15 characters only.') % (partner.vat, partner.name))
744
263
import numpy as np from scipy.interpolate import BSpline from colossus.cosmology import cosmology """ Helper routines for basis functions for the continuous-function estimator. """ ################ # Spline basis # ################ def spline_bases(rmin, rmax, projfn, ncomponents, ncont=2000, order=3): ''' Compute a set of spline basis functions for the given order. Parameters ---------- rmin : double Minimum r-value for basis functions rmax : double Maximum r-value for basis functions projfn : string, default=None Path to projection file if necessary ncomponents : int Number of components (basis functions) ncont : int, default=2000 Number of continuous r-values at which to write the basis function file order : int, default=3 Order of spline to use; default is cubic spline Returns ------- bases: array-like, double 2-d array of basis function values; first column is r-values ''' if ncomponents<order*2: raise ValueError("ncomponents must be at least twice the order") kvs = _get_knot_vectors(rmin, rmax, ncomponents, order) rcont = np.linspace(rmin, rmax, ncont) bases = np.empty((ncont, ncomponents+1)) bases[:,0] = rcont for n in range(ncomponents): kv = kvs[n] b = BSpline.basis_element(kv) bases[:,n+1] = [b(r) if kv[0]<=r<=kv[-1] else 0 for r in rcont] np.savetxt(projfn, bases) return bases def _get_knot_vectors(rmin, rmax, ncomponents, order): nknots = order+2 kvs = np.empty((ncomponents, nknots)) width = (rmax-rmin)/(ncomponents-order) for i in range(order): val = i+1 kvs[i,:] = np.concatenate((np.full(nknots-val, rmin), np.linspace(rmin+width, rmin+width*val, val))) kvs[ncomponents-i-1] = np.concatenate((np.linspace(rmax-width*val, rmax-width, val), np.full(nknots-val, rmax))) for j in range(ncomponents-2*order): idx = j+order kvs[idx] = rmin+width*j + np.arange(0,nknots)*width return kvs ############# # BAO basis # ############# def bao_bases(rmin, rmax, projfn, cosmo_base=None, ncont=2000, redshift=0.0, alpha_guess=1.0, dalpha=0.001, bias=1.0, k0=0.1, k1=10.0, k2=0.1, k3=0.001): ''' Compute the 5-component BAO basis functions based on a cosmological model and linearized around the scale dilation parameter alpha. Parameters ---------- rmin : double Minimum r-value for basis functions rmax : double Maximum r-value for basis functions projfn : string, default=None Path to projection file if necessary cosmo_base : nbodykit cosmology object, default=nbodykit.cosmology.Planck15 Cosmology object for the BAO model. ncont : int, default=2000 Number of continuous r-values at which to write the basis function file redshift : double, default=0.0 Redshift at which to compute power spectrum alpha_guess : double, default=1.0 The alpha (scale dilation parameter) at which to compute the model (alpha=1.0 is no scale shift) dalpha : double, default=0.001 The change in alpha (scale dilation parameter) used to calculate the numerical partial derivative bias : double, default=1.0 The bias parameter by which to scale the model amplitude (bias=1.0 indicates no bias) k0 : double, default=0.1 The initial magnitude of the derivative term k1 : double, default=1.0 The initial magnitude of the s^2 nuisance parameter term k2 : double, default=0.1 The initial magnitude of the s nuisance parameter term k3 : double, default=0.001 The initial magnitude of the constant nuisance parameter term Returns ------- bases: array-like, double 2-d array of basis function values; first column is r-values ''' if cosmo_base is None: print("cosmo_base not provided, defaulting to Planck 2015 cosmology ('planck15')") cosmo_base = cosmology.setCosmology('planck15') cf = cosmo_base.correlationFunction def cf_model(r): return bias * cf(r, z=redshift) rcont = np.linspace(rmin, rmax, ncont) bs = _get_bao_components(rcont, cf_model, dalpha, alpha_guess, k0=k0, k1=k1, k2=k2, k3=k3) nbases = len(bs) bases = np.empty((ncont, nbases+1)) bases[:,0] = rcont bases[:,1:nbases+1] = np.array(bs).T np.savetxt(projfn, bases) ncomponents = bases.shape[1]-1 return bases def _get_bao_components(r, cf_func, dalpha, alpha, k0=0.1, k1=10.0, k2=0.1, k3=0.001): b1 = k1/r**2 b2 = k2/r b3 = k3*np.ones(len(r)) cf = cf_func(alpha*r) b4 = cf cf_dalpha = cf_func((alpha+dalpha)*r) dcf_dalpha = _partial_derivative(cf, cf_dalpha, dalpha) b5 = k0*dcf_dalpha return b1,b2,b3,b4,b5 def _partial_derivative(f1, f2, dv): df = f2-f1 deriv = df/dv return deriv
5,037
1,796
import glob import os import pandas as pd import json import ast from tqdm import tqdm import click import pickle from multiprocessing import Pool, cpu_count, Queue from functools import partial import itertools import sys sys.setrecursionlimit(15000) import logging logpath = "./tree_matches.log" logger = logging.getLogger('log') logger.setLevel(logging.INFO) ch = logging.FileHandler(logpath) # ch.setFormatter(logging.Formatter('%(message)s')) logger.addHandler(ch) def replace_function_subtrees(coral_repr): ignore = [] new_tree = [] for i in range(len(coral_repr)): node = coral_repr[i] if i in ignore: #ignore the children too: ignore = ignore + node.get("children",[]) continue elif node["type"] == "Call": ignore = ignore + node.get("children",[])[1:] new_tree.append(node) return new_tree class Snippet(object): def __init__(self,slug,version_id,source,competition = None, max_size=512): self.slug = slug self.max_size = max_size self.version_id = version_id self.source = source self.coral_repr = parse_string(source)[:self.max_size] self.function_args_removed_repr = replace_function_subtrees(self.coral_repr) self.python_ast = ast.parse(source) def coral_diff(self,other,key = None,attr="coral_repr"): a_attr = getattr(self,attr) b_attr = getattr(other,attr) return self.tree_diff(a_attr, b_attr, key = key) def rear_pad_list(a,n): m = len(a) return a + [None for i in range(n-m)] def make_same_length(a,b): n = max(len(a),len(b)) a = rear_pad_list(a,n) b = rear_pad_list(b,n) return (a,b) def tree_diff(self,a,b,key=None): a,b = make_same_length(a,b) if not key: key = lambda aa,bb: not aa == bb return sum([key(aa,bb) for (aa,bb) in zip(a,b)]) def to_dict(self): return {"slug":self.slug, "version_id" : self.version_id, "source":self.source} def rear_pad_list(a,n): m = len(a) return a + [None for i in range(n-m)] def make_same_length(a,b): n = max(len(a),len(b)) a = rear_pad_list(a,n) b = rear_pad_list(b,n) return (a,b) def tree_diff(a,b,key=None): a,b = make_same_length(a,b) if not key: key = lambda aa,bb: not aa == bb return sum([key(aa,bb) for (aa,bb) in zip(a,b)]) def looks_like_string(node): node_type = node.get("type") if node_type == "Constant": try: float(node.get("value")) return False except (ValueError,TypeError): return True else: return False def dont_count_strings(a,b): if a is None or b is None: return True if looks_like_string(a) and looks_like_string(b): return False else: return (not a == b) def remove_duplicate_matches(matches): to_return = [] record = set() for match in matches: if not (match[0].source,match[1].source) in record: record.add((match[0].source,match[1].source)) to_return.append(match) return to_return # def get_matching_cells(kernel_trees,diff_versions = False, key = None): # matches = [] # all_cells = [] # for slug,versions in kernel_trees.items(): # all_version_cells = [] # for version_id, cells in versions.items(): # if cells: # for cell in cells: # all_version_cells.append(cell) # n = len(all_version_cells) # if n == 1: # continue # for i in range(n): # for j in range(i+1,n): # cell_i = all_version_cells[i] # cell_j = all_version_cells[j] # if diff_versions: # if cell_i.version_id == cell_j.version_id: # continue # diff = cell_i.coral_diff(cell_j,key=key) # if diff == 1: # matches.append((cell_i,cell_j)) # all_cells = all_cells + all_version_cells # return matches def sort_versions_by_version_id(dictionary): tuples = list(dictionary.items()) return sorted(tuples, key=lambda x : int(x[0])) def get_sequential_matching( kernel_trees, key=None, attr="coral_repr"): matches = [] for slug,versions in kernel_trees.items(): sorted_versions = sort_versions_by_version_id(versions) for a,b in zip(sorted_versions, sorted_versions[1:]): a_version_id, a_cells = a b_version_id, b_cells = b for a_cell in a_cells: for b_cell in b_cells: diff = a_cell.coral_diff(b_cell, key=key, attr=attr) if diff == 1: matches.append((a_cell, b_cell)) return matches def get_matching_cells(kernel_trees,diff_versions = False, key = None,attr="coral_repr"): matches = [] all_cells = [] for slug,versions in kernel_trees.items(): all_version_cells = [] for version_id, cells in versions.items(): if cells: for cell in cells: all_version_cells.append(cell) n = len(all_version_cells) if n == 1: continue for i in range(n): for j in range(i+1,n): cell_i = all_version_cells[i] cell_j = all_version_cells[j] if diff_versions: if cell_i.version_id == cell_j.version_id: continue diff = cell_i.coral_diff(cell_j,key=key,attr=attr) if diff == 1: matches.append((cell_i,cell_j)) all_cells = all_cells + all_version_cells return matches def parse_string(string): global c, d tree = ast.parse(string) json_tree = [] def gen_identifier(identifier, node_type = 'identifier'): pos = len(json_tree) json_node = {} json_tree.append(json_node) json_node['type'] = node_type json_node['value'] = identifier return pos def traverse_list(l, node_type = 'list'): pos = len(json_tree) json_node = {} json_tree.append(json_node) json_node['type'] = node_type children = [] for item in l: children.append(traverse(item)) if (len(children) != 0): json_node['children'] = children return pos def traverse(node): pos = len(json_tree) json_node = {} json_tree.append(json_node) json_node['type'] = type(node).__name__ children = [] if isinstance(node, ast.Name): json_node['value'] = node.id elif isinstance(node, ast.Num): json_node['value'] = str(node.n) elif isinstance(node, ast.Str): json_node['value'] = node.s elif isinstance(node, ast.alias): json_node['value'] = str(node.name) if node.asname: children.append(gen_identifier(node.asname)) elif isinstance(node, ast.FunctionDef): json_node['value'] = str(node.name) elif isinstance(node, ast.ClassDef): json_node['value'] = str(node.name) elif isinstance(node, ast.ImportFrom): if node.module: json_node['value'] = str(node.module) elif isinstance(node, ast.Global): for n in node.names: children.append(gen_identifier(n)) elif isinstance(node, ast.keyword): json_node['value'] = str(node.arg) # Process children. if isinstance(node, ast.For): children.append(traverse(node.target)) children.append(traverse(node.iter)) children.append(traverse_list(node.body, 'body')) if node.orelse: children.append(traverse_list(node.orelse, 'orelse')) elif isinstance(node, ast.If) or isinstance(node, ast.While): children.append(traverse(node.test)) children.append(traverse_list(node.body, 'body')) if node.orelse: children.append(traverse_list(node.orelse, 'orelse')) elif isinstance(node, ast.With): children.append(traverse(node.context_expr)) if node.optional_vars: children.append(traverse(node.optional_vars)) children.append(traverse_list(node.body, 'body')) elif isinstance(node, ast.Try): children.append(traverse_list(node.body, 'body')) children.append(traverse_list(node.handlers, 'handlers')) if node.orelse: children.append(traverse_list(node.orelse, 'orelse')) elif isinstance(node, ast.arguments): children.append(traverse_list(node.args, 'args')) children.append(traverse_list(node.defaults, 'defaults')) if node.vararg: children.append(gen_identifier(node.vararg, 'vararg')) if node.kwarg: children.append(gen_identifier(node.kwarg, 'kwarg')) elif isinstance(node, ast.ExceptHandler): if node.type: children.append(traverse_list([node.type], 'type')) if node.name: children.append(traverse_list([node.name], 'name')) children.append(traverse_list(node.body, 'body')) elif isinstance(node, ast.ClassDef): children.append(traverse_list(node.bases, 'bases')) children.append(traverse_list(node.body, 'body')) children.append(traverse_list(node.decorator_list, 'decorator_list')) elif isinstance(node, ast.FunctionDef): children.append(traverse(node.args)) children.append(traverse_list(node.body, 'body')) children.append(traverse_list(node.decorator_list, 'decorator_list')) else: # Default handling: iterate over children. for child in ast.iter_child_nodes(node): if isinstance(child, ast.expr_context) or isinstance(child, ast.operator) or isinstance(child, ast.boolop) or isinstance(child, ast.unaryop) or isinstance(child, ast.cmpop): # Directly include expr_context, and operators into the type instead of creating a child. json_node['type'] = json_node['type'] + type(child).__name__ else: children.append(traverse(child)) if isinstance(node, ast.Attribute): children.append(gen_identifier(node.attr, 'attr')) if (len(children) != 0): json_node['children'] = children return pos traverse(tree) return json_tree def get_param_from_filename(param,filename): template = "\?{}=(.*)\.|\?" query_regex = re.compile(template.format(param)) try: return re.findall(query_regex,filename)[0] except IndexError: return None def get_slug_from_file(filename): return re.split("\?|\.",filename)[0] def load_cell_as_snippets(slug,version_id,path,max_size=512): with open(path) as kernel_file: cells = [] try: res = json.load(kernel_file) except ValueError: return cells if not (type(res) is dict) or not "cells" in res: return cells for cell in res["cells"]: if not cell.get("source"): continue if type(cell["source"]) is list: cell["source"] = "".join(cell["source"]) try: cells.append(Snippet(slug,version_id,cell["source"],max_size=max_size)) except (SyntaxError, AttributeError): continue return cells def get_slug_matches(competition_path,slug,ignore_function_args=False, remove_exact_duplicates=False, length_threshold=None, ignore_strings=False,max_size=512, sequential_matches=False): # in_path is a slug directory kernel_version_snippets = {slug:{}} for version_path in glob.glob(os.path.join(competition_path,slug,"*.json")): filename = os.path.basename(version_path) version_id = os.path.splitext(filename)[0] if not version_id: continue version_snippets = load_cell_as_snippets(slug,version_id,version_path,max_size=max_size) kernel_version_snippets[slug][version_id] = version_snippets if ignore_function_args: match_attr = "function_args_removed_repr" else: match_attr = "coral_repr" if ignore_strings: key = dont_count_strings else: key = None if sequential_matches: matches = get_sequential_matching(kernel_version_snippets,key=key, attr=match_attr) else: matches = get_matching_cells(kernel_version_snippets, diff_versions = True, key=key, attr=match_attr) if length_threshold: matches=[x for x in matches if len(x[0].source.split("\n")) > 5] if remove_exact_duplicates: matches = remove_duplicate_matches(matches) return matches # def get_competition_matches(competition_path): # slugs = [os.path.basename(x) for x in glob.glob(os.path.join(competition_path,"*"))] # matches = [] # for slug in slugs: # matches = matches + get_slug_matches(competition_path,slug) # logger.info("Done with {}".format(competition_path)) # return matches def get_competition_matches(ignore_function_args,length_threshold,remove_exact_duplicates, ignore_strings, max_size, sequential_matches, competition_path): slugs = [os.path.basename(x) for x in glob.glob(os.path.join(competition_path,"*"))] matches = [] for slug in tqdm(slugs): matches = matches + get_slug_matches(competition_path,slug,ignore_function_args, remove_exact_duplicates, length_threshold, ignore_strings, max_size,sequential_matches) logger.info("Done with {}".format(competition_path)) return matches # def get_competition_matcher(ignore_function_args,length_threshold,remove_exact_duplicates, # ignore_strings): # def get_competition_matches(ignore_function_args,length_threshold,remove_exact_duplicates, # ignore_strings, competition_path): # slugs = [os.path.basename(x) for x in glob.glob(os.path.join(competition_path,"*"))] # matches = [] # for slug in slugs: # matches = matches + get_slug_matches(competition_path,slug,ignore_function_args, # remove_exact_duplicates, length_threshold, ignore_strings) # logger.info("Done with {}".format(competition_path)) # return matches # return get_competition_matches def write_matches(out_path,matches): with open(os.path.join(out_path,"matches.jsonl"), 'w') as the_file: for match in matches: the_file.write(json.dumps([match[0].to_dict(),match[1].to_dict()])) the_file.write("\n") @click.command() @click.argument('in_path', type=click.Path()) @click.argument('out_path', type = click.Path()) @click.option('--ignore_function_args', is_flag = True, default=False, show_default=True) @click.option('--length_threshold', default=None, show_default=True) @click.option('--remove_exact_duplicates',is_flag = True, default=False, show_default=True) @click.option('--ignore_strings', is_flag = True,default=False, show_default=True) @click.option('--max_size', default=512, show_default=True) @click.option('--sequential_matches', is_flag=True, default=False,show_default=True) def main(in_path, out_path, ignore_function_args, length_threshold, remove_exact_duplicates, ignore_strings, max_size, sequential_matches): all_comp_paths = glob.glob(os.path.join(in_path,"*"))[1:2] n = len(all_comp_paths) # all_matches = map(get_competition_matches,all_comp_paths) all_matches = [] comp_matcher = partial(get_competition_matches,ignore_function_args, length_threshold, remove_exact_duplicates, ignore_strings, max_size, sequential_matches) all_matches = [comp_matcher(all_comp_paths[0])] # with Pool(16) as pool: # for result in tqdm(pool.imap_unordered(comp_matcher,all_comp_paths),total =n): # all_matches.append(result) # pool.join() # pool.close() # with Pool(8) as worker_pool: # all_matches = tqdm(worker_pool.imap_unordered(get_competition_matches,all_comp_paths),total =n) all_matches = itertools.chain.from_iterable(all_matches) write_matches(out_path,all_matches) if __name__ == '__main__': main()
17,587
5,403
# ================================================================= # # Authors: Stephen Lloyd # Ian Edwards # # Copyright (c) 2020, OpenCDMS Project # # Permission is hereby granted, free of charge, to any person # obtaining a copy of this software and associated documentation # files (the "Software"), to deal in the Software without # restriction, including without limitation the rights to use, # copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following # conditions: # # The above copyright notice and this permission notice shall be # included in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, # EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES # OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND # NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT # HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, # WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING # FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR # OTHER DEALINGS IN THE SOFTWARE. # # ================================================================= def windrose( speed, direction, facet, n_directions=12, n_speeds=5, speed_cuts="NA", col_pal="GnBu", ggtheme="grey", legend_title="Wind Speed", calm_wind=0, variable_wind=990, n_col=1, ): """ Plot a windrose showing the wind speed and direction for given facets using ggplot2. Args: * speed Numeric vector of wind speeds. * direction Numeric vector of wind directions. * facet Character or factor vector of the facets used to plot the various windroses. Kwargs: * n_directions The number of direction bins to plot (petals on the rose) (default 12). * n_speeds The number of equally spaced wind speed bins to plot. This is used if speed_cuts is NA (default 5). * speed_cuts Numeric vector containing the cut points for the wind speed intervals (default "NA"). * col_pal Character string indicating the name of the brewer.pal.info colour palette to be used for plotting (default "GNBU"). * ggtheme Character string (partially) matching the ggtheme to be used for plotting, may be "grey", "gray", "bw", "linedraw", "light", "minimal", "classic" (default "grey"). * legend_title Character string to be used for the legend title (default "Wind Speed"). * calm_wind The upper limit for wind speed that is considered calm (default 0). * variable_wind Numeric code for variable winds (if applicable) (default 990). * n_col The number of columns of plots (default 1). """ # clifro::windrose( # speed, direction, facet, n_directions=12, n_speeds=5, speed_cuts=NA, # col_pal="GnBu", ggtheme=c( # "grey", "gray", "bw", "linedraw", "light", "minimal", "classic"), # legend_title="Wind Speed", calm_wind=0, variable_wind=990, # n_col=1, ...) return None
3,273
1,025
import os from selenium import webdriver from sa11y.analyze import Analyze import urllib3 urllib3.disable_warnings() class TestAccessibilitySa11y(object): def test_analysis(self): capabilities = { 'browserName': 'chrome', 'sauce:options': { 'username': os.environ["SAUCE_USERNAME"], 'accesskey': os.environ["SAUCE_ACCESS_KEY"], } } sauce_url = 'https://ondemand.us-west-1.saucelabs.com/wd/hub' driver = webdriver.Remote(sauce_url, capabilities) driver.get('https://www.saucedemo.com/') Analyze(driver).results() driver.quit()
663
216
# 275. H-Index II # Follow up for H-Index: What if the citations array is sorted in ascending order? Could you optimize your algorithm? class Solution(object): # http://blog.csdn.net/titan0427/article/details/50650006 def hIndex(self, citations): """ :type citations: List[int] :rtype: int """ n = len(citations) start, end = 1, n while start <= end: h = (start + end) / 2 if citations[n-h] < h: end = h-1 elif n-h-1 >= 0 and citations[n-h-1] > h: start = h+1 else: return h return 0
653
215
from django.conf import settings from django import template from news.models import NewsItem, NewsAuthor, NewsCategory register = template.Library() @register.tag def get_news(parser, token): """ {% get_news 5 as news_items %} """ bits = token.split_contents() if len(bits) == 3: limit = None elif len(bits) == 4: try: limit = abs(int(bits[1])) except ValueError: raise template.TemplateSyntaxError("If provided, second argument to `get_news` must be a positive whole number.") if bits[-2].lower() != 'as': raise template.TemplateSyntaxError("Missing 'as' from 'get_news' template tag. Format is {% get_news 5 as news_items %}.") return NewsItemNode(bits[-1], limit) class NewsItemNode(template.Node): """ Returns a QuerySet of published NewsItems based on the lookup parameters. """ def __init__(self, varname, limit=None, author=None, category_slug=None, filters=None): self.varname = varname self.limit = limit self.filters = filters # author is either a literal NewsAuthor slug, # or a template variable containing a NewsAuthor slug. self.author = author self.category = category_slug def render(self, context): # Base QuerySet, which will be filtered further if necessary. news = NewsItem.on_site.published() # Do we filter by author? If so, first attempt to resolve `author` as # a template.Variable. If that doesn't work, use `author` as a literal # NewsAuthor.slug lookup. if self.author is not None: try: author_slug = template.Variable(self.author).resolve(context) except template.VariableDoesNotExist: author_slug = self.author news = news.filter(author__slug=author_slug) if self.category is not None: try: category_slug = template.Variable(self.category).resolve(context) except template.VariableDoesNotExist: category_slug = self.category news = news.filter(category__slug=category_slug) # Apply any additional lookup filters if self.filters: news = news.filter(**self.filters) # Apply a limit. if self.limit: news = news[:self.limit] context[self.varname] = news return u'' def parse_token(token): """ Parses a token into 'slug', 'limit', and 'varname' values. Token must follow format {% tag_name <slug> [<limit>] as <varname> %} """ bits = token.split_contents() if len(bits) == 5: # A limit was passed it -- try to parse / validate it. try: limit = abs(int(bits[2])) except: limit = None elif len(bits) == 4: # No limit was specified. limit = None else: # Syntax is wrong. raise template.TemplateSyntaxError("Wrong number of arguments: format is {%% %s <slug> [<limit>] as <varname> %%}" % bits[0]) if bits[-2].lower() != 'as': raise template.TemplateSyntaxError("Missing 'as': format is {%% %s <slug> [<limit>] as <varname> %%}" % bits[0]) return (bits[1], limit, bits[-1]) @register.tag def get_posts_by_author(parser,token): """ {% get_posts_by_author <slug> [<limit>] as <varname> %} {% get_posts_by_author foo 5 as news_items %} # 5 articles {% get_posts_by_author foo as news_items %} # all articles """ author_slug, limit, varname = parse_token(token) return NewsItemNode(varname, limit, author=author_slug) @register.tag def get_posts_by_category(parser,token): """ {% get_posts_by_category <slug> [<limit>] as <varname> %} {% get_posts_by_category foo 5 as news_items %} # 5 articles {% get_posts_by_category foo as news_items %} # all articles """ category_slug, limit, varname = parse_token(token) return NewsItemNode(varname, limit, category_slug=category_slug) @register.tag def get_news_by_category(parser,token): """ This is because I got sick of having to debug issues due to the fact that I typed one or the other. """ return get_posts_by_category(parser,token) @register.tag def get_posts_by_tag(parser,token): """ {% get_posts_by_tag <tag> [<limit>] as <varname> %} """ tag, limit, varname = parse_token(token) return NewsItemNode(varname, limit, filters={'tags__contains':tag}) @register.tag def months_with_news(parser, token): """ {% months_with_news 4 as months %} """ bits = token.split_contents() if len(bits) == 3: limit = None elif len(bits) == 4: try: limit = abs(int(bits[1])) except ValueError: raise template.TemplateSyntaxError("If provided, second argument to `months_with_news` must be a positive whole number.") if bits[-2].lower() != 'as': raise template.TemplateSyntaxError("Missing 'as' from 'months_with_news' template tag. Format is {% months_with_news 5 as months %}.") return MonthNode(bits[-1], limit=limit) class MonthNode(template.Node): def __init__(self,varname,limit=None): self.varname = varname self.limit = limit # for MonthNode inheritance def render(self, context): try: months = NewsItem.on_site.published().dates('date', 'month', order="DESC") except: months = None if self.limit is not None: months = list(months) months = months[:self.limit] context[self.varname] = months return '' @register.tag def get_categories(parser,token): """ {% get_categories as <varname> %} {% get_categories 5 as <varname> %} """ bits = token.split_contents() if len(bits) == 3: limit = None elif len(bits) == 4: try: limit = abs(int(bits[1])) except ValueError: raise template.TemplateSyntaxError("If provided, second argument to `get_categories` must be a positive whole number.") if bits[-2].lower() != 'as': raise template.TemplateSyntaxError("Missing 'as' from 'get_categories' template tag. Format is {% get_categories 5 as categories %}.") return CategoryNode(bits[-1], limit=limit) class CategoryNode(template.Node): def __init__(self,varname,limit=None): self.varname = varname self.limit = limit def render(self, context): categories = NewsCategory.on_site.all() if self.limit is not None: categories = list(categories) categories = categories[:self.limit] context[self.varname] = categories return '' @register.inclusion_tag('news/news_ul.html') def news_ul(slug): try: return {'category': NewsCategory.objects.get(slug=slug)} except NewsCategory.DoesNotExist: return {}
6,172
2,211
import math import falcon import jsonschema class Model(object): db_table=""# db table name properties={} #schema properties schema={} #to hold schema for each model required=[] #list of required fields def __init__(self,db): self._db=db self.validated_data={} self.read_only=[] self.write_only=[] def get_schema(self): #get schema by providing required fields. Provideed as a list. e.g ["id","name"] self.schema.update({"properties":self.properties,'required':self.required,"title":self.db_table,"type": "object"}) return self.schema def create(self,): pass def update(self,pk): pass def delete(self,pk): pass def all(self): return self._db.table(self.db_table).select() def validate(self,data): try: schema=self.get_schema() jsonschema.validate(data, self.get_schema(), format_checker=jsonschema.FormatChecker()) #if above passes properties=schema.get('properties') for k,v in properties.items(): if v.get('readOnly'): self.read_only.append(k) if v.get('writeOnly'): self.write_only.append(k) #remove items in data that are not in schema properties self.validated_data={k:v for k,v in data.items() if properties.get(k)} except jsonschema.ValidationError as e: raise falcon.HTTPBadRequest('Data validation failed',description=e.message) def get_cleaned_data(self,remove_keys): return {k:v for k,v in self.validated_data.items() if k not in remove_keys}
1,731
524
import os from goldminer import game if __name__ == "__main__": print("Initializing") print("Working directory: " + os.getcwd()) game.start()
155
52
#!/usr/bin/env python from math import ceil import os import sys import argparse import multiprocessing import subprocess as sp import re #from pprint import pprint from array import array from yaml import load, dump contexts = ('CG','CHG','CHH') def main(): fCheck = fileCheck() #class for checking parameters parser = argparse.ArgumentParser(description="Wrapper for Bisulfite Methylation Alignment.") parser.add_argument('-R', metavar='FASTA', help='Reference for alignment', required=True, type=fCheck.fasta) parser.add_argument('-r1', metavar='FASTQ', help='Single or first fastq from pair', required=True, type=fCheck.fastq) parser.add_argument('-r2', metavar='FASTQ', help='Second read', type=fCheck.fastq) parser.add_argument('-O', metavar='STR', help='Output directory (Default: %(default)s)', default='.', type=str) parser.add_argument('-N', '--name', metavar='STR', help='Name for run') parser.add_argument('-U', '--uniq', action='store_true', help="Only use unique alignments") parser.add_argument('-q', help="Fastq Quality Encoding (Default: %(default)s)", default=33, type=int) parser.add_argument('-C', metavar='Chrom', help="Chromosome to use for checking bisulfite conversion rate") parser.add_argument('-S', dest='tileSize', metavar='N', type=int, help="Window size (Default: %(default)s)", default=100) parser.add_argument('-d', metavar='N', type=int, help="Minimum coverage in tile for methylation to be printed (Default: %(default)s - all)", default=1) parser.add_argument('--CG', metavar='N', type=int, help="Minimum sites per tile (Default: %(default)s)", default=3) parser.add_argument('--CHG', metavar='N', type=int, help="Minimum sites per tile (Default: %(default)s)", default=3) parser.add_argument('--CHH', metavar='N', type=int, help="Minimum sites per tile (Default: %(default)s)", default=6) args = parser.parse_args() ###################################################### # Path Section ###################################################### if not args.name: args.name = os.path.splitext(args.r1)[0] if not os.path.exists(args.O): os.makedirs(args.O) outPrefix = os.path.join(args.O, args.name) ###################################################### # Arguments Section ###################################################### config = {'bsmap':{}, 'methratio':{}, 'tiles':{}} #----------------------------------------------------- # Arguments for running BSMAP #----------------------------------------------------- config['bsmap']['-a'] = {'value':args.r1, 'description':'R1 input'} config['bsmap']['-z'] = {'value':str(args.q), 'description':'Fastq quality encoding'} config['bsmap']['-p'] = {'value':str(multiprocessing.cpu_count()), 'description':'Number of threads'} config['bsmap']['-q'] = {'value':'20', 'description':"Quality threshold for trimming 3' ends of reads"} config['bsmap']['-d'] = {'value':args.R, 'description':'Reference'} config['bsmap']['-S'] = {'value':'77345', 'description':'Hardcoded random seed for mapping reproducibility'} config['bsmap']['-w'] = {'value':'10000', 'description':'Number of candidate seeds to align against'} #config['bsmap']['-V'] = {'value':'1', 'description':'Print major messages'} #config['bsmap']['-o'] = {'value':args.name+".sam", 'description':'Output BAM'} # default SAM stdout is piped to samtools #----------------------------------------------------- # Arguments for methratio.py #----------------------------------------------------- #config['methratio']['-q'] = {'value':'', 'description':'Quiet'} config['methratio']['-z'] = {'value':'', 'description':'Report locations with zero methylation'} config['methratio']['-r'] = {'value':'', 'description':'Remove duplicate reads'} config['methratio']['-d'] = {'value':args.R, 'description':'Reference'} config['methratio']['-o'] = {'value':outPrefix+"_methratio.txt", 'description':'Output methylation ratio file'} #----------------------------------------------------- # Paired specific arguments #----------------------------------------------------- if args.r2: config['bsmap']['-b'] = {'value':args.r2, 'description':'R2 input'} config['methratio']['-p'] = {'value':'', 'description':'Require propper pairings'} if args.uniq: config['bsmap']['-r'] = {'value':'0', 'description':'No non-unique hits reported'} config['methratio']['-u'] = {'value':'', 'description':'Only use unique alignments'} else: config['bsmap']['-r'] = {'value':'2', 'description':'non-unique hits reported'} config['bsmap']['-w'] = {'value':'20', 'description':'Only 20 equal best hits reported'} #----------------------------------------------------- # Tile Section #----------------------------------------------------- config['tiles']['size'] = {'value':args.tileSize, 'description':'Size of tiles for summarizing methylation'} config['tiles']['minCoverage'] = {'value':args.d, 'description':'Minimum Coverage'} config['tiles']['CG'] = {'value':args.CG, 'description':'Minimum number of sites per tile'} config['tiles']['CHG'] = {'value':args.CHG, 'description':'Minimum number of sites per tile'} config['tiles']['CHH'] = {'value':args.CHH, 'description':'Minimum number of sites per tile'} ###################################################### # Check for Dependencies ###################################################### for d in ('bsmap','samtools','methratio.py','bedGraphToBigWig'): if not which(d): sys.exit("Please add %s to your path\n"%(d)) # Parse FAI fai = args.R+'.fai' if not os.path.exists(fai): os.system("samtools faidx %s"%(args.R)) ###################################################### # Run workflow ###################################################### faiDict = ParseFai(fai) #----------------------------------------------------- # run BSMAP #----------------------------------------------------- runBSMAP(config, outPrefix, args.r2) #----------------------------------------------------- # run methratio.py and calculate conversion rate #----------------------------------------------------- runRatio(config) if args.C: calcConversion(config, args.C, faiDict) #----------------------------------------------------- # Make Tiles and Bedgraphs #----------------------------------------------------- makeTile(config, outPrefix, faiDict) #----------------------------------------------------- # Make bigWig #----------------------------------------------------- makeBigWig(config,fai) #----------------------------------------------------- # Write YAML #----------------------------------------------------- dump(config, open(outPrefix+'.yaml','w'), default_flow_style=False, width=1000) def calcConversion(config, chrom, faiDict): if not chrom in faiDict: chromStr = '\n - '.join(faiDict.keys()) sys.exit("Chromosome: %s not in reference. Please choose a chromosome from:\n - %s"%(chrom, chromStr)) ratioFile = config['methratio']['-o']['value'] p = sp.Popen(["grep", "^%s\s"%chrom, ratioFile], stdout=sp.PIPE).stdout cSum = 0 ctSum = 0 for line in p: tmp = line.split('\t') cSum += int(tmp[6]) ctSum += int(tmp[7]) percent = round((1.0-float(cSum)/(float(ctSum)+1.0))*100.0, 2) config['conversion'] = {} config['conversion']['Chromosome'] = {'value':chrom, 'description':'Chromosome to calculate conversion efficiency from. No methylation should be expected on this chromosome.'} config['conversion']['C'] = {'value':cSum, 'description':'Number of methylated cytosines'} config['conversion']['CT'] = {'value':ctSum, 'description':'Number of un/methylated cytosines'} config['conversion']['percent'] = {'value':percent, 'description':'Conversion rate: (1-C/CT)*100'} p.close() def runRatio(config): ratioCMD = makeCMD('methratio.py', config, 'methratio')+[config['bsmap_stats']['output']['value']] ratioOUT = sp.check_output(ratioCMD, stderr=sp.STDOUT) statLine = ratioOUT.split('\n')[-2] m = re.match(r".+total\s([0-9]+)\s.+,\s([0-9]+)\s.+age:\s(\w+\.\w+) fold", statLine) mappings, covered, coverage = m.groups() config['methratio_stats'] = {} config['methratio_stats']['mappings'] = {'value':mappings, 'description':'Number of valid mappings'} config['methratio_stats']['covered'] = {'value':covered, 'description':'Number of cytosines covered'} config['methratio_stats']['coverage'] = {'value':coverage, 'description':'Average coverage fold'} def runBSMAP(config, outPrefix, r2): bsmapCMD = makeCMD('bsmap', config, 'bsmap') bsP = sp.Popen(bsmapCMD, stderr=sp.PIPE, stdout=sp.PIPE) cpus = str(multiprocessing.cpu_count()) samP = sp.Popen('samtools view -uS - | samtools sort -m 200M -@ %s -O bam -o %s.bam -T %s_tmp'%(cpus, outPrefix, outPrefix), shell=True, stdin=bsP.stdout, stdout=open(outPrefix+'.bam','wb'), stderr=sp.PIPE) bsP.stdout.close() bsOUT = bsP.stderr.read() samP.wait() if r2: total, aligned, unique, mult = map(int, re.findall(r'pairs:\s+([0-9]+)', bsOUT)) unit='pairs' else: total, aligned, unique, mult = map(int, re.findall(r'reads:\s+([0-9]+)', bsOUT)) unit='reads' config['bsmap_stats'] = {} config['bsmap_stats']['output'] = {'value':outPrefix+".bam", 'description':'Output BAM'} config['bsmap_stats']['input'] = {'value':total, 'description':'Total number of %s in input'%(unit)} config['bsmap_stats']['aligned'] = {'value':aligned, 'description':'Total number of %s aligned'%(unit)} config['bsmap_stats']['unique'] = {'value':unique, 'description':'Total number of %s uniquely aligned'%(unit)} config['bsmap_stats']['mult'] = {'value':mult, 'description':'Total number of %s with multiple alignments'%(unit)} def makeCMD(baseBin, config, section): outCMD = [baseBin] cSec = config[section] for key in cSec.keys(): outCMD.append(key) v = cSec[key]['value'] if v: outCMD.append(v) return outCMD def ParseFai(inFile): ''' Parses a fa.fai into a python dictionary Paramteters ================================ inFile FILE fai file ''' return dict(map(lambda y: (y[0], int(y[1])), map(lambda y: y.split('\t'), open(inFile,'r').readlines()))) class fileCheck: def check(self, file, exts): ext = os.path.splitext(file)[1][1:] fName = os.path.split(file)[1] if not ext in exts: raise argparse.ArgumentTypeError("%s not a %s"%(fName, exts[0])) if not os.path.exists(file): raise argparse.ArgumentTypeError("%s does not exist"%(file)) def fastq(self, file): self.check(file, ['fastq','fq']) return file def fasta(self, file): self.check(file, ['fasta','fa']) return file def makeBigWig(config,fai): bedgraphs = config['tiles']['output']['bedgraphs']['value'] pool = [] bws = [] for bg in bedgraphs: bw = os.path.splitext(bg)[0]+'.bw' bws.append(bw) pool.append(sp.Popen(['bedGraphToBigWig',bg,fai,bw])) for p in pool: p.wait() config['bigwigs'] = {'value':bws,'description':'Bigwig versions of bedgraph files for jbrowse to load'} def makeTile(config, outPrefix, faiDict): # Make sure to do something with the coverage variable bgNames = map(lambda x: outPrefix+'_'+x+'.bedgraph', contexts) config['tiles']['output'] = {\ 'bedgraphs':{'value':bgNames, 'description':'Mehtylation ratios for each methylation motif {CG, CHG, CHH} in bedgraph format.'},\ 'tab':{'value':outPrefix+'.tab', 'description':'Tab delimited file of methylation ratios and coverage for each tile.'}} buffer = 100000 bGs = map(lambda x: open(x, 'w', buffer), bgNames) tab = open(outPrefix+'.tab', 'w', buffer) # Write header #headStr = '\t'.join(['Chr','Start','End']+[ c+'_'+t for c in contexts for t in ('ratio','C','CT')]) ## old out format headStr = '\t'.join(['Chr','Start','End']+[ c+'_'+t for c in contexts for t in ('ratio','C','CT','sites')]) ## new out format tab.write(headStr+'\n') ####################################### # Get parameters ####################################### tileSize = config['tiles']['size']['value'] ratioFile = config['methratio']['-o']['value'] nSitesT = map(lambda y: config['tiles'][y]['value'], contexts) sortedChroms = sorted(faiDict.keys()) ####################################### # start writing by chromosome ####################################### for chrom in sortedChroms: #---------------------------------- # Create data arrays #---------------------------------- offset = int(ceil(faiDict[chrom]/float(tileSize))) # number of tiles C, CT, nSites = makeDataArrays(offset) #---------------------------------- # Read Chrom and populate arrays #---------------------------------- p = sp.Popen(["grep", "^%s\s"%chrom, ratioFile], stdout=sp.PIPE).stdout for line in p: chr, pos, cIndex, c, ct = formatLine(line) index = offset*cIndex+pos/tileSize C[index] += c CT[index] += ct nSites[index] += 1 p.close() # zCheck is true if loc-1 had zero methylation zCheck = [False, False, False] for posIndex in xrange(offset): # tile index start = posIndex*tileSize end = min(start+tileSize, faiDict[chrom]) tabStr = '%s\t%i\t%i'%(chrom,start,end) for cIndex in range(3): loc = offset*cIndex+posIndex # data index tabStr += makeTabStr(C[loc], CT[loc], nSites[loc]) #------------------------- # Generate BG #------------------------- if C[loc]: # if methylated if nSites[loc] < nSitesT[cIndex]: if not zCheck[cIndex]: bgStr = '%s\t%i\t'%(chrom,start) zCheck[cIndex] = True bGs[cIndex].write(bgStr) else: if zCheck[cIndex]: # if previous was 0 bgStr = '%i\t0\n'%(start,) zCheck[cIndex] = False bGs[cIndex].write(bgStr) ratio = float(C[loc])/float(CT[loc]) bgStr = '%s\t%i\t%i\t%.2f\n'%(chrom,start,end,ratio) bGs[cIndex].write(bgStr) else: if not zCheck[cIndex]: bgStr = '%s\t%i\t'%(chrom,start) zCheck[cIndex] = True bGs[cIndex].write(bgStr) #------------------------- tab.write(tabStr+'\n') #--------------------------------- # Write out orphaned zeros #--------------------------------- for cIndex in range(3): if zCheck[cIndex]: bgStr = '%i\t0\n'%(end,) bGs[cIndex].write(bgStr) ###################################### # Close files ###################################### for bg in bGs: bg.close() tab.close() def makeTabStr(C, CT, nSites): ''' Generates a tab-separated string for the .tab file. ''' if C: ratio = float(C)/float(CT) return '\t%.2f\t%i\t%i\t%i'%(ratio, C, CT, nSites) return '\t0\t%i\t%i\t%i'%(C, CT, nSites) def formatLine(line): tmp = line.split('\t') chr = tmp[0] pos = int(tmp[1])-1 cIndex = contexts.index(tmp[3]) c = int(tmp[6]) ct = int(tmp[7]) return (chr, pos, cIndex, c, ct) def which(program): def is_exe(fpath): return os.path.isfile(fpath) and os.access(fpath, os.X_OK) fpath, fname = os.path.split(program) if fpath: if is_exe(program): return program else: for path in os.environ["PATH"].split(os.pathsep): path = path.strip('"') exe_file = os.path.join(path, program) if is_exe(exe_file): return exe_file return None def makeDataArrays(offset): ''' Function for creating arrays that keep track of data from methratio.py output. >>> makeDataArrays(1) (array('H', [0, 0, 0]), array('H', [0, 0, 0]), array('H', [0, 0, 0])) ''' C = array('H', [0]*(offset*3)) CT = array('H', [0]*(offset*3)) nSites = array('H', [0]*(offset*3)) # max is tile size return (C, CT, nSites) if __name__ == "__main__": main()
15,337
5,502
import json import pytest from microdata_validator import Metadata, PatchingError RESOURCE_DIR = 'tests/resources/metadata_model' with open(f'{RESOURCE_DIR}/KREFTREG_DS_described.json') as f: TRANSFORMED_METADATA = json.load(f) with open(f'{RESOURCE_DIR}/KREFTREG_DS_described_update.json') as f: UPDATED_METADATA = json.load(f) with open(f'{RESOURCE_DIR}/KREFTREG_DS_enumerated.json') as f: ENUMERATED_TRANSFORMED_METADATA = json.load(f) with open(f'{RESOURCE_DIR}/KREFTREG_DS_enumerated_update.json') as f: ENUMERATED_UPDATED_METADATA = json.load(f) with open(f'{RESOURCE_DIR}/KREFTREG_DS_enumerated_patched.json') as f: PATCHED_ENUMERATED_METADATA = json.load(f) with open(f'{RESOURCE_DIR}/KREFTREG_DS_described_patched.json') as f: PATCHED_METADATA = json.load(f) with open(f'{RESOURCE_DIR}/KREFTREG_DS_described_illegal_update.json') as f: # New variable name on line 18 ILLEGALLY_UPDATED_METADATA = json.load(f) with open(f'{RESOURCE_DIR}/KREFTREG_DS_described_deleted_object.json') as f: # Deleted keyType object line 34 DELETED_OBJECT_METADATA = json.load(f) def test_object(): transformed_metadata = Metadata(TRANSFORMED_METADATA) assert ( transformed_metadata.get_identifier_key_type_name() == 'SYKDOMSTILFELLE' ) assert transformed_metadata.to_dict() == TRANSFORMED_METADATA def test_patch_described(): transformed_metadata = Metadata(TRANSFORMED_METADATA) updated_metadata = Metadata(UPDATED_METADATA) transformed_metadata.patch(updated_metadata) assert transformed_metadata.to_dict() == PATCHED_METADATA def test_patch_enumerated(): transformed_metadata = Metadata(ENUMERATED_TRANSFORMED_METADATA) updated_metadata = Metadata(ENUMERATED_UPDATED_METADATA) transformed_metadata.patch(updated_metadata) assert transformed_metadata.to_dict() == PATCHED_ENUMERATED_METADATA def test_patch_with_deleted_object(): with pytest.raises(PatchingError) as e: transformed_metadata = Metadata(TRANSFORMED_METADATA) updated_metadata = Metadata(DELETED_OBJECT_METADATA) transformed_metadata.patch(updated_metadata) assert 'Can not delete KeyType' in str(e) def test_patch_with_None(): with pytest.raises(PatchingError) as e: transformed_metadata = Metadata(TRANSFORMED_METADATA) transformed_metadata.patch(None) assert 'Can not patch with NoneType Metadata' in str(e) def test_illegaly_patch(): with pytest.raises(PatchingError) as e: transformed_metadata = Metadata(TRANSFORMED_METADATA) illegally_updated_metadata = Metadata(ILLEGALLY_UPDATED_METADATA) transformed_metadata.patch(illegally_updated_metadata) assert ( 'Illegal change to one of these variable fields: ' '[name, dataType, format, variableRole]' ) in str(e) def test_patch_metadata_with_code_list(): updated = load_file(f'{RESOURCE_DIR}/SYNT_BEFOLKNING_KJOENN_enumerated_update.json') original = load_file(f'{RESOURCE_DIR}/SYNT_BEFOLKNING_KJOENN_enumerated.json') expected = load_file(f'{RESOURCE_DIR}/SYNT_BEFOLKNING_KJOENN_enumerated_patched.json') orig = Metadata(original) orig.patch(Metadata(updated)) assert orig.to_dict() == expected def test_patch_metadata_without_code_list(): updated = load_file(f'{RESOURCE_DIR}/SYNT_PERSON_INNTEKT_described_update.json') original = load_file(f'{RESOURCE_DIR}/SYNT_PERSON_INNTEKT_described.json') expected = load_file(f'{RESOURCE_DIR}/SYNT_PERSON_INNTEKT_described_patched.json') orig = Metadata(original) orig.patch(Metadata(updated)) assert orig.to_dict() == expected def test_patch_metadata_illegal_fields_changes(): """ The "updated" contains randomly chosen fields that are not allowed to be changed. """ updated = load_file(f'{RESOURCE_DIR}/SYNT_BEFOLKNING_KJOENN_enumerated_illegal_update.json') original = load_file(f'{RESOURCE_DIR}/SYNT_BEFOLKNING_KJOENN_enumerated.json') with pytest.raises(PatchingError) as e: orig = Metadata(original) orig.patch(Metadata(updated)) assert 'Can not change these metadata fields [name, temporality, languageCode]' in str(e) def load_file(file_name: str): with open(file_name) as f: source = json.load(f) return source
4,316
1,605
# metrics/__init__.py # author: Playinf # email: playinf@stu.xmu.edu.cn from .metrics import create_tagger_evaluation_metrics
127
48
import sys import pytest from briefcase.platforms.macOS.dmg import macOSDmgCreateCommand if sys.platform != 'darwin': pytest.skip("requires macOS", allow_module_level=True) def test_binary_path(first_app_config, tmp_path): command = macOSDmgCreateCommand(base_path=tmp_path) binary_path = command.binary_path(first_app_config) assert binary_path == tmp_path / 'macOS' / 'First App' / 'First App.app' def test_distribution_path(first_app_config, tmp_path): command = macOSDmgCreateCommand(base_path=tmp_path) distribution_path = command.distribution_path(first_app_config) assert distribution_path == tmp_path / 'macOS' / 'First App-0.0.1.dmg'
680
237
from flask import Flask app = Flask(__name__) if app.config["ENV"] == "production": app.config.from_object("config.ProductionConfig") elif app.config["ENV"] == "testing": app.config.from_object("config.TestingConfig") else: app.config.from_object("config.DevelopmentConfig") from app import views from app import admin_views
336
111
#!/usr/bin/env python # -*- coding: utf-8 -*- # @Project : MeUtils. # @File : conf # @Time : 2021/1/31 10:20 下午 # @Author : yuanjie # @Email : yuanjie@xiaomi.com # @Software : PyCharm # @Description : from meutils.pipe import * # 定义参数 class TrainConf(BaseConfig): epoch = 10 batch_size = 128 def train(**kwargs): logger.info("开始训练") time.sleep(3) # 使用参数 def run(**kwargs): logger.info(f"输入参数: {kwargs}") c = TrainConf.parse_obj(kwargs) logger.info(f"使用参数: {c.dict()}") train(**c.dict()) # 传入参数 conf_cli = lambda: fire.Fire(run) # <conf_cli> --epoch 11 --batch_size 111 # fire.Fire()需要指定命令对象
674
315
install Request module pip install requests import requests r = requests.get('https://xkcd.com/353/') print(r) print(r.text) #Download image r = requests.get('https://xkcd.com/comics/python.png') print(r.content) with open('comic.png', 'wb') as f: f.write(r.content) print(r.status_code) print(r.ok) # Print True for any response <400 print(r.headers) https://httpbin.org # How to pass query parameter payload = {'page' : 2, 'count' :25} r = requests.get('https://httpbin.org/get', params=payload) print(r.text) ####### Post payload = {'username' : 'madhu', 'password' :'testing'} r = requests.post('https://httpbin.org/post', data=payload) r_dict = r.json() print(r_dict['form']) ## timeout r = requests.get('https://xkcd.com/comics/python.png', timeout=3) # if the request don't respond within 3 sec, timeout
888
346
from django.conf.urls import url, include from django.contrib import admin from rest_framework_jwt.views import obtain_jwt_token from rest_framework_jwt.views import refresh_jwt_token from rest_framework_jwt.views import verify_jwt_token # Configuration API Router from rest_framework import routers #router = routers.DefaultRouter() #router.register(r'artists', ArtistViewSet) #router.register(r'albums', AlbumViewSet) #router.register(r'songs', SongViewSet) urlpatterns = [ url(r'^', include('index.urls')), url(r'^admin/', admin.site.urls), #url(r'^api/', include(router.urls)), # AUTH url(r'^cuenta/', include('allauth.urls')), url(r'^api-token-auth/', obtain_jwt_token), url(r'^api-token-refresh/', refresh_jwt_token), url(r'^api-token-verify/', verify_jwt_token), # Apps url(r'^usuario/', include('usuario.urls')), url(r'^stock/', include('stock.urls')), url(r'^contabilidad/', include('contabilidad.urls')), ] from django.conf import settings from django.conf.urls.static import static if settings.DEBUG: urlpatterns += static(settings.MEDIA_URL, document_root=settings.MEDIA_ROOT) urlpatterns += static(settings.STATIC_URL, document_root=settings.STATIC_ROOT)
1,231
430
import numpy as np from scipy.optimize import curve_fit, minimize_scalar h_planck = 4.135667662e-3 # eV/ps h_planck_bar = 6.58211951e-4 # eV/ps kb_boltzmann = 8.6173324e-5 # eV/K def get_standard_errors_from_covariance(covariance): # return np.linalg.eigvals(covariance) return np.sqrt(np.diag(covariance)) #return np.sqrt(np.trace(covariance)) class Lorentzian: def __init__(self, test_frequencies_range, power_spectrum, guess_position=None, guess_height=None): self.test_frequencies_range = test_frequencies_range self.power_spectrum = power_spectrum self.guess_pos = guess_position self.guess_height = guess_height self._fit_params = None self._fit_covariances = None self.curve_name = 'Lorentzian' def _function(self, x, a, b, c, d): """Lorentzian function x: frequency coordinate a: peak position b: half width c: area proportional parameter d: base line """ return c/(np.pi*b*(1.0+((x - a)/b)**2))+d def get_fitting_parameters(self): if self._fit_params is None: if self.guess_pos is None or self.guess_height is None: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum) else: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum, p0=[self.guess_pos, 0.1, self.guess_height, 0.0]) self._fit_covariances = fit_covariances self._fit_params = fit_params return self._fit_params, self._fit_covariances def get_fitting(self): from scipy.integrate import quad try: fit_params, fit_covariances = self.get_fitting_parameters() maximum = fit_params[2]/(fit_params[1]*np.pi) width = 2.0*fit_params[1] frequency = fit_params[0] area = fit_params[2] standard_errors = get_standard_errors_from_covariance(fit_covariances) global_error = np.average(standard_errors[:2])/np.sqrt(area) if np.isnan(global_error): raise RuntimeError #error = get_error_from_covariance(fit_covariances) base_line = fit_params[3] return {'maximum': maximum, 'width': width, 'peak_position': frequency, 'standard_errors': standard_errors, 'global_error': global_error, 'area': area, 'base_line': base_line, 'all_good': True} except RuntimeError: return {'all_good': False} def get_curve(self, frequency_range): return self._function(frequency_range, *self.get_fitting_parameters()[0]) class Lorentzian_asymmetric: def __init__(self, test_frequencies_range, power_spectrum, guess_position=None, guess_height=None): self.test_frequencies_range = test_frequencies_range self.power_spectrum = power_spectrum self.guess_pos = guess_position self.guess_height = guess_height self._fit_params = None self._fit_covariances = None self.curve_name = 'Assym. Lorentzian' def _g_a (self, x, a, b, s): """Asymmetric width term x: frequency coordinate a: peak position b: half width s: asymmetry parameter """ return 2*b/(1.0+np.exp(s*(x-a))) def _function(self, x, a, b, c, d, s): """Lorentzian asymmetric function x: frequency coordinate a: peak position b: half width c: area proportional parameter d: base line s: asymmetry parameter """ return c/(np.pi*self._g_a(x, a, b, s)*(1.0+((x-a)/(self._g_a(x, a, b, s)))**2))+d def get_fitting_parameters(self): if self._fit_params is None: if self.guess_pos is None or self.guess_height is None: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum) else: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum, p0=[self.guess_pos, 0.1, self.guess_height, 0.0, 0.0]) self._fit_covariances = fit_covariances self._fit_params = fit_params return self._fit_params, self._fit_covariances def get_fitting(self): from scipy.integrate import quad try: fit_params, fit_covariances = self.get_fitting_parameters() peak_pos = minimize_scalar(lambda x: -self._function(x, *fit_params), fit_params[0], bounds=[self.test_frequencies_range[0], self.test_frequencies_range[-1]], method='bounded') frequency = peak_pos["x"] maximum = -peak_pos["fun"] width = 2.0 * self._g_a(frequency, fit_params[0], fit_params[1], fit_params[4]) asymmetry = fit_params[4] area, error_integration = quad(self._function, 0, self.test_frequencies_range[-1], args=tuple(fit_params), epsabs=1e-8) # area = fit_params[2] standard_errors = get_standard_errors_from_covariance(fit_covariances) global_error = np.average(standard_errors[:2])/np.sqrt(area) if np.isnan(global_error): raise RuntimeError #error = get_error_from_covariance(fit_covariances) base_line = fit_params[3] return {'maximum': maximum, 'width': width, 'peak_position': frequency, 'global_error': global_error, 'area': area, 'base_line': base_line, 'asymmetry': asymmetry, 'all_good': True} except RuntimeError: return {'all_good': False} def get_curve(self, frequency_range): return self._function(frequency_range, *self.get_fitting_parameters()[0]) class Damped_harmonic: def __init__(self, test_frequencies_range, power_spectrum, guess_position=None, guess_height=None): self.test_frequencies_range = test_frequencies_range self.power_spectrum = power_spectrum self.guess_pos = guess_position self.guess_height = guess_height self._fit_params = None self._fit_covariances = None self.curve_name = 'Damped Harm. Osc.' def _function(self, x, a, b, c, d): """Damped harmonic oscillator PS function x: frequency coordinate a: peak position b: half width c: area proportional parameter d: base line """ return c/((a**2-x**2)**2 + (b*x)**2)+d def get_fitting_parameters(self): if self._fit_params is None: if self.guess_pos is None or self.guess_height is None: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum) else: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum, p0=[self.guess_pos, 0.1, self.guess_height, 0.0]) self._fit_covariances = fit_covariances self._fit_params = fit_params return self._fit_params, self._fit_covariances def get_fitting(self): from scipy.integrate import quad try: fit_params, fit_covariances = self.get_fitting_parameters() self._fit_params = fit_params width = abs(fit_params[1]) maximum = fit_params[2]/(width*np.pi) frequency = fit_params[0] maximum = self.get_curve(frequency) area, error_integration = quad(self._function, 0, self.test_frequencies_range[-1], args=tuple(fit_params), epsabs=1e-8) # area = fit_params[2]*np.pi/(fit_params[0]**3*width) standard_errors = get_standard_errors_from_covariance(fit_covariances) global_error = np.average(standard_errors[:2])/np.sqrt(area) if np.isnan(global_error): raise RuntimeError base_line = fit_params[3] return {'maximum': maximum, 'width': width, 'peak_position': frequency, 'global_error': global_error, 'area': area, 'base_line': base_line, 'all_good': True} except RuntimeError: return {'all_good': False} def get_curve(self, frequency_range): return self._function(frequency_range, *self.get_fitting_parameters()[0]) class Gaussian_function: def __init__(self, test_frequencies_range, power_spectrum, guess_position=None, guess_height=None): self.test_frequencies_range = test_frequencies_range self.power_spectrum = power_spectrum self.guess_pos = guess_position self.guess_height = guess_height self._fit_params = None self._fit_covariances = None self.curve_name = 'Gaussian dist.' def _function(self, x, a, b, c, d): """Gaussian PDF function x: coordinate a: peak position b: deviation (sigma) c: area proportional parameter d: base line """ return c/b*np.sqrt(2*np.pi)*np.exp(-(x-a)**2/(2*b**2))+d def get_fitting_parameters(self): if self._fit_params is None: if self.guess_pos is None or self.guess_height is None: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum) else: fit_params, fit_covariances = curve_fit(self._function, self.test_frequencies_range, self.power_spectrum, p0=[self.guess_pos, 0.1, self.guess_height, 0.0]) self._fit_covariances = fit_covariances self._fit_params = fit_params return self._fit_params, self._fit_covariances def get_fitting(self): from scipy.integrate import quad try: fit_params, fit_covariances = self.get_fitting_parameters() self._fit_params = fit_params width = abs(fit_params[1]) frequency = fit_params[0] maximum = self.get_curve(frequency) area, error_integration = quad(self._function, 0, self.test_frequencies_range[-1], args=tuple(fit_params), epsabs=1e-8) # area = fit_params[2]*np.pi/(fit_params[0]**3*width) standard_errors = get_standard_errors_from_covariance(fit_covariances) global_error = np.average(standard_errors[:2])/np.sqrt(area) if np.isnan(global_error): raise RuntimeError base_line = fit_params[3] return {'maximum': maximum, 'width': width, 'peak_position': frequency, 'global_error': global_error, 'area': area, 'base_line': base_line, 'all_good': True} except RuntimeError: return {'all_good': False} def get_curve(self, frequency_range): return self._function(frequency_range, *self.get_fitting_parameters()[0]) fitting_functions = { 0: Lorentzian, 1: Lorentzian_asymmetric, 2: Damped_harmonic, } # Test for automatic detection (order can change) # import sys, inspect # list_fitting = inspect.getmembers(sys.modules[__name__], inspect.isclass) # Fitting_functions = {} # for i, p in enumerate(list_fitting): # Fitting_functions[i] = p[1]
13,432
3,891
from __init__ import print_msg_box class Node: def __init__(self, dataValue=None): self.dataValue = dataValue self.next = None class singleLinkedList: def __init__(self): self.headValue = None self.temp = None def insertLast(self, *elements): for data in elements: if self.headValue is None: self.headValue = Node(data) self.temp = self.headValue else: self.temp.next = Node(data) self.temp = self.temp.next self.temp.next = self.headValue pass def insertFirst(self, *elements): if self.headValue is not None: prevheadValue = self.headValue self.headValue = None else: prevheadValue = None for data in elements: if self.headValue is None: self.headValue = Node(data) self.temp = self.headValue else: self.temp.next = Node(data) self.temp = self.temp.next if prevheadValue is not None: self.temp.next = prevheadValue self.temp = self.temp.next while self.temp.next != prevheadValue: self.temp = self.temp.next self.temp.next = self.headValue def insertMiddle(self, arg1: "data", arg2: "position"): node = self.headValue for i in range(1,arg2-1): if node.next is None: return node = node.next prev = node.next node.next = Node(arg1) node = node.next node.next = prev while node.next != self.headValue: node = node.next node.next = self.headValue def delete(self, position: "Position to be deleted"): #[data|next] --> [data|next] --> [data|next] --> [data|next] # ^_______________^ node = self.headValue for i in range(position-2): node = node.next node.next = node.next.next while node.next != self.headValue: node = node.next node.next = self.headValue def display(self): printValue = self.headValue if printValue is None: print("list is empty") while printValue is not None: print (printValue.dataValue) printValue = printValue.next pass def hint(self): message="""" Create a node class to have two variables 1. Store data (datavalue) 2. Next data address in last it is usually null in circular (next) linked list Create another class to perform manipulation in list Insert First: *To insert first element we need to have the data to whether any data exist before if so then we have to store it safely * Storing the data in headval * Taking previous value to set next value of another node * It repeats until it reaches the previous head value * Setting the last value to head node Insert last: *To insert last element we need to have the data to whether any data exist before if so then we have to store it safely * It repeats until it reaches the head value is occurred * Setting the last node next value to head node Insert Middle: *To insert middle element we need to have the data to whether any data exist before if so then we have to store it safely * Taking previous value to set next value of another node * It repeats until it reaches the previous head value * Setting the last next value to head node Display: Display will take next value of node repeatedly so the list is infinite loop """ #creating object #list = singleLinkedList() #list.insertLast(50, 60,70) #list.display() ''' It shows the entered things at last output: ======= 50 60 70 50... ''' #list.insertFirst(10,20,30) #list.display() ''' It shows the entered things at first then remaining output: ======= 10 20 30 50 60 70 10... ''' #print(list.insertMiddle.__annotations__) #list.insertMiddle(40,4) #list.display() ''' It shows the inserted element at nth position output: ======= 10 20 30 40 50 60 70 10... ''' #list.delete(6) #list.display() ''' It shows the list after deleting it output: ======= 10 20 30 40 50 60 10... '''
4,517
1,275
# Generated by Django 2.2.14 on 2020-08-23 10:13 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('core', '0006_referral_amount'), ] operations = [ migrations.AddField( model_name='item', name='paystack_link', field=models.CharField(blank=True, max_length=80, null=True), ), ]
407
141
"""Decorators for auth module.""" from functools import wraps from src.protocol import make_response from src.database import session_scope from .models import Session def login_required(func): """Check that user is logged in based on the valid token exists in request.""" @wraps(func) def wrapper(request, *args, **kwargs): if 'token' not in request: return make_response(request, 401, 'Valid authentication credentials lack') with session_scope() as db_session: user_session = db_session.query(Session).filter_by(token=request.get('token')).first() if not user_session or user_session.closed: return make_response(request, 403, 'Access denied') return func(request, *args, **kwargs) return wrapper
798
218
# Name: # Date: # proj05: functions and lists # Part I def divisors(num): """ Takes a number and returns all divisors of the number, ordered least to greatest :param num: int :return: list (int) """ # Fill in the function and change the return statment. numlist = [] check = 1 while check <=num: divisor = num%check if divisor == 0: numlist.append(check) check = check + 1 else: check = check + 1 return numlist def prime(num): """ Takes a number and returns True if the number is prime, otherwise False :param num: int :return: bool """ # Fill in the function and change the return statement. if len(divisors(num)) == 2: return True return False # Part II: # REVIEW: Conditionals, for loops, lists, and functions # # INSTRUCTIONS: # # 1. Make the string "sentence_string" into a list called "sentence_list" sentence_list # should be a list of each letter in the string: ['H', 'e', 'l', 'l', 'o', ',', ' ', 'm', # 'y', ' ', 'n', 'a', 'm', 'e', ' ', 'i', 's', ' ', 'M', 'o', 'n', 't', 'y', ' ', 'P', # 'y', 't', 'h', 'o', 'n', '.'] # # Hint: Use a for loop and with an append function: list.append(letter) # # sentence_string = "Hello, my name is Monty Python." # sentencelist = [] # counter = 0 # for item in sentence_string: # letter = sentence_string[counter] # sentencelist.append(letter) # counter = counter + 1 # print sentencelist # 2. Print every item of sentence_list on a separate line using a for loop, like this: # H # e # l # l # o # , # # m # y # .... keeps going on from here. # 3: Write a for loop that goes through each letter in the list vowels. If the current # letter is 'b', print out the index of the current letter (should print out the # number 1). # vowels = ['a', 'b', 'i', 'o', 'u', 'y'] # counter = 0 # while counter <= len(vowels): # if vowels[counter] == "b": # break # else: # counter = counter + 1 # print counter # 4: use the index found to change the list vowels so that the b is replaced with an e. # for letter in vowels: # vowels[1]="e" # print vowels # 5: Loop through each letter in the sentence_string. For each letter, check to see if the # number is in the vowels list. If the letter is in the vowels list, add one to a # counter. Print out the counter at the end of the loop. This counter should show how # many vowels are in sentence_string. # counter = 0 # for letter in sentence_string: # if letter in vowels: # counter = counter + 1 # print counter # 6: Make a new function called "vowelFinder" that will return a list of the vowels # found in a list (no duplicates).The function's parameters should be "list" and "vowels." vowels = ['a', 'e', 'i', 'o', 'u', 'y'] def vowelFinder(list, vowels): counter = 0 letter = list[counter] vowellist = [] finalvowel= [] lastvowel=[] for letter in list: if letter in vowels: vowellist.append(letter) finalvowel.append(letter) counter = counter + 1 else: counter = counter + 1 for item in vowellist: if item in finalvowel and item not in lastvowel: lastvowel.append(item) lastvowel = sorted(lastvowel) return lastvowel sentence = ["H","e","l","l","o","h","o","w","a","r","e","y","o","u"] print vowelFinder(sentence, vowels) # Example: # vowelList = vowelFinder(sentence_list, vowels) # print vowelList # ['a', 'e', 'i', 'o', 'y'] # def vowelFinder(sentence_list, vowels): # return []
3,607
1,235
# Copyright 2015 Bloomberg Finance L.P. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. r""" ============== BQPlot Package ============== .. currentmodule:: bqplot Each plot starts with a `Figure` object. A `Figure` has a number of `Axis` objects (horizontal and vertical) and a number of `Mark` objects. Each `Mark` object is a visual representation of the data. Each `Axis` and `Mark` has a `Scale` object. The `Scale` objects transform data into a visual property (typically a location in pixel space, but could be a color, etc.). An `Axis` draws an axis associated with the scale. :: from bqplot import * from IPython.display import display x_data = range(10) y_data = [i ** 2 for i in x_data] x_sc = LinearScale() y_sc = LinearScale() ax_x = Axis(label='Test X', scale=x_sc, tick_format='0.0f') ax_y = Axis(label='Test Y', scale=y_sc, orientation='vertical', tick_format='0.2f') line = Lines(x=x_data, y=y_data, scales={'x':x_sc, 'y':y_sc}, colors=['red', 'yellow']) fig = Figure(axes=[ax_x, ax_y], marks=[line]) display(fig) .. automodule:: bqplot.figure .. automodule:: bqplot.scales .. automodule:: bqplot.marks .. automodule:: bqplot.axes .. automodule:: bqplot.market_map .. automodule:: bqplot.interacts .. automodule:: bqplot.traits .. automodule:: bqplot.map .. automodule:: bqplot.pyplot """ from .figure import * from .axes import * from .marks import * from .scales import * from .default_tooltip import *
2,034
674
''' Une case est definie par sa couleur, ses coordonnees et un acces a la grille pour recuperer ses voisins ''' class Case(): def __init__(self, x, y, couleur, grille): self._x = x self._y = y self._couleur = couleur self._grille = grille self.GREY = "grey" def getCouleur(self): return self._couleur def getCouleurOriginale(self): if self._couleur[-1] == "3": return self._couleur[:-1]+"2" return self._couleur def getX(self): return self._x def getY(self): return self._y def setX(self, x): self._x = x def setY(self, y): self._y = y def setCouleur(self, couleur): self._couleur = couleur def getNord(self): if self.getY() > 0: return self._grille[self._y-1][self._x] return None def getSud(self): if self.getY() < len(self._grille) - 1: return self._grille[self._y+1][self._x] return None def getEst(self): if self.getX() < len(self._grille) - 1: return self._grille[self._y][self._x+1] return None def getOuest(self): if self.getX() > 0: return self._grille[self._y][self._x-1] return None def getVoisins(self): return [self.getNord(), self.getSud(), self.getEst(), self.getOuest()] def getGrille(self): return self._grille def surbrillance(self): self._couleur = self._couleur[:-1] + "2" def couleurParDefaut(self): self._couleur = self._couleur[:-1] + "3" def detruire(self): self.setCouleur(self.GREY) def estDetruite(self): return self._couleur == self.GREY
1,915
700
#import Libraries import cv2 import sys import numpy as np from matplotlib import pyplot as plt import matplotlib.image as mpimg ################################################## ''' This example illustrates how to extract interesting key points as features from an image Usage: keypointsSIFTDescriptor.py [<image_name>] image argument defaults to fruits.jpg ''' #Read from input try: fn = sys.argv[1] except IndexError: fn = "img/home.jpg" ################################################## #Read image and plot it img_original = mpimg.imread(fn) img = mpimg.imread(fn) plt.subplot(121), plt.imshow(img) plt.title('Original Image'), plt.xticks([]), plt.yticks([]) #grayscale it gray= cv2.cvtColor(img,cv2.COLOR_BGR2GRAY) ################################################## #use SIFT descriptor for image key points feature extraction sift = cv2.xfeatures2d.SIFT_create() (kps, sift) = sift.detectAndCompute(gray, None) ################################################## #draw the keypoints img = cv2.drawKeypoints(gray,kps,None,None,flags=cv2.DRAW_MATCHES_FLAGS_DRAW_RICH_KEYPOINTS) plt.subplot(122), plt.imshow(img) plt.title('Image with extracted keypoints'), plt.xticks([]), plt.yticks([]) plt.show() ##################################################
1,280
408
import xml.etree.ElementTree as ET from .baseVmWareXmlResponse import BaseVmWareXmlResponse class GetHostInfoResponse(BaseVmWareXmlResponse): def __str__(self): return ('GetHostInfoResponse[vendor={} model={} vCPUs={} memory={}]').format( self.vendor, self.model, self.vCPUs, self.memory) def toDict(self): return dict(vendor=self.vendor, model=self.model, vCPUs=self.vCPUs, memory=self.memory) def __init__(self, response): data = ET.fromstring(response) innerData = self.getSubTreeByTree( data, ['Body', 'RetrievePropertiesExResponse', 'returnval', 'objects']) dataSet = self.findPropertySetValue(innerData,'summary.hardware',False) if dataSet is None: print(response) raise ValueError('no know response data found') self.vendor = self.getSubTree(dataSet,'vendor').text self.model = self.getSubTree(dataSet,'model').text self.vCPUs = int(self.getSubTree(dataSet,'numCpuThreads').text) self.memory = int(self.getSubTree(dataSet,'memorySize').text)
1,103
338
import sys import logging if sys.version_info[:2] <= (2, 6): logging.Logger.getChild = lambda self, suffix:\ self.manager.getLogger('.'.join((self.name, suffix)) if self.root is not self else suffix) import pytest from chatexchange.markdown_detector import markdown logger = logging.getLogger(__name__) def test_markdown(): assert markdown('no markdown here') is None assert markdown(' code formatting') is not None assert markdown('hello `code` here') is not None assert markdown('bare url https://example.com/link gets linked') is not None assert markdown('[hello](http://example.com/hello)') is not None assert markdown('adjacent[hello](http://example.com/hello)text') is not None assert markdown('adjacent.[hello](https://example.com/hello).x') is not None assert markdown('[ftp](ftp://example.com/link) works too') is not None assert markdown('text with *italics*') is not None assert markdown('and **bold** too') is not None assert markdown('*not italics') is None assert markdown('**not bold either') is None assert markdown('***not both neither too also as well') is None assert markdown('****not bold or italic') is None # Odd corner cases: many backticks assert markdown('two ``backticks`` code') is not None assert markdown('unpaired `single double`` fail') is None assert markdown('unpaired `single triple``` fail') is None # Weirdly, 'unpaired ``double triple```' gets rendered as # 'unpaired <code>double triple</code>`' #assert markdown('unpaired ``double triple``` fail') is not None assert markdown('``````````````````18 ticks``````````````````') is not None # Odd corner cases: broken links assert markdown( '[](http://example.com/link) gets linked inside parens') is not None assert markdown('[no link]() is not linked') is None assert markdown('[mailto is not linked](mailto:self@example.com)') is None assert markdown('[sftp](sftp://example.com/link) is not linked') is None assert markdown('[ftps](ftps://example.com/link) is not linked') is None assert markdown( '[https://example.com/no-link]() link in square brackets') is not None assert markdown( 'empty anchor, link in parens [](https://example.com/)') is not None # Odd corner cases: mixed bold and italics assert markdown('this is ***bold italics***') is not None assert markdown('this is **bold and *italics* too**') is not None assert markdown( 'this is *italics and **bold** and **more** too*') is not None # Odd corner cases: broken bold or italics assert markdown('**unpaired neither*') is None assert markdown('*unpaired nor**') is None assert markdown('***unpaired** in the end') is None # chat actually briefly formats as bold italics, then reverts #assert markdown('****this is weird****') is None
2,900
857
x_indexes = [i for i, j in enumerate(xaddr)] if j == myxaddr] y_indexes = [i for i, j in enumerate(yaddr)] if j == myyaddr] print('x_indexes: ' + str(x_indexes)) print('y_indexes:' +str(y_indexes)) # keep common indexes common = [i for i, j in zip(x_indexes, y_indexes) if i == j] print('common: ' + str(common))
313
127
import os from typing import Optional, List from fastapi import APIRouter, Request, Response, status, Depends from pyefriend_api.models.setting import Setting as SettingModel from pyefriend_api.app.auth import login_required from .schema import SettingOrm, SettingUpdate r = APIRouter(prefix='/setting', tags=['setting']) @r.get('/', response_model=List[SettingOrm]) async def get_settings(user=Depends(login_required)): """### 세팅 가능한 값 전부 조회 """ return [SettingOrm.from_orm(item) for item in SettingModel.list()] @r.post('/', status_code=status.HTTP_200_OK) async def initialize_settings(user=Depends(login_required)): """ ### 세팅값 초기화 - force: True일 경우 기존 값 초기화 """ SettingModel.initialize(first=False) return Response('Success', status_code=status.HTTP_200_OK) @r.get('/{section}/{key}', response_model=SettingOrm) async def get_a_setting(section: str, key: str, user=Depends(login_required)): """ ### 세팅값 조회 - section: setting 테이블 내 조회할 section - key: section 내 조회할 key """ return SettingOrm.from_orm(SettingModel.get(section=section, key=key)) @r.put('/{section}/{key}', status_code=status.HTTP_200_OK) async def change_setting(section: str, key: str, request: SettingUpdate, user=Depends(login_required)): """ ### 세팅값 수정 - section: setting 테이블 내 조회할 section - key: section 내 조회할 key """ SettingModel.update(section=section, key=key, value=request.value) return Response('Success', status_code=status.HTTP_200_OK)
1,651
601
"""Unit tests for util/multi_analysis.py""" import os import unittest from dsi.multi_analysis import MultiEvergreenAnalysis, main from test_lib.fixture_files import FixtureFiles from test_lib.test_requests_parent import TestRequestsParent FIXTURE_FILES = FixtureFiles() class TestMultiEvergreenAnalysis(TestRequestsParent): """ Test the MultiEvergreen client class. """ def test_parse_options(self): """MultiEvergreenAnalysis: parse options.""" expected = { "evergreen_config": FIXTURE_FILES.repo_root_file_path("config.yml"), "csv": True, "json": False, "json_array": False, "ycsbfix": False, "yml": False, "id": ["587773af3ff120ab9000946", "587773b03ff1220ab900094a"], } args = [ "587773af3ff120ab9000946", "587773b03ff1220ab900094a", "--evergreen-config", FIXTURE_FILES.repo_root_file_path("config.yml"), ] client = MultiEvergreenAnalysis(args) client.parse_options() self.assertEqual(client.config, expected) def test_parse_options2(self): """MultiEvergreenAnalysis: parse more advanced options.""" input_file = FIXTURE_FILES.fixture_file_path("multi_patch_builds.yml") expected_config = { "evergreen_config": FIXTURE_FILES.repo_root_file_path("config.yml"), "csv": False, "json": True, "json_array": False, "ycsbfix": False, "yml": False, "out": "outfile.json", "id": [], "continue": input_file, } args = [ "--json", "--out", "outfile.json", "--continue", input_file, "--evergreen-config", FIXTURE_FILES.repo_root_file_path("config.yml"), ] client = MultiEvergreenAnalysis(args) client.parse_options() self.assertEqual(client.config, expected_config) self.assertEqual(client.builds[1]["ID"], "5873a2623ff1224e8e0003ee") def test_aggregate_results(self): """MultiEvergreenAnalysis.aggregate_results()""" data = [ { "a_variant": { "a_task": { "data": { "results": [ { "name": "a_test", "results": { "32": { "ops_per_sec": 111.123, "ops_per_sec_values": [111.123, 123.111, 234.123], }, "64": { "ops_per_sec": 222.234, "ops_per_sec_values": [222.234, 333.123, 444.111], }, }, } ] } } } }, { "a_variant": { "a_task": { "data": { "results": [ { "name": "a_test", "results": { "32": { "ops_per_sec": 123, "ops_per_sec_values": [123.123, 234.234, 345.345], }, "64": { "ops_per_sec": 234, "ops_per_sec_values": [234.234, 345.345, 456.456], }, }, } ] } } } }, ] expected = { "a_variant": { "a_task": { "a_test": { 32: { "all_variance_to_mean": 44.10677573939485, "it_range_to_median": [0.999098374637522, 0.9487179487179488], "it_range_to_median_avg": 0.97390816167773542, "it_range_to_median_max": 0.999098374637522, "it_range_to_median_min": 0.9487179487179488, "it_max": [234.123, 345.345], "it_variance": [4599.396047999999, 12345.654321000002], "it_range": [122.99999999999999, 222.22200000000004], "all_min": 111.123, "all_median": 178.623, "it_median": [123.111, 234.234], "min": 111.123, "all_variance": 8608.6061151, "all_range_to_median": 1.3112645068104334, "max": 123, "all_range": 234.22200000000004, "variance": 70.53156449999994, "variance_to_mean": 0.6025171768685686, "it_min": [111.123, 123.123], "all_max": 345.345, "it_variance_to_mean": [29.46083467098815, 52.706500000000005], "average": 117.0615, "median": 117.0615, "ops_per_sec": [111.123, 123], "ops_per_sec_values": [ [111.123, 123.111, 234.123], [123.123, 234.234, 345.345], ], "range": 11.876999999999995, "it_average": [156.119, 234.234], "range_to_median": 0.10145948924283386, "all_average": 195.17650000000003, }, 64: { "all_variance_to_mean": 29.198995681067522, "it_range_to_median": [0.666051278356643, 0.6434782608695652], "it_range_to_median_avg": 0.65476476961310404, "it_range_to_median_max": 0.666051278356643, "it_range_to_median_min": 0.6434782608695652, "it_max": [444.111, 456.456], "it_variance": [12307.351598999998, 12345.654321000002], "it_range": [221.87699999999998, 222.222], "all_min": 222.234, "all_median": 339.23400000000004, "it_median": [333.123, 345.345], "min": 222.234, "all_variance": 9905.773884299999, "all_range_to_median": 0.6904437644811545, "max": 234, "all_range": 234.222, "variance": 69.21937799999989, "variance_to_mean": 0.30343805152619, "it_min": [222.234, 234.234], "all_max": 456.456, "it_variance_to_mean": [36.9417077855419, 35.74875652173913], "average": 228.11700000000002, "median": 228.11700000000002, "ops_per_sec": [222.234, 234], "ops_per_sec_values": [ [222.234, 333.123, 444.111], [234.234, 345.345, 456.456], ], "range": 11.765999999999991, "it_average": [333.156, 345.345], "range_to_median": 0.05157879509199222, "all_average": 339.25050000000005, }, } } } } client = MultiEvergreenAnalysis() client.results = data client.aggregate_results() self.assertEqual(client.agg_results, expected) def test_flatten(self): """MultiEvergreenAnalysis.flat_results()""" client = MultiEvergreenAnalysis() client.agg_results = { "a_variant": { "a_task": { "a_test": { 32: { "all_variance_to_mean": 44.10677573939485, "it_range_to_median": [0.999098374637522, 0.9487179487179488], "it_range_to_median_avg": 0.97390816167773542, "it_range_to_median_max": 0.999098374637522, "it_range_to_median_min": 0.9487179487179488, "it_max": [234.123, 345.345], "it_variance": [4599.396047999999, 12345.654321000002], "it_range": [122.99999999999999, 222.22200000000004], "all_min": 111.123, "all_median": 178.623, "it_median": [123.111, 234.234], "min": 111.123, "all_variance": 8608.6061151, "all_range_to_median": 1.3112645068104334, "max": 123, "all_range": 234.22200000000004, "variance": 70.53156449999994, "variance_to_mean": 0.6025171768685686, "it_min": [111.123, 123.123], "all_max": 345.345, "it_variance_to_mean": [29.46083467098815, 52.706500000000005], "average": 117.0615, "median": 117.0615, "ops_per_sec": [111.123, 123], "ops_per_sec_values": [ [111.123, 123.111, 234.123], [123.123, 234.234, 345.345], ], "range": 11.876999999999995, "it_average": [156.119, 234.234], "range_to_median": 0.10145948924283386, "all_average": 195.17650000000003, }, 64: { "all_variance_to_mean": 29.198995681067522, "it_range_to_median": [0.666051278356643, 0.6434782608695652], "it_range_to_median_avg": 0.65476476961310404, "it_range_to_median_max": 0.666051278356643, "it_range_to_median_min": 0.6434782608695652, "it_max": [444.111, 456.456], "it_variance": [12307.351598999998, 12345.654321000002], "it_range": [221.87699999999998, 222.222], "all_min": 222.234, "all_median": 339.23400000000004, "it_median": [333.123, 345.345], "min": 222.234, "all_variance": 9905.773884299999, "all_range_to_median": 0.6904437644811545, "max": 234, "all_range": 234.222, "variance": 69.21937799999989, "variance_to_mean": 0.30343805152619, "it_min": [222.234, 234.234], "all_max": 456.456, "it_variance_to_mean": [36.9417077855419, 35.74875652173913], "average": 228.11700000000002, "median": 228.11700000000002, "ops_per_sec": [222.234, 234], "ops_per_sec_values": [ [222.234, 333.123, 444.111], [234.234, 345.345, 456.456], ], "range": 11.765999999999991, "it_average": [333.156, 345.345], "range_to_median": 0.05157879509199222, "all_average": 339.25050000000005, }, } } } } expected = [ { "thread_level": 32, "variant_name": "a_variant", "task_name": "a_task", "test_name": "a_test", "added_label": "added_label", "all_variance_to_mean": 44.10677573939485, "it_range_to_median": [0.999098374637522, 0.9487179487179488], "it_range_to_median_avg": 0.97390816167773542, "it_range_to_median_max": 0.999098374637522, "it_range_to_median_min": 0.9487179487179488, "it_max": [234.123, 345.345], "it_variance": [4599.396047999999, 12345.654321000002], "it_range": [122.99999999999999, 222.22200000000004], "all_min": 111.123, "all_median": 178.623, "it_median": [123.111, 234.234], "min": 111.123, "all_variance": 8608.6061151, "all_range_to_median": 1.3112645068104334, "max": 123, "all_range": 234.22200000000004, "variance": 70.53156449999994, "variance_to_mean": 0.6025171768685686, "it_min": [111.123, 123.123], "all_max": 345.345, "it_variance_to_mean": [29.46083467098815, 52.706500000000005], "average": 117.0615, "median": 117.0615, "ops_per_sec": [111.123, 123], "ops_per_sec_values": [[111.123, 123.111, 234.123], [123.123, 234.234, 345.345]], "range": 11.876999999999995, "it_average": [156.119, 234.234], "range_to_median": 0.10145948924283386, "all_average": 195.17650000000003, }, { "thread_level": 64, "variant_name": "a_variant", "task_name": "a_task", "test_name": "a_test", "added_label": "added_label", "all_variance_to_mean": 29.198995681067522, "it_range_to_median": [0.666051278356643, 0.6434782608695652], "it_range_to_median_avg": 0.65476476961310404, "it_range_to_median_max": 0.666051278356643, "it_range_to_median_min": 0.6434782608695652, "it_max": [444.111, 456.456], "it_variance": [12307.351598999998, 12345.654321000002], "it_range": [221.87699999999998, 222.222], "all_min": 222.234, "all_median": 339.23400000000004, "it_median": [333.123, 345.345], "min": 222.234, "all_variance": 9905.773884299999, "all_range_to_median": 0.6904437644811545, "max": 234, "all_range": 234.222, "variance": 69.21937799999989, "variance_to_mean": 0.30343805152619, "it_min": [222.234, 234.234], "all_max": 456.456, "it_variance_to_mean": [36.9417077855419, 35.74875652173913], "average": 228.11700000000002, "median": 228.11700000000002, "ops_per_sec": [222.234, 234], "ops_per_sec_values": [[222.234, 333.123, 444.111], [234.234, 345.345, 456.456]], "range": 11.765999999999991, "it_average": [333.156, 345.345], "range_to_median": 0.05157879509199222, "all_average": 339.25050000000005, }, ] flat_results = client.flat_results({"added_label": "added_label"}) self.assertEqual(flat_results, expected) def test_ycsb_fix(self): """Test MultiEvergreenAnalysis._ycsb_fix()""" client = MultiEvergreenAnalysis() client.results = [ { "a_variant": { "a_task": { "build_id": "a_build_id", "create_time": "2017-04-05T20:14:53.193Z", "data": { "results": [ { "end": 1491482988, "name": "ycsb_load-wiredTiger", "results": {"32": {"ops_per_sec": 50915.97845235792}}, "start": 1491482887, "workload": "ycsb", }, { "end": 1491483185, "name": "ycsb_load-wiredTiger", "results": {"32": {"ops_per_sec": 50418.98173824482}}, "start": 1491483084, "workload": "ycsb", }, ] }, } } } ] client._ycsb_fix() print(client.results) expected_results = [ { "a_variant": { "a_task": { "build_id": "a_build_id", "create_time": "2017-04-05T20:14:53.193Z", "data": { "results": [ { "end": 1491482988, "name": "ycsb_load-wiredTiger", "results": { "32": { "ops_per_sec": 50667.480095301369, "ops_per_sec_values": [ 50915.97845235792, 50418.98173824482, ], } }, "start": 1491482887, "workload": "ycsb", } ] }, } } } ] self.assertEqual(client.results, expected_results) def test_main(self): """MultiEvergreenAnalysis: Fetch real Evergreen results and write output files.""" evergreen_config = FIXTURE_FILES.repo_root_file_path("config.yml") args = [ "--evergreen-config", evergreen_config, "--json", "--out", "test_outfile.json", "587773af3ff1220ab9000946", "587773b03ff1220ab900094a", ] main(args) # Intentionally not checking output files, just testing that we run without exceptions. os.remove("test_outfile.json") if __name__ == "__main__": unittest.main()
20,031
7,796
# -*- coding: utf-8 -*- # Generated by Django 1.9.6 on 2016-05-08 03:42 from __future__ import unicode_literals import django.core.validators from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): initial = True dependencies = [ ('pacientes', '0001_initial'), ] operations = [ migrations.CreateModel( name='MotivoConsulta', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('creado_el', models.DateTimeField(auto_now_add=True, verbose_name='Fecha de creación')), ('modificado_el', models.DateTimeField(auto_now=True, verbose_name='Fecha de modificación')), ('motivo_consulta_paciente', models.TextField(blank=True, default='', help_text='Signos y síntomas explicados por el paciente.', verbose_name='motivo según el paciente')), ('diagnostico_medico', models.TextField(help_text='Diagnóstico que elaboró el médico especialista.', verbose_name='diagnóstico médico')), ('evaluacion_kinesica', models.TextField(help_text='Evaluación elaborada por el kinesiólogo/a.', verbose_name='evaluación kinésica')), ('tratamientos_previos', models.TextField(blank=True, help_text='Descripción de tratamientos previos por el mismo motivo de consulta', verbose_name='tratamientos previos')), ('observaciones', models.TextField(blank=True, verbose_name='observaciones')), ('paciente', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, related_name='motivos_de_consulta', to='pacientes.Paciente', verbose_name='paciente')), ], options={ 'verbose_name': 'motivo de consulta', 'verbose_name_plural': 'motivos de consulta', }, ), migrations.CreateModel( name='Objetivo', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('creado_el', models.DateTimeField(auto_now_add=True, verbose_name='Fecha de creación')), ('modificado_el', models.DateTimeField(auto_now=True, verbose_name='Fecha de modificación')), ('descripcion', models.CharField(max_length=255, verbose_name='descripción')), ('fecha_inicio', models.DateField(null=True, verbose_name='fecha de inicio')), ('fecha_cumplido', models.DateField(null=True, verbose_name='fecha de éxito')), ('observaciones', models.TextField(blank=True, verbose_name='observaciones')), ('motivo_consulta', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, related_name='objetivos', to='tratamientos.MotivoConsulta', verbose_name='motivo de consulta')), ], options={ 'verbose_name': 'objectivo', 'verbose_name_plural': 'objetivos', }, ), migrations.CreateModel( name='Planificacion', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('creado_el', models.DateTimeField(auto_now_add=True, verbose_name='Fecha de creación')), ('modificado_el', models.DateTimeField(auto_now=True, verbose_name='Fecha de modificación')), ('fecha_ingreso', models.DateField(auto_now_add=True, verbose_name='fecha de ingreso')), ('fecha_alta', models.DateField(blank=True, help_text='fecha de alta tentativa.', null=True, verbose_name='fecha de alta')), ('cantidad_sesiones', models.IntegerField(default=10, help_text='Cantidad de sesiones necesarias recetadas por el médico.', verbose_name='cantidad de sesiones')), ('frecuencia', models.PositiveIntegerField(default=1, validators=[django.core.validators.MinValueValidator(1), django.core.validators.MaxValueValidator(7)], verbose_name='frecuencia semanal')), ('estado', models.IntegerField(choices=[(1, 'Planificado'), (2, 'En curso'), (3, 'Finalizado'), (4, 'Cancelado')], default=1, verbose_name='estado')), ('comentarios', models.TextField(blank=True, null=True, verbose_name='comentarios')), ('conclusion', models.TextField(blank=True, null=True, verbose_name='conclusión')), ('motivo_consulta', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, related_name='planificaciones', to='tratamientos.MotivoConsulta')), ], options={ 'verbose_name': 'planificación', 'verbose_name_plural': 'planificaciones', }, ), migrations.CreateModel( name='Sesion', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('creado_el', models.DateTimeField(auto_now_add=True, verbose_name='Fecha de creación')), ('modificado_el', models.DateTimeField(auto_now=True, verbose_name='Fecha de modificación')), ('fecha', models.DateField(verbose_name='fecha')), ('duracion', models.PositiveSmallIntegerField(default=60, help_text='Duración de la sesión en minutos', verbose_name='duración de la sesión')), ('estado_paciente', models.TextField(blank=True, help_text='Descripción de cómo se siente el paciente antes de la sesión', null=True, verbose_name='estado de paciente')), ('actividad', models.TextField(blank=True, null=True, verbose_name='actividades de la sesión')), ('comentarios', models.TextField(blank=True, null=True, verbose_name='comentarios')), ('motivo_consulta', models.ForeignKey(null=True, on_delete=django.db.models.deletion.CASCADE, related_name='sesiones', to='tratamientos.MotivoConsulta')), ('paciente', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, related_name='sesiones_paciente', to='pacientes.Paciente')), ], options={ 'verbose_name': 'sesión', 'verbose_name_plural': 'sesiones', }, ), ]
6,356
1,891
from typing import Any, List, Dict RAW_INFO: Dict[str, List[Dict[str, Any]]] = { "streams": [ { "index": 0, "codec_name": "h264", "codec_long_name": "H.264 / AVC / MPEG-4 AVC / MPEG-4 part 10", "profile": "High", "codec_type": "video", "codec_time_base": "1001/48000", "codec_tag_string": "avc1", "codec_tag": "0x31637661", "width": 1920, "height": 800, "coded_width": 1920, "coded_height": 800, "has_b_frames": 2, "sample_aspect_ratio": "1:1", "display_aspect_ratio": "12:5", "pix_fmt": "yuv420p", "level": 41, "chroma_location": "left", "refs": 1, "is_avc": "true", "nal_length_size": "4", "r_frame_rate": "24000/1001", "avg_frame_rate": "24000/1001", "time_base": "1/24000", "start_pts": 0, "start_time": "0.000000", "duration_ts": 168240072, "duration": "7010.003000", "bit_rate": "2150207", "bits_per_raw_sample": "8", "nb_frames": "168072", "disposition": { "default": 1, "dub": 0, "original": 0, "comment": 0, "lyrics": 0, "karaoke": 0, "forced": 0, "hearing_impaired": 0, "visual_impaired": 0, "clean_effects": 0, "attached_pic": 0, "timed_thumbnails": 0, }, "tags": {"language": "und", "handler_name": "VideoHandler"}, }, { "index": 1, "codec_name": "aac", "codec_long_name": "AAC (Advanced Audio Coding)", "profile": "LC", "codec_type": "audio", "codec_time_base": "1/48000", "codec_tag_string": "mp4a", "codec_tag": "0x6134706d", "sample_fmt": "fltp", "sample_rate": "48000", "channels": 2, "channel_layout": "stereo", "bits_per_sample": 0, "r_frame_rate": "0/0", "avg_frame_rate": "0/0", "time_base": "1/48000", "start_pts": 0, "start_time": "0.000000", "duration_ts": 336480768, "duration": "7010.016000", "bit_rate": "143882", "max_bit_rate": "143882", "nb_frames": "328597", "disposition": { "default": 1, "dub": 0, "original": 0, "comment": 0, "lyrics": 0, "karaoke": 0, "forced": 0, "hearing_impaired": 0, "visual_impaired": 0, "clean_effects": 0, "attached_pic": 0, "timed_thumbnails": 0, }, "tags": {"language": "und", "handler_name": "SoundHandler"}, }, ] } TORRENTS: List[Dict[str, Any]] = [ { "added_on": 1612534456, "amount_left": 0, "auto_tmm": False, "availability": -1, "category": "1", "completed": 1227921990, "completion_on": 1612542927, "content_path": "/home/user/Downloads/2021-01-11-raspios-buster-armhf.zip", "dl_limit": -1, "dlspeed": 0, "downloaded": 1243692499, "downloaded_session": 0, "eta": 8640000, "f_l_piece_prio": False, "force_start": False, "hash": "9005f3068fff382eca98cdd6380f08599319520f", "last_activity": 0, "magnet_uri": "magnet:?xt=urn:btih:9005f3068fff382eca98cdd6380f08599319520f&dn=2021-01-11-raspios-buster-armhf.zip&tr=http%3a%2f%2ftracker.raspberrypi.org%3a6969%2fannounce", "max_ratio": -1, "max_seeding_time": -1, "name": "2021-01-11-raspios-buster-armhf.zip", "num_complete": 0, "num_incomplete": 615, "num_leechs": 0, "num_seeds": 0, "priority": 0, "progress": 1, "ratio": 6.351007187348165e-05, "ratio_limit": -2, "save_path": "/home/user/Downloads/", "seeding_time_limit": -2, "seen_complete": -3600, "seq_dl": False, "size": 1227921990, "state": "pausedUP", "super_seeding": False, "tags": "", "time_active": 14334, "total_size": 1227921990, "tracker": "", "trackers_count": 1, "up_limit": -1, "uploaded": 78987, "uploaded_session": 0, "upspeed": 0, }, { "added_on": 1612746101, "amount_left": 1741422592, "auto_tmm": False, "availability": 0, "category": "2", "completed": 0, "completion_on": -3600, "content_path": "/home/user/Downloads/xubuntu-20.04.2-desktop-amd64.iso", "dl_limit": -1, "dlspeed": 0, "downloaded": 0, "downloaded_session": 0, "eta": 8640000, "f_l_piece_prio": False, "force_start": False, "hash": "5d6bf814125b1660f29a6841dbb5f6e277eb02cc", "last_activity": 1612746105, "magnet_uri": "magnet:?xt=urn:btih:5d6bf814125b1660f29a6841dbb5f6e277eb02cc&dn=xubuntu-20.04.2-desktop-amd64.iso&tr=https%3a%2f%2ftorrent.ubuntu.com%2fannounce", "max_ratio": -1, "max_seeding_time": -1, "name": "xubuntu-20.04.2-desktop-amd64.iso", "num_complete": 0, "num_incomplete": 0, "num_leechs": 0, "num_seeds": 0, "priority": 4, "progress": 0, "ratio": 0, "ratio_limit": -2, "save_path": "/home/user/Downloads/", "seeding_time_limit": -2, "seen_complete": -3600, "seq_dl": False, "size": 1741422592, "state": "stalledDL", "super_seeding": False, "tags": "", "time_active": 0, "total_size": 1741422592, "tracker": "", "trackers_count": 1, "up_limit": -1, "uploaded": 0, "uploaded_session": 0, "upspeed": 0, }, ] MOVIEDB: Dict[str, Any] = { "movie_results": [ { "genre_ids": [18], "original_language": "en", "original_title": "12 Angry Men", "poster_path": "/wh0f80G6GZvYBNiYmvqFngt3IYq.jpg", "video": False, "vote_average": 8.5, "overview": "The defense and the prosecution have rested and the jury is filing into the jury room to decide if a young Spanish-American is guilty or innocent of murdering his father. What begins as an open and shut case soon becomes a mini-drama of each of the jurors' prejudices and preconceptions about the trial, the accused, and each other.", "release_date": "1957-04-10", "vote_count": 5322, "title": "12 Angry Men", "adult": False, "backdrop_path": "/qqHQsStV6exghCM7zbObuYBiYxw.jpg", "id": 389, "popularity": 20.461, } ], "person_results": [], "tv_results": [], "tv_episode_results": [], "tv_season_results": [], }
7,308
2,955
from simulator import PolychromaticField, cf, mm F = PolychromaticField( spectrum=1.5 * cf.illuminant_d65, extent_x=12.0 * mm, extent_y=12.0 * mm, Nx=1200, Ny=1200, ) F.add_aperture_from_image( "./apertures/circular_rings.jpg", pad=(9 * mm, 9 * mm), Nx=1500, Ny=1500 ) rgb = F.compute_colors_at(z=1.5) F.plot(rgb, xlim=[-8, 8], ylim=[-8, 8])
368
191
from items import vehicles, _xml from gui.Scaleform.daapi.view.lobby.trainings.training_room import TrainingRoom; from helpers.statistics import StatisticsCollector; from game import init import ScoreViewTools def exportAll(): ScoreViewTools.Export.init() ScoreViewTools.Export.cleanup() ScoreViewTools.Export.gameInfo() ScoreViewTools.Export.vehicles() #ScoreViewTools.Export.gameData() #ScoreViewTools.Export.equipment() #ScoreViewTools.Export.consumables() ScoreViewTools.Export.maps() #ScoreViewTools.Export.serverSettings() old_noteHangarLoadingState = StatisticsCollector.noteHangarLoadingState def new_noteHangarLoadingState(self, state, initialState=False, showSummaryNow=False): old_noteHangarLoadingState(self, state, initialState, showSummaryNow) StatisticsCollector.noteHangarLoadingState = new_noteHangarLoadingState print dir(TrainingRoom) old_onSettingUpdated = TrainingRoom.onSettingUpdated old_onRostersChanged = TrainingRoom.onRostersChanged old_onPlayerStateChanged = TrainingRoom.onPlayerStateChanged old__TrainingRoomBase__showSettings = TrainingRoom._TrainingRoomBase__showSettings old_showRosters = TrainingRoom._showRosters first = True def new_onSettingUpdated(self, functional, settingName, settingValue): ScoreViewTools.Export.trainingRoomSettings(functional) old_onSettingUpdated(self, functional, settingName, settingValue) def new_onRostersChanged(self, functional, rosters, full): ScoreViewTools.Export.trainingRoomRoster(functional) old_onRostersChanged(self, functional, rosters, full) def new_onPlayerStateChanged(self, functional, roster, accountInfo): ScoreViewTools.Export.trainingRoomRoster(functional) old_onPlayerStateChanged(self, functional, roster, accountInfo) def new__TrainingRoomBase__showSettings(self, functional): ScoreViewTools.Export.trainingRoomSettings(functional) old__TrainingRoomBase__showSettings(self, functional) def new_showRosters(self, functional, rosters): global first if first: first = False exportAll() ScoreViewTools.Export.trainingRoomRoster(functional) old_showRosters(self, functional, rosters) TrainingRoom.onSettingUpdated = new_onSettingUpdated TrainingRoom.onRostersChanged = new_onRostersChanged TrainingRoom.onPlayerStateChanged = new_onPlayerStateChanged TrainingRoom._TrainingRoomBase__showSettings = new__TrainingRoomBase__showSettings TrainingRoom._showRosters = new_showRosters
2,581
754
import random def mergeSort(numbers): if len(numbers) <= 1: return numbers left = numbers[:len(numbers)//2] right = numbers[len(numbers)//2:] left = mergeSort(left) right = mergeSort(right) numbers = merge(left, right, numbers) return numbers def merge(left, right, numbers): i = 0 j = 0 k = 0 while i < len(left) and j < len(right): if left[i] <= right[j]: numbers[k] = left[i] i += 1 else: numbers[k] = right[j] j += 1 k +=1 # process any leftovers while i < len(left): numbers[k] = left[i] i += 1 k +=1 while j < len(right): numbers[k] = right[j] j += 1 k +=1 return numbers numbers = [] for i in range(0, 100): numbers.append(random.randint(1, 100)) numbers = mergeSort(numbers) print(numbers)
897
315
from utilsw2 import * from Reader import * from Adapted_voc_evaluation import * import glob path_to_video = 'datasets/AICity_data/train/S03/c010/vdo.avi' path_to_frames = 'datasets/frames/' results_path = 'Results/Task1_1' def task4(color_space=cv2.COLOR_BGR2GRAY, mu_file = f"W2/task1_1/mu.pkl",sigma_file= f"W2/task1_1/sigma.pkl"): video_n_frames = len(glob.glob1(path_to_frames, "*.jpg")) mu, sigma = GetGaussianModel(path_to_frames, video_n_frames,color_space,mu_file,sigma_file) lowLimit = int(video_n_frames * 0.25) highLimit = int(video_n_frames) det_bb = remove_background(mu, sigma, 6, path_to_frames, lowLimit, highLimit, animation=True, color_space=color_space) reader = AICityChallengeAnnotationReader(path='datasets/AICity_data/train/S03/c010/gt/gt.txt',initFrame=int(video_n_frames * 0.25), finalFrame=int(video_n_frames)) gt = reader.get_annotations(classes=['car'], only_not_parked=True) bb_gt = [] # for frame in gt.keys(): for frame in range(int(video_n_frames * 0.25), int(video_n_frames)): annotations = gt.get(frame, []) bb_gt.append(annotations) ap, prec, rec = mean_average_precision(bb_gt , det_bb) print (ap) if __name__ == '__main__': colors = [cv2.COLOR_BGR2HSV, cv2.COLOR_BGR2RGB, cv2.COLOR_BGR2YCrCb, cv2.COLOR_BGR2LAB] for c in colors: task4(c,f"W2/task4_1/mu{str(c)}.pkl",f"W2/task4_1/sigma{str(c)}.pkl")
1,586
626
# Copyright 2021 Sai Sampath Kumar Balivada # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ file handler reads and writes datastore entries to and from the disk. file paths are case sensitive. """ import os.path import datetime from pathlib import Path from dictstore.exceptions import InvalidFileExtension def generate_file_header_string() -> str: """Generates file header string for the data file""" header = '// Python Dictstore File\n' date_string = str(datetime.datetime.now()) header += '// Last Rewrite: ' + date_string + '\n' return header class FileHandler: """ handles the dictstore datastore file(s) """ def __has_valid_file_extension(self): """Checks if the given file path ends with .dictstore""" if self.file_path.endswith('.dictstore'): return True return False def __init__(self, file_path) -> None: """ creates a file handler for the datastore file. Exceptions: OSError InvalidFileExtension """ # store the given file path self.file_path = file_path # check if the filename is valid if not self.__has_valid_file_extension(): raise InvalidFileExtension() # check if file exists at path # and create a datastore file if it doesn't exist if not os.path.exists(self.file_path): Path(os.path.dirname(self.file_path)).mkdir( parents=True, exist_ok=True ) with open(self.file_path, 'w', encoding='utf-8') as data_file: data_file.write(generate_file_header_string()) # open the file and read its contents with open(self.file_path, 'r', encoding='utf-8') as data_file: self.file_contents = data_file.read() def rewrite_to_file(self, lines) -> None: """Writes the given lines to data file""" with open(self.file_path, 'w', encoding='utf-8') as data_file: data_file.write(generate_file_header_string()) data_file.writelines(lines) def append_to_file(self, string: str) -> None: """Appends the given string to data file""" with open(self.file_path, 'a', encoding='utf-8') as data_file: data_file.write(string) def read_from_file(self) -> str: """ Reads the contents of data file and returns all the contents of file without the first two lines """ with open(self.file_path, 'r', encoding='utf-8') as data_file: data_file.readline() data_file.readline() return data_file.readlines()
3,207
909
# -*- coding: utf-8 -*- # Copyright 2019 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests action mapper""" import unittest from o2a.converter.relation import Relation from o2a.converter.task import Task from o2a.mappers.action_mapper import ActionMapper TEST_MAPPER_NAME = "mapper_name" TEST_DAG_NAME = "dag_name" class TestActionMapper(unittest.TestCase): def test_prepend_task_no_tasks(self): task_1 = Task(task_id=TEST_MAPPER_NAME + "_1", template_name="pig.tpl") with self.assertRaises(IndexError): ActionMapper.prepend_task(task_to_prepend=task_1, tasks=[], relations=[]) def test_prepend_task_empty_relations(self): task_1 = Task(task_id=TEST_MAPPER_NAME + "_1", template_name="pig.tpl") task_2 = Task(task_id=TEST_MAPPER_NAME + "_2", template_name="pig.tpl") tasks, relations = ActionMapper.prepend_task(task_to_prepend=task_1, tasks=[task_2], relations=[]) self.assertEqual([task_1, task_2], tasks) self.assertEqual([Relation(from_task_id="mapper_name_1", to_task_id="mapper_name_2")], relations) def test_prepend_task_some_relations(self): task_1 = Task(task_id=TEST_MAPPER_NAME + "_1", template_name="pig.tpl") task_2 = Task(task_id=TEST_MAPPER_NAME + "_2", template_name="pig.tpl") task_3 = Task(task_id=TEST_MAPPER_NAME + "_3", template_name="pig.tpl") tasks, relations = ActionMapper.prepend_task( task_to_prepend=task_1, tasks=[task_2, task_3], relations=[Relation(from_task_id="mapper_name_2", to_task_id="mapper_name_3")], ) self.assertEqual([task_1, task_2, task_3], tasks) self.assertEqual( [ Relation(from_task_id="mapper_name_1", to_task_id="mapper_name_2"), Relation(from_task_id="mapper_name_2", to_task_id="mapper_name_3"), ], relations, )
2,432
832
def euclidean_gcd(first, second): """ Calculates GCD of two numbers using the division-based Euclidean Algorithm :param first: First number :param second: Second number """ while(second): first, second = second, first % second return first def euclidean_gcd_recursive(first, second): """ Calculates GCD of two numbers using the recursive Euclidean Algorithm :param first: First number :param second: Second number """ if not second: return first return euclidean_gcd_recursive(second, first % second) def main(): first, second = map(int, input('Enter 2 integers: ').split()) print('Division-based: GCD of {} and {} is: {}'.format(first, second, euclidean_gcd( first, second))) print('Recursive: GCD of {} and {} is: {}'.format(first, second, euclidean_gcd_recursive( first, second))) if __name__ == '__main__': main()
1,265
304
""" Distances metrics based on the covariance matrix (mostly in the context of merging and compress)""" import torch import numpy as np import torch.nn.functional as F np.random.seed(0) def cov(m, y=None): """computes covariance of m""" if y is not None: m = torch.cat((m, y), dim=0) m_exp = torch.mean(m, dim=1) x = m - m_exp[:, None] cov = 1 / (x.size(1) - 1) * x.mm(x.t()) return cov def cov_norm(m, y): """computes similarity of x, y covariance matrices""" m = (m - m.mean(dim=0)) / m.std(dim=0) y = (y - y.mean(dim=0)) / y.std(dim=0) # print(m.size()) # print(y.size()) m = cov(m) y = cov(y) return torch.norm(m) - torch.norm(y) def get_svd(m, y): m = (m - m.mean(dim=0)) / m.std(dim=0) y = (y - y.mean(dim=0)) / y.std(dim=0) u1, s1, v1 = torch.svd(m) u2, s2, v2 = torch.svd(y) return s1, s2 def cov_eig(m, y, k=None): """computes similarity of x, y covariance matrices""" s1, s2 = get_svd(m, y) d = (s1 - s2) if k is None else (s1[:k] - s2[:k]) d = d.sum().abs() return d def cov_eig_kl(m, y, k=None): """computes similarity of x, y covariance matrices""" s1, s2 = get_svd(m, y) if k is not None: s1, s2 = s1[:k] - s2[:k] d = F.kl_div(F.softmax(s1) - F.softmax(s2)) return d def cov_kl(m, y, k=None): """computes similarity of x, y covariance matrices""" m_p = F.softmax(m.flatten()) y_p = F.softmax(y.flatten()) d = F.kl_div(m_p, y_p) return d if __name__ == "__main__": x = torch.randn((100, 20)) y = torch.randn((100, 50)) print(cov_norm(x, y))
1,627
750
import tensorflow as tf import tensorflow_hub as hub import numpy as np class TFHubContext: def __init__(self, url="https://tfhub.dev/google/universal-sentence-encoder-large/3") -> None: super().__init__() print('Initialize graph:') # Create graph and finalize (finalizing optional but recommended). self.g = tf.Graph() with self.g.as_default(): # We will be feeding 1D tensors of text into the graph. self.text_input = tf.placeholder(dtype=tf.string, shape=[None]) self.embed = hub.Module(url) self.embedded_text = self.get_embedded_text() self.init_op = tf.group([tf.global_variables_initializer(), tf.tables_initializer()]) self.g.finalize() def get_embedded_text(self): return self.embed(self.text_input) def get_embedding(self, texts): # Reduce logging output. # tf.logging.set_verbosity(tf.logging.ERROR) with tf.Session(graph=self.g) as session: session.run(self.init_op) texts_embeddings = session.run(self.embedded_text, feed_dict={self.text_input: texts}) # for i, message_embedding in enumerate(np.array(texts_embeddings).tolist()): # print("Message: {}".format(texts[i])) # print("Embedding size: {}".format(len(message_embedding))) # message_embedding_snippet = ", ".join( # (str(x) for x in message_embedding[:3])) # print("Embedding: [{}, ...]\n".format(message_embedding_snippet)) return texts_embeddings def close(self): print('TFHubContext closed') class ElmoTFHubContext(TFHubContext): def __init__(self, url="https://tfhub.dev/google/elmo/2", type='elmo') -> None: super().__init__(url) self.type = type def get_embedded_text(self): return self.embed(self.text_input, signature='default', as_dict=True) def get_embedding(self, texts): # Reduce logging output. # tf.logging.set_verbosity(tf.logging.ERROR) with tf.Session(graph=self.g) as session: session.run(self.init_op) texts_embeddings = session.run(self.embedded_text, feed_dict={self.text_input: texts})[self.type] # for i, message_embedding in enumerate(np.array(texts_embeddings).tolist()): # print("Message: {}".format(texts[i])) # print("Embedding size: {}".format(len(message_embedding))) # message_embedding_snippet = ", ".join( # (str(x) for x in message_embedding[:3])) # print("Embedding: [{}, ...]\n".format(message_embedding_snippet)) return texts_embeddings def get_use_embedding(texts): use_embed = hub.Module("https://tfhub.dev/google/universal-sentence-encoder-large/3") # Reduce logging output. # tf.logging.set_verbosity(tf.logging.ERROR) with tf.Session() as session: session.run([tf.global_variables_initializer(), tf.tables_initializer()]) texts_embeddings = session.run(use_embed(texts)) for i, message_embedding in enumerate(np.array(texts_embeddings).tolist()): print("Message: {}".format(texts[i])) print("Embedding size: {}".format(len(message_embedding))) message_embedding_snippet = ", ".join( (str(x) for x in message_embedding[:3])) print("Embedding: [{}, ...]\n".format(message_embedding_snippet)) return texts_embeddings if __name__ == '__main__': emb = ElmoTFHubContext(type='default') tt = emb.get_embedding(['This is a sentence.', 'This is another sentence.']) print(tt.shape)
3,415
1,170
from __future__ import unicode_literals from netmiko.endace.endace_ssh import EndaceSSH __all__ = ['EndaceSSH']
117
46
# -*- coding: utf-8 -*- # pylint: disable=wildcard-import,redefined-builtin,unused-wildcard-import from __future__ import absolute_import, division, print_function from builtins import * # pylint: enable=wildcard-import,redefined-builtin,unused-wildcard-import from genemap.mappers import get_mappers def main(args): """Main function.""" mapper = args.mapper.from_args(args) mapped = mapper.map_ids(args.ids) print(' '.join(mapped)) def configure_subparser(subparser): """Configures subparser for subcommand.""" parser = subparser.add_parser('map_ids') parser.set_defaults(main=main) mapper_subparser = parser.add_subparsers(dest='mapper') mapper_subparser.required = True mappers = get_mappers(with_command_line=True).items() for name, class_ in mappers: mapper_parser = mapper_subparser.add_parser(name) class_.configure_parser(mapper_parser) mapper_parser.add_argument('ids', nargs='+') mapper_parser.set_defaults(mapper=class_)
1,020
351
import gzip import random import subprocess import sys def get_acceptors(filename): accs = [] with gzip.open(filename, 'rt') as fp: for line in fp.readlines(): (exon1, intron, exon2, expression, gene) = line.split() s1 = intron[-22:-2] s2 = intron[-2:] s3 = exon2[0:20] accs.append((s1, s2, s3, expression)) random.shuffle(accs) return accs def get_donors(filename): dons = [] with gzip.open(filename, 'rt') as fp: for line in fp.readlines(): (exon1, intron, exon2, expression, gene) = line.split() s1 = exon1[-20:] s2 = intron[0:2] s3 = intron[2:22] dons.append((s1, s2, s3, expression)) return dons def write_fasta(filename, name, seqs): with open(filename, 'w') as fp: n = 1 for s1, s2, s3, x in seqs: fp.write(f'>{name}-{n} {x}\n') fp.write(f'{s1}{s2}{s3}\n') n += 1 def randomseq(size, contents='ACGT'): seq = '' for i in range(size): seq += random.choice(contents) return seq def make_negative1(seqs): neg = [] for i in range(len(seqs)): s1 = randomseq(20) s2 = seqs[0][1] # either GT or AG s3 = randomseq(20) x = 0 neg.append((s1, s2, s3, x)) return neg def make_negative2(seqs): s1seq = '' # composition of part 1 s3seq = '' # composition of part 2 for s1, s2, s3, x in seqs: s1seq += s1 s3seq += s3 neg = [] for i in range(len(seqs)): s1 = randomseq(20, s1seq) s2 = seqs[0][1] # either GT or AG s3 = randomseq(20, s3seq) x = 0 neg.append((s1, s2, s3, x)) return neg def make_negative3(seqs): col1 = [[] for i in range(20)] col3 = [[] for i in range(20)] for s1, s2, s3, x in seqs: for i in range(20): col1[i].append(s1[i]) col3[i].append(s3[i]) neg = [] for i in range(len(seqs)): s1 = '' s3 = '' for j in range(20): s1 += random.choice(col1[j]) s3 += random.choice(col3[j]) s2 = seqs[0][1] # either GT or AG x = 0 neg.append((s1, s2, s3, x)) return neg def make_negative4(seqs): comp = str.maketrans('ACGTRYMKWSBDHV', 'TGCAYRKMWSVHDB') neg = [] with gzip.open(filename, 'rt') as fp: for line in fp.readlines(): (exon1, intron, exon2, expression, gene) = line.split() seq = exon1 + intron + exon2 anti = seq.translate(comp)[::-1] for i in range(20, len(seq) -20): if anti[i:i+2] == 'GT': pass # this is actually completed elsewhere and not checked in... ############# # 42 nt set # 20 nt upstream and downstream of canonical GT|AG ############# genomes = ('at', 'ce', 'dm') for gen in genomes: # observed eie = f'eie.{gen}.txt.gz' dons = get_donors(eie) accs = get_acceptors(eie) write_fasta(f'splice42/{gen}.don.fa', 'don', dons) write_fasta(f'splice42/{gen}.acc.fa', 'acc', accs) # negative 1 - totally random nd = make_negative1(dons) na = make_negative1(accs) write_fasta(f'splice42/{gen}.n1don.fa', 'n1don', nd) write_fasta(f'splice42/{gen}.n1acc.fa', 'n1acc', na) # negative 2 - compositional but not positional nd = make_negative2(dons) na = make_negative2(accs) write_fasta(f'splice42/{gen}.n2don.fa', 'n2don', nd) write_fasta(f'splice42/{gen}.n2acc.fa', 'n2acc', na) # negative 3 - compositional and positional nd = make_negative3(dons) na = make_negative3(accs) write_fasta(f'splice42/{gen}.n3don.fa', 'n3don', nd) write_fasta(f'splice42/{gen}.n3acc.fa', 'n3acc', na) write_fasta(f'data42/{gen}.n3don.fa', 'n3don', nd) write_fasta(f'data42/{gen}.n3acc.fa', 'n3acc', na) # negative 4 - sequences from the opposite strand nd, na = make_negative4(eie)
3,463
1,660
from sklearn.cluster import KMeans import pandas as pd import numpy as np import seaborn as sns import matplotlib.pyplot as plt def get_columns(db, col1, col2): inputs = db[[col1, col2]] coords = inputs.as_matrix(columns=None) return np.array(coords) def plot_colored_graph(inputs, kmeans_result): x = inputs.transpose() df = pd.DataFrame(dict( crime=x[0], dias_para_completar=x[1], color=x[0] )) sns.lmplot('crime', 'dias_para_completar', data=df, hue='color', fit_reg=False) plt.title('Tempo para finalizar um crime') clusterX = [row[0] for row in kmeans_result] clusterY = [row[1] for row in kmeans_result] plt.plot(clusterX, clusterY, 'rs') plt.show() def find_elbow(inputs, max_k): distorsions = [] for k in max_k: kmeans = KMeans(n_clusters=k) kmeans.fit(inputs) distorsions.append(kmeans.inertia_) plt.plot(max_k, distorsions) plt.title('Elbow curve') def main(): # Load dataset crimes_db = pd.read_csv('base/result_min.csv') inputs = get_columns(crimes_db, 'description', 'clearance_days') # find best k find_elbow(inputs, range(2, 20)) # run k-means kmeans = KMeans(n_clusters=8, random_state=0).fit(inputs) print(kmeans.cluster_centers_) plot_colored_graph(inputs, kmeans.cluster_centers_) main()
1,300
528
# Generated by Django 2.1.4 on 2018-12-12 16:51 from django.db import migrations, models class Migration(migrations.Migration): initial = True dependencies = [ ] operations = [ migrations.CreateModel( name='Test', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('age', models.IntegerField(blank=True, null=True)), ('date', models.DateField(blank=True, null=True)), ('name', models.CharField(blank=True, max_length=100)), ('title', models.CharField(blank=True, max_length=100)), ('permissions', models.CharField(blank=True, max_length=20)), ], ), ]
783
235
import os import pandas import time from datetime import datetime, timedelta from collections import defaultdict from copy import deepcopy from googleapiclient.discovery import build """ All functions that are used for querying, processing, and saving the data are located here. """ VALID_PERIOD_LENGTHS = ["day", "week", "month"] class SearchSampler(object): """ TrendsSampler contains all functions required to sample the Google Health API :param api_key: The API key you received from Google :param search_name: A suffix for your output file. It will be placed in the `{output_path}/{region}`\ folder with the filename `{region}-{search_name}.csv`. :param search_params: A dictionary containing parameters. Must contain keys with:\ `search_term, region, period_start, period_end, period_length`\ Example: {\ "region": "US-DC",\ "search_term": "test",\ "period_start": "2017-01-01",\ "period_end": "2017-01-31",\ "period_length": "week"\ }\ The `search_term` can be a single string, or a list of strings. It can also include Boolean logic.\ See the report methodology for more details. The `region` can be a country, state, or DMA.\ States are formatted like `US-CA`, DMAs are a 3-digit code (see Nielsen for info).\ The `period_start` and `period_end` parameters need to be in the format `YYYY-MM-DD`.\ The `period_length` can be "day", "week", or "month" - but we have only tested this extensively\ with week. :param server: The endpoint to which requests will be made (default is "https://www.googleapis.com") :param version: The API version to use (default is `v1beta`) :param output_path: The path to the folder where query results will be saved (folder will be created\ if it doesn't already exist.) :Example: >>> params = { 'search_term': ['cough', 'sneeze', 'fever'], 'region': 'US-DC', 'period_start': '2017-01-01', 'period_end': '2017-02-01', 'period_length': 'week' } >>> search_name = "flu_symptoms" >>> output_path = "data" >>> num_samples = 5 >>> from SearchSampler.sampler import SearchSampler >>> sampler = SearchSampler(api_key, search_name, params, output_path=output_path) >>> df_results = sampler.pull_rolling_window(num_samples=num_samples) >>> sampler.save_file(df_results, append=True) """ def __init__( self, api_key, search_name, search_params, server="https://www.googleapis.com", version="v1beta", output_path="data" ): # Basic variables if not api_key: raise SystemError('ERROR: Must provide an api_key as the first parameter') self._search_name = search_name self._server = server self._version = version self.service = self._get_service(api_key) # Below exception is to ensure that people actually provide something for an output_path if output_path == "": raise ValueError("Please provide an output path") self.output_path = output_path ## Search parameters # Initialize a dictionary with default parameters self.params = { "search_term": None, "region": None, "period_start": None, "period_end": None, "period_length": "week" } # Force search_term to be a dictionary if not isinstance(search_params, dict): raise ValueError('ERROR: search_params needs to be a dictionary') if type(search_params.get("search_term", None)) == str: search_params["search_term"] = [search_params["search_term"]] self.params.update(search_params) for k, v in self.params.items(): if not v: raise SystemError('ERROR: Must provide a {}'.format(k)) # Check that start date is before end date if self.params['period_end'] < self.params['period_start']: raise ValueError('ERROR: start of period must be before end of period') def _get_service(self, api_key): """ Sets up the connection to the Google Trends Health API :param api_key: API Key :return: Properly configured API object """ url = "/".join([ str(self._server), 'discovery/v1/apis/trends', str(self._version), "rest" ]) service = build( 'trends', self._version, developerKey=api_key, discoveryServiceUrl=url ) return service def _get_file_path(self): """ :return: 2-tuple containing the file path and file name """ str_path = os.path.join(str(self.output_path), str(self.params["region"])) str_file_name = '{region}-{identifier}.csv'.format( region=self.params['region'], identifier=self._search_name ) return (str_path, str_file_name) def load_file(self): """ Loads a csv file for later analysis, based on naming scheme used within class :return: Pandas dataframe """ load_path, load_filename = self._get_file_path() full_file_path = os.path.join(str(load_path), str(load_filename)) print('Attempting to load local file: {}'.format(full_file_path)) return pandas.read_csv(full_file_path) def save_file(self, df, append=True): """ Saves data in df to folder, based on the following structure\: `{output_path}/{region}/{region}-{search_identifier}.csv` :param df: Dataframe to save. Expects format\: Period, value (though names don't matter) :param append: Whether or not to add the new results to an existing file with the same name.\ Setting this to `False` will overwrite any existing file. :return: None """ # set up paths and file name load_path, load_filename = self._get_file_path() # Verify the directory exists; if not, create if not os.path.exists(load_path): os.makedirs(load_path) # If appending results, load previous results and join else: if append: try: df_prev_results = self.load_file() except FileNotFoundError: print('No previous data found. Will save to new file') else: df = pandas.concat([df_prev_results, df]) full_file_path = os.path.join(str(load_path), str(load_filename)) print('Saving local file: {}'.format(full_file_path)) df.to_csv(full_file_path, encoding='utf-8', index=False) def _perform_pull(self, graph_object, attempt=0, sleep_minutes=1, limit=20): """ Given a connection object to the API, return a set of unformatted data. This method accommodates API connection problems up to the specified limit (default 20). :param graph_object: Properly formatted :param attempt: Internal, do not use. Function uses in instances in which the API fails. :param sleep_minutes: :param limit: :return: Unformatted data from API """ # Call API # Enclosed in a try/except block because the API will randomly return a Rate Limit exceeded error # Usually as an HTTPError try: response_health = graph_object.execute() except Exception as msg: attempt += 1 if attempt <= limit: if attempt % 5 == 0: print( 'WARNING: Attempt #{}. This may require an extended period. Sleeping for 5 minutes. \ Error message:\n {}'.format(attempt, str(msg)) ) # Sleep for 5 minutes time.sleep(5 * 60) else: print( 'WARNING: Attempt #{}. Sleeping for just 1 minute. \ Error message:\n {}'.format(attempt, str(msg)) ) # Sleep for 1 minutes time.sleep(sleep_minutes * 60) response_health = self._perform_pull(graph_object, attempt) else: # Give up entirely raise SystemError("Attempted query 5 times and couldn't connect") response_health = None return response_health def pull_data_from_api(self, params=None, format='dict'): """ Pulls data from the API given a set of search terms and other restrictions. :param params: Set of search parameters. Uses the object-level search params (from __init__) if empty. :return: Dataframe with results from API that match parameters. """ # set local parameters to class parameters if necessary if not params: params = deepcopy(self.params) # Check period_length if params['period_length'] not in VALID_PERIOD_LENGTHS: raise SystemError('Period length {} is of the wrong type.'.format(params['period_length'])) # Check region type. Because this changes the parameters in the API call, this sets up the API call # See the difference between geoRestriction_region, _country, and _dma if isinstance(params['region'], list): test_region = str(params['region'][0]) params['region'] = "'{}'".format("', '".join(str(params['region']))) else: test_region = str(params['region']) if test_region[:2] == 'US': # nation-wide if test_region == 'US': graph_health = self.service.getTimelinesForHealth( terms=params['search_term'], geoRestriction_country=params['region'], time_startDate=params['period_start'], time_endDate=params['period_end'], timelineResolution=params['period_length'] ) # Can only use multiple values for states and DMAs # Cannot mix national, state or DMA in the same call, unfortunately # Valid options are ISO-3166-2 else: graph_health = self.service.getTimelinesForHealth( terms=params['search_term'], geoRestriction_region=params['region'], time_startDate=params['period_start'], time_endDate=params['period_end'], timelineResolution=params['period_length'] ) else: # This assumes a DMA # To properly retrieve data, it needs to be a number, so test for this first # For more, see: https://support.google.com/richmedia/answer/2745487 if not isinstance(params['region'], int): raise ValueError('Region "{}" is not an integer, but looks like it is meant to be a DMA' \ .format(params['region'])) # otherwise graph_health = self.service.getTimelinesForHealth( terms=params['search_term'], geoRestriction_dma=params['region'], time_startDate=params['period_start'], time_endDate=params['period_end'], timelineResolution=params['period_length'] ) # Now, finally, call the API print('INFO: Running period {} - {}'.format(params['period_start'], params['period_end'])) response_health = self._perform_pull(graph_health) if not response_health: return None else: d_results = {} for results in response_health['lines']: curr_term = results['term'] df = pandas.DataFrame(results['points']) # re-format date into actual date objects try: df['period'] = pandas.to_datetime(df.date, format='%b %d %Y') except: df['period'] = pandas.to_datetime(df.date, format='%b %Y') d_results[curr_term] = df if format == 'dataframe': # process of saving is slightly different when asking for multiple # search terms than for just one # Need to convert from a dictionary of dataframes if len(d_results) > 1: df = pandas.concat(d_results).reset_index()[['level_0', 'date', 'value', 'period']] df = df.rename(columns={'level_0':'search_term'}) else: df = pandas.DataFrame(d_results) return df elif format == 'dict': return d_results else: raise ValueError("Please provide a proper format for results. Available options are: dict, dataframe.") def _serialize_period_values(self, df, dd_periods=None, lst_periods=None): """ Converts sample into period specific list of values. Assumes dd_periods is a defaultdict :param df: Dataframe with sample values. Must at least have the columns [period, value] :param dd_periods: A dictionary, with periods as keys and lists of query results as values :param lst_periods: A list of valid periods :return: dd_periods with added values """ if not lst_periods: lst_periods = [] if not dd_periods: dd_periods = defaultdict(list) for index, row in df.iterrows(): # If a list of periods was provided, we only expand dd_periods for the ones that were specified if len(lst_periods) > 0: if row['period'] in lst_periods: dd_periods[row['period']].append(row['value']) else: dd_periods[row['period']].append(row['value']) return dd_periods def pull_rolling_window(self, num_samples=5): """ Separates pull into a rolling set of samples to get multiple samples in the same run. This takes advantage of the fact that the API does not cache results if you change the length of time in the search :param num_samples: Amount of samples to pull :return: Dataframe with results from API. Does not include information about the sample frame. """ query_time = datetime.now() # First we run a single query, so we can get the dates for each period from the API. # Could do this logic locally, but this is easier local_params = deepcopy(self.params) local_params['search_term'] = local_params['search_term'][0] samples_taken = 0 d_range_all = self.pull_data_from_api(local_params) lst_periods = list(d_range_all.values())[0]['period'].tolist() d_periods = {} # Next, we pull each week individually. This will always get saved. print("INFO: Running Search Term: {}".format(self.params['search_term'])) for period in lst_periods: curr_date = datetime.strftime(period, '%Y-%m-%d') local_params = deepcopy(self.params) local_params['period_start'] = curr_date local_params['period_end'] = curr_date d_single = self.pull_data_from_api(local_params) if not d_single: raise ValueError('Problems with period {}'.format(curr_date)) for term, result in d_single.items(): if term in d_periods: d_periods[term] = self._serialize_period_values(result, dd_periods=d_periods[term]) else: d_periods[term] = self._serialize_period_values(result, dd_periods=defaultdict(list)) # Increment samples taken by 1 - since each period has been sampled individually samples_taken += 1 # Now do the rolling sample # Using some logic to figure out the window size and how far back to go # First, we get the window size window_size = num_samples - samples_taken print("INFO: window_size: {}".format(str(window_size))) # If in the above samples we've already gotten all that we've asked for, no need to do the rest if window_size > 0: # There's a weird race condition in which window_size = 1, but we've already done the single period samples # So we just change this to a 2 period window size and they get an extra sample if window_size == 1: window_size = 2 # Calculate days before and after, erring on the side of having more periods... # So that we have symmetry between sides if there are an odd number of weeks local_params = deepcopy(self.params) days_diff = window_size * 7 # Get the starting period, specifying that the first window is window_size before the first date starting_period = lst_periods[0] - timedelta(days=days_diff) # Get the ending period, specifying that the last window is window_size after the last date ending_period = lst_periods[-1] + timedelta(days=days_diff) # Set up the loop # Initial window is (starting_period) to (starting_period + window_size) curr_start = starting_period curr_end = curr_start + timedelta(days=days_diff) # Loop until each window is done while curr_end <= ending_period: # Set up query params local_params['period_start'] = datetime.strftime(curr_start, '%Y-%m-%d') local_params['period_end'] = datetime.strftime(curr_end, '%Y-%m-%d') # Call the API d_window = self.pull_data_from_api(local_params) # Save the results for term, result in d_window.items(): d_periods[term] = self._serialize_period_values( result, dd_periods=d_periods[term], lst_periods=lst_periods ) # Increment the window by one week curr_start += timedelta(days=7) curr_end += timedelta(days=7) rows = [] for term, timestamps in d_periods.items(): for timestamp, samples in timestamps.items(): for i, sample in enumerate(samples): if i < num_samples: # Due to the sampling method, we sometimes draw an extra sample # This will skip over that rows.append({ "term": term, "period": timestamp, "sample": i, "value": sample, "query_time": query_time }) return pandas.DataFrame(rows)
19,216
5,095
import os from dotenv import load_dotenv from Cryptodome.Cipher import PKCS1_v1_5 as Cipher_pkcs1_v1_5 from Cryptodome.Signature import PKCS1_v1_5 as Signature_pkcs1_v1_5 from Cryptodome.PublicKey import RSA load_dotenv() API_URI = os.environ.get("API_URI", "https://nodes.thetangle.org:443").split(",") API_OPEN = os.environ.get("API_OPEN", "https://nodes.thetangle.org:443") # encrypt PLAT_RSA_PUB_KEY = RSA.importKey(open("rsa/plat_rsa_public.pem").read()) AMI_CIPHER = Cipher_pkcs1_v1_5.new(PLAT_RSA_PUB_KEY) # signature AMI_RSA_PRI_KEY = RSA.importKey(open("rsa/ami_rsa_private.pem").read()) AMI_SIGNER = Signature_pkcs1_v1_5.new(AMI_RSA_PRI_KEY)
659
305
# Copyright 2015 Google Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Command for deleting users.""" from googlecloudsdk.api_lib.compute import base_classes from googlecloudsdk.api_lib.compute import lister from googlecloudsdk.api_lib.compute import request_helper from googlecloudsdk.api_lib.compute import utils from googlecloudsdk.api_lib.compute.users import client as users_client from googlecloudsdk.calliope import base from googlecloudsdk.core import properties class Delete(base.DeleteCommand): """Delete Google Compute Engine users. *{command}* deletes one or more Google Compute Engine users. ## EXAMPLES To delete one or more users by name, run: $ {command} example-user-1 example-user-2 To delete all users for one or more owners, run: $ {command} example-owner-1@gmail.com example-owner-2@gmail.com --owners """ @staticmethod def Args(parser): parser.add_argument( '--owners', action='store_true', help=('The owner of the user to be created. The owner must be an email ' 'address associated with a Google account')) parser.add_argument( 'names', metavar='NAME', nargs='+', help='The names of the users to delete.') def GetOwnerAccounts(self, client, owners): """Look up all users on the current project owned by the list of owners.""" requests = [] for owner in owners: requests += lister.FormatListRequests( client.users, properties.VALUES.core.project.GetOrFail(), None, None, 'owner eq ' + owner) errors = [] responses = request_helper.MakeRequests( requests=requests, http=client.http, batch_url='https://www.googleapis.com/batch/', errors=errors) if errors: utils.RaiseException(errors, users_client.UserException, error_message=( 'Could not get users for owners:')) return [response.name for response in responses] def Run(self, args): """Issues requests necessary for deleting users.""" holder = base_classes.ComputeUserAccountsApiHolder(self.ReleaseTrack()) client = holder.client if args.owners: names = self.GetOwnerAccounts(client, args.names) else: names = args.names user_refs = [holder.resources.Parse( user, params={'project': properties.VALUES.core.project.GetOrFail}, collection='clouduseraccounts.users') for user in names] utils.PromptForDeletion(user_refs) requests = [] for user_ref in user_refs: request = client.MESSAGES_MODULE.ClouduseraccountsUsersDeleteRequest( project=user_ref.project, user=user_ref.Name()) requests.append((client.users, 'Delete', request)) errors = [] responses = list( request_helper.MakeRequests( requests=requests, http=client.http, batch_url='https://www.googleapis.com/batch/', errors=errors)) if errors: utils.RaiseToolException( errors, error_message='Could not fetch resource:') return responses
3,620
1,042
from .global_hac import GlobalHAC
34
12
from dataclasses import dataclass from functools import total_ordering from collections import Counter import typing import textwrap @dataclass(frozen=True) @total_ordering class Point: x: int y: int def __add__(self, they): return Point(self.x + they.x, self.y + they.y) def __sub__(self, they): return Point(self.x - they.x, self.y - they.y) def reflect(self): return Point(-self.x, self.y) def rotate(self): return Point(-self.y, self.x) def __lt__(self, they): return (self.x, self.y) < (they.x, they.y) Poly = typing.Tuple[Point, ...] def reflect(poly: Poly) -> Poly: return tuple(p.reflect() for p in poly) def rotate(poly: Poly) -> Poly: return tuple(p.rotate() for p in poly) def minimal_repr(poly: Poly) -> Poly: points = sorted(poly) return tuple(p - points[0] for p in points) def normalize(poly: Poly) -> Poly: def all_repr(poly): for i in range(4): yield poly yield reflect(poly) poly = rotate(poly) min_repr = min(minimal_repr(r) for r in all_repr(poly)) return min_repr def generate_from_poly(poly) -> typing.Generator[Poly, None, None]: points = set(poly) for p in poly: for df in ((0, 1), (0, -1), (1, 0), (-1, 0)): q = p + Point(df[0], df[1]) if q in points: continue new_poly = normalize((*poly, q)) yield new_poly def generate(n: int) -> typing.List[Poly]: if n == 1: return [(Point(0, 0),)] prev_results = generate(n - 1) results = set() for prev_poly in prev_results: results.update(generate_from_poly(prev_poly)) return list(results) def hexo_borders(poly: Poly) -> typing.List[typing.Tuple[Point, Point]]: dfs = tuple(Point(x, y) for x, y in ((0, 0), (0, 1), (1, 1), (1, 0))) counter = Counter() for tile in poly: for i in range(4): d1 = dfs[i] d2 = dfs[(i+1) % 4] if d1 < d2: d1, d2 = d2, d1 border = (tile + d1, tile + d2) counter[border] += 1 outer_borders = [border for border, cnt in counter.items() if cnt == 1] return outer_borders def hexo_to_repr(poly: Poly) -> str: assert len(poly) == 6 tiles_str = ', '.join(f'Pos {{ x: {p.x}, y: {p.y} }}' for p in poly) borders = hexo_borders(poly) borders_str = ', '.join( f'(Pos {{ x: {p1.x}, y: {p1.y} }}, Pos {{ x: {p2.x}, y: {p2.y} }})' for (p1, p2) in borders) return ( f'''__Hexo {{ tiles: [{tiles_str}], borders: &[{borders_str}], }}''') if __name__ == '__main__': codegen_template = textwrap.dedent( '''\ #[cfg(not(test))] pub const N_HEXOS: usize = {n_hexos}; #[cfg(not(test))] pub const HEXOS: [__Hexo; {n_hexos}] = [ {hexos} ]; ''' ) I = tuple(Point(0, y) for y in range(6)) hexos = [poly for poly in generate(6) if poly != I] hexos_str = ',\n '.join(hexo_to_repr(hexo) for hexo in hexos) print(codegen_template.format(n_hexos = len(hexos), hexos = hexos_str))
3,195
1,188
#!/usr/bin/env python3 # --------------------( LICENSE )-------------------- # Copyright (c) 2014-2021 Beartype authors. # See "LICENSE" for further details. ''' **Beartype forward reference data submodule.** This submodule exercises **forward reference type hints** (i.e., strings whose values are the names of classes and tuples of classes, one or more of which typically have yet to be defined) support implemented in the :func:`beartype.beartype` decorator. This support can *only* be fully exercised from within an independent data submodule rather than the body of a unit test. Why? Because: * That decorator is only safely importable from within the body of a unit test. * Forward reference type hints can only refer to objects defined at module scope rather than from within the body of a unit test. * Forward reference type hints referring to objects previously defined at module scope fail to exercise the deferred nature of forward references. * Ergo, callables that are decorated by that decorator, annotated by one or more forward reference type hints, and both declared and called from within the body of a unit test fail to exercise this deferred nature. * Ergo, only callables that are decorated by that decorator, annotated by one or more forward reference type hints, and both declared and called at module scope before their referents exercise this deferred nature. ''' # ....................{ IMPORTS }.................... from beartype import beartype from typing import Union # ....................{ CALLABLES }.................... # Decorated callable annotated by a PEP-noncompliant fully-qualified forward # reference referring to a type that has yet to be declared. TheDarkestForwardRefOfTheYear = ( 'beartype_test.a00_unit.data.hint.data_hintref.TheDarkestEveningOfTheYear') @beartype def the_woods_are_lovely(dark_and_deep: TheDarkestForwardRefOfTheYear) -> ( TheDarkestForwardRefOfTheYear): return dark_and_deep # Decorated callable annotated by a PEP-noncompliant tuple containing both # standard types and a fully-qualified forward reference referring to a type # that has yet to be declared. TheDarkestTupleOfTheYear = (complex, TheDarkestForwardRefOfTheYear, bool) @beartype def of_easy_wind(and_downy_flake: TheDarkestTupleOfTheYear) -> ( TheDarkestTupleOfTheYear): return and_downy_flake # Decorated callable annotated by a PEP-compliant unnested unqualified forward # reference referring to a type that has yet to be declared. @beartype def stopping_by_woods_on(a_snowy_evening: 'TheDarkestEveningOfTheYear') -> ( 'TheDarkestEveningOfTheYear'): return a_snowy_evening # Decorated callable annotated by a PEP-compliant nested unqualified forward # reference referring to a type that has yet to be declared. TheDarkestUnionOfTheYear = Union[complex, 'TheDarkestEveningOfTheYear', bytes] @beartype def but_i_have_promises(to_keep: TheDarkestUnionOfTheYear) -> ( TheDarkestUnionOfTheYear): return to_keep # ....................{ CLASSES }.................... # User-defined class previously referred to by forward references above. class TheDarkestEveningOfTheYear(str): pass
3,270
940
# coding: utf-8 StatusContinue = 100 StatusSwitchingProtocols = 101 StatusProcessing = 102 StatusEarlyHints = 103 StatusOK = 200 StatusCreated = 201 StatusAccepted = 202 StatusNonAuthoritativeInfo = 203 StatusNoContent = 204 StatusResetContent = 205 StatusPartialContent = 206 StatusMultiStatus = 207 StatusAlreadyReported = 208 StatusIMUsed = 226 StatusMultipleChoices = 300 StatusMovedPermanently = 301 StatusFound = 302 StatusSeeOther = 303 StatusNotModified = 304 StatusUseProxy = 305 StatusTemporaryRedirect = 307 StatusPermanentRedirect = 308 StatusBadRequest = 400 StatusUnauthorized = 401 StatusPaymentRequired = 402 StatusForbidden = 403 StatusNotFound = 404 StatusMethodNotAllowed = 405 StatusNotAcceptable = 406 StatusProxyAuthRequired = 407 StatusRequestTimeout = 408 StatusConflict = 409 StatusGone = 410 StatusLengthRequired = 411 StatusPreconditionFailed = 412 StatusRequestEntityTooLarge = 413 StatusRequestURITooLong = 414 StatusUnsupportedMediaType = 415 StatusRequestedRangeNotSatisfiable = 416 StatusExpectationFailed = 417 StatusTeapot = 418 StatusMisdirectedRequest = 421 StatusUnprocessableEntity = 422 StatusLocked = 423 StatusFailedDependency = 424 StatusTooEarly = 425 StatusUpgradeRequired = 426 StatusPreconditionRequired = 428 StatusTooManyRequests = 429 StatusRequestHeaderFieldsTooLarge = 431 StatusUnavailableForLegalReasons = 451 StatusInternalServerError = 500 StatusNotImplemented = 501 StatusBadGateway = 502 StatusServiceUnavailable = 503 StatusGatewayTimeout = 504 StatusHTTPVersionNotSupported = 505 StatusVariantAlsoNegotiates = 506 StatusInsufficientStorage = 507 StatusLoopDetected = 508 StatusNotExtended = 510 StatusNetworkAuthenticationRequired = 511
1,701
663
import logging import oscar x0a_name="User lookup" log = logging.getLogger('oscar.snac.x0a') subcodes = {} def x0a_init(o, sock, cb): log.info('initializing') cb() log.info('finished initializing') def x0a_x01(o, sock, data): ''' SNAC (xa, x1): User lookup Family Error reference: U{http://iserverd.khstu.ru/oscar/snac_0a_01.html} ''' errcode, errmsg, subcode = oscar.snac.error(data) submsg = subcodes.setdefault(subcode, 'Unknown') if subcode else None raise oscar.snac.SnacError(0x0a, (errcode, errmsg), (subcode, submsg)) def x0a_x02(email): ''' SNAC (xa, x2): Search by email reference: U{http://iserverd.khstu.ru/oscar/snac_0a_02.html} ''' return 0x0a, 0x02, email def x0a_x03(o, sock, data): ''' SNAC (xa, x3): Search response reference: U{http://iserverd.khstu.ru/oscar/snac_0a_03.html} ''' fmt = (('tlvs', 'tlv_list'),) name_tlvs, data = oscar.unpack(fmt, data) assert not data names = [tlv.v for tlv in name_tlvs]
1,064
469
#!/usr/bin/env python """setup.py Defines the setup instructions for the punch framework Copyright (C) 2016 Rodrigo Chacon Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ import sys from setuptools import setup from setuptools.command.test import test as TestCommand class PyTest(TestCommand): extra_kwargs = {'tests_require': ['pytest']} def finalize_options(self): TestCommand.finalize_options(self) self.test_args = [] self.test_suite = True def run_tests(self): import pytest sys.exit(pytest.main()) try: import pypandoc readme = pypandoc.convert('README.md', 'rst') except (IOError, ImportError, OSError, RuntimeError): readme = '' setup(name='punch', version='0.0.1', description='A Python framework focused (but not limited) in JSON APIs.', long_description=readme, author='Rodrigo Chacon', author_email='rochacon@gmail.com', url='https://github.com/rochacon/punch', license='MIT', packages=['punch'], requires=['webob'], install_requires=['webob'], cmdclass={'test': PyTest}, keywords='Web, Python, Python3, Refactoring, REST, Framework, RPC', classifiers=['Development Status :: 6 - Mature', 'Intended Audience :: Developers', 'Natural Language :: English', 'Environment :: Console', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python', 'Programming Language :: Python :: 3', 'Programming Language :: Python :: 3.2', 'Programming Language :: Python :: 3.3', 'Programming Language :: Python :: 3.4', 'Programming Language :: Python :: 3.5', 'Topic :: Software Development :: Libraries', 'Topic :: Utilities'], **PyTest.extra_kwargs)
2,928
873
''' Drilling info analysis This program reads well header data and production logs (e.g. exported from Drilling Info as .csv files) and walks the user through the genreation of decline curves for each well provided in the input data. Decine curves are fit with a the hyperbolic curve that is estimated using an iterative least squares method. Copyright 2018 Jeffrey E. Thatcher Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. ''' ### Boiler-plate imports and code import sys sys.path.append('./utils/') import os, math import numpy as np import pandas as pd import matplotlib.pyplot as plt import matplotlib from geopy.distance import vincenty # import tools and custom code from tools import load_merge_header_and_production_csv, swap_production_dates_for_time_delta from tools import current_selection, decline_curve, handle_numerical_variables, handle_dateTime_variables from tools import handle_object_variables, plot_map, fit_decline_curve, add_BOE_per_day_column, nominal_decline def main(headerCSV, productionCSV): analysis = Quick_TypeCurve_Analysis(headerCSV, productionCSV) print '\n********************************************************************************' print '* *' print '* Well Type Curve Analysis *' print '* *' print '* Quit this program anytime by pressing `ctrl+C` *\n' print 'reading well header data from: %s' %headerCSV print 'reading production data from: %s' %productionCSV # select by well number print '\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\n' wellByName = raw_input ('would you like to select individual wells by API-UWI number? [y/n]: ') # check user input while wellByName not in ('y', 'n', 'Y', 'N'): wellByName = raw_input('please try again [y/n]? ') if wellByName == 'y' or wellByName == 'Y': analysis.subset_by_well_name() # select nearby wells with a circular radius print '\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\n' wellByName = raw_input ('would you like to select wells near a GPS location? [y/n]: ') # check user input while wellByName not in ('y', 'n', 'Y', 'N'): wellByName = raw_input('please try again [y/n]? ') if wellByName == 'y' or wellByName == 'Y': analysis.subset_wells_by_distance() # select by variable ranges print '\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\n' wellByVariable = raw_input ('would you like to subset wells by column values? [y/n]: ') # check user input while wellByVariable not in ('y', 'n', 'Y', 'N'): wellByVariable = raw_input('please try again [y/n]? ') if wellByVariable == 'y' or wellByVariable == 'Y': analysis.subset_well_by_variable() # plot type curve for all selected wells print '\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\n' b_value = None # determine if user wants to pre-specify any of the decline curve aprameters fixed_b = raw_input ('would you like to pre-specify the decline curve b-factor? [y/n]: ') # check user input while fixed_b not in ('y', 'n', 'Y', 'N'): fixed_b = raw_input('please try again [y/n]? ') if fixed_b.upper() == 'Y': while True: try: b_value = float(raw_input('Enter value for b-factor: ')) except ValueError: print 'Please enter a number' continue else: break analysis.generate_type_curve(b_value) # plot map print '\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\n' analysis.map_selected_wells() # save csv print '\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\n' analysis.save_selected_data() # plot wells individually print '\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\n' analysis.plot_individual_wells_and_type_curves() return class Quick_TypeCurve_Analysis(object): ''' Type curve analysis based on Jessica's work. Decline curve estimates from a python module available at: http://www.uky.edu/KGS/emsweb/devsh/production/decline_obj.py ''' def __init__(self, headerCSV, productionCSV): self.wellDF = load_merge_header_and_production_csv(headerCSV, productionCSV) self.wellDF = add_BOE_per_day_column(self.wellDF) self.userLocation = [] def subset_wells_by_distance(self): # obtain longitude and latitudes from user while len(self.userLocation) != 2: while True: try: self.userLocation = raw_input('\nDefine the center of your radius in Latitude (WGS84), and Longitude (WGS84) (separate by comma): ') self.userLocation = [x.strip() for x in self.userLocation.split(',')] self.userLocation = [float(x) for x in self.userLocation] except ValueError: print 'Please enter numbers' continue else: break # obtain the selection radius from user while True: try: userRadius = float(raw_input('\nDefine the radius within which you will keep all nearby wells (in miles): ')) except ValueError: print 'Please enter numbers' continue else: break # add vicintiy column to data set dist = np.zeros(len(self.wellDF['API/UWI'])) for i,(lat,lon) in enumerate(zip(self.wellDF['Surface Latitude (WGS84)'], self.wellDF['Surface Longitude (WGS84)'])): dist[i] = vincenty([lat, lon], self.userLocation).miles self.wellDF['vicinity'] = dist # keep only wells withing the user selected radius self.wellDF = self.wellDF.loc[self.wellDF['vicinity'] <= userRadius] # notify user of changes to current selection print '%i wells selected' %(len(set(self.wellDF['API/UWI']))) return def subset_by_well_name(self): allWells = list(set(self.wellDF['API/UWI'])) print '\nSelect one or more of the followig wells by API/UWI number\n' print 'all wells available...' for i,well in enumerate(allWells): print '%i -- %s' %(i, well) selection = raw_input('well selection [separate by commas]:\n') selectionList = [x.strip() for x in selection.split(',')] self.wellDF = self.wellDF[self.wellDF['API/UWI'].isin(selectionList)] current_selection(self.wellDF) # notify user of changes to current selection print '%i wells selected' %(len(set(self.wellDF['API/UWI']))) return def subset_well_by_variable(self): allVariables = self.wellDF.columns.values print '\nSelect one or more of the followig variables\n' print 'all variables available...' # generate dictionary of variables variableDict = dict() for i,var in enumerate(allVariables): print '%i -- %s' %(i, var) variableDict.update({i:var}) selectedVars = [] while len(selectedVars) == 0: try: selection = raw_input('Select the variables by their number [separate multiple selections by commas]:\n') selectionList = [x.strip() for x in selection.split(',')] selectedVars = [variableDict.get(int(key)) for key in selectionList] except ValueError: print 'Please enter variables by their number' continue else: break print 'you selected the following variables: ' print selectedVars for colName in selectedVars: print '~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~' print '\nthe variable \"%s\" is of type \"%s\"' %(colName, self.wellDF[colName].dtypes) if str(self.wellDF[colName].dtypes) in ['float64', 'int64']: self.wellDF = handle_numerical_variables(self.wellDF, colName) elif str(self.wellDF[colName].dtypes) in ['object']: self.wellDF = handle_object_variables(self.wellDF, colName) elif str(self.wellDF[colName].dtypes) in ['datetime64', 'timedelta[ns]','datetime64[ns]']: self.wellDF = handle_dateTime_variables(self.wellDF, colName) else: print 'data type not recognized, skipping variable' continue # notify user of changes to current selection print '%i wells selected' %(len(set(self.wellDF['API/UWI']))) return def generate_type_curve(self, b_value = None): # get time dela column from seleccted wells self.wellDF = swap_production_dates_for_time_delta(self.wellDF) # decline curve estiamged parameters qi, b, di, r2 = fit_decline_curve(self.wellDF, fixed_b_factor = b_value) d_nominal = nominal_decline(qi, b, di) # times to estimate for the plot in int(days) time_0 = 0 time_n = np.timedelta64(self.wellDF['Time Delta'].max()) decline_t = np.arange(time_0, time_n, np.timedelta64(10,'D')) decline_t = (decline_t / np.timedelta64(1, 'D')).astype(int) # estimated decline curve decline_y = decline_curve(decline_t, qi, b, di) # plot well data fig, ax = plt.subplots(figsize = (15,8)) for API in set(self.wellDF['API/UWI']): plotData = self.wellDF.loc[self.wellDF['API/UWI'] == API, ['Time Delta', 'BOE per day']] days = plotData['Time Delta'].dt.days liquid = np.array(plotData['BOE per day']) ax.semilogy(days, liquid, '-', label = API) # add decline estimate ax.plot(decline_t, decline_y, '-', color='black', linewidth=5.0, label = 'Estimated Decline') # set axis limits xmin = (self.wellDF['Time Delta'].min() / np.timedelta64(1, 'D')).astype(int) xmin = xmin*0.15 xmax = (self.wellDF['Time Delta'].max() / np.timedelta64(1, 'D')).astype(int) xmax = xmax*1.06 ax.set_xlim([xmin, xmax]) # add titles and legend ax.set_xlabel('Time [Days]') ax.set_ylabel('BOE per Day\n[Barrels of Oil Equivalent per Day]') ax.set_title('Decline Curve Parameters: qi=%.2f, b=%.4f, nominal decline rate=%.1f, r2=%.3f' %(qi, b, d_nominal, r2)) num_col = math.ceil(len(set(self.wellDF['API/UWI']))/40.0) # number of columns to put in legend num_col = int(num_col) ax.legend(bbox_to_anchor=(1.26, 0.9), ncol = num_col, fontsize = 9-num_col, labelspacing=0.2) # Customize the major grid ax.grid(which='major', linestyle='-', linewidth='0.5', color='grey') # Customize the minor grid ax.grid(which='minor', linestyle=':', linewidth='0.5', color='grey') # eliminate unnecessary white space plt.subplots_adjust(left=0.07, right=0.8, top=0.9, bottom=0.1) # save and display plot plt.savefig('./results/Average_decline_estimate.png') plt.close() return def map_selected_wells(self): print 'generating map, this may take a minute...' # send data to mapping function if not(self.userLocation): plot_map(self.wellDF) else: plot_map(self.wellDF, self.userLocation) return def save_selected_data(self): print 'saving selected wells to .csv' self.wellDF.to_csv('./results/selected_wells.csv') return def plot_individual_wells_and_type_curves(self): print 'generating plots for all selected wells' # get time dela column from seleccted wells self.wellDF = swap_production_dates_for_time_delta(self.wellDF) declineFit = [] for well in np.unique(self.wellDF['API/UWI']): print 'fitting well # %s' %(str(well)) wellData = self.wellDF[self.wellDF['API/UWI'] == well] # decline curve estiamged parameters qi, b, di, r2 = fit_decline_curve(wellData) # compute Nominal decline d_nominal = nominal_decline(qi, b, di) # add data to list for saving to excel declineFit.append([wellData, qi, b, d_nominal, di, r2]) # times to estimate for the plot in int(days) time_0 = 0 time_n = np.timedelta64(wellData['Time Delta'].max()) decline_t = np.arange(time_0, time_n, np.timedelta64(10,'D')) decline_t = (decline_t / np.timedelta64(1, 'D')).astype(int) # estimated decline curve decline_y = decline_curve(decline_t, qi, b, di) # plot well data fig, ax = plt.subplots(figsize = (15,8)) days = wellData['Time Delta'].dt.days liquid = np.array(wellData['BOE per day']) ax.semilogy(days, liquid, 'o-', label = well) # add decline estimate ax.plot(decline_t, decline_y, '-', color='black', linewidth=5.0, label = 'Estimated Decline') # set axis limits xmin = (wellData['Time Delta'].min() / np.timedelta64(1, 'D')).astype(int) xmin = xmin*0.15 xmax = (wellData['Time Delta'].max() / np.timedelta64(1, 'D')).astype(int) xmax = xmax*1.06 ax.set_xlim([xmin, xmax]) # add titles and legend ax.set_xlabel('Time [Days]') ax.set_ylabel('BOE per Day\n[Barrels of Oil Equivalent per Day]') ax.set_title('Decline Curve Parameters: qi=%.2f, b=%.4f, nominal decline rate=%.1f, r2=%.3f' %(qi, b, d_nominal, r2)) ax.legend(bbox_to_anchor=(1.28, 1.05)) # Customize the major grid ax.grid(which='major', linestyle='-', linewidth='0.5', color='grey') # Customize the minor grid ax.grid(which='minor', linestyle=':', linewidth='0.5', color='grey') # eliminate unnecessary white space plt.subplots_adjust(left=0.07, right=0.8, top=0.9, bottom=0.1) # save and display plot plt.savefig('./results/' + str(well) + '_decline_estimate.png') plt.close() declineFitDF = pd.DataFrame(declineFit, columns = ['API/UWI', 'qi', 'b', 'nominal decline rate', 'effective decline rate[di]', 'r2']) declineFitDF.to_csv('./results/individual_well_decline_curves.csv') return if __name__ == '__main__': ### well data files headerCSV = './data/Well_header_data.csv' productionCSV = './data/Production_Time_Series.CSV' main(headerCSV, productionCSV)
13,664
5,103
#!/usr/bin/env python import os import re import unittest from git import Repo from semver import match from click import option, argument, echo, ClickException from touchresume.cli import cli from touchresume import __version__ @cli.command(with_appcontext=False) @option('-d', '--dir', default='tests', help='Directory with tests') def test(dir): """Discover and run unit tests.""" testsuite = unittest.TestLoader().discover(dir) unittest.TextTestRunner(verbosity=2, buffer=True).run(testsuite) @cli.command(with_appcontext=False) @option('-d', '--dev', default='dev', help='Develop branch (dev)') @option('-m', '--master', default='master', help='Master branch (master)') @argument('version') def release(dev, master, version, app_path='touchresume'): """Make Git release.""" if not match(version, f'>{__version__}'): raise ClickException(f'Version must be greater than {__version__}') repo = Repo() release = f'release/{version}' echo(f'Create {release} branch') repo.head.ref = repo.heads[dev] repo.head.ref = repo.create_head(release) echo(f'Bump version - {version}') version_file = os.path.join(app_path, '__init__.py') with open(version_file, 'r+') as f: content = f.read() target = f"__version__ = '{__version__}'" value = f"__version__ = '{version}'" f.seek(0) f.write(content.replace(target, value)) repo.index.add([version_file]) repo.index.commit(f'bump version - v{version}') diff = repo.head.commit.diff(None) cf = re.compile(r'^change[s|log].*') changelog_files = [d.a_path for d in diff if cf.match(d.a_path.lower())] if changelog_files: echo(f'Commit {", ".join(changelog_files)}') repo.index.add(changelog_files) repo.index.commit(f'update changelog - v{version}') rf = 'readme' readme_files = [d.a_path for d in diff if d.a_path.lower().startswith(rf)] if readme_files: echo(f'Commit {", ".join(readme_files)}') repo.index.add(readme_files) repo.index.commit(f'update readme - v{version}') echo(f'Merge {release} into {master}') repo.head.ref = repo.heads[master] parents = (repo.branches[release].commit, repo.branches[master].commit) repo.index.commit(f'merge {release}', parent_commits=parents) echo(f'Create v{version} tag') repo.create_tag(f'v{version}') echo(f'Merge {release} back into {dev}') repo.head.ref = repo.heads[dev] dev_parents = (repo.branches[release].commit, repo.branches[dev].commit) repo.index.commit(f'merge {release} back', parent_commits=dev_parents) echo(f'Delete {release} branch') repo.delete_head(release) if __name__ == '__main__': cli()
2,745
956
from reb.src import pynyt from reb.conf import APIKEY_NYT_ARTICLE nyt = pynyt.ArticleSearch(APIKEY_NYT_ARTICLE) nytArchive = pynyt.ArchiveApi(APIKEY_NYT_ARTICLE) # # get 1000 news articles from the Foreign newsdesk from 1987 # results_obama = nyt.query( # q='obama', # begin_date="20170101", # end_date="20170102", # # facet_field=['source', 'day_of_week'], # # facet_filter = True, # verbose=True) arch = nytArchive.query( year="2012", month="1" )
485
218
"""A file system service for managing CVMFS-based client file systems.""" import os from cm.services import service_states import logging log = logging.getLogger('cloudman') class CVMFS(object): def __init__(self, filesystem, fs_type): self.fs = filesystem # File system encapsulating this implementation self.fs_type = fs_type self.app = self.fs.app # A local reference to app (used by @TestFlag) def __str__(self): return str(self.fs.mount_point) def __repr__(self): return str(self.fs.mount_point) def _get_details(self, details): details['DoT'] = "No" details['kind'] = self.fs_type return details def start(self): """ Start the service. For the case of CVMFS, just list the file system path. """ os.listdir(self.fs.mount_point) def stop(self): """Nothing to do for CVMFS.""" pass def status(self): """Check if the mount point contains data and mark as running if so.""" if os.listdir(self.fs.mount_point): self.fs.state = service_states.RUNNING update_size_cmd = ("df --block-size 1 | grep %s$ | awk " "'{print $2, $3, $5}'" % self.fs.mount_point) self.fs._update_size(cmd=update_size_cmd) else: self.fs.state = service_states.ERROR
1,403
428
# -*- coding: utf-8 -*- import re, web, datetime, hashlib, struct, yaml, sys, wikipedia import xml.etree.ElementTree as ET re_NUMERIC = re.compile("(-?\d+)[ ,]+(-?\d+)") re_NUMERICF = re.compile("(-?[\.\d]+)[ ,]+(-?[\.\d]+)") #fractions allowed re_EXPEDITION = re.compile('\[\[(\d{4}-\d{2}-\d{2} -?\d+ -?\d+)') def getdjia(date): try: return web.get("http://geo.crox.net/djia/%s" % date) except: return None def geohash(djia, date): sum = hashlib.md5("%s-%s" % (date, djia)).digest() lat, lon = [x/2.**64 for x in struct.unpack_from(">QQ", sum)]; return lat, lon def exp2latlon(expstring): #parameter: a string in the expedition format yyyy-mm-dd lll lll sdate, lat, lon = expstring.split() date = datetime.datetime.strptime(sdate,"%Y-%m-%d").date() if int(lon)>-30 and date > datetime.date(2008,05,26): date = date - datetime.timedelta(1) #use the previous day for W30 djia = getdjia(date) if not djia: print ("Could not retrieve DJIA for %s." % date) return if "not available" in djia: print ("DJIA for %s not available yet." % date) return if "error" in djia: print ("crox reported an error while retrieving DJIA for %s." % date) return flat, flon = geohash(djia, sdate) geolat = lat + str(flat)[1:] geolon = lon + str(flon)[1:] return geolat, geolon def geolookup(lat, lon): et = None result = {} try: bytes = web.get("http://ws.geonames.org/extendedFindNearby?lat=%s&lng=%s" % (lat,lon)) et = ET.fromstring(bytes) except: phenny.msg(renick, "geonames.org web services seem to be unavailable.") return s = "" for item in et: if item.tag in ["geoname","ocean"]: ifcode = item.find("fcode") if ifcode!=None: result[ifcode.text] = item.find("name").text elif item.tag in ["country","continent"]: result[item.tag] = item.text elif item.tag == "address": result["streetNumber"] = item.find("streetNumber").text result["street"] = item.find("street").text result["postalcode"] = item.find("postalcode").text result["placename"] = item.find("placename").text result["adminName2"] = item.find("adminName2").text result["adminName1"] = item.find("adminName1").text result["countryCode"] = item.find("countryCode").text else: print "Unhandled tag: %s" % item.tag return result site = wikipedia.getSite() if len(sys.argv)>1: user = sys.argv[1] else: print "usage:\n./regional username" sys.exit(1) page = wikipedia.Page(site, "User:"+user) data = page.get() expeditions = re_EXPEDITION.findall(data) regionals = {} count = 0 for exp in expeditions: date, glat, glon = exp.split() lat, lon = exp2latlon(exp) place = geolookup(lat,lon) print place for fcode, name in place.iteritems(): if fcode: if not fcode in regionals: regionals[fcode]={} if not name in regionals[fcode]: regionals[fcode][name]={} regionals[fcode][name][glat+" "+glon]=True for fcode, names in regionals.iteritems(): for name, grats in names.iteritems(): num = len(grats) print "%s %s - %i graticules" % (fcode, name, num) if num>3: for grat in grats: print grat+";", print
3,240
1,229
def nearest_smallest_element(arr): """ Given an array arr, find the nearest smaller element for each element. The index of the smaller element must be smaller than the current element. """ smaller_numbers = [] def nearest(n): def find_previous_num(): for previous_num in reversed(smaller_numbers): if previous_num < n: return previous_num return -1 def append_smaller_number_before_preceding_big(n): while len(smaller_numbers) > 0 and smaller_numbers[-1] > n: smaller_numbers.pop() smaller_numbers.append(n) previous_num = find_previous_num() append_smaller_number_before_preceding_big(n) return previous_num return [nearest(n) for n in arr] def test_nearest_smallest_element(): assert nearest_smallest_element([4, 5, 2, 10, 12, 11] ) == [-1, 4, -1, 2, 10, 10] assert nearest_smallest_element([4]) == [-1] assert nearest_smallest_element([]) == []
1,034
320
# -*- coding: utf-8 -*- ''' Relations for BIRD. ''' import socket import netaddr import netifaces from charmhelpers.core import hookenv from charmhelpers.core.services.helpers import RelationContext def router_id(): ''' Determine the router ID that should be used. This function uses the common logic of finding the IPv4 addresses assigned on all interfaces and picking the numerically lowest of them (that is not in the 127.0.0.0/8 block). ''' def get_assigned_ips(): ifs = netifaces.interfaces() for interface in ifs: if_addrs = netifaces.ifaddresses(interface) ip4_data = if_addrs.get(netifaces.AF_INET, []) for ip4 in ip4_data: yield netaddr.IPAddress(ip4['addr']) excluded_net = netaddr.IPNetwork('127.0.0.0/8') for addr in sorted(get_assigned_ips()): if addr not in excluded_net: return str(addr) def resolve_domain_name(name, ip_version=4): ''' Takes a domain name and resolves it to an IP address of a given version. Currently only ever returns one address. ''' results = socket.getaddrinfo(name, None) addresses = (netaddr.IPAddress(r[4][0]) for r in results) filtered = (a for a in addresses if a.version == ip_version) try: addr = filtered.next() except StopIteration: addr = '' return str(addr) def local_ipv6_address(): ''' Determines the IPv6 address to use to contact this machine. Excludes link-local addresses. Currently only returns the first valid IPv6 address found. ''' for iface in netifaces.interfaces(): addresses = netifaces.ifaddresses(iface) for addr in addresses.get(netifaces.AF_INET6, []): # Make sure we strip any interface specifier from the address. addr = netaddr.IPAddress(addr['addr'].split('%')[0]) if not (addr.is_link_local() or addr.is_loopback()): return str(addr) class BgpRRRelation(RelationContext): ''' Relation context for the BGP Route Reflector interface. ''' name = 'bgp-route-reflector' interface = 'bgp-route-reflector' required_keys = [] def is_ready(self): return True def _is_ready(self, data): return set(data.keys()).issuperset(set(['addr', 'addr6'])) def get_data(self): peers = [] peers6 = [] for rid in hookenv.relation_ids(self.name): for unit in hookenv.related_units(rid): rel = hookenv.relation_get(attribute='addr', rid=rid, unit=unit) if rel is not None: addr = resolve_domain_name(rel) if addr: peers.append(addr) rel6 = hookenv.relation_get(attribute='addr6', rid=rid, unit=unit) if rel6 is not None: peers6.append(rel6) self['bgp_peers'] = peers self['bgp_peers6'] = peers6 self['router_id'] = router_id() return def provide_data(self): return { 'addr': hookenv.unit_get('private-address'), 'addr6': local_ipv6_address() }
3,385
1,015
from hashlib import sha1 from django.core.cache import cache from django.utils.encoding import smart_str def cached(key=None, timeout=300): """ Cache the result of function call. Args: key: the key with which value will be saved. If key is None then it is calculated automatically timeout: number of seconds after which the cached value would be purged. """ _key = key def func_wrapper(func): def args_wrapper(*args, **kwargs): # this is workaround of strange python behaviour key = _key if key is None: # Not sure that this will work correct in all cases key = sha1(str(func.__module__) + str(func.__name__) +\ smart_str(args) +\ smart_str(frozenset(kwargs.items()))).hexdigest() value = cache.get(key) if value: return value else: value = func(*args, **kwargs) cache.set(key, value) return value return args_wrapper return func_wrapper
1,136
287
#!/usr/bin/env python3 """ 1. Go to: https://usage.dteenergy.com/?interval=hour 2. Download CSV 3. Run: python dtecsv.py .\electric_usage_report_05-31-2021_to_06-05-2021.csv """ import csv import datetime import click import matplotlib.pyplot as plt x = [] y = [] @click.command() @click.argument('file', type=click.Path(exists=True)) def main(file): """ Will plot data from DTE Energy CSV :param file: DTE CSV file """ with open(file, 'r') as file: lines = csv.reader(file) next(lines) # Skip first line that is header for row in lines: rawdate = row[1] + ' ' + row[2] # 05/15/2021 11:00 AM # date = datetime.datetime.strptime(rawdate, "%m/%d/%Y %I:00 %p").strftime("%Y-%m-%d %H:00") date = datetime.datetime.strptime(rawdate, "%m/%d/%Y %I:00 %p").strftime("%b %d %H:00") x.append(date) y.append(float(row[3])) # Risize the figure (optional) plt.figure(figsize=(18, 9)) # Plot the x and y values on the graph plt.plot(x, y) # Here you specify the ticks you want to display # You can also specify rotation for the tick labels in degrees or with keywords. plt.xticks(x[::2], rotation='vertical') # Add margins (padding) so that markers don't get clipped by the axes plt.margins(0.2) # Display the graph plt.show() if __name__ == '__main__': main()
1,417
527
# Copyright (c) 2021, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import logging import shutil import sys from distutils.version import LooseVersion from pathlib import Path from typing import List, Optional import yaml from model_navigator.converter import DatasetProfileConfig from model_navigator.exceptions import ModelNavigatorProfileException from model_navigator.kubernetes.yaml import CustomDumper from model_navigator.model_analyzer import ModelAnalyzer, ModelAnalyzerProfileConfig from model_navigator.model_analyzer.config import BaseConfigGenerator, ModelAnalyzerTritonConfig from model_navigator.model_analyzer.model_analyzer import ModelAnalyzerMode from model_navigator.model_analyzer.model_analyzer_config import ModelAnalyzerConfig from model_navigator.perf_analyzer import PerfMeasurementConfig from model_navigator.triton import DeviceKind from model_navigator.triton.model_config import TritonModelConfigGenerator from model_navigator.triton.utils import get_shape_params from model_navigator.utils import Workspace LOGGER = logging.getLogger(__name__) if LooseVersion(sys.version) >= LooseVersion("3.8.0"): from importlib.metadata import version TRITON_MODEL_ANALYZER_VERSION = LooseVersion(version("triton-model-analyzer")) else: import pkg_resources TRITON_MODEL_ANALYZER_VERSION = LooseVersion(pkg_resources.get_distribution("triton-model-analyzer").version) class Profiler: def __init__( self, *, workspace: Workspace, triton_docker_image: str, gpus: List[str], verbose: bool = False, profile_config: ModelAnalyzerProfileConfig, triton_config: ModelAnalyzerTritonConfig, perf_measurement_config: PerfMeasurementConfig, dataset_profile_config: Optional[DatasetProfileConfig] = None, profiling_data_path: Optional[Path] = None, ): self._workspace = workspace self._triton_config = triton_config self._triton_docker_image = triton_docker_image self._profile_config = profile_config self._dataset_profile_config = dataset_profile_config self._profiling_data_path = profiling_data_path self._perf_measurement_config = perf_measurement_config self._config_generator: ProfileConfigGenerator = ProfileConfigGenerator( workspace=self._workspace, profile_config=self._profile_config, triton_config=triton_config, triton_docker_image=triton_docker_image, verbose=verbose, dataset_profile_config=dataset_profile_config, profiling_data_path=profiling_data_path, perf_measurement_config=perf_measurement_config, gpus=gpus, ) self._profile_config_path = self._config_generator.analyzer_path / "config-profile.yaml" self._verbose = verbose self._prepare_catalogs() def run(self) -> Path: config = self._config_generator.generate_config() self._profile_config_path.parent.mkdir(parents=True, exist_ok=True) with self._profile_config_path.open("w") as config_file: config_content = yaml.dump(config, Dumper=CustomDumper) LOGGER.debug("Triton Model Analyzer profile config:\n" f"{config_content}") config_file.write(config_content) analyzer_config = ModelAnalyzerConfig() analyzer_config["config-file"] = self._profile_config_path.as_posix() analyzer = ModelAnalyzer(config=analyzer_config) analyzer.run(mode=ModelAnalyzerMode.PROFILE, verbose=self._verbose) latest_checkpoint_path = self._find_latest_checkpoint() LOGGER.info(f"Triton Model Analyzer profiling done. Results are stored in {latest_checkpoint_path}") return latest_checkpoint_path def _find_latest_checkpoint(self): checkpoints_paths = sorted( self._config_generator.checkpoints_dir_path.glob("*.ckpt"), key=lambda path: int(path.stem), ) latest_checkpoint_path = checkpoints_paths[-1] if checkpoints_paths else None return latest_checkpoint_path def _prepare_catalogs(self): def _remove_and_create_dir(dir_path: Path): if dir_path.is_dir(): LOGGER.debug(f"Removing {dir_path}") shutil.rmtree(dir_path) dir_path.mkdir(parents=True) _remove_and_create_dir(self._config_generator.analyzer_path) class ProfileConfigGenerator(BaseConfigGenerator): def __init__( self, *, workspace: Workspace, profile_config: ModelAnalyzerProfileConfig, triton_config: ModelAnalyzerTritonConfig, perf_measurement_config: PerfMeasurementConfig, gpus: List[str], triton_docker_image: Optional[str] = None, verbose: int = 0, dataset_profile_config: Optional[DatasetProfileConfig] = None, profiling_data_path: Optional[Path] = None, ): super().__init__(workspace=workspace, verbose=verbose) self._analyzer_triton_log_path = self._analyzer_path / "triton.log" self._triton_config = triton_config self._triton_docker_image = triton_docker_image self._verbose = verbose self._profile_config = profile_config self._dataset_profile_config = dataset_profile_config self._profiling_data_path = profiling_data_path self._perf_measurement_config = perf_measurement_config self._gpus = gpus @property def triton_log_path(self) -> Path: return self._analyzer_triton_log_path.resolve() def generate_config(self): model_repository = self._triton_config.model_repository models_list = [model_dir.name for model_dir in model_repository.glob("*") if model_dir.is_dir()] LOGGER.info(f"Prepare profiling for {len(models_list)} models from {model_repository}:") for model_name in models_list: LOGGER.info(f"\t- {model_name}") model_names_with_profile_config = { model_name: self._get_profile_config_for_model(model_name) for model_name in models_list } if any(profile_config for model_name, profile_config in model_names_with_profile_config.items()): models_list = model_names_with_profile_config if self._profile_config.config_search_max_preferred_batch_size > 0: max_preferred_batch_size = self._profile_config.config_search_max_preferred_batch_size else: max_preferred_batch_size = 1 manual_config_search = all( isinstance(models_list, dict) and models_list[model_name].get("model_config_parameters") for model_name in models_list ) # https://github.com/triton-inference-server/model_analyzer/blob/r21.12/docs/config.md config = { "run_config_search_disable": manual_config_search, "profile_models": models_list, "triton_docker_image": self._triton_docker_image, "triton_launch_mode": self._triton_config.triton_launch_mode.value, "model_repository": model_repository.resolve().as_posix(), "checkpoint_directory": self._analyzer_checkpoints_dir_path.as_posix(), "output_model_repository_path": self.output_model_repository_path.as_posix(), "export_path": self._analyzer_path.resolve().as_posix(), "triton_server_flags": {"strict-model-config": False}, "run_config_search_max_concurrency": self._profile_config.config_search_max_concurrency, "run_config_search_max_instance_count": self._profile_config.config_search_max_instance_count, "run_config_search_max_preferred_batch_size": max_preferred_batch_size, "perf_analyzer_timeout": self._perf_measurement_config.perf_analyzer_timeout, "perf_analyzer_flags": self._get_perf_analyzer_flags(), "triton_server_path": self._triton_config.triton_server_path, "override_output_model_repository": True, "gpus": list(self._gpus), "summarize": self._verbose, "verbose": self._verbose, "perf_output": self._verbose, "triton_output_path": self.triton_log_path.as_posix(), } return config def _get_perf_analyzer_flags(self): configuration = {} if self._profiling_data_path: if TRITON_MODEL_ANALYZER_VERSION >= LooseVersion("1.8.0"): configuration["input-data"] = [self._profiling_data_path.as_posix()] else: configuration["input-data"] = self._profiling_data_path.as_posix() elif self._dataset_profile_config and self._dataset_profile_config.max_shapes: shapes = get_shape_params(self._dataset_profile_config) if TRITON_MODEL_ANALYZER_VERSION >= LooseVersion("1.8.0"): configuration["shape"] = shapes else: configuration["shape"] = " ".join(shapes) configuration["measurement-interval"] = self._perf_measurement_config.perf_measurement_interval configuration["measurement-mode"] = self._perf_measurement_config.perf_measurement_mode configuration["measurement-request-count"] = self._perf_measurement_config.perf_measurement_request_count return configuration def _get_profile_config_for_model(self, model_dir_name): original_model_config_path = self._triton_config.model_repository / model_dir_name / "config.pbtxt" original_model_config = TritonModelConfigGenerator.parse_triton_config_pbtxt(original_model_config_path) model_config = {} if self._profile_config.config_search_instance_counts: mapping = {DeviceKind.GPU: "KIND_GPU", DeviceKind.CPU: "KIND_CPU"} model_config["instance_group"] = [ {"kind": mapping[kind], "count": counts} for kind, counts in self._profile_config.config_search_instance_counts.items() ] if self._profile_config.config_search_max_batch_sizes: model_config["max_batch_size"] = self._profile_config.config_search_max_batch_sizes if self._profile_config.config_search_preferred_batch_sizes: model_config["dynamic_batching"] = { "preferred_batch_size": self._profile_config.config_search_preferred_batch_sizes } if self._profile_config.config_search_backend_parameters: original_backend_parameters = original_model_config.backend_parameters_config.triton_backend_parameters original_backend_parameters = { param_name: {"string_value": [param_value]} for param_name, param_value in original_backend_parameters.items() } model_config["parameters"] = { **original_backend_parameters, **{ param_name: {"string_value": list(map(str, param_values))} for param_name, param_values in self._profile_config.config_search_backend_parameters.items() }, } configuration = {} if model_config: configuration["model_config_parameters"] = model_config if self._profile_config.config_search_concurrency: configuration["parameters"] = {"concurrency": self._profile_config.config_search_concurrency} engine_count_per_device = original_model_config.instances_config.engine_count_per_device if self._profile_config.config_search_max_instance_count and engine_count_per_device: if len(set(engine_count_per_device)) > 1: raise ModelNavigatorProfileException( "Triton Model config instance group have more than 1 device kind. " "Use manual profile to swipe over instance group count" ) elif DeviceKind.CPU in engine_count_per_device: configuration["cpu_only"] = True return configuration
12,598
3,677
# The following comments couldn't be translated into the new config version: # Test storing OtherThing as well # Configuration file for PrePoolInputTest import FWCore.ParameterSet.Config as cms process = cms.Process("TEST2ND") process.load("FWCore.Framework.test.cmsExceptionsFatal_cff") #process.maxEvents = cms.untracked.PSet( # input = cms.untracked.int32(11) #) #process.Thing = cms.EDProducer("ThingProducer") process.output = cms.OutputModule("PoolOutputModule", outputCommands = cms.untracked.vstring('keep *', 'drop *_Thing_*_*'), fileName = cms.untracked.string('PoolInput2FileTest.root') ) process.OtherThing = cms.EDProducer("OtherThingProducer") process.source = cms.Source("PoolSource", fileNames = cms.untracked.vstring("file:PoolInputOther.root") ) process.p = cms.Path(process.OtherThing) process.ep = cms.EndPath(process.output)
906
311
import datetime import os, sys import numpy as np import matplotlib.pyplot as plt import casadi as cas ##### For viewing the videos in Jupyter Notebook import io import base64 from IPython.display import HTML # from ..</src> import car_plotting # from .import src.car_plotting PROJECT_PATH = '/home/nbuckman/Dropbox (MIT)/DRL/2020_01_cooperative_mpc/mpc-multiple-vehicles/' sys.path.append(PROJECT_PATH) import src.MPC_Casadi as mpc import src.car_plotting as cplot import src.TrafficWorld as tw np.set_printoptions(precision=2) import src.IterativeBestResponseMPCMultiple as mibr import pickle SAVE = False PLOT = False rounds_ibr = 225 n_other_cars = 4 N = 50 ###### LATEX Dimensions (Not currently Working) fig_width_pt = 246.0 # Get this from LaTeX using \showthe\columnwidth inches_per_pt = 1.0/72.27 # Convert pt to inches golden_mean = (np.sqrt(5)-1.0)/2.0 # Aesthetic ratio fig_width = fig_width_pt*inches_per_pt # width in inches fig_height =fig_width*golden_mean # height in inches fig_size = [fig_width,fig_height] fig_size = [6, 4] #################33 def find_t_final(x, goal_x): i_upper = np.searchsorted(x[0,:], goal_x) i_lower = i_upper - 1 dt = 0.2 # if i_upper >= x.shape[1]: # print(i_upper, x[0,i_lower]) # print("Check: %.03f < %.03f"%(x[0,i_lower], goal_x)) t_lower = i_lower*dt x_lower = x[0, i_lower] x_remaining = goal_x - x_lower v_x = np.cos(x[2, i_lower]) * x[4, i_lower] t_remaining = x_remaining / v_x t_final = t_lower + t_remaining # print("%.03f %.03f"%(t_lower, t_final)) return t_final #### STEP 1: Sort all the files into the correct SVO all_subdir = [ "20200301_215332random_ego", "20200301_215346random_pro", "20200301_215432random_altru", "20200301_215520random_pro", "20200301_215526random_altru", "20200301_215537random_ego", "20200301_215551random_pro", "20200301_215602random_altru", "20200301_215608random_ego", "20200301_215623random_pro", "20200301_215629random_altru", "20200301_215636random_ego", "20200301_215652random_pro", "20200301_215658random_altru", "20200301_215703random_ego", "20200301_215713random_pro", "20200301_215724random_altru", "20200301_215742random_ego", "20200301_215751random_pro", "20200301_215757random_altru", "20200301_215806random_ego", "20200302_104840random_1p", "20200302_104913random_2p", "20200302_104916random_3p", "20200302_104920random_4p", "20200302_104926random_1e", "20200302_104941random_2e", "20200302_104946random_3e", "20200302_105002random_4e", "20200302_105059random_1a", "20200302_105101random_2a", "20200302_105104random_3a", "20200302_105108random_4a", "20200302_114834random_5e", "20200302_114839random_6e", "20200302_114841random_7e", "20200302_114844random_8e", "20200302_114853random_5p", "20200302_114856random_6p", "20200302_114859random_7p", "20200302_114902random_8p", "20200302_114909random_5a", "20200302_114912random_6a", "20200302_114914random_7a", "20200302_114916random_8a", "20200227_133704less_kxdotlarger", "20200228_114359random_pro", "20200228_114437random_pro", "20200228_114440random_pro", "20200228_114443random_pro", "20200228_114448random_pro", "20200228_114450random_pro", "20200228_114913random_pro", "20200228_114914random_pro", "20200228_114916random_pro", "20200228_114917random_pro", "20200227_142916pi_01_ego", "20200228_114517random_ego", "20200228_114518random_ego", "20200228_114528random_ego", "20200228_114532random_ego", "20200228_114547random_ego", "20200228_114551random_ego", "20200228_114803random_ego", "20200228_114805random_ego", "20200228_114806random_ego", "20200227_141954pi2_5altru", "20200228_114501random_altru", "20200228_114503random_altru", "20200228_114505random_altru", "20200228_114506random_altru", "20200228_114507random_altru", "20200228_114509random_altru", "20200228_114850random_altru", "20200228_114851random_altru", "20200228_114852random_altru", ] subdir_name_prosocial_list = [] subdir_name_ego_list = [] subdir_name_altruistic_list = [] altr_theta = [] ego_theta = [] pro_theta = [] NO_GRASS = False world = tw.TrafficWorld(2, 0, 1000) for subdir in all_subdir: try: file_name = "results/" + subdir+"/data/"+"mpc3.p" mpc = pickle.load(open(file_name,'rb')) if mpc.min_y < -999999 or mpc.max_y > 9999999: print("Messed up ymin/max", file_name) continue elif mpc.min_y > world.y_min + 0.000001: print("Grass is NOT allowed!", file_name) if not NO_GRASS: print("Too grass lmmited, ignored", file_name) continue elif mpc.min_y <= world.y_min + 0.00001: print("Grass is allowed!", file_name) if NO_GRASS: print("NO Grass, dataset ignored", file_name) continue if mpc.theta_iamb > np.pi/3: subdir_name_altruistic_list += [subdir] altr_theta += [mpc.theta_iamb] elif mpc.theta_iamb <= np.pi/6.0: subdir_name_ego_list += [subdir] ego_theta += [mpc.theta_iamb] else: subdir_name_prosocial_list += [subdir] pro_theta += [mpc.theta_iamb] except FileNotFoundError: print("Not found:", file_name) print("Atruistic np.pi/2 = 1.5ish") print(subdir_name_altruistic_list) print(altr_theta) print("Egoistic 0") print(subdir_name_ego_list) print(ego_theta) print("Pro-Social", np.pi/2) print(subdir_name_prosocial_list) print(pro_theta) # subdir_name_prosocial_list = [ # "20200227_133704less_kxdotlarger", # "20200228_114359random_pro", # "20200228_114437random_pro", # "20200228_114440random_pro", # "20200228_114443random_pro", # "20200228_114448random_pro", # "20200228_114450random_pro", # "20200228_114913random_pro", # "20200228_114914random_pro", # "20200228_114916random_pro", # "20200228_114917random_pro", # ] # subdir_name_prosocial = "20200227_133704less_kxdotlarger" # folder_prosocial = "results/" + subdir_name_prosocial + "/" # subdir_name_ego_list = [ # "20200227_142916pi_01_ego", # "20200228_114517random_ego", # "20200228_114518random_ego", # "20200228_114528random_ego", # "20200228_114532random_ego", # "20200228_114547random_ego", # "20200228_114551random_ego", # "20200228_114803random_ego", # "20200228_114805random_ego", # "20200228_114806random_ego", # ] # subdir_name_ego = "20200227_142916pi_01_ego" # folder_ego = "results/" + subdir_name_ego + "/" # subdir_name_altruistic_list = [ # "20200227_141954pi2_5altru", # "20200228_114501random_altru", # "20200228_114503random_altru", # "20200228_114505random_altru", # "20200228_114506random_altru", # "20200228_114507random_altru", # "20200228_114509random_altru", # "20200228_114850random_altru", # "20200228_114851random_altru", # "20200228_114852random_altru"] # subdir_name_altruistic = "20200227_141954pi2_5altru" # folder_altruistic = "results/" + subdir_name_altruistic + "/" ################ Analyze Results all_xamb_pro = [] all_uamb_pro = [] all_other_x_pro = [] all_other_u_pro = [] ibr_brounds_array_pro = [] all_xamb_ego = [] all_uamb_ego = [] all_other_x_ego = [] all_other_u_ego = [] ibr_brounds_array_ego = [] all_xamb_altru = [] all_uamb_altru = [] all_other_x_altru = [] all_other_u_altru = [] ibr_brounds_array_altru = [] all_tfinalamb_pro = [] all_tfinalamb_ego = [] all_tfinalamb_altru = [] for sim_i in range(3): if sim_i==0: subdir_name_list = subdir_name_prosocial_list elif sim_i==1: subdir_name_list = subdir_name_ego_list else: subdir_name_list = subdir_name_altruistic_list for folder in subdir_name_list: n_full_rounds = 0 # rounods that the ambulance planned n_all_rounds = 0 all_xamb = np.zeros((6, N+1, rounds_ibr)) all_uamb = np.zeros((2, N, rounds_ibr)) all_xcost = np.zeros((3, rounds_ibr)) all_tfinalamb = np.zeros((1, rounds_ibr)) all_other_x = [np.zeros((6, N+1, rounds_ibr)) for i in range(n_other_cars)] all_other_u = [np.zeros((2, N, rounds_ibr)) for i in range(n_other_cars)] all_other_cost = [np.zeros((3, rounds_ibr)) for i in range(n_other_cars)] all_other_tfinal = [np.zeros((1, rounds_ibr)) for i in range(n_other_cars)] for amb_ibr_i in range(rounds_ibr): if (amb_ibr_i % (n_other_cars + 1) == 1) and amb_ibr_i>51: # We only look at sims when slack activated ibr_prefix = '%03d'%amb_ibr_i try: xamb, uamb, xamb_des, xothers, uothers, xothers_des = mibr.load_state("results/" + folder + "/" + "data/" + ibr_prefix, n_other_cars) all_xamb[:,:,n_full_rounds] = xamb all_uamb[:,:,n_full_rounds] = uamb x_goal = 130 all_tfinalamb[:, n_full_rounds] = find_t_final(xamb, x_goal) for i in range(n_other_cars): all_other_x[i][:,:,n_full_rounds] = xothers[i] all_other_u[i][:,:,n_full_rounds] = uothers[i] # all_other_tfinal[i][:,n_full_rounds] = find_t_final(xothers[i], 120) n_full_rounds += 1 except FileNotFoundError: # print("amb_ibr_i %d missing"%amb_ibr_i) pass n_all_rounds += 1 ### Clip the extra dimension all_xamb = all_xamb[:,:,:n_full_rounds] all_uamb = all_uamb[:,:,:n_full_rounds] all_tfinalamb = all_tfinalamb[:,:n_full_rounds] for i in range(n_other_cars): all_other_x[i] = all_other_x[i][:,:,:n_full_rounds] all_other_u[i] = all_other_u[i][:,:,:n_full_rounds] ibr_brounds_array = np.array(range(1, n_full_rounds +1)) if n_full_rounds > 0 : # only save those that meet slack requirement if sim_i==0: #prosocial directory all_xamb_pro += [all_xamb] all_uamb_pro += [all_uamb] all_other_x_pro += [all_other_x] all_other_u_pro += [all_other_u] ibr_brounds_array_pro += [ibr_brounds_array] all_tfinalamb_pro += [all_tfinalamb] elif sim_i==1: #egoistic directory all_xamb_ego += [all_xamb] all_uamb_ego += [all_uamb] all_other_x_ego += [all_other_x] all_other_u_ego += [all_other_u] ibr_brounds_array_ego += [ibr_brounds_array] all_tfinalamb_ego += [all_tfinalamb] else: #altruistic directory all_xamb_altru += [all_xamb] all_uamb_altru += [all_uamb] all_other_x_altru += [all_other_x] all_other_u_altru += [all_other_u] ibr_brounds_array_altru += [ibr_brounds_array] all_tfinalamb_altru += [all_tfinalamb] else: print("No slack eligible", folder) ### SAVING IN PROSOCIAL'S DIRECTORy folder = "random" #<---- fig_trajectory, ax_trajectory = plt.subplots(1,1) ax_trajectory.set_title("Ambulance Trajectories") # fig_trajectory.set_figheight(fig_height) # fig_trajectory.set_figwidth(fig_width) fig_trajectory.set_size_inches((8,6)) print(len(all_xamb_pro)) print(all_xamb_pro[0].shape) ax_trajectory.plot(all_xamb_pro[0][0,:,-1], all_xamb_pro[0][1,:,-1], '-o', label="Prosocial") ax_trajectory.plot(all_xamb_ego[0][0,:,-1], all_xamb_ego[0][1,:,-1], '-o', label="Egoistic") ax_trajectory.plot(all_xamb_altru[0][0,:,-1], all_xamb_altru[0][1,:,-1], '-o', label="Altruistic") ax_trajectory.set_xlabel("X [m]") ax_trajectory.set_ylabel("Y [m]") if SAVE: fig_file_name = folder + 'plots/' + 'cfig1_amb_trajectory.eps' fig_trajectory.savefig(fig_file_name, dpi=95, format='eps') print("Save to....", fig_file_name) ##########################################333333 svo_labels = ["Egoistic", "Prosocial", "Altruistic"] fig_uamb, ax_uamb = plt.subplots(3,1) fig_uamb.set_size_inches((8,8)) fig_uamb.suptitle("Ambulance Control Input over IBR Iterations") # ax_uamb[0].plot(ibr_brounds_array, np.sum(all_uamb[0,:,:] * all_uamb[0,:,:], axis=0), '-o') ax_uamb[0].bar(range(3), [ np.mean([np.sum(all_x[0,:,-1] * all_x[0,:,-1],axis=0) for all_x in all_uamb_ego]), np.mean([np.sum(all_x[0,:,-1] * all_x[0,:,-1],axis=0) for all_x in all_uamb_pro]), np.mean([np.sum(all_x[0,:,-1] * all_x[0,:,-1],axis=0) for all_x in all_uamb_altru])] ) # ax_uamb[0].set_xlabel("IBR Iteration") ax_uamb[0].set_ylabel(r"$\sum u_{\delta}^2$") ax_uamb[0].set_xticks(range(3)) ax_uamb[0].set_xticklabels(svo_labels) ax_uamb[1].bar(range(3), [ np.mean([np.sum(all_x[1,:,-1] * all_x[1,:,-1],axis=0) for all_x in all_uamb_ego]), np.mean([np.sum(all_x[1,:,-1] * all_x[1,:,-1],axis=0) for all_x in all_uamb_pro]), np.mean([np.sum(all_x[1,:,-1] * all_x[1,:,-1],axis=0) for all_x in all_uamb_altru])] ) # ax_uamb[1].set_xlabel("IBR Iteration") ax_uamb[1].set_ylabel(r"$\sum u_{v}^2$") ax_uamb[1].set_xticks(range(3)) ax_uamb[1].set_xticklabels(svo_labels) # ax_uamb[2].bar(range(3), [ # np.sum(all_uamb_ego[0,:,-1] * all_uamb_ego[0,:,-1],axis=0) + np.sum(all_uamb_ego[1,:,-1] * all_uamb_ego[1,:,-1],axis=0), # np.sum(all_uamb_pro[0,:,-1] * all_uamb_pro[1,:,-1], axis=0) + np.sum(all_uamb_pro[1,:,-1] * all_uamb_pro[1,:,-1], axis=0), # np.sum(all_uamb_altru[0,:,-1] * all_uamb_altru[0,:,-1],axis=0) + np.sum(all_uamb_altru[1,:,-1] * all_uamb_altru[1,:,-1],axis=0)],) # ax_uamb[2].set_xlabel("Vehicles' Social Value Orientation") # ax_uamb[2].set_ylabel("$\sum ||u||^2$") ax_uamb[1].set_xticks(range(3)) ax_uamb[1].set_xticklabels(svo_labels) if SAVE: fig_file_name = folder + 'plots/' + 'cfig2_amb_ctrl_iterations.eps' fig_uamb.savefig(fig_file_name, dpi=95, format='eps') print("Save to....", fig_file_name) ########################################################## #### Convergence ######################################################### fig_reluamb, ax_reluamb = plt.subplots(2,1) # fig_reluamb.set_figheight(fig_height) # fig_reluamb.set_figwidth(fig_width) fig_reluamb.set_size_inches((8,6)) for sim_i in range(3): if sim_i==0: #prosocial directory all_uamb = all_uamb_ego label = "Egoistic" ibr_brounds_array = ibr_brounds_array_ego elif sim_i==1: #egoistic directory all_uamb = all_uamb_pro label = "Prosocial" ibr_brounds_array = ibr_brounds_array_pro else: #altruistic directory all_uamb = all_uamb_altru all_other_u = all_other_u_altru label = "Altruistic" ibr_brounds_array = ibr_brounds_array_altru ax_reluamb[0].plot(ibr_brounds_array[0][1:], np.sum((all_uamb[0][0,:,1:]-all_uamb[0][0,:,0:-1])*(all_uamb[0][0,:,1:]-all_uamb[0][0,:,0:-1]), axis=0), '-o', label=label) ax_reluamb[1].plot(ibr_brounds_array[0][1:], np.sum((all_uamb[0][1,:,1:]-all_uamb[0][1,:,0:-1])*(all_uamb[0][1,:,1:]-all_uamb[0][1,:,0:-1]), axis=0), '-o', label=label) ax_reluamb[0].set_ylabel("$\sum (u_{v\delta,t}-u_{\delta,t-1})^2$") ax_reluamb[1].set_xlabel("IBR Iteration") ax_reluamb[1].set_ylabel("$\sum (u_{v,t}-u_{v,t-1})^2$") ax_reluamb[0].legend() ax_reluamb[1].legend() fig_reluamb.suptitle("Change in Ambulance Control Input over IBR Iterations") if SAVE: fig_file_name = folder + 'plots/' + 'cfig3_change_amb_ctrl_iterations.eps' fig_reluamb.savefig(fig_file_name, dpi=95, format='eps') print("Save to....", fig_file_name) ###################################################################3 ################################################################## fig_xfinal, ax_xfinal = plt.subplots(2,1) fig_xfinal.suptitle("Final Ambulance State Over Iterations") fig_xfinal.set_size_inches((8,6)) # fig_xfinal.set_figheight(fig_height) # fig_xfinal.set_figwidth(fig_width) for sim_i in range(3): if sim_i==0: #prosocial directory all_uamb = all_uamb_ego all_xamb = all_xamb_ego all_other_x = all_other_x_ego label = "Egoistic" ibr_brounds_array = ibr_brounds_array_ego elif sim_i==1: #egoistic directory all_uamb = all_uamb_pro all_xamb = all_xamb_pro all_other_x = all_other_x_pro label = "Prosocial" ibr_brounds_array = ibr_brounds_array_pro else: #altruistic directory all_uamb = all_uamb_altru all_xamb = all_xamb_altru all_other_x = all_other_x_altru all_other_u = all_other_u_altru label = "Altruistic" ibr_brounds_array = ibr_brounds_array_altru ax_xfinal[0].plot(ibr_brounds_array[0], all_xamb[0][0,-1,:], '-o', label=label) ax_xfinal[1].plot(ibr_brounds_array[0], all_xamb[0][2,-1,:], '-o', label=label) # ax_reluamb[0].set_xlabel("IBR Iteration") ax_xfinal[0].set_ylabel("$x_{final}$") ax_xfinal[0].legend() ax_xfinal[1].set_xlabel("IBR Iteration") ax_xfinal[1].set_ylabel(r"$\Theta_{final}$") ax_xfinal[1].legend() if SAVE: fig_file_name = folder + 'plots/' + 'cfig4_iterations_ambperformance.eps' fig_xfinal.savefig(fig_file_name, dpi=95, format='eps') print("Save to....", fig_file_name) ################################################################################ ###################### NOW PLOTTING THE OTHER VEHICLES ######################### fig_xfinal_all, ax_xfinal_all = plt.subplots(3,1) fig_xfinal_all.suptitle("Comparing Distance Travel for the Vehicles") fig_xfinal_all.set_size_inches((8,8)) # fig_xfinal_all.set_figheight(fig_height) # fig_xfinal_all.set_figwidth(fig_width) for sim_i in range(3): if sim_i==0: #prosocial directory all_uamb = all_uamb_ego all_xamb = all_xamb_ego all_other_x = all_other_x_ego label = "Egoistic" ibr_brounds_array = ibr_brounds_array_ego elif sim_i==1: #egoistic directory all_uamb = all_uamb_pro all_xamb = all_xamb_pro all_other_x = all_other_x_pro label = "Prosocial" ibr_brounds_array = ibr_brounds_array_pro else: #altruistic directory all_uamb = all_uamb_altru all_xamb = all_xamb_altru all_other_x = all_other_x_altru all_other_u = all_other_u_altru label = "Altruistic" ibr_brounds_array = ibr_brounds_array_altru bar_width = 0.5 inter_car_width = 2*bar_width width_offset = bar_width*sim_i ticks = [width_offset + (2*bar_width + inter_car_width)*c for c in range(n_other_cars + 1)] # print(len(all_ither_x)) # ax_xfinal_all[0].bar(ticks, # [np.mean([all_x[0, -1, -1] - all_x[0, 0, -1] for all_x in all_xamb])] + [np.mean(all_o_x[i][0,-1,-1] - all_o_x[i][0,0,-1]) for i in range(n_other_cars) for all_o_x in all_other_x], # bar_width, label=label) # ax_xfinal_all[0].set_xticks(range(n_other_cars + 1)) # ax_xfinal_all[0].set_xticklabels(["A"] + [str(i) for i in range(1, n_other_cars+1)]) # ax_xfinal_all[1].bar(ticks, # [all_xamb[-1, -1, -1] - all_xamb[-1, 0, -1]] + [all_other_x[i][-1,-1,-1] - all_other_x[i][-1,0,-1] for i in range(n_other_cars)], # bar_width, label=label) # # ax_xfinal_all[1].set_xticks(range(n_other_cars + 1)) # # ax_xfinal_all[1].set_xticklabels(["A"] + [str(i) for i in range(1, n_other_cars+1)]) # ax_xfinal_all[2].bar(ticks, # [np.sum(all_xamb[2,:,-1]*all_xamb[2,:,-1])] + [np.sum(all_other_x[i][2,:,-1]*all_other_x[i][2,:,-1]) for i in range(n_other_cars)], # bar_width, label=label) width_offset = bar_width*1 ticks = [width_offset + (2*bar_width + inter_car_width)*c for c in range(n_other_cars + 1)] ax_xfinal_all[2].legend() ax_xfinal_all[2].set_xticks(ticks) ax_xfinal_all[2].set_xticklabels(["A"] + [str(i) for i in range(1, n_other_cars+1)]) ax_xfinal_all[0].set_ylabel("Horizontal Displacement $\Delta x$") ax_xfinal_all[0].legend() ax_xfinal_all[0].set_xticks(ticks) ax_xfinal_all[0].set_xticklabels(["A"] + [str(i) for i in range(1, n_other_cars+1)]) ax_xfinal_all[1].set_ylabel("Total Distance $s_f - s_i$") ax_xfinal_all[1].legend() ax_xfinal_all[1].set_xticks(ticks) ax_xfinal_all[1].set_xticklabels(["A"] + [str(i) for i in range(1, n_other_cars+1)]) ax_xfinal_all[2].set_ylabel("Angular Deviation $\sum_{t} \Theta_t^2$") if SAVE: fig_file_name = folder + 'plots/' + 'cfig5_vehicles_comparison.eps' fig_xfinal_all.savefig(fig_file_name, dpi=95, format='eps') print("Save to....", fig_file_name) #########################Let's Reproduce the Table ####################33 print("Amb X Final Avg. Min. Max. ") final_metric_ego = [all_x[0,-1,-1] for all_x in all_xamb_ego] final_metric_pro = [all_x[0,-1,-1] for all_x in all_xamb_pro] final_metric_altru = [all_x[0,-1,-1] for all_x in all_xamb_altru] # print("Egoistic & %.02f & %.02f & %.02f & %.02f"%(all_xamb_ego[0,-1,-1], np.mean(all_xamb_ego[0,-1,:]), np.min(all_xamb_ego[0,-1,:]), np.max(all_xamb_ego[0,-1,:]))) # print("Prosocial & %.02f & %.02f & %.02f & %.02f"%(all_xamb_pro[0,-1,-1], np.mean(all_xamb_pro[0,-1,:]), np.min(all_xamb_pro[0,-1,:]), np.max(all_xamb_pro[0,-1,:]))) # print("Altruistic & %.02f & %.02f & %.02f & %.02f"%(all_xamb_altru[0,-1,-1], np.mean(all_xamb_altru[0,-1,:]), np.min(all_xamb_altru[0,-1,:]), np.max(all_xamb_altru[0,-1,:]))) print("Egoistic & %.02f (%.02f) & %.02f & %.02f"%(np.mean(final_metric_ego), np.std(final_metric_ego), np.min(final_metric_ego), np.max(final_metric_ego))) print("Prosocial & %.02f (%.02f) & %.02f & %.02f"%(np.mean(final_metric_pro), np.std(final_metric_pro), np.min(final_metric_pro), np.max(final_metric_pro))) print("Altruistic & %.02f (%.02f) & %.02f & %.02f"%(np.mean(final_metric_altru), np.std(final_metric_altru), np.min(final_metric_altru), np.max(final_metric_altru))) final_metric_ego = [t_final[:,-1] for t_final in all_tfinalamb_ego] final_metric_pro = [t_final[:,-1] for t_final in all_tfinalamb_pro] final_metric_altru = [t_final[:,-1] for t_final in all_tfinalamb_altru] # print(all_tfinalamb_ego[0].shape) # print(final_metric_ego) # print(final_metric_ego.shape) # print("Egoistic & %.02f & %.02f & %.02f & %.02f"%(all_xamb_ego[0,-1,-1], np.mean(all_xamb_ego[0,-1,:]), np.min(all_xamb_ego[0,-1,:]), np.max(all_xamb_ego[0,-1,:]))) # print("Prosocial & %.02f & %.02f & %.02f & %.02f"%(all_xamb_pro[0,-1,-1], np.mean(all_xamb_pro[0,-1,:]), np.min(all_xamb_pro[0,-1,:]), np.max(all_xamb_pro[0,-1,:]))) # print("Altruistic & %.02f & %.02f & %.02f & %.02f"%(all_xamb_altru[0,-1,-1], np.mean(all_xamb_altru[0,-1,:]), np.min(all_xamb_altru[0,-1,:]), np.max(all_xamb_altru[0,-1,:]))) print("Time To "+str(x_goal)+"m") print("Egoistic & %.02f (%.02f) & %.02f & %.02f %d"%(np.mean(final_metric_ego), np.std(final_metric_ego), np.min(final_metric_ego), np.max(final_metric_ego),len(final_metric_ego))) print("Prosocial & %.02f (%.02f) & %.02f & %.02f %d"%(np.mean(final_metric_pro), np.std(final_metric_pro), np.min(final_metric_pro), np.max(final_metric_pro),len(final_metric_pro))) print("Altruistic & %.02f (%.02f) & %.02f & %.02f %d"%(np.mean(final_metric_altru), np.std(final_metric_altru), np.min(final_metric_altru), np.max(final_metric_altru),len(final_metric_altru))) print("Veh 1 Final Avg. Min. Max. ") i = 0 veh_displace_ego = [all_other_x[i][0,-1,-1] - all_other_x[i][0,0,-1] for all_other_x in all_other_x_ego] veh_displace_pro = [all_other_x[i][0,-1,-1] - all_other_x[i][0,0,-1] for all_other_x in all_other_x_pro] veh_displace_altru = [all_other_x[i][0,-1,-1] - all_other_x[i][0,0,-1] for all_other_x in all_other_x_altru] print(" ") print("Egoistic & %.02f (%.02f) & %.02f & %.02f"%(np.mean(veh_displace_ego), np.std(veh_displace_ego), np.min(veh_displace_ego), np.max(veh_displace_ego))) print("Prosocial & %.02f (%.02f) & %.02f & %.02f "%(np.mean(veh_displace_pro), np.std(veh_displace_pro), np.min(veh_displace_pro), np.max(veh_displace_pro))) print("Altruistic & %.02f (%.02f) & %.02f & %.02f "%( np.mean(veh_displace_altru), np.std(veh_displace_altru), np.min(veh_displace_altru), np.max(veh_displace_altru))) if PLOT: plt.show()
24,165
11,427
import numpy as np from tensorflow.keras.callbacks import TensorBoard import cv2 import sys import threading import keras from keras.layers import Conv2D,Dense,MaxPooling2D,Flatten,BatchNormalization,Dropout from IPython.display import display from PIL import Image import tensorflow as tf np.random.seed(1) with tf.device('/gpu:0'): keras_data=keras.preprocessing.image.ImageDataGenerator() path1="D:\\tiroida\\celule\\leucemie_train" date1 = keras_data.flow_from_directory(path1, target_size = (450, 450),batch_size=32, classes = ["normal","leucemie"], class_mode = "binary") path2="D:\\tiroida\\celule\\leucemie_test" date2 = keras_data.flow_from_directory(path2, target_size = (450, 450),batch_size=100, classes = ["normal","leucemie"], class_mode = "binary") tfmodel=keras.models.Sequential() tfmodel.add(Conv2D(filters=4,kernel_size=(3,3), padding='same',activation="relu",input_shape=(450,450,3))) tfmodel.add(MaxPooling2D(pool_size=(2,2))) tfmodel.add(Conv2D(filters=8, kernel_size=(3,3), activation="relu",padding='same')) tfmodel.add(Conv2D(filters=8, kernel_size=(3,3), activation="relu",padding='same')) tfmodel.add(BatchNormalization()) tfmodel.add(MaxPooling2D(pool_size=(2,2))) tfmodel.add(Conv2D(filters=8, kernel_size=(3,3), activation="relu",padding='same')) tfmodel.add(Conv2D(filters=16, kernel_size=(3,3), activation="relu",padding='same')) tfmodel.add(BatchNormalization()) tfmodel.add(MaxPooling2D(pool_size=(2,2))) tfmodel.add(Flatten()) tfmodel.add(Dense(16, activation="relu")) tfmodel.add(Dense(1, activation="sigmoid")) tfmodel.compile(optimizer='Adam',loss="binary_crossentropy", metrics=["accuracy"]) checkpoint = keras.callbacks.ModelCheckpoint(filepath='leucemie.h5', save_best_only=True,monitor='val_acc') tfmodel.fit_generator(date1,validation_data=date2,epochs=10,steps_per_epoch=100,validation_steps=1,callbacks=[checkpoint]) model=keras.models.load_model('leucemie.h5') print(model.evaluate_generator(date2,steps=1)) input()
2,082
774
#!/usr/bin/env python import distutils from setupfiles.dist import DistributionMetadata from setupfiles.setup import setup __all__ = ["setup"] distutils.dist.DistributionMetadata = DistributionMetadata distutils.core.setup = setup
233
61
import Gramatica def testSeparadorDeSilabas(entrada, esperado): try: salida = Gramatica.separarEnSilabas(entrada) except Gramatica.NoHayVocal: print("[ERROR]","Salida esperada:", "\"" + esperado + "\"", "|", "Salida obtenida:", "Excepcion: No hay vocal") return if esperado != salida: print("[ERROR]","Salida esperada:", "\"" + esperado + "\"", "|", "Salida obtenida:", "\"" + salida + "\"") else: print("[OK]","Entrada:", "\"" + entrada + "\"", "|", "Salida:", "\"" + salida + "\"") testSeparadorDeSilabas("AprEnDer", "A-prEn-Der") testSeparadorDeSilabas("ÉpiCo", "É-pi-Co") testSeparadorDeSilabas("PÓDIO", "PÓ-DIO") testSeparadorDeSilabas("aprender", "a-pren-der") testSeparadorDeSilabas("tabla", "ta-bla") testSeparadorDeSilabas("ratón", "ra-tón") testSeparadorDeSilabas("épico", "é-pi-co") testSeparadorDeSilabas("brocha", "bro-cha") # grupos consonanticos br, cr, dr, gr, fr, kr, tr, bl, cl, gl, fl, kl, pl son inseparables testSeparadorDeSilabas("abrazo", "a-bra-zo") testSeparadorDeSilabas("submarino", "sub-ma-ri-no") # los prefijos pueden o no separarse testSeparadorDeSilabas("perspicacia", "pers-pi-ca-cia") # 3 consonantes consecutivas, 2 van a la silaba anterior y 1 a la siguiente testSeparadorDeSilabas("conspirar", "cons-pi-rar") testSeparadorDeSilabas("obscuro", "obs-cu-ro") testSeparadorDeSilabas("irreal", "i-rre-al") # no se pueden separar las rr testSeparadorDeSilabas("acallar", "a-ca-llar") # no se pueden separar las ll testSeparadorDeSilabas("abstracto", "abs-trac-to") # 4 consonantes consecutivas, 2 van a la silaba anterior y 2 a la siguiente testSeparadorDeSilabas("rubia", "ru-bia") # los diptongos no se separan testSeparadorDeSilabas("labio", "la-bio") testSeparadorDeSilabas("caigo", "cai-go") testSeparadorDeSilabas("oigo", "oi-go") testSeparadorDeSilabas("descafeinado", "des-ca-fei-na-do") testSeparadorDeSilabas("diurno", "diur-no") testSeparadorDeSilabas("ruido", "rui-do") testSeparadorDeSilabas("pódio", "pó-dio") testSeparadorDeSilabas("aplanar", "a-pla-nar") testSeparadorDeSilabas("ocre", "o-cre") testSeparadorDeSilabas("archi", "ar-chi") testSeparadorDeSilabas("leer", "le-er") testSeparadorDeSilabas("caos", "ca-os") testSeparadorDeSilabas("baúl", "ba-úl") testSeparadorDeSilabas("ambiguo", "am-bi-guo") testSeparadorDeSilabas("antifaz", "an-ti-faz") testSeparadorDeSilabas("transplantar", "trans-plan-tar") testSeparadorDeSilabas("substraer", "subs-tra-er") testSeparadorDeSilabas("abstraer", "abs-tra-er") testSeparadorDeSilabas("abstracto", "abs-trac-to") testSeparadorDeSilabas("pingüino", "pin-güi-no") testSeparadorDeSilabas("vergüenza", "ver-güen-za") testSeparadorDeSilabas("bilingüe", "bi-lin-güe") testSeparadorDeSilabas("baúl ocre", "ba-úl o-cre") testSeparadorDeSilabas("", "") testSeparadorDeSilabas(" ", " ") testSeparadorDeSilabas(" ", " ") testSeparadorDeSilabas("k", "k") testSeparadorDeSilabas("1", "1") testSeparadorDeSilabas("abstraer abstracto", "abs-tra-er abs-trac-to")
3,002
1,256
# # Minify JSON data files in the `/dist` directory. # Script invoked by the npm postbuild script after building the project with `npm run build`. # from os import ( path, listdir, fsdecode ) import json from datetime import datetime class JSONMinifier: DIST_CONSTITUENT_DATA_DIRECTORY = path.abspath(path.join(path.dirname(__file__), '..', 'dist', 'assets', 'data')) DIST_SNAPSHOT_DATA_DIRECTORY = path.abspath(path.join(path.dirname(__file__), '..', 'dist', 'assets', 'data')) def minify_json(self, directory): for file in listdir(directory): filename = fsdecode(file) if filename.endswith(".json"): with open(path.join(directory, filename), "r+") as f: data = json.loads(f.read()) f.seek(0) f.write(json.dumps(data, separators=(',', ':'))) f.truncate() print(f"{datetime.now().strftime('%Y/%m/%d %H:%M:%S')} | Minified {filename}") if __name__ == '__main__': minifier = JSONMinifier() minifier.minify_json(minifier.DIST_CONSTITUENT_DATA_DIRECTORY) minifier.minify_json(minifier.DIST_SNAPSHOT_DATA_DIRECTORY)
1,201
397
import subprocess import platform from Scripts import plist, utils class CPUName: def __init__(self, **kwargs): self.u = utils.Utils("CPU-Name") self.plist_path = None self.plist_data = {} self.clear_empty = True self.detected = self.detect_cores() self.cpu_model = self.detect_cpu_model() def ensure_path(self, plist_data, path_list, final_type = list): if not path_list: return plist_data last = plist_data for index,path in enumerate(path_list): if not path in last: if index >= len(path_list)-1: last[path] = final_type() else: last[path] = {} last = last[path] return plist_data def select_plist(self): while True: self.u.head("Select Plist") print("") print("M. Return To Menu") print("Q. Quit") print("") plist_path = self.u.grab("Please drag and drop your config.plist here: ") if not len(plist_path): continue elif plist_path.lower() == "m": return elif plist_path.lower() == "q": self.u.custom_quit() path_checked = self.u.check_path(plist_path) if not path_checked: continue # Got a valid path here - let's try to load it try: with open(path_checked,"rb") as f: plist_data = plist.load(f) if not isinstance(plist_data,dict): raise Exception("Plist root is not a dictionary") except Exception as e: self.u.head("Error Loading Plist") print("\nCould not load {}:\n\n{}\n\n".format(path_checked,repr(e))) self.u.grab("Press [enter] to return...") continue # Got valid plist data - let's store the vars and return self.plist_path = path_checked self.plist_data = plist_data return (path_checked,plist_data) def get_value(self, plist_data, search="revcpuname"): boot_args = plist_data.get("NVRAM",{}).get("Add",{}).get("7C436110-AB2A-4BBB-A880-FE41995C9F82",{}).get("boot-args","") nvram_val = plist_data.get("NVRAM",{}).get("Add",{}).get("4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102",{}).get(search,"") boota_val = "" for arg in boot_args.split(): if not arg.startswith(search+"="): continue boota_val = arg.split("=")[-1] break # Only take the first instance return (boota_val,nvram_val) def get_cpu_name(self, plist_data): return self.get_value(plist_data,"revcpuname") def get_rev_cpu(self, plist_data): return self.get_value(plist_data,"revcpu") def get_proc_type(self, plist_data): return plist_data.get("PlatformInfo",{}).get("Generic",{}).get("ProcessorType",0) def get_kext(self, plist_data): kext_list = plist_data.get("Kernel",{}).get("Add",[]) found = enabled = False for kext in kext_list: if kext.get("ExecutablePath","").lower() == "contents/macos/restrictevents": found = True if kext.get("Enabled"): enabled = True break return (found,enabled) def get_new_proc_type(self, plist_data): while True: p_type = self.get_proc_type(plist_data) p_label = " (8+ Core)" if p_type == 3841 else " (1, 2, 4, or 6 Core)" if p_type == 1537 else " (Must be 0x0601 or 0x0F01 to work)" self.u.head("ProcessorType") print("") print("Current Processor Type: {}{}".format(self.get_hex(p_type),p_label)) print("") print("1. Set to 0x0601 for 1, 2, 4, or 6 Core") print("2. Set to 0x0F01 for 8+ Core") print("3. Reset to the default 0x00") print("") if self.detected != -1: print("L. Use Local Machine's Value ({:,} Core{} = {})".format(self.detected, "" if self.detected==1 else "s", "0x0601" if self.detected < 8 else "0x0F01")) print("M. Return To Menu") print("Q. Quit") print("") proc = self.u.grab("Please select an option: ") if not len(proc): continue if proc.lower() == "m": return None elif proc.lower() == "q": self.u.custom_quit() elif proc == "1": return 1537 elif proc == "2": return 3841 elif proc == "3": return 0 elif self.detected != -1 and proc.lower() == "l": return 1537 if self.detected < 8 else 3841 def detect_cpu_model(self): try: _platform = platform.system().lower() if _platform == "darwin": return subprocess.check_output(["sysctl", "-n", "machdep.cpu.brand_string"]).decode().strip() elif _platform == "windows": return subprocess.check_output(["wmic", "cpu", "get", "Name"]).decode().split("\n")[1].strip() elif _platform == "linux": data = subprocess.check_output(["cat", "/proc/cpuinfo"]).decode().split("\n") for line in data: if line.startswith("model name"): return ": ".join([x for x in line.split(": ")[1:]]) except: pass return "" def detect_cores(self): try: _platform = platform.system().lower() if _platform == "darwin": return int(subprocess.check_output(["sysctl", "-a", "machdep.cpu.core_count"]).decode().split(":")[1].strip()) elif _platform == "windows": return int(subprocess.check_output(["wmic", "cpu", "get", "NumberOfCores"]).decode().split("\n")[1].strip()) elif _platform == "linux": data = subprocess.check_output(["cat", "/proc/cpuinfo"]).decode().split("\n") for line in data: if line.startswith("cpu cores"): return int(line.split(":")[1].strip()) except: pass return -1 def set_values(self, revcpu, cpuname, proctype, plist_data): # Clear any prior values and ensure pathing plist_data = self.clear_values(plist_data) plist_data = self.ensure_path(plist_data,["NVRAM","Add","4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102"],dict) plist_data = self.ensure_path(plist_data,["PlatformInfo","Generic","ProcessorType"],int) # Set our new values plist_data["NVRAM"]["Add"]["4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102"]["revcpu"] = revcpu plist_data["NVRAM"]["Add"]["4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102"]["revcpuname"] = cpuname plist_data["PlatformInfo"]["Generic"]["ProcessorType"] = proctype return plist_data def clear_values(self, plist_data): # Ensure Delete values exist so we can prevent old values from sticking plist_data = self.ensure_path(plist_data,["NVRAM","Delete","4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102"],list) plist_data = self.ensure_path(plist_data,["NVRAM","Delete","7C436110-AB2A-4BBB-A880-FE41995C9F82"],list) # Gather our values boot_args = plist_data["NVRAM"].get("Add",{}).get("7C436110-AB2A-4BBB-A880-FE41995C9F82",{}).get("boot-args","") nv_a_val = plist_data["NVRAM"].get("Add",{}).get("4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102",{}) nv_d_val = plist_data["NVRAM"]["Delete"]["4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102"] # Walk boot args to see if we use any revcpu* values and remove them if any(x in boot_args for x in ("revcpu=","revcpuname=")): boot_args = " ".join([x for x in boot_args.split() if not x.startswith(("revcpu=","revcpuname="))]) plist_data["NVRAM"]["Add"]["7C436110-AB2A-4BBB-A880-FE41995C9F82"]["boot-args"] = boot_args # Remove them from the NVRAM -> Add section if any(x in nv_a_val for x in ("revcpu","revcpuname")): for x in ("revcpu","revcpuname"): nv_a_val.pop(x,None) if nv_a_val: plist_data["NVRAM"]["Add"]["4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102"] = nv_a_val elif self.clear_empty: # Clean out the UUID if empty plist_data["NVRAM"]["Add"].pop("4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102",None) # Ensure they remain in the NVRAM -> Delete section to prevent stuck values for x in ("revcpu","revcpuname"): if x in nv_d_val: continue nv_d_val.append(x) # Make sure we override boot-args to avoid any stickage too if not "boot-args" in plist_data["NVRAM"]["Delete"]["7C436110-AB2A-4BBB-A880-FE41995C9F82"]: plist_data["NVRAM"]["Delete"]["7C436110-AB2A-4BBB-A880-FE41995C9F82"].append("boot-args") plist_data["NVRAM"]["Delete"]["4D1FDA02-38C7-4A6A-9CC6-4BCCA8B30102"] = nv_d_val if plist_data.get("PlatformInfo",{}).get("Generic",{}).get("ProcessorType",0) != 0: plist_data["PlatformInfo"]["Generic"]["ProcessorType"] = 0 return plist_data def get_hex(self, value, pad_to=2): if not isinstance(value,int): return "" h = hex(value)[2:] return "0x"+("0"*(len(h)%pad_to))+h.upper() def get_new_cpu_name(self, plist_data): while True: cpu_nam = self.get_cpu_name(plist_data) self.u.head("New CPU Name") print("") print("Current CPU Name: {}".format(cpu_nam[0]+" (boot-arg)" if cpu_nam[0] else cpu_nam[1] if cpu_nam[1] else "Not Set")) print("") if self.cpu_model: print("L. Use Local Machine's Value ({})".format(self.cpu_model)) print("M. Return To Menu") print("Q. Quit") print("") name = self.u.grab("Please enter a new CPU name: ") if not len(name): continue elif name.lower() == "m": return elif name.lower() == "q": self.u.custom_quit() elif self.cpu_model and name.lower() == "l": return self.cpu_model return name def save_plist(self): try: with open(self.plist_path,"wb") as f: plist.dump(self.plist_data,f) except Exception as e: self.u.head("Error Saving Plist") print("\nCould not save {}:\n\n{}\n\n".format(self.plist_path,repr(e))) self.u.grab("Press [enter] to return...") return False return True def main(self): while True: cpu_rev = self.get_rev_cpu(self.plist_data) cpu_nam = self.get_cpu_name(self.plist_data) p_type = self.get_proc_type(self.plist_data) p_label = " (8+ Core)" if p_type == 3841 else " (1, 2, 4, or 6 Core)" if p_type == 1537 else " (Must be 0x0601 or 0x0F01 to work!)" f,e = self.get_kext(self.plist_data) k_label = "Not Found (Must be present and Enabled to work!)" if not f else "Disabled (Must be Enabled to work!)" if not e else "Found and Enabled" self.u.head() print("") print("Selected Plist: {}".format(self.plist_path)) print("Rev CPU Name: {}".format("" if not self.plist_path else cpu_nam[0]+" (boot-arg)" if cpu_nam[0] else cpu_nam[1] if cpu_nam[1] else "Not Set")) print("Rev CPU: {}".format("" if not self.plist_path else cpu_rev[0]+" (boot-arg)" if cpu_rev[0] else cpu_rev[1] if cpu_rev[1] else "Not Set")) print("Processor Type: {}{}".format("" if not self.plist_path else self.get_hex(p_type),"" if not self.plist_path else p_label)) print("RestrictEvents: {}".format("" if not self.plist_path else k_label)) print("") print("Note: Changes are saved to the target plist immediately.") print(" Make sure you keep a backup!") print("") print("1. Change CPU Name") print("2. Change Processor Type") print("3. Clear CPU Name, Rev CPU, and Processor Type") print("4. Select Plist") print("") print("Q. Quit") print("") menu = self.u.grab("Please select an option: ") if not len(menu): continue elif menu.lower() == "q": self.u.custom_quit() if menu in ("1","2","3") and not self.plist_path: self.select_plist() if not self.plist_path: continue p_type = self.get_proc_type(self.plist_data) # Gather new proc type after loading if menu == "1": if not p_type in (3841,1537): new_type = self.get_new_proc_type(self.plist_data) if new_type is None: continue p_type = new_type new_name = self.get_new_cpu_name(self.plist_data) if new_name is None: continue self.plist_data = self.set_values(1,new_name,p_type,self.plist_data) self.save_plist() elif menu == "2": new_type = self.get_new_proc_type(self.plist_data) if new_type is None: continue self.plist_data = self.ensure_path(self.plist_data,["PlatformInfo","Generic","ProcessorType"],int) self.plist_data["PlatformInfo"]["Generic"]["ProcessorType"] = new_type self.save_plist() elif menu == "3": self.plist_data = self.clear_values(self.plist_data) self.save_plist() elif menu == "4": self.select_plist() c = CPUName() c.main()
13,751
4,705
# -*- coding: UTF-8 -*- # # Copyright (c) 2016, Yung-Yu Chen <yyc@solvcon.net> # BSD 3-Clause License, see COPYING import os import numpy as np import solvcon as sc class Probe(object): """ Represent a point in the mesh. """ def __init__(self, *args, **kw): self.speclst = kw.pop('speclst') self.name = kw.pop('name', None) self.crd = np.array(args, dtype='float64') self.pcl = -1 self.vals = list() def __str__(self): crds = ','.join(['%g'%val for val in self.crd]) return 'Pt/%s#%d(%s)%d' % (self.name, self.pcl, crds, len(self.vals)) def locate_cell(self, svr): icl, ifl, jcl, jfl = svr.alg.locate_point(self.crd) self.pcl = icl def __call__(self, svr, time): ngstcell = svr.ngstcell vlist = [time] for spec in self.speclst: arr = None if isinstance(spec, str): arr = svr.der[spec] # FIXME: translate to qty elif isinstance(spec, int): if spec >= 0 and spec < svr.neq: arr = svr.sol.so0n.F[:,spec] elif spec < 0 and -1-spec < svr.neq: spec = -1-spec arr = svr.sol.so0c.F[:,spec] if arr is None: raise IndexError('spec %s incorrect'%str(spec)) vlist.append(arr[ngstcell+self.pcl]) self.vals.append(vlist) class ProbeAnchor(sc.MeshAnchor): """ Anchor for probe. """ def __init__(self, svr, **kw): speclst = kw.pop('speclst') self.points = list() for data in kw.pop('coords'): pkw = {'speclst': speclst, 'name': data[0]} self.points.append(Probe(*data[1:], **pkw)) super(ProbeAnchor, self).__init__(svr, **kw) def preloop(self): for point in self.points: point.locate_cell(self.svr) for point in self.points: point(self.svr, self.svr.time) def postfull(self): for point in self.points: point(self.svr, self.svr.time) class ProbeHook(sc.MeshHook): """ Point probe. """ def __init__(self, cse, **kw): self.name = kw.pop('name', 'ppank') super(ProbeHook, self).__init__(cse, **kw) self.ankkw = kw self.points = None def drop_anchor(self, svr): ankkw = self.ankkw.copy() ankkw['name'] = self.name self._deliver_anchor(svr, ProbeAnchor, ankkw) def _collect(self): cse = self.cse if cse.is_parallel: dom = cse.solver.domainobj dealer = cse.solver.dealer allpoints = list() for iblk in range(dom.nblk): dealer[iblk].cmd.pullank(self.name, 'points', with_worker=True) allpoints.append(dealer[iblk].recv()) npt = len(allpoints[0]) points = [None]*npt for rpoints in allpoints: ipt = 0 while ipt < npt: if points[ipt] == None and rpoints[ipt].pcl >=0: points[ipt] = rpoints[ipt] ipt += 1 else: svr = self.cse.solver.solverobj points = [pt for pt in svr.runanchors[self.name].points if pt.pcl >= 0] self.points = points def postmarch(self): psteps = self.psteps istep = self.cse.execution.step_current if istep%psteps != 0: return False self._collect() return True def postloop(self): for point in self.points: ptfn = '%s_pt_%s_%s.npy' % ( self.cse.io.basefn, self.name, point.name) ptfn = os.path.join(self.cse.io.basedir, ptfn) np.save(ptfn, np.array(point.vals, dtype='float64')) # vim: set ff=unix fenc=utf8 ft=python nobomb et sw=4 ts=4 tw=79:
3,853
1,368
class BuyingCheap: def thirdBestPrice(self, prices): ls = sorted(set(prices)) return -1 if len(ls) < 3 else ls[2]
134
48
""" COCO dataset (quick and dirty) Hacked together by Ross Wightman """ from __future__ import absolute_import from __future__ import division from __future__ import print_function import torch.utils.data as data import os import cv2 import random import torch import numpy as np from PIL import Image from pycocotools.coco import COCO class CocoDetection(data.Dataset): """`MS Coco Detection <http://mscoco.org/dataset/#detections-challenge2016>`_ Dataset. Args: root (string): Root directory where images are downloaded to. ann_file (string): Path to json annotation file. transform (callable, optional): A function/transform that takes in an PIL image and returns a transformed version. E.g, ``transforms.ToTensor`` """ def __init__(self, root, ann_file, transform=None): super(CocoDetection, self).__init__() if isinstance(root, torch._six.string_classes): root = os.path.expanduser(root) self.root = root self.transform = transform self.yxyx = True # expected for TF model, most PT are xyxy self.include_masks = False self.include_bboxes_ignore = False self.has_annotations = 'image_info' not in ann_file self.coco = None self.cat_ids = [] self.cat_to_label = dict() self.img_ids = [] self.img_ids_invalid = [] self.img_infos = [] self._load_annotations(ann_file) def _load_annotations(self, ann_file): assert self.coco is None self.coco = COCO(ann_file) self.cat_ids = self.coco.getCatIds() img_ids_with_ann = set(_['image_id'] for _ in self.coco.anns.values()) for img_id in sorted(self.coco.imgs.keys()): info = self.coco.loadImgs([img_id])[0] valid_annotation = not self.has_annotations or img_id in img_ids_with_ann if valid_annotation and min(info['width'], info['height']) >= 32: self.img_ids.append(img_id) self.img_infos.append(info) else: self.img_ids_invalid.append(img_id) def _parse_img_ann(self, img_id, img_info): ann_ids = self.coco.getAnnIds(imgIds=[img_id]) ann_info = self.coco.loadAnns(ann_ids) bboxes = [] bboxes_ignore = [] cls = [] for i, ann in enumerate(ann_info): if ann.get('ignore', False): continue x1, y1, w, h = ann['bbox'] if self.include_masks and ann['area'] <= 0: continue if w < 1 or h < 1: continue # To subtract 1 or not, TF doesn't appear to do this so will keep it out for now. if self.yxyx: #bbox = [y1, x1, y1 + h - 1, x1 + w - 1] bbox = [y1, x1, y1 + h, x1 + w] else: #bbox = [x1, y1, x1 + w - 1, y1 + h - 1] bbox = [x1, y1, x1 + w, y1 + h] if ann.get('iscrowd', False): if self.include_bboxes_ignore: bboxes_ignore.append(bbox) else: bboxes.append(bbox) cls.append(self.cat_to_label[ann['category_id']] if self.cat_to_label else ann['category_id']) if bboxes: bboxes = np.array(bboxes, dtype=np.float32) cls = np.array(cls, dtype=np.int64) else: bboxes = np.zeros((0, 4), dtype=np.float32) cls = np.array([], dtype=np.int64) if self.include_bboxes_ignore: if bboxes_ignore: bboxes_ignore = np.array(bboxes_ignore, dtype=np.float32) else: bboxes_ignore = np.zeros((0, 4), dtype=np.float32) ann = dict(img_id=img_id, bbox=bboxes, cls=cls, img_size=(img_info['width'], img_info['height'])) if self.include_bboxes_ignore: ann['bbox_ignore'] = bboxes_ignore return ann def __getitem__(self, index): """ Args: index (int): Index Returns: tuple: Tuple (image, annotations (target)). """ img_id = self.img_ids[index] img_info = self.img_infos[index] if self.has_annotations: ann = self._parse_img_ann(img_id, img_info) else: ann = dict(img_id=img_id, img_size=(img_info['width'], img_info['height'])) path = img_info['file_name'] img = Image.open(os.path.join(self.root, path)).convert('RGB') if self.transform is not None: img, ann = self.transform(img, ann) return img, ann def __len__(self): return len(self.img_ids) class Custom_Dataset(data.Dataset): def __init__(self, root, data, image_ids, transform=None, test=False): self.root = root self.data = data self.image_ids = image_ids self.transform = transform self.test = test def _load_data(self, index): image_id = self.image_ids[index] image = cv2.imread(f'{self.root}/{image_id}.jpg', cv2.IMREAD_COLOR) image = cv2.cvtColor(image, cv2.COLOR_BGR2RGB).astype(np.float32) image /= 255.0 record = self.data[self.data['image_id'] == image_id] boxes = record[['x', 'y', 'w', 'h']].values boxes[:, 2] = boxes[:, 0] + boxes[:, 2] boxes[:, 3] = boxes[:, 1] + boxes[:, 3] return image, boxes def _load_cutmix_data(self, index, imgsize=1024): w, h = imgsize, imgsize s = imgsize // 2 xc, yc = [int(random.uniform(imgsize * .25, imgsize * .75)) for _ in range(2)] indexes = [index] + [random.randint(0, self.image_ids.shape[0] - 1) for _ in range(3)] result_image = np.full((imgsize, imgsize, 3), 1, dtype=np.float32) result_boxes = [] for i, index in enumerate(indexes): image, boxes = self._load_data(index) if i == 0: x1a, y1a, x2a, y2a = max(xc - w, 0), max(yc - h, 0), xc, yc x1b, y1b, x2b, y2b = w - (x2a - x1a), h - (y2a - y1a), w, h elif i == 1: # top right x1a, y1a, x2a, y2a = xc, max(yc - h, 0), min(xc + w, s * 2), yc x1b, y1b, x2b, y2b = 0, h - (y2a - y1a), min(w, x2a - x1a), h elif i == 2: # bottom left x1a, y1a, x2a, y2a = max(xc - w, 0), yc, xc, min(s * 2, yc + h) x1b, y1b, x2b, y2b = w - (x2a - x1a), 0, max(xc, w), min(y2a - y1a, h) elif i == 3: # bottom right x1a, y1a, x2a, y2a = xc, yc, min(xc + w, s * 2), min(s * 2, yc + h) x1b, y1b, x2b, y2b = 0, 0, min(w, x2a - x1a), min(y2a - y1a, h) result_image[y1a:y2a, x1a:x2a] = image[y1b:y2b, x1b:x2b] padw = x1a - x1b padh = y1a - y1b boxes[:, 0] += padw boxes[:, 1] += padh boxes[:, 2] += padw boxes[:, 3] += padh result_boxes.append(boxes) result_boxes = np.concatenate(result_boxes, 0) np.clip(result_boxes[:, 0:], 0, 2 * s, out=result_boxes[:, 0:]) result_boxes = result_boxes.astype(np.int32) result_boxes = result_boxes[np.where((result_boxes[:, 2] - result_boxes[:, 0]) * (result_boxes[:, 3] - result_boxes[:, 1]) > 0)] return result_image, result_boxes def __getitem__(self, index: int): image_id = self.image_ids[index] if self.test or random.random() > 0.35: image, boxes = self._load_data(index) elif random.random() > 0.5: image, boxes = self._load_cutmix_data(index) else: image, boxes = self._load_cutmix_data(index) labels = torch.ones((boxes.shape[0]), dtype=torch.int64) target = {} target['boxes'] = boxes target['labels'] = labels target['image_id'] = torch.tensor(index) if self.transform: for i in range(10): sample = self.transform(**{ 'image': image, 'bboxes': target['boxes'], 'labels': labels }) if len(sample['bboxes']) > 0: image = sample['image'] target['boxes'] = torch.stack(tuple(map(torch.tensor, zip(*sample['bboxes'])))).permute(1, 0) target['boxes'][:, [0, 1, 2, 3]] = target['boxes'][:, [1, 0, 3, 2]] break return image, target, image_id def __len__(self) -> int: return self.image_ids.shape[0]
8,600
3,072
'''OpenGL extension EXT.sRGB_write_control This module customises the behaviour of the OpenGL.raw.GLES2.EXT.sRGB_write_control to provide a more Python-friendly API Overview (from the spec) This extension's intent is to expose new functionality which allows an application the ability to decide if the conversion from linear space to sRGB is necessary by enabling or disabling this conversion at framebuffer write or blending time. An application which passes non-linear vector data to a shader may not want the color conversion occurring, and by disabling conversion the application can be simplified, sometimes in very significant and more optimal ways. The official definition of this extension is available here: http://www.opengl.org/registry/specs/EXT/sRGB_write_control.txt ''' from OpenGL import platform, constant, arrays from OpenGL import extensions, wrapper import ctypes from OpenGL.raw.GLES2 import _types, _glgets from OpenGL.raw.GLES2.EXT.sRGB_write_control import * from OpenGL.raw.GLES2.EXT.sRGB_write_control import _EXTENSION_NAME def glInitSrgbWriteControlEXT(): '''Return boolean indicating whether this extension is available''' from OpenGL import extensions return extensions.hasGLExtension( _EXTENSION_NAME ) ### END AUTOGENERATED SECTION
1,292
350
from imagenet.models.biggan import BigGAN from imagenet.models.u2net import U2NET from imagenet.models.cgn import CGN from imagenet.models.classifier_ensemble import InvariantEnsemble __all__ = [ CGN, InvariantEnsemble, BigGAN, U2NET ]
241
88
# Do not edit this file directly. # It was auto-generated by: code/programs/reflexivity/reflexive_refresh load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive") def osdialog(): http_archive( name="osdialog" , build_file="//bazel/deps/osdialog:build.BUILD" , sha256="3fc6dabcf1fcfdca5fd87f2474a113e17212da4211b3fa3deecd263a6a59dc26" , strip_prefix="osdialog-a3ca84070c620b186f475ea17b86e65efab5ce57" , urls = [ "https://github.com/Unilang/osdialog/archive/a3ca84070c620b186f475ea17b86e65efab5ce57.tar.gz", ], )
595
283
from yaml import safe_load from .blocklist import Blocklist class Configuration: def __init__(self, location): self.__location = location with open(location) as file: data = safe_load(file) self.repo_path = data["repository"]["path"] self.dnsmasq_path = data["dnsmasq"]["path"] self.blocklists = [] for blocklist in data["blocklists"]: self.blocklists.append(Blocklist(blocklist["name"], blocklist["url"])) # TODO handle the configuration here
529
146
""" Create meta data file 'metadata.yaml' for :class:`~pySPACE.resources.dataset_defs.feature_vector.FeatureVectorDataset` Used for external files, which can not be read directly in pySPACE. Eg. csv files without names. To be called in the dataset directory. """ def main(md_file): # Request all necessary data from user data={} msg = "Please enter the name of the file. --> " data['file_name'] = get_user_input(msg) msg = "Please enter the storage_format of the data.\n " msg += "one of arff, csv (csv with header), csvUnnamed (csv without header)--> " data['format'] = get_user_input(msg) if data['format'] != 'arff': while True: msg = "Please enter csv delimiter/separator. \n" msg += "(e.g. ',' , ' ' , ';' or '\t' for a tab, default:',')-->" data['delimiter'] = get_user_input(msg) if check_delimiter(data): break msg = "Please enter all rows that can be ignored, separated by comma or range.\n " msg += "eg. [1, 2, 3] or [1-3] --> " data['rows'] = get_numerical_user_input(msg) msg = "Please enter all columns that can be ignored, separated by comma or range.\n" msg += "The first row gets number 1." msg += "eg. [1, 2, 3] or [1-3] --> " data['columns'] = get_numerical_user_input(msg) msg = 'Please enter the column that contains the label. -1 for last column \n --> ' data['label'] = get_user_input(msg) meta_data = generate_meta_data(data) write_md_file(meta_data, md_file) info_string = """\nMeta data file %s written. \n"""%md_file give_info(info_string) def get_numerical_user_input(msg): """ Request input, split it by ',' and parse it for '-' """ tmp_info = raw_input(msg) tmp_info = tmp_info.replace(' ', '').split(',') return parse_list(tmp_info) def get_user_input(msg): """ Request input """ return raw_input(msg) def parse_list(input_list): """ Replace range by explicit numbers """ info = [] for index in input_list: if type(index) == int: info.append(index) if not type(index) == str: info.append(int(index)) # zero is not an accepted index if index == '0' or index == '': continue # replacing '-' with actual indices if '-' in str(index): index_split = index.split('-') # to handle -1 input if index_split[0] == '': info.append(int(index)) continue low = int(index_split[0]) high = int(index_split[1]) rnge = high - low new_index = [low] for i in range(rnge): new_index.append(low + i + 1) info = info.extend(new_index) else: info.append(int(index)) return info def check_delimiter(data): """ Checks delimiter to have length one """ delimiter = data["delimiter"] if len(delimiter) == 0: # add the deleted spaces data["delimiter"]=' ' return True elif len(delimiter)==1: # tabulator is included here return True else: import warnings warnings.warn('To long delimiter. Only 1 sign allowed. Please try again.') def generate_meta_data(data): """ Map data to the metadata.yaml string and set defaults """ meta_data = "author: " + os.environ['USER'] + '\n' + \ "date: " + time.strftime("%Y%m%d")+ '\n' + \ "type: feature_vector" + "\n" for item in data.items(): if item[1] != '': if item[0] == 'file_name': meta_data += "file_name: " + str(data["file_name"]) + "\n" elif item[0] == 'format': meta_data += "storage_format: [" + str(data["format"]) + ', real]' + "\n" elif item[0] == 'rows': meta_data += "ignored_rows: " + str(data["rows"]) + "\n" elif item[0] == 'columns': meta_data += "ignored_columns: " + str(data["columns"]) + "\n" elif item[0] == 'label': meta_data += "label_column: " + str(data["label"]) + "\n" else: # set defaults if item[0] == 'file_name': meta_data += "file_name: " + "file_name.csv" + "\n" elif item[0] == 'format': meta_data += "storage_format: [" + "csv" + ', real]' + "\n" elif item[0] == 'rows': meta_data += "ignored_rows: " + "[]" + "\n" elif item[0] == 'columns': meta_data += "ignored_columns: " + "[]" + "\n" elif item[0] == 'label': meta_data += "label_column: " + str(-1) + "\n" return meta_data def write_md_file(meta_data, md_file): meta_data_file = open(md_file, "w") meta_data_file.write(meta_data) meta_data_file.close() def give_info(msg): print msg import os, time, sys if __name__ == "__main__": info_string = "\nRunning meta data creator ... \n" give_info(info_string) md_file = "metadata.yaml" if not os.path.isfile(md_file): main(md_file) else: msg = "'metadata.yaml' already exists! \n" give_info(msg) yes_no = raw_input("Overwrite? y/n: ") if yes_no == "y": main(md_file) else: msg = "Exiting ... \n" give_info(msg) sys.exit(0)
5,532
1,749
""" Testing Abstract LUT model """ import unittest import os import shutil import tempfile from PyOpenColorIO.Constants import INTERP_LINEAR, INTERP_TETRAHEDRAL from utils import lut_presets as presets from utils.lut_presets import PresetException, OUT_BITDEPTH import utils.abstract_lut_helper as alh from utils.colorspaces import REC709, SGAMUTSLOG, ALEXALOGCV3 from utils.csp_helper import CSP_HELPER from utils.cube_helper import CUBE_HELPER from utils.threedl_helper import THREEDL_HELPER, SHAPER, MESH from utils.spi_helper import SPI_HELPER from utils.ascii_helper import ASCII_HELPER, AsciiHelperException from utils.clcc_helper import CLCC_HELPER from utils.json_helper import JSON_HELPER from utils.ocio_helper import create_ocio_processor from utils.lut_utils import get_input_range DISPLAY = False class AbstractLUTTest(unittest.TestCase): """ Test export of different type of LUTs """ def setUp(self): test_dir = os.path.join(os.path.dirname(__file__), 'test_files') self.tmp_dir = os.path.join(tempfile.gettempdir(), 'testCoPipe') if not os.path.exists(self.tmp_dir): os.mkdir(self.tmp_dir) # create OCIO processor lut1d = os.path.join(test_dir, 'CineonToLin_1D.csp') lut3d = os.path.join(test_dir, 'saturation.3dl') self.processor_1d = create_ocio_processor(lut1d, interpolation=INTERP_LINEAR) self.processor_3d = create_ocio_processor(lut3d, interpolation=INTERP_TETRAHEDRAL) self.helpers_1d_to_test = [ (CUBE_HELPER, '.cube'), [SPI_HELPER, '.spi1d'], (CSP_HELPER, '.csp'), ] self.helpers_3d_to_test = [ (CUBE_HELPER, '.cube', True), [SPI_HELPER, '.spi3d', True], (CSP_HELPER, '.csp', True), (THREEDL_HELPER, '.3dl', True), (CLCC_HELPER, '.cc', False), (JSON_HELPER, '.json', False) ] def test_default_1d_lut(self): """ Test a default 1d LUT export """ outlutfiles = [] for helper, ext in self.helpers_1d_to_test: outlutfile = os.path.join(self.tmp_dir, "default_1D" + ext) args_1d = helper.get_default_preset() helper.write_1d_lut(self.processor_1d.applyRGB, outlutfile, args_1d) # create a processor and try it proc = create_ocio_processor(outlutfile, interpolation=INTERP_LINEAR) proc.applyRGB([0, 0, 0]) proc.applyRGB([1, 1, 1]) outlutfiles.append(outlutfile) if DISPLAY: import plot_that_lut plot_that_lut.plot_that_lut(outlutfiles) def test_default_3d_lut(self): """ Test a default 3d LUT export """ for helper, ext, ocio_compatible in self.helpers_3d_to_test: outlutfile = os.path.join(self.tmp_dir, "default_3D" + ext) args_3d = helper.get_default_preset() helper.write_3d_lut(self.processor_3d.applyRGB, outlutfile, args_3d) if ocio_compatible: # create a processor and try it proc = create_ocio_processor(outlutfile, interpolation=INTERP_LINEAR) proc.applyRGB([0, 0, 0]) proc.applyRGB([1, 1, 1]) if DISPLAY: import plot_that_lut plot_that_lut.plot_that_lut(outlutfile) def test_check_attributes(self): """ Test preset check function """ outlutfile = os.path.join(self.tmp_dir, "test.cube") default_preset = presets.get_default_preset() CUBE_HELPER.check_preset(default_preset) # test missing attr cust_preset = {} self.assertRaises(presets.PresetException, CUBE_HELPER.check_preset, cust_preset) for attr in presets.BASIC_ATTRS: cust_preset[attr] = default_preset[attr] self.assertRaises(presets.PresetException, CUBE_HELPER.check_preset, cust_preset) ## test specific attr # change type to 1D cust_preset[presets.TYPE] = '1D' self.assertRaises(presets.PresetException, CUBE_HELPER.check_preset, cust_preset) cust_preset[presets.OUT_BITDEPTH] = 12 CUBE_HELPER.check_preset(cust_preset) # try to write a 3D LUT with a 1D preset self.assertRaises(alh.AbstractLUTException, CUBE_HELPER.write_3d_lut, self.processor_1d, outlutfile, cust_preset) # change type to 2D cust_preset[presets.TYPE] = '3D' self.assertRaises(presets.PresetException, CUBE_HELPER.check_preset, cust_preset) cust_preset[presets.CUBE_SIZE] = 17 CUBE_HELPER.check_preset(cust_preset) # try to write a 1D LUT with a 3D preset self.assertRaises(alh.AbstractLUTException, CUBE_HELPER.write_1d_lut, self.processor_1d, outlutfile, cust_preset) # # test value type # cube size cust_preset[presets.CUBE_SIZE] = presets.CUBE_SIZE_MAX_VALUE + 1 self.assertRaises(presets.PresetException, CUBE_HELPER.check_preset, cust_preset) cust_preset[presets.CUBE_SIZE] = default_preset[presets.CUBE_SIZE] # range tests = 'test', ['a', 'a'], [0.0, 0.5, 1.0], 0.1 for test in tests: cust_preset[presets.IN_RANGE] = test self.assertRaises(presets.PresetException, CUBE_HELPER.check_preset, cust_preset) cust_preset[presets.IN_RANGE] = 0.1, 1 CUBE_HELPER.check_preset(cust_preset) cust_preset[presets.IN_RANGE] = (0.1, 1) CUBE_HELPER.check_preset(cust_preset) def test_float_luts(self): """ Test float LUT transparency """ helpers_float_to_test = [(CSP_HELPER, '.csp'), (SPI_HELPER, '.spi1d')] colorspace_to_test = [REC709, SGAMUTSLOG, ALEXALOGCV3] delta = 0.00001 for helper, ext in helpers_float_to_test: for colorspace in colorspace_to_test: # define file name name = colorspace.__class__.__name__ encode_filename = "linTo{0}_1D{1}".format(name, ext) decode_filename = "{0}ToLin_1D{1}".format(name, ext) encode_filepath = os.path.join(self.tmp_dir, encode_filename) decode_filepath = os.path.join(self.tmp_dir, decode_filename) # set preset args_1d = CSP_HELPER.get_default_preset() args_1d[presets.OUT_BITDEPTH] = 16 decode_min = colorspace.decode_gradation(0) decode_max = colorspace.decode_gradation(1) args_1d[presets.IN_RANGE] = get_input_range(colorspace, "encode", 10) # write encode LUT helper.write_2d_lut(colorspace.encode_gradation, encode_filepath, args_1d) # write decode LUT args_1d[presets.IN_RANGE] = get_input_range(colorspace, "decode", 10) helper.write_2d_lut(colorspace.decode_gradation, decode_filepath, args_1d) # test transparency proc = create_ocio_processor(encode_filepath, postlutfile=decode_filepath, interpolation=INTERP_LINEAR) test_values = [[decode_min] * 3, [decode_max] * 3, [0] * 3, [0.5] * 3, [1] * 3] for rgb in test_values: res = proc.applyRGB(rgb) abs_value = abs(rgb[0] - res[0]) self.assertTrue(abs_value < delta, "{0} transparency test failed : {1:8f} >" " acceptable delta ({2:8f})".format(name, abs_value, delta) ) def test_3dl_preset(self): """ Test 3dl preset """ preset = presets.get_default_preset() # test type must be 3D self.assertRaises(presets.PresetException, THREEDL_HELPER.check_preset, preset ) preset[presets.TYPE] = '3D' # test shaper attr exists self.assertRaises(presets.PresetException, THREEDL_HELPER.check_preset, preset ) preset[SHAPER] = True # test mesh attr exists self.assertRaises(presets.PresetException, THREEDL_HELPER.check_preset, preset ) preset[MESH] = True # test preset is ok THREEDL_HELPER.check_preset(preset) # test ranges are int outlutfile = os.path.join(self.tmp_dir, "test.3dl") self.assertRaises(PresetException, THREEDL_HELPER.write_3d_lut, self.processor_3d.applyRGB, outlutfile, preset) def test_ascii_lut(self): """ Test ascii 1D / 2D export """ colorspace = REC709 # 2D LUT outlutfile = os.path.join(self.tmp_dir, "default_2D.lut") preset = ASCII_HELPER.get_default_preset() ASCII_HELPER.write_2d_lut(colorspace.decode_gradation, outlutfile, preset) # 1D LUT outlutfile = os.path.join(self.tmp_dir, "default_1D.lut") preset = ASCII_HELPER.get_default_preset() ASCII_HELPER.write_1d_lut(colorspace.decode_gradation, outlutfile, preset) # test out bit depth inadequate with output range preset[OUT_BITDEPTH] = 12 self.assertRaises(AsciiHelperException, ASCII_HELPER.write_1d_lut, colorspace.decode_gradation, outlutfile, preset) def test_complete_attributes(self): """ Test preset complete function """ colorspace = REC709 outlutfile = os.path.join(self.tmp_dir, "default_ascii_1D.lut") default_preset = ASCII_HELPER.get_default_preset() cust_preset = {} cust_preset = ASCII_HELPER.complete_preset(cust_preset) expression = set(default_preset).issubset(set(cust_preset)) self.assertTrue(expression, ("Something went wrong in preset completion :\n" "Completed preset:\n{0}\nDefault one:\n{1}" ).format(cust_preset, default_preset)) ASCII_HELPER.check_preset(cust_preset) # try to write a float ascii lut without forcing float mode cust_preset[presets.IN_RANGE] = [0, 1.0] self.assertRaises(PresetException, ASCII_HELPER.write_1d_lut, colorspace.decode_gradation, outlutfile, cust_preset) # force float mode cust_preset[presets.IS_FLOAT] = True ASCII_HELPER.write_1d_lut(colorspace.decode_gradation, outlutfile, cust_preset) def tearDown(self): # Remove test directory shutil.rmtree(self.tmp_dir) if __name__ == '__main__': unittest.main()
12,715
3,935
import argparse import sys import logging import json def args_parser(): parser = argparse.ArgumentParser(prog='booktracker', description='book update tracker in python') parser.add_argument('-f', '--urls_file', type=argparse.FileType('r'), help='a file contains book urls, could be a text file list urls or complex json file for url and attributes', required=False) parser.add_argument('-l', '--url', type=str, help='a book url to track', required=False) parser.add_argument('-o', '--output', type=str, help='directory to store book content', required=True) parser.add_argument('--epub', action='store_true', help='generate epub of book', required=False) parser.add_argument('--timeout', type=int, help='network request timeout value, default=13s', required=False, default=13) parser.add_argument('--author', type=str, help='author of the book', required=False, default='') parser.add_argument('--title', type=str, help='title of the book', required=False, default='') parser.add_argument('--header', type=str, action='append', help='http request header', required=False, dest='headers') parser.add_argument('-v', '--verbose', action='count', help='print debug information', required=False, default=0) return parser def parse_urls_file_txt(urls_file): urls = set() for url in urls_file: url = url.strip().replace('\n', '').replace('\r', '') parts = url.split('|') headers = [] if len(parts) > 3: headers = '|'.join(parts[3:]).split(',') urls.add( (parts[0], parts[1] if len(parts) > 1 else '', parts[2] if len(parts) > 2 else '', tuple(headers)) ) return urls def parse_urls_file_json(urls_file): urls = set() books = json.load(urls_file) for book in books: url = book['url'].strip().replace('\n', '').replace('\r', '') author = book['author'].strip().replace('\n', '').replace('\r', '') if 'author' in book else '' title = book['title'].strip().replace('\n', '').replace('\r', '') if 'title' in book else '' headers = book['headers'] if 'headers' in book else [] logging.debug('url:%s, author:%s, title:%s, headers:%s', url, author, title, headers) urls.add((url, author, title, tuple(headers))) return urls if __name__ == '__main__': parser = args_parser().parse_args() if parser.verbose >= 1: logging.getLogger('').setLevel(logging.DEBUG) if parser.urls_file is None and parser.url is None: args_parser().print_usage() sys.exit() urls = set() if parser.urls_file: try: urls = parse_urls_file_json(parser.urls_file) except: logging.exception('urls file:%s is not json try text file', parser.urls_file) parser.urls_file.seek(0) urls = parse_urls_file_txt(parser.urls_file) if parser.url: urls.add((parser.url, parser.author, parser.title, tuple(parser.headers) if parser.headers else tuple([])) ) for url, author, title, headers in sorted(urls): try: if url.find('piaotian') > 0 or url.find('ptwxz') > 0: from piaotian.book_tracker import Tracker as PiaoTianTracker tracker = PiaoTianTracker(url, author, title, parser.output, parser.timeout) elif url.find('23us') > 0: from dingdian.book_tracker import Tracker as DingDianTracker tracker = DingDianTracker(url, author, title, parser.output, parser.timeout) elif url.find('youdubook') > 0: from youdu.book_tracker import Tracker as YouduTracker tracker = YouduTracker(url, author, title, parser.output, parser.timeout) elif url.find('shuku') > 0: from shuku.book_tracker import Tracker as ShuKuTracker tracker = ShuKuTracker(url, author, title, parser.output, parser.timeout) elif url.find('uukanshu') > 0: from uukanshu.book_tracker import Tracker as UUKanShuTracker tracker = UUKanShuTracker(url, author, title, parser.output, parser.timeout) if not tracker: raise ValueError("tracker not found") tracker.headers = list(headers) update_count = tracker.refresh() print(tracker.title, 'update count:', update_count) if parser.epub: tracker.gen_epub() except: logging.exception("update failed:{}".format(url))
4,704
1,388
import math def rectangle_area(b=None, h=None): if b is None or b is None: print("Error wrong parameters") return return b * h def circle_area(radium): return (radium ** 2) * math.pi print(circle_area(5)) def intermediate_number(a, b): return (a + b) / 2 print(intermediate_number(-24, 24)) def separate(list_to_separate): list_to_separate.sort() evens_list = [] odds_list = [] for n in list_to_separate: if n % 2 == 0: evens_list.append(n) else: odds_list.append(n) return evens_list, odds_list evens, odds = separate([6, 5, 2, 1, 7]) print(evens) print(odds)
667
262
#!/usr/bin/env python # # Copyright (c) 2010, iPlant Collaborative, University of Arizona, Cold Spring Harbor Laboratories, University of Texas at Austin # This software is licensed under the CC-GNU GPL version 2.0 or later. # License: http://creativecommons.org/licenses/GPL/2.0/ # # Author: Seung-jin Kim # Contact: seungjin@email.arizona.edu # Twitter: @seungjin # import logging import httplib import urllib from urlparse import urlparse import string import datetime from django.http import HttpResponse from django.template import Context from django.template.loader import get_template from django.http import HttpResponse, Http404 from django.contrib.auth.models import User from django.http import HttpResponseRedirect from django.contrib.auth import logout from django.http import HttpResponseNotFound from django.http import HttpResponseForbidden from django.utils import simplejson from atmosphere.cloudfront.models import * def getToken(request, username, password): auth_server_url_obj = Configs.objects.filter(key="auth_server_url").order_by('value')[0] auth_server_url = auth_server_url_obj.value o = urlparse(auth_server_url) auth_server_url = string.split(o.netloc,":")[0] auth_server_port = int(string.split(o.netloc,":")[1]) auth_server_path = o.path method = "GET" params = None headers = { "Content-type" : "application/x-www-form-urlencoded", "Accept" : "text/plain", "X-Auth-User" : username, "X-Auth-Key" : password, "User-Agent" : "Atmo/CloudFront" } conn = httplib.HTTPSConnection(auth_server_url,auth_server_port) conn.request(method,auth_server_path,params,headers) r1 = conn.getresponse() headers = r1.getheaders() conn.close() api_service_url = None api_service_token = None for header in headers: if header[0] == "x-server-management-url" : api_service_url = header[1] if header[0] == "x-auth-token" : api_service_token = header[1] issued_token = Tokens(username = username, x_auth_token = api_service_token, x_server_management_url = api_service_url, issued_at = datetime.datetime.now()) issued_token.save() request.session['username'] = username request.session['token'] = api_service_token request.session['api_server'] = api_service_url return True def request(request,method): # emulating # ./resource_request seungjin e1463572-517a-41c7-a43c-5a3eb884562e GET http://bond.iplantcollaborative.org:8000/resources/v1/getImageList if request.session.has_key('username') == False: return HttpResponseForbidden('HTTP/1.0 401 UNAUTHORIZED') username = request.session['username'] token = request.session['token'] method_type = str(request.META['REQUEST_METHOD']) resource_url = request.session['api_server'] + "/" + method o = urlparse(resource_url) protocol = o.scheme url = string.split(o.netloc,":")[0] port = int(string.split(o.netloc,":")[1]) path = o.path + "/" params = None if str(method_type).upper() == "GET" : params = '&'.join( [ u"%s=%s"%(f,v) for f,v in request.GET.iteritems() if f]) elif str(method_type).upper() == "POST": params = '&'.join( [ u"%s=%s"%(f,v) for f,v in request.POST.iteritems() if f]) headers = { "Content-type" : "application/x-www-form-urlencoded", "Accept" : "text/plain", "X-Auth-User" : username, "X-Auth-Token" : token, "X-Api-Server" : request.session['api_server'] + "/", "X-Api-Version" : "v1", "User-Agent" : "Atmo/CloudFront" } logging.debug(params) conn = httplib.HTTPSConnection(url,port) conn.request("POST",path,params,headers) r1 = conn.getresponse() return r1.read()
3,647
1,285
import json import os classlist = os.listdir("./image/") for classname in classlist: # "./Classification/"+classname+"/" try: os.mkdir("./Classification/"+classname+"/") except: pass filenamelist = os.listdir("./image/"+classname) url = "https://cdn.jsdelivr.net/gh/2x-ercha/twikoo-magic/image/" + classname + "/" with open("./Classification/"+classname+"/README.md", "w", encoding="utf-8") as f: f.write(classname+"\n\n") for filename in filenamelist: f.write("![](" + url + filename + ")\n")
554
203
#!/usr/bin/env python3 import sys from multiprocessing import Queue,Process,Lock from datetime import datetime import getopt import configparser class Config(object): def __init__(self,filename,arg='DEFAULT'): self._filename = filename self._arg = arg self._obj = configparser.ConfigParser(strict=False) self._obj.read(self._filename) @property def basel(self): return self._obj.getfloat(self._arg,'JiShuL') @property def baseh(self): return self._obj.getfloat(self._arg,'JiShuH') @property def soinsurp(self): sum = 0 for i in ['YangLao','GongJiJin','ShengYu','GongShang','ShiYe','YiLiao']: sum += self._obj.getfloat(self._arg,i) return sum class UserData(object): def __init__(self,userdatafile): self._userdatafile = userdatafile @property def userdata(self): userdata = {} with open(self._userdatafile) as file: for line in file: s = line.split(',') fkey = s[0].strip() fvalue = s[1].strip() userdata[fkey] = float(fvalue) return userdata class Salary(object): #bftax is salary before the pitax #soinsurp is socail insur pecentage #basel is the lowest base #baseh is the hightest base def __init__(self,bftax,soinsurp,basel,baseh): self._bftax = bftax self._soinsurp = soinsurp self._basel = basel self._baseh = baseh @property def soinsur(self): if self._bftax <= self._basel: return self._basel * self._soinsurp elif self._bftax >= self._baseh: return self._baseh * self._soinsurp else: return self._bftax * self._soinsurp @property def pitax(self): taxbase = self._bftax - self.soinsur - 3500 if taxbase <= 0: return 0 elif taxbase > 0 and taxbase <= 1500: return taxbase * 0.03 elif taxbase > 1500 and taxbase <= 4500: return (taxbase * 0.1 - 105) elif taxbase > 4500 and taxbase <= 9000: return (taxbase * 0.2 - 555) elif taxbase > 9000 and taxbase <= 35000: return (taxbase * 0.25 - 1005) elif taxbase > 35000 and taxbase <= 55000: return (taxbase * 0.3 - 2755) elif taxbase > 55000 and taxbase <= 80000: return (taxbase * 0.35 - 5505) else: return (taxbase * 0.45 - 13505) @property def aftax(self): return self._bftax - self.soinsur - self.pitax que1 = Queue() que2 = Queue() def putda_func(arg,lock): # user_inst = UserData(arg) g = [ (k,v) for k,v in\ user_inst.userdata.items()] for i in g: with lock: que1.put(i) def comp_func(soinsurp,basel,baseh,lock): while True: i = que1.get() bftax = i[1] salary = Salary(bftax,soinsurp,basel,baseh) sal_list = [i[0],i[1],salary.soinsur,salary.pitax,\ salary.aftax] with lock: que2.put(sal_list) if que1.empty(): break def outfi_func(arg): while True: lis = que2.get() with open(arg,'a') as file: file.write(lis[0]) for i in lis[1:]: file.write(','+'{:.2f}'.format(i)) t = datetime.now() t_str = datetime.strftime(t,'%Y-%m-%d %H:%M:%S') file.write(',' + t_str) file.write('\n') if que2.empty(): break def usage(): line ='Usage: ' + sys.argv[0] + ' -C cityname -c configfile -d userdata -o resultdata' print(line) def main(): try: opts,args = getopt.getopt(sys.argv[1:],'ho:d:C:c:',['help',]) except getopt.GetoptError as err: print(err) usage() sys.exit(2) cityname = 'DEFAULT' userfile = None configfile = None outfile = None try: for o,a in opts: if o in ('-h','--help'): usage() sys.exit() if o == '-o': outfile = a elif o == '-C': cityname = a elif o == '-d': userfile = a elif o == '-c': configfile = a else: raise NameError config = Config(configfile,cityname.upper()) lo1 = Lock() lo2 = Lock() Process(target=putda_func,args=(userfile,lo1)).start() Process(target=comp_func, args=(config.soinsurp,\ config.basel,config.baseh,lo2)).start() Process(target=outfi_func, args=(outfile,)).start() except NameError as err: usage() print(err) sys.exit(2) if __name__ == '__main__': main()
4,964
1,698
#!/usr/bin/env python3 import argparse import yaml import pathlib import decimal import datetime import os decimal.getcontext().prec = 10 parser = argparse.ArgumentParser() parser.add_argument('--data', help='path to data directory', required=True) args = parser.parse_args() script_path = os.path.dirname(os.path.realpath(__file__)) config_path = script_path + '/../config' # Configuration config = {} with open(config_path + '/tax.yaml') as f: config['tax'] = yaml.safe_load(f.read()) # Find current tax year today = datetime.date.today() config['current_tax'] = next(x for x in config['tax'] if x['start_date'] <= today and x['end_date'] >= today) # Data total_sales = decimal.Decimal(0.00) total_payments = decimal.Decimal(0.00) data_directory = str(args.data) data_path = pathlib.Path(data_directory) invoice_files = list(data_path.glob('data/invoices/*.yaml')) for invoice_file in invoice_files: fp = invoice_file.open() invoice_data = yaml.safe_load(fp.read()) fp.close() if invoice_data['issue_date'] >= config['current_tax']['start_date'] and invoice_data['issue_date'] <= config['current_tax']['end_date'] and invoice_data['issue_date'] <= today: print(invoice_data['number']) total_sales += decimal.Decimal(invoice_data['total']) print(invoice_data['total']) # Subtract any payments from accounts receivable if 'payments' in invoice_data: for payment in invoice_data['payments']: print(payment['amount']) total_payments += decimal.Decimal(payment['amount']) print() print("Total sales: %.2f" % total_sales) print("Total payments: %.2f" % total_payments) # Calculate tax and national insurance
1,730
562
# -*- coding: utf-8 -*- #for local #import config #config.write_environ() import os,json from flask import Flask, render_template, request, redirect, url_for, session from requests_oauthlib import OAuth1Session from datetime import timedelta import twitter_auth import twitter_delete import postTweet import databaseIO app = Flask(__name__) app.secret_key = os.environ['APP_SECRET_KEY'] app.permanent_session_lifetime = timedelta(minutes=5) #session.permanent = True #scheduler = BackgroundScheduler(daemon = True) ################################################################## ## トークン関連 CK = os.environ.get('CONSUMER_KEY', '0') CS = os.environ.get('CONSUMER_SECRET', '0') ################################################################## is_verified = False name = "" screen_name = "" w = ('stop','running') @app.route('/') def index(): session['is_verified'] = False session['auth_process'] = False return render_template('index.html') @app.route('/authorize') def authorize(): session['auth_process'] = True authorize_endpoint = twitter_auth.user_authorize() return redirect(authorize_endpoint) @app.route('/authenticate') def authenticate(): session['auth_process'] = True authenticate_endpoint = twitter_auth.user_authenticate() return redirect(authenticate_endpoint) #return #render_template('tweet.html',message=message,title=title) """@app.route('/verified') def verified(): is_verified,name,screen_name = twitter_auth.user_verified() #return redirect('http://127.0.0.1:5000/') return render_template('verified.html',is_verified = is_verified,name=name,screen_name=screen_name) @app.route('/setting_authenticate') def authenticate(): authenticate_url = twitter_auth.user_authenticate_setting() return redirect(authenticate_url) #return #render_template('tweet.html',message=message,title=title) """ @app.route('/setting', methods=['GET','POST']) def setting(): global is_verified, name, screen_name user_id = "" if session.get('is_verified') != True: session['is_verified'] = False if session.get('auth_process') != True: print("no auth_process") session['auth_process'] = False if session['auth_process'] == True : try: twitter_auth.user_verified() print("verify success") session['auth_process'] = False except: print("verify failed") session['auth_process'] = False return render_template('setting.html',is_verified = False) else: if session['is_verified'] == True: #設定保存時 if(request.form["work"]=='running'): work_value = 1 else: work_value = 0 databaseIO.set_value(session['user_id'], work_value, request.form["deletetime"]) print(request.form["work"]) print(request.form["deletetime"]) #param = json.loads(request.data.decode('utf-8')) #print(param["work"]) #print(param.get('deletetime')) print("verified") else: print("invalid transition") session['auth_process'] = False return render_template('setting.html',is_verified = False) user_id = session['user_id'] userinfo = databaseIO.get_value(user_id) is_verified = session['is_verified'] name = session['name'] screen_name = session['screen_name'] work = userinfo[3] delete_time = userinfo[4] print(name) return render_template('setting.html',is_verified = is_verified,name=name,screen_name=screen_name,work=w[work],delete_time=delete_time) @app.route('/delete', methods=['GET','POST']) def delete(): if request.method == 'POST': databaseIO.auth_deleteuser(session['user_id']) print("delete") return render_template('delete.html',deleted=True) else: return render_template('delete.html',deleted=False) return render_template('delete.html',deleted=False) if __name__ == '__main__': #app.debug = True app.run(threaded=True)
4,131
1,265
from PySide.QtGui import QKeySequence from PySide.QtCore import Qt from .menu import Menu, MenuEntry, MenuSeparator class DisasmInsnContextMenu(Menu): def __init__(self, disasm_view): super(DisasmInsnContextMenu, self).__init__("", parent=disasm_view) self.insn_addr = None self.entries.extend([ MenuEntry('T&oggle selection', self._toggle_instruction_selection), MenuSeparator(), MenuEntry('E&xecute symbolically...', self._disasm_view.popup_newpath_dialog), MenuEntry('&Avoid in execution...', self._avoid_in_execution) ]) @property def _disasm_view(self): return self.parent def _toggle_instruction_selection(self): self._disasm_view.toggle_instruction_selection(self.insn_addr) def _avoid_in_execution(self): self._disasm_view.avoid_addr_in_exec(self.insn_addr)
882
279
""" shades contains classes and functions relating to Shades' shade object """ from abc import ABC, abstractmethod from typing import Tuple, List import numpy as np from PIL import Image from .noise_fields import NoiseField, noise_fields from .utils import color_clamp class Shade(ABC): """ An Abstract base clase Shade. Methods are used to mark shapes onto images according to various color rules. Initialisation parameters of warp_noise takes two noise_fields affecting how much a point is moved across x and y axis. warp_size determines the amount that a warp_noise result of 1 (maximum perlin value) translates as """ def __init__( self, color: Tuple[int, int, int] = (0, 0, 0), warp_noise: Tuple[NoiseField] = noise_fields(channels=2), warp_size: float = 0, ): self.color = color self.warp_noise = warp_noise self.warp_size = warp_size @abstractmethod def determine_shade(self, xy_coords: Tuple[int, int]) -> Tuple[int, int, int]: """ Determines the shade/color for given xy coordinate. """ def adjust_point(self, xy_coords: Tuple[int, int]) -> Tuple[int, int]: """ If warp is applied in shade, appropriately adjusts location of point. """ if self.warp_size == 0: return xy_coords x_coord = xy_coords[0] + (self.warp_noise[0].noise(xy_coords) * self.warp_size) y_coord = xy_coords[1] + (self.warp_noise[1].noise(xy_coords) * self.warp_size) return (x_coord, y_coord) def point(self, canvas: Image, xy_coords: Tuple[int, int]) -> None: """ Determines colour and draws a point on an image. """ color = self.determine_shade(xy_coords) if color is None: return xy_coords = self.adjust_point(xy_coords) if self.in_bounds(canvas, xy_coords): canvas.putpixel((int(xy_coords[0]), int(xy_coords[1])), color) def in_bounds(self, canvas: Image, xy_coords: Tuple[int, int]) -> bool: """ determined whether xy_coords are within the size of canvas image """ if (xy_coords[0] < 0) or (xy_coords[0] >= canvas.width): return False if (xy_coords[1] < 0) or (xy_coords[1] >= canvas.height): return False return True def weighted_point(self, canvas: Image, xy_coords: Tuple[int, int], weight: int): """ Determines colour and draws a weighted point on an image. """ color = self.determine_shade(xy_coords) if self.warp_size != 0: xy_coords = self.adjust_point(xy_coords) for x_coord in range(0, weight): for y_coord in range(0, weight): new_point = (int(xy_coords[0]+x_coord), int(xy_coords[1]+y_coord)) if self.in_bounds(canvas, new_point): canvas.putpixel(new_point, color) def pixels_inside_edge(self, edge_pixels: List) -> List: """ Returns a list of pixels from inside a edge of points using ray casting algorithm https://en.wikipedia.org/wiki/Point_in_polygon vertex correction requires improvements, unusual or particularly angular shapes may cause difficulties """ inner_pixels = [] x_coords = {i[0] for i in edge_pixels} for x_coord in range(min(x_coords), max(x_coords)+1): y_coords = {i[1] for i in edge_pixels if i[0] == x_coord} y_coords = [i for i in y_coords if i-1 not in y_coords] ray_count = 0 for y_coord in range(min(y_coords), max(y_coords)+1): if y_coord in y_coords and (x_coord, y_coord): ray_count += 1 if ray_count % 2 == 1: inner_pixels.append((x_coord, y_coord)) return list(set(inner_pixels + edge_pixels)) def pixels_between_two_points(self, xy_coord_1: Tuple, xy_coord_2: Tuple) -> List: """ Returns a list of pixels that form a straight line between two points. Parameters: xy_coord_1 (int iterable): Coordinates for first point. xy_coord_2 (int iterable): Coordinates for second point. Returns: pixels (int iterable): List of pixels between the two points. """ if abs(xy_coord_1[0] - xy_coord_2[0]) > abs(xy_coord_1[1] - xy_coord_2[1]): if xy_coord_1[0] > xy_coord_2[0]: x_step = -1 else: x_step = 1 y_step = (abs(xy_coord_1[1] - xy_coord_2[1]) / abs(xy_coord_1[0] - xy_coord_2[0])) if xy_coord_1[1] > xy_coord_2[1]: y_step *= -1 i_stop = abs(xy_coord_1[0] - xy_coord_2[0]) else: if xy_coord_1[1] > xy_coord_2[1]: y_step = -1 else: y_step = 1 x_step = (abs(xy_coord_1[0] - xy_coord_2[0]) / abs(xy_coord_1[1] - xy_coord_2[1])) if xy_coord_1[0] > xy_coord_2[0]: x_step *= -1 i_stop = abs(xy_coord_1[1]-xy_coord_2[1]) pixels = [] x_coord, y_coord = xy_coord_1 for _ in range(0, int(i_stop) + 1): pixels.append((int(x_coord), int(y_coord))) x_coord += x_step y_coord += y_step return pixels def line( self, canvas: Image, xy_coords_1: Tuple[int, int], xy_coords_2: Tuple[int, int], weight: int = 2, ) -> None: """ Draws a weighted line on the image. """ for pixel in self.pixels_between_two_points(xy_coords_1, xy_coords_2): self.weighted_point(canvas, pixel, weight) def fill(self, canvas: Image) -> None: """ Fills the entire image with color. """ # we'll temporarily turn off warping as it isn't needed here warp_size_keeper = self.warp_size self.warp_size = 0 for x_coord in range(0, canvas.width): for y_coord in range(0, canvas.height): self.point(canvas, (x_coord, y_coord)) #[[self.point(canvas, (x, y)) for x in range(0, canvas.width)] # for y in range(0, canvas.height)] self.warp_size = warp_size_keeper def get_shape_edge(self, list_of_points: List[Tuple[int, int]]) -> List[Tuple]: """ Returns list of coordinates making up the edge of a shape """ edge = self.pixels_between_two_points( list_of_points[-1], list_of_points[0]) for i in range(0, len(list_of_points)-1): edge += self.pixels_between_two_points( list_of_points[i], list_of_points[i+1]) return edge def shape(self, canvas: Image, points: List[Tuple[int, int]]) -> None: """ Draws a shape on an image based on a list of points. """ edge = self.get_shape_edge(points) for pixel in self.pixels_inside_edge(edge): self.point(canvas, pixel) def shape_outline( self, canvas: Image, points: List[Tuple[int, int]], weight: int = 2, ) -> None: """ Draws a shape outline on an image based on a list of points. """ for pixel in self.get_shape_edge(points): self.weighted_point(canvas, pixel, weight) def rectangle( self, canvas: Image, top_corner: Tuple[int, int], width: int, height: int, ) -> None: """ Draws a rectangle on the image. """ for x_coord in range(top_corner[0], top_corner[0] + width): for y_coord in range(top_corner[1], top_corner[1] + height): self.point(canvas, (x_coord, y_coord)) def square( self, canvas: Image, top_corner: Tuple[int, int], size: int, ) -> None: """ Draws a square on the canvas """ self.rectangle(canvas, top_corner, size, size) def triangle( self, canvas, xy1: Tuple[int, int], xy2: Tuple[int, int], xy3: Tuple[int, int], ) -> None: """ Draws a triangle on the image. This is the same as calling Shade.shape with a list of three points. """ self.shape(canvas, [xy1, xy2, xy3]) def triangle_outline( self, canvas, xy1: Tuple[int, int], xy2: Tuple[int, int], xy3: Tuple[int, int], weight: int = 2, ) -> None: """ Draws a triangle outline on the image. Note that this is the same as calling Shade.shape_outline with a list of three points. """ self.shape_outline(canvas, [xy1, xy2, xy3], weight) def get_circle_edge( self, center: Tuple[int, int], radius: int, ) -> List[Tuple[int, int]]: """ Returns the edge coordinates of a circle """ edge_pixels = [] circumference = radius * 2 * np.pi for i in range(0, int(circumference)+1): angle = (i/circumference) * 360 opposite = np.sin(np.radians(angle)) * radius adjacent = np.cos(np.radians(angle)) * radius point = (int(center[0] + adjacent), int(center[1] + opposite)) edge_pixels.append(point) return edge_pixels def circle( self, canvas: Image, center: Tuple[int, int], radius: int, ) -> None: """ Draws a circle on the image. """ edge_pixels = self.get_circle_edge(center, radius) for pixel in self.pixels_inside_edge(edge_pixels): self.point(canvas, pixel) def circle_outline( self, canvas: Image, center: Tuple[int, int], radius: int, weight: int = 2, ) -> None: """ Draws a circle outline on the image. """ edge_pixels = self.get_circle_edge(center, radius) for pixel in edge_pixels: self.weighted_point(canvas, pixel, weight) def circle_slice( self, canvas: Image, center: Tuple[int, int], radius: int, start_angle: int, degrees_of_slice: int, ) -> None: """ Draws a partial circle based on degrees. (will have the appearance of a 'pizza slice' or 'pacman' depending on degrees). """ # due to Shade.pixels_between_two_points vertex correction issues, # breaks down shape into smaller parts def _internal(canvas, center, radius, start_angle, degrees_of_slice): circumference = radius * 2 * np.pi start_point = int( (((start_angle - 90) % 361) / 360) * circumference) slice_length = int((degrees_of_slice / 360) * circumference) end_point = start_point + slice_length edge_pixels = [] for i in range(start_point, end_point + 1): angle = (i/circumference) * 360 opposite = np.sin(np.radians(angle)) * radius adjacent = np.cos(np.radians(angle)) * radius point = (int(center[0] + adjacent), int(center[1] + opposite)) edge_pixels.append(point) if i in [start_point, end_point]: edge_pixels += self.pixels_between_two_points(point, center) for pixel in self.pixels_inside_edge(edge_pixels): self.point(canvas, pixel) if degrees_of_slice > 180: _internal(canvas, center, radius, start_angle, 180) _internal(canvas, center, radius, start_angle + 180, degrees_of_slice - 180) else: _internal(canvas, center, radius, start_angle, degrees_of_slice) class BlockColor(Shade): """ Type of shade that will always fill with defined color without variation. """ def determine_shade(self, xy_coords: Tuple[int, int]) -> Tuple[int, int, int]: """ Ignores xy coordinates and returns defined color. """ return self.color class NoiseGradient(Shade): """ Type of shade that will produce varying gradient based on noise fields. Unique Parameters: color_variance: How much noise is allowed to affect the color from the central shade color_fields: A noise field for each channel (r,g,b) """ def __init__( self, color: Tuple[int, int, int] = (0, 0, 0), warp_noise: Tuple[NoiseField, NoiseField, NoiseField] = noise_fields(channels=3), warp_size: int = 0, color_variance: int = 70, color_fields: Tuple[NoiseField, NoiseField, NoiseField] = noise_fields(channels=3), ): super().__init__(color, warp_noise, warp_size) self.color_variance = color_variance self.color_fields = tuple(color_fields) def determine_shade(self, xy_coords: Tuple[int, int]) -> Tuple[int, int, int]: """ Measures noise from coordinates and affects color based upon return. """ def apply_noise(i): noise = self.color_fields[i].noise(xy_coords) - 0.5 color_affect = noise * (2*self.color_variance) return self.color[i] + color_affect return color_clamp([apply_noise(i) for i in range(len(self.color))]) class DomainWarpGradient(Shade): """ Type of shade that will produce varying gradient based on recursive noise fields. Unique Parameters: color_variance: How much noise is allowed to affect the color from the central shade color_fields: A noise field for each channel (r,g,b) depth: Number of recursions within noise to make feedback: Affect of recursive calls, recomended around 0-2 """ def __init__( self, color: Tuple[int, int, int] = (0, 0, 0), warp_noise: Tuple[NoiseField, NoiseField] = noise_fields(channels=2), warp_size: int = 0, color_variance: int = 70, color_fields: Tuple[NoiseField, NoiseField, NoiseField] = noise_fields(channels=3), depth: int = 2, feedback: float = 0.7, ): super().__init__(color, warp_noise, warp_size) self.color_variance = color_variance self.color_fields = tuple(color_fields) self.depth = depth self.feedback = feedback def determine_shade(self, xy_coords: Tuple[int, int]) -> Tuple[int, int, int]: """ Determines shade based on xy coordinates. """ def apply_noise(i): noise = self.color_fields[i].recursive_noise( xy_coords, self.depth, self.feedback) - 0.5 color_affect = noise * (2*self.color_variance) return self.color[i] + color_affect return color_clamp([apply_noise(i) for i in range(len(self.color))]) class SwirlOfShades(Shade): """ Type of shade that will select from list of other shades based on recursive noise field. Unique Parameters: swirl_field: a NoiseField from which the selection of the shade is made depth: Number of recursive calls to make from swirl_field.noise (defaults to 0) feedback: Affect of recursive calls from swirl_field.noise shades: this one is very specific, and determines when shades are used. must be list of tuples of this form: (lower_bound, upper_bound, Shade) because the 'shades' arguments potentially confusing, here's an example. The below will color white when noise of 0 - 0.5 is returned, and black if noise of 0.5 - 1 [(0, 0.5, shades.BlockColor((255, 255, 255)), (0.5, 1, shades.BlockColor((0, 0, 0)))] """ def __init__( self, shades: List[Tuple[float, float, Shade]], warp_noise: Tuple[NoiseField, NoiseField] = noise_fields(channels=2), warp_size: int = 0, color_variance: int = 70, swirl_field: NoiseField = NoiseField(), depth: int = 1, feedback: float = 0.7, ): super().__init__(warp_noise=warp_noise, warp_size=warp_size) self.color_variance = color_variance self.swirl_field = swirl_field self.depth = depth self.feedback = feedback self.shades = shades def determine_shade(self, xy_coords: Tuple[int, int]): """ Determines shade based on xy coordinates. """ noise = self.swirl_field.recursive_noise(xy_coords, self.depth, self.feedback) shades = [i for i in self.shades if i[0] <= noise < i[1]] if len(shades) > 0: shade = shades[0][2] return shade.determine_shade(xy_coords) return None class LinearGradient(Shade): """ Type of shade that will determine color based on transition between various 'color_points' Unique Parameters: color_points: Groups of colours and coordinate at which they should appear axis: 0 for horizontal gradient, 1 for vertical Here's an example of color_points in this, anything before 50 (on whichever axis specified) will be black, anything after 100 will be white between 50 and 100 will be grey, with tone based on proximity to 50 or 100 [((0, 0, 0), 50), ((250, 250, 250), 100)] """ def __init__( self, color_points: List[Tuple[int, Tuple[int, int, int]]], axis: int = 0, warp_noise: Tuple[NoiseField, NoiseField] = noise_fields(channels=2), warp_size: int = 0, ): super().__init__(warp_noise=warp_noise, warp_size=warp_size) self.color_points = color_points self.axis = axis def determine_shade(self, xy_coords): """ Determines shade based on xy coordinates. Parameters: xy (iterable): xy coordinates Returns: color in form of tuple """ larger = [i[1] for i in self.color_points if i[1] >= xy_coords[self.axis]] smaller = [i[1] for i in self.color_points if i[1] < xy_coords[self.axis]] if len(smaller) == 0: next_item = min(larger) next_color = [i[0] for i in self.color_points if i[1] == next_item][0] return next_color if len(larger) == 0: last_item = max(smaller) last_color = [i[0] for i in self.color_points if i[1] == last_item][0] return last_color next_item = min(larger) last_item = max(smaller) next_color = [i[0] for i in self.color_points if i[1] == next_item][0] last_color = [i[0] for i in self.color_points if i[1] == last_item][0] distance_from_next = abs(next_item - xy_coords[self.axis]) distance_from_last = abs(last_item - xy_coords[self.axis]) from_last_to_next = distance_from_last / (distance_from_next + distance_from_last) color = [0 for i in len(next_color)] for i, _ in enumerate(next_color): color_difference = ( last_color[i] - next_color[i]) * from_last_to_next color[i] = last_color[i] - color_difference return color_clamp(color) class VerticalGradient(LinearGradient): """ Type of shade that will determine color based on transition between various 'color_points' Unique Parameters: color_points: Groups of colours and coordinate at which they should appear Here's an example of color_points in this, anything before 50 (on y axis) will be black, anything after 100 will be white between 50 and 100 will be grey, with tone based on proximity to 50 or 100 """ def __init__( self, color_points: List[Tuple[int, Tuple[int, int, int]]], warp_noise: Tuple[NoiseField, NoiseField] = noise_fields(channels=2), warp_size: int = 0, ): super().__init__( color_points=color_points, axis=1, warp_noise=warp_noise, warp_size=warp_size, ) class HorizontalGradient(LinearGradient): """ Type of shade that will determine color based on transition between various 'color_points' Unique Parameters: color_points: Groups of colours and coordinate at which they should appear Here's an example of color_points in this, anything before 50 (on x axis) will be black, anything after 100 will be white between 50 and 100 will be grey, with tone based on proximity to 50 or 100 """ def __init__(self, color_points: List[Tuple[int, Tuple[int, int, int]]], warp_noise: Tuple[NoiseField, NoiseField] = noise_fields(channels=2), warp_size: int = 0, ): super().__init__( color_points=color_points, axis=0, warp_noise=warp_noise, warp_size=warp_size, )
21,209
6,890
def CA(file): """correspondence analysis. Args: file (directory): csv file contains genes' RSCU values Returns: - csv file contains genes' values for the first 4 axes of the correspondence analysis result - csv file contains codons' values for the first 4 axes of the correspondence analysis result - plot the genes first 2 axes values of the correspondence analysis result - plot the codons first 2 axes values of the correspondence analysis result """ import pandas as pd import prince import matplotlib.pyplot as plt file = str(file) df = pd.read_csv(file) df.set_index(df.iloc[:,0] , inplace=True)# to make the first column is the index df.drop(df.columns[0], axis=1,inplace= True) df.replace(0,0.0000001,inplace=True) #with prince # make onle CA for 2 axis ca = prince.CA( n_components=4, n_iter=3, copy=True, check_input=True, engine='auto', random_state=42 ) df.columns.rename('Gene Name', inplace=True) df.index.rename('Codons', inplace=True) ca = ca.fit(df) codons = ca.row_coordinates(df) # for Codons genes = ca.column_coordinates(df) #for genes #ca.eigenvalues_ ca.total_inertia_ #total inertia ca.explained_inertia_ #inertia for each axis inertia = ca.explained_inertia_ #save information file_genes = file.replace(".csv",'') file_genes = file_genes + "genes" file_genes = file_genes + ".csv" genes.rename(columns={genes.columns[0]: 'axis 1', genes.columns[1]: 'axis 2', genes.columns[2]: 'axis 3', genes.columns[3]: 'axis 4'}, inplace=True) genes.to_csv(file_genes,sep=',', index=True, header=True) # return csv file for genes ca result file_codons = file.replace(".csv",'') file_codons = file_codons+ "codons" file_codons = file_codons + ".csv" codons.rename(columns={codons.columns[0]: 'axis 1', codons.columns[1]: 'axis 2', codons.columns[2]: 'axis 3', codons.columns[3]: 'axis 4'},inplace=True) codons.to_csv(file_codons, sep=',', index=True, header=True) # return csv file for codon ca result file_inertia = file.replace('.csv','.txt') with open(file_inertia, 'a') as f: f.write("explained inertia" + "\n") for i in range(len(inertia)): i_count = i + 1 with open(file_inertia,'a') as f: f.write ("axis " + str(i_count) + " = " + str(inertia[i]) + "\n" ) with open(file_inertia,'a') as f: f.write("Total Inertia = " + str(ca.total_inertia_)) #plot For genes plt.style.use('seaborn-dark-palette') fig = plt.figure() plt.xlabel("Axis 1") plt.ylabel("Axis 2") plt.title("CA-plot") plt.scatter(genes['axis 1'],genes['axis 2'],s=10,marker ='o') plt.axhline(0, color='black', linestyle='-') plt.axvline(0, color='black', linestyle='-') save_file_name__ca_plot = file + "_CA_gens_plot.png" plt.savefig(save_file_name__ca_plot) # return plot file for gene ca result #for codons plt.style.use('seaborn-dark-palette') fig3 = plt.figure() plt.xlabel("Axis 1") plt.ylabel("Axis 2") plt.title("CA-plot") plt.scatter(codons['axis 1'],codons['axis 2'], s=10,marker ='o') plt.axhline(0, color='black', linestyle='-') plt.axvline(0, color='black', linestyle='-') if len(codons) < 200: for x , y , t in zip(codons['axis 1'],codons['axis 2'] , codons.index.values): x = x * (1 + 0.01) y = y * (1 + 0.01) plt.text(x,y,t) file = file.replace('.csv','') save_file_name__ca_codons_plot = file + "_CA_codos_plot.png" plt.savefig(save_file_name__ca_codons_plot) # return plot file for codon ca result read_genes_file = pd.read_csv(file_genes) read_genes_file.rename(columns={genes.columns[0]: 'gene id', genes.columns[1]: 'axis 1', genes.columns[2]: 'axis 2'}, inplace=True) return read_genes_file
4,104
1,594
""" Main RenderChan package """
32
12
import sys import os import shutil sys.path.append('.') import chia_rep def test_filter_peaks(): sample_dict = chia_rep.read_data('test/sample_input_file.txt', 'test/test_files/hg38.chrom.sizes', output_dir='test/output') for sample in sample_dict: sample_dict[sample].filter_peaks(60, 'chr1') assert len(sample_dict[sample].peak_dict['chr1']) == 60 # if sample == 'sampleA1': # print(len(sample_dict[sample].peak_dict['chr2'])) # assert len(sample_dict[sample].peak_dict['chr2']) == 30 def test_package(): bin_size = 5000 window_size = 3000000 shutil.rmtree('test/output') sample_dict = chia_rep.read_data('test/sample_input_file.txt', 'test/test_files/hg38.chrom.sizes', output_dir='test/output') l = sample_dict chia_rep.preprocess(l, output_dir='test/output') emd_scores, j_scores = chia_rep.compare(l, 'all', compare_list_file='test/pairs.txt', bin_size=bin_size, window_size=window_size, output_dir='test/output') chia_rep.output_to_csv(emd_scores, j_scores, window_size, bin_size, 'all', output_dir='test/output') assert os.path.isfile('test/output/loops/sampleA1.all.loops') assert os.path.isfile('test/output/loops/sampleA2.all.loops') assert os.path.isfile('test/output/loops/sampleB1.all.loops') assert os.path.isfile('test/output/peaks/sampleA1.all.peaks') assert os.path.isfile('test/output/peaks/sampleA2.all.peaks') assert os.path.isfile('test/output/peaks/sampleB1.all.peaks') param = f'{window_size}.{bin_size}.all' assert os.path.isfile(f'test/output/{param}/scores/emd_complete.csv') assert os.path.isfile(f'test/output/{param}/scores/j_complete.csv') assert os.path.isfile(f'test/output/timings/comparison.{param}.txt') assert os.path.isfile(f'test/output/timings/read_data.txt') assert os.path.isfile( f'test/output/{param}/scores/windows/sampleA1_sampleA2_chr1.txt') assert os.path.isfile( f'test/output/{param}/scores/windows/sampleA1_sampleB1_chr1.txt') assert os.path.isfile( f'test/output/{param}/scores/windows/sampleA2_sampleB1_chr1.txt') assert os.path.isfile( f'test/output/{param}/scores/chromosomes/sampleA1_sampleA2.txt') assert os.path.isfile( f'test/output/{param}/scores/chromosomes/sampleA1_sampleB1.txt') assert os.path.isfile( f'test/output/{param}/scores/chromosomes/sampleA2_sampleB1.txt') def test_package2(): bin_size = 5000 window_size = 3000000 shutil.rmtree('test/output') sample_dict = chia_rep.read_data('test/sample_input_file.txt', 'test/test_files/hg38.chrom.sizes', output_dir='test/output') l = sample_dict chia_rep.preprocess(l, output_dir='test/output') comparison_list = [ ['sampleA1', 'sampleA2'], ['sampleA1', 'sampleB1'], ['sampleA2', 'sampleB1'] ] emd_scores, j_scores = chia_rep.compare(l, 'all', compare_list=comparison_list, bin_size=bin_size, window_size=window_size, output_dir='test/output') chia_rep.output_to_csv(emd_scores, j_scores, window_size, bin_size, 'all', output_dir='test/output') assert os.path.isfile('test/output/loops/sampleA1.all.loops') assert os.path.isfile('test/output/loops/sampleA2.all.loops') assert os.path.isfile('test/output/loops/sampleB1.all.loops') assert os.path.isfile('test/output/peaks/sampleA1.all.peaks') assert os.path.isfile('test/output/peaks/sampleA2.all.peaks') assert os.path.isfile('test/output/peaks/sampleB1.all.peaks') param = f'{window_size}.{bin_size}.all' assert os.path.isfile(f'test/output/{param}/scores/emd_complete.csv') assert os.path.isfile(f'test/output/{param}/scores/j_complete.csv') assert os.path.isfile(f'test/output/timings/comparison.{param}.txt') assert os.path.isfile(f'test/output/timings/read_data.txt') assert os.path.isfile( f'test/output/{param}/scores/windows/sampleA1_sampleA2_chr1.txt') assert os.path.isfile( f'test/output/{param}/scores/windows/sampleA1_sampleB1_chr1.txt') assert os.path.isfile( f'test/output/{param}/scores/windows/sampleA2_sampleB1_chr1.txt') assert os.path.isfile( f'test/output/{param}/scores/chromosomes/sampleA1_sampleA2.txt') assert os.path.isfile( f'test/output/{param}/scores/chromosomes/sampleA1_sampleB1.txt') assert os.path.isfile( f'test/output/{param}/scores/chromosomes/sampleA2_sampleB1.txt')
5,110
1,796
# Jacqueline Kory Westlund # May 2016 # # The MIT License (MIT) # # Copyright (c) 2016 Personal Robots Group # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in all # copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # SOFTWARE. from PySide import QtGui # basic GUI stuff from jibo_msgs.msg import JiboAction # ROS msgs from jibo_teleop_ros import jibo_teleop_ros from functools import partial class jibo_animation_ui(QtGui.QWidget): # List of animations for Tega. Not all the SILENT animations are here. animations = [ JiboAction.EMOJI_SHARK, JiboAction.EMOJI_BEER, JiboAction.EMOJI_PARTY_PINK, JiboAction.EMOJI_PARTY_BLUE, JiboAction.EMOJI_RAINCLOUD, JiboAction.HAPPY_GO_LUCKY_DANCE ] def __init__(self, ros_node): """ Make a button for each animation """ super(jibo_animation_ui, self).__init__() # get reference to ros node so we can do callbacks to publish messages self.ros_node = ros_node self.hold_last_frame = False #tracks state of whether jibo will hold last frame of animation or not. False by default # put buttons in a box anim_box = QtGui.QGroupBox(self) anim_layout = QtGui.QGridLayout(anim_box) anim_box.setTitle("Animations") # create animation buttons and add to layout col = 0 row = 1 for anim in self.animations: button = QtGui.QPushButton(anim.lower().replace("\"", ""), anim_box) button.clicked.connect(partial(self.ros_node.send_motion_message, anim)) # if in the top left, make button green if (col < 3 and row < 7): button.setStyleSheet('QPushButton {color: green;}') # if in top right, make button red if (col > 2 and row < 3): button.setStyleSheet('QPushButton {color: red;}') anim_layout.addWidget(button, row, col) col += 1 if(col >= 4): # ten animation buttons per row col = 0 row += 1 #set button to toggle Hold Last Frame row += 1 self.anim_trans_button = QtGui.QPushButton("Turn Hold-Last-Frame ON",anim_box) self.anim_trans_button.setStyleSheet('QPushButton {color: green;}') self.anim_trans_button.clicked.connect(self.on_hold_last_frame_pressed) anim_layout.addWidget(self.anim_trans_button, row, 0) def on_hold_last_frame_pressed(self): if self.hold_last_frame: #we are switching to False state, so the next button press should take us back to TRUE self.anim_trans_button.setText('"Turn Hold-Last-Frame ON') self.anim_trans_button.setStyleSheet('QPushButton {color: green;}') self.ros_node.send_anim_transition_message(JiboAction.ANIMTRANS_RESET) else: self.anim_trans_button.setText('"Turn Hold-Last-Frame OFF') self.anim_trans_button.setStyleSheet('QPushButton {color: red;}') self.ros_node.send_anim_transition_message(JiboAction.ANIMTRANS_KEEP_LASTFRAME) self.hold_last_frame = not self.hold_last_frame #flip state to reflect button press def on_stop_record(self): print("Stop Recording") self.record_button.clicked.disconnect() self.record_button.clicked.connect(self.on_start_record)
4,343
1,389
# Generated by Django 4.0.1 on 2022-01-11 19:00 from django.db import migrations, models import django.db.models.deletion import scans.models class Migration(migrations.Migration): initial = True dependencies = [ ] operations = [ migrations.CreateModel( name='Host', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('hostname', models.CharField(blank=True, default='', max_length=100)), ('hostname_type', models.CharField(blank=True, default='', max_length=50, verbose_name='Host Type')), ('ip_address', models.GenericIPAddressField(protocol='IPv4', verbose_name='IP Address')), ('mac_address', models.CharField(blank=True, default='', max_length=30, verbose_name='MAC Address')), ('assessment_status_1', models.CharField(default='New', max_length=50, verbose_name='Test Status')), ('os_name', models.CharField(blank=True, default='', max_length=100)), ('os_family', models.CharField(blank=True, default='', max_length=100)), ('os_vendor', models.CharField(blank=True, default='', max_length=100)), ('os_gen', models.CharField(blank=True, default='', max_length=100)), ('os_type', models.CharField(blank=True, default='', max_length=100)), ('state', models.CharField(choices=[('up', 'Live'), ('dn', 'Down')], help_text='Host is live or down', max_length=2)), ('state_reason', models.CharField(blank=True, default='', max_length=100, verbose_name='state reason')), ('category', models.CharField(blank=True, default='', max_length=100)), ('criticality', models.SmallIntegerField(default=50, help_text='Asset importance/criticality score 1-100', verbose_name='Asset Criticality')), ('date_discovered', models.DateTimeField(auto_now=True, help_text='Date first seen/scanned')), ('date_last_seen', models.DateTimeField(auto_now=True, help_text='Date last seen/scanned')), ('count_scanned', models.SmallIntegerField(help_text='Number of times this host has been scanned')), ], options={ 'verbose_name': 'host', 'verbose_name_plural': 'hosts', 'ordering': ('ip_address',), }, ), migrations.CreateModel( name='Scan', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('name', models.CharField(max_length=50, unique_for_date='date_created', verbose_name='name')), ('arguments', models.TextField()), ('scan_start', models.DateTimeField(verbose_name='Scan Start')), ('scan_end', models.DateTimeField(verbose_name='Scan End')), ('duration', models.DurationField()), ('nmap_version', models.CharField(max_length=20)), ('xml_version', models.CharField(max_length=20)), ('count_live_hosts', models.IntegerField(verbose_name='Live Hosts')), ('scan_file', models.FileField(help_text='Nmap XML file', upload_to=scans.models.set_files_path, verbose_name='scan file')), ('scan_md5', models.CharField(help_text='MD5 hash of the XML file used for this scan record', max_length=32, verbose_name='MD5')), ('notes', models.TextField(blank=True, default='')), ('date_created', models.DateTimeField(auto_now_add=True)), ('date_modified', models.DateTimeField(auto_now=True)), ], options={ 'verbose_name': 'scan', 'verbose_name_plural': 'scans', 'ordering': ('id',), }, ), migrations.CreateModel( name='ScanPolicy', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('name', models.CharField(max_length=75, unique=True, verbose_name='name')), ('scan_type', models.CharField(default='Discovery', max_length=50, verbose_name='scan type')), ('arguments', models.TextField(help_text='nmap scan command arguments', verbose_name='arguments')), ('output_filename', models.CharField(default='nmap-scan-date.xml', max_length=150, verbose_name='output filename')), ('notes', models.TextField(blank=True, default='')), ], options={ 'verbose_name': 'scan policy', 'verbose_name_plural': 'scan policies', 'ordering': ('scan_type', 'name'), }, ), migrations.CreateModel( name='Service', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('port_number', models.IntegerField(verbose_name='port')), ('port_proto', models.CharField(max_length=10, verbose_name='protocol')), ('service_name', models.CharField(blank=True, default='', max_length=255, verbose_name='service name')), ('product_name', models.CharField(blank=True, default='', max_length=255, verbose_name='product name')), ('product_version', models.CharField(blank=True, default='', max_length=50, verbose_name='product version')), ('product_extrainfo', models.TextField(blank=True, default='', help_text='Extra service info and/or raw scan output')), ('assessment_status_1', models.CharField(default='New', max_length=50, verbose_name='Test Status')), ('state', models.CharField(choices=[('up', 'Live'), ('dn', 'Down')], max_length=2, verbose_name='state')), ('state_reason', models.CharField(blank=True, default='', max_length=100, verbose_name='state reason')), ('category', models.CharField(blank=True, default='', max_length=100)), ('attack_value', models.SmallIntegerField(default=0, help_text='Attack value score 1-100', verbose_name='attack value')), ('notes', models.TextField(blank=True, default='')), ('date_discovered', models.DateTimeField(auto_now=True, help_text='Date first seen/scanned')), ('date_last_seen', models.DateTimeField(auto_now=True, help_text='Date last seen/scanned')), ('count_scanned', models.SmallIntegerField(default=1, help_text='Number of times this host & port has been scanned')), ('host_id', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='scans.host', verbose_name='Host ID')), ('scan_id', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='scans.scan', verbose_name='Scan ID')), ], options={ 'verbose_name': 'service', 'verbose_name_plural': 'services', 'ordering': ('port_number',), }, ), migrations.AddField( model_name='host', name='scan_id', field=models.ForeignKey(on_delete=django.db.models.deletion.PROTECT, to='scans.scan', verbose_name='Scan ID'), ), ]
7,470
2,100
#!/usr/bin/env python # -*- coding: utf-8 -*- # ** # # ======================== # # CHECK_RESERVATIONS_COMMAND # # ======================== # # Command for checking reservations. # # @author ES # ** import logging from collections import OrderedDict from es_common.command.es_command import ESCommand from es_common.enums.command_enums import ActionCommand class CheckReservationsCommand(ESCommand): def __init__(self, is_speech_related=False): super(CheckReservationsCommand, self).__init__(is_speech_related=is_speech_related) self.logger = logging.getLogger("GetReservations Command") self.command_type = ActionCommand.CHECK_RESERVATIONS # ======================= # Override Parent methods # ======================= def execute(self): success = False try: self.logger.info("Not implemented!") except Exception as e: self.logger.error("Error while checking the reservation! {}".format(e)) finally: return success def reset(self): pass def clone(self): return CheckReservationsCommand() ### # SERIALIZATION ### def serialize(self): return OrderedDict([ ("id", self.id), ("command_type", self.command_type.name) ]) def deserialize(self, data, hashmap={}): self.id = data["id"] hashmap[data["id"]] = self return True
1,447
424
# coding: utf-8 from email.mime.text import MIMEText from email.parser import Parser import os import pytest @pytest.fixture def debugsmtp(request, tmpdir): from mr.hermes import DebuggingServer debugsmtp = DebuggingServer(('localhost', 0), ('localhost', 0)) debugsmtp.path = str(tmpdir) yield debugsmtp debugsmtp.close() @pytest.fixture def debugsmtp_thread(debugsmtp): import asyncore import threading thread = threading.Thread( target=asyncore.loop, kwargs=dict( timeout=1)) thread.start() yield thread debugsmtp.close() thread.join() @pytest.fixture def sendmail(debugsmtp, debugsmtp_thread): def sendmail(msg): import smtplib (host, port) = debugsmtp.socket.getsockname() s = smtplib.SMTP(host, port) s.sendmail(msg['From'], [msg['To']], msg.as_string()) s.quit() return sendmail @pytest.fixture def email_msg(): msg = MIMEText(u'Söme text', 'plain', 'utf-8') msg['Subject'] = 'Testmail' msg['From'] = 'sender@example.com' msg['To'] = 'receiver@example.com' return msg def test_mails_filename_order(debugsmtp): me = 'bar@example.com' you = 'foo@example.com' for i in range(10): msg = MIMEText('Mail%02i.' % i) msg['Subject'] = 'Test' msg['From'] = me msg['To'] = you debugsmtp.process_message(('localhost', 0), me, [you], msg.as_string()) mail_content = [] path = os.path.join(debugsmtp.path, 'foo@example.com') for filename in os.listdir(path): with open(os.path.join(path, filename)) as f: msg = Parser().parsestr(f.read()) mail_content.append(msg.get_payload()) assert mail_content == [ 'Mail00.', 'Mail01.', 'Mail02.', 'Mail03.', 'Mail04.', 'Mail05.', 'Mail06.', 'Mail07.', 'Mail08.', 'Mail09.'] def test_functional(sendmail, email_msg, tmpdir): sendmail(email_msg) (receiver,) = tmpdir.listdir() assert receiver.basename == 'receiver@example.com' (email_path,) = receiver.listdir() assert email_path.basename.endswith('.eml') with email_path.open() as f: email = Parser().parsestr(f.read()) body = email.get_payload(decode=True) body = body.decode(email.get_content_charset()) assert email['Subject'] == 'Testmail' assert email['From'] == 'sender@example.com' assert email['To'] == 'receiver@example.com' assert u'Söme text' in body
2,471
871
# Copyright 2020 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import re import uuid import warnings import importlib import traceback import subprocess from io import StringIO from pathlib import Path from functools import partial from multiprocessing import cpu_count from typing import Any, Callable, Dict, List, Optional, Tuple, Union import yaml import numpy import requests from pandas import DataFrame, Int64Dtype, isnull, isna, read_csv, NA from tqdm import tqdm from .anomaly import detect_anomaly_all, detect_stale_columns from .cast import column_convert from .concurrent import process_map from .net import download_snapshot from .io import read_file, fuzzy_text, export_csv from .utils import ( ROOT, CACHE_URL, combine_tables, drop_na_records, filter_output_columns, infer_new_and_total, stratify_age_and_sex, ) class DataSource: """ Interface for data sources. A data source consists of a series of steps performed in the following order: 1. Fetch: download resources into raw data 1. Parse: convert raw data to structured format 1. Merge: associate each record with a known `key` The default implementation of a data source includes the following functionality: * Fetch: downloads raw data from a list of URLs into ../snapshots folder. See [lib.net]. * Merge: outputs a key from the auxiliary dataset after performing best-effort matching. The merge function provided here is crucial for many sources that use it. The easiest/fastest way to merge records is by providing the exact `key` that will match an existing record in the [data/metadata.csv] file. """ config: Dict[str, Any] def __init__(self, config: Dict[str, Any] = None): super().__init__() self.config = config or {} def fetch( self, output_folder: Path, cache: Dict[str, str], fetch_opts: List[Dict[str, Any]] ) -> List[str]: """ Downloads the required resources and returns a list of local paths. Args: output_folder: Root folder where snapshot, intermediate and tables will be placed. cache: Map of data sources that are stored in the cache layer (used for daily-only). fetch_opts: Additional options defined in the DataPipeline config.yaml. Returns: List[str]: List of absolute paths where the fetched resources were stored, in the same order as they are defined in `config`. """ return [ download_snapshot(source_config["url"], output_folder, **source_config.get("opts", {})) for source_config in fetch_opts ] def _read(self, file_paths: List[str], **read_opts) -> List[DataFrame]: """ Reads a raw file input path into a DataFrame """ return [read_file(file_path, **read_opts) for file_path in file_paths] def parse(self, sources: List[str], aux: Dict[str, DataFrame], **parse_opts) -> DataFrame: """ Parses a list of raw data records into a DataFrame. """ # Some read options are passed as parse_opts read_opts = {k: v for k, v in parse_opts.items() if k in ("sep",)} return self.parse_dataframes(self._read(sources, **read_opts), aux, **parse_opts) def parse_dataframes( self, dataframes: List[DataFrame], aux: Dict[str, DataFrame], **parse_opts ) -> DataFrame: """ Parse the inputs into a single output dataframe """ raise NotImplementedError() def merge(self, record: Dict[str, Any], aux: Dict[str, DataFrame]) -> Optional[str]: """ Outputs a key used to merge this record with the datasets. The key must be present in the `aux` DataFrame index. """ # Merge only needs the metadata auxiliary data table metadata = aux["metadata"] # Exact key match might be possible and it's the fastest option if "key" in record and not isnull(record["key"]): if record["key"] in metadata["key"].values: return record["key"] else: warnings.warn("Key provided but not found in metadata: {}".format(record)) return None # Start by filtering the auxiliary dataset as much as possible for column_prefix in ("country", "subregion1", "subregion2"): for column_suffix in ("code", "name"): column = "{}_{}".format(column_prefix, column_suffix) if column not in record: continue elif isnull(record[column]): metadata = metadata[metadata[column].isna()] elif record[column]: metadata = metadata[metadata[column] == record[column]] # Auxiliary dataset might have a single record left, then we are done if len(metadata) == 1: return metadata.iloc[0]["key"] # Compute a fuzzy version of the record's match string for comparison match_string = fuzzy_text(record["match_string"]) if "match_string" in record else None # Provided match string could be a subregion code / name if match_string is not None: for column_prefix in ("subregion1", "subregion2"): for column_suffix in ("code", "name"): column = "{}_{}".format(column_prefix, column_suffix) aux_match = metadata[column + "_fuzzy"] == match_string if sum(aux_match) == 1: return metadata[aux_match].iloc[0]["key"] # Provided match string could be identical to `match_string` (or with simple fuzzy match) if match_string is not None: aux_match_1 = metadata["match_string_fuzzy"] == match_string if sum(aux_match_1) == 1: return metadata[aux_match_1].iloc[0]["key"] aux_match_2 = metadata["match_string"] == record["match_string"] if sum(aux_match_2) == 1: return metadata[aux_match_2].iloc[0]["key"] # Last resort is to match the `match_string` column with a regex from aux if match_string is not None: aux_mask = ~metadata["match_string"].isna() aux_regex = metadata["match_string"][aux_mask].apply( lambda x: re.compile(x, re.IGNORECASE) ) for search_string in (match_string, record["match_string"]): aux_match = aux_regex.apply(lambda x: True if x.match(search_string) else False) if sum(aux_match) == 1: metadata = metadata[aux_mask] return metadata[aux_match].iloc[0]["key"] # Uncomment when debugging mismatches # print(aux_regex) # print(match_string) # print(record) # print(metadata) # raise ValueError() warnings.warn("No key match found for:\n{}".format(record)) return None def run( self, output_folder: Path, cache: Dict[str, str], aux: Dict[str, DataFrame], skip_existing: bool = False, ) -> DataFrame: """ Executes the fetch, parse and merge steps for this data source. Args: output_folder: Root folder where snapshot, intermediate and tables will be placed. cache: Map of data sources that are stored in the cache layer (used for daily-only). aux: Map of auxiliary DataFrames used as part of the processing of this DataSource. skip_existing: Flag indicating whether to use the locally stored snapshots if possible. Returns: DataFrame: Processed data, with columns defined in config.yaml corresponding to the DataPipeline that this DataSource is part of. """ data: DataFrame = None # Insert skip_existing flag to fetch options if requested fetch_opts = self.config.get("fetch", []) if skip_existing: for opt in fetch_opts: opt["opts"] = {**opt.get("opts", {}), "skip_existing": True} # Fetch the data, feeding the cached resources to the fetch step data = self.fetch(output_folder, cache, fetch_opts) # Make yet another copy of the auxiliary table to avoid affecting future steps in `parse` parse_opts = self.config.get("parse", {}) data = self.parse(data, {name: df.copy() for name, df in aux.items()}, **parse_opts) # Merge expects for null values to be NaN (otherwise grouping does not work as expected) data.replace([None], numpy.nan, inplace=True) # Merging is done record by record, but can be sped up if we build a map first aggregating # by the non-temporal fields and only matching the aggregated records with keys merge_opts = self.config.get("merge", {}) key_merge_columns = [ col for col in data if col in aux["metadata"].columns and len(data[col].unique()) > 1 ] if not key_merge_columns or (merge_opts and merge_opts.get("serial")): data["key"] = data.apply(lambda x: self.merge(x, aux), axis=1) else: # "_nan_magic_number" replacement necessary to work around # https://github.com/pandas-dev/pandas/issues/3729 # This issue will be fixed in Pandas 1.1 _nan_magic_number = -123456789 grouped_data = ( data.fillna(_nan_magic_number) .groupby(key_merge_columns) .first() .reset_index() .replace([_nan_magic_number], numpy.nan) ) # Build a _vec column used to merge the key back from the groups into data make_key_vec = lambda x: "|".join([str(x[col]) for col in key_merge_columns]) grouped_data["_vec"] = grouped_data.apply(make_key_vec, axis=1) data["_vec"] = data.apply(make_key_vec, axis=1) # Iterate only over the grouped data to merge with the metadata key grouped_data["key"] = grouped_data.apply(lambda x: self.merge(x, aux), axis=1) # Merge the grouped data which has key back with the original data if "key" in data.columns: data = data.drop(columns=["key"]) data = data.merge(grouped_data[["key", "_vec"]], on="_vec").drop(columns=["_vec"]) # Drop records which have no key merged # TODO: log records with missing key somewhere on disk data = data.dropna(subset=["key"]) # Filter out data according to the user-provided filter function if "query" in self.config: data = data.query(self.config["query"]) # Get the schema of our index table, necessary for processing to infer which columns in the # data belong to the index and should not be aggregated index_schema = DataPipeline.load("index").schema # Provide a stratified view of certain key variables if any(stratify_column in data.columns for stratify_column in ("age", "sex")): data = stratify_age_and_sex(data, index_schema) # Process each record to add missing cumsum or daily diffs data = infer_new_and_total(data, index_schema) # Return the final dataframe return data class DataPipeline: """ A pipeline chain is a collection of individual [DataSource]s which produce a full table ready for output. This is a very thin wrapper that runs the data pipelines and combines their outputs. One of the reasons for a dedicated class is to allow for discovery of [DataPipeline] objects via reflection, users of this class are encouraged to override its methods if custom processing is required. A pipeline chain is responsible for loading the auxiliary datasets that are passed to the individual pipelines. Pipelines can load data themselves, but if the same auxiliary dataset is used by many of them it is more efficient to load it here. """ schema: Dict[str, Any] """ Names and corresponding dtypes of output columns """ data_sources: List[Tuple[DataSource, Dict[str, Any]]] """ List of <data source, option> tuples executed in order """ auxiliary_tables: Dict[str, Union[Path, str]] = { "metadata": ROOT / "src" / "data" / "metadata.csv" } """ Auxiliary datasets passed to the pipelines during processing """ def __init__( self, schema: Dict[str, type], auxiliary: Dict[str, Union[Path, str]], data_sources: List[Tuple[DataSource, Dict[str, Any]]], ): super().__init__() self.schema = schema self.auxiliary_tables = {**self.auxiliary_tables, **auxiliary} self.data_sources = data_sources @staticmethod def load(name: str): config_path = ROOT / "src" / "pipelines" / name / "config.yaml" with open(config_path, "r") as fd: config_yaml = yaml.safe_load(fd) schema = { name: DataPipeline._parse_dtype(dtype) for name, dtype in config_yaml["schema"].items() } auxiliary = {name: ROOT / path for name, path in config_yaml.get("auxiliary", {}).items()} pipelines = [] for pipeline_config in config_yaml["sources"]: module_tokens = pipeline_config["name"].split(".") class_name = module_tokens[-1] module_name = ".".join(module_tokens[:-1]) module = importlib.import_module(module_name) pipelines.append(getattr(module, class_name)(pipeline_config)) return DataPipeline(schema, auxiliary, pipelines) @staticmethod def _parse_dtype(dtype_name: str) -> type: if dtype_name == "str": return str if dtype_name == "int": return Int64Dtype() if dtype_name == "float": return float raise TypeError(f"Unsupported dtype: {dtype_name}") def output_table(self, data: DataFrame) -> DataFrame: """ This function performs the following operations: 1. Filters out columns not in the output schema 2. Converts each column to the appropriate type 3. Sorts the values based on the column order 4. Outputs the resulting data """ output_columns = list(self.schema.keys()) # Make sure all columns are present and have the appropriate type for column, dtype in self.schema.items(): if column not in data: data[column] = None data[column] = column_convert(data[column], dtype) # Filter only output columns and output the sorted data return drop_na_records(data[output_columns], ["date", "key"]).sort_values(output_columns) @staticmethod def _run_wrapper( output_folder: Path, cache: Dict[str, str], aux: Dict[str, DataFrame], data_source: DataSource, ) -> Optional[DataFrame]: """ Workaround necessary for multiprocess pool, which does not accept lambda functions """ try: return data_source.run(output_folder, cache, aux) except Exception: data_source_name = data_source.__class__.__name__ warnings.warn( f"Error running data source {data_source_name} with config {data_source.config}" ) traceback.print_exc() return None def run( self, pipeline_name: str, output_folder: Path, process_count: int = cpu_count(), verify: str = "simple", progress: bool = True, ) -> DataFrame: """ Main method which executes all the associated [DataSource] objects and combines their outputs. """ # Read the cache directory from our cloud storage try: cache = requests.get("{}/sitemap.json".format(CACHE_URL)).json() except: cache = {} warnings.warn("Cache unavailable") # Read the auxiliary input files into memory aux = {name: read_file(file_name) for name, file_name in self.auxiliary_tables.items()} # Precompute some useful transformations in the auxiliary input files aux["metadata"]["match_string_fuzzy"] = aux["metadata"].match_string.apply(fuzzy_text) for category in ("country", "subregion1", "subregion2"): for suffix in ("code", "name"): column = "{}_{}".format(category, suffix) aux["metadata"]["{}_fuzzy".format(column)] = aux["metadata"][column].apply( fuzzy_text ) # Get all the pipeline outputs # This operation is parallelized but output order is preserved # Make a copy of the auxiliary table to prevent modifying it for everyone, but this way # we allow for local modification (which might be wanted for optimization purposes) aux_copy = {name: df.copy() for name, df in aux.items()} # Create a function to be used during mapping. The nestedness is an unfortunate outcome of # the multiprocessing module's limitations when dealing with lambda functions, coupled with # the "sandboxing" we implement to ensure resiliency. run_func = partial(DataPipeline._run_wrapper, output_folder, cache, aux_copy) # If the process count is less than one, run in series (useful to evaluate performance) data_sources_count = len(self.data_sources) progress_label = f"Run {pipeline_name} pipeline" if process_count <= 1 or data_sources_count <= 1: map_func = tqdm( map(run_func, self.data_sources), total=data_sources_count, desc=progress_label, disable=not progress, ) else: map_func = process_map( run_func, self.data_sources, desc=progress_label, disable=not progress ) # Save all intermediate results (to allow for reprocessing) intermediate_outputs = output_folder / "intermediate" intermediate_outputs_files = [] for data_source, result in zip(self.data_sources, map_func): data_source_class = data_source.__class__ data_source_config = str(data_source.config) source_full_name = f"{data_source_class.__module__}.{data_source_class.__name__}" intermediate_name = uuid.uuid5( uuid.NAMESPACE_DNS, f"{source_full_name}.{data_source_config}" ) intermediate_file = intermediate_outputs / f"{intermediate_name}.csv" intermediate_outputs_files += [intermediate_file] if result is not None: export_csv(result, intermediate_file) # Reload all intermediate results from disk # In-memory results are discarded, this ensures reproducibility and allows for data sources # to fail since the last successful intermediate result will be used in the combined output pipeline_outputs = [] for source_output in intermediate_outputs_files: try: pipeline_outputs += [read_file(source_output)] except Exception as exc: warnings.warn(f"Failed to read intermediate file {source_output}. Error: {exc}") # Get rid of all columns which are not part of the output to speed up data combination pipeline_outputs = [ source_output[filter_output_columns(source_output.columns, self.schema)] for source_output in pipeline_outputs ] # Combine all pipeline outputs into a single DataFrame if not pipeline_outputs: warnings.warn("Empty result for pipeline chain {}".format(pipeline_name)) data = DataFrame(columns=self.schema.keys()) else: progress_label = pipeline_name if progress else None data = combine_tables(pipeline_outputs, ["date", "key"], progress_label=progress_label) # Return data using the pipeline's output parameters data = self.output_table(data) # Skip anomaly detection unless requested if verify == "simple": # Validate that the table looks good detect_anomaly_all(self.schema, data, [pipeline_name]) if verify == "full": # Perform stale column detection for each known key map_iter = data.key.unique() map_func = lambda key: detect_stale_columns( self.schema, data[data.key == key], (pipeline_name, key) ) progress_label = f"Verify {pipeline_name} pipeline" if process_count <= 1 or len(map_iter) <= 1: map_func = tqdm( map(map_func, map_iter), total=len(map_iter), desc=progress_label, disable=not progress, ) else: map_func = process_map( map_func, map_iter, desc=progress_label, disable=not progress ) # Show progress as the results arrive if requested if progress: map_func = tqdm( map_func, total=len(map_iter), desc=f"Verify {pipeline_name} pipeline" ) # Consume the results _ = list(map_func) return data
21,967
5,910