instruction
stringclasses 1
value | input
stringlengths 4
139
| output
stringlengths 194
201
|
|---|---|---|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.581380427, molar mass of 279.96 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=Cc1cc(Br)cc(Br)c1O
|
The monomer compound has a SC_score of 2.089948776, molar mass of 277.94 g/mol, boiling point of 130.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Oc1c(S)cc(Br)cc1Br
|
The monomer compound has a SC_score of 1.74038002, molar mass of 283.97 g/mol, boiling point of 94.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NNc1cc(Br)cc(Br)c1O
|
The monomer compound has a SC_score of 2.158466657, molar mass of 281.94 g/mol, boiling point of 94.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CCCc1c(Br)cncc1Br
|
The monomer compound has a SC_score of 2.058674535, molar mass of 288.97 g/mol, boiling point of 134.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NNc1c(Br)cncc1Br
|
The monomer compound has a SC_score of 1.787632583, molar mass of 266.92 g/mol, boiling point of 53.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1cc(Br)c(C2CO2)s1
|
The monomer compound has a SC_score of 2.045180793, molar mass of 283.97 g/mol, boiling point of 89.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
SCc1sc(Br)cc1Br
|
The monomer compound has a SC_score of 2.09608678, molar mass of 288.03 g/mol, boiling point of 51.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Sc1sc(Br)cc1Br
|
The monomer compound has a SC_score of 1.890510469, molar mass of 274.0 g/mol, boiling point of 28.1 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
N=C(N)c1sc(Br)cc1Br
|
The monomer compound has a SC_score of 2.047567179, molar mass of 283.98 g/mol, boiling point of 46.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1ccc(Br)c(C2CO2)c1
|
The monomer compound has a SC_score of 1.805730624, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1cncc(Br)c1C1CO1
|
The monomer compound has a SC_score of 1.856816215, molar mass of 278.93 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
N#CCCc1c(Br)cncc1Br
|
The monomer compound has a SC_score of 2.161927374, molar mass of 289.96 g/mol, boiling point of 117.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(C#N)c1c(Br)cncc1Br
|
The monomer compound has a SC_score of 2.002937062, molar mass of 289.96 g/mol, boiling point of 117.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NOCc1c(Br)cncc1Br
|
The monomer compound has a SC_score of 1.974038576, molar mass of 281.94 g/mol, boiling point of 92.1 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(C)(O)c1cc(Br)c(Br)o1
|
The monomer compound has a SC_score of 1.680697898, molar mass of 283.95 g/mol, boiling point of 128.1 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=CCc1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.989858691, molar mass of 277.94 g/mol, boiling point of 193.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CCc1c(Br)cncc1Br
|
The monomer compound has a SC_score of 1.953213624, molar mass of 274.94 g/mol, boiling point of 110.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NOCc1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.867633499, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C=Nc1c(Br)cncc1Br
|
The monomer compound has a SC_score of 1.904034841, molar mass of 277.9 g/mol, boiling point of 100.3 °C, flammability rating of 4, toxicity level of 2, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CC(C)c1c(Br)cncc1Br
|
The monomer compound has a SC_score of 2.124244569, molar mass of 288.97 g/mol, boiling point of 134.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1cc(C2CO2)oc1Br
|
The monomer compound has a SC_score of 2.129294067, molar mass of 267.9 g/mol, boiling point of 104.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
OCCc1sc(Br)cc1Br
|
The monomer compound has a SC_score of 2.044521138, molar mass of 285.99 g/mol, boiling point of 89.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC1(c2cc(Br)c(Br)o2)CO1
|
The monomer compound has a SC_score of 1.897168, molar mass of 281.93 g/mol, boiling point of 128.1 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(O)c1cc(Br)c(Br)o1
|
The monomer compound has a SC_score of 1.948981111, molar mass of 269.92 g/mol, boiling point of 104.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=Cc1sc(Br)cc1Br
|
The monomer compound has a SC_score of 2.091751037, molar mass of 267.97 g/mol, boiling point of 64.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Oc1cc(Br)c(Br)o1
|
The monomer compound has a SC_score of 1.623791462, molar mass of 241.87 g/mol, boiling point of 57.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Oc1sc(Br)cc1Br
|
The monomer compound has a SC_score of 1.73062883, molar mass of 257.93 g/mol, boiling point of 42.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
OCc1sc(Br)cc1Br
|
The monomer compound has a SC_score of 1.954868085, molar mass of 271.96 g/mol, boiling point of 66.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
ONCc1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.979902015, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(C#N)c1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 2.110808099, molar mass of 288.97 g/mol, boiling point of 143.3 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=Cc1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.611982036, molar mass of 261.94 g/mol, boiling point of 116.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1ccc(C2CO2)c(Br)c1
|
The monomer compound has a SC_score of 2.112665138, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CCc1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.940882669, molar mass of 273.95 g/mol, boiling point of 136.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CCc1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.998878186, molar mass of 273.95 g/mol, boiling point of 136.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
SCc1cc(Br)cnc1Br
|
The monomer compound has a SC_score of 2.019619414, molar mass of 282.99 g/mol, boiling point of 77.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CC(C)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.921423314, molar mass of 287.98 g/mol, boiling point of 159.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
N=C(N)c1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.87980356, molar mass of 277.95 g/mol, boiling point of 97.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NOCc1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.045950749, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=Cc1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.77893371, molar mass of 261.94 g/mol, boiling point of 116.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NNc1cc(Br)c(O)c(Br)c1
|
The monomer compound has a SC_score of 1.854313744, molar mass of 281.94 g/mol, boiling point of 94.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=CC=Cc1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.973934198, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#Cc1ccc(Br)cc1Br
|
The monomer compound has a SC_score of 1.685499188, molar mass of 259.93 g/mol, boiling point of 112.6 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(O)c1c(Br)cncc1Br
|
The monomer compound has a SC_score of 1.615002712, molar mass of 280.95 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(O)c1ccc(Br)c(Br)c1
|
The monomer compound has a SC_score of 1.666912203, molar mass of 279.96 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=CC(=O)c1ccc(Br)c(Br)c1
|
The monomer compound has a SC_score of 2.138174715, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CCc1cc(Br)c(O)c(Br)c1
|
The monomer compound has a SC_score of 2.067076399, molar mass of 289.95 g/mol, boiling point of 150.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#Cc1cc(Br)c(OC)c(Br)c1
|
The monomer compound has a SC_score of 2.040158671, molar mass of 289.95 g/mol, boiling point of 150.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=Cc1cc(Br)c(O)c(Br)c1
|
The monomer compound has a SC_score of 1.827045879, molar mass of 277.94 g/mol, boiling point of 130.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C=Nc1ccc(Br)c(Br)c1
|
The monomer compound has a SC_score of 1.664947441, molar mass of 276.92 g/mol, boiling point of 126.1 °C, flammability rating of 4, toxicity level of 2, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#Cc1cc(Br)cnc1Br
|
The monomer compound has a SC_score of 1.908219563, molar mass of 260.92 g/mol, boiling point of 86.8 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(C#N)c1ncc(Br)cc1Br
|
The monomer compound has a SC_score of 2.056882236, molar mass of 289.96 g/mol, boiling point of 117.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(O)c1cc(Br)cnc1Br
|
The monomer compound has a SC_score of 1.939985279, molar mass of 280.95 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1cnc(C2CO2)c(Br)c1
|
The monomer compound has a SC_score of 1.994847959, molar mass of 278.93 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=Cc1cc(Br)cnc1Br
|
The monomer compound has a SC_score of 2.020715989, molar mass of 262.93 g/mol, boiling point of 90.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1cccc(Br)c1C1CO1
|
The monomer compound has a SC_score of 1.86902609, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Brc1ccc(C2CO2)cc1Br
|
The monomer compound has a SC_score of 1.964283928, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=CC=Cc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.459929903, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CCCc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.927560291, molar mass of 287.98 g/mol, boiling point of 159.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(O)c1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.482338401, molar mass of 279.96 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
N=C(N)c1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.769739005, molar mass of 277.95 g/mol, boiling point of 97.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CCc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.842323986, molar mass of 273.95 g/mol, boiling point of 136.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#CC(C)c1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.948992732, molar mass of 287.98 g/mol, boiling point of 159.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=Cc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.315488235, molar mass of 261.94 g/mol, boiling point of 116.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
ONCc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.878012397, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C#Cc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.625178533, molar mass of 259.93 g/mol, boiling point of 112.6 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NNc1cc(Br)cnc1Br
|
The monomer compound has a SC_score of 2.08877811, molar mass of 266.92 g/mol, boiling point of 53.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=CCc1cc(Br)cnc1Br
|
The monomer compound has a SC_score of 2.152368341, molar mass of 278.93 g/mol, boiling point of 167.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
NOCc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.552561523, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=CC(=O)c1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.876401319, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
SCc1c(Br)cccc1Br
|
The monomer compound has a SC_score of 1.324925041, molar mass of 282.0 g/mol, boiling point of 103.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
COCOc1c(Br)cc(F)cc1Br
|
The monomer compound has a SC_score of 1.738694112, molar mass of 313.95 g/mol, boiling point of 156.1 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CCCCNC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.993452654, molar mass of 335.04 g/mol, boiling point of 264.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Nc1ccncc1)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.072440138, molar mass of 356.02 g/mol, boiling point of 298.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CCCCCCNC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.127885893, molar mass of 363.09 g/mol, boiling point of 311.1 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(O)c1cnn(Cc2ccccc2Br)c1Br
|
The monomer compound has a SC_score of 2.153317709, molar mass of 360.0 g/mol, boiling point of 285.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
COC(CNC(=O)c1cc(Br)ccc1Br)OC
|
The monomer compound has a SC_score of 2.090950082, molar mass of 367.04 g/mol, boiling point of 293.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
COC(=O)C(C)NC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.07723865, molar mass of 365.02 g/mol, boiling point of 345.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Cc1ccc(Br)cc1)Nc1ncccc1Br
|
The monomer compound has a SC_score of 2.086876004, molar mass of 370.04 g/mol, boiling point of 322.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Nc1ccc(Cl)cc1)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.944114321, molar mass of 389.47 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Nc1ccccc1Cl)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.953158108, molar mass of 389.47 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Cc1ccccc1NC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.056870394, molar mass of 369.06 g/mol, boiling point of 348.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
C=C(C)COc1c(Br)cc(C=O)cc1Br
|
The monomer compound has a SC_score of 1.944172905, molar mass of 334.01 g/mol, boiling point of 268.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Cc1cc(Br)c(S(=O)(=O)NC(C)(C)C)cc1Br
|
The monomer compound has a SC_score of 1.888324985, molar mass of 385.12 g/mol, boiling point of 257.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(c1ccc(Br)nc1)c1ccc(Br)nc1
|
The monomer compound has a SC_score of 1.968741577, molar mass of 341.99 g/mol, boiling point of 272.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Nc1ccccc1NC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.982974732, molar mass of 370.04 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=S(=O)(Cl)Cc1cccc(Br)c1Br
|
The monomer compound has a SC_score of 1.891479241, molar mass of 348.44 g/mol, boiling point of 163.2 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Cc1c(Br)csc1Br
|
The monomer compound has a SC_score of 1.69559546, molar mass of 255.96 g/mol, boiling point of 51.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(O)Cc1cc(Br)sc1Br
|
The monomer compound has a SC_score of 2.044835394, molar mass of 299.97 g/mol, boiling point of 156.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(=O)SCc1cccc(Br)c1Br
|
The monomer compound has a SC_score of 1.795124513, molar mass of 324.04 g/mol, boiling point of 216.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Nc1ncccc1Br)c1ccccc1Br
|
The monomer compound has a SC_score of 2.061974552, molar mass of 356.02 g/mol, boiling point of 298.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Nc1ncccc1Br)c1ccc(Br)cc1
|
The monomer compound has a SC_score of 1.953907916, molar mass of 356.02 g/mol, boiling point of 298.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
Cc1ccc(Br)c(NC(=O)c2cccc(Br)c2)c1
|
The monomer compound has a SC_score of 2.109515641, molar mass of 369.06 g/mol, boiling point of 348.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Nc1cccc(Cl)c1)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.026351686, molar mass of 389.47 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CCOC(=O)CNC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 1.993445994, molar mass of 365.02 g/mol, boiling point of 345.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
O=C(Nc1ccccc1F)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.041223123, molar mass of 373.02 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(=O)NCCNC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.060236885, molar mass of 364.04 g/mol, boiling point of 330.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CCCCCNC(=O)c1cc(Br)ccc1Br
|
The monomer compound has a SC_score of 2.077469481, molar mass of 349.07 g/mol, boiling point of 287.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CCOC(=O)C(N)Cc1cc(Br)cc(Br)c1
|
The monomer compound has a SC_score of 1.845577142, molar mass of 351.04 g/mol, boiling point of 278.6 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
|
Based on the given SMILES string, predict the monomer's relevant properties.
|
CC(C)=CCOc1c(Br)cc(Br)cc1C=O
|
The monomer compound has a SC_score of 2.009460398, molar mass of 348.03 g/mol, boiling point of 291.5 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.