instruction
stringclasses
1 value
input
stringlengths
4
139
output
stringlengths
194
201
Based on the given SMILES string, predict the monomer's relevant properties.
CC(O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.581380427, molar mass of 279.96 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=Cc1cc(Br)cc(Br)c1O
The monomer compound has a SC_score of 2.089948776, molar mass of 277.94 g/mol, boiling point of 130.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Oc1c(S)cc(Br)cc1Br
The monomer compound has a SC_score of 1.74038002, molar mass of 283.97 g/mol, boiling point of 94.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NNc1cc(Br)cc(Br)c1O
The monomer compound has a SC_score of 2.158466657, molar mass of 281.94 g/mol, boiling point of 94.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CCCc1c(Br)cncc1Br
The monomer compound has a SC_score of 2.058674535, molar mass of 288.97 g/mol, boiling point of 134.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NNc1c(Br)cncc1Br
The monomer compound has a SC_score of 1.787632583, molar mass of 266.92 g/mol, boiling point of 53.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1cc(Br)c(C2CO2)s1
The monomer compound has a SC_score of 2.045180793, molar mass of 283.97 g/mol, boiling point of 89.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
SCc1sc(Br)cc1Br
The monomer compound has a SC_score of 2.09608678, molar mass of 288.03 g/mol, boiling point of 51.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Sc1sc(Br)cc1Br
The monomer compound has a SC_score of 1.890510469, molar mass of 274.0 g/mol, boiling point of 28.1 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
N=C(N)c1sc(Br)cc1Br
The monomer compound has a SC_score of 2.047567179, molar mass of 283.98 g/mol, boiling point of 46.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1ccc(Br)c(C2CO2)c1
The monomer compound has a SC_score of 1.805730624, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1cncc(Br)c1C1CO1
The monomer compound has a SC_score of 1.856816215, molar mass of 278.93 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
N#CCCc1c(Br)cncc1Br
The monomer compound has a SC_score of 2.161927374, molar mass of 289.96 g/mol, boiling point of 117.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(C#N)c1c(Br)cncc1Br
The monomer compound has a SC_score of 2.002937062, molar mass of 289.96 g/mol, boiling point of 117.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NOCc1c(Br)cncc1Br
The monomer compound has a SC_score of 1.974038576, molar mass of 281.94 g/mol, boiling point of 92.1 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(C)(O)c1cc(Br)c(Br)o1
The monomer compound has a SC_score of 1.680697898, molar mass of 283.95 g/mol, boiling point of 128.1 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=CCc1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.989858691, molar mass of 277.94 g/mol, boiling point of 193.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CCc1c(Br)cncc1Br
The monomer compound has a SC_score of 1.953213624, molar mass of 274.94 g/mol, boiling point of 110.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NOCc1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.867633499, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C=Nc1c(Br)cncc1Br
The monomer compound has a SC_score of 1.904034841, molar mass of 277.9 g/mol, boiling point of 100.3 °C, flammability rating of 4, toxicity level of 2, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CC(C)c1c(Br)cncc1Br
The monomer compound has a SC_score of 2.124244569, molar mass of 288.97 g/mol, boiling point of 134.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1cc(C2CO2)oc1Br
The monomer compound has a SC_score of 2.129294067, molar mass of 267.9 g/mol, boiling point of 104.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
OCCc1sc(Br)cc1Br
The monomer compound has a SC_score of 2.044521138, molar mass of 285.99 g/mol, boiling point of 89.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC1(c2cc(Br)c(Br)o2)CO1
The monomer compound has a SC_score of 1.897168, molar mass of 281.93 g/mol, boiling point of 128.1 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(O)c1cc(Br)c(Br)o1
The monomer compound has a SC_score of 1.948981111, molar mass of 269.92 g/mol, boiling point of 104.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=Cc1sc(Br)cc1Br
The monomer compound has a SC_score of 2.091751037, molar mass of 267.97 g/mol, boiling point of 64.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Oc1cc(Br)c(Br)o1
The monomer compound has a SC_score of 1.623791462, molar mass of 241.87 g/mol, boiling point of 57.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Oc1sc(Br)cc1Br
The monomer compound has a SC_score of 1.73062883, molar mass of 257.93 g/mol, boiling point of 42.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
OCc1sc(Br)cc1Br
The monomer compound has a SC_score of 1.954868085, molar mass of 271.96 g/mol, boiling point of 66.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
ONCc1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.979902015, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(C#N)c1ccc(Br)cc1Br
The monomer compound has a SC_score of 2.110808099, molar mass of 288.97 g/mol, boiling point of 143.3 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=Cc1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.611982036, molar mass of 261.94 g/mol, boiling point of 116.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1ccc(C2CO2)c(Br)c1
The monomer compound has a SC_score of 2.112665138, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CCc1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.940882669, molar mass of 273.95 g/mol, boiling point of 136.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CCc1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.998878186, molar mass of 273.95 g/mol, boiling point of 136.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
SCc1cc(Br)cnc1Br
The monomer compound has a SC_score of 2.019619414, molar mass of 282.99 g/mol, boiling point of 77.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CC(C)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.921423314, molar mass of 287.98 g/mol, boiling point of 159.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
N=C(N)c1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.87980356, molar mass of 277.95 g/mol, boiling point of 97.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NOCc1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.045950749, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=Cc1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.77893371, molar mass of 261.94 g/mol, boiling point of 116.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NNc1cc(Br)c(O)c(Br)c1
The monomer compound has a SC_score of 1.854313744, molar mass of 281.94 g/mol, boiling point of 94.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
Based on the given SMILES string, predict the monomer's relevant properties.
O=CC=Cc1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.973934198, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#Cc1ccc(Br)cc1Br
The monomer compound has a SC_score of 1.685499188, molar mass of 259.93 g/mol, boiling point of 112.6 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(O)c1c(Br)cncc1Br
The monomer compound has a SC_score of 1.615002712, molar mass of 280.95 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(O)c1ccc(Br)c(Br)c1
The monomer compound has a SC_score of 1.666912203, molar mass of 279.96 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=CC(=O)c1ccc(Br)c(Br)c1
The monomer compound has a SC_score of 2.138174715, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CCc1cc(Br)c(O)c(Br)c1
The monomer compound has a SC_score of 2.067076399, molar mass of 289.95 g/mol, boiling point of 150.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#Cc1cc(Br)c(OC)c(Br)c1
The monomer compound has a SC_score of 2.040158671, molar mass of 289.95 g/mol, boiling point of 150.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=Cc1cc(Br)c(O)c(Br)c1
The monomer compound has a SC_score of 1.827045879, molar mass of 277.94 g/mol, boiling point of 130.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C=Nc1ccc(Br)c(Br)c1
The monomer compound has a SC_score of 1.664947441, molar mass of 276.92 g/mol, boiling point of 126.1 °C, flammability rating of 4, toxicity level of 2, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#Cc1cc(Br)cnc1Br
The monomer compound has a SC_score of 1.908219563, molar mass of 260.92 g/mol, boiling point of 86.8 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(C#N)c1ncc(Br)cc1Br
The monomer compound has a SC_score of 2.056882236, molar mass of 289.96 g/mol, boiling point of 117.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(O)c1cc(Br)cnc1Br
The monomer compound has a SC_score of 1.939985279, molar mass of 280.95 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1cnc(C2CO2)c(Br)c1
The monomer compound has a SC_score of 1.994847959, molar mass of 278.93 g/mol, boiling point of 115.7 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=Cc1cc(Br)cnc1Br
The monomer compound has a SC_score of 2.020715989, molar mass of 262.93 g/mol, boiling point of 90.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1cccc(Br)c1C1CO1
The monomer compound has a SC_score of 1.86902609, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Brc1ccc(C2CO2)cc1Br
The monomer compound has a SC_score of 1.964283928, molar mass of 277.94 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=CC=Cc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.459929903, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CCCc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.927560291, molar mass of 287.98 g/mol, boiling point of 159.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(O)c1c(Br)cccc1Br
The monomer compound has a SC_score of 1.482338401, molar mass of 279.96 g/mol, boiling point of 141.5 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
N=C(N)c1c(Br)cccc1Br
The monomer compound has a SC_score of 1.769739005, molar mass of 277.95 g/mol, boiling point of 97.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CCc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.842323986, molar mass of 273.95 g/mol, boiling point of 136.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#CC(C)c1c(Br)cccc1Br
The monomer compound has a SC_score of 1.948992732, molar mass of 287.98 g/mol, boiling point of 159.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=Cc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.315488235, molar mass of 261.94 g/mol, boiling point of 116.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
ONCc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.878012397, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C#Cc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.625178533, molar mass of 259.93 g/mol, boiling point of 112.6 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NNc1cc(Br)cnc1Br
The monomer compound has a SC_score of 2.08877811, molar mass of 266.92 g/mol, boiling point of 53.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 2.
Based on the given SMILES string, predict the monomer's relevant properties.
O=CCc1cc(Br)cnc1Br
The monomer compound has a SC_score of 2.152368341, molar mass of 278.93 g/mol, boiling point of 167.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
NOCc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.552561523, molar mass of 280.95 g/mol, boiling point of 117.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=CC(=O)c1c(Br)cccc1Br
The monomer compound has a SC_score of 1.876401319, molar mass of 289.95 g/mol, boiling point of 206.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
SCc1c(Br)cccc1Br
The monomer compound has a SC_score of 1.324925041, molar mass of 282.0 g/mol, boiling point of 103.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
COCOc1c(Br)cc(F)cc1Br
The monomer compound has a SC_score of 1.738694112, molar mass of 313.95 g/mol, boiling point of 156.1 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CCCCNC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.993452654, molar mass of 335.04 g/mol, boiling point of 264.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Nc1ccncc1)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.072440138, molar mass of 356.02 g/mol, boiling point of 298.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CCCCCCNC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.127885893, molar mass of 363.09 g/mol, boiling point of 311.1 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(O)c1cnn(Cc2ccccc2Br)c1Br
The monomer compound has a SC_score of 2.153317709, molar mass of 360.0 g/mol, boiling point of 285.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
COC(CNC(=O)c1cc(Br)ccc1Br)OC
The monomer compound has a SC_score of 2.090950082, molar mass of 367.04 g/mol, boiling point of 293.2 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
COC(=O)C(C)NC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.07723865, molar mass of 365.02 g/mol, boiling point of 345.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Cc1ccc(Br)cc1)Nc1ncccc1Br
The monomer compound has a SC_score of 2.086876004, molar mass of 370.04 g/mol, boiling point of 322.2 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Nc1ccc(Cl)cc1)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.944114321, molar mass of 389.47 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Nc1ccccc1Cl)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.953158108, molar mass of 389.47 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Cc1ccccc1NC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.056870394, molar mass of 369.06 g/mol, boiling point of 348.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
C=C(C)COc1c(Br)cc(C=O)cc1Br
The monomer compound has a SC_score of 1.944172905, molar mass of 334.01 g/mol, boiling point of 268.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Cc1cc(Br)c(S(=O)(=O)NC(C)(C)C)cc1Br
The monomer compound has a SC_score of 1.888324985, molar mass of 385.12 g/mol, boiling point of 257.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(c1ccc(Br)nc1)c1ccc(Br)nc1
The monomer compound has a SC_score of 1.968741577, molar mass of 341.99 g/mol, boiling point of 272.9 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Nc1ccccc1NC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.982974732, molar mass of 370.04 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=S(=O)(Cl)Cc1cccc(Br)c1Br
The monomer compound has a SC_score of 1.891479241, molar mass of 348.44 g/mol, boiling point of 163.2 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Cc1c(Br)csc1Br
The monomer compound has a SC_score of 1.69559546, molar mass of 255.96 g/mol, boiling point of 51.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(O)Cc1cc(Br)sc1Br
The monomer compound has a SC_score of 2.044835394, molar mass of 299.97 g/mol, boiling point of 156.3 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(=O)SCc1cccc(Br)c1Br
The monomer compound has a SC_score of 1.795124513, molar mass of 324.04 g/mol, boiling point of 216.8 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Nc1ncccc1Br)c1ccccc1Br
The monomer compound has a SC_score of 2.061974552, molar mass of 356.02 g/mol, boiling point of 298.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Nc1ncccc1Br)c1ccc(Br)cc1
The monomer compound has a SC_score of 1.953907916, molar mass of 356.02 g/mol, boiling point of 298.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
Cc1ccc(Br)c(NC(=O)c2cccc(Br)c2)c1
The monomer compound has a SC_score of 2.109515641, molar mass of 369.06 g/mol, boiling point of 348.0 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Nc1cccc(Cl)c1)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.026351686, molar mass of 389.47 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CCOC(=O)CNC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 1.993445994, molar mass of 365.02 g/mol, boiling point of 345.0 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
O=C(Nc1ccccc1F)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.041223123, molar mass of 373.02 g/mol, boiling point of 324.5 °C, flammability rating of 4, toxicity level of 3, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(=O)NCCNC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.060236885, molar mass of 364.04 g/mol, boiling point of 330.4 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CCCCCNC(=O)c1cc(Br)ccc1Br
The monomer compound has a SC_score of 2.077469481, molar mass of 349.07 g/mol, boiling point of 287.6 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CCOC(=O)C(N)Cc1cc(Br)cc(Br)c1
The monomer compound has a SC_score of 1.845577142, molar mass of 351.04 g/mol, boiling point of 278.6 °C, flammability rating of 4, toxicity level of 5, odor rating of 0, and solubility rating of 1.
Based on the given SMILES string, predict the monomer's relevant properties.
CC(C)=CCOc1c(Br)cc(Br)cc1C=O
The monomer compound has a SC_score of 2.009460398, molar mass of 348.03 g/mol, boiling point of 291.5 °C, flammability rating of 4, toxicity level of 4, odor rating of 0, and solubility rating of 1.