Add files using upload-large-folder tool

janus/lib/python3.10/site-packages/numpy/_core/__init__.py

@@ -0,0 +1,180 @@
+"""
+Contains the core of NumPy: ndarray, ufuncs, dtypes, etc.
+
+Please note that this module is private.  All functions and objects
+are available in the main ``numpy`` namespace - use that instead.
+
+"""
+
+import os
+
+from numpy.version import version as __version__
+
+
+# disables OpenBLAS affinity setting of the main thread that limits
+# python threads or processes to one core
+env_added = []
+for envkey in ['OPENBLAS_MAIN_FREE', 'GOTOBLAS_MAIN_FREE']:
+    if envkey not in os.environ:
+        os.environ[envkey] = '1'
+        env_added.append(envkey)
+
+try:
+    from . import multiarray
+except ImportError as exc:
+    import sys
+    msg = """
+
+IMPORTANT: PLEASE READ THIS FOR ADVICE ON HOW TO SOLVE THIS ISSUE!
+
+Importing the numpy C-extensions failed. This error can happen for
+many reasons, often due to issues with your setup or how NumPy was
+installed.
+
+We have compiled some common reasons and troubleshooting tips at:
+
+    https://numpy.org/devdocs/user/troubleshooting-importerror.html
+
+Please note and check the following:
+
+  * The Python version is: Python%d.%d from "%s"
+  * The NumPy version is: "%s"
+
+and make sure that they are the versions you expect.
+Please carefully study the documentation linked above for further help.
+
+Original error was: %s
+""" % (sys.version_info[0], sys.version_info[1], sys.executable,
+        __version__, exc)
+    raise ImportError(msg)
+finally:
+    for envkey in env_added:
+        del os.environ[envkey]
+del envkey
+del env_added
+del os
+
+from . import umath
+
+# Check that multiarray,umath are pure python modules wrapping
+# _multiarray_umath and not either of the old c-extension modules
+if not (hasattr(multiarray, '_multiarray_umath') and
+        hasattr(umath, '_multiarray_umath')):
+    import sys
+    path = sys.modules['numpy'].__path__
+    msg = ("Something is wrong with the numpy installation. "
+        "While importing we detected an older version of "
+        "numpy in {}. One method of fixing this is to repeatedly uninstall "
+        "numpy until none is found, then reinstall this version.")
+    raise ImportError(msg.format(path))
+
+from . import numerictypes as nt
+from .numerictypes import sctypes, sctypeDict
+multiarray.set_typeDict(nt.sctypeDict)
+from . import numeric
+from .numeric import *
+from . import fromnumeric
+from .fromnumeric import *
+from .records import record, recarray
+# Note: module name memmap is overwritten by a class with same name
+from .memmap import *
+from . import function_base
+from .function_base import *
+from . import _machar
+from . import getlimits
+from .getlimits import *
+from . import shape_base
+from .shape_base import *
+from . import einsumfunc
+from .einsumfunc import *
+del nt
+
+from .numeric import absolute as abs
+
+# do this after everything else, to minimize the chance of this misleadingly
+# appearing in an import-time traceback
+from . import _add_newdocs
+from . import _add_newdocs_scalars
+# add these for module-freeze analysis (like PyInstaller)
+from . import _dtype_ctypes
+from . import _internal
+from . import _dtype
+from . import _methods
+
+acos = numeric.arccos
+acosh = numeric.arccosh
+asin = numeric.arcsin
+asinh = numeric.arcsinh
+atan = numeric.arctan
+atanh = numeric.arctanh
+atan2 = numeric.arctan2
+concat = numeric.concatenate
+bitwise_left_shift = numeric.left_shift
+bitwise_invert = numeric.invert
+bitwise_right_shift = numeric.right_shift
+permute_dims = numeric.transpose
+pow = numeric.power
+
+__all__ = [
+    "abs", "acos", "acosh", "asin", "asinh", "atan", "atanh", "atan2",
+    "bitwise_invert", "bitwise_left_shift", "bitwise_right_shift", "concat",
+    "pow", "permute_dims", "memmap", "sctypeDict", "record", "recarray"
+]
+__all__ += numeric.__all__
+__all__ += function_base.__all__
+__all__ += getlimits.__all__
+__all__ += shape_base.__all__
+__all__ += einsumfunc.__all__
+
+
+def _ufunc_reduce(func):
+    # Report the `__name__`. pickle will try to find the module. Note that
+    # pickle supports for this `__name__` to be a `__qualname__`. It may
+    # make sense to add a `__qualname__` to ufuncs, to allow this more
+    # explicitly (Numba has ufuncs as attributes).
+    # See also: https://github.com/dask/distributed/issues/3450
+    return func.__name__
+
+
+def _DType_reconstruct(scalar_type):
+    # This is a work-around to pickle type(np.dtype(np.float64)), etc.
+    # and it should eventually be replaced with a better solution, e.g. when
+    # DTypes become HeapTypes.
+    return type(dtype(scalar_type))
+
+
+def _DType_reduce(DType):
+    # As types/classes, most DTypes can simply be pickled by their name:
+    if not DType._legacy or DType.__module__ == "numpy.dtypes":
+        return DType.__name__
+
+    # However, user defined legacy dtypes (like rational) do not end up in
+    # `numpy.dtypes` as module and do not have a public class at all.
+    # For these, we pickle them by reconstructing them from the scalar type:
+    scalar_type = DType.type
+    return _DType_reconstruct, (scalar_type,)
+
+
+def __getattr__(name):
+    # Deprecated 2022-11-22, NumPy 1.25.
+    if name == "MachAr":
+        import warnings
+        warnings.warn(
+            "The `np._core.MachAr` is considered private API (NumPy 1.24)",
+            DeprecationWarning, stacklevel=2,
+        )
+        return _machar.MachAr
+    raise AttributeError(f"Module {__name__!r} has no attribute {name!r}")
+
+
+import copyreg
+
+copyreg.pickle(ufunc, _ufunc_reduce)
+copyreg.pickle(type(dtype), _DType_reduce, _DType_reconstruct)
+
+# Unclutter namespace (must keep _*_reconstruct for unpickling)
+del copyreg, _ufunc_reduce, _DType_reduce
+
+from numpy._pytesttester import PytestTester
+test = PytestTester(__name__)
+del PytestTester

janus/lib/python3.10/site-packages/numpy/_core/__init__.pyi

@@ -0,0 +1,2 @@
+# NOTE: The `np._core` namespace is deliberately kept empty due to it
+# being private

janus/lib/python3.10/site-packages/numpy/_core/_asarray.pyi

@@ -0,0 +1,41 @@
+from collections.abc import Iterable
+from typing import Any, TypeAlias, TypeVar, overload, Literal
+
+from numpy._typing import NDArray, DTypeLike, _SupportsArrayFunc
+
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+_Requirements: TypeAlias = Literal[
+    "C", "C_CONTIGUOUS", "CONTIGUOUS",
+    "F", "F_CONTIGUOUS", "FORTRAN",
+    "A", "ALIGNED",
+    "W", "WRITEABLE",
+    "O", "OWNDATA"
+]
+_E: TypeAlias = Literal["E", "ENSUREARRAY"]
+_RequirementsWithE: TypeAlias = _Requirements | _E
+
+@overload
+def require(
+    a: _ArrayType,
+    dtype: None = ...,
+    requirements: None | _Requirements | Iterable[_Requirements] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> _ArrayType: ...
+@overload
+def require(
+    a: object,
+    dtype: DTypeLike = ...,
+    requirements: _E | Iterable[_RequirementsWithE] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> NDArray[Any]: ...
+@overload
+def require(
+    a: object,
+    dtype: DTypeLike = ...,
+    requirements: None | _Requirements | Iterable[_Requirements] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> NDArray[Any]: ...

janus/lib/python3.10/site-packages/numpy/_core/_dtype.py

@@ -0,0 +1,374 @@
+"""
+A place for code to be called from the implementation of np.dtype
+
+String handling is much easier to do correctly in python.
+"""
+import numpy as np
+
+
+_kind_to_stem = {
+    'u': 'uint',
+    'i': 'int',
+    'c': 'complex',
+    'f': 'float',
+    'b': 'bool',
+    'V': 'void',
+    'O': 'object',
+    'M': 'datetime',
+    'm': 'timedelta',
+    'S': 'bytes',
+    'U': 'str',
+}
+
+
+def _kind_name(dtype):
+    try:
+        return _kind_to_stem[dtype.kind]
+    except KeyError as e:
+        raise RuntimeError(
+            "internal dtype error, unknown kind {!r}"
+            .format(dtype.kind)
+        ) from None
+
+
+def __str__(dtype):
+    if dtype.fields is not None:
+        return _struct_str(dtype, include_align=True)
+    elif dtype.subdtype:
+        return _subarray_str(dtype)
+    elif issubclass(dtype.type, np.flexible) or not dtype.isnative:
+        return dtype.str
+    else:
+        return dtype.name
+
+
+def __repr__(dtype):
+    arg_str = _construction_repr(dtype, include_align=False)
+    if dtype.isalignedstruct:
+        arg_str = arg_str + ", align=True"
+    return "dtype({})".format(arg_str)
+
+
+def _unpack_field(dtype, offset, title=None):
+    """
+    Helper function to normalize the items in dtype.fields.
+
+    Call as:
+
+    dtype, offset, title = _unpack_field(*dtype.fields[name])
+    """
+    return dtype, offset, title
+
+
+def _isunsized(dtype):
+    # PyDataType_ISUNSIZED
+    return dtype.itemsize == 0
+
+
+def _construction_repr(dtype, include_align=False, short=False):
+    """
+    Creates a string repr of the dtype, excluding the 'dtype()' part
+    surrounding the object. This object may be a string, a list, or
+    a dict depending on the nature of the dtype. This
+    is the object passed as the first parameter to the dtype
+    constructor, and if no additional constructor parameters are
+    given, will reproduce the exact memory layout.
+
+    Parameters
+    ----------
+    short : bool
+        If true, this creates a shorter repr using 'kind' and 'itemsize',
+        instead of the longer type name.
+
+    include_align : bool
+        If true, this includes the 'align=True' parameter
+        inside the struct dtype construction dict when needed. Use this flag
+        if you want a proper repr string without the 'dtype()' part around it.
+
+        If false, this does not preserve the
+        'align=True' parameter or sticky NPY_ALIGNED_STRUCT flag for
+        struct arrays like the regular repr does, because the 'align'
+        flag is not part of first dtype constructor parameter. This
+        mode is intended for a full 'repr', where the 'align=True' is
+        provided as the second parameter.
+    """
+    if dtype.fields is not None:
+        return _struct_str(dtype, include_align=include_align)
+    elif dtype.subdtype:
+        return _subarray_str(dtype)
+    else:
+        return _scalar_str(dtype, short=short)
+
+
+def _scalar_str(dtype, short):
+    byteorder = _byte_order_str(dtype)
+
+    if dtype.type == np.bool:
+        if short:
+            return "'?'"
+        else:
+            return "'bool'"
+
+    elif dtype.type == np.object_:
+        # The object reference may be different sizes on different
+        # platforms, so it should never include the itemsize here.
+        return "'O'"
+
+    elif dtype.type == np.bytes_:
+        if _isunsized(dtype):
+            return "'S'"
+        else:
+            return "'S%d'" % dtype.itemsize
+
+    elif dtype.type == np.str_:
+        if _isunsized(dtype):
+            return "'%sU'" % byteorder
+        else:
+            return "'%sU%d'" % (byteorder, dtype.itemsize / 4)
+
+    elif dtype.type == str:
+        return "'T'"
+
+    elif not type(dtype)._legacy:
+        return f"'{byteorder}{type(dtype).__name__}{dtype.itemsize * 8}'"
+
+    # unlike the other types, subclasses of void are preserved - but
+    # historically the repr does not actually reveal the subclass
+    elif issubclass(dtype.type, np.void):
+        if _isunsized(dtype):
+            return "'V'"
+        else:
+            return "'V%d'" % dtype.itemsize
+
+    elif dtype.type == np.datetime64:
+        return "'%sM8%s'" % (byteorder, _datetime_metadata_str(dtype))
+
+    elif dtype.type == np.timedelta64:
+        return "'%sm8%s'" % (byteorder, _datetime_metadata_str(dtype))
+
+    elif np.issubdtype(dtype, np.number):
+        # Short repr with endianness, like '<f8'
+        if short or dtype.byteorder not in ('=', '|'):
+            return "'%s%c%d'" % (byteorder, dtype.kind, dtype.itemsize)
+
+        # Longer repr, like 'float64'
+        else:
+            return "'%s%d'" % (_kind_name(dtype), 8*dtype.itemsize)
+
+    elif dtype.isbuiltin == 2:
+        return dtype.type.__name__
+
+    else:
+        raise RuntimeError(
+            "Internal error: NumPy dtype unrecognized type number")
+
+
+def _byte_order_str(dtype):
+    """ Normalize byteorder to '<' or '>' """
+    # hack to obtain the native and swapped byte order characters
+    swapped = np.dtype(int).newbyteorder('S')
+    native = swapped.newbyteorder('S')
+
+    byteorder = dtype.byteorder
+    if byteorder == '=':
+        return native.byteorder
+    if byteorder == 'S':
+        # TODO: this path can never be reached
+        return swapped.byteorder
+    elif byteorder == '|':
+        return ''
+    else:
+        return byteorder
+
+
+def _datetime_metadata_str(dtype):
+    # TODO: this duplicates the C metastr_to_unicode functionality
+    unit, count = np.datetime_data(dtype)
+    if unit == 'generic':
+        return ''
+    elif count == 1:
+        return '[{}]'.format(unit)
+    else:
+        return '[{}{}]'.format(count, unit)
+
+
+def _struct_dict_str(dtype, includealignedflag):
+    # unpack the fields dictionary into ls
+    names = dtype.names
+    fld_dtypes = []
+    offsets = []
+    titles = []
+    for name in names:
+        fld_dtype, offset, title = _unpack_field(*dtype.fields[name])
+        fld_dtypes.append(fld_dtype)
+        offsets.append(offset)
+        titles.append(title)
+
+    # Build up a string to make the dictionary
+
+    if np._core.arrayprint._get_legacy_print_mode() <= 121:
+        colon = ":"
+        fieldsep = ","
+    else:
+        colon = ": "
+        fieldsep = ", "
+
+    # First, the names
+    ret = "{'names'%s[" % colon
+    ret += fieldsep.join(repr(name) for name in names)
+
+    # Second, the formats
+    ret += "], 'formats'%s[" % colon
+    ret += fieldsep.join(
+        _construction_repr(fld_dtype, short=True) for fld_dtype in fld_dtypes)
+
+    # Third, the offsets
+    ret += "], 'offsets'%s[" % colon
+    ret += fieldsep.join("%d" % offset for offset in offsets)
+
+    # Fourth, the titles
+    if any(title is not None for title in titles):
+        ret += "], 'titles'%s[" % colon
+        ret += fieldsep.join(repr(title) for title in titles)
+
+    # Fifth, the itemsize
+    ret += "], 'itemsize'%s%d" % (colon, dtype.itemsize)
+
+    if (includealignedflag and dtype.isalignedstruct):
+        # Finally, the aligned flag
+        ret += ", 'aligned'%sTrue}" % colon
+    else:
+        ret += "}"
+
+    return ret
+
+
+def _aligned_offset(offset, alignment):
+    # round up offset:
+    return - (-offset // alignment) * alignment
+
+
+def _is_packed(dtype):
+    """
+    Checks whether the structured data type in 'dtype'
+    has a simple layout, where all the fields are in order,
+    and follow each other with no alignment padding.
+
+    When this returns true, the dtype can be reconstructed
+    from a list of the field names and dtypes with no additional
+    dtype parameters.
+
+    Duplicates the C `is_dtype_struct_simple_unaligned_layout` function.
+    """
+    align = dtype.isalignedstruct
+    max_alignment = 1
+    total_offset = 0
+    for name in dtype.names:
+        fld_dtype, fld_offset, title = _unpack_field(*dtype.fields[name])
+
+        if align:
+            total_offset = _aligned_offset(total_offset, fld_dtype.alignment)
+            max_alignment = max(max_alignment, fld_dtype.alignment)
+
+        if fld_offset != total_offset:
+            return False
+        total_offset += fld_dtype.itemsize
+
+    if align:
+        total_offset = _aligned_offset(total_offset, max_alignment)
+
+    return total_offset == dtype.itemsize
+
+
+def _struct_list_str(dtype):
+    items = []
+    for name in dtype.names:
+        fld_dtype, fld_offset, title = _unpack_field(*dtype.fields[name])
+
+        item = "("
+        if title is not None:
+            item += "({!r}, {!r}), ".format(title, name)
+        else:
+            item += "{!r}, ".format(name)
+        # Special case subarray handling here
+        if fld_dtype.subdtype is not None:
+            base, shape = fld_dtype.subdtype
+            item += "{}, {}".format(
+                _construction_repr(base, short=True),
+                shape
+            )
+        else:
+            item += _construction_repr(fld_dtype, short=True)
+
+        item += ")"
+        items.append(item)
+
+    return "[" + ", ".join(items) + "]"
+
+
+def _struct_str(dtype, include_align):
+    # The list str representation can't include the 'align=' flag,
+    # so if it is requested and the struct has the aligned flag set,
+    # we must use the dict str instead.
+    if not (include_align and dtype.isalignedstruct) and _is_packed(dtype):
+        sub = _struct_list_str(dtype)
+
+    else:
+        sub = _struct_dict_str(dtype, include_align)
+
+    # If the data type isn't the default, void, show it
+    if dtype.type != np.void:
+        return "({t.__module__}.{t.__name__}, {f})".format(t=dtype.type, f=sub)
+    else:
+        return sub
+
+
+def _subarray_str(dtype):
+    base, shape = dtype.subdtype
+    return "({}, {})".format(
+        _construction_repr(base, short=True),
+        shape
+    )
+
+
+def _name_includes_bit_suffix(dtype):
+    if dtype.type == np.object_:
+        # pointer size varies by system, best to omit it
+        return False
+    elif dtype.type == np.bool:
+        # implied
+        return False
+    elif dtype.type is None:
+        return True
+    elif np.issubdtype(dtype, np.flexible) and _isunsized(dtype):
+        # unspecified
+        return False
+    else:
+        return True
+
+
+def _name_get(dtype):
+    # provides dtype.name.__get__, documented as returning a "bit name"
+
+    if dtype.isbuiltin == 2:
+        # user dtypes don't promise to do anything special
+        return dtype.type.__name__
+
+    if not type(dtype)._legacy:
+        name = type(dtype).__name__
+
+    elif issubclass(dtype.type, np.void):
+        # historically, void subclasses preserve their name, eg `record64`
+        name = dtype.type.__name__
+    else:
+        name = _kind_name(dtype)
+
+    # append bit counts
+    if _name_includes_bit_suffix(dtype):
+        name += "{}".format(dtype.itemsize * 8)
+
+    # append metadata to datetimes
+    if dtype.type in (np.datetime64, np.timedelta64):
+        name += _datetime_metadata_str(dtype)
+
+    return name

janus/lib/python3.10/site-packages/numpy/_core/_internal.pyi

@@ -0,0 +1,30 @@
+from typing import Any, TypeVar, overload, Generic
+import ctypes as ct
+
+from numpy.typing import NDArray
+from numpy.ctypeslib import c_intp
+
+_CastT = TypeVar("_CastT", bound=ct._CanCastTo)  # Copied from `ctypes.cast`
+_CT = TypeVar("_CT", bound=ct._CData)
+_PT = TypeVar("_PT", bound=int)
+
+# TODO: Let the likes of `shape_as` and `strides_as` return `None`
+# for 0D arrays once we've got shape-support
+
+class _ctypes(Generic[_PT]):
+    @overload
+    def __new__(cls, array: NDArray[Any], ptr: None = ...) -> _ctypes[None]: ...
+    @overload
+    def __new__(cls, array: NDArray[Any], ptr: _PT) -> _ctypes[_PT]: ...
+    @property
+    def data(self) -> _PT: ...
+    @property
+    def shape(self) -> ct.Array[c_intp]: ...
+    @property
+    def strides(self) -> ct.Array[c_intp]: ...
+    @property
+    def _as_parameter_(self) -> ct.c_void_p: ...
+
+    def data_as(self, obj: type[_CastT]) -> _CastT: ...
+    def shape_as(self, obj: type[_CT]) -> ct.Array[_CT]: ...
+    def strides_as(self, obj: type[_CT]) -> ct.Array[_CT]: ...

janus/lib/python3.10/site-packages/numpy/_core/_methods.py

@@ -0,0 +1,256 @@
+"""
+Array methods which are called by both the C-code for the method
+and the Python code for the NumPy-namespace function
+
+"""
+import os
+import pickle
+import warnings
+from contextlib import nullcontext
+
+import numpy as np
+from numpy._core import multiarray as mu
+from numpy._core import umath as um
+from numpy._core.multiarray import asanyarray
+from numpy._core import numerictypes as nt
+from numpy._core import _exceptions
+from numpy._globals import _NoValue
+
+# save those O(100) nanoseconds!
+bool_dt = mu.dtype("bool")
+umr_maximum = um.maximum.reduce
+umr_minimum = um.minimum.reduce
+umr_sum = um.add.reduce
+umr_prod = um.multiply.reduce
+umr_bitwise_count = um.bitwise_count
+umr_any = um.logical_or.reduce
+umr_all = um.logical_and.reduce
+
+# Complex types to -> (2,)float view for fast-path computation in _var()
+_complex_to_float = {
+    nt.dtype(nt.csingle) : nt.dtype(nt.single),
+    nt.dtype(nt.cdouble) : nt.dtype(nt.double),
+}
+# Special case for windows: ensure double takes precedence
+if nt.dtype(nt.longdouble) != nt.dtype(nt.double):
+    _complex_to_float.update({
+        nt.dtype(nt.clongdouble) : nt.dtype(nt.longdouble),
+    })
+
+# avoid keyword arguments to speed up parsing, saves about 15%-20% for very
+# small reductions
+def _amax(a, axis=None, out=None, keepdims=False,
+          initial=_NoValue, where=True):
+    return umr_maximum(a, axis, None, out, keepdims, initial, where)
+
+def _amin(a, axis=None, out=None, keepdims=False,
+          initial=_NoValue, where=True):
+    return umr_minimum(a, axis, None, out, keepdims, initial, where)
+
+def _sum(a, axis=None, dtype=None, out=None, keepdims=False,
+         initial=_NoValue, where=True):
+    return umr_sum(a, axis, dtype, out, keepdims, initial, where)
+
+def _prod(a, axis=None, dtype=None, out=None, keepdims=False,
+          initial=_NoValue, where=True):
+    return umr_prod(a, axis, dtype, out, keepdims, initial, where)
+
+def _any(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True):
+    # By default, return a boolean for any and all
+    if dtype is None:
+        dtype = bool_dt
+    # Parsing keyword arguments is currently fairly slow, so avoid it for now
+    if where is True:
+        return umr_any(a, axis, dtype, out, keepdims)
+    return umr_any(a, axis, dtype, out, keepdims, where=where)
+
+def _all(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True):
+    # By default, return a boolean for any and all
+    if dtype is None:
+        dtype = bool_dt
+    # Parsing keyword arguments is currently fairly slow, so avoid it for now
+    if where is True:
+        return umr_all(a, axis, dtype, out, keepdims)
+    return umr_all(a, axis, dtype, out, keepdims, where=where)
+
+def _count_reduce_items(arr, axis, keepdims=False, where=True):
+    # fast-path for the default case
+    if where is True:
+        # no boolean mask given, calculate items according to axis
+        if axis is None:
+            axis = tuple(range(arr.ndim))
+        elif not isinstance(axis, tuple):
+            axis = (axis,)
+        items = 1
+        for ax in axis:
+            items *= arr.shape[mu.normalize_axis_index(ax, arr.ndim)]
+        items = nt.intp(items)
+    else:
+        # TODO: Optimize case when `where` is broadcast along a non-reduction
+        # axis and full sum is more excessive than needed.
+
+        # guarded to protect circular imports
+        from numpy.lib._stride_tricks_impl import broadcast_to
+        # count True values in (potentially broadcasted) boolean mask
+        items = umr_sum(broadcast_to(where, arr.shape), axis, nt.intp, None,
+                        keepdims)
+    return items
+
+def _clip(a, min=None, max=None, out=None, **kwargs):
+    if a.dtype.kind in "iu":
+        # If min/max is a Python integer, deal with out-of-bound values here.
+        # (This enforces NEP 50 rules as no value based promotion is done.)
+        if type(min) is int and min <= np.iinfo(a.dtype).min:
+            min = None
+        if type(max) is int and max >= np.iinfo(a.dtype).max:
+            max = None
+
+    if min is None and max is None:
+        # return identity
+        return um.positive(a, out=out, **kwargs)
+    elif min is None:
+        return um.minimum(a, max, out=out, **kwargs)
+    elif max is None:
+        return um.maximum(a, min, out=out, **kwargs)
+    else:
+        return um.clip(a, min, max, out=out, **kwargs)
+
+def _mean(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True):
+    arr = asanyarray(a)
+
+    is_float16_result = False
+
+    rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where)
+    if rcount == 0 if where is True else umr_any(rcount == 0, axis=None):
+        warnings.warn("Mean of empty slice.", RuntimeWarning, stacklevel=2)
+
+    # Cast bool, unsigned int, and int to float64 by default
+    if dtype is None:
+        if issubclass(arr.dtype.type, (nt.integer, nt.bool)):
+            dtype = mu.dtype('f8')
+        elif issubclass(arr.dtype.type, nt.float16):
+            dtype = mu.dtype('f4')
+            is_float16_result = True
+
+    ret = umr_sum(arr, axis, dtype, out, keepdims, where=where)
+    if isinstance(ret, mu.ndarray):
+        ret = um.true_divide(
+                ret, rcount, out=ret, casting='unsafe', subok=False)
+        if is_float16_result and out is None:
+            ret = arr.dtype.type(ret)
+    elif hasattr(ret, 'dtype'):
+        if is_float16_result:
+            ret = arr.dtype.type(ret / rcount)
+        else:
+            ret = ret.dtype.type(ret / rcount)
+    else:
+        ret = ret / rcount
+
+    return ret
+
+def _var(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *,
+         where=True, mean=None):
+    arr = asanyarray(a)
+
+    rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where)
+    # Make this warning show up on top.
+    if ddof >= rcount if where is True else umr_any(ddof >= rcount, axis=None):
+        warnings.warn("Degrees of freedom <= 0 for slice", RuntimeWarning,
+                      stacklevel=2)
+
+    # Cast bool, unsigned int, and int to float64 by default
+    if dtype is None and issubclass(arr.dtype.type, (nt.integer, nt.bool)):
+        dtype = mu.dtype('f8')
+
+    if mean is not None:
+        arrmean = mean
+    else:
+        # Compute the mean.
+        # Note that if dtype is not of inexact type then arraymean will
+        # not be either.
+        arrmean = umr_sum(arr, axis, dtype, keepdims=True, where=where)
+        # The shape of rcount has to match arrmean to not change the shape of
+        # out in broadcasting. Otherwise, it cannot be stored back to arrmean.
+        if rcount.ndim == 0:
+            # fast-path for default case when where is True
+            div = rcount
+        else:
+            # matching rcount to arrmean when where is specified as array
+            div = rcount.reshape(arrmean.shape)
+        if isinstance(arrmean, mu.ndarray):
+            arrmean = um.true_divide(arrmean, div, out=arrmean,
+                                     casting='unsafe', subok=False)
+        elif hasattr(arrmean, "dtype"):
+            arrmean = arrmean.dtype.type(arrmean / rcount)
+        else:
+            arrmean = arrmean / rcount
+
+    # Compute sum of squared deviations from mean
+    # Note that x may not be inexact and that we need it to be an array,
+    # not a scalar.
+    x = asanyarray(arr - arrmean)
+
+    if issubclass(arr.dtype.type, (nt.floating, nt.integer)):
+        x = um.multiply(x, x, out=x)
+    # Fast-paths for built-in complex types
+    elif x.dtype in _complex_to_float:
+        xv = x.view(dtype=(_complex_to_float[x.dtype], (2,)))
+        um.multiply(xv, xv, out=xv)
+        x = um.add(xv[..., 0], xv[..., 1], out=x.real).real
+    # Most general case; includes handling object arrays containing imaginary
+    # numbers and complex types with non-native byteorder
+    else:
+        x = um.multiply(x, um.conjugate(x), out=x).real
+
+    ret = umr_sum(x, axis, dtype, out, keepdims=keepdims, where=where)
+
+    # Compute degrees of freedom and make sure it is not negative.
+    rcount = um.maximum(rcount - ddof, 0)
+
+    # divide by degrees of freedom
+    if isinstance(ret, mu.ndarray):
+        ret = um.true_divide(
+                ret, rcount, out=ret, casting='unsafe', subok=False)
+    elif hasattr(ret, 'dtype'):
+        ret = ret.dtype.type(ret / rcount)
+    else:
+        ret = ret / rcount
+
+    return ret
+
+def _std(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *,
+         where=True, mean=None):
+    ret = _var(a, axis=axis, dtype=dtype, out=out, ddof=ddof,
+               keepdims=keepdims, where=where, mean=mean)
+
+    if isinstance(ret, mu.ndarray):
+        ret = um.sqrt(ret, out=ret)
+    elif hasattr(ret, 'dtype'):
+        ret = ret.dtype.type(um.sqrt(ret))
+    else:
+        ret = um.sqrt(ret)
+
+    return ret
+
+def _ptp(a, axis=None, out=None, keepdims=False):
+    return um.subtract(
+        umr_maximum(a, axis, None, out, keepdims),
+        umr_minimum(a, axis, None, None, keepdims),
+        out
+    )
+
+def _dump(self, file, protocol=2):
+    if hasattr(file, 'write'):
+        ctx = nullcontext(file)
+    else:
+        ctx = open(os.fspath(file), "wb")
+    with ctx as f:
+        pickle.dump(self, f, protocol=protocol)
+
+def _dumps(self, protocol=2):
+    return pickle.dumps(self, protocol=protocol)
+
+def _bitwise_count(a, out=None, *, where=True, casting='same_kind',
+          order='K', dtype=None, subok=True):
+    return umr_bitwise_count(a, out, where=where, casting=casting,
+            order=order, dtype=dtype, subok=subok)

janus/lib/python3.10/site-packages/numpy/_core/_type_aliases.pyi

@@ -0,0 +1,96 @@
+from collections.abc import Collection
+from typing import Any, Final, Literal as L, TypeAlias, TypedDict, type_check_only
+
+import numpy as np
+
+__all__ = (
+    "_abstract_type_names",
+    "_aliases",
+    "_extra_aliases",
+    "allTypes",
+    "c_names_dict",
+    "sctypeDict",
+    "sctypes",
+)
+
+sctypeDict: Final[dict[str, type[np.generic]]]
+allTypes: Final[dict[str, type[np.generic]]]
+
+@type_check_only
+class _CNamesDict(TypedDict):
+    BOOL: np.dtype[np.bool]
+    HALF: np.dtype[np.half]
+    FLOAT: np.dtype[np.single]
+    DOUBLE: np.dtype[np.double]
+    LONGDOUBLE: np.dtype[np.longdouble]
+    CFLOAT: np.dtype[np.csingle]
+    CDOUBLE: np.dtype[np.cdouble]
+    CLONGDOUBLE: np.dtype[np.clongdouble]
+    STRING: np.dtype[np.bytes_]
+    UNICODE: np.dtype[np.str_]
+    VOID: np.dtype[np.void]
+    OBJECT: np.dtype[np.object_]
+    DATETIME: np.dtype[np.datetime64]
+    TIMEDELTA: np.dtype[np.timedelta64]
+    BYTE: np.dtype[np.byte]
+    UBYTE: np.dtype[np.ubyte]
+    SHORT: np.dtype[np.short]
+    USHORT: np.dtype[np.ushort]
+    INT: np.dtype[np.intc]
+    UINT: np.dtype[np.uintc]
+    LONG: np.dtype[np.long]
+    ULONG: np.dtype[np.ulong]
+    LONGLONG: np.dtype[np.longlong]
+    ULONGLONG: np.dtype[np.ulonglong]
+
+c_names_dict: Final[_CNamesDict]
+
+_AbstractTypeName: TypeAlias = L[
+    "generic",
+    "flexible",
+    "character",
+    "number",
+    "integer",
+    "inexact",
+    "unsignedinteger",
+    "signedinteger",
+    "floating",
+    "complexfloating",
+]
+_abstract_type_names: Final[set[_AbstractTypeName]]
+
+@type_check_only
+class _AliasesType(TypedDict):
+    double: L["float64"]
+    cdouble: L["complex128"]
+    single: L["float32"]
+    csingle: L["complex64"]
+    half: L["float16"]
+    bool_: L["bool"]
+    int_: L["intp"]
+    uint: L["intp"]
+
+_aliases: Final[_AliasesType]
+
+@type_check_only
+class _ExtraAliasesType(TypedDict):
+    float: L["float64"]
+    complex: L["complex128"]
+    object: L["object_"]
+    bytes: L["bytes_"]
+    a: L["bytes_"]
+    int: L["int_"]
+    str: L["str_"]
+    unicode: L["str_"]
+
+_extra_aliases: Final[_ExtraAliasesType]
+
+@type_check_only
+class _SCTypes(TypedDict):
+    int: Collection[type[np.signedinteger[Any]]]
+    uint: Collection[type[np.unsignedinteger[Any]]]
+    float: Collection[type[np.floating[Any]]]
+    complex: Collection[type[np.complexfloating[Any, Any]]]
+    others: Collection[type[np.flexible | np.bool | np.object_]]
+
+sctypes: Final[_SCTypes]

janus/lib/python3.10/site-packages/numpy/_core/_ufunc_config.py

@@ -0,0 +1,483 @@
+"""
+Functions for changing global ufunc configuration
+
+This provides helpers which wrap `_get_extobj_dict` and `_make_extobj`, and
+`_extobj_contextvar` from umath.
+"""
+import contextlib
+import contextvars
+import functools
+
+from .._utils import set_module
+from .umath import _make_extobj, _get_extobj_dict, _extobj_contextvar
+
+__all__ = [
+    "seterr", "geterr", "setbufsize", "getbufsize", "seterrcall", "geterrcall",
+    "errstate"
+]
+
+
+@set_module('numpy')
+def seterr(all=None, divide=None, over=None, under=None, invalid=None):
+    """
+    Set how floating-point errors are handled.
+
+    Note that operations on integer scalar types (such as `int16`) are
+    handled like floating point, and are affected by these settings.
+
+    Parameters
+    ----------
+    all : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Set treatment for all types of floating-point errors at once:
+
+        - ignore: Take no action when the exception occurs.
+        - warn: Print a :exc:`RuntimeWarning` (via the Python `warnings`
+          module).
+        - raise: Raise a :exc:`FloatingPointError`.
+        - call: Call a function specified using the `seterrcall` function.
+        - print: Print a warning directly to ``stdout``.
+        - log: Record error in a Log object specified by `seterrcall`.
+
+        The default is not to change the current behavior.
+    divide : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for division by zero.
+    over : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for floating-point overflow.
+    under : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for floating-point underflow.
+    invalid : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for invalid floating-point operation.
+
+    Returns
+    -------
+    old_settings : dict
+        Dictionary containing the old settings.
+
+    See also
+    --------
+    seterrcall : Set a callback function for the 'call' mode.
+    geterr, geterrcall, errstate
+
+    Notes
+    -----
+    The floating-point exceptions are defined in the IEEE 754 standard [1]_:
+
+    - Division by zero: infinite result obtained from finite numbers.
+    - Overflow: result too large to be expressed.
+    - Underflow: result so close to zero that some precision
+      was lost.
+    - Invalid operation: result is not an expressible number, typically
+      indicates that a NaN was produced.
+
+    .. [1] https://en.wikipedia.org/wiki/IEEE_754
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> orig_settings = np.seterr(all='ignore')  # seterr to known value
+    >>> np.int16(32000) * np.int16(3)
+    np.int16(30464)
+    >>> np.seterr(over='raise')
+    {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'}
+    >>> old_settings = np.seterr(all='warn', over='raise')
+    >>> np.int16(32000) * np.int16(3)
+    Traceback (most recent call last):
+      File "<stdin>", line 1, in <module>
+    FloatingPointError: overflow encountered in scalar multiply
+
+    >>> old_settings = np.seterr(all='print')
+    >>> np.geterr()
+    {'divide': 'print', 'over': 'print', 'under': 'print', 'invalid': 'print'}
+    >>> np.int16(32000) * np.int16(3)
+    np.int16(30464)
+    >>> np.seterr(**orig_settings)  # restore original
+    {'divide': 'print', 'over': 'print', 'under': 'print', 'invalid': 'print'}
+
+    """
+
+    old = _get_extobj_dict()
+    # The errstate doesn't include call and bufsize, so pop them:
+    old.pop("call", None)
+    old.pop("bufsize", None)
+
+    extobj = _make_extobj(
+            all=all, divide=divide, over=over, under=under, invalid=invalid)
+    _extobj_contextvar.set(extobj)
+    return old
+
+
+@set_module('numpy')
+def geterr():
+    """
+    Get the current way of handling floating-point errors.
+
+    Returns
+    -------
+    res : dict
+        A dictionary with keys "divide", "over", "under", and "invalid",
+        whose values are from the strings "ignore", "print", "log", "warn",
+        "raise", and "call". The keys represent possible floating-point
+        exceptions, and the values define how these exceptions are handled.
+
+    See Also
+    --------
+    geterrcall, seterr, seterrcall
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.geterr()
+    {'divide': 'warn', 'over': 'warn', 'under': 'ignore', 'invalid': 'warn'}
+    >>> np.arange(3.) / np.arange(3.)  # doctest: +SKIP
+    array([nan,  1.,  1.])
+    RuntimeWarning: invalid value encountered in divide
+
+    >>> oldsettings = np.seterr(all='warn', invalid='raise')
+    >>> np.geterr()
+    {'divide': 'warn', 'over': 'warn', 'under': 'warn', 'invalid': 'raise'}
+    >>> np.arange(3.) / np.arange(3.)
+    Traceback (most recent call last):
+      ...
+    FloatingPointError: invalid value encountered in divide
+    >>> oldsettings = np.seterr(**oldsettings)  # restore original
+
+    """
+    res = _get_extobj_dict()
+    # The "geterr" doesn't include call and bufsize,:
+    res.pop("call", None)
+    res.pop("bufsize", None)
+    return res
+
+
+@set_module('numpy')
+def setbufsize(size):
+    """
+    Set the size of the buffer used in ufuncs.
+
+    .. versionchanged:: 2.0
+        The scope of setting the buffer is tied to the `numpy.errstate`
+        context.  Exiting a ``with errstate():`` will also restore the bufsize.
+
+    Parameters
+    ----------
+    size : int
+        Size of buffer.
+
+    Returns
+    -------
+    bufsize : int
+        Previous size of ufunc buffer in bytes.
+
+    Examples
+    --------
+    When exiting a `numpy.errstate` context manager the bufsize is restored:
+
+    >>> import numpy as np
+    >>> with np.errstate():
+    ...     np.setbufsize(4096)
+    ...     print(np.getbufsize())
+    ...
+    8192
+    4096
+    >>> np.getbufsize()
+    8192
+
+    """
+    old = _get_extobj_dict()["bufsize"]
+    extobj = _make_extobj(bufsize=size)
+    _extobj_contextvar.set(extobj)
+    return old
+
+
+@set_module('numpy')
+def getbufsize():
+    """
+    Return the size of the buffer used in ufuncs.
+
+    Returns
+    -------
+    getbufsize : int
+        Size of ufunc buffer in bytes.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.getbufsize()
+    8192
+
+    """
+    return _get_extobj_dict()["bufsize"]
+
+
+@set_module('numpy')
+def seterrcall(func):
+    """
+    Set the floating-point error callback function or log object.
+
+    There are two ways to capture floating-point error messages.  The first
+    is to set the error-handler to 'call', using `seterr`.  Then, set
+    the function to call using this function.
+
+    The second is to set the error-handler to 'log', using `seterr`.
+    Floating-point errors then trigger a call to the 'write' method of
+    the provided object.
+
+    Parameters
+    ----------
+    func : callable f(err, flag) or object with write method
+        Function to call upon floating-point errors ('call'-mode) or
+        object whose 'write' method is used to log such message ('log'-mode).
+
+        The call function takes two arguments. The first is a string describing
+        the type of error (such as "divide by zero", "overflow", "underflow",
+        or "invalid value"), and the second is the status flag.  The flag is a
+        byte, whose four least-significant bits indicate the type of error, one
+        of "divide", "over", "under", "invalid"::
+
+          [0 0 0 0 divide over under invalid]
+
+        In other words, ``flags = divide + 2*over + 4*under + 8*invalid``.
+
+        If an object is provided, its write method should take one argument,
+        a string.
+
+    Returns
+    -------
+    h : callable, log instance or None
+        The old error handler.
+
+    See Also
+    --------
+    seterr, geterr, geterrcall
+
+    Examples
+    --------
+    Callback upon error:
+
+    >>> def err_handler(type, flag):
+    ...     print("Floating point error (%s), with flag %s" % (type, flag))
+    ...
+
+    >>> import numpy as np
+
+    >>> orig_handler = np.seterrcall(err_handler)
+    >>> orig_err = np.seterr(all='call')
+
+    >>> np.array([1, 2, 3]) / 0.0
+    Floating point error (divide by zero), with flag 1
+    array([inf, inf, inf])
+
+    >>> np.seterrcall(orig_handler)
+    <function err_handler at 0x...>
+    >>> np.seterr(**orig_err)
+    {'divide': 'call', 'over': 'call', 'under': 'call', 'invalid': 'call'}
+
+    Log error message:
+
+    >>> class Log:
+    ...     def write(self, msg):
+    ...         print("LOG: %s" % msg)
+    ...
+
+    >>> log = Log()
+    >>> saved_handler = np.seterrcall(log)
+    >>> save_err = np.seterr(all='log')
+
+    >>> np.array([1, 2, 3]) / 0.0
+    LOG: Warning: divide by zero encountered in divide
+    array([inf, inf, inf])
+
+    >>> np.seterrcall(orig_handler)
+    <numpy.Log object at 0x...>
+    >>> np.seterr(**orig_err)
+    {'divide': 'log', 'over': 'log', 'under': 'log', 'invalid': 'log'}
+
+    """
+    old = _get_extobj_dict()["call"]
+    extobj = _make_extobj(call=func)
+    _extobj_contextvar.set(extobj)
+    return old
+
+
+@set_module('numpy')
+def geterrcall():
+    """
+    Return the current callback function used on floating-point errors.
+
+    When the error handling for a floating-point error (one of "divide",
+    "over", "under", or "invalid") is set to 'call' or 'log', the function
+    that is called or the log instance that is written to is returned by
+    `geterrcall`. This function or log instance has been set with
+    `seterrcall`.
+
+    Returns
+    -------
+    errobj : callable, log instance or None
+        The current error handler. If no handler was set through `seterrcall`,
+        ``None`` is returned.
+
+    See Also
+    --------
+    seterrcall, seterr, geterr
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.geterrcall()  # we did not yet set a handler, returns None
+
+    >>> orig_settings = np.seterr(all='call')
+    >>> def err_handler(type, flag):
+    ...     print("Floating point error (%s), with flag %s" % (type, flag))
+    >>> old_handler = np.seterrcall(err_handler)
+    >>> np.array([1, 2, 3]) / 0.0
+    Floating point error (divide by zero), with flag 1
+    array([inf, inf, inf])
+
+    >>> cur_handler = np.geterrcall()
+    >>> cur_handler is err_handler
+    True
+    >>> old_settings = np.seterr(**orig_settings)  # restore original
+    >>> old_handler = np.seterrcall(None)  # restore original
+
+    """
+    return _get_extobj_dict()["call"]
+
+
+class _unspecified:
+    pass
+
+
+_Unspecified = _unspecified()
+
+
+@set_module('numpy')
+class errstate:
+    """
+    errstate(**kwargs)
+
+    Context manager for floating-point error handling.
+
+    Using an instance of `errstate` as a context manager allows statements in
+    that context to execute with a known error handling behavior. Upon entering
+    the context the error handling is set with `seterr` and `seterrcall`, and
+    upon exiting it is reset to what it was before.
+
+    ..  versionchanged:: 1.17.0
+        `errstate` is also usable as a function decorator, saving
+        a level of indentation if an entire function is wrapped.
+
+    .. versionchanged:: 2.0
+        `errstate` is now fully thread and asyncio safe, but may not be
+        entered more than once.
+        It is not safe to decorate async functions using ``errstate``.
+
+    Parameters
+    ----------
+    kwargs : {divide, over, under, invalid}
+        Keyword arguments. The valid keywords are the possible floating-point
+        exceptions. Each keyword should have a string value that defines the
+        treatment for the particular error. Possible values are
+        {'ignore', 'warn', 'raise', 'call', 'print', 'log'}.
+
+    See Also
+    --------
+    seterr, geterr, seterrcall, geterrcall
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> olderr = np.seterr(all='ignore')  # Set error handling to known state.
+
+    >>> np.arange(3) / 0.
+    array([nan, inf, inf])
+    >>> with np.errstate(divide='ignore'):
+    ...     np.arange(3) / 0.
+    array([nan, inf, inf])
+
+    >>> np.sqrt(-1)
+    np.float64(nan)
+    >>> with np.errstate(invalid='raise'):
+    ...     np.sqrt(-1)
+    Traceback (most recent call last):
+      File "<stdin>", line 2, in <module>
+    FloatingPointError: invalid value encountered in sqrt
+
+    Outside the context the error handling behavior has not changed:
+
+    >>> np.geterr()
+    {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'}
+    >>> olderr = np.seterr(**olderr)  # restore original state
+
+    """
+    __slots__ = (
+        "_call", "_all", "_divide", "_over", "_under", "_invalid", "_token")
+
+    def __init__(self, *, call=_Unspecified,
+                 all=None, divide=None, over=None, under=None, invalid=None):
+        self._token = None
+        self._call = call
+        self._all = all
+        self._divide = divide
+        self._over = over
+        self._under = under
+        self._invalid = invalid
+
+    def __enter__(self):
+        # Note that __call__ duplicates much of this logic
+        if self._token is not None:
+            raise TypeError("Cannot enter `np.errstate` twice.")
+        if self._call is _Unspecified:
+            extobj = _make_extobj(
+                    all=self._all, divide=self._divide, over=self._over,
+                    under=self._under, invalid=self._invalid)
+        else:
+            extobj = _make_extobj(
+                    call=self._call,
+                    all=self._all, divide=self._divide, over=self._over,
+                    under=self._under, invalid=self._invalid)
+
+        self._token = _extobj_contextvar.set(extobj)
+
+    def __exit__(self, *exc_info):
+        _extobj_contextvar.reset(self._token)
+
+    def __call__(self, func):
+        # We need to customize `__call__` compared to `ContextDecorator`
+        # because we must store the token per-thread so cannot store it on
+        # the instance (we could create a new instance for this).
+        # This duplicates the code from `__enter__`.
+        @functools.wraps(func)
+        def inner(*args, **kwargs):
+            if self._call is _Unspecified:
+                extobj = _make_extobj(
+                        all=self._all, divide=self._divide, over=self._over,
+                        under=self._under, invalid=self._invalid)
+            else:
+                extobj = _make_extobj(
+                        call=self._call,
+                        all=self._all, divide=self._divide, over=self._over,
+                        under=self._under, invalid=self._invalid)
+
+            _token = _extobj_contextvar.set(extobj)
+            try:
+                # Call the original, decorated, function:
+                return func(*args, **kwargs)
+            finally:
+                _extobj_contextvar.reset(_token)
+
+        return inner

janus/lib/python3.10/site-packages/numpy/_core/arrayprint.pyi

@@ -0,0 +1,137 @@
+from collections.abc import Callable
+from typing import Any, Literal, TypeAlias, TypedDict, SupportsIndex, type_check_only
+
+# Using a private class is by no means ideal, but it is simply a consequence
+# of a `contextlib.context` returning an instance of aforementioned class
+from contextlib import _GeneratorContextManager
+
+import numpy as np
+from numpy import (
+    integer,
+    timedelta64,
+    datetime64,
+    floating,
+    complexfloating,
+    void,
+    longdouble,
+    clongdouble,
+)
+from numpy._typing import NDArray, _CharLike_co, _FloatLike_co
+
+_FloatMode: TypeAlias = Literal["fixed", "unique", "maxprec", "maxprec_equal"]
+
+@type_check_only
+class _FormatDict(TypedDict, total=False):
+    bool: Callable[[np.bool], str]
+    int: Callable[[integer[Any]], str]
+    timedelta: Callable[[timedelta64], str]
+    datetime: Callable[[datetime64], str]
+    float: Callable[[floating[Any]], str]
+    longfloat: Callable[[longdouble], str]
+    complexfloat: Callable[[complexfloating[Any, Any]], str]
+    longcomplexfloat: Callable[[clongdouble], str]
+    void: Callable[[void], str]
+    numpystr: Callable[[_CharLike_co], str]
+    object: Callable[[object], str]
+    all: Callable[[object], str]
+    int_kind: Callable[[integer[Any]], str]
+    float_kind: Callable[[floating[Any]], str]
+    complex_kind: Callable[[complexfloating[Any, Any]], str]
+    str_kind: Callable[[_CharLike_co], str]
+
+@type_check_only
+class _FormatOptions(TypedDict):
+    precision: int
+    threshold: int
+    edgeitems: int
+    linewidth: int
+    suppress: bool
+    nanstr: str
+    infstr: str
+    formatter: None | _FormatDict
+    sign: Literal["-", "+", " "]
+    floatmode: _FloatMode
+    legacy: Literal[False, "1.13", "1.21"]
+
+def set_printoptions(
+    precision: None | SupportsIndex = ...,
+    threshold: None | int = ...,
+    edgeitems: None | int = ...,
+    linewidth: None | int = ...,
+    suppress: None | bool = ...,
+    nanstr: None | str = ...,
+    infstr: None | str = ...,
+    formatter: None | _FormatDict = ...,
+    sign: Literal[None, "-", "+", " "] = ...,
+    floatmode: None | _FloatMode = ...,
+    *,
+    legacy: Literal[None, False, "1.13", "1.21"] = ...,
+    override_repr: None | Callable[[NDArray[Any]], str] = ...,
+) -> None: ...
+def get_printoptions() -> _FormatOptions: ...
+def array2string(
+    a: NDArray[Any],
+    max_line_width: None | int = ...,
+    precision: None | SupportsIndex = ...,
+    suppress_small: None | bool = ...,
+    separator: str = ...,
+    prefix: str = ...,
+    # NOTE: With the `style` argument being deprecated,
+    # all arguments between `formatter` and `suffix` are de facto
+    # keyworld-only arguments
+    *,
+    formatter: None | _FormatDict = ...,
+    threshold: None | int = ...,
+    edgeitems: None | int = ...,
+    sign: Literal[None, "-", "+", " "] = ...,
+    floatmode: None | _FloatMode = ...,
+    suffix: str = ...,
+    legacy: Literal[None, False, "1.13", "1.21"] = ...,
+) -> str: ...
+def format_float_scientific(
+    x: _FloatLike_co,
+    precision: None | int = ...,
+    unique: bool = ...,
+    trim: Literal["k", ".", "0", "-"] = ...,
+    sign: bool = ...,
+    pad_left: None | int = ...,
+    exp_digits: None | int = ...,
+    min_digits: None | int = ...,
+) -> str: ...
+def format_float_positional(
+    x: _FloatLike_co,
+    precision: None | int = ...,
+    unique: bool = ...,
+    fractional: bool = ...,
+    trim: Literal["k", ".", "0", "-"] = ...,
+    sign: bool = ...,
+    pad_left: None | int = ...,
+    pad_right: None | int = ...,
+    min_digits: None | int = ...,
+) -> str: ...
+def array_repr(
+    arr: NDArray[Any],
+    max_line_width: None | int = ...,
+    precision: None | SupportsIndex = ...,
+    suppress_small: None | bool = ...,
+) -> str: ...
+def array_str(
+    a: NDArray[Any],
+    max_line_width: None | int = ...,
+    precision: None | SupportsIndex = ...,
+    suppress_small: None | bool = ...,
+) -> str: ...
+def printoptions(
+    precision: None | SupportsIndex = ...,
+    threshold: None | int = ...,
+    edgeitems: None | int = ...,
+    linewidth: None | int = ...,
+    suppress: None | bool = ...,
+    nanstr: None | str = ...,
+    infstr: None | str = ...,
+    formatter: None | _FormatDict = ...,
+    sign: Literal[None, "-", "+", " "] = ...,
+    floatmode: None | _FloatMode = ...,
+    *,
+    legacy: Literal[None, False, "1.13", "1.21"] = ...
+) -> _GeneratorContextManager[_FormatOptions]: ...

janus/lib/python3.10/site-packages/numpy/_core/cversions.py

@@ -0,0 +1,13 @@
+"""Simple script to compute the api hash of the current API.
+
+The API has is defined by numpy_api_order and ufunc_api_order.
+
+"""
+from os.path import dirname
+
+from code_generators.genapi import fullapi_hash
+from code_generators.numpy_api import full_api
+
+if __name__ == '__main__':
+    curdir = dirname(__file__)
+    print(fullapi_hash(full_api))

janus/lib/python3.10/site-packages/numpy/_core/defchararray.py

@@ -0,0 +1,1414 @@
+"""
+This module contains a set of functions for vectorized string
+operations and methods.
+
+.. note::
+   The `chararray` class exists for backwards compatibility with
+   Numarray, it is not recommended for new development. Starting from numpy
+   1.4, if one needs arrays of strings, it is recommended to use arrays of
+   `dtype` `object_`, `bytes_` or `str_`, and use the free functions
+   in the `numpy.char` module for fast vectorized string operations.
+
+Some methods will only be available if the corresponding string method is
+available in your version of Python.
+
+The preferred alias for `defchararray` is `numpy.char`.
+
+"""
+import functools
+
+import numpy as np
+from .._utils import set_module
+from .numerictypes import bytes_, str_, character
+from .numeric import ndarray, array as narray, asarray as asnarray
+from numpy._core.multiarray import compare_chararrays
+from numpy._core import overrides
+from numpy.strings import *
+from numpy.strings import (
+    multiply as strings_multiply,
+    partition as strings_partition,
+    rpartition as strings_rpartition,
+)
+from numpy._core.strings import (
+    _split as split,
+    _rsplit as rsplit,
+    _splitlines as splitlines,
+    _join as join,
+)
+
+__all__ = [
+    'equal', 'not_equal', 'greater_equal', 'less_equal',
+    'greater', 'less', 'str_len', 'add', 'multiply', 'mod', 'capitalize',
+    'center', 'count', 'decode', 'encode', 'endswith', 'expandtabs',
+    'find', 'index', 'isalnum', 'isalpha', 'isdigit', 'islower', 'isspace',
+    'istitle', 'isupper', 'join', 'ljust', 'lower', 'lstrip', 'partition',
+    'replace', 'rfind', 'rindex', 'rjust', 'rpartition', 'rsplit',
+    'rstrip', 'split', 'splitlines', 'startswith', 'strip', 'swapcase',
+    'title', 'translate', 'upper', 'zfill', 'isnumeric', 'isdecimal',
+    'array', 'asarray', 'compare_chararrays', 'chararray'
+    ]
+
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy.char')
+
+
+def _binary_op_dispatcher(x1, x2):
+    return (x1, x2)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def equal(x1, x2):
+    """
+    Return (x1 == x2) element-wise.
+
+    Unlike `numpy.equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> y = "aa "
+    >>> x = "aa"
+    >>> np.char.equal(x, y)
+    array(True)
+
+    See Also
+    --------
+    not_equal, greater_equal, less_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '==', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def not_equal(x1, x2):
+    """
+    Return (x1 != x2) element-wise.
+
+    Unlike `numpy.not_equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, greater_equal, less_equal, greater, less
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x1 = np.array(['a', 'b', 'c'])
+    >>> np.char.not_equal(x1, 'b')
+    array([ True, False,  True])
+
+    """
+    return compare_chararrays(x1, x2, '!=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def greater_equal(x1, x2):
+    """
+    Return (x1 >= x2) element-wise.
+
+    Unlike `numpy.greater_equal`, this comparison is performed by
+    first stripping whitespace characters from the end of the string.
+    This behavior is provided for backward-compatibility with
+    numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, less_equal, greater, less
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x1 = np.array(['a', 'b', 'c'])
+    >>> np.char.greater_equal(x1, 'b')
+    array([False,  True,  True])
+
+    """
+    return compare_chararrays(x1, x2, '>=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def less_equal(x1, x2):
+    """
+    Return (x1 <= x2) element-wise.
+
+    Unlike `numpy.less_equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, greater, less
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x1 = np.array(['a', 'b', 'c'])
+    >>> np.char.less_equal(x1, 'b')
+    array([ True,  True, False])
+
+    """
+    return compare_chararrays(x1, x2, '<=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def greater(x1, x2):
+    """
+    Return (x1 > x2) element-wise.
+
+    Unlike `numpy.greater`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, less_equal, less
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x1 = np.array(['a', 'b', 'c'])
+    >>> np.char.greater(x1, 'b')
+    array([False, False,  True])
+
+    """
+    return compare_chararrays(x1, x2, '>', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def less(x1, x2):
+    """
+    Return (x1 < x2) element-wise.
+
+    Unlike `numpy.greater`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, less_equal, greater
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x1 = np.array(['a', 'b', 'c'])
+    >>> np.char.less(x1, 'b')
+    array([True, False, False])
+
+    """
+    return compare_chararrays(x1, x2, '<', True)
+
+
+@set_module("numpy.char")
+def multiply(a, i):
+    """
+    Return (a * i), that is string multiple concatenation,
+    element-wise.
+
+    Values in ``i`` of less than 0 are treated as 0 (which yields an
+    empty string).
+
+    Parameters
+    ----------
+    a : array_like, with `np.bytes_` or `np.str_` dtype
+
+    i : array_like, with any integer dtype
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input types
+
+    Notes
+    -----
+    This is a thin wrapper around np.strings.multiply that raises
+    `ValueError` when ``i`` is not an integer. It only
+    exists for backwards-compatibility.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.array(["a", "b", "c"])
+    >>> np.strings.multiply(a, 3)
+    array(['aaa', 'bbb', 'ccc'], dtype='<U3')
+    >>> i = np.array([1, 2, 3])
+    >>> np.strings.multiply(a, i)
+    array(['a', 'bb', 'ccc'], dtype='<U3')
+    >>> np.strings.multiply(np.array(['a']), i)
+    array(['a', 'aa', 'aaa'], dtype='<U3')
+    >>> a = np.array(['a', 'b', 'c', 'd', 'e', 'f']).reshape((2, 3))
+    >>> np.strings.multiply(a, 3)
+    array([['aaa', 'bbb', 'ccc'],
+           ['ddd', 'eee', 'fff']], dtype='<U3')
+    >>> np.strings.multiply(a, i)
+    array([['a', 'bb', 'ccc'],
+           ['d', 'ee', 'fff']], dtype='<U3')
+
+    """
+    try:
+        return strings_multiply(a, i)
+    except TypeError:
+        raise ValueError("Can only multiply by integers")
+
+
+@set_module("numpy.char")
+def partition(a, sep):
+    """
+    Partition each element in `a` around `sep`.
+
+    Calls :meth:`str.partition` element-wise.
+
+    For each element in `a`, split the element as the first
+    occurrence of `sep`, and return 3 strings containing the part
+    before the separator, the separator itself, and the part after
+    the separator. If the separator is not found, return 3 strings
+    containing the string itself, followed by two empty strings.
+
+    Parameters
+    ----------
+    a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype
+        Input array
+    sep : {str, unicode}
+        Separator to split each string element in `a`.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype,
+        depending on input types. The output array will have an extra
+        dimension with 3 elements per input element.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x = np.array(["Numpy is nice!"])
+    >>> np.char.partition(x, " ")
+    array([['Numpy', ' ', 'is nice!']], dtype='<U8')
+
+    See Also
+    --------
+    str.partition
+
+    """
+    return np.stack(strings_partition(a, sep), axis=-1)
+
+
+@set_module("numpy.char")
+def rpartition(a, sep):
+    """
+    Partition (split) each element around the right-most separator.
+
+    Calls :meth:`str.rpartition` element-wise.
+
+    For each element in `a`, split the element as the last
+    occurrence of `sep`, and return 3 strings containing the part
+    before the separator, the separator itself, and the part after
+    the separator. If the separator is not found, return 3 strings
+    containing the string itself, followed by two empty strings.
+
+    Parameters
+    ----------
+    a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype
+        Input array
+    sep : str or unicode
+        Right-most separator to split each element in array.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype,
+        depending on input types. The output array will have an extra
+        dimension with 3 elements per input element.
+
+    See Also
+    --------
+    str.rpartition
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.array(['aAaAaA', '  aA  ', 'abBABba'])
+    >>> np.char.rpartition(a, 'A')
+    array([['aAaAa', 'A', ''],
+       ['  a', 'A', '  '],
+       ['abB', 'A', 'Bba']], dtype='<U5')
+
+    """
+    return np.stack(strings_rpartition(a, sep), axis=-1)
+
+
+@set_module("numpy.char")
+class chararray(ndarray):
+    """
+    chararray(shape, itemsize=1, unicode=False, buffer=None, offset=0,
+              strides=None, order=None)
+
+    Provides a convenient view on arrays of string and unicode values.
+
+    .. note::
+       The `chararray` class exists for backwards compatibility with
+       Numarray, it is not recommended for new development. Starting from numpy
+       1.4, if one needs arrays of strings, it is recommended to use arrays of
+       `dtype` `~numpy.object_`, `~numpy.bytes_` or `~numpy.str_`, and use
+       the free functions in the `numpy.char` module for fast vectorized
+       string operations.
+
+    Versus a NumPy array of dtype `~numpy.bytes_` or `~numpy.str_`, this
+    class adds the following functionality:
+
+    1) values automatically have whitespace removed from the end
+       when indexed
+
+    2) comparison operators automatically remove whitespace from the
+       end when comparing values
+
+    3) vectorized string operations are provided as methods
+       (e.g. `.endswith`) and infix operators (e.g. ``"+", "*", "%"``)
+
+    chararrays should be created using `numpy.char.array` or
+    `numpy.char.asarray`, rather than this constructor directly.
+
+    This constructor creates the array, using `buffer` (with `offset`
+    and `strides`) if it is not ``None``. If `buffer` is ``None``, then
+    constructs a new array with `strides` in "C order", unless both
+    ``len(shape) >= 2`` and ``order='F'``, in which case `strides`
+    is in "Fortran order".
+
+    Methods
+    -------
+    astype
+    argsort
+    copy
+    count
+    decode
+    dump
+    dumps
+    encode
+    endswith
+    expandtabs
+    fill
+    find
+    flatten
+    getfield
+    index
+    isalnum
+    isalpha
+    isdecimal
+    isdigit
+    islower
+    isnumeric
+    isspace
+    istitle
+    isupper
+    item
+    join
+    ljust
+    lower
+    lstrip
+    nonzero
+    put
+    ravel
+    repeat
+    replace
+    reshape
+    resize
+    rfind
+    rindex
+    rjust
+    rsplit
+    rstrip
+    searchsorted
+    setfield
+    setflags
+    sort
+    split
+    splitlines
+    squeeze
+    startswith
+    strip
+    swapaxes
+    swapcase
+    take
+    title
+    tofile
+    tolist
+    tostring
+    translate
+    transpose
+    upper
+    view
+    zfill
+
+    Parameters
+    ----------
+    shape : tuple
+        Shape of the array.
+    itemsize : int, optional
+        Length of each array element, in number of characters. Default is 1.
+    unicode : bool, optional
+        Are the array elements of type unicode (True) or string (False).
+        Default is False.
+    buffer : object exposing the buffer interface or str, optional
+        Memory address of the start of the array data.  Default is None,
+        in which case a new array is created.
+    offset : int, optional
+        Fixed stride displacement from the beginning of an axis?
+        Default is 0. Needs to be >=0.
+    strides : array_like of ints, optional
+        Strides for the array (see `~numpy.ndarray.strides` for
+        full description). Default is None.
+    order : {'C', 'F'}, optional
+        The order in which the array data is stored in memory: 'C' ->
+        "row major" order (the default), 'F' -> "column major"
+        (Fortran) order.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> charar = np.char.chararray((3, 3))
+    >>> charar[:] = 'a'
+    >>> charar
+    chararray([[b'a', b'a', b'a'],
+               [b'a', b'a', b'a'],
+               [b'a', b'a', b'a']], dtype='|S1')
+
+    >>> charar = np.char.chararray(charar.shape, itemsize=5)
+    >>> charar[:] = 'abc'
+    >>> charar
+    chararray([[b'abc', b'abc', b'abc'],
+               [b'abc', b'abc', b'abc'],
+               [b'abc', b'abc', b'abc']], dtype='|S5')
+
+    """
+    def __new__(subtype, shape, itemsize=1, unicode=False, buffer=None,
+                offset=0, strides=None, order='C'):
+        if unicode:
+            dtype = str_
+        else:
+            dtype = bytes_
+
+        # force itemsize to be a Python int, since using NumPy integer
+        # types results in itemsize.itemsize being used as the size of
+        # strings in the new array.
+        itemsize = int(itemsize)
+
+        if isinstance(buffer, str):
+            # unicode objects do not have the buffer interface
+            filler = buffer
+            buffer = None
+        else:
+            filler = None
+
+        if buffer is None:
+            self = ndarray.__new__(subtype, shape, (dtype, itemsize),
+                                   order=order)
+        else:
+            self = ndarray.__new__(subtype, shape, (dtype, itemsize),
+                                   buffer=buffer,
+                                   offset=offset, strides=strides,
+                                   order=order)
+        if filler is not None:
+            self[...] = filler
+
+        return self
+
+    def __array_wrap__(self, arr, context=None, return_scalar=False):
+        # When calling a ufunc (and some other functions), we return a
+        # chararray if the ufunc output is a string-like array,
+        # or an ndarray otherwise
+        if arr.dtype.char in "SUbc":
+            return arr.view(type(self))
+        return arr
+
+    def __array_finalize__(self, obj):
+        # The b is a special case because it is used for reconstructing.
+        if self.dtype.char not in 'VSUbc':
+            raise ValueError("Can only create a chararray from string data.")
+
+    def __getitem__(self, obj):
+        val = ndarray.__getitem__(self, obj)
+        if isinstance(val, character):
+            return val.rstrip()
+        return val
+
+    # IMPLEMENTATION NOTE: Most of the methods of this class are
+    # direct delegations to the free functions in this module.
+    # However, those that return an array of strings should instead
+    # return a chararray, so some extra wrapping is required.
+
+    def __eq__(self, other):
+        """
+        Return (self == other) element-wise.
+
+        See Also
+        --------
+        equal
+        """
+        return equal(self, other)
+
+    def __ne__(self, other):
+        """
+        Return (self != other) element-wise.
+
+        See Also
+        --------
+        not_equal
+        """
+        return not_equal(self, other)
+
+    def __ge__(self, other):
+        """
+        Return (self >= other) element-wise.
+
+        See Also
+        --------
+        greater_equal
+        """
+        return greater_equal(self, other)
+
+    def __le__(self, other):
+        """
+        Return (self <= other) element-wise.
+
+        See Also
+        --------
+        less_equal
+        """
+        return less_equal(self, other)
+
+    def __gt__(self, other):
+        """
+        Return (self > other) element-wise.
+
+        See Also
+        --------
+        greater
+        """
+        return greater(self, other)
+
+    def __lt__(self, other):
+        """
+        Return (self < other) element-wise.
+
+        See Also
+        --------
+        less
+        """
+        return less(self, other)
+
+    def __add__(self, other):
+        """
+        Return (self + other), that is string concatenation,
+        element-wise for a pair of array_likes of str or unicode.
+
+        See Also
+        --------
+        add
+        """
+        return add(self, other)
+
+    def __radd__(self, other):
+        """
+        Return (other + self), that is string concatenation,
+        element-wise for a pair of array_likes of `bytes_` or `str_`.
+
+        See Also
+        --------
+        add
+        """
+        return add(other, self)
+
+    def __mul__(self, i):
+        """
+        Return (self * i), that is string multiple concatenation,
+        element-wise.
+
+        See Also
+        --------
+        multiply
+        """
+        return asarray(multiply(self, i))
+
+    def __rmul__(self, i):
+        """
+        Return (self * i), that is string multiple concatenation,
+        element-wise.
+
+        See Also
+        --------
+        multiply
+        """
+        return asarray(multiply(self, i))
+
+    def __mod__(self, i):
+        """
+        Return (self % i), that is pre-Python 2.6 string formatting
+        (interpolation), element-wise for a pair of array_likes of `bytes_`
+        or `str_`.
+
+        See Also
+        --------
+        mod
+        """
+        return asarray(mod(self, i))
+
+    def __rmod__(self, other):
+        return NotImplemented
+
+    def argsort(self, axis=-1, kind=None, order=None):
+        """
+        Return the indices that sort the array lexicographically.
+
+        For full documentation see `numpy.argsort`, for which this method is
+        in fact merely a "thin wrapper."
+
+        Examples
+        --------
+        >>> c = np.array(['a1b c', '1b ca', 'b ca1', 'Ca1b'], 'S5')
+        >>> c = c.view(np.char.chararray); c
+        chararray(['a1b c', '1b ca', 'b ca1', 'Ca1b'],
+              dtype='|S5')
+        >>> c[c.argsort()]
+        chararray(['1b ca', 'Ca1b', 'a1b c', 'b ca1'],
+              dtype='|S5')
+
+        """
+        return self.__array__().argsort(axis, kind, order)
+    argsort.__doc__ = ndarray.argsort.__doc__
+
+    def capitalize(self):
+        """
+        Return a copy of `self` with only the first character of each element
+        capitalized.
+
+        See Also
+        --------
+        char.capitalize
+
+        """
+        return asarray(capitalize(self))
+
+    def center(self, width, fillchar=' '):
+        """
+        Return a copy of `self` with its elements centered in a
+        string of length `width`.
+
+        See Also
+        --------
+        center
+        """
+        return asarray(center(self, width, fillchar))
+
+    def count(self, sub, start=0, end=None):
+        """
+        Returns an array with the number of non-overlapping occurrences of
+        substring `sub` in the range [`start`, `end`].
+
+        See Also
+        --------
+        char.count
+
+        """
+        return count(self, sub, start, end)
+
+    def decode(self, encoding=None, errors=None):
+        """
+        Calls ``bytes.decode`` element-wise.
+
+        See Also
+        --------
+        char.decode
+
+        """
+        return decode(self, encoding, errors)
+
+    def encode(self, encoding=None, errors=None):
+        """
+        Calls :meth:`str.encode` element-wise.
+
+        See Also
+        --------
+        char.encode
+
+        """
+        return encode(self, encoding, errors)
+
+    def endswith(self, suffix, start=0, end=None):
+        """
+        Returns a boolean array which is `True` where the string element
+        in `self` ends with `suffix`, otherwise `False`.
+
+        See Also
+        --------
+        char.endswith
+
+        """
+        return endswith(self, suffix, start, end)
+
+    def expandtabs(self, tabsize=8):
+        """
+        Return a copy of each string element where all tab characters are
+        replaced by one or more spaces.
+
+        See Also
+        --------
+        char.expandtabs
+
+        """
+        return asarray(expandtabs(self, tabsize))
+
+    def find(self, sub, start=0, end=None):
+        """
+        For each element, return the lowest index in the string where
+        substring `sub` is found.
+
+        See Also
+        --------
+        char.find
+
+        """
+        return find(self, sub, start, end)
+
+    def index(self, sub, start=0, end=None):
+        """
+        Like `find`, but raises :exc:`ValueError` when the substring is not
+        found.
+
+        See Also
+        --------
+        char.index
+
+        """
+        return index(self, sub, start, end)
+
+    def isalnum(self):
+        """
+        Returns true for each element if all characters in the string
+        are alphanumeric and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isalnum
+
+        """
+        return isalnum(self)
+
+    def isalpha(self):
+        """
+        Returns true for each element if all characters in the string
+        are alphabetic and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isalpha
+
+        """
+        return isalpha(self)
+
+    def isdigit(self):
+        """
+        Returns true for each element if all characters in the string are
+        digits and there is at least one character, false otherwise.
+
+        See Also
+        --------
+        char.isdigit
+
+        """
+        return isdigit(self)
+
+    def islower(self):
+        """
+        Returns true for each element if all cased characters in the
+        string are lowercase and there is at least one cased character,
+        false otherwise.
+
+        See Also
+        --------
+        char.islower
+
+        """
+        return islower(self)
+
+    def isspace(self):
+        """
+        Returns true for each element if there are only whitespace
+        characters in the string and there is at least one character,
+        false otherwise.
+
+        See Also
+        --------
+        char.isspace
+
+        """
+        return isspace(self)
+
+    def istitle(self):
+        """
+        Returns true for each element if the element is a titlecased
+        string and there is at least one character, false otherwise.
+
+        See Also
+        --------
+        char.istitle
+
+        """
+        return istitle(self)
+
+    def isupper(self):
+        """
+        Returns true for each element if all cased characters in the
+        string are uppercase and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isupper
+
+        """
+        return isupper(self)
+
+    def join(self, seq):
+        """
+        Return a string which is the concatenation of the strings in the
+        sequence `seq`.
+
+        See Also
+        --------
+        char.join
+
+        """
+        return join(self, seq)
+
+    def ljust(self, width, fillchar=' '):
+        """
+        Return an array with the elements of `self` left-justified in a
+        string of length `width`.
+
+        See Also
+        --------
+        char.ljust
+
+        """
+        return asarray(ljust(self, width, fillchar))
+
+    def lower(self):
+        """
+        Return an array with the elements of `self` converted to
+        lowercase.
+
+        See Also
+        --------
+        char.lower
+
+        """
+        return asarray(lower(self))
+
+    def lstrip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the leading characters
+        removed.
+
+        See Also
+        --------
+        char.lstrip
+
+        """
+        return lstrip(self, chars)
+
+    def partition(self, sep):
+        """
+        Partition each element in `self` around `sep`.
+
+        See Also
+        --------
+        partition
+        """
+        return asarray(partition(self, sep))
+
+    def replace(self, old, new, count=None):
+        """
+        For each element in `self`, return a copy of the string with all
+        occurrences of substring `old` replaced by `new`.
+
+        See Also
+        --------
+        char.replace
+
+        """
+        return replace(self, old, new, count if count is not None else -1)
+
+    def rfind(self, sub, start=0, end=None):
+        """
+        For each element in `self`, return the highest index in the string
+        where substring `sub` is found, such that `sub` is contained
+        within [`start`, `end`].
+
+        See Also
+        --------
+        char.rfind
+
+        """
+        return rfind(self, sub, start, end)
+
+    def rindex(self, sub, start=0, end=None):
+        """
+        Like `rfind`, but raises :exc:`ValueError` when the substring `sub` is
+        not found.
+
+        See Also
+        --------
+        char.rindex
+
+        """
+        return rindex(self, sub, start, end)
+
+    def rjust(self, width, fillchar=' '):
+        """
+        Return an array with the elements of `self`
+        right-justified in a string of length `width`.
+
+        See Also
+        --------
+        char.rjust
+
+        """
+        return asarray(rjust(self, width, fillchar))
+
+    def rpartition(self, sep):
+        """
+        Partition each element in `self` around `sep`.
+
+        See Also
+        --------
+        rpartition
+        """
+        return asarray(rpartition(self, sep))
+
+    def rsplit(self, sep=None, maxsplit=None):
+        """
+        For each element in `self`, return a list of the words in
+        the string, using `sep` as the delimiter string.
+
+        See Also
+        --------
+        char.rsplit
+
+        """
+        return rsplit(self, sep, maxsplit)
+
+    def rstrip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the trailing
+        characters removed.
+
+        See Also
+        --------
+        char.rstrip
+
+        """
+        return rstrip(self, chars)
+
+    def split(self, sep=None, maxsplit=None):
+        """
+        For each element in `self`, return a list of the words in the
+        string, using `sep` as the delimiter string.
+
+        See Also
+        --------
+        char.split
+
+        """
+        return split(self, sep, maxsplit)
+
+    def splitlines(self, keepends=None):
+        """
+        For each element in `self`, return a list of the lines in the
+        element, breaking at line boundaries.
+
+        See Also
+        --------
+        char.splitlines
+
+        """
+        return splitlines(self, keepends)
+
+    def startswith(self, prefix, start=0, end=None):
+        """
+        Returns a boolean array which is `True` where the string element
+        in `self` starts with `prefix`, otherwise `False`.
+
+        See Also
+        --------
+        char.startswith
+
+        """
+        return startswith(self, prefix, start, end)
+
+    def strip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the leading and
+        trailing characters removed.
+
+        See Also
+        --------
+        char.strip
+
+        """
+        return strip(self, chars)
+
+    def swapcase(self):
+        """
+        For each element in `self`, return a copy of the string with
+        uppercase characters converted to lowercase and vice versa.
+
+        See Also
+        --------
+        char.swapcase
+
+        """
+        return asarray(swapcase(self))
+
+    def title(self):
+        """
+        For each element in `self`, return a titlecased version of the
+        string: words start with uppercase characters, all remaining cased
+        characters are lowercase.
+
+        See Also
+        --------
+        char.title
+
+        """
+        return asarray(title(self))
+
+    def translate(self, table, deletechars=None):
+        """
+        For each element in `self`, return a copy of the string where
+        all characters occurring in the optional argument
+        `deletechars` are removed, and the remaining characters have
+        been mapped through the given translation table.
+
+        See Also
+        --------
+        char.translate
+
+        """
+        return asarray(translate(self, table, deletechars))
+
+    def upper(self):
+        """
+        Return an array with the elements of `self` converted to
+        uppercase.
+
+        See Also
+        --------
+        char.upper
+
+        """
+        return asarray(upper(self))
+
+    def zfill(self, width):
+        """
+        Return the numeric string left-filled with zeros in a string of
+        length `width`.
+
+        See Also
+        --------
+        char.zfill
+
+        """
+        return asarray(zfill(self, width))
+
+    def isnumeric(self):
+        """
+        For each element in `self`, return True if there are only
+        numeric characters in the element.
+
+        See Also
+        --------
+        char.isnumeric
+
+        """
+        return isnumeric(self)
+
+    def isdecimal(self):
+        """
+        For each element in `self`, return True if there are only
+        decimal characters in the element.
+
+        See Also
+        --------
+        char.isdecimal
+
+        """
+        return isdecimal(self)
+
+
+@set_module("numpy.char")
+def array(obj, itemsize=None, copy=True, unicode=None, order=None):
+    """
+    Create a `~numpy.char.chararray`.
+
+    .. note::
+       This class is provided for numarray backward-compatibility.
+       New code (not concerned with numarray compatibility) should use
+       arrays of type `bytes_` or `str_` and use the free functions
+       in :mod:`numpy.char` for fast vectorized string operations instead.
+
+    Versus a NumPy array of dtype `bytes_` or `str_`, this
+    class adds the following functionality:
+
+    1) values automatically have whitespace removed from the end
+       when indexed
+
+    2) comparison operators automatically remove whitespace from the
+       end when comparing values
+
+    3) vectorized string operations are provided as methods
+       (e.g. `chararray.endswith <numpy.char.chararray.endswith>`)
+       and infix operators (e.g. ``+, *, %``)
+
+    Parameters
+    ----------
+    obj : array of str or unicode-like
+
+    itemsize : int, optional
+        `itemsize` is the number of characters per scalar in the
+        resulting array.  If `itemsize` is None, and `obj` is an
+        object array or a Python list, the `itemsize` will be
+        automatically determined.  If `itemsize` is provided and `obj`
+        is of type str or unicode, then the `obj` string will be
+        chunked into `itemsize` pieces.
+
+    copy : bool, optional
+        If true (default), then the object is copied.  Otherwise, a copy
+        will only be made if ``__array__`` returns a copy, if obj is a
+        nested sequence, or if a copy is needed to satisfy any of the other
+        requirements (`itemsize`, unicode, `order`, etc.).
+
+    unicode : bool, optional
+        When true, the resulting `~numpy.char.chararray` can contain Unicode
+        characters, when false only 8-bit characters.  If unicode is
+        None and `obj` is one of the following:
+
+        - a `~numpy.char.chararray`,
+        - an ndarray of type :class:`str_` or :class:`bytes_`
+        - a Python :class:`str` or :class:`bytes` object,
+
+        then the unicode setting of the output array will be
+        automatically determined.
+
+    order : {'C', 'F', 'A'}, optional
+        Specify the order of the array.  If order is 'C' (default), then the
+        array will be in C-contiguous order (last-index varies the
+        fastest).  If order is 'F', then the returned array
+        will be in Fortran-contiguous order (first-index varies the
+        fastest).  If order is 'A', then the returned array may
+        be in any order (either C-, Fortran-contiguous, or even
+        discontiguous).
+    
+    Examples
+    --------
+
+    >>> import numpy as np
+    >>> char_array = np.char.array(['hello', 'world', 'numpy','array'])
+    >>> char_array
+    chararray(['hello', 'world', 'numpy', 'array'], dtype='<U5')
+
+    """
+    if isinstance(obj, (bytes, str)):
+        if unicode is None:
+            if isinstance(obj, str):
+                unicode = True
+            else:
+                unicode = False
+
+        if itemsize is None:
+            itemsize = len(obj)
+        shape = len(obj) // itemsize
+
+        return chararray(shape, itemsize=itemsize, unicode=unicode,
+                         buffer=obj, order=order)
+
+    if isinstance(obj, (list, tuple)):
+        obj = asnarray(obj)
+
+    if isinstance(obj, ndarray) and issubclass(obj.dtype.type, character):
+        # If we just have a vanilla chararray, create a chararray
+        # view around it.
+        if not isinstance(obj, chararray):
+            obj = obj.view(chararray)
+
+        if itemsize is None:
+            itemsize = obj.itemsize
+            # itemsize is in 8-bit chars, so for Unicode, we need
+            # to divide by the size of a single Unicode character,
+            # which for NumPy is always 4
+            if issubclass(obj.dtype.type, str_):
+                itemsize //= 4
+
+        if unicode is None:
+            if issubclass(obj.dtype.type, str_):
+                unicode = True
+            else:
+                unicode = False
+
+        if unicode:
+            dtype = str_
+        else:
+            dtype = bytes_
+
+        if order is not None:
+            obj = asnarray(obj, order=order)
+        if (copy or
+                (itemsize != obj.itemsize) or
+                (not unicode and isinstance(obj, str_)) or
+                (unicode and isinstance(obj, bytes_))):
+            obj = obj.astype((dtype, int(itemsize)))
+        return obj
+
+    if isinstance(obj, ndarray) and issubclass(obj.dtype.type, object):
+        if itemsize is None:
+            # Since no itemsize was specified, convert the input array to
+            # a list so the ndarray constructor will automatically
+            # determine the itemsize for us.
+            obj = obj.tolist()
+            # Fall through to the default case
+
+    if unicode:
+        dtype = str_
+    else:
+        dtype = bytes_
+
+    if itemsize is None:
+        val = narray(obj, dtype=dtype, order=order, subok=True)
+    else:
+        val = narray(obj, dtype=(dtype, itemsize), order=order, subok=True)
+    return val.view(chararray)
+
+
+@set_module("numpy.char")
+def asarray(obj, itemsize=None, unicode=None, order=None):
+    """
+    Convert the input to a `~numpy.char.chararray`, copying the data only if
+    necessary.
+
+    Versus a NumPy array of dtype `bytes_` or `str_`, this
+    class adds the following functionality:
+
+    1) values automatically have whitespace removed from the end
+       when indexed
+
+    2) comparison operators automatically remove whitespace from the
+       end when comparing values
+
+    3) vectorized string operations are provided as methods
+       (e.g. `chararray.endswith <numpy.char.chararray.endswith>`)
+       and infix operators (e.g. ``+``, ``*``, ``%``)
+
+    Parameters
+    ----------
+    obj : array of str or unicode-like
+
+    itemsize : int, optional
+        `itemsize` is the number of characters per scalar in the
+        resulting array.  If `itemsize` is None, and `obj` is an
+        object array or a Python list, the `itemsize` will be
+        automatically determined.  If `itemsize` is provided and `obj`
+        is of type str or unicode, then the `obj` string will be
+        chunked into `itemsize` pieces.
+
+    unicode : bool, optional
+        When true, the resulting `~numpy.char.chararray` can contain Unicode
+        characters, when false only 8-bit characters.  If unicode is
+        None and `obj` is one of the following:
+
+        - a `~numpy.char.chararray`,
+        - an ndarray of type `str_` or `unicode_`
+        - a Python str or unicode object,
+
+        then the unicode setting of the output array will be
+        automatically determined.
+
+    order : {'C', 'F'}, optional
+        Specify the order of the array.  If order is 'C' (default), then the
+        array will be in C-contiguous order (last-index varies the
+        fastest).  If order is 'F', then the returned array
+        will be in Fortran-contiguous order (first-index varies the
+        fastest).
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.char.asarray(['hello', 'world'])
+    chararray(['hello', 'world'], dtype='<U5')
+
+    """
+    return array(obj, itemsize, copy=False,
+                 unicode=unicode, order=order)

janus/lib/python3.10/site-packages/numpy/_core/defchararray.pyi

@@ -0,0 +1,1096 @@
+from typing import (
+    Literal as L,
+    overload,
+    TypeAlias,
+    TypeVar,
+    Any,
+    SupportsIndex,
+    SupportsInt,
+)
+
+import numpy as np
+from numpy import (
+    ndarray,
+    dtype,
+    str_,
+    bytes_,
+    int_,
+    object_,
+    _OrderKACF,
+    _SupportsBuffer,
+    _SupportsArray
+)
+from numpy._typing import (
+    NDArray,
+    _Shape,
+    _ShapeLike,
+    _ArrayLikeStr_co as U_co,
+    _ArrayLikeBytes_co as S_co,
+    _ArrayLikeString_co as T_co,
+    _ArrayLikeAnyString_co as UST_co,
+    _ArrayLikeInt_co as i_co,
+    _ArrayLikeBool_co as b_co,
+)
+from numpy._core.multiarray import compare_chararrays
+
+__all__ = [
+    "equal",
+    "not_equal",
+    "greater_equal",
+    "less_equal",
+    "greater",
+    "less",
+    "str_len",
+    "add",
+    "multiply",
+    "mod",
+    "capitalize",
+    "center",
+    "count",
+    "decode",
+    "encode",
+    "endswith",
+    "expandtabs",
+    "find",
+    "index",
+    "isalnum",
+    "isalpha",
+    "isdigit",
+    "islower",
+    "isspace",
+    "istitle",
+    "isupper",
+    "join",
+    "ljust",
+    "lower",
+    "lstrip",
+    "partition",
+    "replace",
+    "rfind",
+    "rindex",
+    "rjust",
+    "rpartition",
+    "rsplit",
+    "rstrip",
+    "split",
+    "splitlines",
+    "startswith",
+    "strip",
+    "swapcase",
+    "title",
+    "translate",
+    "upper",
+    "zfill",
+    "isnumeric",
+    "isdecimal",
+    "array",
+    "asarray",
+    "compare_chararrays",
+    "chararray",
+]
+
+_ShapeT_co = TypeVar("_ShapeT_co", bound=tuple[int, ...], covariant=True)
+_SCT = TypeVar("_SCT", bound=np.character)
+_CharDType_co = TypeVar("_CharDType_co", bound=dtype[np.character], covariant=True)
+_CharArray: TypeAlias = chararray[tuple[int, ...], dtype[_SCT]]
+
+_StringDTypeArray: TypeAlias = np.ndarray[_Shape, np.dtypes.StringDType]
+_StringDTypeSupportsArray: TypeAlias = _SupportsArray[np.dtypes.StringDType]
+_StringDTypeOrUnicodeArray: TypeAlias = np.ndarray[_Shape, np.dtype[np.str_]] | np.ndarray[_Shape, np.dtypes.StringDType]
+
+class chararray(ndarray[_ShapeT_co, _CharDType_co]):
+    @overload
+    def __new__(
+        subtype,
+        shape: _ShapeLike,
+        itemsize: SupportsIndex | SupportsInt = ...,
+        unicode: L[False] = ...,
+        buffer: _SupportsBuffer = ...,
+        offset: SupportsIndex = ...,
+        strides: _ShapeLike = ...,
+        order: _OrderKACF = ...,
+    ) -> chararray[_Shape, dtype[bytes_]]: ...
+    @overload
+    def __new__(
+        subtype,
+        shape: _ShapeLike,
+        itemsize: SupportsIndex | SupportsInt = ...,
+        unicode: L[True] = ...,
+        buffer: _SupportsBuffer = ...,
+        offset: SupportsIndex = ...,
+        strides: _ShapeLike = ...,
+        order: _OrderKACF = ...,
+    ) -> chararray[_Shape, dtype[str_]]: ...
+
+    def __array_finalize__(self, obj: object) -> None: ...
+    def __mul__(self, other: i_co) -> chararray[_Shape, _CharDType_co]: ...
+    def __rmul__(self, other: i_co) -> chararray[_Shape, _CharDType_co]: ...
+    def __mod__(self, i: Any) -> chararray[_Shape, _CharDType_co]: ...
+
+    @overload
+    def __eq__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def __eq__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> NDArray[np.bool]: ...
+
+    @overload
+    def __ne__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def __ne__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> NDArray[np.bool]: ...
+
+    @overload
+    def __ge__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def __ge__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> NDArray[np.bool]: ...
+
+    @overload
+    def __le__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def __le__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> NDArray[np.bool]: ...
+
+    @overload
+    def __gt__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def __gt__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> NDArray[np.bool]: ...
+
+    @overload
+    def __lt__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def __lt__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> NDArray[np.bool]: ...
+
+    @overload
+    def __add__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def __add__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def __radd__(
+        self: _CharArray[str_],
+        other: U_co,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def __radd__(
+        self: _CharArray[bytes_],
+        other: S_co,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def center(
+        self: _CharArray[str_],
+        width: i_co,
+        fillchar: U_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def center(
+        self: _CharArray[bytes_],
+        width: i_co,
+        fillchar: S_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def count(
+        self: _CharArray[str_],
+        sub: U_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+    @overload
+    def count(
+        self: _CharArray[bytes_],
+        sub: S_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+
+    def decode(
+        self: _CharArray[bytes_],
+        encoding: None | str = ...,
+        errors: None | str = ...,
+    ) -> _CharArray[str_]: ...
+
+    def encode(
+        self: _CharArray[str_],
+        encoding: None | str = ...,
+        errors: None | str = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def endswith(
+        self: _CharArray[str_],
+        suffix: U_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def endswith(
+        self: _CharArray[bytes_],
+        suffix: S_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[np.bool]: ...
+
+    def expandtabs(
+        self,
+        tabsize: i_co = ...,
+    ) -> chararray[_Shape, _CharDType_co]: ...
+
+    @overload
+    def find(
+        self: _CharArray[str_],
+        sub: U_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+    @overload
+    def find(
+        self: _CharArray[bytes_],
+        sub: S_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+
+    @overload
+    def index(
+        self: _CharArray[str_],
+        sub: U_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+    @overload
+    def index(
+        self: _CharArray[bytes_],
+        sub: S_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+
+    @overload
+    def join(
+        self: _CharArray[str_],
+        seq: U_co,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def join(
+        self: _CharArray[bytes_],
+        seq: S_co,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def ljust(
+        self: _CharArray[str_],
+        width: i_co,
+        fillchar: U_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def ljust(
+        self: _CharArray[bytes_],
+        width: i_co,
+        fillchar: S_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def lstrip(
+        self: _CharArray[str_],
+        chars: None | U_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def lstrip(
+        self: _CharArray[bytes_],
+        chars: None | S_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def partition(
+        self: _CharArray[str_],
+        sep: U_co,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def partition(
+        self: _CharArray[bytes_],
+        sep: S_co,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def replace(
+        self: _CharArray[str_],
+        old: U_co,
+        new: U_co,
+        count: None | i_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def replace(
+        self: _CharArray[bytes_],
+        old: S_co,
+        new: S_co,
+        count: None | i_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def rfind(
+        self: _CharArray[str_],
+        sub: U_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+    @overload
+    def rfind(
+        self: _CharArray[bytes_],
+        sub: S_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+
+    @overload
+    def rindex(
+        self: _CharArray[str_],
+        sub: U_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+    @overload
+    def rindex(
+        self: _CharArray[bytes_],
+        sub: S_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[int_]: ...
+
+    @overload
+    def rjust(
+        self: _CharArray[str_],
+        width: i_co,
+        fillchar: U_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def rjust(
+        self: _CharArray[bytes_],
+        width: i_co,
+        fillchar: S_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def rpartition(
+        self: _CharArray[str_],
+        sep: U_co,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def rpartition(
+        self: _CharArray[bytes_],
+        sep: S_co,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def rsplit(
+        self: _CharArray[str_],
+        sep: None | U_co = ...,
+        maxsplit: None | i_co = ...,
+    ) -> NDArray[object_]: ...
+    @overload
+    def rsplit(
+        self: _CharArray[bytes_],
+        sep: None | S_co = ...,
+        maxsplit: None | i_co = ...,
+    ) -> NDArray[object_]: ...
+
+    @overload
+    def rstrip(
+        self: _CharArray[str_],
+        chars: None | U_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def rstrip(
+        self: _CharArray[bytes_],
+        chars: None | S_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def split(
+        self: _CharArray[str_],
+        sep: None | U_co = ...,
+        maxsplit: None | i_co = ...,
+    ) -> NDArray[object_]: ...
+    @overload
+    def split(
+        self: _CharArray[bytes_],
+        sep: None | S_co = ...,
+        maxsplit: None | i_co = ...,
+    ) -> NDArray[object_]: ...
+
+    def splitlines(self, keepends: None | b_co = ...) -> NDArray[object_]: ...
+
+    @overload
+    def startswith(
+        self: _CharArray[str_],
+        prefix: U_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[np.bool]: ...
+    @overload
+    def startswith(
+        self: _CharArray[bytes_],
+        prefix: S_co,
+        start: i_co = ...,
+        end: None | i_co = ...,
+    ) -> NDArray[np.bool]: ...
+
+    @overload
+    def strip(
+        self: _CharArray[str_],
+        chars: None | U_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def strip(
+        self: _CharArray[bytes_],
+        chars: None | S_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    @overload
+    def translate(
+        self: _CharArray[str_],
+        table: U_co,
+        deletechars: None | U_co = ...,
+    ) -> _CharArray[str_]: ...
+    @overload
+    def translate(
+        self: _CharArray[bytes_],
+        table: S_co,
+        deletechars: None | S_co = ...,
+    ) -> _CharArray[bytes_]: ...
+
+    def zfill(self, width: i_co) -> chararray[_Shape, _CharDType_co]: ...
+    def capitalize(self) -> chararray[_ShapeT_co, _CharDType_co]: ...
+    def title(self) -> chararray[_ShapeT_co, _CharDType_co]: ...
+    def swapcase(self) -> chararray[_ShapeT_co, _CharDType_co]: ...
+    def lower(self) -> chararray[_ShapeT_co, _CharDType_co]: ...
+    def upper(self) -> chararray[_ShapeT_co, _CharDType_co]: ...
+    def isalnum(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def isalpha(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def isdigit(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def islower(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def isspace(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def istitle(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def isupper(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def isnumeric(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+    def isdecimal(self) -> ndarray[_ShapeT_co, dtype[np.bool]]: ...
+
+
+# Comparison
+@overload
+def equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def not_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def not_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def not_equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def greater_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def greater_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def greater_equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def less_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def less_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def less_equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def greater(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def greater(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def greater(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def less(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def less(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def less(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def add(x1: U_co, x2: U_co) -> NDArray[np.str_]: ...
+@overload
+def add(x1: S_co, x2: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def add(x1: _StringDTypeSupportsArray, x2: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def add(x1: T_co, T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def multiply(a: U_co, i: i_co) -> NDArray[np.str_]: ...
+@overload
+def multiply(a: S_co, i: i_co) -> NDArray[np.bytes_]: ...
+@overload
+def multiply(a: _StringDTypeSupportsArray, i: i_co) -> _StringDTypeArray: ...
+@overload
+def multiply(a: T_co, i: i_co) -> _StringDTypeOrUnicodeArray: ...
+
+
+@overload
+def mod(a: U_co, value: Any) -> NDArray[np.str_]: ...
+@overload
+def mod(a: S_co, value: Any) -> NDArray[np.bytes_]: ...
+@overload
+def mod(a: _StringDTypeSupportsArray, value: Any) -> _StringDTypeArray: ...
+@overload
+def mod(a: T_co, value: Any) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def capitalize(a: U_co) -> NDArray[str_]: ...
+@overload
+def capitalize(a: S_co) -> NDArray[bytes_]: ...
+@overload
+def capitalize(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def capitalize(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def center(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ...
+@overload
+def center(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ...
+@overload
+def center(a: _StringDTypeSupportsArray, width: i_co, fillchar: _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def center(a: T_co, width: i_co, fillchar: T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+def decode(
+    a: S_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[str_]: ...
+def encode(
+    a: U_co | T_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def expandtabs(a: U_co, tabsize: i_co = ...) -> NDArray[str_]: ...
+@overload
+def expandtabs(a: S_co, tabsize: i_co = ...) -> NDArray[bytes_]: ...
+@overload
+def expandtabs(a: _StringDTypeSupportsArray, tabsize: i_co = ...) -> _StringDTypeArray: ...
+@overload
+def expandtabs(a: T_co, tabsize: i_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def join(sep: U_co, seq: U_co) -> NDArray[str_]: ...
+@overload
+def join(sep: S_co, seq: S_co) -> NDArray[bytes_]: ...
+@overload
+def join(sep: _StringDTypeSupportsArray, seq: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def join(sep: T_co, seq: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def ljust(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ...
+@overload
+def ljust(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ...
+@overload
+def ljust(a: _StringDTypeSupportsArray, width: i_co, fillchar: _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def ljust(a: T_co, width: i_co, fillchar: T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def lower(a: U_co) -> NDArray[str_]: ...
+@overload
+def lower(a: S_co) -> NDArray[bytes_]: ...
+@overload
+def lower(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def lower(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def lstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def lstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+@overload
+def lstrip(a: _StringDTypeSupportsArray, chars: None | _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def lstrip(a: T_co, chars: None | T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def partition(a: U_co, sep: U_co) -> NDArray[str_]: ...
+@overload
+def partition(a: S_co, sep: S_co) -> NDArray[bytes_]: ...
+@overload
+def partition(a: _StringDTypeSupportsArray, sep: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def partition(a: T_co, sep: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def replace(
+    a: U_co,
+    old: U_co,
+    new: U_co,
+    count: None | i_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def replace(
+    a: S_co,
+    old: S_co,
+    new: S_co,
+    count: None | i_co = ...,
+) -> NDArray[bytes_]: ...
+@overload
+def replace(
+    a: _StringDTypeSupportsArray,
+    old: _StringDTypeSupportsArray,
+    new: _StringDTypeSupportsArray,
+    count: i_co = ...,
+) -> _StringDTypeArray: ...
+@overload
+def replace(
+    a: T_co,
+    old: T_co,
+    new: T_co,
+    count: i_co = ...,
+) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def rjust(
+    a: U_co,
+    width: i_co,
+    fillchar: U_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def rjust(
+    a: S_co,
+    width: i_co,
+    fillchar: S_co = ...,
+) -> NDArray[bytes_]: ...
+@overload
+def rjust(
+    a: _StringDTypeSupportsArray,
+    width: i_co,
+    fillchar: _StringDTypeSupportsArray = ...,
+) -> _StringDTypeArray: ...
+@overload
+def rjust(
+    a: T_co,
+    width: i_co,
+    fillchar: T_co = ...,
+) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def rpartition(a: U_co, sep: U_co) -> NDArray[str_]: ...
+@overload
+def rpartition(a: S_co, sep: S_co) -> NDArray[bytes_]: ...
+@overload
+def rpartition(a: _StringDTypeSupportsArray, sep: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def rpartition(a: T_co, sep: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def rsplit(
+    a: U_co,
+    sep: None | U_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def rsplit(
+    a: S_co,
+    sep: None | S_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def rsplit(
+    a: _StringDTypeSupportsArray,
+    sep: None | _StringDTypeSupportsArray = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def rsplit(
+    a: T_co,
+    sep: None | T_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def rstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def rstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+@overload
+def rstrip(a: _StringDTypeSupportsArray, chars: None | _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def rstrip(a: T_co, chars: None | T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def split(
+    a: U_co,
+    sep: None | U_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def split(
+    a: S_co,
+    sep: None | S_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def split(
+    a: _StringDTypeSupportsArray,
+    sep: None | _StringDTypeSupportsArray = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def split(
+    a: T_co,
+    sep: None | T_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+
+def splitlines(a: UST_co, keepends: None | b_co = ...) -> NDArray[np.object_]: ...
+
+@overload
+def strip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def strip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+@overload
+def strip(a: _StringDTypeSupportsArray, chars: None | _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def strip(a: T_co, chars: None | T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def swapcase(a: U_co) -> NDArray[str_]: ...
+@overload
+def swapcase(a: S_co) -> NDArray[bytes_]: ...
+@overload
+def swapcase(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def swapcase(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def title(a: U_co) -> NDArray[str_]: ...
+@overload
+def title(a: S_co) -> NDArray[bytes_]: ...
+@overload
+def title(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def title(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def translate(
+    a: U_co,
+    table: str,
+    deletechars: None | str = ...,
+) -> NDArray[str_]: ...
+@overload
+def translate(
+    a: S_co,
+    table: str,
+    deletechars: None | str = ...,
+) -> NDArray[bytes_]: ...
+@overload
+def translate(
+    a: _StringDTypeSupportsArray,
+    table: str,
+    deletechars: None | str = ...,
+) -> _StringDTypeArray: ...
+@overload
+def translate(
+    a: T_co,
+    table: str,
+    deletechars: None | str = ...,
+) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def upper(a: U_co) -> NDArray[str_]: ...
+@overload
+def upper(a: S_co) -> NDArray[bytes_]: ...
+@overload
+def upper(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def upper(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def zfill(a: U_co, width: i_co) -> NDArray[str_]: ...
+@overload
+def zfill(a: S_co, width: i_co) -> NDArray[bytes_]: ...
+@overload
+def zfill(a: _StringDTypeSupportsArray, width: i_co) -> _StringDTypeArray: ...
+@overload
+def zfill(a: T_co, width: i_co) -> _StringDTypeOrUnicodeArray: ...
+
+# String information
+@overload
+def count(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def count(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def count(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def endswith(
+    a: U_co,
+    suffix: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def endswith(
+    a: S_co,
+    suffix: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def endswith(
+    a: T_co,
+    suffix: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+
+@overload
+def find(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def find(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def find(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def index(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def index(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def index(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+def isalpha(a: UST_co) -> NDArray[np.bool]: ...
+def isalnum(a: UST_co) -> NDArray[np.bool]: ...
+def isdecimal(a: U_co | T_co) -> NDArray[np.bool]: ...
+def isdigit(a: UST_co) -> NDArray[np.bool]: ...
+def islower(a: UST_co) -> NDArray[np.bool]: ...
+def isnumeric(a: U_co | T_co) -> NDArray[np.bool]: ...
+def isspace(a: UST_co) -> NDArray[np.bool]: ...
+def istitle(a: UST_co) -> NDArray[np.bool]: ...
+def isupper(a: UST_co) -> NDArray[np.bool]: ...
+
+@overload
+def rfind(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rfind(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rfind(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def rindex(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rindex(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rindex(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def startswith(
+    a: U_co,
+    prefix: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def startswith(
+    a: S_co,
+    prefix: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def startswith(
+    a: T_co,
+    suffix: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+
+def str_len(A: UST_co) -> NDArray[int_]: ...
+
+# Overload 1 and 2: str- or bytes-based array-likes
+# overload 3: arbitrary object with unicode=False  (-> bytes_)
+# overload 4: arbitrary object with unicode=True  (-> str_)
+@overload
+def array(
+    obj: U_co,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+@overload
+def array(
+    obj: S_co,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def array(
+    obj: object,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def array(
+    obj: object,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[True] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+
+@overload
+def asarray(
+    obj: U_co,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+@overload
+def asarray(
+    obj: S_co,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def asarray(
+    obj: object,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def asarray(
+    obj: object,
+    itemsize: None | int = ...,
+    unicode: L[True] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...

janus/lib/python3.10/site-packages/numpy/_core/einsumfunc.py

@@ -0,0 +1,1499 @@
+"""
+Implementation of optimized einsum.
+
+"""
+import itertools
+import operator
+
+from numpy._core.multiarray import c_einsum
+from numpy._core.numeric import asanyarray, tensordot
+from numpy._core.overrides import array_function_dispatch
+
+__all__ = ['einsum', 'einsum_path']
+
+# importing string for string.ascii_letters would be too slow
+# the first import before caching has been measured to take 800 µs (#23777)
+einsum_symbols = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ'
+einsum_symbols_set = set(einsum_symbols)
+
+
+def _flop_count(idx_contraction, inner, num_terms, size_dictionary):
+    """
+    Computes the number of FLOPS in the contraction.
+
+    Parameters
+    ----------
+    idx_contraction : iterable
+        The indices involved in the contraction
+    inner : bool
+        Does this contraction require an inner product?
+    num_terms : int
+        The number of terms in a contraction
+    size_dictionary : dict
+        The size of each of the indices in idx_contraction
+
+    Returns
+    -------
+    flop_count : int
+        The total number of FLOPS required for the contraction.
+
+    Examples
+    --------
+
+    >>> _flop_count('abc', False, 1, {'a': 2, 'b':3, 'c':5})
+    30
+
+    >>> _flop_count('abc', True, 2, {'a': 2, 'b':3, 'c':5})
+    60
+
+    """
+
+    overall_size = _compute_size_by_dict(idx_contraction, size_dictionary)
+    op_factor = max(1, num_terms - 1)
+    if inner:
+        op_factor += 1
+
+    return overall_size * op_factor
+
+def _compute_size_by_dict(indices, idx_dict):
+    """
+    Computes the product of the elements in indices based on the dictionary
+    idx_dict.
+
+    Parameters
+    ----------
+    indices : iterable
+        Indices to base the product on.
+    idx_dict : dictionary
+        Dictionary of index sizes
+
+    Returns
+    -------
+    ret : int
+        The resulting product.
+
+    Examples
+    --------
+    >>> _compute_size_by_dict('abbc', {'a': 2, 'b':3, 'c':5})
+    90
+
+    """
+    ret = 1
+    for i in indices:
+        ret *= idx_dict[i]
+    return ret
+
+
+def _find_contraction(positions, input_sets, output_set):
+    """
+    Finds the contraction for a given set of input and output sets.
+
+    Parameters
+    ----------
+    positions : iterable
+        Integer positions of terms used in the contraction.
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+
+    Returns
+    -------
+    new_result : set
+        The indices of the resulting contraction
+    remaining : list
+        List of sets that have not been contracted, the new set is appended to
+        the end of this list
+    idx_removed : set
+        Indices removed from the entire contraction
+    idx_contraction : set
+        The indices used in the current contraction
+
+    Examples
+    --------
+
+    # A simple dot product test case
+    >>> pos = (0, 1)
+    >>> isets = [set('ab'), set('bc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}], {'b'}, {'a', 'b', 'c'})
+
+    # A more complex case with additional terms in the contraction
+    >>> pos = (0, 2)
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}, {'a', 'c'}], {'b', 'd'}, {'a', 'b', 'c', 'd'})
+    """
+
+    idx_contract = set()
+    idx_remain = output_set.copy()
+    remaining = []
+    for ind, value in enumerate(input_sets):
+        if ind in positions:
+            idx_contract |= value
+        else:
+            remaining.append(value)
+            idx_remain |= value
+
+    new_result = idx_remain & idx_contract
+    idx_removed = (idx_contract - new_result)
+    remaining.append(new_result)
+
+    return (new_result, remaining, idx_removed, idx_contract)
+
+
+def _optimal_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Computes all possible pair contractions, sieves the results based
+    on ``memory_limit`` and returns the lowest cost path. This algorithm
+    scales factorial with respect to the elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The optimal contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _optimal_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    full_results = [(0, [], input_sets)]
+    for iteration in range(len(input_sets) - 1):
+        iter_results = []
+
+        # Compute all unique pairs
+        for curr in full_results:
+            cost, positions, remaining = curr
+            for con in itertools.combinations(
+                range(len(input_sets) - iteration), 2
+            ):
+
+                # Find the contraction
+                cont = _find_contraction(con, remaining, output_set)
+                new_result, new_input_sets, idx_removed, idx_contract = cont
+
+                # Sieve the results based on memory_limit
+                new_size = _compute_size_by_dict(new_result, idx_dict)
+                if new_size > memory_limit:
+                    continue
+
+                # Build (total_cost, positions, indices_remaining)
+                total_cost = cost + _flop_count(
+                    idx_contract, idx_removed, len(con), idx_dict
+                )
+                new_pos = positions + [con]
+                iter_results.append((total_cost, new_pos, new_input_sets))
+
+        # Update combinatorial list, if we did not find anything return best
+        # path + remaining contractions
+        if iter_results:
+            full_results = iter_results
+        else:
+            path = min(full_results, key=lambda x: x[0])[1]
+            path += [tuple(range(len(input_sets) - iteration))]
+            return path
+
+    # If we have not found anything return single einsum contraction
+    if len(full_results) == 0:
+        return [tuple(range(len(input_sets)))]
+
+    path = min(full_results, key=lambda x: x[0])[1]
+    return path
+
+def _parse_possible_contraction(
+        positions, input_sets, output_set, idx_dict,
+        memory_limit, path_cost, naive_cost
+    ):
+    """Compute the cost (removed size + flops) and resultant indices for
+    performing the contraction specified by ``positions``.
+
+    Parameters
+    ----------
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    input_sets : list of sets
+        The indices found on each tensors.
+    output_set : set
+        The output indices of the expression.
+    idx_dict : dict
+        Mapping of each index to its size.
+    memory_limit : int
+        The total allowed size for an intermediary tensor.
+    path_cost : int
+        The contraction cost so far.
+    naive_cost : int
+        The cost of the unoptimized expression.
+
+    Returns
+    -------
+    cost : (int, int)
+        A tuple containing the size of any indices removed, and the flop cost.
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    new_input_sets : list of sets
+        The resulting new list of indices if this proposed contraction
+        is performed.
+
+    """
+
+    # Find the contraction
+    contract = _find_contraction(positions, input_sets, output_set)
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+
+    # Sieve the results based on memory_limit
+    new_size = _compute_size_by_dict(idx_result, idx_dict)
+    if new_size > memory_limit:
+        return None
+
+    # Build sort tuple
+    old_sizes = (
+        _compute_size_by_dict(input_sets[p], idx_dict) for p in positions
+    )
+    removed_size = sum(old_sizes) - new_size
+
+    # NB: removed_size used to be just the size of any removed indices i.e.:
+    #     helpers.compute_size_by_dict(idx_removed, idx_dict)
+    cost = _flop_count(idx_contract, idx_removed, len(positions), idx_dict)
+    sort = (-removed_size, cost)
+
+    # Sieve based on total cost as well
+    if (path_cost + cost) > naive_cost:
+        return None
+
+    # Add contraction to possible choices
+    return [sort, positions, new_input_sets]
+
+
+def _update_other_results(results, best):
+    """Update the positions and provisional input_sets of ``results``
+    based on performing the contraction result ``best``. Remove any
+    involving the tensors contracted.
+
+    Parameters
+    ----------
+    results : list
+        List of contraction results produced by
+        ``_parse_possible_contraction``.
+    best : list
+        The best contraction of ``results`` i.e. the one that
+        will be performed.
+
+    Returns
+    -------
+    mod_results : list
+        The list of modified results, updated with outcome of
+        ``best`` contraction.
+    """
+
+    best_con = best[1]
+    bx, by = best_con
+    mod_results = []
+
+    for cost, (x, y), con_sets in results:
+
+        # Ignore results involving tensors just contracted
+        if x in best_con or y in best_con:
+            continue
+
+        # Update the input_sets
+        del con_sets[by - int(by > x) - int(by > y)]
+        del con_sets[bx - int(bx > x) - int(bx > y)]
+        con_sets.insert(-1, best[2][-1])
+
+        # Update the position indices
+        mod_con = x - int(x > bx) - int(x > by), y - int(y > bx) - int(y > by)
+        mod_results.append((cost, mod_con, con_sets))
+
+    return mod_results
+
+def _greedy_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Finds the path by contracting the best pair until the input list is
+    exhausted. The best pair is found by minimizing the tuple
+    ``(-prod(indices_removed), cost)``.  What this amounts to is prioritizing
+    matrix multiplication or inner product operations, then Hadamard like
+    operations, and finally outer operations. Outer products are limited by
+    ``memory_limit``. This algorithm scales cubically with respect to the
+    number of elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The greedy contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _greedy_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    # Handle trivial cases that leaked through
+    if len(input_sets) == 1:
+        return [(0,)]
+    elif len(input_sets) == 2:
+        return [(0, 1)]
+
+    # Build up a naive cost
+    contract = _find_contraction(
+        range(len(input_sets)), input_sets, output_set
+    )
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+    naive_cost = _flop_count(
+        idx_contract, idx_removed, len(input_sets), idx_dict
+    )
+
+    # Initially iterate over all pairs
+    comb_iter = itertools.combinations(range(len(input_sets)), 2)
+    known_contractions = []
+
+    path_cost = 0
+    path = []
+
+    for iteration in range(len(input_sets) - 1):
+
+        # Iterate over all pairs on the first step, only previously
+        # found pairs on subsequent steps
+        for positions in comb_iter:
+
+            # Always initially ignore outer products
+            if input_sets[positions[0]].isdisjoint(input_sets[positions[1]]):
+                continue
+
+            result = _parse_possible_contraction(
+                positions, input_sets, output_set, idx_dict,
+                memory_limit, path_cost, naive_cost
+            )
+            if result is not None:
+                known_contractions.append(result)
+
+        # If we do not have a inner contraction, rescan pairs
+        # including outer products
+        if len(known_contractions) == 0:
+
+            # Then check the outer products
+            for positions in itertools.combinations(
+                range(len(input_sets)), 2
+            ):
+                result = _parse_possible_contraction(
+                    positions, input_sets, output_set, idx_dict,
+                    memory_limit, path_cost, naive_cost
+                )
+                if result is not None:
+                    known_contractions.append(result)
+
+            # If we still did not find any remaining contractions,
+            # default back to einsum like behavior
+            if len(known_contractions) == 0:
+                path.append(tuple(range(len(input_sets))))
+                break
+
+        # Sort based on first index
+        best = min(known_contractions, key=lambda x: x[0])
+
+        # Now propagate as many unused contractions as possible
+        # to the next iteration
+        known_contractions = _update_other_results(known_contractions, best)
+
+        # Next iteration only compute contractions with the new tensor
+        # All other contractions have been accounted for
+        input_sets = best[2]
+        new_tensor_pos = len(input_sets) - 1
+        comb_iter = ((i, new_tensor_pos) for i in range(new_tensor_pos))
+
+        # Update path and total cost
+        path.append(best[1])
+        path_cost += best[0][1]
+
+    return path
+
+
+def _can_dot(inputs, result, idx_removed):
+    """
+    Checks if we can use BLAS (np.tensordot) call and its beneficial to do so.
+
+    Parameters
+    ----------
+    inputs : list of str
+        Specifies the subscripts for summation.
+    result : str
+        Resulting summation.
+    idx_removed : set
+        Indices that are removed in the summation
+
+
+    Returns
+    -------
+    type : bool
+        Returns true if BLAS should and can be used, else False
+
+    Notes
+    -----
+    If the operations is BLAS level 1 or 2 and is not already aligned
+    we default back to einsum as the memory movement to copy is more
+    costly than the operation itself.
+
+
+    Examples
+    --------
+
+    # Standard GEMM operation
+    >>> _can_dot(['ij', 'jk'], 'ik', set('j'))
+    True
+
+    # Can use the standard BLAS, but requires odd data movement
+    >>> _can_dot(['ijj', 'jk'], 'ik', set('j'))
+    False
+
+    # DDOT where the memory is not aligned
+    >>> _can_dot(['ijk', 'ikj'], '', set('ijk'))
+    False
+
+    """
+
+    # All `dot` calls remove indices
+    if len(idx_removed) == 0:
+        return False
+
+    # BLAS can only handle two operands
+    if len(inputs) != 2:
+        return False
+
+    input_left, input_right = inputs
+
+    for c in set(input_left + input_right):
+        # can't deal with repeated indices on same input or more than 2 total
+        nl, nr = input_left.count(c), input_right.count(c)
+        if (nl > 1) or (nr > 1) or (nl + nr > 2):
+            return False
+
+        # can't do implicit summation or dimension collapse e.g.
+        #     "ab,bc->c" (implicitly sum over 'a')
+        #     "ab,ca->ca" (take diagonal of 'a')
+        if nl + nr - 1 == int(c in result):
+            return False
+
+    # Build a few temporaries
+    set_left = set(input_left)
+    set_right = set(input_right)
+    keep_left = set_left - idx_removed
+    keep_right = set_right - idx_removed
+    rs = len(idx_removed)
+
+    # At this point we are a DOT, GEMV, or GEMM operation
+
+    # Handle inner products
+
+    # DDOT with aligned data
+    if input_left == input_right:
+        return True
+
+    # DDOT without aligned data (better to use einsum)
+    if set_left == set_right:
+        return False
+
+    # Handle the 4 possible (aligned) GEMV or GEMM cases
+
+    # GEMM or GEMV no transpose
+    if input_left[-rs:] == input_right[:rs]:
+        return True
+
+    # GEMM or GEMV transpose both
+    if input_left[:rs] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose right
+    if input_left[-rs:] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose left
+    if input_left[:rs] == input_right[:rs]:
+        return True
+
+    # Einsum is faster than GEMV if we have to copy data
+    if not keep_left or not keep_right:
+        return False
+
+    # We are a matrix-matrix product, but we need to copy data
+    return True
+
+
+def _parse_einsum_input(operands):
+    """
+    A reproduction of einsum c side einsum parsing in python.
+
+    Returns
+    -------
+    input_strings : str
+        Parsed input strings
+    output_string : str
+        Parsed output string
+    operands : list of array_like
+        The operands to use in the numpy contraction
+
+    Examples
+    --------
+    The operand list is simplified to reduce printing:
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(4, 4)
+    >>> b = np.random.rand(4, 4, 4)
+    >>> _parse_einsum_input(('...a,...a->...', a, b))
+    ('za,xza', 'xz', [a, b]) # may vary
+
+    >>> _parse_einsum_input((a, [Ellipsis, 0], b, [Ellipsis, 0]))
+    ('za,xza', 'xz', [a, b]) # may vary
+    """
+
+    if len(operands) == 0:
+        raise ValueError("No input operands")
+
+    if isinstance(operands[0], str):
+        subscripts = operands[0].replace(" ", "")
+        operands = [asanyarray(v) for v in operands[1:]]
+
+        # Ensure all characters are valid
+        for s in subscripts:
+            if s in '.,->':
+                continue
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+
+    else:
+        tmp_operands = list(operands)
+        operand_list = []
+        subscript_list = []
+        for p in range(len(operands) // 2):
+            operand_list.append(tmp_operands.pop(0))
+            subscript_list.append(tmp_operands.pop(0))
+
+        output_list = tmp_operands[-1] if len(tmp_operands) else None
+        operands = [asanyarray(v) for v in operand_list]
+        subscripts = ""
+        last = len(subscript_list) - 1
+        for num, sub in enumerate(subscript_list):
+            for s in sub:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError(
+                            "For this input type lists must contain "
+                            "either int or Ellipsis"
+                        ) from e
+                    subscripts += einsum_symbols[s]
+            if num != last:
+                subscripts += ","
+
+        if output_list is not None:
+            subscripts += "->"
+            for s in output_list:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError(
+                            "For this input type lists must contain "
+                            "either int or Ellipsis"
+                        ) from e
+                    subscripts += einsum_symbols[s]
+    # Check for proper "->"
+    if ("-" in subscripts) or (">" in subscripts):
+        invalid = (subscripts.count("-") > 1) or (subscripts.count(">") > 1)
+        if invalid or (subscripts.count("->") != 1):
+            raise ValueError("Subscripts can only contain one '->'.")
+
+    # Parse ellipses
+    if "." in subscripts:
+        used = subscripts.replace(".", "").replace(",", "").replace("->", "")
+        unused = list(einsum_symbols_set - set(used))
+        ellipse_inds = "".join(unused)
+        longest = 0
+
+        if "->" in subscripts:
+            input_tmp, output_sub = subscripts.split("->")
+            split_subscripts = input_tmp.split(",")
+            out_sub = True
+        else:
+            split_subscripts = subscripts.split(',')
+            out_sub = False
+
+        for num, sub in enumerate(split_subscripts):
+            if "." in sub:
+                if (sub.count(".") != 3) or (sub.count("...") != 1):
+                    raise ValueError("Invalid Ellipses.")
+
+                # Take into account numerical values
+                if operands[num].shape == ():
+                    ellipse_count = 0
+                else:
+                    ellipse_count = max(operands[num].ndim, 1)
+                    ellipse_count -= (len(sub) - 3)
+
+                if ellipse_count > longest:
+                    longest = ellipse_count
+
+                if ellipse_count < 0:
+                    raise ValueError("Ellipses lengths do not match.")
+                elif ellipse_count == 0:
+                    split_subscripts[num] = sub.replace('...', '')
+                else:
+                    rep_inds = ellipse_inds[-ellipse_count:]
+                    split_subscripts[num] = sub.replace('...', rep_inds)
+
+        subscripts = ",".join(split_subscripts)
+        if longest == 0:
+            out_ellipse = ""
+        else:
+            out_ellipse = ellipse_inds[-longest:]
+
+        if out_sub:
+            subscripts += "->" + output_sub.replace("...", out_ellipse)
+        else:
+            # Special care for outputless ellipses
+            output_subscript = ""
+            tmp_subscripts = subscripts.replace(",", "")
+            for s in sorted(set(tmp_subscripts)):
+                if s not in (einsum_symbols):
+                    raise ValueError("Character %s is not a valid symbol." % s)
+                if tmp_subscripts.count(s) == 1:
+                    output_subscript += s
+            normal_inds = ''.join(sorted(set(output_subscript) -
+                                         set(out_ellipse)))
+
+            subscripts += "->" + out_ellipse + normal_inds
+
+    # Build output string if does not exist
+    if "->" in subscripts:
+        input_subscripts, output_subscript = subscripts.split("->")
+    else:
+        input_subscripts = subscripts
+        # Build output subscripts
+        tmp_subscripts = subscripts.replace(",", "")
+        output_subscript = ""
+        for s in sorted(set(tmp_subscripts)):
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+            if tmp_subscripts.count(s) == 1:
+                output_subscript += s
+
+    # Make sure output subscripts are in the input
+    for char in output_subscript:
+        if output_subscript.count(char) != 1:
+            raise ValueError("Output character %s appeared more than once in "
+                             "the output." % char)
+        if char not in input_subscripts:
+            raise ValueError("Output character %s did not appear in the input"
+                             % char)
+
+    # Make sure number operands is equivalent to the number of terms
+    if len(input_subscripts.split(',')) != len(operands):
+        raise ValueError("Number of einsum subscripts must be equal to the "
+                         "number of operands.")
+
+    return (input_subscripts, output_subscript, operands)
+
+
+def _einsum_path_dispatcher(*operands, optimize=None, einsum_call=None):
+    # NOTE: technically, we should only dispatch on array-like arguments, not
+    # subscripts (given as strings). But separating operands into
+    # arrays/subscripts is a little tricky/slow (given einsum's two supported
+    # signatures), so as a practical shortcut we dispatch on everything.
+    # Strings will be ignored for dispatching since they don't define
+    # __array_function__.
+    return operands
+
+
+@array_function_dispatch(_einsum_path_dispatcher, module='numpy')
+def einsum_path(*operands, optimize='greedy', einsum_call=False):
+    """
+    einsum_path(subscripts, *operands, optimize='greedy')
+
+    Evaluates the lowest cost contraction order for an einsum expression by
+    considering the creation of intermediate arrays.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation.
+    *operands : list of array_like
+        These are the arrays for the operation.
+    optimize : {bool, list, tuple, 'greedy', 'optimal'}
+        Choose the type of path. If a tuple is provided, the second argument is
+        assumed to be the maximum intermediate size created. If only a single
+        argument is provided the largest input or output array size is used
+        as a maximum intermediate size.
+
+        * if a list is given that starts with ``einsum_path``, uses this as the
+          contraction path
+        * if False no optimization is taken
+        * if True defaults to the 'greedy' algorithm
+        * 'optimal' An algorithm that combinatorially explores all possible
+          ways of contracting the listed tensors and chooses the least costly
+          path. Scales exponentially with the number of terms in the
+          contraction.
+        * 'greedy' An algorithm that chooses the best pair contraction
+          at each step. Effectively, this algorithm searches the largest inner,
+          Hadamard, and then outer products at each step. Scales cubically with
+          the number of terms in the contraction. Equivalent to the 'optimal'
+          path for most contractions.
+
+        Default is 'greedy'.
+
+    Returns
+    -------
+    path : list of tuples
+        A list representation of the einsum path.
+    string_repr : str
+        A printable representation of the einsum path.
+
+    Notes
+    -----
+    The resulting path indicates which terms of the input contraction should be
+    contracted first, the result of this contraction is then appended to the
+    end of the contraction list. This list can then be iterated over until all
+    intermediate contractions are complete.
+
+    See Also
+    --------
+    einsum, linalg.multi_dot
+
+    Examples
+    --------
+
+    We can begin with a chain dot example. In this case, it is optimal to
+    contract the ``b`` and ``c`` tensors first as represented by the first
+    element of the path ``(1, 2)``. The resulting tensor is added to the end
+    of the contraction and the remaining contraction ``(0, 1)`` is then
+    completed.
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(2, 2)
+    >>> b = np.random.rand(2, 5)
+    >>> c = np.random.rand(5, 2)
+    >>> path_info = np.einsum_path('ij,jk,kl->il', a, b, c, optimize='greedy')
+    >>> print(path_info[0])
+    ['einsum_path', (1, 2), (0, 1)]
+    >>> print(path_info[1])
+      Complete contraction:  ij,jk,kl->il # may vary
+             Naive scaling:  4
+         Optimized scaling:  3
+          Naive FLOP count:  1.600e+02
+      Optimized FLOP count:  5.600e+01
+       Theoretical speedup:  2.857
+      Largest intermediate:  4.000e+00 elements
+    -------------------------------------------------------------------------
+    scaling                  current                                remaining
+    -------------------------------------------------------------------------
+       3                   kl,jk->jl                                ij,jl->il
+       3                   jl,ij->il                                   il->il
+
+
+    A more complex index transformation example.
+
+    >>> I = np.random.rand(10, 10, 10, 10)
+    >>> C = np.random.rand(10, 10)
+    >>> path_info = np.einsum_path('ea,fb,abcd,gc,hd->efgh', C, C, I, C, C,
+    ...                            optimize='greedy')
+
+    >>> print(path_info[0])
+    ['einsum_path', (0, 2), (0, 3), (0, 2), (0, 1)]
+    >>> print(path_info[1])
+      Complete contraction:  ea,fb,abcd,gc,hd->efgh # may vary
+             Naive scaling:  8
+         Optimized scaling:  5
+          Naive FLOP count:  8.000e+08
+      Optimized FLOP count:  8.000e+05
+       Theoretical speedup:  1000.000
+      Largest intermediate:  1.000e+04 elements
+    --------------------------------------------------------------------------
+    scaling                  current                                remaining
+    --------------------------------------------------------------------------
+       5               abcd,ea->bcde                      fb,gc,hd,bcde->efgh
+       5               bcde,fb->cdef                         gc,hd,cdef->efgh
+       5               cdef,gc->defg                            hd,defg->efgh
+       5               defg,hd->efgh                               efgh->efgh
+    """
+
+    # Figure out what the path really is
+    path_type = optimize
+    if path_type is True:
+        path_type = 'greedy'
+    if path_type is None:
+        path_type = False
+
+    explicit_einsum_path = False
+    memory_limit = None
+
+    # No optimization or a named path algorithm
+    if (path_type is False) or isinstance(path_type, str):
+        pass
+
+    # Given an explicit path
+    elif len(path_type) and (path_type[0] == 'einsum_path'):
+        explicit_einsum_path = True
+
+    # Path tuple with memory limit
+    elif ((len(path_type) == 2) and isinstance(path_type[0], str) and
+            isinstance(path_type[1], (int, float))):
+        memory_limit = int(path_type[1])
+        path_type = path_type[0]
+
+    else:
+        raise TypeError("Did not understand the path: %s" % str(path_type))
+
+    # Hidden option, only einsum should call this
+    einsum_call_arg = einsum_call
+
+    # Python side parsing
+    input_subscripts, output_subscript, operands = (
+        _parse_einsum_input(operands)
+    )
+
+    # Build a few useful list and sets
+    input_list = input_subscripts.split(',')
+    input_sets = [set(x) for x in input_list]
+    output_set = set(output_subscript)
+    indices = set(input_subscripts.replace(',', ''))
+
+    # Get length of each unique dimension and ensure all dimensions are correct
+    dimension_dict = {}
+    broadcast_indices = [[] for x in range(len(input_list))]
+    for tnum, term in enumerate(input_list):
+        sh = operands[tnum].shape
+        if len(sh) != len(term):
+            raise ValueError("Einstein sum subscript %s does not contain the "
+                             "correct number of indices for operand %d."
+                             % (input_subscripts[tnum], tnum))
+        for cnum, char in enumerate(term):
+            dim = sh[cnum]
+
+            # Build out broadcast indices
+            if dim == 1:
+                broadcast_indices[tnum].append(char)
+
+            if char in dimension_dict.keys():
+                # For broadcasting cases we always want the largest dim size
+                if dimension_dict[char] == 1:
+                    dimension_dict[char] = dim
+                elif dim not in (1, dimension_dict[char]):
+                    raise ValueError("Size of label '%s' for operand %d (%d) "
+                                     "does not match previous terms (%d)."
+                                     % (char, tnum, dimension_dict[char], dim))
+            else:
+                dimension_dict[char] = dim
+
+    # Convert broadcast inds to sets
+    broadcast_indices = [set(x) for x in broadcast_indices]
+
+    # Compute size of each input array plus the output array
+    size_list = [_compute_size_by_dict(term, dimension_dict)
+                 for term in input_list + [output_subscript]]
+    max_size = max(size_list)
+
+    if memory_limit is None:
+        memory_arg = max_size
+    else:
+        memory_arg = memory_limit
+
+    # Compute naive cost
+    # This isn't quite right, need to look into exactly how einsum does this
+    inner_product = (sum(len(x) for x in input_sets) - len(indices)) > 0
+    naive_cost = _flop_count(
+        indices, inner_product, len(input_list), dimension_dict
+    )
+
+    # Compute the path
+    if explicit_einsum_path:
+        path = path_type[1:]
+    elif (
+        (path_type is False)
+        or (len(input_list) in [1, 2])
+        or (indices == output_set)
+    ):
+        # Nothing to be optimized, leave it to einsum
+        path = [tuple(range(len(input_list)))]
+    elif path_type == "greedy":
+        path = _greedy_path(
+            input_sets, output_set, dimension_dict, memory_arg
+        )
+    elif path_type == "optimal":
+        path = _optimal_path(
+            input_sets, output_set, dimension_dict, memory_arg
+        )
+    else:
+        raise KeyError("Path name %s not found", path_type)
+
+    cost_list, scale_list, size_list, contraction_list = [], [], [], []
+
+    # Build contraction tuple (positions, gemm, einsum_str, remaining)
+    for cnum, contract_inds in enumerate(path):
+        # Make sure we remove inds from right to left
+        contract_inds = tuple(sorted(contract_inds, reverse=True))
+
+        contract = _find_contraction(contract_inds, input_sets, output_set)
+        out_inds, input_sets, idx_removed, idx_contract = contract
+
+        cost = _flop_count(
+            idx_contract, idx_removed, len(contract_inds), dimension_dict
+        )
+        cost_list.append(cost)
+        scale_list.append(len(idx_contract))
+        size_list.append(_compute_size_by_dict(out_inds, dimension_dict))
+
+        bcast = set()
+        tmp_inputs = []
+        for x in contract_inds:
+            tmp_inputs.append(input_list.pop(x))
+            bcast |= broadcast_indices.pop(x)
+
+        new_bcast_inds = bcast - idx_removed
+
+        # If we're broadcasting, nix blas
+        if not len(idx_removed & bcast):
+            do_blas = _can_dot(tmp_inputs, out_inds, idx_removed)
+        else:
+            do_blas = False
+
+        # Last contraction
+        if (cnum - len(path)) == -1:
+            idx_result = output_subscript
+        else:
+            sort_result = [(dimension_dict[ind], ind) for ind in out_inds]
+            idx_result = "".join([x[1] for x in sorted(sort_result)])
+
+        input_list.append(idx_result)
+        broadcast_indices.append(new_bcast_inds)
+        einsum_str = ",".join(tmp_inputs) + "->" + idx_result
+
+        contraction = (
+            contract_inds, idx_removed, einsum_str, input_list[:], do_blas
+        )
+        contraction_list.append(contraction)
+
+    opt_cost = sum(cost_list) + 1
+
+    if len(input_list) != 1:
+        # Explicit "einsum_path" is usually trusted, but we detect this kind of
+        # mistake in order to prevent from returning an intermediate value.
+        raise RuntimeError(
+            "Invalid einsum_path is specified: {} more operands has to be "
+            "contracted.".format(len(input_list) - 1))
+
+    if einsum_call_arg:
+        return (operands, contraction_list)
+
+    # Return the path along with a nice string representation
+    overall_contraction = input_subscripts + "->" + output_subscript
+    header = ("scaling", "current", "remaining")
+
+    speedup = naive_cost / opt_cost
+    max_i = max(size_list)
+
+    path_print = "  Complete contraction:  %s\n" % overall_contraction
+    path_print += "         Naive scaling:  %d\n" % len(indices)
+    path_print += "     Optimized scaling:  %d\n" % max(scale_list)
+    path_print += "      Naive FLOP count:  %.3e\n" % naive_cost
+    path_print += "  Optimized FLOP count:  %.3e\n" % opt_cost
+    path_print += "   Theoretical speedup:  %3.3f\n" % speedup
+    path_print += "  Largest intermediate:  %.3e elements\n" % max_i
+    path_print += "-" * 74 + "\n"
+    path_print += "%6s %24s %40s\n" % header
+    path_print += "-" * 74
+
+    for n, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        remaining_str = ",".join(remaining) + "->" + output_subscript
+        path_run = (scale_list[n], einsum_str, remaining_str)
+        path_print += "\n%4d    %24s %40s" % path_run
+
+    path = ['einsum_path'] + path
+    return (path, path_print)
+
+
+def _einsum_dispatcher(*operands, out=None, optimize=None, **kwargs):
+    # Arguably we dispatch on more arguments than we really should; see note in
+    # _einsum_path_dispatcher for why.
+    yield from operands
+    yield out
+
+
+# Rewrite einsum to handle different cases
+@array_function_dispatch(_einsum_dispatcher, module='numpy')
+def einsum(*operands, out=None, optimize=False, **kwargs):
+    """
+    einsum(subscripts, *operands, out=None, dtype=None, order='K',
+           casting='safe', optimize=False)
+
+    Evaluates the Einstein summation convention on the operands.
+
+    Using the Einstein summation convention, many common multi-dimensional,
+    linear algebraic array operations can be represented in a simple fashion.
+    In *implicit* mode `einsum` computes these values.
+
+    In *explicit* mode, `einsum` provides further flexibility to compute
+    other array operations that might not be considered classical Einstein
+    summation operations, by disabling, or forcing summation over specified
+    subscript labels.
+
+    See the notes and examples for clarification.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation as comma separated list of
+        subscript labels. An implicit (classical Einstein summation)
+        calculation is performed unless the explicit indicator '->' is
+        included as well as subscript labels of the precise output form.
+    operands : list of array_like
+        These are the arrays for the operation.
+    out : ndarray, optional
+        If provided, the calculation is done into this array.
+    dtype : {data-type, None}, optional
+        If provided, forces the calculation to use the data type specified.
+        Note that you may have to also give a more liberal `casting`
+        parameter to allow the conversions. Default is None.
+    order : {'C', 'F', 'A', 'K'}, optional
+        Controls the memory layout of the output. 'C' means it should
+        be C contiguous. 'F' means it should be Fortran contiguous,
+        'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise.
+        'K' means it should be as close to the layout as the inputs as
+        is possible, including arbitrarily permuted axes.
+        Default is 'K'.
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur.  Setting this to
+        'unsafe' is not recommended, as it can adversely affect accumulations.
+
+        * 'no' means the data types should not be cast at all.
+        * 'equiv' means only byte-order changes are allowed.
+        * 'safe' means only casts which can preserve values are allowed.
+        * 'same_kind' means only safe casts or casts within a kind,
+          like float64 to float32, are allowed.
+        * 'unsafe' means any data conversions may be done.
+
+        Default is 'safe'.
+    optimize : {False, True, 'greedy', 'optimal'}, optional
+        Controls if intermediate optimization should occur. No optimization
+        will occur if False and True will default to the 'greedy' algorithm.
+        Also accepts an explicit contraction list from the ``np.einsum_path``
+        function. See ``np.einsum_path`` for more details. Defaults to False.
+
+    Returns
+    -------
+    output : ndarray
+        The calculation based on the Einstein summation convention.
+
+    See Also
+    --------
+    einsum_path, dot, inner, outer, tensordot, linalg.multi_dot
+    einsum:
+        Similar verbose interface is provided by the
+        `einops <https://github.com/arogozhnikov/einops>`_ package to cover
+        additional operations: transpose, reshape/flatten, repeat/tile,
+        squeeze/unsqueeze and reductions.
+        The `opt_einsum <https://optimized-einsum.readthedocs.io/en/stable/>`_
+        optimizes contraction order for einsum-like expressions
+        in backend-agnostic manner.
+
+    Notes
+    -----
+    The Einstein summation convention can be used to compute
+    many multi-dimensional, linear algebraic array operations. `einsum`
+    provides a succinct way of representing these.
+
+    A non-exhaustive list of these operations,
+    which can be computed by `einsum`, is shown below along with examples:
+
+    * Trace of an array, :py:func:`numpy.trace`.
+    * Return a diagonal, :py:func:`numpy.diag`.
+    * Array axis summations, :py:func:`numpy.sum`.
+    * Transpositions and permutations, :py:func:`numpy.transpose`.
+    * Matrix multiplication and dot product, :py:func:`numpy.matmul`
+        :py:func:`numpy.dot`.
+    * Vector inner and outer products, :py:func:`numpy.inner`
+        :py:func:`numpy.outer`.
+    * Broadcasting, element-wise and scalar multiplication,
+        :py:func:`numpy.multiply`.
+    * Tensor contractions, :py:func:`numpy.tensordot`.
+    * Chained array operations, in efficient calculation order,
+        :py:func:`numpy.einsum_path`.
+
+    The subscripts string is a comma-separated list of subscript labels,
+    where each label refers to a dimension of the corresponding operand.
+    Whenever a label is repeated it is summed, so ``np.einsum('i,i', a, b)``
+    is equivalent to :py:func:`np.inner(a,b) <numpy.inner>`. If a label
+    appears only once, it is not summed, so ``np.einsum('i', a)``
+    produces a view of ``a`` with no changes. A further example
+    ``np.einsum('ij,jk', a, b)`` describes traditional matrix multiplication
+    and is equivalent to :py:func:`np.matmul(a,b) <numpy.matmul>`.
+    Repeated subscript labels in one operand take the diagonal.
+    For example, ``np.einsum('ii', a)`` is equivalent to
+    :py:func:`np.trace(a) <numpy.trace>`.
+
+    In *implicit mode*, the chosen subscripts are important
+    since the axes of the output are reordered alphabetically.  This
+    means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while
+    ``np.einsum('ji', a)`` takes its transpose. Additionally,
+    ``np.einsum('ij,jk', a, b)`` returns a matrix multiplication, while,
+    ``np.einsum('ij,jh', a, b)`` returns the transpose of the
+    multiplication since subscript 'h' precedes subscript 'i'.
+
+    In *explicit mode* the output can be directly controlled by
+    specifying output subscript labels.  This requires the
+    identifier '->' as well as the list of output subscript labels.
+    This feature increases the flexibility of the function since
+    summing can be disabled or forced when required. The call
+    ``np.einsum('i->', a)`` is like :py:func:`np.sum(a) <numpy.sum>`
+    if ``a`` is a 1-D array, and ``np.einsum('ii->i', a)``
+    is like :py:func:`np.diag(a) <numpy.diag>` if ``a`` is a square 2-D array.
+    The difference is that `einsum` does not allow broadcasting by default.
+    Additionally ``np.einsum('ij,jh->ih', a, b)`` directly specifies the
+    order of the output subscript labels and therefore returns matrix
+    multiplication, unlike the example above in implicit mode.
+
+    To enable and control broadcasting, use an ellipsis.  Default
+    NumPy-style broadcasting is done by adding an ellipsis
+    to the left of each term, like ``np.einsum('...ii->...i', a)``.
+    ``np.einsum('...i->...', a)`` is like
+    :py:func:`np.sum(a, axis=-1) <numpy.sum>` for array ``a`` of any shape.
+    To take the trace along the first and last axes,
+    you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix
+    product with the left-most indices instead of rightmost, one can do
+    ``np.einsum('ij...,jk...->ik...', a, b)``.
+
+    When there is only one operand, no axes are summed, and no output
+    parameter is provided, a view into the operand is returned instead
+    of a new array.  Thus, taking the diagonal as ``np.einsum('ii->i', a)``
+    produces a view (changed in version 1.10.0).
+
+    `einsum` also provides an alternative way to provide the subscripts and
+    operands as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``.
+    If the output shape is not provided in this format `einsum` will be
+    calculated in implicit mode, otherwise it will be performed explicitly.
+    The examples below have corresponding `einsum` calls with the two
+    parameter methods.
+
+    Views returned from einsum are now writeable whenever the input array
+    is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now
+    have the same effect as :py:func:`np.swapaxes(a, 0, 2) <numpy.swapaxes>`
+    and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal
+    of a 2D array.
+
+    Added the ``optimize`` argument which will optimize the contraction order
+    of an einsum expression. For a contraction with three or more operands
+    this can greatly increase the computational efficiency at the cost of
+    a larger memory footprint during computation.
+
+    Typically a 'greedy' algorithm is applied which empirical tests have shown
+    returns the optimal path in the majority of cases. In some cases 'optimal'
+    will return the superlative path through a more expensive, exhaustive
+    search. For iterative calculations it may be advisable to calculate
+    the optimal path once and reuse that path by supplying it as an argument.
+    An example is given below.
+
+    See :py:func:`numpy.einsum_path` for more details.
+
+    Examples
+    --------
+    >>> a = np.arange(25).reshape(5,5)
+    >>> b = np.arange(5)
+    >>> c = np.arange(6).reshape(2,3)
+
+    Trace of a matrix:
+
+    >>> np.einsum('ii', a)
+    60
+    >>> np.einsum(a, [0,0])
+    60
+    >>> np.trace(a)
+    60
+
+    Extract the diagonal (requires explicit form):
+
+    >>> np.einsum('ii->i', a)
+    array([ 0,  6, 12, 18, 24])
+    >>> np.einsum(a, [0,0], [0])
+    array([ 0,  6, 12, 18, 24])
+    >>> np.diag(a)
+    array([ 0,  6, 12, 18, 24])
+
+    Sum over an axis (requires explicit form):
+
+    >>> np.einsum('ij->i', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [0,1], [0])
+    array([ 10,  35,  60,  85, 110])
+    >>> np.sum(a, axis=1)
+    array([ 10,  35,  60,  85, 110])
+
+    For higher dimensional arrays summing a single axis can be done
+    with ellipsis:
+
+    >>> np.einsum('...j->...', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [Ellipsis,1], [Ellipsis])
+    array([ 10,  35,  60,  85, 110])
+
+    Compute a matrix transpose, or reorder any number of axes:
+
+    >>> np.einsum('ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum('ij->ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum(c, [1,0])
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.transpose(c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+
+    Vector inner products:
+
+    >>> np.einsum('i,i', b, b)
+    30
+    >>> np.einsum(b, [0], b, [0])
+    30
+    >>> np.inner(b,b)
+    30
+
+    Matrix vector multiplication:
+
+    >>> np.einsum('ij,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum(a, [0,1], b, [1])
+    array([ 30,  80, 130, 180, 230])
+    >>> np.dot(a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum('...j,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+
+    Broadcasting and scalar multiplication:
+
+    >>> np.einsum('..., ...', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(',ij', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(3, [Ellipsis], c, [Ellipsis])
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.multiply(3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+
+    Vector outer product:
+
+    >>> np.einsum('i,j', np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.einsum(np.arange(2)+1, [0], b, [1])
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.outer(np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+
+    Tensor contraction:
+
+    >>> a = np.arange(60.).reshape(3,4,5)
+    >>> b = np.arange(24.).reshape(4,3,2)
+    >>> np.einsum('ijk,jil->kl', a, b)
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3])
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.tensordot(a,b, axes=([1,0],[0,1]))
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+
+    Writeable returned arrays (since version 1.10.0):
+
+    >>> a = np.zeros((3, 3))
+    >>> np.einsum('ii->i', a)[:] = 1
+    >>> a
+    array([[1., 0., 0.],
+           [0., 1., 0.],
+           [0., 0., 1.]])
+
+    Example of ellipsis use:
+
+    >>> a = np.arange(6).reshape((3,2))
+    >>> b = np.arange(12).reshape((4,3))
+    >>> np.einsum('ki,jk->ij', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('ki,...k->i...', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('k...,jk', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+
+    Chained array operations. For more complicated contractions, speed ups
+    might be achieved by repeatedly computing a 'greedy' path or pre-computing
+    the 'optimal' path and repeatedly applying it, using an `einsum_path`
+    insertion (since version 1.12.0). Performance improvements can be
+    particularly significant with larger arrays:
+
+    >>> a = np.ones(64).reshape(2,4,8)
+
+    Basic `einsum`: ~1520ms  (benchmarked on 3.1GHz Intel i5.)
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a)
+
+    Sub-optimal `einsum` (due to repeated path calculation time): ~330ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a,
+    ...         optimize='optimal')
+
+    Greedy `einsum` (faster optimal path approximation): ~160ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='greedy')
+
+    Optimal `einsum` (best usage pattern in some use cases): ~110ms
+
+    >>> path = np.einsum_path('ijk,ilm,njm,nlk,abc->',a,a,a,a,a,
+    ...     optimize='optimal')[0]
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize=path)
+
+    """
+    # Special handling if out is specified
+    specified_out = out is not None
+
+    # If no optimization, run pure einsum
+    if optimize is False:
+        if specified_out:
+            kwargs['out'] = out
+        return c_einsum(*operands, **kwargs)
+
+    # Check the kwargs to avoid a more cryptic error later, without having to
+    # repeat default values here
+    valid_einsum_kwargs = ['dtype', 'order', 'casting']
+    unknown_kwargs = [k for (k, v) in kwargs.items() if
+                      k not in valid_einsum_kwargs]
+    if len(unknown_kwargs):
+        raise TypeError("Did not understand the following kwargs: %s"
+                        % unknown_kwargs)
+
+    # Build the contraction list and operand
+    operands, contraction_list = einsum_path(*operands, optimize=optimize,
+                                             einsum_call=True)
+
+    # Handle order kwarg for output array, c_einsum allows mixed case
+    output_order = kwargs.pop('order', 'K')
+    if output_order.upper() == 'A':
+        if all(arr.flags.f_contiguous for arr in operands):
+            output_order = 'F'
+        else:
+            output_order = 'C'
+
+    # Start contraction loop
+    for num, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        tmp_operands = [operands.pop(x) for x in inds]
+
+        # Do we need to deal with the output?
+        handle_out = specified_out and ((num + 1) == len(contraction_list))
+
+        # Call tensordot if still possible
+        if blas:
+            # Checks have already been handled
+            input_str, results_index = einsum_str.split('->')
+            input_left, input_right = input_str.split(',')
+
+            tensor_result = input_left + input_right
+            for s in idx_rm:
+                tensor_result = tensor_result.replace(s, "")
+
+            # Find indices to contract over
+            left_pos, right_pos = [], []
+            for s in sorted(idx_rm):
+                left_pos.append(input_left.find(s))
+                right_pos.append(input_right.find(s))
+
+            # Contract!
+            new_view = tensordot(
+                *tmp_operands, axes=(tuple(left_pos), tuple(right_pos))
+            )
+
+            # Build a new view if needed
+            if (tensor_result != results_index) or handle_out:
+                if handle_out:
+                    kwargs["out"] = out
+                new_view = c_einsum(
+                    tensor_result + '->' + results_index, new_view, **kwargs
+                )
+
+        # Call einsum
+        else:
+            # If out was specified
+            if handle_out:
+                kwargs["out"] = out
+
+            # Do the contraction
+            new_view = c_einsum(einsum_str, *tmp_operands, **kwargs)
+
+        # Append new items and dereference what we can
+        operands.append(new_view)
+        del tmp_operands, new_view
+
+    if specified_out:
+        return out
+    else:
+        return asanyarray(operands[0], order=output_order)

janus/lib/python3.10/site-packages/numpy/_core/einsumfunc.pyi

@@ -0,0 +1,184 @@
+from collections.abc import Sequence
+from typing import TypeAlias, TypeVar, Any, overload, Literal
+
+import numpy as np
+from numpy import number, _OrderKACF
+from numpy._typing import (
+    NDArray,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+    _DTypeLikeBool,
+    _DTypeLikeUInt,
+    _DTypeLikeInt,
+    _DTypeLikeFloat,
+    _DTypeLikeComplex,
+    _DTypeLikeComplex_co,
+    _DTypeLikeObject,
+)
+
+__all__ = ["einsum", "einsum_path"]
+
+_ArrayType = TypeVar(
+    "_ArrayType",
+    bound=NDArray[np.bool | number[Any]],
+)
+
+_OptimizeKind: TypeAlias = bool | Literal["greedy", "optimal"] | Sequence[Any] | None
+_CastingSafe: TypeAlias = Literal["no", "equiv", "safe", "same_kind"]
+_CastingUnsafe: TypeAlias = Literal["unsafe"]
+
+
+# TODO: Properly handle the `casting`-based combinatorics
+# TODO: We need to evaluate the content `__subscripts` in order
+# to identify whether or an array or scalar is returned. At a cursory
+# glance this seems like something that can quite easily be done with
+# a mypy plugin.
+# Something like `is_scalar = bool(__subscripts.partition("->")[-1])`
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeBool_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeBool = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeUInt_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeUInt = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeInt_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeInt = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeFloat_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeFloat = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeComplex = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    out: None = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co,
+    out: _ArrayType,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    out: _ArrayType,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeObject_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeObject = ...,
+    out: None = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeObject_co,
+    out: _ArrayType,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    out: _ArrayType,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+
+# NOTE: `einsum_call` is a hidden kwarg unavailable for public use.
+# It is therefore excluded from the signatures below.
+# NOTE: In practice the list consists of a `str` (first element)
+# and a variable number of integer tuples.
+def einsum_path(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co | _DTypeLikeObject,
+    optimize: _OptimizeKind = ...,
+) -> tuple[list[Any], str]: ...

janus/lib/python3.10/site-packages/numpy/_core/fromnumeric.pyi

@@ -0,0 +1,1512 @@
+from collections.abc import Sequence
+from typing import (
+    Any,
+    Literal,
+    NoReturn,
+    Protocol,
+    SupportsIndex,
+    TypeAlias,
+    TypeVar,
+    overload,
+    type_check_only,
+)
+from typing_extensions import Never, deprecated
+
+import numpy as np
+from numpy import (
+    number,
+    uint64,
+    int_,
+    int64,
+    intp,
+    float16,
+    floating,
+    complexfloating,
+    timedelta64,
+    object_,
+    generic,
+    _AnyShapeType,
+    _OrderKACF,
+    _OrderACF,
+    _ModeKind,
+    _PartitionKind,
+    _SortKind,
+    _SortSide,
+    _CastingKind,
+)
+from numpy._typing import (
+    DTypeLike,
+    _DTypeLike,
+    ArrayLike,
+    _ArrayLike,
+    NDArray,
+    _NestedSequence,
+    _ShapeLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeTD64_co,
+    _IntLike_co,
+    _BoolLike_co,
+    _ComplexLike_co,
+    _NumberLike_co,
+    _ScalarLike_co,
+)
+
+__all__ = [
+    "all",
+    "amax",
+    "amin",
+    "any",
+    "argmax",
+    "argmin",
+    "argpartition",
+    "argsort",
+    "around",
+    "choose",
+    "clip",
+    "compress",
+    "cumprod",
+    "cumsum",
+    "cumulative_prod",
+    "cumulative_sum",
+    "diagonal",
+    "mean",
+    "max",
+    "min",
+    "matrix_transpose",
+    "ndim",
+    "nonzero",
+    "partition",
+    "prod",
+    "ptp",
+    "put",
+    "ravel",
+    "repeat",
+    "reshape",
+    "resize",
+    "round",
+    "searchsorted",
+    "shape",
+    "size",
+    "sort",
+    "squeeze",
+    "std",
+    "sum",
+    "swapaxes",
+    "take",
+    "trace",
+    "transpose",
+    "var",
+]
+
+_SCT = TypeVar("_SCT", bound=generic)
+_SCT_uifcO = TypeVar("_SCT_uifcO", bound=number[Any] | object_)
+_ArrayType = TypeVar("_ArrayType", bound=np.ndarray[Any, Any])
+_SizeType = TypeVar("_SizeType", bound=int)
+_ShapeType = TypeVar("_ShapeType", bound=tuple[int, ...])
+_ShapeType_co = TypeVar("_ShapeType_co", bound=tuple[int, ...], covariant=True)
+
+@type_check_only
+class _SupportsShape(Protocol[_ShapeType_co]):
+    # NOTE: it matters that `self` is positional only
+    @property
+    def shape(self, /) -> _ShapeType_co: ...
+
+# a "sequence" that isn't a string, bytes, bytearray, or memoryview
+_T = TypeVar("_T")
+_PyArray: TypeAlias = list[_T] | tuple[_T, ...]
+# `int` also covers `bool`
+_PyScalar: TypeAlias = int | float | complex | bytes | str
+
+@overload
+def take(
+    a: _ArrayLike[_SCT],
+    indices: _IntLike_co,
+    axis: None = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> _SCT: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _IntLike_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> Any: ...
+@overload
+def take(
+    a: _ArrayLike[_SCT],
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    mode: _ModeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def reshape(  # shape: index
+    a: _ArrayLike[_SCT],
+    /,
+    shape: SupportsIndex,
+    order: _OrderACF = "C",
+    *,
+    copy: bool | None = None,
+) -> np.ndarray[tuple[int], np.dtype[_SCT]]: ...
+@overload
+def reshape(  # shape: (int, ...) @ _AnyShapeType
+    a: _ArrayLike[_SCT],
+    /,
+    shape: _AnyShapeType,
+    order: _OrderACF = "C",
+    *,
+    copy: bool | None = None,
+) -> np.ndarray[_AnyShapeType, np.dtype[_SCT]]: ...
+@overload  # shape: Sequence[index]
+def reshape(
+    a: _ArrayLike[_SCT],
+    /,
+    shape: Sequence[SupportsIndex],
+    order: _OrderACF = "C",
+    *,
+    copy: bool | None = None,
+) -> NDArray[_SCT]: ...
+@overload  # shape: index
+def reshape(
+    a: ArrayLike,
+    /,
+    shape: SupportsIndex,
+    order: _OrderACF = "C",
+    *,
+    copy: bool | None = None,
+) -> np.ndarray[tuple[int], np.dtype[Any]]: ...
+@overload
+def reshape(  # shape: (int, ...) @ _AnyShapeType
+    a: ArrayLike,
+    /,
+    shape: _AnyShapeType,
+    order: _OrderACF = "C",
+    *,
+    copy: bool | None = None,
+) -> np.ndarray[_AnyShapeType, np.dtype[Any]]: ...
+@overload  # shape: Sequence[index]
+def reshape(
+    a: ArrayLike,
+    /,
+    shape: Sequence[SupportsIndex],
+    order: _OrderACF = "C",
+    *,
+    copy: bool | None = None,
+) -> NDArray[Any]: ...
+@overload
+@deprecated(
+    "`newshape` keyword argument is deprecated, "
+    "use `shape=...` or pass shape positionally instead. "
+    "(deprecated in NumPy 2.1)",
+)
+def reshape(
+    a: ArrayLike,
+    /,
+    shape: None = None,
+    order: _OrderACF = "C",
+    *,
+    newshape: _ShapeLike,
+    copy: bool | None = None,
+) -> NDArray[Any]: ...
+
+@overload
+def choose(
+    a: _IntLike_co,
+    choices: ArrayLike,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> Any: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: _ArrayLike[_SCT],
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: ArrayLike,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: ArrayLike,
+    out: _ArrayType = ...,
+    mode: _ModeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def repeat(
+    a: _ArrayLike[_SCT],
+    repeats: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def repeat(
+    a: ArrayLike,
+    repeats: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+def put(
+    a: NDArray[Any],
+    ind: _ArrayLikeInt_co,
+    v: ArrayLike,
+    mode: _ModeKind = ...,
+) -> None: ...
+
+@overload
+def swapaxes(
+    a: _ArrayLike[_SCT],
+    axis1: SupportsIndex,
+    axis2: SupportsIndex,
+) -> NDArray[_SCT]: ...
+@overload
+def swapaxes(
+    a: ArrayLike,
+    axis1: SupportsIndex,
+    axis2: SupportsIndex,
+) -> NDArray[Any]: ...
+
+@overload
+def transpose(
+    a: _ArrayLike[_SCT],
+    axes: None | _ShapeLike = ...
+) -> NDArray[_SCT]: ...
+@overload
+def transpose(
+    a: ArrayLike,
+    axes: None | _ShapeLike = ...
+) -> NDArray[Any]: ...
+
+@overload
+def matrix_transpose(x: _ArrayLike[_SCT]) -> NDArray[_SCT]: ...
+@overload
+def matrix_transpose(x: ArrayLike) -> NDArray[Any]: ...
+
+@overload
+def partition(
+    a: _ArrayLike[_SCT],
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def partition(
+    a: ArrayLike,
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[Any]: ...
+
+def argpartition(
+    a: ArrayLike,
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[intp]: ...
+
+@overload
+def sort(
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+    *,
+    stable: None | bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def sort(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+    *,
+    stable: None | bool = ...,
+) -> NDArray[Any]: ...
+
+def argsort(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+    *,
+    stable: None | bool = ...,
+) -> NDArray[intp]: ...
+
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> intp: ...
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> intp: ...
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def searchsorted(
+    a: ArrayLike,
+    v: _ScalarLike_co,
+    side: _SortSide = ...,
+    sorter: None | _ArrayLikeInt_co = ...,  # 1D int array
+) -> intp: ...
+@overload
+def searchsorted(
+    a: ArrayLike,
+    v: ArrayLike,
+    side: _SortSide = ...,
+    sorter: None | _ArrayLikeInt_co = ...,  # 1D int array
+) -> NDArray[intp]: ...
+
+# unlike `reshape`, `resize` only accepts positive integers, so literal ints can be used
+@overload
+def resize(a: _ArrayLike[_SCT], new_shape: _SizeType) -> np.ndarray[tuple[_SizeType], np.dtype[_SCT]]: ...
+@overload
+def resize(a: _ArrayLike[_SCT], new_shape: SupportsIndex) -> np.ndarray[tuple[int], np.dtype[_SCT]]: ...
+@overload
+def resize(a: _ArrayLike[_SCT], new_shape: _ShapeType) -> np.ndarray[_ShapeType, np.dtype[_SCT]]: ...
+@overload
+def resize(a: _ArrayLike[_SCT], new_shape: Sequence[SupportsIndex]) -> NDArray[_SCT]: ...
+@overload
+def resize(a: ArrayLike, new_shape: _SizeType) -> np.ndarray[tuple[_SizeType], np.dtype[Any]]: ...
+@overload
+def resize(a: ArrayLike, new_shape: SupportsIndex) -> np.ndarray[tuple[int], np.dtype[Any]]: ...
+@overload
+def resize(a: ArrayLike, new_shape: _ShapeType) -> np.ndarray[_ShapeType, np.dtype[Any]]: ...
+@overload
+def resize(a: ArrayLike, new_shape: Sequence[SupportsIndex]) -> NDArray[Any]: ...
+
+@overload
+def squeeze(
+    a: _SCT,
+    axis: None | _ShapeLike = ...,
+) -> _SCT: ...
+@overload
+def squeeze(
+    a: _ArrayLike[_SCT],
+    axis: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def squeeze(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def diagonal(
+    a: _ArrayLike[_SCT],
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,  # >= 2D array
+) -> NDArray[_SCT]: ...
+@overload
+def diagonal(
+    a: ArrayLike,
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,  # >= 2D array
+) -> NDArray[Any]: ...
+
+@overload
+def trace(
+    a: ArrayLike,  # >= 2D array
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> Any: ...
+@overload
+def trace(
+    a: ArrayLike,  # >= 2D array
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+_Array1D: TypeAlias = np.ndarray[tuple[int], np.dtype[_SCT]]
+
+@overload
+def ravel(a: _ArrayLike[_SCT], order: _OrderKACF = "C") -> _Array1D[_SCT]: ...
+@overload
+def ravel(a: bytes | _NestedSequence[bytes], order: _OrderKACF = "C") -> _Array1D[np.bytes_]: ...
+@overload
+def ravel(a: str | _NestedSequence[str], order: _OrderKACF = "C") -> _Array1D[np.str_]: ...
+@overload
+def ravel(a: bool | _NestedSequence[bool], order: _OrderKACF = "C") -> _Array1D[np.bool]: ...
+@overload
+def ravel(a: int | _NestedSequence[int], order: _OrderKACF = "C") -> _Array1D[np.int_ | np.bool]: ...
+@overload
+def ravel(a: float | _NestedSequence[float], order: _OrderKACF = "C") -> _Array1D[np.float64 | np.int_ | np.bool]: ...
+@overload
+def ravel(
+    a: complex | _NestedSequence[complex],
+    order: _OrderKACF = "C",
+) -> _Array1D[np.complex128 | np.float64 | np.int_ | np.bool]: ...
+@overload
+def ravel(a: ArrayLike, order: _OrderKACF = "C") -> np.ndarray[tuple[int], np.dtype[Any]]: ...
+
+@overload
+def nonzero(a: np.generic | np.ndarray[tuple[()], Any]) -> NoReturn: ...
+@overload
+def nonzero(a: _ArrayLike[Any]) -> tuple[NDArray[intp], ...]: ...
+
+# this prevents `Any` from being returned with Pyright
+@overload
+def shape(a: _SupportsShape[Never]) -> tuple[int, ...]: ...
+@overload
+def shape(a: _SupportsShape[_ShapeType]) -> _ShapeType: ...
+@overload
+def shape(a: _PyScalar) -> tuple[()]: ...
+# `collections.abc.Sequence` can't be used hesre, since `bytes` and `str` are
+# subtypes of it, which would make the return types incompatible.
+@overload
+def shape(a: _PyArray[_PyScalar]) -> tuple[int]: ...
+@overload
+def shape(a: _PyArray[_PyArray[_PyScalar]]) -> tuple[int, int]: ...
+# this overload will be skipped by typecheckers that don't support PEP 688
+@overload
+def shape(a: memoryview | bytearray) -> tuple[int]: ...
+@overload
+def shape(a: ArrayLike) -> tuple[int, ...]: ...
+
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def clip(
+    a: _SCT,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    min: None | ArrayLike = ...,
+    max: None | ArrayLike = ...,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    casting: _CastingKind = ...,
+) -> _SCT: ...
+@overload
+def clip(
+    a: _ScalarLike_co,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    min: None | ArrayLike = ...,
+    max: None | ArrayLike = ...,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    casting: _CastingKind = ...,
+) -> Any: ...
+@overload
+def clip(
+    a: _ArrayLike[_SCT],
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    min: None | ArrayLike = ...,
+    max: None | ArrayLike = ...,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    casting: _CastingKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    min: None | ArrayLike = ...,
+    max: None | ArrayLike = ...,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    casting: _CastingKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: _ArrayType = ...,
+    *,
+    min: None | ArrayLike = ...,
+    max: None | ArrayLike = ...,
+    dtype: DTypeLike,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    casting: _CastingKind = ...,
+) -> Any: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: _ArrayType,
+    *,
+    min: None | ArrayLike = ...,
+    max: None | ArrayLike = ...,
+    dtype: DTypeLike = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    casting: _CastingKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def sum(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    dtype: None = ...,
+    out: None  = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def sum(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    dtype: None = ...,
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT | NDArray[_SCT]: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None,
+    dtype: _DTypeLike[_SCT],
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike,
+    dtype: _DTypeLike[_SCT],
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT | NDArray[_SCT]: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT | NDArray[_SCT]: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def all(
+    a: ArrayLike,
+    axis: None = None,
+    out: None = None,
+    keepdims: Literal[False, 0] = False,
+    *,
+    where: _ArrayLikeBool_co = True,
+) -> np.bool: ...
+@overload
+def all(
+    a: ArrayLike,
+    axis: None | int | tuple[int, ...] = None,
+    out: None = None,
+    keepdims: SupportsIndex = False,
+    *,
+    where: _ArrayLikeBool_co = True,
+) -> np.bool | NDArray[np.bool]: ...
+@overload
+def all(
+    a: ArrayLike,
+    axis: None | int | tuple[int, ...],
+    out: _ArrayType,
+    keepdims: SupportsIndex = False,
+    *,
+    where: _ArrayLikeBool_co = True,
+) -> _ArrayType: ...
+@overload
+def all(
+    a: ArrayLike,
+    axis: None | int | tuple[int, ...] = None,
+    *,
+    out: _ArrayType,
+    keepdims: SupportsIndex = False,
+    where: _ArrayLikeBool_co = True,
+) -> _ArrayType: ...
+
+@overload
+def any(
+    a: ArrayLike,
+    axis: None = None,
+    out: None = None,
+    keepdims: Literal[False, 0] = False,
+    *,
+    where: _ArrayLikeBool_co = True,
+) -> np.bool: ...
+@overload
+def any(
+    a: ArrayLike,
+    axis: None | int | tuple[int, ...] = None,
+    out: None = None,
+    keepdims: SupportsIndex = False,
+    *,
+    where: _ArrayLikeBool_co = True,
+) -> np.bool | NDArray[np.bool]: ...
+@overload
+def any(
+    a: ArrayLike,
+    axis: None | int | tuple[int, ...],
+    out: _ArrayType,
+    keepdims: SupportsIndex = False,
+    *,
+    where: _ArrayLikeBool_co = True,
+) -> _ArrayType: ...
+@overload
+def any(
+    a: ArrayLike,
+    axis: None | int | tuple[int, ...] = None,
+    *,
+    out: _ArrayType,
+    keepdims: SupportsIndex = False,
+    where: _ArrayLikeBool_co = True,
+) -> _ArrayType: ...
+
+@overload
+def cumsum(
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def cumulative_sum(
+    x: _ArrayLike[_SCT],
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumulative_sum(
+    x: ArrayLike,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumulative_sum(
+    x: ArrayLike,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumulative_sum(
+    x: ArrayLike,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumulative_sum(
+    x: ArrayLike,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    include_initial: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def ptp(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+) -> _SCT: ...
+@overload
+def ptp(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def ptp(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def amax(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def amax(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def amax(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def amin(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def amin(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def amin(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+# TODO: `np.prod()``: For object arrays `initial` does not necessarily
+# have to be a numerical scalar.
+# The only requirement is that it is compatible
+# with the `.__mul__()` method(s) of the passed array's elements.
+
+# Note that the same situation holds for all wrappers around
+# `np.ufunc.reduce`, e.g. `np.sum()` (`.__add__()`).
+@overload
+def prod(
+    a: _ArrayLikeBool_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> int_: ...
+@overload
+def prod(
+    a: _ArrayLikeUInt_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> uint64: ...
+@overload
+def prod(
+    a: _ArrayLikeInt_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> int64: ...
+@overload
+def prod(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None | DTypeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None | DTypeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def cumprod(
+    a: _ArrayLikeBool_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[int_]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeUInt_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[uint64]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[int64]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeFloat_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[object_]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def cumulative_prod(
+    x: _ArrayLikeBool_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[int_]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeUInt_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[uint64]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeInt_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[int64]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeFloat_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeComplex_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeObject_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[object_]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    include_initial: bool = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumulative_prod(
+    x: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    /,
+    *,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    include_initial: bool = ...,
+) -> _ArrayType: ...
+
+def ndim(a: ArrayLike) -> int: ...
+
+def size(a: ArrayLike, axis: None | int = ...) -> int: ...
+
+@overload
+def around(
+    a: _BoolLike_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> float16: ...
+@overload
+def around(
+    a: _SCT_uifcO,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> _SCT_uifcO: ...
+@overload
+def around(
+    a: _ComplexLike_co | object_,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> Any: ...
+@overload
+def around(
+    a: _ArrayLikeBool_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[float16]: ...
+@overload
+def around(
+    a: _ArrayLike[_SCT_uifcO],
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[_SCT_uifcO]: ...
+@overload
+def around(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def around(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    decimals: SupportsIndex = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def mean(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def mean(
+    a: _ArrayLikeTD64_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> timedelta64: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None,
+    dtype: _DTypeLike[_SCT],
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT | NDArray[_SCT]: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+    out: None = ...,
+    keepdims: bool = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT | NDArray[_SCT]: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def std(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co = ...,
+    correction: int | float = ...,
+) -> floating[Any]: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> Any: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> _SCT: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> Any: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    ddof: int | float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> _ArrayType: ...
+
+@overload
+def var(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co = ...,
+    correction: int | float = ...,
+) -> floating[Any]: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> Any: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> _SCT: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    ddof: int | float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> Any: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    ddof: int | float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+    mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+    correction: int | float = ...,
+) -> _ArrayType: ...
+
+max = amax
+min = amin
+round = around

janus/lib/python3.10/site-packages/numpy/_core/function_base.pyi

@@ -0,0 +1,202 @@
+from typing import (
+    Literal as L,
+    overload,
+    Any,
+    SupportsIndex,
+    TypeVar,
+)
+
+from numpy import floating, complexfloating, generic
+from numpy._typing import (
+    NDArray,
+    DTypeLike,
+    _DTypeLike,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+)
+
+__all__ = ["logspace", "linspace", "geomspace"]
+
+_SCT = TypeVar("_SCT", bound=generic)
+
+@overload
+def linspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+@overload
+def linspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> tuple[NDArray[floating[Any]], floating[Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> tuple[NDArray[complexfloating[Any, Any]], complexfloating[Any, Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> tuple[NDArray[_SCT], _SCT]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> tuple[NDArray[Any], Any]: ...
+
+@overload
+def logspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeFloat_co = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def geomspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+def add_newdoc(
+    place: str,
+    obj: str,
+    doc: str | tuple[str, str] | list[tuple[str, str]],
+    warn_on_python: bool = ...,
+) -> None: ...

janus/lib/python3.10/site-packages/numpy/_core/getlimits.py

@@ -0,0 +1,747 @@
+"""Machine limits for Float32 and Float64 and (long double) if available...
+
+"""
+__all__ = ['finfo', 'iinfo']
+
+import types
+import warnings
+
+from .._utils import set_module
+from ._machar import MachAr
+from . import numeric
+from . import numerictypes as ntypes
+from .numeric import array, inf, nan
+from .umath import log10, exp2, nextafter, isnan
+
+
+def _fr0(a):
+    """fix rank-0 --> rank-1"""
+    if a.ndim == 0:
+        a = a.copy()
+        a.shape = (1,)
+    return a
+
+
+def _fr1(a):
+    """fix rank > 0 --> rank-0"""
+    if a.size == 1:
+        a = a.copy()
+        a.shape = ()
+    return a
+
+
+class MachArLike:
+    """ Object to simulate MachAr instance """
+    def __init__(self, ftype, *, eps, epsneg, huge, tiny,
+                 ibeta, smallest_subnormal=None, **kwargs):
+        self.params = _MACHAR_PARAMS[ftype]
+        self.ftype = ftype
+        self.title = self.params['title']
+        # Parameter types same as for discovered MachAr object.
+        if not smallest_subnormal:
+            self._smallest_subnormal = nextafter(
+                self.ftype(0), self.ftype(1), dtype=self.ftype)
+        else:
+            self._smallest_subnormal = smallest_subnormal
+        self.epsilon = self.eps = self._float_to_float(eps)
+        self.epsneg = self._float_to_float(epsneg)
+        self.xmax = self.huge = self._float_to_float(huge)
+        self.xmin = self._float_to_float(tiny)
+        self.smallest_normal = self.tiny = self._float_to_float(tiny)
+        self.ibeta = self.params['itype'](ibeta)
+        self.__dict__.update(kwargs)
+        self.precision = int(-log10(self.eps))
+        self.resolution = self._float_to_float(
+            self._float_conv(10) ** (-self.precision))
+        self._str_eps = self._float_to_str(self.eps)
+        self._str_epsneg = self._float_to_str(self.epsneg)
+        self._str_xmin = self._float_to_str(self.xmin)
+        self._str_xmax = self._float_to_str(self.xmax)
+        self._str_resolution = self._float_to_str(self.resolution)
+        self._str_smallest_normal = self._float_to_str(self.xmin)
+
+    @property
+    def smallest_subnormal(self):
+        """Return the value for the smallest subnormal.
+
+        Returns
+        -------
+        smallest_subnormal : float
+            value for the smallest subnormal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest subnormal is zero.
+        """
+        # Check that the calculated value is not zero, in case it raises a
+        # warning.
+        value = self._smallest_subnormal
+        if self.ftype(0) == value:
+            warnings.warn(
+                'The value of the smallest subnormal for {} type '
+                'is zero.'.format(self.ftype), UserWarning, stacklevel=2)
+
+        return self._float_to_float(value)
+
+    @property
+    def _str_smallest_subnormal(self):
+        """Return the string representation of the smallest subnormal."""
+        return self._float_to_str(self.smallest_subnormal)
+
+    def _float_to_float(self, value):
+        """Converts float to float.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return _fr1(self._float_conv(value))
+
+    def _float_conv(self, value):
+        """Converts float to conv.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return array([value], self.ftype)
+
+    def _float_to_str(self, value):
+        """Converts float to str.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return self.params['fmt'] % array(_fr0(value)[0], self.ftype)
+
+
+_convert_to_float = {
+    ntypes.csingle: ntypes.single,
+    ntypes.complex128: ntypes.float64,
+    ntypes.clongdouble: ntypes.longdouble
+    }
+
+# Parameters for creating MachAr / MachAr-like objects
+_title_fmt = 'numpy {} precision floating point number'
+_MACHAR_PARAMS = {
+    ntypes.double: dict(
+        itype = ntypes.int64,
+        fmt = '%24.16e',
+        title = _title_fmt.format('double')),
+    ntypes.single: dict(
+        itype = ntypes.int32,
+        fmt = '%15.7e',
+        title = _title_fmt.format('single')),
+    ntypes.longdouble: dict(
+        itype = ntypes.longlong,
+        fmt = '%s',
+        title = _title_fmt.format('long double')),
+    ntypes.half: dict(
+        itype = ntypes.int16,
+        fmt = '%12.5e',
+        title = _title_fmt.format('half'))}
+
+# Key to identify the floating point type.  Key is result of
+#
+#    ftype = np.longdouble        # or float64, float32, etc.
+#    v = (ftype(-1.0) / ftype(10.0))
+#    v.view(v.dtype.newbyteorder('<')).tobytes()
+#
+# Uses division to work around deficiencies in strtold on some platforms.
+# See:
+# https://perl5.git.perl.org/perl.git/blob/3118d7d684b56cbeb702af874f4326683c45f045:/Configure
+
+_KNOWN_TYPES = {}
+def _register_type(machar, bytepat):
+    _KNOWN_TYPES[bytepat] = machar
+
+
+_float_ma = {}
+
+
+def _register_known_types():
+    # Known parameters for float16
+    # See docstring of MachAr class for description of parameters.
+    f16 = ntypes.float16
+    float16_ma = MachArLike(f16,
+                            machep=-10,
+                            negep=-11,
+                            minexp=-14,
+                            maxexp=16,
+                            it=10,
+                            iexp=5,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(f16(-10)),
+                            epsneg=exp2(f16(-11)),
+                            huge=f16(65504),
+                            tiny=f16(2 ** -14))
+    _register_type(float16_ma, b'f\xae')
+    _float_ma[16] = float16_ma
+
+    # Known parameters for float32
+    f32 = ntypes.float32
+    float32_ma = MachArLike(f32,
+                            machep=-23,
+                            negep=-24,
+                            minexp=-126,
+                            maxexp=128,
+                            it=23,
+                            iexp=8,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(f32(-23)),
+                            epsneg=exp2(f32(-24)),
+                            huge=f32((1 - 2 ** -24) * 2**128),
+                            tiny=exp2(f32(-126)))
+    _register_type(float32_ma, b'\xcd\xcc\xcc\xbd')
+    _float_ma[32] = float32_ma
+
+    # Known parameters for float64
+    f64 = ntypes.float64
+    epsneg_f64 = 2.0 ** -53.0
+    tiny_f64 = 2.0 ** -1022.0
+    float64_ma = MachArLike(f64,
+                            machep=-52,
+                            negep=-53,
+                            minexp=-1022,
+                            maxexp=1024,
+                            it=52,
+                            iexp=11,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=2.0 ** -52.0,
+                            epsneg=epsneg_f64,
+                            huge=(1.0 - epsneg_f64) / tiny_f64 * f64(4),
+                            tiny=tiny_f64)
+    _register_type(float64_ma, b'\x9a\x99\x99\x99\x99\x99\xb9\xbf')
+    _float_ma[64] = float64_ma
+
+    # Known parameters for IEEE 754 128-bit binary float
+    ld = ntypes.longdouble
+    epsneg_f128 = exp2(ld(-113))
+    tiny_f128 = exp2(ld(-16382))
+    # Ignore runtime error when this is not f128
+    with numeric.errstate(all='ignore'):
+        huge_f128 = (ld(1) - epsneg_f128) / tiny_f128 * ld(4)
+    float128_ma = MachArLike(ld,
+                             machep=-112,
+                             negep=-113,
+                             minexp=-16382,
+                             maxexp=16384,
+                             it=112,
+                             iexp=15,
+                             ibeta=2,
+                             irnd=5,
+                             ngrd=0,
+                             eps=exp2(ld(-112)),
+                             epsneg=epsneg_f128,
+                             huge=huge_f128,
+                             tiny=tiny_f128)
+    # IEEE 754 128-bit binary float
+    _register_type(float128_ma,
+        b'\x9a\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\xfb\xbf')
+    _float_ma[128] = float128_ma
+
+    # Known parameters for float80 (Intel 80-bit extended precision)
+    epsneg_f80 = exp2(ld(-64))
+    tiny_f80 = exp2(ld(-16382))
+    # Ignore runtime error when this is not f80
+    with numeric.errstate(all='ignore'):
+        huge_f80 = (ld(1) - epsneg_f80) / tiny_f80 * ld(4)
+    float80_ma = MachArLike(ld,
+                            machep=-63,
+                            negep=-64,
+                            minexp=-16382,
+                            maxexp=16384,
+                            it=63,
+                            iexp=15,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(ld(-63)),
+                            epsneg=epsneg_f80,
+                            huge=huge_f80,
+                            tiny=tiny_f80)
+    # float80, first 10 bytes containing actual storage
+    _register_type(float80_ma, b'\xcd\xcc\xcc\xcc\xcc\xcc\xcc\xcc\xfb\xbf')
+    _float_ma[80] = float80_ma
+
+    # Guessed / known parameters for double double; see:
+    # https://en.wikipedia.org/wiki/Quadruple-precision_floating-point_format#Double-double_arithmetic
+    # These numbers have the same exponent range as float64, but extended
+    # number of digits in the significand.
+    huge_dd = nextafter(ld(inf), ld(0), dtype=ld)
+    # As the smallest_normal in double double is so hard to calculate we set
+    # it to NaN.
+    smallest_normal_dd = nan
+    # Leave the same value for the smallest subnormal as double
+    smallest_subnormal_dd = ld(nextafter(0., 1.))
+    float_dd_ma = MachArLike(ld,
+                             machep=-105,
+                             negep=-106,
+                             minexp=-1022,
+                             maxexp=1024,
+                             it=105,
+                             iexp=11,
+                             ibeta=2,
+                             irnd=5,
+                             ngrd=0,
+                             eps=exp2(ld(-105)),
+                             epsneg=exp2(ld(-106)),
+                             huge=huge_dd,
+                             tiny=smallest_normal_dd,
+                             smallest_subnormal=smallest_subnormal_dd)
+    # double double; low, high order (e.g. PPC 64)
+    _register_type(float_dd_ma,
+        b'\x9a\x99\x99\x99\x99\x99Y<\x9a\x99\x99\x99\x99\x99\xb9\xbf')
+    # double double; high, low order (e.g. PPC 64 le)
+    _register_type(float_dd_ma,
+        b'\x9a\x99\x99\x99\x99\x99\xb9\xbf\x9a\x99\x99\x99\x99\x99Y<')
+    _float_ma['dd'] = float_dd_ma
+
+
+def _get_machar(ftype):
+    """ Get MachAr instance or MachAr-like instance
+
+    Get parameters for floating point type, by first trying signatures of
+    various known floating point types, then, if none match, attempting to
+    identify parameters by analysis.
+
+    Parameters
+    ----------
+    ftype : class
+        Numpy floating point type class (e.g. ``np.float64``)
+
+    Returns
+    -------
+    ma_like : instance of :class:`MachAr` or :class:`MachArLike`
+        Object giving floating point parameters for `ftype`.
+
+    Warns
+    -----
+    UserWarning
+        If the binary signature of the float type is not in the dictionary of
+        known float types.
+    """
+    params = _MACHAR_PARAMS.get(ftype)
+    if params is None:
+        raise ValueError(repr(ftype))
+    # Detect known / suspected types
+    # ftype(-1.0) / ftype(10.0) is better than ftype('-0.1') because stold
+    # may be deficient
+    key = (ftype(-1.0) / ftype(10.))
+    key = key.view(key.dtype.newbyteorder("<")).tobytes()
+    ma_like = None
+    if ftype == ntypes.longdouble:
+        # Could be 80 bit == 10 byte extended precision, where last bytes can
+        # be random garbage.
+        # Comparing first 10 bytes to pattern first to avoid branching on the
+        # random garbage.
+        ma_like = _KNOWN_TYPES.get(key[:10])
+    if ma_like is None:
+        # see if the full key is known.
+        ma_like = _KNOWN_TYPES.get(key)
+    if ma_like is None and len(key) == 16:
+        # machine limits could be f80 masquerading as np.float128,
+        # find all keys with length 16 and make new dict, but make the keys
+        # only 10 bytes long, the last bytes can be random garbage
+        _kt = {k[:10]: v for k, v in _KNOWN_TYPES.items() if len(k) == 16}
+        ma_like = _kt.get(key[:10])
+    if ma_like is not None:
+        return ma_like
+    # Fall back to parameter discovery
+    warnings.warn(
+        f'Signature {key} for {ftype} does not match any known type: '
+        'falling back to type probe function.\n'
+        'This warnings indicates broken support for the dtype!',
+        UserWarning, stacklevel=2)
+    return _discovered_machar(ftype)
+
+
+def _discovered_machar(ftype):
+    """ Create MachAr instance with found information on float types
+
+    TODO: MachAr should be retired completely ideally.  We currently only
+          ever use it system with broken longdouble (valgrind, WSL).
+    """
+    params = _MACHAR_PARAMS[ftype]
+    return MachAr(lambda v: array([v], ftype),
+                  lambda v: _fr0(v.astype(params['itype']))[0],
+                  lambda v: array(_fr0(v)[0], ftype),
+                  lambda v: params['fmt'] % array(_fr0(v)[0], ftype),
+                  params['title'])
+
+
+@set_module('numpy')
+class finfo:
+    """
+    finfo(dtype)
+
+    Machine limits for floating point types.
+
+    Attributes
+    ----------
+    bits : int
+        The number of bits occupied by the type.
+    dtype : dtype
+        Returns the dtype for which `finfo` returns information. For complex
+        input, the returned dtype is the associated ``float*`` dtype for its
+        real and complex components.
+    eps : float
+        The difference between 1.0 and the next smallest representable float
+        larger than 1.0. For example, for 64-bit binary floats in the IEEE-754
+        standard, ``eps = 2**-52``, approximately 2.22e-16.
+    epsneg : float
+        The difference between 1.0 and the next smallest representable float
+        less than 1.0. For example, for 64-bit binary floats in the IEEE-754
+        standard, ``epsneg = 2**-53``, approximately 1.11e-16.
+    iexp : int
+        The number of bits in the exponent portion of the floating point
+        representation.
+    machep : int
+        The exponent that yields `eps`.
+    max : floating point number of the appropriate type
+        The largest representable number.
+    maxexp : int
+        The smallest positive power of the base (2) that causes overflow.
+    min : floating point number of the appropriate type
+        The smallest representable number, typically ``-max``.
+    minexp : int
+        The most negative power of the base (2) consistent with there
+        being no leading 0's in the mantissa.
+    negep : int
+        The exponent that yields `epsneg`.
+    nexp : int
+        The number of bits in the exponent including its sign and bias.
+    nmant : int
+        The number of bits in the mantissa.
+    precision : int
+        The approximate number of decimal digits to which this kind of
+        float is precise.
+    resolution : floating point number of the appropriate type
+        The approximate decimal resolution of this type, i.e.,
+        ``10**-precision``.
+    tiny : float
+        An alias for `smallest_normal`, kept for backwards compatibility.
+    smallest_normal : float
+        The smallest positive floating point number with 1 as leading bit in
+        the mantissa following IEEE-754 (see Notes).
+    smallest_subnormal : float
+        The smallest positive floating point number with 0 as leading bit in
+        the mantissa following IEEE-754.
+
+    Parameters
+    ----------
+    dtype : float, dtype, or instance
+        Kind of floating point or complex floating point
+        data-type about which to get information.
+
+    See Also
+    --------
+    iinfo : The equivalent for integer data types.
+    spacing : The distance between a value and the nearest adjacent number
+    nextafter : The next floating point value after x1 towards x2
+
+    Notes
+    -----
+    For developers of NumPy: do not instantiate this at the module level.
+    The initial calculation of these parameters is expensive and negatively
+    impacts import times.  These objects are cached, so calling ``finfo()``
+    repeatedly inside your functions is not a problem.
+
+    Note that ``smallest_normal`` is not actually the smallest positive
+    representable value in a NumPy floating point type. As in the IEEE-754
+    standard [1]_, NumPy floating point types make use of subnormal numbers to
+    fill the gap between 0 and ``smallest_normal``. However, subnormal numbers
+    may have significantly reduced precision [2]_.
+
+    This function can also be used for complex data types as well. If used,
+    the output will be the same as the corresponding real float type
+    (e.g. numpy.finfo(numpy.csingle) is the same as numpy.finfo(numpy.single)).
+    However, the output is true for the real and imaginary components.
+
+    References
+    ----------
+    .. [1] IEEE Standard for Floating-Point Arithmetic, IEEE Std 754-2008,
+           pp.1-70, 2008, https://doi.org/10.1109/IEEESTD.2008.4610935
+    .. [2] Wikipedia, "Denormal Numbers",
+           https://en.wikipedia.org/wiki/Denormal_number
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.finfo(np.float64).dtype
+    dtype('float64')
+    >>> np.finfo(np.complex64).dtype
+    dtype('float32')
+
+    """
+
+    _finfo_cache = {}
+
+    __class_getitem__ = classmethod(types.GenericAlias)
+
+    def __new__(cls, dtype):
+        try:
+            obj = cls._finfo_cache.get(dtype)  # most common path
+            if obj is not None:
+                return obj
+        except TypeError:
+            pass
+
+        if dtype is None:
+            # Deprecated in NumPy 1.25, 2023-01-16
+            warnings.warn(
+                "finfo() dtype cannot be None. This behavior will "
+                "raise an error in the future. (Deprecated in NumPy 1.25)",
+                DeprecationWarning,
+                stacklevel=2
+            )
+
+        try:
+            dtype = numeric.dtype(dtype)
+        except TypeError:
+            # In case a float instance was given
+            dtype = numeric.dtype(type(dtype))
+
+        obj = cls._finfo_cache.get(dtype)
+        if obj is not None:
+            return obj
+        dtypes = [dtype]
+        newdtype = ntypes.obj2sctype(dtype)
+        if newdtype is not dtype:
+            dtypes.append(newdtype)
+            dtype = newdtype
+        if not issubclass(dtype, numeric.inexact):
+            raise ValueError("data type %r not inexact" % (dtype))
+        obj = cls._finfo_cache.get(dtype)
+        if obj is not None:
+            return obj
+        if not issubclass(dtype, numeric.floating):
+            newdtype = _convert_to_float[dtype]
+            if newdtype is not dtype:
+                # dtype changed, for example from complex128 to float64
+                dtypes.append(newdtype)
+                dtype = newdtype
+
+                obj = cls._finfo_cache.get(dtype, None)
+                if obj is not None:
+                    # the original dtype was not in the cache, but the new
+                    # dtype is in the cache. we add the original dtypes to
+                    # the cache and return the result
+                    for dt in dtypes:
+                        cls._finfo_cache[dt] = obj
+                    return obj
+        obj = object.__new__(cls)._init(dtype)
+        for dt in dtypes:
+            cls._finfo_cache[dt] = obj
+        return obj
+
+    def _init(self, dtype):
+        self.dtype = numeric.dtype(dtype)
+        machar = _get_machar(dtype)
+
+        for word in ['precision', 'iexp',
+                     'maxexp', 'minexp', 'negep',
+                     'machep']:
+            setattr(self, word, getattr(machar, word))
+        for word in ['resolution', 'epsneg', 'smallest_subnormal']:
+            setattr(self, word, getattr(machar, word).flat[0])
+        self.bits = self.dtype.itemsize * 8
+        self.max = machar.huge.flat[0]
+        self.min = -self.max
+        self.eps = machar.eps.flat[0]
+        self.nexp = machar.iexp
+        self.nmant = machar.it
+        self._machar = machar
+        self._str_tiny = machar._str_xmin.strip()
+        self._str_max = machar._str_xmax.strip()
+        self._str_epsneg = machar._str_epsneg.strip()
+        self._str_eps = machar._str_eps.strip()
+        self._str_resolution = machar._str_resolution.strip()
+        self._str_smallest_normal = machar._str_smallest_normal.strip()
+        self._str_smallest_subnormal = machar._str_smallest_subnormal.strip()
+        return self
+
+    def __str__(self):
+        fmt = (
+            'Machine parameters for %(dtype)s\n'
+            '---------------------------------------------------------------\n'
+            'precision = %(precision)3s   resolution = %(_str_resolution)s\n'
+            'machep = %(machep)6s   eps =        %(_str_eps)s\n'
+            'negep =  %(negep)6s   epsneg =     %(_str_epsneg)s\n'
+            'minexp = %(minexp)6s   tiny =       %(_str_tiny)s\n'
+            'maxexp = %(maxexp)6s   max =        %(_str_max)s\n'
+            'nexp =   %(nexp)6s   min =        -max\n'
+            'smallest_normal = %(_str_smallest_normal)s   '
+            'smallest_subnormal = %(_str_smallest_subnormal)s\n'
+            '---------------------------------------------------------------\n'
+            )
+        return fmt % self.__dict__
+
+    def __repr__(self):
+        c = self.__class__.__name__
+        d = self.__dict__.copy()
+        d['klass'] = c
+        return (("%(klass)s(resolution=%(resolution)s, min=-%(_str_max)s,"
+                 " max=%(_str_max)s, dtype=%(dtype)s)") % d)
+
+    @property
+    def smallest_normal(self):
+        """Return the value for the smallest normal.
+
+        Returns
+        -------
+        smallest_normal : float
+            Value for the smallest normal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest normal is requested for
+            double-double.
+        """
+        # This check is necessary because the value for smallest_normal is
+        # platform dependent for longdouble types.
+        if isnan(self._machar.smallest_normal.flat[0]):
+            warnings.warn(
+                'The value of smallest normal is undefined for double double',
+                UserWarning, stacklevel=2)
+        return self._machar.smallest_normal.flat[0]
+
+    @property
+    def tiny(self):
+        """Return the value for tiny, alias of smallest_normal.
+
+        Returns
+        -------
+        tiny : float
+            Value for the smallest normal, alias of smallest_normal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest normal is requested for
+            double-double.
+        """
+        return self.smallest_normal
+
+
+@set_module('numpy')
+class iinfo:
+    """
+    iinfo(type)
+
+    Machine limits for integer types.
+
+    Attributes
+    ----------
+    bits : int
+        The number of bits occupied by the type.
+    dtype : dtype
+        Returns the dtype for which `iinfo` returns information.
+    min : int
+        The smallest integer expressible by the type.
+    max : int
+        The largest integer expressible by the type.
+
+    Parameters
+    ----------
+    int_type : integer type, dtype, or instance
+        The kind of integer data type to get information about.
+
+    See Also
+    --------
+    finfo : The equivalent for floating point data types.
+
+    Examples
+    --------
+    With types:
+
+    >>> import numpy as np
+    >>> ii16 = np.iinfo(np.int16)
+    >>> ii16.min
+    -32768
+    >>> ii16.max
+    32767
+    >>> ii32 = np.iinfo(np.int32)
+    >>> ii32.min
+    -2147483648
+    >>> ii32.max
+    2147483647
+
+    With instances:
+
+    >>> ii32 = np.iinfo(np.int32(10))
+    >>> ii32.min
+    -2147483648
+    >>> ii32.max
+    2147483647
+
+    """
+
+    _min_vals = {}
+    _max_vals = {}
+
+    __class_getitem__ = classmethod(types.GenericAlias)
+
+    def __init__(self, int_type):
+        try:
+            self.dtype = numeric.dtype(int_type)
+        except TypeError:
+            self.dtype = numeric.dtype(type(int_type))
+        self.kind = self.dtype.kind
+        self.bits = self.dtype.itemsize * 8
+        self.key = "%s%d" % (self.kind, self.bits)
+        if self.kind not in 'iu':
+            raise ValueError("Invalid integer data type %r." % (self.kind,))
+
+    @property
+    def min(self):
+        """Minimum value of given dtype."""
+        if self.kind == 'u':
+            return 0
+        else:
+            try:
+                val = iinfo._min_vals[self.key]
+            except KeyError:
+                val = int(-(1 << (self.bits-1)))
+                iinfo._min_vals[self.key] = val
+            return val
+
+    @property
+    def max(self):
+        """Maximum value of given dtype."""
+        try:
+            val = iinfo._max_vals[self.key]
+        except KeyError:
+            if self.kind == 'u':
+                val = int((1 << self.bits) - 1)
+            else:
+                val = int((1 << (self.bits-1)) - 1)
+            iinfo._max_vals[self.key] = val
+        return val
+
+    def __str__(self):
+        """String representation."""
+        fmt = (
+            'Machine parameters for %(dtype)s\n'
+            '---------------------------------------------------------------\n'
+            'min = %(min)s\n'
+            'max = %(max)s\n'
+            '---------------------------------------------------------------\n'
+            )
+        return fmt % {'dtype': self.dtype, 'min': self.min, 'max': self.max}
+
+    def __repr__(self):
+        return "%s(min=%s, max=%s, dtype=%s)" % (self.__class__.__name__,
+                                    self.min, self.max, self.dtype)

janus/lib/python3.10/site-packages/numpy/_core/getlimits.pyi

@@ -0,0 +1,3 @@
+from numpy import finfo, iinfo
+
+__all__ = ["finfo", "iinfo"]

janus/lib/python3.10/site-packages/numpy/_core/memmap.pyi

@@ -0,0 +1,3 @@
+from numpy import memmap
+
+__all__ = ["memmap"]

janus/lib/python3.10/site-packages/numpy/_core/multiarray.pyi

@@ -0,0 +1,1348 @@
+# TODO: Sort out any and all missing functions in this namespace
+import datetime as dt
+from _typeshed import StrOrBytesPath, SupportsLenAndGetItem
+from collections.abc import Sequence, Callable, Iterable
+from typing import (
+    Literal as L,
+    Any,
+    TypeAlias,
+    overload,
+    TypeVar,
+    TypedDict,
+    SupportsIndex,
+    final,
+    Final,
+    Protocol,
+    ClassVar,
+    type_check_only,
+)
+from typing_extensions import CapsuleType, Unpack
+
+import numpy as np
+from numpy import (  # type: ignore[attr-defined]
+    # Re-exports
+    busdaycalendar,
+    broadcast,
+    correlate,
+    count_nonzero,
+    dtype,
+    einsum as c_einsum,
+    flatiter,
+    from_dlpack,
+    interp,
+    matmul,
+    ndarray,
+    nditer,
+    vecdot,
+
+    # The rest
+    ufunc,
+    str_,
+    uint8,
+    intp,
+    int_,
+    float64,
+    timedelta64,
+    datetime64,
+    generic,
+    unsignedinteger,
+    signedinteger,
+    floating,
+    complexfloating,
+    _OrderKACF,
+    _OrderCF,
+    _CastingKind,
+    _ModeKind,
+    _SupportsBuffer,
+    _SupportsFileMethods,
+    _CopyMode,
+    _NDIterFlagsKind,
+    _NDIterFlagsOp,
+)
+from numpy.lib._array_utils_impl import normalize_axis_index
+
+from numpy._typing import (
+    # Shapes
+    _ShapeLike,
+
+    # DTypes
+    DTypeLike,
+    _DTypeLike,
+    _SupportsDType,
+
+    # Arrays
+    NDArray,
+    ArrayLike,
+    _ArrayLike,
+    _SupportsArrayFunc,
+    _NestedSequence,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeTD64_co,
+    _ArrayLikeDT64_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeStr_co,
+    _ArrayLikeBytes_co,
+    _ScalarLike_co,
+    _IntLike_co,
+    _FloatLike_co,
+    _TD64Like_co,
+)
+from numpy._typing._ufunc import (
+    _2PTuple,
+    _PyFunc_Nin1_Nout1,
+    _PyFunc_Nin2_Nout1,
+    _PyFunc_Nin3P_Nout1,
+    _PyFunc_Nin1P_Nout2P,
+)
+
+__all__ = [
+    "_ARRAY_API",
+    "ALLOW_THREADS",
+    "BUFSIZE",
+    "CLIP",
+    "DATETIMEUNITS",
+    "ITEM_HASOBJECT",
+    "ITEM_IS_POINTER",
+    "LIST_PICKLE",
+    "MAXDIMS",
+    "MAY_SHARE_BOUNDS",
+    "MAY_SHARE_EXACT",
+    "NEEDS_INIT",
+    "NEEDS_PYAPI",
+    "RAISE",
+    "USE_GETITEM",
+    "USE_SETITEM",
+    "WRAP",
+    "_flagdict",
+    "from_dlpack",
+    "_place",
+    "_reconstruct",
+    "_vec_string",
+    "_monotonicity",
+    "add_docstring",
+    "arange",
+    "array",
+    "asarray",
+    "asanyarray",
+    "ascontiguousarray",
+    "asfortranarray",
+    "bincount",
+    "broadcast",
+    "busday_count",
+    "busday_offset",
+    "busdaycalendar",
+    "can_cast",
+    "compare_chararrays",
+    "concatenate",
+    "copyto",
+    "correlate",
+    "correlate2",
+    "count_nonzero",
+    "c_einsum",
+    "datetime_as_string",
+    "datetime_data",
+    "dot",
+    "dragon4_positional",
+    "dragon4_scientific",
+    "dtype",
+    "empty",
+    "empty_like",
+    "error",
+    "flagsobj",
+    "flatiter",
+    "format_longfloat",
+    "frombuffer",
+    "fromfile",
+    "fromiter",
+    "fromstring",
+    "get_handler_name",
+    "get_handler_version",
+    "inner",
+    "interp",
+    "interp_complex",
+    "is_busday",
+    "lexsort",
+    "matmul",
+    "vecdot",
+    "may_share_memory",
+    "min_scalar_type",
+    "ndarray",
+    "nditer",
+    "nested_iters",
+    "normalize_axis_index",
+    "packbits",
+    "promote_types",
+    "putmask",
+    "ravel_multi_index",
+    "result_type",
+    "scalar",
+    "set_datetimeparse_function",
+    "set_typeDict",
+    "shares_memory",
+    "typeinfo",
+    "unpackbits",
+    "unravel_index",
+    "vdot",
+    "where",
+    "zeros",
+]
+
+_T_co = TypeVar("_T_co", covariant=True)
+_T_contra = TypeVar("_T_contra", contravariant=True)
+_SCT = TypeVar("_SCT", bound=generic)
+_DType = TypeVar("_DType", bound=np.dtype[Any])
+_ArrayType = TypeVar("_ArrayType", bound=ndarray[Any, Any])
+_ArrayType_co = TypeVar(
+    "_ArrayType_co",
+    bound=ndarray[Any, Any],
+    covariant=True,
+)
+_ReturnType = TypeVar("_ReturnType")
+_IDType = TypeVar("_IDType")
+_Nin = TypeVar("_Nin", bound=int)
+_Nout = TypeVar("_Nout", bound=int)
+
+_SizeType = TypeVar("_SizeType", bound=int)
+_ShapeType = TypeVar("_ShapeType", bound=tuple[int, ...])
+_1DArray: TypeAlias = ndarray[tuple[_SizeType], dtype[_SCT]]
+_Array: TypeAlias = ndarray[_ShapeType, dtype[_SCT]]
+
+# Valid time units
+_UnitKind: TypeAlias = L[
+    "Y",
+    "M",
+    "D",
+    "h",
+    "m",
+    "s",
+    "ms",
+    "us", "μs",
+    "ns",
+    "ps",
+    "fs",
+    "as",
+]
+_RollKind: TypeAlias = L[  # `raise` is deliberately excluded
+    "nat",
+    "forward",
+    "following",
+    "backward",
+    "preceding",
+    "modifiedfollowing",
+    "modifiedpreceding",
+]
+
+@type_check_only
+class _SupportsArray(Protocol[_ArrayType_co]):
+    def __array__(self, /) -> _ArrayType_co: ...
+
+@type_check_only
+class _KwargsEmpty(TypedDict, total=False):
+    device: None | L["cpu"]
+    like: None | _SupportsArrayFunc
+
+@type_check_only
+class _ConstructorEmpty(Protocol):
+    # 1-D shape
+    @overload
+    def __call__(
+        self, /,
+        shape: _SizeType,
+        dtype: None = ...,
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> _Array[tuple[_SizeType], float64]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _SizeType,
+        dtype: _DType | _SupportsDType[_DType],
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> ndarray[tuple[_SizeType], _DType]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _SizeType,
+        dtype: type[_SCT],
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> _Array[tuple[_SizeType], _SCT]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _SizeType,
+        dtype: DTypeLike,
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> _Array[tuple[_SizeType], Any]: ...
+
+    # known shape
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeType,
+        dtype: None = ...,
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> _Array[_ShapeType, float64]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeType,
+        dtype: _DType | _SupportsDType[_DType],
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> ndarray[_ShapeType, _DType]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeType,
+        dtype: type[_SCT],
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> _Array[_ShapeType, _SCT]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeType,
+        dtype: DTypeLike,
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> _Array[_ShapeType, Any]: ...
+
+    # unknown shape
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeLike,
+        dtype: None = ...,
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> NDArray[float64]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeLike,
+        dtype: _DType | _SupportsDType[_DType],
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> ndarray[Any, _DType]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeLike,
+        dtype: type[_SCT],
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> NDArray[_SCT]: ...
+    @overload
+    def __call__(
+        self, /,
+        shape: _ShapeLike,
+        dtype: DTypeLike,
+        order: _OrderCF = ...,
+        **kwargs: Unpack[_KwargsEmpty],
+    ) -> NDArray[Any]: ...
+
+error: Final = Exception
+
+# from ._multiarray_umath
+ITEM_HASOBJECT: Final[L[1]]
+LIST_PICKLE: Final[L[2]]
+ITEM_IS_POINTER: Final[L[4]]
+NEEDS_INIT: Final[L[8]]
+NEEDS_PYAPI: Final[L[16]]
+USE_GETITEM: Final[L[32]]
+USE_SETITEM: Final[L[64]]
+DATETIMEUNITS: Final[CapsuleType]
+_ARRAY_API: Final[CapsuleType]
+_flagdict: Final[dict[str, int]]
+_monotonicity: Final[Callable[..., object]]
+_place: Final[Callable[..., object]]
+_reconstruct: Final[Callable[..., object]]
+_vec_string: Final[Callable[..., object]]
+correlate2: Final[Callable[..., object]]
+dragon4_positional: Final[Callable[..., object]]
+dragon4_scientific: Final[Callable[..., object]]
+interp_complex: Final[Callable[..., object]]
+set_datetimeparse_function: Final[Callable[..., object]]
+def get_handler_name(a: NDArray[Any] = ..., /) -> str | None: ...
+def get_handler_version(a: NDArray[Any] = ..., /) -> int | None: ...
+def format_longfloat(x: np.longdouble, precision: int) -> str: ...
+def scalar(dtype: _DType, object: bytes | object = ...) -> ndarray[tuple[()], _DType]: ...
+def set_typeDict(dict_: dict[str, np.dtype[Any]], /) -> None: ...
+typeinfo: Final[dict[str, np.dtype[np.generic]]]
+
+ALLOW_THREADS: Final[int]  # 0 or 1 (system-specific)
+BUFSIZE: L[8192]
+CLIP: L[0]
+WRAP: L[1]
+RAISE: L[2]
+MAXDIMS: L[32]
+MAY_SHARE_BOUNDS: L[0]
+MAY_SHARE_EXACT: L[-1]
+tracemalloc_domain: L[389047]
+
+zeros: Final[_ConstructorEmpty]
+empty: Final[_ConstructorEmpty]
+
+@overload
+def empty_like(
+    prototype: _ArrayType,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> _ArrayType: ...
+@overload
+def empty_like(
+    prototype: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def empty_like(
+    prototype: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+@overload
+def empty_like(
+    prototype: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def empty_like(
+    prototype: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def array(
+    object: _ArrayType,
+    dtype: None = ...,
+    *,
+    copy: None | bool | _CopyMode = ...,
+    order: _OrderKACF = ...,
+    subok: L[True],
+    ndmin: int = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _ArrayType: ...
+@overload
+def array(
+    object: _SupportsArray[_ArrayType],
+    dtype: None = ...,
+    *,
+    copy: None | bool | _CopyMode = ...,
+    order: _OrderKACF = ...,
+    subok: L[True],
+    ndmin: L[0] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _ArrayType: ...
+@overload
+def array(
+    object: _ArrayLike[_SCT],
+    dtype: None = ...,
+    *,
+    copy: None | bool | _CopyMode = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    ndmin: int = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def array(
+    object: object,
+    dtype: None = ...,
+    *,
+    copy: None | bool | _CopyMode = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    ndmin: int = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+@overload
+def array(
+    object: Any,
+    dtype: _DTypeLike[_SCT],
+    *,
+    copy: None | bool | _CopyMode = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    ndmin: int = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def array(
+    object: Any,
+    dtype: DTypeLike,
+    *,
+    copy: None | bool | _CopyMode = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    ndmin: int = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def unravel_index(  # type: ignore[misc]
+    indices: _IntLike_co,
+    shape: _ShapeLike,
+    order: _OrderCF = ...,
+) -> tuple[intp, ...]: ...
+@overload
+def unravel_index(
+    indices: _ArrayLikeInt_co,
+    shape: _ShapeLike,
+    order: _OrderCF = ...,
+) -> tuple[NDArray[intp], ...]: ...
+
+@overload
+def ravel_multi_index(  # type: ignore[misc]
+    multi_index: Sequence[_IntLike_co],
+    dims: Sequence[SupportsIndex],
+    mode: _ModeKind | tuple[_ModeKind, ...] = ...,
+    order: _OrderCF = ...,
+) -> intp: ...
+@overload
+def ravel_multi_index(
+    multi_index: Sequence[_ArrayLikeInt_co],
+    dims: Sequence[SupportsIndex],
+    mode: _ModeKind | tuple[_ModeKind, ...] = ...,
+    order: _OrderCF = ...,
+) -> NDArray[intp]: ...
+
+# NOTE: Allow any sequence of array-like objects
+@overload
+def concatenate(  # type: ignore[misc]
+    arrays: _ArrayLike[_SCT],
+    /,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    casting: None | _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def concatenate(  # type: ignore[misc]
+    arrays: SupportsLenAndGetItem[ArrayLike],
+    /,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    casting: None | _CastingKind = ...
+) -> NDArray[Any]: ...
+@overload
+def concatenate(  # type: ignore[misc]
+    arrays: SupportsLenAndGetItem[ArrayLike],
+    /,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: None | _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def concatenate(  # type: ignore[misc]
+    arrays: SupportsLenAndGetItem[ArrayLike],
+    /,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: DTypeLike,
+    casting: None | _CastingKind = ...
+) -> NDArray[Any]: ...
+@overload
+def concatenate(
+    arrays: SupportsLenAndGetItem[ArrayLike],
+    /,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    dtype: DTypeLike = ...,
+    casting: None | _CastingKind = ...
+) -> _ArrayType: ...
+
+def inner(
+    a: ArrayLike,
+    b: ArrayLike,
+    /,
+) -> Any: ...
+
+@overload
+def where(
+    condition: ArrayLike,
+    /,
+) -> tuple[NDArray[intp], ...]: ...
+@overload
+def where(
+    condition: ArrayLike,
+    x: ArrayLike,
+    y: ArrayLike,
+    /,
+) -> NDArray[Any]: ...
+
+def lexsort(
+    keys: ArrayLike,
+    axis: None | SupportsIndex = ...,
+) -> Any: ...
+
+def can_cast(
+    from_: ArrayLike | DTypeLike,
+    to: DTypeLike,
+    casting: None | _CastingKind = ...,
+) -> bool: ...
+
+def min_scalar_type(
+    a: ArrayLike, /,
+) -> dtype[Any]: ...
+
+def result_type(
+    *arrays_and_dtypes: ArrayLike | DTypeLike,
+) -> dtype[Any]: ...
+
+@overload
+def dot(a: ArrayLike, b: ArrayLike, out: None = ...) -> Any: ...
+@overload
+def dot(a: ArrayLike, b: ArrayLike, out: _ArrayType) -> _ArrayType: ...
+
+@overload
+def vdot(a: _ArrayLikeBool_co, b: _ArrayLikeBool_co, /) -> np.bool: ...  # type: ignore[misc]
+@overload
+def vdot(a: _ArrayLikeUInt_co, b: _ArrayLikeUInt_co, /) -> unsignedinteger[Any]: ...  # type: ignore[misc]
+@overload
+def vdot(a: _ArrayLikeInt_co, b: _ArrayLikeInt_co, /) -> signedinteger[Any]: ... # type: ignore[misc]
+@overload
+def vdot(a: _ArrayLikeFloat_co, b: _ArrayLikeFloat_co, /) -> floating[Any]: ...  # type: ignore[misc]
+@overload
+def vdot(a: _ArrayLikeComplex_co, b: _ArrayLikeComplex_co, /) -> complexfloating[Any, Any]: ...  # type: ignore[misc]
+@overload
+def vdot(a: _ArrayLikeTD64_co, b: _ArrayLikeTD64_co, /) -> timedelta64: ...
+@overload
+def vdot(a: _ArrayLikeObject_co, b: Any, /) -> Any: ...
+@overload
+def vdot(a: Any, b: _ArrayLikeObject_co, /) -> Any: ...
+
+def bincount(
+    x: ArrayLike,
+    /,
+    weights: None | ArrayLike = ...,
+    minlength: SupportsIndex = ...,
+) -> NDArray[intp]: ...
+
+def copyto(
+    dst: NDArray[Any],
+    src: ArrayLike,
+    casting: None | _CastingKind = ...,
+    where: None | _ArrayLikeBool_co = ...,
+) -> None: ...
+
+def putmask(
+    a: NDArray[Any],
+    /,
+    mask: _ArrayLikeBool_co,
+    values: ArrayLike,
+) -> None: ...
+
+def packbits(
+    a: _ArrayLikeInt_co,
+    /,
+    axis: None | SupportsIndex = ...,
+    bitorder: L["big", "little"] = ...,
+) -> NDArray[uint8]: ...
+
+def unpackbits(
+    a: _ArrayLike[uint8],
+    /,
+    axis: None | SupportsIndex = ...,
+    count: None | SupportsIndex = ...,
+    bitorder: L["big", "little"] = ...,
+) -> NDArray[uint8]: ...
+
+def shares_memory(
+    a: object,
+    b: object,
+    /,
+    max_work: None | int = ...,
+) -> bool: ...
+
+def may_share_memory(
+    a: object,
+    b: object,
+    /,
+    max_work: None | int = ...,
+) -> bool: ...
+
+@overload
+def asarray(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asarray(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+@overload
+def asarray(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asarray(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def asanyarray(
+    a: _ArrayType,  # Preserve subclass-information
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _ArrayType: ...
+@overload
+def asanyarray(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asanyarray(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+@overload
+def asanyarray(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asanyarray(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    copy: None | bool = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def ascontiguousarray(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ascontiguousarray(
+    a: object,
+    dtype: None = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+@overload
+def ascontiguousarray(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ascontiguousarray(
+    a: Any,
+    dtype: DTypeLike,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def asfortranarray(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asfortranarray(
+    a: object,
+    dtype: None = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+@overload
+def asfortranarray(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asfortranarray(
+    a: Any,
+    dtype: DTypeLike,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+def promote_types(__type1: DTypeLike, __type2: DTypeLike) -> dtype[Any]: ...
+
+# `sep` is a de facto mandatory argument, as its default value is deprecated
+@overload
+def fromstring(
+    string: str | bytes,
+    dtype: None = ...,
+    count: SupportsIndex = ...,
+    *,
+    sep: str,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def fromstring(
+    string: str | bytes,
+    dtype: _DTypeLike[_SCT],
+    count: SupportsIndex = ...,
+    *,
+    sep: str,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def fromstring(
+    string: str | bytes,
+    dtype: DTypeLike,
+    count: SupportsIndex = ...,
+    *,
+    sep: str,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def frompyfunc(  # type: ignore[overload-overlap]
+    func: Callable[[Any], _ReturnType], /,
+    nin: L[1],
+    nout: L[1],
+    *,
+    identity: None = ...,
+) -> _PyFunc_Nin1_Nout1[_ReturnType, None]: ...
+@overload
+def frompyfunc(  # type: ignore[overload-overlap]
+    func: Callable[[Any], _ReturnType], /,
+    nin: L[1],
+    nout: L[1],
+    *,
+    identity: _IDType,
+) -> _PyFunc_Nin1_Nout1[_ReturnType, _IDType]: ...
+@overload
+def frompyfunc(  # type: ignore[overload-overlap]
+    func: Callable[[Any, Any], _ReturnType], /,
+    nin: L[2],
+    nout: L[1],
+    *,
+    identity: None = ...,
+) -> _PyFunc_Nin2_Nout1[_ReturnType, None]: ...
+@overload
+def frompyfunc(  # type: ignore[overload-overlap]
+    func: Callable[[Any, Any], _ReturnType], /,
+    nin: L[2],
+    nout: L[1],
+    *,
+    identity: _IDType,
+) -> _PyFunc_Nin2_Nout1[_ReturnType, _IDType]: ...
+@overload
+def frompyfunc(  # type: ignore[overload-overlap]
+    func: Callable[..., _ReturnType], /,
+    nin: _Nin,
+    nout: L[1],
+    *,
+    identity: None = ...,
+) -> _PyFunc_Nin3P_Nout1[_ReturnType, None, _Nin]: ...
+@overload
+def frompyfunc(  # type: ignore[overload-overlap]
+    func: Callable[..., _ReturnType], /,
+    nin: _Nin,
+    nout: L[1],
+    *,
+    identity: _IDType,
+) -> _PyFunc_Nin3P_Nout1[_ReturnType, _IDType, _Nin]: ...
+@overload
+def frompyfunc(
+    func: Callable[..., _2PTuple[_ReturnType]], /,
+    nin: _Nin,
+    nout: _Nout,
+    *,
+    identity: None = ...,
+) -> _PyFunc_Nin1P_Nout2P[_ReturnType, None, _Nin, _Nout]: ...
+@overload
+def frompyfunc(
+    func: Callable[..., _2PTuple[_ReturnType]], /,
+    nin: _Nin,
+    nout: _Nout,
+    *,
+    identity: _IDType,
+) -> _PyFunc_Nin1P_Nout2P[_ReturnType, _IDType, _Nin, _Nout]: ...
+@overload
+def frompyfunc(
+    func: Callable[..., Any], /,
+    nin: SupportsIndex,
+    nout: SupportsIndex,
+    *,
+    identity: None | object = ...,
+) -> ufunc: ...
+
+@overload
+def fromfile(
+    file: StrOrBytesPath | _SupportsFileMethods,
+    dtype: None = ...,
+    count: SupportsIndex = ...,
+    sep: str = ...,
+    offset: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def fromfile(
+    file: StrOrBytesPath | _SupportsFileMethods,
+    dtype: _DTypeLike[_SCT],
+    count: SupportsIndex = ...,
+    sep: str = ...,
+    offset: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def fromfile(
+    file: StrOrBytesPath | _SupportsFileMethods,
+    dtype: DTypeLike,
+    count: SupportsIndex = ...,
+    sep: str = ...,
+    offset: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def fromiter(
+    iter: Iterable[Any],
+    dtype: _DTypeLike[_SCT],
+    count: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def fromiter(
+    iter: Iterable[Any],
+    dtype: DTypeLike,
+    count: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def frombuffer(
+    buffer: _SupportsBuffer,
+    dtype: None = ...,
+    count: SupportsIndex = ...,
+    offset: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def frombuffer(
+    buffer: _SupportsBuffer,
+    dtype: _DTypeLike[_SCT],
+    count: SupportsIndex = ...,
+    offset: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def frombuffer(
+    buffer: _SupportsBuffer,
+    dtype: DTypeLike,
+    count: SupportsIndex = ...,
+    offset: SupportsIndex = ...,
+    *,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def arange(  # type: ignore[misc]
+    stop: _IntLike_co,
+    /, *,
+    dtype: None = ...,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, signedinteger[Any]]: ...
+@overload
+def arange(  # type: ignore[misc]
+    start: _IntLike_co,
+    stop: _IntLike_co,
+    step: _IntLike_co = ...,
+    dtype: None = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, signedinteger[Any]]: ...
+@overload
+def arange(  # type: ignore[misc]
+    stop: _FloatLike_co,
+    /, *,
+    dtype: None = ...,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, floating[Any]]: ...
+@overload
+def arange(  # type: ignore[misc]
+    start: _FloatLike_co,
+    stop: _FloatLike_co,
+    step: _FloatLike_co = ...,
+    dtype: None = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, floating[Any]]: ...
+@overload
+def arange(
+    stop: _TD64Like_co,
+    /, *,
+    dtype: None = ...,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, timedelta64]: ...
+@overload
+def arange(
+    start: _TD64Like_co,
+    stop: _TD64Like_co,
+    step: _TD64Like_co = ...,
+    dtype: None = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, timedelta64]: ...
+@overload
+def arange(  # both start and stop must always be specified for datetime64
+    start: datetime64,
+    stop: datetime64,
+    step: datetime64 = ...,
+    dtype: None = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, datetime64]: ...
+@overload
+def arange(
+    stop: Any,
+    /, *,
+    dtype: _DTypeLike[_SCT],
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, _SCT]: ...
+@overload
+def arange(
+    start: Any,
+    stop: Any,
+    step: Any = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, _SCT]: ...
+@overload
+def arange(
+    stop: Any, /,
+    *,
+    dtype: DTypeLike,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, Any]: ...
+@overload
+def arange(
+    start: Any,
+    stop: Any,
+    step: Any = ...,
+    dtype: DTypeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> _1DArray[int, Any]: ...
+
+def datetime_data(
+    dtype: str | _DTypeLike[datetime64] | _DTypeLike[timedelta64], /,
+) -> tuple[str, int]: ...
+
+# The datetime functions perform unsafe casts to `datetime64[D]`,
+# so a lot of different argument types are allowed here
+
+@overload
+def busday_count(  # type: ignore[misc]
+    begindates: _ScalarLike_co | dt.date,
+    enddates: _ScalarLike_co | dt.date,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> int_: ...
+@overload
+def busday_count(  # type: ignore[misc]
+    begindates: ArrayLike | dt.date | _NestedSequence[dt.date],
+    enddates: ArrayLike | dt.date | _NestedSequence[dt.date],
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> NDArray[int_]: ...
+@overload
+def busday_count(
+    begindates: ArrayLike | dt.date | _NestedSequence[dt.date],
+    enddates: ArrayLike | dt.date | _NestedSequence[dt.date],
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+# `roll="raise"` is (more or less?) equivalent to `casting="safe"`
+@overload
+def busday_offset(  # type: ignore[misc]
+    dates: datetime64 | dt.date,
+    offsets: _TD64Like_co | dt.timedelta,
+    roll: L["raise"] = ...,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> datetime64: ...
+@overload
+def busday_offset(  # type: ignore[misc]
+    dates: _ArrayLike[datetime64] | dt.date | _NestedSequence[dt.date],
+    offsets: _ArrayLikeTD64_co | dt.timedelta | _NestedSequence[dt.timedelta],
+    roll: L["raise"] = ...,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> NDArray[datetime64]: ...
+@overload
+def busday_offset(  # type: ignore[misc]
+    dates: _ArrayLike[datetime64] | dt.date | _NestedSequence[dt.date],
+    offsets: _ArrayLikeTD64_co | dt.timedelta | _NestedSequence[dt.timedelta],
+    roll: L["raise"] = ...,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+@overload
+def busday_offset(  # type: ignore[misc]
+    dates: _ScalarLike_co | dt.date,
+    offsets: _ScalarLike_co | dt.timedelta,
+    roll: _RollKind,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> datetime64: ...
+@overload
+def busday_offset(  # type: ignore[misc]
+    dates: ArrayLike | dt.date | _NestedSequence[dt.date],
+    offsets: ArrayLike | dt.timedelta | _NestedSequence[dt.timedelta],
+    roll: _RollKind,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> NDArray[datetime64]: ...
+@overload
+def busday_offset(
+    dates: ArrayLike | dt.date | _NestedSequence[dt.date],
+    offsets: ArrayLike | dt.timedelta | _NestedSequence[dt.timedelta],
+    roll: _RollKind,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def is_busday(  # type: ignore[misc]
+    dates: _ScalarLike_co | dt.date,
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> np.bool: ...
+@overload
+def is_busday(  # type: ignore[misc]
+    dates: ArrayLike | _NestedSequence[dt.date],
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def is_busday(
+    dates: ArrayLike | _NestedSequence[dt.date],
+    weekmask: ArrayLike = ...,
+    holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ...,
+    busdaycal: None | busdaycalendar = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def datetime_as_string(  # type: ignore[misc]
+    arr: datetime64 | dt.date,
+    unit: None | L["auto"] | _UnitKind = ...,
+    timezone: L["naive", "UTC", "local"] | dt.tzinfo = ...,
+    casting: _CastingKind = ...,
+) -> str_: ...
+@overload
+def datetime_as_string(
+    arr: _ArrayLikeDT64_co | _NestedSequence[dt.date],
+    unit: None | L["auto"] | _UnitKind = ...,
+    timezone: L["naive", "UTC", "local"] | dt.tzinfo = ...,
+    casting: _CastingKind = ...,
+) -> NDArray[str_]: ...
+
+@overload
+def compare_chararrays(
+    a1: _ArrayLikeStr_co,
+    a2: _ArrayLikeStr_co,
+    cmp: L["<", "<=", "==", ">=", ">", "!="],
+    rstrip: bool,
+) -> NDArray[np.bool]: ...
+@overload
+def compare_chararrays(
+    a1: _ArrayLikeBytes_co,
+    a2: _ArrayLikeBytes_co,
+    cmp: L["<", "<=", "==", ">=", ">", "!="],
+    rstrip: bool,
+) -> NDArray[np.bool]: ...
+
+def add_docstring(obj: Callable[..., Any], docstring: str, /) -> None: ...
+
+_GetItemKeys: TypeAlias = L[
+    "C", "CONTIGUOUS", "C_CONTIGUOUS",
+    "F", "FORTRAN", "F_CONTIGUOUS",
+    "W", "WRITEABLE",
+    "B", "BEHAVED",
+    "O", "OWNDATA",
+    "A", "ALIGNED",
+    "X", "WRITEBACKIFCOPY",
+    "CA", "CARRAY",
+    "FA", "FARRAY",
+    "FNC",
+    "FORC",
+]
+_SetItemKeys: TypeAlias = L[
+    "A", "ALIGNED",
+    "W", "WRITEABLE",
+    "X", "WRITEBACKIFCOPY",
+]
+
+@final
+class flagsobj:
+    __hash__: ClassVar[None]  # type: ignore[assignment]
+    aligned: bool
+    # NOTE: deprecated
+    # updateifcopy: bool
+    writeable: bool
+    writebackifcopy: bool
+    @property
+    def behaved(self) -> bool: ...
+    @property
+    def c_contiguous(self) -> bool: ...
+    @property
+    def carray(self) -> bool: ...
+    @property
+    def contiguous(self) -> bool: ...
+    @property
+    def f_contiguous(self) -> bool: ...
+    @property
+    def farray(self) -> bool: ...
+    @property
+    def fnc(self) -> bool: ...
+    @property
+    def forc(self) -> bool: ...
+    @property
+    def fortran(self) -> bool: ...
+    @property
+    def num(self) -> int: ...
+    @property
+    def owndata(self) -> bool: ...
+    def __getitem__(self, key: _GetItemKeys) -> bool: ...
+    def __setitem__(self, key: _SetItemKeys, value: bool) -> None: ...
+
+def nested_iters(
+    op: ArrayLike | Sequence[ArrayLike],
+    axes: Sequence[Sequence[SupportsIndex]],
+    flags: None | Sequence[_NDIterFlagsKind] = ...,
+    op_flags: None | Sequence[Sequence[_NDIterFlagsOp]] = ...,
+    op_dtypes: DTypeLike | Sequence[DTypeLike] = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingKind = ...,
+    buffersize: SupportsIndex = ...,
+) -> tuple[nditer, ...]: ...

janus/lib/python3.10/site-packages/numpy/_core/numeric.pyi

@@ -0,0 +1,886 @@
+from collections.abc import Callable, Sequence
+from typing import (
+    Any,
+    Final,
+    TypeAlias,
+    overload,
+    TypeVar,
+    Literal as L,
+    SupportsAbs,
+    SupportsIndex,
+    NoReturn,
+    TypeGuard,
+)
+from typing_extensions import Unpack
+
+import numpy as np
+from numpy import (
+    # re-exports
+    bitwise_not,
+    False_,
+    True_,
+    broadcast,
+    dtype,
+    flatiter,
+    from_dlpack,
+    inf,
+    little_endian,
+    matmul,
+    vecdot,
+    nan,
+    ndarray,
+    nditer,
+    newaxis,
+    ufunc,
+
+    # other
+    generic,
+    unsignedinteger,
+    signedinteger,
+    floating,
+    complexfloating,
+    int_,
+    intp,
+    float64,
+    timedelta64,
+    object_,
+    _OrderKACF,
+    _OrderCF,
+)
+from .multiarray import (
+    # re-exports
+    arange,
+    array,
+    asarray,
+    asanyarray,
+    ascontiguousarray,
+    asfortranarray,
+    can_cast,
+    concatenate,
+    copyto,
+    dot,
+    empty,
+    empty_like,
+    frombuffer,
+    fromfile,
+    fromiter,
+    fromstring,
+    inner,
+    lexsort,
+    may_share_memory,
+    min_scalar_type,
+    nested_iters,
+    putmask,
+    promote_types,
+    result_type,
+    shares_memory,
+    vdot,
+    where,
+    zeros,
+
+    # other
+    _Array,
+    _ConstructorEmpty,
+    _KwargsEmpty,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    DTypeLike,
+    _SupportsDType,
+    _ShapeLike,
+    _DTypeLike,
+    _ArrayLike,
+    _SupportsArrayFunc,
+    _ScalarLike_co,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeTD64_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeUnknown,
+)
+
+__all__ = [
+    "newaxis",
+    "ndarray",
+    "flatiter",
+    "nditer",
+    "nested_iters",
+    "ufunc",
+    "arange",
+    "array",
+    "asarray",
+    "asanyarray",
+    "ascontiguousarray",
+    "asfortranarray",
+    "zeros",
+    "count_nonzero",
+    "empty",
+    "broadcast",
+    "dtype",
+    "fromstring",
+    "fromfile",
+    "frombuffer",
+    "from_dlpack",
+    "where",
+    "argwhere",
+    "copyto",
+    "concatenate",
+    "lexsort",
+    "astype",
+    "can_cast",
+    "promote_types",
+    "min_scalar_type",
+    "result_type",
+    "isfortran",
+    "empty_like",
+    "zeros_like",
+    "ones_like",
+    "correlate",
+    "convolve",
+    "inner",
+    "dot",
+    "outer",
+    "vdot",
+    "roll",
+    "rollaxis",
+    "moveaxis",
+    "cross",
+    "tensordot",
+    "little_endian",
+    "fromiter",
+    "array_equal",
+    "array_equiv",
+    "indices",
+    "fromfunction",
+    "isclose",
+    "isscalar",
+    "binary_repr",
+    "base_repr",
+    "ones",
+    "identity",
+    "allclose",
+    "putmask",
+    "flatnonzero",
+    "inf",
+    "nan",
+    "False_",
+    "True_",
+    "bitwise_not",
+    "full",
+    "full_like",
+    "matmul",
+    "vecdot",
+    "shares_memory",
+    "may_share_memory",
+]
+
+_T = TypeVar("_T")
+_SCT = TypeVar("_SCT", bound=generic)
+_DType = TypeVar("_DType", bound=np.dtype[Any])
+_ArrayType = TypeVar("_ArrayType", bound=np.ndarray[Any, Any])
+_SizeType = TypeVar("_SizeType", bound=int)
+_ShapeType = TypeVar("_ShapeType", bound=tuple[int, ...])
+
+_CorrelateMode: TypeAlias = L["valid", "same", "full"]
+
+@overload
+def zeros_like(
+    a: _ArrayType,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: L[True] = ...,
+    shape: None = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> _ArrayType: ...
+@overload
+def zeros_like(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def zeros_like(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+@overload
+def zeros_like(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def zeros_like(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+
+ones: Final[_ConstructorEmpty]
+
+@overload
+def ones_like(
+    a: _ArrayType,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: L[True] = ...,
+    shape: None = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> _ArrayType: ...
+@overload
+def ones_like(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones_like(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+@overload
+def ones_like(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones_like(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+
+# TODO: Add overloads for bool, int, float, complex, str, bytes, and memoryview
+# 1-D shape
+@overload
+def full(
+    shape: _SizeType,
+    fill_value: _SCT,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> _Array[tuple[_SizeType], _SCT]: ...
+@overload
+def full(
+    shape: _SizeType,
+    fill_value: Any,
+    dtype: _DType | _SupportsDType[_DType],
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> np.ndarray[tuple[_SizeType], _DType]: ...
+@overload
+def full(
+    shape: _SizeType,
+    fill_value: Any,
+    dtype: type[_SCT],
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> _Array[tuple[_SizeType], _SCT]: ...
+@overload
+def full(
+    shape: _SizeType,
+    fill_value: Any,
+    dtype: None | DTypeLike = ...,
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> _Array[tuple[_SizeType], Any]: ...
+# known shape
+@overload
+def full(
+    shape: _ShapeType,
+    fill_value: _SCT,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> _Array[_ShapeType, _SCT]: ...
+@overload
+def full(
+    shape: _ShapeType,
+    fill_value: Any,
+    dtype: _DType | _SupportsDType[_DType],
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> np.ndarray[_ShapeType, _DType]: ...
+@overload
+def full(
+    shape: _ShapeType,
+    fill_value: Any,
+    dtype: type[_SCT],
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> _Array[_ShapeType, _SCT]: ...
+@overload
+def full(
+    shape: _ShapeType,
+    fill_value: Any,
+    dtype: None | DTypeLike = ...,
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> _Array[_ShapeType, Any]: ...
+# unknown shape
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: _SCT,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> NDArray[_SCT]: ...
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: _DType | _SupportsDType[_DType],
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> np.ndarray[Any, _DType]: ...
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: type[_SCT],
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> NDArray[_SCT]: ...
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: None | DTypeLike = ...,
+    order: _OrderCF = ...,
+    **kwargs: Unpack[_KwargsEmpty],
+) -> NDArray[Any]: ...
+
+@overload
+def full_like(
+    a: _ArrayType,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: L[True] = ...,
+    shape: None = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> _ArrayType: ...
+@overload
+def full_like(
+    a: _ArrayLike[_SCT],
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full_like(
+    a: object,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+@overload
+def full_like(
+    a: Any,
+    fill_value: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full_like(
+    a: Any,
+    fill_value: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+    *,
+    device: None | L["cpu"] = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def count_nonzero(
+    a: ArrayLike,
+    axis: None = ...,
+    *,
+    keepdims: L[False] = ...,
+) -> int: ...
+@overload
+def count_nonzero(
+    a: ArrayLike,
+    axis: _ShapeLike = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...  # TODO: np.intp or ndarray[np.intp]
+
+def isfortran(a: NDArray[Any] | generic) -> bool: ...
+
+def argwhere(a: ArrayLike) -> NDArray[intp]: ...
+
+def flatnonzero(a: ArrayLike) -> NDArray[intp]: ...
+
+@overload
+def correlate(
+    a: _ArrayLikeUnknown,
+    v: _ArrayLikeUnknown,
+    mode: _CorrelateMode = ...,
+) -> NDArray[Any]: ...
+@overload
+def correlate(
+    a: _ArrayLikeBool_co,
+    v: _ArrayLikeBool_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def correlate(
+    a: _ArrayLikeUInt_co,
+    v: _ArrayLikeUInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeInt_co,
+    v: _ArrayLikeInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeTD64_co,
+    v: _ArrayLikeTD64_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def correlate(
+    a: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def convolve(
+    a: _ArrayLikeUnknown,
+    v: _ArrayLikeUnknown,
+    mode: _CorrelateMode = ...,
+) -> NDArray[Any]: ...
+@overload
+def convolve(
+    a: _ArrayLikeBool_co,
+    v: _ArrayLikeBool_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def convolve(
+    a: _ArrayLikeUInt_co,
+    v: _ArrayLikeUInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeInt_co,
+    v: _ArrayLikeInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeTD64_co,
+    v: _ArrayLikeTD64_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def convolve(
+    a: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def outer(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def outer(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    out: None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def outer(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    out: None = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    out: None = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    out: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    out: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeTD64_co,
+    b: _ArrayLikeTD64_co,
+    out: None = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def outer(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    out: None = ...,
+) -> NDArray[object_]: ...
+@overload
+def outer(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    b: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    out: _ArrayType,
+) -> _ArrayType: ...
+
+@overload
+def tensordot(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[Any]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeTD64_co,
+    b: _ArrayLikeTD64_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def roll(
+    a: _ArrayLike[_SCT],
+    shift: _ShapeLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def roll(
+    a: ArrayLike,
+    shift: _ShapeLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[Any]: ...
+
+def rollaxis(
+    a: NDArray[_SCT],
+    axis: int,
+    start: int = ...,
+) -> NDArray[_SCT]: ...
+
+def moveaxis(
+    a: NDArray[_SCT],
+    source: _ShapeLike,
+    destination: _ShapeLike,
+) -> NDArray[_SCT]: ...
+
+@overload
+def cross(
+    x1: _ArrayLikeUnknown,
+    x2: _ArrayLikeUnknown,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[Any]: ...
+@overload
+def cross(
+    x1: _ArrayLikeBool_co,
+    x2: _ArrayLikeBool_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NoReturn: ...
+@overload
+def cross(
+    x1: _ArrayLikeUInt_co,
+    x2: _ArrayLikeUInt_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def cross(
+    x1: _ArrayLikeInt_co,
+    x2: _ArrayLikeInt_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def cross(
+    x1: _ArrayLikeFloat_co,
+    x2: _ArrayLikeFloat_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cross(
+    x1: _ArrayLikeComplex_co,
+    x2: _ArrayLikeComplex_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cross(
+    x1: _ArrayLikeObject_co,
+    x2: _ArrayLikeObject_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: type[int] = ...,
+    sparse: L[False] = ...,
+) -> NDArray[int_]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: type[int] = ...,
+    sparse: L[True] = ...,
+) -> tuple[NDArray[int_], ...]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: _DTypeLike[_SCT],
+    sparse: L[False] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: _DTypeLike[_SCT],
+    sparse: L[True],
+) -> tuple[NDArray[_SCT], ...]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: DTypeLike,
+    sparse: L[False] = ...,
+) -> NDArray[Any]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: DTypeLike,
+    sparse: L[True],
+) -> tuple[NDArray[Any], ...]: ...
+
+def fromfunction(
+    function: Callable[..., _T],
+    shape: Sequence[int],
+    *,
+    dtype: DTypeLike = ...,
+    like: _SupportsArrayFunc = ...,
+    **kwargs: Any,
+) -> _T: ...
+
+def isscalar(element: object) -> TypeGuard[
+    generic | bool | int | float | complex | str | bytes | memoryview
+]: ...
+
+def binary_repr(num: SupportsIndex, width: None | int = ...) -> str: ...
+
+def base_repr(
+    number: SupportsAbs[float],
+    base: float = ...,
+    padding: SupportsIndex = ...,
+) -> str: ...
+
+@overload
+def identity(
+    n: int,
+    dtype: None = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def identity(
+    n: int,
+    dtype: _DTypeLike[_SCT],
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def identity(
+    n: int,
+    dtype: DTypeLike,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+def allclose(
+    a: ArrayLike,
+    b: ArrayLike,
+    rtol: ArrayLike = ...,
+    atol: ArrayLike = ...,
+    equal_nan: bool = ...,
+) -> bool: ...
+
+@overload
+def isclose(
+    a: _ScalarLike_co,
+    b: _ScalarLike_co,
+    rtol: ArrayLike = ...,
+    atol: ArrayLike = ...,
+    equal_nan: bool = ...,
+) -> np.bool: ...
+@overload
+def isclose(
+    a: ArrayLike,
+    b: ArrayLike,
+    rtol: ArrayLike = ...,
+    atol: ArrayLike = ...,
+    equal_nan: bool = ...,
+) -> NDArray[np.bool]: ...
+
+def array_equal(a1: ArrayLike, a2: ArrayLike, equal_nan: bool = ...) -> bool: ...
+
+def array_equiv(a1: ArrayLike, a2: ArrayLike) -> bool: ...
+
+@overload
+def astype(
+    x: ndarray[_ShapeType, dtype[Any]],
+    dtype: _DTypeLike[_SCT],
+    copy: bool = ...,
+    device: None | L["cpu"] = ...,
+) -> ndarray[_ShapeType, dtype[_SCT]]: ...
+@overload
+def astype(
+    x: ndarray[_ShapeType, dtype[Any]],
+    dtype: DTypeLike,
+    copy: bool = ...,
+    device: None | L["cpu"] = ...,
+) -> ndarray[_ShapeType, dtype[Any]]: ...

janus/lib/python3.10/site-packages/numpy/_core/numerictypes.py

@@ -0,0 +1,629 @@
+"""
+numerictypes: Define the numeric type objects
+
+This module is designed so "from numerictypes import \\*" is safe.
+Exported symbols include:
+
+  Dictionary with all registered number types (including aliases):
+    sctypeDict
+
+  Type objects (not all will be available, depends on platform):
+      see variable sctypes for which ones you have
+
+    Bit-width names
+
+    int8 int16 int32 int64 int128
+    uint8 uint16 uint32 uint64 uint128
+    float16 float32 float64 float96 float128 float256
+    complex32 complex64 complex128 complex192 complex256 complex512
+    datetime64 timedelta64
+
+    c-based names
+
+    bool
+
+    object_
+
+    void, str_
+
+    byte, ubyte,
+    short, ushort
+    intc, uintc,
+    intp, uintp,
+    int_, uint,
+    longlong, ulonglong,
+
+    single, csingle,
+    double, cdouble,
+    longdouble, clongdouble,
+
+   As part of the type-hierarchy:    xx -- is bit-width
+
+   generic
+     +-> bool                                   (kind=b)
+     +-> number
+     |   +-> integer
+     |   |   +-> signedinteger     (intxx)      (kind=i)
+     |   |   |     byte
+     |   |   |     short
+     |   |   |     intc
+     |   |   |     intp
+     |   |   |     int_
+     |   |   |     longlong
+     |   |   \\-> unsignedinteger  (uintxx)     (kind=u)
+     |   |         ubyte
+     |   |         ushort
+     |   |         uintc
+     |   |         uintp
+     |   |         uint
+     |   |         ulonglong
+     |   +-> inexact
+     |       +-> floating          (floatxx)    (kind=f)
+     |       |     half
+     |       |     single
+     |       |     double
+     |       |     longdouble
+     |       \\-> complexfloating  (complexxx)  (kind=c)
+     |             csingle
+     |             cdouble
+     |             clongdouble
+     +-> flexible
+     |   +-> character
+     |   |     bytes_                           (kind=S)
+     |   |     str_                             (kind=U)
+     |   |
+     |   \\-> void                              (kind=V)
+     \\-> object_ (not used much)               (kind=O)
+
+"""
+import numbers
+import warnings
+
+from . import multiarray as ma
+from .multiarray import (
+        ndarray, dtype, datetime_data, datetime_as_string,
+        busday_offset, busday_count, is_busday, busdaycalendar
+        )
+from .._utils import set_module
+
+# we add more at the bottom
+__all__ = [
+    'ScalarType', 'typecodes', 'issubdtype', 'datetime_data',
+    'datetime_as_string', 'busday_offset', 'busday_count',
+    'is_busday', 'busdaycalendar', 'isdtype'
+]
+
+# we don't need all these imports, but we need to keep them for compatibility
+# for users using np._core.numerictypes.UPPER_TABLE
+from ._string_helpers import (  # noqa: F401
+    english_lower, english_upper, english_capitalize, LOWER_TABLE, UPPER_TABLE
+)
+
+from ._type_aliases import (
+    sctypeDict, allTypes, sctypes
+)
+from ._dtype import _kind_name
+
+# we don't export these for import *, but we do want them accessible
+# as numerictypes.bool, etc.
+from builtins import bool, int, float, complex, object, str, bytes  # noqa: F401, UP029
+
+
+# We use this later
+generic = allTypes['generic']
+
+genericTypeRank = ['bool', 'int8', 'uint8', 'int16', 'uint16',
+                   'int32', 'uint32', 'int64', 'uint64', 'int128',
+                   'uint128', 'float16',
+                   'float32', 'float64', 'float80', 'float96', 'float128',
+                   'float256',
+                   'complex32', 'complex64', 'complex128', 'complex160',
+                   'complex192', 'complex256', 'complex512', 'object']
+
+@set_module('numpy')
+def maximum_sctype(t):
+    """
+    Return the scalar type of highest precision of the same kind as the input.
+
+    .. deprecated:: 2.0
+        Use an explicit dtype like int64 or float64 instead.
+
+    Parameters
+    ----------
+    t : dtype or dtype specifier
+        The input data type. This can be a `dtype` object or an object that
+        is convertible to a `dtype`.
+
+    Returns
+    -------
+    out : dtype
+        The highest precision data type of the same kind (`dtype.kind`) as `t`.
+
+    See Also
+    --------
+    obj2sctype, mintypecode, sctype2char
+    dtype
+
+    Examples
+    --------
+    >>> from numpy._core.numerictypes import maximum_sctype
+    >>> maximum_sctype(int)
+    <class 'numpy.int64'>
+    >>> maximum_sctype(np.uint8)
+    <class 'numpy.uint64'>
+    >>> maximum_sctype(complex)
+    <class 'numpy.complex256'> # may vary
+
+    >>> maximum_sctype(str)
+    <class 'numpy.str_'>
+
+    >>> maximum_sctype('i2')
+    <class 'numpy.int64'>
+    >>> maximum_sctype('f4')
+    <class 'numpy.float128'> # may vary
+
+    """
+
+    # Deprecated in NumPy 2.0, 2023-07-11
+    warnings.warn(
+        "`maximum_sctype` is deprecated. Use an explicit dtype like int64 "
+        "or float64 instead. (deprecated in NumPy 2.0)",
+        DeprecationWarning,
+        stacklevel=2
+    )
+
+    g = obj2sctype(t)
+    if g is None:
+        return t
+    t = g
+    base = _kind_name(dtype(t))
+    if base in sctypes:
+        return sctypes[base][-1]
+    else:
+        return t
+
+
+@set_module('numpy')
+def issctype(rep):
+    """
+    Determines whether the given object represents a scalar data-type.
+
+    Parameters
+    ----------
+    rep : any
+        If `rep` is an instance of a scalar dtype, True is returned. If not,
+        False is returned.
+
+    Returns
+    -------
+    out : bool
+        Boolean result of check whether `rep` is a scalar dtype.
+
+    See Also
+    --------
+    issubsctype, issubdtype, obj2sctype, sctype2char
+
+    Examples
+    --------
+    >>> from numpy._core.numerictypes import issctype
+    >>> issctype(np.int32)
+    True
+    >>> issctype(list)
+    False
+    >>> issctype(1.1)
+    False
+
+    Strings are also a scalar type:
+
+    >>> issctype(np.dtype('str'))
+    True
+
+    """
+    if not isinstance(rep, (type, dtype)):
+        return False
+    try:
+        res = obj2sctype(rep)
+        if res and res != object_:
+            return True
+        else:
+            return False
+    except Exception:
+        return False
+
+
+@set_module('numpy')
+def obj2sctype(rep, default=None):
+    """
+    Return the scalar dtype or NumPy equivalent of Python type of an object.
+
+    Parameters
+    ----------
+    rep : any
+        The object of which the type is returned.
+    default : any, optional
+        If given, this is returned for objects whose types can not be
+        determined. If not given, None is returned for those objects.
+
+    Returns
+    -------
+    dtype : dtype or Python type
+        The data type of `rep`.
+
+    See Also
+    --------
+    sctype2char, issctype, issubsctype, issubdtype
+
+    Examples
+    --------
+    >>> from numpy._core.numerictypes import obj2sctype
+    >>> obj2sctype(np.int32)
+    <class 'numpy.int32'>
+    >>> obj2sctype(np.array([1., 2.]))
+    <class 'numpy.float64'>
+    >>> obj2sctype(np.array([1.j]))
+    <class 'numpy.complex128'>
+
+    >>> obj2sctype(dict)
+    <class 'numpy.object_'>
+    >>> obj2sctype('string')
+
+    >>> obj2sctype(1, default=list)
+    <class 'list'>
+
+    """
+    # prevent abstract classes being upcast
+    if isinstance(rep, type) and issubclass(rep, generic):
+        return rep
+    # extract dtype from arrays
+    if isinstance(rep, ndarray):
+        return rep.dtype.type
+    # fall back on dtype to convert
+    try:
+        res = dtype(rep)
+    except Exception:
+        return default
+    else:
+        return res.type
+
+
+@set_module('numpy')
+def issubclass_(arg1, arg2):
+    """
+    Determine if a class is a subclass of a second class.
+
+    `issubclass_` is equivalent to the Python built-in ``issubclass``,
+    except that it returns False instead of raising a TypeError if one
+    of the arguments is not a class.
+
+    Parameters
+    ----------
+    arg1 : class
+        Input class. True is returned if `arg1` is a subclass of `arg2`.
+    arg2 : class or tuple of classes.
+        Input class. If a tuple of classes, True is returned if `arg1` is a
+        subclass of any of the tuple elements.
+
+    Returns
+    -------
+    out : bool
+        Whether `arg1` is a subclass of `arg2` or not.
+
+    See Also
+    --------
+    issubsctype, issubdtype, issctype
+
+    Examples
+    --------
+    >>> np.issubclass_(np.int32, int)
+    False
+    >>> np.issubclass_(np.int32, float)
+    False
+    >>> np.issubclass_(np.float64, float)
+    True
+
+    """
+    try:
+        return issubclass(arg1, arg2)
+    except TypeError:
+        return False
+
+
+@set_module('numpy')
+def issubsctype(arg1, arg2):
+    """
+    Determine if the first argument is a subclass of the second argument.
+
+    Parameters
+    ----------
+    arg1, arg2 : dtype or dtype specifier
+        Data-types.
+
+    Returns
+    -------
+    out : bool
+        The result.
+
+    See Also
+    --------
+    issctype, issubdtype, obj2sctype
+
+    Examples
+    --------
+    >>> from numpy._core import issubsctype
+    >>> issubsctype('S8', str)
+    False
+    >>> issubsctype(np.array([1]), int)
+    True
+    >>> issubsctype(np.array([1]), float)
+    False
+
+    """
+    return issubclass(obj2sctype(arg1), obj2sctype(arg2))
+
+
+class _PreprocessDTypeError(Exception):
+    pass
+
+
+def _preprocess_dtype(dtype):
+    """
+    Preprocess dtype argument by:
+      1. fetching type from a data type
+      2. verifying that types are built-in NumPy dtypes
+    """
+    if isinstance(dtype, ma.dtype):
+        dtype = dtype.type
+    if isinstance(dtype, ndarray) or dtype not in allTypes.values():
+        raise _PreprocessDTypeError
+    return dtype
+
+
+@set_module('numpy')
+def isdtype(dtype, kind):
+    """
+    Determine if a provided dtype is of a specified data type ``kind``.
+
+    This function only supports built-in NumPy's data types.
+    Third-party dtypes are not yet supported.
+
+    Parameters
+    ----------
+    dtype : dtype
+        The input dtype.
+    kind : dtype or str or tuple of dtypes/strs.
+        dtype or dtype kind. Allowed dtype kinds are:
+        * ``'bool'`` : boolean kind
+        * ``'signed integer'`` : signed integer data types
+        * ``'unsigned integer'`` : unsigned integer data types
+        * ``'integral'`` : integer data types
+        * ``'real floating'`` : real-valued floating-point data types
+        * ``'complex floating'`` : complex floating-point data types
+        * ``'numeric'`` : numeric data types
+
+    Returns
+    -------
+    out : bool
+
+    See Also
+    --------
+    issubdtype
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.isdtype(np.float32, np.float64)
+    False
+    >>> np.isdtype(np.float32, "real floating")
+    True
+    >>> np.isdtype(np.complex128, ("real floating", "complex floating"))
+    True
+
+    """
+    try:
+        dtype = _preprocess_dtype(dtype)
+    except _PreprocessDTypeError:
+        raise TypeError(
+            "dtype argument must be a NumPy dtype, "
+            f"but it is a {type(dtype)}."
+        ) from None
+
+    input_kinds = kind if isinstance(kind, tuple) else (kind,)
+
+    processed_kinds = set()
+
+    for kind in input_kinds:
+        if kind == "bool":
+            processed_kinds.add(allTypes["bool"])
+        elif kind == "signed integer":
+            processed_kinds.update(sctypes["int"])
+        elif kind == "unsigned integer":
+            processed_kinds.update(sctypes["uint"])
+        elif kind == "integral":
+            processed_kinds.update(sctypes["int"] + sctypes["uint"])
+        elif kind == "real floating":
+            processed_kinds.update(sctypes["float"])
+        elif kind == "complex floating":
+            processed_kinds.update(sctypes["complex"])
+        elif kind == "numeric":
+            processed_kinds.update(
+                sctypes["int"] + sctypes["uint"] +
+                sctypes["float"] + sctypes["complex"]
+            )
+        elif isinstance(kind, str):
+            raise ValueError(
+                "kind argument is a string, but"
+                f" {kind!r} is not a known kind name."
+            )
+        else:
+            try:
+                kind = _preprocess_dtype(kind)
+            except _PreprocessDTypeError:
+                raise TypeError(
+                    "kind argument must be comprised of "
+                    "NumPy dtypes or strings only, "
+                    f"but is a {type(kind)}."
+                ) from None
+            processed_kinds.add(kind)
+
+    return dtype in processed_kinds
+
+
+@set_module('numpy')
+def issubdtype(arg1, arg2):
+    r"""
+    Returns True if first argument is a typecode lower/equal in type hierarchy.
+
+    This is like the builtin :func:`issubclass`, but for `dtype`\ s.
+
+    Parameters
+    ----------
+    arg1, arg2 : dtype_like
+        `dtype` or object coercible to one
+
+    Returns
+    -------
+    out : bool
+
+    See Also
+    --------
+    :ref:`arrays.scalars` : Overview of the numpy type hierarchy.
+
+    Examples
+    --------
+    `issubdtype` can be used to check the type of arrays:
+
+    >>> ints = np.array([1, 2, 3], dtype=np.int32)
+    >>> np.issubdtype(ints.dtype, np.integer)
+    True
+    >>> np.issubdtype(ints.dtype, np.floating)
+    False
+
+    >>> floats = np.array([1, 2, 3], dtype=np.float32)
+    >>> np.issubdtype(floats.dtype, np.integer)
+    False
+    >>> np.issubdtype(floats.dtype, np.floating)
+    True
+
+    Similar types of different sizes are not subdtypes of each other:
+
+    >>> np.issubdtype(np.float64, np.float32)
+    False
+    >>> np.issubdtype(np.float32, np.float64)
+    False
+
+    but both are subtypes of `floating`:
+
+    >>> np.issubdtype(np.float64, np.floating)
+    True
+    >>> np.issubdtype(np.float32, np.floating)
+    True
+
+    For convenience, dtype-like objects are allowed too:
+
+    >>> np.issubdtype('S1', np.bytes_)
+    True
+    >>> np.issubdtype('i4', np.signedinteger)
+    True
+
+    """
+    if not issubclass_(arg1, generic):
+        arg1 = dtype(arg1).type
+    if not issubclass_(arg2, generic):
+        arg2 = dtype(arg2).type
+
+    return issubclass(arg1, arg2)
+
+
+@set_module('numpy')
+def sctype2char(sctype):
+    """
+    Return the string representation of a scalar dtype.
+
+    Parameters
+    ----------
+    sctype : scalar dtype or object
+        If a scalar dtype, the corresponding string character is
+        returned. If an object, `sctype2char` tries to infer its scalar type
+        and then return the corresponding string character.
+
+    Returns
+    -------
+    typechar : str
+        The string character corresponding to the scalar type.
+
+    Raises
+    ------
+    ValueError
+        If `sctype` is an object for which the type can not be inferred.
+
+    See Also
+    --------
+    obj2sctype, issctype, issubsctype, mintypecode
+
+    Examples
+    --------
+    >>> from numpy._core.numerictypes import sctype2char
+    >>> for sctype in [np.int32, np.double, np.cdouble, np.bytes_, np.ndarray]:
+    ...     print(sctype2char(sctype))
+    l # may vary
+    d
+    D
+    S
+    O
+
+    >>> x = np.array([1., 2-1.j])
+    >>> sctype2char(x)
+    'D'
+    >>> sctype2char(list)
+    'O'
+
+    """
+    sctype = obj2sctype(sctype)
+    if sctype is None:
+        raise ValueError("unrecognized type")
+    if sctype not in sctypeDict.values():
+        # for compatibility
+        raise KeyError(sctype)
+    return dtype(sctype).char
+
+
+def _scalar_type_key(typ):
+    """A ``key`` function for `sorted`."""
+    dt = dtype(typ)
+    return (dt.kind.lower(), dt.itemsize)
+
+
+ScalarType = [int, float, complex, bool, bytes, str, memoryview]
+ScalarType += sorted(set(sctypeDict.values()), key=_scalar_type_key)
+ScalarType = tuple(ScalarType)
+
+
+# Now add the types we've determined to this module
+for key in allTypes:
+    globals()[key] = allTypes[key]
+    __all__.append(key)
+
+del key
+
+typecodes = {'Character': 'c',
+             'Integer': 'bhilqnp',
+             'UnsignedInteger': 'BHILQNP',
+             'Float': 'efdg',
+             'Complex': 'FDG',
+             'AllInteger': 'bBhHiIlLqQnNpP',
+             'AllFloat': 'efdgFDG',
+             'Datetime': 'Mm',
+             'All': '?bhilqnpBHILQNPefdgFDGSUVOMm'}
+
+# backwards compatibility --- deprecated name
+# Formal deprecation: Numpy 1.20.0, 2020-10-19 (see numpy/__init__.py)
+typeDict = sctypeDict
+
+def _register_types():
+    numbers.Integral.register(integer)
+    numbers.Complex.register(inexact)
+    numbers.Real.register(floating)
+    numbers.Number.register(number)
+
+
+_register_types()

janus/lib/python3.10/site-packages/numpy/_core/numerictypes.pyi

@@ -0,0 +1,217 @@
+import builtins
+from typing import (
+    Any,
+    Literal as L,
+    TypedDict,
+    type_check_only,
+)
+
+import numpy as np
+from numpy import (
+    dtype,
+    generic,
+    bool,
+    bool_,
+    uint8,
+    uint16,
+    uint32,
+    uint64,
+    ubyte,
+    ushort,
+    uintc,
+    ulong,
+    ulonglong,
+    uintp,
+    uint,
+    int8,
+    int16,
+    int32,
+    int64,
+    byte,
+    short,
+    intc,
+    long,
+    longlong,
+    intp,
+    int_,
+    float16,
+    float32,
+    float64,
+    half,
+    single,
+    double,
+    longdouble,
+    complex64,
+    complex128,
+    csingle,
+    cdouble,
+    clongdouble,
+    datetime64,
+    timedelta64,
+    object_,
+    str_,
+    bytes_,
+    void,
+    unsignedinteger,
+    character,
+    inexact,
+    number,
+    integer,
+    flexible,
+    complexfloating,
+    signedinteger,
+    floating,
+)
+from ._type_aliases import sctypeDict  # noqa: F401
+from .multiarray import (
+    busday_count,
+    busday_offset,
+    busdaycalendar,
+    datetime_as_string,
+    datetime_data,
+    is_busday,
+)
+
+from numpy._typing import DTypeLike
+from numpy._typing._extended_precision import (
+    uint128,
+    uint256,
+    int128,
+    int256,
+    float80,
+    float96,
+    float128,
+    float256,
+    complex160,
+    complex192,
+    complex256,
+    complex512,
+)
+
+__all__ = [
+    "ScalarType",
+    "typecodes",
+    "issubdtype",
+    "datetime_data",
+    "datetime_as_string",
+    "busday_offset",
+    "busday_count",
+    "is_busday",
+    "busdaycalendar",
+    "isdtype",
+    "generic",
+    "unsignedinteger",
+    "character",
+    "inexact",
+    "number",
+    "integer",
+    "flexible",
+    "complexfloating",
+    "signedinteger",
+    "floating",
+    "bool",
+    "float16",
+    "float32",
+    "float64",
+    "longdouble",
+    "complex64",
+    "complex128",
+    "clongdouble",
+    "bytes_",
+    "str_",
+    "void",
+    "object_",
+    "datetime64",
+    "timedelta64",
+    "int8",
+    "byte",
+    "uint8",
+    "ubyte",
+    "int16",
+    "short",
+    "uint16",
+    "ushort",
+    "int32",
+    "intc",
+    "uint32",
+    "uintc",
+    "int64",
+    "long",
+    "uint64",
+    "ulong",
+    "longlong",
+    "ulonglong",
+    "intp",
+    "uintp",
+    "double",
+    "cdouble",
+    "single",
+    "csingle",
+    "half",
+    "bool_",
+    "int_",
+    "uint",
+    "uint128",
+    "uint256",
+    "int128",
+    "int256",
+    "float80",
+    "float96",
+    "float128",
+    "float256",
+    "complex160",
+    "complex192",
+    "complex256",
+    "complex512",
+]
+
+@type_check_only
+class _TypeCodes(TypedDict):
+    Character: L['c']
+    Integer: L['bhilqnp']
+    UnsignedInteger: L['BHILQNP']
+    Float: L['efdg']
+    Complex: L['FDG']
+    AllInteger: L['bBhHiIlLqQnNpP']
+    AllFloat: L['efdgFDG']
+    Datetime: L['Mm']
+    All: L['?bhilqnpBHILQNPefdgFDGSUVOMm']
+
+def isdtype(dtype: dtype[Any] | type[Any], kind: DTypeLike | tuple[DTypeLike, ...]) -> builtins.bool: ...
+
+def issubdtype(arg1: DTypeLike, arg2: DTypeLike) -> builtins.bool: ...
+
+typecodes: _TypeCodes
+ScalarType: tuple[
+    type[int],
+    type[float],
+    type[complex],
+    type[builtins.bool],
+    type[bytes],
+    type[str],
+    type[memoryview],
+    type[np.bool],
+    type[csingle],
+    type[cdouble],
+    type[clongdouble],
+    type[half],
+    type[single],
+    type[double],
+    type[longdouble],
+    type[byte],
+    type[short],
+    type[intc],
+    type[long],
+    type[longlong],
+    type[timedelta64],
+    type[datetime64],
+    type[object_],
+    type[bytes_],
+    type[str_],
+    type[ubyte],
+    type[ushort],
+    type[uintc],
+    type[ulong],
+    type[ulonglong],
+    type[void],
+]

janus/lib/python3.10/site-packages/numpy/_core/printoptions.py

@@ -0,0 +1,32 @@
+"""
+Stores and defines the low-level format_options context variable.
+
+This is defined in its own file outside of the arrayprint module
+so we can import it from C while initializing the multiarray
+C module during import without introducing circular dependencies.
+"""
+
+import sys
+from contextvars import ContextVar
+
+__all__ = ["format_options"]
+
+default_format_options_dict = {
+    "edgeitems": 3,  # repr N leading and trailing items of each dimension
+    "threshold": 1000,  # total items > triggers array summarization
+    "floatmode": "maxprec",
+    "precision": 8,  # precision of floating point representations
+    "suppress": False,  # suppress printing small floating values in exp format
+    "linewidth": 75,
+    "nanstr": "nan",
+    "infstr": "inf",
+    "sign": "-",
+    "formatter": None,
+    # Internally stored as an int to simplify comparisons; converted from/to
+    # str/False on the way in/out.
+    'legacy': sys.maxsize,
+    'override_repr': None,
+}
+
+format_options = ContextVar(
+    "format_options", default=default_format_options_dict.copy())

janus/lib/python3.10/site-packages/numpy/_core/records.pyi

@@ -0,0 +1,347 @@
+from _typeshed import StrOrBytesPath
+from collections.abc import Sequence, Iterable
+from types import EllipsisType
+from typing import (
+    Any,
+    TypeAlias,
+    TypeVar,
+    overload,
+    Protocol,
+    SupportsIndex,
+    Literal,
+    type_check_only
+)
+
+from numpy import (
+    ndarray,
+    dtype,
+    generic,
+    void,
+    _ByteOrder,
+    _SupportsBuffer,
+    _OrderKACF,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    DTypeLike,
+    NDArray,
+    _Shape,
+    _ShapeLike,
+    _ArrayLikeInt_co,
+    _ArrayLikeVoid_co,
+    _NestedSequence,
+)
+
+__all__ = [
+    "record",
+    "recarray",
+    "format_parser",
+    "fromarrays",
+    "fromrecords",
+    "fromstring",
+    "fromfile",
+    "array",
+    "find_duplicate",
+]
+
+_T = TypeVar("_T")
+_SCT = TypeVar("_SCT", bound=generic)
+_DType_co = TypeVar("_DType_co", bound=dtype[Any], covariant=True)
+_ShapeT_co = TypeVar("_ShapeT_co", bound=tuple[int, ...], covariant=True)
+
+_RecArray: TypeAlias = recarray[Any, dtype[_SCT]]
+
+@type_check_only
+class _SupportsReadInto(Protocol):
+    def seek(self, offset: int, whence: int, /) -> object: ...
+    def tell(self, /) -> int: ...
+    def readinto(self, buffer: memoryview, /) -> int: ...
+
+class record(void):
+    def __getattribute__(self, attr: str) -> Any: ...
+    def __setattr__(self, attr: str, val: ArrayLike) -> None: ...
+    def pprint(self) -> str: ...
+    @overload
+    def __getitem__(self, key: str | SupportsIndex) -> Any: ...
+    @overload
+    def __getitem__(self, key: list[str]) -> record: ...
+
+class recarray(ndarray[_ShapeT_co, _DType_co]):
+    # NOTE: While not strictly mandatory, we're demanding here that arguments
+    # for the `format_parser`- and `dtype`-based dtype constructors are
+    # mutually exclusive
+    @overload
+    def __new__(
+        subtype,
+        shape: _ShapeLike,
+        dtype: None = ...,
+        buf: None | _SupportsBuffer = ...,
+        offset: SupportsIndex = ...,
+        strides: None | _ShapeLike = ...,
+        *,
+        formats: DTypeLike,
+        names: None | str | Sequence[str] = ...,
+        titles: None | str | Sequence[str] = ...,
+        byteorder: None | _ByteOrder = ...,
+        aligned: bool = ...,
+        order: _OrderKACF = ...,
+    ) -> recarray[Any, dtype[record]]: ...
+    @overload
+    def __new__(
+        subtype,
+        shape: _ShapeLike,
+        dtype: DTypeLike,
+        buf: None | _SupportsBuffer = ...,
+        offset: SupportsIndex = ...,
+        strides: None | _ShapeLike = ...,
+        formats: None = ...,
+        names: None = ...,
+        titles: None = ...,
+        byteorder: None = ...,
+        aligned: Literal[False] = ...,
+        order: _OrderKACF = ...,
+    ) -> recarray[Any, dtype[Any]]: ...
+    def __array_finalize__(self, obj: object) -> None: ...
+    def __getattribute__(self, attr: str) -> Any: ...
+    def __setattr__(self, attr: str, val: ArrayLike) -> None: ...
+    @overload
+    def __getitem__(self, indx: (
+        SupportsIndex
+        | _ArrayLikeInt_co
+        | tuple[SupportsIndex | _ArrayLikeInt_co, ...]
+    )) -> Any: ...
+    @overload
+    def __getitem__(self: recarray[Any, dtype[void]], indx: (
+        None
+        | slice
+        | EllipsisType
+        | SupportsIndex
+        | _ArrayLikeInt_co
+        | tuple[None | slice | EllipsisType | _ArrayLikeInt_co | SupportsIndex, ...]
+    )) -> recarray[_Shape, _DType_co]: ...
+    @overload
+    def __getitem__(self, indx: (
+        None
+        | slice
+        | EllipsisType
+        | SupportsIndex
+        | _ArrayLikeInt_co
+        | tuple[None | slice | EllipsisType | _ArrayLikeInt_co | SupportsIndex, ...]
+    )) -> ndarray[_Shape, _DType_co]: ...
+    @overload
+    def __getitem__(self, indx: str) -> NDArray[Any]: ...
+    @overload
+    def __getitem__(self, indx: list[str]) -> recarray[_ShapeT_co, dtype[record]]: ...
+    @overload
+    def field(self, attr: int | str, val: None = ...) -> Any: ...
+    @overload
+    def field(self, attr: int | str, val: ArrayLike) -> None: ...
+
+class format_parser:
+    dtype: dtype[void]
+    def __init__(
+        self,
+        formats: DTypeLike,
+        names: None | str | Sequence[str],
+        titles: None | str | Sequence[str],
+        aligned: bool = ...,
+        byteorder: None | _ByteOrder = ...,
+    ) -> None: ...
+
+@overload
+def fromarrays(
+    arrayList: Iterable[ArrayLike],
+    dtype: DTypeLike = ...,
+    shape: None | _ShapeLike = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[Any]: ...
+@overload
+def fromarrays(
+    arrayList: Iterable[ArrayLike],
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def fromrecords(
+    recList: _ArrayLikeVoid_co | tuple[Any, ...] | _NestedSequence[tuple[Any, ...]],
+    dtype: DTypeLike = ...,
+    shape: None | _ShapeLike = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[record]: ...
+@overload
+def fromrecords(
+    recList: _ArrayLikeVoid_co | tuple[Any, ...] | _NestedSequence[tuple[Any, ...]],
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    formats: DTypeLike = ...,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def fromstring(
+    datastring: _SupportsBuffer,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[record]: ...
+@overload
+def fromstring(
+    datastring: _SupportsBuffer,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def fromfile(
+    fd: StrOrBytesPath | _SupportsReadInto,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[Any]: ...
+@overload
+def fromfile(
+    fd: StrOrBytesPath | _SupportsReadInto,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def array(
+    obj: _SCT | NDArray[_SCT],
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[_SCT]: ...
+@overload
+def array(
+    obj: ArrayLike,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[Any]: ...
+@overload
+def array(
+    obj: ArrayLike,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+    copy: bool = ...,
+) -> _RecArray[record]: ...
+@overload
+def array(
+    obj: None,
+    dtype: DTypeLike,
+    shape: _ShapeLike,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[Any]: ...
+@overload
+def array(
+    obj: None,
+    dtype: None = ...,
+    *,
+    shape: _ShapeLike,
+    offset: int = ...,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+    copy: bool = ...,
+) -> _RecArray[record]: ...
+@overload
+def array(
+    obj: _SupportsReadInto,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[Any]: ...
+@overload
+def array(
+    obj: _SupportsReadInto,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+    copy: bool = ...,
+) -> _RecArray[record]: ...
+
+def find_duplicate(list: Iterable[_T]) -> list[_T]: ...

janus/lib/python3.10/site-packages/numpy/_core/shape_base.py

@@ -0,0 +1,1004 @@
+__all__ = ['atleast_1d', 'atleast_2d', 'atleast_3d', 'block', 'hstack',
+           'stack', 'unstack', 'vstack']
+
+import functools
+import itertools
+import operator
+
+from . import numeric as _nx
+from . import overrides
+from .multiarray import array, asanyarray, normalize_axis_index
+from . import fromnumeric as _from_nx
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy')
+
+
+def _atleast_1d_dispatcher(*arys):
+    return arys
+
+
+@array_function_dispatch(_atleast_1d_dispatcher)
+def atleast_1d(*arys):
+    """
+    Convert inputs to arrays with at least one dimension.
+
+    Scalar inputs are converted to 1-dimensional arrays, whilst
+    higher-dimensional inputs are preserved.
+
+    Parameters
+    ----------
+    arys1, arys2, ... : array_like
+        One or more input arrays.
+
+    Returns
+    -------
+    ret : ndarray
+        An array, or tuple of arrays, each with ``a.ndim >= 1``.
+        Copies are made only if necessary.
+
+    See Also
+    --------
+    atleast_2d, atleast_3d
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.atleast_1d(1.0)
+    array([1.])
+
+    >>> x = np.arange(9.0).reshape(3,3)
+    >>> np.atleast_1d(x)
+    array([[0., 1., 2.],
+           [3., 4., 5.],
+           [6., 7., 8.]])
+    >>> np.atleast_1d(x) is x
+    True
+
+    >>> np.atleast_1d(1, [3, 4])
+    (array([1]), array([3, 4]))
+
+    """
+    if len(arys) == 1:
+        result = asanyarray(arys[0])
+        if result.ndim == 0:
+            result = result.reshape(1)
+        return result
+    res = []
+    for ary in arys:
+        result = asanyarray(ary)
+        if result.ndim == 0:
+            result = result.reshape(1)
+        res.append(result)
+    return tuple(res)
+
+
+def _atleast_2d_dispatcher(*arys):
+    return arys
+
+
+@array_function_dispatch(_atleast_2d_dispatcher)
+def atleast_2d(*arys):
+    """
+    View inputs as arrays with at least two dimensions.
+
+    Parameters
+    ----------
+    arys1, arys2, ... : array_like
+        One or more array-like sequences.  Non-array inputs are converted
+        to arrays.  Arrays that already have two or more dimensions are
+        preserved.
+
+    Returns
+    -------
+    res, res2, ... : ndarray
+        An array, or tuple of arrays, each with ``a.ndim >= 2``.
+        Copies are avoided where possible, and views with two or more
+        dimensions are returned.
+
+    See Also
+    --------
+    atleast_1d, atleast_3d
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.atleast_2d(3.0)
+    array([[3.]])
+
+    >>> x = np.arange(3.0)
+    >>> np.atleast_2d(x)
+    array([[0., 1., 2.]])
+    >>> np.atleast_2d(x).base is x
+    True
+
+    >>> np.atleast_2d(1, [1, 2], [[1, 2]])
+    (array([[1]]), array([[1, 2]]), array([[1, 2]]))
+
+    """
+    res = []
+    for ary in arys:
+        ary = asanyarray(ary)
+        if ary.ndim == 0:
+            result = ary.reshape(1, 1)
+        elif ary.ndim == 1:
+            result = ary[_nx.newaxis, :]
+        else:
+            result = ary
+        res.append(result)
+    if len(res) == 1:
+        return res[0]
+    else:
+        return tuple(res)
+
+
+def _atleast_3d_dispatcher(*arys):
+    return arys
+
+
+@array_function_dispatch(_atleast_3d_dispatcher)
+def atleast_3d(*arys):
+    """
+    View inputs as arrays with at least three dimensions.
+
+    Parameters
+    ----------
+    arys1, arys2, ... : array_like
+        One or more array-like sequences.  Non-array inputs are converted to
+        arrays.  Arrays that already have three or more dimensions are
+        preserved.
+
+    Returns
+    -------
+    res1, res2, ... : ndarray
+        An array, or tuple of arrays, each with ``a.ndim >= 3``.  Copies are
+        avoided where possible, and views with three or more dimensions are
+        returned.  For example, a 1-D array of shape ``(N,)`` becomes a view
+        of shape ``(1, N, 1)``, and a 2-D array of shape ``(M, N)`` becomes a
+        view of shape ``(M, N, 1)``.
+
+    See Also
+    --------
+    atleast_1d, atleast_2d
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.atleast_3d(3.0)
+    array([[[3.]]])
+
+    >>> x = np.arange(3.0)
+    >>> np.atleast_3d(x).shape
+    (1, 3, 1)
+
+    >>> x = np.arange(12.0).reshape(4,3)
+    >>> np.atleast_3d(x).shape
+    (4, 3, 1)
+    >>> np.atleast_3d(x).base is x.base  # x is a reshape, so not base itself
+    True
+
+    >>> for arr in np.atleast_3d([1, 2], [[1, 2]], [[[1, 2]]]):
+    ...     print(arr, arr.shape) # doctest: +SKIP
+    ...
+    [[[1]
+      [2]]] (1, 2, 1)
+    [[[1]
+      [2]]] (1, 2, 1)
+    [[[1 2]]] (1, 1, 2)
+
+    """
+    res = []
+    for ary in arys:
+        ary = asanyarray(ary)
+        if ary.ndim == 0:
+            result = ary.reshape(1, 1, 1)
+        elif ary.ndim == 1:
+            result = ary[_nx.newaxis, :, _nx.newaxis]
+        elif ary.ndim == 2:
+            result = ary[:, :, _nx.newaxis]
+        else:
+            result = ary
+        res.append(result)
+    if len(res) == 1:
+        return res[0]
+    else:
+        return tuple(res)
+
+
+def _arrays_for_stack_dispatcher(arrays):
+    if not hasattr(arrays, "__getitem__"):
+        raise TypeError('arrays to stack must be passed as a "sequence" type '
+                        'such as list or tuple.')
+
+    return tuple(arrays)
+
+
+def _vhstack_dispatcher(tup, *, dtype=None, casting=None):
+    return _arrays_for_stack_dispatcher(tup)
+
+
+@array_function_dispatch(_vhstack_dispatcher)
+def vstack(tup, *, dtype=None, casting="same_kind"):
+    """
+    Stack arrays in sequence vertically (row wise).
+
+    This is equivalent to concatenation along the first axis after 1-D arrays
+    of shape `(N,)` have been reshaped to `(1,N)`. Rebuilds arrays divided by
+    `vsplit`.
+
+    This function makes most sense for arrays with up to 3 dimensions. For
+    instance, for pixel-data with a height (first axis), width (second axis),
+    and r/g/b channels (third axis). The functions `concatenate`, `stack` and
+    `block` provide more general stacking and concatenation operations.
+
+    Parameters
+    ----------
+    tup : sequence of ndarrays
+        The arrays must have the same shape along all but the first axis.
+        1-D arrays must have the same length. In the case of a single
+        array_like input, it will be treated as a sequence of arrays; i.e.,
+        each element along the zeroth axis is treated as a separate array.
+
+    dtype : str or dtype
+        If provided, the destination array will have this dtype. Cannot be
+        provided together with `out`.
+
+        .. versionadded:: 1.24
+
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur. Defaults to 'same_kind'.
+
+        .. versionadded:: 1.24
+
+    Returns
+    -------
+    stacked : ndarray
+        The array formed by stacking the given arrays, will be at least 2-D.
+
+    See Also
+    --------
+    concatenate : Join a sequence of arrays along an existing axis.
+    stack : Join a sequence of arrays along a new axis.
+    block : Assemble an nd-array from nested lists of blocks.
+    hstack : Stack arrays in sequence horizontally (column wise).
+    dstack : Stack arrays in sequence depth wise (along third axis).
+    column_stack : Stack 1-D arrays as columns into a 2-D array.
+    vsplit : Split an array into multiple sub-arrays vertically (row-wise).
+    unstack : Split an array into a tuple of sub-arrays along an axis.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.array([1, 2, 3])
+    >>> b = np.array([4, 5, 6])
+    >>> np.vstack((a,b))
+    array([[1, 2, 3],
+           [4, 5, 6]])
+
+    >>> a = np.array([[1], [2], [3]])
+    >>> b = np.array([[4], [5], [6]])
+    >>> np.vstack((a,b))
+    array([[1],
+           [2],
+           [3],
+           [4],
+           [5],
+           [6]])
+
+    """
+    arrs = atleast_2d(*tup)
+    if not isinstance(arrs, tuple):
+        arrs = (arrs,)
+    return _nx.concatenate(arrs, 0, dtype=dtype, casting=casting)
+
+
+@array_function_dispatch(_vhstack_dispatcher)
+def hstack(tup, *, dtype=None, casting="same_kind"):
+    """
+    Stack arrays in sequence horizontally (column wise).
+
+    This is equivalent to concatenation along the second axis, except for 1-D
+    arrays where it concatenates along the first axis. Rebuilds arrays divided
+    by `hsplit`.
+
+    This function makes most sense for arrays with up to 3 dimensions. For
+    instance, for pixel-data with a height (first axis), width (second axis),
+    and r/g/b channels (third axis). The functions `concatenate`, `stack` and
+    `block` provide more general stacking and concatenation operations.
+
+    Parameters
+    ----------
+    tup : sequence of ndarrays
+        The arrays must have the same shape along all but the second axis,
+        except 1-D arrays which can be any length. In the case of a single
+        array_like input, it will be treated as a sequence of arrays; i.e.,
+        each element along the zeroth axis is treated as a separate array.
+
+    dtype : str or dtype
+        If provided, the destination array will have this dtype. Cannot be
+        provided together with `out`.
+
+        .. versionadded:: 1.24
+
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur. Defaults to 'same_kind'.
+
+        .. versionadded:: 1.24
+
+    Returns
+    -------
+    stacked : ndarray
+        The array formed by stacking the given arrays.
+
+    See Also
+    --------
+    concatenate : Join a sequence of arrays along an existing axis.
+    stack : Join a sequence of arrays along a new axis.
+    block : Assemble an nd-array from nested lists of blocks.
+    vstack : Stack arrays in sequence vertically (row wise).
+    dstack : Stack arrays in sequence depth wise (along third axis).
+    column_stack : Stack 1-D arrays as columns into a 2-D array.
+    hsplit : Split an array into multiple sub-arrays
+             horizontally (column-wise).
+    unstack : Split an array into a tuple of sub-arrays along an axis.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.array((1,2,3))
+    >>> b = np.array((4,5,6))
+    >>> np.hstack((a,b))
+    array([1, 2, 3, 4, 5, 6])
+    >>> a = np.array([[1],[2],[3]])
+    >>> b = np.array([[4],[5],[6]])
+    >>> np.hstack((a,b))
+    array([[1, 4],
+           [2, 5],
+           [3, 6]])
+
+    """
+    arrs = atleast_1d(*tup)
+    if not isinstance(arrs, tuple):
+        arrs = (arrs,)
+    # As a special case, dimension 0 of 1-dimensional arrays is "horizontal"
+    if arrs and arrs[0].ndim == 1:
+        return _nx.concatenate(arrs, 0, dtype=dtype, casting=casting)
+    else:
+        return _nx.concatenate(arrs, 1, dtype=dtype, casting=casting)
+
+
+def _stack_dispatcher(arrays, axis=None, out=None, *,
+                      dtype=None, casting=None):
+    arrays = _arrays_for_stack_dispatcher(arrays)
+    if out is not None:
+        # optimize for the typical case where only arrays is provided
+        arrays = list(arrays)
+        arrays.append(out)
+    return arrays
+
+
+@array_function_dispatch(_stack_dispatcher)
+def stack(arrays, axis=0, out=None, *, dtype=None, casting="same_kind"):
+    """
+    Join a sequence of arrays along a new axis.
+
+    The ``axis`` parameter specifies the index of the new axis in the
+    dimensions of the result. For example, if ``axis=0`` it will be the first
+    dimension and if ``axis=-1`` it will be the last dimension.
+
+    Parameters
+    ----------
+    arrays : sequence of ndarrays
+        Each array must have the same shape. In the case of a single ndarray
+        array_like input, it will be treated as a sequence of arrays; i.e.,
+        each element along the zeroth axis is treated as a separate array.
+
+    axis : int, optional
+        The axis in the result array along which the input arrays are stacked.
+
+    out : ndarray, optional
+        If provided, the destination to place the result. The shape must be
+        correct, matching that of what stack would have returned if no
+        out argument were specified.
+
+    dtype : str or dtype
+        If provided, the destination array will have this dtype. Cannot be
+        provided together with `out`.
+
+        .. versionadded:: 1.24
+
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur. Defaults to 'same_kind'.
+
+        .. versionadded:: 1.24
+
+
+    Returns
+    -------
+    stacked : ndarray
+        The stacked array has one more dimension than the input arrays.
+
+    See Also
+    --------
+    concatenate : Join a sequence of arrays along an existing axis.
+    block : Assemble an nd-array from nested lists of blocks.
+    split : Split array into a list of multiple sub-arrays of equal size.
+    unstack : Split an array into a tuple of sub-arrays along an axis.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> rng = np.random.default_rng()
+    >>> arrays = [rng.normal(size=(3,4)) for _ in range(10)]
+    >>> np.stack(arrays, axis=0).shape
+    (10, 3, 4)
+
+    >>> np.stack(arrays, axis=1).shape
+    (3, 10, 4)
+
+    >>> np.stack(arrays, axis=2).shape
+    (3, 4, 10)
+
+    >>> a = np.array([1, 2, 3])
+    >>> b = np.array([4, 5, 6])
+    >>> np.stack((a, b))
+    array([[1, 2, 3],
+           [4, 5, 6]])
+
+    >>> np.stack((a, b), axis=-1)
+    array([[1, 4],
+           [2, 5],
+           [3, 6]])
+
+    """
+    arrays = [asanyarray(arr) for arr in arrays]
+    if not arrays:
+        raise ValueError('need at least one array to stack')
+
+    shapes = {arr.shape for arr in arrays}
+    if len(shapes) != 1:
+        raise ValueError('all input arrays must have the same shape')
+
+    result_ndim = arrays[0].ndim + 1
+    axis = normalize_axis_index(axis, result_ndim)
+
+    sl = (slice(None),) * axis + (_nx.newaxis,)
+    expanded_arrays = [arr[sl] for arr in arrays]
+    return _nx.concatenate(expanded_arrays, axis=axis, out=out,
+                           dtype=dtype, casting=casting)
+
+def _unstack_dispatcher(x, /, *, axis=None):
+    return (x,)
+
+@array_function_dispatch(_unstack_dispatcher)
+def unstack(x, /, *, axis=0):
+    """
+    Split an array into a sequence of arrays along the given axis.
+
+    The ``axis`` parameter specifies the dimension along which the array will
+    be split. For example, if ``axis=0`` (the default) it will be the first
+    dimension and if ``axis=-1`` it will be the last dimension.
+
+    The result is a tuple of arrays split along ``axis``.
+
+    .. versionadded:: 2.1.0
+
+    Parameters
+    ----------
+    x : ndarray
+        The array to be unstacked.
+    axis : int, optional
+        Axis along which the array will be split. Default: ``0``.
+
+    Returns
+    -------
+    unstacked : tuple of ndarrays
+        The unstacked arrays.
+
+    See Also
+    --------
+    stack : Join a sequence of arrays along a new axis.
+    concatenate : Join a sequence of arrays along an existing axis.
+    block : Assemble an nd-array from nested lists of blocks.
+    split : Split array into a list of multiple sub-arrays of equal size.
+
+    Notes
+    -----
+    ``unstack`` serves as the reverse operation of :py:func:`stack`, i.e.,
+    ``stack(unstack(x, axis=axis), axis=axis) == x``.
+
+    This function is equivalent to ``tuple(np.moveaxis(x, axis, 0))``, since
+    iterating on an array iterates along the first axis.
+
+    Examples
+    --------
+    >>> arr = np.arange(24).reshape((2, 3, 4))
+    >>> np.unstack(arr)
+    (array([[ 0,  1,  2,  3],
+            [ 4,  5,  6,  7],
+            [ 8,  9, 10, 11]]),
+     array([[12, 13, 14, 15],
+            [16, 17, 18, 19],
+            [20, 21, 22, 23]]))
+    >>> np.unstack(arr, axis=1)
+    (array([[ 0,  1,  2,  3],
+            [12, 13, 14, 15]]),
+     array([[ 4,  5,  6,  7],
+            [16, 17, 18, 19]]),
+     array([[ 8,  9, 10, 11],
+            [20, 21, 22, 23]]))
+    >>> arr2 = np.stack(np.unstack(arr, axis=1), axis=1)
+    >>> arr2.shape
+    (2, 3, 4)
+    >>> np.all(arr == arr2)
+    np.True_
+
+    """
+    if x.ndim == 0:
+        raise ValueError("Input array must be at least 1-d.")
+    return tuple(_nx.moveaxis(x, axis, 0))
+
+# Internal functions to eliminate the overhead of repeated dispatch in one of
+# the two possible paths inside np.block.
+# Use getattr to protect against __array_function__ being disabled.
+_size = getattr(_from_nx.size, '__wrapped__', _from_nx.size)
+_ndim = getattr(_from_nx.ndim, '__wrapped__', _from_nx.ndim)
+_concatenate = getattr(_from_nx.concatenate,
+                       '__wrapped__', _from_nx.concatenate)
+
+
+def _block_format_index(index):
+    """
+    Convert a list of indices ``[0, 1, 2]`` into ``"arrays[0][1][2]"``.
+    """
+    idx_str = ''.join('[{}]'.format(i) for i in index if i is not None)
+    return 'arrays' + idx_str
+
+
+def _block_check_depths_match(arrays, parent_index=[]):
+    """
+    Recursive function checking that the depths of nested lists in `arrays`
+    all match. Mismatch raises a ValueError as described in the block
+    docstring below.
+
+    The entire index (rather than just the depth) needs to be calculated
+    for each innermost list, in case an error needs to be raised, so that
+    the index of the offending list can be printed as part of the error.
+
+    Parameters
+    ----------
+    arrays : nested list of arrays
+        The arrays to check
+    parent_index : list of int
+        The full index of `arrays` within the nested lists passed to
+        `_block_check_depths_match` at the top of the recursion.
+
+    Returns
+    -------
+    first_index : list of int
+        The full index of an element from the bottom of the nesting in
+        `arrays`. If any element at the bottom is an empty list, this will
+        refer to it, and the last index along the empty axis will be None.
+    max_arr_ndim : int
+        The maximum of the ndims of the arrays nested in `arrays`.
+    final_size: int
+        The number of elements in the final array. This is used the motivate
+        the choice of algorithm used using benchmarking wisdom.
+
+    """
+    if type(arrays) is tuple:
+        # not strictly necessary, but saves us from:
+        #  - more than one way to do things - no point treating tuples like
+        #    lists
+        #  - horribly confusing behaviour that results when tuples are
+        #    treated like ndarray
+        raise TypeError(
+            '{} is a tuple. '
+            'Only lists can be used to arrange blocks, and np.block does '
+            'not allow implicit conversion from tuple to ndarray.'.format(
+                _block_format_index(parent_index)
+            )
+        )
+    elif type(arrays) is list and len(arrays) > 0:
+        idxs_ndims = (_block_check_depths_match(arr, parent_index + [i])
+                      for i, arr in enumerate(arrays))
+
+        first_index, max_arr_ndim, final_size = next(idxs_ndims)
+        for index, ndim, size in idxs_ndims:
+            final_size += size
+            if ndim > max_arr_ndim:
+                max_arr_ndim = ndim
+            if len(index) != len(first_index):
+                raise ValueError(
+                    "List depths are mismatched. First element was at depth "
+                    "{}, but there is an element at depth {} ({})".format(
+                        len(first_index),
+                        len(index),
+                        _block_format_index(index)
+                    )
+                )
+            # propagate our flag that indicates an empty list at the bottom
+            if index[-1] is None:
+                first_index = index
+
+        return first_index, max_arr_ndim, final_size
+    elif type(arrays) is list and len(arrays) == 0:
+        # We've 'bottomed out' on an empty list
+        return parent_index + [None], 0, 0
+    else:
+        # We've 'bottomed out' - arrays is either a scalar or an array
+        size = _size(arrays)
+        return parent_index, _ndim(arrays), size
+
+
+def _atleast_nd(a, ndim):
+    # Ensures `a` has at least `ndim` dimensions by prepending
+    # ones to `a.shape` as necessary
+    return array(a, ndmin=ndim, copy=None, subok=True)
+
+
+def _accumulate(values):
+    return list(itertools.accumulate(values))
+
+
+def _concatenate_shapes(shapes, axis):
+    """Given array shapes, return the resulting shape and slices prefixes.
+
+    These help in nested concatenation.
+
+    Returns
+    -------
+    shape: tuple of int
+        This tuple satisfies::
+
+            shape, _ = _concatenate_shapes([arr.shape for shape in arrs], axis)
+            shape == concatenate(arrs, axis).shape
+
+    slice_prefixes: tuple of (slice(start, end), )
+        For a list of arrays being concatenated, this returns the slice
+        in the larger array at axis that needs to be sliced into.
+
+        For example, the following holds::
+
+            ret = concatenate([a, b, c], axis)
+            _, (sl_a, sl_b, sl_c) = concatenate_slices([a, b, c], axis)
+
+            ret[(slice(None),) * axis + sl_a] == a
+            ret[(slice(None),) * axis + sl_b] == b
+            ret[(slice(None),) * axis + sl_c] == c
+
+        These are called slice prefixes since they are used in the recursive
+        blocking algorithm to compute the left-most slices during the
+        recursion. Therefore, they must be prepended to rest of the slice
+        that was computed deeper in the recursion.
+
+        These are returned as tuples to ensure that they can quickly be added
+        to existing slice tuple without creating a new tuple every time.
+
+    """
+    # Cache a result that will be reused.
+    shape_at_axis = [shape[axis] for shape in shapes]
+
+    # Take a shape, any shape
+    first_shape = shapes[0]
+    first_shape_pre = first_shape[:axis]
+    first_shape_post = first_shape[axis+1:]
+
+    if any(shape[:axis] != first_shape_pre or
+           shape[axis+1:] != first_shape_post for shape in shapes):
+        raise ValueError(
+            'Mismatched array shapes in block along axis {}.'.format(axis))
+
+    shape = (first_shape_pre + (sum(shape_at_axis),) + first_shape[axis+1:])
+
+    offsets_at_axis = _accumulate(shape_at_axis)
+    slice_prefixes = [(slice(start, end),)
+                      for start, end in zip([0] + offsets_at_axis,
+                                            offsets_at_axis)]
+    return shape, slice_prefixes
+
+
+def _block_info_recursion(arrays, max_depth, result_ndim, depth=0):
+    """
+    Returns the shape of the final array, along with a list
+    of slices and a list of arrays that can be used for assignment inside the
+    new array
+
+    Parameters
+    ----------
+    arrays : nested list of arrays
+        The arrays to check
+    max_depth : list of int
+        The number of nested lists
+    result_ndim : int
+        The number of dimensions in thefinal array.
+
+    Returns
+    -------
+    shape : tuple of int
+        The shape that the final array will take on.
+    slices: list of tuple of slices
+        The slices into the full array required for assignment. These are
+        required to be prepended with ``(Ellipsis, )`` to obtain to correct
+        final index.
+    arrays: list of ndarray
+        The data to assign to each slice of the full array
+
+    """
+    if depth < max_depth:
+        shapes, slices, arrays = zip(
+            *[_block_info_recursion(arr, max_depth, result_ndim, depth+1)
+              for arr in arrays])
+
+        axis = result_ndim - max_depth + depth
+        shape, slice_prefixes = _concatenate_shapes(shapes, axis)
+
+        # Prepend the slice prefix and flatten the slices
+        slices = [slice_prefix + the_slice
+                  for slice_prefix, inner_slices in zip(slice_prefixes, slices)
+                  for the_slice in inner_slices]
+
+        # Flatten the array list
+        arrays = functools.reduce(operator.add, arrays)
+
+        return shape, slices, arrays
+    else:
+        # We've 'bottomed out' - arrays is either a scalar or an array
+        # type(arrays) is not list
+        # Return the slice and the array inside a list to be consistent with
+        # the recursive case.
+        arr = _atleast_nd(arrays, result_ndim)
+        return arr.shape, [()], [arr]
+
+
+def _block(arrays, max_depth, result_ndim, depth=0):
+    """
+    Internal implementation of block based on repeated concatenation.
+    `arrays` is the argument passed to
+    block. `max_depth` is the depth of nested lists within `arrays` and
+    `result_ndim` is the greatest of the dimensions of the arrays in
+    `arrays` and the depth of the lists in `arrays` (see block docstring
+    for details).
+    """
+    if depth < max_depth:
+        arrs = [_block(arr, max_depth, result_ndim, depth+1)
+                for arr in arrays]
+        return _concatenate(arrs, axis=-(max_depth-depth))
+    else:
+        # We've 'bottomed out' - arrays is either a scalar or an array
+        # type(arrays) is not list
+        return _atleast_nd(arrays, result_ndim)
+
+
+def _block_dispatcher(arrays):
+    # Use type(...) is list to match the behavior of np.block(), which special
+    # cases list specifically rather than allowing for generic iterables or
+    # tuple. Also, we know that list.__array_function__ will never exist.
+    if type(arrays) is list:
+        for subarrays in arrays:
+            yield from _block_dispatcher(subarrays)
+    else:
+        yield arrays
+
+
+@array_function_dispatch(_block_dispatcher)
+def block(arrays):
+    """
+    Assemble an nd-array from nested lists of blocks.
+
+    Blocks in the innermost lists are concatenated (see `concatenate`) along
+    the last dimension (-1), then these are concatenated along the
+    second-last dimension (-2), and so on until the outermost list is reached.
+
+    Blocks can be of any dimension, but will not be broadcasted using
+    the normal rules. Instead, leading axes of size 1 are inserted,
+    to make ``block.ndim`` the same for all blocks. This is primarily useful
+    for working with scalars, and means that code like ``np.block([v, 1])``
+    is valid, where ``v.ndim == 1``.
+
+    When the nested list is two levels deep, this allows block matrices to be
+    constructed from their components.
+
+    Parameters
+    ----------
+    arrays : nested list of array_like or scalars (but not tuples)
+        If passed a single ndarray or scalar (a nested list of depth 0), this
+        is returned unmodified (and not copied).
+
+        Elements shapes must match along the appropriate axes (without
+        broadcasting), but leading 1s will be prepended to the shape as
+        necessary to make the dimensions match.
+
+    Returns
+    -------
+    block_array : ndarray
+        The array assembled from the given blocks.
+
+        The dimensionality of the output is equal to the greatest of:
+
+        * the dimensionality of all the inputs
+        * the depth to which the input list is nested
+
+    Raises
+    ------
+    ValueError
+        * If list depths are mismatched - for instance, ``[[a, b], c]`` is
+          illegal, and should be spelt ``[[a, b], [c]]``
+        * If lists are empty - for instance, ``[[a, b], []]``
+
+    See Also
+    --------
+    concatenate : Join a sequence of arrays along an existing axis.
+    stack : Join a sequence of arrays along a new axis.
+    vstack : Stack arrays in sequence vertically (row wise).
+    hstack : Stack arrays in sequence horizontally (column wise).
+    dstack : Stack arrays in sequence depth wise (along third axis).
+    column_stack : Stack 1-D arrays as columns into a 2-D array.
+    vsplit : Split an array into multiple sub-arrays vertically (row-wise).
+    unstack : Split an array into a tuple of sub-arrays along an axis.
+
+    Notes
+    -----
+    When called with only scalars, ``np.block`` is equivalent to an ndarray
+    call. So ``np.block([[1, 2], [3, 4]])`` is equivalent to
+    ``np.array([[1, 2], [3, 4]])``.
+
+    This function does not enforce that the blocks lie on a fixed grid.
+    ``np.block([[a, b], [c, d]])`` is not restricted to arrays of the form::
+
+        AAAbb
+        AAAbb
+        cccDD
+
+    But is also allowed to produce, for some ``a, b, c, d``::
+
+        AAAbb
+        AAAbb
+        cDDDD
+
+    Since concatenation happens along the last axis first, `block` is *not*
+    capable of producing the following directly::
+
+        AAAbb
+        cccbb
+        cccDD
+
+    Matlab's "square bracket stacking", ``[A, B, ...; p, q, ...]``, is
+    equivalent to ``np.block([[A, B, ...], [p, q, ...]])``.
+
+    Examples
+    --------
+    The most common use of this function is to build a block matrix:
+
+    >>> import numpy as np
+    >>> A = np.eye(2) * 2
+    >>> B = np.eye(3) * 3
+    >>> np.block([
+    ...     [A,               np.zeros((2, 3))],
+    ...     [np.ones((3, 2)), B               ]
+    ... ])
+    array([[2., 0., 0., 0., 0.],
+           [0., 2., 0., 0., 0.],
+           [1., 1., 3., 0., 0.],
+           [1., 1., 0., 3., 0.],
+           [1., 1., 0., 0., 3.]])
+
+    With a list of depth 1, `block` can be used as `hstack`:
+
+    >>> np.block([1, 2, 3])              # hstack([1, 2, 3])
+    array([1, 2, 3])
+
+    >>> a = np.array([1, 2, 3])
+    >>> b = np.array([4, 5, 6])
+    >>> np.block([a, b, 10])             # hstack([a, b, 10])
+    array([ 1,  2,  3,  4,  5,  6, 10])
+
+    >>> A = np.ones((2, 2), int)
+    >>> B = 2 * A
+    >>> np.block([A, B])                 # hstack([A, B])
+    array([[1, 1, 2, 2],
+           [1, 1, 2, 2]])
+
+    With a list of depth 2, `block` can be used in place of `vstack`:
+
+    >>> a = np.array([1, 2, 3])
+    >>> b = np.array([4, 5, 6])
+    >>> np.block([[a], [b]])             # vstack([a, b])
+    array([[1, 2, 3],
+           [4, 5, 6]])
+
+    >>> A = np.ones((2, 2), int)
+    >>> B = 2 * A
+    >>> np.block([[A], [B]])             # vstack([A, B])
+    array([[1, 1],
+           [1, 1],
+           [2, 2],
+           [2, 2]])
+
+    It can also be used in place of `atleast_1d` and `atleast_2d`:
+
+    >>> a = np.array(0)
+    >>> b = np.array([1])
+    >>> np.block([a])                    # atleast_1d(a)
+    array([0])
+    >>> np.block([b])                    # atleast_1d(b)
+    array([1])
+
+    >>> np.block([[a]])                  # atleast_2d(a)
+    array([[0]])
+    >>> np.block([[b]])                  # atleast_2d(b)
+    array([[1]])
+
+
+    """
+    arrays, list_ndim, result_ndim, final_size = _block_setup(arrays)
+
+    # It was found through benchmarking that making an array of final size
+    # around 256x256 was faster by straight concatenation on a
+    # i7-7700HQ processor and dual channel ram 2400MHz.
+    # It didn't seem to matter heavily on the dtype used.
+    #
+    # A 2D array using repeated concatenation requires 2 copies of the array.
+    #
+    # The fastest algorithm will depend on the ratio of CPU power to memory
+    # speed.
+    # One can monitor the results of the benchmark
+    # https://pv.github.io/numpy-bench/#bench_shape_base.Block2D.time_block2d
+    # to tune this parameter until a C version of the `_block_info_recursion`
+    # algorithm is implemented which would likely be faster than the python
+    # version.
+    if list_ndim * final_size > (2 * 512 * 512):
+        return _block_slicing(arrays, list_ndim, result_ndim)
+    else:
+        return _block_concatenate(arrays, list_ndim, result_ndim)
+
+
+# These helper functions are mostly used for testing.
+# They allow us to write tests that directly call `_block_slicing`
+# or `_block_concatenate` without blocking large arrays to force the wisdom
+# to trigger the desired path.
+def _block_setup(arrays):
+    """
+    Returns
+    (`arrays`, list_ndim, result_ndim, final_size)
+    """
+    bottom_index, arr_ndim, final_size = _block_check_depths_match(arrays)
+    list_ndim = len(bottom_index)
+    if bottom_index and bottom_index[-1] is None:
+        raise ValueError(
+            'List at {} cannot be empty'.format(
+                _block_format_index(bottom_index)
+            )
+        )
+    result_ndim = max(arr_ndim, list_ndim)
+    return arrays, list_ndim, result_ndim, final_size
+
+
+def _block_slicing(arrays, list_ndim, result_ndim):
+    shape, slices, arrays = _block_info_recursion(
+        arrays, list_ndim, result_ndim)
+    dtype = _nx.result_type(*[arr.dtype for arr in arrays])
+
+    # Test preferring F only in the case that all input arrays are F
+    F_order = all(arr.flags['F_CONTIGUOUS'] for arr in arrays)
+    C_order = all(arr.flags['C_CONTIGUOUS'] for arr in arrays)
+    order = 'F' if F_order and not C_order else 'C'
+    result = _nx.empty(shape=shape, dtype=dtype, order=order)
+    # Note: In a c implementation, the function
+    # PyArray_CreateMultiSortedStridePerm could be used for more advanced
+    # guessing of the desired order.
+
+    for the_slice, arr in zip(slices, arrays):
+        result[(Ellipsis,) + the_slice] = arr
+    return result
+
+
+def _block_concatenate(arrays, list_ndim, result_ndim):
+    result = _block(arrays, list_ndim, result_ndim)
+    if list_ndim == 0:
+        # Catch an edge case where _block returns a view because
+        # `arrays` is a single numpy array and not a list of numpy arrays.
+        # This might copy scalars or lists twice, but this isn't a likely
+        # usecase for those interested in performance
+        result = result.copy()
+    return result

janus/lib/python3.10/site-packages/numpy/_core/shape_base.pyi

@@ -0,0 +1,147 @@
+from collections.abc import Sequence
+from typing import TypeVar, overload, Any, SupportsIndex
+
+from numpy import generic, _CastingKind
+from numpy._typing import (
+    NDArray,
+    ArrayLike,
+    DTypeLike,
+    _ArrayLike,
+    _DTypeLike,
+)
+
+__all__ = [
+    "atleast_1d",
+    "atleast_2d",
+    "atleast_3d",
+    "block",
+    "hstack",
+    "stack",
+    "unstack",
+    "vstack",
+]
+
+_SCT = TypeVar("_SCT", bound=generic)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+@overload
+def atleast_1d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_1d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_1d(*arys: ArrayLike) -> tuple[NDArray[Any], ...]: ...
+
+@overload
+def atleast_2d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_2d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_2d(*arys: ArrayLike) -> tuple[NDArray[Any], ...]: ...
+
+@overload
+def atleast_3d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_3d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_3d(*arys: ArrayLike) -> tuple[NDArray[Any], ...]: ...
+
+@overload
+def vstack(
+    tup: Sequence[_ArrayLike[_SCT]],
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def vstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def vstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+
+@overload
+def hstack(
+    tup: Sequence[_ArrayLike[_SCT]],
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def hstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def hstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+
+@overload
+def stack(
+    arrays: Sequence[_ArrayLike[_SCT]],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> _ArrayType: ...
+
+@overload
+def unstack(
+    array: _ArrayLike[_SCT],
+    /,
+    *,
+    axis: int = ...,
+) -> tuple[NDArray[_SCT], ...]: ...
+@overload
+def unstack(
+    array: ArrayLike,
+    /,
+    *,
+    axis: int = ...,
+) -> tuple[NDArray[Any], ...]: ...
+
+@overload
+def block(arrays: _ArrayLike[_SCT]) -> NDArray[_SCT]: ...
+@overload
+def block(arrays: ArrayLike) -> NDArray[Any]: ...

janus/lib/python3.10/site-packages/numpy/_core/strings.pyi

@@ -0,0 +1,478 @@
+from typing import Any, overload, TypeAlias
+
+import numpy as np
+from numpy._typing import (
+    NDArray,
+    _ArrayLikeStr_co as U_co,
+    _ArrayLikeBytes_co as S_co,
+    _ArrayLikeInt_co as i_co,
+    _ArrayLikeString_co as T_co,
+    _ArrayLikeAnyString_co as UST_co,
+    _Shape,
+    _SupportsArray,
+)
+
+
+_StringDTypeArray: TypeAlias = np.ndarray[_Shape, np.dtypes.StringDType]
+_StringDTypeSupportsArray: TypeAlias = _SupportsArray[np.dtypes.StringDType]
+_StringDTypeOrUnicodeArray: TypeAlias = np.ndarray[_Shape, np.dtype[np.str_]] | np.ndarray[_Shape, np.dtypes.StringDType]
+
+@overload
+def equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def not_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def not_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def not_equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def greater_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def greater_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def greater_equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def less_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def less_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def less_equal(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def greater(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def greater(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def greater(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def less(x1: U_co, x2: U_co) -> NDArray[np.bool]: ...
+@overload
+def less(x1: S_co, x2: S_co) -> NDArray[np.bool]: ...
+@overload
+def less(x1: T_co, x2: T_co) -> NDArray[np.bool]: ...
+
+@overload
+def add(x1: U_co, x2: U_co) -> NDArray[np.str_]: ...
+@overload
+def add(x1: S_co, x2: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def add(x1: _StringDTypeSupportsArray, x2: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def add(x1: T_co, T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def multiply(a: U_co, i: i_co) -> NDArray[np.str_]: ...
+@overload
+def multiply(a: S_co, i: i_co) -> NDArray[np.bytes_]: ...
+@overload
+def multiply(a: _StringDTypeSupportsArray, i: i_co) -> _StringDTypeArray: ...
+@overload
+def multiply(a: T_co, i: i_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def mod(a: U_co, value: Any) -> NDArray[np.str_]: ...
+@overload
+def mod(a: S_co, value: Any) -> NDArray[np.bytes_]: ...
+@overload
+def mod(a: _StringDTypeSupportsArray, value: Any) -> _StringDTypeArray: ...
+@overload
+def mod(a: T_co, value: Any) -> _StringDTypeOrUnicodeArray: ...
+
+def isalpha(x: UST_co) -> NDArray[np.bool]: ...
+def isalnum(a: UST_co) -> NDArray[np.bool]: ...
+def isdigit(x: UST_co) -> NDArray[np.bool]: ...
+def isspace(x: UST_co) -> NDArray[np.bool]: ...
+def isdecimal(x: U_co | T_co) -> NDArray[np.bool]: ...
+def isnumeric(x: U_co | T_co) -> NDArray[np.bool]: ...
+def islower(a: UST_co) -> NDArray[np.bool]: ...
+def istitle(a: UST_co) -> NDArray[np.bool]: ...
+def isupper(a: UST_co) -> NDArray[np.bool]: ...
+
+def str_len(x: UST_co) -> NDArray[np.int_]: ...
+
+@overload
+def find(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def find(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def find(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def rfind(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def rfind(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def rfind(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def index(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def index(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def index(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def rindex(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def rindex(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def rindex(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def count(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def count(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+@overload
+def count(
+    a: T_co,
+    sub: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.int_]: ...
+
+@overload
+def startswith(
+    a: U_co,
+    prefix: U_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def startswith(
+    a: S_co,
+    prefix: S_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def startswith(
+    a: T_co,
+    suffix: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+
+@overload
+def endswith(
+    a: U_co,
+    suffix: U_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def endswith(
+    a: S_co,
+    suffix: S_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def endswith(
+    a: T_co,
+    suffix: T_co,
+    start: i_co = ...,
+    end: i_co | None = ...,
+) -> NDArray[np.bool]: ...
+
+def decode(
+    a: S_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[np.str_]: ...
+def encode(
+    a: U_co | T_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[np.bytes_]: ...
+
+@overload
+def expandtabs(a: U_co, tabsize: i_co = ...) -> NDArray[np.str_]: ...
+@overload
+def expandtabs(a: S_co, tabsize: i_co = ...) -> NDArray[np.bytes_]: ...
+@overload
+def expandtabs(a: _StringDTypeSupportsArray, tabsize: i_co = ...) -> _StringDTypeArray: ...
+@overload
+def expandtabs(a: T_co, tabsize: i_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def center(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[np.str_]: ...
+@overload
+def center(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[np.bytes_]: ...
+@overload
+def center(a: _StringDTypeSupportsArray, width: i_co, fillchar: _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def center(a: T_co, width: i_co, fillchar: T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def ljust(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[np.str_]: ...
+@overload
+def ljust(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[np.bytes_]: ...
+@overload
+def ljust(a: _StringDTypeSupportsArray, width: i_co, fillchar: _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def ljust(a: T_co, width: i_co, fillchar: T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def rjust(
+    a: U_co,
+    width: i_co,
+    fillchar: U_co = ...,
+) -> NDArray[np.str_]: ...
+@overload
+def rjust(
+    a: S_co,
+    width: i_co,
+    fillchar: S_co = ...,
+) -> NDArray[np.bytes_]: ...
+@overload
+def rjust(
+    a: _StringDTypeSupportsArray,
+    width: i_co,
+    fillchar: _StringDTypeSupportsArray = ...,
+) -> _StringDTypeArray: ...
+@overload
+def rjust(
+    a: T_co,
+    width: i_co,
+    fillchar: T_co = ...,
+) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def lstrip(a: U_co, chars: None | U_co = ...) -> NDArray[np.str_]: ...
+@overload
+def lstrip(a: S_co, chars: None | S_co = ...) -> NDArray[np.bytes_]: ...
+@overload
+def lstrip(a: _StringDTypeSupportsArray, chars: None | _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def lstrip(a: T_co, chars: None | T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def rstrip(a: U_co, char: None | U_co = ...) -> NDArray[np.str_]: ...
+@overload
+def rstrip(a: S_co, char: None | S_co = ...) -> NDArray[np.bytes_]: ...
+@overload
+def rstrip(a: _StringDTypeSupportsArray, chars: None | _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def rstrip(a: T_co, chars: None | T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def strip(a: U_co, chars: None | U_co = ...) -> NDArray[np.str_]: ...
+@overload
+def strip(a: S_co, chars: None | S_co = ...) -> NDArray[np.bytes_]: ...
+@overload
+def strip(a: _StringDTypeSupportsArray, chars: None | _StringDTypeSupportsArray = ...) -> _StringDTypeArray: ...
+@overload
+def strip(a: T_co, chars: None | T_co = ...) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def zfill(a: U_co, width: i_co) -> NDArray[np.str_]: ...
+@overload
+def zfill(a: S_co, width: i_co) -> NDArray[np.bytes_]: ...
+@overload
+def zfill(a: _StringDTypeSupportsArray, width: i_co) -> _StringDTypeArray: ...
+@overload
+def zfill(a: T_co, width: i_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def upper(a: U_co) -> NDArray[np.str_]: ...
+@overload
+def upper(a: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def upper(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def upper(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def lower(a: U_co) -> NDArray[np.str_]: ...
+@overload
+def lower(a: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def lower(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def lower(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def swapcase(a: U_co) -> NDArray[np.str_]: ...
+@overload
+def swapcase(a: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def swapcase(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def swapcase(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def capitalize(a: U_co) -> NDArray[np.str_]: ...
+@overload
+def capitalize(a: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def capitalize(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def capitalize(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def title(a: U_co) -> NDArray[np.str_]: ...
+@overload
+def title(a: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def title(a: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def title(a: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def replace(
+    a: U_co,
+    old: U_co,
+    new: U_co,
+    count: i_co = ...,
+) -> NDArray[np.str_]: ...
+@overload
+def replace(
+    a: S_co,
+    old: S_co,
+    new: S_co,
+    count: i_co = ...,
+) -> NDArray[np.bytes_]: ...
+@overload
+def replace(
+    a: _StringDTypeSupportsArray,
+    old: _StringDTypeSupportsArray,
+    new: _StringDTypeSupportsArray,
+    count: i_co = ...,
+) -> _StringDTypeArray: ...
+@overload
+def replace(
+    a: T_co,
+    old: T_co,
+    new: T_co,
+    count: i_co = ...,
+) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def join(sep: U_co, seq: U_co) -> NDArray[np.str_]: ...
+@overload
+def join(sep: S_co, seq: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def join(sep: _StringDTypeSupportsArray, seq: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def join(sep: T_co, seq: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def partition(a: U_co, sep: U_co) -> NDArray[np.str_]: ...
+@overload
+def partition(a: S_co, sep: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def partition(a: _StringDTypeSupportsArray, sep: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def partition(a: T_co, sep: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def rpartition(a: U_co, sep: U_co) -> NDArray[np.str_]: ...
+@overload
+def rpartition(a: S_co, sep: S_co) -> NDArray[np.bytes_]: ...
+@overload
+def rpartition(a: _StringDTypeSupportsArray, sep: _StringDTypeSupportsArray) -> _StringDTypeArray: ...
+@overload
+def rpartition(a: T_co, sep: T_co) -> _StringDTypeOrUnicodeArray: ...
+
+@overload
+def translate(
+    a: U_co,
+    table: str,
+    deletechars: None | str = ...,
+) -> NDArray[np.str_]: ...
+@overload
+def translate(
+    a: S_co,
+    table: str,
+    deletechars: None | str = ...,
+) -> NDArray[np.bytes_]: ...
+@overload
+def translate(
+    a: _StringDTypeSupportsArray,
+    table: str,
+    deletechars: None | str = ...,
+) -> _StringDTypeArray: ...
+@overload
+def translate(
+    a: T_co,
+    table: str,
+    deletechars: None | str = ...,
+) -> _StringDTypeOrUnicodeArray: ...

janus/lib/python3.10/site-packages/numpy/_core/tests/_locales.py

@@ -0,0 +1,72 @@
+"""Provide class for testing in French locale
+
+"""
+import sys
+import locale
+
+import pytest
+
+__ALL__ = ['CommaDecimalPointLocale']
+
+
+def find_comma_decimal_point_locale():
+    """See if platform has a decimal point as comma locale.
+
+    Find a locale that uses a comma instead of a period as the
+    decimal point.
+
+    Returns
+    -------
+    old_locale: str
+        Locale when the function was called.
+    new_locale: {str, None)
+        First French locale found, None if none found.
+
+    """
+    if sys.platform == 'win32':
+        locales = ['FRENCH']
+    else:
+        locales = ['fr_FR', 'fr_FR.UTF-8', 'fi_FI', 'fi_FI.UTF-8']
+
+    old_locale = locale.getlocale(locale.LC_NUMERIC)
+    new_locale = None
+    try:
+        for loc in locales:
+            try:
+                locale.setlocale(locale.LC_NUMERIC, loc)
+                new_locale = loc
+                break
+            except locale.Error:
+                pass
+    finally:
+        locale.setlocale(locale.LC_NUMERIC, locale=old_locale)
+    return old_locale, new_locale
+
+
+class CommaDecimalPointLocale:
+    """Sets LC_NUMERIC to a locale with comma as decimal point.
+
+    Classes derived from this class have setup and teardown methods that run
+    tests with locale.LC_NUMERIC set to a locale where commas (',') are used as
+    the decimal point instead of periods ('.'). On exit the locale is restored
+    to the initial locale. It also serves as context manager with the same
+    effect. If no such locale is available, the test is skipped.
+
+    """
+    (cur_locale, tst_locale) = find_comma_decimal_point_locale()
+
+    def setup_method(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def teardown_method(self):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)
+
+    def __enter__(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def __exit__(self, type, value, traceback):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)

janus/lib/python3.10/site-packages/numpy/_core/tests/test__exceptions.py

@@ -0,0 +1,89 @@
+"""
+Tests of the ._exceptions module. Primarily for exercising the __str__ methods.
+"""
+
+import pickle
+
+import pytest
+import numpy as np
+from numpy.exceptions import AxisError
+
+_ArrayMemoryError = np._core._exceptions._ArrayMemoryError
+_UFuncNoLoopError = np._core._exceptions._UFuncNoLoopError
+
+class TestArrayMemoryError:
+    def test_pickling(self):
+        """ Test that _ArrayMemoryError can be pickled """
+        error = _ArrayMemoryError((1023,), np.dtype(np.uint8))
+        res = pickle.loads(pickle.dumps(error))
+        assert res._total_size == error._total_size
+
+    def test_str(self):
+        e = _ArrayMemoryError((1023,), np.dtype(np.uint8))
+        str(e)  # not crashing is enough
+
+    # testing these properties is easier than testing the full string repr
+    def test__size_to_string(self):
+        """ Test e._size_to_string """
+        f = _ArrayMemoryError._size_to_string
+        Ki = 1024
+        assert f(0) == '0 bytes'
+        assert f(1) == '1 bytes'
+        assert f(1023) == '1023 bytes'
+        assert f(Ki) == '1.00 KiB'
+        assert f(Ki+1) == '1.00 KiB'
+        assert f(10*Ki) == '10.0 KiB'
+        assert f(int(999.4*Ki)) == '999. KiB'
+        assert f(int(1023.4*Ki)) == '1023. KiB'
+        assert f(int(1023.5*Ki)) == '1.00 MiB'
+        assert f(Ki*Ki) == '1.00 MiB'
+
+        # 1023.9999 Mib should round to 1 GiB
+        assert f(int(Ki*Ki*Ki*0.9999)) == '1.00 GiB'
+        assert f(Ki*Ki*Ki*Ki*Ki*Ki) == '1.00 EiB'
+        # larger than sys.maxsize, adding larger prefixes isn't going to help
+        # anyway.
+        assert f(Ki*Ki*Ki*Ki*Ki*Ki*123456) == '123456. EiB'
+
+    def test__total_size(self):
+        """ Test e._total_size """
+        e = _ArrayMemoryError((1,), np.dtype(np.uint8))
+        assert e._total_size == 1
+
+        e = _ArrayMemoryError((2, 4), np.dtype((np.uint64, 16)))
+        assert e._total_size == 1024
+
+
+class TestUFuncNoLoopError:
+    def test_pickling(self):
+        """ Test that _UFuncNoLoopError can be pickled """
+        assert isinstance(pickle.dumps(_UFuncNoLoopError), bytes)
+
+
+@pytest.mark.parametrize("args", [
+    (2, 1, None),
+    (2, 1, "test_prefix"),
+    ("test message",),
+])
+class TestAxisError:
+    def test_attr(self, args):
+        """Validate attribute types."""
+        exc = AxisError(*args)
+        if len(args) == 1:
+            assert exc.axis is None
+            assert exc.ndim is None
+        else:
+            axis, ndim, *_ = args
+            assert exc.axis == axis
+            assert exc.ndim == ndim
+
+    def test_pickling(self, args):
+        """Test that `AxisError` can be pickled."""
+        exc = AxisError(*args)
+        exc2 = pickle.loads(pickle.dumps(exc))
+
+        assert type(exc) is type(exc2)
+        for name in ("axis", "ndim", "args"):
+            attr1 = getattr(exc, name)
+            attr2 = getattr(exc2, name)
+            assert attr1 == attr2, name

janus/lib/python3.10/site-packages/numpy/_core/tests/test_api.py

@@ -0,0 +1,616 @@
+import sys
+
+import numpy as np
+import numpy._core.umath as ncu
+from numpy._core._rational_tests import rational
+import pytest
+from numpy.testing import (
+     assert_, assert_equal, assert_array_equal, assert_raises, assert_warns,
+     HAS_REFCOUNT
+    )
+
+
+def test_array_array():
+    tobj = type(object)
+    ones11 = np.ones((1, 1), np.float64)
+    tndarray = type(ones11)
+    # Test is_ndarray
+    assert_equal(np.array(ones11, dtype=np.float64), ones11)
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tndarray)
+        np.array(ones11)
+        assert_equal(old_refcount, sys.getrefcount(tndarray))
+
+    # test None
+    assert_equal(np.array(None, dtype=np.float64),
+                 np.array(np.nan, dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tobj)
+        np.array(None, dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(tobj))
+
+    # test scalar
+    assert_equal(np.array(1.0, dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(np.float64)
+        np.array(np.array(1.0, dtype=np.float64), dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(np.float64))
+
+    # test string
+    S2 = np.dtype((bytes, 2))
+    S3 = np.dtype((bytes, 3))
+    S5 = np.dtype((bytes, 5))
+    assert_equal(np.array(b"1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array(b"1.0").dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=bytes).dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=S2), np.array(b"1."))
+    assert_equal(np.array(b"1", dtype=S5), np.ones((), dtype=S5))
+
+    # test string
+    U2 = np.dtype((str, 2))
+    U3 = np.dtype((str, 3))
+    U5 = np.dtype((str, 5))
+    assert_equal(np.array("1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array("1.0").dtype, U3)
+    assert_equal(np.array("1.0", dtype=str).dtype, U3)
+    assert_equal(np.array("1.0", dtype=U2), np.array(str("1.")))
+    assert_equal(np.array("1", dtype=U5), np.ones((), dtype=U5))
+
+    builtins = getattr(__builtins__, '__dict__', __builtins__)
+    assert_(hasattr(builtins, 'get'))
+
+    # test memoryview
+    dat = np.array(memoryview(b'1.0'), dtype=np.float64)
+    assert_equal(dat, [49.0, 46.0, 48.0])
+    assert_(dat.dtype.type is np.float64)
+
+    dat = np.array(memoryview(b'1.0'))
+    assert_equal(dat, [49, 46, 48])
+    assert_(dat.dtype.type is np.uint8)
+
+    # test array interface
+    a = np.array(100.0, dtype=np.float64)
+    o = type("o", (object,),
+             dict(__array_interface__=a.__array_interface__))
+    assert_equal(np.array(o, dtype=np.float64), a)
+
+    # test array_struct interface
+    a = np.array([(1, 4.0, 'Hello'), (2, 6.0, 'World')],
+                 dtype=[('f0', int), ('f1', float), ('f2', str)])
+    o = type("o", (object,),
+             dict(__array_struct__=a.__array_struct__))
+    ## wasn't what I expected... is np.array(o) supposed to equal a ?
+    ## instead we get a array([...], dtype=">V18")
+    assert_equal(bytes(np.array(o).data), bytes(a.data))
+
+    # test array
+    def custom__array__(self, dtype=None, copy=None):
+        return np.array(100.0, dtype=dtype, copy=copy)
+
+    o = type("o", (object,), dict(__array__=custom__array__))()
+    assert_equal(np.array(o, dtype=np.float64), np.array(100.0, np.float64))
+
+    # test recursion
+    nested = 1.5
+    for i in range(ncu.MAXDIMS):
+        nested = [nested]
+
+    # no error
+    np.array(nested)
+
+    # Exceeds recursion limit
+    assert_raises(ValueError, np.array, [nested], dtype=np.float64)
+
+    # Try with lists...
+    # float32
+    assert_equal(np.array([None] * 10, dtype=np.float32),
+                 np.full((10,), np.nan, dtype=np.float32))
+    assert_equal(np.array([[None]] * 10, dtype=np.float32),
+                 np.full((10, 1), np.nan, dtype=np.float32))
+    assert_equal(np.array([[None] * 10], dtype=np.float32),
+                 np.full((1, 10), np.nan, dtype=np.float32))
+    assert_equal(np.array([[None] * 10] * 10, dtype=np.float32),
+                 np.full((10, 10), np.nan, dtype=np.float32))
+    # float64
+    assert_equal(np.array([None] * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None]] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array([1.0] * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([[1.0]] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+    # Try with tuples
+    assert_equal(np.array((None,) * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,)] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array((1.0,) * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([(1.0,)] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+@pytest.mark.parametrize("array", [True, False])
+def test_array_impossible_casts(array):
+    # All builtin types can be forcibly cast, at least theoretically,
+    # but user dtypes cannot necessarily.
+    rt = rational(1, 2)
+    if array:
+        rt = np.array(rt)
+    with assert_raises(TypeError):
+        np.array(rt, dtype="M8")
+
+
+def test_array_astype():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+    # Default behavior: allows unsafe casts, keeps memory layout,
+    #                   always copies.
+    b = a.astype('i4')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.strides, b.strides)
+    b = a.T.astype('i4')
+    assert_equal(a.T, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.T.strides, b.strides)
+    b = a.astype('f4')
+    assert_equal(a, b)
+    assert_(not (a is b))
+
+    # copy=False parameter skips a copy
+    b = a.astype('f4', copy=False)
+    assert_(a is b)
+
+    # order parameter allows overriding of the memory layout,
+    # forcing a copy if the layout is wrong
+    b = a.astype('f4', order='F', copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(b.flags.f_contiguous)
+
+    b = a.astype('f4', order='C', copy=False)
+    assert_equal(a, b)
+    assert_(a is b)
+    assert_(b.flags.c_contiguous)
+
+    # casting parameter allows catching bad casts
+    b = a.astype('c8', casting='safe')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('c8'))
+
+    assert_raises(TypeError, a.astype, 'i4', casting='safe')
+
+    # subok=False passes through a non-subclassed array
+    b = a.astype('f4', subok=0, copy=False)
+    assert_(a is b)
+
+    class MyNDArray(np.ndarray):
+        pass
+
+    a = np.array([[0, 1, 2], [3, 4, 5]], dtype='f4').view(MyNDArray)
+
+    # subok=True passes through a subclass
+    b = a.astype('f4', subok=True, copy=False)
+    assert_(a is b)
+
+    # subok=True is default, and creates a subtype on a cast
+    b = a.astype('i4', copy=False)
+    assert_equal(a, b)
+    assert_equal(type(b), MyNDArray)
+
+    # subok=False never returns a subclass
+    b = a.astype('f4', subok=False, copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(type(b) is not MyNDArray)
+
+    # Make sure converting from string object to fixed length string
+    # does not truncate.
+    a = np.array([b'a'*100], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S100'))
+    a = np.array(['a'*100], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U100'))
+
+    # Same test as above but for strings shorter than 64 characters
+    a = np.array([b'a'*10], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S10'))
+    a = np.array(['a'*10], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U10'))
+
+    a = np.array(123456789012345678901234567890, dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='O').astype('U')
+    assert_array_equal(a, np.array('1234567890' * 3, dtype='U30'))
+
+    a = np.array([123456789012345678901234567890], dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array([123456789012345678901234567890], dtype='O').astype('U')
+    assert_array_equal(a, np.array('1234567890' * 3, dtype='U30'))
+
+    a = np.array(123456789012345678901234567890, dtype='S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='U')
+    assert_array_equal(a, np.array('1234567890' * 3, dtype='U30'))
+
+    a = np.array('a\u0140', dtype='U')
+    b = np.ndarray(buffer=a, dtype='uint32', shape=2)
+    assert_(b.size == 2)
+
+    a = np.array([1000], dtype='i4')
+    assert_raises(TypeError, a.astype, 'S1', casting='safe')
+
+    a = np.array(1000, dtype='i4')
+    assert_raises(TypeError, a.astype, 'U1', casting='safe')
+
+    # gh-24023
+    assert_raises(TypeError, a.astype)
+
+@pytest.mark.parametrize("dt", ["S", "U"])
+def test_array_astype_to_string_discovery_empty(dt):
+    # See also gh-19085
+    arr = np.array([""], dtype=object)
+    # Note, the itemsize is the `0 -> 1` logic, which should change.
+    # The important part the test is rather that it does not error.
+    assert arr.astype(dt).dtype.itemsize == np.dtype(f"{dt}1").itemsize
+
+    # check the same thing for `np.can_cast` (since it accepts arrays)
+    assert np.can_cast(arr, dt, casting="unsafe")
+    assert not np.can_cast(arr, dt, casting="same_kind")
+    # as well as for the object as a descriptor:
+    assert np.can_cast("O", dt, casting="unsafe")
+
+@pytest.mark.parametrize("dt", ["d", "f", "S13", "U32"])
+def test_array_astype_to_void(dt):
+    dt = np.dtype(dt)
+    arr = np.array([], dtype=dt)
+    assert arr.astype("V").dtype.itemsize == dt.itemsize
+
+def test_object_array_astype_to_void():
+    # This is different to `test_array_astype_to_void` as object arrays
+    # are inspected.  The default void is "V8" (8 is the length of double)
+    arr = np.array([], dtype="O").astype("V")
+    assert arr.dtype == "V8"
+
+@pytest.mark.parametrize("t",
+    np._core.sctypes['uint'] +
+    np._core.sctypes['int'] +
+    np._core.sctypes['float']
+)
+def test_array_astype_warning(t):
+    # test ComplexWarning when casting from complex to float or int
+    a = np.array(10, dtype=np.complex128)
+    assert_warns(np.exceptions.ComplexWarning, a.astype, t)
+
+@pytest.mark.parametrize(["dtype", "out_dtype"],
+        [(np.bytes_, np.bool),
+         (np.str_, np.bool),
+         (np.dtype("S10,S9"), np.dtype("?,?")),
+         # The following also checks unaligned unicode access:
+         (np.dtype("S7,U9"), np.dtype("?,?"))])
+def test_string_to_boolean_cast(dtype, out_dtype):
+    # Only the last two (empty) strings are falsy (the `\0` is stripped):
+    arr = np.array(
+            ["10", "10\0\0\0", "0\0\0", "0", "False", " ", "", "\0"],
+            dtype=dtype)
+    expected = np.array(
+            [True, True, True, True, True, True, False, False],
+            dtype=out_dtype)
+    assert_array_equal(arr.astype(out_dtype), expected)
+    # As it's similar, check that nonzero behaves the same (structs are
+    # nonzero if all entries are)
+    assert_array_equal(np.nonzero(arr), np.nonzero(expected))
+
+@pytest.mark.parametrize("str_type", [str, bytes, np.str_])
+@pytest.mark.parametrize("scalar_type",
+        [np.complex64, np.complex128, np.clongdouble])
+def test_string_to_complex_cast(str_type, scalar_type):
+    value = scalar_type(b"1+3j")
+    assert scalar_type(value) == 1+3j
+    assert np.array([value], dtype=object).astype(scalar_type)[()] == 1+3j
+    assert np.array(value).astype(scalar_type)[()] == 1+3j
+    arr = np.zeros(1, dtype=scalar_type)
+    arr[0] = value
+    assert arr[0] == 1+3j
+
+@pytest.mark.parametrize("dtype", np.typecodes["AllFloat"])
+def test_none_to_nan_cast(dtype):
+    # Note that at the time of writing this test, the scalar constructors
+    # reject None
+    arr = np.zeros(1, dtype=dtype)
+    arr[0] = None
+    assert np.isnan(arr)[0]
+    assert np.isnan(np.array(None, dtype=dtype))[()]
+    assert np.isnan(np.array([None], dtype=dtype))[0]
+    assert np.isnan(np.array(None).astype(dtype))[()]
+
+def test_copyto_fromscalar():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, 1.5)
+    assert_equal(a, 1.5)
+    np.copyto(a.T, 2.5)
+    assert_equal(a, 2.5)
+
+    # Where-masked copy
+    mask = np.array([[0, 1, 0], [0, 0, 1]], dtype='?')
+    np.copyto(a, 3.5, where=mask)
+    assert_equal(a, [[2.5, 3.5, 2.5], [2.5, 2.5, 3.5]])
+    mask = np.array([[0, 1], [1, 1], [1, 0]], dtype='?')
+    np.copyto(a.T, 4.5, where=mask)
+    assert_equal(a, [[2.5, 4.5, 4.5], [4.5, 4.5, 3.5]])
+
+def test_copyto():
+    a = np.arange(6, dtype='i4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, [[3, 1, 5], [6, 2, 1]])
+    assert_equal(a, [[3, 1, 5], [6, 2, 1]])
+
+    # Overlapping copy should work
+    np.copyto(a[:, :2], a[::-1, 1::-1])
+    assert_equal(a, [[2, 6, 5], [1, 3, 1]])
+
+    # Defaults to 'same_kind' casting
+    assert_raises(TypeError, np.copyto, a, 1.5)
+
+    # Force a copy with 'unsafe' casting, truncating 1.5 to 1
+    np.copyto(a, 1.5, casting='unsafe')
+    assert_equal(a, 1)
+
+    # Copying with a mask
+    np.copyto(a, 3, where=[True, False, True])
+    assert_equal(a, [[3, 1, 3], [3, 1, 3]])
+
+    # Casting rule still applies with a mask
+    assert_raises(TypeError, np.copyto, a, 3.5, where=[True, False, True])
+
+    # Lists of integer 0's and 1's is ok too
+    np.copyto(a, 4.0, casting='unsafe', where=[[0, 1, 1], [1, 0, 0]])
+    assert_equal(a, [[3, 4, 4], [4, 1, 3]])
+
+    # Overlapping copy with mask should work
+    np.copyto(a[:, :2], a[::-1, 1::-1], where=[[0, 1], [1, 1]])
+    assert_equal(a, [[3, 4, 4], [4, 3, 3]])
+
+    # 'dst' must be an array
+    assert_raises(TypeError, np.copyto, [1, 2, 3], [2, 3, 4])
+
+
+def test_copyto_cast_safety():
+    with pytest.raises(TypeError):
+        np.copyto(np.arange(3), 3., casting="safe")
+
+    # Can put integer and float scalars safely (and equiv):
+    np.copyto(np.arange(3), 3, casting="equiv")
+    np.copyto(np.arange(3.), 3., casting="equiv")
+    # And also with less precision safely:
+    np.copyto(np.arange(3, dtype="uint8"), 3, casting="safe")
+    np.copyto(np.arange(3., dtype="float32"), 3., casting="safe")
+
+    # But not equiv:
+    with pytest.raises(TypeError):
+        np.copyto(np.arange(3, dtype="uint8"), 3, casting="equiv")
+
+    with pytest.raises(TypeError):
+        np.copyto(np.arange(3., dtype="float32"), 3., casting="equiv")
+
+    # As a special thing, object is equiv currently:
+    np.copyto(np.arange(3, dtype=object), 3, casting="equiv")
+
+    # The following raises an overflow error/gives a warning but not
+    # type error (due to casting), though:
+    with pytest.raises(OverflowError):
+        np.copyto(np.arange(3), 2**80, casting="safe")
+
+    with pytest.warns(RuntimeWarning):
+        np.copyto(np.arange(3, dtype=np.float32), 2e300, casting="safe")
+
+
+def test_copyto_permut():
+    # test explicit overflow case
+    pad = 500
+    l = [True] * pad + [True, True, True, True]
+    r = np.zeros(len(l)-pad)
+    d = np.ones(len(l)-pad)
+    mask = np.array(l)[pad:]
+    np.copyto(r, d, where=mask[::-1])
+
+    # test all permutation of possible masks, 9 should be sufficient for
+    # current 4 byte unrolled code
+    power = 9
+    d = np.ones(power)
+    for i in range(2**power):
+        r = np.zeros(power)
+        l = [(i & x) != 0 for x in range(power)]
+        mask = np.array(l)
+        np.copyto(r, d, where=mask)
+        assert_array_equal(r == 1, l)
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r, d, where=mask[::-1])
+        assert_array_equal(r == 1, l[::-1])
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::2])
+        assert_array_equal(r[::2] == 1, l[::2])
+        assert_equal(r[::2].sum(), sum(l[::2]))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::-2])
+        assert_array_equal(r[::2] == 1, l[::-2])
+        assert_equal(r[::2].sum(), sum(l[::-2]))
+
+        for c in [0xFF, 0x7F, 0x02, 0x10]:
+            r = np.zeros(power)
+            mask = np.array(l)
+            imask = np.array(l).view(np.uint8)
+            imask[mask != 0] = c
+            np.copyto(r, d, where=mask)
+            assert_array_equal(r == 1, l)
+            assert_equal(r.sum(), sum(l))
+
+    r = np.zeros(power)
+    np.copyto(r, d, where=True)
+    assert_equal(r.sum(), r.size)
+    r = np.ones(power)
+    d = np.zeros(power)
+    np.copyto(r, d, where=False)
+    assert_equal(r.sum(), r.size)
+
+def test_copy_order():
+    a = np.arange(24).reshape(2, 1, 3, 4)
+    b = a.copy(order='F')
+    c = np.arange(24).reshape(2, 1, 4, 3).swapaxes(2, 3)
+
+    def check_copy_result(x, y, ccontig, fcontig, strides=False):
+        assert_(not (x is y))
+        assert_equal(x, y)
+        assert_equal(res.flags.c_contiguous, ccontig)
+        assert_equal(res.flags.f_contiguous, fcontig)
+
+    # Validate the initial state of a, b, and c
+    assert_(a.flags.c_contiguous)
+    assert_(not a.flags.f_contiguous)
+    assert_(not b.flags.c_contiguous)
+    assert_(b.flags.f_contiguous)
+    assert_(not c.flags.c_contiguous)
+    assert_(not c.flags.f_contiguous)
+
+    # Copy with order='C'
+    res = a.copy(order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = c.copy(order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(a, order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(c, order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+
+    # Copy with order='F'
+    res = a.copy(order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = b.copy(order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(a, order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(b, order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+
+    # Copy with order='K'
+    res = a.copy(order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+    res = np.copy(a, order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+
+def test_contiguous_flags():
+    a = np.ones((4, 4, 1))[::2,:,:]
+    a.strides = a.strides[:2] + (-123,)
+    b = np.ones((2, 2, 1, 2, 2)).swapaxes(3, 4)
+
+    def check_contig(a, ccontig, fcontig):
+        assert_(a.flags.c_contiguous == ccontig)
+        assert_(a.flags.f_contiguous == fcontig)
+
+    # Check if new arrays are correct:
+    check_contig(a, False, False)
+    check_contig(b, False, False)
+    check_contig(np.empty((2, 2, 0, 2, 2)), True, True)
+    check_contig(np.array([[[1], [2]]], order='F'), True, True)
+    check_contig(np.empty((2, 2)), True, False)
+    check_contig(np.empty((2, 2), order='F'), False, True)
+
+    # Check that np.array creates correct contiguous flags:
+    check_contig(np.array(a, copy=None), False, False)
+    check_contig(np.array(a, copy=None, order='C'), True, False)
+    check_contig(np.array(a, ndmin=4, copy=None, order='F'), False, True)
+
+    # Check slicing update of flags and :
+    check_contig(a[0], True, True)
+    check_contig(a[None, ::4, ..., None], True, True)
+    check_contig(b[0, 0, ...], False, True)
+    check_contig(b[:, :, 0:0, :, :], True, True)
+
+    # Test ravel and squeeze.
+    check_contig(a.ravel(), True, True)
+    check_contig(np.ones((1, 3, 1)).squeeze(), True, True)
+
+def test_broadcast_arrays():
+    # Test user defined dtypes
+    a = np.array([(1, 2, 3)], dtype='u4,u4,u4')
+    b = np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4')
+    result = np.broadcast_arrays(a, b)
+    assert_equal(result[0], np.array([(1, 2, 3), (1, 2, 3), (1, 2, 3)], dtype='u4,u4,u4'))
+    assert_equal(result[1], np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4'))
+
+@pytest.mark.parametrize(["shape", "fill_value", "expected_output"],
+        [((2, 2), [5.0,  6.0], np.array([[5.0, 6.0], [5.0, 6.0]])),
+         ((3, 2), [1.0,  2.0], np.array([[1.0, 2.0], [1.0, 2.0], [1.0,  2.0]]))])
+def test_full_from_list(shape, fill_value, expected_output):
+    output = np.full(shape, fill_value)
+    assert_equal(output, expected_output)
+
+def test_astype_copyflag():
+    # test the various copyflag options
+    arr = np.arange(10, dtype=np.intp)
+
+    res_true = arr.astype(np.intp, copy=True)
+    assert not np.shares_memory(arr, res_true)
+
+    res_false = arr.astype(np.intp, copy=False)
+    assert np.shares_memory(arr, res_false)
+
+    res_false_float = arr.astype(np.float64, copy=False)
+    assert not np.shares_memory(arr, res_false_float)
+
+    # _CopyMode enum isn't allowed
+    assert_raises(ValueError, arr.astype, np.float64,
+                  copy=np._CopyMode.NEVER)

janus/lib/python3.10/site-packages/numpy/_core/tests/test_array_api_info.py

@@ -0,0 +1,112 @@
+import numpy as np
+import pytest
+
+info = np.__array_namespace_info__()
+
+
+def test_capabilities():
+    caps = info.capabilities()
+    assert caps["boolean indexing"] is True
+    assert caps["data-dependent shapes"] is True
+
+    # This will be added in the 2024.12 release of the array API standard.
+
+    # assert caps["max rank"] == 64
+    # np.zeros((1,)*64)
+    # with pytest.raises(ValueError):
+    #     np.zeros((1,)*65)
+
+
+def test_default_device():
+    assert info.default_device() == "cpu" == np.asarray(0).device
+
+
+def test_default_dtypes():
+    dtypes = info.default_dtypes()
+    assert dtypes["real floating"] == np.float64 == np.asarray(0.0).dtype
+    assert dtypes["complex floating"] == np.complex128 == \
+        np.asarray(0.0j).dtype
+    assert dtypes["integral"] == np.intp == np.asarray(0).dtype
+    assert dtypes["indexing"] == np.intp == np.argmax(np.zeros(10)).dtype
+
+    with pytest.raises(ValueError, match="Device not understood"):
+        info.default_dtypes(device="gpu")
+
+
+def test_dtypes_all():
+    dtypes = info.dtypes()
+    assert dtypes == {
+        "bool": np.bool_,
+        "int8": np.int8,
+        "int16": np.int16,
+        "int32": np.int32,
+        "int64": np.int64,
+        "uint8": np.uint8,
+        "uint16": np.uint16,
+        "uint32": np.uint32,
+        "uint64": np.uint64,
+        "float32": np.float32,
+        "float64": np.float64,
+        "complex64": np.complex64,
+        "complex128": np.complex128,
+    }
+
+
+dtype_categories = {
+    "bool": {"bool": np.bool_},
+    "signed integer": {
+        "int8": np.int8,
+        "int16": np.int16,
+        "int32": np.int32,
+        "int64": np.int64,
+    },
+    "unsigned integer": {
+        "uint8": np.uint8,
+        "uint16": np.uint16,
+        "uint32": np.uint32,
+        "uint64": np.uint64,
+    },
+    "integral": ("signed integer", "unsigned integer"),
+    "real floating": {"float32": np.float32, "float64": np.float64},
+    "complex floating": {"complex64": np.complex64, "complex128":
+                         np.complex128},
+    "numeric": ("integral", "real floating", "complex floating"),
+}
+
+
+@pytest.mark.parametrize("kind", dtype_categories)
+def test_dtypes_kind(kind):
+    expected = dtype_categories[kind]
+    if isinstance(expected, tuple):
+        assert info.dtypes(kind=kind) == info.dtypes(kind=expected)
+    else:
+        assert info.dtypes(kind=kind) == expected
+
+
+def test_dtypes_tuple():
+    dtypes = info.dtypes(kind=("bool", "integral"))
+    assert dtypes == {
+        "bool": np.bool_,
+        "int8": np.int8,
+        "int16": np.int16,
+        "int32": np.int32,
+        "int64": np.int64,
+        "uint8": np.uint8,
+        "uint16": np.uint16,
+        "uint32": np.uint32,
+        "uint64": np.uint64,
+    }
+
+
+def test_dtypes_invalid_kind():
+    with pytest.raises(ValueError, match="unsupported kind"):
+        info.dtypes(kind="invalid")
+
+
+def test_dtypes_invalid_device():
+    with pytest.raises(ValueError, match="Device not understood"):
+        info.dtypes(device="gpu")
+
+
+def test_devices():
+    assert info.devices() == ["cpu"]

janus/lib/python3.10/site-packages/numpy/_core/tests/test_arrayprint.py

@@ -0,0 +1,1281 @@
+import sys
+import gc
+from hypothesis import given
+from hypothesis.extra import numpy as hynp
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_warns, HAS_REFCOUNT,
+    assert_raises_regex, IS_WASM
+    )
+from numpy.testing._private.utils import run_threaded
+from numpy._core.arrayprint import _typelessdata
+import textwrap
+
+class TestArrayRepr:
+    def test_nan_inf(self):
+        x = np.array([np.nan, np.inf])
+        assert_equal(repr(x), 'array([nan, inf])')
+
+    def test_subclass(self):
+        class sub(np.ndarray):
+            pass
+
+        # one dimensional
+        x1d = np.array([1, 2]).view(sub)
+        assert_equal(repr(x1d), 'sub([1, 2])')
+
+        # two dimensional
+        x2d = np.array([[1, 2], [3, 4]]).view(sub)
+        assert_equal(repr(x2d),
+            'sub([[1, 2],\n'
+            '     [3, 4]])')
+
+        # two dimensional with flexible dtype
+        xstruct = np.ones((2,2), dtype=[('a', '<i4')]).view(sub)
+        assert_equal(repr(xstruct),
+            "sub([[(1,), (1,)],\n"
+            "     [(1,), (1,)]], dtype=[('a', '<i4')])"
+        )
+
+    @pytest.mark.xfail(reason="See gh-10544")
+    def test_object_subclass(self):
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super().__getitem__(ind)
+                return sub(ret)
+
+        # test that object + subclass is OK:
+        x = sub([None, None])
+        assert_equal(repr(x), 'sub([None, None], dtype=object)')
+        assert_equal(str(x), '[None None]')
+
+        x = sub([None, sub([None, None])])
+        assert_equal(repr(x),
+            'sub([None, sub([None, None], dtype=object)], dtype=object)')
+        assert_equal(str(x), '[None sub([None, None], dtype=object)]')
+
+    def test_0d_object_subclass(self):
+        # make sure that subclasses which return 0ds instead
+        # of scalars don't cause infinite recursion in str
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super().__getitem__(ind)
+                return sub(ret)
+
+        x = sub(1)
+        assert_equal(repr(x), 'sub(1)')
+        assert_equal(str(x), '1')
+
+        x = sub([1, 1])
+        assert_equal(repr(x), 'sub([1, 1])')
+        assert_equal(str(x), '[1 1]')
+
+        # check it works properly with object arrays too
+        x = sub(None)
+        assert_equal(repr(x), 'sub(None, dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # plus recursive object arrays (even depth > 1)
+        y = sub(None)
+        x[()] = y
+        y[()] = x
+        assert_equal(repr(x),
+            'sub(sub(sub(..., dtype=object), dtype=object), dtype=object)')
+        assert_equal(str(x), '...')
+        x[()] = 0  # resolve circular references for garbage collector
+
+        # nested 0d-subclass-object
+        x = sub(None)
+        x[()] = sub(None)
+        assert_equal(repr(x), 'sub(sub(None, dtype=object), dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # gh-10663
+        class DuckCounter(np.ndarray):
+            def __getitem__(self, item):
+                result = super().__getitem__(item)
+                if not isinstance(result, DuckCounter):
+                    result = result[...].view(DuckCounter)
+                return result
+
+            def to_string(self):
+                return {0: 'zero', 1: 'one', 2: 'two'}.get(self.item(), 'many')
+
+            def __str__(self):
+                if self.shape == ():
+                    return self.to_string()
+                else:
+                    fmt = {'all': lambda x: x.to_string()}
+                    return np.array2string(self, formatter=fmt)
+
+        dc = np.arange(5).view(DuckCounter)
+        assert_equal(str(dc), "[zero one two many many]")
+        assert_equal(str(dc[0]), "zero")
+
+    def test_self_containing(self):
+        arr0d = np.array(None)
+        arr0d[()] = arr0d
+        assert_equal(repr(arr0d),
+            'array(array(..., dtype=object), dtype=object)')
+        arr0d[()] = 0  # resolve recursion for garbage collector
+
+        arr1d = np.array([None, None])
+        arr1d[1] = arr1d
+        assert_equal(repr(arr1d),
+            'array([None, array(..., dtype=object)], dtype=object)')
+        arr1d[1] = 0  # resolve recursion for garbage collector
+
+        first = np.array(None)
+        second = np.array(None)
+        first[()] = second
+        second[()] = first
+        assert_equal(repr(first),
+            'array(array(array(..., dtype=object), dtype=object), dtype=object)')
+        first[()] = 0  # resolve circular references for garbage collector
+
+    def test_containing_list(self):
+        # printing square brackets directly would be ambiguous
+        arr1d = np.array([None, None])
+        arr1d[0] = [1, 2]
+        arr1d[1] = [3]
+        assert_equal(repr(arr1d),
+            'array([list([1, 2]), list([3])], dtype=object)')
+
+    def test_void_scalar_recursion(self):
+        # gh-9345
+        repr(np.void(b'test'))  # RecursionError ?
+
+    def test_fieldless_structured(self):
+        # gh-10366
+        no_fields = np.dtype([])
+        arr_no_fields = np.empty(4, dtype=no_fields)
+        assert_equal(repr(arr_no_fields), 'array([(), (), (), ()], dtype=[])')
+
+
+class TestComplexArray:
+    def test_str(self):
+        rvals = [0, 1, -1, np.inf, -np.inf, np.nan]
+        cvals = [complex(rp, ip) for rp in rvals for ip in rvals]
+        dtypes = [np.complex64, np.cdouble, np.clongdouble]
+        actual = [str(np.array([c], dt)) for c in cvals for dt in dtypes]
+        wanted = [
+            '[0.+0.j]',    '[0.+0.j]',    '[0.+0.j]',
+            '[0.+1.j]',    '[0.+1.j]',    '[0.+1.j]',
+            '[0.-1.j]',    '[0.-1.j]',    '[0.-1.j]',
+            '[0.+infj]',   '[0.+infj]',   '[0.+infj]',
+            '[0.-infj]',   '[0.-infj]',   '[0.-infj]',
+            '[0.+nanj]',   '[0.+nanj]',   '[0.+nanj]',
+            '[1.+0.j]',    '[1.+0.j]',    '[1.+0.j]',
+            '[1.+1.j]',    '[1.+1.j]',    '[1.+1.j]',
+            '[1.-1.j]',    '[1.-1.j]',    '[1.-1.j]',
+            '[1.+infj]',   '[1.+infj]',   '[1.+infj]',
+            '[1.-infj]',   '[1.-infj]',   '[1.-infj]',
+            '[1.+nanj]',   '[1.+nanj]',   '[1.+nanj]',
+            '[-1.+0.j]',   '[-1.+0.j]',   '[-1.+0.j]',
+            '[-1.+1.j]',   '[-1.+1.j]',   '[-1.+1.j]',
+            '[-1.-1.j]',   '[-1.-1.j]',   '[-1.-1.j]',
+            '[-1.+infj]',  '[-1.+infj]',  '[-1.+infj]',
+            '[-1.-infj]',  '[-1.-infj]',  '[-1.-infj]',
+            '[-1.+nanj]',  '[-1.+nanj]',  '[-1.+nanj]',
+            '[inf+0.j]',   '[inf+0.j]',   '[inf+0.j]',
+            '[inf+1.j]',   '[inf+1.j]',   '[inf+1.j]',
+            '[inf-1.j]',   '[inf-1.j]',   '[inf-1.j]',
+            '[inf+infj]',  '[inf+infj]',  '[inf+infj]',
+            '[inf-infj]',  '[inf-infj]',  '[inf-infj]',
+            '[inf+nanj]',  '[inf+nanj]',  '[inf+nanj]',
+            '[-inf+0.j]',  '[-inf+0.j]',  '[-inf+0.j]',
+            '[-inf+1.j]',  '[-inf+1.j]',  '[-inf+1.j]',
+            '[-inf-1.j]',  '[-inf-1.j]',  '[-inf-1.j]',
+            '[-inf+infj]', '[-inf+infj]', '[-inf+infj]',
+            '[-inf-infj]', '[-inf-infj]', '[-inf-infj]',
+            '[-inf+nanj]', '[-inf+nanj]', '[-inf+nanj]',
+            '[nan+0.j]',   '[nan+0.j]',   '[nan+0.j]',
+            '[nan+1.j]',   '[nan+1.j]',   '[nan+1.j]',
+            '[nan-1.j]',   '[nan-1.j]',   '[nan-1.j]',
+            '[nan+infj]',  '[nan+infj]',  '[nan+infj]',
+            '[nan-infj]',  '[nan-infj]',  '[nan-infj]',
+            '[nan+nanj]',  '[nan+nanj]',  '[nan+nanj]']
+
+        for res, val in zip(actual, wanted):
+            assert_equal(res, val)
+
+class TestArray2String:
+    def test_basic(self):
+        """Basic test of array2string."""
+        a = np.arange(3)
+        assert_(np.array2string(a) == '[0 1 2]')
+        assert_(np.array2string(a, max_line_width=4, legacy='1.13') == '[0 1\n 2]')
+        assert_(np.array2string(a, max_line_width=4) == '[0\n 1\n 2]')
+
+    def test_unexpected_kwarg(self):
+        # ensure than an appropriate TypeError
+        # is raised when array2string receives
+        # an unexpected kwarg
+
+        with assert_raises_regex(TypeError, 'nonsense'):
+            np.array2string(np.array([1, 2, 3]),
+                            nonsense=None)
+
+    def test_format_function(self):
+        """Test custom format function for each element in array."""
+        def _format_function(x):
+            if np.abs(x) < 1:
+                return '.'
+            elif np.abs(x) < 2:
+                return 'o'
+            else:
+                return 'O'
+
+        x = np.arange(3)
+        x_hex = "[0x0 0x1 0x2]"
+        x_oct = "[0o0 0o1 0o2]"
+        assert_(np.array2string(x, formatter={'all':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'int_kind':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'all':lambda x: "%.4f" % x}) ==
+                "[0.0000 1.0000 2.0000]")
+        assert_equal(np.array2string(x, formatter={'int':lambda x: hex(x)}),
+                x_hex)
+        assert_equal(np.array2string(x, formatter={'int':lambda x: oct(x)}),
+                x_oct)
+
+        x = np.arange(3.)
+        assert_(np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+        assert_(np.array2string(x, formatter={'float':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+
+        s = np.array(['abc', 'def'])
+        assert_(np.array2string(s, formatter={'numpystr':lambda s: s*2}) ==
+                '[abcabc defdef]')
+
+    def test_structure_format_mixed(self):
+        dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))])
+        x = np.array([('Sarah', (8.0, 7.0)), ('John', (6.0, 7.0))], dtype=dt)
+        assert_equal(np.array2string(x),
+                "[('Sarah', [8., 7.]) ('John', [6., 7.])]")
+
+        np.set_printoptions(legacy='1.13')
+        try:
+            # for issue #5692
+            A = np.zeros(shape=10, dtype=[("A", "M8[s]")])
+            A[5:].fill(np.datetime64('NaT'))
+            assert_equal(
+                np.array2string(A),
+                textwrap.dedent("""\
+                [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+                 ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('NaT',) ('NaT',)
+                 ('NaT',) ('NaT',) ('NaT',)]""")
+            )
+        finally:
+            np.set_printoptions(legacy=False)
+
+        # same again, but with non-legacy behavior
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) (                'NaT',)
+             (                'NaT',) (                'NaT',)
+             (                'NaT',) (                'NaT',)]""")
+        )
+
+        # and again, with timedeltas
+        A = np.full(10, 123456, dtype=[("A", "m8[s]")])
+        A[5:].fill(np.datetime64('NaT'))
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [(123456,) (123456,) (123456,) (123456,) (123456,) ( 'NaT',) ( 'NaT',)
+             ( 'NaT',) ( 'NaT',) ( 'NaT',)]""")
+        )
+
+    def test_structure_format_int(self):
+        # See #8160
+        struct_int = np.array([([1, -1],), ([123, 1],)],
+                dtype=[('B', 'i4', 2)])
+        assert_equal(np.array2string(struct_int),
+                "[([  1,  -1],) ([123,   1],)]")
+        struct_2dint = np.array([([[0, 1], [2, 3]],), ([[12, 0], [0, 0]],)],
+                dtype=[('B', 'i4', (2, 2))])
+        assert_equal(np.array2string(struct_2dint),
+                "[([[ 0,  1], [ 2,  3]],) ([[12,  0], [ 0,  0]],)]")
+
+    def test_structure_format_float(self):
+        # See #8172
+        array_scalar = np.array(
+                (1., 2.1234567890123456789, 3.), dtype=('f8,f8,f8'))
+        assert_equal(np.array2string(array_scalar), "(1., 2.12345679, 3.)")
+
+    def test_unstructured_void_repr(self):
+        a = np.array([27, 91, 50, 75,  7, 65, 10,  8,
+                      27, 91, 51, 49,109, 82,101,100], dtype='u1').view('V8')
+        assert_equal(repr(a[0]),
+            r"np.void(b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08')")
+        assert_equal(str(a[0]), r"b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'")
+        assert_equal(repr(a),
+            r"array([b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'," "\n"
+            r"       b'\x1B\x5B\x33\x31\x6D\x52\x65\x64'], dtype='|V8')")
+
+        assert_equal(eval(repr(a), vars(np)), a)
+        assert_equal(eval(repr(a[0]), dict(np=np)), a[0])
+
+    def test_edgeitems_kwarg(self):
+        # previously the global print options would be taken over the kwarg
+        arr = np.zeros(3, int)
+        assert_equal(
+            np.array2string(arr, edgeitems=1, threshold=0),
+            "[0 ... 0]"
+        )
+
+    def test_summarize_1d(self):
+        A = np.arange(1001)
+        strA = '[   0    1    2 ...  998  999 1000]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([   0,    1,    2, ...,  998,  999, 1000])'
+        try:
+            np.set_printoptions(legacy='2.1')
+            assert_equal(repr(A), reprA)
+        finally:
+            np.set_printoptions(legacy=False)
+
+        assert_equal(repr(A), reprA.replace(')', ', shape=(1001,))'))
+
+    def test_summarize_2d(self):
+        A = np.arange(1002).reshape(2, 501)
+        strA = '[[   0    1    2 ...  498  499  500]\n' \
+               ' [ 501  502  503 ...  999 1000 1001]]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([[   0,    1,    2, ...,  498,  499,  500],\n' \
+                '       [ 501,  502,  503, ...,  999, 1000, 1001]])'
+        try:
+            np.set_printoptions(legacy='2.1')
+            assert_equal(repr(A), reprA)
+        finally:
+            np.set_printoptions(legacy=False)
+
+        assert_equal(repr(A), reprA.replace(')', ', shape=(2, 501))'))
+
+    def test_summarize_2d_dtype(self):
+        A = np.arange(1002, dtype='i2').reshape(2, 501)
+        strA = '[[   0    1    2 ...  498  499  500]\n' \
+               ' [ 501  502  503 ...  999 1000 1001]]'
+        assert_equal(str(A), strA)
+
+        reprA = ('array([[   0,    1,    2, ...,  498,  499,  500],\n'
+                 '       [ 501,  502,  503, ...,  999, 1000, 1001]],\n'
+                 '      shape=(2, 501), dtype=int16)')
+        assert_equal(repr(A), reprA)
+
+    def test_summarize_structure(self):
+        A = (np.arange(2002, dtype="<i8").reshape(2, 1001)
+             .view([('i', "<i8", (1001,))]))
+        strA = ("[[([   0,    1,    2, ...,  998,  999, 1000],)]\n"
+                " [([1001, 1002, 1003, ..., 1999, 2000, 2001],)]]")
+        assert_equal(str(A), strA)
+
+        reprA = ("array([[([   0,    1,    2, ...,  998,  999, 1000],)],\n"
+                 "       [([1001, 1002, 1003, ..., 1999, 2000, 2001],)]],\n"
+                 "      dtype=[('i', '<i8', (1001,))])")
+        assert_equal(repr(A), reprA)
+
+        B = np.ones(2002, dtype=">i8").view([('i', ">i8", (2, 1001))])
+        strB = "[([[1, 1, 1, ..., 1, 1, 1], [1, 1, 1, ..., 1, 1, 1]],)]"
+        assert_equal(str(B), strB)
+
+        reprB = (
+            "array([([[1, 1, 1, ..., 1, 1, 1], [1, 1, 1, ..., 1, 1, 1]],)],\n"
+            "      dtype=[('i', '>i8', (2, 1001))])"
+        )
+        assert_equal(repr(B), reprB)
+
+        C = (np.arange(22, dtype="<i8").reshape(2, 11)
+             .view([('i1', "<i8"), ('i10', "<i8", (10,))]))
+        strC = "[[( 0, [ 1, ..., 10])]\n [(11, [12, ..., 21])]]"
+        assert_equal(np.array2string(C, threshold=1, edgeitems=1), strC)
+
+    def test_linewidth(self):
+        a = np.full(6, 1)
+
+        def make_str(a, width, **kw):
+            return np.array2string(a, separator="", max_line_width=width, **kw)
+
+        assert_equal(make_str(a, 8, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 7, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 5, legacy='1.13'), '[1111\n'
+                                                    ' 11]')
+
+        assert_equal(make_str(a, 8), '[111111]')
+        assert_equal(make_str(a, 7), '[11111\n'
+                                     ' 1]')
+        assert_equal(make_str(a, 5), '[111\n'
+                                     ' 111]')
+
+        b = a[None,None,:]
+
+        assert_equal(make_str(b, 12, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  9, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  8, legacy='1.13'), '[[[11111\n'
+                                                     '   1]]]')
+
+        assert_equal(make_str(b, 12), '[[[111111]]]')
+        assert_equal(make_str(b,  9), '[[[111\n'
+                                      '   111]]]')
+        assert_equal(make_str(b,  8), '[[[11\n'
+                                      '   11\n'
+                                      '   11]]]')
+
+    def test_wide_element(self):
+        a = np.array(['xxxxx'])
+        assert_equal(
+            np.array2string(a, max_line_width=5),
+            "['xxxxx']"
+        )
+        assert_equal(
+            np.array2string(a, max_line_width=5, legacy='1.13'),
+            "[ 'xxxxx']"
+        )
+
+    def test_multiline_repr(self):
+        class MultiLine:
+            def __repr__(self):
+                return "Line 1\nLine 2"
+
+        a = np.array([[None, MultiLine()], [MultiLine(), None]])
+
+        assert_equal(
+            np.array2string(a),
+            '[[None Line 1\n'
+            '       Line 2]\n'
+            ' [Line 1\n'
+            '  Line 2 None]]'
+        )
+        assert_equal(
+            np.array2string(a, max_line_width=5),
+            '[[None\n'
+            '  Line 1\n'
+            '  Line 2]\n'
+            ' [Line 1\n'
+            '  Line 2\n'
+            '  None]]'
+        )
+        assert_equal(
+            repr(a),
+            'array([[None, Line 1\n'
+            '              Line 2],\n'
+            '       [Line 1\n'
+            '        Line 2, None]], dtype=object)'
+        )
+
+        class MultiLineLong:
+            def __repr__(self):
+                return "Line 1\nLooooooooooongestLine2\nLongerLine 3"
+
+        a = np.array([[None, MultiLineLong()], [MultiLineLong(), None]])
+        assert_equal(
+            repr(a),
+            'array([[None, Line 1\n'
+            '              LooooooooooongestLine2\n'
+            '              LongerLine 3          ],\n'
+            '       [Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          , None]], dtype=object)'
+        )
+        assert_equal(
+            np.array_repr(a, 20),
+            'array([[None,\n'
+            '        Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          ],\n'
+            '       [Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          ,\n'
+            '        None]],\n'
+            '      dtype=object)'
+        )
+
+    def test_nested_array_repr(self):
+        a = np.empty((2, 2), dtype=object)
+        a[0, 0] = np.eye(2)
+        a[0, 1] = np.eye(3)
+        a[1, 0] = None
+        a[1, 1] = np.ones((3, 1))
+        assert_equal(
+            repr(a),
+            'array([[array([[1., 0.],\n'
+            '               [0., 1.]]), array([[1., 0., 0.],\n'
+            '                                  [0., 1., 0.],\n'
+            '                                  [0., 0., 1.]])],\n'
+            '       [None, array([[1.],\n'
+            '                     [1.],\n'
+            '                     [1.]])]], dtype=object)'
+        )
+
+    @given(hynp.from_dtype(np.dtype("U")))
+    def test_any_text(self, text):
+        # This test checks that, given any value that can be represented in an
+        # array of dtype("U") (i.e. unicode string), ...
+        a = np.array([text, text, text])
+        # casting a list of them to an array does not e.g. truncate the value
+        assert_equal(a[0], text)
+        text = text.item()  # use raw python strings for repr below
+        # and that np.array2string puts a newline in the expected location
+        expected_repr = "[{0!r} {0!r}\n {0!r}]".format(text)
+        result = np.array2string(a, max_line_width=len(repr(text)) * 2 + 3)
+        assert_equal(result, expected_repr)
+
+    @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts")
+    def test_refcount(self):
+        # make sure we do not hold references to the array due to a recursive
+        # closure (gh-10620)
+        gc.disable()
+        a = np.arange(2)
+        r1 = sys.getrefcount(a)
+        np.array2string(a)
+        np.array2string(a)
+        r2 = sys.getrefcount(a)
+        gc.collect()
+        gc.enable()
+        assert_(r1 == r2)
+
+    def test_with_sign(self):
+        # mixed negative and positive value array
+        a = np.array([-2, 0, 3])
+        assert_equal(
+            np.array2string(a, sign='+'),
+            '[-2 +0 +3]'
+        )
+        assert_equal(
+            np.array2string(a, sign='-'),
+            '[-2  0  3]'
+        )
+        assert_equal(
+            np.array2string(a, sign=' '),
+            '[-2  0  3]'
+        )
+        # all non-negative array
+        a = np.array([2, 0, 3])
+        assert_equal(
+            np.array2string(a, sign='+'),
+            '[+2 +0 +3]'
+        )
+        assert_equal(
+            np.array2string(a, sign='-'),
+            '[2 0 3]'
+        )
+        assert_equal(
+            np.array2string(a, sign=' '),
+            '[ 2  0  3]'
+        )
+        # all negative array
+        a = np.array([-2, -1, -3])
+        assert_equal(
+            np.array2string(a, sign='+'),
+            '[-2 -1 -3]'
+        )
+        assert_equal(
+            np.array2string(a, sign='-'),
+            '[-2 -1 -3]'
+        )
+        assert_equal(
+            np.array2string(a, sign=' '),
+            '[-2 -1 -3]'
+        )
+        # 2d array mixed negative and positive
+        a = np.array([[10, -1, 1, 1], [10, 10, 10, 10]])
+        assert_equal(
+            np.array2string(a, sign='+'),
+            '[[+10  -1  +1  +1]\n [+10 +10 +10 +10]]'
+        )
+        assert_equal(
+            np.array2string(a, sign='-'),
+            '[[10 -1  1  1]\n [10 10 10 10]]'
+        )
+        assert_equal(
+            np.array2string(a, sign=' '),
+            '[[10 -1  1  1]\n [10 10 10 10]]'
+        )
+        # 2d array all positive
+        a = np.array([[10, 0, 1, 1], [10, 10, 10, 10]])
+        assert_equal(
+            np.array2string(a, sign='+'),
+            '[[+10  +0  +1  +1]\n [+10 +10 +10 +10]]'
+        )
+        assert_equal(
+            np.array2string(a, sign='-'),
+            '[[10  0  1  1]\n [10 10 10 10]]'
+        )
+        assert_equal(
+            np.array2string(a, sign=' '),
+            '[[ 10   0   1   1]\n [ 10  10  10  10]]'
+        )
+        # 2d array all negative
+        a = np.array([[-10, -1, -1, -1], [-10, -10, -10, -10]])
+        assert_equal(
+            np.array2string(a, sign='+'),
+            '[[-10  -1  -1  -1]\n [-10 -10 -10 -10]]'
+        )
+        assert_equal(
+            np.array2string(a, sign='-'),
+            '[[-10  -1  -1  -1]\n [-10 -10 -10 -10]]'
+        )
+        assert_equal(
+            np.array2string(a, sign=' '),
+            '[[-10  -1  -1  -1]\n [-10 -10 -10 -10]]'
+        )
+
+
+class TestPrintOptions:
+    """Test getting and setting global print options."""
+
+    def setup_method(self):
+        self.oldopts = np.get_printoptions()
+
+    def teardown_method(self):
+        np.set_printoptions(**self.oldopts)
+
+    def test_basic(self):
+        x = np.array([1.5, 0, 1.234567890])
+        assert_equal(repr(x), "array([1.5       , 0.        , 1.23456789])")
+        ret = np.set_printoptions(precision=4)
+        assert_equal(repr(x), "array([1.5   , 0.    , 1.2346])")
+        assert ret is None
+
+    def test_precision_zero(self):
+        np.set_printoptions(precision=0)
+        for values, string in (
+                ([0.], "0."), ([.3], "0."), ([-.3], "-0."), ([.7], "1."),
+                ([1.5], "2."), ([-1.5], "-2."), ([-15.34], "-15."),
+                ([100.], "100."), ([.2, -1, 122.51], "  0.,  -1., 123."),
+                ([0], "0"), ([-12], "-12"), ([complex(.3, -.7)], "0.-1.j")):
+            x = np.array(values)
+            assert_equal(repr(x), "array([%s])" % string)
+
+    def test_formatter(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+
+    def test_formatter_reset(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'all':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'int':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int_kind':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        x = np.arange(3.)
+        np.set_printoptions(formatter={'float':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1.0, 0.0, 1.0])")
+        np.set_printoptions(formatter={'float_kind':None})
+        assert_equal(repr(x), "array([0., 1., 2.])")
+
+    def test_override_repr(self):
+        x = np.arange(3)
+        np.set_printoptions(override_repr=lambda x: "FOO")
+        assert_equal(repr(x), "FOO")
+        np.set_printoptions(override_repr=None)
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        with np.printoptions(override_repr=lambda x: "BAR"):
+            assert_equal(repr(x), "BAR")
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+    def test_0d_arrays(self):
+        assert_equal(str(np.array('café', '<U4')), 'café')
+
+        assert_equal(repr(np.array('café', '<U4')),
+                     "array('café', dtype='<U4')")
+        assert_equal(str(np.array('test', np.str_)), 'test')
+
+        a = np.zeros(1, dtype=[('a', '<i4', (3,))])
+        assert_equal(str(a[0]), '([0, 0, 0],)')
+
+        assert_equal(repr(np.datetime64('2005-02-25')[...]),
+                     "array('2005-02-25', dtype='datetime64[D]')")
+
+        assert_equal(repr(np.timedelta64('10', 'Y')[...]),
+                     "array(10, dtype='timedelta64[Y]')")
+
+        # repr of 0d arrays is affected by printoptions
+        x = np.array(1)
+        np.set_printoptions(formatter={'all':lambda x: "test"})
+        assert_equal(repr(x), "array(test)")
+        # str is unaffected
+        assert_equal(str(x), "1")
+
+        # check `style` arg raises
+        assert_warns(DeprecationWarning, np.array2string,
+                                         np.array(1.), style=repr)
+        # but not in legacy mode
+        np.array2string(np.array(1.), style=repr, legacy='1.13')
+        # gh-10934 style was broken in legacy mode, check it works
+        np.array2string(np.array(1.), legacy='1.13')
+
+    def test_float_spacing(self):
+        x = np.array([1., 2., 3.])
+        y = np.array([1., 2., -10.])
+        z = np.array([100., 2., -1.])
+        w = np.array([-100., 2., 1.])
+
+        assert_equal(repr(x), 'array([1., 2., 3.])')
+        assert_equal(repr(y), 'array([  1.,   2., -10.])')
+        assert_equal(repr(np.array(y[0])), 'array(1.)')
+        assert_equal(repr(np.array(y[-1])), 'array(-10.)')
+        assert_equal(repr(z), 'array([100.,   2.,  -1.])')
+        assert_equal(repr(w), 'array([-100.,    2.,    1.])')
+
+        assert_equal(repr(np.array([np.nan, np.inf])), 'array([nan, inf])')
+        assert_equal(repr(np.array([np.nan, -np.inf])), 'array([ nan, -inf])')
+
+        x = np.array([np.inf, 100000, 1.1234])
+        y = np.array([np.inf, 100000, -1.1234])
+        z = np.array([np.inf, 1.1234, -1e120])
+        np.set_printoptions(precision=2)
+        assert_equal(repr(x), 'array([     inf, 1.00e+05, 1.12e+00])')
+        assert_equal(repr(y), 'array([      inf,  1.00e+05, -1.12e+00])')
+        assert_equal(repr(z), 'array([       inf,  1.12e+000, -1.00e+120])')
+
+    def test_bool_spacing(self):
+        assert_equal(repr(np.array([True,  True])),
+                     'array([ True,  True])')
+        assert_equal(repr(np.array([True, False])),
+                     'array([ True, False])')
+        assert_equal(repr(np.array([True])),
+                     'array([ True])')
+        assert_equal(repr(np.array(True)),
+                     'array(True)')
+        assert_equal(repr(np.array(False)),
+                     'array(False)')
+
+    def test_sign_spacing(self):
+        a = np.arange(4.)
+        b = np.array([1.234e9])
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        assert_equal(repr(a), 'array([0., 1., 2., 3.])')
+        assert_equal(repr(np.array(1.)), 'array(1.)')
+        assert_equal(repr(b), 'array([1.234e+09])')
+        assert_equal(repr(np.array([0.])), 'array([0.])')
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign=' ')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(np.array(1.)), 'array( 1.)')
+        assert_equal(repr(b), 'array([ 1.234e+09])')
+        assert_equal(repr(c),
+            "array([ 1.        +1.j        ,  1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign='+')
+        assert_equal(repr(a), 'array([+0., +1., +2., +3.])')
+        assert_equal(repr(np.array(1.)), 'array(+1.)')
+        assert_equal(repr(b), 'array([+1.234e+09])')
+        assert_equal(repr(c),
+            "array([+1.        +1.j        , +1.12345679+1.12345679j])")
+
+        np.set_printoptions(legacy='1.13')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(b),  'array([  1.23400000e+09])')
+        assert_equal(repr(-b), 'array([ -1.23400000e+09])')
+        assert_equal(repr(np.array(1.)), 'array(1.0)')
+        assert_equal(repr(np.array([0.])), 'array([ 0.])')
+        assert_equal(repr(c),
+            "array([ 1.00000000+1.j        ,  1.12345679+1.12345679j])")
+        # gh-10383
+        assert_equal(str(np.array([-1., 10])), "[ -1.  10.]")
+
+        assert_raises(TypeError, np.set_printoptions, wrongarg=True)
+
+    def test_float_overflow_nowarn(self):
+        # make sure internal computations in FloatingFormat don't
+        # warn about overflow
+        repr(np.array([1e4, 0.1], dtype='f2'))
+
+    def test_sign_spacing_structured(self):
+        a = np.ones(2, dtype='<f,<f')
+        assert_equal(repr(a),
+            "array([(1., 1.), (1., 1.)], dtype=[('f0', '<f4'), ('f1', '<f4')])")
+        assert_equal(repr(a[0]),
+            "np.void((1.0, 1.0), dtype=[('f0', '<f4'), ('f1', '<f4')])")
+
+    def test_floatmode(self):
+        x = np.array([0.6104, 0.922, 0.457, 0.0906, 0.3733, 0.007244,
+                      0.5933, 0.947, 0.2383, 0.4226], dtype=np.float16)
+        y = np.array([0.2918820979355541, 0.5064172631089138,
+                      0.2848750619642916, 0.4342965294660567,
+                      0.7326538397312751, 0.3459503329096204,
+                      0.0862072768214508, 0.39112753029631175],
+                      dtype=np.float64)
+        z = np.arange(6, dtype=np.float16)/10
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        # also make sure 1e23 is right (is between two fp numbers)
+        w = np.array(['1e{}'.format(i) for i in range(25)], dtype=np.float64)
+        # note: we construct w from the strings `1eXX` instead of doing
+        # `10.**arange(24)` because it turns out the two are not equivalent in
+        # python. On some architectures `1e23 != 10.**23`.
+        wp = np.array([1.234e1, 1e2, 1e123])
+
+        # unique mode
+        np.set_printoptions(floatmode='unique')
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918820979355541 , 0.5064172631089138 , 0.2848750619642916 ,\n"
+            "       0.4342965294660567 , 0.7326538397312751 , 0.3459503329096204 ,\n"
+            "       0.0862072768214508 , 0.39112753029631175])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w),
+            "array([1.e+00, 1.e+01, 1.e+02, 1.e+03, 1.e+04, 1.e+05, 1.e+06, 1.e+07,\n"
+            "       1.e+08, 1.e+09, 1.e+10, 1.e+11, 1.e+12, 1.e+13, 1.e+14, 1.e+15,\n"
+            "       1.e+16, 1.e+17, 1.e+18, 1.e+19, 1.e+20, 1.e+21, 1.e+22, 1.e+23,\n"
+            "       1.e+24])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.         +1.j         , 1.123456789+1.123456789j])")
+
+        # maxprec mode, precision=8
+        np.set_printoptions(floatmode='maxprec', precision=8)
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918821 , 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+
+        # fixed mode, precision=4
+        np.set_printoptions(floatmode='fixed', precision=4)
+        assert_equal(repr(x),
+            "array([0.6104, 0.9219, 0.4570, 0.0906, 0.3733, 0.0072, 0.5933, 0.9468,\n"
+            "       0.2383, 0.4226], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2919, 0.5064, 0.2849, 0.4343, 0.7327, 0.3460, 0.0862, 0.3911])")
+        assert_equal(repr(z),
+            "array([0.0000, 0.1000, 0.2000, 0.3000, 0.3999, 0.5000], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.0000e+00, 1.0000e+05, 1.0000e+10, 1.0000e+15, 1.0000e+20])")
+        assert_equal(repr(wp), "array([1.2340e+001, 1.0000e+002, 1.0000e+123])")
+        assert_equal(repr(np.zeros(3)), "array([0.0000, 0.0000, 0.0000])")
+        assert_equal(repr(c),
+            "array([1.0000+1.0000j, 1.1235+1.1235j])")
+        # for larger precision, representation error becomes more apparent:
+        np.set_printoptions(floatmode='fixed', precision=8)
+        assert_equal(repr(z),
+            "array([0.00000000, 0.09997559, 0.19995117, 0.30004883, 0.39990234,\n"
+            "       0.50000000], dtype=float16)")
+
+        # maxprec_equal  mode, precision=8
+        np.set_printoptions(floatmode='maxprec_equal', precision=8)
+        assert_equal(repr(x),
+            "array([0.610352, 0.921875, 0.457031, 0.090576, 0.373291, 0.007244,\n"
+            "       0.593262, 0.946777, 0.238281, 0.422607], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.29188210, 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0.0, 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.00000000+1.00000000j, 1.12345679+1.12345679j])")
+
+        # test unique special case (gh-18609)
+        a = np.float64.fromhex('-1p-97')
+        assert_equal(np.float64(np.array2string(a, floatmode='unique')), a)
+
+    def test_legacy_mode_scalars(self):
+        # in legacy mode, str of floats get truncated, and complex scalars
+        # use * for non-finite imaginary part
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.float64(1.123456789123456789)), '1.12345678912')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nan*j)')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.float64(1.123456789123456789)),
+                     '1.1234567891234568')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nanj)')
+
+    def test_legacy_stray_comma(self):
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ..., 9997 9998 9999]')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ... 9997 9998 9999]')
+
+    def test_dtype_linewidth_wrapping(self):
+        np.set_printoptions(linewidth=75)
+        assert_equal(repr(np.arange(10,20., dtype='f4')),
+            "array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19.], dtype=float32)")
+        assert_equal(repr(np.arange(10,23., dtype='f4')), textwrap.dedent("""\
+            array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19., 20., 21., 22.],
+                  dtype=float32)"""))
+
+        styp = '<U4'
+        assert_equal(repr(np.ones(3, dtype=styp)),
+            "array(['1', '1', '1'], dtype='{}')".format(styp))
+        assert_equal(repr(np.ones(12, dtype=styp)), textwrap.dedent("""\
+            array(['1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1'],
+                  dtype='{}')""".format(styp)))
+
+    @pytest.mark.parametrize(
+        ['native'],
+        [
+            ('bool',),
+            ('uint8',),
+            ('uint16',),
+            ('uint32',),
+            ('uint64',),
+            ('int8',),
+            ('int16',),
+            ('int32',),
+            ('int64',),
+            ('float16',),
+            ('float32',),
+            ('float64',),
+            ('U1',),     # 4-byte width string
+        ],
+    )
+    def test_dtype_endianness_repr(self, native):
+        '''
+        there was an issue where
+        repr(array([0], dtype='<u2')) and repr(array([0], dtype='>u2'))
+        both returned the same thing:
+        array([0], dtype=uint16)
+        even though their dtypes have different endianness.
+        '''
+        native_dtype = np.dtype(native)
+        non_native_dtype = native_dtype.newbyteorder()
+        non_native_repr = repr(np.array([1], non_native_dtype))
+        native_repr = repr(np.array([1], native_dtype))
+        # preserve the sensible default of only showing dtype if nonstandard
+        assert ('dtype' in native_repr) ^ (native_dtype in _typelessdata),\
+                ("an array's repr should show dtype if and only if the type "
+                 'of the array is NOT one of the standard types '
+                 '(e.g., int32, bool, float64).')
+        if non_native_dtype.itemsize > 1:
+            # if the type is >1 byte, the non-native endian version
+            # must show endianness.
+            assert non_native_repr != native_repr
+            assert f"dtype='{non_native_dtype.byteorder}" in non_native_repr
+
+    def test_linewidth_repr(self):
+        a = np.full(7, fill_value=2)
+        np.set_printoptions(linewidth=17)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2])""")
+        )
+        np.set_printoptions(linewidth=17, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+        a = np.full(8, fill_value=2)
+
+        np.set_printoptions(linewidth=18, legacy=False)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2, 2])""")
+        )
+
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+    def test_linewidth_str(self):
+        a = np.full(18, fill_value=2)
+        np.set_printoptions(linewidth=18)
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2
+             2 2]""")
+        )
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2 2]""")
+        )
+
+    def test_edgeitems(self):
+        np.set_printoptions(edgeitems=1, threshold=1)
+        a = np.arange(27).reshape((3, 3, 3))
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([[[ 0, ...,  2],
+                    ...,
+                    [ 6, ...,  8]],
+
+                   ...,
+
+                   [[18, ..., 20],
+                    ...,
+                    [24, ..., 26]]], shape=(3, 3, 3))""")
+        )
+
+        b = np.zeros((3, 3, 1, 1))
+        assert_equal(
+            repr(b),
+            textwrap.dedent("""\
+            array([[[[0.]],
+
+                    ...,
+
+                    [[0.]]],
+
+
+                   ...,
+
+
+                   [[[0.]],
+
+                    ...,
+
+                    [[0.]]]], shape=(3, 3, 1, 1))""")
+        )
+
+        # 1.13 had extra trailing spaces, and was missing newlines
+        try:
+            np.set_printoptions(legacy='1.13')
+            assert_equal(repr(a), (
+                "array([[[ 0, ...,  2],\n"
+                "        ..., \n"
+                "        [ 6, ...,  8]],\n"
+                "\n"
+                "       ..., \n"
+                "       [[18, ..., 20],\n"
+                "        ..., \n"
+                "        [24, ..., 26]]])")
+            )
+            assert_equal(repr(b), (
+                "array([[[[ 0.]],\n"
+                "\n"
+                "        ..., \n"
+                "        [[ 0.]]],\n"
+                "\n"
+                "\n"
+                "       ..., \n"
+                "       [[[ 0.]],\n"
+                "\n"
+                "        ..., \n"
+                "        [[ 0.]]]])")
+            )
+        finally:
+            np.set_printoptions(legacy=False)
+
+    def test_edgeitems_structured(self):
+        np.set_printoptions(edgeitems=1, threshold=1)
+        A = np.arange(5*2*3, dtype="<i8").view([('i', "<i8", (5, 2, 3))])
+        reprA = (
+            "array([([[[ 0, ...,  2], [ 3, ...,  5]], ..., "
+            "[[24, ..., 26], [27, ..., 29]]],)],\n"
+            "      dtype=[('i', '<i8', (5, 2, 3))])"
+        )
+        assert_equal(repr(A), reprA)
+
+    def test_bad_args(self):
+        assert_raises(ValueError, np.set_printoptions, threshold=float('nan'))
+        assert_raises(TypeError, np.set_printoptions, threshold='1')
+        assert_raises(TypeError, np.set_printoptions, threshold=b'1')
+
+        assert_raises(TypeError, np.set_printoptions, precision='1')
+        assert_raises(TypeError, np.set_printoptions, precision=1.5)
+
+def test_unicode_object_array():
+    expected = "array(['é'], dtype=object)"
+    x = np.array(['\xe9'], dtype=object)
+    assert_equal(repr(x), expected)
+
+
+class TestContextManager:
+    def test_ctx_mgr(self):
+        # test that context manager actually works
+        with np.printoptions(precision=2):
+            s = str(np.array([2.0]) / 3)
+        assert_equal(s, '[0.67]')
+
+    def test_ctx_mgr_restores(self):
+        # test that print options are actually restored
+        opts = np.get_printoptions()
+        with np.printoptions(precision=opts['precision'] - 1,
+                             linewidth=opts['linewidth'] - 4):
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_exceptions(self):
+        # test that print options are restored even if an exception is raised
+        opts = np.get_printoptions()
+        try:
+            with np.printoptions(precision=2, linewidth=11):
+                raise ValueError
+        except ValueError:
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_as_smth(self):
+        opts = {"precision": 2}
+        with np.printoptions(**opts) as ctx:
+            saved_opts = ctx.copy()
+        assert_equal({k: saved_opts[k] for k in opts}, opts)
+
+
+@pytest.mark.parametrize("dtype", "bhilqpBHILQPefdgFDG")
+@pytest.mark.parametrize("value", [0, 1])
+def test_scalar_repr_numbers(dtype, value):
+    # Test NEP 51 scalar repr (and legacy option) for numeric types
+    dtype = np.dtype(dtype)
+    scalar = np.array(value, dtype=dtype)[()]
+    assert isinstance(scalar, np.generic)
+
+    string = str(scalar)
+    repr_string = string.strip("()")  # complex may have extra brackets
+    representation = repr(scalar)
+    if dtype.char == "g":
+        assert representation == f"np.longdouble('{repr_string}')"
+    elif dtype.char == 'G':
+        assert representation == f"np.clongdouble('{repr_string}')"
+    else:
+        normalized_name = np.dtype(f"{dtype.kind}{dtype.itemsize}").type.__name__
+        assert representation == f"np.{normalized_name}({repr_string})"
+
+    with np.printoptions(legacy="1.25"):
+        assert repr(scalar) == string
+
+
+@pytest.mark.parametrize("scalar, legacy_repr, representation", [
+        (np.True_, "True", "np.True_"),
+        (np.bytes_(b'a'), "b'a'", "np.bytes_(b'a')"),
+        (np.str_('a'), "'a'", "np.str_('a')"),
+        (np.datetime64("2012"),
+            "numpy.datetime64('2012')", "np.datetime64('2012')"),
+        (np.timedelta64(1), "numpy.timedelta64(1)", "np.timedelta64(1)"),
+        (np.void((True, 2), dtype="?,<i8"),
+            "(True, 2)",
+            "np.void((True, 2), dtype=[('f0', '?'), ('f1', '<i8')])"),
+        (np.void((1, 2), dtype="<f8,>f4"),
+            "(1., 2.)",
+            "np.void((1.0, 2.0), dtype=[('f0', '<f8'), ('f1', '>f4')])"),
+        (np.void(b'a'), r"void(b'\x61')", r"np.void(b'\x61')"),
+    ])
+def test_scalar_repr_special(scalar, legacy_repr, representation):
+    # Test NEP 51 scalar repr (and legacy option) for numeric types
+    assert repr(scalar) == representation
+
+    with np.printoptions(legacy="1.25"):
+        assert repr(scalar) == legacy_repr
+
+def test_scalar_void_float_str():
+    # Note that based on this currently we do not print the same as a tuple
+    # would, since the tuple would include the repr() inside for floats, but
+    # we do not do that.
+    scalar = np.void((1.0, 2.0), dtype=[('f0', '<f8'), ('f1', '>f4')])
+    assert str(scalar) == "(1.0, 2.0)"
+
+@pytest.mark.skipif(IS_WASM, reason="wasm doesn't support asyncio")
+@pytest.mark.skipif(sys.version_info < (3, 11),
+                    reason="asyncio.barrier was added in Python 3.11")
+def test_printoptions_asyncio_safe():
+    asyncio = pytest.importorskip("asyncio")
+
+    b = asyncio.Barrier(2)
+
+    async def legacy_113():
+        np.set_printoptions(legacy='1.13', precision=12)
+        await b.wait()
+        po = np.get_printoptions()
+        assert po['legacy'] == '1.13'
+        assert po['precision'] == 12
+        orig_linewidth = po['linewidth']
+        with np.printoptions(linewidth=34, legacy='1.21'):
+            po = np.get_printoptions()
+            assert po['legacy'] == '1.21'
+            assert po['precision'] == 12
+            assert po['linewidth'] == 34
+        po = np.get_printoptions()
+        assert po['linewidth'] == orig_linewidth
+        assert po['legacy'] == '1.13'
+        assert po['precision'] == 12
+
+    async def legacy_125():
+        np.set_printoptions(legacy='1.25', precision=7)
+        await b.wait()
+        po = np.get_printoptions()
+        assert po['legacy'] == '1.25'
+        assert po['precision'] == 7
+        orig_linewidth = po['linewidth']
+        with np.printoptions(linewidth=6, legacy='1.13'):
+            po = np.get_printoptions()
+            assert po['legacy'] == '1.13'
+            assert po['precision'] == 7
+            assert po['linewidth'] == 6
+        po = np.get_printoptions()
+        assert po['linewidth'] == orig_linewidth
+        assert po['legacy'] == '1.25'
+        assert po['precision'] == 7
+
+    async def main():
+        await asyncio.gather(legacy_125(), legacy_125())
+
+    loop = asyncio.new_event_loop()
+    asyncio.run(main())
+    loop.close()
+
+@pytest.mark.skipif(IS_WASM, reason="wasm doesn't support threads")
+def test_multithreaded_array_printing():
+    # the dragon4 implementation uses a static scratch space for performance
+    # reasons this test makes sure it is set up in a thread-safe manner
+
+    run_threaded(TestPrintOptions().test_floatmode, 500)

janus/lib/python3.10/site-packages/numpy/_core/tests/test_casting_floatingpoint_errors.py

@@ -0,0 +1,154 @@
+import pytest
+from pytest import param
+from numpy.testing import IS_WASM
+import numpy as np
+
+
+def values_and_dtypes():
+    """
+    Generate value+dtype pairs that generate floating point errors during
+    casts.  The invalid casts to integers will generate "invalid" value
+    warnings, the float casts all generate "overflow".
+
+    (The Python int/float paths don't need to get tested in all the same
+    situations, but it does not hurt.)
+    """
+    # Casting to float16:
+    yield param(70000, "float16", id="int-to-f2")
+    yield param("70000", "float16", id="str-to-f2")
+    yield param(70000.0, "float16", id="float-to-f2")
+    yield param(np.longdouble(70000.), "float16", id="longdouble-to-f2")
+    yield param(np.float64(70000.), "float16", id="double-to-f2")
+    yield param(np.float32(70000.), "float16", id="float-to-f2")
+    # Casting to float32:
+    yield param(10**100, "float32", id="int-to-f4")
+    yield param(1e100, "float32", id="float-to-f2")
+    yield param(np.longdouble(1e300), "float32", id="longdouble-to-f2")
+    yield param(np.float64(1e300), "float32", id="double-to-f2")
+    # Casting to float64:
+    # If longdouble is double-double, its max can be rounded down to the double
+    # max.  So we correct the double spacing (a bit weird, admittedly):
+    max_ld = np.finfo(np.longdouble).max
+    spacing = np.spacing(np.nextafter(np.finfo("f8").max, 0))
+    if max_ld - spacing > np.finfo("f8").max:
+        yield param(np.finfo(np.longdouble).max, "float64",
+                    id="longdouble-to-f8")
+
+    # Cast to complex32:
+    yield param(2e300, "complex64", id="float-to-c8")
+    yield param(2e300+0j, "complex64", id="complex-to-c8")
+    yield param(2e300j, "complex64", id="complex-to-c8")
+    yield param(np.longdouble(2e300), "complex64", id="longdouble-to-c8")
+
+    # Invalid float to integer casts:
+    with np.errstate(over="ignore"):
+        for to_dt in np.typecodes["AllInteger"]:
+            for value in [np.inf, np.nan]:
+                for from_dt in np.typecodes["AllFloat"]:
+                    from_dt = np.dtype(from_dt)
+                    from_val = from_dt.type(value)
+
+                    yield param(from_val, to_dt, id=f"{from_val}-to-{to_dt}")
+
+
+def check_operations(dtype, value):
+    """
+    There are many dedicated paths in NumPy which cast and should check for
+    floating point errors which occurred during those casts.
+    """
+    if dtype.kind != 'i':
+        # These assignments use the stricter setitem logic:
+        def assignment():
+            arr = np.empty(3, dtype=dtype)
+            arr[0] = value
+
+        yield assignment
+
+        def fill():
+            arr = np.empty(3, dtype=dtype)
+            arr.fill(value)
+
+        yield fill
+
+    def copyto_scalar():
+        arr = np.empty(3, dtype=dtype)
+        np.copyto(arr, value, casting="unsafe")
+
+    yield copyto_scalar
+
+    def copyto():
+        arr = np.empty(3, dtype=dtype)
+        np.copyto(arr, np.array([value, value, value]), casting="unsafe")
+
+    yield copyto
+
+    def copyto_scalar_masked():
+        arr = np.empty(3, dtype=dtype)
+        np.copyto(arr, value, casting="unsafe",
+                  where=[True, False, True])
+
+    yield copyto_scalar_masked
+
+    def copyto_masked():
+        arr = np.empty(3, dtype=dtype)
+        np.copyto(arr, np.array([value, value, value]), casting="unsafe",
+                  where=[True, False, True])
+
+    yield copyto_masked
+
+    def direct_cast():
+        np.array([value, value, value]).astype(dtype)
+
+    yield direct_cast
+
+    def direct_cast_nd_strided():
+        arr = np.full((5, 5, 5), fill_value=value)[:, ::2, :]
+        arr.astype(dtype)
+
+    yield direct_cast_nd_strided
+
+    def boolean_array_assignment():
+        arr = np.empty(3, dtype=dtype)
+        arr[[True, False, True]] = np.array([value, value])
+
+    yield boolean_array_assignment
+
+    def integer_array_assignment():
+        arr = np.empty(3, dtype=dtype)
+        values = np.array([value, value])
+
+        arr[[0, 1]] = values
+
+    yield integer_array_assignment
+
+    def integer_array_assignment_with_subspace():
+        arr = np.empty((5, 3), dtype=dtype)
+        values = np.array([value, value, value])
+
+        arr[[0, 2]] = values
+
+    yield integer_array_assignment_with_subspace
+
+    def flat_assignment():
+        arr = np.empty((3,), dtype=dtype)
+        values = np.array([value, value, value])
+        arr.flat[:] = values
+
+    yield flat_assignment
+
+@pytest.mark.skipif(IS_WASM, reason="no wasm fp exception support")
+@pytest.mark.parametrize(["value", "dtype"], values_and_dtypes())
+@pytest.mark.filterwarnings("ignore::numpy.exceptions.ComplexWarning")
+def test_floatingpoint_errors_casting(dtype, value):
+    dtype = np.dtype(dtype)
+    for operation in check_operations(dtype, value):
+        dtype = np.dtype(dtype)
+
+        match = "invalid" if dtype.kind in 'iu' else "overflow"
+        with pytest.warns(RuntimeWarning, match=match):
+            operation()
+
+        with np.errstate(all="raise"):
+            with pytest.raises(FloatingPointError, match=match):
+                operation()
+

janus/lib/python3.10/site-packages/numpy/_core/tests/test_conversion_utils.py

@@ -0,0 +1,209 @@
+"""
+Tests for numpy/_core/src/multiarray/conversion_utils.c
+"""
+import re
+import sys
+
+import pytest
+
+import numpy as np
+import numpy._core._multiarray_tests as mt
+from numpy._core.multiarray import CLIP, WRAP, RAISE
+from numpy.testing import assert_warns, IS_PYPY
+
+
+class StringConverterTestCase:
+    allow_bytes = True
+    case_insensitive = True
+    exact_match = False
+    warn = True
+
+    def _check_value_error(self, val):
+        pattern = r'\(got {}\)'.format(re.escape(repr(val)))
+        with pytest.raises(ValueError, match=pattern) as exc:
+            self.conv(val)
+
+    def _check_conv_assert_warn(self, val, expected):
+        if self.warn:
+            with assert_warns(DeprecationWarning) as exc:
+                assert self.conv(val) == expected
+        else:
+            assert self.conv(val) == expected
+
+    def _check(self, val, expected):
+        """Takes valid non-deprecated inputs for converters,
+        runs converters on inputs, checks correctness of outputs,
+        warnings and errors"""
+        assert self.conv(val) == expected
+
+        if self.allow_bytes:
+            assert self.conv(val.encode('ascii')) == expected
+        else:
+            with pytest.raises(TypeError):
+                self.conv(val.encode('ascii'))
+
+        if len(val) != 1:
+            if self.exact_match:
+                self._check_value_error(val[:1])
+                self._check_value_error(val + '\0')
+            else:
+                self._check_conv_assert_warn(val[:1], expected)
+
+        if self.case_insensitive:
+            if val != val.lower():
+                self._check_conv_assert_warn(val.lower(), expected)
+            if val != val.upper():
+                self._check_conv_assert_warn(val.upper(), expected)
+        else:
+            if val != val.lower():
+                self._check_value_error(val.lower())
+            if val != val.upper():
+                self._check_value_error(val.upper())
+
+    def test_wrong_type(self):
+        # common cases which apply to all the below
+        with pytest.raises(TypeError):
+            self.conv({})
+        with pytest.raises(TypeError):
+            self.conv([])
+
+    def test_wrong_value(self):
+        # nonsense strings
+        self._check_value_error('')
+        self._check_value_error('\N{greek small letter pi}')
+
+        if self.allow_bytes:
+            self._check_value_error(b'')
+            # bytes which can't be converted to strings via utf8
+            self._check_value_error(b"\xFF")
+        if self.exact_match:
+            self._check_value_error("there's no way this is supported")
+
+
+class TestByteorderConverter(StringConverterTestCase):
+    """ Tests of PyArray_ByteorderConverter """
+    conv = mt.run_byteorder_converter
+    warn = False
+
+    def test_valid(self):
+        for s in ['big', '>']:
+            self._check(s, 'NPY_BIG')
+        for s in ['little', '<']:
+            self._check(s, 'NPY_LITTLE')
+        for s in ['native', '=']:
+            self._check(s, 'NPY_NATIVE')
+        for s in ['ignore', '|']:
+            self._check(s, 'NPY_IGNORE')
+        for s in ['swap']:
+            self._check(s, 'NPY_SWAP')
+
+
+class TestSortkindConverter(StringConverterTestCase):
+    """ Tests of PyArray_SortkindConverter """
+    conv = mt.run_sortkind_converter
+    warn = False
+
+    def test_valid(self):
+        self._check('quicksort', 'NPY_QUICKSORT')
+        self._check('heapsort', 'NPY_HEAPSORT')
+        self._check('mergesort', 'NPY_STABLESORT')  # alias
+        self._check('stable', 'NPY_STABLESORT')
+
+
+class TestSelectkindConverter(StringConverterTestCase):
+    """ Tests of PyArray_SelectkindConverter """
+    conv = mt.run_selectkind_converter
+    case_insensitive = False
+    exact_match = True
+
+    def test_valid(self):
+        self._check('introselect', 'NPY_INTROSELECT')
+
+
+class TestSearchsideConverter(StringConverterTestCase):
+    """ Tests of PyArray_SearchsideConverter """
+    conv = mt.run_searchside_converter
+    def test_valid(self):
+        self._check('left', 'NPY_SEARCHLEFT')
+        self._check('right', 'NPY_SEARCHRIGHT')
+
+
+class TestOrderConverter(StringConverterTestCase):
+    """ Tests of PyArray_OrderConverter """
+    conv = mt.run_order_converter
+    warn = False
+
+    def test_valid(self):
+        self._check('c', 'NPY_CORDER')
+        self._check('f', 'NPY_FORTRANORDER')
+        self._check('a', 'NPY_ANYORDER')
+        self._check('k', 'NPY_KEEPORDER')
+
+    def test_flatten_invalid_order(self):
+        # invalid after gh-14596
+        with pytest.raises(ValueError):
+            self.conv('Z')
+        for order in [False, True, 0, 8]:
+            with pytest.raises(TypeError):
+                self.conv(order)
+
+
+class TestClipmodeConverter(StringConverterTestCase):
+    """ Tests of PyArray_ClipmodeConverter """
+    conv = mt.run_clipmode_converter
+    def test_valid(self):
+        self._check('clip', 'NPY_CLIP')
+        self._check('wrap', 'NPY_WRAP')
+        self._check('raise', 'NPY_RAISE')
+
+        # integer values allowed here
+        assert self.conv(CLIP) == 'NPY_CLIP'
+        assert self.conv(WRAP) == 'NPY_WRAP'
+        assert self.conv(RAISE) == 'NPY_RAISE'
+
+
+class TestCastingConverter(StringConverterTestCase):
+    """ Tests of PyArray_CastingConverter """
+    conv = mt.run_casting_converter
+    case_insensitive = False
+    exact_match = True
+
+    def test_valid(self):
+        self._check("no", "NPY_NO_CASTING")
+        self._check("equiv", "NPY_EQUIV_CASTING")
+        self._check("safe", "NPY_SAFE_CASTING")
+        self._check("same_kind", "NPY_SAME_KIND_CASTING")
+        self._check("unsafe", "NPY_UNSAFE_CASTING")
+
+
+class TestIntpConverter:
+    """ Tests of PyArray_IntpConverter """
+    conv = mt.run_intp_converter
+
+    def test_basic(self):
+        assert self.conv(1) == (1,)
+        assert self.conv((1, 2)) == (1, 2)
+        assert self.conv([1, 2]) == (1, 2)
+        assert self.conv(()) == ()
+
+    def test_none(self):
+        # once the warning expires, this will raise TypeError
+        with pytest.warns(DeprecationWarning):
+            assert self.conv(None) == ()
+
+    @pytest.mark.skipif(IS_PYPY and sys.implementation.version <= (7, 3, 8),
+            reason="PyPy bug in error formatting")
+    def test_float(self):
+        with pytest.raises(TypeError):
+            self.conv(1.0)
+        with pytest.raises(TypeError):
+            self.conv([1, 1.0])
+
+    def test_too_large(self):
+        with pytest.raises(ValueError):
+            self.conv(2**64)
+
+    def test_too_many_dims(self):
+        assert self.conv([1]*64) == (1,)*64
+        with pytest.raises(ValueError):
+            self.conv([1]*65)

janus/lib/python3.10/site-packages/numpy/_core/tests/test_custom_dtypes.py

@@ -0,0 +1,311 @@
+from tempfile import NamedTemporaryFile
+
+import pytest
+
+import numpy as np
+from numpy.testing import assert_array_equal
+from numpy._core._multiarray_umath import (
+    _discover_array_parameters as discover_array_params, _get_sfloat_dtype)
+
+
+SF = _get_sfloat_dtype()
+
+
+class TestSFloat:
+    def _get_array(self, scaling, aligned=True):
+        if not aligned:
+            a = np.empty(3*8 + 1, dtype=np.uint8)[1:]
+            a = a.view(np.float64)
+            a[:] = [1., 2., 3.]
+        else:
+            a = np.array([1., 2., 3.])
+
+        a *= 1./scaling  # the casting code also uses the reciprocal.
+        return a.view(SF(scaling))
+
+    def test_sfloat_rescaled(self):
+        sf = SF(1.)
+        sf2 = sf.scaled_by(2.)
+        assert sf2.get_scaling() == 2.
+        sf6 = sf2.scaled_by(3.)
+        assert sf6.get_scaling() == 6.
+
+    def test_class_discovery(self):
+        # This does not test much, since we always discover the scaling as 1.
+        # But most of NumPy (when writing) does not understand DType classes
+        dt, _ = discover_array_params([1., 2., 3.], dtype=SF)
+        assert dt == SF(1.)
+
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_scaled_float_from_floats(self, scaling):
+        a = np.array([1., 2., 3.], dtype=SF(scaling))
+
+        assert a.dtype.get_scaling() == scaling
+        assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.])
+
+    def test_repr(self):
+        # Check the repr, mainly to cover the code paths:
+        assert repr(SF(scaling=1.)) == "_ScaledFloatTestDType(scaling=1.0)"
+
+    def test_dtype_name(self):
+        assert SF(1.).name == "_ScaledFloatTestDType64"
+
+    def test_sfloat_structured_dtype_printing(self):
+        dt = np.dtype([("id", int), ("value", SF(0.5))])
+        # repr of structured dtypes need special handling because the
+        # implementation bypasses the object repr
+        assert "('value', '_ScaledFloatTestDType64')" in repr(dt)
+
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_sfloat_from_float(self, scaling):
+        a = np.array([1., 2., 3.]).astype(dtype=SF(scaling))
+
+        assert a.dtype.get_scaling() == scaling
+        assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.])
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_sfloat_getitem(self, aligned, scaling):
+        a = self._get_array(1., aligned)
+        assert a.tolist() == [1., 2., 3.]
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    def test_sfloat_casts(self, aligned):
+        a = self._get_array(1., aligned)
+
+        assert np.can_cast(a, SF(-1.), casting="equiv")
+        assert not np.can_cast(a, SF(-1.), casting="no")
+        na = a.astype(SF(-1.))
+        assert_array_equal(-1 * na.view(np.float64), a.view(np.float64))
+
+        assert np.can_cast(a, SF(2.), casting="same_kind")
+        assert not np.can_cast(a, SF(2.), casting="safe")
+        a2 = a.astype(SF(2.))
+        assert_array_equal(2 * a2.view(np.float64), a.view(np.float64))
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    def test_sfloat_cast_internal_errors(self, aligned):
+        a = self._get_array(2e300, aligned)
+
+        with pytest.raises(TypeError,
+                match="error raised inside the core-loop: non-finite factor!"):
+            a.astype(SF(2e-300))
+
+    def test_sfloat_promotion(self):
+        assert np.result_type(SF(2.), SF(3.)) == SF(3.)
+        assert np.result_type(SF(3.), SF(2.)) == SF(3.)
+        # Float64 -> SF(1.) and then promotes normally, so both of this work:
+        assert np.result_type(SF(3.), np.float64) == SF(3.)
+        assert np.result_type(np.float64, SF(0.5)) == SF(1.)
+
+        # Test an undefined promotion:
+        with pytest.raises(TypeError):
+            np.result_type(SF(1.), np.int64)
+
+    def test_basic_multiply(self):
+        a = self._get_array(2.)
+        b = self._get_array(4.)
+
+        res = a * b
+        # multiplies dtype scaling and content separately:
+        assert res.dtype.get_scaling() == 8.
+        expected_view = a.view(np.float64) * b.view(np.float64)
+        assert_array_equal(res.view(np.float64), expected_view)
+
+    def test_possible_and_impossible_reduce(self):
+        # For reductions to work, the first and last operand must have the
+        # same dtype.  For this parametric DType that is not necessarily true.
+        a = self._get_array(2.)
+        # Addition reduction works (as of writing requires to pass initial
+        # because setting a scaled-float from the default `0` fails).
+        res = np.add.reduce(a, initial=0.)
+        assert res == a.astype(np.float64).sum()
+
+        # But each multiplication changes the factor, so a reduction is not
+        # possible (the relaxed version of the old refusal to handle any
+        # flexible dtype).
+        with pytest.raises(TypeError,
+                match="the resolved dtypes are not compatible"):
+            np.multiply.reduce(a)
+
+    def test_basic_ufunc_at(self):
+        float_a = np.array([1., 2., 3.])
+        b = self._get_array(2.)
+
+        float_b = b.view(np.float64).copy()
+        np.multiply.at(float_b, [1, 1, 1], float_a)
+        np.multiply.at(b, [1, 1, 1], float_a)
+
+        assert_array_equal(b.view(np.float64), float_b)
+
+    def test_basic_multiply_promotion(self):
+        float_a = np.array([1., 2., 3.])
+        b = self._get_array(2.)
+
+        res1 = float_a * b
+        res2 = b * float_a
+
+        # one factor is one, so we get the factor of b:
+        assert res1.dtype == res2.dtype == b.dtype
+        expected_view = float_a * b.view(np.float64)
+        assert_array_equal(res1.view(np.float64), expected_view)
+        assert_array_equal(res2.view(np.float64), expected_view)
+
+        # Check that promotion works when `out` is used:
+        np.multiply(b, float_a, out=res2)
+        with pytest.raises(TypeError):
+            # The promoter accepts this (maybe it should not), but the SFloat
+            # result cannot be cast to integer:
+            np.multiply(b, float_a, out=np.arange(3))
+
+    def test_basic_addition(self):
+        a = self._get_array(2.)
+        b = self._get_array(4.)
+
+        res = a + b
+        # addition uses the type promotion rules for the result:
+        assert res.dtype == np.result_type(a.dtype, b.dtype)
+        expected_view = (a.astype(res.dtype).view(np.float64) +
+                         b.astype(res.dtype).view(np.float64))
+        assert_array_equal(res.view(np.float64), expected_view)
+
+    def test_addition_cast_safety(self):
+        """The addition method is special for the scaled float, because it
+        includes the "cast" between different factors, thus cast-safety
+        is influenced by the implementation.
+        """
+        a = self._get_array(2.)
+        b = self._get_array(-2.)
+        c = self._get_array(3.)
+
+        # sign change is "equiv":
+        np.add(a, b, casting="equiv")
+        with pytest.raises(TypeError):
+            np.add(a, b, casting="no")
+
+        # Different factor is "same_kind" (default) so check that "safe" fails
+        with pytest.raises(TypeError):
+            np.add(a, c, casting="safe")
+
+        # Check that casting the output fails also (done by the ufunc here)
+        with pytest.raises(TypeError):
+            np.add(a, a, out=c, casting="safe")
+
+    @pytest.mark.parametrize("ufunc",
+            [np.logical_and, np.logical_or, np.logical_xor])
+    def test_logical_ufuncs_casts_to_bool(self, ufunc):
+        a = self._get_array(2.)
+        a[0] = 0.  # make sure first element is considered False.
+
+        float_equiv = a.astype(float)
+        expected = ufunc(float_equiv, float_equiv)
+        res = ufunc(a, a)
+        assert_array_equal(res, expected)
+
+        # also check that the same works for reductions:
+        expected = ufunc.reduce(float_equiv)
+        res = ufunc.reduce(a)
+        assert_array_equal(res, expected)
+
+        # The output casting does not match the bool, bool -> bool loop:
+        with pytest.raises(TypeError):
+            ufunc(a, a, out=np.empty(a.shape, dtype=int), casting="equiv")
+
+    def test_wrapped_and_wrapped_reductions(self):
+        a = self._get_array(2.)
+        float_equiv = a.astype(float)
+
+        expected = np.hypot(float_equiv, float_equiv)
+        res = np.hypot(a, a)
+        assert res.dtype == a.dtype
+        res_float = res.view(np.float64) * 2
+        assert_array_equal(res_float, expected)
+
+        # Also check reduction (keepdims, due to incorrect getitem)
+        res = np.hypot.reduce(a, keepdims=True)
+        assert res.dtype == a.dtype
+        expected = np.hypot.reduce(float_equiv, keepdims=True)
+        assert res.view(np.float64) * 2 == expected
+
+    def test_astype_class(self):
+        # Very simple test that we accept `.astype()` also on the class.
+        # ScaledFloat always returns the default descriptor, but it does
+        # check the relevant code paths.
+        arr = np.array([1., 2., 3.], dtype=object)
+
+        res = arr.astype(SF)  # passing the class class
+        expected = arr.astype(SF(1.))  # above will have discovered 1. scaling
+        assert_array_equal(res.view(np.float64), expected.view(np.float64))
+
+    def test_creation_class(self):
+        # passing in a dtype class should return
+        # the default descriptor
+        arr1 = np.array([1., 2., 3.], dtype=SF)
+        assert arr1.dtype == SF(1.)
+        arr2 = np.array([1., 2., 3.], dtype=SF(1.))
+        assert_array_equal(arr1.view(np.float64), arr2.view(np.float64))
+        assert arr1.dtype == arr2.dtype
+
+        assert np.empty(3, dtype=SF).dtype == SF(1.)
+        assert np.empty_like(arr1, dtype=SF).dtype == SF(1.)
+        assert np.zeros(3, dtype=SF).dtype == SF(1.)
+        assert np.zeros_like(arr1, dtype=SF).dtype == SF(1.)
+
+    def test_np_save_load(self):
+        # this monkeypatch is needed because pickle
+        # uses the repr of a type to reconstruct it
+        np._ScaledFloatTestDType = SF
+
+        arr = np.array([1.0, 2.0, 3.0], dtype=SF(1.0))
+
+        # adapted from RoundtripTest.roundtrip in np.save tests
+        with NamedTemporaryFile("wb", delete=False, suffix=".npz") as f:
+            with pytest.warns(UserWarning) as record:
+                np.savez(f.name, arr)
+
+        assert len(record) == 1
+
+        with np.load(f.name, allow_pickle=True) as data:
+            larr = data["arr_0"]
+        assert_array_equal(arr.view(np.float64), larr.view(np.float64))
+        assert larr.dtype == arr.dtype == SF(1.0)
+
+        del np._ScaledFloatTestDType
+
+    def test_flatiter(self):
+        arr = np.array([1.0, 2.0, 3.0], dtype=SF(1.0))
+
+        for i, val in enumerate(arr.flat):
+            assert arr[i] == val
+
+    @pytest.mark.parametrize(
+        "index", [
+            [1, 2], ..., slice(None, 2, None),
+            np.array([True, True, False]), np.array([0, 1])
+        ], ids=["int_list", "ellipsis", "slice", "bool_array", "int_array"])
+    def test_flatiter_index(self, index):
+        arr = np.array([1.0, 2.0, 3.0], dtype=SF(1.0))
+        np.testing.assert_array_equal(
+            arr[index].view(np.float64), arr.flat[index].view(np.float64))
+
+        arr2 = arr.copy()
+        arr[index] = 5.0
+        arr2.flat[index] = 5.0
+        np.testing.assert_array_equal(
+            arr.view(np.float64), arr2.view(np.float64))
+
+def test_type_pickle():
+    # can't actually unpickle, but we can pickle (if in namespace)
+    import pickle
+
+    np._ScaledFloatTestDType = SF
+
+    s = pickle.dumps(SF)
+    res = pickle.loads(s)
+    assert res is SF
+
+    del np._ScaledFloatTestDType
+
+
+def test_is_numeric():
+    assert SF._is_numeric

janus/lib/python3.10/site-packages/numpy/_core/tests/test_dlpack.py

@@ -0,0 +1,178 @@
+import sys
+import pytest
+
+import numpy as np
+from numpy.testing import assert_array_equal, IS_PYPY
+
+
+def new_and_old_dlpack():
+    yield np.arange(5)
+
+    class OldDLPack(np.ndarray):
+        # Support only the "old" version
+        def __dlpack__(self, stream=None):
+            return super().__dlpack__(stream=None)
+
+    yield np.arange(5).view(OldDLPack)
+
+
+class TestDLPack:
+    @pytest.mark.skipif(IS_PYPY, reason="PyPy can't get refcounts.")
+    @pytest.mark.parametrize("max_version", [(0, 0), None, (1, 0), (100, 3)])
+    def test_dunder_dlpack_refcount(self, max_version):
+        x = np.arange(5)
+        y = x.__dlpack__(max_version=max_version)
+        assert sys.getrefcount(x) == 3
+        del y
+        assert sys.getrefcount(x) == 2
+
+    def test_dunder_dlpack_stream(self):
+        x = np.arange(5)
+        x.__dlpack__(stream=None)
+
+        with pytest.raises(RuntimeError):
+            x.__dlpack__(stream=1)
+
+    def test_dunder_dlpack_copy(self):
+        # Checks the argument parsing of __dlpack__ explicitly.
+        # Honoring the flag is tested in the from_dlpack round-tripping test.
+        x = np.arange(5)
+        x.__dlpack__(copy=True)
+        x.__dlpack__(copy=None)
+        x.__dlpack__(copy=False)
+
+        with pytest.raises(ValueError):
+            # NOTE: The copy converter should be stricter, but not just here.
+            x.__dlpack__(copy=np.array([1, 2, 3]))
+
+    def test_strides_not_multiple_of_itemsize(self):
+        dt = np.dtype([('int', np.int32), ('char', np.int8)])
+        y = np.zeros((5,), dtype=dt)
+        z = y['int']
+
+        with pytest.raises(BufferError):
+            np.from_dlpack(z)
+
+    @pytest.mark.skipif(IS_PYPY, reason="PyPy can't get refcounts.")
+    @pytest.mark.parametrize("arr", new_and_old_dlpack())
+    def test_from_dlpack_refcount(self, arr):
+        arr = arr.copy()
+        y = np.from_dlpack(arr)
+        assert sys.getrefcount(arr) == 3
+        del y
+        assert sys.getrefcount(arr) == 2
+
+    @pytest.mark.parametrize("dtype", [
+        np.bool,
+        np.int8, np.int16, np.int32, np.int64,
+        np.uint8, np.uint16, np.uint32, np.uint64,
+        np.float16, np.float32, np.float64,
+        np.complex64, np.complex128
+    ])
+    @pytest.mark.parametrize("arr", new_and_old_dlpack())
+    def test_dtype_passthrough(self, arr, dtype):
+        x = arr.astype(dtype)
+        y = np.from_dlpack(x)
+
+        assert y.dtype == x.dtype
+        assert_array_equal(x, y)
+
+    def test_invalid_dtype(self):
+        x = np.asarray(np.datetime64('2021-05-27'))
+
+        with pytest.raises(BufferError):
+            np.from_dlpack(x)
+
+    def test_invalid_byte_swapping(self):
+        dt = np.dtype('=i8').newbyteorder()
+        x = np.arange(5, dtype=dt)
+
+        with pytest.raises(BufferError):
+            np.from_dlpack(x)
+
+    def test_non_contiguous(self):
+        x = np.arange(25).reshape((5, 5))
+
+        y1 = x[0]
+        assert_array_equal(y1, np.from_dlpack(y1))
+
+        y2 = x[:, 0]
+        assert_array_equal(y2, np.from_dlpack(y2))
+
+        y3 = x[1, :]
+        assert_array_equal(y3, np.from_dlpack(y3))
+
+        y4 = x[1]
+        assert_array_equal(y4, np.from_dlpack(y4))
+
+        y5 = np.diagonal(x).copy()
+        assert_array_equal(y5, np.from_dlpack(y5))
+
+    @pytest.mark.parametrize("ndim", range(33))
+    def test_higher_dims(self, ndim):
+        shape = (1,) * ndim
+        x = np.zeros(shape, dtype=np.float64)
+
+        assert shape == np.from_dlpack(x).shape
+
+    def test_dlpack_device(self):
+        x = np.arange(5)
+        assert x.__dlpack_device__() == (1, 0)
+        y = np.from_dlpack(x)
+        assert y.__dlpack_device__() == (1, 0)
+        z = y[::2]
+        assert z.__dlpack_device__() == (1, 0)
+
+    def dlpack_deleter_exception(self, max_version):
+        x = np.arange(5)
+        _ = x.__dlpack__(max_version=max_version)
+        raise RuntimeError
+
+    @pytest.mark.parametrize("max_version", [None, (1, 0)])
+    def test_dlpack_destructor_exception(self, max_version):
+        with pytest.raises(RuntimeError):
+            self.dlpack_deleter_exception(max_version=max_version)
+
+    def test_readonly(self):
+        x = np.arange(5)
+        x.flags.writeable = False
+        # Raises without max_version
+        with pytest.raises(BufferError):
+            x.__dlpack__()
+
+        # But works fine if we try with version
+        y = np.from_dlpack(x)
+        assert not y.flags.writeable
+
+    def test_ndim0(self):
+        x = np.array(1.0)
+        y = np.from_dlpack(x)
+        assert_array_equal(x, y)
+
+    def test_size1dims_arrays(self):
+        x = np.ndarray(dtype='f8', shape=(10, 5, 1), strides=(8, 80, 4),
+                       buffer=np.ones(1000, dtype=np.uint8), order='F')
+        y = np.from_dlpack(x)
+        assert_array_equal(x, y)
+
+    def test_copy(self):
+        x = np.arange(5)
+
+        y = np.from_dlpack(x)
+        assert np.may_share_memory(x, y)
+        y = np.from_dlpack(x, copy=False)
+        assert np.may_share_memory(x, y)
+        y = np.from_dlpack(x, copy=True)
+        assert not np.may_share_memory(x, y)
+
+    def test_device(self):
+        x = np.arange(5)
+        # requesting (1, 0), i.e. CPU device works in both calls:
+        x.__dlpack__(dl_device=(1, 0))
+        np.from_dlpack(x, device="cpu")
+        np.from_dlpack(x, device=None)
+
+        with pytest.raises(ValueError):
+            x.__dlpack__(dl_device=(10, 0))
+        with pytest.raises(ValueError):
+            np.from_dlpack(x, device="gpu")

janus/lib/python3.10/site-packages/numpy/_core/tests/test_errstate.py

@@ -0,0 +1,129 @@
+import pytest
+import sysconfig
+
+import numpy as np
+from numpy.testing import assert_, assert_raises, IS_WASM
+
+# The floating point emulation on ARM EABI systems lacking a hardware FPU is
+# known to be buggy. This is an attempt to identify these hosts. It may not
+# catch all possible cases, but it catches the known cases of gh-413 and
+# gh-15562.
+hosttype = sysconfig.get_config_var('HOST_GNU_TYPE')
+arm_softfloat = False if hosttype is None else hosttype.endswith('gnueabi')
+
+class TestErrstate:
+    @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm")
+    @pytest.mark.skipif(arm_softfloat,
+                        reason='platform/cpu issue with FPU (gh-413,-15562)')
+    def test_invalid(self):
+        with np.errstate(all='raise', under='ignore'):
+            a = -np.arange(3)
+            # This should work
+            with np.errstate(invalid='ignore'):
+                np.sqrt(a)
+            # While this should fail!
+            with assert_raises(FloatingPointError):
+                np.sqrt(a)
+
+    @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm")
+    @pytest.mark.skipif(arm_softfloat,
+                        reason='platform/cpu issue with FPU (gh-15562)')
+    def test_divide(self):
+        with np.errstate(all='raise', under='ignore'):
+            a = -np.arange(3)
+            # This should work
+            with np.errstate(divide='ignore'):
+                a // 0
+            # While this should fail!
+            with assert_raises(FloatingPointError):
+                a // 0
+            # As should this, see gh-15562
+            with assert_raises(FloatingPointError):
+                a // a
+
+    @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm")
+    @pytest.mark.skipif(arm_softfloat,
+                        reason='platform/cpu issue with FPU (gh-15562)')
+    def test_errcall(self):
+        count = 0
+        def foo(*args):
+            nonlocal count
+            count += 1
+
+        olderrcall = np.geterrcall()
+        with np.errstate(call=foo):
+            assert np.geterrcall() is foo
+            with np.errstate(call=None):
+                assert np.geterrcall() is None
+        assert np.geterrcall() is olderrcall
+        assert count == 0
+
+        with np.errstate(call=foo, invalid="call"):
+            np.array(np.inf) - np.array(np.inf)
+
+        assert count == 1
+
+    def test_errstate_decorator(self):
+        @np.errstate(all='ignore')
+        def foo():
+            a = -np.arange(3)
+            a // 0
+
+        foo()
+
+    def test_errstate_enter_once(self):
+        errstate = np.errstate(invalid="warn")
+        with errstate:
+            pass
+
+        # The errstate context cannot be entered twice as that would not be
+        # thread-safe
+        with pytest.raises(TypeError,
+                match="Cannot enter `np.errstate` twice"):
+            with errstate:
+                pass
+
+    @pytest.mark.skipif(IS_WASM, reason="wasm doesn't support asyncio")
+    def test_asyncio_safe(self):
+        # asyncio may not always work, lets assume its fine if missing
+        # Pyodide/wasm doesn't support it.  If this test makes problems,
+        # it should just be skipped liberally (or run differently).
+        asyncio = pytest.importorskip("asyncio")
+
+        @np.errstate(invalid="ignore")
+        def decorated():
+            # Decorated non-async function (it is not safe to decorate an
+            # async one)
+            assert np.geterr()["invalid"] == "ignore"
+
+        async def func1():
+            decorated()
+            await asyncio.sleep(0.1)
+            decorated()
+
+        async def func2():
+            with np.errstate(invalid="raise"):
+                assert np.geterr()["invalid"] == "raise"
+                await asyncio.sleep(0.125)
+                assert np.geterr()["invalid"] == "raise"
+
+        # for good sport, a third one with yet another state:
+        async def func3():
+            with np.errstate(invalid="print"):
+                assert np.geterr()["invalid"] == "print"
+                await asyncio.sleep(0.11)
+                assert np.geterr()["invalid"] == "print"
+
+        async def main():
+            # simply run all three function multiple times:
+            await asyncio.gather(
+                    func1(), func2(), func3(), func1(), func2(), func3(),
+                    func1(), func2(), func3(), func1(), func2(), func3())
+
+        loop = asyncio.new_event_loop()
+        with np.errstate(invalid="warn"):
+            asyncio.run(main())
+            assert np.geterr()["invalid"] == "warn"
+
+        assert np.geterr()["invalid"] == "warn"  # the default
+        loop.close()