Add files using upload-large-folder tool
Browse filesThis view is limited to 50 files because it contains too many changes. See raw diff
- .gitattributes +3 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/alias.py +267 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/application.py +492 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/async_helpers.py +155 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/autocall.py +70 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/builtin_trap.py +86 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/completerlib.py +382 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/crashhandler.py +248 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/debugger.py +1136 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/display.py +1373 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/display_functions.py +391 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/display_trap.py +70 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/displayhook.py +336 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/error.py +60 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/events.py +158 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/excolors.py +192 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/extensions.py +135 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/formatters.py +1090 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/getipython.py +24 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/guarded_eval.py +895 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/history.py +989 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/historyapp.py +158 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/hooks.py +173 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/inputsplitter.py +799 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/inputtransformer2.py +830 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/interactiveshell.py +0 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/latex_symbols.py +1301 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/macro.py +53 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/magic.py +759 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/oinspect.py +1283 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/page.py +348 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/payloadpage.py +51 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/prefilter.py +707 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/profile/README_STARTUP +11 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/profiledir.py +244 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/pylabtools.py +542 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/splitinput.py +145 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/__init__.py +0 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/print_argv.py +3 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/simpleerr.py +33 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_alias.py +66 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_autocall.py +68 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_compilerop.py +68 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_display.py +513 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_formatters.py +545 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_hooks.py +76 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_imports.py +52 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_inputsplitter.py +643 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_inputtransformer2.py +448 -0
- evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_magic.py +1556 -0
.gitattributes
CHANGED
|
@@ -853,3 +853,6 @@ infer_4_47_1/lib/liblzma.so.5 filter=lfs diff=lfs merge=lfs -text
|
|
| 853 |
infer_4_47_1/lib/libbz2.so filter=lfs diff=lfs merge=lfs -text
|
| 854 |
evalkit_eagle/lib/python3.10/site-packages/scipy/ndimage/_nd_image.cpython-310-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
|
| 855 |
evalkit_eagle/lib/python3.10/site-packages/scipy/optimize/__pycache__/_optimize.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text
|
|
|
|
|
|
|
|
|
|
|
|
| 853 |
infer_4_47_1/lib/libbz2.so filter=lfs diff=lfs merge=lfs -text
|
| 854 |
evalkit_eagle/lib/python3.10/site-packages/scipy/ndimage/_nd_image.cpython-310-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
|
| 855 |
evalkit_eagle/lib/python3.10/site-packages/scipy/optimize/__pycache__/_optimize.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text
|
| 856 |
+
evalkit_eagle/lib/python3.10/site-packages/scipy/special/tests/__pycache__/test_basic.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text
|
| 857 |
+
evalkit_eagle/lib/python3.10/site-packages/scipy/sparse/csgraph/_tools.cpython-310-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
|
| 858 |
+
evalkit_eagle/lib/python3.10/site-packages/scipy/sparse/tests/__pycache__/test_base.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/alias.py
ADDED
|
@@ -0,0 +1,267 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
System command aliases.
|
| 4 |
+
|
| 5 |
+
Authors:
|
| 6 |
+
|
| 7 |
+
* Fernando Perez
|
| 8 |
+
* Brian Granger
|
| 9 |
+
"""
|
| 10 |
+
|
| 11 |
+
#-----------------------------------------------------------------------------
|
| 12 |
+
# Copyright (C) 2008-2011 The IPython Development Team
|
| 13 |
+
#
|
| 14 |
+
# Distributed under the terms of the BSD License.
|
| 15 |
+
#
|
| 16 |
+
# The full license is in the file COPYING.txt, distributed with this software.
|
| 17 |
+
#-----------------------------------------------------------------------------
|
| 18 |
+
|
| 19 |
+
#-----------------------------------------------------------------------------
|
| 20 |
+
# Imports
|
| 21 |
+
#-----------------------------------------------------------------------------
|
| 22 |
+
|
| 23 |
+
import os
|
| 24 |
+
import re
|
| 25 |
+
import sys
|
| 26 |
+
|
| 27 |
+
from traitlets.config.configurable import Configurable
|
| 28 |
+
from .error import UsageError
|
| 29 |
+
|
| 30 |
+
from traitlets import List, Instance
|
| 31 |
+
from logging import error
|
| 32 |
+
|
| 33 |
+
import typing as t
|
| 34 |
+
|
| 35 |
+
|
| 36 |
+
#-----------------------------------------------------------------------------
|
| 37 |
+
# Utilities
|
| 38 |
+
#-----------------------------------------------------------------------------
|
| 39 |
+
|
| 40 |
+
# This is used as the pattern for calls to split_user_input.
|
| 41 |
+
shell_line_split = re.compile(r'^(\s*)()(\S+)(.*$)')
|
| 42 |
+
|
| 43 |
+
def default_aliases() -> t.List[t.Tuple[str, str]]:
|
| 44 |
+
"""Return list of shell aliases to auto-define.
|
| 45 |
+
"""
|
| 46 |
+
# Note: the aliases defined here should be safe to use on a kernel
|
| 47 |
+
# regardless of what frontend it is attached to. Frontends that use a
|
| 48 |
+
# kernel in-process can define additional aliases that will only work in
|
| 49 |
+
# their case. For example, things like 'less' or 'clear' that manipulate
|
| 50 |
+
# the terminal should NOT be declared here, as they will only work if the
|
| 51 |
+
# kernel is running inside a true terminal, and not over the network.
|
| 52 |
+
|
| 53 |
+
if os.name == 'posix':
|
| 54 |
+
default_aliases = [('mkdir', 'mkdir'), ('rmdir', 'rmdir'),
|
| 55 |
+
('mv', 'mv'), ('rm', 'rm'), ('cp', 'cp'),
|
| 56 |
+
('cat', 'cat'),
|
| 57 |
+
]
|
| 58 |
+
# Useful set of ls aliases. The GNU and BSD options are a little
|
| 59 |
+
# different, so we make aliases that provide as similar as possible
|
| 60 |
+
# behavior in ipython, by passing the right flags for each platform
|
| 61 |
+
if sys.platform.startswith('linux'):
|
| 62 |
+
ls_aliases = [('ls', 'ls -F --color'),
|
| 63 |
+
# long ls
|
| 64 |
+
('ll', 'ls -F -o --color'),
|
| 65 |
+
# ls normal files only
|
| 66 |
+
('lf', 'ls -F -o --color %l | grep ^-'),
|
| 67 |
+
# ls symbolic links
|
| 68 |
+
('lk', 'ls -F -o --color %l | grep ^l'),
|
| 69 |
+
# directories or links to directories,
|
| 70 |
+
('ldir', 'ls -F -o --color %l | grep /$'),
|
| 71 |
+
# things which are executable
|
| 72 |
+
('lx', 'ls -F -o --color %l | grep ^-..x'),
|
| 73 |
+
]
|
| 74 |
+
elif sys.platform.startswith('openbsd') or sys.platform.startswith('netbsd'):
|
| 75 |
+
# OpenBSD, NetBSD. The ls implementation on these platforms do not support
|
| 76 |
+
# the -G switch and lack the ability to use colorized output.
|
| 77 |
+
ls_aliases = [('ls', 'ls -F'),
|
| 78 |
+
# long ls
|
| 79 |
+
('ll', 'ls -F -l'),
|
| 80 |
+
# ls normal files only
|
| 81 |
+
('lf', 'ls -F -l %l | grep ^-'),
|
| 82 |
+
# ls symbolic links
|
| 83 |
+
('lk', 'ls -F -l %l | grep ^l'),
|
| 84 |
+
# directories or links to directories,
|
| 85 |
+
('ldir', 'ls -F -l %l | grep /$'),
|
| 86 |
+
# things which are executable
|
| 87 |
+
('lx', 'ls -F -l %l | grep ^-..x'),
|
| 88 |
+
]
|
| 89 |
+
else:
|
| 90 |
+
# BSD, OSX, etc.
|
| 91 |
+
ls_aliases = [('ls', 'ls -F -G'),
|
| 92 |
+
# long ls
|
| 93 |
+
('ll', 'ls -F -l -G'),
|
| 94 |
+
# ls normal files only
|
| 95 |
+
('lf', 'ls -F -l -G %l | grep ^-'),
|
| 96 |
+
# ls symbolic links
|
| 97 |
+
('lk', 'ls -F -l -G %l | grep ^l'),
|
| 98 |
+
# directories or links to directories,
|
| 99 |
+
('ldir', 'ls -F -G -l %l | grep /$'),
|
| 100 |
+
# things which are executable
|
| 101 |
+
('lx', 'ls -F -l -G %l | grep ^-..x'),
|
| 102 |
+
]
|
| 103 |
+
default_aliases = default_aliases + ls_aliases
|
| 104 |
+
elif os.name in ['nt', 'dos']:
|
| 105 |
+
default_aliases = [('ls', 'dir /on'),
|
| 106 |
+
('ddir', 'dir /ad /on'), ('ldir', 'dir /ad /on'),
|
| 107 |
+
('mkdir', 'mkdir'), ('rmdir', 'rmdir'),
|
| 108 |
+
('echo', 'echo'), ('ren', 'ren'), ('copy', 'copy'),
|
| 109 |
+
]
|
| 110 |
+
else:
|
| 111 |
+
default_aliases = []
|
| 112 |
+
|
| 113 |
+
return default_aliases
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
class AliasError(Exception):
|
| 117 |
+
pass
|
| 118 |
+
|
| 119 |
+
|
| 120 |
+
class InvalidAliasError(AliasError):
|
| 121 |
+
pass
|
| 122 |
+
|
| 123 |
+
class Alias(object):
|
| 124 |
+
"""Callable object storing the details of one alias.
|
| 125 |
+
|
| 126 |
+
Instances are registered as magic functions to allow use of aliases.
|
| 127 |
+
"""
|
| 128 |
+
|
| 129 |
+
# Prepare blacklist
|
| 130 |
+
blacklist = {'cd','popd','pushd','dhist','alias','unalias'}
|
| 131 |
+
|
| 132 |
+
def __init__(self, shell, name, cmd):
|
| 133 |
+
self.shell = shell
|
| 134 |
+
self.name = name
|
| 135 |
+
self.cmd = cmd
|
| 136 |
+
self.__doc__ = "Alias for `!{}`".format(cmd)
|
| 137 |
+
self.nargs = self.validate()
|
| 138 |
+
|
| 139 |
+
def validate(self):
|
| 140 |
+
"""Validate the alias, and return the number of arguments."""
|
| 141 |
+
if self.name in self.blacklist:
|
| 142 |
+
raise InvalidAliasError("The name %s can't be aliased "
|
| 143 |
+
"because it is a keyword or builtin." % self.name)
|
| 144 |
+
try:
|
| 145 |
+
caller = self.shell.magics_manager.magics['line'][self.name]
|
| 146 |
+
except KeyError:
|
| 147 |
+
pass
|
| 148 |
+
else:
|
| 149 |
+
if not isinstance(caller, Alias):
|
| 150 |
+
raise InvalidAliasError("The name %s can't be aliased "
|
| 151 |
+
"because it is another magic command." % self.name)
|
| 152 |
+
|
| 153 |
+
if not (isinstance(self.cmd, str)):
|
| 154 |
+
raise InvalidAliasError("An alias command must be a string, "
|
| 155 |
+
"got: %r" % self.cmd)
|
| 156 |
+
|
| 157 |
+
nargs = self.cmd.count('%s') - self.cmd.count('%%s')
|
| 158 |
+
|
| 159 |
+
if (nargs > 0) and (self.cmd.find('%l') >= 0):
|
| 160 |
+
raise InvalidAliasError('The %s and %l specifiers are mutually '
|
| 161 |
+
'exclusive in alias definitions.')
|
| 162 |
+
|
| 163 |
+
return nargs
|
| 164 |
+
|
| 165 |
+
def __repr__(self):
|
| 166 |
+
return "<alias {} for {!r}>".format(self.name, self.cmd)
|
| 167 |
+
|
| 168 |
+
def __call__(self, rest=''):
|
| 169 |
+
cmd = self.cmd
|
| 170 |
+
nargs = self.nargs
|
| 171 |
+
# Expand the %l special to be the user's input line
|
| 172 |
+
if cmd.find('%l') >= 0:
|
| 173 |
+
cmd = cmd.replace('%l', rest)
|
| 174 |
+
rest = ''
|
| 175 |
+
|
| 176 |
+
if nargs==0:
|
| 177 |
+
if cmd.find('%%s') >= 1:
|
| 178 |
+
cmd = cmd.replace('%%s', '%s')
|
| 179 |
+
# Simple, argument-less aliases
|
| 180 |
+
cmd = '%s %s' % (cmd, rest)
|
| 181 |
+
else:
|
| 182 |
+
# Handle aliases with positional arguments
|
| 183 |
+
args = rest.split(None, nargs)
|
| 184 |
+
if len(args) < nargs:
|
| 185 |
+
raise UsageError('Alias <%s> requires %s arguments, %s given.' %
|
| 186 |
+
(self.name, nargs, len(args)))
|
| 187 |
+
cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:]))
|
| 188 |
+
|
| 189 |
+
self.shell.system(cmd)
|
| 190 |
+
|
| 191 |
+
#-----------------------------------------------------------------------------
|
| 192 |
+
# Main AliasManager class
|
| 193 |
+
#-----------------------------------------------------------------------------
|
| 194 |
+
|
| 195 |
+
class AliasManager(Configurable):
|
| 196 |
+
default_aliases: List = List(default_aliases()).tag(config=True)
|
| 197 |
+
user_aliases: List = List(default_value=[]).tag(config=True)
|
| 198 |
+
shell = Instance(
|
| 199 |
+
"IPython.core.interactiveshell.InteractiveShellABC", allow_none=True
|
| 200 |
+
)
|
| 201 |
+
|
| 202 |
+
def __init__(self, shell=None, **kwargs):
|
| 203 |
+
super(AliasManager, self).__init__(shell=shell, **kwargs)
|
| 204 |
+
# For convenient access
|
| 205 |
+
if self.shell is not None:
|
| 206 |
+
self.linemagics = self.shell.magics_manager.magics["line"]
|
| 207 |
+
self.init_aliases()
|
| 208 |
+
|
| 209 |
+
def init_aliases(self):
|
| 210 |
+
# Load default & user aliases
|
| 211 |
+
for name, cmd in self.default_aliases + self.user_aliases:
|
| 212 |
+
if (
|
| 213 |
+
cmd.startswith("ls ")
|
| 214 |
+
and self.shell is not None
|
| 215 |
+
and self.shell.colors == "NoColor"
|
| 216 |
+
):
|
| 217 |
+
cmd = cmd.replace(" --color", "")
|
| 218 |
+
self.soft_define_alias(name, cmd)
|
| 219 |
+
|
| 220 |
+
@property
|
| 221 |
+
def aliases(self):
|
| 222 |
+
return [(n, func.cmd) for (n, func) in self.linemagics.items()
|
| 223 |
+
if isinstance(func, Alias)]
|
| 224 |
+
|
| 225 |
+
def soft_define_alias(self, name, cmd):
|
| 226 |
+
"""Define an alias, but don't raise on an AliasError."""
|
| 227 |
+
try:
|
| 228 |
+
self.define_alias(name, cmd)
|
| 229 |
+
except AliasError as e:
|
| 230 |
+
error("Invalid alias: %s" % e)
|
| 231 |
+
|
| 232 |
+
def define_alias(self, name, cmd):
|
| 233 |
+
"""Define a new alias after validating it.
|
| 234 |
+
|
| 235 |
+
This will raise an :exc:`AliasError` if there are validation
|
| 236 |
+
problems.
|
| 237 |
+
"""
|
| 238 |
+
caller = Alias(shell=self.shell, name=name, cmd=cmd)
|
| 239 |
+
self.shell.magics_manager.register_function(caller, magic_kind='line',
|
| 240 |
+
magic_name=name)
|
| 241 |
+
|
| 242 |
+
def get_alias(self, name):
|
| 243 |
+
"""Return an alias, or None if no alias by that name exists."""
|
| 244 |
+
aname = self.linemagics.get(name, None)
|
| 245 |
+
return aname if isinstance(aname, Alias) else None
|
| 246 |
+
|
| 247 |
+
def is_alias(self, name):
|
| 248 |
+
"""Return whether or not a given name has been defined as an alias"""
|
| 249 |
+
return self.get_alias(name) is not None
|
| 250 |
+
|
| 251 |
+
def undefine_alias(self, name):
|
| 252 |
+
if self.is_alias(name):
|
| 253 |
+
del self.linemagics[name]
|
| 254 |
+
else:
|
| 255 |
+
raise ValueError('%s is not an alias' % name)
|
| 256 |
+
|
| 257 |
+
def clear_aliases(self):
|
| 258 |
+
for name, _ in self.aliases:
|
| 259 |
+
self.undefine_alias(name)
|
| 260 |
+
|
| 261 |
+
def retrieve_alias(self, name):
|
| 262 |
+
"""Retrieve the command to which an alias expands."""
|
| 263 |
+
caller = self.get_alias(name)
|
| 264 |
+
if caller:
|
| 265 |
+
return caller.cmd
|
| 266 |
+
else:
|
| 267 |
+
raise ValueError('%s is not an alias' % name)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/application.py
ADDED
|
@@ -0,0 +1,492 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
An application for IPython.
|
| 4 |
+
|
| 5 |
+
All top-level applications should use the classes in this module for
|
| 6 |
+
handling configuration and creating configurables.
|
| 7 |
+
|
| 8 |
+
The job of an :class:`Application` is to create the master configuration
|
| 9 |
+
object and then create the configurable objects, passing the config to them.
|
| 10 |
+
"""
|
| 11 |
+
|
| 12 |
+
# Copyright (c) IPython Development Team.
|
| 13 |
+
# Distributed under the terms of the Modified BSD License.
|
| 14 |
+
|
| 15 |
+
import atexit
|
| 16 |
+
from copy import deepcopy
|
| 17 |
+
import logging
|
| 18 |
+
import os
|
| 19 |
+
import shutil
|
| 20 |
+
import sys
|
| 21 |
+
|
| 22 |
+
from pathlib import Path
|
| 23 |
+
|
| 24 |
+
from traitlets.config.application import Application, catch_config_error
|
| 25 |
+
from traitlets.config.loader import ConfigFileNotFound, PyFileConfigLoader
|
| 26 |
+
from IPython.core import release, crashhandler
|
| 27 |
+
from IPython.core.profiledir import ProfileDir, ProfileDirError
|
| 28 |
+
from IPython.paths import get_ipython_dir, get_ipython_package_dir
|
| 29 |
+
from IPython.utils.path import ensure_dir_exists
|
| 30 |
+
from traitlets import (
|
| 31 |
+
List, Unicode, Type, Bool, Set, Instance, Undefined,
|
| 32 |
+
default, observe,
|
| 33 |
+
)
|
| 34 |
+
|
| 35 |
+
if os.name == "nt":
|
| 36 |
+
programdata = os.environ.get("PROGRAMDATA", None)
|
| 37 |
+
if programdata is not None:
|
| 38 |
+
SYSTEM_CONFIG_DIRS = [str(Path(programdata) / "ipython")]
|
| 39 |
+
else: # PROGRAMDATA is not defined by default on XP.
|
| 40 |
+
SYSTEM_CONFIG_DIRS = []
|
| 41 |
+
else:
|
| 42 |
+
SYSTEM_CONFIG_DIRS = [
|
| 43 |
+
"/usr/local/etc/ipython",
|
| 44 |
+
"/etc/ipython",
|
| 45 |
+
]
|
| 46 |
+
|
| 47 |
+
|
| 48 |
+
ENV_CONFIG_DIRS = []
|
| 49 |
+
_env_config_dir = os.path.join(sys.prefix, 'etc', 'ipython')
|
| 50 |
+
if _env_config_dir not in SYSTEM_CONFIG_DIRS:
|
| 51 |
+
# only add ENV_CONFIG if sys.prefix is not already included
|
| 52 |
+
ENV_CONFIG_DIRS.append(_env_config_dir)
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
_envvar = os.environ.get('IPYTHON_SUPPRESS_CONFIG_ERRORS')
|
| 56 |
+
if _envvar in {None, ''}:
|
| 57 |
+
IPYTHON_SUPPRESS_CONFIG_ERRORS = None
|
| 58 |
+
else:
|
| 59 |
+
if _envvar.lower() in {'1','true'}:
|
| 60 |
+
IPYTHON_SUPPRESS_CONFIG_ERRORS = True
|
| 61 |
+
elif _envvar.lower() in {'0','false'} :
|
| 62 |
+
IPYTHON_SUPPRESS_CONFIG_ERRORS = False
|
| 63 |
+
else:
|
| 64 |
+
sys.exit("Unsupported value for environment variable: 'IPYTHON_SUPPRESS_CONFIG_ERRORS' is set to '%s' which is none of {'0', '1', 'false', 'true', ''}."% _envvar )
|
| 65 |
+
|
| 66 |
+
# aliases and flags
|
| 67 |
+
|
| 68 |
+
base_aliases = {}
|
| 69 |
+
if isinstance(Application.aliases, dict):
|
| 70 |
+
# traitlets 5
|
| 71 |
+
base_aliases.update(Application.aliases)
|
| 72 |
+
base_aliases.update(
|
| 73 |
+
{
|
| 74 |
+
"profile-dir": "ProfileDir.location",
|
| 75 |
+
"profile": "BaseIPythonApplication.profile",
|
| 76 |
+
"ipython-dir": "BaseIPythonApplication.ipython_dir",
|
| 77 |
+
"log-level": "Application.log_level",
|
| 78 |
+
"config": "BaseIPythonApplication.extra_config_file",
|
| 79 |
+
}
|
| 80 |
+
)
|
| 81 |
+
|
| 82 |
+
base_flags = dict()
|
| 83 |
+
if isinstance(Application.flags, dict):
|
| 84 |
+
# traitlets 5
|
| 85 |
+
base_flags.update(Application.flags)
|
| 86 |
+
base_flags.update(
|
| 87 |
+
dict(
|
| 88 |
+
debug=(
|
| 89 |
+
{"Application": {"log_level": logging.DEBUG}},
|
| 90 |
+
"set log level to logging.DEBUG (maximize logging output)",
|
| 91 |
+
),
|
| 92 |
+
quiet=(
|
| 93 |
+
{"Application": {"log_level": logging.CRITICAL}},
|
| 94 |
+
"set log level to logging.CRITICAL (minimize logging output)",
|
| 95 |
+
),
|
| 96 |
+
init=(
|
| 97 |
+
{
|
| 98 |
+
"BaseIPythonApplication": {
|
| 99 |
+
"copy_config_files": True,
|
| 100 |
+
"auto_create": True,
|
| 101 |
+
}
|
| 102 |
+
},
|
| 103 |
+
"""Initialize profile with default config files. This is equivalent
|
| 104 |
+
to running `ipython profile create <profile>` prior to startup.
|
| 105 |
+
""",
|
| 106 |
+
),
|
| 107 |
+
)
|
| 108 |
+
)
|
| 109 |
+
|
| 110 |
+
|
| 111 |
+
class ProfileAwareConfigLoader(PyFileConfigLoader):
|
| 112 |
+
"""A Python file config loader that is aware of IPython profiles."""
|
| 113 |
+
def load_subconfig(self, fname, path=None, profile=None):
|
| 114 |
+
if profile is not None:
|
| 115 |
+
try:
|
| 116 |
+
profile_dir = ProfileDir.find_profile_dir_by_name(
|
| 117 |
+
get_ipython_dir(),
|
| 118 |
+
profile,
|
| 119 |
+
)
|
| 120 |
+
except ProfileDirError:
|
| 121 |
+
return
|
| 122 |
+
path = profile_dir.location
|
| 123 |
+
return super(ProfileAwareConfigLoader, self).load_subconfig(fname, path=path)
|
| 124 |
+
|
| 125 |
+
class BaseIPythonApplication(Application):
|
| 126 |
+
name = "ipython"
|
| 127 |
+
description = "IPython: an enhanced interactive Python shell."
|
| 128 |
+
version = Unicode(release.version)
|
| 129 |
+
|
| 130 |
+
aliases = base_aliases
|
| 131 |
+
flags = base_flags
|
| 132 |
+
classes = List([ProfileDir])
|
| 133 |
+
|
| 134 |
+
# enable `load_subconfig('cfg.py', profile='name')`
|
| 135 |
+
python_config_loader_class = ProfileAwareConfigLoader
|
| 136 |
+
|
| 137 |
+
# Track whether the config_file has changed,
|
| 138 |
+
# because some logic happens only if we aren't using the default.
|
| 139 |
+
config_file_specified = Set()
|
| 140 |
+
|
| 141 |
+
config_file_name = Unicode()
|
| 142 |
+
@default('config_file_name')
|
| 143 |
+
def _config_file_name_default(self):
|
| 144 |
+
return self.name.replace('-','_') + u'_config.py'
|
| 145 |
+
@observe('config_file_name')
|
| 146 |
+
def _config_file_name_changed(self, change):
|
| 147 |
+
if change['new'] != change['old']:
|
| 148 |
+
self.config_file_specified.add(change['new'])
|
| 149 |
+
|
| 150 |
+
# The directory that contains IPython's builtin profiles.
|
| 151 |
+
builtin_profile_dir = Unicode(
|
| 152 |
+
os.path.join(get_ipython_package_dir(), u'config', u'profile', u'default')
|
| 153 |
+
)
|
| 154 |
+
|
| 155 |
+
config_file_paths = List(Unicode())
|
| 156 |
+
@default('config_file_paths')
|
| 157 |
+
def _config_file_paths_default(self):
|
| 158 |
+
return []
|
| 159 |
+
|
| 160 |
+
extra_config_file = Unicode(
|
| 161 |
+
help="""Path to an extra config file to load.
|
| 162 |
+
|
| 163 |
+
If specified, load this config file in addition to any other IPython config.
|
| 164 |
+
""").tag(config=True)
|
| 165 |
+
@observe('extra_config_file')
|
| 166 |
+
def _extra_config_file_changed(self, change):
|
| 167 |
+
old = change['old']
|
| 168 |
+
new = change['new']
|
| 169 |
+
try:
|
| 170 |
+
self.config_files.remove(old)
|
| 171 |
+
except ValueError:
|
| 172 |
+
pass
|
| 173 |
+
self.config_file_specified.add(new)
|
| 174 |
+
self.config_files.append(new)
|
| 175 |
+
|
| 176 |
+
profile = Unicode(u'default',
|
| 177 |
+
help="""The IPython profile to use."""
|
| 178 |
+
).tag(config=True)
|
| 179 |
+
|
| 180 |
+
@observe('profile')
|
| 181 |
+
def _profile_changed(self, change):
|
| 182 |
+
self.builtin_profile_dir = os.path.join(
|
| 183 |
+
get_ipython_package_dir(), u'config', u'profile', change['new']
|
| 184 |
+
)
|
| 185 |
+
|
| 186 |
+
add_ipython_dir_to_sys_path = Bool(
|
| 187 |
+
False,
|
| 188 |
+
"""Should the IPython profile directory be added to sys path ?
|
| 189 |
+
|
| 190 |
+
This option was non-existing before IPython 8.0, and ipython_dir was added to
|
| 191 |
+
sys path to allow import of extensions present there. This was historical
|
| 192 |
+
baggage from when pip did not exist. This now default to false,
|
| 193 |
+
but can be set to true for legacy reasons.
|
| 194 |
+
""",
|
| 195 |
+
).tag(config=True)
|
| 196 |
+
|
| 197 |
+
ipython_dir = Unicode(
|
| 198 |
+
help="""
|
| 199 |
+
The name of the IPython directory. This directory is used for logging
|
| 200 |
+
configuration (through profiles), history storage, etc. The default
|
| 201 |
+
is usually $HOME/.ipython. This option can also be specified through
|
| 202 |
+
the environment variable IPYTHONDIR.
|
| 203 |
+
"""
|
| 204 |
+
).tag(config=True)
|
| 205 |
+
@default('ipython_dir')
|
| 206 |
+
def _ipython_dir_default(self):
|
| 207 |
+
d = get_ipython_dir()
|
| 208 |
+
self._ipython_dir_changed({
|
| 209 |
+
'name': 'ipython_dir',
|
| 210 |
+
'old': d,
|
| 211 |
+
'new': d,
|
| 212 |
+
})
|
| 213 |
+
return d
|
| 214 |
+
|
| 215 |
+
_in_init_profile_dir = False
|
| 216 |
+
|
| 217 |
+
profile_dir = Instance(ProfileDir, allow_none=True)
|
| 218 |
+
|
| 219 |
+
@default('profile_dir')
|
| 220 |
+
def _profile_dir_default(self):
|
| 221 |
+
# avoid recursion
|
| 222 |
+
if self._in_init_profile_dir:
|
| 223 |
+
return
|
| 224 |
+
# profile_dir requested early, force initialization
|
| 225 |
+
self.init_profile_dir()
|
| 226 |
+
return self.profile_dir
|
| 227 |
+
|
| 228 |
+
overwrite = Bool(False,
|
| 229 |
+
help="""Whether to overwrite existing config files when copying"""
|
| 230 |
+
).tag(config=True)
|
| 231 |
+
|
| 232 |
+
auto_create = Bool(False,
|
| 233 |
+
help="""Whether to create profile dir if it doesn't exist"""
|
| 234 |
+
).tag(config=True)
|
| 235 |
+
|
| 236 |
+
config_files = List(Unicode())
|
| 237 |
+
|
| 238 |
+
@default('config_files')
|
| 239 |
+
def _config_files_default(self):
|
| 240 |
+
return [self.config_file_name]
|
| 241 |
+
|
| 242 |
+
copy_config_files = Bool(False,
|
| 243 |
+
help="""Whether to install the default config files into the profile dir.
|
| 244 |
+
If a new profile is being created, and IPython contains config files for that
|
| 245 |
+
profile, then they will be staged into the new directory. Otherwise,
|
| 246 |
+
default config files will be automatically generated.
|
| 247 |
+
""").tag(config=True)
|
| 248 |
+
|
| 249 |
+
verbose_crash = Bool(False,
|
| 250 |
+
help="""Create a massive crash report when IPython encounters what may be an
|
| 251 |
+
internal error. The default is to append a short message to the
|
| 252 |
+
usual traceback""").tag(config=True)
|
| 253 |
+
|
| 254 |
+
# The class to use as the crash handler.
|
| 255 |
+
crash_handler_class = Type(crashhandler.CrashHandler)
|
| 256 |
+
|
| 257 |
+
@catch_config_error
|
| 258 |
+
def __init__(self, **kwargs):
|
| 259 |
+
super(BaseIPythonApplication, self).__init__(**kwargs)
|
| 260 |
+
# ensure current working directory exists
|
| 261 |
+
try:
|
| 262 |
+
os.getcwd()
|
| 263 |
+
except:
|
| 264 |
+
# exit if cwd doesn't exist
|
| 265 |
+
self.log.error("Current working directory doesn't exist.")
|
| 266 |
+
self.exit(1)
|
| 267 |
+
|
| 268 |
+
#-------------------------------------------------------------------------
|
| 269 |
+
# Various stages of Application creation
|
| 270 |
+
#-------------------------------------------------------------------------
|
| 271 |
+
|
| 272 |
+
def init_crash_handler(self):
|
| 273 |
+
"""Create a crash handler, typically setting sys.excepthook to it."""
|
| 274 |
+
self.crash_handler = self.crash_handler_class(self)
|
| 275 |
+
sys.excepthook = self.excepthook
|
| 276 |
+
def unset_crashhandler():
|
| 277 |
+
sys.excepthook = sys.__excepthook__
|
| 278 |
+
atexit.register(unset_crashhandler)
|
| 279 |
+
|
| 280 |
+
def excepthook(self, etype, evalue, tb):
|
| 281 |
+
"""this is sys.excepthook after init_crashhandler
|
| 282 |
+
|
| 283 |
+
set self.verbose_crash=True to use our full crashhandler, instead of
|
| 284 |
+
a regular traceback with a short message (crash_handler_lite)
|
| 285 |
+
"""
|
| 286 |
+
|
| 287 |
+
if self.verbose_crash:
|
| 288 |
+
return self.crash_handler(etype, evalue, tb)
|
| 289 |
+
else:
|
| 290 |
+
return crashhandler.crash_handler_lite(etype, evalue, tb)
|
| 291 |
+
|
| 292 |
+
@observe('ipython_dir')
|
| 293 |
+
def _ipython_dir_changed(self, change):
|
| 294 |
+
old = change['old']
|
| 295 |
+
new = change['new']
|
| 296 |
+
if old is not Undefined:
|
| 297 |
+
str_old = os.path.abspath(old)
|
| 298 |
+
if str_old in sys.path:
|
| 299 |
+
sys.path.remove(str_old)
|
| 300 |
+
if self.add_ipython_dir_to_sys_path:
|
| 301 |
+
str_path = os.path.abspath(new)
|
| 302 |
+
sys.path.append(str_path)
|
| 303 |
+
ensure_dir_exists(new)
|
| 304 |
+
readme = os.path.join(new, "README")
|
| 305 |
+
readme_src = os.path.join(
|
| 306 |
+
get_ipython_package_dir(), "config", "profile", "README"
|
| 307 |
+
)
|
| 308 |
+
if not os.path.exists(readme) and os.path.exists(readme_src):
|
| 309 |
+
shutil.copy(readme_src, readme)
|
| 310 |
+
for d in ("extensions", "nbextensions"):
|
| 311 |
+
path = os.path.join(new, d)
|
| 312 |
+
try:
|
| 313 |
+
ensure_dir_exists(path)
|
| 314 |
+
except OSError as e:
|
| 315 |
+
# this will not be EEXIST
|
| 316 |
+
self.log.error("couldn't create path %s: %s", path, e)
|
| 317 |
+
self.log.debug("IPYTHONDIR set to: %s", new)
|
| 318 |
+
|
| 319 |
+
def load_config_file(self, suppress_errors=IPYTHON_SUPPRESS_CONFIG_ERRORS):
|
| 320 |
+
"""Load the config file.
|
| 321 |
+
|
| 322 |
+
By default, errors in loading config are handled, and a warning
|
| 323 |
+
printed on screen. For testing, the suppress_errors option is set
|
| 324 |
+
to False, so errors will make tests fail.
|
| 325 |
+
|
| 326 |
+
`suppress_errors` default value is to be `None` in which case the
|
| 327 |
+
behavior default to the one of `traitlets.Application`.
|
| 328 |
+
|
| 329 |
+
The default value can be set :
|
| 330 |
+
- to `False` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '0', or 'false' (case insensitive).
|
| 331 |
+
- to `True` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '1' or 'true' (case insensitive).
|
| 332 |
+
- to `None` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '' (empty string) or leaving it unset.
|
| 333 |
+
|
| 334 |
+
Any other value are invalid, and will make IPython exit with a non-zero return code.
|
| 335 |
+
"""
|
| 336 |
+
|
| 337 |
+
|
| 338 |
+
self.log.debug("Searching path %s for config files", self.config_file_paths)
|
| 339 |
+
base_config = 'ipython_config.py'
|
| 340 |
+
self.log.debug("Attempting to load config file: %s" %
|
| 341 |
+
base_config)
|
| 342 |
+
try:
|
| 343 |
+
if suppress_errors is not None:
|
| 344 |
+
old_value = Application.raise_config_file_errors
|
| 345 |
+
Application.raise_config_file_errors = not suppress_errors;
|
| 346 |
+
Application.load_config_file(
|
| 347 |
+
self,
|
| 348 |
+
base_config,
|
| 349 |
+
path=self.config_file_paths
|
| 350 |
+
)
|
| 351 |
+
except ConfigFileNotFound:
|
| 352 |
+
# ignore errors loading parent
|
| 353 |
+
self.log.debug("Config file %s not found", base_config)
|
| 354 |
+
pass
|
| 355 |
+
if suppress_errors is not None:
|
| 356 |
+
Application.raise_config_file_errors = old_value
|
| 357 |
+
|
| 358 |
+
for config_file_name in self.config_files:
|
| 359 |
+
if not config_file_name or config_file_name == base_config:
|
| 360 |
+
continue
|
| 361 |
+
self.log.debug("Attempting to load config file: %s" %
|
| 362 |
+
self.config_file_name)
|
| 363 |
+
try:
|
| 364 |
+
Application.load_config_file(
|
| 365 |
+
self,
|
| 366 |
+
config_file_name,
|
| 367 |
+
path=self.config_file_paths
|
| 368 |
+
)
|
| 369 |
+
except ConfigFileNotFound:
|
| 370 |
+
# Only warn if the default config file was NOT being used.
|
| 371 |
+
if config_file_name in self.config_file_specified:
|
| 372 |
+
msg = self.log.warning
|
| 373 |
+
else:
|
| 374 |
+
msg = self.log.debug
|
| 375 |
+
msg("Config file not found, skipping: %s", config_file_name)
|
| 376 |
+
except Exception:
|
| 377 |
+
# For testing purposes.
|
| 378 |
+
if not suppress_errors:
|
| 379 |
+
raise
|
| 380 |
+
self.log.warning("Error loading config file: %s" %
|
| 381 |
+
self.config_file_name, exc_info=True)
|
| 382 |
+
|
| 383 |
+
def init_profile_dir(self):
|
| 384 |
+
"""initialize the profile dir"""
|
| 385 |
+
self._in_init_profile_dir = True
|
| 386 |
+
if self.profile_dir is not None:
|
| 387 |
+
# already ran
|
| 388 |
+
return
|
| 389 |
+
if 'ProfileDir.location' not in self.config:
|
| 390 |
+
# location not specified, find by profile name
|
| 391 |
+
try:
|
| 392 |
+
p = ProfileDir.find_profile_dir_by_name(self.ipython_dir, self.profile, self.config)
|
| 393 |
+
except ProfileDirError:
|
| 394 |
+
# not found, maybe create it (always create default profile)
|
| 395 |
+
if self.auto_create or self.profile == 'default':
|
| 396 |
+
try:
|
| 397 |
+
p = ProfileDir.create_profile_dir_by_name(self.ipython_dir, self.profile, self.config)
|
| 398 |
+
except ProfileDirError:
|
| 399 |
+
self.log.fatal("Could not create profile: %r"%self.profile)
|
| 400 |
+
self.exit(1)
|
| 401 |
+
else:
|
| 402 |
+
self.log.info("Created profile dir: %r"%p.location)
|
| 403 |
+
else:
|
| 404 |
+
self.log.fatal("Profile %r not found."%self.profile)
|
| 405 |
+
self.exit(1)
|
| 406 |
+
else:
|
| 407 |
+
self.log.debug("Using existing profile dir: %r", p.location)
|
| 408 |
+
else:
|
| 409 |
+
location = self.config.ProfileDir.location
|
| 410 |
+
# location is fully specified
|
| 411 |
+
try:
|
| 412 |
+
p = ProfileDir.find_profile_dir(location, self.config)
|
| 413 |
+
except ProfileDirError:
|
| 414 |
+
# not found, maybe create it
|
| 415 |
+
if self.auto_create:
|
| 416 |
+
try:
|
| 417 |
+
p = ProfileDir.create_profile_dir(location, self.config)
|
| 418 |
+
except ProfileDirError:
|
| 419 |
+
self.log.fatal("Could not create profile directory: %r"%location)
|
| 420 |
+
self.exit(1)
|
| 421 |
+
else:
|
| 422 |
+
self.log.debug("Creating new profile dir: %r"%location)
|
| 423 |
+
else:
|
| 424 |
+
self.log.fatal("Profile directory %r not found."%location)
|
| 425 |
+
self.exit(1)
|
| 426 |
+
else:
|
| 427 |
+
self.log.debug("Using existing profile dir: %r", p.location)
|
| 428 |
+
# if profile_dir is specified explicitly, set profile name
|
| 429 |
+
dir_name = os.path.basename(p.location)
|
| 430 |
+
if dir_name.startswith('profile_'):
|
| 431 |
+
self.profile = dir_name[8:]
|
| 432 |
+
|
| 433 |
+
self.profile_dir = p
|
| 434 |
+
self.config_file_paths.append(p.location)
|
| 435 |
+
self._in_init_profile_dir = False
|
| 436 |
+
|
| 437 |
+
def init_config_files(self):
|
| 438 |
+
"""[optionally] copy default config files into profile dir."""
|
| 439 |
+
self.config_file_paths.extend(ENV_CONFIG_DIRS)
|
| 440 |
+
self.config_file_paths.extend(SYSTEM_CONFIG_DIRS)
|
| 441 |
+
# copy config files
|
| 442 |
+
path = Path(self.builtin_profile_dir)
|
| 443 |
+
if self.copy_config_files:
|
| 444 |
+
src = self.profile
|
| 445 |
+
|
| 446 |
+
cfg = self.config_file_name
|
| 447 |
+
if path and (path / cfg).exists():
|
| 448 |
+
self.log.warning(
|
| 449 |
+
"Staging %r from %s into %r [overwrite=%s]"
|
| 450 |
+
% (cfg, src, self.profile_dir.location, self.overwrite)
|
| 451 |
+
)
|
| 452 |
+
self.profile_dir.copy_config_file(cfg, path=path, overwrite=self.overwrite)
|
| 453 |
+
else:
|
| 454 |
+
self.stage_default_config_file()
|
| 455 |
+
else:
|
| 456 |
+
# Still stage *bundled* config files, but not generated ones
|
| 457 |
+
# This is necessary for `ipython profile=sympy` to load the profile
|
| 458 |
+
# on the first go
|
| 459 |
+
files = path.glob("*.py")
|
| 460 |
+
for fullpath in files:
|
| 461 |
+
cfg = fullpath.name
|
| 462 |
+
if self.profile_dir.copy_config_file(cfg, path=path, overwrite=False):
|
| 463 |
+
# file was copied
|
| 464 |
+
self.log.warning("Staging bundled %s from %s into %r"%(
|
| 465 |
+
cfg, self.profile, self.profile_dir.location)
|
| 466 |
+
)
|
| 467 |
+
|
| 468 |
+
|
| 469 |
+
def stage_default_config_file(self):
|
| 470 |
+
"""auto generate default config file, and stage it into the profile."""
|
| 471 |
+
s = self.generate_config_file()
|
| 472 |
+
config_file = Path(self.profile_dir.location) / self.config_file_name
|
| 473 |
+
if self.overwrite or not config_file.exists():
|
| 474 |
+
self.log.warning("Generating default config file: %r", (config_file))
|
| 475 |
+
config_file.write_text(s, encoding="utf-8")
|
| 476 |
+
|
| 477 |
+
@catch_config_error
|
| 478 |
+
def initialize(self, argv=None):
|
| 479 |
+
# don't hook up crash handler before parsing command-line
|
| 480 |
+
self.parse_command_line(argv)
|
| 481 |
+
self.init_crash_handler()
|
| 482 |
+
if self.subapp is not None:
|
| 483 |
+
# stop here if subapp is taking over
|
| 484 |
+
return
|
| 485 |
+
# save a copy of CLI config to re-load after config files
|
| 486 |
+
# so that it has highest priority
|
| 487 |
+
cl_config = deepcopy(self.config)
|
| 488 |
+
self.init_profile_dir()
|
| 489 |
+
self.init_config_files()
|
| 490 |
+
self.load_config_file()
|
| 491 |
+
# enforce cl-opts override configfile opts:
|
| 492 |
+
self.update_config(cl_config)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/async_helpers.py
ADDED
|
@@ -0,0 +1,155 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""
|
| 2 |
+
Async helper function that are invalid syntax on Python 3.5 and below.
|
| 3 |
+
|
| 4 |
+
This code is best effort, and may have edge cases not behaving as expected. In
|
| 5 |
+
particular it contain a number of heuristics to detect whether code is
|
| 6 |
+
effectively async and need to run in an event loop or not.
|
| 7 |
+
|
| 8 |
+
Some constructs (like top-level `return`, or `yield`) are taken care of
|
| 9 |
+
explicitly to actually raise a SyntaxError and stay as close as possible to
|
| 10 |
+
Python semantics.
|
| 11 |
+
"""
|
| 12 |
+
|
| 13 |
+
import ast
|
| 14 |
+
import asyncio
|
| 15 |
+
import inspect
|
| 16 |
+
from functools import wraps
|
| 17 |
+
|
| 18 |
+
_asyncio_event_loop = None
|
| 19 |
+
|
| 20 |
+
|
| 21 |
+
def get_asyncio_loop():
|
| 22 |
+
"""asyncio has deprecated get_event_loop
|
| 23 |
+
|
| 24 |
+
Replicate it here, with our desired semantics:
|
| 25 |
+
|
| 26 |
+
- always returns a valid, not-closed loop
|
| 27 |
+
- not thread-local like asyncio's,
|
| 28 |
+
because we only want one loop for IPython
|
| 29 |
+
- if called from inside a coroutine (e.g. in ipykernel),
|
| 30 |
+
return the running loop
|
| 31 |
+
|
| 32 |
+
.. versionadded:: 8.0
|
| 33 |
+
"""
|
| 34 |
+
try:
|
| 35 |
+
return asyncio.get_running_loop()
|
| 36 |
+
except RuntimeError:
|
| 37 |
+
# not inside a coroutine,
|
| 38 |
+
# track our own global
|
| 39 |
+
pass
|
| 40 |
+
|
| 41 |
+
# not thread-local like asyncio's,
|
| 42 |
+
# because we only track one event loop to run for IPython itself,
|
| 43 |
+
# always in the main thread.
|
| 44 |
+
global _asyncio_event_loop
|
| 45 |
+
if _asyncio_event_loop is None or _asyncio_event_loop.is_closed():
|
| 46 |
+
_asyncio_event_loop = asyncio.new_event_loop()
|
| 47 |
+
return _asyncio_event_loop
|
| 48 |
+
|
| 49 |
+
|
| 50 |
+
class _AsyncIORunner:
|
| 51 |
+
def __call__(self, coro):
|
| 52 |
+
"""
|
| 53 |
+
Handler for asyncio autoawait
|
| 54 |
+
"""
|
| 55 |
+
return get_asyncio_loop().run_until_complete(coro)
|
| 56 |
+
|
| 57 |
+
def __str__(self):
|
| 58 |
+
return "asyncio"
|
| 59 |
+
|
| 60 |
+
|
| 61 |
+
_asyncio_runner = _AsyncIORunner()
|
| 62 |
+
|
| 63 |
+
|
| 64 |
+
class _AsyncIOProxy:
|
| 65 |
+
"""Proxy-object for an asyncio
|
| 66 |
+
|
| 67 |
+
Any coroutine methods will be wrapped in event_loop.run_
|
| 68 |
+
"""
|
| 69 |
+
|
| 70 |
+
def __init__(self, obj, event_loop):
|
| 71 |
+
self._obj = obj
|
| 72 |
+
self._event_loop = event_loop
|
| 73 |
+
|
| 74 |
+
def __repr__(self):
|
| 75 |
+
return f"<_AsyncIOProxy({self._obj!r})>"
|
| 76 |
+
|
| 77 |
+
def __getattr__(self, key):
|
| 78 |
+
attr = getattr(self._obj, key)
|
| 79 |
+
if inspect.iscoroutinefunction(attr):
|
| 80 |
+
# if it's a coroutine method,
|
| 81 |
+
# return a threadsafe wrapper onto the _current_ asyncio loop
|
| 82 |
+
@wraps(attr)
|
| 83 |
+
def _wrapped(*args, **kwargs):
|
| 84 |
+
concurrent_future = asyncio.run_coroutine_threadsafe(
|
| 85 |
+
attr(*args, **kwargs), self._event_loop
|
| 86 |
+
)
|
| 87 |
+
return asyncio.wrap_future(concurrent_future)
|
| 88 |
+
|
| 89 |
+
return _wrapped
|
| 90 |
+
else:
|
| 91 |
+
return attr
|
| 92 |
+
|
| 93 |
+
def __dir__(self):
|
| 94 |
+
return dir(self._obj)
|
| 95 |
+
|
| 96 |
+
|
| 97 |
+
def _curio_runner(coroutine):
|
| 98 |
+
"""
|
| 99 |
+
handler for curio autoawait
|
| 100 |
+
"""
|
| 101 |
+
import curio
|
| 102 |
+
|
| 103 |
+
return curio.run(coroutine)
|
| 104 |
+
|
| 105 |
+
|
| 106 |
+
def _trio_runner(async_fn):
|
| 107 |
+
import trio
|
| 108 |
+
|
| 109 |
+
async def loc(coro):
|
| 110 |
+
"""
|
| 111 |
+
We need the dummy no-op async def to protect from
|
| 112 |
+
trio's internal. See https://github.com/python-trio/trio/issues/89
|
| 113 |
+
"""
|
| 114 |
+
return await coro
|
| 115 |
+
|
| 116 |
+
return trio.run(loc, async_fn)
|
| 117 |
+
|
| 118 |
+
|
| 119 |
+
def _pseudo_sync_runner(coro):
|
| 120 |
+
"""
|
| 121 |
+
A runner that does not really allow async execution, and just advance the coroutine.
|
| 122 |
+
|
| 123 |
+
See discussion in https://github.com/python-trio/trio/issues/608,
|
| 124 |
+
|
| 125 |
+
Credit to Nathaniel Smith
|
| 126 |
+
"""
|
| 127 |
+
try:
|
| 128 |
+
coro.send(None)
|
| 129 |
+
except StopIteration as exc:
|
| 130 |
+
return exc.value
|
| 131 |
+
else:
|
| 132 |
+
# TODO: do not raise but return an execution result with the right info.
|
| 133 |
+
raise RuntimeError(
|
| 134 |
+
"{coro_name!r} needs a real async loop".format(coro_name=coro.__name__)
|
| 135 |
+
)
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
def _should_be_async(cell: str) -> bool:
|
| 139 |
+
"""Detect if a block of code need to be wrapped in an `async def`
|
| 140 |
+
|
| 141 |
+
Attempt to parse the block of code, it it compile we're fine.
|
| 142 |
+
Otherwise we wrap if and try to compile.
|
| 143 |
+
|
| 144 |
+
If it works, assume it should be async. Otherwise Return False.
|
| 145 |
+
|
| 146 |
+
Not handled yet: If the block of code has a return statement as the top
|
| 147 |
+
level, it will be seen as async. This is a know limitation.
|
| 148 |
+
"""
|
| 149 |
+
try:
|
| 150 |
+
code = compile(
|
| 151 |
+
cell, "<>", "exec", flags=getattr(ast, "PyCF_ALLOW_TOP_LEVEL_AWAIT", 0x0)
|
| 152 |
+
)
|
| 153 |
+
return inspect.CO_COROUTINE & code.co_flags == inspect.CO_COROUTINE
|
| 154 |
+
except (SyntaxError, MemoryError):
|
| 155 |
+
return False
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/autocall.py
ADDED
|
@@ -0,0 +1,70 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
Autocall capabilities for IPython.core.
|
| 4 |
+
|
| 5 |
+
Authors:
|
| 6 |
+
|
| 7 |
+
* Brian Granger
|
| 8 |
+
* Fernando Perez
|
| 9 |
+
* Thomas Kluyver
|
| 10 |
+
|
| 11 |
+
Notes
|
| 12 |
+
-----
|
| 13 |
+
"""
|
| 14 |
+
|
| 15 |
+
#-----------------------------------------------------------------------------
|
| 16 |
+
# Copyright (C) 2008-2011 The IPython Development Team
|
| 17 |
+
#
|
| 18 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 19 |
+
# the file COPYING, distributed as part of this software.
|
| 20 |
+
#-----------------------------------------------------------------------------
|
| 21 |
+
|
| 22 |
+
#-----------------------------------------------------------------------------
|
| 23 |
+
# Imports
|
| 24 |
+
#-----------------------------------------------------------------------------
|
| 25 |
+
|
| 26 |
+
|
| 27 |
+
#-----------------------------------------------------------------------------
|
| 28 |
+
# Code
|
| 29 |
+
#-----------------------------------------------------------------------------
|
| 30 |
+
|
| 31 |
+
class IPyAutocall(object):
|
| 32 |
+
""" Instances of this class are always autocalled
|
| 33 |
+
|
| 34 |
+
This happens regardless of 'autocall' variable state. Use this to
|
| 35 |
+
develop macro-like mechanisms.
|
| 36 |
+
"""
|
| 37 |
+
_ip = None
|
| 38 |
+
rewrite = True
|
| 39 |
+
def __init__(self, ip=None):
|
| 40 |
+
self._ip = ip
|
| 41 |
+
|
| 42 |
+
def set_ip(self, ip):
|
| 43 |
+
"""Will be used to set _ip point to current ipython instance b/f call
|
| 44 |
+
|
| 45 |
+
Override this method if you don't want this to happen.
|
| 46 |
+
|
| 47 |
+
"""
|
| 48 |
+
self._ip = ip
|
| 49 |
+
|
| 50 |
+
|
| 51 |
+
class ExitAutocall(IPyAutocall):
|
| 52 |
+
"""An autocallable object which will be added to the user namespace so that
|
| 53 |
+
exit, exit(), quit or quit() are all valid ways to close the shell."""
|
| 54 |
+
rewrite = False
|
| 55 |
+
|
| 56 |
+
def __call__(self):
|
| 57 |
+
self._ip.ask_exit()
|
| 58 |
+
|
| 59 |
+
class ZMQExitAutocall(ExitAutocall):
|
| 60 |
+
"""Exit IPython. Autocallable, so it needn't be explicitly called.
|
| 61 |
+
|
| 62 |
+
Parameters
|
| 63 |
+
----------
|
| 64 |
+
keep_kernel : bool
|
| 65 |
+
If True, leave the kernel alive. Otherwise, tell the kernel to exit too
|
| 66 |
+
(default).
|
| 67 |
+
"""
|
| 68 |
+
def __call__(self, keep_kernel=False):
|
| 69 |
+
self._ip.keepkernel_on_exit = keep_kernel
|
| 70 |
+
self._ip.ask_exit()
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/builtin_trap.py
ADDED
|
@@ -0,0 +1,86 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""
|
| 2 |
+
A context manager for managing things injected into :mod:`builtins`.
|
| 3 |
+
"""
|
| 4 |
+
# Copyright (c) IPython Development Team.
|
| 5 |
+
# Distributed under the terms of the Modified BSD License.
|
| 6 |
+
import builtins as builtin_mod
|
| 7 |
+
|
| 8 |
+
from traitlets.config.configurable import Configurable
|
| 9 |
+
|
| 10 |
+
from traitlets import Instance
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
class __BuiltinUndefined(object): pass
|
| 14 |
+
BuiltinUndefined = __BuiltinUndefined()
|
| 15 |
+
|
| 16 |
+
class __HideBuiltin(object): pass
|
| 17 |
+
HideBuiltin = __HideBuiltin()
|
| 18 |
+
|
| 19 |
+
|
| 20 |
+
class BuiltinTrap(Configurable):
|
| 21 |
+
|
| 22 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC',
|
| 23 |
+
allow_none=True)
|
| 24 |
+
|
| 25 |
+
def __init__(self, shell=None):
|
| 26 |
+
super(BuiltinTrap, self).__init__(shell=shell, config=None)
|
| 27 |
+
self._orig_builtins = {}
|
| 28 |
+
# We define this to track if a single BuiltinTrap is nested.
|
| 29 |
+
# Only turn off the trap when the outermost call to __exit__ is made.
|
| 30 |
+
self._nested_level = 0
|
| 31 |
+
self.shell = shell
|
| 32 |
+
# builtins we always add - if set to HideBuiltin, they will just
|
| 33 |
+
# be removed instead of being replaced by something else
|
| 34 |
+
self.auto_builtins = {'exit': HideBuiltin,
|
| 35 |
+
'quit': HideBuiltin,
|
| 36 |
+
'get_ipython': self.shell.get_ipython,
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
def __enter__(self):
|
| 40 |
+
if self._nested_level == 0:
|
| 41 |
+
self.activate()
|
| 42 |
+
self._nested_level += 1
|
| 43 |
+
# I return self, so callers can use add_builtin in a with clause.
|
| 44 |
+
return self
|
| 45 |
+
|
| 46 |
+
def __exit__(self, type, value, traceback):
|
| 47 |
+
if self._nested_level == 1:
|
| 48 |
+
self.deactivate()
|
| 49 |
+
self._nested_level -= 1
|
| 50 |
+
# Returning False will cause exceptions to propagate
|
| 51 |
+
return False
|
| 52 |
+
|
| 53 |
+
def add_builtin(self, key, value):
|
| 54 |
+
"""Add a builtin and save the original."""
|
| 55 |
+
bdict = builtin_mod.__dict__
|
| 56 |
+
orig = bdict.get(key, BuiltinUndefined)
|
| 57 |
+
if value is HideBuiltin:
|
| 58 |
+
if orig is not BuiltinUndefined: #same as 'key in bdict'
|
| 59 |
+
self._orig_builtins[key] = orig
|
| 60 |
+
del bdict[key]
|
| 61 |
+
else:
|
| 62 |
+
self._orig_builtins[key] = orig
|
| 63 |
+
bdict[key] = value
|
| 64 |
+
|
| 65 |
+
def remove_builtin(self, key, orig):
|
| 66 |
+
"""Remove an added builtin and re-set the original."""
|
| 67 |
+
if orig is BuiltinUndefined:
|
| 68 |
+
del builtin_mod.__dict__[key]
|
| 69 |
+
else:
|
| 70 |
+
builtin_mod.__dict__[key] = orig
|
| 71 |
+
|
| 72 |
+
def activate(self):
|
| 73 |
+
"""Store ipython references in the __builtin__ namespace."""
|
| 74 |
+
|
| 75 |
+
add_builtin = self.add_builtin
|
| 76 |
+
for name, func in self.auto_builtins.items():
|
| 77 |
+
add_builtin(name, func)
|
| 78 |
+
|
| 79 |
+
def deactivate(self):
|
| 80 |
+
"""Remove any builtins which might have been added by add_builtins, or
|
| 81 |
+
restore overwritten ones to their previous values."""
|
| 82 |
+
remove_builtin = self.remove_builtin
|
| 83 |
+
for key, val in self._orig_builtins.items():
|
| 84 |
+
remove_builtin(key, val)
|
| 85 |
+
self._orig_builtins.clear()
|
| 86 |
+
self._builtins_added = False
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/completerlib.py
ADDED
|
@@ -0,0 +1,382 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""Implementations for various useful completers.
|
| 3 |
+
|
| 4 |
+
These are all loaded by default by IPython.
|
| 5 |
+
"""
|
| 6 |
+
#-----------------------------------------------------------------------------
|
| 7 |
+
# Copyright (C) 2010-2011 The IPython Development Team.
|
| 8 |
+
#
|
| 9 |
+
# Distributed under the terms of the BSD License.
|
| 10 |
+
#
|
| 11 |
+
# The full license is in the file COPYING.txt, distributed with this software.
|
| 12 |
+
#-----------------------------------------------------------------------------
|
| 13 |
+
|
| 14 |
+
#-----------------------------------------------------------------------------
|
| 15 |
+
# Imports
|
| 16 |
+
#-----------------------------------------------------------------------------
|
| 17 |
+
|
| 18 |
+
# Stdlib imports
|
| 19 |
+
import glob
|
| 20 |
+
import inspect
|
| 21 |
+
import os
|
| 22 |
+
import re
|
| 23 |
+
import sys
|
| 24 |
+
from importlib import import_module
|
| 25 |
+
from importlib.machinery import all_suffixes
|
| 26 |
+
|
| 27 |
+
|
| 28 |
+
# Third-party imports
|
| 29 |
+
from time import time
|
| 30 |
+
from zipimport import zipimporter
|
| 31 |
+
|
| 32 |
+
# Our own imports
|
| 33 |
+
from .completer import expand_user, compress_user
|
| 34 |
+
from .error import TryNext
|
| 35 |
+
from ..utils._process_common import arg_split
|
| 36 |
+
|
| 37 |
+
# FIXME: this should be pulled in with the right call via the component system
|
| 38 |
+
from IPython import get_ipython
|
| 39 |
+
|
| 40 |
+
from typing import List
|
| 41 |
+
|
| 42 |
+
#-----------------------------------------------------------------------------
|
| 43 |
+
# Globals and constants
|
| 44 |
+
#-----------------------------------------------------------------------------
|
| 45 |
+
_suffixes = all_suffixes()
|
| 46 |
+
|
| 47 |
+
# Time in seconds after which the rootmodules will be stored permanently in the
|
| 48 |
+
# ipython ip.db database (kept in the user's .ipython dir).
|
| 49 |
+
TIMEOUT_STORAGE = 2
|
| 50 |
+
|
| 51 |
+
# Time in seconds after which we give up
|
| 52 |
+
TIMEOUT_GIVEUP = 20
|
| 53 |
+
|
| 54 |
+
# Regular expression for the python import statement
|
| 55 |
+
import_re = re.compile(r'(?P<name>[^\W\d]\w*?)'
|
| 56 |
+
r'(?P<package>[/\\]__init__)?'
|
| 57 |
+
r'(?P<suffix>%s)$' %
|
| 58 |
+
r'|'.join(re.escape(s) for s in _suffixes))
|
| 59 |
+
|
| 60 |
+
# RE for the ipython %run command (python + ipython scripts)
|
| 61 |
+
magic_run_re = re.compile(r'.*(\.ipy|\.ipynb|\.py[w]?)$')
|
| 62 |
+
|
| 63 |
+
#-----------------------------------------------------------------------------
|
| 64 |
+
# Local utilities
|
| 65 |
+
#-----------------------------------------------------------------------------
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
def module_list(path: str) -> List[str]:
|
| 69 |
+
"""
|
| 70 |
+
Return the list containing the names of the modules available in the given
|
| 71 |
+
folder.
|
| 72 |
+
"""
|
| 73 |
+
# sys.path has the cwd as an empty string, but isdir/listdir need it as '.'
|
| 74 |
+
if path == '':
|
| 75 |
+
path = '.'
|
| 76 |
+
|
| 77 |
+
# A few local constants to be used in loops below
|
| 78 |
+
pjoin = os.path.join
|
| 79 |
+
|
| 80 |
+
if os.path.isdir(path):
|
| 81 |
+
# Build a list of all files in the directory and all files
|
| 82 |
+
# in its subdirectories. For performance reasons, do not
|
| 83 |
+
# recurse more than one level into subdirectories.
|
| 84 |
+
files: List[str] = []
|
| 85 |
+
for root, dirs, nondirs in os.walk(path, followlinks=True):
|
| 86 |
+
subdir = root[len(path)+1:]
|
| 87 |
+
if subdir:
|
| 88 |
+
files.extend(pjoin(subdir, f) for f in nondirs)
|
| 89 |
+
dirs[:] = [] # Do not recurse into additional subdirectories.
|
| 90 |
+
else:
|
| 91 |
+
files.extend(nondirs)
|
| 92 |
+
|
| 93 |
+
else:
|
| 94 |
+
try:
|
| 95 |
+
files = list(zipimporter(path)._files.keys()) # type: ignore
|
| 96 |
+
except Exception:
|
| 97 |
+
files = []
|
| 98 |
+
|
| 99 |
+
# Build a list of modules which match the import_re regex.
|
| 100 |
+
modules = []
|
| 101 |
+
for f in files:
|
| 102 |
+
m = import_re.match(f)
|
| 103 |
+
if m:
|
| 104 |
+
modules.append(m.group('name'))
|
| 105 |
+
return list(set(modules))
|
| 106 |
+
|
| 107 |
+
|
| 108 |
+
def get_root_modules():
|
| 109 |
+
"""
|
| 110 |
+
Returns a list containing the names of all the modules available in the
|
| 111 |
+
folders of the pythonpath.
|
| 112 |
+
|
| 113 |
+
ip.db['rootmodules_cache'] maps sys.path entries to list of modules.
|
| 114 |
+
"""
|
| 115 |
+
ip = get_ipython()
|
| 116 |
+
if ip is None:
|
| 117 |
+
# No global shell instance to store cached list of modules.
|
| 118 |
+
# Don't try to scan for modules every time.
|
| 119 |
+
return list(sys.builtin_module_names)
|
| 120 |
+
|
| 121 |
+
if getattr(ip.db, "_mock", False):
|
| 122 |
+
rootmodules_cache = {}
|
| 123 |
+
else:
|
| 124 |
+
rootmodules_cache = ip.db.get("rootmodules_cache", {})
|
| 125 |
+
rootmodules = list(sys.builtin_module_names)
|
| 126 |
+
start_time = time()
|
| 127 |
+
store = False
|
| 128 |
+
for path in sys.path:
|
| 129 |
+
try:
|
| 130 |
+
modules = rootmodules_cache[path]
|
| 131 |
+
except KeyError:
|
| 132 |
+
modules = module_list(path)
|
| 133 |
+
try:
|
| 134 |
+
modules.remove('__init__')
|
| 135 |
+
except ValueError:
|
| 136 |
+
pass
|
| 137 |
+
if path not in ('', '.'): # cwd modules should not be cached
|
| 138 |
+
rootmodules_cache[path] = modules
|
| 139 |
+
if time() - start_time > TIMEOUT_STORAGE and not store:
|
| 140 |
+
store = True
|
| 141 |
+
print("\nCaching the list of root modules, please wait!")
|
| 142 |
+
print("(This will only be done once - type '%rehashx' to "
|
| 143 |
+
"reset cache!)\n")
|
| 144 |
+
sys.stdout.flush()
|
| 145 |
+
if time() - start_time > TIMEOUT_GIVEUP:
|
| 146 |
+
print("This is taking too long, we give up.\n")
|
| 147 |
+
return []
|
| 148 |
+
rootmodules.extend(modules)
|
| 149 |
+
if store:
|
| 150 |
+
ip.db['rootmodules_cache'] = rootmodules_cache
|
| 151 |
+
rootmodules = list(set(rootmodules))
|
| 152 |
+
return rootmodules
|
| 153 |
+
|
| 154 |
+
|
| 155 |
+
def is_importable(module, attr: str, only_modules) -> bool:
|
| 156 |
+
if only_modules:
|
| 157 |
+
try:
|
| 158 |
+
mod = getattr(module, attr)
|
| 159 |
+
except ModuleNotFoundError:
|
| 160 |
+
# See gh-14434
|
| 161 |
+
return False
|
| 162 |
+
return inspect.ismodule(mod)
|
| 163 |
+
else:
|
| 164 |
+
return not(attr[:2] == '__' and attr[-2:] == '__')
|
| 165 |
+
|
| 166 |
+
def is_possible_submodule(module, attr):
|
| 167 |
+
try:
|
| 168 |
+
obj = getattr(module, attr)
|
| 169 |
+
except AttributeError:
|
| 170 |
+
# Is possibly an unimported submodule
|
| 171 |
+
return True
|
| 172 |
+
except TypeError:
|
| 173 |
+
# https://github.com/ipython/ipython/issues/9678
|
| 174 |
+
return False
|
| 175 |
+
return inspect.ismodule(obj)
|
| 176 |
+
|
| 177 |
+
|
| 178 |
+
def try_import(mod: str, only_modules=False) -> List[str]:
|
| 179 |
+
"""
|
| 180 |
+
Try to import given module and return list of potential completions.
|
| 181 |
+
"""
|
| 182 |
+
mod = mod.rstrip('.')
|
| 183 |
+
try:
|
| 184 |
+
m = import_module(mod)
|
| 185 |
+
except:
|
| 186 |
+
return []
|
| 187 |
+
|
| 188 |
+
m_is_init = '__init__' in (getattr(m, '__file__', '') or '')
|
| 189 |
+
|
| 190 |
+
completions = []
|
| 191 |
+
if (not hasattr(m, '__file__')) or (not only_modules) or m_is_init:
|
| 192 |
+
completions.extend( [attr for attr in dir(m) if
|
| 193 |
+
is_importable(m, attr, only_modules)])
|
| 194 |
+
|
| 195 |
+
m_all = getattr(m, "__all__", [])
|
| 196 |
+
if only_modules:
|
| 197 |
+
completions.extend(attr for attr in m_all if is_possible_submodule(m, attr))
|
| 198 |
+
else:
|
| 199 |
+
completions.extend(m_all)
|
| 200 |
+
|
| 201 |
+
if m_is_init:
|
| 202 |
+
file_ = m.__file__
|
| 203 |
+
file_path = os.path.dirname(file_) # type: ignore
|
| 204 |
+
if file_path is not None:
|
| 205 |
+
completions.extend(module_list(file_path))
|
| 206 |
+
completions_set = {c for c in completions if isinstance(c, str)}
|
| 207 |
+
completions_set.discard('__init__')
|
| 208 |
+
return list(completions_set)
|
| 209 |
+
|
| 210 |
+
|
| 211 |
+
#-----------------------------------------------------------------------------
|
| 212 |
+
# Completion-related functions.
|
| 213 |
+
#-----------------------------------------------------------------------------
|
| 214 |
+
|
| 215 |
+
def quick_completer(cmd, completions):
|
| 216 |
+
r""" Easily create a trivial completer for a command.
|
| 217 |
+
|
| 218 |
+
Takes either a list of completions, or all completions in string (that will
|
| 219 |
+
be split on whitespace).
|
| 220 |
+
|
| 221 |
+
Example::
|
| 222 |
+
|
| 223 |
+
[d:\ipython]|1> import ipy_completers
|
| 224 |
+
[d:\ipython]|2> ipy_completers.quick_completer('foo', ['bar','baz'])
|
| 225 |
+
[d:\ipython]|3> foo b<TAB>
|
| 226 |
+
bar baz
|
| 227 |
+
[d:\ipython]|3> foo ba
|
| 228 |
+
"""
|
| 229 |
+
|
| 230 |
+
if isinstance(completions, str):
|
| 231 |
+
completions = completions.split()
|
| 232 |
+
|
| 233 |
+
def do_complete(self, event):
|
| 234 |
+
return completions
|
| 235 |
+
|
| 236 |
+
get_ipython().set_hook('complete_command',do_complete, str_key = cmd)
|
| 237 |
+
|
| 238 |
+
def module_completion(line):
|
| 239 |
+
"""
|
| 240 |
+
Returns a list containing the completion possibilities for an import line.
|
| 241 |
+
|
| 242 |
+
The line looks like this :
|
| 243 |
+
'import xml.d'
|
| 244 |
+
'from xml.dom import'
|
| 245 |
+
"""
|
| 246 |
+
|
| 247 |
+
words = line.split(' ')
|
| 248 |
+
nwords = len(words)
|
| 249 |
+
|
| 250 |
+
# from whatever <tab> -> 'import '
|
| 251 |
+
if nwords == 3 and words[0] == 'from':
|
| 252 |
+
return ['import ']
|
| 253 |
+
|
| 254 |
+
# 'from xy<tab>' or 'import xy<tab>'
|
| 255 |
+
if nwords < 3 and (words[0] in {'%aimport', 'import', 'from'}) :
|
| 256 |
+
if nwords == 1:
|
| 257 |
+
return get_root_modules()
|
| 258 |
+
mod = words[1].split('.')
|
| 259 |
+
if len(mod) < 2:
|
| 260 |
+
return get_root_modules()
|
| 261 |
+
completion_list = try_import('.'.join(mod[:-1]), True)
|
| 262 |
+
return ['.'.join(mod[:-1] + [el]) for el in completion_list]
|
| 263 |
+
|
| 264 |
+
# 'from xyz import abc<tab>'
|
| 265 |
+
if nwords >= 3 and words[0] == 'from':
|
| 266 |
+
mod = words[1]
|
| 267 |
+
return try_import(mod)
|
| 268 |
+
|
| 269 |
+
#-----------------------------------------------------------------------------
|
| 270 |
+
# Completers
|
| 271 |
+
#-----------------------------------------------------------------------------
|
| 272 |
+
# These all have the func(self, event) signature to be used as custom
|
| 273 |
+
# completers
|
| 274 |
+
|
| 275 |
+
def module_completer(self,event):
|
| 276 |
+
"""Give completions after user has typed 'import ...' or 'from ...'"""
|
| 277 |
+
|
| 278 |
+
# This works in all versions of python. While 2.5 has
|
| 279 |
+
# pkgutil.walk_packages(), that particular routine is fairly dangerous,
|
| 280 |
+
# since it imports *EVERYTHING* on sys.path. That is: a) very slow b) full
|
| 281 |
+
# of possibly problematic side effects.
|
| 282 |
+
# This search the folders in the sys.path for available modules.
|
| 283 |
+
|
| 284 |
+
return module_completion(event.line)
|
| 285 |
+
|
| 286 |
+
# FIXME: there's a lot of logic common to the run, cd and builtin file
|
| 287 |
+
# completers, that is currently reimplemented in each.
|
| 288 |
+
|
| 289 |
+
def magic_run_completer(self, event):
|
| 290 |
+
"""Complete files that end in .py or .ipy or .ipynb for the %run command.
|
| 291 |
+
"""
|
| 292 |
+
comps = arg_split(event.line, strict=False)
|
| 293 |
+
# relpath should be the current token that we need to complete.
|
| 294 |
+
if (len(comps) > 1) and (not event.line.endswith(' ')):
|
| 295 |
+
relpath = comps[-1].strip("'\"")
|
| 296 |
+
else:
|
| 297 |
+
relpath = ''
|
| 298 |
+
|
| 299 |
+
#print("\nev=", event) # dbg
|
| 300 |
+
#print("rp=", relpath) # dbg
|
| 301 |
+
#print('comps=', comps) # dbg
|
| 302 |
+
|
| 303 |
+
lglob = glob.glob
|
| 304 |
+
isdir = os.path.isdir
|
| 305 |
+
relpath, tilde_expand, tilde_val = expand_user(relpath)
|
| 306 |
+
|
| 307 |
+
# Find if the user has already typed the first filename, after which we
|
| 308 |
+
# should complete on all files, since after the first one other files may
|
| 309 |
+
# be arguments to the input script.
|
| 310 |
+
|
| 311 |
+
if any(magic_run_re.match(c) for c in comps):
|
| 312 |
+
matches = [f.replace('\\','/') + ('/' if isdir(f) else '')
|
| 313 |
+
for f in lglob(relpath+'*')]
|
| 314 |
+
else:
|
| 315 |
+
dirs = [f.replace('\\','/') + "/" for f in lglob(relpath+'*') if isdir(f)]
|
| 316 |
+
pys = [f.replace('\\','/')
|
| 317 |
+
for f in lglob(relpath+'*.py') + lglob(relpath+'*.ipy') +
|
| 318 |
+
lglob(relpath+'*.ipynb') + lglob(relpath + '*.pyw')]
|
| 319 |
+
|
| 320 |
+
matches = dirs + pys
|
| 321 |
+
|
| 322 |
+
#print('run comp:', dirs+pys) # dbg
|
| 323 |
+
return [compress_user(p, tilde_expand, tilde_val) for p in matches]
|
| 324 |
+
|
| 325 |
+
|
| 326 |
+
def cd_completer(self, event):
|
| 327 |
+
"""Completer function for cd, which only returns directories."""
|
| 328 |
+
ip = get_ipython()
|
| 329 |
+
relpath = event.symbol
|
| 330 |
+
|
| 331 |
+
#print(event) # dbg
|
| 332 |
+
if event.line.endswith('-b') or ' -b ' in event.line:
|
| 333 |
+
# return only bookmark completions
|
| 334 |
+
bkms = self.db.get('bookmarks', None)
|
| 335 |
+
if bkms:
|
| 336 |
+
return bkms.keys()
|
| 337 |
+
else:
|
| 338 |
+
return []
|
| 339 |
+
|
| 340 |
+
if event.symbol == '-':
|
| 341 |
+
width_dh = str(len(str(len(ip.user_ns['_dh']) + 1)))
|
| 342 |
+
# jump in directory history by number
|
| 343 |
+
fmt = '-%0' + width_dh +'d [%s]'
|
| 344 |
+
ents = [ fmt % (i,s) for i,s in enumerate(ip.user_ns['_dh'])]
|
| 345 |
+
if len(ents) > 1:
|
| 346 |
+
return ents
|
| 347 |
+
return []
|
| 348 |
+
|
| 349 |
+
if event.symbol.startswith('--'):
|
| 350 |
+
return ["--" + os.path.basename(d) for d in ip.user_ns['_dh']]
|
| 351 |
+
|
| 352 |
+
# Expand ~ in path and normalize directory separators.
|
| 353 |
+
relpath, tilde_expand, tilde_val = expand_user(relpath)
|
| 354 |
+
relpath = relpath.replace('\\','/')
|
| 355 |
+
|
| 356 |
+
found = []
|
| 357 |
+
for d in [f.replace('\\','/') + '/' for f in glob.glob(relpath+'*')
|
| 358 |
+
if os.path.isdir(f)]:
|
| 359 |
+
if ' ' in d:
|
| 360 |
+
# we don't want to deal with any of that, complex code
|
| 361 |
+
# for this is elsewhere
|
| 362 |
+
raise TryNext
|
| 363 |
+
|
| 364 |
+
found.append(d)
|
| 365 |
+
|
| 366 |
+
if not found:
|
| 367 |
+
if os.path.isdir(relpath):
|
| 368 |
+
return [compress_user(relpath, tilde_expand, tilde_val)]
|
| 369 |
+
|
| 370 |
+
# if no completions so far, try bookmarks
|
| 371 |
+
bks = self.db.get('bookmarks',{})
|
| 372 |
+
bkmatches = [s for s in bks if s.startswith(event.symbol)]
|
| 373 |
+
if bkmatches:
|
| 374 |
+
return bkmatches
|
| 375 |
+
|
| 376 |
+
raise TryNext
|
| 377 |
+
|
| 378 |
+
return [compress_user(p, tilde_expand, tilde_val) for p in found]
|
| 379 |
+
|
| 380 |
+
def reset_completer(self, event):
|
| 381 |
+
"A completer for %reset magic"
|
| 382 |
+
return '-f -s in out array dhist'.split()
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/crashhandler.py
ADDED
|
@@ -0,0 +1,248 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""sys.excepthook for IPython itself, leaves a detailed report on disk.
|
| 3 |
+
|
| 4 |
+
Authors:
|
| 5 |
+
|
| 6 |
+
* Fernando Perez
|
| 7 |
+
* Brian E. Granger
|
| 8 |
+
"""
|
| 9 |
+
|
| 10 |
+
#-----------------------------------------------------------------------------
|
| 11 |
+
# Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu>
|
| 12 |
+
# Copyright (C) 2008-2011 The IPython Development Team
|
| 13 |
+
#
|
| 14 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 15 |
+
# the file COPYING, distributed as part of this software.
|
| 16 |
+
#-----------------------------------------------------------------------------
|
| 17 |
+
|
| 18 |
+
#-----------------------------------------------------------------------------
|
| 19 |
+
# Imports
|
| 20 |
+
#-----------------------------------------------------------------------------
|
| 21 |
+
|
| 22 |
+
import sys
|
| 23 |
+
import traceback
|
| 24 |
+
from pprint import pformat
|
| 25 |
+
from pathlib import Path
|
| 26 |
+
|
| 27 |
+
import builtins as builtin_mod
|
| 28 |
+
|
| 29 |
+
from IPython.core import ultratb
|
| 30 |
+
from IPython.core.application import Application
|
| 31 |
+
from IPython.core.release import author_email
|
| 32 |
+
from IPython.utils.sysinfo import sys_info
|
| 33 |
+
|
| 34 |
+
from IPython.core.release import __version__ as version
|
| 35 |
+
|
| 36 |
+
from typing import Optional, Dict
|
| 37 |
+
import types
|
| 38 |
+
|
| 39 |
+
#-----------------------------------------------------------------------------
|
| 40 |
+
# Code
|
| 41 |
+
#-----------------------------------------------------------------------------
|
| 42 |
+
|
| 43 |
+
# Template for the user message.
|
| 44 |
+
_default_message_template = """\
|
| 45 |
+
Oops, {app_name} crashed. We do our best to make it stable, but...
|
| 46 |
+
|
| 47 |
+
A crash report was automatically generated with the following information:
|
| 48 |
+
- A verbatim copy of the crash traceback.
|
| 49 |
+
- A copy of your input history during this session.
|
| 50 |
+
- Data on your current {app_name} configuration.
|
| 51 |
+
|
| 52 |
+
It was left in the file named:
|
| 53 |
+
\t'{crash_report_fname}'
|
| 54 |
+
If you can email this file to the developers, the information in it will help
|
| 55 |
+
them in understanding and correcting the problem.
|
| 56 |
+
|
| 57 |
+
You can mail it to: {contact_name} at {contact_email}
|
| 58 |
+
with the subject '{app_name} Crash Report'.
|
| 59 |
+
|
| 60 |
+
If you want to do it now, the following command will work (under Unix):
|
| 61 |
+
mail -s '{app_name} Crash Report' {contact_email} < {crash_report_fname}
|
| 62 |
+
|
| 63 |
+
In your email, please also include information about:
|
| 64 |
+
- The operating system under which the crash happened: Linux, macOS, Windows,
|
| 65 |
+
other, and which exact version (for example: Ubuntu 16.04.3, macOS 10.13.2,
|
| 66 |
+
Windows 10 Pro), and whether it is 32-bit or 64-bit;
|
| 67 |
+
- How {app_name} was installed: using pip or conda, from GitHub, as part of
|
| 68 |
+
a Docker container, or other, providing more detail if possible;
|
| 69 |
+
- How to reproduce the crash: what exact sequence of instructions can one
|
| 70 |
+
input to get the same crash? Ideally, find a minimal yet complete sequence
|
| 71 |
+
of instructions that yields the crash.
|
| 72 |
+
|
| 73 |
+
To ensure accurate tracking of this issue, please file a report about it at:
|
| 74 |
+
{bug_tracker}
|
| 75 |
+
"""
|
| 76 |
+
|
| 77 |
+
_lite_message_template = """
|
| 78 |
+
If you suspect this is an IPython {version} bug, please report it at:
|
| 79 |
+
https://github.com/ipython/ipython/issues
|
| 80 |
+
or send an email to the mailing list at {email}
|
| 81 |
+
|
| 82 |
+
You can print a more detailed traceback right now with "%tb", or use "%debug"
|
| 83 |
+
to interactively debug it.
|
| 84 |
+
|
| 85 |
+
Extra-detailed tracebacks for bug-reporting purposes can be enabled via:
|
| 86 |
+
{config}Application.verbose_crash=True
|
| 87 |
+
"""
|
| 88 |
+
|
| 89 |
+
|
| 90 |
+
class CrashHandler:
|
| 91 |
+
"""Customizable crash handlers for IPython applications.
|
| 92 |
+
|
| 93 |
+
Instances of this class provide a :meth:`__call__` method which can be
|
| 94 |
+
used as a ``sys.excepthook``. The :meth:`__call__` signature is::
|
| 95 |
+
|
| 96 |
+
def __call__(self, etype, evalue, etb)
|
| 97 |
+
"""
|
| 98 |
+
|
| 99 |
+
message_template = _default_message_template
|
| 100 |
+
section_sep = '\n\n'+'*'*75+'\n\n'
|
| 101 |
+
info: Dict[str, Optional[str]]
|
| 102 |
+
|
| 103 |
+
def __init__(
|
| 104 |
+
self,
|
| 105 |
+
app: Application,
|
| 106 |
+
contact_name: Optional[str] = None,
|
| 107 |
+
contact_email: Optional[str] = None,
|
| 108 |
+
bug_tracker: Optional[str] = None,
|
| 109 |
+
show_crash_traceback: bool = True,
|
| 110 |
+
call_pdb: bool = False,
|
| 111 |
+
):
|
| 112 |
+
"""Create a new crash handler
|
| 113 |
+
|
| 114 |
+
Parameters
|
| 115 |
+
----------
|
| 116 |
+
app : Application
|
| 117 |
+
A running :class:`Application` instance, which will be queried at
|
| 118 |
+
crash time for internal information.
|
| 119 |
+
contact_name : str
|
| 120 |
+
A string with the name of the person to contact.
|
| 121 |
+
contact_email : str
|
| 122 |
+
A string with the email address of the contact.
|
| 123 |
+
bug_tracker : str
|
| 124 |
+
A string with the URL for your project's bug tracker.
|
| 125 |
+
show_crash_traceback : bool
|
| 126 |
+
If false, don't print the crash traceback on stderr, only generate
|
| 127 |
+
the on-disk report
|
| 128 |
+
call_pdb
|
| 129 |
+
Whether to call pdb on crash
|
| 130 |
+
|
| 131 |
+
Attributes
|
| 132 |
+
----------
|
| 133 |
+
These instances contain some non-argument attributes which allow for
|
| 134 |
+
further customization of the crash handler's behavior. Please see the
|
| 135 |
+
source for further details.
|
| 136 |
+
|
| 137 |
+
"""
|
| 138 |
+
self.crash_report_fname = "Crash_report_%s.txt" % app.name
|
| 139 |
+
self.app = app
|
| 140 |
+
self.call_pdb = call_pdb
|
| 141 |
+
#self.call_pdb = True # dbg
|
| 142 |
+
self.show_crash_traceback = show_crash_traceback
|
| 143 |
+
self.info = dict(app_name = app.name,
|
| 144 |
+
contact_name = contact_name,
|
| 145 |
+
contact_email = contact_email,
|
| 146 |
+
bug_tracker = bug_tracker,
|
| 147 |
+
crash_report_fname = self.crash_report_fname)
|
| 148 |
+
|
| 149 |
+
def __call__(
|
| 150 |
+
self,
|
| 151 |
+
etype: type[BaseException],
|
| 152 |
+
evalue: BaseException,
|
| 153 |
+
etb: types.TracebackType,
|
| 154 |
+
) -> None:
|
| 155 |
+
"""Handle an exception, call for compatible with sys.excepthook"""
|
| 156 |
+
|
| 157 |
+
# do not allow the crash handler to be called twice without reinstalling it
|
| 158 |
+
# this prevents unlikely errors in the crash handling from entering an
|
| 159 |
+
# infinite loop.
|
| 160 |
+
sys.excepthook = sys.__excepthook__
|
| 161 |
+
|
| 162 |
+
# Report tracebacks shouldn't use color in general (safer for users)
|
| 163 |
+
color_scheme = 'NoColor'
|
| 164 |
+
|
| 165 |
+
# Use this ONLY for developer debugging (keep commented out for release)
|
| 166 |
+
# color_scheme = 'Linux' # dbg
|
| 167 |
+
ipython_dir = getattr(self.app, "ipython_dir", None)
|
| 168 |
+
if ipython_dir is not None:
|
| 169 |
+
assert isinstance(ipython_dir, str)
|
| 170 |
+
rptdir = Path(ipython_dir)
|
| 171 |
+
else:
|
| 172 |
+
rptdir = Path.cwd()
|
| 173 |
+
if not rptdir.is_dir():
|
| 174 |
+
rptdir = Path.cwd()
|
| 175 |
+
report_name = rptdir / self.crash_report_fname
|
| 176 |
+
# write the report filename into the instance dict so it can get
|
| 177 |
+
# properly expanded out in the user message template
|
| 178 |
+
self.crash_report_fname = str(report_name)
|
| 179 |
+
self.info["crash_report_fname"] = str(report_name)
|
| 180 |
+
TBhandler = ultratb.VerboseTB(
|
| 181 |
+
color_scheme=color_scheme,
|
| 182 |
+
long_header=True,
|
| 183 |
+
call_pdb=self.call_pdb,
|
| 184 |
+
)
|
| 185 |
+
if self.call_pdb:
|
| 186 |
+
TBhandler(etype,evalue,etb)
|
| 187 |
+
return
|
| 188 |
+
else:
|
| 189 |
+
traceback = TBhandler.text(etype,evalue,etb,context=31)
|
| 190 |
+
|
| 191 |
+
# print traceback to screen
|
| 192 |
+
if self.show_crash_traceback:
|
| 193 |
+
print(traceback, file=sys.stderr)
|
| 194 |
+
|
| 195 |
+
# and generate a complete report on disk
|
| 196 |
+
try:
|
| 197 |
+
report = open(report_name, "w", encoding="utf-8")
|
| 198 |
+
except:
|
| 199 |
+
print('Could not create crash report on disk.', file=sys.stderr)
|
| 200 |
+
return
|
| 201 |
+
|
| 202 |
+
with report:
|
| 203 |
+
# Inform user on stderr of what happened
|
| 204 |
+
print('\n'+'*'*70+'\n', file=sys.stderr)
|
| 205 |
+
print(self.message_template.format(**self.info), file=sys.stderr)
|
| 206 |
+
|
| 207 |
+
# Construct report on disk
|
| 208 |
+
report.write(self.make_report(str(traceback)))
|
| 209 |
+
|
| 210 |
+
builtin_mod.input("Hit <Enter> to quit (your terminal may close):")
|
| 211 |
+
|
| 212 |
+
def make_report(self, traceback: str) -> str:
|
| 213 |
+
"""Return a string containing a crash report."""
|
| 214 |
+
|
| 215 |
+
sec_sep = self.section_sep
|
| 216 |
+
|
| 217 |
+
report = ['*'*75+'\n\n'+'IPython post-mortem report\n\n']
|
| 218 |
+
rpt_add = report.append
|
| 219 |
+
rpt_add(sys_info())
|
| 220 |
+
|
| 221 |
+
try:
|
| 222 |
+
config = pformat(self.app.config)
|
| 223 |
+
rpt_add(sec_sep)
|
| 224 |
+
rpt_add("Application name: %s\n\n" % self.app.name)
|
| 225 |
+
rpt_add("Current user configuration structure:\n\n")
|
| 226 |
+
rpt_add(config)
|
| 227 |
+
except:
|
| 228 |
+
pass
|
| 229 |
+
rpt_add(sec_sep+'Crash traceback:\n\n' + traceback)
|
| 230 |
+
|
| 231 |
+
return ''.join(report)
|
| 232 |
+
|
| 233 |
+
|
| 234 |
+
def crash_handler_lite(
|
| 235 |
+
etype: type[BaseException], evalue: BaseException, tb: types.TracebackType
|
| 236 |
+
) -> None:
|
| 237 |
+
"""a light excepthook, adding a small message to the usual traceback"""
|
| 238 |
+
traceback.print_exception(etype, evalue, tb)
|
| 239 |
+
|
| 240 |
+
from IPython.core.interactiveshell import InteractiveShell
|
| 241 |
+
if InteractiveShell.initialized():
|
| 242 |
+
# we are in a Shell environment, give %magic example
|
| 243 |
+
config = "%config "
|
| 244 |
+
else:
|
| 245 |
+
# we are not in a shell, show generic config
|
| 246 |
+
config = "c."
|
| 247 |
+
print(_lite_message_template.format(email=author_email, config=config, version=version), file=sys.stderr)
|
| 248 |
+
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/debugger.py
ADDED
|
@@ -0,0 +1,1136 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""
|
| 2 |
+
Pdb debugger class.
|
| 3 |
+
|
| 4 |
+
|
| 5 |
+
This is an extension to PDB which adds a number of new features.
|
| 6 |
+
Note that there is also the `IPython.terminal.debugger` class which provides UI
|
| 7 |
+
improvements.
|
| 8 |
+
|
| 9 |
+
We also strongly recommend to use this via the `ipdb` package, which provides
|
| 10 |
+
extra configuration options.
|
| 11 |
+
|
| 12 |
+
Among other things, this subclass of PDB:
|
| 13 |
+
- supports many IPython magics like pdef/psource
|
| 14 |
+
- hide frames in tracebacks based on `__tracebackhide__`
|
| 15 |
+
- allows to skip frames based on `__debuggerskip__`
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
Global Configuration
|
| 19 |
+
--------------------
|
| 20 |
+
|
| 21 |
+
The IPython debugger will by read the global ``~/.pdbrc`` file.
|
| 22 |
+
That is to say you can list all commands supported by ipdb in your `~/.pdbrc`
|
| 23 |
+
configuration file, to globally configure pdb.
|
| 24 |
+
|
| 25 |
+
Example::
|
| 26 |
+
|
| 27 |
+
# ~/.pdbrc
|
| 28 |
+
skip_predicates debuggerskip false
|
| 29 |
+
skip_hidden false
|
| 30 |
+
context 25
|
| 31 |
+
|
| 32 |
+
Features
|
| 33 |
+
--------
|
| 34 |
+
|
| 35 |
+
The IPython debugger can hide and skip frames when printing or moving through
|
| 36 |
+
the stack. This can have a performance impact, so can be configures.
|
| 37 |
+
|
| 38 |
+
The skipping and hiding frames are configurable via the `skip_predicates`
|
| 39 |
+
command.
|
| 40 |
+
|
| 41 |
+
By default, frames from readonly files will be hidden, frames containing
|
| 42 |
+
``__tracebackhide__ = True`` will be hidden.
|
| 43 |
+
|
| 44 |
+
Frames containing ``__debuggerskip__`` will be stepped over, frames whose parent
|
| 45 |
+
frames value of ``__debuggerskip__`` is ``True`` will also be skipped.
|
| 46 |
+
|
| 47 |
+
>>> def helpers_helper():
|
| 48 |
+
... pass
|
| 49 |
+
...
|
| 50 |
+
... def helper_1():
|
| 51 |
+
... print("don't step in me")
|
| 52 |
+
... helpers_helpers() # will be stepped over unless breakpoint set.
|
| 53 |
+
...
|
| 54 |
+
...
|
| 55 |
+
... def helper_2():
|
| 56 |
+
... print("in me neither")
|
| 57 |
+
...
|
| 58 |
+
|
| 59 |
+
One can define a decorator that wraps a function between the two helpers:
|
| 60 |
+
|
| 61 |
+
>>> def pdb_skipped_decorator(function):
|
| 62 |
+
...
|
| 63 |
+
...
|
| 64 |
+
... def wrapped_fn(*args, **kwargs):
|
| 65 |
+
... __debuggerskip__ = True
|
| 66 |
+
... helper_1()
|
| 67 |
+
... __debuggerskip__ = False
|
| 68 |
+
... result = function(*args, **kwargs)
|
| 69 |
+
... __debuggerskip__ = True
|
| 70 |
+
... helper_2()
|
| 71 |
+
... # setting __debuggerskip__ to False again is not necessary
|
| 72 |
+
... return result
|
| 73 |
+
...
|
| 74 |
+
... return wrapped_fn
|
| 75 |
+
|
| 76 |
+
When decorating a function, ipdb will directly step into ``bar()`` by
|
| 77 |
+
default:
|
| 78 |
+
|
| 79 |
+
>>> @foo_decorator
|
| 80 |
+
... def bar(x, y):
|
| 81 |
+
... return x * y
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
You can toggle the behavior with
|
| 85 |
+
|
| 86 |
+
ipdb> skip_predicates debuggerskip false
|
| 87 |
+
|
| 88 |
+
or configure it in your ``.pdbrc``
|
| 89 |
+
|
| 90 |
+
|
| 91 |
+
|
| 92 |
+
License
|
| 93 |
+
-------
|
| 94 |
+
|
| 95 |
+
Modified from the standard pdb.Pdb class to avoid including readline, so that
|
| 96 |
+
the command line completion of other programs which include this isn't
|
| 97 |
+
damaged.
|
| 98 |
+
|
| 99 |
+
In the future, this class will be expanded with improvements over the standard
|
| 100 |
+
pdb.
|
| 101 |
+
|
| 102 |
+
The original code in this file is mainly lifted out of cmd.py in Python 2.2,
|
| 103 |
+
with minor changes. Licensing should therefore be under the standard Python
|
| 104 |
+
terms. For details on the PSF (Python Software Foundation) standard license,
|
| 105 |
+
see:
|
| 106 |
+
|
| 107 |
+
https://docs.python.org/2/license.html
|
| 108 |
+
|
| 109 |
+
|
| 110 |
+
All the changes since then are under the same license as IPython.
|
| 111 |
+
|
| 112 |
+
"""
|
| 113 |
+
|
| 114 |
+
#*****************************************************************************
|
| 115 |
+
#
|
| 116 |
+
# This file is licensed under the PSF license.
|
| 117 |
+
#
|
| 118 |
+
# Copyright (C) 2001 Python Software Foundation, www.python.org
|
| 119 |
+
# Copyright (C) 2005-2006 Fernando Perez. <fperez@colorado.edu>
|
| 120 |
+
#
|
| 121 |
+
#
|
| 122 |
+
#*****************************************************************************
|
| 123 |
+
|
| 124 |
+
from __future__ import annotations
|
| 125 |
+
|
| 126 |
+
import inspect
|
| 127 |
+
import linecache
|
| 128 |
+
import os
|
| 129 |
+
import re
|
| 130 |
+
import sys
|
| 131 |
+
from contextlib import contextmanager
|
| 132 |
+
from functools import lru_cache
|
| 133 |
+
|
| 134 |
+
from IPython import get_ipython
|
| 135 |
+
from IPython.core.excolors import exception_colors
|
| 136 |
+
from IPython.utils import PyColorize, coloransi, py3compat
|
| 137 |
+
|
| 138 |
+
from typing import TYPE_CHECKING
|
| 139 |
+
|
| 140 |
+
if TYPE_CHECKING:
|
| 141 |
+
# otherwise circular import
|
| 142 |
+
from IPython.core.interactiveshell import InteractiveShell
|
| 143 |
+
|
| 144 |
+
# skip module docstests
|
| 145 |
+
__skip_doctest__ = True
|
| 146 |
+
|
| 147 |
+
prompt = 'ipdb> '
|
| 148 |
+
|
| 149 |
+
# We have to check this directly from sys.argv, config struct not yet available
|
| 150 |
+
from pdb import Pdb as OldPdb
|
| 151 |
+
|
| 152 |
+
# Allow the set_trace code to operate outside of an ipython instance, even if
|
| 153 |
+
# it does so with some limitations. The rest of this support is implemented in
|
| 154 |
+
# the Tracer constructor.
|
| 155 |
+
|
| 156 |
+
DEBUGGERSKIP = "__debuggerskip__"
|
| 157 |
+
|
| 158 |
+
|
| 159 |
+
# this has been implemented in Pdb in Python 3.13 (https://github.com/python/cpython/pull/106676
|
| 160 |
+
# on lower python versions, we backported the feature.
|
| 161 |
+
CHAIN_EXCEPTIONS = sys.version_info < (3, 13)
|
| 162 |
+
|
| 163 |
+
|
| 164 |
+
def make_arrow(pad):
|
| 165 |
+
"""generate the leading arrow in front of traceback or debugger"""
|
| 166 |
+
if pad >= 2:
|
| 167 |
+
return '-'*(pad-2) + '> '
|
| 168 |
+
elif pad == 1:
|
| 169 |
+
return '>'
|
| 170 |
+
return ''
|
| 171 |
+
|
| 172 |
+
|
| 173 |
+
def BdbQuit_excepthook(et, ev, tb, excepthook=None):
|
| 174 |
+
"""Exception hook which handles `BdbQuit` exceptions.
|
| 175 |
+
|
| 176 |
+
All other exceptions are processed using the `excepthook`
|
| 177 |
+
parameter.
|
| 178 |
+
"""
|
| 179 |
+
raise ValueError(
|
| 180 |
+
"`BdbQuit_excepthook` is deprecated since version 5.1. It is still around only because it is still imported by ipdb.",
|
| 181 |
+
)
|
| 182 |
+
|
| 183 |
+
|
| 184 |
+
RGX_EXTRA_INDENT = re.compile(r'(?<=\n)\s+')
|
| 185 |
+
|
| 186 |
+
|
| 187 |
+
def strip_indentation(multiline_string):
|
| 188 |
+
return RGX_EXTRA_INDENT.sub('', multiline_string)
|
| 189 |
+
|
| 190 |
+
|
| 191 |
+
def decorate_fn_with_doc(new_fn, old_fn, additional_text=""):
|
| 192 |
+
"""Make new_fn have old_fn's doc string. This is particularly useful
|
| 193 |
+
for the ``do_...`` commands that hook into the help system.
|
| 194 |
+
Adapted from from a comp.lang.python posting
|
| 195 |
+
by Duncan Booth."""
|
| 196 |
+
def wrapper(*args, **kw):
|
| 197 |
+
return new_fn(*args, **kw)
|
| 198 |
+
if old_fn.__doc__:
|
| 199 |
+
wrapper.__doc__ = strip_indentation(old_fn.__doc__) + additional_text
|
| 200 |
+
return wrapper
|
| 201 |
+
|
| 202 |
+
|
| 203 |
+
class Pdb(OldPdb):
|
| 204 |
+
"""Modified Pdb class, does not load readline.
|
| 205 |
+
|
| 206 |
+
for a standalone version that uses prompt_toolkit, see
|
| 207 |
+
`IPython.terminal.debugger.TerminalPdb` and
|
| 208 |
+
`IPython.terminal.debugger.set_trace()`
|
| 209 |
+
|
| 210 |
+
|
| 211 |
+
This debugger can hide and skip frames that are tagged according to some predicates.
|
| 212 |
+
See the `skip_predicates` commands.
|
| 213 |
+
|
| 214 |
+
"""
|
| 215 |
+
|
| 216 |
+
shell: InteractiveShell
|
| 217 |
+
|
| 218 |
+
if CHAIN_EXCEPTIONS:
|
| 219 |
+
MAX_CHAINED_EXCEPTION_DEPTH = 999
|
| 220 |
+
|
| 221 |
+
default_predicates = {
|
| 222 |
+
"tbhide": True,
|
| 223 |
+
"readonly": False,
|
| 224 |
+
"ipython_internal": True,
|
| 225 |
+
"debuggerskip": True,
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
def __init__(self, completekey=None, stdin=None, stdout=None, context=5, **kwargs):
|
| 229 |
+
"""Create a new IPython debugger.
|
| 230 |
+
|
| 231 |
+
Parameters
|
| 232 |
+
----------
|
| 233 |
+
completekey : default None
|
| 234 |
+
Passed to pdb.Pdb.
|
| 235 |
+
stdin : default None
|
| 236 |
+
Passed to pdb.Pdb.
|
| 237 |
+
stdout : default None
|
| 238 |
+
Passed to pdb.Pdb.
|
| 239 |
+
context : int
|
| 240 |
+
Number of lines of source code context to show when
|
| 241 |
+
displaying stacktrace information.
|
| 242 |
+
**kwargs
|
| 243 |
+
Passed to pdb.Pdb.
|
| 244 |
+
|
| 245 |
+
Notes
|
| 246 |
+
-----
|
| 247 |
+
The possibilities are python version dependent, see the python
|
| 248 |
+
docs for more info.
|
| 249 |
+
"""
|
| 250 |
+
|
| 251 |
+
# Parent constructor:
|
| 252 |
+
try:
|
| 253 |
+
self.context = int(context)
|
| 254 |
+
if self.context <= 0:
|
| 255 |
+
raise ValueError("Context must be a positive integer")
|
| 256 |
+
except (TypeError, ValueError) as e:
|
| 257 |
+
raise ValueError("Context must be a positive integer") from e
|
| 258 |
+
|
| 259 |
+
# `kwargs` ensures full compatibility with stdlib's `pdb.Pdb`.
|
| 260 |
+
OldPdb.__init__(self, completekey, stdin, stdout, **kwargs)
|
| 261 |
+
|
| 262 |
+
# IPython changes...
|
| 263 |
+
self.shell = get_ipython()
|
| 264 |
+
|
| 265 |
+
if self.shell is None:
|
| 266 |
+
save_main = sys.modules['__main__']
|
| 267 |
+
# No IPython instance running, we must create one
|
| 268 |
+
from IPython.terminal.interactiveshell import \
|
| 269 |
+
TerminalInteractiveShell
|
| 270 |
+
self.shell = TerminalInteractiveShell.instance()
|
| 271 |
+
# needed by any code which calls __import__("__main__") after
|
| 272 |
+
# the debugger was entered. See also #9941.
|
| 273 |
+
sys.modules["__main__"] = save_main
|
| 274 |
+
|
| 275 |
+
|
| 276 |
+
color_scheme = self.shell.colors
|
| 277 |
+
|
| 278 |
+
self.aliases = {}
|
| 279 |
+
|
| 280 |
+
# Create color table: we copy the default one from the traceback
|
| 281 |
+
# module and add a few attributes needed for debugging
|
| 282 |
+
self.color_scheme_table = exception_colors()
|
| 283 |
+
|
| 284 |
+
# shorthands
|
| 285 |
+
C = coloransi.TermColors
|
| 286 |
+
cst = self.color_scheme_table
|
| 287 |
+
|
| 288 |
+
|
| 289 |
+
# Add a python parser so we can syntax highlight source while
|
| 290 |
+
# debugging.
|
| 291 |
+
self.parser = PyColorize.Parser(style=color_scheme)
|
| 292 |
+
self.set_colors(color_scheme)
|
| 293 |
+
|
| 294 |
+
# Set the prompt - the default prompt is '(Pdb)'
|
| 295 |
+
self.prompt = prompt
|
| 296 |
+
self.skip_hidden = True
|
| 297 |
+
self.report_skipped = True
|
| 298 |
+
|
| 299 |
+
# list of predicates we use to skip frames
|
| 300 |
+
self._predicates = self.default_predicates
|
| 301 |
+
|
| 302 |
+
if CHAIN_EXCEPTIONS:
|
| 303 |
+
self._chained_exceptions = tuple()
|
| 304 |
+
self._chained_exception_index = 0
|
| 305 |
+
|
| 306 |
+
#
|
| 307 |
+
def set_colors(self, scheme):
|
| 308 |
+
"""Shorthand access to the color table scheme selector method."""
|
| 309 |
+
self.color_scheme_table.set_active_scheme(scheme)
|
| 310 |
+
self.parser.style = scheme
|
| 311 |
+
|
| 312 |
+
def set_trace(self, frame=None):
|
| 313 |
+
if frame is None:
|
| 314 |
+
frame = sys._getframe().f_back
|
| 315 |
+
self.initial_frame = frame
|
| 316 |
+
return super().set_trace(frame)
|
| 317 |
+
|
| 318 |
+
def _hidden_predicate(self, frame):
|
| 319 |
+
"""
|
| 320 |
+
Given a frame return whether it it should be hidden or not by IPython.
|
| 321 |
+
"""
|
| 322 |
+
|
| 323 |
+
if self._predicates["readonly"]:
|
| 324 |
+
fname = frame.f_code.co_filename
|
| 325 |
+
# we need to check for file existence and interactively define
|
| 326 |
+
# function would otherwise appear as RO.
|
| 327 |
+
if os.path.isfile(fname) and not os.access(fname, os.W_OK):
|
| 328 |
+
return True
|
| 329 |
+
|
| 330 |
+
if self._predicates["tbhide"]:
|
| 331 |
+
if frame in (self.curframe, getattr(self, "initial_frame", None)):
|
| 332 |
+
return False
|
| 333 |
+
frame_locals = self._get_frame_locals(frame)
|
| 334 |
+
if "__tracebackhide__" not in frame_locals:
|
| 335 |
+
return False
|
| 336 |
+
return frame_locals["__tracebackhide__"]
|
| 337 |
+
return False
|
| 338 |
+
|
| 339 |
+
def hidden_frames(self, stack):
|
| 340 |
+
"""
|
| 341 |
+
Given an index in the stack return whether it should be skipped.
|
| 342 |
+
|
| 343 |
+
This is used in up/down and where to skip frames.
|
| 344 |
+
"""
|
| 345 |
+
# The f_locals dictionary is updated from the actual frame
|
| 346 |
+
# locals whenever the .f_locals accessor is called, so we
|
| 347 |
+
# avoid calling it here to preserve self.curframe_locals.
|
| 348 |
+
# Furthermore, there is no good reason to hide the current frame.
|
| 349 |
+
ip_hide = [self._hidden_predicate(s[0]) for s in stack]
|
| 350 |
+
ip_start = [i for i, s in enumerate(ip_hide) if s == "__ipython_bottom__"]
|
| 351 |
+
if ip_start and self._predicates["ipython_internal"]:
|
| 352 |
+
ip_hide = [h if i > ip_start[0] else True for (i, h) in enumerate(ip_hide)]
|
| 353 |
+
return ip_hide
|
| 354 |
+
|
| 355 |
+
if CHAIN_EXCEPTIONS:
|
| 356 |
+
|
| 357 |
+
def _get_tb_and_exceptions(self, tb_or_exc):
|
| 358 |
+
"""
|
| 359 |
+
Given a tracecack or an exception, return a tuple of chained exceptions
|
| 360 |
+
and current traceback to inspect.
|
| 361 |
+
This will deal with selecting the right ``__cause__`` or ``__context__``
|
| 362 |
+
as well as handling cycles, and return a flattened list of exceptions we
|
| 363 |
+
can jump to with do_exceptions.
|
| 364 |
+
"""
|
| 365 |
+
_exceptions = []
|
| 366 |
+
if isinstance(tb_or_exc, BaseException):
|
| 367 |
+
traceback, current = tb_or_exc.__traceback__, tb_or_exc
|
| 368 |
+
|
| 369 |
+
while current is not None:
|
| 370 |
+
if current in _exceptions:
|
| 371 |
+
break
|
| 372 |
+
_exceptions.append(current)
|
| 373 |
+
if current.__cause__ is not None:
|
| 374 |
+
current = current.__cause__
|
| 375 |
+
elif (
|
| 376 |
+
current.__context__ is not None
|
| 377 |
+
and not current.__suppress_context__
|
| 378 |
+
):
|
| 379 |
+
current = current.__context__
|
| 380 |
+
|
| 381 |
+
if len(_exceptions) >= self.MAX_CHAINED_EXCEPTION_DEPTH:
|
| 382 |
+
self.message(
|
| 383 |
+
f"More than {self.MAX_CHAINED_EXCEPTION_DEPTH}"
|
| 384 |
+
" chained exceptions found, not all exceptions"
|
| 385 |
+
"will be browsable with `exceptions`."
|
| 386 |
+
)
|
| 387 |
+
break
|
| 388 |
+
else:
|
| 389 |
+
traceback = tb_or_exc
|
| 390 |
+
return tuple(reversed(_exceptions)), traceback
|
| 391 |
+
|
| 392 |
+
@contextmanager
|
| 393 |
+
def _hold_exceptions(self, exceptions):
|
| 394 |
+
"""
|
| 395 |
+
Context manager to ensure proper cleaning of exceptions references
|
| 396 |
+
When given a chained exception instead of a traceback,
|
| 397 |
+
pdb may hold references to many objects which may leak memory.
|
| 398 |
+
We use this context manager to make sure everything is properly cleaned
|
| 399 |
+
"""
|
| 400 |
+
try:
|
| 401 |
+
self._chained_exceptions = exceptions
|
| 402 |
+
self._chained_exception_index = len(exceptions) - 1
|
| 403 |
+
yield
|
| 404 |
+
finally:
|
| 405 |
+
# we can't put those in forget as otherwise they would
|
| 406 |
+
# be cleared on exception change
|
| 407 |
+
self._chained_exceptions = tuple()
|
| 408 |
+
self._chained_exception_index = 0
|
| 409 |
+
|
| 410 |
+
def do_exceptions(self, arg):
|
| 411 |
+
"""exceptions [number]
|
| 412 |
+
List or change current exception in an exception chain.
|
| 413 |
+
Without arguments, list all the current exception in the exception
|
| 414 |
+
chain. Exceptions will be numbered, with the current exception indicated
|
| 415 |
+
with an arrow.
|
| 416 |
+
If given an integer as argument, switch to the exception at that index.
|
| 417 |
+
"""
|
| 418 |
+
if not self._chained_exceptions:
|
| 419 |
+
self.message(
|
| 420 |
+
"Did not find chained exceptions. To move between"
|
| 421 |
+
" exceptions, pdb/post_mortem must be given an exception"
|
| 422 |
+
" object rather than a traceback."
|
| 423 |
+
)
|
| 424 |
+
return
|
| 425 |
+
if not arg:
|
| 426 |
+
for ix, exc in enumerate(self._chained_exceptions):
|
| 427 |
+
prompt = ">" if ix == self._chained_exception_index else " "
|
| 428 |
+
rep = repr(exc)
|
| 429 |
+
if len(rep) > 80:
|
| 430 |
+
rep = rep[:77] + "..."
|
| 431 |
+
indicator = (
|
| 432 |
+
" -"
|
| 433 |
+
if self._chained_exceptions[ix].__traceback__ is None
|
| 434 |
+
else f"{ix:>3}"
|
| 435 |
+
)
|
| 436 |
+
self.message(f"{prompt} {indicator} {rep}")
|
| 437 |
+
else:
|
| 438 |
+
try:
|
| 439 |
+
number = int(arg)
|
| 440 |
+
except ValueError:
|
| 441 |
+
self.error("Argument must be an integer")
|
| 442 |
+
return
|
| 443 |
+
if 0 <= number < len(self._chained_exceptions):
|
| 444 |
+
if self._chained_exceptions[number].__traceback__ is None:
|
| 445 |
+
self.error(
|
| 446 |
+
"This exception does not have a traceback, cannot jump to it"
|
| 447 |
+
)
|
| 448 |
+
return
|
| 449 |
+
|
| 450 |
+
self._chained_exception_index = number
|
| 451 |
+
self.setup(None, self._chained_exceptions[number].__traceback__)
|
| 452 |
+
self.print_stack_entry(self.stack[self.curindex])
|
| 453 |
+
else:
|
| 454 |
+
self.error("No exception with that number")
|
| 455 |
+
|
| 456 |
+
def interaction(self, frame, tb_or_exc):
|
| 457 |
+
try:
|
| 458 |
+
if CHAIN_EXCEPTIONS:
|
| 459 |
+
# this context manager is part of interaction in 3.13
|
| 460 |
+
_chained_exceptions, tb = self._get_tb_and_exceptions(tb_or_exc)
|
| 461 |
+
if isinstance(tb_or_exc, BaseException):
|
| 462 |
+
assert tb is not None, "main exception must have a traceback"
|
| 463 |
+
with self._hold_exceptions(_chained_exceptions):
|
| 464 |
+
OldPdb.interaction(self, frame, tb)
|
| 465 |
+
else:
|
| 466 |
+
OldPdb.interaction(self, frame, tb_or_exc)
|
| 467 |
+
|
| 468 |
+
except KeyboardInterrupt:
|
| 469 |
+
self.stdout.write("\n" + self.shell.get_exception_only())
|
| 470 |
+
|
| 471 |
+
def precmd(self, line):
|
| 472 |
+
"""Perform useful escapes on the command before it is executed."""
|
| 473 |
+
|
| 474 |
+
if line.endswith("??"):
|
| 475 |
+
line = "pinfo2 " + line[:-2]
|
| 476 |
+
elif line.endswith("?"):
|
| 477 |
+
line = "pinfo " + line[:-1]
|
| 478 |
+
|
| 479 |
+
line = super().precmd(line)
|
| 480 |
+
|
| 481 |
+
return line
|
| 482 |
+
|
| 483 |
+
def new_do_quit(self, arg):
|
| 484 |
+
return OldPdb.do_quit(self, arg)
|
| 485 |
+
|
| 486 |
+
do_q = do_quit = decorate_fn_with_doc(new_do_quit, OldPdb.do_quit)
|
| 487 |
+
|
| 488 |
+
def print_stack_trace(self, context=None):
|
| 489 |
+
Colors = self.color_scheme_table.active_colors
|
| 490 |
+
ColorsNormal = Colors.Normal
|
| 491 |
+
if context is None:
|
| 492 |
+
context = self.context
|
| 493 |
+
try:
|
| 494 |
+
context = int(context)
|
| 495 |
+
if context <= 0:
|
| 496 |
+
raise ValueError("Context must be a positive integer")
|
| 497 |
+
except (TypeError, ValueError) as e:
|
| 498 |
+
raise ValueError("Context must be a positive integer") from e
|
| 499 |
+
try:
|
| 500 |
+
skipped = 0
|
| 501 |
+
for hidden, frame_lineno in zip(self.hidden_frames(self.stack), self.stack):
|
| 502 |
+
if hidden and self.skip_hidden:
|
| 503 |
+
skipped += 1
|
| 504 |
+
continue
|
| 505 |
+
if skipped:
|
| 506 |
+
print(
|
| 507 |
+
f"{Colors.excName} [... skipping {skipped} hidden frame(s)]{ColorsNormal}\n"
|
| 508 |
+
)
|
| 509 |
+
skipped = 0
|
| 510 |
+
self.print_stack_entry(frame_lineno, context=context)
|
| 511 |
+
if skipped:
|
| 512 |
+
print(
|
| 513 |
+
f"{Colors.excName} [... skipping {skipped} hidden frame(s)]{ColorsNormal}\n"
|
| 514 |
+
)
|
| 515 |
+
except KeyboardInterrupt:
|
| 516 |
+
pass
|
| 517 |
+
|
| 518 |
+
def print_stack_entry(self, frame_lineno, prompt_prefix='\n-> ',
|
| 519 |
+
context=None):
|
| 520 |
+
if context is None:
|
| 521 |
+
context = self.context
|
| 522 |
+
try:
|
| 523 |
+
context = int(context)
|
| 524 |
+
if context <= 0:
|
| 525 |
+
raise ValueError("Context must be a positive integer")
|
| 526 |
+
except (TypeError, ValueError) as e:
|
| 527 |
+
raise ValueError("Context must be a positive integer") from e
|
| 528 |
+
print(self.format_stack_entry(frame_lineno, '', context), file=self.stdout)
|
| 529 |
+
|
| 530 |
+
# vds: >>
|
| 531 |
+
frame, lineno = frame_lineno
|
| 532 |
+
filename = frame.f_code.co_filename
|
| 533 |
+
self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
|
| 534 |
+
# vds: <<
|
| 535 |
+
|
| 536 |
+
def _get_frame_locals(self, frame):
|
| 537 |
+
""" "
|
| 538 |
+
Accessing f_local of current frame reset the namespace, so we want to avoid
|
| 539 |
+
that or the following can happen
|
| 540 |
+
|
| 541 |
+
ipdb> foo
|
| 542 |
+
"old"
|
| 543 |
+
ipdb> foo = "new"
|
| 544 |
+
ipdb> foo
|
| 545 |
+
"new"
|
| 546 |
+
ipdb> where
|
| 547 |
+
ipdb> foo
|
| 548 |
+
"old"
|
| 549 |
+
|
| 550 |
+
So if frame is self.current_frame we instead return self.curframe_locals
|
| 551 |
+
|
| 552 |
+
"""
|
| 553 |
+
if frame is getattr(self, "curframe", None):
|
| 554 |
+
return self.curframe_locals
|
| 555 |
+
else:
|
| 556 |
+
return frame.f_locals
|
| 557 |
+
|
| 558 |
+
def format_stack_entry(self, frame_lineno, lprefix=': ', context=None):
|
| 559 |
+
if context is None:
|
| 560 |
+
context = self.context
|
| 561 |
+
try:
|
| 562 |
+
context = int(context)
|
| 563 |
+
if context <= 0:
|
| 564 |
+
print("Context must be a positive integer", file=self.stdout)
|
| 565 |
+
except (TypeError, ValueError):
|
| 566 |
+
print("Context must be a positive integer", file=self.stdout)
|
| 567 |
+
|
| 568 |
+
import reprlib
|
| 569 |
+
|
| 570 |
+
ret = []
|
| 571 |
+
|
| 572 |
+
Colors = self.color_scheme_table.active_colors
|
| 573 |
+
ColorsNormal = Colors.Normal
|
| 574 |
+
tpl_link = "%s%%s%s" % (Colors.filenameEm, ColorsNormal)
|
| 575 |
+
tpl_call = "%s%%s%s%%s%s" % (Colors.vName, Colors.valEm, ColorsNormal)
|
| 576 |
+
tpl_line = "%%s%s%%s %s%%s" % (Colors.lineno, ColorsNormal)
|
| 577 |
+
tpl_line_em = "%%s%s%%s %s%%s%s" % (Colors.linenoEm, Colors.line, ColorsNormal)
|
| 578 |
+
|
| 579 |
+
frame, lineno = frame_lineno
|
| 580 |
+
|
| 581 |
+
return_value = ''
|
| 582 |
+
loc_frame = self._get_frame_locals(frame)
|
| 583 |
+
if "__return__" in loc_frame:
|
| 584 |
+
rv = loc_frame["__return__"]
|
| 585 |
+
# return_value += '->'
|
| 586 |
+
return_value += reprlib.repr(rv) + "\n"
|
| 587 |
+
ret.append(return_value)
|
| 588 |
+
|
| 589 |
+
#s = filename + '(' + `lineno` + ')'
|
| 590 |
+
filename = self.canonic(frame.f_code.co_filename)
|
| 591 |
+
link = tpl_link % py3compat.cast_unicode(filename)
|
| 592 |
+
|
| 593 |
+
if frame.f_code.co_name:
|
| 594 |
+
func = frame.f_code.co_name
|
| 595 |
+
else:
|
| 596 |
+
func = "<lambda>"
|
| 597 |
+
|
| 598 |
+
call = ""
|
| 599 |
+
if func != "?":
|
| 600 |
+
if "__args__" in loc_frame:
|
| 601 |
+
args = reprlib.repr(loc_frame["__args__"])
|
| 602 |
+
else:
|
| 603 |
+
args = '()'
|
| 604 |
+
call = tpl_call % (func, args)
|
| 605 |
+
|
| 606 |
+
# The level info should be generated in the same format pdb uses, to
|
| 607 |
+
# avoid breaking the pdbtrack functionality of python-mode in *emacs.
|
| 608 |
+
if frame is self.curframe:
|
| 609 |
+
ret.append('> ')
|
| 610 |
+
else:
|
| 611 |
+
ret.append(" ")
|
| 612 |
+
ret.append("%s(%s)%s\n" % (link, lineno, call))
|
| 613 |
+
|
| 614 |
+
start = lineno - 1 - context//2
|
| 615 |
+
lines = linecache.getlines(filename)
|
| 616 |
+
start = min(start, len(lines) - context)
|
| 617 |
+
start = max(start, 0)
|
| 618 |
+
lines = lines[start : start + context]
|
| 619 |
+
|
| 620 |
+
for i, line in enumerate(lines):
|
| 621 |
+
show_arrow = start + 1 + i == lineno
|
| 622 |
+
linetpl = (frame is self.curframe or show_arrow) and tpl_line_em or tpl_line
|
| 623 |
+
ret.append(
|
| 624 |
+
self.__format_line(
|
| 625 |
+
linetpl, filename, start + 1 + i, line, arrow=show_arrow
|
| 626 |
+
)
|
| 627 |
+
)
|
| 628 |
+
return "".join(ret)
|
| 629 |
+
|
| 630 |
+
def __format_line(self, tpl_line, filename, lineno, line, arrow=False):
|
| 631 |
+
bp_mark = ""
|
| 632 |
+
bp_mark_color = ""
|
| 633 |
+
|
| 634 |
+
new_line, err = self.parser.format2(line, 'str')
|
| 635 |
+
if not err:
|
| 636 |
+
line = new_line
|
| 637 |
+
|
| 638 |
+
bp = None
|
| 639 |
+
if lineno in self.get_file_breaks(filename):
|
| 640 |
+
bps = self.get_breaks(filename, lineno)
|
| 641 |
+
bp = bps[-1]
|
| 642 |
+
|
| 643 |
+
if bp:
|
| 644 |
+
Colors = self.color_scheme_table.active_colors
|
| 645 |
+
bp_mark = str(bp.number)
|
| 646 |
+
bp_mark_color = Colors.breakpoint_enabled
|
| 647 |
+
if not bp.enabled:
|
| 648 |
+
bp_mark_color = Colors.breakpoint_disabled
|
| 649 |
+
|
| 650 |
+
numbers_width = 7
|
| 651 |
+
if arrow:
|
| 652 |
+
# This is the line with the error
|
| 653 |
+
pad = numbers_width - len(str(lineno)) - len(bp_mark)
|
| 654 |
+
num = '%s%s' % (make_arrow(pad), str(lineno))
|
| 655 |
+
else:
|
| 656 |
+
num = '%*s' % (numbers_width - len(bp_mark), str(lineno))
|
| 657 |
+
|
| 658 |
+
return tpl_line % (bp_mark_color + bp_mark, num, line)
|
| 659 |
+
|
| 660 |
+
def print_list_lines(self, filename, first, last):
|
| 661 |
+
"""The printing (as opposed to the parsing part of a 'list'
|
| 662 |
+
command."""
|
| 663 |
+
try:
|
| 664 |
+
Colors = self.color_scheme_table.active_colors
|
| 665 |
+
ColorsNormal = Colors.Normal
|
| 666 |
+
tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal)
|
| 667 |
+
tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line, ColorsNormal)
|
| 668 |
+
src = []
|
| 669 |
+
if filename == "<string>" and hasattr(self, "_exec_filename"):
|
| 670 |
+
filename = self._exec_filename
|
| 671 |
+
|
| 672 |
+
for lineno in range(first, last+1):
|
| 673 |
+
line = linecache.getline(filename, lineno)
|
| 674 |
+
if not line:
|
| 675 |
+
break
|
| 676 |
+
|
| 677 |
+
if lineno == self.curframe.f_lineno:
|
| 678 |
+
line = self.__format_line(
|
| 679 |
+
tpl_line_em, filename, lineno, line, arrow=True
|
| 680 |
+
)
|
| 681 |
+
else:
|
| 682 |
+
line = self.__format_line(
|
| 683 |
+
tpl_line, filename, lineno, line, arrow=False
|
| 684 |
+
)
|
| 685 |
+
|
| 686 |
+
src.append(line)
|
| 687 |
+
self.lineno = lineno
|
| 688 |
+
|
| 689 |
+
print(''.join(src), file=self.stdout)
|
| 690 |
+
|
| 691 |
+
except KeyboardInterrupt:
|
| 692 |
+
pass
|
| 693 |
+
|
| 694 |
+
def do_skip_predicates(self, args):
|
| 695 |
+
"""
|
| 696 |
+
Turn on/off individual predicates as to whether a frame should be hidden/skip.
|
| 697 |
+
|
| 698 |
+
The global option to skip (or not) hidden frames is set with skip_hidden
|
| 699 |
+
|
| 700 |
+
To change the value of a predicate
|
| 701 |
+
|
| 702 |
+
skip_predicates key [true|false]
|
| 703 |
+
|
| 704 |
+
Call without arguments to see the current values.
|
| 705 |
+
|
| 706 |
+
To permanently change the value of an option add the corresponding
|
| 707 |
+
command to your ``~/.pdbrc`` file. If you are programmatically using the
|
| 708 |
+
Pdb instance you can also change the ``default_predicates`` class
|
| 709 |
+
attribute.
|
| 710 |
+
"""
|
| 711 |
+
if not args.strip():
|
| 712 |
+
print("current predicates:")
|
| 713 |
+
for p, v in self._predicates.items():
|
| 714 |
+
print(" ", p, ":", v)
|
| 715 |
+
return
|
| 716 |
+
type_value = args.strip().split(" ")
|
| 717 |
+
if len(type_value) != 2:
|
| 718 |
+
print(
|
| 719 |
+
f"Usage: skip_predicates <type> <value>, with <type> one of {set(self._predicates.keys())}"
|
| 720 |
+
)
|
| 721 |
+
return
|
| 722 |
+
|
| 723 |
+
type_, value = type_value
|
| 724 |
+
if type_ not in self._predicates:
|
| 725 |
+
print(f"{type_!r} not in {set(self._predicates.keys())}")
|
| 726 |
+
return
|
| 727 |
+
if value.lower() not in ("true", "yes", "1", "no", "false", "0"):
|
| 728 |
+
print(
|
| 729 |
+
f"{value!r} is invalid - use one of ('true', 'yes', '1', 'no', 'false', '0')"
|
| 730 |
+
)
|
| 731 |
+
return
|
| 732 |
+
|
| 733 |
+
self._predicates[type_] = value.lower() in ("true", "yes", "1")
|
| 734 |
+
if not any(self._predicates.values()):
|
| 735 |
+
print(
|
| 736 |
+
"Warning, all predicates set to False, skip_hidden may not have any effects."
|
| 737 |
+
)
|
| 738 |
+
|
| 739 |
+
def do_skip_hidden(self, arg):
|
| 740 |
+
"""
|
| 741 |
+
Change whether or not we should skip frames with the
|
| 742 |
+
__tracebackhide__ attribute.
|
| 743 |
+
"""
|
| 744 |
+
if not arg.strip():
|
| 745 |
+
print(
|
| 746 |
+
f"skip_hidden = {self.skip_hidden}, use 'yes','no', 'true', or 'false' to change."
|
| 747 |
+
)
|
| 748 |
+
elif arg.strip().lower() in ("true", "yes"):
|
| 749 |
+
self.skip_hidden = True
|
| 750 |
+
elif arg.strip().lower() in ("false", "no"):
|
| 751 |
+
self.skip_hidden = False
|
| 752 |
+
if not any(self._predicates.values()):
|
| 753 |
+
print(
|
| 754 |
+
"Warning, all predicates set to False, skip_hidden may not have any effects."
|
| 755 |
+
)
|
| 756 |
+
|
| 757 |
+
def do_list(self, arg):
|
| 758 |
+
"""Print lines of code from the current stack frame
|
| 759 |
+
"""
|
| 760 |
+
self.lastcmd = 'list'
|
| 761 |
+
last = None
|
| 762 |
+
if arg and arg != ".":
|
| 763 |
+
try:
|
| 764 |
+
x = eval(arg, {}, {})
|
| 765 |
+
if type(x) == type(()):
|
| 766 |
+
first, last = x
|
| 767 |
+
first = int(first)
|
| 768 |
+
last = int(last)
|
| 769 |
+
if last < first:
|
| 770 |
+
# Assume it's a count
|
| 771 |
+
last = first + last
|
| 772 |
+
else:
|
| 773 |
+
first = max(1, int(x) - 5)
|
| 774 |
+
except:
|
| 775 |
+
print('*** Error in argument:', repr(arg), file=self.stdout)
|
| 776 |
+
return
|
| 777 |
+
elif self.lineno is None or arg == ".":
|
| 778 |
+
first = max(1, self.curframe.f_lineno - 5)
|
| 779 |
+
else:
|
| 780 |
+
first = self.lineno + 1
|
| 781 |
+
if last is None:
|
| 782 |
+
last = first + 10
|
| 783 |
+
self.print_list_lines(self.curframe.f_code.co_filename, first, last)
|
| 784 |
+
|
| 785 |
+
# vds: >>
|
| 786 |
+
lineno = first
|
| 787 |
+
filename = self.curframe.f_code.co_filename
|
| 788 |
+
self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
|
| 789 |
+
# vds: <<
|
| 790 |
+
|
| 791 |
+
do_l = do_list
|
| 792 |
+
|
| 793 |
+
def getsourcelines(self, obj):
|
| 794 |
+
lines, lineno = inspect.findsource(obj)
|
| 795 |
+
if inspect.isframe(obj) and obj.f_globals is self._get_frame_locals(obj):
|
| 796 |
+
# must be a module frame: do not try to cut a block out of it
|
| 797 |
+
return lines, 1
|
| 798 |
+
elif inspect.ismodule(obj):
|
| 799 |
+
return lines, 1
|
| 800 |
+
return inspect.getblock(lines[lineno:]), lineno+1
|
| 801 |
+
|
| 802 |
+
def do_longlist(self, arg):
|
| 803 |
+
"""Print lines of code from the current stack frame.
|
| 804 |
+
|
| 805 |
+
Shows more lines than 'list' does.
|
| 806 |
+
"""
|
| 807 |
+
self.lastcmd = 'longlist'
|
| 808 |
+
try:
|
| 809 |
+
lines, lineno = self.getsourcelines(self.curframe)
|
| 810 |
+
except OSError as err:
|
| 811 |
+
self.error(err)
|
| 812 |
+
return
|
| 813 |
+
last = lineno + len(lines)
|
| 814 |
+
self.print_list_lines(self.curframe.f_code.co_filename, lineno, last)
|
| 815 |
+
do_ll = do_longlist
|
| 816 |
+
|
| 817 |
+
def do_debug(self, arg):
|
| 818 |
+
"""debug code
|
| 819 |
+
Enter a recursive debugger that steps through the code
|
| 820 |
+
argument (which is an arbitrary expression or statement to be
|
| 821 |
+
executed in the current environment).
|
| 822 |
+
"""
|
| 823 |
+
trace_function = sys.gettrace()
|
| 824 |
+
sys.settrace(None)
|
| 825 |
+
globals = self.curframe.f_globals
|
| 826 |
+
locals = self.curframe_locals
|
| 827 |
+
p = self.__class__(completekey=self.completekey,
|
| 828 |
+
stdin=self.stdin, stdout=self.stdout)
|
| 829 |
+
p.use_rawinput = self.use_rawinput
|
| 830 |
+
p.prompt = "(%s) " % self.prompt.strip()
|
| 831 |
+
self.message("ENTERING RECURSIVE DEBUGGER")
|
| 832 |
+
sys.call_tracing(p.run, (arg, globals, locals))
|
| 833 |
+
self.message("LEAVING RECURSIVE DEBUGGER")
|
| 834 |
+
sys.settrace(trace_function)
|
| 835 |
+
self.lastcmd = p.lastcmd
|
| 836 |
+
|
| 837 |
+
def do_pdef(self, arg):
|
| 838 |
+
"""Print the call signature for any callable object.
|
| 839 |
+
|
| 840 |
+
The debugger interface to %pdef"""
|
| 841 |
+
namespaces = [
|
| 842 |
+
("Locals", self.curframe_locals),
|
| 843 |
+
("Globals", self.curframe.f_globals),
|
| 844 |
+
]
|
| 845 |
+
self.shell.find_line_magic("pdef")(arg, namespaces=namespaces)
|
| 846 |
+
|
| 847 |
+
def do_pdoc(self, arg):
|
| 848 |
+
"""Print the docstring for an object.
|
| 849 |
+
|
| 850 |
+
The debugger interface to %pdoc."""
|
| 851 |
+
namespaces = [
|
| 852 |
+
("Locals", self.curframe_locals),
|
| 853 |
+
("Globals", self.curframe.f_globals),
|
| 854 |
+
]
|
| 855 |
+
self.shell.find_line_magic("pdoc")(arg, namespaces=namespaces)
|
| 856 |
+
|
| 857 |
+
def do_pfile(self, arg):
|
| 858 |
+
"""Print (or run through pager) the file where an object is defined.
|
| 859 |
+
|
| 860 |
+
The debugger interface to %pfile.
|
| 861 |
+
"""
|
| 862 |
+
namespaces = [
|
| 863 |
+
("Locals", self.curframe_locals),
|
| 864 |
+
("Globals", self.curframe.f_globals),
|
| 865 |
+
]
|
| 866 |
+
self.shell.find_line_magic("pfile")(arg, namespaces=namespaces)
|
| 867 |
+
|
| 868 |
+
def do_pinfo(self, arg):
|
| 869 |
+
"""Provide detailed information about an object.
|
| 870 |
+
|
| 871 |
+
The debugger interface to %pinfo, i.e., obj?."""
|
| 872 |
+
namespaces = [
|
| 873 |
+
("Locals", self.curframe_locals),
|
| 874 |
+
("Globals", self.curframe.f_globals),
|
| 875 |
+
]
|
| 876 |
+
self.shell.find_line_magic("pinfo")(arg, namespaces=namespaces)
|
| 877 |
+
|
| 878 |
+
def do_pinfo2(self, arg):
|
| 879 |
+
"""Provide extra detailed information about an object.
|
| 880 |
+
|
| 881 |
+
The debugger interface to %pinfo2, i.e., obj??."""
|
| 882 |
+
namespaces = [
|
| 883 |
+
("Locals", self.curframe_locals),
|
| 884 |
+
("Globals", self.curframe.f_globals),
|
| 885 |
+
]
|
| 886 |
+
self.shell.find_line_magic("pinfo2")(arg, namespaces=namespaces)
|
| 887 |
+
|
| 888 |
+
def do_psource(self, arg):
|
| 889 |
+
"""Print (or run through pager) the source code for an object."""
|
| 890 |
+
namespaces = [
|
| 891 |
+
("Locals", self.curframe_locals),
|
| 892 |
+
("Globals", self.curframe.f_globals),
|
| 893 |
+
]
|
| 894 |
+
self.shell.find_line_magic("psource")(arg, namespaces=namespaces)
|
| 895 |
+
|
| 896 |
+
def do_where(self, arg):
|
| 897 |
+
"""w(here)
|
| 898 |
+
Print a stack trace, with the most recent frame at the bottom.
|
| 899 |
+
An arrow indicates the "current frame", which determines the
|
| 900 |
+
context of most commands. 'bt' is an alias for this command.
|
| 901 |
+
|
| 902 |
+
Take a number as argument as an (optional) number of context line to
|
| 903 |
+
print"""
|
| 904 |
+
if arg:
|
| 905 |
+
try:
|
| 906 |
+
context = int(arg)
|
| 907 |
+
except ValueError as err:
|
| 908 |
+
self.error(err)
|
| 909 |
+
return
|
| 910 |
+
self.print_stack_trace(context)
|
| 911 |
+
else:
|
| 912 |
+
self.print_stack_trace()
|
| 913 |
+
|
| 914 |
+
do_w = do_where
|
| 915 |
+
|
| 916 |
+
def break_anywhere(self, frame):
|
| 917 |
+
"""
|
| 918 |
+
_stop_in_decorator_internals is overly restrictive, as we may still want
|
| 919 |
+
to trace function calls, so we need to also update break_anywhere so
|
| 920 |
+
that is we don't `stop_here`, because of debugger skip, we may still
|
| 921 |
+
stop at any point inside the function
|
| 922 |
+
|
| 923 |
+
"""
|
| 924 |
+
|
| 925 |
+
sup = super().break_anywhere(frame)
|
| 926 |
+
if sup:
|
| 927 |
+
return sup
|
| 928 |
+
if self._predicates["debuggerskip"]:
|
| 929 |
+
if DEBUGGERSKIP in frame.f_code.co_varnames:
|
| 930 |
+
return True
|
| 931 |
+
if frame.f_back and self._get_frame_locals(frame.f_back).get(DEBUGGERSKIP):
|
| 932 |
+
return True
|
| 933 |
+
return False
|
| 934 |
+
|
| 935 |
+
def _is_in_decorator_internal_and_should_skip(self, frame):
|
| 936 |
+
"""
|
| 937 |
+
Utility to tell us whether we are in a decorator internal and should stop.
|
| 938 |
+
|
| 939 |
+
"""
|
| 940 |
+
# if we are disabled don't skip
|
| 941 |
+
if not self._predicates["debuggerskip"]:
|
| 942 |
+
return False
|
| 943 |
+
|
| 944 |
+
return self._cachable_skip(frame)
|
| 945 |
+
|
| 946 |
+
@lru_cache(1024)
|
| 947 |
+
def _cached_one_parent_frame_debuggerskip(self, frame):
|
| 948 |
+
"""
|
| 949 |
+
Cache looking up for DEBUGGERSKIP on parent frame.
|
| 950 |
+
|
| 951 |
+
This should speedup walking through deep frame when one of the highest
|
| 952 |
+
one does have a debugger skip.
|
| 953 |
+
|
| 954 |
+
This is likely to introduce fake positive though.
|
| 955 |
+
"""
|
| 956 |
+
while getattr(frame, "f_back", None):
|
| 957 |
+
frame = frame.f_back
|
| 958 |
+
if self._get_frame_locals(frame).get(DEBUGGERSKIP):
|
| 959 |
+
return True
|
| 960 |
+
return None
|
| 961 |
+
|
| 962 |
+
@lru_cache(1024)
|
| 963 |
+
def _cachable_skip(self, frame):
|
| 964 |
+
# if frame is tagged, skip by default.
|
| 965 |
+
if DEBUGGERSKIP in frame.f_code.co_varnames:
|
| 966 |
+
return True
|
| 967 |
+
|
| 968 |
+
# if one of the parent frame value set to True skip as well.
|
| 969 |
+
if self._cached_one_parent_frame_debuggerskip(frame):
|
| 970 |
+
return True
|
| 971 |
+
|
| 972 |
+
return False
|
| 973 |
+
|
| 974 |
+
def stop_here(self, frame):
|
| 975 |
+
if self._is_in_decorator_internal_and_should_skip(frame) is True:
|
| 976 |
+
return False
|
| 977 |
+
|
| 978 |
+
hidden = False
|
| 979 |
+
if self.skip_hidden:
|
| 980 |
+
hidden = self._hidden_predicate(frame)
|
| 981 |
+
if hidden:
|
| 982 |
+
if self.report_skipped:
|
| 983 |
+
Colors = self.color_scheme_table.active_colors
|
| 984 |
+
ColorsNormal = Colors.Normal
|
| 985 |
+
print(
|
| 986 |
+
f"{Colors.excName} [... skipped 1 hidden frame]{ColorsNormal}\n"
|
| 987 |
+
)
|
| 988 |
+
return super().stop_here(frame)
|
| 989 |
+
|
| 990 |
+
def do_up(self, arg):
|
| 991 |
+
"""u(p) [count]
|
| 992 |
+
Move the current frame count (default one) levels up in the
|
| 993 |
+
stack trace (to an older frame).
|
| 994 |
+
|
| 995 |
+
Will skip hidden frames.
|
| 996 |
+
"""
|
| 997 |
+
# modified version of upstream that skips
|
| 998 |
+
# frames with __tracebackhide__
|
| 999 |
+
if self.curindex == 0:
|
| 1000 |
+
self.error("Oldest frame")
|
| 1001 |
+
return
|
| 1002 |
+
try:
|
| 1003 |
+
count = int(arg or 1)
|
| 1004 |
+
except ValueError:
|
| 1005 |
+
self.error("Invalid frame count (%s)" % arg)
|
| 1006 |
+
return
|
| 1007 |
+
skipped = 0
|
| 1008 |
+
if count < 0:
|
| 1009 |
+
_newframe = 0
|
| 1010 |
+
else:
|
| 1011 |
+
counter = 0
|
| 1012 |
+
hidden_frames = self.hidden_frames(self.stack)
|
| 1013 |
+
for i in range(self.curindex - 1, -1, -1):
|
| 1014 |
+
if hidden_frames[i] and self.skip_hidden:
|
| 1015 |
+
skipped += 1
|
| 1016 |
+
continue
|
| 1017 |
+
counter += 1
|
| 1018 |
+
if counter >= count:
|
| 1019 |
+
break
|
| 1020 |
+
else:
|
| 1021 |
+
# if no break occurred.
|
| 1022 |
+
self.error(
|
| 1023 |
+
"all frames above hidden, use `skip_hidden False` to get get into those."
|
| 1024 |
+
)
|
| 1025 |
+
return
|
| 1026 |
+
|
| 1027 |
+
Colors = self.color_scheme_table.active_colors
|
| 1028 |
+
ColorsNormal = Colors.Normal
|
| 1029 |
+
_newframe = i
|
| 1030 |
+
self._select_frame(_newframe)
|
| 1031 |
+
if skipped:
|
| 1032 |
+
print(
|
| 1033 |
+
f"{Colors.excName} [... skipped {skipped} hidden frame(s)]{ColorsNormal}\n"
|
| 1034 |
+
)
|
| 1035 |
+
|
| 1036 |
+
def do_down(self, arg):
|
| 1037 |
+
"""d(own) [count]
|
| 1038 |
+
Move the current frame count (default one) levels down in the
|
| 1039 |
+
stack trace (to a newer frame).
|
| 1040 |
+
|
| 1041 |
+
Will skip hidden frames.
|
| 1042 |
+
"""
|
| 1043 |
+
if self.curindex + 1 == len(self.stack):
|
| 1044 |
+
self.error("Newest frame")
|
| 1045 |
+
return
|
| 1046 |
+
try:
|
| 1047 |
+
count = int(arg or 1)
|
| 1048 |
+
except ValueError:
|
| 1049 |
+
self.error("Invalid frame count (%s)" % arg)
|
| 1050 |
+
return
|
| 1051 |
+
if count < 0:
|
| 1052 |
+
_newframe = len(self.stack) - 1
|
| 1053 |
+
else:
|
| 1054 |
+
counter = 0
|
| 1055 |
+
skipped = 0
|
| 1056 |
+
hidden_frames = self.hidden_frames(self.stack)
|
| 1057 |
+
for i in range(self.curindex + 1, len(self.stack)):
|
| 1058 |
+
if hidden_frames[i] and self.skip_hidden:
|
| 1059 |
+
skipped += 1
|
| 1060 |
+
continue
|
| 1061 |
+
counter += 1
|
| 1062 |
+
if counter >= count:
|
| 1063 |
+
break
|
| 1064 |
+
else:
|
| 1065 |
+
self.error(
|
| 1066 |
+
"all frames below hidden, use `skip_hidden False` to get get into those."
|
| 1067 |
+
)
|
| 1068 |
+
return
|
| 1069 |
+
|
| 1070 |
+
Colors = self.color_scheme_table.active_colors
|
| 1071 |
+
ColorsNormal = Colors.Normal
|
| 1072 |
+
if skipped:
|
| 1073 |
+
print(
|
| 1074 |
+
f"{Colors.excName} [... skipped {skipped} hidden frame(s)]{ColorsNormal}\n"
|
| 1075 |
+
)
|
| 1076 |
+
_newframe = i
|
| 1077 |
+
|
| 1078 |
+
self._select_frame(_newframe)
|
| 1079 |
+
|
| 1080 |
+
do_d = do_down
|
| 1081 |
+
do_u = do_up
|
| 1082 |
+
|
| 1083 |
+
def do_context(self, context):
|
| 1084 |
+
"""context number_of_lines
|
| 1085 |
+
Set the number of lines of source code to show when displaying
|
| 1086 |
+
stacktrace information.
|
| 1087 |
+
"""
|
| 1088 |
+
try:
|
| 1089 |
+
new_context = int(context)
|
| 1090 |
+
if new_context <= 0:
|
| 1091 |
+
raise ValueError()
|
| 1092 |
+
self.context = new_context
|
| 1093 |
+
except ValueError:
|
| 1094 |
+
self.error(
|
| 1095 |
+
f"The 'context' command requires a positive integer argument (current value {self.context})."
|
| 1096 |
+
)
|
| 1097 |
+
|
| 1098 |
+
|
| 1099 |
+
class InterruptiblePdb(Pdb):
|
| 1100 |
+
"""Version of debugger where KeyboardInterrupt exits the debugger altogether."""
|
| 1101 |
+
|
| 1102 |
+
def cmdloop(self, intro=None):
|
| 1103 |
+
"""Wrap cmdloop() such that KeyboardInterrupt stops the debugger."""
|
| 1104 |
+
try:
|
| 1105 |
+
return OldPdb.cmdloop(self, intro=intro)
|
| 1106 |
+
except KeyboardInterrupt:
|
| 1107 |
+
self.stop_here = lambda frame: False
|
| 1108 |
+
self.do_quit("")
|
| 1109 |
+
sys.settrace(None)
|
| 1110 |
+
self.quitting = False
|
| 1111 |
+
raise
|
| 1112 |
+
|
| 1113 |
+
def _cmdloop(self):
|
| 1114 |
+
while True:
|
| 1115 |
+
try:
|
| 1116 |
+
# keyboard interrupts allow for an easy way to cancel
|
| 1117 |
+
# the current command, so allow them during interactive input
|
| 1118 |
+
self.allow_kbdint = True
|
| 1119 |
+
self.cmdloop()
|
| 1120 |
+
self.allow_kbdint = False
|
| 1121 |
+
break
|
| 1122 |
+
except KeyboardInterrupt:
|
| 1123 |
+
self.message('--KeyboardInterrupt--')
|
| 1124 |
+
raise
|
| 1125 |
+
|
| 1126 |
+
|
| 1127 |
+
def set_trace(frame=None, header=None):
|
| 1128 |
+
"""
|
| 1129 |
+
Start debugging from `frame`.
|
| 1130 |
+
|
| 1131 |
+
If frame is not specified, debugging starts from caller's frame.
|
| 1132 |
+
"""
|
| 1133 |
+
pdb = Pdb()
|
| 1134 |
+
if header is not None:
|
| 1135 |
+
pdb.message(header)
|
| 1136 |
+
pdb.set_trace(frame or sys._getframe().f_back)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/display.py
ADDED
|
@@ -0,0 +1,1373 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Top-level display functions for displaying object in different formats."""
|
| 3 |
+
|
| 4 |
+
# Copyright (c) IPython Development Team.
|
| 5 |
+
# Distributed under the terms of the Modified BSD License.
|
| 6 |
+
|
| 7 |
+
|
| 8 |
+
from binascii import b2a_base64, hexlify
|
| 9 |
+
import html
|
| 10 |
+
import json
|
| 11 |
+
import mimetypes
|
| 12 |
+
import os
|
| 13 |
+
import struct
|
| 14 |
+
import warnings
|
| 15 |
+
from copy import deepcopy
|
| 16 |
+
from os.path import splitext
|
| 17 |
+
from pathlib import Path, PurePath
|
| 18 |
+
|
| 19 |
+
from typing import Optional
|
| 20 |
+
|
| 21 |
+
from IPython.testing.skipdoctest import skip_doctest
|
| 22 |
+
from . import display_functions
|
| 23 |
+
|
| 24 |
+
|
| 25 |
+
__all__ = [
|
| 26 |
+
"display_pretty",
|
| 27 |
+
"display_html",
|
| 28 |
+
"display_markdown",
|
| 29 |
+
"display_svg",
|
| 30 |
+
"display_png",
|
| 31 |
+
"display_jpeg",
|
| 32 |
+
"display_webp",
|
| 33 |
+
"display_latex",
|
| 34 |
+
"display_json",
|
| 35 |
+
"display_javascript",
|
| 36 |
+
"display_pdf",
|
| 37 |
+
"DisplayObject",
|
| 38 |
+
"TextDisplayObject",
|
| 39 |
+
"Pretty",
|
| 40 |
+
"HTML",
|
| 41 |
+
"Markdown",
|
| 42 |
+
"Math",
|
| 43 |
+
"Latex",
|
| 44 |
+
"SVG",
|
| 45 |
+
"ProgressBar",
|
| 46 |
+
"JSON",
|
| 47 |
+
"GeoJSON",
|
| 48 |
+
"Javascript",
|
| 49 |
+
"Image",
|
| 50 |
+
"set_matplotlib_formats",
|
| 51 |
+
"set_matplotlib_close",
|
| 52 |
+
"Video",
|
| 53 |
+
]
|
| 54 |
+
|
| 55 |
+
_deprecated_names = ["display", "clear_output", "publish_display_data", "update_display", "DisplayHandle"]
|
| 56 |
+
|
| 57 |
+
__all__ = __all__ + _deprecated_names
|
| 58 |
+
|
| 59 |
+
|
| 60 |
+
# ----- warn to import from IPython.display -----
|
| 61 |
+
|
| 62 |
+
from warnings import warn
|
| 63 |
+
|
| 64 |
+
|
| 65 |
+
def __getattr__(name):
|
| 66 |
+
if name in _deprecated_names:
|
| 67 |
+
warn(
|
| 68 |
+
f"Importing {name} from IPython.core.display is deprecated since IPython 7.14, please import from IPython.display",
|
| 69 |
+
DeprecationWarning,
|
| 70 |
+
stacklevel=2,
|
| 71 |
+
)
|
| 72 |
+
return getattr(display_functions, name)
|
| 73 |
+
|
| 74 |
+
if name in globals().keys():
|
| 75 |
+
return globals()[name]
|
| 76 |
+
else:
|
| 77 |
+
raise AttributeError(f"module {__name__} has no attribute {name}")
|
| 78 |
+
|
| 79 |
+
|
| 80 |
+
#-----------------------------------------------------------------------------
|
| 81 |
+
# utility functions
|
| 82 |
+
#-----------------------------------------------------------------------------
|
| 83 |
+
|
| 84 |
+
def _safe_exists(path):
|
| 85 |
+
"""Check path, but don't let exceptions raise"""
|
| 86 |
+
try:
|
| 87 |
+
return os.path.exists(path)
|
| 88 |
+
except Exception:
|
| 89 |
+
return False
|
| 90 |
+
|
| 91 |
+
|
| 92 |
+
def _display_mimetype(mimetype, objs, raw=False, metadata=None):
|
| 93 |
+
"""internal implementation of all display_foo methods
|
| 94 |
+
|
| 95 |
+
Parameters
|
| 96 |
+
----------
|
| 97 |
+
mimetype : str
|
| 98 |
+
The mimetype to be published (e.g. 'image/png')
|
| 99 |
+
*objs : object
|
| 100 |
+
The Python objects to display, or if raw=True raw text data to
|
| 101 |
+
display.
|
| 102 |
+
raw : bool
|
| 103 |
+
Are the data objects raw data or Python objects that need to be
|
| 104 |
+
formatted before display? [default: False]
|
| 105 |
+
metadata : dict (optional)
|
| 106 |
+
Metadata to be associated with the specific mimetype output.
|
| 107 |
+
"""
|
| 108 |
+
if metadata:
|
| 109 |
+
metadata = {mimetype: metadata}
|
| 110 |
+
if raw:
|
| 111 |
+
# turn list of pngdata into list of { 'image/png': pngdata }
|
| 112 |
+
objs = [ {mimetype: obj} for obj in objs ]
|
| 113 |
+
display_functions.display(*objs, raw=raw, metadata=metadata, include=[mimetype])
|
| 114 |
+
|
| 115 |
+
#-----------------------------------------------------------------------------
|
| 116 |
+
# Main functions
|
| 117 |
+
#-----------------------------------------------------------------------------
|
| 118 |
+
|
| 119 |
+
|
| 120 |
+
def display_pretty(*objs, **kwargs):
|
| 121 |
+
"""Display the pretty (default) representation of an object.
|
| 122 |
+
|
| 123 |
+
Parameters
|
| 124 |
+
----------
|
| 125 |
+
*objs : object
|
| 126 |
+
The Python objects to display, or if raw=True raw text data to
|
| 127 |
+
display.
|
| 128 |
+
raw : bool
|
| 129 |
+
Are the data objects raw data or Python objects that need to be
|
| 130 |
+
formatted before display? [default: False]
|
| 131 |
+
metadata : dict (optional)
|
| 132 |
+
Metadata to be associated with the specific mimetype output.
|
| 133 |
+
"""
|
| 134 |
+
_display_mimetype('text/plain', objs, **kwargs)
|
| 135 |
+
|
| 136 |
+
|
| 137 |
+
def display_html(*objs, **kwargs):
|
| 138 |
+
"""Display the HTML representation of an object.
|
| 139 |
+
|
| 140 |
+
Note: If raw=False and the object does not have a HTML
|
| 141 |
+
representation, no HTML will be shown.
|
| 142 |
+
|
| 143 |
+
Parameters
|
| 144 |
+
----------
|
| 145 |
+
*objs : object
|
| 146 |
+
The Python objects to display, or if raw=True raw HTML data to
|
| 147 |
+
display.
|
| 148 |
+
raw : bool
|
| 149 |
+
Are the data objects raw data or Python objects that need to be
|
| 150 |
+
formatted before display? [default: False]
|
| 151 |
+
metadata : dict (optional)
|
| 152 |
+
Metadata to be associated with the specific mimetype output.
|
| 153 |
+
"""
|
| 154 |
+
_display_mimetype('text/html', objs, **kwargs)
|
| 155 |
+
|
| 156 |
+
|
| 157 |
+
def display_markdown(*objs, **kwargs):
|
| 158 |
+
"""Displays the Markdown representation of an object.
|
| 159 |
+
|
| 160 |
+
Parameters
|
| 161 |
+
----------
|
| 162 |
+
*objs : object
|
| 163 |
+
The Python objects to display, or if raw=True raw markdown data to
|
| 164 |
+
display.
|
| 165 |
+
raw : bool
|
| 166 |
+
Are the data objects raw data or Python objects that need to be
|
| 167 |
+
formatted before display? [default: False]
|
| 168 |
+
metadata : dict (optional)
|
| 169 |
+
Metadata to be associated with the specific mimetype output.
|
| 170 |
+
"""
|
| 171 |
+
|
| 172 |
+
_display_mimetype('text/markdown', objs, **kwargs)
|
| 173 |
+
|
| 174 |
+
|
| 175 |
+
def display_svg(*objs, **kwargs):
|
| 176 |
+
"""Display the SVG representation of an object.
|
| 177 |
+
|
| 178 |
+
Parameters
|
| 179 |
+
----------
|
| 180 |
+
*objs : object
|
| 181 |
+
The Python objects to display, or if raw=True raw svg data to
|
| 182 |
+
display.
|
| 183 |
+
raw : bool
|
| 184 |
+
Are the data objects raw data or Python objects that need to be
|
| 185 |
+
formatted before display? [default: False]
|
| 186 |
+
metadata : dict (optional)
|
| 187 |
+
Metadata to be associated with the specific mimetype output.
|
| 188 |
+
"""
|
| 189 |
+
_display_mimetype('image/svg+xml', objs, **kwargs)
|
| 190 |
+
|
| 191 |
+
|
| 192 |
+
def display_png(*objs, **kwargs):
|
| 193 |
+
"""Display the PNG representation of an object.
|
| 194 |
+
|
| 195 |
+
Parameters
|
| 196 |
+
----------
|
| 197 |
+
*objs : object
|
| 198 |
+
The Python objects to display, or if raw=True raw png data to
|
| 199 |
+
display.
|
| 200 |
+
raw : bool
|
| 201 |
+
Are the data objects raw data or Python objects that need to be
|
| 202 |
+
formatted before display? [default: False]
|
| 203 |
+
metadata : dict (optional)
|
| 204 |
+
Metadata to be associated with the specific mimetype output.
|
| 205 |
+
"""
|
| 206 |
+
_display_mimetype('image/png', objs, **kwargs)
|
| 207 |
+
|
| 208 |
+
|
| 209 |
+
def display_jpeg(*objs, **kwargs):
|
| 210 |
+
"""Display the JPEG representation of an object.
|
| 211 |
+
|
| 212 |
+
Parameters
|
| 213 |
+
----------
|
| 214 |
+
*objs : object
|
| 215 |
+
The Python objects to display, or if raw=True raw JPEG data to
|
| 216 |
+
display.
|
| 217 |
+
raw : bool
|
| 218 |
+
Are the data objects raw data or Python objects that need to be
|
| 219 |
+
formatted before display? [default: False]
|
| 220 |
+
metadata : dict (optional)
|
| 221 |
+
Metadata to be associated with the specific mimetype output.
|
| 222 |
+
"""
|
| 223 |
+
_display_mimetype('image/jpeg', objs, **kwargs)
|
| 224 |
+
|
| 225 |
+
|
| 226 |
+
def display_webp(*objs, **kwargs):
|
| 227 |
+
"""Display the WEBP representation of an object.
|
| 228 |
+
|
| 229 |
+
Parameters
|
| 230 |
+
----------
|
| 231 |
+
*objs : object
|
| 232 |
+
The Python objects to display, or if raw=True raw JPEG data to
|
| 233 |
+
display.
|
| 234 |
+
raw : bool
|
| 235 |
+
Are the data objects raw data or Python objects that need to be
|
| 236 |
+
formatted before display? [default: False]
|
| 237 |
+
metadata : dict (optional)
|
| 238 |
+
Metadata to be associated with the specific mimetype output.
|
| 239 |
+
"""
|
| 240 |
+
_display_mimetype("image/webp", objs, **kwargs)
|
| 241 |
+
|
| 242 |
+
|
| 243 |
+
def display_latex(*objs, **kwargs):
|
| 244 |
+
"""Display the LaTeX representation of an object.
|
| 245 |
+
|
| 246 |
+
Parameters
|
| 247 |
+
----------
|
| 248 |
+
*objs : object
|
| 249 |
+
The Python objects to display, or if raw=True raw latex data to
|
| 250 |
+
display.
|
| 251 |
+
raw : bool
|
| 252 |
+
Are the data objects raw data or Python objects that need to be
|
| 253 |
+
formatted before display? [default: False]
|
| 254 |
+
metadata : dict (optional)
|
| 255 |
+
Metadata to be associated with the specific mimetype output.
|
| 256 |
+
"""
|
| 257 |
+
_display_mimetype('text/latex', objs, **kwargs)
|
| 258 |
+
|
| 259 |
+
|
| 260 |
+
def display_json(*objs, **kwargs):
|
| 261 |
+
"""Display the JSON representation of an object.
|
| 262 |
+
|
| 263 |
+
Note that not many frontends support displaying JSON.
|
| 264 |
+
|
| 265 |
+
Parameters
|
| 266 |
+
----------
|
| 267 |
+
*objs : object
|
| 268 |
+
The Python objects to display, or if raw=True raw json data to
|
| 269 |
+
display.
|
| 270 |
+
raw : bool
|
| 271 |
+
Are the data objects raw data or Python objects that need to be
|
| 272 |
+
formatted before display? [default: False]
|
| 273 |
+
metadata : dict (optional)
|
| 274 |
+
Metadata to be associated with the specific mimetype output.
|
| 275 |
+
"""
|
| 276 |
+
_display_mimetype('application/json', objs, **kwargs)
|
| 277 |
+
|
| 278 |
+
|
| 279 |
+
def display_javascript(*objs, **kwargs):
|
| 280 |
+
"""Display the Javascript representation of an object.
|
| 281 |
+
|
| 282 |
+
Parameters
|
| 283 |
+
----------
|
| 284 |
+
*objs : object
|
| 285 |
+
The Python objects to display, or if raw=True raw javascript data to
|
| 286 |
+
display.
|
| 287 |
+
raw : bool
|
| 288 |
+
Are the data objects raw data or Python objects that need to be
|
| 289 |
+
formatted before display? [default: False]
|
| 290 |
+
metadata : dict (optional)
|
| 291 |
+
Metadata to be associated with the specific mimetype output.
|
| 292 |
+
"""
|
| 293 |
+
_display_mimetype('application/javascript', objs, **kwargs)
|
| 294 |
+
|
| 295 |
+
|
| 296 |
+
def display_pdf(*objs, **kwargs):
|
| 297 |
+
"""Display the PDF representation of an object.
|
| 298 |
+
|
| 299 |
+
Parameters
|
| 300 |
+
----------
|
| 301 |
+
*objs : object
|
| 302 |
+
The Python objects to display, or if raw=True raw javascript data to
|
| 303 |
+
display.
|
| 304 |
+
raw : bool
|
| 305 |
+
Are the data objects raw data or Python objects that need to be
|
| 306 |
+
formatted before display? [default: False]
|
| 307 |
+
metadata : dict (optional)
|
| 308 |
+
Metadata to be associated with the specific mimetype output.
|
| 309 |
+
"""
|
| 310 |
+
_display_mimetype('application/pdf', objs, **kwargs)
|
| 311 |
+
|
| 312 |
+
|
| 313 |
+
#-----------------------------------------------------------------------------
|
| 314 |
+
# Smart classes
|
| 315 |
+
#-----------------------------------------------------------------------------
|
| 316 |
+
|
| 317 |
+
|
| 318 |
+
class DisplayObject(object):
|
| 319 |
+
"""An object that wraps data to be displayed."""
|
| 320 |
+
|
| 321 |
+
_read_flags = 'r'
|
| 322 |
+
_show_mem_addr = False
|
| 323 |
+
metadata = None
|
| 324 |
+
|
| 325 |
+
def __init__(self, data=None, url=None, filename=None, metadata=None):
|
| 326 |
+
"""Create a display object given raw data.
|
| 327 |
+
|
| 328 |
+
When this object is returned by an expression or passed to the
|
| 329 |
+
display function, it will result in the data being displayed
|
| 330 |
+
in the frontend. The MIME type of the data should match the
|
| 331 |
+
subclasses used, so the Png subclass should be used for 'image/png'
|
| 332 |
+
data. If the data is a URL, the data will first be downloaded
|
| 333 |
+
and then displayed.
|
| 334 |
+
|
| 335 |
+
Parameters
|
| 336 |
+
----------
|
| 337 |
+
data : unicode, str or bytes
|
| 338 |
+
The raw data or a URL or file to load the data from
|
| 339 |
+
url : unicode
|
| 340 |
+
A URL to download the data from.
|
| 341 |
+
filename : unicode
|
| 342 |
+
Path to a local file to load the data from.
|
| 343 |
+
metadata : dict
|
| 344 |
+
Dict of metadata associated to be the object when displayed
|
| 345 |
+
"""
|
| 346 |
+
if isinstance(data, (Path, PurePath)):
|
| 347 |
+
data = str(data)
|
| 348 |
+
|
| 349 |
+
if data is not None and isinstance(data, str):
|
| 350 |
+
if data.startswith('http') and url is None:
|
| 351 |
+
url = data
|
| 352 |
+
filename = None
|
| 353 |
+
data = None
|
| 354 |
+
elif _safe_exists(data) and filename is None:
|
| 355 |
+
url = None
|
| 356 |
+
filename = data
|
| 357 |
+
data = None
|
| 358 |
+
|
| 359 |
+
self.url = url
|
| 360 |
+
self.filename = filename
|
| 361 |
+
# because of @data.setter methods in
|
| 362 |
+
# subclasses ensure url and filename are set
|
| 363 |
+
# before assigning to self.data
|
| 364 |
+
self.data = data
|
| 365 |
+
|
| 366 |
+
if metadata is not None:
|
| 367 |
+
self.metadata = metadata
|
| 368 |
+
elif self.metadata is None:
|
| 369 |
+
self.metadata = {}
|
| 370 |
+
|
| 371 |
+
self.reload()
|
| 372 |
+
self._check_data()
|
| 373 |
+
|
| 374 |
+
def __repr__(self):
|
| 375 |
+
if not self._show_mem_addr:
|
| 376 |
+
cls = self.__class__
|
| 377 |
+
r = "<%s.%s object>" % (cls.__module__, cls.__name__)
|
| 378 |
+
else:
|
| 379 |
+
r = super(DisplayObject, self).__repr__()
|
| 380 |
+
return r
|
| 381 |
+
|
| 382 |
+
def _check_data(self):
|
| 383 |
+
"""Override in subclasses if there's something to check."""
|
| 384 |
+
pass
|
| 385 |
+
|
| 386 |
+
def _data_and_metadata(self):
|
| 387 |
+
"""shortcut for returning metadata with shape information, if defined"""
|
| 388 |
+
if self.metadata:
|
| 389 |
+
return self.data, deepcopy(self.metadata)
|
| 390 |
+
else:
|
| 391 |
+
return self.data
|
| 392 |
+
|
| 393 |
+
def reload(self):
|
| 394 |
+
"""Reload the raw data from file or URL."""
|
| 395 |
+
if self.filename is not None:
|
| 396 |
+
encoding = None if "b" in self._read_flags else "utf-8"
|
| 397 |
+
with open(self.filename, self._read_flags, encoding=encoding) as f:
|
| 398 |
+
self.data = f.read()
|
| 399 |
+
elif self.url is not None:
|
| 400 |
+
# Deferred import
|
| 401 |
+
from urllib.request import urlopen
|
| 402 |
+
response = urlopen(self.url)
|
| 403 |
+
data = response.read()
|
| 404 |
+
# extract encoding from header, if there is one:
|
| 405 |
+
encoding = None
|
| 406 |
+
if 'content-type' in response.headers:
|
| 407 |
+
for sub in response.headers['content-type'].split(';'):
|
| 408 |
+
sub = sub.strip()
|
| 409 |
+
if sub.startswith('charset'):
|
| 410 |
+
encoding = sub.split('=')[-1].strip()
|
| 411 |
+
break
|
| 412 |
+
if 'content-encoding' in response.headers:
|
| 413 |
+
# TODO: do deflate?
|
| 414 |
+
if 'gzip' in response.headers['content-encoding']:
|
| 415 |
+
import gzip
|
| 416 |
+
from io import BytesIO
|
| 417 |
+
|
| 418 |
+
# assume utf-8 if encoding is not specified
|
| 419 |
+
with gzip.open(
|
| 420 |
+
BytesIO(data), "rt", encoding=encoding or "utf-8"
|
| 421 |
+
) as fp:
|
| 422 |
+
encoding = None
|
| 423 |
+
data = fp.read()
|
| 424 |
+
|
| 425 |
+
# decode data, if an encoding was specified
|
| 426 |
+
# We only touch self.data once since
|
| 427 |
+
# subclasses such as SVG have @data.setter methods
|
| 428 |
+
# that transform self.data into ... well svg.
|
| 429 |
+
if encoding:
|
| 430 |
+
self.data = data.decode(encoding, 'replace')
|
| 431 |
+
else:
|
| 432 |
+
self.data = data
|
| 433 |
+
|
| 434 |
+
|
| 435 |
+
class TextDisplayObject(DisplayObject):
|
| 436 |
+
"""Create a text display object given raw data.
|
| 437 |
+
|
| 438 |
+
Parameters
|
| 439 |
+
----------
|
| 440 |
+
data : str or unicode
|
| 441 |
+
The raw data or a URL or file to load the data from.
|
| 442 |
+
url : unicode
|
| 443 |
+
A URL to download the data from.
|
| 444 |
+
filename : unicode
|
| 445 |
+
Path to a local file to load the data from.
|
| 446 |
+
metadata : dict
|
| 447 |
+
Dict of metadata associated to be the object when displayed
|
| 448 |
+
"""
|
| 449 |
+
def _check_data(self):
|
| 450 |
+
if self.data is not None and not isinstance(self.data, str):
|
| 451 |
+
raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data))
|
| 452 |
+
|
| 453 |
+
class Pretty(TextDisplayObject):
|
| 454 |
+
|
| 455 |
+
def _repr_pretty_(self, pp, cycle):
|
| 456 |
+
return pp.text(self.data)
|
| 457 |
+
|
| 458 |
+
|
| 459 |
+
class HTML(TextDisplayObject):
|
| 460 |
+
|
| 461 |
+
def __init__(self, data=None, url=None, filename=None, metadata=None):
|
| 462 |
+
def warn():
|
| 463 |
+
if not data:
|
| 464 |
+
return False
|
| 465 |
+
|
| 466 |
+
#
|
| 467 |
+
# Avoid calling lower() on the entire data, because it could be a
|
| 468 |
+
# long string and we're only interested in its beginning and end.
|
| 469 |
+
#
|
| 470 |
+
prefix = data[:10].lower()
|
| 471 |
+
suffix = data[-10:].lower()
|
| 472 |
+
return prefix.startswith("<iframe ") and suffix.endswith("</iframe>")
|
| 473 |
+
|
| 474 |
+
if warn():
|
| 475 |
+
warnings.warn("Consider using IPython.display.IFrame instead")
|
| 476 |
+
super(HTML, self).__init__(data=data, url=url, filename=filename, metadata=metadata)
|
| 477 |
+
|
| 478 |
+
def _repr_html_(self):
|
| 479 |
+
return self._data_and_metadata()
|
| 480 |
+
|
| 481 |
+
def __html__(self):
|
| 482 |
+
"""
|
| 483 |
+
This method exists to inform other HTML-using modules (e.g. Markupsafe,
|
| 484 |
+
htmltag, etc) that this object is HTML and does not need things like
|
| 485 |
+
special characters (<>&) escaped.
|
| 486 |
+
"""
|
| 487 |
+
return self._repr_html_()
|
| 488 |
+
|
| 489 |
+
|
| 490 |
+
class Markdown(TextDisplayObject):
|
| 491 |
+
|
| 492 |
+
def _repr_markdown_(self):
|
| 493 |
+
return self._data_and_metadata()
|
| 494 |
+
|
| 495 |
+
|
| 496 |
+
class Math(TextDisplayObject):
|
| 497 |
+
|
| 498 |
+
def _repr_latex_(self):
|
| 499 |
+
s = r"$\displaystyle %s$" % self.data.strip('$')
|
| 500 |
+
if self.metadata:
|
| 501 |
+
return s, deepcopy(self.metadata)
|
| 502 |
+
else:
|
| 503 |
+
return s
|
| 504 |
+
|
| 505 |
+
|
| 506 |
+
class Latex(TextDisplayObject):
|
| 507 |
+
|
| 508 |
+
def _repr_latex_(self):
|
| 509 |
+
return self._data_and_metadata()
|
| 510 |
+
|
| 511 |
+
|
| 512 |
+
class SVG(DisplayObject):
|
| 513 |
+
"""Embed an SVG into the display.
|
| 514 |
+
|
| 515 |
+
Note if you just want to view a svg image via a URL use `:class:Image` with
|
| 516 |
+
a url=URL keyword argument.
|
| 517 |
+
"""
|
| 518 |
+
|
| 519 |
+
_read_flags = 'rb'
|
| 520 |
+
# wrap data in a property, which extracts the <svg> tag, discarding
|
| 521 |
+
# document headers
|
| 522 |
+
_data: Optional[str] = None
|
| 523 |
+
|
| 524 |
+
@property
|
| 525 |
+
def data(self):
|
| 526 |
+
return self._data
|
| 527 |
+
|
| 528 |
+
@data.setter
|
| 529 |
+
def data(self, svg):
|
| 530 |
+
if svg is None:
|
| 531 |
+
self._data = None
|
| 532 |
+
return
|
| 533 |
+
# parse into dom object
|
| 534 |
+
from xml.dom import minidom
|
| 535 |
+
x = minidom.parseString(svg)
|
| 536 |
+
# get svg tag (should be 1)
|
| 537 |
+
found_svg = x.getElementsByTagName('svg')
|
| 538 |
+
if found_svg:
|
| 539 |
+
svg = found_svg[0].toxml()
|
| 540 |
+
else:
|
| 541 |
+
# fallback on the input, trust the user
|
| 542 |
+
# but this is probably an error.
|
| 543 |
+
pass
|
| 544 |
+
if isinstance(svg, bytes):
|
| 545 |
+
self._data = svg.decode(errors="replace")
|
| 546 |
+
else:
|
| 547 |
+
self._data = svg
|
| 548 |
+
|
| 549 |
+
def _repr_svg_(self):
|
| 550 |
+
return self._data_and_metadata()
|
| 551 |
+
|
| 552 |
+
class ProgressBar(DisplayObject):
|
| 553 |
+
"""Progressbar supports displaying a progressbar like element
|
| 554 |
+
"""
|
| 555 |
+
def __init__(self, total):
|
| 556 |
+
"""Creates a new progressbar
|
| 557 |
+
|
| 558 |
+
Parameters
|
| 559 |
+
----------
|
| 560 |
+
total : int
|
| 561 |
+
maximum size of the progressbar
|
| 562 |
+
"""
|
| 563 |
+
self.total = total
|
| 564 |
+
self._progress = 0
|
| 565 |
+
self.html_width = '60ex'
|
| 566 |
+
self.text_width = 60
|
| 567 |
+
self._display_id = hexlify(os.urandom(8)).decode('ascii')
|
| 568 |
+
|
| 569 |
+
def __repr__(self):
|
| 570 |
+
fraction = self.progress / self.total
|
| 571 |
+
filled = '=' * int(fraction * self.text_width)
|
| 572 |
+
rest = ' ' * (self.text_width - len(filled))
|
| 573 |
+
return '[{}{}] {}/{}'.format(
|
| 574 |
+
filled, rest,
|
| 575 |
+
self.progress, self.total,
|
| 576 |
+
)
|
| 577 |
+
|
| 578 |
+
def _repr_html_(self):
|
| 579 |
+
return "<progress style='width:{}' max='{}' value='{}'></progress>".format(
|
| 580 |
+
self.html_width, self.total, self.progress)
|
| 581 |
+
|
| 582 |
+
def display(self):
|
| 583 |
+
display_functions.display(self, display_id=self._display_id)
|
| 584 |
+
|
| 585 |
+
def update(self):
|
| 586 |
+
display_functions.display(self, display_id=self._display_id, update=True)
|
| 587 |
+
|
| 588 |
+
@property
|
| 589 |
+
def progress(self):
|
| 590 |
+
return self._progress
|
| 591 |
+
|
| 592 |
+
@progress.setter
|
| 593 |
+
def progress(self, value):
|
| 594 |
+
self._progress = value
|
| 595 |
+
self.update()
|
| 596 |
+
|
| 597 |
+
def __iter__(self):
|
| 598 |
+
self.display()
|
| 599 |
+
self._progress = -1 # First iteration is 0
|
| 600 |
+
return self
|
| 601 |
+
|
| 602 |
+
def __next__(self):
|
| 603 |
+
"""Returns current value and increments display by one."""
|
| 604 |
+
self.progress += 1
|
| 605 |
+
if self.progress < self.total:
|
| 606 |
+
return self.progress
|
| 607 |
+
else:
|
| 608 |
+
raise StopIteration()
|
| 609 |
+
|
| 610 |
+
class JSON(DisplayObject):
|
| 611 |
+
"""JSON expects a JSON-able dict or list
|
| 612 |
+
|
| 613 |
+
not an already-serialized JSON string.
|
| 614 |
+
|
| 615 |
+
Scalar types (None, number, string) are not allowed, only dict or list containers.
|
| 616 |
+
"""
|
| 617 |
+
# wrap data in a property, which warns about passing already-serialized JSON
|
| 618 |
+
_data = None
|
| 619 |
+
def __init__(self, data=None, url=None, filename=None, expanded=False, metadata=None, root='root', **kwargs):
|
| 620 |
+
"""Create a JSON display object given raw data.
|
| 621 |
+
|
| 622 |
+
Parameters
|
| 623 |
+
----------
|
| 624 |
+
data : dict or list
|
| 625 |
+
JSON data to display. Not an already-serialized JSON string.
|
| 626 |
+
Scalar types (None, number, string) are not allowed, only dict
|
| 627 |
+
or list containers.
|
| 628 |
+
url : unicode
|
| 629 |
+
A URL to download the data from.
|
| 630 |
+
filename : unicode
|
| 631 |
+
Path to a local file to load the data from.
|
| 632 |
+
expanded : boolean
|
| 633 |
+
Metadata to control whether a JSON display component is expanded.
|
| 634 |
+
metadata : dict
|
| 635 |
+
Specify extra metadata to attach to the json display object.
|
| 636 |
+
root : str
|
| 637 |
+
The name of the root element of the JSON tree
|
| 638 |
+
"""
|
| 639 |
+
self.metadata = {
|
| 640 |
+
'expanded': expanded,
|
| 641 |
+
'root': root,
|
| 642 |
+
}
|
| 643 |
+
if metadata:
|
| 644 |
+
self.metadata.update(metadata)
|
| 645 |
+
if kwargs:
|
| 646 |
+
self.metadata.update(kwargs)
|
| 647 |
+
super(JSON, self).__init__(data=data, url=url, filename=filename)
|
| 648 |
+
|
| 649 |
+
def _check_data(self):
|
| 650 |
+
if self.data is not None and not isinstance(self.data, (dict, list)):
|
| 651 |
+
raise TypeError("%s expects JSONable dict or list, not %r" % (self.__class__.__name__, self.data))
|
| 652 |
+
|
| 653 |
+
@property
|
| 654 |
+
def data(self):
|
| 655 |
+
return self._data
|
| 656 |
+
|
| 657 |
+
@data.setter
|
| 658 |
+
def data(self, data):
|
| 659 |
+
if isinstance(data, (Path, PurePath)):
|
| 660 |
+
data = str(data)
|
| 661 |
+
|
| 662 |
+
if isinstance(data, str):
|
| 663 |
+
if self.filename is None and self.url is None:
|
| 664 |
+
warnings.warn("JSON expects JSONable dict or list, not JSON strings")
|
| 665 |
+
data = json.loads(data)
|
| 666 |
+
self._data = data
|
| 667 |
+
|
| 668 |
+
def _data_and_metadata(self):
|
| 669 |
+
return self.data, self.metadata
|
| 670 |
+
|
| 671 |
+
def _repr_json_(self):
|
| 672 |
+
return self._data_and_metadata()
|
| 673 |
+
|
| 674 |
+
|
| 675 |
+
_css_t = """var link = document.createElement("link");
|
| 676 |
+
link.rel = "stylesheet";
|
| 677 |
+
link.type = "text/css";
|
| 678 |
+
link.href = "%s";
|
| 679 |
+
document.head.appendChild(link);
|
| 680 |
+
"""
|
| 681 |
+
|
| 682 |
+
_lib_t1 = """new Promise(function(resolve, reject) {
|
| 683 |
+
var script = document.createElement("script");
|
| 684 |
+
script.onload = resolve;
|
| 685 |
+
script.onerror = reject;
|
| 686 |
+
script.src = "%s";
|
| 687 |
+
document.head.appendChild(script);
|
| 688 |
+
}).then(() => {
|
| 689 |
+
"""
|
| 690 |
+
|
| 691 |
+
_lib_t2 = """
|
| 692 |
+
});"""
|
| 693 |
+
|
| 694 |
+
class GeoJSON(JSON):
|
| 695 |
+
"""GeoJSON expects JSON-able dict
|
| 696 |
+
|
| 697 |
+
not an already-serialized JSON string.
|
| 698 |
+
|
| 699 |
+
Scalar types (None, number, string) are not allowed, only dict containers.
|
| 700 |
+
"""
|
| 701 |
+
|
| 702 |
+
def __init__(self, *args, **kwargs):
|
| 703 |
+
"""Create a GeoJSON display object given raw data.
|
| 704 |
+
|
| 705 |
+
Parameters
|
| 706 |
+
----------
|
| 707 |
+
data : dict or list
|
| 708 |
+
VegaLite data. Not an already-serialized JSON string.
|
| 709 |
+
Scalar types (None, number, string) are not allowed, only dict
|
| 710 |
+
or list containers.
|
| 711 |
+
url_template : string
|
| 712 |
+
Leaflet TileLayer URL template: http://leafletjs.com/reference.html#url-template
|
| 713 |
+
layer_options : dict
|
| 714 |
+
Leaflet TileLayer options: http://leafletjs.com/reference.html#tilelayer-options
|
| 715 |
+
url : unicode
|
| 716 |
+
A URL to download the data from.
|
| 717 |
+
filename : unicode
|
| 718 |
+
Path to a local file to load the data from.
|
| 719 |
+
metadata : dict
|
| 720 |
+
Specify extra metadata to attach to the json display object.
|
| 721 |
+
|
| 722 |
+
Examples
|
| 723 |
+
--------
|
| 724 |
+
The following will display an interactive map of Mars with a point of
|
| 725 |
+
interest on frontend that do support GeoJSON display.
|
| 726 |
+
|
| 727 |
+
>>> from IPython.display import GeoJSON
|
| 728 |
+
|
| 729 |
+
>>> GeoJSON(data={
|
| 730 |
+
... "type": "Feature",
|
| 731 |
+
... "geometry": {
|
| 732 |
+
... "type": "Point",
|
| 733 |
+
... "coordinates": [-81.327, 296.038]
|
| 734 |
+
... }
|
| 735 |
+
... },
|
| 736 |
+
... url_template="http://s3-eu-west-1.amazonaws.com/whereonmars.cartodb.net/{basemap_id}/{z}/{x}/{y}.png",
|
| 737 |
+
... layer_options={
|
| 738 |
+
... "basemap_id": "celestia_mars-shaded-16k_global",
|
| 739 |
+
... "attribution" : "Celestia/praesepe",
|
| 740 |
+
... "minZoom" : 0,
|
| 741 |
+
... "maxZoom" : 18,
|
| 742 |
+
... })
|
| 743 |
+
<IPython.core.display.GeoJSON object>
|
| 744 |
+
|
| 745 |
+
In the terminal IPython, you will only see the text representation of
|
| 746 |
+
the GeoJSON object.
|
| 747 |
+
|
| 748 |
+
"""
|
| 749 |
+
|
| 750 |
+
super(GeoJSON, self).__init__(*args, **kwargs)
|
| 751 |
+
|
| 752 |
+
|
| 753 |
+
def _ipython_display_(self):
|
| 754 |
+
bundle = {
|
| 755 |
+
'application/geo+json': self.data,
|
| 756 |
+
'text/plain': '<IPython.display.GeoJSON object>'
|
| 757 |
+
}
|
| 758 |
+
metadata = {
|
| 759 |
+
'application/geo+json': self.metadata
|
| 760 |
+
}
|
| 761 |
+
display_functions.display(bundle, metadata=metadata, raw=True)
|
| 762 |
+
|
| 763 |
+
class Javascript(TextDisplayObject):
|
| 764 |
+
|
| 765 |
+
def __init__(self, data=None, url=None, filename=None, lib=None, css=None):
|
| 766 |
+
"""Create a Javascript display object given raw data.
|
| 767 |
+
|
| 768 |
+
When this object is returned by an expression or passed to the
|
| 769 |
+
display function, it will result in the data being displayed
|
| 770 |
+
in the frontend. If the data is a URL, the data will first be
|
| 771 |
+
downloaded and then displayed.
|
| 772 |
+
|
| 773 |
+
In the Notebook, the containing element will be available as `element`,
|
| 774 |
+
and jQuery will be available. Content appended to `element` will be
|
| 775 |
+
visible in the output area.
|
| 776 |
+
|
| 777 |
+
Parameters
|
| 778 |
+
----------
|
| 779 |
+
data : unicode, str or bytes
|
| 780 |
+
The Javascript source code or a URL to download it from.
|
| 781 |
+
url : unicode
|
| 782 |
+
A URL to download the data from.
|
| 783 |
+
filename : unicode
|
| 784 |
+
Path to a local file to load the data from.
|
| 785 |
+
lib : list or str
|
| 786 |
+
A sequence of Javascript library URLs to load asynchronously before
|
| 787 |
+
running the source code. The full URLs of the libraries should
|
| 788 |
+
be given. A single Javascript library URL can also be given as a
|
| 789 |
+
string.
|
| 790 |
+
css : list or str
|
| 791 |
+
A sequence of css files to load before running the source code.
|
| 792 |
+
The full URLs of the css files should be given. A single css URL
|
| 793 |
+
can also be given as a string.
|
| 794 |
+
"""
|
| 795 |
+
if isinstance(lib, str):
|
| 796 |
+
lib = [lib]
|
| 797 |
+
elif lib is None:
|
| 798 |
+
lib = []
|
| 799 |
+
if isinstance(css, str):
|
| 800 |
+
css = [css]
|
| 801 |
+
elif css is None:
|
| 802 |
+
css = []
|
| 803 |
+
if not isinstance(lib, (list,tuple)):
|
| 804 |
+
raise TypeError('expected sequence, got: %r' % lib)
|
| 805 |
+
if not isinstance(css, (list,tuple)):
|
| 806 |
+
raise TypeError('expected sequence, got: %r' % css)
|
| 807 |
+
self.lib = lib
|
| 808 |
+
self.css = css
|
| 809 |
+
super(Javascript, self).__init__(data=data, url=url, filename=filename)
|
| 810 |
+
|
| 811 |
+
def _repr_javascript_(self):
|
| 812 |
+
r = ''
|
| 813 |
+
for c in self.css:
|
| 814 |
+
r += _css_t % c
|
| 815 |
+
for l in self.lib:
|
| 816 |
+
r += _lib_t1 % l
|
| 817 |
+
r += self.data
|
| 818 |
+
r += _lib_t2*len(self.lib)
|
| 819 |
+
return r
|
| 820 |
+
|
| 821 |
+
|
| 822 |
+
# constants for identifying png/jpeg/gif/webp data
|
| 823 |
+
_PNG = b"\x89PNG\r\n\x1a\n"
|
| 824 |
+
_JPEG = b"\xff\xd8"
|
| 825 |
+
_GIF1 = b"GIF87a"
|
| 826 |
+
_GIF2 = b"GIF89a"
|
| 827 |
+
_WEBP = b"WEBP"
|
| 828 |
+
|
| 829 |
+
|
| 830 |
+
def _pngxy(data):
|
| 831 |
+
"""read the (width, height) from a PNG header"""
|
| 832 |
+
ihdr = data.index(b'IHDR')
|
| 833 |
+
# next 8 bytes are width/height
|
| 834 |
+
return struct.unpack('>ii', data[ihdr+4:ihdr+12])
|
| 835 |
+
|
| 836 |
+
|
| 837 |
+
def _jpegxy(data):
|
| 838 |
+
"""read the (width, height) from a JPEG header"""
|
| 839 |
+
# adapted from http://www.64lines.com/jpeg-width-height
|
| 840 |
+
|
| 841 |
+
idx = 4
|
| 842 |
+
while True:
|
| 843 |
+
block_size = struct.unpack('>H', data[idx:idx+2])[0]
|
| 844 |
+
idx = idx + block_size
|
| 845 |
+
if data[idx:idx+2] == b'\xFF\xC0':
|
| 846 |
+
# found Start of Frame
|
| 847 |
+
iSOF = idx
|
| 848 |
+
break
|
| 849 |
+
else:
|
| 850 |
+
# read another block
|
| 851 |
+
idx += 2
|
| 852 |
+
|
| 853 |
+
h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9])
|
| 854 |
+
return w, h
|
| 855 |
+
|
| 856 |
+
|
| 857 |
+
def _gifxy(data):
|
| 858 |
+
"""read the (width, height) from a GIF header"""
|
| 859 |
+
return struct.unpack('<HH', data[6:10])
|
| 860 |
+
|
| 861 |
+
|
| 862 |
+
def _webpxy(data):
|
| 863 |
+
"""read the (width, height) from a WEBP header"""
|
| 864 |
+
if data[12:16] == b"VP8 ":
|
| 865 |
+
width, height = struct.unpack("<HH", data[24:30])
|
| 866 |
+
width = width & 0x3FFF
|
| 867 |
+
height = height & 0x3FFF
|
| 868 |
+
return (width, height)
|
| 869 |
+
elif data[12:16] == b"VP8L":
|
| 870 |
+
size_info = struct.unpack("<I", data[21:25])[0]
|
| 871 |
+
width = 1 + ((size_info & 0x3F) << 8) | (size_info >> 24)
|
| 872 |
+
height = 1 + (
|
| 873 |
+
(((size_info >> 8) & 0xF) << 10)
|
| 874 |
+
| (((size_info >> 14) & 0x3FC) << 2)
|
| 875 |
+
| ((size_info >> 22) & 0x3)
|
| 876 |
+
)
|
| 877 |
+
return (width, height)
|
| 878 |
+
else:
|
| 879 |
+
raise ValueError("Not a valid WEBP header")
|
| 880 |
+
|
| 881 |
+
|
| 882 |
+
class Image(DisplayObject):
|
| 883 |
+
|
| 884 |
+
_read_flags = "rb"
|
| 885 |
+
_FMT_JPEG = "jpeg"
|
| 886 |
+
_FMT_PNG = "png"
|
| 887 |
+
_FMT_GIF = "gif"
|
| 888 |
+
_FMT_WEBP = "webp"
|
| 889 |
+
_ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG, _FMT_GIF, _FMT_WEBP]
|
| 890 |
+
_MIMETYPES = {
|
| 891 |
+
_FMT_PNG: "image/png",
|
| 892 |
+
_FMT_JPEG: "image/jpeg",
|
| 893 |
+
_FMT_GIF: "image/gif",
|
| 894 |
+
_FMT_WEBP: "image/webp",
|
| 895 |
+
}
|
| 896 |
+
|
| 897 |
+
def __init__(
|
| 898 |
+
self,
|
| 899 |
+
data=None,
|
| 900 |
+
url=None,
|
| 901 |
+
filename=None,
|
| 902 |
+
format=None,
|
| 903 |
+
embed=None,
|
| 904 |
+
width=None,
|
| 905 |
+
height=None,
|
| 906 |
+
retina=False,
|
| 907 |
+
unconfined=False,
|
| 908 |
+
metadata=None,
|
| 909 |
+
alt=None,
|
| 910 |
+
):
|
| 911 |
+
"""Create a PNG/JPEG/GIF/WEBP image object given raw data.
|
| 912 |
+
|
| 913 |
+
When this object is returned by an input cell or passed to the
|
| 914 |
+
display function, it will result in the image being displayed
|
| 915 |
+
in the frontend.
|
| 916 |
+
|
| 917 |
+
Parameters
|
| 918 |
+
----------
|
| 919 |
+
data : unicode, str or bytes
|
| 920 |
+
The raw image data or a URL or filename to load the data from.
|
| 921 |
+
This always results in embedded image data.
|
| 922 |
+
|
| 923 |
+
url : unicode
|
| 924 |
+
A URL to download the data from. If you specify `url=`,
|
| 925 |
+
the image data will not be embedded unless you also specify `embed=True`.
|
| 926 |
+
|
| 927 |
+
filename : unicode
|
| 928 |
+
Path to a local file to load the data from.
|
| 929 |
+
Images from a file are always embedded.
|
| 930 |
+
|
| 931 |
+
format : unicode
|
| 932 |
+
The format of the image data (png/jpeg/jpg/gif/webp). If a filename or URL is given
|
| 933 |
+
for format will be inferred from the filename extension.
|
| 934 |
+
|
| 935 |
+
embed : bool
|
| 936 |
+
Should the image data be embedded using a data URI (True) or be
|
| 937 |
+
loaded using an <img> tag. Set this to True if you want the image
|
| 938 |
+
to be viewable later with no internet connection in the notebook.
|
| 939 |
+
|
| 940 |
+
Default is `True`, unless the keyword argument `url` is set, then
|
| 941 |
+
default value is `False`.
|
| 942 |
+
|
| 943 |
+
Note that QtConsole is not able to display images if `embed` is set to `False`
|
| 944 |
+
|
| 945 |
+
width : int
|
| 946 |
+
Width in pixels to which to constrain the image in html
|
| 947 |
+
|
| 948 |
+
height : int
|
| 949 |
+
Height in pixels to which to constrain the image in html
|
| 950 |
+
|
| 951 |
+
retina : bool
|
| 952 |
+
Automatically set the width and height to half of the measured
|
| 953 |
+
width and height.
|
| 954 |
+
This only works for embedded images because it reads the width/height
|
| 955 |
+
from image data.
|
| 956 |
+
For non-embedded images, you can just set the desired display width
|
| 957 |
+
and height directly.
|
| 958 |
+
|
| 959 |
+
unconfined : bool
|
| 960 |
+
Set unconfined=True to disable max-width confinement of the image.
|
| 961 |
+
|
| 962 |
+
metadata : dict
|
| 963 |
+
Specify extra metadata to attach to the image.
|
| 964 |
+
|
| 965 |
+
alt : unicode
|
| 966 |
+
Alternative text for the image, for use by screen readers.
|
| 967 |
+
|
| 968 |
+
Examples
|
| 969 |
+
--------
|
| 970 |
+
embedded image data, works in qtconsole and notebook
|
| 971 |
+
when passed positionally, the first arg can be any of raw image data,
|
| 972 |
+
a URL, or a filename from which to load image data.
|
| 973 |
+
The result is always embedding image data for inline images.
|
| 974 |
+
|
| 975 |
+
>>> Image('https://www.google.fr/images/srpr/logo3w.png') # doctest: +SKIP
|
| 976 |
+
<IPython.core.display.Image object>
|
| 977 |
+
|
| 978 |
+
>>> Image('/path/to/image.jpg')
|
| 979 |
+
<IPython.core.display.Image object>
|
| 980 |
+
|
| 981 |
+
>>> Image(b'RAW_PNG_DATA...')
|
| 982 |
+
<IPython.core.display.Image object>
|
| 983 |
+
|
| 984 |
+
Specifying Image(url=...) does not embed the image data,
|
| 985 |
+
it only generates ``<img>`` tag with a link to the source.
|
| 986 |
+
This will not work in the qtconsole or offline.
|
| 987 |
+
|
| 988 |
+
>>> Image(url='https://www.google.fr/images/srpr/logo3w.png')
|
| 989 |
+
<IPython.core.display.Image object>
|
| 990 |
+
|
| 991 |
+
"""
|
| 992 |
+
if isinstance(data, (Path, PurePath)):
|
| 993 |
+
data = str(data)
|
| 994 |
+
|
| 995 |
+
if filename is not None:
|
| 996 |
+
ext = self._find_ext(filename)
|
| 997 |
+
elif url is not None:
|
| 998 |
+
ext = self._find_ext(url)
|
| 999 |
+
elif data is None:
|
| 1000 |
+
raise ValueError("No image data found. Expecting filename, url, or data.")
|
| 1001 |
+
elif isinstance(data, str) and (
|
| 1002 |
+
data.startswith('http') or _safe_exists(data)
|
| 1003 |
+
):
|
| 1004 |
+
ext = self._find_ext(data)
|
| 1005 |
+
else:
|
| 1006 |
+
ext = None
|
| 1007 |
+
|
| 1008 |
+
if format is None:
|
| 1009 |
+
if ext is not None:
|
| 1010 |
+
if ext == u'jpg' or ext == u'jpeg':
|
| 1011 |
+
format = self._FMT_JPEG
|
| 1012 |
+
elif ext == u'png':
|
| 1013 |
+
format = self._FMT_PNG
|
| 1014 |
+
elif ext == u'gif':
|
| 1015 |
+
format = self._FMT_GIF
|
| 1016 |
+
elif ext == "webp":
|
| 1017 |
+
format = self._FMT_WEBP
|
| 1018 |
+
else:
|
| 1019 |
+
format = ext.lower()
|
| 1020 |
+
elif isinstance(data, bytes):
|
| 1021 |
+
# infer image type from image data header,
|
| 1022 |
+
# only if format has not been specified.
|
| 1023 |
+
if data[:2] == _JPEG:
|
| 1024 |
+
format = self._FMT_JPEG
|
| 1025 |
+
elif data[:8] == _PNG:
|
| 1026 |
+
format = self._FMT_PNG
|
| 1027 |
+
elif data[8:12] == _WEBP:
|
| 1028 |
+
format = self._FMT_WEBP
|
| 1029 |
+
elif data[:6] == _GIF1 or data[:6] == _GIF2:
|
| 1030 |
+
format = self._FMT_GIF
|
| 1031 |
+
|
| 1032 |
+
# failed to detect format, default png
|
| 1033 |
+
if format is None:
|
| 1034 |
+
format = self._FMT_PNG
|
| 1035 |
+
|
| 1036 |
+
if format.lower() == 'jpg':
|
| 1037 |
+
# jpg->jpeg
|
| 1038 |
+
format = self._FMT_JPEG
|
| 1039 |
+
|
| 1040 |
+
self.format = format.lower()
|
| 1041 |
+
self.embed = embed if embed is not None else (url is None)
|
| 1042 |
+
|
| 1043 |
+
if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS:
|
| 1044 |
+
raise ValueError("Cannot embed the '%s' image format" % (self.format))
|
| 1045 |
+
if self.embed:
|
| 1046 |
+
self._mimetype = self._MIMETYPES.get(self.format)
|
| 1047 |
+
|
| 1048 |
+
self.width = width
|
| 1049 |
+
self.height = height
|
| 1050 |
+
self.retina = retina
|
| 1051 |
+
self.unconfined = unconfined
|
| 1052 |
+
self.alt = alt
|
| 1053 |
+
super(Image, self).__init__(data=data, url=url, filename=filename,
|
| 1054 |
+
metadata=metadata)
|
| 1055 |
+
|
| 1056 |
+
if self.width is None and self.metadata.get('width', {}):
|
| 1057 |
+
self.width = metadata['width']
|
| 1058 |
+
|
| 1059 |
+
if self.height is None and self.metadata.get('height', {}):
|
| 1060 |
+
self.height = metadata['height']
|
| 1061 |
+
|
| 1062 |
+
if self.alt is None and self.metadata.get("alt", {}):
|
| 1063 |
+
self.alt = metadata["alt"]
|
| 1064 |
+
|
| 1065 |
+
if retina:
|
| 1066 |
+
self._retina_shape()
|
| 1067 |
+
|
| 1068 |
+
|
| 1069 |
+
def _retina_shape(self):
|
| 1070 |
+
"""load pixel-doubled width and height from image data"""
|
| 1071 |
+
if not self.embed:
|
| 1072 |
+
return
|
| 1073 |
+
if self.format == self._FMT_PNG:
|
| 1074 |
+
w, h = _pngxy(self.data)
|
| 1075 |
+
elif self.format == self._FMT_JPEG:
|
| 1076 |
+
w, h = _jpegxy(self.data)
|
| 1077 |
+
elif self.format == self._FMT_GIF:
|
| 1078 |
+
w, h = _gifxy(self.data)
|
| 1079 |
+
else:
|
| 1080 |
+
# retina only supports png
|
| 1081 |
+
return
|
| 1082 |
+
self.width = w // 2
|
| 1083 |
+
self.height = h // 2
|
| 1084 |
+
|
| 1085 |
+
def reload(self):
|
| 1086 |
+
"""Reload the raw data from file or URL."""
|
| 1087 |
+
if self.embed:
|
| 1088 |
+
super(Image,self).reload()
|
| 1089 |
+
if self.retina:
|
| 1090 |
+
self._retina_shape()
|
| 1091 |
+
|
| 1092 |
+
def _repr_html_(self):
|
| 1093 |
+
if not self.embed:
|
| 1094 |
+
width = height = klass = alt = ""
|
| 1095 |
+
if self.width:
|
| 1096 |
+
width = ' width="%d"' % self.width
|
| 1097 |
+
if self.height:
|
| 1098 |
+
height = ' height="%d"' % self.height
|
| 1099 |
+
if self.unconfined:
|
| 1100 |
+
klass = ' class="unconfined"'
|
| 1101 |
+
if self.alt:
|
| 1102 |
+
alt = ' alt="%s"' % html.escape(self.alt)
|
| 1103 |
+
return '<img src="{url}"{width}{height}{klass}{alt}/>'.format(
|
| 1104 |
+
url=self.url,
|
| 1105 |
+
width=width,
|
| 1106 |
+
height=height,
|
| 1107 |
+
klass=klass,
|
| 1108 |
+
alt=alt,
|
| 1109 |
+
)
|
| 1110 |
+
|
| 1111 |
+
def _repr_mimebundle_(self, include=None, exclude=None):
|
| 1112 |
+
"""Return the image as a mimebundle
|
| 1113 |
+
|
| 1114 |
+
Any new mimetype support should be implemented here.
|
| 1115 |
+
"""
|
| 1116 |
+
if self.embed:
|
| 1117 |
+
mimetype = self._mimetype
|
| 1118 |
+
data, metadata = self._data_and_metadata(always_both=True)
|
| 1119 |
+
if metadata:
|
| 1120 |
+
metadata = {mimetype: metadata}
|
| 1121 |
+
return {mimetype: data}, metadata
|
| 1122 |
+
else:
|
| 1123 |
+
return {'text/html': self._repr_html_()}
|
| 1124 |
+
|
| 1125 |
+
def _data_and_metadata(self, always_both=False):
|
| 1126 |
+
"""shortcut for returning metadata with shape information, if defined"""
|
| 1127 |
+
try:
|
| 1128 |
+
b64_data = b2a_base64(self.data, newline=False).decode("ascii")
|
| 1129 |
+
except TypeError as e:
|
| 1130 |
+
raise FileNotFoundError(
|
| 1131 |
+
"No such file or directory: '%s'" % (self.data)) from e
|
| 1132 |
+
md = {}
|
| 1133 |
+
if self.metadata:
|
| 1134 |
+
md.update(self.metadata)
|
| 1135 |
+
if self.width:
|
| 1136 |
+
md['width'] = self.width
|
| 1137 |
+
if self.height:
|
| 1138 |
+
md['height'] = self.height
|
| 1139 |
+
if self.unconfined:
|
| 1140 |
+
md['unconfined'] = self.unconfined
|
| 1141 |
+
if self.alt:
|
| 1142 |
+
md["alt"] = self.alt
|
| 1143 |
+
if md or always_both:
|
| 1144 |
+
return b64_data, md
|
| 1145 |
+
else:
|
| 1146 |
+
return b64_data
|
| 1147 |
+
|
| 1148 |
+
def _repr_png_(self):
|
| 1149 |
+
if self.embed and self.format == self._FMT_PNG:
|
| 1150 |
+
return self._data_and_metadata()
|
| 1151 |
+
|
| 1152 |
+
def _repr_jpeg_(self):
|
| 1153 |
+
if self.embed and self.format == self._FMT_JPEG:
|
| 1154 |
+
return self._data_and_metadata()
|
| 1155 |
+
|
| 1156 |
+
def _find_ext(self, s):
|
| 1157 |
+
base, ext = splitext(s)
|
| 1158 |
+
|
| 1159 |
+
if not ext:
|
| 1160 |
+
return base
|
| 1161 |
+
|
| 1162 |
+
# `splitext` includes leading period, so we skip it
|
| 1163 |
+
return ext[1:].lower()
|
| 1164 |
+
|
| 1165 |
+
|
| 1166 |
+
class Video(DisplayObject):
|
| 1167 |
+
|
| 1168 |
+
def __init__(self, data=None, url=None, filename=None, embed=False,
|
| 1169 |
+
mimetype=None, width=None, height=None, html_attributes="controls"):
|
| 1170 |
+
"""Create a video object given raw data or an URL.
|
| 1171 |
+
|
| 1172 |
+
When this object is returned by an input cell or passed to the
|
| 1173 |
+
display function, it will result in the video being displayed
|
| 1174 |
+
in the frontend.
|
| 1175 |
+
|
| 1176 |
+
Parameters
|
| 1177 |
+
----------
|
| 1178 |
+
data : unicode, str or bytes
|
| 1179 |
+
The raw video data or a URL or filename to load the data from.
|
| 1180 |
+
Raw data will require passing ``embed=True``.
|
| 1181 |
+
|
| 1182 |
+
url : unicode
|
| 1183 |
+
A URL for the video. If you specify ``url=``,
|
| 1184 |
+
the image data will not be embedded.
|
| 1185 |
+
|
| 1186 |
+
filename : unicode
|
| 1187 |
+
Path to a local file containing the video.
|
| 1188 |
+
Will be interpreted as a local URL unless ``embed=True``.
|
| 1189 |
+
|
| 1190 |
+
embed : bool
|
| 1191 |
+
Should the video be embedded using a data URI (True) or be
|
| 1192 |
+
loaded using a <video> tag (False).
|
| 1193 |
+
|
| 1194 |
+
Since videos are large, embedding them should be avoided, if possible.
|
| 1195 |
+
You must confirm embedding as your intention by passing ``embed=True``.
|
| 1196 |
+
|
| 1197 |
+
Local files can be displayed with URLs without embedding the content, via::
|
| 1198 |
+
|
| 1199 |
+
Video('./video.mp4')
|
| 1200 |
+
|
| 1201 |
+
mimetype : unicode
|
| 1202 |
+
Specify the mimetype for embedded videos.
|
| 1203 |
+
Default will be guessed from file extension, if available.
|
| 1204 |
+
|
| 1205 |
+
width : int
|
| 1206 |
+
Width in pixels to which to constrain the video in HTML.
|
| 1207 |
+
If not supplied, defaults to the width of the video.
|
| 1208 |
+
|
| 1209 |
+
height : int
|
| 1210 |
+
Height in pixels to which to constrain the video in html.
|
| 1211 |
+
If not supplied, defaults to the height of the video.
|
| 1212 |
+
|
| 1213 |
+
html_attributes : str
|
| 1214 |
+
Attributes for the HTML ``<video>`` block.
|
| 1215 |
+
Default: ``"controls"`` to get video controls.
|
| 1216 |
+
Other examples: ``"controls muted"`` for muted video with controls,
|
| 1217 |
+
``"loop autoplay"`` for looping autoplaying video without controls.
|
| 1218 |
+
|
| 1219 |
+
Examples
|
| 1220 |
+
--------
|
| 1221 |
+
::
|
| 1222 |
+
|
| 1223 |
+
Video('https://archive.org/download/Sita_Sings_the_Blues/Sita_Sings_the_Blues_small.mp4')
|
| 1224 |
+
Video('path/to/video.mp4')
|
| 1225 |
+
Video('path/to/video.mp4', embed=True)
|
| 1226 |
+
Video('path/to/video.mp4', embed=True, html_attributes="controls muted autoplay")
|
| 1227 |
+
Video(b'raw-videodata', embed=True)
|
| 1228 |
+
"""
|
| 1229 |
+
if isinstance(data, (Path, PurePath)):
|
| 1230 |
+
data = str(data)
|
| 1231 |
+
|
| 1232 |
+
if url is None and isinstance(data, str) and data.startswith(('http:', 'https:')):
|
| 1233 |
+
url = data
|
| 1234 |
+
data = None
|
| 1235 |
+
elif data is not None and os.path.exists(data):
|
| 1236 |
+
filename = data
|
| 1237 |
+
data = None
|
| 1238 |
+
|
| 1239 |
+
if data and not embed:
|
| 1240 |
+
msg = ''.join([
|
| 1241 |
+
"To embed videos, you must pass embed=True ",
|
| 1242 |
+
"(this may make your notebook files huge)\n",
|
| 1243 |
+
"Consider passing Video(url='...')",
|
| 1244 |
+
])
|
| 1245 |
+
raise ValueError(msg)
|
| 1246 |
+
|
| 1247 |
+
self.mimetype = mimetype
|
| 1248 |
+
self.embed = embed
|
| 1249 |
+
self.width = width
|
| 1250 |
+
self.height = height
|
| 1251 |
+
self.html_attributes = html_attributes
|
| 1252 |
+
super(Video, self).__init__(data=data, url=url, filename=filename)
|
| 1253 |
+
|
| 1254 |
+
def _repr_html_(self):
|
| 1255 |
+
width = height = ''
|
| 1256 |
+
if self.width:
|
| 1257 |
+
width = ' width="%d"' % self.width
|
| 1258 |
+
if self.height:
|
| 1259 |
+
height = ' height="%d"' % self.height
|
| 1260 |
+
|
| 1261 |
+
# External URLs and potentially local files are not embedded into the
|
| 1262 |
+
# notebook output.
|
| 1263 |
+
if not self.embed:
|
| 1264 |
+
url = self.url if self.url is not None else self.filename
|
| 1265 |
+
output = """<video src="{0}" {1} {2} {3}>
|
| 1266 |
+
Your browser does not support the <code>video</code> element.
|
| 1267 |
+
</video>""".format(url, self.html_attributes, width, height)
|
| 1268 |
+
return output
|
| 1269 |
+
|
| 1270 |
+
# Embedded videos are base64-encoded.
|
| 1271 |
+
mimetype = self.mimetype
|
| 1272 |
+
if self.filename is not None:
|
| 1273 |
+
if not mimetype:
|
| 1274 |
+
mimetype, _ = mimetypes.guess_type(self.filename)
|
| 1275 |
+
|
| 1276 |
+
with open(self.filename, 'rb') as f:
|
| 1277 |
+
video = f.read()
|
| 1278 |
+
else:
|
| 1279 |
+
video = self.data
|
| 1280 |
+
if isinstance(video, str):
|
| 1281 |
+
# unicode input is already b64-encoded
|
| 1282 |
+
b64_video = video
|
| 1283 |
+
else:
|
| 1284 |
+
b64_video = b2a_base64(video, newline=False).decode("ascii").rstrip()
|
| 1285 |
+
|
| 1286 |
+
output = """<video {0} {1} {2}>
|
| 1287 |
+
<source src="data:{3};base64,{4}" type="{3}">
|
| 1288 |
+
Your browser does not support the video tag.
|
| 1289 |
+
</video>""".format(self.html_attributes, width, height, mimetype, b64_video)
|
| 1290 |
+
return output
|
| 1291 |
+
|
| 1292 |
+
def reload(self):
|
| 1293 |
+
# TODO
|
| 1294 |
+
pass
|
| 1295 |
+
|
| 1296 |
+
|
| 1297 |
+
@skip_doctest
|
| 1298 |
+
def set_matplotlib_formats(*formats, **kwargs):
|
| 1299 |
+
"""
|
| 1300 |
+
.. deprecated:: 7.23
|
| 1301 |
+
|
| 1302 |
+
use `matplotlib_inline.backend_inline.set_matplotlib_formats()`
|
| 1303 |
+
|
| 1304 |
+
Select figure formats for the inline backend. Optionally pass quality for JPEG.
|
| 1305 |
+
|
| 1306 |
+
For example, this enables PNG and JPEG output with a JPEG quality of 90%::
|
| 1307 |
+
|
| 1308 |
+
In [1]: set_matplotlib_formats('png', 'jpeg', quality=90)
|
| 1309 |
+
|
| 1310 |
+
To set this in your config files use the following::
|
| 1311 |
+
|
| 1312 |
+
c.InlineBackend.figure_formats = {'png', 'jpeg'}
|
| 1313 |
+
c.InlineBackend.print_figure_kwargs.update({'quality' : 90})
|
| 1314 |
+
|
| 1315 |
+
Parameters
|
| 1316 |
+
----------
|
| 1317 |
+
*formats : strs
|
| 1318 |
+
One or more figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'.
|
| 1319 |
+
**kwargs
|
| 1320 |
+
Keyword args will be relayed to ``figure.canvas.print_figure``.
|
| 1321 |
+
"""
|
| 1322 |
+
warnings.warn(
|
| 1323 |
+
"`set_matplotlib_formats` is deprecated since IPython 7.23, directly "
|
| 1324 |
+
"use `matplotlib_inline.backend_inline.set_matplotlib_formats()`",
|
| 1325 |
+
DeprecationWarning,
|
| 1326 |
+
stacklevel=2,
|
| 1327 |
+
)
|
| 1328 |
+
|
| 1329 |
+
from matplotlib_inline.backend_inline import (
|
| 1330 |
+
set_matplotlib_formats as set_matplotlib_formats_orig,
|
| 1331 |
+
)
|
| 1332 |
+
|
| 1333 |
+
set_matplotlib_formats_orig(*formats, **kwargs)
|
| 1334 |
+
|
| 1335 |
+
@skip_doctest
|
| 1336 |
+
def set_matplotlib_close(close=True):
|
| 1337 |
+
"""
|
| 1338 |
+
.. deprecated:: 7.23
|
| 1339 |
+
|
| 1340 |
+
use `matplotlib_inline.backend_inline.set_matplotlib_close()`
|
| 1341 |
+
|
| 1342 |
+
Set whether the inline backend closes all figures automatically or not.
|
| 1343 |
+
|
| 1344 |
+
By default, the inline backend used in the IPython Notebook will close all
|
| 1345 |
+
matplotlib figures automatically after each cell is run. This means that
|
| 1346 |
+
plots in different cells won't interfere. Sometimes, you may want to make
|
| 1347 |
+
a plot in one cell and then refine it in later cells. This can be accomplished
|
| 1348 |
+
by::
|
| 1349 |
+
|
| 1350 |
+
In [1]: set_matplotlib_close(False)
|
| 1351 |
+
|
| 1352 |
+
To set this in your config files use the following::
|
| 1353 |
+
|
| 1354 |
+
c.InlineBackend.close_figures = False
|
| 1355 |
+
|
| 1356 |
+
Parameters
|
| 1357 |
+
----------
|
| 1358 |
+
close : bool
|
| 1359 |
+
Should all matplotlib figures be automatically closed after each cell is
|
| 1360 |
+
run?
|
| 1361 |
+
"""
|
| 1362 |
+
warnings.warn(
|
| 1363 |
+
"`set_matplotlib_close` is deprecated since IPython 7.23, directly "
|
| 1364 |
+
"use `matplotlib_inline.backend_inline.set_matplotlib_close()`",
|
| 1365 |
+
DeprecationWarning,
|
| 1366 |
+
stacklevel=2,
|
| 1367 |
+
)
|
| 1368 |
+
|
| 1369 |
+
from matplotlib_inline.backend_inline import (
|
| 1370 |
+
set_matplotlib_close as set_matplotlib_close_orig,
|
| 1371 |
+
)
|
| 1372 |
+
|
| 1373 |
+
set_matplotlib_close_orig(close)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/display_functions.py
ADDED
|
@@ -0,0 +1,391 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Top-level display functions for displaying object in different formats."""
|
| 3 |
+
|
| 4 |
+
# Copyright (c) IPython Development Team.
|
| 5 |
+
# Distributed under the terms of the Modified BSD License.
|
| 6 |
+
|
| 7 |
+
|
| 8 |
+
from binascii import b2a_hex
|
| 9 |
+
import os
|
| 10 |
+
import sys
|
| 11 |
+
import warnings
|
| 12 |
+
|
| 13 |
+
__all__ = ['display', 'clear_output', 'publish_display_data', 'update_display', 'DisplayHandle']
|
| 14 |
+
|
| 15 |
+
#-----------------------------------------------------------------------------
|
| 16 |
+
# utility functions
|
| 17 |
+
#-----------------------------------------------------------------------------
|
| 18 |
+
|
| 19 |
+
|
| 20 |
+
def _merge(d1, d2):
|
| 21 |
+
"""Like update, but merges sub-dicts instead of clobbering at the top level.
|
| 22 |
+
|
| 23 |
+
Updates d1 in-place
|
| 24 |
+
"""
|
| 25 |
+
|
| 26 |
+
if not isinstance(d2, dict) or not isinstance(d1, dict):
|
| 27 |
+
return d2
|
| 28 |
+
for key, value in d2.items():
|
| 29 |
+
d1[key] = _merge(d1.get(key), value)
|
| 30 |
+
return d1
|
| 31 |
+
|
| 32 |
+
|
| 33 |
+
#-----------------------------------------------------------------------------
|
| 34 |
+
# Main functions
|
| 35 |
+
#-----------------------------------------------------------------------------
|
| 36 |
+
|
| 37 |
+
class _Sentinel:
|
| 38 |
+
def __repr__(self):
|
| 39 |
+
return "<deprecated>"
|
| 40 |
+
|
| 41 |
+
|
| 42 |
+
_sentinel = _Sentinel()
|
| 43 |
+
|
| 44 |
+
# use * to indicate transient is keyword-only
|
| 45 |
+
def publish_display_data(
|
| 46 |
+
data, metadata=None, source=_sentinel, *, transient=None, **kwargs
|
| 47 |
+
):
|
| 48 |
+
"""Publish data and metadata to all frontends.
|
| 49 |
+
|
| 50 |
+
See the ``display_data`` message in the messaging documentation for
|
| 51 |
+
more details about this message type.
|
| 52 |
+
|
| 53 |
+
Keys of data and metadata can be any mime-type.
|
| 54 |
+
|
| 55 |
+
Parameters
|
| 56 |
+
----------
|
| 57 |
+
data : dict
|
| 58 |
+
A dictionary having keys that are valid MIME types (like
|
| 59 |
+
'text/plain' or 'image/svg+xml') and values that are the data for
|
| 60 |
+
that MIME type. The data itself must be a JSON'able data
|
| 61 |
+
structure. Minimally all data should have the 'text/plain' data,
|
| 62 |
+
which can be displayed by all frontends. If more than the plain
|
| 63 |
+
text is given, it is up to the frontend to decide which
|
| 64 |
+
representation to use.
|
| 65 |
+
metadata : dict
|
| 66 |
+
A dictionary for metadata related to the data. This can contain
|
| 67 |
+
arbitrary key, value pairs that frontends can use to interpret
|
| 68 |
+
the data. mime-type keys matching those in data can be used
|
| 69 |
+
to specify metadata about particular representations.
|
| 70 |
+
source : str, deprecated
|
| 71 |
+
Unused.
|
| 72 |
+
transient : dict, keyword-only
|
| 73 |
+
A dictionary of transient data, such as display_id.
|
| 74 |
+
"""
|
| 75 |
+
from IPython.core.interactiveshell import InteractiveShell
|
| 76 |
+
|
| 77 |
+
if source is not _sentinel:
|
| 78 |
+
warnings.warn(
|
| 79 |
+
"The `source` parameter emit a deprecation warning since"
|
| 80 |
+
" IPython 8.0, it had no effects for a long time and will "
|
| 81 |
+
" be removed in future versions.",
|
| 82 |
+
DeprecationWarning,
|
| 83 |
+
stacklevel=2,
|
| 84 |
+
)
|
| 85 |
+
display_pub = InteractiveShell.instance().display_pub
|
| 86 |
+
|
| 87 |
+
# only pass transient if supplied,
|
| 88 |
+
# to avoid errors with older ipykernel.
|
| 89 |
+
# TODO: We could check for ipykernel version and provide a detailed upgrade message.
|
| 90 |
+
if transient:
|
| 91 |
+
kwargs['transient'] = transient
|
| 92 |
+
|
| 93 |
+
display_pub.publish(
|
| 94 |
+
data=data,
|
| 95 |
+
metadata=metadata,
|
| 96 |
+
**kwargs
|
| 97 |
+
)
|
| 98 |
+
|
| 99 |
+
|
| 100 |
+
def _new_id():
|
| 101 |
+
"""Generate a new random text id with urandom"""
|
| 102 |
+
return b2a_hex(os.urandom(16)).decode('ascii')
|
| 103 |
+
|
| 104 |
+
|
| 105 |
+
def display(
|
| 106 |
+
*objs,
|
| 107 |
+
include=None,
|
| 108 |
+
exclude=None,
|
| 109 |
+
metadata=None,
|
| 110 |
+
transient=None,
|
| 111 |
+
display_id=None,
|
| 112 |
+
raw=False,
|
| 113 |
+
clear=False,
|
| 114 |
+
**kwargs,
|
| 115 |
+
):
|
| 116 |
+
"""Display a Python object in all frontends.
|
| 117 |
+
|
| 118 |
+
By default all representations will be computed and sent to the frontends.
|
| 119 |
+
Frontends can decide which representation is used and how.
|
| 120 |
+
|
| 121 |
+
In terminal IPython this will be similar to using :func:`print`, for use in richer
|
| 122 |
+
frontends see Jupyter notebook examples with rich display logic.
|
| 123 |
+
|
| 124 |
+
Parameters
|
| 125 |
+
----------
|
| 126 |
+
*objs : object
|
| 127 |
+
The Python objects to display.
|
| 128 |
+
raw : bool, optional
|
| 129 |
+
Are the objects to be displayed already mimetype-keyed dicts of raw display data,
|
| 130 |
+
or Python objects that need to be formatted before display? [default: False]
|
| 131 |
+
include : list, tuple or set, optional
|
| 132 |
+
A list of format type strings (MIME types) to include in the
|
| 133 |
+
format data dict. If this is set *only* the format types included
|
| 134 |
+
in this list will be computed.
|
| 135 |
+
exclude : list, tuple or set, optional
|
| 136 |
+
A list of format type strings (MIME types) to exclude in the format
|
| 137 |
+
data dict. If this is set all format types will be computed,
|
| 138 |
+
except for those included in this argument.
|
| 139 |
+
metadata : dict, optional
|
| 140 |
+
A dictionary of metadata to associate with the output.
|
| 141 |
+
mime-type keys in this dictionary will be associated with the individual
|
| 142 |
+
representation formats, if they exist.
|
| 143 |
+
transient : dict, optional
|
| 144 |
+
A dictionary of transient data to associate with the output.
|
| 145 |
+
Data in this dict should not be persisted to files (e.g. notebooks).
|
| 146 |
+
display_id : str, bool optional
|
| 147 |
+
Set an id for the display.
|
| 148 |
+
This id can be used for updating this display area later via update_display.
|
| 149 |
+
If given as `True`, generate a new `display_id`
|
| 150 |
+
clear : bool, optional
|
| 151 |
+
Should the output area be cleared before displaying anything? If True,
|
| 152 |
+
this will wait for additional output before clearing. [default: False]
|
| 153 |
+
**kwargs : additional keyword-args, optional
|
| 154 |
+
Additional keyword-arguments are passed through to the display publisher.
|
| 155 |
+
|
| 156 |
+
Returns
|
| 157 |
+
-------
|
| 158 |
+
handle: DisplayHandle
|
| 159 |
+
Returns a handle on updatable displays for use with :func:`update_display`,
|
| 160 |
+
if `display_id` is given. Returns :any:`None` if no `display_id` is given
|
| 161 |
+
(default).
|
| 162 |
+
|
| 163 |
+
Examples
|
| 164 |
+
--------
|
| 165 |
+
>>> class Json(object):
|
| 166 |
+
... def __init__(self, json):
|
| 167 |
+
... self.json = json
|
| 168 |
+
... def _repr_pretty_(self, pp, cycle):
|
| 169 |
+
... import json
|
| 170 |
+
... pp.text(json.dumps(self.json, indent=2))
|
| 171 |
+
... def __repr__(self):
|
| 172 |
+
... return str(self.json)
|
| 173 |
+
...
|
| 174 |
+
|
| 175 |
+
>>> d = Json({1:2, 3: {4:5}})
|
| 176 |
+
|
| 177 |
+
>>> print(d)
|
| 178 |
+
{1: 2, 3: {4: 5}}
|
| 179 |
+
|
| 180 |
+
>>> display(d)
|
| 181 |
+
{
|
| 182 |
+
"1": 2,
|
| 183 |
+
"3": {
|
| 184 |
+
"4": 5
|
| 185 |
+
}
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
>>> def int_formatter(integer, pp, cycle):
|
| 189 |
+
... pp.text('I'*integer)
|
| 190 |
+
|
| 191 |
+
>>> plain = get_ipython().display_formatter.formatters['text/plain']
|
| 192 |
+
>>> plain.for_type(int, int_formatter)
|
| 193 |
+
<function _repr_pprint at 0x...>
|
| 194 |
+
>>> display(7-5)
|
| 195 |
+
II
|
| 196 |
+
|
| 197 |
+
>>> del plain.type_printers[int]
|
| 198 |
+
>>> display(7-5)
|
| 199 |
+
2
|
| 200 |
+
|
| 201 |
+
See Also
|
| 202 |
+
--------
|
| 203 |
+
:func:`update_display`
|
| 204 |
+
|
| 205 |
+
Notes
|
| 206 |
+
-----
|
| 207 |
+
In Python, objects can declare their textual representation using the
|
| 208 |
+
`__repr__` method. IPython expands on this idea and allows objects to declare
|
| 209 |
+
other, rich representations including:
|
| 210 |
+
|
| 211 |
+
- HTML
|
| 212 |
+
- JSON
|
| 213 |
+
- PNG
|
| 214 |
+
- JPEG
|
| 215 |
+
- SVG
|
| 216 |
+
- LaTeX
|
| 217 |
+
|
| 218 |
+
A single object can declare some or all of these representations; all are
|
| 219 |
+
handled by IPython's display system.
|
| 220 |
+
|
| 221 |
+
The main idea of the first approach is that you have to implement special
|
| 222 |
+
display methods when you define your class, one for each representation you
|
| 223 |
+
want to use. Here is a list of the names of the special methods and the
|
| 224 |
+
values they must return:
|
| 225 |
+
|
| 226 |
+
- `_repr_html_`: return raw HTML as a string, or a tuple (see below).
|
| 227 |
+
- `_repr_json_`: return a JSONable dict, or a tuple (see below).
|
| 228 |
+
- `_repr_jpeg_`: return raw JPEG data, or a tuple (see below).
|
| 229 |
+
- `_repr_png_`: return raw PNG data, or a tuple (see below).
|
| 230 |
+
- `_repr_svg_`: return raw SVG data as a string, or a tuple (see below).
|
| 231 |
+
- `_repr_latex_`: return LaTeX commands in a string surrounded by "$",
|
| 232 |
+
or a tuple (see below).
|
| 233 |
+
- `_repr_mimebundle_`: return a full mimebundle containing the mapping
|
| 234 |
+
from all mimetypes to data.
|
| 235 |
+
Use this for any mime-type not listed above.
|
| 236 |
+
|
| 237 |
+
The above functions may also return the object's metadata alonside the
|
| 238 |
+
data. If the metadata is available, the functions will return a tuple
|
| 239 |
+
containing the data and metadata, in that order. If there is no metadata
|
| 240 |
+
available, then the functions will return the data only.
|
| 241 |
+
|
| 242 |
+
When you are directly writing your own classes, you can adapt them for
|
| 243 |
+
display in IPython by following the above approach. But in practice, you
|
| 244 |
+
often need to work with existing classes that you can't easily modify.
|
| 245 |
+
|
| 246 |
+
You can refer to the documentation on integrating with the display system in
|
| 247 |
+
order to register custom formatters for already existing types
|
| 248 |
+
(:ref:`integrating_rich_display`).
|
| 249 |
+
|
| 250 |
+
.. versionadded:: 5.4 display available without import
|
| 251 |
+
.. versionadded:: 6.1 display available without import
|
| 252 |
+
|
| 253 |
+
Since IPython 5.4 and 6.1 :func:`display` is automatically made available to
|
| 254 |
+
the user without import. If you are using display in a document that might
|
| 255 |
+
be used in a pure python context or with older version of IPython, use the
|
| 256 |
+
following import at the top of your file::
|
| 257 |
+
|
| 258 |
+
from IPython.display import display
|
| 259 |
+
|
| 260 |
+
"""
|
| 261 |
+
from IPython.core.interactiveshell import InteractiveShell
|
| 262 |
+
|
| 263 |
+
if not InteractiveShell.initialized():
|
| 264 |
+
# Directly print objects.
|
| 265 |
+
print(*objs)
|
| 266 |
+
return
|
| 267 |
+
|
| 268 |
+
if transient is None:
|
| 269 |
+
transient = {}
|
| 270 |
+
if metadata is None:
|
| 271 |
+
metadata={}
|
| 272 |
+
if display_id:
|
| 273 |
+
if display_id is True:
|
| 274 |
+
display_id = _new_id()
|
| 275 |
+
transient['display_id'] = display_id
|
| 276 |
+
if kwargs.get('update') and 'display_id' not in transient:
|
| 277 |
+
raise TypeError('display_id required for update_display')
|
| 278 |
+
if transient:
|
| 279 |
+
kwargs['transient'] = transient
|
| 280 |
+
|
| 281 |
+
if not objs and display_id:
|
| 282 |
+
# if given no objects, but still a request for a display_id,
|
| 283 |
+
# we assume the user wants to insert an empty output that
|
| 284 |
+
# can be updated later
|
| 285 |
+
objs = [{}]
|
| 286 |
+
raw = True
|
| 287 |
+
|
| 288 |
+
if not raw:
|
| 289 |
+
format = InteractiveShell.instance().display_formatter.format
|
| 290 |
+
|
| 291 |
+
if clear:
|
| 292 |
+
clear_output(wait=True)
|
| 293 |
+
|
| 294 |
+
for obj in objs:
|
| 295 |
+
if raw:
|
| 296 |
+
publish_display_data(data=obj, metadata=metadata, **kwargs)
|
| 297 |
+
else:
|
| 298 |
+
format_dict, md_dict = format(obj, include=include, exclude=exclude)
|
| 299 |
+
if not format_dict:
|
| 300 |
+
# nothing to display (e.g. _ipython_display_ took over)
|
| 301 |
+
continue
|
| 302 |
+
if metadata:
|
| 303 |
+
# kwarg-specified metadata gets precedence
|
| 304 |
+
_merge(md_dict, metadata)
|
| 305 |
+
publish_display_data(data=format_dict, metadata=md_dict, **kwargs)
|
| 306 |
+
if display_id:
|
| 307 |
+
return DisplayHandle(display_id)
|
| 308 |
+
|
| 309 |
+
|
| 310 |
+
# use * for keyword-only display_id arg
|
| 311 |
+
def update_display(obj, *, display_id, **kwargs):
|
| 312 |
+
"""Update an existing display by id
|
| 313 |
+
|
| 314 |
+
Parameters
|
| 315 |
+
----------
|
| 316 |
+
obj
|
| 317 |
+
The object with which to update the display
|
| 318 |
+
display_id : keyword-only
|
| 319 |
+
The id of the display to update
|
| 320 |
+
|
| 321 |
+
See Also
|
| 322 |
+
--------
|
| 323 |
+
:func:`display`
|
| 324 |
+
"""
|
| 325 |
+
kwargs['update'] = True
|
| 326 |
+
display(obj, display_id=display_id, **kwargs)
|
| 327 |
+
|
| 328 |
+
|
| 329 |
+
class DisplayHandle(object):
|
| 330 |
+
"""A handle on an updatable display
|
| 331 |
+
|
| 332 |
+
Call `.update(obj)` to display a new object.
|
| 333 |
+
|
| 334 |
+
Call `.display(obj`) to add a new instance of this display,
|
| 335 |
+
and update existing instances.
|
| 336 |
+
|
| 337 |
+
See Also
|
| 338 |
+
--------
|
| 339 |
+
|
| 340 |
+
:func:`display`, :func:`update_display`
|
| 341 |
+
|
| 342 |
+
"""
|
| 343 |
+
|
| 344 |
+
def __init__(self, display_id=None):
|
| 345 |
+
if display_id is None:
|
| 346 |
+
display_id = _new_id()
|
| 347 |
+
self.display_id = display_id
|
| 348 |
+
|
| 349 |
+
def __repr__(self):
|
| 350 |
+
return "<%s display_id=%s>" % (self.__class__.__name__, self.display_id)
|
| 351 |
+
|
| 352 |
+
def display(self, obj, **kwargs):
|
| 353 |
+
"""Make a new display with my id, updating existing instances.
|
| 354 |
+
|
| 355 |
+
Parameters
|
| 356 |
+
----------
|
| 357 |
+
obj
|
| 358 |
+
object to display
|
| 359 |
+
**kwargs
|
| 360 |
+
additional keyword arguments passed to display
|
| 361 |
+
"""
|
| 362 |
+
display(obj, display_id=self.display_id, **kwargs)
|
| 363 |
+
|
| 364 |
+
def update(self, obj, **kwargs):
|
| 365 |
+
"""Update existing displays with my id
|
| 366 |
+
|
| 367 |
+
Parameters
|
| 368 |
+
----------
|
| 369 |
+
obj
|
| 370 |
+
object to display
|
| 371 |
+
**kwargs
|
| 372 |
+
additional keyword arguments passed to update_display
|
| 373 |
+
"""
|
| 374 |
+
update_display(obj, display_id=self.display_id, **kwargs)
|
| 375 |
+
|
| 376 |
+
|
| 377 |
+
def clear_output(wait=False):
|
| 378 |
+
"""Clear the output of the current cell receiving output.
|
| 379 |
+
|
| 380 |
+
Parameters
|
| 381 |
+
----------
|
| 382 |
+
wait : bool [default: false]
|
| 383 |
+
Wait to clear the output until new output is available to replace it."""
|
| 384 |
+
from IPython.core.interactiveshell import InteractiveShell
|
| 385 |
+
if InteractiveShell.initialized():
|
| 386 |
+
InteractiveShell.instance().display_pub.clear_output(wait)
|
| 387 |
+
else:
|
| 388 |
+
print('\033[2K\r', end='')
|
| 389 |
+
sys.stdout.flush()
|
| 390 |
+
print('\033[2K\r', end='')
|
| 391 |
+
sys.stderr.flush()
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/display_trap.py
ADDED
|
@@ -0,0 +1,70 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
A context manager for handling sys.displayhook.
|
| 4 |
+
|
| 5 |
+
Authors:
|
| 6 |
+
|
| 7 |
+
* Robert Kern
|
| 8 |
+
* Brian Granger
|
| 9 |
+
"""
|
| 10 |
+
|
| 11 |
+
#-----------------------------------------------------------------------------
|
| 12 |
+
# Copyright (C) 2008-2011 The IPython Development Team
|
| 13 |
+
#
|
| 14 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 15 |
+
# the file COPYING, distributed as part of this software.
|
| 16 |
+
#-----------------------------------------------------------------------------
|
| 17 |
+
|
| 18 |
+
#-----------------------------------------------------------------------------
|
| 19 |
+
# Imports
|
| 20 |
+
#-----------------------------------------------------------------------------
|
| 21 |
+
|
| 22 |
+
import sys
|
| 23 |
+
|
| 24 |
+
from traitlets.config.configurable import Configurable
|
| 25 |
+
from traitlets import Any
|
| 26 |
+
|
| 27 |
+
#-----------------------------------------------------------------------------
|
| 28 |
+
# Classes and functions
|
| 29 |
+
#-----------------------------------------------------------------------------
|
| 30 |
+
|
| 31 |
+
|
| 32 |
+
class DisplayTrap(Configurable):
|
| 33 |
+
"""Object to manage sys.displayhook.
|
| 34 |
+
|
| 35 |
+
This came from IPython.core.kernel.display_hook, but is simplified
|
| 36 |
+
(no callbacks or formatters) until more of the core is refactored.
|
| 37 |
+
"""
|
| 38 |
+
|
| 39 |
+
hook = Any()
|
| 40 |
+
|
| 41 |
+
def __init__(self, hook=None):
|
| 42 |
+
super(DisplayTrap, self).__init__(hook=hook, config=None)
|
| 43 |
+
self.old_hook = None
|
| 44 |
+
# We define this to track if a single BuiltinTrap is nested.
|
| 45 |
+
# Only turn off the trap when the outermost call to __exit__ is made.
|
| 46 |
+
self._nested_level = 0
|
| 47 |
+
|
| 48 |
+
def __enter__(self):
|
| 49 |
+
if self._nested_level == 0:
|
| 50 |
+
self.set()
|
| 51 |
+
self._nested_level += 1
|
| 52 |
+
return self
|
| 53 |
+
|
| 54 |
+
def __exit__(self, type, value, traceback):
|
| 55 |
+
if self._nested_level == 1:
|
| 56 |
+
self.unset()
|
| 57 |
+
self._nested_level -= 1
|
| 58 |
+
# Returning False will cause exceptions to propagate
|
| 59 |
+
return False
|
| 60 |
+
|
| 61 |
+
def set(self):
|
| 62 |
+
"""Set the hook."""
|
| 63 |
+
if sys.displayhook is not self.hook:
|
| 64 |
+
self.old_hook = sys.displayhook
|
| 65 |
+
sys.displayhook = self.hook
|
| 66 |
+
|
| 67 |
+
def unset(self):
|
| 68 |
+
"""Unset the hook."""
|
| 69 |
+
sys.displayhook = self.old_hook
|
| 70 |
+
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/displayhook.py
ADDED
|
@@ -0,0 +1,336 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Displayhook for IPython.
|
| 3 |
+
|
| 4 |
+
This defines a callable class that IPython uses for `sys.displayhook`.
|
| 5 |
+
"""
|
| 6 |
+
|
| 7 |
+
# Copyright (c) IPython Development Team.
|
| 8 |
+
# Distributed under the terms of the Modified BSD License.
|
| 9 |
+
|
| 10 |
+
import builtins as builtin_mod
|
| 11 |
+
import sys
|
| 12 |
+
import io as _io
|
| 13 |
+
import tokenize
|
| 14 |
+
|
| 15 |
+
from traitlets.config.configurable import Configurable
|
| 16 |
+
from traitlets import Instance, Float
|
| 17 |
+
from warnings import warn
|
| 18 |
+
|
| 19 |
+
# TODO: Move the various attributes (cache_size, [others now moved]). Some
|
| 20 |
+
# of these are also attributes of InteractiveShell. They should be on ONE object
|
| 21 |
+
# only and the other objects should ask that one object for their values.
|
| 22 |
+
|
| 23 |
+
class DisplayHook(Configurable):
|
| 24 |
+
"""The custom IPython displayhook to replace sys.displayhook.
|
| 25 |
+
|
| 26 |
+
This class does many things, but the basic idea is that it is a callable
|
| 27 |
+
that gets called anytime user code returns a value.
|
| 28 |
+
"""
|
| 29 |
+
|
| 30 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC',
|
| 31 |
+
allow_none=True)
|
| 32 |
+
exec_result = Instance('IPython.core.interactiveshell.ExecutionResult',
|
| 33 |
+
allow_none=True)
|
| 34 |
+
cull_fraction = Float(0.2)
|
| 35 |
+
|
| 36 |
+
def __init__(self, shell=None, cache_size=1000, **kwargs):
|
| 37 |
+
super(DisplayHook, self).__init__(shell=shell, **kwargs)
|
| 38 |
+
cache_size_min = 3
|
| 39 |
+
if cache_size <= 0:
|
| 40 |
+
self.do_full_cache = 0
|
| 41 |
+
cache_size = 0
|
| 42 |
+
elif cache_size < cache_size_min:
|
| 43 |
+
self.do_full_cache = 0
|
| 44 |
+
cache_size = 0
|
| 45 |
+
warn('caching was disabled (min value for cache size is %s).' %
|
| 46 |
+
cache_size_min,stacklevel=3)
|
| 47 |
+
else:
|
| 48 |
+
self.do_full_cache = 1
|
| 49 |
+
|
| 50 |
+
self.cache_size = cache_size
|
| 51 |
+
|
| 52 |
+
# we need a reference to the user-level namespace
|
| 53 |
+
self.shell = shell
|
| 54 |
+
|
| 55 |
+
self._,self.__,self.___ = '','',''
|
| 56 |
+
|
| 57 |
+
# these are deliberately global:
|
| 58 |
+
to_user_ns = {'_':self._,'__':self.__,'___':self.___}
|
| 59 |
+
self.shell.user_ns.update(to_user_ns)
|
| 60 |
+
|
| 61 |
+
@property
|
| 62 |
+
def prompt_count(self):
|
| 63 |
+
return self.shell.execution_count
|
| 64 |
+
|
| 65 |
+
#-------------------------------------------------------------------------
|
| 66 |
+
# Methods used in __call__. Override these methods to modify the behavior
|
| 67 |
+
# of the displayhook.
|
| 68 |
+
#-------------------------------------------------------------------------
|
| 69 |
+
|
| 70 |
+
def check_for_underscore(self):
|
| 71 |
+
"""Check if the user has set the '_' variable by hand."""
|
| 72 |
+
# If something injected a '_' variable in __builtin__, delete
|
| 73 |
+
# ipython's automatic one so we don't clobber that. gettext() in
|
| 74 |
+
# particular uses _, so we need to stay away from it.
|
| 75 |
+
if '_' in builtin_mod.__dict__:
|
| 76 |
+
try:
|
| 77 |
+
user_value = self.shell.user_ns['_']
|
| 78 |
+
if user_value is not self._:
|
| 79 |
+
return
|
| 80 |
+
del self.shell.user_ns['_']
|
| 81 |
+
except KeyError:
|
| 82 |
+
pass
|
| 83 |
+
|
| 84 |
+
def quiet(self):
|
| 85 |
+
"""Should we silence the display hook because of ';'?"""
|
| 86 |
+
# do not print output if input ends in ';'
|
| 87 |
+
|
| 88 |
+
try:
|
| 89 |
+
cell = self.shell.history_manager.input_hist_parsed[-1]
|
| 90 |
+
except IndexError:
|
| 91 |
+
# some uses of ipshellembed may fail here
|
| 92 |
+
return False
|
| 93 |
+
|
| 94 |
+
return self.semicolon_at_end_of_expression(cell)
|
| 95 |
+
|
| 96 |
+
@staticmethod
|
| 97 |
+
def semicolon_at_end_of_expression(expression):
|
| 98 |
+
"""Parse Python expression and detects whether last token is ';'"""
|
| 99 |
+
|
| 100 |
+
sio = _io.StringIO(expression)
|
| 101 |
+
tokens = list(tokenize.generate_tokens(sio.readline))
|
| 102 |
+
|
| 103 |
+
for token in reversed(tokens):
|
| 104 |
+
if token[0] in (tokenize.ENDMARKER, tokenize.NL, tokenize.NEWLINE, tokenize.COMMENT):
|
| 105 |
+
continue
|
| 106 |
+
if (token[0] == tokenize.OP) and (token[1] == ';'):
|
| 107 |
+
return True
|
| 108 |
+
else:
|
| 109 |
+
return False
|
| 110 |
+
|
| 111 |
+
def start_displayhook(self):
|
| 112 |
+
"""Start the displayhook, initializing resources."""
|
| 113 |
+
pass
|
| 114 |
+
|
| 115 |
+
def write_output_prompt(self):
|
| 116 |
+
"""Write the output prompt.
|
| 117 |
+
|
| 118 |
+
The default implementation simply writes the prompt to
|
| 119 |
+
``sys.stdout``.
|
| 120 |
+
"""
|
| 121 |
+
# Use write, not print which adds an extra space.
|
| 122 |
+
sys.stdout.write(self.shell.separate_out)
|
| 123 |
+
outprompt = 'Out[{}]: '.format(self.shell.execution_count)
|
| 124 |
+
if self.do_full_cache:
|
| 125 |
+
sys.stdout.write(outprompt)
|
| 126 |
+
|
| 127 |
+
def compute_format_data(self, result):
|
| 128 |
+
"""Compute format data of the object to be displayed.
|
| 129 |
+
|
| 130 |
+
The format data is a generalization of the :func:`repr` of an object.
|
| 131 |
+
In the default implementation the format data is a :class:`dict` of
|
| 132 |
+
key value pair where the keys are valid MIME types and the values
|
| 133 |
+
are JSON'able data structure containing the raw data for that MIME
|
| 134 |
+
type. It is up to frontends to determine pick a MIME to to use and
|
| 135 |
+
display that data in an appropriate manner.
|
| 136 |
+
|
| 137 |
+
This method only computes the format data for the object and should
|
| 138 |
+
NOT actually print or write that to a stream.
|
| 139 |
+
|
| 140 |
+
Parameters
|
| 141 |
+
----------
|
| 142 |
+
result : object
|
| 143 |
+
The Python object passed to the display hook, whose format will be
|
| 144 |
+
computed.
|
| 145 |
+
|
| 146 |
+
Returns
|
| 147 |
+
-------
|
| 148 |
+
(format_dict, md_dict) : dict
|
| 149 |
+
format_dict is a :class:`dict` whose keys are valid MIME types and values are
|
| 150 |
+
JSON'able raw data for that MIME type. It is recommended that
|
| 151 |
+
all return values of this should always include the "text/plain"
|
| 152 |
+
MIME type representation of the object.
|
| 153 |
+
md_dict is a :class:`dict` with the same MIME type keys
|
| 154 |
+
of metadata associated with each output.
|
| 155 |
+
|
| 156 |
+
"""
|
| 157 |
+
return self.shell.display_formatter.format(result)
|
| 158 |
+
|
| 159 |
+
# This can be set to True by the write_output_prompt method in a subclass
|
| 160 |
+
prompt_end_newline = False
|
| 161 |
+
|
| 162 |
+
def write_format_data(self, format_dict, md_dict=None) -> None:
|
| 163 |
+
"""Write the format data dict to the frontend.
|
| 164 |
+
|
| 165 |
+
This default version of this method simply writes the plain text
|
| 166 |
+
representation of the object to ``sys.stdout``. Subclasses should
|
| 167 |
+
override this method to send the entire `format_dict` to the
|
| 168 |
+
frontends.
|
| 169 |
+
|
| 170 |
+
Parameters
|
| 171 |
+
----------
|
| 172 |
+
format_dict : dict
|
| 173 |
+
The format dict for the object passed to `sys.displayhook`.
|
| 174 |
+
md_dict : dict (optional)
|
| 175 |
+
The metadata dict to be associated with the display data.
|
| 176 |
+
"""
|
| 177 |
+
if 'text/plain' not in format_dict:
|
| 178 |
+
# nothing to do
|
| 179 |
+
return
|
| 180 |
+
# We want to print because we want to always make sure we have a
|
| 181 |
+
# newline, even if all the prompt separators are ''. This is the
|
| 182 |
+
# standard IPython behavior.
|
| 183 |
+
result_repr = format_dict['text/plain']
|
| 184 |
+
if '\n' in result_repr:
|
| 185 |
+
# So that multi-line strings line up with the left column of
|
| 186 |
+
# the screen, instead of having the output prompt mess up
|
| 187 |
+
# their first line.
|
| 188 |
+
# We use the prompt template instead of the expanded prompt
|
| 189 |
+
# because the expansion may add ANSI escapes that will interfere
|
| 190 |
+
# with our ability to determine whether or not we should add
|
| 191 |
+
# a newline.
|
| 192 |
+
if not self.prompt_end_newline:
|
| 193 |
+
# But avoid extraneous empty lines.
|
| 194 |
+
result_repr = '\n' + result_repr
|
| 195 |
+
|
| 196 |
+
try:
|
| 197 |
+
print(result_repr)
|
| 198 |
+
except UnicodeEncodeError:
|
| 199 |
+
# If a character is not supported by the terminal encoding replace
|
| 200 |
+
# it with its \u or \x representation
|
| 201 |
+
print(result_repr.encode(sys.stdout.encoding,'backslashreplace').decode(sys.stdout.encoding))
|
| 202 |
+
|
| 203 |
+
def update_user_ns(self, result):
|
| 204 |
+
"""Update user_ns with various things like _, __, _1, etc."""
|
| 205 |
+
|
| 206 |
+
# Avoid recursive reference when displaying _oh/Out
|
| 207 |
+
if self.cache_size and result is not self.shell.user_ns['_oh']:
|
| 208 |
+
if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache:
|
| 209 |
+
self.cull_cache()
|
| 210 |
+
|
| 211 |
+
# Don't overwrite '_' and friends if '_' is in __builtin__
|
| 212 |
+
# (otherwise we cause buggy behavior for things like gettext). and
|
| 213 |
+
# do not overwrite _, __ or ___ if one of these has been assigned
|
| 214 |
+
# by the user.
|
| 215 |
+
update_unders = True
|
| 216 |
+
for unders in ['_'*i for i in range(1,4)]:
|
| 217 |
+
if not unders in self.shell.user_ns:
|
| 218 |
+
continue
|
| 219 |
+
if getattr(self, unders) is not self.shell.user_ns.get(unders):
|
| 220 |
+
update_unders = False
|
| 221 |
+
|
| 222 |
+
self.___ = self.__
|
| 223 |
+
self.__ = self._
|
| 224 |
+
self._ = result
|
| 225 |
+
|
| 226 |
+
if ('_' not in builtin_mod.__dict__) and (update_unders):
|
| 227 |
+
self.shell.push({'_':self._,
|
| 228 |
+
'__':self.__,
|
| 229 |
+
'___':self.___}, interactive=False)
|
| 230 |
+
|
| 231 |
+
# hackish access to top-level namespace to create _1,_2... dynamically
|
| 232 |
+
to_main = {}
|
| 233 |
+
if self.do_full_cache:
|
| 234 |
+
new_result = '_%s' % self.prompt_count
|
| 235 |
+
to_main[new_result] = result
|
| 236 |
+
self.shell.push(to_main, interactive=False)
|
| 237 |
+
self.shell.user_ns['_oh'][self.prompt_count] = result
|
| 238 |
+
|
| 239 |
+
def fill_exec_result(self, result):
|
| 240 |
+
if self.exec_result is not None:
|
| 241 |
+
self.exec_result.result = result
|
| 242 |
+
|
| 243 |
+
def log_output(self, format_dict):
|
| 244 |
+
"""Log the output."""
|
| 245 |
+
if 'text/plain' not in format_dict:
|
| 246 |
+
# nothing to do
|
| 247 |
+
return
|
| 248 |
+
if self.shell.logger.log_output:
|
| 249 |
+
self.shell.logger.log_write(format_dict['text/plain'], 'output')
|
| 250 |
+
self.shell.history_manager.output_hist_reprs[self.prompt_count] = \
|
| 251 |
+
format_dict['text/plain']
|
| 252 |
+
|
| 253 |
+
def finish_displayhook(self):
|
| 254 |
+
"""Finish up all displayhook activities."""
|
| 255 |
+
sys.stdout.write(self.shell.separate_out2)
|
| 256 |
+
sys.stdout.flush()
|
| 257 |
+
|
| 258 |
+
def __call__(self, result=None):
|
| 259 |
+
"""Printing with history cache management.
|
| 260 |
+
|
| 261 |
+
This is invoked every time the interpreter needs to print, and is
|
| 262 |
+
activated by setting the variable sys.displayhook to it.
|
| 263 |
+
"""
|
| 264 |
+
self.check_for_underscore()
|
| 265 |
+
if result is not None and not self.quiet():
|
| 266 |
+
self.start_displayhook()
|
| 267 |
+
self.write_output_prompt()
|
| 268 |
+
format_dict, md_dict = self.compute_format_data(result)
|
| 269 |
+
self.update_user_ns(result)
|
| 270 |
+
self.fill_exec_result(result)
|
| 271 |
+
if format_dict:
|
| 272 |
+
self.write_format_data(format_dict, md_dict)
|
| 273 |
+
self.log_output(format_dict)
|
| 274 |
+
self.finish_displayhook()
|
| 275 |
+
|
| 276 |
+
def cull_cache(self):
|
| 277 |
+
"""Output cache is full, cull the oldest entries"""
|
| 278 |
+
oh = self.shell.user_ns.get('_oh', {})
|
| 279 |
+
sz = len(oh)
|
| 280 |
+
cull_count = max(int(sz * self.cull_fraction), 2)
|
| 281 |
+
warn('Output cache limit (currently {sz} entries) hit.\n'
|
| 282 |
+
'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count))
|
| 283 |
+
|
| 284 |
+
for i, n in enumerate(sorted(oh)):
|
| 285 |
+
if i >= cull_count:
|
| 286 |
+
break
|
| 287 |
+
self.shell.user_ns.pop('_%i' % n, None)
|
| 288 |
+
oh.pop(n, None)
|
| 289 |
+
|
| 290 |
+
|
| 291 |
+
def flush(self):
|
| 292 |
+
if not self.do_full_cache:
|
| 293 |
+
raise ValueError("You shouldn't have reached the cache flush "
|
| 294 |
+
"if full caching is not enabled!")
|
| 295 |
+
# delete auto-generated vars from global namespace
|
| 296 |
+
|
| 297 |
+
for n in range(1,self.prompt_count + 1):
|
| 298 |
+
key = '_'+repr(n)
|
| 299 |
+
try:
|
| 300 |
+
del self.shell.user_ns_hidden[key]
|
| 301 |
+
except KeyError:
|
| 302 |
+
pass
|
| 303 |
+
try:
|
| 304 |
+
del self.shell.user_ns[key]
|
| 305 |
+
except KeyError:
|
| 306 |
+
pass
|
| 307 |
+
# In some embedded circumstances, the user_ns doesn't have the
|
| 308 |
+
# '_oh' key set up.
|
| 309 |
+
oh = self.shell.user_ns.get('_oh', None)
|
| 310 |
+
if oh is not None:
|
| 311 |
+
oh.clear()
|
| 312 |
+
|
| 313 |
+
# Release our own references to objects:
|
| 314 |
+
self._, self.__, self.___ = '', '', ''
|
| 315 |
+
|
| 316 |
+
if '_' not in builtin_mod.__dict__:
|
| 317 |
+
self.shell.user_ns.update({'_':self._,'__':self.__,'___':self.___})
|
| 318 |
+
import gc
|
| 319 |
+
# TODO: Is this really needed?
|
| 320 |
+
# IronPython blocks here forever
|
| 321 |
+
if sys.platform != "cli":
|
| 322 |
+
gc.collect()
|
| 323 |
+
|
| 324 |
+
|
| 325 |
+
class CapturingDisplayHook(object):
|
| 326 |
+
def __init__(self, shell, outputs=None):
|
| 327 |
+
self.shell = shell
|
| 328 |
+
if outputs is None:
|
| 329 |
+
outputs = []
|
| 330 |
+
self.outputs = outputs
|
| 331 |
+
|
| 332 |
+
def __call__(self, result=None):
|
| 333 |
+
if result is None:
|
| 334 |
+
return
|
| 335 |
+
format_dict, md_dict = self.shell.display_formatter.format(result)
|
| 336 |
+
self.outputs.append({ 'data': format_dict, 'metadata': md_dict })
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/error.py
ADDED
|
@@ -0,0 +1,60 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
Global exception classes for IPython.core.
|
| 4 |
+
|
| 5 |
+
Authors:
|
| 6 |
+
|
| 7 |
+
* Brian Granger
|
| 8 |
+
* Fernando Perez
|
| 9 |
+
* Min Ragan-Kelley
|
| 10 |
+
|
| 11 |
+
Notes
|
| 12 |
+
-----
|
| 13 |
+
"""
|
| 14 |
+
|
| 15 |
+
#-----------------------------------------------------------------------------
|
| 16 |
+
# Copyright (C) 2008 The IPython Development Team
|
| 17 |
+
#
|
| 18 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 19 |
+
# the file COPYING, distributed as part of this software.
|
| 20 |
+
#-----------------------------------------------------------------------------
|
| 21 |
+
|
| 22 |
+
#-----------------------------------------------------------------------------
|
| 23 |
+
# Imports
|
| 24 |
+
#-----------------------------------------------------------------------------
|
| 25 |
+
|
| 26 |
+
#-----------------------------------------------------------------------------
|
| 27 |
+
# Exception classes
|
| 28 |
+
#-----------------------------------------------------------------------------
|
| 29 |
+
|
| 30 |
+
class IPythonCoreError(Exception):
|
| 31 |
+
pass
|
| 32 |
+
|
| 33 |
+
|
| 34 |
+
class TryNext(IPythonCoreError):
|
| 35 |
+
"""Try next hook exception.
|
| 36 |
+
|
| 37 |
+
Raise this in your hook function to indicate that the next hook handler
|
| 38 |
+
should be used to handle the operation.
|
| 39 |
+
"""
|
| 40 |
+
|
| 41 |
+
class UsageError(IPythonCoreError):
|
| 42 |
+
"""Error in magic function arguments, etc.
|
| 43 |
+
|
| 44 |
+
Something that probably won't warrant a full traceback, but should
|
| 45 |
+
nevertheless interrupt a macro / batch file.
|
| 46 |
+
"""
|
| 47 |
+
|
| 48 |
+
class StdinNotImplementedError(IPythonCoreError, NotImplementedError):
|
| 49 |
+
"""raw_input was requested in a context where it is not supported
|
| 50 |
+
|
| 51 |
+
For use in IPython kernels, where only some frontends may support
|
| 52 |
+
stdin requests.
|
| 53 |
+
"""
|
| 54 |
+
|
| 55 |
+
class InputRejected(Exception):
|
| 56 |
+
"""Input rejected by ast transformer.
|
| 57 |
+
|
| 58 |
+
Raise this in your NodeTransformer to indicate that InteractiveShell should
|
| 59 |
+
not execute the supplied input.
|
| 60 |
+
"""
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/events.py
ADDED
|
@@ -0,0 +1,158 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Infrastructure for registering and firing callbacks on application events.
|
| 2 |
+
|
| 3 |
+
Unlike :mod:`IPython.core.hooks`, which lets end users set single functions to
|
| 4 |
+
be called at specific times, or a collection of alternative methods to try,
|
| 5 |
+
callbacks are designed to be used by extension authors. A number of callbacks
|
| 6 |
+
can be registered for the same event without needing to be aware of one another.
|
| 7 |
+
|
| 8 |
+
The functions defined in this module are no-ops indicating the names of available
|
| 9 |
+
events and the arguments which will be passed to them.
|
| 10 |
+
|
| 11 |
+
.. note::
|
| 12 |
+
|
| 13 |
+
This API is experimental in IPython 2.0, and may be revised in future versions.
|
| 14 |
+
"""
|
| 15 |
+
|
| 16 |
+
|
| 17 |
+
class EventManager(object):
|
| 18 |
+
"""Manage a collection of events and a sequence of callbacks for each.
|
| 19 |
+
|
| 20 |
+
This is attached to :class:`~IPython.core.interactiveshell.InteractiveShell`
|
| 21 |
+
instances as an ``events`` attribute.
|
| 22 |
+
|
| 23 |
+
.. note::
|
| 24 |
+
|
| 25 |
+
This API is experimental in IPython 2.0, and may be revised in future versions.
|
| 26 |
+
"""
|
| 27 |
+
|
| 28 |
+
def __init__(self, shell, available_events, print_on_error=True):
|
| 29 |
+
"""Initialise the :class:`CallbackManager`.
|
| 30 |
+
|
| 31 |
+
Parameters
|
| 32 |
+
----------
|
| 33 |
+
shell
|
| 34 |
+
The :class:`~IPython.core.interactiveshell.InteractiveShell` instance
|
| 35 |
+
available_events
|
| 36 |
+
An iterable of names for callback events.
|
| 37 |
+
print_on_error:
|
| 38 |
+
A boolean flag to set whether the EventManager will print a warning which a event errors.
|
| 39 |
+
"""
|
| 40 |
+
self.shell = shell
|
| 41 |
+
self.callbacks = {n:[] for n in available_events}
|
| 42 |
+
self.print_on_error = print_on_error
|
| 43 |
+
|
| 44 |
+
def register(self, event, function):
|
| 45 |
+
"""Register a new event callback.
|
| 46 |
+
|
| 47 |
+
Parameters
|
| 48 |
+
----------
|
| 49 |
+
event : str
|
| 50 |
+
The event for which to register this callback.
|
| 51 |
+
function : callable
|
| 52 |
+
A function to be called on the given event. It should take the same
|
| 53 |
+
parameters as the appropriate callback prototype.
|
| 54 |
+
|
| 55 |
+
Raises
|
| 56 |
+
------
|
| 57 |
+
TypeError
|
| 58 |
+
If ``function`` is not callable.
|
| 59 |
+
KeyError
|
| 60 |
+
If ``event`` is not one of the known events.
|
| 61 |
+
"""
|
| 62 |
+
if not callable(function):
|
| 63 |
+
raise TypeError('Need a callable, got %r' % function)
|
| 64 |
+
if function not in self.callbacks[event]:
|
| 65 |
+
self.callbacks[event].append(function)
|
| 66 |
+
|
| 67 |
+
def unregister(self, event, function):
|
| 68 |
+
"""Remove a callback from the given event."""
|
| 69 |
+
if function in self.callbacks[event]:
|
| 70 |
+
return self.callbacks[event].remove(function)
|
| 71 |
+
|
| 72 |
+
raise ValueError('Function {!r} is not registered as a {} callback'.format(function, event))
|
| 73 |
+
|
| 74 |
+
def trigger(self, event, *args, **kwargs):
|
| 75 |
+
"""Call callbacks for ``event``.
|
| 76 |
+
|
| 77 |
+
Any additional arguments are passed to all callbacks registered for this
|
| 78 |
+
event. Exceptions raised by callbacks are caught, and a message printed.
|
| 79 |
+
"""
|
| 80 |
+
for func in self.callbacks[event][:]:
|
| 81 |
+
try:
|
| 82 |
+
func(*args, **kwargs)
|
| 83 |
+
except (Exception, KeyboardInterrupt):
|
| 84 |
+
if self.print_on_error:
|
| 85 |
+
print(
|
| 86 |
+
"Error in callback {} (for {}), with arguments args {},kwargs {}:".format(
|
| 87 |
+
func, event, args, kwargs
|
| 88 |
+
)
|
| 89 |
+
)
|
| 90 |
+
self.shell.showtraceback()
|
| 91 |
+
|
| 92 |
+
# event_name -> prototype mapping
|
| 93 |
+
available_events = {}
|
| 94 |
+
|
| 95 |
+
def _define_event(callback_function):
|
| 96 |
+
available_events[callback_function.__name__] = callback_function
|
| 97 |
+
return callback_function
|
| 98 |
+
|
| 99 |
+
# ------------------------------------------------------------------------------
|
| 100 |
+
# Callback prototypes
|
| 101 |
+
#
|
| 102 |
+
# No-op functions which describe the names of available events and the
|
| 103 |
+
# signatures of callbacks for those events.
|
| 104 |
+
# ------------------------------------------------------------------------------
|
| 105 |
+
|
| 106 |
+
@_define_event
|
| 107 |
+
def pre_execute():
|
| 108 |
+
"""Fires before code is executed in response to user/frontend action.
|
| 109 |
+
|
| 110 |
+
This includes comm and widget messages and silent execution, as well as user
|
| 111 |
+
code cells.
|
| 112 |
+
"""
|
| 113 |
+
pass
|
| 114 |
+
|
| 115 |
+
@_define_event
|
| 116 |
+
def pre_run_cell(info):
|
| 117 |
+
"""Fires before user-entered code runs.
|
| 118 |
+
|
| 119 |
+
Parameters
|
| 120 |
+
----------
|
| 121 |
+
info : :class:`~IPython.core.interactiveshell.ExecutionInfo`
|
| 122 |
+
An object containing information used for the code execution.
|
| 123 |
+
"""
|
| 124 |
+
pass
|
| 125 |
+
|
| 126 |
+
@_define_event
|
| 127 |
+
def post_execute():
|
| 128 |
+
"""Fires after code is executed in response to user/frontend action.
|
| 129 |
+
|
| 130 |
+
This includes comm and widget messages and silent execution, as well as user
|
| 131 |
+
code cells.
|
| 132 |
+
"""
|
| 133 |
+
pass
|
| 134 |
+
|
| 135 |
+
@_define_event
|
| 136 |
+
def post_run_cell(result):
|
| 137 |
+
"""Fires after user-entered code runs.
|
| 138 |
+
|
| 139 |
+
Parameters
|
| 140 |
+
----------
|
| 141 |
+
result : :class:`~IPython.core.interactiveshell.ExecutionResult`
|
| 142 |
+
The object which will be returned as the execution result.
|
| 143 |
+
"""
|
| 144 |
+
pass
|
| 145 |
+
|
| 146 |
+
@_define_event
|
| 147 |
+
def shell_initialized(ip):
|
| 148 |
+
"""Fires after initialisation of :class:`~IPython.core.interactiveshell.InteractiveShell`.
|
| 149 |
+
|
| 150 |
+
This is before extensions and startup scripts are loaded, so it can only be
|
| 151 |
+
set by subclassing.
|
| 152 |
+
|
| 153 |
+
Parameters
|
| 154 |
+
----------
|
| 155 |
+
ip : :class:`~IPython.core.interactiveshell.InteractiveShell`
|
| 156 |
+
The newly initialised shell.
|
| 157 |
+
"""
|
| 158 |
+
pass
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/excolors.py
ADDED
|
@@ -0,0 +1,192 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""
|
| 3 |
+
Color schemes for exception handling code in IPython.
|
| 4 |
+
"""
|
| 5 |
+
|
| 6 |
+
import os
|
| 7 |
+
|
| 8 |
+
#*****************************************************************************
|
| 9 |
+
# Copyright (C) 2005-2006 Fernando Perez <fperez@colorado.edu>
|
| 10 |
+
#
|
| 11 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 12 |
+
# the file COPYING, distributed as part of this software.
|
| 13 |
+
#*****************************************************************************
|
| 14 |
+
|
| 15 |
+
from IPython.utils.coloransi import ColorSchemeTable, TermColors, ColorScheme
|
| 16 |
+
|
| 17 |
+
def exception_colors():
|
| 18 |
+
"""Return a color table with fields for exception reporting.
|
| 19 |
+
|
| 20 |
+
The table is an instance of ColorSchemeTable with schemes added for
|
| 21 |
+
'Neutral', 'Linux', 'LightBG' and 'NoColor' and fields for exception handling filled
|
| 22 |
+
in.
|
| 23 |
+
|
| 24 |
+
Examples:
|
| 25 |
+
|
| 26 |
+
>>> ec = exception_colors()
|
| 27 |
+
>>> ec.active_scheme_name
|
| 28 |
+
''
|
| 29 |
+
>>> print(ec.active_colors)
|
| 30 |
+
None
|
| 31 |
+
|
| 32 |
+
Now we activate a color scheme:
|
| 33 |
+
>>> ec.set_active_scheme('NoColor')
|
| 34 |
+
>>> ec.active_scheme_name
|
| 35 |
+
'NoColor'
|
| 36 |
+
>>> sorted(ec.active_colors.keys())
|
| 37 |
+
['Normal', 'breakpoint_disabled', 'breakpoint_enabled', 'caret', 'em',
|
| 38 |
+
'excName', 'filename', 'filenameEm', 'line', 'lineno', 'linenoEm', 'name',
|
| 39 |
+
'nameEm', 'normalEm', 'prompt', 'topline', 'vName', 'val', 'valEm']
|
| 40 |
+
|
| 41 |
+
"""
|
| 42 |
+
|
| 43 |
+
ex_colors = ColorSchemeTable()
|
| 44 |
+
|
| 45 |
+
# Populate it with color schemes
|
| 46 |
+
C = TermColors # shorthand and local lookup
|
| 47 |
+
ex_colors.add_scheme(
|
| 48 |
+
ColorScheme(
|
| 49 |
+
"NoColor",
|
| 50 |
+
{
|
| 51 |
+
# The color to be used for the top line
|
| 52 |
+
"topline": C.NoColor,
|
| 53 |
+
|
| 54 |
+
# The colors to be used in the traceback
|
| 55 |
+
"filename": C.NoColor,
|
| 56 |
+
"lineno": C.NoColor,
|
| 57 |
+
"name": C.NoColor,
|
| 58 |
+
"vName": C.NoColor,
|
| 59 |
+
"val": C.NoColor,
|
| 60 |
+
"em": C.NoColor,
|
| 61 |
+
|
| 62 |
+
# Emphasized colors for the last frame of the traceback
|
| 63 |
+
"normalEm": C.NoColor,
|
| 64 |
+
"filenameEm": C.NoColor,
|
| 65 |
+
"linenoEm": C.NoColor,
|
| 66 |
+
"nameEm": C.NoColor,
|
| 67 |
+
"valEm": C.NoColor,
|
| 68 |
+
|
| 69 |
+
# Colors for printing the exception
|
| 70 |
+
"excName": C.NoColor,
|
| 71 |
+
"line": C.NoColor,
|
| 72 |
+
"caret": C.NoColor,
|
| 73 |
+
"Normal": C.NoColor,
|
| 74 |
+
# debugger
|
| 75 |
+
"prompt": C.NoColor,
|
| 76 |
+
"breakpoint_enabled": C.NoColor,
|
| 77 |
+
"breakpoint_disabled": C.NoColor,
|
| 78 |
+
},
|
| 79 |
+
)
|
| 80 |
+
)
|
| 81 |
+
|
| 82 |
+
# make some schemes as instances so we can copy them for modification easily
|
| 83 |
+
ex_colors.add_scheme(
|
| 84 |
+
ColorScheme(
|
| 85 |
+
"Linux",
|
| 86 |
+
{
|
| 87 |
+
# The color to be used for the top line
|
| 88 |
+
"topline": C.LightRed,
|
| 89 |
+
# The colors to be used in the traceback
|
| 90 |
+
"filename": C.Green,
|
| 91 |
+
"lineno": C.Green,
|
| 92 |
+
"name": C.Purple,
|
| 93 |
+
"vName": C.Cyan,
|
| 94 |
+
"val": C.Green,
|
| 95 |
+
"em": C.LightCyan,
|
| 96 |
+
# Emphasized colors for the last frame of the traceback
|
| 97 |
+
"normalEm": C.LightCyan,
|
| 98 |
+
"filenameEm": C.LightGreen,
|
| 99 |
+
"linenoEm": C.LightGreen,
|
| 100 |
+
"nameEm": C.LightPurple,
|
| 101 |
+
"valEm": C.LightBlue,
|
| 102 |
+
# Colors for printing the exception
|
| 103 |
+
"excName": C.LightRed,
|
| 104 |
+
"line": C.Yellow,
|
| 105 |
+
"caret": C.White,
|
| 106 |
+
"Normal": C.Normal,
|
| 107 |
+
# debugger
|
| 108 |
+
"prompt": C.Green,
|
| 109 |
+
"breakpoint_enabled": C.LightRed,
|
| 110 |
+
"breakpoint_disabled": C.Red,
|
| 111 |
+
},
|
| 112 |
+
)
|
| 113 |
+
)
|
| 114 |
+
|
| 115 |
+
# For light backgrounds, swap dark/light colors
|
| 116 |
+
ex_colors.add_scheme(
|
| 117 |
+
ColorScheme(
|
| 118 |
+
"LightBG",
|
| 119 |
+
{
|
| 120 |
+
# The color to be used for the top line
|
| 121 |
+
"topline": C.Red,
|
| 122 |
+
|
| 123 |
+
# The colors to be used in the traceback
|
| 124 |
+
"filename": C.LightGreen,
|
| 125 |
+
"lineno": C.LightGreen,
|
| 126 |
+
"name": C.LightPurple,
|
| 127 |
+
"vName": C.Cyan,
|
| 128 |
+
"val": C.LightGreen,
|
| 129 |
+
"em": C.Cyan,
|
| 130 |
+
|
| 131 |
+
# Emphasized colors for the last frame of the traceback
|
| 132 |
+
"normalEm": C.Cyan,
|
| 133 |
+
"filenameEm": C.Green,
|
| 134 |
+
"linenoEm": C.Green,
|
| 135 |
+
"nameEm": C.Purple,
|
| 136 |
+
"valEm": C.Blue,
|
| 137 |
+
|
| 138 |
+
# Colors for printing the exception
|
| 139 |
+
"excName": C.Red,
|
| 140 |
+
# "line": C.Brown, # brown often is displayed as yellow
|
| 141 |
+
"line": C.Red,
|
| 142 |
+
"caret": C.Normal,
|
| 143 |
+
"Normal": C.Normal,
|
| 144 |
+
# debugger
|
| 145 |
+
"prompt": C.Blue,
|
| 146 |
+
"breakpoint_enabled": C.LightRed,
|
| 147 |
+
"breakpoint_disabled": C.Red,
|
| 148 |
+
},
|
| 149 |
+
)
|
| 150 |
+
)
|
| 151 |
+
|
| 152 |
+
ex_colors.add_scheme(
|
| 153 |
+
ColorScheme(
|
| 154 |
+
"Neutral",
|
| 155 |
+
{
|
| 156 |
+
# The color to be used for the top line
|
| 157 |
+
"topline": C.Red,
|
| 158 |
+
# The colors to be used in the traceback
|
| 159 |
+
"filename": C.LightGreen,
|
| 160 |
+
"lineno": C.LightGreen,
|
| 161 |
+
"name": C.LightPurple,
|
| 162 |
+
"vName": C.Cyan,
|
| 163 |
+
"val": C.LightGreen,
|
| 164 |
+
"em": C.Cyan,
|
| 165 |
+
# Emphasized colors for the last frame of the traceback
|
| 166 |
+
"normalEm": C.Cyan,
|
| 167 |
+
"filenameEm": C.Green,
|
| 168 |
+
"linenoEm": C.Green,
|
| 169 |
+
"nameEm": C.Purple,
|
| 170 |
+
"valEm": C.Blue,
|
| 171 |
+
# Colors for printing the exception
|
| 172 |
+
"excName": C.Red,
|
| 173 |
+
# line = C.Brown, # brown often is displayed as yellow
|
| 174 |
+
"line": C.Red,
|
| 175 |
+
"caret": C.Normal,
|
| 176 |
+
"Normal": C.Normal,
|
| 177 |
+
# debugger
|
| 178 |
+
"prompt": C.Blue,
|
| 179 |
+
"breakpoint_enabled": C.LightRed,
|
| 180 |
+
"breakpoint_disabled": C.Red,
|
| 181 |
+
},
|
| 182 |
+
)
|
| 183 |
+
)
|
| 184 |
+
|
| 185 |
+
# Hack: the 'neutral' colours are not very visible on a dark background on
|
| 186 |
+
# Windows. Since Windows command prompts have a dark background by default, and
|
| 187 |
+
# relatively few users are likely to alter that, we will use the 'Linux' colours,
|
| 188 |
+
# designed for a dark background, as the default on Windows.
|
| 189 |
+
if os.name == "nt":
|
| 190 |
+
ex_colors.add_scheme(ex_colors['Linux'].copy('Neutral'))
|
| 191 |
+
|
| 192 |
+
return ex_colors
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/extensions.py
ADDED
|
@@ -0,0 +1,135 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""A class for managing IPython extensions."""
|
| 3 |
+
|
| 4 |
+
# Copyright (c) IPython Development Team.
|
| 5 |
+
# Distributed under the terms of the Modified BSD License.
|
| 6 |
+
|
| 7 |
+
import os
|
| 8 |
+
import os.path
|
| 9 |
+
import sys
|
| 10 |
+
from importlib import import_module, reload
|
| 11 |
+
|
| 12 |
+
from traitlets.config.configurable import Configurable
|
| 13 |
+
from IPython.utils.path import ensure_dir_exists
|
| 14 |
+
from traitlets import Instance
|
| 15 |
+
|
| 16 |
+
|
| 17 |
+
#-----------------------------------------------------------------------------
|
| 18 |
+
# Main class
|
| 19 |
+
#-----------------------------------------------------------------------------
|
| 20 |
+
|
| 21 |
+
BUILTINS_EXTS = {"storemagic": False, "autoreload": False}
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
class ExtensionManager(Configurable):
|
| 25 |
+
"""A class to manage IPython extensions.
|
| 26 |
+
|
| 27 |
+
An IPython extension is an importable Python module that has
|
| 28 |
+
a function with the signature::
|
| 29 |
+
|
| 30 |
+
def load_ipython_extension(ipython):
|
| 31 |
+
# Do things with ipython
|
| 32 |
+
|
| 33 |
+
This function is called after your extension is imported and the
|
| 34 |
+
currently active :class:`InteractiveShell` instance is passed as
|
| 35 |
+
the only argument. You can do anything you want with IPython at
|
| 36 |
+
that point, including defining new magic and aliases, adding new
|
| 37 |
+
components, etc.
|
| 38 |
+
|
| 39 |
+
You can also optionally define an :func:`unload_ipython_extension(ipython)`
|
| 40 |
+
function, which will be called if the user unloads or reloads the extension.
|
| 41 |
+
The extension manager will only call :func:`load_ipython_extension` again
|
| 42 |
+
if the extension is reloaded.
|
| 43 |
+
|
| 44 |
+
You can put your extension modules anywhere you want, as long as
|
| 45 |
+
they can be imported by Python's standard import mechanism.
|
| 46 |
+
"""
|
| 47 |
+
|
| 48 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
| 49 |
+
|
| 50 |
+
def __init__(self, shell=None, **kwargs):
|
| 51 |
+
super(ExtensionManager, self).__init__(shell=shell, **kwargs)
|
| 52 |
+
self.loaded = set()
|
| 53 |
+
|
| 54 |
+
def load_extension(self, module_str: str):
|
| 55 |
+
"""Load an IPython extension by its module name.
|
| 56 |
+
|
| 57 |
+
Returns the string "already loaded" if the extension is already loaded,
|
| 58 |
+
"no load function" if the module doesn't have a load_ipython_extension
|
| 59 |
+
function, or None if it succeeded.
|
| 60 |
+
"""
|
| 61 |
+
try:
|
| 62 |
+
return self._load_extension(module_str)
|
| 63 |
+
except ModuleNotFoundError:
|
| 64 |
+
if module_str in BUILTINS_EXTS:
|
| 65 |
+
BUILTINS_EXTS[module_str] = True
|
| 66 |
+
return self._load_extension("IPython.extensions." + module_str)
|
| 67 |
+
raise
|
| 68 |
+
|
| 69 |
+
def _load_extension(self, module_str: str):
|
| 70 |
+
if module_str in self.loaded:
|
| 71 |
+
return "already loaded"
|
| 72 |
+
|
| 73 |
+
assert self.shell is not None
|
| 74 |
+
|
| 75 |
+
with self.shell.builtin_trap:
|
| 76 |
+
if module_str not in sys.modules:
|
| 77 |
+
mod = import_module(module_str)
|
| 78 |
+
mod = sys.modules[module_str]
|
| 79 |
+
if self._call_load_ipython_extension(mod):
|
| 80 |
+
self.loaded.add(module_str)
|
| 81 |
+
else:
|
| 82 |
+
return "no load function"
|
| 83 |
+
|
| 84 |
+
def unload_extension(self, module_str: str):
|
| 85 |
+
"""Unload an IPython extension by its module name.
|
| 86 |
+
|
| 87 |
+
This function looks up the extension's name in ``sys.modules`` and
|
| 88 |
+
simply calls ``mod.unload_ipython_extension(self)``.
|
| 89 |
+
|
| 90 |
+
Returns the string "no unload function" if the extension doesn't define
|
| 91 |
+
a function to unload itself, "not loaded" if the extension isn't loaded,
|
| 92 |
+
otherwise None.
|
| 93 |
+
"""
|
| 94 |
+
if BUILTINS_EXTS.get(module_str, False) is True:
|
| 95 |
+
module_str = "IPython.extensions." + module_str
|
| 96 |
+
if module_str not in self.loaded:
|
| 97 |
+
return "not loaded"
|
| 98 |
+
|
| 99 |
+
if module_str in sys.modules:
|
| 100 |
+
mod = sys.modules[module_str]
|
| 101 |
+
if self._call_unload_ipython_extension(mod):
|
| 102 |
+
self.loaded.discard(module_str)
|
| 103 |
+
else:
|
| 104 |
+
return "no unload function"
|
| 105 |
+
|
| 106 |
+
def reload_extension(self, module_str: str):
|
| 107 |
+
"""Reload an IPython extension by calling reload.
|
| 108 |
+
|
| 109 |
+
If the module has not been loaded before,
|
| 110 |
+
:meth:`InteractiveShell.load_extension` is called. Otherwise
|
| 111 |
+
:func:`reload` is called and then the :func:`load_ipython_extension`
|
| 112 |
+
function of the module, if it exists is called.
|
| 113 |
+
"""
|
| 114 |
+
|
| 115 |
+
if BUILTINS_EXTS.get(module_str, False) is True:
|
| 116 |
+
module_str = "IPython.extensions." + module_str
|
| 117 |
+
|
| 118 |
+
if (module_str in self.loaded) and (module_str in sys.modules):
|
| 119 |
+
self.unload_extension(module_str)
|
| 120 |
+
mod = sys.modules[module_str]
|
| 121 |
+
reload(mod)
|
| 122 |
+
if self._call_load_ipython_extension(mod):
|
| 123 |
+
self.loaded.add(module_str)
|
| 124 |
+
else:
|
| 125 |
+
self.load_extension(module_str)
|
| 126 |
+
|
| 127 |
+
def _call_load_ipython_extension(self, mod):
|
| 128 |
+
if hasattr(mod, 'load_ipython_extension'):
|
| 129 |
+
mod.load_ipython_extension(self.shell)
|
| 130 |
+
return True
|
| 131 |
+
|
| 132 |
+
def _call_unload_ipython_extension(self, mod):
|
| 133 |
+
if hasattr(mod, 'unload_ipython_extension'):
|
| 134 |
+
mod.unload_ipython_extension(self.shell)
|
| 135 |
+
return True
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/formatters.py
ADDED
|
@@ -0,0 +1,1090 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Display formatters.
|
| 3 |
+
|
| 4 |
+
This module defines the base instances in order to implement custom
|
| 5 |
+
formatters/mimetypes
|
| 6 |
+
got objects:
|
| 7 |
+
|
| 8 |
+
As we want to see internal IPython working we are going to use the following
|
| 9 |
+
function to diaply objects instead of the normal print or display method:
|
| 10 |
+
|
| 11 |
+
>>> ip = get_ipython()
|
| 12 |
+
>>> ip.display_formatter.format(...)
|
| 13 |
+
({'text/plain': 'Ellipsis'}, {})
|
| 14 |
+
|
| 15 |
+
This return a tuple with the mimebumdle for the current object, and the
|
| 16 |
+
associated metadata.
|
| 17 |
+
|
| 18 |
+
|
| 19 |
+
We can now define our own formatter and register it:
|
| 20 |
+
|
| 21 |
+
|
| 22 |
+
>>> from IPython.core.formatters import BaseFormatter, FormatterABC
|
| 23 |
+
|
| 24 |
+
|
| 25 |
+
>>> class LLMFormatter(BaseFormatter):
|
| 26 |
+
...
|
| 27 |
+
... format_type = 'x-vendor/llm'
|
| 28 |
+
... print_method = '_repr_llm_'
|
| 29 |
+
... _return_type = (dict, str)
|
| 30 |
+
|
| 31 |
+
>>> llm_formatter = LLMFormatter(parent=ip.display_formatter)
|
| 32 |
+
|
| 33 |
+
>>> ip.display_formatter.formatters[LLMFormatter.format_type] = llm_formatter
|
| 34 |
+
|
| 35 |
+
Now any class that define `_repr_llm_` will return a x-vendor/llm as part of
|
| 36 |
+
it's display data:
|
| 37 |
+
|
| 38 |
+
>>> class A:
|
| 39 |
+
...
|
| 40 |
+
... def _repr_llm_(self, *kwargs):
|
| 41 |
+
... return 'This a A'
|
| 42 |
+
...
|
| 43 |
+
|
| 44 |
+
>>> ip.display_formatter.format(A())
|
| 45 |
+
({'text/plain': '<IPython.core.formatters.A at ...>', 'x-vendor/llm': 'This a A'}, {})
|
| 46 |
+
|
| 47 |
+
As usual, you can register methods for third party types (see
|
| 48 |
+
:ref:`third_party_formatting`)
|
| 49 |
+
|
| 50 |
+
>>> def llm_int(obj):
|
| 51 |
+
... return 'This is the integer %s, in between %s and %s'%(obj, obj-1, obj+1)
|
| 52 |
+
|
| 53 |
+
>>> llm_formatter.for_type(int, llm_int)
|
| 54 |
+
|
| 55 |
+
>>> ip.display_formatter.format(42)
|
| 56 |
+
({'text/plain': '42', 'x-vendor/llm': 'This is the integer 42, in between 41 and 43'}, {})
|
| 57 |
+
|
| 58 |
+
|
| 59 |
+
Inheritance diagram:
|
| 60 |
+
|
| 61 |
+
.. inheritance-diagram:: IPython.core.formatters
|
| 62 |
+
:parts: 3
|
| 63 |
+
"""
|
| 64 |
+
|
| 65 |
+
# Copyright (c) IPython Development Team.
|
| 66 |
+
# Distributed under the terms of the Modified BSD License.
|
| 67 |
+
|
| 68 |
+
import abc
|
| 69 |
+
import sys
|
| 70 |
+
import traceback
|
| 71 |
+
import warnings
|
| 72 |
+
from io import StringIO
|
| 73 |
+
|
| 74 |
+
from decorator import decorator
|
| 75 |
+
|
| 76 |
+
from traitlets.config.configurable import Configurable
|
| 77 |
+
from .getipython import get_ipython
|
| 78 |
+
from ..utils.sentinel import Sentinel
|
| 79 |
+
from ..utils.dir2 import get_real_method
|
| 80 |
+
from ..lib import pretty
|
| 81 |
+
from traitlets import (
|
| 82 |
+
Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List,
|
| 83 |
+
ForwardDeclaredInstance,
|
| 84 |
+
default, observe,
|
| 85 |
+
)
|
| 86 |
+
|
| 87 |
+
from typing import Any
|
| 88 |
+
|
| 89 |
+
|
| 90 |
+
class DisplayFormatter(Configurable):
|
| 91 |
+
|
| 92 |
+
active_types = List(Unicode(),
|
| 93 |
+
help="""List of currently active mime-types to display.
|
| 94 |
+
You can use this to set a white-list for formats to display.
|
| 95 |
+
|
| 96 |
+
Most users will not need to change this value.
|
| 97 |
+
""",
|
| 98 |
+
).tag(config=True)
|
| 99 |
+
|
| 100 |
+
@default('active_types')
|
| 101 |
+
def _active_types_default(self):
|
| 102 |
+
return self.format_types
|
| 103 |
+
|
| 104 |
+
@observe('active_types')
|
| 105 |
+
def _active_types_changed(self, change):
|
| 106 |
+
for key, formatter in self.formatters.items():
|
| 107 |
+
if key in change['new']:
|
| 108 |
+
formatter.enabled = True
|
| 109 |
+
else:
|
| 110 |
+
formatter.enabled = False
|
| 111 |
+
|
| 112 |
+
ipython_display_formatter = ForwardDeclaredInstance("FormatterABC") # type: ignore
|
| 113 |
+
|
| 114 |
+
@default("ipython_display_formatter")
|
| 115 |
+
def _default_formatter(self):
|
| 116 |
+
return IPythonDisplayFormatter(parent=self)
|
| 117 |
+
|
| 118 |
+
mimebundle_formatter = ForwardDeclaredInstance("FormatterABC") # type: ignore
|
| 119 |
+
|
| 120 |
+
@default("mimebundle_formatter")
|
| 121 |
+
def _default_mime_formatter(self):
|
| 122 |
+
return MimeBundleFormatter(parent=self)
|
| 123 |
+
|
| 124 |
+
# A dict of formatter whose keys are format types (MIME types) and whose
|
| 125 |
+
# values are subclasses of BaseFormatter.
|
| 126 |
+
formatters = Dict()
|
| 127 |
+
|
| 128 |
+
@default("formatters")
|
| 129 |
+
def _formatters_default(self):
|
| 130 |
+
"""Activate the default formatters."""
|
| 131 |
+
formatter_classes = [
|
| 132 |
+
PlainTextFormatter,
|
| 133 |
+
HTMLFormatter,
|
| 134 |
+
MarkdownFormatter,
|
| 135 |
+
SVGFormatter,
|
| 136 |
+
PNGFormatter,
|
| 137 |
+
PDFFormatter,
|
| 138 |
+
JPEGFormatter,
|
| 139 |
+
LatexFormatter,
|
| 140 |
+
JSONFormatter,
|
| 141 |
+
JavascriptFormatter
|
| 142 |
+
]
|
| 143 |
+
d = {}
|
| 144 |
+
for cls in formatter_classes:
|
| 145 |
+
f = cls(parent=self)
|
| 146 |
+
d[f.format_type] = f
|
| 147 |
+
return d
|
| 148 |
+
|
| 149 |
+
def format(self, obj, include=None, exclude=None):
|
| 150 |
+
"""Return a format data dict for an object.
|
| 151 |
+
|
| 152 |
+
By default all format types will be computed.
|
| 153 |
+
|
| 154 |
+
The following MIME types are usually implemented:
|
| 155 |
+
|
| 156 |
+
* text/plain
|
| 157 |
+
* text/html
|
| 158 |
+
* text/markdown
|
| 159 |
+
* text/latex
|
| 160 |
+
* application/json
|
| 161 |
+
* application/javascript
|
| 162 |
+
* application/pdf
|
| 163 |
+
* image/png
|
| 164 |
+
* image/jpeg
|
| 165 |
+
* image/svg+xml
|
| 166 |
+
|
| 167 |
+
Parameters
|
| 168 |
+
----------
|
| 169 |
+
obj : object
|
| 170 |
+
The Python object whose format data will be computed.
|
| 171 |
+
include : list, tuple or set; optional
|
| 172 |
+
A list of format type strings (MIME types) to include in the
|
| 173 |
+
format data dict. If this is set *only* the format types included
|
| 174 |
+
in this list will be computed.
|
| 175 |
+
exclude : list, tuple or set; optional
|
| 176 |
+
A list of format type string (MIME types) to exclude in the format
|
| 177 |
+
data dict. If this is set all format types will be computed,
|
| 178 |
+
except for those included in this argument.
|
| 179 |
+
Mimetypes present in exclude will take precedence over the ones in include
|
| 180 |
+
|
| 181 |
+
Returns
|
| 182 |
+
-------
|
| 183 |
+
(format_dict, metadata_dict) : tuple of two dicts
|
| 184 |
+
format_dict is a dictionary of key/value pairs, one of each format that was
|
| 185 |
+
generated for the object. The keys are the format types, which
|
| 186 |
+
will usually be MIME type strings and the values and JSON'able
|
| 187 |
+
data structure containing the raw data for the representation in
|
| 188 |
+
that format.
|
| 189 |
+
|
| 190 |
+
metadata_dict is a dictionary of metadata about each mime-type output.
|
| 191 |
+
Its keys will be a strict subset of the keys in format_dict.
|
| 192 |
+
|
| 193 |
+
Notes
|
| 194 |
+
-----
|
| 195 |
+
If an object implement `_repr_mimebundle_` as well as various
|
| 196 |
+
`_repr_*_`, the data returned by `_repr_mimebundle_` will take
|
| 197 |
+
precedence and the corresponding `_repr_*_` for this mimetype will
|
| 198 |
+
not be called.
|
| 199 |
+
|
| 200 |
+
"""
|
| 201 |
+
format_dict = {}
|
| 202 |
+
md_dict = {}
|
| 203 |
+
|
| 204 |
+
if self.ipython_display_formatter(obj):
|
| 205 |
+
# object handled itself, don't proceed
|
| 206 |
+
return {}, {}
|
| 207 |
+
|
| 208 |
+
format_dict, md_dict = self.mimebundle_formatter(obj, include=include, exclude=exclude)
|
| 209 |
+
|
| 210 |
+
if format_dict or md_dict:
|
| 211 |
+
if include:
|
| 212 |
+
format_dict = {k:v for k,v in format_dict.items() if k in include}
|
| 213 |
+
md_dict = {k:v for k,v in md_dict.items() if k in include}
|
| 214 |
+
if exclude:
|
| 215 |
+
format_dict = {k:v for k,v in format_dict.items() if k not in exclude}
|
| 216 |
+
md_dict = {k:v for k,v in md_dict.items() if k not in exclude}
|
| 217 |
+
|
| 218 |
+
for format_type, formatter in self.formatters.items():
|
| 219 |
+
if format_type in format_dict:
|
| 220 |
+
# already got it from mimebundle, maybe don't render again.
|
| 221 |
+
# exception: manually registered per-mime renderer
|
| 222 |
+
# check priority:
|
| 223 |
+
# 1. user-registered per-mime formatter
|
| 224 |
+
# 2. mime-bundle (user-registered or repr method)
|
| 225 |
+
# 3. default per-mime formatter (e.g. repr method)
|
| 226 |
+
try:
|
| 227 |
+
formatter.lookup(obj)
|
| 228 |
+
except KeyError:
|
| 229 |
+
# no special formatter, use mime-bundle-provided value
|
| 230 |
+
continue
|
| 231 |
+
if include and format_type not in include:
|
| 232 |
+
continue
|
| 233 |
+
if exclude and format_type in exclude:
|
| 234 |
+
continue
|
| 235 |
+
|
| 236 |
+
md = None
|
| 237 |
+
try:
|
| 238 |
+
data = formatter(obj)
|
| 239 |
+
except:
|
| 240 |
+
# FIXME: log the exception
|
| 241 |
+
raise
|
| 242 |
+
|
| 243 |
+
# formatters can return raw data or (data, metadata)
|
| 244 |
+
if isinstance(data, tuple) and len(data) == 2:
|
| 245 |
+
data, md = data
|
| 246 |
+
|
| 247 |
+
if data is not None:
|
| 248 |
+
format_dict[format_type] = data
|
| 249 |
+
if md is not None:
|
| 250 |
+
md_dict[format_type] = md
|
| 251 |
+
return format_dict, md_dict
|
| 252 |
+
|
| 253 |
+
@property
|
| 254 |
+
def format_types(self):
|
| 255 |
+
"""Return the format types (MIME types) of the active formatters."""
|
| 256 |
+
return list(self.formatters.keys())
|
| 257 |
+
|
| 258 |
+
|
| 259 |
+
#-----------------------------------------------------------------------------
|
| 260 |
+
# Formatters for specific format types (text, html, svg, etc.)
|
| 261 |
+
#-----------------------------------------------------------------------------
|
| 262 |
+
|
| 263 |
+
|
| 264 |
+
def _safe_repr(obj):
|
| 265 |
+
"""Try to return a repr of an object
|
| 266 |
+
|
| 267 |
+
always returns a string, at least.
|
| 268 |
+
"""
|
| 269 |
+
try:
|
| 270 |
+
return repr(obj)
|
| 271 |
+
except Exception as e:
|
| 272 |
+
return "un-repr-able object (%r)" % e
|
| 273 |
+
|
| 274 |
+
|
| 275 |
+
class FormatterWarning(UserWarning):
|
| 276 |
+
"""Warning class for errors in formatters"""
|
| 277 |
+
|
| 278 |
+
@decorator
|
| 279 |
+
def catch_format_error(method, self, *args, **kwargs):
|
| 280 |
+
"""show traceback on failed format call"""
|
| 281 |
+
try:
|
| 282 |
+
r = method(self, *args, **kwargs)
|
| 283 |
+
except NotImplementedError:
|
| 284 |
+
# don't warn on NotImplementedErrors
|
| 285 |
+
return self._check_return(None, args[0])
|
| 286 |
+
except Exception:
|
| 287 |
+
exc_info = sys.exc_info()
|
| 288 |
+
ip = get_ipython()
|
| 289 |
+
if ip is not None:
|
| 290 |
+
ip.showtraceback(exc_info)
|
| 291 |
+
else:
|
| 292 |
+
traceback.print_exception(*exc_info)
|
| 293 |
+
return self._check_return(None, args[0])
|
| 294 |
+
return self._check_return(r, args[0])
|
| 295 |
+
|
| 296 |
+
|
| 297 |
+
class FormatterABC(metaclass=abc.ABCMeta):
|
| 298 |
+
""" Abstract base class for Formatters.
|
| 299 |
+
|
| 300 |
+
A formatter is a callable class that is responsible for computing the
|
| 301 |
+
raw format data for a particular format type (MIME type). For example,
|
| 302 |
+
an HTML formatter would have a format type of `text/html` and would return
|
| 303 |
+
the HTML representation of the object when called.
|
| 304 |
+
"""
|
| 305 |
+
|
| 306 |
+
# The format type of the data returned, usually a MIME type.
|
| 307 |
+
format_type = 'text/plain'
|
| 308 |
+
|
| 309 |
+
# Is the formatter enabled...
|
| 310 |
+
enabled = True
|
| 311 |
+
|
| 312 |
+
@abc.abstractmethod
|
| 313 |
+
def __call__(self, obj):
|
| 314 |
+
"""Return a JSON'able representation of the object.
|
| 315 |
+
|
| 316 |
+
If the object cannot be formatted by this formatter,
|
| 317 |
+
warn and return None.
|
| 318 |
+
"""
|
| 319 |
+
return repr(obj)
|
| 320 |
+
|
| 321 |
+
|
| 322 |
+
def _mod_name_key(typ):
|
| 323 |
+
"""Return a (__module__, __name__) tuple for a type.
|
| 324 |
+
|
| 325 |
+
Used as key in Formatter.deferred_printers.
|
| 326 |
+
"""
|
| 327 |
+
module = getattr(typ, '__module__', None)
|
| 328 |
+
name = getattr(typ, '__name__', None)
|
| 329 |
+
return (module, name)
|
| 330 |
+
|
| 331 |
+
|
| 332 |
+
def _get_type(obj):
|
| 333 |
+
"""Return the type of an instance (old and new-style)"""
|
| 334 |
+
return getattr(obj, '__class__', None) or type(obj)
|
| 335 |
+
|
| 336 |
+
|
| 337 |
+
_raise_key_error = Sentinel(
|
| 338 |
+
"_raise_key_error",
|
| 339 |
+
__name__,
|
| 340 |
+
"""
|
| 341 |
+
Special value to raise a KeyError
|
| 342 |
+
|
| 343 |
+
Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop`
|
| 344 |
+
""",
|
| 345 |
+
)
|
| 346 |
+
|
| 347 |
+
|
| 348 |
+
class BaseFormatter(Configurable):
|
| 349 |
+
"""A base formatter class that is configurable.
|
| 350 |
+
|
| 351 |
+
This formatter should usually be used as the base class of all formatters.
|
| 352 |
+
It is a traited :class:`Configurable` class and includes an extensible
|
| 353 |
+
API for users to determine how their objects are formatted. The following
|
| 354 |
+
logic is used to find a function to format an given object.
|
| 355 |
+
|
| 356 |
+
1. The object is introspected to see if it has a method with the name
|
| 357 |
+
:attr:`print_method`. If is does, that object is passed to that method
|
| 358 |
+
for formatting.
|
| 359 |
+
2. If no print method is found, three internal dictionaries are consulted
|
| 360 |
+
to find print method: :attr:`singleton_printers`, :attr:`type_printers`
|
| 361 |
+
and :attr:`deferred_printers`.
|
| 362 |
+
|
| 363 |
+
Users should use these dictionaries to register functions that will be
|
| 364 |
+
used to compute the format data for their objects (if those objects don't
|
| 365 |
+
have the special print methods). The easiest way of using these
|
| 366 |
+
dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name`
|
| 367 |
+
methods.
|
| 368 |
+
|
| 369 |
+
If no function/callable is found to compute the format data, ``None`` is
|
| 370 |
+
returned and this format type is not used.
|
| 371 |
+
"""
|
| 372 |
+
|
| 373 |
+
format_type = Unicode("text/plain")
|
| 374 |
+
_return_type: Any = str
|
| 375 |
+
|
| 376 |
+
enabled = Bool(True).tag(config=True)
|
| 377 |
+
|
| 378 |
+
print_method = ObjectName('__repr__')
|
| 379 |
+
|
| 380 |
+
# The singleton printers.
|
| 381 |
+
# Maps the IDs of the builtin singleton objects to the format functions.
|
| 382 |
+
singleton_printers = Dict().tag(config=True)
|
| 383 |
+
|
| 384 |
+
# The type-specific printers.
|
| 385 |
+
# Map type objects to the format functions.
|
| 386 |
+
type_printers = Dict().tag(config=True)
|
| 387 |
+
|
| 388 |
+
# The deferred-import type-specific printers.
|
| 389 |
+
# Map (modulename, classname) pairs to the format functions.
|
| 390 |
+
deferred_printers = Dict().tag(config=True)
|
| 391 |
+
|
| 392 |
+
@catch_format_error
|
| 393 |
+
def __call__(self, obj):
|
| 394 |
+
"""Compute the format for an object."""
|
| 395 |
+
if self.enabled:
|
| 396 |
+
# lookup registered printer
|
| 397 |
+
try:
|
| 398 |
+
printer = self.lookup(obj)
|
| 399 |
+
except KeyError:
|
| 400 |
+
pass
|
| 401 |
+
else:
|
| 402 |
+
return printer(obj)
|
| 403 |
+
# Finally look for special method names
|
| 404 |
+
method = get_real_method(obj, self.print_method)
|
| 405 |
+
if method is not None:
|
| 406 |
+
return method()
|
| 407 |
+
return None
|
| 408 |
+
else:
|
| 409 |
+
return None
|
| 410 |
+
|
| 411 |
+
def __contains__(self, typ):
|
| 412 |
+
"""map in to lookup_by_type"""
|
| 413 |
+
try:
|
| 414 |
+
self.lookup_by_type(typ)
|
| 415 |
+
except KeyError:
|
| 416 |
+
return False
|
| 417 |
+
else:
|
| 418 |
+
return True
|
| 419 |
+
|
| 420 |
+
def _check_return(self, r, obj):
|
| 421 |
+
"""Check that a return value is appropriate
|
| 422 |
+
|
| 423 |
+
Return the value if so, None otherwise, warning if invalid.
|
| 424 |
+
"""
|
| 425 |
+
if r is None or isinstance(r, self._return_type) or \
|
| 426 |
+
(isinstance(r, tuple) and r and isinstance(r[0], self._return_type)):
|
| 427 |
+
return r
|
| 428 |
+
else:
|
| 429 |
+
warnings.warn(
|
| 430 |
+
"%s formatter returned invalid type %s (expected %s) for object: %s" % \
|
| 431 |
+
(self.format_type, type(r), self._return_type, _safe_repr(obj)),
|
| 432 |
+
FormatterWarning
|
| 433 |
+
)
|
| 434 |
+
|
| 435 |
+
def lookup(self, obj):
|
| 436 |
+
"""Look up the formatter for a given instance.
|
| 437 |
+
|
| 438 |
+
Parameters
|
| 439 |
+
----------
|
| 440 |
+
obj : object instance
|
| 441 |
+
|
| 442 |
+
Returns
|
| 443 |
+
-------
|
| 444 |
+
f : callable
|
| 445 |
+
The registered formatting callable for the type.
|
| 446 |
+
|
| 447 |
+
Raises
|
| 448 |
+
------
|
| 449 |
+
KeyError if the type has not been registered.
|
| 450 |
+
"""
|
| 451 |
+
# look for singleton first
|
| 452 |
+
obj_id = id(obj)
|
| 453 |
+
if obj_id in self.singleton_printers:
|
| 454 |
+
return self.singleton_printers[obj_id]
|
| 455 |
+
# then lookup by type
|
| 456 |
+
return self.lookup_by_type(_get_type(obj))
|
| 457 |
+
|
| 458 |
+
def lookup_by_type(self, typ):
|
| 459 |
+
"""Look up the registered formatter for a type.
|
| 460 |
+
|
| 461 |
+
Parameters
|
| 462 |
+
----------
|
| 463 |
+
typ : type or '__module__.__name__' string for a type
|
| 464 |
+
|
| 465 |
+
Returns
|
| 466 |
+
-------
|
| 467 |
+
f : callable
|
| 468 |
+
The registered formatting callable for the type.
|
| 469 |
+
|
| 470 |
+
Raises
|
| 471 |
+
------
|
| 472 |
+
KeyError if the type has not been registered.
|
| 473 |
+
"""
|
| 474 |
+
if isinstance(typ, str):
|
| 475 |
+
typ_key = tuple(typ.rsplit('.',1))
|
| 476 |
+
if typ_key not in self.deferred_printers:
|
| 477 |
+
# We may have it cached in the type map. We will have to
|
| 478 |
+
# iterate over all of the types to check.
|
| 479 |
+
for cls in self.type_printers:
|
| 480 |
+
if _mod_name_key(cls) == typ_key:
|
| 481 |
+
return self.type_printers[cls]
|
| 482 |
+
else:
|
| 483 |
+
return self.deferred_printers[typ_key]
|
| 484 |
+
else:
|
| 485 |
+
for cls in pretty._get_mro(typ):
|
| 486 |
+
if cls in self.type_printers or self._in_deferred_types(cls):
|
| 487 |
+
return self.type_printers[cls]
|
| 488 |
+
|
| 489 |
+
# If we have reached here, the lookup failed.
|
| 490 |
+
raise KeyError("No registered printer for {0!r}".format(typ))
|
| 491 |
+
|
| 492 |
+
def for_type(self, typ, func=None):
|
| 493 |
+
"""Add a format function for a given type.
|
| 494 |
+
|
| 495 |
+
Parameters
|
| 496 |
+
----------
|
| 497 |
+
typ : type or '__module__.__name__' string for a type
|
| 498 |
+
The class of the object that will be formatted using `func`.
|
| 499 |
+
|
| 500 |
+
func : callable
|
| 501 |
+
A callable for computing the format data.
|
| 502 |
+
`func` will be called with the object to be formatted,
|
| 503 |
+
and will return the raw data in this formatter's format.
|
| 504 |
+
Subclasses may use a different call signature for the
|
| 505 |
+
`func` argument.
|
| 506 |
+
|
| 507 |
+
If `func` is None or not specified, there will be no change,
|
| 508 |
+
only returning the current value.
|
| 509 |
+
|
| 510 |
+
Returns
|
| 511 |
+
-------
|
| 512 |
+
oldfunc : callable
|
| 513 |
+
The currently registered callable.
|
| 514 |
+
If you are registering a new formatter,
|
| 515 |
+
this will be the previous value (to enable restoring later).
|
| 516 |
+
"""
|
| 517 |
+
# if string given, interpret as 'pkg.module.class_name'
|
| 518 |
+
if isinstance(typ, str):
|
| 519 |
+
type_module, type_name = typ.rsplit('.', 1)
|
| 520 |
+
return self.for_type_by_name(type_module, type_name, func)
|
| 521 |
+
|
| 522 |
+
try:
|
| 523 |
+
oldfunc = self.lookup_by_type(typ)
|
| 524 |
+
except KeyError:
|
| 525 |
+
oldfunc = None
|
| 526 |
+
|
| 527 |
+
if func is not None:
|
| 528 |
+
self.type_printers[typ] = func
|
| 529 |
+
|
| 530 |
+
return oldfunc
|
| 531 |
+
|
| 532 |
+
def for_type_by_name(self, type_module, type_name, func=None):
|
| 533 |
+
"""Add a format function for a type specified by the full dotted
|
| 534 |
+
module and name of the type, rather than the type of the object.
|
| 535 |
+
|
| 536 |
+
Parameters
|
| 537 |
+
----------
|
| 538 |
+
type_module : str
|
| 539 |
+
The full dotted name of the module the type is defined in, like
|
| 540 |
+
``numpy``.
|
| 541 |
+
|
| 542 |
+
type_name : str
|
| 543 |
+
The name of the type (the class name), like ``dtype``
|
| 544 |
+
|
| 545 |
+
func : callable
|
| 546 |
+
A callable for computing the format data.
|
| 547 |
+
`func` will be called with the object to be formatted,
|
| 548 |
+
and will return the raw data in this formatter's format.
|
| 549 |
+
Subclasses may use a different call signature for the
|
| 550 |
+
`func` argument.
|
| 551 |
+
|
| 552 |
+
If `func` is None or unspecified, there will be no change,
|
| 553 |
+
only returning the current value.
|
| 554 |
+
|
| 555 |
+
Returns
|
| 556 |
+
-------
|
| 557 |
+
oldfunc : callable
|
| 558 |
+
The currently registered callable.
|
| 559 |
+
If you are registering a new formatter,
|
| 560 |
+
this will be the previous value (to enable restoring later).
|
| 561 |
+
"""
|
| 562 |
+
key = (type_module, type_name)
|
| 563 |
+
|
| 564 |
+
try:
|
| 565 |
+
oldfunc = self.lookup_by_type("%s.%s" % key)
|
| 566 |
+
except KeyError:
|
| 567 |
+
oldfunc = None
|
| 568 |
+
|
| 569 |
+
if func is not None:
|
| 570 |
+
self.deferred_printers[key] = func
|
| 571 |
+
return oldfunc
|
| 572 |
+
|
| 573 |
+
def pop(self, typ, default=_raise_key_error):
|
| 574 |
+
"""Pop a formatter for the given type.
|
| 575 |
+
|
| 576 |
+
Parameters
|
| 577 |
+
----------
|
| 578 |
+
typ : type or '__module__.__name__' string for a type
|
| 579 |
+
default : object
|
| 580 |
+
value to be returned if no formatter is registered for typ.
|
| 581 |
+
|
| 582 |
+
Returns
|
| 583 |
+
-------
|
| 584 |
+
obj : object
|
| 585 |
+
The last registered object for the type.
|
| 586 |
+
|
| 587 |
+
Raises
|
| 588 |
+
------
|
| 589 |
+
KeyError if the type is not registered and default is not specified.
|
| 590 |
+
"""
|
| 591 |
+
|
| 592 |
+
if isinstance(typ, str):
|
| 593 |
+
typ_key = tuple(typ.rsplit('.',1))
|
| 594 |
+
if typ_key not in self.deferred_printers:
|
| 595 |
+
# We may have it cached in the type map. We will have to
|
| 596 |
+
# iterate over all of the types to check.
|
| 597 |
+
for cls in self.type_printers:
|
| 598 |
+
if _mod_name_key(cls) == typ_key:
|
| 599 |
+
old = self.type_printers.pop(cls)
|
| 600 |
+
break
|
| 601 |
+
else:
|
| 602 |
+
old = default
|
| 603 |
+
else:
|
| 604 |
+
old = self.deferred_printers.pop(typ_key)
|
| 605 |
+
else:
|
| 606 |
+
if typ in self.type_printers:
|
| 607 |
+
old = self.type_printers.pop(typ)
|
| 608 |
+
else:
|
| 609 |
+
old = self.deferred_printers.pop(_mod_name_key(typ), default)
|
| 610 |
+
if old is _raise_key_error:
|
| 611 |
+
raise KeyError("No registered value for {0!r}".format(typ))
|
| 612 |
+
return old
|
| 613 |
+
|
| 614 |
+
def _in_deferred_types(self, cls):
|
| 615 |
+
"""
|
| 616 |
+
Check if the given class is specified in the deferred type registry.
|
| 617 |
+
|
| 618 |
+
Successful matches will be moved to the regular type registry for future use.
|
| 619 |
+
"""
|
| 620 |
+
mod = getattr(cls, '__module__', None)
|
| 621 |
+
name = getattr(cls, '__name__', None)
|
| 622 |
+
key = (mod, name)
|
| 623 |
+
if key in self.deferred_printers:
|
| 624 |
+
# Move the printer over to the regular registry.
|
| 625 |
+
printer = self.deferred_printers.pop(key)
|
| 626 |
+
self.type_printers[cls] = printer
|
| 627 |
+
return True
|
| 628 |
+
return False
|
| 629 |
+
|
| 630 |
+
|
| 631 |
+
class PlainTextFormatter(BaseFormatter):
|
| 632 |
+
"""The default pretty-printer.
|
| 633 |
+
|
| 634 |
+
This uses :mod:`IPython.lib.pretty` to compute the format data of
|
| 635 |
+
the object. If the object cannot be pretty printed, :func:`repr` is used.
|
| 636 |
+
See the documentation of :mod:`IPython.lib.pretty` for details on
|
| 637 |
+
how to write pretty printers. Here is a simple example::
|
| 638 |
+
|
| 639 |
+
def dtype_pprinter(obj, p, cycle):
|
| 640 |
+
if cycle:
|
| 641 |
+
return p.text('dtype(...)')
|
| 642 |
+
if hasattr(obj, 'fields'):
|
| 643 |
+
if obj.fields is None:
|
| 644 |
+
p.text(repr(obj))
|
| 645 |
+
else:
|
| 646 |
+
p.begin_group(7, 'dtype([')
|
| 647 |
+
for i, field in enumerate(obj.descr):
|
| 648 |
+
if i > 0:
|
| 649 |
+
p.text(',')
|
| 650 |
+
p.breakable()
|
| 651 |
+
p.pretty(field)
|
| 652 |
+
p.end_group(7, '])')
|
| 653 |
+
"""
|
| 654 |
+
|
| 655 |
+
# The format type of data returned.
|
| 656 |
+
format_type = Unicode('text/plain')
|
| 657 |
+
|
| 658 |
+
# This subclass ignores this attribute as it always need to return
|
| 659 |
+
# something.
|
| 660 |
+
enabled = Bool(True).tag(config=False)
|
| 661 |
+
|
| 662 |
+
max_seq_length = Integer(pretty.MAX_SEQ_LENGTH,
|
| 663 |
+
help="""Truncate large collections (lists, dicts, tuples, sets) to this size.
|
| 664 |
+
|
| 665 |
+
Set to 0 to disable truncation.
|
| 666 |
+
""",
|
| 667 |
+
).tag(config=True)
|
| 668 |
+
|
| 669 |
+
# Look for a _repr_pretty_ methods to use for pretty printing.
|
| 670 |
+
print_method = ObjectName('_repr_pretty_')
|
| 671 |
+
|
| 672 |
+
# Whether to pretty-print or not.
|
| 673 |
+
pprint = Bool(True).tag(config=True)
|
| 674 |
+
|
| 675 |
+
# Whether to be verbose or not.
|
| 676 |
+
verbose = Bool(False).tag(config=True)
|
| 677 |
+
|
| 678 |
+
# The maximum width.
|
| 679 |
+
max_width = Integer(79).tag(config=True)
|
| 680 |
+
|
| 681 |
+
# The newline character.
|
| 682 |
+
newline = Unicode('\n').tag(config=True)
|
| 683 |
+
|
| 684 |
+
# format-string for pprinting floats
|
| 685 |
+
float_format = Unicode('%r')
|
| 686 |
+
# setter for float precision, either int or direct format-string
|
| 687 |
+
float_precision = CUnicode('').tag(config=True)
|
| 688 |
+
|
| 689 |
+
@observe('float_precision')
|
| 690 |
+
def _float_precision_changed(self, change):
|
| 691 |
+
"""float_precision changed, set float_format accordingly.
|
| 692 |
+
|
| 693 |
+
float_precision can be set by int or str.
|
| 694 |
+
This will set float_format, after interpreting input.
|
| 695 |
+
If numpy has been imported, numpy print precision will also be set.
|
| 696 |
+
|
| 697 |
+
integer `n` sets format to '%.nf', otherwise, format set directly.
|
| 698 |
+
|
| 699 |
+
An empty string returns to defaults (repr for float, 8 for numpy).
|
| 700 |
+
|
| 701 |
+
This parameter can be set via the '%precision' magic.
|
| 702 |
+
"""
|
| 703 |
+
new = change['new']
|
| 704 |
+
if '%' in new:
|
| 705 |
+
# got explicit format string
|
| 706 |
+
fmt = new
|
| 707 |
+
try:
|
| 708 |
+
fmt%3.14159
|
| 709 |
+
except Exception as e:
|
| 710 |
+
raise ValueError("Precision must be int or format string, not %r"%new) from e
|
| 711 |
+
elif new:
|
| 712 |
+
# otherwise, should be an int
|
| 713 |
+
try:
|
| 714 |
+
i = int(new)
|
| 715 |
+
assert i >= 0
|
| 716 |
+
except ValueError as e:
|
| 717 |
+
raise ValueError("Precision must be int or format string, not %r"%new) from e
|
| 718 |
+
except AssertionError as e:
|
| 719 |
+
raise ValueError("int precision must be non-negative, not %r"%i) from e
|
| 720 |
+
|
| 721 |
+
fmt = '%%.%if'%i
|
| 722 |
+
if 'numpy' in sys.modules:
|
| 723 |
+
# set numpy precision if it has been imported
|
| 724 |
+
import numpy
|
| 725 |
+
numpy.set_printoptions(precision=i)
|
| 726 |
+
else:
|
| 727 |
+
# default back to repr
|
| 728 |
+
fmt = '%r'
|
| 729 |
+
if 'numpy' in sys.modules:
|
| 730 |
+
import numpy
|
| 731 |
+
# numpy default is 8
|
| 732 |
+
numpy.set_printoptions(precision=8)
|
| 733 |
+
self.float_format = fmt
|
| 734 |
+
|
| 735 |
+
# Use the default pretty printers from IPython.lib.pretty.
|
| 736 |
+
@default('singleton_printers')
|
| 737 |
+
def _singleton_printers_default(self):
|
| 738 |
+
return pretty._singleton_pprinters.copy()
|
| 739 |
+
|
| 740 |
+
@default('type_printers')
|
| 741 |
+
def _type_printers_default(self):
|
| 742 |
+
d = pretty._type_pprinters.copy()
|
| 743 |
+
d[float] = lambda obj,p,cycle: p.text(self.float_format%obj)
|
| 744 |
+
# if NumPy is used, set precision for its float64 type
|
| 745 |
+
if "numpy" in sys.modules:
|
| 746 |
+
import numpy
|
| 747 |
+
|
| 748 |
+
d[numpy.float64] = lambda obj, p, cycle: p.text(self.float_format % obj)
|
| 749 |
+
return d
|
| 750 |
+
|
| 751 |
+
@default('deferred_printers')
|
| 752 |
+
def _deferred_printers_default(self):
|
| 753 |
+
return pretty._deferred_type_pprinters.copy()
|
| 754 |
+
|
| 755 |
+
#### FormatterABC interface ####
|
| 756 |
+
|
| 757 |
+
@catch_format_error
|
| 758 |
+
def __call__(self, obj):
|
| 759 |
+
"""Compute the pretty representation of the object."""
|
| 760 |
+
if not self.pprint:
|
| 761 |
+
return repr(obj)
|
| 762 |
+
else:
|
| 763 |
+
stream = StringIO()
|
| 764 |
+
printer = pretty.RepresentationPrinter(stream, self.verbose,
|
| 765 |
+
self.max_width, self.newline,
|
| 766 |
+
max_seq_length=self.max_seq_length,
|
| 767 |
+
singleton_pprinters=self.singleton_printers,
|
| 768 |
+
type_pprinters=self.type_printers,
|
| 769 |
+
deferred_pprinters=self.deferred_printers)
|
| 770 |
+
printer.pretty(obj)
|
| 771 |
+
printer.flush()
|
| 772 |
+
return stream.getvalue()
|
| 773 |
+
|
| 774 |
+
|
| 775 |
+
class HTMLFormatter(BaseFormatter):
|
| 776 |
+
"""An HTML formatter.
|
| 777 |
+
|
| 778 |
+
To define the callables that compute the HTML representation of your
|
| 779 |
+
objects, define a :meth:`_repr_html_` method or use the :meth:`for_type`
|
| 780 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 781 |
+
this.
|
| 782 |
+
|
| 783 |
+
The return value of this formatter should be a valid HTML snippet that
|
| 784 |
+
could be injected into an existing DOM. It should *not* include the
|
| 785 |
+
```<html>`` or ```<body>`` tags.
|
| 786 |
+
"""
|
| 787 |
+
format_type = Unicode('text/html')
|
| 788 |
+
|
| 789 |
+
print_method = ObjectName('_repr_html_')
|
| 790 |
+
|
| 791 |
+
|
| 792 |
+
class MarkdownFormatter(BaseFormatter):
|
| 793 |
+
"""A Markdown formatter.
|
| 794 |
+
|
| 795 |
+
To define the callables that compute the Markdown representation of your
|
| 796 |
+
objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type`
|
| 797 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 798 |
+
this.
|
| 799 |
+
|
| 800 |
+
The return value of this formatter should be a valid Markdown.
|
| 801 |
+
"""
|
| 802 |
+
format_type = Unicode('text/markdown')
|
| 803 |
+
|
| 804 |
+
print_method = ObjectName('_repr_markdown_')
|
| 805 |
+
|
| 806 |
+
class SVGFormatter(BaseFormatter):
|
| 807 |
+
"""An SVG formatter.
|
| 808 |
+
|
| 809 |
+
To define the callables that compute the SVG representation of your
|
| 810 |
+
objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type`
|
| 811 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 812 |
+
this.
|
| 813 |
+
|
| 814 |
+
The return value of this formatter should be valid SVG enclosed in
|
| 815 |
+
```<svg>``` tags, that could be injected into an existing DOM. It should
|
| 816 |
+
*not* include the ```<html>`` or ```<body>`` tags.
|
| 817 |
+
"""
|
| 818 |
+
format_type = Unicode('image/svg+xml')
|
| 819 |
+
|
| 820 |
+
print_method = ObjectName('_repr_svg_')
|
| 821 |
+
|
| 822 |
+
|
| 823 |
+
class PNGFormatter(BaseFormatter):
|
| 824 |
+
"""A PNG formatter.
|
| 825 |
+
|
| 826 |
+
To define the callables that compute the PNG representation of your
|
| 827 |
+
objects, define a :meth:`_repr_png_` method or use the :meth:`for_type`
|
| 828 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 829 |
+
this.
|
| 830 |
+
|
| 831 |
+
The return value of this formatter should be raw PNG data, *not*
|
| 832 |
+
base64 encoded.
|
| 833 |
+
"""
|
| 834 |
+
format_type = Unicode('image/png')
|
| 835 |
+
|
| 836 |
+
print_method = ObjectName('_repr_png_')
|
| 837 |
+
|
| 838 |
+
_return_type = (bytes, str)
|
| 839 |
+
|
| 840 |
+
|
| 841 |
+
class JPEGFormatter(BaseFormatter):
|
| 842 |
+
"""A JPEG formatter.
|
| 843 |
+
|
| 844 |
+
To define the callables that compute the JPEG representation of your
|
| 845 |
+
objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type`
|
| 846 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 847 |
+
this.
|
| 848 |
+
|
| 849 |
+
The return value of this formatter should be raw JPEG data, *not*
|
| 850 |
+
base64 encoded.
|
| 851 |
+
"""
|
| 852 |
+
format_type = Unicode('image/jpeg')
|
| 853 |
+
|
| 854 |
+
print_method = ObjectName('_repr_jpeg_')
|
| 855 |
+
|
| 856 |
+
_return_type = (bytes, str)
|
| 857 |
+
|
| 858 |
+
|
| 859 |
+
class LatexFormatter(BaseFormatter):
|
| 860 |
+
"""A LaTeX formatter.
|
| 861 |
+
|
| 862 |
+
To define the callables that compute the LaTeX representation of your
|
| 863 |
+
objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type`
|
| 864 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 865 |
+
this.
|
| 866 |
+
|
| 867 |
+
The return value of this formatter should be a valid LaTeX equation,
|
| 868 |
+
enclosed in either ```$```, ```$$``` or another LaTeX equation
|
| 869 |
+
environment.
|
| 870 |
+
"""
|
| 871 |
+
format_type = Unicode('text/latex')
|
| 872 |
+
|
| 873 |
+
print_method = ObjectName('_repr_latex_')
|
| 874 |
+
|
| 875 |
+
|
| 876 |
+
class JSONFormatter(BaseFormatter):
|
| 877 |
+
"""A JSON string formatter.
|
| 878 |
+
|
| 879 |
+
To define the callables that compute the JSONable representation of
|
| 880 |
+
your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type`
|
| 881 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 882 |
+
this.
|
| 883 |
+
|
| 884 |
+
The return value of this formatter should be a JSONable list or dict.
|
| 885 |
+
JSON scalars (None, number, string) are not allowed, only dict or list containers.
|
| 886 |
+
"""
|
| 887 |
+
format_type = Unicode('application/json')
|
| 888 |
+
_return_type = (list, dict)
|
| 889 |
+
|
| 890 |
+
print_method = ObjectName('_repr_json_')
|
| 891 |
+
|
| 892 |
+
def _check_return(self, r, obj):
|
| 893 |
+
"""Check that a return value is appropriate
|
| 894 |
+
|
| 895 |
+
Return the value if so, None otherwise, warning if invalid.
|
| 896 |
+
"""
|
| 897 |
+
if r is None:
|
| 898 |
+
return
|
| 899 |
+
md = None
|
| 900 |
+
if isinstance(r, tuple):
|
| 901 |
+
# unpack data, metadata tuple for type checking on first element
|
| 902 |
+
r, md = r
|
| 903 |
+
|
| 904 |
+
assert not isinstance(
|
| 905 |
+
r, str
|
| 906 |
+
), "JSON-as-string has been deprecated since IPython < 3"
|
| 907 |
+
|
| 908 |
+
if md is not None:
|
| 909 |
+
# put the tuple back together
|
| 910 |
+
r = (r, md)
|
| 911 |
+
return super(JSONFormatter, self)._check_return(r, obj)
|
| 912 |
+
|
| 913 |
+
|
| 914 |
+
class JavascriptFormatter(BaseFormatter):
|
| 915 |
+
"""A Javascript formatter.
|
| 916 |
+
|
| 917 |
+
To define the callables that compute the Javascript representation of
|
| 918 |
+
your objects, define a :meth:`_repr_javascript_` method or use the
|
| 919 |
+
:meth:`for_type` or :meth:`for_type_by_name` methods to register functions
|
| 920 |
+
that handle this.
|
| 921 |
+
|
| 922 |
+
The return value of this formatter should be valid Javascript code and
|
| 923 |
+
should *not* be enclosed in ```<script>``` tags.
|
| 924 |
+
"""
|
| 925 |
+
format_type = Unicode('application/javascript')
|
| 926 |
+
|
| 927 |
+
print_method = ObjectName('_repr_javascript_')
|
| 928 |
+
|
| 929 |
+
|
| 930 |
+
class PDFFormatter(BaseFormatter):
|
| 931 |
+
"""A PDF formatter.
|
| 932 |
+
|
| 933 |
+
To define the callables that compute the PDF representation of your
|
| 934 |
+
objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type`
|
| 935 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 936 |
+
this.
|
| 937 |
+
|
| 938 |
+
The return value of this formatter should be raw PDF data, *not*
|
| 939 |
+
base64 encoded.
|
| 940 |
+
"""
|
| 941 |
+
format_type = Unicode('application/pdf')
|
| 942 |
+
|
| 943 |
+
print_method = ObjectName('_repr_pdf_')
|
| 944 |
+
|
| 945 |
+
_return_type = (bytes, str)
|
| 946 |
+
|
| 947 |
+
class IPythonDisplayFormatter(BaseFormatter):
|
| 948 |
+
"""An escape-hatch Formatter for objects that know how to display themselves.
|
| 949 |
+
|
| 950 |
+
To define the callables that compute the representation of your
|
| 951 |
+
objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type`
|
| 952 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 953 |
+
this. Unlike mime-type displays, this method should not return anything,
|
| 954 |
+
instead calling any appropriate display methods itself.
|
| 955 |
+
|
| 956 |
+
This display formatter has highest priority.
|
| 957 |
+
If it fires, no other display formatter will be called.
|
| 958 |
+
|
| 959 |
+
Prior to IPython 6.1, `_ipython_display_` was the only way to display custom mime-types
|
| 960 |
+
without registering a new Formatter.
|
| 961 |
+
|
| 962 |
+
IPython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types,
|
| 963 |
+
so `_ipython_display_` should only be used for objects that require unusual
|
| 964 |
+
display patterns, such as multiple display calls.
|
| 965 |
+
"""
|
| 966 |
+
print_method = ObjectName('_ipython_display_')
|
| 967 |
+
_return_type = (type(None), bool)
|
| 968 |
+
|
| 969 |
+
@catch_format_error
|
| 970 |
+
def __call__(self, obj):
|
| 971 |
+
"""Compute the format for an object."""
|
| 972 |
+
if self.enabled:
|
| 973 |
+
# lookup registered printer
|
| 974 |
+
try:
|
| 975 |
+
printer = self.lookup(obj)
|
| 976 |
+
except KeyError:
|
| 977 |
+
pass
|
| 978 |
+
else:
|
| 979 |
+
printer(obj)
|
| 980 |
+
return True
|
| 981 |
+
# Finally look for special method names
|
| 982 |
+
method = get_real_method(obj, self.print_method)
|
| 983 |
+
if method is not None:
|
| 984 |
+
method()
|
| 985 |
+
return True
|
| 986 |
+
|
| 987 |
+
|
| 988 |
+
class MimeBundleFormatter(BaseFormatter):
|
| 989 |
+
"""A Formatter for arbitrary mime-types.
|
| 990 |
+
|
| 991 |
+
Unlike other `_repr_<mimetype>_` methods,
|
| 992 |
+
`_repr_mimebundle_` should return mime-bundle data,
|
| 993 |
+
either the mime-keyed `data` dictionary or the tuple `(data, metadata)`.
|
| 994 |
+
Any mime-type is valid.
|
| 995 |
+
|
| 996 |
+
To define the callables that compute the mime-bundle representation of your
|
| 997 |
+
objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type`
|
| 998 |
+
or :meth:`for_type_by_name` methods to register functions that handle
|
| 999 |
+
this.
|
| 1000 |
+
|
| 1001 |
+
.. versionadded:: 6.1
|
| 1002 |
+
"""
|
| 1003 |
+
print_method = ObjectName('_repr_mimebundle_')
|
| 1004 |
+
_return_type = dict
|
| 1005 |
+
|
| 1006 |
+
def _check_return(self, r, obj):
|
| 1007 |
+
r = super(MimeBundleFormatter, self)._check_return(r, obj)
|
| 1008 |
+
# always return (data, metadata):
|
| 1009 |
+
if r is None:
|
| 1010 |
+
return {}, {}
|
| 1011 |
+
if not isinstance(r, tuple):
|
| 1012 |
+
return r, {}
|
| 1013 |
+
return r
|
| 1014 |
+
|
| 1015 |
+
@catch_format_error
|
| 1016 |
+
def __call__(self, obj, include=None, exclude=None):
|
| 1017 |
+
"""Compute the format for an object.
|
| 1018 |
+
|
| 1019 |
+
Identical to parent's method but we pass extra parameters to the method.
|
| 1020 |
+
|
| 1021 |
+
Unlike other _repr_*_ `_repr_mimebundle_` should allow extra kwargs, in
|
| 1022 |
+
particular `include` and `exclude`.
|
| 1023 |
+
"""
|
| 1024 |
+
if self.enabled:
|
| 1025 |
+
# lookup registered printer
|
| 1026 |
+
try:
|
| 1027 |
+
printer = self.lookup(obj)
|
| 1028 |
+
except KeyError:
|
| 1029 |
+
pass
|
| 1030 |
+
else:
|
| 1031 |
+
return printer(obj)
|
| 1032 |
+
# Finally look for special method names
|
| 1033 |
+
method = get_real_method(obj, self.print_method)
|
| 1034 |
+
|
| 1035 |
+
if method is not None:
|
| 1036 |
+
return method(include=include, exclude=exclude)
|
| 1037 |
+
return None
|
| 1038 |
+
else:
|
| 1039 |
+
return None
|
| 1040 |
+
|
| 1041 |
+
|
| 1042 |
+
FormatterABC.register(BaseFormatter)
|
| 1043 |
+
FormatterABC.register(PlainTextFormatter)
|
| 1044 |
+
FormatterABC.register(HTMLFormatter)
|
| 1045 |
+
FormatterABC.register(MarkdownFormatter)
|
| 1046 |
+
FormatterABC.register(SVGFormatter)
|
| 1047 |
+
FormatterABC.register(PNGFormatter)
|
| 1048 |
+
FormatterABC.register(PDFFormatter)
|
| 1049 |
+
FormatterABC.register(JPEGFormatter)
|
| 1050 |
+
FormatterABC.register(LatexFormatter)
|
| 1051 |
+
FormatterABC.register(JSONFormatter)
|
| 1052 |
+
FormatterABC.register(JavascriptFormatter)
|
| 1053 |
+
FormatterABC.register(IPythonDisplayFormatter)
|
| 1054 |
+
FormatterABC.register(MimeBundleFormatter)
|
| 1055 |
+
|
| 1056 |
+
|
| 1057 |
+
def format_display_data(obj, include=None, exclude=None):
|
| 1058 |
+
"""Return a format data dict for an object.
|
| 1059 |
+
|
| 1060 |
+
By default all format types will be computed.
|
| 1061 |
+
|
| 1062 |
+
Parameters
|
| 1063 |
+
----------
|
| 1064 |
+
obj : object
|
| 1065 |
+
The Python object whose format data will be computed.
|
| 1066 |
+
|
| 1067 |
+
Returns
|
| 1068 |
+
-------
|
| 1069 |
+
format_dict : dict
|
| 1070 |
+
A dictionary of key/value pairs, one or each format that was
|
| 1071 |
+
generated for the object. The keys are the format types, which
|
| 1072 |
+
will usually be MIME type strings and the values and JSON'able
|
| 1073 |
+
data structure containing the raw data for the representation in
|
| 1074 |
+
that format.
|
| 1075 |
+
include : list or tuple, optional
|
| 1076 |
+
A list of format type strings (MIME types) to include in the
|
| 1077 |
+
format data dict. If this is set *only* the format types included
|
| 1078 |
+
in this list will be computed.
|
| 1079 |
+
exclude : list or tuple, optional
|
| 1080 |
+
A list of format type string (MIME types) to exclude in the format
|
| 1081 |
+
data dict. If this is set all format types will be computed,
|
| 1082 |
+
except for those included in this argument.
|
| 1083 |
+
"""
|
| 1084 |
+
from .interactiveshell import InteractiveShell
|
| 1085 |
+
|
| 1086 |
+
return InteractiveShell.instance().display_formatter.format(
|
| 1087 |
+
obj,
|
| 1088 |
+
include,
|
| 1089 |
+
exclude
|
| 1090 |
+
)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/getipython.py
ADDED
|
@@ -0,0 +1,24 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""Simple function to call to get the current InteractiveShell instance
|
| 3 |
+
"""
|
| 4 |
+
|
| 5 |
+
#-----------------------------------------------------------------------------
|
| 6 |
+
# Copyright (C) 2013 The IPython Development Team
|
| 7 |
+
#
|
| 8 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 9 |
+
# the file COPYING, distributed as part of this software.
|
| 10 |
+
#-----------------------------------------------------------------------------
|
| 11 |
+
|
| 12 |
+
#-----------------------------------------------------------------------------
|
| 13 |
+
# Classes and functions
|
| 14 |
+
#-----------------------------------------------------------------------------
|
| 15 |
+
|
| 16 |
+
|
| 17 |
+
def get_ipython():
|
| 18 |
+
"""Get the global InteractiveShell instance.
|
| 19 |
+
|
| 20 |
+
Returns None if no InteractiveShell instance is registered.
|
| 21 |
+
"""
|
| 22 |
+
from IPython.core.interactiveshell import InteractiveShell
|
| 23 |
+
if InteractiveShell.initialized():
|
| 24 |
+
return InteractiveShell.instance()
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/guarded_eval.py
ADDED
|
@@ -0,0 +1,895 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from inspect import isclass, signature, Signature
|
| 2 |
+
from typing import (
|
| 3 |
+
Annotated,
|
| 4 |
+
AnyStr,
|
| 5 |
+
Callable,
|
| 6 |
+
Dict,
|
| 7 |
+
Literal,
|
| 8 |
+
NamedTuple,
|
| 9 |
+
NewType,
|
| 10 |
+
Optional,
|
| 11 |
+
Protocol,
|
| 12 |
+
Set,
|
| 13 |
+
Sequence,
|
| 14 |
+
Tuple,
|
| 15 |
+
Type,
|
| 16 |
+
TypeGuard,
|
| 17 |
+
Union,
|
| 18 |
+
get_args,
|
| 19 |
+
get_origin,
|
| 20 |
+
is_typeddict,
|
| 21 |
+
)
|
| 22 |
+
import ast
|
| 23 |
+
import builtins
|
| 24 |
+
import collections
|
| 25 |
+
import operator
|
| 26 |
+
import sys
|
| 27 |
+
from functools import cached_property
|
| 28 |
+
from dataclasses import dataclass, field
|
| 29 |
+
from types import MethodDescriptorType, ModuleType
|
| 30 |
+
|
| 31 |
+
from IPython.utils.decorators import undoc
|
| 32 |
+
|
| 33 |
+
|
| 34 |
+
if sys.version_info < (3, 11):
|
| 35 |
+
from typing_extensions import Self, LiteralString
|
| 36 |
+
else:
|
| 37 |
+
from typing import Self, LiteralString
|
| 38 |
+
|
| 39 |
+
if sys.version_info < (3, 12):
|
| 40 |
+
from typing_extensions import TypeAliasType
|
| 41 |
+
else:
|
| 42 |
+
from typing import TypeAliasType
|
| 43 |
+
|
| 44 |
+
|
| 45 |
+
@undoc
|
| 46 |
+
class HasGetItem(Protocol):
|
| 47 |
+
def __getitem__(self, key) -> None: ...
|
| 48 |
+
|
| 49 |
+
|
| 50 |
+
@undoc
|
| 51 |
+
class InstancesHaveGetItem(Protocol):
|
| 52 |
+
def __call__(self, *args, **kwargs) -> HasGetItem: ...
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
@undoc
|
| 56 |
+
class HasGetAttr(Protocol):
|
| 57 |
+
def __getattr__(self, key) -> None: ...
|
| 58 |
+
|
| 59 |
+
|
| 60 |
+
@undoc
|
| 61 |
+
class DoesNotHaveGetAttr(Protocol):
|
| 62 |
+
pass
|
| 63 |
+
|
| 64 |
+
|
| 65 |
+
# By default `__getattr__` is not explicitly implemented on most objects
|
| 66 |
+
MayHaveGetattr = Union[HasGetAttr, DoesNotHaveGetAttr]
|
| 67 |
+
|
| 68 |
+
|
| 69 |
+
def _unbind_method(func: Callable) -> Union[Callable, None]:
|
| 70 |
+
"""Get unbound method for given bound method.
|
| 71 |
+
|
| 72 |
+
Returns None if cannot get unbound method, or method is already unbound.
|
| 73 |
+
"""
|
| 74 |
+
owner = getattr(func, "__self__", None)
|
| 75 |
+
owner_class = type(owner)
|
| 76 |
+
name = getattr(func, "__name__", None)
|
| 77 |
+
instance_dict_overrides = getattr(owner, "__dict__", None)
|
| 78 |
+
if (
|
| 79 |
+
owner is not None
|
| 80 |
+
and name
|
| 81 |
+
and (
|
| 82 |
+
not instance_dict_overrides
|
| 83 |
+
or (instance_dict_overrides and name not in instance_dict_overrides)
|
| 84 |
+
)
|
| 85 |
+
):
|
| 86 |
+
return getattr(owner_class, name)
|
| 87 |
+
return None
|
| 88 |
+
|
| 89 |
+
|
| 90 |
+
@undoc
|
| 91 |
+
@dataclass
|
| 92 |
+
class EvaluationPolicy:
|
| 93 |
+
"""Definition of evaluation policy."""
|
| 94 |
+
|
| 95 |
+
allow_locals_access: bool = False
|
| 96 |
+
allow_globals_access: bool = False
|
| 97 |
+
allow_item_access: bool = False
|
| 98 |
+
allow_attr_access: bool = False
|
| 99 |
+
allow_builtins_access: bool = False
|
| 100 |
+
allow_all_operations: bool = False
|
| 101 |
+
allow_any_calls: bool = False
|
| 102 |
+
allowed_calls: Set[Callable] = field(default_factory=set)
|
| 103 |
+
|
| 104 |
+
def can_get_item(self, value, item):
|
| 105 |
+
return self.allow_item_access
|
| 106 |
+
|
| 107 |
+
def can_get_attr(self, value, attr):
|
| 108 |
+
return self.allow_attr_access
|
| 109 |
+
|
| 110 |
+
def can_operate(self, dunders: Tuple[str, ...], a, b=None):
|
| 111 |
+
if self.allow_all_operations:
|
| 112 |
+
return True
|
| 113 |
+
|
| 114 |
+
def can_call(self, func):
|
| 115 |
+
if self.allow_any_calls:
|
| 116 |
+
return True
|
| 117 |
+
|
| 118 |
+
if func in self.allowed_calls:
|
| 119 |
+
return True
|
| 120 |
+
|
| 121 |
+
owner_method = _unbind_method(func)
|
| 122 |
+
|
| 123 |
+
if owner_method and owner_method in self.allowed_calls:
|
| 124 |
+
return True
|
| 125 |
+
|
| 126 |
+
|
| 127 |
+
def _get_external(module_name: str, access_path: Sequence[str]):
|
| 128 |
+
"""Get value from external module given a dotted access path.
|
| 129 |
+
|
| 130 |
+
Raises:
|
| 131 |
+
* `KeyError` if module is removed not found, and
|
| 132 |
+
* `AttributeError` if access path does not match an exported object
|
| 133 |
+
"""
|
| 134 |
+
member_type = sys.modules[module_name]
|
| 135 |
+
for attr in access_path:
|
| 136 |
+
member_type = getattr(member_type, attr)
|
| 137 |
+
return member_type
|
| 138 |
+
|
| 139 |
+
|
| 140 |
+
def _has_original_dunder_external(
|
| 141 |
+
value,
|
| 142 |
+
module_name: str,
|
| 143 |
+
access_path: Sequence[str],
|
| 144 |
+
method_name: str,
|
| 145 |
+
):
|
| 146 |
+
if module_name not in sys.modules:
|
| 147 |
+
# LBYLB as it is faster
|
| 148 |
+
return False
|
| 149 |
+
try:
|
| 150 |
+
member_type = _get_external(module_name, access_path)
|
| 151 |
+
value_type = type(value)
|
| 152 |
+
if type(value) == member_type:
|
| 153 |
+
return True
|
| 154 |
+
if method_name == "__getattribute__":
|
| 155 |
+
# we have to short-circuit here due to an unresolved issue in
|
| 156 |
+
# `isinstance` implementation: https://bugs.python.org/issue32683
|
| 157 |
+
return False
|
| 158 |
+
if isinstance(value, member_type):
|
| 159 |
+
method = getattr(value_type, method_name, None)
|
| 160 |
+
member_method = getattr(member_type, method_name, None)
|
| 161 |
+
if member_method == method:
|
| 162 |
+
return True
|
| 163 |
+
except (AttributeError, KeyError):
|
| 164 |
+
return False
|
| 165 |
+
|
| 166 |
+
|
| 167 |
+
def _has_original_dunder(
|
| 168 |
+
value, allowed_types, allowed_methods, allowed_external, method_name
|
| 169 |
+
):
|
| 170 |
+
# note: Python ignores `__getattr__`/`__getitem__` on instances,
|
| 171 |
+
# we only need to check at class level
|
| 172 |
+
value_type = type(value)
|
| 173 |
+
|
| 174 |
+
# strict type check passes → no need to check method
|
| 175 |
+
if value_type in allowed_types:
|
| 176 |
+
return True
|
| 177 |
+
|
| 178 |
+
method = getattr(value_type, method_name, None)
|
| 179 |
+
|
| 180 |
+
if method is None:
|
| 181 |
+
return None
|
| 182 |
+
|
| 183 |
+
if method in allowed_methods:
|
| 184 |
+
return True
|
| 185 |
+
|
| 186 |
+
for module_name, *access_path in allowed_external:
|
| 187 |
+
if _has_original_dunder_external(value, module_name, access_path, method_name):
|
| 188 |
+
return True
|
| 189 |
+
|
| 190 |
+
return False
|
| 191 |
+
|
| 192 |
+
|
| 193 |
+
@undoc
|
| 194 |
+
@dataclass
|
| 195 |
+
class SelectivePolicy(EvaluationPolicy):
|
| 196 |
+
allowed_getitem: Set[InstancesHaveGetItem] = field(default_factory=set)
|
| 197 |
+
allowed_getitem_external: Set[Tuple[str, ...]] = field(default_factory=set)
|
| 198 |
+
|
| 199 |
+
allowed_getattr: Set[MayHaveGetattr] = field(default_factory=set)
|
| 200 |
+
allowed_getattr_external: Set[Tuple[str, ...]] = field(default_factory=set)
|
| 201 |
+
|
| 202 |
+
allowed_operations: Set = field(default_factory=set)
|
| 203 |
+
allowed_operations_external: Set[Tuple[str, ...]] = field(default_factory=set)
|
| 204 |
+
|
| 205 |
+
_operation_methods_cache: Dict[str, Set[Callable]] = field(
|
| 206 |
+
default_factory=dict, init=False
|
| 207 |
+
)
|
| 208 |
+
|
| 209 |
+
def can_get_attr(self, value, attr):
|
| 210 |
+
has_original_attribute = _has_original_dunder(
|
| 211 |
+
value,
|
| 212 |
+
allowed_types=self.allowed_getattr,
|
| 213 |
+
allowed_methods=self._getattribute_methods,
|
| 214 |
+
allowed_external=self.allowed_getattr_external,
|
| 215 |
+
method_name="__getattribute__",
|
| 216 |
+
)
|
| 217 |
+
has_original_attr = _has_original_dunder(
|
| 218 |
+
value,
|
| 219 |
+
allowed_types=self.allowed_getattr,
|
| 220 |
+
allowed_methods=self._getattr_methods,
|
| 221 |
+
allowed_external=self.allowed_getattr_external,
|
| 222 |
+
method_name="__getattr__",
|
| 223 |
+
)
|
| 224 |
+
|
| 225 |
+
accept = False
|
| 226 |
+
|
| 227 |
+
# Many objects do not have `__getattr__`, this is fine.
|
| 228 |
+
if has_original_attr is None and has_original_attribute:
|
| 229 |
+
accept = True
|
| 230 |
+
else:
|
| 231 |
+
# Accept objects without modifications to `__getattr__` and `__getattribute__`
|
| 232 |
+
accept = has_original_attr and has_original_attribute
|
| 233 |
+
|
| 234 |
+
if accept:
|
| 235 |
+
# We still need to check for overridden properties.
|
| 236 |
+
|
| 237 |
+
value_class = type(value)
|
| 238 |
+
if not hasattr(value_class, attr):
|
| 239 |
+
return True
|
| 240 |
+
|
| 241 |
+
class_attr_val = getattr(value_class, attr)
|
| 242 |
+
is_property = isinstance(class_attr_val, property)
|
| 243 |
+
|
| 244 |
+
if not is_property:
|
| 245 |
+
return True
|
| 246 |
+
|
| 247 |
+
# Properties in allowed types are ok (although we do not include any
|
| 248 |
+
# properties in our default allow list currently).
|
| 249 |
+
if type(value) in self.allowed_getattr:
|
| 250 |
+
return True # pragma: no cover
|
| 251 |
+
|
| 252 |
+
# Properties in subclasses of allowed types may be ok if not changed
|
| 253 |
+
for module_name, *access_path in self.allowed_getattr_external:
|
| 254 |
+
try:
|
| 255 |
+
external_class = _get_external(module_name, access_path)
|
| 256 |
+
external_class_attr_val = getattr(external_class, attr)
|
| 257 |
+
except (KeyError, AttributeError):
|
| 258 |
+
return False # pragma: no cover
|
| 259 |
+
return class_attr_val == external_class_attr_val
|
| 260 |
+
|
| 261 |
+
return False
|
| 262 |
+
|
| 263 |
+
def can_get_item(self, value, item):
|
| 264 |
+
"""Allow accessing `__getiitem__` of allow-listed instances unless it was not modified."""
|
| 265 |
+
return _has_original_dunder(
|
| 266 |
+
value,
|
| 267 |
+
allowed_types=self.allowed_getitem,
|
| 268 |
+
allowed_methods=self._getitem_methods,
|
| 269 |
+
allowed_external=self.allowed_getitem_external,
|
| 270 |
+
method_name="__getitem__",
|
| 271 |
+
)
|
| 272 |
+
|
| 273 |
+
def can_operate(self, dunders: Tuple[str, ...], a, b=None):
|
| 274 |
+
objects = [a]
|
| 275 |
+
if b is not None:
|
| 276 |
+
objects.append(b)
|
| 277 |
+
return all(
|
| 278 |
+
[
|
| 279 |
+
_has_original_dunder(
|
| 280 |
+
obj,
|
| 281 |
+
allowed_types=self.allowed_operations,
|
| 282 |
+
allowed_methods=self._operator_dunder_methods(dunder),
|
| 283 |
+
allowed_external=self.allowed_operations_external,
|
| 284 |
+
method_name=dunder,
|
| 285 |
+
)
|
| 286 |
+
for dunder in dunders
|
| 287 |
+
for obj in objects
|
| 288 |
+
]
|
| 289 |
+
)
|
| 290 |
+
|
| 291 |
+
def _operator_dunder_methods(self, dunder: str) -> Set[Callable]:
|
| 292 |
+
if dunder not in self._operation_methods_cache:
|
| 293 |
+
self._operation_methods_cache[dunder] = self._safe_get_methods(
|
| 294 |
+
self.allowed_operations, dunder
|
| 295 |
+
)
|
| 296 |
+
return self._operation_methods_cache[dunder]
|
| 297 |
+
|
| 298 |
+
@cached_property
|
| 299 |
+
def _getitem_methods(self) -> Set[Callable]:
|
| 300 |
+
return self._safe_get_methods(self.allowed_getitem, "__getitem__")
|
| 301 |
+
|
| 302 |
+
@cached_property
|
| 303 |
+
def _getattr_methods(self) -> Set[Callable]:
|
| 304 |
+
return self._safe_get_methods(self.allowed_getattr, "__getattr__")
|
| 305 |
+
|
| 306 |
+
@cached_property
|
| 307 |
+
def _getattribute_methods(self) -> Set[Callable]:
|
| 308 |
+
return self._safe_get_methods(self.allowed_getattr, "__getattribute__")
|
| 309 |
+
|
| 310 |
+
def _safe_get_methods(self, classes, name) -> Set[Callable]:
|
| 311 |
+
return {
|
| 312 |
+
method
|
| 313 |
+
for class_ in classes
|
| 314 |
+
for method in [getattr(class_, name, None)]
|
| 315 |
+
if method
|
| 316 |
+
}
|
| 317 |
+
|
| 318 |
+
|
| 319 |
+
class _DummyNamedTuple(NamedTuple):
|
| 320 |
+
"""Used internally to retrieve methods of named tuple instance."""
|
| 321 |
+
|
| 322 |
+
|
| 323 |
+
class EvaluationContext(NamedTuple):
|
| 324 |
+
#: Local namespace
|
| 325 |
+
locals: dict
|
| 326 |
+
#: Global namespace
|
| 327 |
+
globals: dict
|
| 328 |
+
#: Evaluation policy identifier
|
| 329 |
+
evaluation: Literal["forbidden", "minimal", "limited", "unsafe", "dangerous"] = (
|
| 330 |
+
"forbidden"
|
| 331 |
+
)
|
| 332 |
+
#: Whether the evaluation of code takes place inside of a subscript.
|
| 333 |
+
#: Useful for evaluating ``:-1, 'col'`` in ``df[:-1, 'col']``.
|
| 334 |
+
in_subscript: bool = False
|
| 335 |
+
|
| 336 |
+
|
| 337 |
+
class _IdentitySubscript:
|
| 338 |
+
"""Returns the key itself when item is requested via subscript."""
|
| 339 |
+
|
| 340 |
+
def __getitem__(self, key):
|
| 341 |
+
return key
|
| 342 |
+
|
| 343 |
+
|
| 344 |
+
IDENTITY_SUBSCRIPT = _IdentitySubscript()
|
| 345 |
+
SUBSCRIPT_MARKER = "__SUBSCRIPT_SENTINEL__"
|
| 346 |
+
UNKNOWN_SIGNATURE = Signature()
|
| 347 |
+
NOT_EVALUATED = object()
|
| 348 |
+
|
| 349 |
+
|
| 350 |
+
class GuardRejection(Exception):
|
| 351 |
+
"""Exception raised when guard rejects evaluation attempt."""
|
| 352 |
+
|
| 353 |
+
pass
|
| 354 |
+
|
| 355 |
+
|
| 356 |
+
def guarded_eval(code: str, context: EvaluationContext):
|
| 357 |
+
"""Evaluate provided code in the evaluation context.
|
| 358 |
+
|
| 359 |
+
If evaluation policy given by context is set to ``forbidden``
|
| 360 |
+
no evaluation will be performed; if it is set to ``dangerous``
|
| 361 |
+
standard :func:`eval` will be used; finally, for any other,
|
| 362 |
+
policy :func:`eval_node` will be called on parsed AST.
|
| 363 |
+
"""
|
| 364 |
+
locals_ = context.locals
|
| 365 |
+
|
| 366 |
+
if context.evaluation == "forbidden":
|
| 367 |
+
raise GuardRejection("Forbidden mode")
|
| 368 |
+
|
| 369 |
+
# note: not using `ast.literal_eval` as it does not implement
|
| 370 |
+
# getitem at all, for example it fails on simple `[0][1]`
|
| 371 |
+
|
| 372 |
+
if context.in_subscript:
|
| 373 |
+
# syntactic sugar for ellipsis (:) is only available in subscripts
|
| 374 |
+
# so we need to trick the ast parser into thinking that we have
|
| 375 |
+
# a subscript, but we need to be able to later recognise that we did
|
| 376 |
+
# it so we can ignore the actual __getitem__ operation
|
| 377 |
+
if not code:
|
| 378 |
+
return tuple()
|
| 379 |
+
locals_ = locals_.copy()
|
| 380 |
+
locals_[SUBSCRIPT_MARKER] = IDENTITY_SUBSCRIPT
|
| 381 |
+
code = SUBSCRIPT_MARKER + "[" + code + "]"
|
| 382 |
+
context = EvaluationContext(**{**context._asdict(), **{"locals": locals_}})
|
| 383 |
+
|
| 384 |
+
if context.evaluation == "dangerous":
|
| 385 |
+
return eval(code, context.globals, context.locals)
|
| 386 |
+
|
| 387 |
+
expression = ast.parse(code, mode="eval")
|
| 388 |
+
|
| 389 |
+
return eval_node(expression, context)
|
| 390 |
+
|
| 391 |
+
|
| 392 |
+
BINARY_OP_DUNDERS: Dict[Type[ast.operator], Tuple[str]] = {
|
| 393 |
+
ast.Add: ("__add__",),
|
| 394 |
+
ast.Sub: ("__sub__",),
|
| 395 |
+
ast.Mult: ("__mul__",),
|
| 396 |
+
ast.Div: ("__truediv__",),
|
| 397 |
+
ast.FloorDiv: ("__floordiv__",),
|
| 398 |
+
ast.Mod: ("__mod__",),
|
| 399 |
+
ast.Pow: ("__pow__",),
|
| 400 |
+
ast.LShift: ("__lshift__",),
|
| 401 |
+
ast.RShift: ("__rshift__",),
|
| 402 |
+
ast.BitOr: ("__or__",),
|
| 403 |
+
ast.BitXor: ("__xor__",),
|
| 404 |
+
ast.BitAnd: ("__and__",),
|
| 405 |
+
ast.MatMult: ("__matmul__",),
|
| 406 |
+
}
|
| 407 |
+
|
| 408 |
+
COMP_OP_DUNDERS: Dict[Type[ast.cmpop], Tuple[str, ...]] = {
|
| 409 |
+
ast.Eq: ("__eq__",),
|
| 410 |
+
ast.NotEq: ("__ne__", "__eq__"),
|
| 411 |
+
ast.Lt: ("__lt__", "__gt__"),
|
| 412 |
+
ast.LtE: ("__le__", "__ge__"),
|
| 413 |
+
ast.Gt: ("__gt__", "__lt__"),
|
| 414 |
+
ast.GtE: ("__ge__", "__le__"),
|
| 415 |
+
ast.In: ("__contains__",),
|
| 416 |
+
# Note: ast.Is, ast.IsNot, ast.NotIn are handled specially
|
| 417 |
+
}
|
| 418 |
+
|
| 419 |
+
UNARY_OP_DUNDERS: Dict[Type[ast.unaryop], Tuple[str, ...]] = {
|
| 420 |
+
ast.USub: ("__neg__",),
|
| 421 |
+
ast.UAdd: ("__pos__",),
|
| 422 |
+
# we have to check both __inv__ and __invert__!
|
| 423 |
+
ast.Invert: ("__invert__", "__inv__"),
|
| 424 |
+
ast.Not: ("__not__",),
|
| 425 |
+
}
|
| 426 |
+
|
| 427 |
+
|
| 428 |
+
class ImpersonatingDuck:
|
| 429 |
+
"""A dummy class used to create objects of other classes without calling their ``__init__``"""
|
| 430 |
+
|
| 431 |
+
# no-op: override __class__ to impersonate
|
| 432 |
+
|
| 433 |
+
|
| 434 |
+
class _Duck:
|
| 435 |
+
"""A dummy class used to create objects pretending to have given attributes"""
|
| 436 |
+
|
| 437 |
+
def __init__(self, attributes: Optional[dict] = None, items: Optional[dict] = None):
|
| 438 |
+
self.attributes = attributes or {}
|
| 439 |
+
self.items = items or {}
|
| 440 |
+
|
| 441 |
+
def __getattr__(self, attr: str):
|
| 442 |
+
return self.attributes[attr]
|
| 443 |
+
|
| 444 |
+
def __hasattr__(self, attr: str):
|
| 445 |
+
return attr in self.attributes
|
| 446 |
+
|
| 447 |
+
def __dir__(self):
|
| 448 |
+
return [*dir(super), *self.attributes]
|
| 449 |
+
|
| 450 |
+
def __getitem__(self, key: str):
|
| 451 |
+
return self.items[key]
|
| 452 |
+
|
| 453 |
+
def __hasitem__(self, key: str):
|
| 454 |
+
return self.items[key]
|
| 455 |
+
|
| 456 |
+
def _ipython_key_completions_(self):
|
| 457 |
+
return self.items.keys()
|
| 458 |
+
|
| 459 |
+
|
| 460 |
+
def _find_dunder(node_op, dunders) -> Union[Tuple[str, ...], None]:
|
| 461 |
+
dunder = None
|
| 462 |
+
for op, candidate_dunder in dunders.items():
|
| 463 |
+
if isinstance(node_op, op):
|
| 464 |
+
dunder = candidate_dunder
|
| 465 |
+
return dunder
|
| 466 |
+
|
| 467 |
+
|
| 468 |
+
def eval_node(node: Union[ast.AST, None], context: EvaluationContext):
|
| 469 |
+
"""Evaluate AST node in provided context.
|
| 470 |
+
|
| 471 |
+
Applies evaluation restrictions defined in the context. Currently does not support evaluation of functions with keyword arguments.
|
| 472 |
+
|
| 473 |
+
Does not evaluate actions that always have side effects:
|
| 474 |
+
|
| 475 |
+
- class definitions (``class sth: ...``)
|
| 476 |
+
- function definitions (``def sth: ...``)
|
| 477 |
+
- variable assignments (``x = 1``)
|
| 478 |
+
- augmented assignments (``x += 1``)
|
| 479 |
+
- deletions (``del x``)
|
| 480 |
+
|
| 481 |
+
Does not evaluate operations which do not return values:
|
| 482 |
+
|
| 483 |
+
- assertions (``assert x``)
|
| 484 |
+
- pass (``pass``)
|
| 485 |
+
- imports (``import x``)
|
| 486 |
+
- control flow:
|
| 487 |
+
|
| 488 |
+
- conditionals (``if x:``) except for ternary IfExp (``a if x else b``)
|
| 489 |
+
- loops (``for`` and ``while``)
|
| 490 |
+
- exception handling
|
| 491 |
+
|
| 492 |
+
The purpose of this function is to guard against unwanted side-effects;
|
| 493 |
+
it does not give guarantees on protection from malicious code execution.
|
| 494 |
+
"""
|
| 495 |
+
policy = EVALUATION_POLICIES[context.evaluation]
|
| 496 |
+
if node is None:
|
| 497 |
+
return None
|
| 498 |
+
if isinstance(node, ast.Expression):
|
| 499 |
+
return eval_node(node.body, context)
|
| 500 |
+
if isinstance(node, ast.BinOp):
|
| 501 |
+
left = eval_node(node.left, context)
|
| 502 |
+
right = eval_node(node.right, context)
|
| 503 |
+
dunders = _find_dunder(node.op, BINARY_OP_DUNDERS)
|
| 504 |
+
if dunders:
|
| 505 |
+
if policy.can_operate(dunders, left, right):
|
| 506 |
+
return getattr(left, dunders[0])(right)
|
| 507 |
+
else:
|
| 508 |
+
raise GuardRejection(
|
| 509 |
+
f"Operation (`{dunders}`) for",
|
| 510 |
+
type(left),
|
| 511 |
+
f"not allowed in {context.evaluation} mode",
|
| 512 |
+
)
|
| 513 |
+
if isinstance(node, ast.Compare):
|
| 514 |
+
left = eval_node(node.left, context)
|
| 515 |
+
all_true = True
|
| 516 |
+
negate = False
|
| 517 |
+
for op, right in zip(node.ops, node.comparators):
|
| 518 |
+
right = eval_node(right, context)
|
| 519 |
+
dunder = None
|
| 520 |
+
dunders = _find_dunder(op, COMP_OP_DUNDERS)
|
| 521 |
+
if not dunders:
|
| 522 |
+
if isinstance(op, ast.NotIn):
|
| 523 |
+
dunders = COMP_OP_DUNDERS[ast.In]
|
| 524 |
+
negate = True
|
| 525 |
+
if isinstance(op, ast.Is):
|
| 526 |
+
dunder = "is_"
|
| 527 |
+
if isinstance(op, ast.IsNot):
|
| 528 |
+
dunder = "is_"
|
| 529 |
+
negate = True
|
| 530 |
+
if not dunder and dunders:
|
| 531 |
+
dunder = dunders[0]
|
| 532 |
+
if dunder:
|
| 533 |
+
a, b = (right, left) if dunder == "__contains__" else (left, right)
|
| 534 |
+
if dunder == "is_" or dunders and policy.can_operate(dunders, a, b):
|
| 535 |
+
result = getattr(operator, dunder)(a, b)
|
| 536 |
+
if negate:
|
| 537 |
+
result = not result
|
| 538 |
+
if not result:
|
| 539 |
+
all_true = False
|
| 540 |
+
left = right
|
| 541 |
+
else:
|
| 542 |
+
raise GuardRejection(
|
| 543 |
+
f"Comparison (`{dunder}`) for",
|
| 544 |
+
type(left),
|
| 545 |
+
f"not allowed in {context.evaluation} mode",
|
| 546 |
+
)
|
| 547 |
+
else:
|
| 548 |
+
raise ValueError(
|
| 549 |
+
f"Comparison `{dunder}` not supported"
|
| 550 |
+
) # pragma: no cover
|
| 551 |
+
return all_true
|
| 552 |
+
if isinstance(node, ast.Constant):
|
| 553 |
+
return node.value
|
| 554 |
+
if isinstance(node, ast.Tuple):
|
| 555 |
+
return tuple(eval_node(e, context) for e in node.elts)
|
| 556 |
+
if isinstance(node, ast.List):
|
| 557 |
+
return [eval_node(e, context) for e in node.elts]
|
| 558 |
+
if isinstance(node, ast.Set):
|
| 559 |
+
return {eval_node(e, context) for e in node.elts}
|
| 560 |
+
if isinstance(node, ast.Dict):
|
| 561 |
+
return dict(
|
| 562 |
+
zip(
|
| 563 |
+
[eval_node(k, context) for k in node.keys],
|
| 564 |
+
[eval_node(v, context) for v in node.values],
|
| 565 |
+
)
|
| 566 |
+
)
|
| 567 |
+
if isinstance(node, ast.Slice):
|
| 568 |
+
return slice(
|
| 569 |
+
eval_node(node.lower, context),
|
| 570 |
+
eval_node(node.upper, context),
|
| 571 |
+
eval_node(node.step, context),
|
| 572 |
+
)
|
| 573 |
+
if isinstance(node, ast.UnaryOp):
|
| 574 |
+
value = eval_node(node.operand, context)
|
| 575 |
+
dunders = _find_dunder(node.op, UNARY_OP_DUNDERS)
|
| 576 |
+
if dunders:
|
| 577 |
+
if policy.can_operate(dunders, value):
|
| 578 |
+
return getattr(value, dunders[0])()
|
| 579 |
+
else:
|
| 580 |
+
raise GuardRejection(
|
| 581 |
+
f"Operation (`{dunders}`) for",
|
| 582 |
+
type(value),
|
| 583 |
+
f"not allowed in {context.evaluation} mode",
|
| 584 |
+
)
|
| 585 |
+
if isinstance(node, ast.Subscript):
|
| 586 |
+
value = eval_node(node.value, context)
|
| 587 |
+
slice_ = eval_node(node.slice, context)
|
| 588 |
+
if policy.can_get_item(value, slice_):
|
| 589 |
+
return value[slice_]
|
| 590 |
+
raise GuardRejection(
|
| 591 |
+
"Subscript access (`__getitem__`) for",
|
| 592 |
+
type(value), # not joined to avoid calling `repr`
|
| 593 |
+
f" not allowed in {context.evaluation} mode",
|
| 594 |
+
)
|
| 595 |
+
if isinstance(node, ast.Name):
|
| 596 |
+
return _eval_node_name(node.id, context)
|
| 597 |
+
if isinstance(node, ast.Attribute):
|
| 598 |
+
value = eval_node(node.value, context)
|
| 599 |
+
if policy.can_get_attr(value, node.attr):
|
| 600 |
+
return getattr(value, node.attr)
|
| 601 |
+
raise GuardRejection(
|
| 602 |
+
"Attribute access (`__getattr__`) for",
|
| 603 |
+
type(value), # not joined to avoid calling `repr`
|
| 604 |
+
f"not allowed in {context.evaluation} mode",
|
| 605 |
+
)
|
| 606 |
+
if isinstance(node, ast.IfExp):
|
| 607 |
+
test = eval_node(node.test, context)
|
| 608 |
+
if test:
|
| 609 |
+
return eval_node(node.body, context)
|
| 610 |
+
else:
|
| 611 |
+
return eval_node(node.orelse, context)
|
| 612 |
+
if isinstance(node, ast.Call):
|
| 613 |
+
func = eval_node(node.func, context)
|
| 614 |
+
if policy.can_call(func) and not node.keywords:
|
| 615 |
+
args = [eval_node(arg, context) for arg in node.args]
|
| 616 |
+
return func(*args)
|
| 617 |
+
if isclass(func):
|
| 618 |
+
# this code path gets entered when calling class e.g. `MyClass()`
|
| 619 |
+
# or `my_instance.__class__()` - in both cases `func` is `MyClass`.
|
| 620 |
+
# Should return `MyClass` if `__new__` is not overridden,
|
| 621 |
+
# otherwise whatever `__new__` return type is.
|
| 622 |
+
overridden_return_type = _eval_return_type(func.__new__, node, context)
|
| 623 |
+
if overridden_return_type is not NOT_EVALUATED:
|
| 624 |
+
return overridden_return_type
|
| 625 |
+
return _create_duck_for_heap_type(func)
|
| 626 |
+
else:
|
| 627 |
+
return_type = _eval_return_type(func, node, context)
|
| 628 |
+
if return_type is not NOT_EVALUATED:
|
| 629 |
+
return return_type
|
| 630 |
+
raise GuardRejection(
|
| 631 |
+
"Call for",
|
| 632 |
+
func, # not joined to avoid calling `repr`
|
| 633 |
+
f"not allowed in {context.evaluation} mode",
|
| 634 |
+
)
|
| 635 |
+
raise ValueError("Unhandled node", ast.dump(node))
|
| 636 |
+
|
| 637 |
+
|
| 638 |
+
def _eval_return_type(func: Callable, node: ast.Call, context: EvaluationContext):
|
| 639 |
+
"""Evaluate return type of a given callable function.
|
| 640 |
+
|
| 641 |
+
Returns the built-in type, a duck or NOT_EVALUATED sentinel.
|
| 642 |
+
"""
|
| 643 |
+
try:
|
| 644 |
+
sig = signature(func)
|
| 645 |
+
except ValueError:
|
| 646 |
+
sig = UNKNOWN_SIGNATURE
|
| 647 |
+
# if annotation was not stringized, or it was stringized
|
| 648 |
+
# but resolved by signature call we know the return type
|
| 649 |
+
not_empty = sig.return_annotation is not Signature.empty
|
| 650 |
+
if not_empty:
|
| 651 |
+
return _resolve_annotation(sig.return_annotation, sig, func, node, context)
|
| 652 |
+
return NOT_EVALUATED
|
| 653 |
+
|
| 654 |
+
|
| 655 |
+
def _resolve_annotation(
|
| 656 |
+
annotation,
|
| 657 |
+
sig: Signature,
|
| 658 |
+
func: Callable,
|
| 659 |
+
node: ast.Call,
|
| 660 |
+
context: EvaluationContext,
|
| 661 |
+
):
|
| 662 |
+
"""Resolve annotation created by user with `typing` module and custom objects."""
|
| 663 |
+
annotation = (
|
| 664 |
+
_eval_node_name(annotation, context)
|
| 665 |
+
if isinstance(annotation, str)
|
| 666 |
+
else annotation
|
| 667 |
+
)
|
| 668 |
+
origin = get_origin(annotation)
|
| 669 |
+
if annotation is Self and hasattr(func, "__self__"):
|
| 670 |
+
return func.__self__
|
| 671 |
+
elif origin is Literal:
|
| 672 |
+
type_args = get_args(annotation)
|
| 673 |
+
if len(type_args) == 1:
|
| 674 |
+
return type_args[0]
|
| 675 |
+
elif annotation is LiteralString:
|
| 676 |
+
return ""
|
| 677 |
+
elif annotation is AnyStr:
|
| 678 |
+
index = None
|
| 679 |
+
for i, (key, value) in enumerate(sig.parameters.items()):
|
| 680 |
+
if value.annotation is AnyStr:
|
| 681 |
+
index = i
|
| 682 |
+
break
|
| 683 |
+
if index is not None and index < len(node.args):
|
| 684 |
+
return eval_node(node.args[index], context)
|
| 685 |
+
elif origin is TypeGuard:
|
| 686 |
+
return bool()
|
| 687 |
+
elif origin is Union:
|
| 688 |
+
attributes = [
|
| 689 |
+
attr
|
| 690 |
+
for type_arg in get_args(annotation)
|
| 691 |
+
for attr in dir(_resolve_annotation(type_arg, sig, func, node, context))
|
| 692 |
+
]
|
| 693 |
+
return _Duck(attributes=dict.fromkeys(attributes))
|
| 694 |
+
elif is_typeddict(annotation):
|
| 695 |
+
return _Duck(
|
| 696 |
+
attributes=dict.fromkeys(dir(dict())),
|
| 697 |
+
items={
|
| 698 |
+
k: _resolve_annotation(v, sig, func, node, context)
|
| 699 |
+
for k, v in annotation.__annotations__.items()
|
| 700 |
+
},
|
| 701 |
+
)
|
| 702 |
+
elif hasattr(annotation, "_is_protocol"):
|
| 703 |
+
return _Duck(attributes=dict.fromkeys(dir(annotation)))
|
| 704 |
+
elif origin is Annotated:
|
| 705 |
+
type_arg = get_args(annotation)[0]
|
| 706 |
+
return _resolve_annotation(type_arg, sig, func, node, context)
|
| 707 |
+
elif isinstance(annotation, NewType):
|
| 708 |
+
return _eval_or_create_duck(annotation.__supertype__, node, context)
|
| 709 |
+
elif isinstance(annotation, TypeAliasType):
|
| 710 |
+
return _eval_or_create_duck(annotation.__value__, node, context)
|
| 711 |
+
else:
|
| 712 |
+
return _eval_or_create_duck(annotation, node, context)
|
| 713 |
+
|
| 714 |
+
|
| 715 |
+
def _eval_node_name(node_id: str, context: EvaluationContext):
|
| 716 |
+
policy = EVALUATION_POLICIES[context.evaluation]
|
| 717 |
+
if policy.allow_locals_access and node_id in context.locals:
|
| 718 |
+
return context.locals[node_id]
|
| 719 |
+
if policy.allow_globals_access and node_id in context.globals:
|
| 720 |
+
return context.globals[node_id]
|
| 721 |
+
if policy.allow_builtins_access and hasattr(builtins, node_id):
|
| 722 |
+
# note: do not use __builtins__, it is implementation detail of cPython
|
| 723 |
+
return getattr(builtins, node_id)
|
| 724 |
+
if not policy.allow_globals_access and not policy.allow_locals_access:
|
| 725 |
+
raise GuardRejection(
|
| 726 |
+
f"Namespace access not allowed in {context.evaluation} mode"
|
| 727 |
+
)
|
| 728 |
+
else:
|
| 729 |
+
raise NameError(f"{node_id} not found in locals, globals, nor builtins")
|
| 730 |
+
|
| 731 |
+
|
| 732 |
+
def _eval_or_create_duck(duck_type, node: ast.Call, context: EvaluationContext):
|
| 733 |
+
policy = EVALUATION_POLICIES[context.evaluation]
|
| 734 |
+
# if allow-listed builtin is on type annotation, instantiate it
|
| 735 |
+
if policy.can_call(duck_type) and not node.keywords:
|
| 736 |
+
args = [eval_node(arg, context) for arg in node.args]
|
| 737 |
+
return duck_type(*args)
|
| 738 |
+
# if custom class is in type annotation, mock it
|
| 739 |
+
return _create_duck_for_heap_type(duck_type)
|
| 740 |
+
|
| 741 |
+
|
| 742 |
+
def _create_duck_for_heap_type(duck_type):
|
| 743 |
+
"""Create an imitation of an object of a given type (a duck).
|
| 744 |
+
|
| 745 |
+
Returns the duck or NOT_EVALUATED sentinel if duck could not be created.
|
| 746 |
+
"""
|
| 747 |
+
duck = ImpersonatingDuck()
|
| 748 |
+
try:
|
| 749 |
+
# this only works for heap types, not builtins
|
| 750 |
+
duck.__class__ = duck_type
|
| 751 |
+
return duck
|
| 752 |
+
except TypeError:
|
| 753 |
+
pass
|
| 754 |
+
return NOT_EVALUATED
|
| 755 |
+
|
| 756 |
+
|
| 757 |
+
SUPPORTED_EXTERNAL_GETITEM = {
|
| 758 |
+
("pandas", "core", "indexing", "_iLocIndexer"),
|
| 759 |
+
("pandas", "core", "indexing", "_LocIndexer"),
|
| 760 |
+
("pandas", "DataFrame"),
|
| 761 |
+
("pandas", "Series"),
|
| 762 |
+
("numpy", "ndarray"),
|
| 763 |
+
("numpy", "void"),
|
| 764 |
+
}
|
| 765 |
+
|
| 766 |
+
|
| 767 |
+
BUILTIN_GETITEM: Set[InstancesHaveGetItem] = {
|
| 768 |
+
dict,
|
| 769 |
+
str, # type: ignore[arg-type]
|
| 770 |
+
bytes, # type: ignore[arg-type]
|
| 771 |
+
list,
|
| 772 |
+
tuple,
|
| 773 |
+
collections.defaultdict,
|
| 774 |
+
collections.deque,
|
| 775 |
+
collections.OrderedDict,
|
| 776 |
+
collections.ChainMap,
|
| 777 |
+
collections.UserDict,
|
| 778 |
+
collections.UserList,
|
| 779 |
+
collections.UserString, # type: ignore[arg-type]
|
| 780 |
+
_DummyNamedTuple,
|
| 781 |
+
_IdentitySubscript,
|
| 782 |
+
}
|
| 783 |
+
|
| 784 |
+
|
| 785 |
+
def _list_methods(cls, source=None):
|
| 786 |
+
"""For use on immutable objects or with methods returning a copy"""
|
| 787 |
+
return [getattr(cls, k) for k in (source if source else dir(cls))]
|
| 788 |
+
|
| 789 |
+
|
| 790 |
+
dict_non_mutating_methods = ("copy", "keys", "values", "items")
|
| 791 |
+
list_non_mutating_methods = ("copy", "index", "count")
|
| 792 |
+
set_non_mutating_methods = set(dir(set)) & set(dir(frozenset))
|
| 793 |
+
|
| 794 |
+
|
| 795 |
+
dict_keys: Type[collections.abc.KeysView] = type({}.keys())
|
| 796 |
+
|
| 797 |
+
NUMERICS = {int, float, complex}
|
| 798 |
+
|
| 799 |
+
ALLOWED_CALLS = {
|
| 800 |
+
bytes,
|
| 801 |
+
*_list_methods(bytes),
|
| 802 |
+
dict,
|
| 803 |
+
*_list_methods(dict, dict_non_mutating_methods),
|
| 804 |
+
dict_keys.isdisjoint,
|
| 805 |
+
list,
|
| 806 |
+
*_list_methods(list, list_non_mutating_methods),
|
| 807 |
+
set,
|
| 808 |
+
*_list_methods(set, set_non_mutating_methods),
|
| 809 |
+
frozenset,
|
| 810 |
+
*_list_methods(frozenset),
|
| 811 |
+
range,
|
| 812 |
+
str,
|
| 813 |
+
*_list_methods(str),
|
| 814 |
+
tuple,
|
| 815 |
+
*_list_methods(tuple),
|
| 816 |
+
*NUMERICS,
|
| 817 |
+
*[method for numeric_cls in NUMERICS for method in _list_methods(numeric_cls)],
|
| 818 |
+
collections.deque,
|
| 819 |
+
*_list_methods(collections.deque, list_non_mutating_methods),
|
| 820 |
+
collections.defaultdict,
|
| 821 |
+
*_list_methods(collections.defaultdict, dict_non_mutating_methods),
|
| 822 |
+
collections.OrderedDict,
|
| 823 |
+
*_list_methods(collections.OrderedDict, dict_non_mutating_methods),
|
| 824 |
+
collections.UserDict,
|
| 825 |
+
*_list_methods(collections.UserDict, dict_non_mutating_methods),
|
| 826 |
+
collections.UserList,
|
| 827 |
+
*_list_methods(collections.UserList, list_non_mutating_methods),
|
| 828 |
+
collections.UserString,
|
| 829 |
+
*_list_methods(collections.UserString, dir(str)),
|
| 830 |
+
collections.Counter,
|
| 831 |
+
*_list_methods(collections.Counter, dict_non_mutating_methods),
|
| 832 |
+
collections.Counter.elements,
|
| 833 |
+
collections.Counter.most_common,
|
| 834 |
+
}
|
| 835 |
+
|
| 836 |
+
BUILTIN_GETATTR: Set[MayHaveGetattr] = {
|
| 837 |
+
*BUILTIN_GETITEM,
|
| 838 |
+
set,
|
| 839 |
+
frozenset,
|
| 840 |
+
object,
|
| 841 |
+
type, # `type` handles a lot of generic cases, e.g. numbers as in `int.real`.
|
| 842 |
+
*NUMERICS,
|
| 843 |
+
dict_keys,
|
| 844 |
+
MethodDescriptorType,
|
| 845 |
+
ModuleType,
|
| 846 |
+
}
|
| 847 |
+
|
| 848 |
+
|
| 849 |
+
BUILTIN_OPERATIONS = {*BUILTIN_GETATTR}
|
| 850 |
+
|
| 851 |
+
EVALUATION_POLICIES = {
|
| 852 |
+
"minimal": EvaluationPolicy(
|
| 853 |
+
allow_builtins_access=True,
|
| 854 |
+
allow_locals_access=False,
|
| 855 |
+
allow_globals_access=False,
|
| 856 |
+
allow_item_access=False,
|
| 857 |
+
allow_attr_access=False,
|
| 858 |
+
allowed_calls=set(),
|
| 859 |
+
allow_any_calls=False,
|
| 860 |
+
allow_all_operations=False,
|
| 861 |
+
),
|
| 862 |
+
"limited": SelectivePolicy(
|
| 863 |
+
allowed_getitem=BUILTIN_GETITEM,
|
| 864 |
+
allowed_getitem_external=SUPPORTED_EXTERNAL_GETITEM,
|
| 865 |
+
allowed_getattr=BUILTIN_GETATTR,
|
| 866 |
+
allowed_getattr_external={
|
| 867 |
+
# pandas Series/Frame implements custom `__getattr__`
|
| 868 |
+
("pandas", "DataFrame"),
|
| 869 |
+
("pandas", "Series"),
|
| 870 |
+
},
|
| 871 |
+
allowed_operations=BUILTIN_OPERATIONS,
|
| 872 |
+
allow_builtins_access=True,
|
| 873 |
+
allow_locals_access=True,
|
| 874 |
+
allow_globals_access=True,
|
| 875 |
+
allowed_calls=ALLOWED_CALLS,
|
| 876 |
+
),
|
| 877 |
+
"unsafe": EvaluationPolicy(
|
| 878 |
+
allow_builtins_access=True,
|
| 879 |
+
allow_locals_access=True,
|
| 880 |
+
allow_globals_access=True,
|
| 881 |
+
allow_attr_access=True,
|
| 882 |
+
allow_item_access=True,
|
| 883 |
+
allow_any_calls=True,
|
| 884 |
+
allow_all_operations=True,
|
| 885 |
+
),
|
| 886 |
+
}
|
| 887 |
+
|
| 888 |
+
|
| 889 |
+
__all__ = [
|
| 890 |
+
"guarded_eval",
|
| 891 |
+
"eval_node",
|
| 892 |
+
"GuardRejection",
|
| 893 |
+
"EvaluationContext",
|
| 894 |
+
"_unbind_method",
|
| 895 |
+
]
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/history.py
ADDED
|
@@ -0,0 +1,989 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
""" History related magics and functionality """
|
| 2 |
+
|
| 3 |
+
# Copyright (c) IPython Development Team.
|
| 4 |
+
# Distributed under the terms of the Modified BSD License.
|
| 5 |
+
|
| 6 |
+
|
| 7 |
+
import atexit
|
| 8 |
+
import datetime
|
| 9 |
+
import re
|
| 10 |
+
import sqlite3
|
| 11 |
+
import threading
|
| 12 |
+
from pathlib import Path
|
| 13 |
+
|
| 14 |
+
from decorator import decorator
|
| 15 |
+
from traitlets import (
|
| 16 |
+
Any,
|
| 17 |
+
Bool,
|
| 18 |
+
Dict,
|
| 19 |
+
Instance,
|
| 20 |
+
Integer,
|
| 21 |
+
List,
|
| 22 |
+
TraitError,
|
| 23 |
+
Unicode,
|
| 24 |
+
Union,
|
| 25 |
+
default,
|
| 26 |
+
observe,
|
| 27 |
+
)
|
| 28 |
+
from traitlets.config.configurable import LoggingConfigurable
|
| 29 |
+
|
| 30 |
+
from IPython.paths import locate_profile
|
| 31 |
+
from IPython.utils.decorators import undoc
|
| 32 |
+
|
| 33 |
+
#-----------------------------------------------------------------------------
|
| 34 |
+
# Classes and functions
|
| 35 |
+
#-----------------------------------------------------------------------------
|
| 36 |
+
|
| 37 |
+
@undoc
|
| 38 |
+
class DummyDB(object):
|
| 39 |
+
"""Dummy DB that will act as a black hole for history.
|
| 40 |
+
|
| 41 |
+
Only used in the absence of sqlite"""
|
| 42 |
+
def execute(*args, **kwargs):
|
| 43 |
+
return []
|
| 44 |
+
|
| 45 |
+
def commit(self, *args, **kwargs):
|
| 46 |
+
pass
|
| 47 |
+
|
| 48 |
+
def __enter__(self, *args, **kwargs):
|
| 49 |
+
pass
|
| 50 |
+
|
| 51 |
+
def __exit__(self, *args, **kwargs):
|
| 52 |
+
pass
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
@decorator
|
| 56 |
+
def only_when_enabled(f, self, *a, **kw):
|
| 57 |
+
"""Decorator: return an empty list in the absence of sqlite."""
|
| 58 |
+
if not self.enabled:
|
| 59 |
+
return []
|
| 60 |
+
else:
|
| 61 |
+
return f(self, *a, **kw)
|
| 62 |
+
|
| 63 |
+
|
| 64 |
+
# use 16kB as threshold for whether a corrupt history db should be saved
|
| 65 |
+
# that should be at least 100 entries or so
|
| 66 |
+
_SAVE_DB_SIZE = 16384
|
| 67 |
+
|
| 68 |
+
@decorator
|
| 69 |
+
def catch_corrupt_db(f, self, *a, **kw):
|
| 70 |
+
"""A decorator which wraps HistoryAccessor method calls to catch errors from
|
| 71 |
+
a corrupt SQLite database, move the old database out of the way, and create
|
| 72 |
+
a new one.
|
| 73 |
+
|
| 74 |
+
We avoid clobbering larger databases because this may be triggered due to filesystem issues,
|
| 75 |
+
not just a corrupt file.
|
| 76 |
+
"""
|
| 77 |
+
try:
|
| 78 |
+
return f(self, *a, **kw)
|
| 79 |
+
except (sqlite3.DatabaseError, sqlite3.OperationalError) as e:
|
| 80 |
+
self._corrupt_db_counter += 1
|
| 81 |
+
self.log.error("Failed to open SQLite history %s (%s).", self.hist_file, e)
|
| 82 |
+
if self.hist_file != ':memory:':
|
| 83 |
+
if self._corrupt_db_counter > self._corrupt_db_limit:
|
| 84 |
+
self.hist_file = ':memory:'
|
| 85 |
+
self.log.error("Failed to load history too many times, history will not be saved.")
|
| 86 |
+
elif self.hist_file.is_file():
|
| 87 |
+
# move the file out of the way
|
| 88 |
+
base = str(self.hist_file.parent / self.hist_file.stem)
|
| 89 |
+
ext = self.hist_file.suffix
|
| 90 |
+
size = self.hist_file.stat().st_size
|
| 91 |
+
if size >= _SAVE_DB_SIZE:
|
| 92 |
+
# if there's significant content, avoid clobbering
|
| 93 |
+
now = datetime.datetime.now().isoformat().replace(':', '.')
|
| 94 |
+
newpath = base + '-corrupt-' + now + ext
|
| 95 |
+
# don't clobber previous corrupt backups
|
| 96 |
+
for i in range(100):
|
| 97 |
+
if not Path(newpath).exists():
|
| 98 |
+
break
|
| 99 |
+
else:
|
| 100 |
+
newpath = base + '-corrupt-' + now + (u'-%i' % i) + ext
|
| 101 |
+
else:
|
| 102 |
+
# not much content, possibly empty; don't worry about clobbering
|
| 103 |
+
# maybe we should just delete it?
|
| 104 |
+
newpath = base + '-corrupt' + ext
|
| 105 |
+
self.hist_file.rename(newpath)
|
| 106 |
+
self.log.error("History file was moved to %s and a new file created.", newpath)
|
| 107 |
+
self.init_db()
|
| 108 |
+
return []
|
| 109 |
+
else:
|
| 110 |
+
# Failed with :memory:, something serious is wrong
|
| 111 |
+
raise
|
| 112 |
+
|
| 113 |
+
|
| 114 |
+
class HistoryAccessorBase(LoggingConfigurable):
|
| 115 |
+
"""An abstract class for History Accessors """
|
| 116 |
+
|
| 117 |
+
def get_tail(self, n=10, raw=True, output=False, include_latest=False):
|
| 118 |
+
raise NotImplementedError
|
| 119 |
+
|
| 120 |
+
def search(self, pattern="*", raw=True, search_raw=True,
|
| 121 |
+
output=False, n=None, unique=False):
|
| 122 |
+
raise NotImplementedError
|
| 123 |
+
|
| 124 |
+
def get_range(self, session, start=1, stop=None, raw=True,output=False):
|
| 125 |
+
raise NotImplementedError
|
| 126 |
+
|
| 127 |
+
def get_range_by_str(self, rangestr, raw=True, output=False):
|
| 128 |
+
raise NotImplementedError
|
| 129 |
+
|
| 130 |
+
|
| 131 |
+
class HistoryAccessor(HistoryAccessorBase):
|
| 132 |
+
"""Access the history database without adding to it.
|
| 133 |
+
|
| 134 |
+
This is intended for use by standalone history tools. IPython shells use
|
| 135 |
+
HistoryManager, below, which is a subclass of this."""
|
| 136 |
+
|
| 137 |
+
# counter for init_db retries, so we don't keep trying over and over
|
| 138 |
+
_corrupt_db_counter = 0
|
| 139 |
+
# after two failures, fallback on :memory:
|
| 140 |
+
_corrupt_db_limit = 2
|
| 141 |
+
|
| 142 |
+
# String holding the path to the history file
|
| 143 |
+
hist_file = Union(
|
| 144 |
+
[Instance(Path), Unicode()],
|
| 145 |
+
help="""Path to file to use for SQLite history database.
|
| 146 |
+
|
| 147 |
+
By default, IPython will put the history database in the IPython
|
| 148 |
+
profile directory. If you would rather share one history among
|
| 149 |
+
profiles, you can set this value in each, so that they are consistent.
|
| 150 |
+
|
| 151 |
+
Due to an issue with fcntl, SQLite is known to misbehave on some NFS
|
| 152 |
+
mounts. If you see IPython hanging, try setting this to something on a
|
| 153 |
+
local disk, e.g::
|
| 154 |
+
|
| 155 |
+
ipython --HistoryManager.hist_file=/tmp/ipython_hist.sqlite
|
| 156 |
+
|
| 157 |
+
you can also use the specific value `:memory:` (including the colon
|
| 158 |
+
at both end but not the back ticks), to avoid creating an history file.
|
| 159 |
+
|
| 160 |
+
""",
|
| 161 |
+
).tag(config=True)
|
| 162 |
+
|
| 163 |
+
enabled = Bool(True,
|
| 164 |
+
help="""enable the SQLite history
|
| 165 |
+
|
| 166 |
+
set enabled=False to disable the SQLite history,
|
| 167 |
+
in which case there will be no stored history, no SQLite connection,
|
| 168 |
+
and no background saving thread. This may be necessary in some
|
| 169 |
+
threaded environments where IPython is embedded.
|
| 170 |
+
""",
|
| 171 |
+
).tag(config=True)
|
| 172 |
+
|
| 173 |
+
connection_options = Dict(
|
| 174 |
+
help="""Options for configuring the SQLite connection
|
| 175 |
+
|
| 176 |
+
These options are passed as keyword args to sqlite3.connect
|
| 177 |
+
when establishing database connections.
|
| 178 |
+
"""
|
| 179 |
+
).tag(config=True)
|
| 180 |
+
|
| 181 |
+
@default("connection_options")
|
| 182 |
+
def _default_connection_options(self):
|
| 183 |
+
return dict(check_same_thread=False)
|
| 184 |
+
|
| 185 |
+
# The SQLite database
|
| 186 |
+
db = Any()
|
| 187 |
+
@observe('db')
|
| 188 |
+
def _db_changed(self, change):
|
| 189 |
+
"""validate the db, since it can be an Instance of two different types"""
|
| 190 |
+
new = change['new']
|
| 191 |
+
connection_types = (DummyDB, sqlite3.Connection)
|
| 192 |
+
if not isinstance(new, connection_types):
|
| 193 |
+
msg = "%s.db must be sqlite3 Connection or DummyDB, not %r" % \
|
| 194 |
+
(self.__class__.__name__, new)
|
| 195 |
+
raise TraitError(msg)
|
| 196 |
+
|
| 197 |
+
def __init__(self, profile="default", hist_file="", **traits):
|
| 198 |
+
"""Create a new history accessor.
|
| 199 |
+
|
| 200 |
+
Parameters
|
| 201 |
+
----------
|
| 202 |
+
profile : str
|
| 203 |
+
The name of the profile from which to open history.
|
| 204 |
+
hist_file : str
|
| 205 |
+
Path to an SQLite history database stored by IPython. If specified,
|
| 206 |
+
hist_file overrides profile.
|
| 207 |
+
config : :class:`~traitlets.config.loader.Config`
|
| 208 |
+
Config object. hist_file can also be set through this.
|
| 209 |
+
"""
|
| 210 |
+
super(HistoryAccessor, self).__init__(**traits)
|
| 211 |
+
# defer setting hist_file from kwarg until after init,
|
| 212 |
+
# otherwise the default kwarg value would clobber any value
|
| 213 |
+
# set by config
|
| 214 |
+
if hist_file:
|
| 215 |
+
self.hist_file = hist_file
|
| 216 |
+
|
| 217 |
+
try:
|
| 218 |
+
self.hist_file
|
| 219 |
+
except TraitError:
|
| 220 |
+
# No one has set the hist_file, yet.
|
| 221 |
+
self.hist_file = self._get_hist_file_name(profile)
|
| 222 |
+
|
| 223 |
+
self.init_db()
|
| 224 |
+
|
| 225 |
+
def _get_hist_file_name(self, profile='default'):
|
| 226 |
+
"""Find the history file for the given profile name.
|
| 227 |
+
|
| 228 |
+
This is overridden by the HistoryManager subclass, to use the shell's
|
| 229 |
+
active profile.
|
| 230 |
+
|
| 231 |
+
Parameters
|
| 232 |
+
----------
|
| 233 |
+
profile : str
|
| 234 |
+
The name of a profile which has a history file.
|
| 235 |
+
"""
|
| 236 |
+
return Path(locate_profile(profile)) / "history.sqlite"
|
| 237 |
+
|
| 238 |
+
@catch_corrupt_db
|
| 239 |
+
def init_db(self):
|
| 240 |
+
"""Connect to the database, and create tables if necessary."""
|
| 241 |
+
if not self.enabled:
|
| 242 |
+
self.db = DummyDB()
|
| 243 |
+
return
|
| 244 |
+
|
| 245 |
+
# use detect_types so that timestamps return datetime objects
|
| 246 |
+
kwargs = dict(detect_types=sqlite3.PARSE_DECLTYPES|sqlite3.PARSE_COLNAMES)
|
| 247 |
+
kwargs.update(self.connection_options)
|
| 248 |
+
self.db = sqlite3.connect(str(self.hist_file), **kwargs)
|
| 249 |
+
with self.db:
|
| 250 |
+
self.db.execute(
|
| 251 |
+
"""CREATE TABLE IF NOT EXISTS sessions (session integer
|
| 252 |
+
primary key autoincrement, start timestamp,
|
| 253 |
+
end timestamp, num_cmds integer, remark text)"""
|
| 254 |
+
)
|
| 255 |
+
self.db.execute(
|
| 256 |
+
"""CREATE TABLE IF NOT EXISTS history
|
| 257 |
+
(session integer, line integer, source text, source_raw text,
|
| 258 |
+
PRIMARY KEY (session, line))"""
|
| 259 |
+
)
|
| 260 |
+
# Output history is optional, but ensure the table's there so it can be
|
| 261 |
+
# enabled later.
|
| 262 |
+
self.db.execute(
|
| 263 |
+
"""CREATE TABLE IF NOT EXISTS output_history
|
| 264 |
+
(session integer, line integer, output text,
|
| 265 |
+
PRIMARY KEY (session, line))"""
|
| 266 |
+
)
|
| 267 |
+
# success! reset corrupt db count
|
| 268 |
+
self._corrupt_db_counter = 0
|
| 269 |
+
|
| 270 |
+
def writeout_cache(self):
|
| 271 |
+
"""Overridden by HistoryManager to dump the cache before certain
|
| 272 |
+
database lookups."""
|
| 273 |
+
pass
|
| 274 |
+
|
| 275 |
+
## -------------------------------
|
| 276 |
+
## Methods for retrieving history:
|
| 277 |
+
## -------------------------------
|
| 278 |
+
def _run_sql(self, sql, params, raw=True, output=False, latest=False):
|
| 279 |
+
"""Prepares and runs an SQL query for the history database.
|
| 280 |
+
|
| 281 |
+
Parameters
|
| 282 |
+
----------
|
| 283 |
+
sql : str
|
| 284 |
+
Any filtering expressions to go after SELECT ... FROM ...
|
| 285 |
+
params : tuple
|
| 286 |
+
Parameters passed to the SQL query (to replace "?")
|
| 287 |
+
raw, output : bool
|
| 288 |
+
See :meth:`get_range`
|
| 289 |
+
latest : bool
|
| 290 |
+
Select rows with max (session, line)
|
| 291 |
+
|
| 292 |
+
Returns
|
| 293 |
+
-------
|
| 294 |
+
Tuples as :meth:`get_range`
|
| 295 |
+
"""
|
| 296 |
+
toget = 'source_raw' if raw else 'source'
|
| 297 |
+
sqlfrom = "history"
|
| 298 |
+
if output:
|
| 299 |
+
sqlfrom = "history LEFT JOIN output_history USING (session, line)"
|
| 300 |
+
toget = "history.%s, output_history.output" % toget
|
| 301 |
+
if latest:
|
| 302 |
+
toget += ", MAX(session * 128 * 1024 + line)"
|
| 303 |
+
this_querry = "SELECT session, line, %s FROM %s " % (toget, sqlfrom) + sql
|
| 304 |
+
cur = self.db.execute(this_querry, params)
|
| 305 |
+
if latest:
|
| 306 |
+
cur = (row[:-1] for row in cur)
|
| 307 |
+
if output: # Regroup into 3-tuples, and parse JSON
|
| 308 |
+
return ((ses, lin, (inp, out)) for ses, lin, inp, out in cur)
|
| 309 |
+
return cur
|
| 310 |
+
|
| 311 |
+
@only_when_enabled
|
| 312 |
+
@catch_corrupt_db
|
| 313 |
+
def get_session_info(self, session):
|
| 314 |
+
"""Get info about a session.
|
| 315 |
+
|
| 316 |
+
Parameters
|
| 317 |
+
----------
|
| 318 |
+
session : int
|
| 319 |
+
Session number to retrieve.
|
| 320 |
+
|
| 321 |
+
Returns
|
| 322 |
+
-------
|
| 323 |
+
session_id : int
|
| 324 |
+
Session ID number
|
| 325 |
+
start : datetime
|
| 326 |
+
Timestamp for the start of the session.
|
| 327 |
+
end : datetime
|
| 328 |
+
Timestamp for the end of the session, or None if IPython crashed.
|
| 329 |
+
num_cmds : int
|
| 330 |
+
Number of commands run, or None if IPython crashed.
|
| 331 |
+
remark : unicode
|
| 332 |
+
A manually set description.
|
| 333 |
+
"""
|
| 334 |
+
query = "SELECT * from sessions where session == ?"
|
| 335 |
+
return self.db.execute(query, (session,)).fetchone()
|
| 336 |
+
|
| 337 |
+
@catch_corrupt_db
|
| 338 |
+
def get_last_session_id(self):
|
| 339 |
+
"""Get the last session ID currently in the database.
|
| 340 |
+
|
| 341 |
+
Within IPython, this should be the same as the value stored in
|
| 342 |
+
:attr:`HistoryManager.session_number`.
|
| 343 |
+
"""
|
| 344 |
+
for record in self.get_tail(n=1, include_latest=True):
|
| 345 |
+
return record[0]
|
| 346 |
+
|
| 347 |
+
@catch_corrupt_db
|
| 348 |
+
def get_tail(self, n=10, raw=True, output=False, include_latest=False):
|
| 349 |
+
"""Get the last n lines from the history database.
|
| 350 |
+
|
| 351 |
+
Parameters
|
| 352 |
+
----------
|
| 353 |
+
n : int
|
| 354 |
+
The number of lines to get
|
| 355 |
+
raw, output : bool
|
| 356 |
+
See :meth:`get_range`
|
| 357 |
+
include_latest : bool
|
| 358 |
+
If False (default), n+1 lines are fetched, and the latest one
|
| 359 |
+
is discarded. This is intended to be used where the function
|
| 360 |
+
is called by a user command, which it should not return.
|
| 361 |
+
|
| 362 |
+
Returns
|
| 363 |
+
-------
|
| 364 |
+
Tuples as :meth:`get_range`
|
| 365 |
+
"""
|
| 366 |
+
self.writeout_cache()
|
| 367 |
+
if not include_latest:
|
| 368 |
+
n += 1
|
| 369 |
+
cur = self._run_sql(
|
| 370 |
+
"ORDER BY session DESC, line DESC LIMIT ?", (n,), raw=raw, output=output
|
| 371 |
+
)
|
| 372 |
+
if not include_latest:
|
| 373 |
+
return reversed(list(cur)[1:])
|
| 374 |
+
return reversed(list(cur))
|
| 375 |
+
|
| 376 |
+
@catch_corrupt_db
|
| 377 |
+
def search(self, pattern="*", raw=True, search_raw=True,
|
| 378 |
+
output=False, n=None, unique=False):
|
| 379 |
+
"""Search the database using unix glob-style matching (wildcards
|
| 380 |
+
* and ?).
|
| 381 |
+
|
| 382 |
+
Parameters
|
| 383 |
+
----------
|
| 384 |
+
pattern : str
|
| 385 |
+
The wildcarded pattern to match when searching
|
| 386 |
+
search_raw : bool
|
| 387 |
+
If True, search the raw input, otherwise, the parsed input
|
| 388 |
+
raw, output : bool
|
| 389 |
+
See :meth:`get_range`
|
| 390 |
+
n : None or int
|
| 391 |
+
If an integer is given, it defines the limit of
|
| 392 |
+
returned entries.
|
| 393 |
+
unique : bool
|
| 394 |
+
When it is true, return only unique entries.
|
| 395 |
+
|
| 396 |
+
Returns
|
| 397 |
+
-------
|
| 398 |
+
Tuples as :meth:`get_range`
|
| 399 |
+
"""
|
| 400 |
+
tosearch = "source_raw" if search_raw else "source"
|
| 401 |
+
if output:
|
| 402 |
+
tosearch = "history." + tosearch
|
| 403 |
+
self.writeout_cache()
|
| 404 |
+
sqlform = "WHERE %s GLOB ?" % tosearch
|
| 405 |
+
params = (pattern,)
|
| 406 |
+
if unique:
|
| 407 |
+
sqlform += ' GROUP BY {0}'.format(tosearch)
|
| 408 |
+
if n is not None:
|
| 409 |
+
sqlform += " ORDER BY session DESC, line DESC LIMIT ?"
|
| 410 |
+
params += (n,)
|
| 411 |
+
elif unique:
|
| 412 |
+
sqlform += " ORDER BY session, line"
|
| 413 |
+
cur = self._run_sql(sqlform, params, raw=raw, output=output, latest=unique)
|
| 414 |
+
if n is not None:
|
| 415 |
+
return reversed(list(cur))
|
| 416 |
+
return cur
|
| 417 |
+
|
| 418 |
+
@catch_corrupt_db
|
| 419 |
+
def get_range(self, session, start=1, stop=None, raw=True,output=False):
|
| 420 |
+
"""Retrieve input by session.
|
| 421 |
+
|
| 422 |
+
Parameters
|
| 423 |
+
----------
|
| 424 |
+
session : int
|
| 425 |
+
Session number to retrieve.
|
| 426 |
+
start : int
|
| 427 |
+
First line to retrieve.
|
| 428 |
+
stop : int
|
| 429 |
+
End of line range (excluded from output itself). If None, retrieve
|
| 430 |
+
to the end of the session.
|
| 431 |
+
raw : bool
|
| 432 |
+
If True, return untranslated input
|
| 433 |
+
output : bool
|
| 434 |
+
If True, attempt to include output. This will be 'real' Python
|
| 435 |
+
objects for the current session, or text reprs from previous
|
| 436 |
+
sessions if db_log_output was enabled at the time. Where no output
|
| 437 |
+
is found, None is used.
|
| 438 |
+
|
| 439 |
+
Returns
|
| 440 |
+
-------
|
| 441 |
+
entries
|
| 442 |
+
An iterator over the desired lines. Each line is a 3-tuple, either
|
| 443 |
+
(session, line, input) if output is False, or
|
| 444 |
+
(session, line, (input, output)) if output is True.
|
| 445 |
+
"""
|
| 446 |
+
if stop:
|
| 447 |
+
lineclause = "line >= ? AND line < ?"
|
| 448 |
+
params = (session, start, stop)
|
| 449 |
+
else:
|
| 450 |
+
lineclause = "line>=?"
|
| 451 |
+
params = (session, start)
|
| 452 |
+
|
| 453 |
+
return self._run_sql("WHERE session==? AND %s" % lineclause,
|
| 454 |
+
params, raw=raw, output=output)
|
| 455 |
+
|
| 456 |
+
def get_range_by_str(self, rangestr, raw=True, output=False):
|
| 457 |
+
"""Get lines of history from a string of ranges, as used by magic
|
| 458 |
+
commands %hist, %save, %macro, etc.
|
| 459 |
+
|
| 460 |
+
Parameters
|
| 461 |
+
----------
|
| 462 |
+
rangestr : str
|
| 463 |
+
A string specifying ranges, e.g. "5 ~2/1-4". If empty string is used,
|
| 464 |
+
this will return everything from current session's history.
|
| 465 |
+
|
| 466 |
+
See the documentation of :func:`%history` for the full details.
|
| 467 |
+
|
| 468 |
+
raw, output : bool
|
| 469 |
+
As :meth:`get_range`
|
| 470 |
+
|
| 471 |
+
Returns
|
| 472 |
+
-------
|
| 473 |
+
Tuples as :meth:`get_range`
|
| 474 |
+
"""
|
| 475 |
+
for sess, s, e in extract_hist_ranges(rangestr):
|
| 476 |
+
for line in self.get_range(sess, s, e, raw=raw, output=output):
|
| 477 |
+
yield line
|
| 478 |
+
|
| 479 |
+
|
| 480 |
+
class HistoryManager(HistoryAccessor):
|
| 481 |
+
"""A class to organize all history-related functionality in one place.
|
| 482 |
+
"""
|
| 483 |
+
# Public interface
|
| 484 |
+
|
| 485 |
+
# An instance of the IPython shell we are attached to
|
| 486 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC',
|
| 487 |
+
allow_none=True)
|
| 488 |
+
# Lists to hold processed and raw history. These start with a blank entry
|
| 489 |
+
# so that we can index them starting from 1
|
| 490 |
+
input_hist_parsed = List([""])
|
| 491 |
+
input_hist_raw = List([""])
|
| 492 |
+
# A list of directories visited during session
|
| 493 |
+
dir_hist: List = List()
|
| 494 |
+
|
| 495 |
+
@default("dir_hist")
|
| 496 |
+
def _dir_hist_default(self):
|
| 497 |
+
try:
|
| 498 |
+
return [Path.cwd()]
|
| 499 |
+
except OSError:
|
| 500 |
+
return []
|
| 501 |
+
|
| 502 |
+
# A dict of output history, keyed with ints from the shell's
|
| 503 |
+
# execution count.
|
| 504 |
+
output_hist = Dict()
|
| 505 |
+
# The text/plain repr of outputs.
|
| 506 |
+
output_hist_reprs = Dict()
|
| 507 |
+
|
| 508 |
+
# The number of the current session in the history database
|
| 509 |
+
session_number = Integer()
|
| 510 |
+
|
| 511 |
+
db_log_output = Bool(False,
|
| 512 |
+
help="Should the history database include output? (default: no)"
|
| 513 |
+
).tag(config=True)
|
| 514 |
+
db_cache_size = Integer(0,
|
| 515 |
+
help="Write to database every x commands (higher values save disk access & power).\n"
|
| 516 |
+
"Values of 1 or less effectively disable caching."
|
| 517 |
+
).tag(config=True)
|
| 518 |
+
# The input and output caches
|
| 519 |
+
db_input_cache: List = List()
|
| 520 |
+
db_output_cache: List = List()
|
| 521 |
+
|
| 522 |
+
# History saving in separate thread
|
| 523 |
+
save_thread = Instance('IPython.core.history.HistorySavingThread',
|
| 524 |
+
allow_none=True)
|
| 525 |
+
save_flag = Instance(threading.Event, allow_none=True)
|
| 526 |
+
|
| 527 |
+
# Private interface
|
| 528 |
+
# Variables used to store the three last inputs from the user. On each new
|
| 529 |
+
# history update, we populate the user's namespace with these, shifted as
|
| 530 |
+
# necessary.
|
| 531 |
+
_i00 = Unicode("")
|
| 532 |
+
_i = Unicode("")
|
| 533 |
+
_ii = Unicode("")
|
| 534 |
+
_iii = Unicode("")
|
| 535 |
+
|
| 536 |
+
# A regex matching all forms of the exit command, so that we don't store
|
| 537 |
+
# them in the history (it's annoying to rewind the first entry and land on
|
| 538 |
+
# an exit call).
|
| 539 |
+
_exit_re = re.compile(r"(exit|quit)(\s*\(.*\))?$")
|
| 540 |
+
|
| 541 |
+
def __init__(self, shell=None, config=None, **traits):
|
| 542 |
+
"""Create a new history manager associated with a shell instance.
|
| 543 |
+
"""
|
| 544 |
+
super(HistoryManager, self).__init__(shell=shell, config=config,
|
| 545 |
+
**traits)
|
| 546 |
+
self.save_flag = threading.Event()
|
| 547 |
+
self.db_input_cache_lock = threading.Lock()
|
| 548 |
+
self.db_output_cache_lock = threading.Lock()
|
| 549 |
+
|
| 550 |
+
try:
|
| 551 |
+
self.new_session()
|
| 552 |
+
except sqlite3.OperationalError:
|
| 553 |
+
self.log.error("Failed to create history session in %s. History will not be saved.",
|
| 554 |
+
self.hist_file, exc_info=True)
|
| 555 |
+
self.hist_file = ':memory:'
|
| 556 |
+
|
| 557 |
+
if self.enabled and self.hist_file != ':memory:':
|
| 558 |
+
self.save_thread = HistorySavingThread(self)
|
| 559 |
+
try:
|
| 560 |
+
self.save_thread.start()
|
| 561 |
+
except RuntimeError:
|
| 562 |
+
self.log.error(
|
| 563 |
+
"Failed to start history saving thread. History will not be saved.",
|
| 564 |
+
exc_info=True,
|
| 565 |
+
)
|
| 566 |
+
self.hist_file = ":memory:"
|
| 567 |
+
|
| 568 |
+
def _get_hist_file_name(self, profile=None):
|
| 569 |
+
"""Get default history file name based on the Shell's profile.
|
| 570 |
+
|
| 571 |
+
The profile parameter is ignored, but must exist for compatibility with
|
| 572 |
+
the parent class."""
|
| 573 |
+
profile_dir = self.shell.profile_dir.location
|
| 574 |
+
return Path(profile_dir) / "history.sqlite"
|
| 575 |
+
|
| 576 |
+
@only_when_enabled
|
| 577 |
+
def new_session(self, conn=None):
|
| 578 |
+
"""Get a new session number."""
|
| 579 |
+
if conn is None:
|
| 580 |
+
conn = self.db
|
| 581 |
+
|
| 582 |
+
with conn:
|
| 583 |
+
cur = conn.execute(
|
| 584 |
+
"""INSERT INTO sessions VALUES (NULL, ?, NULL,
|
| 585 |
+
NULL, '') """,
|
| 586 |
+
(datetime.datetime.now().isoformat(" "),),
|
| 587 |
+
)
|
| 588 |
+
self.session_number = cur.lastrowid
|
| 589 |
+
|
| 590 |
+
def end_session(self):
|
| 591 |
+
"""Close the database session, filling in the end time and line count."""
|
| 592 |
+
self.writeout_cache()
|
| 593 |
+
with self.db:
|
| 594 |
+
self.db.execute(
|
| 595 |
+
"""UPDATE sessions SET end=?, num_cmds=? WHERE
|
| 596 |
+
session==?""",
|
| 597 |
+
(
|
| 598 |
+
datetime.datetime.now().isoformat(" "),
|
| 599 |
+
len(self.input_hist_parsed) - 1,
|
| 600 |
+
self.session_number,
|
| 601 |
+
),
|
| 602 |
+
)
|
| 603 |
+
self.session_number = 0
|
| 604 |
+
|
| 605 |
+
def name_session(self, name):
|
| 606 |
+
"""Give the current session a name in the history database."""
|
| 607 |
+
with self.db:
|
| 608 |
+
self.db.execute("UPDATE sessions SET remark=? WHERE session==?",
|
| 609 |
+
(name, self.session_number))
|
| 610 |
+
|
| 611 |
+
def reset(self, new_session=True):
|
| 612 |
+
"""Clear the session history, releasing all object references, and
|
| 613 |
+
optionally open a new session."""
|
| 614 |
+
self.output_hist.clear()
|
| 615 |
+
# The directory history can't be completely empty
|
| 616 |
+
self.dir_hist[:] = [Path.cwd()]
|
| 617 |
+
|
| 618 |
+
if new_session:
|
| 619 |
+
if self.session_number:
|
| 620 |
+
self.end_session()
|
| 621 |
+
self.input_hist_parsed[:] = [""]
|
| 622 |
+
self.input_hist_raw[:] = [""]
|
| 623 |
+
self.new_session()
|
| 624 |
+
|
| 625 |
+
# ------------------------------
|
| 626 |
+
# Methods for retrieving history
|
| 627 |
+
# ------------------------------
|
| 628 |
+
def get_session_info(self, session=0):
|
| 629 |
+
"""Get info about a session.
|
| 630 |
+
|
| 631 |
+
Parameters
|
| 632 |
+
----------
|
| 633 |
+
session : int
|
| 634 |
+
Session number to retrieve. The current session is 0, and negative
|
| 635 |
+
numbers count back from current session, so -1 is the previous session.
|
| 636 |
+
|
| 637 |
+
Returns
|
| 638 |
+
-------
|
| 639 |
+
session_id : int
|
| 640 |
+
Session ID number
|
| 641 |
+
start : datetime
|
| 642 |
+
Timestamp for the start of the session.
|
| 643 |
+
end : datetime
|
| 644 |
+
Timestamp for the end of the session, or None if IPython crashed.
|
| 645 |
+
num_cmds : int
|
| 646 |
+
Number of commands run, or None if IPython crashed.
|
| 647 |
+
remark : unicode
|
| 648 |
+
A manually set description.
|
| 649 |
+
"""
|
| 650 |
+
if session <= 0:
|
| 651 |
+
session += self.session_number
|
| 652 |
+
|
| 653 |
+
return super(HistoryManager, self).get_session_info(session=session)
|
| 654 |
+
|
| 655 |
+
@catch_corrupt_db
|
| 656 |
+
def get_tail(self, n=10, raw=True, output=False, include_latest=False):
|
| 657 |
+
"""Get the last n lines from the history database.
|
| 658 |
+
|
| 659 |
+
Most recent entry last.
|
| 660 |
+
|
| 661 |
+
Completion will be reordered so that that the last ones are when
|
| 662 |
+
possible from current session.
|
| 663 |
+
|
| 664 |
+
Parameters
|
| 665 |
+
----------
|
| 666 |
+
n : int
|
| 667 |
+
The number of lines to get
|
| 668 |
+
raw, output : bool
|
| 669 |
+
See :meth:`get_range`
|
| 670 |
+
include_latest : bool
|
| 671 |
+
If False (default), n+1 lines are fetched, and the latest one
|
| 672 |
+
is discarded. This is intended to be used where the function
|
| 673 |
+
is called by a user command, which it should not return.
|
| 674 |
+
|
| 675 |
+
Returns
|
| 676 |
+
-------
|
| 677 |
+
Tuples as :meth:`get_range`
|
| 678 |
+
"""
|
| 679 |
+
self.writeout_cache()
|
| 680 |
+
if not include_latest:
|
| 681 |
+
n += 1
|
| 682 |
+
# cursor/line/entry
|
| 683 |
+
this_cur = list(
|
| 684 |
+
self._run_sql(
|
| 685 |
+
"WHERE session == ? ORDER BY line DESC LIMIT ? ",
|
| 686 |
+
(self.session_number, n),
|
| 687 |
+
raw=raw,
|
| 688 |
+
output=output,
|
| 689 |
+
)
|
| 690 |
+
)
|
| 691 |
+
other_cur = list(
|
| 692 |
+
self._run_sql(
|
| 693 |
+
"WHERE session != ? ORDER BY session DESC, line DESC LIMIT ?",
|
| 694 |
+
(self.session_number, n),
|
| 695 |
+
raw=raw,
|
| 696 |
+
output=output,
|
| 697 |
+
)
|
| 698 |
+
)
|
| 699 |
+
|
| 700 |
+
everything = this_cur + other_cur
|
| 701 |
+
|
| 702 |
+
everything = everything[:n]
|
| 703 |
+
|
| 704 |
+
if not include_latest:
|
| 705 |
+
return list(everything)[:0:-1]
|
| 706 |
+
return list(everything)[::-1]
|
| 707 |
+
|
| 708 |
+
def _get_range_session(self, start=1, stop=None, raw=True, output=False):
|
| 709 |
+
"""Get input and output history from the current session. Called by
|
| 710 |
+
get_range, and takes similar parameters."""
|
| 711 |
+
input_hist = self.input_hist_raw if raw else self.input_hist_parsed
|
| 712 |
+
|
| 713 |
+
n = len(input_hist)
|
| 714 |
+
if start < 0:
|
| 715 |
+
start += n
|
| 716 |
+
if not stop or (stop > n):
|
| 717 |
+
stop = n
|
| 718 |
+
elif stop < 0:
|
| 719 |
+
stop += n
|
| 720 |
+
|
| 721 |
+
for i in range(start, stop):
|
| 722 |
+
if output:
|
| 723 |
+
line = (input_hist[i], self.output_hist_reprs.get(i))
|
| 724 |
+
else:
|
| 725 |
+
line = input_hist[i]
|
| 726 |
+
yield (0, i, line)
|
| 727 |
+
|
| 728 |
+
def get_range(self, session=0, start=1, stop=None, raw=True,output=False):
|
| 729 |
+
"""Retrieve input by session.
|
| 730 |
+
|
| 731 |
+
Parameters
|
| 732 |
+
----------
|
| 733 |
+
session : int
|
| 734 |
+
Session number to retrieve. The current session is 0, and negative
|
| 735 |
+
numbers count back from current session, so -1 is previous session.
|
| 736 |
+
start : int
|
| 737 |
+
First line to retrieve.
|
| 738 |
+
stop : int
|
| 739 |
+
End of line range (excluded from output itself). If None, retrieve
|
| 740 |
+
to the end of the session.
|
| 741 |
+
raw : bool
|
| 742 |
+
If True, return untranslated input
|
| 743 |
+
output : bool
|
| 744 |
+
If True, attempt to include output. This will be 'real' Python
|
| 745 |
+
objects for the current session, or text reprs from previous
|
| 746 |
+
sessions if db_log_output was enabled at the time. Where no output
|
| 747 |
+
is found, None is used.
|
| 748 |
+
|
| 749 |
+
Returns
|
| 750 |
+
-------
|
| 751 |
+
entries
|
| 752 |
+
An iterator over the desired lines. Each line is a 3-tuple, either
|
| 753 |
+
(session, line, input) if output is False, or
|
| 754 |
+
(session, line, (input, output)) if output is True.
|
| 755 |
+
"""
|
| 756 |
+
if session <= 0:
|
| 757 |
+
session += self.session_number
|
| 758 |
+
if session==self.session_number: # Current session
|
| 759 |
+
return self._get_range_session(start, stop, raw, output)
|
| 760 |
+
return super(HistoryManager, self).get_range(session, start, stop, raw,
|
| 761 |
+
output)
|
| 762 |
+
|
| 763 |
+
## ----------------------------
|
| 764 |
+
## Methods for storing history:
|
| 765 |
+
## ----------------------------
|
| 766 |
+
def store_inputs(self, line_num, source, source_raw=None):
|
| 767 |
+
"""Store source and raw input in history and create input cache
|
| 768 |
+
variables ``_i*``.
|
| 769 |
+
|
| 770 |
+
Parameters
|
| 771 |
+
----------
|
| 772 |
+
line_num : int
|
| 773 |
+
The prompt number of this input.
|
| 774 |
+
source : str
|
| 775 |
+
Python input.
|
| 776 |
+
source_raw : str, optional
|
| 777 |
+
If given, this is the raw input without any IPython transformations
|
| 778 |
+
applied to it. If not given, ``source`` is used.
|
| 779 |
+
"""
|
| 780 |
+
if source_raw is None:
|
| 781 |
+
source_raw = source
|
| 782 |
+
source = source.rstrip('\n')
|
| 783 |
+
source_raw = source_raw.rstrip('\n')
|
| 784 |
+
|
| 785 |
+
# do not store exit/quit commands
|
| 786 |
+
if self._exit_re.match(source_raw.strip()):
|
| 787 |
+
return
|
| 788 |
+
|
| 789 |
+
self.input_hist_parsed.append(source)
|
| 790 |
+
self.input_hist_raw.append(source_raw)
|
| 791 |
+
|
| 792 |
+
with self.db_input_cache_lock:
|
| 793 |
+
self.db_input_cache.append((line_num, source, source_raw))
|
| 794 |
+
# Trigger to flush cache and write to DB.
|
| 795 |
+
if len(self.db_input_cache) >= self.db_cache_size:
|
| 796 |
+
self.save_flag.set()
|
| 797 |
+
|
| 798 |
+
# update the auto _i variables
|
| 799 |
+
self._iii = self._ii
|
| 800 |
+
self._ii = self._i
|
| 801 |
+
self._i = self._i00
|
| 802 |
+
self._i00 = source_raw
|
| 803 |
+
|
| 804 |
+
# hackish access to user namespace to create _i1,_i2... dynamically
|
| 805 |
+
new_i = '_i%s' % line_num
|
| 806 |
+
to_main = {'_i': self._i,
|
| 807 |
+
'_ii': self._ii,
|
| 808 |
+
'_iii': self._iii,
|
| 809 |
+
new_i : self._i00 }
|
| 810 |
+
|
| 811 |
+
if self.shell is not None:
|
| 812 |
+
self.shell.push(to_main, interactive=False)
|
| 813 |
+
|
| 814 |
+
def store_output(self, line_num):
|
| 815 |
+
"""If database output logging is enabled, this saves all the
|
| 816 |
+
outputs from the indicated prompt number to the database. It's
|
| 817 |
+
called by run_cell after code has been executed.
|
| 818 |
+
|
| 819 |
+
Parameters
|
| 820 |
+
----------
|
| 821 |
+
line_num : int
|
| 822 |
+
The line number from which to save outputs
|
| 823 |
+
"""
|
| 824 |
+
if (not self.db_log_output) or (line_num not in self.output_hist_reprs):
|
| 825 |
+
return
|
| 826 |
+
output = self.output_hist_reprs[line_num]
|
| 827 |
+
|
| 828 |
+
with self.db_output_cache_lock:
|
| 829 |
+
self.db_output_cache.append((line_num, output))
|
| 830 |
+
if self.db_cache_size <= 1:
|
| 831 |
+
self.save_flag.set()
|
| 832 |
+
|
| 833 |
+
def _writeout_input_cache(self, conn):
|
| 834 |
+
with conn:
|
| 835 |
+
for line in self.db_input_cache:
|
| 836 |
+
conn.execute("INSERT INTO history VALUES (?, ?, ?, ?)",
|
| 837 |
+
(self.session_number,)+line)
|
| 838 |
+
|
| 839 |
+
def _writeout_output_cache(self, conn):
|
| 840 |
+
with conn:
|
| 841 |
+
for line in self.db_output_cache:
|
| 842 |
+
conn.execute("INSERT INTO output_history VALUES (?, ?, ?)",
|
| 843 |
+
(self.session_number,)+line)
|
| 844 |
+
|
| 845 |
+
@only_when_enabled
|
| 846 |
+
def writeout_cache(self, conn=None):
|
| 847 |
+
"""Write any entries in the cache to the database."""
|
| 848 |
+
if conn is None:
|
| 849 |
+
conn = self.db
|
| 850 |
+
|
| 851 |
+
with self.db_input_cache_lock:
|
| 852 |
+
try:
|
| 853 |
+
self._writeout_input_cache(conn)
|
| 854 |
+
except sqlite3.IntegrityError:
|
| 855 |
+
self.new_session(conn)
|
| 856 |
+
print("ERROR! Session/line number was not unique in",
|
| 857 |
+
"database. History logging moved to new session",
|
| 858 |
+
self.session_number)
|
| 859 |
+
try:
|
| 860 |
+
# Try writing to the new session. If this fails, don't
|
| 861 |
+
# recurse
|
| 862 |
+
self._writeout_input_cache(conn)
|
| 863 |
+
except sqlite3.IntegrityError:
|
| 864 |
+
pass
|
| 865 |
+
finally:
|
| 866 |
+
self.db_input_cache = []
|
| 867 |
+
|
| 868 |
+
with self.db_output_cache_lock:
|
| 869 |
+
try:
|
| 870 |
+
self._writeout_output_cache(conn)
|
| 871 |
+
except sqlite3.IntegrityError:
|
| 872 |
+
print("!! Session/line number for output was not unique",
|
| 873 |
+
"in database. Output will not be stored.")
|
| 874 |
+
finally:
|
| 875 |
+
self.db_output_cache = []
|
| 876 |
+
|
| 877 |
+
|
| 878 |
+
class HistorySavingThread(threading.Thread):
|
| 879 |
+
"""This thread takes care of writing history to the database, so that
|
| 880 |
+
the UI isn't held up while that happens.
|
| 881 |
+
|
| 882 |
+
It waits for the HistoryManager's save_flag to be set, then writes out
|
| 883 |
+
the history cache. The main thread is responsible for setting the flag when
|
| 884 |
+
the cache size reaches a defined threshold."""
|
| 885 |
+
daemon = True
|
| 886 |
+
stop_now = False
|
| 887 |
+
enabled = True
|
| 888 |
+
def __init__(self, history_manager):
|
| 889 |
+
super(HistorySavingThread, self).__init__(name="IPythonHistorySavingThread")
|
| 890 |
+
self.history_manager = history_manager
|
| 891 |
+
self.enabled = history_manager.enabled
|
| 892 |
+
|
| 893 |
+
@only_when_enabled
|
| 894 |
+
def run(self):
|
| 895 |
+
atexit.register(self.stop)
|
| 896 |
+
# We need a separate db connection per thread:
|
| 897 |
+
try:
|
| 898 |
+
self.db = sqlite3.connect(
|
| 899 |
+
str(self.history_manager.hist_file),
|
| 900 |
+
**self.history_manager.connection_options,
|
| 901 |
+
)
|
| 902 |
+
while True:
|
| 903 |
+
self.history_manager.save_flag.wait()
|
| 904 |
+
if self.stop_now:
|
| 905 |
+
self.db.close()
|
| 906 |
+
return
|
| 907 |
+
self.history_manager.save_flag.clear()
|
| 908 |
+
self.history_manager.writeout_cache(self.db)
|
| 909 |
+
except Exception as e:
|
| 910 |
+
print(("The history saving thread hit an unexpected error (%s)."
|
| 911 |
+
"History will not be written to the database.") % repr(e))
|
| 912 |
+
finally:
|
| 913 |
+
atexit.unregister(self.stop)
|
| 914 |
+
|
| 915 |
+
def stop(self):
|
| 916 |
+
"""This can be called from the main thread to safely stop this thread.
|
| 917 |
+
|
| 918 |
+
Note that it does not attempt to write out remaining history before
|
| 919 |
+
exiting. That should be done by calling the HistoryManager's
|
| 920 |
+
end_session method."""
|
| 921 |
+
self.stop_now = True
|
| 922 |
+
self.history_manager.save_flag.set()
|
| 923 |
+
self.join()
|
| 924 |
+
|
| 925 |
+
|
| 926 |
+
# To match, e.g. ~5/8-~2/3
|
| 927 |
+
range_re = re.compile(r"""
|
| 928 |
+
((?P<startsess>~?\d+)/)?
|
| 929 |
+
(?P<start>\d+)?
|
| 930 |
+
((?P<sep>[\-:])
|
| 931 |
+
((?P<endsess>~?\d+)/)?
|
| 932 |
+
(?P<end>\d+))?
|
| 933 |
+
$""", re.VERBOSE)
|
| 934 |
+
|
| 935 |
+
|
| 936 |
+
def extract_hist_ranges(ranges_str):
|
| 937 |
+
"""Turn a string of history ranges into 3-tuples of (session, start, stop).
|
| 938 |
+
|
| 939 |
+
Empty string results in a `[(0, 1, None)]`, i.e. "everything from current
|
| 940 |
+
session".
|
| 941 |
+
|
| 942 |
+
Examples
|
| 943 |
+
--------
|
| 944 |
+
>>> list(extract_hist_ranges("~8/5-~7/4 2"))
|
| 945 |
+
[(-8, 5, None), (-7, 1, 5), (0, 2, 3)]
|
| 946 |
+
"""
|
| 947 |
+
if ranges_str == "":
|
| 948 |
+
yield (0, 1, None) # Everything from current session
|
| 949 |
+
return
|
| 950 |
+
|
| 951 |
+
for range_str in ranges_str.split():
|
| 952 |
+
rmatch = range_re.match(range_str)
|
| 953 |
+
if not rmatch:
|
| 954 |
+
continue
|
| 955 |
+
start = rmatch.group("start")
|
| 956 |
+
if start:
|
| 957 |
+
start = int(start)
|
| 958 |
+
end = rmatch.group("end")
|
| 959 |
+
# If no end specified, get (a, a + 1)
|
| 960 |
+
end = int(end) if end else start + 1
|
| 961 |
+
else: # start not specified
|
| 962 |
+
if not rmatch.group('startsess'): # no startsess
|
| 963 |
+
continue
|
| 964 |
+
start = 1
|
| 965 |
+
end = None # provide the entire session hist
|
| 966 |
+
|
| 967 |
+
if rmatch.group("sep") == "-": # 1-3 == 1:4 --> [1, 2, 3]
|
| 968 |
+
end += 1
|
| 969 |
+
startsess = rmatch.group("startsess") or "0"
|
| 970 |
+
endsess = rmatch.group("endsess") or startsess
|
| 971 |
+
startsess = int(startsess.replace("~","-"))
|
| 972 |
+
endsess = int(endsess.replace("~","-"))
|
| 973 |
+
assert endsess >= startsess, "start session must be earlier than end session"
|
| 974 |
+
|
| 975 |
+
if endsess == startsess:
|
| 976 |
+
yield (startsess, start, end)
|
| 977 |
+
continue
|
| 978 |
+
# Multiple sessions in one range:
|
| 979 |
+
yield (startsess, start, None)
|
| 980 |
+
for sess in range(startsess+1, endsess):
|
| 981 |
+
yield (sess, 1, None)
|
| 982 |
+
yield (endsess, 1, end)
|
| 983 |
+
|
| 984 |
+
|
| 985 |
+
def _format_lineno(session, line):
|
| 986 |
+
"""Helper function to format line numbers properly."""
|
| 987 |
+
if session == 0:
|
| 988 |
+
return str(line)
|
| 989 |
+
return "%s#%s" % (session, line)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/historyapp.py
ADDED
|
@@ -0,0 +1,158 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
An application for managing IPython history.
|
| 4 |
+
|
| 5 |
+
To be invoked as the `ipython history` subcommand.
|
| 6 |
+
"""
|
| 7 |
+
|
| 8 |
+
import sqlite3
|
| 9 |
+
from pathlib import Path
|
| 10 |
+
|
| 11 |
+
from traitlets.config.application import Application
|
| 12 |
+
from .application import BaseIPythonApplication
|
| 13 |
+
from traitlets import Bool, Int, Dict
|
| 14 |
+
from ..utils.io import ask_yes_no
|
| 15 |
+
|
| 16 |
+
trim_hist_help = """Trim the IPython history database to the last 1000 entries.
|
| 17 |
+
|
| 18 |
+
This actually copies the last 1000 entries to a new database, and then replaces
|
| 19 |
+
the old file with the new. Use the `--keep=` argument to specify a number
|
| 20 |
+
other than 1000.
|
| 21 |
+
"""
|
| 22 |
+
|
| 23 |
+
clear_hist_help = """Clear the IPython history database, deleting all entries.
|
| 24 |
+
|
| 25 |
+
Because this is a destructive operation, IPython will prompt the user if they
|
| 26 |
+
really want to do this. Passing a `-f` flag will force clearing without a
|
| 27 |
+
prompt.
|
| 28 |
+
|
| 29 |
+
This is an handy alias to `ipython history trim --keep=0`
|
| 30 |
+
"""
|
| 31 |
+
|
| 32 |
+
|
| 33 |
+
class HistoryTrim(BaseIPythonApplication):
|
| 34 |
+
description = trim_hist_help
|
| 35 |
+
|
| 36 |
+
backup = Bool(False, help="Keep the old history file as history.sqlite.<N>").tag(
|
| 37 |
+
config=True
|
| 38 |
+
)
|
| 39 |
+
|
| 40 |
+
keep = Int(1000, help="Number of recent lines to keep in the database.").tag(
|
| 41 |
+
config=True
|
| 42 |
+
)
|
| 43 |
+
|
| 44 |
+
flags = Dict( # type: ignore
|
| 45 |
+
dict(backup=({"HistoryTrim": {"backup": True}}, backup.help))
|
| 46 |
+
)
|
| 47 |
+
|
| 48 |
+
aliases = Dict(dict(keep="HistoryTrim.keep")) # type: ignore
|
| 49 |
+
|
| 50 |
+
def start(self):
|
| 51 |
+
profile_dir = Path(self.profile_dir.location)
|
| 52 |
+
hist_file = profile_dir / "history.sqlite"
|
| 53 |
+
con = sqlite3.connect(hist_file)
|
| 54 |
+
|
| 55 |
+
# Grab the recent history from the current database.
|
| 56 |
+
inputs = list(con.execute('SELECT session, line, source, source_raw FROM '
|
| 57 |
+
'history ORDER BY session DESC, line DESC LIMIT ?', (self.keep+1,)))
|
| 58 |
+
if len(inputs) <= self.keep:
|
| 59 |
+
print("There are already at most %d entries in the history database." % self.keep)
|
| 60 |
+
print("Not doing anything. Use --keep= argument to keep fewer entries")
|
| 61 |
+
return
|
| 62 |
+
|
| 63 |
+
print("Trimming history to the most recent %d entries." % self.keep)
|
| 64 |
+
|
| 65 |
+
inputs.pop() # Remove the extra element we got to check the length.
|
| 66 |
+
inputs.reverse()
|
| 67 |
+
if inputs:
|
| 68 |
+
first_session = inputs[0][0]
|
| 69 |
+
outputs = list(con.execute('SELECT session, line, output FROM '
|
| 70 |
+
'output_history WHERE session >= ?', (first_session,)))
|
| 71 |
+
sessions = list(con.execute('SELECT session, start, end, num_cmds, remark FROM '
|
| 72 |
+
'sessions WHERE session >= ?', (first_session,)))
|
| 73 |
+
con.close()
|
| 74 |
+
|
| 75 |
+
# Create the new history database.
|
| 76 |
+
new_hist_file = profile_dir / "history.sqlite.new"
|
| 77 |
+
i = 0
|
| 78 |
+
while new_hist_file.exists():
|
| 79 |
+
# Make sure we don't interfere with an existing file.
|
| 80 |
+
i += 1
|
| 81 |
+
new_hist_file = profile_dir / ("history.sqlite.new" + str(i))
|
| 82 |
+
new_db = sqlite3.connect(new_hist_file)
|
| 83 |
+
new_db.execute("""CREATE TABLE IF NOT EXISTS sessions (session integer
|
| 84 |
+
primary key autoincrement, start timestamp,
|
| 85 |
+
end timestamp, num_cmds integer, remark text)""")
|
| 86 |
+
new_db.execute("""CREATE TABLE IF NOT EXISTS history
|
| 87 |
+
(session integer, line integer, source text, source_raw text,
|
| 88 |
+
PRIMARY KEY (session, line))""")
|
| 89 |
+
new_db.execute("""CREATE TABLE IF NOT EXISTS output_history
|
| 90 |
+
(session integer, line integer, output text,
|
| 91 |
+
PRIMARY KEY (session, line))""")
|
| 92 |
+
new_db.commit()
|
| 93 |
+
|
| 94 |
+
|
| 95 |
+
if inputs:
|
| 96 |
+
with new_db:
|
| 97 |
+
# Add the recent history into the new database.
|
| 98 |
+
new_db.executemany('insert into sessions values (?,?,?,?,?)', sessions)
|
| 99 |
+
new_db.executemany('insert into history values (?,?,?,?)', inputs)
|
| 100 |
+
new_db.executemany('insert into output_history values (?,?,?)', outputs)
|
| 101 |
+
new_db.close()
|
| 102 |
+
|
| 103 |
+
if self.backup:
|
| 104 |
+
i = 1
|
| 105 |
+
backup_hist_file = profile_dir / ("history.sqlite.old.%d" % i)
|
| 106 |
+
while backup_hist_file.exists():
|
| 107 |
+
i += 1
|
| 108 |
+
backup_hist_file = profile_dir / ("history.sqlite.old.%d" % i)
|
| 109 |
+
hist_file.rename(backup_hist_file)
|
| 110 |
+
print("Backed up longer history file to", backup_hist_file)
|
| 111 |
+
else:
|
| 112 |
+
hist_file.unlink()
|
| 113 |
+
|
| 114 |
+
new_hist_file.rename(hist_file)
|
| 115 |
+
|
| 116 |
+
|
| 117 |
+
class HistoryClear(HistoryTrim):
|
| 118 |
+
description = clear_hist_help
|
| 119 |
+
keep = Int(0, help="Number of recent lines to keep in the database.")
|
| 120 |
+
|
| 121 |
+
force = Bool(False, help="Don't prompt user for confirmation").tag(config=True)
|
| 122 |
+
|
| 123 |
+
flags = Dict( # type: ignore
|
| 124 |
+
dict(
|
| 125 |
+
force=({"HistoryClear": {"force": True}}, force.help),
|
| 126 |
+
f=({"HistoryTrim": {"force": True}}, force.help),
|
| 127 |
+
)
|
| 128 |
+
)
|
| 129 |
+
aliases = Dict() # type: ignore
|
| 130 |
+
|
| 131 |
+
def start(self):
|
| 132 |
+
if self.force or ask_yes_no(
|
| 133 |
+
"Really delete all ipython history? ", default="no", interrupt="no"
|
| 134 |
+
):
|
| 135 |
+
HistoryTrim.start(self)
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
class HistoryApp(Application):
|
| 139 |
+
name = "ipython-history"
|
| 140 |
+
description = "Manage the IPython history database."
|
| 141 |
+
|
| 142 |
+
subcommands = Dict(dict(
|
| 143 |
+
trim = (HistoryTrim, HistoryTrim.description.splitlines()[0]),
|
| 144 |
+
clear = (HistoryClear, HistoryClear.description.splitlines()[0]),
|
| 145 |
+
))
|
| 146 |
+
|
| 147 |
+
def start(self):
|
| 148 |
+
if self.subapp is None:
|
| 149 |
+
print(
|
| 150 |
+
"No subcommand specified. Must specify one of: "
|
| 151 |
+
+ ", ".join(map(repr, self.subcommands))
|
| 152 |
+
+ ".\n"
|
| 153 |
+
)
|
| 154 |
+
self.print_description()
|
| 155 |
+
self.print_subcommands()
|
| 156 |
+
self.exit(1)
|
| 157 |
+
else:
|
| 158 |
+
return self.subapp.start()
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/hooks.py
ADDED
|
@@ -0,0 +1,173 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Hooks for IPython.
|
| 2 |
+
|
| 3 |
+
In Python, it is possible to overwrite any method of any object if you really
|
| 4 |
+
want to. But IPython exposes a few 'hooks', methods which are *designed* to
|
| 5 |
+
be overwritten by users for customization purposes. This module defines the
|
| 6 |
+
default versions of all such hooks, which get used by IPython if not
|
| 7 |
+
overridden by the user.
|
| 8 |
+
|
| 9 |
+
Hooks are simple functions, but they should be declared with ``self`` as their
|
| 10 |
+
first argument, because when activated they are registered into IPython as
|
| 11 |
+
instance methods. The self argument will be the IPython running instance
|
| 12 |
+
itself, so hooks have full access to the entire IPython object.
|
| 13 |
+
|
| 14 |
+
If you wish to define a new hook and activate it, you can make an :doc:`extension
|
| 15 |
+
</config/extensions/index>` or a :ref:`startup script <startup_files>`. For
|
| 16 |
+
example, you could use a startup file like this::
|
| 17 |
+
|
| 18 |
+
import os
|
| 19 |
+
|
| 20 |
+
def calljed(self,filename, linenum):
|
| 21 |
+
"My editor hook calls the jed editor directly."
|
| 22 |
+
print("Calling my own editor, jed ...")
|
| 23 |
+
if os.system('jed +%d %s' % (linenum,filename)) != 0:
|
| 24 |
+
raise TryNext()
|
| 25 |
+
|
| 26 |
+
def load_ipython_extension(ip):
|
| 27 |
+
ip.set_hook('editor', calljed)
|
| 28 |
+
|
| 29 |
+
"""
|
| 30 |
+
|
| 31 |
+
#*****************************************************************************
|
| 32 |
+
# Copyright (C) 2005 Fernando Perez. <fperez@colorado.edu>
|
| 33 |
+
#
|
| 34 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 35 |
+
# the file COPYING, distributed as part of this software.
|
| 36 |
+
#*****************************************************************************
|
| 37 |
+
|
| 38 |
+
import os
|
| 39 |
+
import subprocess
|
| 40 |
+
import sys
|
| 41 |
+
|
| 42 |
+
from .error import TryNext
|
| 43 |
+
|
| 44 |
+
# List here all the default hooks. For now it's just the editor functions
|
| 45 |
+
# but over time we'll move here all the public API for user-accessible things.
|
| 46 |
+
|
| 47 |
+
__all__ = [
|
| 48 |
+
"editor",
|
| 49 |
+
"synchronize_with_editor",
|
| 50 |
+
"show_in_pager",
|
| 51 |
+
"pre_prompt_hook",
|
| 52 |
+
"clipboard_get",
|
| 53 |
+
]
|
| 54 |
+
|
| 55 |
+
deprecated = {'pre_run_code_hook': "a callback for the 'pre_execute' or 'pre_run_cell' event",
|
| 56 |
+
'late_startup_hook': "a callback for the 'shell_initialized' event",
|
| 57 |
+
'shutdown_hook': "the atexit module",
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
def editor(self, filename, linenum=None, wait=True):
|
| 61 |
+
"""Open the default editor at the given filename and linenumber.
|
| 62 |
+
|
| 63 |
+
This is IPython's default editor hook, you can use it as an example to
|
| 64 |
+
write your own modified one. To set your own editor function as the
|
| 65 |
+
new editor hook, call ip.set_hook('editor',yourfunc)."""
|
| 66 |
+
|
| 67 |
+
# IPython configures a default editor at startup by reading $EDITOR from
|
| 68 |
+
# the environment, and falling back on vi (unix) or notepad (win32).
|
| 69 |
+
editor = self.editor
|
| 70 |
+
|
| 71 |
+
# marker for at which line to open the file (for existing objects)
|
| 72 |
+
if linenum is None or editor=='notepad':
|
| 73 |
+
linemark = ''
|
| 74 |
+
else:
|
| 75 |
+
linemark = '+%d' % int(linenum)
|
| 76 |
+
|
| 77 |
+
# Enclose in quotes if necessary and legal
|
| 78 |
+
if ' ' in editor and os.path.isfile(editor) and editor[0] != '"':
|
| 79 |
+
editor = '"%s"' % editor
|
| 80 |
+
|
| 81 |
+
# Call the actual editor
|
| 82 |
+
proc = subprocess.Popen('%s %s %s' % (editor, linemark, filename),
|
| 83 |
+
shell=True)
|
| 84 |
+
if wait and proc.wait() != 0:
|
| 85 |
+
raise TryNext()
|
| 86 |
+
|
| 87 |
+
|
| 88 |
+
def synchronize_with_editor(self, filename, linenum, column):
|
| 89 |
+
pass
|
| 90 |
+
|
| 91 |
+
|
| 92 |
+
class CommandChainDispatcher:
|
| 93 |
+
""" Dispatch calls to a chain of commands until some func can handle it
|
| 94 |
+
|
| 95 |
+
Usage: instantiate, execute "add" to add commands (with optional
|
| 96 |
+
priority), execute normally via f() calling mechanism.
|
| 97 |
+
|
| 98 |
+
"""
|
| 99 |
+
def __init__(self,commands=None):
|
| 100 |
+
if commands is None:
|
| 101 |
+
self.chain = []
|
| 102 |
+
else:
|
| 103 |
+
self.chain = commands
|
| 104 |
+
|
| 105 |
+
|
| 106 |
+
def __call__(self,*args, **kw):
|
| 107 |
+
""" Command chain is called just like normal func.
|
| 108 |
+
|
| 109 |
+
This will call all funcs in chain with the same args as were given to
|
| 110 |
+
this function, and return the result of first func that didn't raise
|
| 111 |
+
TryNext"""
|
| 112 |
+
last_exc = TryNext()
|
| 113 |
+
for prio,cmd in self.chain:
|
| 114 |
+
# print("prio",prio,"cmd",cmd) # dbg
|
| 115 |
+
try:
|
| 116 |
+
return cmd(*args, **kw)
|
| 117 |
+
except TryNext as exc:
|
| 118 |
+
last_exc = exc
|
| 119 |
+
# if no function will accept it, raise TryNext up to the caller
|
| 120 |
+
raise last_exc
|
| 121 |
+
|
| 122 |
+
def __str__(self):
|
| 123 |
+
return str(self.chain)
|
| 124 |
+
|
| 125 |
+
def add(self, func, priority=0):
|
| 126 |
+
""" Add a func to the cmd chain with given priority """
|
| 127 |
+
self.chain.append((priority, func))
|
| 128 |
+
self.chain.sort(key=lambda x: x[0])
|
| 129 |
+
|
| 130 |
+
def __iter__(self):
|
| 131 |
+
""" Return all objects in chain.
|
| 132 |
+
|
| 133 |
+
Handy if the objects are not callable.
|
| 134 |
+
"""
|
| 135 |
+
return iter(self.chain)
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
def show_in_pager(self, data, start, screen_lines):
|
| 139 |
+
""" Run a string through pager """
|
| 140 |
+
# raising TryNext here will use the default paging functionality
|
| 141 |
+
raise TryNext
|
| 142 |
+
|
| 143 |
+
|
| 144 |
+
def pre_prompt_hook(self):
|
| 145 |
+
""" Run before displaying the next prompt
|
| 146 |
+
|
| 147 |
+
Use this e.g. to display output from asynchronous operations (in order
|
| 148 |
+
to not mess up text entry)
|
| 149 |
+
"""
|
| 150 |
+
|
| 151 |
+
return None
|
| 152 |
+
|
| 153 |
+
|
| 154 |
+
def clipboard_get(self):
|
| 155 |
+
""" Get text from the clipboard.
|
| 156 |
+
"""
|
| 157 |
+
from ..lib.clipboard import (
|
| 158 |
+
osx_clipboard_get,
|
| 159 |
+
tkinter_clipboard_get,
|
| 160 |
+
win32_clipboard_get,
|
| 161 |
+
wayland_clipboard_get,
|
| 162 |
+
)
|
| 163 |
+
if sys.platform == 'win32':
|
| 164 |
+
chain = [win32_clipboard_get, tkinter_clipboard_get]
|
| 165 |
+
elif sys.platform == 'darwin':
|
| 166 |
+
chain = [osx_clipboard_get, tkinter_clipboard_get]
|
| 167 |
+
else:
|
| 168 |
+
chain = [wayland_clipboard_get, tkinter_clipboard_get]
|
| 169 |
+
dispatcher = CommandChainDispatcher()
|
| 170 |
+
for func in chain:
|
| 171 |
+
dispatcher.add(func)
|
| 172 |
+
text = dispatcher()
|
| 173 |
+
return text
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/inputsplitter.py
ADDED
|
@@ -0,0 +1,799 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""DEPRECATED: Input handling and transformation machinery.
|
| 2 |
+
|
| 3 |
+
This module was deprecated in IPython 7.0, in favour of inputtransformer2.
|
| 4 |
+
|
| 5 |
+
The first class in this module, :class:`InputSplitter`, is designed to tell when
|
| 6 |
+
input from a line-oriented frontend is complete and should be executed, and when
|
| 7 |
+
the user should be prompted for another line of code instead. The name 'input
|
| 8 |
+
splitter' is largely for historical reasons.
|
| 9 |
+
|
| 10 |
+
A companion, :class:`IPythonInputSplitter`, provides the same functionality but
|
| 11 |
+
with full support for the extended IPython syntax (magics, system calls, etc).
|
| 12 |
+
The code to actually do these transformations is in :mod:`IPython.core.inputtransformer`.
|
| 13 |
+
:class:`IPythonInputSplitter` feeds the raw code to the transformers in order
|
| 14 |
+
and stores the results.
|
| 15 |
+
|
| 16 |
+
For more details, see the class docstrings below.
|
| 17 |
+
"""
|
| 18 |
+
|
| 19 |
+
from __future__ import annotations
|
| 20 |
+
|
| 21 |
+
from warnings import warn
|
| 22 |
+
|
| 23 |
+
warn('IPython.core.inputsplitter is deprecated since IPython 7 in favor of `IPython.core.inputtransformer2`',
|
| 24 |
+
DeprecationWarning)
|
| 25 |
+
|
| 26 |
+
# Copyright (c) IPython Development Team.
|
| 27 |
+
# Distributed under the terms of the Modified BSD License.
|
| 28 |
+
import ast
|
| 29 |
+
import codeop
|
| 30 |
+
import io
|
| 31 |
+
import re
|
| 32 |
+
import sys
|
| 33 |
+
import tokenize
|
| 34 |
+
import warnings
|
| 35 |
+
|
| 36 |
+
from typing import List, Tuple, Union, Optional, TYPE_CHECKING
|
| 37 |
+
from types import CodeType
|
| 38 |
+
|
| 39 |
+
from IPython.core.inputtransformer import (leading_indent,
|
| 40 |
+
classic_prompt,
|
| 41 |
+
ipy_prompt,
|
| 42 |
+
cellmagic,
|
| 43 |
+
assemble_logical_lines,
|
| 44 |
+
help_end,
|
| 45 |
+
escaped_commands,
|
| 46 |
+
assign_from_magic,
|
| 47 |
+
assign_from_system,
|
| 48 |
+
assemble_python_lines,
|
| 49 |
+
)
|
| 50 |
+
from IPython.utils import tokenutil
|
| 51 |
+
|
| 52 |
+
# These are available in this module for backwards compatibility.
|
| 53 |
+
from IPython.core.inputtransformer import (ESC_SHELL, ESC_SH_CAP, ESC_HELP,
|
| 54 |
+
ESC_HELP2, ESC_MAGIC, ESC_MAGIC2,
|
| 55 |
+
ESC_QUOTE, ESC_QUOTE2, ESC_PAREN, ESC_SEQUENCES)
|
| 56 |
+
|
| 57 |
+
if TYPE_CHECKING:
|
| 58 |
+
from typing_extensions import Self
|
| 59 |
+
#-----------------------------------------------------------------------------
|
| 60 |
+
# Utilities
|
| 61 |
+
#-----------------------------------------------------------------------------
|
| 62 |
+
|
| 63 |
+
# FIXME: These are general-purpose utilities that later can be moved to the
|
| 64 |
+
# general ward. Kept here for now because we're being very strict about test
|
| 65 |
+
# coverage with this code, and this lets us ensure that we keep 100% coverage
|
| 66 |
+
# while developing.
|
| 67 |
+
|
| 68 |
+
# compiled regexps for autoindent management
|
| 69 |
+
dedent_re = re.compile('|'.join([
|
| 70 |
+
r'^\s+raise(\s.*)?$', # raise statement (+ space + other stuff, maybe)
|
| 71 |
+
r'^\s+raise\([^\)]*\).*$', # wacky raise with immediate open paren
|
| 72 |
+
r'^\s+return(\s.*)?$', # normal return (+ space + other stuff, maybe)
|
| 73 |
+
r'^\s+return\([^\)]*\).*$', # wacky return with immediate open paren
|
| 74 |
+
r'^\s+pass\s*$', # pass (optionally followed by trailing spaces)
|
| 75 |
+
r'^\s+break\s*$', # break (optionally followed by trailing spaces)
|
| 76 |
+
r'^\s+continue\s*$', # continue (optionally followed by trailing spaces)
|
| 77 |
+
]))
|
| 78 |
+
ini_spaces_re = re.compile(r'^([ \t\r\f\v]+)')
|
| 79 |
+
|
| 80 |
+
# regexp to match pure comment lines so we don't accidentally insert 'if 1:'
|
| 81 |
+
# before pure comments
|
| 82 |
+
comment_line_re = re.compile(r'^\s*\#')
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
def num_ini_spaces(s):
|
| 86 |
+
"""Return the number of initial spaces in a string.
|
| 87 |
+
|
| 88 |
+
Note that tabs are counted as a single space. For now, we do *not* support
|
| 89 |
+
mixing of tabs and spaces in the user's input.
|
| 90 |
+
|
| 91 |
+
Parameters
|
| 92 |
+
----------
|
| 93 |
+
s : string
|
| 94 |
+
|
| 95 |
+
Returns
|
| 96 |
+
-------
|
| 97 |
+
n : int
|
| 98 |
+
"""
|
| 99 |
+
warnings.warn(
|
| 100 |
+
"`num_ini_spaces` is Pending Deprecation since IPython 8.17."
|
| 101 |
+
"It is considered for removal in in future version. "
|
| 102 |
+
"Please open an issue if you believe it should be kept.",
|
| 103 |
+
stacklevel=2,
|
| 104 |
+
category=PendingDeprecationWarning,
|
| 105 |
+
)
|
| 106 |
+
ini_spaces = ini_spaces_re.match(s)
|
| 107 |
+
if ini_spaces:
|
| 108 |
+
return ini_spaces.end()
|
| 109 |
+
else:
|
| 110 |
+
return 0
|
| 111 |
+
|
| 112 |
+
# Fake token types for partial_tokenize:
|
| 113 |
+
INCOMPLETE_STRING = tokenize.N_TOKENS
|
| 114 |
+
IN_MULTILINE_STATEMENT = tokenize.N_TOKENS + 1
|
| 115 |
+
|
| 116 |
+
# The 2 classes below have the same API as TokenInfo, but don't try to look up
|
| 117 |
+
# a token type name that they won't find.
|
| 118 |
+
class IncompleteString:
|
| 119 |
+
type = exact_type = INCOMPLETE_STRING
|
| 120 |
+
def __init__(self, s, start, end, line):
|
| 121 |
+
self.s = s
|
| 122 |
+
self.start = start
|
| 123 |
+
self.end = end
|
| 124 |
+
self.line = line
|
| 125 |
+
|
| 126 |
+
class InMultilineStatement:
|
| 127 |
+
type = exact_type = IN_MULTILINE_STATEMENT
|
| 128 |
+
def __init__(self, pos, line):
|
| 129 |
+
self.s = ''
|
| 130 |
+
self.start = self.end = pos
|
| 131 |
+
self.line = line
|
| 132 |
+
|
| 133 |
+
def partial_tokens(s):
|
| 134 |
+
"""Iterate over tokens from a possibly-incomplete string of code.
|
| 135 |
+
|
| 136 |
+
This adds two special token types: INCOMPLETE_STRING and
|
| 137 |
+
IN_MULTILINE_STATEMENT. These can only occur as the last token yielded, and
|
| 138 |
+
represent the two main ways for code to be incomplete.
|
| 139 |
+
"""
|
| 140 |
+
readline = io.StringIO(s).readline
|
| 141 |
+
token = tokenize.TokenInfo(tokenize.NEWLINE, '', (1, 0), (1, 0), '')
|
| 142 |
+
try:
|
| 143 |
+
for token in tokenutil.generate_tokens_catch_errors(readline):
|
| 144 |
+
yield token
|
| 145 |
+
except tokenize.TokenError as e:
|
| 146 |
+
# catch EOF error
|
| 147 |
+
lines = s.splitlines(keepends=True)
|
| 148 |
+
end = len(lines), len(lines[-1])
|
| 149 |
+
if 'multi-line string' in e.args[0]:
|
| 150 |
+
l, c = start = token.end
|
| 151 |
+
s = lines[l-1][c:] + ''.join(lines[l:])
|
| 152 |
+
yield IncompleteString(s, start, end, lines[-1])
|
| 153 |
+
elif 'multi-line statement' in e.args[0]:
|
| 154 |
+
yield InMultilineStatement(end, lines[-1])
|
| 155 |
+
else:
|
| 156 |
+
raise
|
| 157 |
+
|
| 158 |
+
def find_next_indent(code) -> int:
|
| 159 |
+
"""Find the number of spaces for the next line of indentation"""
|
| 160 |
+
tokens = list(partial_tokens(code))
|
| 161 |
+
if tokens[-1].type == tokenize.ENDMARKER:
|
| 162 |
+
tokens.pop()
|
| 163 |
+
if not tokens:
|
| 164 |
+
return 0
|
| 165 |
+
|
| 166 |
+
while tokens[-1].type in {
|
| 167 |
+
tokenize.DEDENT,
|
| 168 |
+
tokenize.NEWLINE,
|
| 169 |
+
tokenize.COMMENT,
|
| 170 |
+
tokenize.ERRORTOKEN,
|
| 171 |
+
}:
|
| 172 |
+
tokens.pop()
|
| 173 |
+
|
| 174 |
+
# Starting in Python 3.12, the tokenize module adds implicit newlines at the end
|
| 175 |
+
# of input. We need to remove those if we're in a multiline statement
|
| 176 |
+
if tokens[-1].type == IN_MULTILINE_STATEMENT:
|
| 177 |
+
while tokens[-2].type in {tokenize.NL}:
|
| 178 |
+
tokens.pop(-2)
|
| 179 |
+
|
| 180 |
+
|
| 181 |
+
if tokens[-1].type == INCOMPLETE_STRING:
|
| 182 |
+
# Inside a multiline string
|
| 183 |
+
return 0
|
| 184 |
+
|
| 185 |
+
# Find the indents used before
|
| 186 |
+
prev_indents = [0]
|
| 187 |
+
def _add_indent(n):
|
| 188 |
+
if n != prev_indents[-1]:
|
| 189 |
+
prev_indents.append(n)
|
| 190 |
+
|
| 191 |
+
tokiter = iter(tokens)
|
| 192 |
+
for tok in tokiter:
|
| 193 |
+
if tok.type in {tokenize.INDENT, tokenize.DEDENT}:
|
| 194 |
+
_add_indent(tok.end[1])
|
| 195 |
+
elif (tok.type == tokenize.NL):
|
| 196 |
+
try:
|
| 197 |
+
_add_indent(next(tokiter).start[1])
|
| 198 |
+
except StopIteration:
|
| 199 |
+
break
|
| 200 |
+
|
| 201 |
+
last_indent = prev_indents.pop()
|
| 202 |
+
|
| 203 |
+
# If we've just opened a multiline statement (e.g. 'a = ['), indent more
|
| 204 |
+
if tokens[-1].type == IN_MULTILINE_STATEMENT:
|
| 205 |
+
if tokens[-2].exact_type in {tokenize.LPAR, tokenize.LSQB, tokenize.LBRACE}:
|
| 206 |
+
return last_indent + 4
|
| 207 |
+
return last_indent
|
| 208 |
+
|
| 209 |
+
if tokens[-1].exact_type == tokenize.COLON:
|
| 210 |
+
# Line ends with colon - indent
|
| 211 |
+
return last_indent + 4
|
| 212 |
+
|
| 213 |
+
if last_indent:
|
| 214 |
+
# Examine the last line for dedent cues - statements like return or
|
| 215 |
+
# raise which normally end a block of code.
|
| 216 |
+
last_line_starts = 0
|
| 217 |
+
for i, tok in enumerate(tokens):
|
| 218 |
+
if tok.type == tokenize.NEWLINE:
|
| 219 |
+
last_line_starts = i + 1
|
| 220 |
+
|
| 221 |
+
last_line_tokens = tokens[last_line_starts:]
|
| 222 |
+
names = [t.string for t in last_line_tokens if t.type == tokenize.NAME]
|
| 223 |
+
if names and names[0] in {'raise', 'return', 'pass', 'break', 'continue'}:
|
| 224 |
+
# Find the most recent indentation less than the current level
|
| 225 |
+
for indent in reversed(prev_indents):
|
| 226 |
+
if indent < last_indent:
|
| 227 |
+
return indent
|
| 228 |
+
|
| 229 |
+
return last_indent
|
| 230 |
+
|
| 231 |
+
|
| 232 |
+
def last_blank(src):
|
| 233 |
+
"""Determine if the input source ends in a blank.
|
| 234 |
+
|
| 235 |
+
A blank is either a newline or a line consisting of whitespace.
|
| 236 |
+
|
| 237 |
+
Parameters
|
| 238 |
+
----------
|
| 239 |
+
src : string
|
| 240 |
+
A single or multiline string.
|
| 241 |
+
"""
|
| 242 |
+
if not src: return False
|
| 243 |
+
ll = src.splitlines()[-1]
|
| 244 |
+
return (ll == '') or ll.isspace()
|
| 245 |
+
|
| 246 |
+
|
| 247 |
+
last_two_blanks_re = re.compile(r'\n\s*\n\s*$', re.MULTILINE)
|
| 248 |
+
last_two_blanks_re2 = re.compile(r'.+\n\s*\n\s+$', re.MULTILINE)
|
| 249 |
+
|
| 250 |
+
def last_two_blanks(src):
|
| 251 |
+
"""Determine if the input source ends in two blanks.
|
| 252 |
+
|
| 253 |
+
A blank is either a newline or a line consisting of whitespace.
|
| 254 |
+
|
| 255 |
+
Parameters
|
| 256 |
+
----------
|
| 257 |
+
src : string
|
| 258 |
+
A single or multiline string.
|
| 259 |
+
"""
|
| 260 |
+
if not src: return False
|
| 261 |
+
# The logic here is tricky: I couldn't get a regexp to work and pass all
|
| 262 |
+
# the tests, so I took a different approach: split the source by lines,
|
| 263 |
+
# grab the last two and prepend '###\n' as a stand-in for whatever was in
|
| 264 |
+
# the body before the last two lines. Then, with that structure, it's
|
| 265 |
+
# possible to analyze with two regexps. Not the most elegant solution, but
|
| 266 |
+
# it works. If anyone tries to change this logic, make sure to validate
|
| 267 |
+
# the whole test suite first!
|
| 268 |
+
new_src = '\n'.join(['###\n'] + src.splitlines()[-2:])
|
| 269 |
+
return (bool(last_two_blanks_re.match(new_src)) or
|
| 270 |
+
bool(last_two_blanks_re2.match(new_src)) )
|
| 271 |
+
|
| 272 |
+
|
| 273 |
+
def remove_comments(src):
|
| 274 |
+
"""Remove all comments from input source.
|
| 275 |
+
|
| 276 |
+
Note: comments are NOT recognized inside of strings!
|
| 277 |
+
|
| 278 |
+
Parameters
|
| 279 |
+
----------
|
| 280 |
+
src : string
|
| 281 |
+
A single or multiline input string.
|
| 282 |
+
|
| 283 |
+
Returns
|
| 284 |
+
-------
|
| 285 |
+
String with all Python comments removed.
|
| 286 |
+
"""
|
| 287 |
+
|
| 288 |
+
return re.sub('#.*', '', src)
|
| 289 |
+
|
| 290 |
+
|
| 291 |
+
def get_input_encoding():
|
| 292 |
+
"""Return the default standard input encoding.
|
| 293 |
+
|
| 294 |
+
If sys.stdin has no encoding, 'ascii' is returned."""
|
| 295 |
+
# There are strange environments for which sys.stdin.encoding is None. We
|
| 296 |
+
# ensure that a valid encoding is returned.
|
| 297 |
+
encoding = getattr(sys.stdin, 'encoding', None)
|
| 298 |
+
if encoding is None:
|
| 299 |
+
encoding = 'ascii'
|
| 300 |
+
return encoding
|
| 301 |
+
|
| 302 |
+
#-----------------------------------------------------------------------------
|
| 303 |
+
# Classes and functions for normal Python syntax handling
|
| 304 |
+
#-----------------------------------------------------------------------------
|
| 305 |
+
|
| 306 |
+
class InputSplitter(object):
|
| 307 |
+
r"""An object that can accumulate lines of Python source before execution.
|
| 308 |
+
|
| 309 |
+
This object is designed to be fed python source line-by-line, using
|
| 310 |
+
:meth:`push`. It will return on each push whether the currently pushed
|
| 311 |
+
code could be executed already. In addition, it provides a method called
|
| 312 |
+
:meth:`push_accepts_more` that can be used to query whether more input
|
| 313 |
+
can be pushed into a single interactive block.
|
| 314 |
+
|
| 315 |
+
This is a simple example of how an interactive terminal-based client can use
|
| 316 |
+
this tool::
|
| 317 |
+
|
| 318 |
+
isp = InputSplitter()
|
| 319 |
+
while isp.push_accepts_more():
|
| 320 |
+
indent = ' '*isp.indent_spaces
|
| 321 |
+
prompt = '>>> ' + indent
|
| 322 |
+
line = indent + raw_input(prompt)
|
| 323 |
+
isp.push(line)
|
| 324 |
+
print('Input source was:\n', isp.source_reset())
|
| 325 |
+
"""
|
| 326 |
+
# A cache for storing the current indentation
|
| 327 |
+
# The first value stores the most recently processed source input
|
| 328 |
+
# The second value is the number of spaces for the current indentation
|
| 329 |
+
# If self.source matches the first value, the second value is a valid
|
| 330 |
+
# current indentation. Otherwise, the cache is invalid and the indentation
|
| 331 |
+
# must be recalculated.
|
| 332 |
+
_indent_spaces_cache: Union[Tuple[None, None], Tuple[str, int]] = None, None
|
| 333 |
+
# String, indicating the default input encoding. It is computed by default
|
| 334 |
+
# at initialization time via get_input_encoding(), but it can be reset by a
|
| 335 |
+
# client with specific knowledge of the encoding.
|
| 336 |
+
encoding = ''
|
| 337 |
+
# String where the current full source input is stored, properly encoded.
|
| 338 |
+
# Reading this attribute is the normal way of querying the currently pushed
|
| 339 |
+
# source code, that has been properly encoded.
|
| 340 |
+
source: str = ""
|
| 341 |
+
# Code object corresponding to the current source. It is automatically
|
| 342 |
+
# synced to the source, so it can be queried at any time to obtain the code
|
| 343 |
+
# object; it will be None if the source doesn't compile to valid Python.
|
| 344 |
+
code: Optional[CodeType] = None
|
| 345 |
+
|
| 346 |
+
# Private attributes
|
| 347 |
+
|
| 348 |
+
# List with lines of input accumulated so far
|
| 349 |
+
_buffer: List[str]
|
| 350 |
+
# Command compiler
|
| 351 |
+
_compile: codeop.CommandCompiler
|
| 352 |
+
# Boolean indicating whether the current block is complete
|
| 353 |
+
_is_complete: Optional[bool] = None
|
| 354 |
+
# Boolean indicating whether the current block has an unrecoverable syntax error
|
| 355 |
+
_is_invalid: bool = False
|
| 356 |
+
|
| 357 |
+
def __init__(self) -> None:
|
| 358 |
+
"""Create a new InputSplitter instance."""
|
| 359 |
+
self._buffer = []
|
| 360 |
+
self._compile = codeop.CommandCompiler()
|
| 361 |
+
self.encoding = get_input_encoding()
|
| 362 |
+
|
| 363 |
+
def reset(self):
|
| 364 |
+
"""Reset the input buffer and associated state."""
|
| 365 |
+
self._buffer[:] = []
|
| 366 |
+
self.source = ''
|
| 367 |
+
self.code = None
|
| 368 |
+
self._is_complete = False
|
| 369 |
+
self._is_invalid = False
|
| 370 |
+
|
| 371 |
+
def source_reset(self):
|
| 372 |
+
"""Return the input source and perform a full reset.
|
| 373 |
+
"""
|
| 374 |
+
out = self.source
|
| 375 |
+
self.reset()
|
| 376 |
+
return out
|
| 377 |
+
|
| 378 |
+
def check_complete(self, source):
|
| 379 |
+
"""Return whether a block of code is ready to execute, or should be continued
|
| 380 |
+
|
| 381 |
+
This is a non-stateful API, and will reset the state of this InputSplitter.
|
| 382 |
+
|
| 383 |
+
Parameters
|
| 384 |
+
----------
|
| 385 |
+
source : string
|
| 386 |
+
Python input code, which can be multiline.
|
| 387 |
+
|
| 388 |
+
Returns
|
| 389 |
+
-------
|
| 390 |
+
status : str
|
| 391 |
+
One of 'complete', 'incomplete', or 'invalid' if source is not a
|
| 392 |
+
prefix of valid code.
|
| 393 |
+
indent_spaces : int or None
|
| 394 |
+
The number of spaces by which to indent the next line of code. If
|
| 395 |
+
status is not 'incomplete', this is None.
|
| 396 |
+
"""
|
| 397 |
+
self.reset()
|
| 398 |
+
try:
|
| 399 |
+
self.push(source)
|
| 400 |
+
except SyntaxError:
|
| 401 |
+
# Transformers in IPythonInputSplitter can raise SyntaxError,
|
| 402 |
+
# which push() will not catch.
|
| 403 |
+
return 'invalid', None
|
| 404 |
+
else:
|
| 405 |
+
if self._is_invalid:
|
| 406 |
+
return 'invalid', None
|
| 407 |
+
elif self.push_accepts_more():
|
| 408 |
+
return 'incomplete', self.get_indent_spaces()
|
| 409 |
+
else:
|
| 410 |
+
return 'complete', None
|
| 411 |
+
finally:
|
| 412 |
+
self.reset()
|
| 413 |
+
|
| 414 |
+
def push(self, lines:str) -> bool:
|
| 415 |
+
"""Push one or more lines of input.
|
| 416 |
+
|
| 417 |
+
This stores the given lines and returns a status code indicating
|
| 418 |
+
whether the code forms a complete Python block or not.
|
| 419 |
+
|
| 420 |
+
Any exceptions generated in compilation are swallowed, but if an
|
| 421 |
+
exception was produced, the method returns True.
|
| 422 |
+
|
| 423 |
+
Parameters
|
| 424 |
+
----------
|
| 425 |
+
lines : string
|
| 426 |
+
One or more lines of Python input.
|
| 427 |
+
|
| 428 |
+
Returns
|
| 429 |
+
-------
|
| 430 |
+
is_complete : boolean
|
| 431 |
+
True if the current input source (the result of the current input
|
| 432 |
+
plus prior inputs) forms a complete Python execution block. Note that
|
| 433 |
+
this value is also stored as a private attribute (``_is_complete``), so it
|
| 434 |
+
can be queried at any time.
|
| 435 |
+
"""
|
| 436 |
+
assert isinstance(lines, str)
|
| 437 |
+
self._store(lines)
|
| 438 |
+
source = self.source
|
| 439 |
+
|
| 440 |
+
# Before calling _compile(), reset the code object to None so that if an
|
| 441 |
+
# exception is raised in compilation, we don't mislead by having
|
| 442 |
+
# inconsistent code/source attributes.
|
| 443 |
+
self.code, self._is_complete = None, None
|
| 444 |
+
self._is_invalid = False
|
| 445 |
+
|
| 446 |
+
# Honor termination lines properly
|
| 447 |
+
if source.endswith('\\\n'):
|
| 448 |
+
return False
|
| 449 |
+
|
| 450 |
+
try:
|
| 451 |
+
with warnings.catch_warnings():
|
| 452 |
+
warnings.simplefilter('error', SyntaxWarning)
|
| 453 |
+
self.code = self._compile(source, symbol="exec")
|
| 454 |
+
# Invalid syntax can produce any of a number of different errors from
|
| 455 |
+
# inside the compiler, so we have to catch them all. Syntax errors
|
| 456 |
+
# immediately produce a 'ready' block, so the invalid Python can be
|
| 457 |
+
# sent to the kernel for evaluation with possible ipython
|
| 458 |
+
# special-syntax conversion.
|
| 459 |
+
except (SyntaxError, OverflowError, ValueError, TypeError,
|
| 460 |
+
MemoryError, SyntaxWarning):
|
| 461 |
+
self._is_complete = True
|
| 462 |
+
self._is_invalid = True
|
| 463 |
+
else:
|
| 464 |
+
# Compilation didn't produce any exceptions (though it may not have
|
| 465 |
+
# given a complete code object)
|
| 466 |
+
self._is_complete = self.code is not None
|
| 467 |
+
|
| 468 |
+
return self._is_complete
|
| 469 |
+
|
| 470 |
+
def push_accepts_more(self):
|
| 471 |
+
"""Return whether a block of interactive input can accept more input.
|
| 472 |
+
|
| 473 |
+
This method is meant to be used by line-oriented frontends, who need to
|
| 474 |
+
guess whether a block is complete or not based solely on prior and
|
| 475 |
+
current input lines. The InputSplitter considers it has a complete
|
| 476 |
+
interactive block and will not accept more input when either:
|
| 477 |
+
|
| 478 |
+
* A SyntaxError is raised
|
| 479 |
+
|
| 480 |
+
* The code is complete and consists of a single line or a single
|
| 481 |
+
non-compound statement
|
| 482 |
+
|
| 483 |
+
* The code is complete and has a blank line at the end
|
| 484 |
+
|
| 485 |
+
If the current input produces a syntax error, this method immediately
|
| 486 |
+
returns False but does *not* raise the syntax error exception, as
|
| 487 |
+
typically clients will want to send invalid syntax to an execution
|
| 488 |
+
backend which might convert the invalid syntax into valid Python via
|
| 489 |
+
one of the dynamic IPython mechanisms.
|
| 490 |
+
"""
|
| 491 |
+
|
| 492 |
+
# With incomplete input, unconditionally accept more
|
| 493 |
+
# A syntax error also sets _is_complete to True - see push()
|
| 494 |
+
if not self._is_complete:
|
| 495 |
+
#print("Not complete") # debug
|
| 496 |
+
return True
|
| 497 |
+
|
| 498 |
+
# The user can make any (complete) input execute by leaving a blank line
|
| 499 |
+
last_line = self.source.splitlines()[-1]
|
| 500 |
+
if (not last_line) or last_line.isspace():
|
| 501 |
+
#print("Blank line") # debug
|
| 502 |
+
return False
|
| 503 |
+
|
| 504 |
+
# If there's just a single line or AST node, and we're flush left, as is
|
| 505 |
+
# the case after a simple statement such as 'a=1', we want to execute it
|
| 506 |
+
# straight away.
|
| 507 |
+
if self.get_indent_spaces() == 0:
|
| 508 |
+
if len(self.source.splitlines()) <= 1:
|
| 509 |
+
return False
|
| 510 |
+
|
| 511 |
+
try:
|
| 512 |
+
code_ast = ast.parse("".join(self._buffer))
|
| 513 |
+
except Exception:
|
| 514 |
+
#print("Can't parse AST") # debug
|
| 515 |
+
return False
|
| 516 |
+
else:
|
| 517 |
+
if len(code_ast.body) == 1 and \
|
| 518 |
+
not hasattr(code_ast.body[0], 'body'):
|
| 519 |
+
#print("Simple statement") # debug
|
| 520 |
+
return False
|
| 521 |
+
|
| 522 |
+
# General fallback - accept more code
|
| 523 |
+
return True
|
| 524 |
+
|
| 525 |
+
def get_indent_spaces(self) -> int:
|
| 526 |
+
sourcefor, n = self._indent_spaces_cache
|
| 527 |
+
if sourcefor == self.source:
|
| 528 |
+
assert n is not None
|
| 529 |
+
return n
|
| 530 |
+
|
| 531 |
+
# self.source always has a trailing newline
|
| 532 |
+
n = find_next_indent(self.source[:-1])
|
| 533 |
+
self._indent_spaces_cache = (self.source, n)
|
| 534 |
+
return n
|
| 535 |
+
|
| 536 |
+
# Backwards compatibility. I think all code that used .indent_spaces was
|
| 537 |
+
# inside IPython, but we can leave this here until IPython 7 in case any
|
| 538 |
+
# other modules are using it. -TK, November 2017
|
| 539 |
+
indent_spaces = property(get_indent_spaces)
|
| 540 |
+
|
| 541 |
+
def _store(self, lines, buffer=None, store='source'):
|
| 542 |
+
"""Store one or more lines of input.
|
| 543 |
+
|
| 544 |
+
If input lines are not newline-terminated, a newline is automatically
|
| 545 |
+
appended."""
|
| 546 |
+
|
| 547 |
+
if buffer is None:
|
| 548 |
+
buffer = self._buffer
|
| 549 |
+
|
| 550 |
+
if lines.endswith('\n'):
|
| 551 |
+
buffer.append(lines)
|
| 552 |
+
else:
|
| 553 |
+
buffer.append(lines+'\n')
|
| 554 |
+
setattr(self, store, self._set_source(buffer))
|
| 555 |
+
|
| 556 |
+
def _set_source(self, buffer):
|
| 557 |
+
return u''.join(buffer)
|
| 558 |
+
|
| 559 |
+
|
| 560 |
+
class IPythonInputSplitter(InputSplitter):
|
| 561 |
+
"""An input splitter that recognizes all of IPython's special syntax."""
|
| 562 |
+
|
| 563 |
+
# String with raw, untransformed input.
|
| 564 |
+
source_raw = ''
|
| 565 |
+
|
| 566 |
+
# Flag to track when a transformer has stored input that it hasn't given
|
| 567 |
+
# back yet.
|
| 568 |
+
transformer_accumulating = False
|
| 569 |
+
|
| 570 |
+
# Flag to track when assemble_python_lines has stored input that it hasn't
|
| 571 |
+
# given back yet.
|
| 572 |
+
within_python_line = False
|
| 573 |
+
|
| 574 |
+
# Private attributes
|
| 575 |
+
|
| 576 |
+
# List with lines of raw input accumulated so far.
|
| 577 |
+
_buffer_raw: List[str]
|
| 578 |
+
|
| 579 |
+
def __init__(self, line_input_checker=True, physical_line_transforms=None,
|
| 580 |
+
logical_line_transforms=None, python_line_transforms=None):
|
| 581 |
+
super(IPythonInputSplitter, self).__init__()
|
| 582 |
+
self._buffer_raw = []
|
| 583 |
+
self._validate = True
|
| 584 |
+
|
| 585 |
+
if physical_line_transforms is not None:
|
| 586 |
+
self.physical_line_transforms = physical_line_transforms
|
| 587 |
+
else:
|
| 588 |
+
self.physical_line_transforms = [
|
| 589 |
+
leading_indent(),
|
| 590 |
+
classic_prompt(),
|
| 591 |
+
ipy_prompt(),
|
| 592 |
+
cellmagic(end_on_blank_line=line_input_checker),
|
| 593 |
+
]
|
| 594 |
+
|
| 595 |
+
self.assemble_logical_lines = assemble_logical_lines()
|
| 596 |
+
if logical_line_transforms is not None:
|
| 597 |
+
self.logical_line_transforms = logical_line_transforms
|
| 598 |
+
else:
|
| 599 |
+
self.logical_line_transforms = [
|
| 600 |
+
help_end(),
|
| 601 |
+
escaped_commands(),
|
| 602 |
+
assign_from_magic(),
|
| 603 |
+
assign_from_system(),
|
| 604 |
+
]
|
| 605 |
+
|
| 606 |
+
self.assemble_python_lines = assemble_python_lines()
|
| 607 |
+
if python_line_transforms is not None:
|
| 608 |
+
self.python_line_transforms = python_line_transforms
|
| 609 |
+
else:
|
| 610 |
+
# We don't use any of these at present
|
| 611 |
+
self.python_line_transforms = []
|
| 612 |
+
|
| 613 |
+
@property
|
| 614 |
+
def transforms(self):
|
| 615 |
+
"Quick access to all transformers."
|
| 616 |
+
return self.physical_line_transforms + \
|
| 617 |
+
[self.assemble_logical_lines] + self.logical_line_transforms + \
|
| 618 |
+
[self.assemble_python_lines] + self.python_line_transforms
|
| 619 |
+
|
| 620 |
+
@property
|
| 621 |
+
def transforms_in_use(self):
|
| 622 |
+
"""Transformers, excluding logical line transformers if we're in a
|
| 623 |
+
Python line."""
|
| 624 |
+
t = self.physical_line_transforms[:]
|
| 625 |
+
if not self.within_python_line:
|
| 626 |
+
t += [self.assemble_logical_lines] + self.logical_line_transforms
|
| 627 |
+
return t + [self.assemble_python_lines] + self.python_line_transforms
|
| 628 |
+
|
| 629 |
+
def reset(self):
|
| 630 |
+
"""Reset the input buffer and associated state."""
|
| 631 |
+
super(IPythonInputSplitter, self).reset()
|
| 632 |
+
self._buffer_raw[:] = []
|
| 633 |
+
self.source_raw = ''
|
| 634 |
+
self.transformer_accumulating = False
|
| 635 |
+
self.within_python_line = False
|
| 636 |
+
|
| 637 |
+
for t in self.transforms:
|
| 638 |
+
try:
|
| 639 |
+
t.reset()
|
| 640 |
+
except SyntaxError:
|
| 641 |
+
# Nothing that calls reset() expects to handle transformer
|
| 642 |
+
# errors
|
| 643 |
+
pass
|
| 644 |
+
|
| 645 |
+
def flush_transformers(self: Self):
|
| 646 |
+
def _flush(transform, outs: List[str]):
|
| 647 |
+
"""yield transformed lines
|
| 648 |
+
|
| 649 |
+
always strings, never None
|
| 650 |
+
|
| 651 |
+
transform: the current transform
|
| 652 |
+
outs: an iterable of previously transformed inputs.
|
| 653 |
+
Each may be multiline, which will be passed
|
| 654 |
+
one line at a time to transform.
|
| 655 |
+
"""
|
| 656 |
+
for out in outs:
|
| 657 |
+
for line in out.splitlines():
|
| 658 |
+
# push one line at a time
|
| 659 |
+
tmp = transform.push(line)
|
| 660 |
+
if tmp is not None:
|
| 661 |
+
yield tmp
|
| 662 |
+
|
| 663 |
+
# reset the transform
|
| 664 |
+
tmp = transform.reset()
|
| 665 |
+
if tmp is not None:
|
| 666 |
+
yield tmp
|
| 667 |
+
|
| 668 |
+
out: List[str] = []
|
| 669 |
+
for t in self.transforms_in_use:
|
| 670 |
+
out = _flush(t, out)
|
| 671 |
+
|
| 672 |
+
out = list(out)
|
| 673 |
+
if out:
|
| 674 |
+
self._store('\n'.join(out))
|
| 675 |
+
|
| 676 |
+
def raw_reset(self):
|
| 677 |
+
"""Return raw input only and perform a full reset.
|
| 678 |
+
"""
|
| 679 |
+
out = self.source_raw
|
| 680 |
+
self.reset()
|
| 681 |
+
return out
|
| 682 |
+
|
| 683 |
+
def source_reset(self):
|
| 684 |
+
try:
|
| 685 |
+
self.flush_transformers()
|
| 686 |
+
return self.source
|
| 687 |
+
finally:
|
| 688 |
+
self.reset()
|
| 689 |
+
|
| 690 |
+
def push_accepts_more(self):
|
| 691 |
+
if self.transformer_accumulating:
|
| 692 |
+
return True
|
| 693 |
+
else:
|
| 694 |
+
return super(IPythonInputSplitter, self).push_accepts_more()
|
| 695 |
+
|
| 696 |
+
def transform_cell(self, cell):
|
| 697 |
+
"""Process and translate a cell of input.
|
| 698 |
+
"""
|
| 699 |
+
self.reset()
|
| 700 |
+
try:
|
| 701 |
+
self.push(cell)
|
| 702 |
+
self.flush_transformers()
|
| 703 |
+
return self.source
|
| 704 |
+
finally:
|
| 705 |
+
self.reset()
|
| 706 |
+
|
| 707 |
+
def push(self, lines:str) -> bool:
|
| 708 |
+
"""Push one or more lines of IPython input.
|
| 709 |
+
|
| 710 |
+
This stores the given lines and returns a status code indicating
|
| 711 |
+
whether the code forms a complete Python block or not, after processing
|
| 712 |
+
all input lines for special IPython syntax.
|
| 713 |
+
|
| 714 |
+
Any exceptions generated in compilation are swallowed, but if an
|
| 715 |
+
exception was produced, the method returns True.
|
| 716 |
+
|
| 717 |
+
Parameters
|
| 718 |
+
----------
|
| 719 |
+
lines : string
|
| 720 |
+
One or more lines of Python input.
|
| 721 |
+
|
| 722 |
+
Returns
|
| 723 |
+
-------
|
| 724 |
+
is_complete : boolean
|
| 725 |
+
True if the current input source (the result of the current input
|
| 726 |
+
plus prior inputs) forms a complete Python execution block. Note that
|
| 727 |
+
this value is also stored as a private attribute (_is_complete), so it
|
| 728 |
+
can be queried at any time.
|
| 729 |
+
"""
|
| 730 |
+
assert isinstance(lines, str)
|
| 731 |
+
# We must ensure all input is pure unicode
|
| 732 |
+
# ''.splitlines() --> [], but we need to push the empty line to transformers
|
| 733 |
+
lines_list = lines.splitlines()
|
| 734 |
+
if not lines_list:
|
| 735 |
+
lines_list = ['']
|
| 736 |
+
|
| 737 |
+
# Store raw source before applying any transformations to it. Note
|
| 738 |
+
# that this must be done *after* the reset() call that would otherwise
|
| 739 |
+
# flush the buffer.
|
| 740 |
+
self._store(lines, self._buffer_raw, 'source_raw')
|
| 741 |
+
|
| 742 |
+
transformed_lines_list = []
|
| 743 |
+
for line in lines_list:
|
| 744 |
+
transformed = self._transform_line(line)
|
| 745 |
+
if transformed is not None:
|
| 746 |
+
transformed_lines_list.append(transformed)
|
| 747 |
+
|
| 748 |
+
if transformed_lines_list:
|
| 749 |
+
transformed_lines = '\n'.join(transformed_lines_list)
|
| 750 |
+
return super(IPythonInputSplitter, self).push(transformed_lines)
|
| 751 |
+
else:
|
| 752 |
+
# Got nothing back from transformers - they must be waiting for
|
| 753 |
+
# more input.
|
| 754 |
+
return False
|
| 755 |
+
|
| 756 |
+
def _transform_line(self, line):
|
| 757 |
+
"""Push a line of input code through the various transformers.
|
| 758 |
+
|
| 759 |
+
Returns any output from the transformers, or None if a transformer
|
| 760 |
+
is accumulating lines.
|
| 761 |
+
|
| 762 |
+
Sets self.transformer_accumulating as a side effect.
|
| 763 |
+
"""
|
| 764 |
+
def _accumulating(dbg):
|
| 765 |
+
#print(dbg)
|
| 766 |
+
self.transformer_accumulating = True
|
| 767 |
+
return None
|
| 768 |
+
|
| 769 |
+
for transformer in self.physical_line_transforms:
|
| 770 |
+
line = transformer.push(line)
|
| 771 |
+
if line is None:
|
| 772 |
+
return _accumulating(transformer)
|
| 773 |
+
|
| 774 |
+
if not self.within_python_line:
|
| 775 |
+
line = self.assemble_logical_lines.push(line)
|
| 776 |
+
if line is None:
|
| 777 |
+
return _accumulating('acc logical line')
|
| 778 |
+
|
| 779 |
+
for transformer in self.logical_line_transforms:
|
| 780 |
+
line = transformer.push(line)
|
| 781 |
+
if line is None:
|
| 782 |
+
return _accumulating(transformer)
|
| 783 |
+
|
| 784 |
+
line = self.assemble_python_lines.push(line)
|
| 785 |
+
if line is None:
|
| 786 |
+
self.within_python_line = True
|
| 787 |
+
return _accumulating('acc python line')
|
| 788 |
+
else:
|
| 789 |
+
self.within_python_line = False
|
| 790 |
+
|
| 791 |
+
for transformer in self.python_line_transforms:
|
| 792 |
+
line = transformer.push(line)
|
| 793 |
+
if line is None:
|
| 794 |
+
return _accumulating(transformer)
|
| 795 |
+
|
| 796 |
+
#print("transformers clear") #debug
|
| 797 |
+
self.transformer_accumulating = False
|
| 798 |
+
return line
|
| 799 |
+
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/inputtransformer2.py
ADDED
|
@@ -0,0 +1,830 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Input transformer machinery to support IPython special syntax.
|
| 2 |
+
|
| 3 |
+
This includes the machinery to recognise and transform ``%magic`` commands,
|
| 4 |
+
``!system`` commands, ``help?`` querying, prompt stripping, and so forth.
|
| 5 |
+
|
| 6 |
+
Added: IPython 7.0. Replaces inputsplitter and inputtransformer which were
|
| 7 |
+
deprecated in 7.0.
|
| 8 |
+
"""
|
| 9 |
+
|
| 10 |
+
# Copyright (c) IPython Development Team.
|
| 11 |
+
# Distributed under the terms of the Modified BSD License.
|
| 12 |
+
|
| 13 |
+
import ast
|
| 14 |
+
from codeop import CommandCompiler, Compile
|
| 15 |
+
import re
|
| 16 |
+
import sys
|
| 17 |
+
import tokenize
|
| 18 |
+
from typing import List, Tuple, Optional, Any
|
| 19 |
+
import warnings
|
| 20 |
+
|
| 21 |
+
from IPython.utils import tokenutil
|
| 22 |
+
|
| 23 |
+
_indent_re = re.compile(r'^[ \t]+')
|
| 24 |
+
|
| 25 |
+
def leading_empty_lines(lines):
|
| 26 |
+
"""Remove leading empty lines
|
| 27 |
+
|
| 28 |
+
If the leading lines are empty or contain only whitespace, they will be
|
| 29 |
+
removed.
|
| 30 |
+
"""
|
| 31 |
+
if not lines:
|
| 32 |
+
return lines
|
| 33 |
+
for i, line in enumerate(lines):
|
| 34 |
+
if line and not line.isspace():
|
| 35 |
+
return lines[i:]
|
| 36 |
+
return lines
|
| 37 |
+
|
| 38 |
+
def leading_indent(lines):
|
| 39 |
+
"""Remove leading indentation.
|
| 40 |
+
|
| 41 |
+
If the first line starts with a spaces or tabs, the same whitespace will be
|
| 42 |
+
removed from each following line in the cell.
|
| 43 |
+
"""
|
| 44 |
+
if not lines:
|
| 45 |
+
return lines
|
| 46 |
+
m = _indent_re.match(lines[0])
|
| 47 |
+
if not m:
|
| 48 |
+
return lines
|
| 49 |
+
space = m.group(0)
|
| 50 |
+
n = len(space)
|
| 51 |
+
return [l[n:] if l.startswith(space) else l
|
| 52 |
+
for l in lines]
|
| 53 |
+
|
| 54 |
+
class PromptStripper:
|
| 55 |
+
"""Remove matching input prompts from a block of input.
|
| 56 |
+
|
| 57 |
+
Parameters
|
| 58 |
+
----------
|
| 59 |
+
prompt_re : regular expression
|
| 60 |
+
A regular expression matching any input prompt (including continuation,
|
| 61 |
+
e.g. ``...``)
|
| 62 |
+
initial_re : regular expression, optional
|
| 63 |
+
A regular expression matching only the initial prompt, but not continuation.
|
| 64 |
+
If no initial expression is given, prompt_re will be used everywhere.
|
| 65 |
+
Used mainly for plain Python prompts (``>>>``), where the continuation prompt
|
| 66 |
+
``...`` is a valid Python expression in Python 3, so shouldn't be stripped.
|
| 67 |
+
|
| 68 |
+
Notes
|
| 69 |
+
-----
|
| 70 |
+
|
| 71 |
+
If initial_re and prompt_re differ,
|
| 72 |
+
only initial_re will be tested against the first line.
|
| 73 |
+
If any prompt is found on the first two lines,
|
| 74 |
+
prompts will be stripped from the rest of the block.
|
| 75 |
+
"""
|
| 76 |
+
def __init__(self, prompt_re, initial_re=None):
|
| 77 |
+
self.prompt_re = prompt_re
|
| 78 |
+
self.initial_re = initial_re or prompt_re
|
| 79 |
+
|
| 80 |
+
def _strip(self, lines):
|
| 81 |
+
return [self.prompt_re.sub('', l, count=1) for l in lines]
|
| 82 |
+
|
| 83 |
+
def __call__(self, lines):
|
| 84 |
+
if not lines:
|
| 85 |
+
return lines
|
| 86 |
+
if self.initial_re.match(lines[0]) or \
|
| 87 |
+
(len(lines) > 1 and self.prompt_re.match(lines[1])):
|
| 88 |
+
return self._strip(lines)
|
| 89 |
+
return lines
|
| 90 |
+
|
| 91 |
+
classic_prompt = PromptStripper(
|
| 92 |
+
prompt_re=re.compile(r'^(>>>|\.\.\.)( |$)'),
|
| 93 |
+
initial_re=re.compile(r'^>>>( |$)')
|
| 94 |
+
)
|
| 95 |
+
|
| 96 |
+
ipython_prompt = PromptStripper(
|
| 97 |
+
re.compile(
|
| 98 |
+
r"""
|
| 99 |
+
^( # Match from the beginning of a line, either:
|
| 100 |
+
|
| 101 |
+
# 1. First-line prompt:
|
| 102 |
+
((\[nav\]|\[ins\])?\ )? # Vi editing mode prompt, if it's there
|
| 103 |
+
In\ # The 'In' of the prompt, with a space
|
| 104 |
+
\[\d+\]: # Command index, as displayed in the prompt
|
| 105 |
+
\ # With a mandatory trailing space
|
| 106 |
+
|
| 107 |
+
| # ... or ...
|
| 108 |
+
|
| 109 |
+
# 2. The three dots of the multiline prompt
|
| 110 |
+
\s* # All leading whitespace characters
|
| 111 |
+
\.{3,}: # The three (or more) dots
|
| 112 |
+
\ ? # With an optional trailing space
|
| 113 |
+
|
| 114 |
+
)
|
| 115 |
+
""",
|
| 116 |
+
re.VERBOSE,
|
| 117 |
+
)
|
| 118 |
+
)
|
| 119 |
+
|
| 120 |
+
|
| 121 |
+
def cell_magic(lines):
|
| 122 |
+
if not lines or not lines[0].startswith('%%'):
|
| 123 |
+
return lines
|
| 124 |
+
if re.match(r'%%\w+\?', lines[0]):
|
| 125 |
+
# This case will be handled by help_end
|
| 126 |
+
return lines
|
| 127 |
+
magic_name, _, first_line = lines[0][2:].rstrip().partition(' ')
|
| 128 |
+
body = ''.join(lines[1:])
|
| 129 |
+
return ['get_ipython().run_cell_magic(%r, %r, %r)\n'
|
| 130 |
+
% (magic_name, first_line, body)]
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
def _find_assign_op(token_line) -> Optional[int]:
|
| 134 |
+
"""Get the index of the first assignment in the line ('=' not inside brackets)
|
| 135 |
+
|
| 136 |
+
Note: We don't try to support multiple special assignment (a = b = %foo)
|
| 137 |
+
"""
|
| 138 |
+
paren_level = 0
|
| 139 |
+
for i, ti in enumerate(token_line):
|
| 140 |
+
s = ti.string
|
| 141 |
+
if s == '=' and paren_level == 0:
|
| 142 |
+
return i
|
| 143 |
+
if s in {'(','[','{'}:
|
| 144 |
+
paren_level += 1
|
| 145 |
+
elif s in {')', ']', '}'}:
|
| 146 |
+
if paren_level > 0:
|
| 147 |
+
paren_level -= 1
|
| 148 |
+
return None
|
| 149 |
+
|
| 150 |
+
def find_end_of_continued_line(lines, start_line: int):
|
| 151 |
+
"""Find the last line of a line explicitly extended using backslashes.
|
| 152 |
+
|
| 153 |
+
Uses 0-indexed line numbers.
|
| 154 |
+
"""
|
| 155 |
+
end_line = start_line
|
| 156 |
+
while lines[end_line].endswith('\\\n'):
|
| 157 |
+
end_line += 1
|
| 158 |
+
if end_line >= len(lines):
|
| 159 |
+
break
|
| 160 |
+
return end_line
|
| 161 |
+
|
| 162 |
+
def assemble_continued_line(lines, start: Tuple[int, int], end_line: int):
|
| 163 |
+
r"""Assemble a single line from multiple continued line pieces
|
| 164 |
+
|
| 165 |
+
Continued lines are lines ending in ``\``, and the line following the last
|
| 166 |
+
``\`` in the block.
|
| 167 |
+
|
| 168 |
+
For example, this code continues over multiple lines::
|
| 169 |
+
|
| 170 |
+
if (assign_ix is not None) \
|
| 171 |
+
and (len(line) >= assign_ix + 2) \
|
| 172 |
+
and (line[assign_ix+1].string == '%') \
|
| 173 |
+
and (line[assign_ix+2].type == tokenize.NAME):
|
| 174 |
+
|
| 175 |
+
This statement contains four continued line pieces.
|
| 176 |
+
Assembling these pieces into a single line would give::
|
| 177 |
+
|
| 178 |
+
if (assign_ix is not None) and (len(line) >= assign_ix + 2) and (line[...
|
| 179 |
+
|
| 180 |
+
This uses 0-indexed line numbers. *start* is (lineno, colno).
|
| 181 |
+
|
| 182 |
+
Used to allow ``%magic`` and ``!system`` commands to be continued over
|
| 183 |
+
multiple lines.
|
| 184 |
+
"""
|
| 185 |
+
parts = [lines[start[0]][start[1]:]] + lines[start[0]+1:end_line+1]
|
| 186 |
+
return ' '.join([p.rstrip()[:-1] for p in parts[:-1]] # Strip backslash+newline
|
| 187 |
+
+ [parts[-1].rstrip()]) # Strip newline from last line
|
| 188 |
+
|
| 189 |
+
class TokenTransformBase:
|
| 190 |
+
"""Base class for transformations which examine tokens.
|
| 191 |
+
|
| 192 |
+
Special syntax should not be transformed when it occurs inside strings or
|
| 193 |
+
comments. This is hard to reliably avoid with regexes. The solution is to
|
| 194 |
+
tokenise the code as Python, and recognise the special syntax in the tokens.
|
| 195 |
+
|
| 196 |
+
IPython's special syntax is not valid Python syntax, so tokenising may go
|
| 197 |
+
wrong after the special syntax starts. These classes therefore find and
|
| 198 |
+
transform *one* instance of special syntax at a time into regular Python
|
| 199 |
+
syntax. After each transformation, tokens are regenerated to find the next
|
| 200 |
+
piece of special syntax.
|
| 201 |
+
|
| 202 |
+
Subclasses need to implement one class method (find)
|
| 203 |
+
and one regular method (transform).
|
| 204 |
+
|
| 205 |
+
The priority attribute can select which transformation to apply if multiple
|
| 206 |
+
transformers match in the same place. Lower numbers have higher priority.
|
| 207 |
+
This allows "%magic?" to be turned into a help call rather than a magic call.
|
| 208 |
+
"""
|
| 209 |
+
# Lower numbers -> higher priority (for matches in the same location)
|
| 210 |
+
priority = 10
|
| 211 |
+
|
| 212 |
+
def sortby(self):
|
| 213 |
+
return self.start_line, self.start_col, self.priority
|
| 214 |
+
|
| 215 |
+
def __init__(self, start):
|
| 216 |
+
self.start_line = start[0] - 1 # Shift from 1-index to 0-index
|
| 217 |
+
self.start_col = start[1]
|
| 218 |
+
|
| 219 |
+
@classmethod
|
| 220 |
+
def find(cls, tokens_by_line):
|
| 221 |
+
"""Find one instance of special syntax in the provided tokens.
|
| 222 |
+
|
| 223 |
+
Tokens are grouped into logical lines for convenience,
|
| 224 |
+
so it is easy to e.g. look at the first token of each line.
|
| 225 |
+
*tokens_by_line* is a list of lists of tokenize.TokenInfo objects.
|
| 226 |
+
|
| 227 |
+
This should return an instance of its class, pointing to the start
|
| 228 |
+
position it has found, or None if it found no match.
|
| 229 |
+
"""
|
| 230 |
+
raise NotImplementedError
|
| 231 |
+
|
| 232 |
+
def transform(self, lines: List[str]):
|
| 233 |
+
"""Transform one instance of special syntax found by ``find()``
|
| 234 |
+
|
| 235 |
+
Takes a list of strings representing physical lines,
|
| 236 |
+
returns a similar list of transformed lines.
|
| 237 |
+
"""
|
| 238 |
+
raise NotImplementedError
|
| 239 |
+
|
| 240 |
+
class MagicAssign(TokenTransformBase):
|
| 241 |
+
"""Transformer for assignments from magics (a = %foo)"""
|
| 242 |
+
@classmethod
|
| 243 |
+
def find(cls, tokens_by_line):
|
| 244 |
+
"""Find the first magic assignment (a = %foo) in the cell.
|
| 245 |
+
"""
|
| 246 |
+
for line in tokens_by_line:
|
| 247 |
+
assign_ix = _find_assign_op(line)
|
| 248 |
+
if (assign_ix is not None) \
|
| 249 |
+
and (len(line) >= assign_ix + 2) \
|
| 250 |
+
and (line[assign_ix+1].string == '%') \
|
| 251 |
+
and (line[assign_ix+2].type == tokenize.NAME):
|
| 252 |
+
return cls(line[assign_ix+1].start)
|
| 253 |
+
|
| 254 |
+
def transform(self, lines: List[str]):
|
| 255 |
+
"""Transform a magic assignment found by the ``find()`` classmethod.
|
| 256 |
+
"""
|
| 257 |
+
start_line, start_col = self.start_line, self.start_col
|
| 258 |
+
lhs = lines[start_line][:start_col]
|
| 259 |
+
end_line = find_end_of_continued_line(lines, start_line)
|
| 260 |
+
rhs = assemble_continued_line(lines, (start_line, start_col), end_line)
|
| 261 |
+
assert rhs.startswith('%'), rhs
|
| 262 |
+
magic_name, _, args = rhs[1:].partition(' ')
|
| 263 |
+
|
| 264 |
+
lines_before = lines[:start_line]
|
| 265 |
+
call = "get_ipython().run_line_magic({!r}, {!r})".format(magic_name, args)
|
| 266 |
+
new_line = lhs + call + '\n'
|
| 267 |
+
lines_after = lines[end_line+1:]
|
| 268 |
+
|
| 269 |
+
return lines_before + [new_line] + lines_after
|
| 270 |
+
|
| 271 |
+
|
| 272 |
+
class SystemAssign(TokenTransformBase):
|
| 273 |
+
"""Transformer for assignments from system commands (a = !foo)"""
|
| 274 |
+
@classmethod
|
| 275 |
+
def find_pre_312(cls, tokens_by_line):
|
| 276 |
+
for line in tokens_by_line:
|
| 277 |
+
assign_ix = _find_assign_op(line)
|
| 278 |
+
if (assign_ix is not None) \
|
| 279 |
+
and not line[assign_ix].line.strip().startswith('=') \
|
| 280 |
+
and (len(line) >= assign_ix + 2) \
|
| 281 |
+
and (line[assign_ix + 1].type == tokenize.ERRORTOKEN):
|
| 282 |
+
ix = assign_ix + 1
|
| 283 |
+
|
| 284 |
+
while ix < len(line) and line[ix].type == tokenize.ERRORTOKEN:
|
| 285 |
+
if line[ix].string == '!':
|
| 286 |
+
return cls(line[ix].start)
|
| 287 |
+
elif not line[ix].string.isspace():
|
| 288 |
+
break
|
| 289 |
+
ix += 1
|
| 290 |
+
|
| 291 |
+
@classmethod
|
| 292 |
+
def find_post_312(cls, tokens_by_line):
|
| 293 |
+
for line in tokens_by_line:
|
| 294 |
+
assign_ix = _find_assign_op(line)
|
| 295 |
+
if (
|
| 296 |
+
(assign_ix is not None)
|
| 297 |
+
and not line[assign_ix].line.strip().startswith("=")
|
| 298 |
+
and (len(line) >= assign_ix + 2)
|
| 299 |
+
and (line[assign_ix + 1].type == tokenize.OP)
|
| 300 |
+
and (line[assign_ix + 1].string == "!")
|
| 301 |
+
):
|
| 302 |
+
return cls(line[assign_ix + 1].start)
|
| 303 |
+
|
| 304 |
+
@classmethod
|
| 305 |
+
def find(cls, tokens_by_line):
|
| 306 |
+
"""Find the first system assignment (a = !foo) in the cell."""
|
| 307 |
+
if sys.version_info < (3, 12):
|
| 308 |
+
return cls.find_pre_312(tokens_by_line)
|
| 309 |
+
return cls.find_post_312(tokens_by_line)
|
| 310 |
+
|
| 311 |
+
def transform(self, lines: List[str]):
|
| 312 |
+
"""Transform a system assignment found by the ``find()`` classmethod.
|
| 313 |
+
"""
|
| 314 |
+
start_line, start_col = self.start_line, self.start_col
|
| 315 |
+
|
| 316 |
+
lhs = lines[start_line][:start_col]
|
| 317 |
+
end_line = find_end_of_continued_line(lines, start_line)
|
| 318 |
+
rhs = assemble_continued_line(lines, (start_line, start_col), end_line)
|
| 319 |
+
assert rhs.startswith('!'), rhs
|
| 320 |
+
cmd = rhs[1:]
|
| 321 |
+
|
| 322 |
+
lines_before = lines[:start_line]
|
| 323 |
+
call = "get_ipython().getoutput({!r})".format(cmd)
|
| 324 |
+
new_line = lhs + call + '\n'
|
| 325 |
+
lines_after = lines[end_line + 1:]
|
| 326 |
+
|
| 327 |
+
return lines_before + [new_line] + lines_after
|
| 328 |
+
|
| 329 |
+
# The escape sequences that define the syntax transformations IPython will
|
| 330 |
+
# apply to user input. These can NOT be just changed here: many regular
|
| 331 |
+
# expressions and other parts of the code may use their hardcoded values, and
|
| 332 |
+
# for all intents and purposes they constitute the 'IPython syntax', so they
|
| 333 |
+
# should be considered fixed.
|
| 334 |
+
|
| 335 |
+
ESC_SHELL = '!' # Send line to underlying system shell
|
| 336 |
+
ESC_SH_CAP = '!!' # Send line to system shell and capture output
|
| 337 |
+
ESC_HELP = '?' # Find information about object
|
| 338 |
+
ESC_HELP2 = '??' # Find extra-detailed information about object
|
| 339 |
+
ESC_MAGIC = '%' # Call magic function
|
| 340 |
+
ESC_MAGIC2 = '%%' # Call cell-magic function
|
| 341 |
+
ESC_QUOTE = ',' # Split args on whitespace, quote each as string and call
|
| 342 |
+
ESC_QUOTE2 = ';' # Quote all args as a single string, call
|
| 343 |
+
ESC_PAREN = '/' # Call first argument with rest of line as arguments
|
| 344 |
+
|
| 345 |
+
ESCAPE_SINGLES = {'!', '?', '%', ',', ';', '/'}
|
| 346 |
+
ESCAPE_DOUBLES = {'!!', '??'} # %% (cell magic) is handled separately
|
| 347 |
+
|
| 348 |
+
def _make_help_call(target, esc):
|
| 349 |
+
"""Prepares a pinfo(2)/psearch call from a target name and the escape
|
| 350 |
+
(i.e. ? or ??)"""
|
| 351 |
+
method = 'pinfo2' if esc == '??' \
|
| 352 |
+
else 'psearch' if '*' in target \
|
| 353 |
+
else 'pinfo'
|
| 354 |
+
arg = " ".join([method, target])
|
| 355 |
+
#Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args)
|
| 356 |
+
t_magic_name, _, t_magic_arg_s = arg.partition(' ')
|
| 357 |
+
t_magic_name = t_magic_name.lstrip(ESC_MAGIC)
|
| 358 |
+
return "get_ipython().run_line_magic(%r, %r)" % (t_magic_name, t_magic_arg_s)
|
| 359 |
+
|
| 360 |
+
|
| 361 |
+
def _tr_help(content):
|
| 362 |
+
"""Translate lines escaped with: ?
|
| 363 |
+
|
| 364 |
+
A naked help line should fire the intro help screen (shell.show_usage())
|
| 365 |
+
"""
|
| 366 |
+
if not content:
|
| 367 |
+
return 'get_ipython().show_usage()'
|
| 368 |
+
|
| 369 |
+
return _make_help_call(content, '?')
|
| 370 |
+
|
| 371 |
+
def _tr_help2(content):
|
| 372 |
+
"""Translate lines escaped with: ??
|
| 373 |
+
|
| 374 |
+
A naked help line should fire the intro help screen (shell.show_usage())
|
| 375 |
+
"""
|
| 376 |
+
if not content:
|
| 377 |
+
return 'get_ipython().show_usage()'
|
| 378 |
+
|
| 379 |
+
return _make_help_call(content, '??')
|
| 380 |
+
|
| 381 |
+
def _tr_magic(content):
|
| 382 |
+
"Translate lines escaped with a percent sign: %"
|
| 383 |
+
name, _, args = content.partition(' ')
|
| 384 |
+
return 'get_ipython().run_line_magic(%r, %r)' % (name, args)
|
| 385 |
+
|
| 386 |
+
def _tr_quote(content):
|
| 387 |
+
"Translate lines escaped with a comma: ,"
|
| 388 |
+
name, _, args = content.partition(' ')
|
| 389 |
+
return '%s("%s")' % (name, '", "'.join(args.split()) )
|
| 390 |
+
|
| 391 |
+
def _tr_quote2(content):
|
| 392 |
+
"Translate lines escaped with a semicolon: ;"
|
| 393 |
+
name, _, args = content.partition(' ')
|
| 394 |
+
return '%s("%s")' % (name, args)
|
| 395 |
+
|
| 396 |
+
def _tr_paren(content):
|
| 397 |
+
"Translate lines escaped with a slash: /"
|
| 398 |
+
name, _, args = content.partition(" ")
|
| 399 |
+
if name == "":
|
| 400 |
+
raise SyntaxError(f'"{ESC_SHELL}" must be followed by a callable name')
|
| 401 |
+
|
| 402 |
+
return '%s(%s)' % (name, ", ".join(args.split()))
|
| 403 |
+
|
| 404 |
+
tr = { ESC_SHELL : 'get_ipython().system({!r})'.format,
|
| 405 |
+
ESC_SH_CAP : 'get_ipython().getoutput({!r})'.format,
|
| 406 |
+
ESC_HELP : _tr_help,
|
| 407 |
+
ESC_HELP2 : _tr_help2,
|
| 408 |
+
ESC_MAGIC : _tr_magic,
|
| 409 |
+
ESC_QUOTE : _tr_quote,
|
| 410 |
+
ESC_QUOTE2 : _tr_quote2,
|
| 411 |
+
ESC_PAREN : _tr_paren }
|
| 412 |
+
|
| 413 |
+
class EscapedCommand(TokenTransformBase):
|
| 414 |
+
"""Transformer for escaped commands like %foo, !foo, or /foo"""
|
| 415 |
+
@classmethod
|
| 416 |
+
def find(cls, tokens_by_line):
|
| 417 |
+
"""Find the first escaped command (%foo, !foo, etc.) in the cell.
|
| 418 |
+
"""
|
| 419 |
+
for line in tokens_by_line:
|
| 420 |
+
if not line:
|
| 421 |
+
continue
|
| 422 |
+
ix = 0
|
| 423 |
+
ll = len(line)
|
| 424 |
+
while ll > ix and line[ix].type in {tokenize.INDENT, tokenize.DEDENT}:
|
| 425 |
+
ix += 1
|
| 426 |
+
if ix >= ll:
|
| 427 |
+
continue
|
| 428 |
+
if line[ix].string in ESCAPE_SINGLES:
|
| 429 |
+
return cls(line[ix].start)
|
| 430 |
+
|
| 431 |
+
def transform(self, lines):
|
| 432 |
+
"""Transform an escaped line found by the ``find()`` classmethod.
|
| 433 |
+
"""
|
| 434 |
+
start_line, start_col = self.start_line, self.start_col
|
| 435 |
+
|
| 436 |
+
indent = lines[start_line][:start_col]
|
| 437 |
+
end_line = find_end_of_continued_line(lines, start_line)
|
| 438 |
+
line = assemble_continued_line(lines, (start_line, start_col), end_line)
|
| 439 |
+
|
| 440 |
+
if len(line) > 1 and line[:2] in ESCAPE_DOUBLES:
|
| 441 |
+
escape, content = line[:2], line[2:]
|
| 442 |
+
else:
|
| 443 |
+
escape, content = line[:1], line[1:]
|
| 444 |
+
|
| 445 |
+
if escape in tr:
|
| 446 |
+
call = tr[escape](content)
|
| 447 |
+
else:
|
| 448 |
+
call = ''
|
| 449 |
+
|
| 450 |
+
lines_before = lines[:start_line]
|
| 451 |
+
new_line = indent + call + '\n'
|
| 452 |
+
lines_after = lines[end_line + 1:]
|
| 453 |
+
|
| 454 |
+
return lines_before + [new_line] + lines_after
|
| 455 |
+
|
| 456 |
+
|
| 457 |
+
_help_end_re = re.compile(
|
| 458 |
+
r"""(%{0,2}
|
| 459 |
+
(?!\d)[\w*]+ # Variable name
|
| 460 |
+
(\.(?!\d)[\w*]+|\[-?[0-9]+\])* # .etc.etc or [0], we only support literal integers.
|
| 461 |
+
)
|
| 462 |
+
(\?\??)$ # ? or ??
|
| 463 |
+
""",
|
| 464 |
+
re.VERBOSE,
|
| 465 |
+
)
|
| 466 |
+
|
| 467 |
+
|
| 468 |
+
class HelpEnd(TokenTransformBase):
|
| 469 |
+
"""Transformer for help syntax: obj? and obj??"""
|
| 470 |
+
# This needs to be higher priority (lower number) than EscapedCommand so
|
| 471 |
+
# that inspecting magics (%foo?) works.
|
| 472 |
+
priority = 5
|
| 473 |
+
|
| 474 |
+
def __init__(self, start, q_locn):
|
| 475 |
+
super().__init__(start)
|
| 476 |
+
self.q_line = q_locn[0] - 1 # Shift from 1-indexed to 0-indexed
|
| 477 |
+
self.q_col = q_locn[1]
|
| 478 |
+
|
| 479 |
+
@classmethod
|
| 480 |
+
def find(cls, tokens_by_line):
|
| 481 |
+
"""Find the first help command (foo?) in the cell.
|
| 482 |
+
"""
|
| 483 |
+
for line in tokens_by_line:
|
| 484 |
+
# Last token is NEWLINE; look at last but one
|
| 485 |
+
if len(line) > 2 and line[-2].string == '?':
|
| 486 |
+
# Find the first token that's not INDENT/DEDENT
|
| 487 |
+
ix = 0
|
| 488 |
+
while line[ix].type in {tokenize.INDENT, tokenize.DEDENT}:
|
| 489 |
+
ix += 1
|
| 490 |
+
return cls(line[ix].start, line[-2].start)
|
| 491 |
+
|
| 492 |
+
def transform(self, lines):
|
| 493 |
+
"""Transform a help command found by the ``find()`` classmethod.
|
| 494 |
+
"""
|
| 495 |
+
|
| 496 |
+
piece = "".join(lines[self.start_line : self.q_line + 1])
|
| 497 |
+
indent, content = piece[: self.start_col], piece[self.start_col :]
|
| 498 |
+
lines_before = lines[: self.start_line]
|
| 499 |
+
lines_after = lines[self.q_line + 1 :]
|
| 500 |
+
|
| 501 |
+
m = _help_end_re.search(content)
|
| 502 |
+
if not m:
|
| 503 |
+
raise SyntaxError(content)
|
| 504 |
+
assert m is not None, content
|
| 505 |
+
target = m.group(1)
|
| 506 |
+
esc = m.group(3)
|
| 507 |
+
|
| 508 |
+
|
| 509 |
+
call = _make_help_call(target, esc)
|
| 510 |
+
new_line = indent + call + '\n'
|
| 511 |
+
|
| 512 |
+
return lines_before + [new_line] + lines_after
|
| 513 |
+
|
| 514 |
+
def make_tokens_by_line(lines:List[str]):
|
| 515 |
+
"""Tokenize a series of lines and group tokens by line.
|
| 516 |
+
|
| 517 |
+
The tokens for a multiline Python string or expression are grouped as one
|
| 518 |
+
line. All lines except the last lines should keep their line ending ('\\n',
|
| 519 |
+
'\\r\\n') for this to properly work. Use `.splitlines(keeplineending=True)`
|
| 520 |
+
for example when passing block of text to this function.
|
| 521 |
+
|
| 522 |
+
"""
|
| 523 |
+
# NL tokens are used inside multiline expressions, but also after blank
|
| 524 |
+
# lines or comments. This is intentional - see https://bugs.python.org/issue17061
|
| 525 |
+
# We want to group the former case together but split the latter, so we
|
| 526 |
+
# track parentheses level, similar to the internals of tokenize.
|
| 527 |
+
|
| 528 |
+
# reexported from token on 3.7+
|
| 529 |
+
NEWLINE, NL = tokenize.NEWLINE, tokenize.NL # type: ignore
|
| 530 |
+
tokens_by_line: List[List[Any]] = [[]]
|
| 531 |
+
if len(lines) > 1 and not lines[0].endswith(("\n", "\r", "\r\n", "\x0b", "\x0c")):
|
| 532 |
+
warnings.warn(
|
| 533 |
+
"`make_tokens_by_line` received a list of lines which do not have lineending markers ('\\n', '\\r', '\\r\\n', '\\x0b', '\\x0c'), behavior will be unspecified",
|
| 534 |
+
stacklevel=2,
|
| 535 |
+
)
|
| 536 |
+
parenlev = 0
|
| 537 |
+
try:
|
| 538 |
+
for token in tokenutil.generate_tokens_catch_errors(
|
| 539 |
+
iter(lines).__next__, extra_errors_to_catch=["expected EOF"]
|
| 540 |
+
):
|
| 541 |
+
tokens_by_line[-1].append(token)
|
| 542 |
+
if (token.type == NEWLINE) \
|
| 543 |
+
or ((token.type == NL) and (parenlev <= 0)):
|
| 544 |
+
tokens_by_line.append([])
|
| 545 |
+
elif token.string in {'(', '[', '{'}:
|
| 546 |
+
parenlev += 1
|
| 547 |
+
elif token.string in {')', ']', '}'}:
|
| 548 |
+
if parenlev > 0:
|
| 549 |
+
parenlev -= 1
|
| 550 |
+
except tokenize.TokenError:
|
| 551 |
+
# Input ended in a multiline string or expression. That's OK for us.
|
| 552 |
+
pass
|
| 553 |
+
|
| 554 |
+
|
| 555 |
+
if not tokens_by_line[-1]:
|
| 556 |
+
tokens_by_line.pop()
|
| 557 |
+
|
| 558 |
+
|
| 559 |
+
return tokens_by_line
|
| 560 |
+
|
| 561 |
+
|
| 562 |
+
def has_sunken_brackets(tokens: List[tokenize.TokenInfo]):
|
| 563 |
+
"""Check if the depth of brackets in the list of tokens drops below 0"""
|
| 564 |
+
parenlev = 0
|
| 565 |
+
for token in tokens:
|
| 566 |
+
if token.string in {"(", "[", "{"}:
|
| 567 |
+
parenlev += 1
|
| 568 |
+
elif token.string in {")", "]", "}"}:
|
| 569 |
+
parenlev -= 1
|
| 570 |
+
if parenlev < 0:
|
| 571 |
+
return True
|
| 572 |
+
return False
|
| 573 |
+
|
| 574 |
+
|
| 575 |
+
def show_linewise_tokens(s: str):
|
| 576 |
+
"""For investigation and debugging"""
|
| 577 |
+
warnings.warn(
|
| 578 |
+
"show_linewise_tokens is deprecated since IPython 8.6",
|
| 579 |
+
DeprecationWarning,
|
| 580 |
+
stacklevel=2,
|
| 581 |
+
)
|
| 582 |
+
if not s.endswith("\n"):
|
| 583 |
+
s += "\n"
|
| 584 |
+
lines = s.splitlines(keepends=True)
|
| 585 |
+
for line in make_tokens_by_line(lines):
|
| 586 |
+
print("Line -------")
|
| 587 |
+
for tokinfo in line:
|
| 588 |
+
print(" ", tokinfo)
|
| 589 |
+
|
| 590 |
+
# Arbitrary limit to prevent getting stuck in infinite loops
|
| 591 |
+
TRANSFORM_LOOP_LIMIT = 500
|
| 592 |
+
|
| 593 |
+
class TransformerManager:
|
| 594 |
+
"""Applies various transformations to a cell or code block.
|
| 595 |
+
|
| 596 |
+
The key methods for external use are ``transform_cell()``
|
| 597 |
+
and ``check_complete()``.
|
| 598 |
+
"""
|
| 599 |
+
def __init__(self):
|
| 600 |
+
self.cleanup_transforms = [
|
| 601 |
+
leading_empty_lines,
|
| 602 |
+
leading_indent,
|
| 603 |
+
classic_prompt,
|
| 604 |
+
ipython_prompt,
|
| 605 |
+
]
|
| 606 |
+
self.line_transforms = [
|
| 607 |
+
cell_magic,
|
| 608 |
+
]
|
| 609 |
+
self.token_transformers = [
|
| 610 |
+
MagicAssign,
|
| 611 |
+
SystemAssign,
|
| 612 |
+
EscapedCommand,
|
| 613 |
+
HelpEnd,
|
| 614 |
+
]
|
| 615 |
+
|
| 616 |
+
def do_one_token_transform(self, lines):
|
| 617 |
+
"""Find and run the transform earliest in the code.
|
| 618 |
+
|
| 619 |
+
Returns (changed, lines).
|
| 620 |
+
|
| 621 |
+
This method is called repeatedly until changed is False, indicating
|
| 622 |
+
that all available transformations are complete.
|
| 623 |
+
|
| 624 |
+
The tokens following IPython special syntax might not be valid, so
|
| 625 |
+
the transformed code is retokenised every time to identify the next
|
| 626 |
+
piece of special syntax. Hopefully long code cells are mostly valid
|
| 627 |
+
Python, not using lots of IPython special syntax, so this shouldn't be
|
| 628 |
+
a performance issue.
|
| 629 |
+
"""
|
| 630 |
+
tokens_by_line = make_tokens_by_line(lines)
|
| 631 |
+
candidates = []
|
| 632 |
+
for transformer_cls in self.token_transformers:
|
| 633 |
+
transformer = transformer_cls.find(tokens_by_line)
|
| 634 |
+
if transformer:
|
| 635 |
+
candidates.append(transformer)
|
| 636 |
+
|
| 637 |
+
if not candidates:
|
| 638 |
+
# Nothing to transform
|
| 639 |
+
return False, lines
|
| 640 |
+
ordered_transformers = sorted(candidates, key=TokenTransformBase.sortby)
|
| 641 |
+
for transformer in ordered_transformers:
|
| 642 |
+
try:
|
| 643 |
+
return True, transformer.transform(lines)
|
| 644 |
+
except SyntaxError:
|
| 645 |
+
pass
|
| 646 |
+
return False, lines
|
| 647 |
+
|
| 648 |
+
def do_token_transforms(self, lines):
|
| 649 |
+
for _ in range(TRANSFORM_LOOP_LIMIT):
|
| 650 |
+
changed, lines = self.do_one_token_transform(lines)
|
| 651 |
+
if not changed:
|
| 652 |
+
return lines
|
| 653 |
+
|
| 654 |
+
raise RuntimeError("Input transformation still changing after "
|
| 655 |
+
"%d iterations. Aborting." % TRANSFORM_LOOP_LIMIT)
|
| 656 |
+
|
| 657 |
+
def transform_cell(self, cell: str) -> str:
|
| 658 |
+
"""Transforms a cell of input code"""
|
| 659 |
+
if not cell.endswith('\n'):
|
| 660 |
+
cell += '\n' # Ensure the cell has a trailing newline
|
| 661 |
+
lines = cell.splitlines(keepends=True)
|
| 662 |
+
for transform in self.cleanup_transforms + self.line_transforms:
|
| 663 |
+
lines = transform(lines)
|
| 664 |
+
|
| 665 |
+
lines = self.do_token_transforms(lines)
|
| 666 |
+
return ''.join(lines)
|
| 667 |
+
|
| 668 |
+
def check_complete(self, cell: str):
|
| 669 |
+
"""Return whether a block of code is ready to execute, or should be continued
|
| 670 |
+
|
| 671 |
+
Parameters
|
| 672 |
+
----------
|
| 673 |
+
cell : string
|
| 674 |
+
Python input code, which can be multiline.
|
| 675 |
+
|
| 676 |
+
Returns
|
| 677 |
+
-------
|
| 678 |
+
status : str
|
| 679 |
+
One of 'complete', 'incomplete', or 'invalid' if source is not a
|
| 680 |
+
prefix of valid code.
|
| 681 |
+
indent_spaces : int or None
|
| 682 |
+
The number of spaces by which to indent the next line of code. If
|
| 683 |
+
status is not 'incomplete', this is None.
|
| 684 |
+
"""
|
| 685 |
+
# Remember if the lines ends in a new line.
|
| 686 |
+
ends_with_newline = False
|
| 687 |
+
for character in reversed(cell):
|
| 688 |
+
if character == '\n':
|
| 689 |
+
ends_with_newline = True
|
| 690 |
+
break
|
| 691 |
+
elif character.strip():
|
| 692 |
+
break
|
| 693 |
+
else:
|
| 694 |
+
continue
|
| 695 |
+
|
| 696 |
+
if not ends_with_newline:
|
| 697 |
+
# Append an newline for consistent tokenization
|
| 698 |
+
# See https://bugs.python.org/issue33899
|
| 699 |
+
cell += '\n'
|
| 700 |
+
|
| 701 |
+
lines = cell.splitlines(keepends=True)
|
| 702 |
+
|
| 703 |
+
if not lines:
|
| 704 |
+
return 'complete', None
|
| 705 |
+
|
| 706 |
+
for line in reversed(lines):
|
| 707 |
+
if not line.strip():
|
| 708 |
+
continue
|
| 709 |
+
elif line.strip("\n").endswith("\\"):
|
| 710 |
+
return "incomplete", find_last_indent(lines)
|
| 711 |
+
else:
|
| 712 |
+
break
|
| 713 |
+
|
| 714 |
+
try:
|
| 715 |
+
for transform in self.cleanup_transforms:
|
| 716 |
+
if not getattr(transform, 'has_side_effects', False):
|
| 717 |
+
lines = transform(lines)
|
| 718 |
+
except SyntaxError:
|
| 719 |
+
return 'invalid', None
|
| 720 |
+
|
| 721 |
+
if lines[0].startswith('%%'):
|
| 722 |
+
# Special case for cell magics - completion marked by blank line
|
| 723 |
+
if lines[-1].strip():
|
| 724 |
+
return 'incomplete', find_last_indent(lines)
|
| 725 |
+
else:
|
| 726 |
+
return 'complete', None
|
| 727 |
+
|
| 728 |
+
try:
|
| 729 |
+
for transform in self.line_transforms:
|
| 730 |
+
if not getattr(transform, 'has_side_effects', False):
|
| 731 |
+
lines = transform(lines)
|
| 732 |
+
lines = self.do_token_transforms(lines)
|
| 733 |
+
except SyntaxError:
|
| 734 |
+
return 'invalid', None
|
| 735 |
+
|
| 736 |
+
tokens_by_line = make_tokens_by_line(lines)
|
| 737 |
+
|
| 738 |
+
# Bail if we got one line and there are more closing parentheses than
|
| 739 |
+
# the opening ones
|
| 740 |
+
if (
|
| 741 |
+
len(lines) == 1
|
| 742 |
+
and tokens_by_line
|
| 743 |
+
and has_sunken_brackets(tokens_by_line[0])
|
| 744 |
+
):
|
| 745 |
+
return "invalid", None
|
| 746 |
+
|
| 747 |
+
if not tokens_by_line:
|
| 748 |
+
return 'incomplete', find_last_indent(lines)
|
| 749 |
+
|
| 750 |
+
if (
|
| 751 |
+
tokens_by_line[-1][-1].type != tokenize.ENDMARKER
|
| 752 |
+
and tokens_by_line[-1][-1].type != tokenize.ERRORTOKEN
|
| 753 |
+
):
|
| 754 |
+
# We're in a multiline string or expression
|
| 755 |
+
return 'incomplete', find_last_indent(lines)
|
| 756 |
+
|
| 757 |
+
newline_types = {tokenize.NEWLINE, tokenize.COMMENT, tokenize.ENDMARKER} # type: ignore
|
| 758 |
+
|
| 759 |
+
# Pop the last line which only contains DEDENTs and ENDMARKER
|
| 760 |
+
last_token_line = None
|
| 761 |
+
if {t.type for t in tokens_by_line[-1]} in [
|
| 762 |
+
{tokenize.DEDENT, tokenize.ENDMARKER},
|
| 763 |
+
{tokenize.ENDMARKER}
|
| 764 |
+
] and len(tokens_by_line) > 1:
|
| 765 |
+
last_token_line = tokens_by_line.pop()
|
| 766 |
+
|
| 767 |
+
while tokens_by_line[-1] and tokens_by_line[-1][-1].type in newline_types:
|
| 768 |
+
tokens_by_line[-1].pop()
|
| 769 |
+
|
| 770 |
+
if not tokens_by_line[-1]:
|
| 771 |
+
return 'incomplete', find_last_indent(lines)
|
| 772 |
+
|
| 773 |
+
if tokens_by_line[-1][-1].string == ':':
|
| 774 |
+
# The last line starts a block (e.g. 'if foo:')
|
| 775 |
+
ix = 0
|
| 776 |
+
while tokens_by_line[-1][ix].type in {tokenize.INDENT, tokenize.DEDENT}:
|
| 777 |
+
ix += 1
|
| 778 |
+
|
| 779 |
+
indent = tokens_by_line[-1][ix].start[1]
|
| 780 |
+
return 'incomplete', indent + 4
|
| 781 |
+
|
| 782 |
+
if tokens_by_line[-1][0].line.endswith('\\'):
|
| 783 |
+
return 'incomplete', None
|
| 784 |
+
|
| 785 |
+
# At this point, our checks think the code is complete (or invalid).
|
| 786 |
+
# We'll use codeop.compile_command to check this with the real parser
|
| 787 |
+
try:
|
| 788 |
+
with warnings.catch_warnings():
|
| 789 |
+
warnings.simplefilter('error', SyntaxWarning)
|
| 790 |
+
res = compile_command(''.join(lines), symbol='exec')
|
| 791 |
+
except (SyntaxError, OverflowError, ValueError, TypeError,
|
| 792 |
+
MemoryError, SyntaxWarning):
|
| 793 |
+
return 'invalid', None
|
| 794 |
+
else:
|
| 795 |
+
if res is None:
|
| 796 |
+
return 'incomplete', find_last_indent(lines)
|
| 797 |
+
|
| 798 |
+
if last_token_line and last_token_line[0].type == tokenize.DEDENT:
|
| 799 |
+
if ends_with_newline:
|
| 800 |
+
return 'complete', None
|
| 801 |
+
return 'incomplete', find_last_indent(lines)
|
| 802 |
+
|
| 803 |
+
# If there's a blank line at the end, assume we're ready to execute
|
| 804 |
+
if not lines[-1].strip():
|
| 805 |
+
return 'complete', None
|
| 806 |
+
|
| 807 |
+
return 'complete', None
|
| 808 |
+
|
| 809 |
+
|
| 810 |
+
def find_last_indent(lines):
|
| 811 |
+
m = _indent_re.match(lines[-1])
|
| 812 |
+
if not m:
|
| 813 |
+
return 0
|
| 814 |
+
return len(m.group(0).replace('\t', ' '*4))
|
| 815 |
+
|
| 816 |
+
|
| 817 |
+
class MaybeAsyncCompile(Compile):
|
| 818 |
+
def __init__(self, extra_flags=0):
|
| 819 |
+
super().__init__()
|
| 820 |
+
self.flags |= extra_flags
|
| 821 |
+
|
| 822 |
+
|
| 823 |
+
class MaybeAsyncCommandCompiler(CommandCompiler):
|
| 824 |
+
def __init__(self, extra_flags=0):
|
| 825 |
+
self.compiler = MaybeAsyncCompile(extra_flags=extra_flags)
|
| 826 |
+
|
| 827 |
+
|
| 828 |
+
_extra_flags = ast.PyCF_ALLOW_TOP_LEVEL_AWAIT
|
| 829 |
+
|
| 830 |
+
compile_command = MaybeAsyncCommandCompiler(extra_flags=_extra_flags)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/interactiveshell.py
ADDED
|
The diff for this file is too large to render.
See raw diff
|
|
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/latex_symbols.py
ADDED
|
@@ -0,0 +1,1301 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
|
| 3 |
+
# DO NOT EDIT THIS FILE BY HAND.
|
| 4 |
+
|
| 5 |
+
# To update this file, run the script /tools/gen_latex_symbols.py using Python 3
|
| 6 |
+
|
| 7 |
+
# This file is autogenerated from the file:
|
| 8 |
+
# https://raw.githubusercontent.com/JuliaLang/julia/master/base/latex_symbols.jl
|
| 9 |
+
# This original list is filtered to remove any unicode characters that are not valid
|
| 10 |
+
# Python identifiers.
|
| 11 |
+
|
| 12 |
+
latex_symbols = {
|
| 13 |
+
|
| 14 |
+
"\\euler" : "ℯ",
|
| 15 |
+
"\\^a" : "ᵃ",
|
| 16 |
+
"\\^b" : "ᵇ",
|
| 17 |
+
"\\^c" : "ᶜ",
|
| 18 |
+
"\\^d" : "ᵈ",
|
| 19 |
+
"\\^e" : "ᵉ",
|
| 20 |
+
"\\^f" : "ᶠ",
|
| 21 |
+
"\\^g" : "ᵍ",
|
| 22 |
+
"\\^h" : "ʰ",
|
| 23 |
+
"\\^i" : "ⁱ",
|
| 24 |
+
"\\^j" : "ʲ",
|
| 25 |
+
"\\^k" : "ᵏ",
|
| 26 |
+
"\\^l" : "ˡ",
|
| 27 |
+
"\\^m" : "ᵐ",
|
| 28 |
+
"\\^n" : "ⁿ",
|
| 29 |
+
"\\^o" : "ᵒ",
|
| 30 |
+
"\\^p" : "ᵖ",
|
| 31 |
+
"\\^r" : "ʳ",
|
| 32 |
+
"\\^s" : "ˢ",
|
| 33 |
+
"\\^t" : "ᵗ",
|
| 34 |
+
"\\^u" : "ᵘ",
|
| 35 |
+
"\\^v" : "ᵛ",
|
| 36 |
+
"\\^w" : "ʷ",
|
| 37 |
+
"\\^x" : "ˣ",
|
| 38 |
+
"\\^y" : "ʸ",
|
| 39 |
+
"\\^z" : "ᶻ",
|
| 40 |
+
"\\^A" : "ᴬ",
|
| 41 |
+
"\\^B" : "ᴮ",
|
| 42 |
+
"\\^D" : "ᴰ",
|
| 43 |
+
"\\^E" : "ᴱ",
|
| 44 |
+
"\\^G" : "ᴳ",
|
| 45 |
+
"\\^H" : "ᴴ",
|
| 46 |
+
"\\^I" : "ᴵ",
|
| 47 |
+
"\\^J" : "ᴶ",
|
| 48 |
+
"\\^K" : "ᴷ",
|
| 49 |
+
"\\^L" : "ᴸ",
|
| 50 |
+
"\\^M" : "ᴹ",
|
| 51 |
+
"\\^N" : "ᴺ",
|
| 52 |
+
"\\^O" : "ᴼ",
|
| 53 |
+
"\\^P" : "ᴾ",
|
| 54 |
+
"\\^R" : "ᴿ",
|
| 55 |
+
"\\^T" : "ᵀ",
|
| 56 |
+
"\\^U" : "ᵁ",
|
| 57 |
+
"\\^V" : "ⱽ",
|
| 58 |
+
"\\^W" : "ᵂ",
|
| 59 |
+
"\\^alpha" : "ᵅ",
|
| 60 |
+
"\\^beta" : "ᵝ",
|
| 61 |
+
"\\^gamma" : "ᵞ",
|
| 62 |
+
"\\^delta" : "ᵟ",
|
| 63 |
+
"\\^epsilon" : "ᵋ",
|
| 64 |
+
"\\^theta" : "ᶿ",
|
| 65 |
+
"\\^iota" : "ᶥ",
|
| 66 |
+
"\\^phi" : "ᵠ",
|
| 67 |
+
"\\^chi" : "ᵡ",
|
| 68 |
+
"\\^Phi" : "ᶲ",
|
| 69 |
+
"\\_a" : "ₐ",
|
| 70 |
+
"\\_e" : "ₑ",
|
| 71 |
+
"\\_h" : "ₕ",
|
| 72 |
+
"\\_i" : "ᵢ",
|
| 73 |
+
"\\_j" : "ⱼ",
|
| 74 |
+
"\\_k" : "ₖ",
|
| 75 |
+
"\\_l" : "ₗ",
|
| 76 |
+
"\\_m" : "ₘ",
|
| 77 |
+
"\\_n" : "ₙ",
|
| 78 |
+
"\\_o" : "ₒ",
|
| 79 |
+
"\\_p" : "ₚ",
|
| 80 |
+
"\\_r" : "ᵣ",
|
| 81 |
+
"\\_s" : "ₛ",
|
| 82 |
+
"\\_t" : "ₜ",
|
| 83 |
+
"\\_u" : "ᵤ",
|
| 84 |
+
"\\_v" : "ᵥ",
|
| 85 |
+
"\\_x" : "ₓ",
|
| 86 |
+
"\\_schwa" : "ₔ",
|
| 87 |
+
"\\_beta" : "ᵦ",
|
| 88 |
+
"\\_gamma" : "ᵧ",
|
| 89 |
+
"\\_rho" : "ᵨ",
|
| 90 |
+
"\\_phi" : "ᵩ",
|
| 91 |
+
"\\_chi" : "ᵪ",
|
| 92 |
+
"\\hbar" : "ħ",
|
| 93 |
+
"\\sout" : "̶",
|
| 94 |
+
"\\ordfeminine" : "ª",
|
| 95 |
+
"\\cdotp" : "·",
|
| 96 |
+
"\\ordmasculine" : "º",
|
| 97 |
+
"\\AA" : "Å",
|
| 98 |
+
"\\AE" : "Æ",
|
| 99 |
+
"\\DH" : "Ð",
|
| 100 |
+
"\\O" : "Ø",
|
| 101 |
+
"\\TH" : "Þ",
|
| 102 |
+
"\\ss" : "ß",
|
| 103 |
+
"\\aa" : "å",
|
| 104 |
+
"\\ae" : "æ",
|
| 105 |
+
"\\eth" : "ð",
|
| 106 |
+
"\\dh" : "ð",
|
| 107 |
+
"\\o" : "ø",
|
| 108 |
+
"\\th" : "þ",
|
| 109 |
+
"\\DJ" : "Đ",
|
| 110 |
+
"\\dj" : "đ",
|
| 111 |
+
"\\imath" : "ı",
|
| 112 |
+
"\\jmath" : "ȷ",
|
| 113 |
+
"\\L" : "Ł",
|
| 114 |
+
"\\l" : "ł",
|
| 115 |
+
"\\NG" : "Ŋ",
|
| 116 |
+
"\\ng" : "ŋ",
|
| 117 |
+
"\\OE" : "Œ",
|
| 118 |
+
"\\oe" : "œ",
|
| 119 |
+
"\\hvlig" : "ƕ",
|
| 120 |
+
"\\nrleg" : "ƞ",
|
| 121 |
+
"\\doublepipe" : "ǂ",
|
| 122 |
+
"\\trna" : "ɐ",
|
| 123 |
+
"\\trnsa" : "ɒ",
|
| 124 |
+
"\\openo" : "ɔ",
|
| 125 |
+
"\\rtld" : "ɖ",
|
| 126 |
+
"\\schwa" : "ə",
|
| 127 |
+
"\\varepsilon" : "ε",
|
| 128 |
+
"\\pgamma" : "ɣ",
|
| 129 |
+
"\\pbgam" : "ɤ",
|
| 130 |
+
"\\trnh" : "ɥ",
|
| 131 |
+
"\\btdl" : "ɬ",
|
| 132 |
+
"\\rtll" : "ɭ",
|
| 133 |
+
"\\trnm" : "ɯ",
|
| 134 |
+
"\\trnmlr" : "ɰ",
|
| 135 |
+
"\\ltlmr" : "ɱ",
|
| 136 |
+
"\\ltln" : "ɲ",
|
| 137 |
+
"\\rtln" : "ɳ",
|
| 138 |
+
"\\clomeg" : "ɷ",
|
| 139 |
+
"\\ltphi" : "ɸ",
|
| 140 |
+
"\\trnr" : "ɹ",
|
| 141 |
+
"\\trnrl" : "ɺ",
|
| 142 |
+
"\\rttrnr" : "ɻ",
|
| 143 |
+
"\\rl" : "ɼ",
|
| 144 |
+
"\\rtlr" : "ɽ",
|
| 145 |
+
"\\fhr" : "ɾ",
|
| 146 |
+
"\\rtls" : "ʂ",
|
| 147 |
+
"\\esh" : "ʃ",
|
| 148 |
+
"\\trnt" : "ʇ",
|
| 149 |
+
"\\rtlt" : "ʈ",
|
| 150 |
+
"\\pupsil" : "ʊ",
|
| 151 |
+
"\\pscrv" : "ʋ",
|
| 152 |
+
"\\invv" : "ʌ",
|
| 153 |
+
"\\invw" : "ʍ",
|
| 154 |
+
"\\trny" : "ʎ",
|
| 155 |
+
"\\rtlz" : "ʐ",
|
| 156 |
+
"\\yogh" : "ʒ",
|
| 157 |
+
"\\glst" : "ʔ",
|
| 158 |
+
"\\reglst" : "ʕ",
|
| 159 |
+
"\\inglst" : "ʖ",
|
| 160 |
+
"\\turnk" : "ʞ",
|
| 161 |
+
"\\dyogh" : "ʤ",
|
| 162 |
+
"\\tesh" : "ʧ",
|
| 163 |
+
"\\rasp" : "ʼ",
|
| 164 |
+
"\\verts" : "ˈ",
|
| 165 |
+
"\\verti" : "ˌ",
|
| 166 |
+
"\\lmrk" : "ː",
|
| 167 |
+
"\\hlmrk" : "ˑ",
|
| 168 |
+
"\\grave" : "̀",
|
| 169 |
+
"\\acute" : "́",
|
| 170 |
+
"\\hat" : "̂",
|
| 171 |
+
"\\tilde" : "̃",
|
| 172 |
+
"\\bar" : "̄",
|
| 173 |
+
"\\breve" : "̆",
|
| 174 |
+
"\\dot" : "̇",
|
| 175 |
+
"\\ddot" : "̈",
|
| 176 |
+
"\\ocirc" : "̊",
|
| 177 |
+
"\\H" : "̋",
|
| 178 |
+
"\\check" : "̌",
|
| 179 |
+
"\\palh" : "̡",
|
| 180 |
+
"\\rh" : "̢",
|
| 181 |
+
"\\c" : "̧",
|
| 182 |
+
"\\k" : "̨",
|
| 183 |
+
"\\sbbrg" : "̪",
|
| 184 |
+
"\\strike" : "̶",
|
| 185 |
+
"\\Alpha" : "Α",
|
| 186 |
+
"\\Beta" : "Β",
|
| 187 |
+
"\\Gamma" : "Γ",
|
| 188 |
+
"\\Delta" : "Δ",
|
| 189 |
+
"\\Epsilon" : "Ε",
|
| 190 |
+
"\\Zeta" : "Ζ",
|
| 191 |
+
"\\Eta" : "Η",
|
| 192 |
+
"\\Theta" : "Θ",
|
| 193 |
+
"\\Iota" : "Ι",
|
| 194 |
+
"\\Kappa" : "Κ",
|
| 195 |
+
"\\Lambda" : "Λ",
|
| 196 |
+
"\\Xi" : "Ξ",
|
| 197 |
+
"\\Pi" : "Π",
|
| 198 |
+
"\\Rho" : "Ρ",
|
| 199 |
+
"\\Sigma" : "Σ",
|
| 200 |
+
"\\Tau" : "Τ",
|
| 201 |
+
"\\Upsilon" : "Υ",
|
| 202 |
+
"\\Phi" : "Φ",
|
| 203 |
+
"\\Chi" : "Χ",
|
| 204 |
+
"\\Psi" : "Ψ",
|
| 205 |
+
"\\Omega" : "Ω",
|
| 206 |
+
"\\alpha" : "α",
|
| 207 |
+
"\\beta" : "β",
|
| 208 |
+
"\\gamma" : "γ",
|
| 209 |
+
"\\delta" : "δ",
|
| 210 |
+
"\\zeta" : "ζ",
|
| 211 |
+
"\\eta" : "η",
|
| 212 |
+
"\\theta" : "θ",
|
| 213 |
+
"\\iota" : "ι",
|
| 214 |
+
"\\kappa" : "κ",
|
| 215 |
+
"\\lambda" : "λ",
|
| 216 |
+
"\\mu" : "μ",
|
| 217 |
+
"\\nu" : "ν",
|
| 218 |
+
"\\xi" : "ξ",
|
| 219 |
+
"\\pi" : "π",
|
| 220 |
+
"\\rho" : "ρ",
|
| 221 |
+
"\\varsigma" : "ς",
|
| 222 |
+
"\\sigma" : "σ",
|
| 223 |
+
"\\tau" : "τ",
|
| 224 |
+
"\\upsilon" : "υ",
|
| 225 |
+
"\\varphi" : "φ",
|
| 226 |
+
"\\chi" : "χ",
|
| 227 |
+
"\\psi" : "ψ",
|
| 228 |
+
"\\omega" : "ω",
|
| 229 |
+
"\\vartheta" : "ϑ",
|
| 230 |
+
"\\phi" : "ϕ",
|
| 231 |
+
"\\varpi" : "ϖ",
|
| 232 |
+
"\\Stigma" : "Ϛ",
|
| 233 |
+
"\\Digamma" : "Ϝ",
|
| 234 |
+
"\\digamma" : "ϝ",
|
| 235 |
+
"\\Koppa" : "Ϟ",
|
| 236 |
+
"\\Sampi" : "Ϡ",
|
| 237 |
+
"\\varkappa" : "ϰ",
|
| 238 |
+
"\\varrho" : "ϱ",
|
| 239 |
+
"\\varTheta" : "ϴ",
|
| 240 |
+
"\\epsilon" : "ϵ",
|
| 241 |
+
"\\dddot" : "⃛",
|
| 242 |
+
"\\ddddot" : "⃜",
|
| 243 |
+
"\\hslash" : "ℏ",
|
| 244 |
+
"\\Im" : "ℑ",
|
| 245 |
+
"\\ell" : "ℓ",
|
| 246 |
+
"\\wp" : "℘",
|
| 247 |
+
"\\Re" : "ℜ",
|
| 248 |
+
"\\aleph" : "ℵ",
|
| 249 |
+
"\\beth" : "ℶ",
|
| 250 |
+
"\\gimel" : "ℷ",
|
| 251 |
+
"\\daleth" : "ℸ",
|
| 252 |
+
"\\bbPi" : "ℿ",
|
| 253 |
+
"\\Zbar" : "Ƶ",
|
| 254 |
+
"\\overbar" : "̅",
|
| 255 |
+
"\\ovhook" : "̉",
|
| 256 |
+
"\\candra" : "̐",
|
| 257 |
+
"\\oturnedcomma" : "̒",
|
| 258 |
+
"\\ocommatopright" : "̕",
|
| 259 |
+
"\\droang" : "̚",
|
| 260 |
+
"\\wideutilde" : "̰",
|
| 261 |
+
"\\not" : "̸",
|
| 262 |
+
"\\upMu" : "Μ",
|
| 263 |
+
"\\upNu" : "Ν",
|
| 264 |
+
"\\upOmicron" : "Ο",
|
| 265 |
+
"\\upepsilon" : "ε",
|
| 266 |
+
"\\upomicron" : "ο",
|
| 267 |
+
"\\upvarbeta" : "ϐ",
|
| 268 |
+
"\\upoldKoppa" : "Ϙ",
|
| 269 |
+
"\\upoldkoppa" : "ϙ",
|
| 270 |
+
"\\upstigma" : "ϛ",
|
| 271 |
+
"\\upkoppa" : "ϟ",
|
| 272 |
+
"\\upsampi" : "ϡ",
|
| 273 |
+
"\\tieconcat" : "⁀",
|
| 274 |
+
"\\leftharpoonaccent" : "⃐",
|
| 275 |
+
"\\rightharpoonaccent" : "⃑",
|
| 276 |
+
"\\vertoverlay" : "⃒",
|
| 277 |
+
"\\overleftarrow" : "⃖",
|
| 278 |
+
"\\vec" : "⃗",
|
| 279 |
+
"\\overleftrightarrow" : "⃡",
|
| 280 |
+
"\\annuity" : "⃧",
|
| 281 |
+
"\\threeunderdot" : "⃨",
|
| 282 |
+
"\\widebridgeabove" : "⃩",
|
| 283 |
+
"\\bbC" : "ℂ",
|
| 284 |
+
"\\eulermascheroni" : "ℇ",
|
| 285 |
+
"\\scrg" : "ℊ",
|
| 286 |
+
"\\scrH" : "ℋ",
|
| 287 |
+
"\\frakH" : "ℌ",
|
| 288 |
+
"\\bbH" : "ℍ",
|
| 289 |
+
"\\planck" : "ℎ",
|
| 290 |
+
"\\scrI" : "ℐ",
|
| 291 |
+
"\\scrL" : "ℒ",
|
| 292 |
+
"\\bbN" : "ℕ",
|
| 293 |
+
"\\bbP" : "ℙ",
|
| 294 |
+
"\\bbQ" : "ℚ",
|
| 295 |
+
"\\scrR" : "ℛ",
|
| 296 |
+
"\\bbR" : "ℝ",
|
| 297 |
+
"\\bbZ" : "ℤ",
|
| 298 |
+
"\\frakZ" : "ℨ",
|
| 299 |
+
"\\Angstrom" : "Å",
|
| 300 |
+
"\\scrB" : "ℬ",
|
| 301 |
+
"\\frakC" : "ℭ",
|
| 302 |
+
"\\scre" : "ℯ",
|
| 303 |
+
"\\scrE" : "ℰ",
|
| 304 |
+
"\\scrF" : "ℱ",
|
| 305 |
+
"\\Finv" : "Ⅎ",
|
| 306 |
+
"\\scrM" : "ℳ",
|
| 307 |
+
"\\scro" : "ℴ",
|
| 308 |
+
"\\bbgamma" : "ℽ",
|
| 309 |
+
"\\bbGamma" : "ℾ",
|
| 310 |
+
"\\bbiD" : "ⅅ",
|
| 311 |
+
"\\bbid" : "ⅆ",
|
| 312 |
+
"\\bbie" : "ⅇ",
|
| 313 |
+
"\\bbii" : "ⅈ",
|
| 314 |
+
"\\bbij" : "ⅉ",
|
| 315 |
+
"\\bfA" : "𝐀",
|
| 316 |
+
"\\bfB" : "𝐁",
|
| 317 |
+
"\\bfC" : "𝐂",
|
| 318 |
+
"\\bfD" : "𝐃",
|
| 319 |
+
"\\bfE" : "𝐄",
|
| 320 |
+
"\\bfF" : "𝐅",
|
| 321 |
+
"\\bfG" : "𝐆",
|
| 322 |
+
"\\bfH" : "𝐇",
|
| 323 |
+
"\\bfI" : "𝐈",
|
| 324 |
+
"\\bfJ" : "𝐉",
|
| 325 |
+
"\\bfK" : "𝐊",
|
| 326 |
+
"\\bfL" : "𝐋",
|
| 327 |
+
"\\bfM" : "𝐌",
|
| 328 |
+
"\\bfN" : "𝐍",
|
| 329 |
+
"\\bfO" : "𝐎",
|
| 330 |
+
"\\bfP" : "𝐏",
|
| 331 |
+
"\\bfQ" : "𝐐",
|
| 332 |
+
"\\bfR" : "𝐑",
|
| 333 |
+
"\\bfS" : "𝐒",
|
| 334 |
+
"\\bfT" : "𝐓",
|
| 335 |
+
"\\bfU" : "𝐔",
|
| 336 |
+
"\\bfV" : "𝐕",
|
| 337 |
+
"\\bfW" : "𝐖",
|
| 338 |
+
"\\bfX" : "𝐗",
|
| 339 |
+
"\\bfY" : "𝐘",
|
| 340 |
+
"\\bfZ" : "𝐙",
|
| 341 |
+
"\\bfa" : "𝐚",
|
| 342 |
+
"\\bfb" : "𝐛",
|
| 343 |
+
"\\bfc" : "𝐜",
|
| 344 |
+
"\\bfd" : "𝐝",
|
| 345 |
+
"\\bfe" : "𝐞",
|
| 346 |
+
"\\bff" : "𝐟",
|
| 347 |
+
"\\bfg" : "𝐠",
|
| 348 |
+
"\\bfh" : "𝐡",
|
| 349 |
+
"\\bfi" : "𝐢",
|
| 350 |
+
"\\bfj" : "𝐣",
|
| 351 |
+
"\\bfk" : "𝐤",
|
| 352 |
+
"\\bfl" : "𝐥",
|
| 353 |
+
"\\bfm" : "𝐦",
|
| 354 |
+
"\\bfn" : "𝐧",
|
| 355 |
+
"\\bfo" : "𝐨",
|
| 356 |
+
"\\bfp" : "𝐩",
|
| 357 |
+
"\\bfq" : "𝐪",
|
| 358 |
+
"\\bfr" : "𝐫",
|
| 359 |
+
"\\bfs" : "𝐬",
|
| 360 |
+
"\\bft" : "𝐭",
|
| 361 |
+
"\\bfu" : "𝐮",
|
| 362 |
+
"\\bfv" : "𝐯",
|
| 363 |
+
"\\bfw" : "𝐰",
|
| 364 |
+
"\\bfx" : "𝐱",
|
| 365 |
+
"\\bfy" : "𝐲",
|
| 366 |
+
"\\bfz" : "𝐳",
|
| 367 |
+
"\\itA" : "𝐴",
|
| 368 |
+
"\\itB" : "𝐵",
|
| 369 |
+
"\\itC" : "𝐶",
|
| 370 |
+
"\\itD" : "𝐷",
|
| 371 |
+
"\\itE" : "𝐸",
|
| 372 |
+
"\\itF" : "𝐹",
|
| 373 |
+
"\\itG" : "𝐺",
|
| 374 |
+
"\\itH" : "𝐻",
|
| 375 |
+
"\\itI" : "𝐼",
|
| 376 |
+
"\\itJ" : "𝐽",
|
| 377 |
+
"\\itK" : "𝐾",
|
| 378 |
+
"\\itL" : "𝐿",
|
| 379 |
+
"\\itM" : "𝑀",
|
| 380 |
+
"\\itN" : "𝑁",
|
| 381 |
+
"\\itO" : "𝑂",
|
| 382 |
+
"\\itP" : "𝑃",
|
| 383 |
+
"\\itQ" : "𝑄",
|
| 384 |
+
"\\itR" : "𝑅",
|
| 385 |
+
"\\itS" : "𝑆",
|
| 386 |
+
"\\itT" : "𝑇",
|
| 387 |
+
"\\itU" : "𝑈",
|
| 388 |
+
"\\itV" : "𝑉",
|
| 389 |
+
"\\itW" : "𝑊",
|
| 390 |
+
"\\itX" : "𝑋",
|
| 391 |
+
"\\itY" : "𝑌",
|
| 392 |
+
"\\itZ" : "𝑍",
|
| 393 |
+
"\\ita" : "𝑎",
|
| 394 |
+
"\\itb" : "𝑏",
|
| 395 |
+
"\\itc" : "𝑐",
|
| 396 |
+
"\\itd" : "𝑑",
|
| 397 |
+
"\\ite" : "𝑒",
|
| 398 |
+
"\\itf" : "𝑓",
|
| 399 |
+
"\\itg" : "𝑔",
|
| 400 |
+
"\\iti" : "𝑖",
|
| 401 |
+
"\\itj" : "𝑗",
|
| 402 |
+
"\\itk" : "𝑘",
|
| 403 |
+
"\\itl" : "𝑙",
|
| 404 |
+
"\\itm" : "𝑚",
|
| 405 |
+
"\\itn" : "𝑛",
|
| 406 |
+
"\\ito" : "𝑜",
|
| 407 |
+
"\\itp" : "𝑝",
|
| 408 |
+
"\\itq" : "𝑞",
|
| 409 |
+
"\\itr" : "𝑟",
|
| 410 |
+
"\\its" : "𝑠",
|
| 411 |
+
"\\itt" : "𝑡",
|
| 412 |
+
"\\itu" : "𝑢",
|
| 413 |
+
"\\itv" : "𝑣",
|
| 414 |
+
"\\itw" : "𝑤",
|
| 415 |
+
"\\itx" : "𝑥",
|
| 416 |
+
"\\ity" : "𝑦",
|
| 417 |
+
"\\itz" : "𝑧",
|
| 418 |
+
"\\biA" : "𝑨",
|
| 419 |
+
"\\biB" : "𝑩",
|
| 420 |
+
"\\biC" : "𝑪",
|
| 421 |
+
"\\biD" : "𝑫",
|
| 422 |
+
"\\biE" : "𝑬",
|
| 423 |
+
"\\biF" : "𝑭",
|
| 424 |
+
"\\biG" : "𝑮",
|
| 425 |
+
"\\biH" : "𝑯",
|
| 426 |
+
"\\biI" : "𝑰",
|
| 427 |
+
"\\biJ" : "𝑱",
|
| 428 |
+
"\\biK" : "𝑲",
|
| 429 |
+
"\\biL" : "𝑳",
|
| 430 |
+
"\\biM" : "𝑴",
|
| 431 |
+
"\\biN" : "𝑵",
|
| 432 |
+
"\\biO" : "𝑶",
|
| 433 |
+
"\\biP" : "𝑷",
|
| 434 |
+
"\\biQ" : "𝑸",
|
| 435 |
+
"\\biR" : "𝑹",
|
| 436 |
+
"\\biS" : "𝑺",
|
| 437 |
+
"\\biT" : "𝑻",
|
| 438 |
+
"\\biU" : "𝑼",
|
| 439 |
+
"\\biV" : "𝑽",
|
| 440 |
+
"\\biW" : "𝑾",
|
| 441 |
+
"\\biX" : "𝑿",
|
| 442 |
+
"\\biY" : "𝒀",
|
| 443 |
+
"\\biZ" : "𝒁",
|
| 444 |
+
"\\bia" : "𝒂",
|
| 445 |
+
"\\bib" : "𝒃",
|
| 446 |
+
"\\bic" : "𝒄",
|
| 447 |
+
"\\bid" : "𝒅",
|
| 448 |
+
"\\bie" : "𝒆",
|
| 449 |
+
"\\bif" : "𝒇",
|
| 450 |
+
"\\big" : "𝒈",
|
| 451 |
+
"\\bih" : "𝒉",
|
| 452 |
+
"\\bii" : "𝒊",
|
| 453 |
+
"\\bij" : "𝒋",
|
| 454 |
+
"\\bik" : "𝒌",
|
| 455 |
+
"\\bil" : "𝒍",
|
| 456 |
+
"\\bim" : "𝒎",
|
| 457 |
+
"\\bin" : "𝒏",
|
| 458 |
+
"\\bio" : "𝒐",
|
| 459 |
+
"\\bip" : "𝒑",
|
| 460 |
+
"\\biq" : "𝒒",
|
| 461 |
+
"\\bir" : "𝒓",
|
| 462 |
+
"\\bis" : "𝒔",
|
| 463 |
+
"\\bit" : "𝒕",
|
| 464 |
+
"\\biu" : "𝒖",
|
| 465 |
+
"\\biv" : "𝒗",
|
| 466 |
+
"\\biw" : "𝒘",
|
| 467 |
+
"\\bix" : "𝒙",
|
| 468 |
+
"\\biy" : "𝒚",
|
| 469 |
+
"\\biz" : "𝒛",
|
| 470 |
+
"\\scrA" : "𝒜",
|
| 471 |
+
"\\scrC" : "𝒞",
|
| 472 |
+
"\\scrD" : "𝒟",
|
| 473 |
+
"\\scrG" : "𝒢",
|
| 474 |
+
"\\scrJ" : "𝒥",
|
| 475 |
+
"\\scrK" : "𝒦",
|
| 476 |
+
"\\scrN" : "𝒩",
|
| 477 |
+
"\\scrO" : "𝒪",
|
| 478 |
+
"\\scrP" : "𝒫",
|
| 479 |
+
"\\scrQ" : "𝒬",
|
| 480 |
+
"\\scrS" : "𝒮",
|
| 481 |
+
"\\scrT" : "𝒯",
|
| 482 |
+
"\\scrU" : "𝒰",
|
| 483 |
+
"\\scrV" : "𝒱",
|
| 484 |
+
"\\scrW" : "𝒲",
|
| 485 |
+
"\\scrX" : "𝒳",
|
| 486 |
+
"\\scrY" : "𝒴",
|
| 487 |
+
"\\scrZ" : "𝒵",
|
| 488 |
+
"\\scra" : "𝒶",
|
| 489 |
+
"\\scrb" : "𝒷",
|
| 490 |
+
"\\scrc" : "𝒸",
|
| 491 |
+
"\\scrd" : "𝒹",
|
| 492 |
+
"\\scrf" : "𝒻",
|
| 493 |
+
"\\scrh" : "𝒽",
|
| 494 |
+
"\\scri" : "𝒾",
|
| 495 |
+
"\\scrj" : "𝒿",
|
| 496 |
+
"\\scrk" : "𝓀",
|
| 497 |
+
"\\scrm" : "𝓂",
|
| 498 |
+
"\\scrn" : "𝓃",
|
| 499 |
+
"\\scrp" : "𝓅",
|
| 500 |
+
"\\scrq" : "𝓆",
|
| 501 |
+
"\\scrr" : "𝓇",
|
| 502 |
+
"\\scrs" : "𝓈",
|
| 503 |
+
"\\scrt" : "𝓉",
|
| 504 |
+
"\\scru" : "𝓊",
|
| 505 |
+
"\\scrv" : "𝓋",
|
| 506 |
+
"\\scrw" : "𝓌",
|
| 507 |
+
"\\scrx" : "𝓍",
|
| 508 |
+
"\\scry" : "𝓎",
|
| 509 |
+
"\\scrz" : "𝓏",
|
| 510 |
+
"\\bscrA" : "𝓐",
|
| 511 |
+
"\\bscrB" : "𝓑",
|
| 512 |
+
"\\bscrC" : "𝓒",
|
| 513 |
+
"\\bscrD" : "𝓓",
|
| 514 |
+
"\\bscrE" : "𝓔",
|
| 515 |
+
"\\bscrF" : "𝓕",
|
| 516 |
+
"\\bscrG" : "𝓖",
|
| 517 |
+
"\\bscrH" : "𝓗",
|
| 518 |
+
"\\bscrI" : "𝓘",
|
| 519 |
+
"\\bscrJ" : "𝓙",
|
| 520 |
+
"\\bscrK" : "𝓚",
|
| 521 |
+
"\\bscrL" : "𝓛",
|
| 522 |
+
"\\bscrM" : "𝓜",
|
| 523 |
+
"\\bscrN" : "𝓝",
|
| 524 |
+
"\\bscrO" : "𝓞",
|
| 525 |
+
"\\bscrP" : "𝓟",
|
| 526 |
+
"\\bscrQ" : "𝓠",
|
| 527 |
+
"\\bscrR" : "𝓡",
|
| 528 |
+
"\\bscrS" : "𝓢",
|
| 529 |
+
"\\bscrT" : "𝓣",
|
| 530 |
+
"\\bscrU" : "𝓤",
|
| 531 |
+
"\\bscrV" : "𝓥",
|
| 532 |
+
"\\bscrW" : "𝓦",
|
| 533 |
+
"\\bscrX" : "𝓧",
|
| 534 |
+
"\\bscrY" : "𝓨",
|
| 535 |
+
"\\bscrZ" : "𝓩",
|
| 536 |
+
"\\bscra" : "𝓪",
|
| 537 |
+
"\\bscrb" : "𝓫",
|
| 538 |
+
"\\bscrc" : "𝓬",
|
| 539 |
+
"\\bscrd" : "𝓭",
|
| 540 |
+
"\\bscre" : "𝓮",
|
| 541 |
+
"\\bscrf" : "𝓯",
|
| 542 |
+
"\\bscrg" : "𝓰",
|
| 543 |
+
"\\bscrh" : "𝓱",
|
| 544 |
+
"\\bscri" : "𝓲",
|
| 545 |
+
"\\bscrj" : "𝓳",
|
| 546 |
+
"\\bscrk" : "𝓴",
|
| 547 |
+
"\\bscrl" : "𝓵",
|
| 548 |
+
"\\bscrm" : "𝓶",
|
| 549 |
+
"\\bscrn" : "𝓷",
|
| 550 |
+
"\\bscro" : "𝓸",
|
| 551 |
+
"\\bscrp" : "𝓹",
|
| 552 |
+
"\\bscrq" : "𝓺",
|
| 553 |
+
"\\bscrr" : "𝓻",
|
| 554 |
+
"\\bscrs" : "𝓼",
|
| 555 |
+
"\\bscrt" : "𝓽",
|
| 556 |
+
"\\bscru" : "𝓾",
|
| 557 |
+
"\\bscrv" : "𝓿",
|
| 558 |
+
"\\bscrw" : "𝔀",
|
| 559 |
+
"\\bscrx" : "𝔁",
|
| 560 |
+
"\\bscry" : "𝔂",
|
| 561 |
+
"\\bscrz" : "𝔃",
|
| 562 |
+
"\\frakA" : "𝔄",
|
| 563 |
+
"\\frakB" : "𝔅",
|
| 564 |
+
"\\frakD" : "𝔇",
|
| 565 |
+
"\\frakE" : "𝔈",
|
| 566 |
+
"\\frakF" : "𝔉",
|
| 567 |
+
"\\frakG" : "𝔊",
|
| 568 |
+
"\\frakJ" : "𝔍",
|
| 569 |
+
"\\frakK" : "𝔎",
|
| 570 |
+
"\\frakL" : "𝔏",
|
| 571 |
+
"\\frakM" : "𝔐",
|
| 572 |
+
"\\frakN" : "𝔑",
|
| 573 |
+
"\\frakO" : "𝔒",
|
| 574 |
+
"\\frakP" : "𝔓",
|
| 575 |
+
"\\frakQ" : "𝔔",
|
| 576 |
+
"\\frakS" : "𝔖",
|
| 577 |
+
"\\frakT" : "𝔗",
|
| 578 |
+
"\\frakU" : "𝔘",
|
| 579 |
+
"\\frakV" : "𝔙",
|
| 580 |
+
"\\frakW" : "𝔚",
|
| 581 |
+
"\\frakX" : "𝔛",
|
| 582 |
+
"\\frakY" : "𝔜",
|
| 583 |
+
"\\fraka" : "𝔞",
|
| 584 |
+
"\\frakb" : "𝔟",
|
| 585 |
+
"\\frakc" : "𝔠",
|
| 586 |
+
"\\frakd" : "𝔡",
|
| 587 |
+
"\\frake" : "𝔢",
|
| 588 |
+
"\\frakf" : "𝔣",
|
| 589 |
+
"\\frakg" : "𝔤",
|
| 590 |
+
"\\frakh" : "𝔥",
|
| 591 |
+
"\\fraki" : "𝔦",
|
| 592 |
+
"\\frakj" : "𝔧",
|
| 593 |
+
"\\frakk" : "𝔨",
|
| 594 |
+
"\\frakl" : "𝔩",
|
| 595 |
+
"\\frakm" : "𝔪",
|
| 596 |
+
"\\frakn" : "𝔫",
|
| 597 |
+
"\\frako" : "𝔬",
|
| 598 |
+
"\\frakp" : "𝔭",
|
| 599 |
+
"\\frakq" : "𝔮",
|
| 600 |
+
"\\frakr" : "𝔯",
|
| 601 |
+
"\\fraks" : "𝔰",
|
| 602 |
+
"\\frakt" : "𝔱",
|
| 603 |
+
"\\fraku" : "𝔲",
|
| 604 |
+
"\\frakv" : "𝔳",
|
| 605 |
+
"\\frakw" : "𝔴",
|
| 606 |
+
"\\frakx" : "𝔵",
|
| 607 |
+
"\\fraky" : "𝔶",
|
| 608 |
+
"\\frakz" : "𝔷",
|
| 609 |
+
"\\bbA" : "𝔸",
|
| 610 |
+
"\\bbB" : "𝔹",
|
| 611 |
+
"\\bbD" : "𝔻",
|
| 612 |
+
"\\bbE" : "𝔼",
|
| 613 |
+
"\\bbF" : "𝔽",
|
| 614 |
+
"\\bbG" : "𝔾",
|
| 615 |
+
"\\bbI" : "𝕀",
|
| 616 |
+
"\\bbJ" : "𝕁",
|
| 617 |
+
"\\bbK" : "𝕂",
|
| 618 |
+
"\\bbL" : "𝕃",
|
| 619 |
+
"\\bbM" : "𝕄",
|
| 620 |
+
"\\bbO" : "𝕆",
|
| 621 |
+
"\\bbS" : "𝕊",
|
| 622 |
+
"\\bbT" : "𝕋",
|
| 623 |
+
"\\bbU" : "𝕌",
|
| 624 |
+
"\\bbV" : "𝕍",
|
| 625 |
+
"\\bbW" : "𝕎",
|
| 626 |
+
"\\bbX" : "𝕏",
|
| 627 |
+
"\\bbY" : "𝕐",
|
| 628 |
+
"\\bba" : "𝕒",
|
| 629 |
+
"\\bbb" : "𝕓",
|
| 630 |
+
"\\bbc" : "𝕔",
|
| 631 |
+
"\\bbd" : "𝕕",
|
| 632 |
+
"\\bbe" : "𝕖",
|
| 633 |
+
"\\bbf" : "𝕗",
|
| 634 |
+
"\\bbg" : "𝕘",
|
| 635 |
+
"\\bbh" : "𝕙",
|
| 636 |
+
"\\bbi" : "𝕚",
|
| 637 |
+
"\\bbj" : "𝕛",
|
| 638 |
+
"\\bbk" : "𝕜",
|
| 639 |
+
"\\bbl" : "𝕝",
|
| 640 |
+
"\\bbm" : "𝕞",
|
| 641 |
+
"\\bbn" : "𝕟",
|
| 642 |
+
"\\bbo" : "𝕠",
|
| 643 |
+
"\\bbp" : "𝕡",
|
| 644 |
+
"\\bbq" : "𝕢",
|
| 645 |
+
"\\bbr" : "𝕣",
|
| 646 |
+
"\\bbs" : "𝕤",
|
| 647 |
+
"\\bbt" : "𝕥",
|
| 648 |
+
"\\bbu" : "𝕦",
|
| 649 |
+
"\\bbv" : "𝕧",
|
| 650 |
+
"\\bbw" : "𝕨",
|
| 651 |
+
"\\bbx" : "𝕩",
|
| 652 |
+
"\\bby" : "𝕪",
|
| 653 |
+
"\\bbz" : "𝕫",
|
| 654 |
+
"\\bfrakA" : "𝕬",
|
| 655 |
+
"\\bfrakB" : "𝕭",
|
| 656 |
+
"\\bfrakC" : "𝕮",
|
| 657 |
+
"\\bfrakD" : "𝕯",
|
| 658 |
+
"\\bfrakE" : "𝕰",
|
| 659 |
+
"\\bfrakF" : "𝕱",
|
| 660 |
+
"\\bfrakG" : "𝕲",
|
| 661 |
+
"\\bfrakH" : "𝕳",
|
| 662 |
+
"\\bfrakI" : "𝕴",
|
| 663 |
+
"\\bfrakJ" : "𝕵",
|
| 664 |
+
"\\bfrakK" : "𝕶",
|
| 665 |
+
"\\bfrakL" : "𝕷",
|
| 666 |
+
"\\bfrakM" : "𝕸",
|
| 667 |
+
"\\bfrakN" : "𝕹",
|
| 668 |
+
"\\bfrakO" : "𝕺",
|
| 669 |
+
"\\bfrakP" : "𝕻",
|
| 670 |
+
"\\bfrakQ" : "𝕼",
|
| 671 |
+
"\\bfrakR" : "𝕽",
|
| 672 |
+
"\\bfrakS" : "𝕾",
|
| 673 |
+
"\\bfrakT" : "𝕿",
|
| 674 |
+
"\\bfrakU" : "𝖀",
|
| 675 |
+
"\\bfrakV" : "𝖁",
|
| 676 |
+
"\\bfrakW" : "𝖂",
|
| 677 |
+
"\\bfrakX" : "𝖃",
|
| 678 |
+
"\\bfrakY" : "𝖄",
|
| 679 |
+
"\\bfrakZ" : "𝖅",
|
| 680 |
+
"\\bfraka" : "𝖆",
|
| 681 |
+
"\\bfrakb" : "𝖇",
|
| 682 |
+
"\\bfrakc" : "𝖈",
|
| 683 |
+
"\\bfrakd" : "𝖉",
|
| 684 |
+
"\\bfrake" : "𝖊",
|
| 685 |
+
"\\bfrakf" : "𝖋",
|
| 686 |
+
"\\bfrakg" : "𝖌",
|
| 687 |
+
"\\bfrakh" : "𝖍",
|
| 688 |
+
"\\bfraki" : "𝖎",
|
| 689 |
+
"\\bfrakj" : "𝖏",
|
| 690 |
+
"\\bfrakk" : "𝖐",
|
| 691 |
+
"\\bfrakl" : "𝖑",
|
| 692 |
+
"\\bfrakm" : "𝖒",
|
| 693 |
+
"\\bfrakn" : "𝖓",
|
| 694 |
+
"\\bfrako" : "𝖔",
|
| 695 |
+
"\\bfrakp" : "𝖕",
|
| 696 |
+
"\\bfrakq" : "𝖖",
|
| 697 |
+
"\\bfrakr" : "𝖗",
|
| 698 |
+
"\\bfraks" : "𝖘",
|
| 699 |
+
"\\bfrakt" : "𝖙",
|
| 700 |
+
"\\bfraku" : "𝖚",
|
| 701 |
+
"\\bfrakv" : "𝖛",
|
| 702 |
+
"\\bfrakw" : "𝖜",
|
| 703 |
+
"\\bfrakx" : "𝖝",
|
| 704 |
+
"\\bfraky" : "𝖞",
|
| 705 |
+
"\\bfrakz" : "𝖟",
|
| 706 |
+
"\\sansA" : "𝖠",
|
| 707 |
+
"\\sansB" : "𝖡",
|
| 708 |
+
"\\sansC" : "𝖢",
|
| 709 |
+
"\\sansD" : "𝖣",
|
| 710 |
+
"\\sansE" : "𝖤",
|
| 711 |
+
"\\sansF" : "𝖥",
|
| 712 |
+
"\\sansG" : "𝖦",
|
| 713 |
+
"\\sansH" : "𝖧",
|
| 714 |
+
"\\sansI" : "𝖨",
|
| 715 |
+
"\\sansJ" : "𝖩",
|
| 716 |
+
"\\sansK" : "𝖪",
|
| 717 |
+
"\\sansL" : "𝖫",
|
| 718 |
+
"\\sansM" : "𝖬",
|
| 719 |
+
"\\sansN" : "𝖭",
|
| 720 |
+
"\\sansO" : "𝖮",
|
| 721 |
+
"\\sansP" : "𝖯",
|
| 722 |
+
"\\sansQ" : "𝖰",
|
| 723 |
+
"\\sansR" : "𝖱",
|
| 724 |
+
"\\sansS" : "𝖲",
|
| 725 |
+
"\\sansT" : "𝖳",
|
| 726 |
+
"\\sansU" : "𝖴",
|
| 727 |
+
"\\sansV" : "𝖵",
|
| 728 |
+
"\\sansW" : "𝖶",
|
| 729 |
+
"\\sansX" : "𝖷",
|
| 730 |
+
"\\sansY" : "𝖸",
|
| 731 |
+
"\\sansZ" : "𝖹",
|
| 732 |
+
"\\sansa" : "𝖺",
|
| 733 |
+
"\\sansb" : "𝖻",
|
| 734 |
+
"\\sansc" : "𝖼",
|
| 735 |
+
"\\sansd" : "𝖽",
|
| 736 |
+
"\\sanse" : "𝖾",
|
| 737 |
+
"\\sansf" : "𝖿",
|
| 738 |
+
"\\sansg" : "𝗀",
|
| 739 |
+
"\\sansh" : "𝗁",
|
| 740 |
+
"\\sansi" : "𝗂",
|
| 741 |
+
"\\sansj" : "𝗃",
|
| 742 |
+
"\\sansk" : "𝗄",
|
| 743 |
+
"\\sansl" : "𝗅",
|
| 744 |
+
"\\sansm" : "𝗆",
|
| 745 |
+
"\\sansn" : "𝗇",
|
| 746 |
+
"\\sanso" : "𝗈",
|
| 747 |
+
"\\sansp" : "𝗉",
|
| 748 |
+
"\\sansq" : "𝗊",
|
| 749 |
+
"\\sansr" : "𝗋",
|
| 750 |
+
"\\sanss" : "𝗌",
|
| 751 |
+
"\\sanst" : "𝗍",
|
| 752 |
+
"\\sansu" : "𝗎",
|
| 753 |
+
"\\sansv" : "𝗏",
|
| 754 |
+
"\\sansw" : "𝗐",
|
| 755 |
+
"\\sansx" : "𝗑",
|
| 756 |
+
"\\sansy" : "𝗒",
|
| 757 |
+
"\\sansz" : "𝗓",
|
| 758 |
+
"\\bsansA" : "𝗔",
|
| 759 |
+
"\\bsansB" : "𝗕",
|
| 760 |
+
"\\bsansC" : "𝗖",
|
| 761 |
+
"\\bsansD" : "𝗗",
|
| 762 |
+
"\\bsansE" : "𝗘",
|
| 763 |
+
"\\bsansF" : "𝗙",
|
| 764 |
+
"\\bsansG" : "𝗚",
|
| 765 |
+
"\\bsansH" : "𝗛",
|
| 766 |
+
"\\bsansI" : "𝗜",
|
| 767 |
+
"\\bsansJ" : "𝗝",
|
| 768 |
+
"\\bsansK" : "𝗞",
|
| 769 |
+
"\\bsansL" : "𝗟",
|
| 770 |
+
"\\bsansM" : "𝗠",
|
| 771 |
+
"\\bsansN" : "𝗡",
|
| 772 |
+
"\\bsansO" : "𝗢",
|
| 773 |
+
"\\bsansP" : "𝗣",
|
| 774 |
+
"\\bsansQ" : "𝗤",
|
| 775 |
+
"\\bsansR" : "𝗥",
|
| 776 |
+
"\\bsansS" : "𝗦",
|
| 777 |
+
"\\bsansT" : "𝗧",
|
| 778 |
+
"\\bsansU" : "𝗨",
|
| 779 |
+
"\\bsansV" : "𝗩",
|
| 780 |
+
"\\bsansW" : "𝗪",
|
| 781 |
+
"\\bsansX" : "𝗫",
|
| 782 |
+
"\\bsansY" : "𝗬",
|
| 783 |
+
"\\bsansZ" : "𝗭",
|
| 784 |
+
"\\bsansa" : "𝗮",
|
| 785 |
+
"\\bsansb" : "𝗯",
|
| 786 |
+
"\\bsansc" : "𝗰",
|
| 787 |
+
"\\bsansd" : "𝗱",
|
| 788 |
+
"\\bsanse" : "𝗲",
|
| 789 |
+
"\\bsansf" : "𝗳",
|
| 790 |
+
"\\bsansg" : "𝗴",
|
| 791 |
+
"\\bsansh" : "𝗵",
|
| 792 |
+
"\\bsansi" : "𝗶",
|
| 793 |
+
"\\bsansj" : "𝗷",
|
| 794 |
+
"\\bsansk" : "𝗸",
|
| 795 |
+
"\\bsansl" : "𝗹",
|
| 796 |
+
"\\bsansm" : "𝗺",
|
| 797 |
+
"\\bsansn" : "𝗻",
|
| 798 |
+
"\\bsanso" : "𝗼",
|
| 799 |
+
"\\bsansp" : "𝗽",
|
| 800 |
+
"\\bsansq" : "𝗾",
|
| 801 |
+
"\\bsansr" : "𝗿",
|
| 802 |
+
"\\bsanss" : "𝘀",
|
| 803 |
+
"\\bsanst" : "𝘁",
|
| 804 |
+
"\\bsansu" : "𝘂",
|
| 805 |
+
"\\bsansv" : "𝘃",
|
| 806 |
+
"\\bsansw" : "𝘄",
|
| 807 |
+
"\\bsansx" : "𝘅",
|
| 808 |
+
"\\bsansy" : "𝘆",
|
| 809 |
+
"\\bsansz" : "𝘇",
|
| 810 |
+
"\\isansA" : "𝘈",
|
| 811 |
+
"\\isansB" : "𝘉",
|
| 812 |
+
"\\isansC" : "𝘊",
|
| 813 |
+
"\\isansD" : "𝘋",
|
| 814 |
+
"\\isansE" : "𝘌",
|
| 815 |
+
"\\isansF" : "𝘍",
|
| 816 |
+
"\\isansG" : "𝘎",
|
| 817 |
+
"\\isansH" : "𝘏",
|
| 818 |
+
"\\isansI" : "𝘐",
|
| 819 |
+
"\\isansJ" : "𝘑",
|
| 820 |
+
"\\isansK" : "𝘒",
|
| 821 |
+
"\\isansL" : "𝘓",
|
| 822 |
+
"\\isansM" : "𝘔",
|
| 823 |
+
"\\isansN" : "𝘕",
|
| 824 |
+
"\\isansO" : "𝘖",
|
| 825 |
+
"\\isansP" : "𝘗",
|
| 826 |
+
"\\isansQ" : "𝘘",
|
| 827 |
+
"\\isansR" : "𝘙",
|
| 828 |
+
"\\isansS" : "𝘚",
|
| 829 |
+
"\\isansT" : "𝘛",
|
| 830 |
+
"\\isansU" : "𝘜",
|
| 831 |
+
"\\isansV" : "𝘝",
|
| 832 |
+
"\\isansW" : "𝘞",
|
| 833 |
+
"\\isansX" : "𝘟",
|
| 834 |
+
"\\isansY" : "𝘠",
|
| 835 |
+
"\\isansZ" : "𝘡",
|
| 836 |
+
"\\isansa" : "𝘢",
|
| 837 |
+
"\\isansb" : "𝘣",
|
| 838 |
+
"\\isansc" : "𝘤",
|
| 839 |
+
"\\isansd" : "𝘥",
|
| 840 |
+
"\\isanse" : "𝘦",
|
| 841 |
+
"\\isansf" : "𝘧",
|
| 842 |
+
"\\isansg" : "𝘨",
|
| 843 |
+
"\\isansh" : "𝘩",
|
| 844 |
+
"\\isansi" : "𝘪",
|
| 845 |
+
"\\isansj" : "𝘫",
|
| 846 |
+
"\\isansk" : "𝘬",
|
| 847 |
+
"\\isansl" : "𝘭",
|
| 848 |
+
"\\isansm" : "𝘮",
|
| 849 |
+
"\\isansn" : "𝘯",
|
| 850 |
+
"\\isanso" : "𝘰",
|
| 851 |
+
"\\isansp" : "𝘱",
|
| 852 |
+
"\\isansq" : "𝘲",
|
| 853 |
+
"\\isansr" : "𝘳",
|
| 854 |
+
"\\isanss" : "𝘴",
|
| 855 |
+
"\\isanst" : "𝘵",
|
| 856 |
+
"\\isansu" : "𝘶",
|
| 857 |
+
"\\isansv" : "𝘷",
|
| 858 |
+
"\\isansw" : "𝘸",
|
| 859 |
+
"\\isansx" : "𝘹",
|
| 860 |
+
"\\isansy" : "𝘺",
|
| 861 |
+
"\\isansz" : "𝘻",
|
| 862 |
+
"\\bisansA" : "𝘼",
|
| 863 |
+
"\\bisansB" : "𝘽",
|
| 864 |
+
"\\bisansC" : "𝘾",
|
| 865 |
+
"\\bisansD" : "𝘿",
|
| 866 |
+
"\\bisansE" : "𝙀",
|
| 867 |
+
"\\bisansF" : "𝙁",
|
| 868 |
+
"\\bisansG" : "𝙂",
|
| 869 |
+
"\\bisansH" : "𝙃",
|
| 870 |
+
"\\bisansI" : "𝙄",
|
| 871 |
+
"\\bisansJ" : "𝙅",
|
| 872 |
+
"\\bisansK" : "𝙆",
|
| 873 |
+
"\\bisansL" : "𝙇",
|
| 874 |
+
"\\bisansM" : "𝙈",
|
| 875 |
+
"\\bisansN" : "𝙉",
|
| 876 |
+
"\\bisansO" : "𝙊",
|
| 877 |
+
"\\bisansP" : "𝙋",
|
| 878 |
+
"\\bisansQ" : "𝙌",
|
| 879 |
+
"\\bisansR" : "𝙍",
|
| 880 |
+
"\\bisansS" : "𝙎",
|
| 881 |
+
"\\bisansT" : "𝙏",
|
| 882 |
+
"\\bisansU" : "𝙐",
|
| 883 |
+
"\\bisansV" : "𝙑",
|
| 884 |
+
"\\bisansW" : "𝙒",
|
| 885 |
+
"\\bisansX" : "𝙓",
|
| 886 |
+
"\\bisansY" : "𝙔",
|
| 887 |
+
"\\bisansZ" : "𝙕",
|
| 888 |
+
"\\bisansa" : "𝙖",
|
| 889 |
+
"\\bisansb" : "𝙗",
|
| 890 |
+
"\\bisansc" : "𝙘",
|
| 891 |
+
"\\bisansd" : "𝙙",
|
| 892 |
+
"\\bisanse" : "𝙚",
|
| 893 |
+
"\\bisansf" : "𝙛",
|
| 894 |
+
"\\bisansg" : "𝙜",
|
| 895 |
+
"\\bisansh" : "𝙝",
|
| 896 |
+
"\\bisansi" : "𝙞",
|
| 897 |
+
"\\bisansj" : "𝙟",
|
| 898 |
+
"\\bisansk" : "𝙠",
|
| 899 |
+
"\\bisansl" : "𝙡",
|
| 900 |
+
"\\bisansm" : "𝙢",
|
| 901 |
+
"\\bisansn" : "𝙣",
|
| 902 |
+
"\\bisanso" : "𝙤",
|
| 903 |
+
"\\bisansp" : "𝙥",
|
| 904 |
+
"\\bisansq" : "𝙦",
|
| 905 |
+
"\\bisansr" : "𝙧",
|
| 906 |
+
"\\bisanss" : "𝙨",
|
| 907 |
+
"\\bisanst" : "𝙩",
|
| 908 |
+
"\\bisansu" : "𝙪",
|
| 909 |
+
"\\bisansv" : "𝙫",
|
| 910 |
+
"\\bisansw" : "𝙬",
|
| 911 |
+
"\\bisansx" : "𝙭",
|
| 912 |
+
"\\bisansy" : "𝙮",
|
| 913 |
+
"\\bisansz" : "𝙯",
|
| 914 |
+
"\\ttA" : "𝙰",
|
| 915 |
+
"\\ttB" : "𝙱",
|
| 916 |
+
"\\ttC" : "𝙲",
|
| 917 |
+
"\\ttD" : "𝙳",
|
| 918 |
+
"\\ttE" : "𝙴",
|
| 919 |
+
"\\ttF" : "𝙵",
|
| 920 |
+
"\\ttG" : "𝙶",
|
| 921 |
+
"\\ttH" : "𝙷",
|
| 922 |
+
"\\ttI" : "𝙸",
|
| 923 |
+
"\\ttJ" : "𝙹",
|
| 924 |
+
"\\ttK" : "𝙺",
|
| 925 |
+
"\\ttL" : "𝙻",
|
| 926 |
+
"\\ttM" : "𝙼",
|
| 927 |
+
"\\ttN" : "𝙽",
|
| 928 |
+
"\\ttO" : "𝙾",
|
| 929 |
+
"\\ttP" : "𝙿",
|
| 930 |
+
"\\ttQ" : "𝚀",
|
| 931 |
+
"\\ttR" : "𝚁",
|
| 932 |
+
"\\ttS" : "𝚂",
|
| 933 |
+
"\\ttT" : "𝚃",
|
| 934 |
+
"\\ttU" : "𝚄",
|
| 935 |
+
"\\ttV" : "𝚅",
|
| 936 |
+
"\\ttW" : "𝚆",
|
| 937 |
+
"\\ttX" : "𝚇",
|
| 938 |
+
"\\ttY" : "𝚈",
|
| 939 |
+
"\\ttZ" : "𝚉",
|
| 940 |
+
"\\tta" : "𝚊",
|
| 941 |
+
"\\ttb" : "𝚋",
|
| 942 |
+
"\\ttc" : "𝚌",
|
| 943 |
+
"\\ttd" : "𝚍",
|
| 944 |
+
"\\tte" : "𝚎",
|
| 945 |
+
"\\ttf" : "𝚏",
|
| 946 |
+
"\\ttg" : "𝚐",
|
| 947 |
+
"\\tth" : "𝚑",
|
| 948 |
+
"\\tti" : "𝚒",
|
| 949 |
+
"\\ttj" : "𝚓",
|
| 950 |
+
"\\ttk" : "𝚔",
|
| 951 |
+
"\\ttl" : "𝚕",
|
| 952 |
+
"\\ttm" : "𝚖",
|
| 953 |
+
"\\ttn" : "𝚗",
|
| 954 |
+
"\\tto" : "𝚘",
|
| 955 |
+
"\\ttp" : "𝚙",
|
| 956 |
+
"\\ttq" : "𝚚",
|
| 957 |
+
"\\ttr" : "𝚛",
|
| 958 |
+
"\\tts" : "𝚜",
|
| 959 |
+
"\\ttt" : "𝚝",
|
| 960 |
+
"\\ttu" : "𝚞",
|
| 961 |
+
"\\ttv" : "𝚟",
|
| 962 |
+
"\\ttw" : "𝚠",
|
| 963 |
+
"\\ttx" : "𝚡",
|
| 964 |
+
"\\tty" : "𝚢",
|
| 965 |
+
"\\ttz" : "𝚣",
|
| 966 |
+
"\\bfAlpha" : "𝚨",
|
| 967 |
+
"\\bfBeta" : "𝚩",
|
| 968 |
+
"\\bfGamma" : "𝚪",
|
| 969 |
+
"\\bfDelta" : "𝚫",
|
| 970 |
+
"\\bfEpsilon" : "𝚬",
|
| 971 |
+
"\\bfZeta" : "𝚭",
|
| 972 |
+
"\\bfEta" : "𝚮",
|
| 973 |
+
"\\bfTheta" : "𝚯",
|
| 974 |
+
"\\bfIota" : "𝚰",
|
| 975 |
+
"\\bfKappa" : "𝚱",
|
| 976 |
+
"\\bfLambda" : "𝚲",
|
| 977 |
+
"\\bfMu" : "𝚳",
|
| 978 |
+
"\\bfNu" : "𝚴",
|
| 979 |
+
"\\bfXi" : "𝚵",
|
| 980 |
+
"\\bfOmicron" : "𝚶",
|
| 981 |
+
"\\bfPi" : "𝚷",
|
| 982 |
+
"\\bfRho" : "𝚸",
|
| 983 |
+
"\\bfvarTheta" : "𝚹",
|
| 984 |
+
"\\bfSigma" : "𝚺",
|
| 985 |
+
"\\bfTau" : "𝚻",
|
| 986 |
+
"\\bfUpsilon" : "𝚼",
|
| 987 |
+
"\\bfPhi" : "𝚽",
|
| 988 |
+
"\\bfChi" : "𝚾",
|
| 989 |
+
"\\bfPsi" : "𝚿",
|
| 990 |
+
"\\bfOmega" : "𝛀",
|
| 991 |
+
"\\bfalpha" : "𝛂",
|
| 992 |
+
"\\bfbeta" : "𝛃",
|
| 993 |
+
"\\bfgamma" : "𝛄",
|
| 994 |
+
"\\bfdelta" : "𝛅",
|
| 995 |
+
"\\bfepsilon" : "𝛆",
|
| 996 |
+
"\\bfzeta" : "𝛇",
|
| 997 |
+
"\\bfeta" : "𝛈",
|
| 998 |
+
"\\bftheta" : "𝛉",
|
| 999 |
+
"\\bfiota" : "𝛊",
|
| 1000 |
+
"\\bfkappa" : "𝛋",
|
| 1001 |
+
"\\bflambda" : "𝛌",
|
| 1002 |
+
"\\bfmu" : "𝛍",
|
| 1003 |
+
"\\bfnu" : "𝛎",
|
| 1004 |
+
"\\bfxi" : "𝛏",
|
| 1005 |
+
"\\bfomicron" : "𝛐",
|
| 1006 |
+
"\\bfpi" : "𝛑",
|
| 1007 |
+
"\\bfrho" : "𝛒",
|
| 1008 |
+
"\\bfvarsigma" : "𝛓",
|
| 1009 |
+
"\\bfsigma" : "𝛔",
|
| 1010 |
+
"\\bftau" : "𝛕",
|
| 1011 |
+
"\\bfupsilon" : "𝛖",
|
| 1012 |
+
"\\bfvarphi" : "𝛗",
|
| 1013 |
+
"\\bfchi" : "𝛘",
|
| 1014 |
+
"\\bfpsi" : "𝛙",
|
| 1015 |
+
"\\bfomega" : "𝛚",
|
| 1016 |
+
"\\bfvarepsilon" : "𝛜",
|
| 1017 |
+
"\\bfvartheta" : "𝛝",
|
| 1018 |
+
"\\bfvarkappa" : "𝛞",
|
| 1019 |
+
"\\bfphi" : "𝛟",
|
| 1020 |
+
"\\bfvarrho" : "𝛠",
|
| 1021 |
+
"\\bfvarpi" : "𝛡",
|
| 1022 |
+
"\\itAlpha" : "𝛢",
|
| 1023 |
+
"\\itBeta" : "𝛣",
|
| 1024 |
+
"\\itGamma" : "𝛤",
|
| 1025 |
+
"\\itDelta" : "𝛥",
|
| 1026 |
+
"\\itEpsilon" : "𝛦",
|
| 1027 |
+
"\\itZeta" : "𝛧",
|
| 1028 |
+
"\\itEta" : "𝛨",
|
| 1029 |
+
"\\itTheta" : "𝛩",
|
| 1030 |
+
"\\itIota" : "𝛪",
|
| 1031 |
+
"\\itKappa" : "𝛫",
|
| 1032 |
+
"\\itLambda" : "𝛬",
|
| 1033 |
+
"\\itMu" : "𝛭",
|
| 1034 |
+
"\\itNu" : "𝛮",
|
| 1035 |
+
"\\itXi" : "𝛯",
|
| 1036 |
+
"\\itOmicron" : "𝛰",
|
| 1037 |
+
"\\itPi" : "𝛱",
|
| 1038 |
+
"\\itRho" : "𝛲",
|
| 1039 |
+
"\\itvarTheta" : "𝛳",
|
| 1040 |
+
"\\itSigma" : "𝛴",
|
| 1041 |
+
"\\itTau" : "𝛵",
|
| 1042 |
+
"\\itUpsilon" : "𝛶",
|
| 1043 |
+
"\\itPhi" : "𝛷",
|
| 1044 |
+
"\\itChi" : "𝛸",
|
| 1045 |
+
"\\itPsi" : "𝛹",
|
| 1046 |
+
"\\itOmega" : "𝛺",
|
| 1047 |
+
"\\italpha" : "𝛼",
|
| 1048 |
+
"\\itbeta" : "𝛽",
|
| 1049 |
+
"\\itgamma" : "𝛾",
|
| 1050 |
+
"\\itdelta" : "𝛿",
|
| 1051 |
+
"\\itepsilon" : "𝜀",
|
| 1052 |
+
"\\itzeta" : "𝜁",
|
| 1053 |
+
"\\iteta" : "𝜂",
|
| 1054 |
+
"\\ittheta" : "𝜃",
|
| 1055 |
+
"\\itiota" : "𝜄",
|
| 1056 |
+
"\\itkappa" : "𝜅",
|
| 1057 |
+
"\\itlambda" : "𝜆",
|
| 1058 |
+
"\\itmu" : "𝜇",
|
| 1059 |
+
"\\itnu" : "𝜈",
|
| 1060 |
+
"\\itxi" : "𝜉",
|
| 1061 |
+
"\\itomicron" : "𝜊",
|
| 1062 |
+
"\\itpi" : "𝜋",
|
| 1063 |
+
"\\itrho" : "𝜌",
|
| 1064 |
+
"\\itvarsigma" : "𝜍",
|
| 1065 |
+
"\\itsigma" : "𝜎",
|
| 1066 |
+
"\\ittau" : "𝜏",
|
| 1067 |
+
"\\itupsilon" : "𝜐",
|
| 1068 |
+
"\\itphi" : "𝜑",
|
| 1069 |
+
"\\itchi" : "𝜒",
|
| 1070 |
+
"\\itpsi" : "𝜓",
|
| 1071 |
+
"\\itomega" : "𝜔",
|
| 1072 |
+
"\\itvarepsilon" : "𝜖",
|
| 1073 |
+
"\\itvartheta" : "𝜗",
|
| 1074 |
+
"\\itvarkappa" : "𝜘",
|
| 1075 |
+
"\\itvarphi" : "𝜙",
|
| 1076 |
+
"\\itvarrho" : "𝜚",
|
| 1077 |
+
"\\itvarpi" : "𝜛",
|
| 1078 |
+
"\\biAlpha" : "𝜜",
|
| 1079 |
+
"\\biBeta" : "𝜝",
|
| 1080 |
+
"\\biGamma" : "𝜞",
|
| 1081 |
+
"\\biDelta" : "𝜟",
|
| 1082 |
+
"\\biEpsilon" : "𝜠",
|
| 1083 |
+
"\\biZeta" : "𝜡",
|
| 1084 |
+
"\\biEta" : "𝜢",
|
| 1085 |
+
"\\biTheta" : "𝜣",
|
| 1086 |
+
"\\biIota" : "𝜤",
|
| 1087 |
+
"\\biKappa" : "𝜥",
|
| 1088 |
+
"\\biLambda" : "𝜦",
|
| 1089 |
+
"\\biMu" : "𝜧",
|
| 1090 |
+
"\\biNu" : "𝜨",
|
| 1091 |
+
"\\biXi" : "𝜩",
|
| 1092 |
+
"\\biOmicron" : "𝜪",
|
| 1093 |
+
"\\biPi" : "𝜫",
|
| 1094 |
+
"\\biRho" : "𝜬",
|
| 1095 |
+
"\\bivarTheta" : "𝜭",
|
| 1096 |
+
"\\biSigma" : "𝜮",
|
| 1097 |
+
"\\biTau" : "𝜯",
|
| 1098 |
+
"\\biUpsilon" : "𝜰",
|
| 1099 |
+
"\\biPhi" : "𝜱",
|
| 1100 |
+
"\\biChi" : "𝜲",
|
| 1101 |
+
"\\biPsi" : "𝜳",
|
| 1102 |
+
"\\biOmega" : "𝜴",
|
| 1103 |
+
"\\bialpha" : "𝜶",
|
| 1104 |
+
"\\bibeta" : "𝜷",
|
| 1105 |
+
"\\bigamma" : "𝜸",
|
| 1106 |
+
"\\bidelta" : "𝜹",
|
| 1107 |
+
"\\biepsilon" : "𝜺",
|
| 1108 |
+
"\\bizeta" : "𝜻",
|
| 1109 |
+
"\\bieta" : "𝜼",
|
| 1110 |
+
"\\bitheta" : "𝜽",
|
| 1111 |
+
"\\biiota" : "𝜾",
|
| 1112 |
+
"\\bikappa" : "𝜿",
|
| 1113 |
+
"\\bilambda" : "𝝀",
|
| 1114 |
+
"\\bimu" : "𝝁",
|
| 1115 |
+
"\\binu" : "𝝂",
|
| 1116 |
+
"\\bixi" : "𝝃",
|
| 1117 |
+
"\\biomicron" : "𝝄",
|
| 1118 |
+
"\\bipi" : "𝝅",
|
| 1119 |
+
"\\birho" : "𝝆",
|
| 1120 |
+
"\\bivarsigma" : "𝝇",
|
| 1121 |
+
"\\bisigma" : "𝝈",
|
| 1122 |
+
"\\bitau" : "𝝉",
|
| 1123 |
+
"\\biupsilon" : "𝝊",
|
| 1124 |
+
"\\biphi" : "𝝋",
|
| 1125 |
+
"\\bichi" : "𝝌",
|
| 1126 |
+
"\\bipsi" : "𝝍",
|
| 1127 |
+
"\\biomega" : "𝝎",
|
| 1128 |
+
"\\bivarepsilon" : "𝝐",
|
| 1129 |
+
"\\bivartheta" : "𝝑",
|
| 1130 |
+
"\\bivarkappa" : "𝝒",
|
| 1131 |
+
"\\bivarphi" : "𝝓",
|
| 1132 |
+
"\\bivarrho" : "𝝔",
|
| 1133 |
+
"\\bivarpi" : "𝝕",
|
| 1134 |
+
"\\bsansAlpha" : "𝝖",
|
| 1135 |
+
"\\bsansBeta" : "𝝗",
|
| 1136 |
+
"\\bsansGamma" : "𝝘",
|
| 1137 |
+
"\\bsansDelta" : "𝝙",
|
| 1138 |
+
"\\bsansEpsilon" : "𝝚",
|
| 1139 |
+
"\\bsansZeta" : "𝝛",
|
| 1140 |
+
"\\bsansEta" : "𝝜",
|
| 1141 |
+
"\\bsansTheta" : "𝝝",
|
| 1142 |
+
"\\bsansIota" : "𝝞",
|
| 1143 |
+
"\\bsansKappa" : "𝝟",
|
| 1144 |
+
"\\bsansLambda" : "𝝠",
|
| 1145 |
+
"\\bsansMu" : "𝝡",
|
| 1146 |
+
"\\bsansNu" : "𝝢",
|
| 1147 |
+
"\\bsansXi" : "𝝣",
|
| 1148 |
+
"\\bsansOmicron" : "𝝤",
|
| 1149 |
+
"\\bsansPi" : "𝝥",
|
| 1150 |
+
"\\bsansRho" : "𝝦",
|
| 1151 |
+
"\\bsansvarTheta" : "𝝧",
|
| 1152 |
+
"\\bsansSigma" : "𝝨",
|
| 1153 |
+
"\\bsansTau" : "𝝩",
|
| 1154 |
+
"\\bsansUpsilon" : "𝝪",
|
| 1155 |
+
"\\bsansPhi" : "𝝫",
|
| 1156 |
+
"\\bsansChi" : "𝝬",
|
| 1157 |
+
"\\bsansPsi" : "𝝭",
|
| 1158 |
+
"\\bsansOmega" : "𝝮",
|
| 1159 |
+
"\\bsansalpha" : "𝝰",
|
| 1160 |
+
"\\bsansbeta" : "𝝱",
|
| 1161 |
+
"\\bsansgamma" : "𝝲",
|
| 1162 |
+
"\\bsansdelta" : "𝝳",
|
| 1163 |
+
"\\bsansepsilon" : "𝝴",
|
| 1164 |
+
"\\bsanszeta" : "𝝵",
|
| 1165 |
+
"\\bsanseta" : "𝝶",
|
| 1166 |
+
"\\bsanstheta" : "𝝷",
|
| 1167 |
+
"\\bsansiota" : "𝝸",
|
| 1168 |
+
"\\bsanskappa" : "𝝹",
|
| 1169 |
+
"\\bsanslambda" : "𝝺",
|
| 1170 |
+
"\\bsansmu" : "𝝻",
|
| 1171 |
+
"\\bsansnu" : "𝝼",
|
| 1172 |
+
"\\bsansxi" : "𝝽",
|
| 1173 |
+
"\\bsansomicron" : "𝝾",
|
| 1174 |
+
"\\bsanspi" : "𝝿",
|
| 1175 |
+
"\\bsansrho" : "𝞀",
|
| 1176 |
+
"\\bsansvarsigma" : "𝞁",
|
| 1177 |
+
"\\bsanssigma" : "𝞂",
|
| 1178 |
+
"\\bsanstau" : "𝞃",
|
| 1179 |
+
"\\bsansupsilon" : "𝞄",
|
| 1180 |
+
"\\bsansphi" : "𝞅",
|
| 1181 |
+
"\\bsanschi" : "𝞆",
|
| 1182 |
+
"\\bsanspsi" : "𝞇",
|
| 1183 |
+
"\\bsansomega" : "𝞈",
|
| 1184 |
+
"\\bsansvarepsilon" : "𝞊",
|
| 1185 |
+
"\\bsansvartheta" : "𝞋",
|
| 1186 |
+
"\\bsansvarkappa" : "𝞌",
|
| 1187 |
+
"\\bsansvarphi" : "𝞍",
|
| 1188 |
+
"\\bsansvarrho" : "𝞎",
|
| 1189 |
+
"\\bsansvarpi" : "𝞏",
|
| 1190 |
+
"\\bisansAlpha" : "𝞐",
|
| 1191 |
+
"\\bisansBeta" : "𝞑",
|
| 1192 |
+
"\\bisansGamma" : "𝞒",
|
| 1193 |
+
"\\bisansDelta" : "𝞓",
|
| 1194 |
+
"\\bisansEpsilon" : "𝞔",
|
| 1195 |
+
"\\bisansZeta" : "𝞕",
|
| 1196 |
+
"\\bisansEta" : "𝞖",
|
| 1197 |
+
"\\bisansTheta" : "𝞗",
|
| 1198 |
+
"\\bisansIota" : "𝞘",
|
| 1199 |
+
"\\bisansKappa" : "𝞙",
|
| 1200 |
+
"\\bisansLambda" : "𝞚",
|
| 1201 |
+
"\\bisansMu" : "𝞛",
|
| 1202 |
+
"\\bisansNu" : "𝞜",
|
| 1203 |
+
"\\bisansXi" : "𝞝",
|
| 1204 |
+
"\\bisansOmicron" : "𝞞",
|
| 1205 |
+
"\\bisansPi" : "𝞟",
|
| 1206 |
+
"\\bisansRho" : "𝞠",
|
| 1207 |
+
"\\bisansvarTheta" : "𝞡",
|
| 1208 |
+
"\\bisansSigma" : "𝞢",
|
| 1209 |
+
"\\bisansTau" : "𝞣",
|
| 1210 |
+
"\\bisansUpsilon" : "𝞤",
|
| 1211 |
+
"\\bisansPhi" : "𝞥",
|
| 1212 |
+
"\\bisansChi" : "𝞦",
|
| 1213 |
+
"\\bisansPsi" : "𝞧",
|
| 1214 |
+
"\\bisansOmega" : "𝞨",
|
| 1215 |
+
"\\bisansalpha" : "𝞪",
|
| 1216 |
+
"\\bisansbeta" : "𝞫",
|
| 1217 |
+
"\\bisansgamma" : "𝞬",
|
| 1218 |
+
"\\bisansdelta" : "𝞭",
|
| 1219 |
+
"\\bisansepsilon" : "𝞮",
|
| 1220 |
+
"\\bisanszeta" : "𝞯",
|
| 1221 |
+
"\\bisanseta" : "𝞰",
|
| 1222 |
+
"\\bisanstheta" : "𝞱",
|
| 1223 |
+
"\\bisansiota" : "𝞲",
|
| 1224 |
+
"\\bisanskappa" : "𝞳",
|
| 1225 |
+
"\\bisanslambda" : "𝞴",
|
| 1226 |
+
"\\bisansmu" : "𝞵",
|
| 1227 |
+
"\\bisansnu" : "𝞶",
|
| 1228 |
+
"\\bisansxi" : "𝞷",
|
| 1229 |
+
"\\bisansomicron" : "𝞸",
|
| 1230 |
+
"\\bisanspi" : "𝞹",
|
| 1231 |
+
"\\bisansrho" : "𝞺",
|
| 1232 |
+
"\\bisansvarsigma" : "𝞻",
|
| 1233 |
+
"\\bisanssigma" : "𝞼",
|
| 1234 |
+
"\\bisanstau" : "𝞽",
|
| 1235 |
+
"\\bisansupsilon" : "𝞾",
|
| 1236 |
+
"\\bisansphi" : "𝞿",
|
| 1237 |
+
"\\bisanschi" : "𝟀",
|
| 1238 |
+
"\\bisanspsi" : "𝟁",
|
| 1239 |
+
"\\bisansomega" : "𝟂",
|
| 1240 |
+
"\\bisansvarepsilon" : "𝟄",
|
| 1241 |
+
"\\bisansvartheta" : "𝟅",
|
| 1242 |
+
"\\bisansvarkappa" : "𝟆",
|
| 1243 |
+
"\\bisansvarphi" : "𝟇",
|
| 1244 |
+
"\\bisansvarrho" : "𝟈",
|
| 1245 |
+
"\\bisansvarpi" : "𝟉",
|
| 1246 |
+
"\\bfzero" : "𝟎",
|
| 1247 |
+
"\\bfone" : "𝟏",
|
| 1248 |
+
"\\bftwo" : "𝟐",
|
| 1249 |
+
"\\bfthree" : "𝟑",
|
| 1250 |
+
"\\bffour" : "𝟒",
|
| 1251 |
+
"\\bffive" : "𝟓",
|
| 1252 |
+
"\\bfsix" : "𝟔",
|
| 1253 |
+
"\\bfseven" : "𝟕",
|
| 1254 |
+
"\\bfeight" : "𝟖",
|
| 1255 |
+
"\\bfnine" : "𝟗",
|
| 1256 |
+
"\\bbzero" : "𝟘",
|
| 1257 |
+
"\\bbone" : "𝟙",
|
| 1258 |
+
"\\bbtwo" : "𝟚",
|
| 1259 |
+
"\\bbthree" : "𝟛",
|
| 1260 |
+
"\\bbfour" : "𝟜",
|
| 1261 |
+
"\\bbfive" : "𝟝",
|
| 1262 |
+
"\\bbsix" : "𝟞",
|
| 1263 |
+
"\\bbseven" : "𝟟",
|
| 1264 |
+
"\\bbeight" : "𝟠",
|
| 1265 |
+
"\\bbnine" : "𝟡",
|
| 1266 |
+
"\\sanszero" : "𝟢",
|
| 1267 |
+
"\\sansone" : "𝟣",
|
| 1268 |
+
"\\sanstwo" : "𝟤",
|
| 1269 |
+
"\\sansthree" : "𝟥",
|
| 1270 |
+
"\\sansfour" : "𝟦",
|
| 1271 |
+
"\\sansfive" : "𝟧",
|
| 1272 |
+
"\\sanssix" : "𝟨",
|
| 1273 |
+
"\\sansseven" : "𝟩",
|
| 1274 |
+
"\\sanseight" : "𝟪",
|
| 1275 |
+
"\\sansnine" : "𝟫",
|
| 1276 |
+
"\\bsanszero" : "𝟬",
|
| 1277 |
+
"\\bsansone" : "𝟭",
|
| 1278 |
+
"\\bsanstwo" : "𝟮",
|
| 1279 |
+
"\\bsansthree" : "𝟯",
|
| 1280 |
+
"\\bsansfour" : "𝟰",
|
| 1281 |
+
"\\bsansfive" : "𝟱",
|
| 1282 |
+
"\\bsanssix" : "𝟲",
|
| 1283 |
+
"\\bsansseven" : "𝟳",
|
| 1284 |
+
"\\bsanseight" : "𝟴",
|
| 1285 |
+
"\\bsansnine" : "𝟵",
|
| 1286 |
+
"\\ttzero" : "𝟶",
|
| 1287 |
+
"\\ttone" : "𝟷",
|
| 1288 |
+
"\\tttwo" : "𝟸",
|
| 1289 |
+
"\\ttthree" : "𝟹",
|
| 1290 |
+
"\\ttfour" : "𝟺",
|
| 1291 |
+
"\\ttfive" : "𝟻",
|
| 1292 |
+
"\\ttsix" : "𝟼",
|
| 1293 |
+
"\\ttseven" : "𝟽",
|
| 1294 |
+
"\\tteight" : "𝟾",
|
| 1295 |
+
"\\ttnine" : "𝟿",
|
| 1296 |
+
"\\underbar" : "̲",
|
| 1297 |
+
"\\underleftrightarrow" : "͍",
|
| 1298 |
+
}
|
| 1299 |
+
|
| 1300 |
+
|
| 1301 |
+
reverse_latex_symbol = { v:k for k,v in latex_symbols.items()}
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/macro.py
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Support for interactive macros in IPython"""
|
| 2 |
+
|
| 3 |
+
#*****************************************************************************
|
| 4 |
+
# Copyright (C) 2001-2005 Fernando Perez <fperez@colorado.edu>
|
| 5 |
+
#
|
| 6 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 7 |
+
# the file COPYING, distributed as part of this software.
|
| 8 |
+
#*****************************************************************************
|
| 9 |
+
|
| 10 |
+
import re
|
| 11 |
+
|
| 12 |
+
from IPython.utils.encoding import DEFAULT_ENCODING
|
| 13 |
+
|
| 14 |
+
coding_declaration = re.compile(r"#\s*coding[:=]\s*([-\w.]+)")
|
| 15 |
+
|
| 16 |
+
class Macro(object):
|
| 17 |
+
"""Simple class to store the value of macros as strings.
|
| 18 |
+
|
| 19 |
+
Macro is just a callable that executes a string of IPython
|
| 20 |
+
input when called.
|
| 21 |
+
"""
|
| 22 |
+
|
| 23 |
+
def __init__(self,code):
|
| 24 |
+
"""store the macro value, as a single string which can be executed"""
|
| 25 |
+
lines = []
|
| 26 |
+
enc = None
|
| 27 |
+
for line in code.splitlines():
|
| 28 |
+
coding_match = coding_declaration.match(line)
|
| 29 |
+
if coding_match:
|
| 30 |
+
enc = coding_match.group(1)
|
| 31 |
+
else:
|
| 32 |
+
lines.append(line)
|
| 33 |
+
code = "\n".join(lines)
|
| 34 |
+
if isinstance(code, bytes):
|
| 35 |
+
code = code.decode(enc or DEFAULT_ENCODING)
|
| 36 |
+
self.value = code + '\n'
|
| 37 |
+
|
| 38 |
+
def __str__(self):
|
| 39 |
+
return self.value
|
| 40 |
+
|
| 41 |
+
def __repr__(self):
|
| 42 |
+
return 'IPython.macro.Macro(%s)' % repr(self.value)
|
| 43 |
+
|
| 44 |
+
def __getstate__(self):
|
| 45 |
+
""" needed for safe pickling via %store """
|
| 46 |
+
return {'value': self.value}
|
| 47 |
+
|
| 48 |
+
def __add__(self, other):
|
| 49 |
+
if isinstance(other, Macro):
|
| 50 |
+
return Macro(self.value + other.value)
|
| 51 |
+
elif isinstance(other, str):
|
| 52 |
+
return Macro(self.value + other)
|
| 53 |
+
raise TypeError
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/magic.py
ADDED
|
@@ -0,0 +1,759 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""Magic functions for InteractiveShell.
|
| 3 |
+
"""
|
| 4 |
+
|
| 5 |
+
#-----------------------------------------------------------------------------
|
| 6 |
+
# Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and
|
| 7 |
+
# Copyright (C) 2001 Fernando Perez <fperez@colorado.edu>
|
| 8 |
+
# Copyright (C) 2008 The IPython Development Team
|
| 9 |
+
|
| 10 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 11 |
+
# the file COPYING, distributed as part of this software.
|
| 12 |
+
#-----------------------------------------------------------------------------
|
| 13 |
+
|
| 14 |
+
import os
|
| 15 |
+
import re
|
| 16 |
+
import sys
|
| 17 |
+
from getopt import getopt, GetoptError
|
| 18 |
+
|
| 19 |
+
from traitlets.config.configurable import Configurable
|
| 20 |
+
from . import oinspect
|
| 21 |
+
from .error import UsageError
|
| 22 |
+
from .inputtransformer2 import ESC_MAGIC, ESC_MAGIC2
|
| 23 |
+
from ..utils.ipstruct import Struct
|
| 24 |
+
from ..utils.process import arg_split
|
| 25 |
+
from ..utils.text import dedent
|
| 26 |
+
from traitlets import Bool, Dict, Instance, observe
|
| 27 |
+
from logging import error
|
| 28 |
+
|
| 29 |
+
import typing as t
|
| 30 |
+
|
| 31 |
+
#-----------------------------------------------------------------------------
|
| 32 |
+
# Globals
|
| 33 |
+
#-----------------------------------------------------------------------------
|
| 34 |
+
|
| 35 |
+
# A dict we'll use for each class that has magics, used as temporary storage to
|
| 36 |
+
# pass information between the @line/cell_magic method decorators and the
|
| 37 |
+
# @magics_class class decorator, because the method decorators have no
|
| 38 |
+
# access to the class when they run. See for more details:
|
| 39 |
+
# http://stackoverflow.com/questions/2366713/can-a-python-decorator-of-an-instance-method-access-the-class
|
| 40 |
+
|
| 41 |
+
magics: t.Dict = dict(line={}, cell={})
|
| 42 |
+
|
| 43 |
+
magic_kinds = ('line', 'cell')
|
| 44 |
+
magic_spec = ('line', 'cell', 'line_cell')
|
| 45 |
+
magic_escapes = dict(line=ESC_MAGIC, cell=ESC_MAGIC2)
|
| 46 |
+
|
| 47 |
+
#-----------------------------------------------------------------------------
|
| 48 |
+
# Utility classes and functions
|
| 49 |
+
#-----------------------------------------------------------------------------
|
| 50 |
+
|
| 51 |
+
class Bunch: pass
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
def on_off(tag):
|
| 55 |
+
"""Return an ON/OFF string for a 1/0 input. Simple utility function."""
|
| 56 |
+
return ['OFF','ON'][tag]
|
| 57 |
+
|
| 58 |
+
|
| 59 |
+
def compress_dhist(dh):
|
| 60 |
+
"""Compress a directory history into a new one with at most 20 entries.
|
| 61 |
+
|
| 62 |
+
Return a new list made from the first and last 10 elements of dhist after
|
| 63 |
+
removal of duplicates.
|
| 64 |
+
"""
|
| 65 |
+
head, tail = dh[:-10], dh[-10:]
|
| 66 |
+
|
| 67 |
+
newhead = []
|
| 68 |
+
done = set()
|
| 69 |
+
for h in head:
|
| 70 |
+
if h in done:
|
| 71 |
+
continue
|
| 72 |
+
newhead.append(h)
|
| 73 |
+
done.add(h)
|
| 74 |
+
|
| 75 |
+
return newhead + tail
|
| 76 |
+
|
| 77 |
+
|
| 78 |
+
def needs_local_scope(func):
|
| 79 |
+
"""Decorator to mark magic functions which need to local scope to run."""
|
| 80 |
+
func.needs_local_scope = True
|
| 81 |
+
return func
|
| 82 |
+
|
| 83 |
+
#-----------------------------------------------------------------------------
|
| 84 |
+
# Class and method decorators for registering magics
|
| 85 |
+
#-----------------------------------------------------------------------------
|
| 86 |
+
|
| 87 |
+
def magics_class(cls):
|
| 88 |
+
"""Class decorator for all subclasses of the main Magics class.
|
| 89 |
+
|
| 90 |
+
Any class that subclasses Magics *must* also apply this decorator, to
|
| 91 |
+
ensure that all the methods that have been decorated as line/cell magics
|
| 92 |
+
get correctly registered in the class instance. This is necessary because
|
| 93 |
+
when method decorators run, the class does not exist yet, so they
|
| 94 |
+
temporarily store their information into a module global. Application of
|
| 95 |
+
this class decorator copies that global data to the class instance and
|
| 96 |
+
clears the global.
|
| 97 |
+
|
| 98 |
+
Obviously, this mechanism is not thread-safe, which means that the
|
| 99 |
+
*creation* of subclasses of Magic should only be done in a single-thread
|
| 100 |
+
context. Instantiation of the classes has no restrictions. Given that
|
| 101 |
+
these classes are typically created at IPython startup time and before user
|
| 102 |
+
application code becomes active, in practice this should not pose any
|
| 103 |
+
problems.
|
| 104 |
+
"""
|
| 105 |
+
cls.registered = True
|
| 106 |
+
cls.magics = dict(line = magics['line'],
|
| 107 |
+
cell = magics['cell'])
|
| 108 |
+
magics['line'] = {}
|
| 109 |
+
magics['cell'] = {}
|
| 110 |
+
return cls
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
def record_magic(dct, magic_kind, magic_name, func):
|
| 114 |
+
"""Utility function to store a function as a magic of a specific kind.
|
| 115 |
+
|
| 116 |
+
Parameters
|
| 117 |
+
----------
|
| 118 |
+
dct : dict
|
| 119 |
+
A dictionary with 'line' and 'cell' subdicts.
|
| 120 |
+
magic_kind : str
|
| 121 |
+
Kind of magic to be stored.
|
| 122 |
+
magic_name : str
|
| 123 |
+
Key to store the magic as.
|
| 124 |
+
func : function
|
| 125 |
+
Callable object to store.
|
| 126 |
+
"""
|
| 127 |
+
if magic_kind == 'line_cell':
|
| 128 |
+
dct['line'][magic_name] = dct['cell'][magic_name] = func
|
| 129 |
+
else:
|
| 130 |
+
dct[magic_kind][magic_name] = func
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
def validate_type(magic_kind):
|
| 134 |
+
"""Ensure that the given magic_kind is valid.
|
| 135 |
+
|
| 136 |
+
Check that the given magic_kind is one of the accepted spec types (stored
|
| 137 |
+
in the global `magic_spec`), raise ValueError otherwise.
|
| 138 |
+
"""
|
| 139 |
+
if magic_kind not in magic_spec:
|
| 140 |
+
raise ValueError('magic_kind must be one of %s, %s given' %
|
| 141 |
+
magic_kinds, magic_kind)
|
| 142 |
+
|
| 143 |
+
|
| 144 |
+
# The docstrings for the decorator below will be fairly similar for the two
|
| 145 |
+
# types (method and function), so we generate them here once and reuse the
|
| 146 |
+
# templates below.
|
| 147 |
+
_docstring_template = \
|
| 148 |
+
"""Decorate the given {0} as {1} magic.
|
| 149 |
+
|
| 150 |
+
The decorator can be used with or without arguments, as follows.
|
| 151 |
+
|
| 152 |
+
i) without arguments: it will create a {1} magic named as the {0} being
|
| 153 |
+
decorated::
|
| 154 |
+
|
| 155 |
+
@deco
|
| 156 |
+
def foo(...)
|
| 157 |
+
|
| 158 |
+
will create a {1} magic named `foo`.
|
| 159 |
+
|
| 160 |
+
ii) with one string argument: which will be used as the actual name of the
|
| 161 |
+
resulting magic::
|
| 162 |
+
|
| 163 |
+
@deco('bar')
|
| 164 |
+
def foo(...)
|
| 165 |
+
|
| 166 |
+
will create a {1} magic named `bar`.
|
| 167 |
+
|
| 168 |
+
To register a class magic use ``Interactiveshell.register_magic(class or instance)``.
|
| 169 |
+
"""
|
| 170 |
+
|
| 171 |
+
# These two are decorator factories. While they are conceptually very similar,
|
| 172 |
+
# there are enough differences in the details that it's simpler to have them
|
| 173 |
+
# written as completely standalone functions rather than trying to share code
|
| 174 |
+
# and make a single one with convoluted logic.
|
| 175 |
+
|
| 176 |
+
def _method_magic_marker(magic_kind):
|
| 177 |
+
"""Decorator factory for methods in Magics subclasses.
|
| 178 |
+
"""
|
| 179 |
+
|
| 180 |
+
validate_type(magic_kind)
|
| 181 |
+
|
| 182 |
+
# This is a closure to capture the magic_kind. We could also use a class,
|
| 183 |
+
# but it's overkill for just that one bit of state.
|
| 184 |
+
def magic_deco(arg):
|
| 185 |
+
if callable(arg):
|
| 186 |
+
# "Naked" decorator call (just @foo, no args)
|
| 187 |
+
func = arg
|
| 188 |
+
name = func.__name__
|
| 189 |
+
retval = arg
|
| 190 |
+
record_magic(magics, magic_kind, name, name)
|
| 191 |
+
elif isinstance(arg, str):
|
| 192 |
+
# Decorator called with arguments (@foo('bar'))
|
| 193 |
+
name = arg
|
| 194 |
+
def mark(func, *a, **kw):
|
| 195 |
+
record_magic(magics, magic_kind, name, func.__name__)
|
| 196 |
+
return func
|
| 197 |
+
retval = mark
|
| 198 |
+
else:
|
| 199 |
+
raise TypeError("Decorator can only be called with "
|
| 200 |
+
"string or function")
|
| 201 |
+
return retval
|
| 202 |
+
|
| 203 |
+
# Ensure the resulting decorator has a usable docstring
|
| 204 |
+
magic_deco.__doc__ = _docstring_template.format('method', magic_kind)
|
| 205 |
+
return magic_deco
|
| 206 |
+
|
| 207 |
+
|
| 208 |
+
def _function_magic_marker(magic_kind):
|
| 209 |
+
"""Decorator factory for standalone functions.
|
| 210 |
+
"""
|
| 211 |
+
validate_type(magic_kind)
|
| 212 |
+
|
| 213 |
+
# This is a closure to capture the magic_kind. We could also use a class,
|
| 214 |
+
# but it's overkill for just that one bit of state.
|
| 215 |
+
def magic_deco(arg):
|
| 216 |
+
# Find get_ipython() in the caller's namespace
|
| 217 |
+
caller = sys._getframe(1)
|
| 218 |
+
for ns in ['f_locals', 'f_globals', 'f_builtins']:
|
| 219 |
+
get_ipython = getattr(caller, ns).get('get_ipython')
|
| 220 |
+
if get_ipython is not None:
|
| 221 |
+
break
|
| 222 |
+
else:
|
| 223 |
+
raise NameError('Decorator can only run in context where '
|
| 224 |
+
'`get_ipython` exists')
|
| 225 |
+
|
| 226 |
+
ip = get_ipython()
|
| 227 |
+
|
| 228 |
+
if callable(arg):
|
| 229 |
+
# "Naked" decorator call (just @foo, no args)
|
| 230 |
+
func = arg
|
| 231 |
+
name = func.__name__
|
| 232 |
+
ip.register_magic_function(func, magic_kind, name)
|
| 233 |
+
retval = arg
|
| 234 |
+
elif isinstance(arg, str):
|
| 235 |
+
# Decorator called with arguments (@foo('bar'))
|
| 236 |
+
name = arg
|
| 237 |
+
def mark(func, *a, **kw):
|
| 238 |
+
ip.register_magic_function(func, magic_kind, name)
|
| 239 |
+
return func
|
| 240 |
+
retval = mark
|
| 241 |
+
else:
|
| 242 |
+
raise TypeError("Decorator can only be called with "
|
| 243 |
+
"string or function")
|
| 244 |
+
return retval
|
| 245 |
+
|
| 246 |
+
# Ensure the resulting decorator has a usable docstring
|
| 247 |
+
ds = _docstring_template.format('function', magic_kind)
|
| 248 |
+
|
| 249 |
+
ds += dedent("""
|
| 250 |
+
Note: this decorator can only be used in a context where IPython is already
|
| 251 |
+
active, so that the `get_ipython()` call succeeds. You can therefore use
|
| 252 |
+
it in your startup files loaded after IPython initializes, but *not* in the
|
| 253 |
+
IPython configuration file itself, which is executed before IPython is
|
| 254 |
+
fully up and running. Any file located in the `startup` subdirectory of
|
| 255 |
+
your configuration profile will be OK in this sense.
|
| 256 |
+
""")
|
| 257 |
+
|
| 258 |
+
magic_deco.__doc__ = ds
|
| 259 |
+
return magic_deco
|
| 260 |
+
|
| 261 |
+
|
| 262 |
+
MAGIC_NO_VAR_EXPAND_ATTR = "_ipython_magic_no_var_expand"
|
| 263 |
+
MAGIC_OUTPUT_CAN_BE_SILENCED = "_ipython_magic_output_can_be_silenced"
|
| 264 |
+
|
| 265 |
+
|
| 266 |
+
def no_var_expand(magic_func):
|
| 267 |
+
"""Mark a magic function as not needing variable expansion
|
| 268 |
+
|
| 269 |
+
By default, IPython interprets `{a}` or `$a` in the line passed to magics
|
| 270 |
+
as variables that should be interpolated from the interactive namespace
|
| 271 |
+
before passing the line to the magic function.
|
| 272 |
+
This is not always desirable, e.g. when the magic executes Python code
|
| 273 |
+
(%timeit, %time, etc.).
|
| 274 |
+
Decorate magics with `@no_var_expand` to opt-out of variable expansion.
|
| 275 |
+
|
| 276 |
+
.. versionadded:: 7.3
|
| 277 |
+
"""
|
| 278 |
+
setattr(magic_func, MAGIC_NO_VAR_EXPAND_ATTR, True)
|
| 279 |
+
return magic_func
|
| 280 |
+
|
| 281 |
+
|
| 282 |
+
def output_can_be_silenced(magic_func):
|
| 283 |
+
"""Mark a magic function so its output may be silenced.
|
| 284 |
+
|
| 285 |
+
The output is silenced if the Python code used as a parameter of
|
| 286 |
+
the magic ends in a semicolon, not counting a Python comment that can
|
| 287 |
+
follow it.
|
| 288 |
+
"""
|
| 289 |
+
setattr(magic_func, MAGIC_OUTPUT_CAN_BE_SILENCED, True)
|
| 290 |
+
return magic_func
|
| 291 |
+
|
| 292 |
+
# Create the actual decorators for public use
|
| 293 |
+
|
| 294 |
+
# These three are used to decorate methods in class definitions
|
| 295 |
+
line_magic = _method_magic_marker('line')
|
| 296 |
+
cell_magic = _method_magic_marker('cell')
|
| 297 |
+
line_cell_magic = _method_magic_marker('line_cell')
|
| 298 |
+
|
| 299 |
+
# These three decorate standalone functions and perform the decoration
|
| 300 |
+
# immediately. They can only run where get_ipython() works
|
| 301 |
+
register_line_magic = _function_magic_marker('line')
|
| 302 |
+
register_cell_magic = _function_magic_marker('cell')
|
| 303 |
+
register_line_cell_magic = _function_magic_marker('line_cell')
|
| 304 |
+
|
| 305 |
+
#-----------------------------------------------------------------------------
|
| 306 |
+
# Core Magic classes
|
| 307 |
+
#-----------------------------------------------------------------------------
|
| 308 |
+
|
| 309 |
+
class MagicsManager(Configurable):
|
| 310 |
+
"""Object that handles all magic-related functionality for IPython.
|
| 311 |
+
"""
|
| 312 |
+
# Non-configurable class attributes
|
| 313 |
+
|
| 314 |
+
# A two-level dict, first keyed by magic type, then by magic function, and
|
| 315 |
+
# holding the actual callable object as value. This is the dict used for
|
| 316 |
+
# magic function dispatch
|
| 317 |
+
magics = Dict()
|
| 318 |
+
lazy_magics = Dict(
|
| 319 |
+
help="""
|
| 320 |
+
Mapping from magic names to modules to load.
|
| 321 |
+
|
| 322 |
+
This can be used in IPython/IPykernel configuration to declare lazy magics
|
| 323 |
+
that will only be imported/registered on first use.
|
| 324 |
+
|
| 325 |
+
For example::
|
| 326 |
+
|
| 327 |
+
c.MagicsManager.lazy_magics = {
|
| 328 |
+
"my_magic": "slow.to.import",
|
| 329 |
+
"my_other_magic": "also.slow",
|
| 330 |
+
}
|
| 331 |
+
|
| 332 |
+
On first invocation of `%my_magic`, `%%my_magic`, `%%my_other_magic` or
|
| 333 |
+
`%%my_other_magic`, the corresponding module will be loaded as an ipython
|
| 334 |
+
extensions as if you had previously done `%load_ext ipython`.
|
| 335 |
+
|
| 336 |
+
Magics names should be without percent(s) as magics can be both cell
|
| 337 |
+
and line magics.
|
| 338 |
+
|
| 339 |
+
Lazy loading happen relatively late in execution process, and
|
| 340 |
+
complex extensions that manipulate Python/IPython internal state or global state
|
| 341 |
+
might not support lazy loading.
|
| 342 |
+
"""
|
| 343 |
+
).tag(
|
| 344 |
+
config=True,
|
| 345 |
+
)
|
| 346 |
+
|
| 347 |
+
# A registry of the original objects that we've been given holding magics.
|
| 348 |
+
registry = Dict()
|
| 349 |
+
|
| 350 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
| 351 |
+
|
| 352 |
+
auto_magic = Bool(True, help=
|
| 353 |
+
"Automatically call line magics without requiring explicit % prefix"
|
| 354 |
+
).tag(config=True)
|
| 355 |
+
@observe('auto_magic')
|
| 356 |
+
def _auto_magic_changed(self, change):
|
| 357 |
+
self.shell.automagic = change['new']
|
| 358 |
+
|
| 359 |
+
_auto_status = [
|
| 360 |
+
'Automagic is OFF, % prefix IS needed for line magics.',
|
| 361 |
+
'Automagic is ON, % prefix IS NOT needed for line magics.']
|
| 362 |
+
|
| 363 |
+
user_magics = Instance('IPython.core.magics.UserMagics', allow_none=True)
|
| 364 |
+
|
| 365 |
+
def __init__(self, shell=None, config=None, user_magics=None, **traits):
|
| 366 |
+
|
| 367 |
+
super(MagicsManager, self).__init__(shell=shell, config=config,
|
| 368 |
+
user_magics=user_magics, **traits)
|
| 369 |
+
self.magics = dict(line={}, cell={})
|
| 370 |
+
# Let's add the user_magics to the registry for uniformity, so *all*
|
| 371 |
+
# registered magic containers can be found there.
|
| 372 |
+
self.registry[user_magics.__class__.__name__] = user_magics
|
| 373 |
+
|
| 374 |
+
def auto_status(self):
|
| 375 |
+
"""Return descriptive string with automagic status."""
|
| 376 |
+
return self._auto_status[self.auto_magic]
|
| 377 |
+
|
| 378 |
+
def lsmagic(self):
|
| 379 |
+
"""Return a dict of currently available magic functions.
|
| 380 |
+
|
| 381 |
+
The return dict has the keys 'line' and 'cell', corresponding to the
|
| 382 |
+
two types of magics we support. Each value is a list of names.
|
| 383 |
+
"""
|
| 384 |
+
return self.magics
|
| 385 |
+
|
| 386 |
+
def lsmagic_docs(self, brief=False, missing=''):
|
| 387 |
+
"""Return dict of documentation of magic functions.
|
| 388 |
+
|
| 389 |
+
The return dict has the keys 'line' and 'cell', corresponding to the
|
| 390 |
+
two types of magics we support. Each value is a dict keyed by magic
|
| 391 |
+
name whose value is the function docstring. If a docstring is
|
| 392 |
+
unavailable, the value of `missing` is used instead.
|
| 393 |
+
|
| 394 |
+
If brief is True, only the first line of each docstring will be returned.
|
| 395 |
+
"""
|
| 396 |
+
docs = {}
|
| 397 |
+
for m_type in self.magics:
|
| 398 |
+
m_docs = {}
|
| 399 |
+
for m_name, m_func in self.magics[m_type].items():
|
| 400 |
+
if m_func.__doc__:
|
| 401 |
+
if brief:
|
| 402 |
+
m_docs[m_name] = m_func.__doc__.split('\n', 1)[0]
|
| 403 |
+
else:
|
| 404 |
+
m_docs[m_name] = m_func.__doc__.rstrip()
|
| 405 |
+
else:
|
| 406 |
+
m_docs[m_name] = missing
|
| 407 |
+
docs[m_type] = m_docs
|
| 408 |
+
return docs
|
| 409 |
+
|
| 410 |
+
def register_lazy(self, name: str, fully_qualified_name: str):
|
| 411 |
+
"""
|
| 412 |
+
Lazily register a magic via an extension.
|
| 413 |
+
|
| 414 |
+
|
| 415 |
+
Parameters
|
| 416 |
+
----------
|
| 417 |
+
name : str
|
| 418 |
+
Name of the magic you wish to register.
|
| 419 |
+
fully_qualified_name :
|
| 420 |
+
Fully qualified name of the module/submodule that should be loaded
|
| 421 |
+
as an extensions when the magic is first called.
|
| 422 |
+
It is assumed that loading this extensions will register the given
|
| 423 |
+
magic.
|
| 424 |
+
"""
|
| 425 |
+
|
| 426 |
+
self.lazy_magics[name] = fully_qualified_name
|
| 427 |
+
|
| 428 |
+
def register(self, *magic_objects):
|
| 429 |
+
"""Register one or more instances of Magics.
|
| 430 |
+
|
| 431 |
+
Take one or more classes or instances of classes that subclass the main
|
| 432 |
+
`core.Magic` class, and register them with IPython to use the magic
|
| 433 |
+
functions they provide. The registration process will then ensure that
|
| 434 |
+
any methods that have decorated to provide line and/or cell magics will
|
| 435 |
+
be recognized with the `%x`/`%%x` syntax as a line/cell magic
|
| 436 |
+
respectively.
|
| 437 |
+
|
| 438 |
+
If classes are given, they will be instantiated with the default
|
| 439 |
+
constructor. If your classes need a custom constructor, you should
|
| 440 |
+
instanitate them first and pass the instance.
|
| 441 |
+
|
| 442 |
+
The provided arguments can be an arbitrary mix of classes and instances.
|
| 443 |
+
|
| 444 |
+
Parameters
|
| 445 |
+
----------
|
| 446 |
+
*magic_objects : one or more classes or instances
|
| 447 |
+
"""
|
| 448 |
+
# Start by validating them to ensure they have all had their magic
|
| 449 |
+
# methods registered at the instance level
|
| 450 |
+
for m in magic_objects:
|
| 451 |
+
if not m.registered:
|
| 452 |
+
raise ValueError("Class of magics %r was constructed without "
|
| 453 |
+
"the @register_magics class decorator")
|
| 454 |
+
if isinstance(m, type):
|
| 455 |
+
# If we're given an uninstantiated class
|
| 456 |
+
m = m(shell=self.shell)
|
| 457 |
+
|
| 458 |
+
# Now that we have an instance, we can register it and update the
|
| 459 |
+
# table of callables
|
| 460 |
+
self.registry[m.__class__.__name__] = m
|
| 461 |
+
for mtype in magic_kinds:
|
| 462 |
+
self.magics[mtype].update(m.magics[mtype])
|
| 463 |
+
|
| 464 |
+
def register_function(self, func, magic_kind='line', magic_name=None):
|
| 465 |
+
"""Expose a standalone function as magic function for IPython.
|
| 466 |
+
|
| 467 |
+
This will create an IPython magic (line, cell or both) from a
|
| 468 |
+
standalone function. The functions should have the following
|
| 469 |
+
signatures:
|
| 470 |
+
|
| 471 |
+
* For line magics: `def f(line)`
|
| 472 |
+
* For cell magics: `def f(line, cell)`
|
| 473 |
+
* For a function that does both: `def f(line, cell=None)`
|
| 474 |
+
|
| 475 |
+
In the latter case, the function will be called with `cell==None` when
|
| 476 |
+
invoked as `%f`, and with cell as a string when invoked as `%%f`.
|
| 477 |
+
|
| 478 |
+
Parameters
|
| 479 |
+
----------
|
| 480 |
+
func : callable
|
| 481 |
+
Function to be registered as a magic.
|
| 482 |
+
magic_kind : str
|
| 483 |
+
Kind of magic, one of 'line', 'cell' or 'line_cell'
|
| 484 |
+
magic_name : optional str
|
| 485 |
+
If given, the name the magic will have in the IPython namespace. By
|
| 486 |
+
default, the name of the function itself is used.
|
| 487 |
+
"""
|
| 488 |
+
|
| 489 |
+
# Create the new method in the user_magics and register it in the
|
| 490 |
+
# global table
|
| 491 |
+
validate_type(magic_kind)
|
| 492 |
+
magic_name = func.__name__ if magic_name is None else magic_name
|
| 493 |
+
setattr(self.user_magics, magic_name, func)
|
| 494 |
+
record_magic(self.magics, magic_kind, magic_name, func)
|
| 495 |
+
|
| 496 |
+
def register_alias(self, alias_name, magic_name, magic_kind='line', magic_params=None):
|
| 497 |
+
"""Register an alias to a magic function.
|
| 498 |
+
|
| 499 |
+
The alias is an instance of :class:`MagicAlias`, which holds the
|
| 500 |
+
name and kind of the magic it should call. Binding is done at
|
| 501 |
+
call time, so if the underlying magic function is changed the alias
|
| 502 |
+
will call the new function.
|
| 503 |
+
|
| 504 |
+
Parameters
|
| 505 |
+
----------
|
| 506 |
+
alias_name : str
|
| 507 |
+
The name of the magic to be registered.
|
| 508 |
+
magic_name : str
|
| 509 |
+
The name of an existing magic.
|
| 510 |
+
magic_kind : str
|
| 511 |
+
Kind of magic, one of 'line' or 'cell'
|
| 512 |
+
"""
|
| 513 |
+
|
| 514 |
+
# `validate_type` is too permissive, as it allows 'line_cell'
|
| 515 |
+
# which we do not handle.
|
| 516 |
+
if magic_kind not in magic_kinds:
|
| 517 |
+
raise ValueError('magic_kind must be one of %s, %s given' %
|
| 518 |
+
magic_kinds, magic_kind)
|
| 519 |
+
|
| 520 |
+
alias = MagicAlias(self.shell, magic_name, magic_kind, magic_params)
|
| 521 |
+
setattr(self.user_magics, alias_name, alias)
|
| 522 |
+
record_magic(self.magics, magic_kind, alias_name, alias)
|
| 523 |
+
|
| 524 |
+
# Key base class that provides the central functionality for magics.
|
| 525 |
+
|
| 526 |
+
|
| 527 |
+
class Magics(Configurable):
|
| 528 |
+
"""Base class for implementing magic functions.
|
| 529 |
+
|
| 530 |
+
Shell functions which can be reached as %function_name. All magic
|
| 531 |
+
functions should accept a string, which they can parse for their own
|
| 532 |
+
needs. This can make some functions easier to type, eg `%cd ../`
|
| 533 |
+
vs. `%cd("../")`
|
| 534 |
+
|
| 535 |
+
Classes providing magic functions need to subclass this class, and they
|
| 536 |
+
MUST:
|
| 537 |
+
|
| 538 |
+
- Use the method decorators `@line_magic` and `@cell_magic` to decorate
|
| 539 |
+
individual methods as magic functions, AND
|
| 540 |
+
|
| 541 |
+
- Use the class decorator `@magics_class` to ensure that the magic
|
| 542 |
+
methods are properly registered at the instance level upon instance
|
| 543 |
+
initialization.
|
| 544 |
+
|
| 545 |
+
See :mod:`magic_functions` for examples of actual implementation classes.
|
| 546 |
+
"""
|
| 547 |
+
# Dict holding all command-line options for each magic.
|
| 548 |
+
options_table = None
|
| 549 |
+
# Dict for the mapping of magic names to methods, set by class decorator
|
| 550 |
+
magics = None
|
| 551 |
+
# Flag to check that the class decorator was properly applied
|
| 552 |
+
registered = False
|
| 553 |
+
# Instance of IPython shell
|
| 554 |
+
shell = None
|
| 555 |
+
|
| 556 |
+
def __init__(self, shell=None, **kwargs):
|
| 557 |
+
if not(self.__class__.registered):
|
| 558 |
+
raise ValueError('Magics subclass without registration - '
|
| 559 |
+
'did you forget to apply @magics_class?')
|
| 560 |
+
if shell is not None:
|
| 561 |
+
if hasattr(shell, 'configurables'):
|
| 562 |
+
shell.configurables.append(self)
|
| 563 |
+
if hasattr(shell, 'config'):
|
| 564 |
+
kwargs.setdefault('parent', shell)
|
| 565 |
+
|
| 566 |
+
self.shell = shell
|
| 567 |
+
self.options_table = {}
|
| 568 |
+
# The method decorators are run when the instance doesn't exist yet, so
|
| 569 |
+
# they can only record the names of the methods they are supposed to
|
| 570 |
+
# grab. Only now, that the instance exists, can we create the proper
|
| 571 |
+
# mapping to bound methods. So we read the info off the original names
|
| 572 |
+
# table and replace each method name by the actual bound method.
|
| 573 |
+
# But we mustn't clobber the *class* mapping, in case of multiple instances.
|
| 574 |
+
class_magics = self.magics
|
| 575 |
+
self.magics = {}
|
| 576 |
+
for mtype in magic_kinds:
|
| 577 |
+
tab = self.magics[mtype] = {}
|
| 578 |
+
cls_tab = class_magics[mtype]
|
| 579 |
+
for magic_name, meth_name in cls_tab.items():
|
| 580 |
+
if isinstance(meth_name, str):
|
| 581 |
+
# it's a method name, grab it
|
| 582 |
+
tab[magic_name] = getattr(self, meth_name)
|
| 583 |
+
else:
|
| 584 |
+
# it's the real thing
|
| 585 |
+
tab[magic_name] = meth_name
|
| 586 |
+
# Configurable **needs** to be initiated at the end or the config
|
| 587 |
+
# magics get screwed up.
|
| 588 |
+
super(Magics, self).__init__(**kwargs)
|
| 589 |
+
|
| 590 |
+
def arg_err(self,func):
|
| 591 |
+
"""Print docstring if incorrect arguments were passed"""
|
| 592 |
+
print('Error in arguments:')
|
| 593 |
+
print(oinspect.getdoc(func))
|
| 594 |
+
|
| 595 |
+
def format_latex(self, strng):
|
| 596 |
+
"""Format a string for latex inclusion."""
|
| 597 |
+
|
| 598 |
+
# Characters that need to be escaped for latex:
|
| 599 |
+
escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE)
|
| 600 |
+
# Magic command names as headers:
|
| 601 |
+
cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC,
|
| 602 |
+
re.MULTILINE)
|
| 603 |
+
# Magic commands
|
| 604 |
+
cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC,
|
| 605 |
+
re.MULTILINE)
|
| 606 |
+
# Paragraph continue
|
| 607 |
+
par_re = re.compile(r'\\$',re.MULTILINE)
|
| 608 |
+
|
| 609 |
+
# The "\n" symbol
|
| 610 |
+
newline_re = re.compile(r'\\n')
|
| 611 |
+
|
| 612 |
+
# Now build the string for output:
|
| 613 |
+
#strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng)
|
| 614 |
+
strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:',
|
| 615 |
+
strng)
|
| 616 |
+
strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng)
|
| 617 |
+
strng = par_re.sub(r'\\\\',strng)
|
| 618 |
+
strng = escape_re.sub(r'\\\1',strng)
|
| 619 |
+
strng = newline_re.sub(r'\\textbackslash{}n',strng)
|
| 620 |
+
return strng
|
| 621 |
+
|
| 622 |
+
def parse_options(self, arg_str, opt_str, *long_opts, **kw):
|
| 623 |
+
"""Parse options passed to an argument string.
|
| 624 |
+
|
| 625 |
+
The interface is similar to that of :func:`getopt.getopt`, but it
|
| 626 |
+
returns a :class:`~IPython.utils.struct.Struct` with the options as keys
|
| 627 |
+
and the stripped argument string still as a string.
|
| 628 |
+
|
| 629 |
+
arg_str is quoted as a true sys.argv vector by using shlex.split.
|
| 630 |
+
This allows us to easily expand variables, glob files, quote
|
| 631 |
+
arguments, etc.
|
| 632 |
+
|
| 633 |
+
Parameters
|
| 634 |
+
----------
|
| 635 |
+
arg_str : str
|
| 636 |
+
The arguments to parse.
|
| 637 |
+
opt_str : str
|
| 638 |
+
The options specification.
|
| 639 |
+
mode : str, default 'string'
|
| 640 |
+
If given as 'list', the argument string is returned as a list (split
|
| 641 |
+
on whitespace) instead of a string.
|
| 642 |
+
list_all : bool, default False
|
| 643 |
+
Put all option values in lists. Normally only options
|
| 644 |
+
appearing more than once are put in a list.
|
| 645 |
+
posix : bool, default True
|
| 646 |
+
Whether to split the input line in POSIX mode or not, as per the
|
| 647 |
+
conventions outlined in the :mod:`shlex` module from the standard
|
| 648 |
+
library.
|
| 649 |
+
"""
|
| 650 |
+
|
| 651 |
+
# inject default options at the beginning of the input line
|
| 652 |
+
caller = sys._getframe(1).f_code.co_name
|
| 653 |
+
arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str)
|
| 654 |
+
|
| 655 |
+
mode = kw.get('mode','string')
|
| 656 |
+
if mode not in ['string','list']:
|
| 657 |
+
raise ValueError('incorrect mode given: %s' % mode)
|
| 658 |
+
# Get options
|
| 659 |
+
list_all = kw.get('list_all',0)
|
| 660 |
+
posix = kw.get('posix', os.name == 'posix')
|
| 661 |
+
strict = kw.get('strict', True)
|
| 662 |
+
|
| 663 |
+
preserve_non_opts = kw.get("preserve_non_opts", False)
|
| 664 |
+
remainder_arg_str = arg_str
|
| 665 |
+
|
| 666 |
+
# Check if we have more than one argument to warrant extra processing:
|
| 667 |
+
odict = {} # Dictionary with options
|
| 668 |
+
args = arg_str.split()
|
| 669 |
+
if len(args) >= 1:
|
| 670 |
+
# If the list of inputs only has 0 or 1 thing in it, there's no
|
| 671 |
+
# need to look for options
|
| 672 |
+
argv = arg_split(arg_str, posix, strict)
|
| 673 |
+
# Do regular option processing
|
| 674 |
+
try:
|
| 675 |
+
opts,args = getopt(argv, opt_str, long_opts)
|
| 676 |
+
except GetoptError as e:
|
| 677 |
+
raise UsageError(
|
| 678 |
+
'%s ( allowed: "%s" %s)' % (e.msg, opt_str, " ".join(long_opts))
|
| 679 |
+
) from e
|
| 680 |
+
for o, a in opts:
|
| 681 |
+
if mode == "string" and preserve_non_opts:
|
| 682 |
+
# remove option-parts from the original args-string and preserve remaining-part.
|
| 683 |
+
# This relies on the arg_split(...) and getopt(...)'s impl spec, that the parsed options are
|
| 684 |
+
# returned in the original order.
|
| 685 |
+
remainder_arg_str = remainder_arg_str.replace(o, "", 1).replace(
|
| 686 |
+
a, "", 1
|
| 687 |
+
)
|
| 688 |
+
if o.startswith("--"):
|
| 689 |
+
o = o[2:]
|
| 690 |
+
else:
|
| 691 |
+
o = o[1:]
|
| 692 |
+
try:
|
| 693 |
+
odict[o].append(a)
|
| 694 |
+
except AttributeError:
|
| 695 |
+
odict[o] = [odict[o],a]
|
| 696 |
+
except KeyError:
|
| 697 |
+
if list_all:
|
| 698 |
+
odict[o] = [a]
|
| 699 |
+
else:
|
| 700 |
+
odict[o] = a
|
| 701 |
+
|
| 702 |
+
# Prepare opts,args for return
|
| 703 |
+
opts = Struct(odict)
|
| 704 |
+
if mode == 'string':
|
| 705 |
+
if preserve_non_opts:
|
| 706 |
+
args = remainder_arg_str.lstrip()
|
| 707 |
+
else:
|
| 708 |
+
args = " ".join(args)
|
| 709 |
+
|
| 710 |
+
return opts,args
|
| 711 |
+
|
| 712 |
+
def default_option(self, fn, optstr):
|
| 713 |
+
"""Make an entry in the options_table for fn, with value optstr"""
|
| 714 |
+
|
| 715 |
+
if fn not in self.lsmagic():
|
| 716 |
+
error("%s is not a magic function" % fn)
|
| 717 |
+
self.options_table[fn] = optstr
|
| 718 |
+
|
| 719 |
+
|
| 720 |
+
class MagicAlias(object):
|
| 721 |
+
"""An alias to another magic function.
|
| 722 |
+
|
| 723 |
+
An alias is determined by its magic name and magic kind. Lookup
|
| 724 |
+
is done at call time, so if the underlying magic changes the alias
|
| 725 |
+
will call the new function.
|
| 726 |
+
|
| 727 |
+
Use the :meth:`MagicsManager.register_alias` method or the
|
| 728 |
+
`%alias_magic` magic function to create and register a new alias.
|
| 729 |
+
"""
|
| 730 |
+
def __init__(self, shell, magic_name, magic_kind, magic_params=None):
|
| 731 |
+
self.shell = shell
|
| 732 |
+
self.magic_name = magic_name
|
| 733 |
+
self.magic_params = magic_params
|
| 734 |
+
self.magic_kind = magic_kind
|
| 735 |
+
|
| 736 |
+
self.pretty_target = '%s%s' % (magic_escapes[self.magic_kind], self.magic_name)
|
| 737 |
+
self.__doc__ = "Alias for `%s`." % self.pretty_target
|
| 738 |
+
|
| 739 |
+
self._in_call = False
|
| 740 |
+
|
| 741 |
+
def __call__(self, *args, **kwargs):
|
| 742 |
+
"""Call the magic alias."""
|
| 743 |
+
fn = self.shell.find_magic(self.magic_name, self.magic_kind)
|
| 744 |
+
if fn is None:
|
| 745 |
+
raise UsageError("Magic `%s` not found." % self.pretty_target)
|
| 746 |
+
|
| 747 |
+
# Protect against infinite recursion.
|
| 748 |
+
if self._in_call:
|
| 749 |
+
raise UsageError("Infinite recursion detected; "
|
| 750 |
+
"magic aliases cannot call themselves.")
|
| 751 |
+
self._in_call = True
|
| 752 |
+
try:
|
| 753 |
+
if self.magic_params:
|
| 754 |
+
args_list = list(args)
|
| 755 |
+
args_list[0] = self.magic_params + " " + args[0]
|
| 756 |
+
args = tuple(args_list)
|
| 757 |
+
return fn(*args, **kwargs)
|
| 758 |
+
finally:
|
| 759 |
+
self._in_call = False
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/oinspect.py
ADDED
|
@@ -0,0 +1,1283 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Tools for inspecting Python objects.
|
| 2 |
+
|
| 3 |
+
Uses syntax highlighting for presenting the various information elements.
|
| 4 |
+
|
| 5 |
+
Similar in spirit to the inspect module, but all calls take a name argument to
|
| 6 |
+
reference the name under which an object is being read.
|
| 7 |
+
"""
|
| 8 |
+
|
| 9 |
+
# Copyright (c) IPython Development Team.
|
| 10 |
+
# Distributed under the terms of the Modified BSD License.
|
| 11 |
+
|
| 12 |
+
__all__ = ['Inspector','InspectColors']
|
| 13 |
+
|
| 14 |
+
# stdlib modules
|
| 15 |
+
from dataclasses import dataclass
|
| 16 |
+
from inspect import signature
|
| 17 |
+
from textwrap import dedent
|
| 18 |
+
import ast
|
| 19 |
+
import html
|
| 20 |
+
import inspect
|
| 21 |
+
import io as stdlib_io
|
| 22 |
+
import linecache
|
| 23 |
+
import os
|
| 24 |
+
import types
|
| 25 |
+
import warnings
|
| 26 |
+
|
| 27 |
+
|
| 28 |
+
from typing import (
|
| 29 |
+
cast,
|
| 30 |
+
Any,
|
| 31 |
+
Optional,
|
| 32 |
+
Dict,
|
| 33 |
+
Union,
|
| 34 |
+
List,
|
| 35 |
+
TypedDict,
|
| 36 |
+
TypeAlias,
|
| 37 |
+
Tuple,
|
| 38 |
+
)
|
| 39 |
+
|
| 40 |
+
import traitlets
|
| 41 |
+
|
| 42 |
+
# IPython's own
|
| 43 |
+
from IPython.core import page
|
| 44 |
+
from IPython.lib.pretty import pretty
|
| 45 |
+
from IPython.testing.skipdoctest import skip_doctest
|
| 46 |
+
from IPython.utils import PyColorize, openpy
|
| 47 |
+
from IPython.utils.dir2 import safe_hasattr
|
| 48 |
+
from IPython.utils.path import compress_user
|
| 49 |
+
from IPython.utils.text import indent
|
| 50 |
+
from IPython.utils.wildcard import list_namespace, typestr2type
|
| 51 |
+
from IPython.utils.coloransi import TermColors
|
| 52 |
+
from IPython.utils.colorable import Colorable
|
| 53 |
+
from IPython.utils.decorators import undoc
|
| 54 |
+
|
| 55 |
+
from pygments import highlight
|
| 56 |
+
from pygments.lexers import PythonLexer
|
| 57 |
+
from pygments.formatters import HtmlFormatter
|
| 58 |
+
|
| 59 |
+
HOOK_NAME = "__custom_documentations__"
|
| 60 |
+
|
| 61 |
+
|
| 62 |
+
UnformattedBundle: TypeAlias = Dict[str, List[Tuple[str, str]]] # List of (title, body)
|
| 63 |
+
Bundle: TypeAlias = Dict[str, str]
|
| 64 |
+
|
| 65 |
+
|
| 66 |
+
@dataclass
|
| 67 |
+
class OInfo:
|
| 68 |
+
ismagic: bool
|
| 69 |
+
isalias: bool
|
| 70 |
+
found: bool
|
| 71 |
+
namespace: Optional[str]
|
| 72 |
+
parent: Any
|
| 73 |
+
obj: Any
|
| 74 |
+
|
| 75 |
+
def get(self, field):
|
| 76 |
+
"""Get a field from the object for backward compatibility with before 8.12
|
| 77 |
+
|
| 78 |
+
see https://github.com/h5py/h5py/issues/2253
|
| 79 |
+
"""
|
| 80 |
+
# We need to deprecate this at some point, but the warning will show in completion.
|
| 81 |
+
# Let's comment this for now and uncomment end of 2023 ish
|
| 82 |
+
# warnings.warn(
|
| 83 |
+
# f"OInfo dataclass with fields access since IPython 8.12 please use OInfo.{field} instead."
|
| 84 |
+
# "OInfo used to be a dict but a dataclass provide static fields verification with mypy."
|
| 85 |
+
# "This warning and backward compatibility `get()` method were added in 8.13.",
|
| 86 |
+
# DeprecationWarning,
|
| 87 |
+
# stacklevel=2,
|
| 88 |
+
# )
|
| 89 |
+
return getattr(self, field)
|
| 90 |
+
|
| 91 |
+
|
| 92 |
+
def pylight(code):
|
| 93 |
+
return highlight(code, PythonLexer(), HtmlFormatter(noclasses=True))
|
| 94 |
+
|
| 95 |
+
# builtin docstrings to ignore
|
| 96 |
+
_func_call_docstring = types.FunctionType.__call__.__doc__
|
| 97 |
+
_object_init_docstring = object.__init__.__doc__
|
| 98 |
+
_builtin_type_docstrings = {
|
| 99 |
+
inspect.getdoc(t) for t in (types.ModuleType, types.MethodType,
|
| 100 |
+
types.FunctionType, property)
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
_builtin_func_type = type(all)
|
| 104 |
+
_builtin_meth_type = type(str.upper) # Bound methods have the same type as builtin functions
|
| 105 |
+
#****************************************************************************
|
| 106 |
+
# Builtin color schemes
|
| 107 |
+
|
| 108 |
+
Colors = TermColors # just a shorthand
|
| 109 |
+
|
| 110 |
+
InspectColors = PyColorize.ANSICodeColors
|
| 111 |
+
|
| 112 |
+
#****************************************************************************
|
| 113 |
+
# Auxiliary functions and objects
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
class InfoDict(TypedDict):
|
| 117 |
+
type_name: Optional[str]
|
| 118 |
+
base_class: Optional[str]
|
| 119 |
+
string_form: Optional[str]
|
| 120 |
+
namespace: Optional[str]
|
| 121 |
+
length: Optional[str]
|
| 122 |
+
file: Optional[str]
|
| 123 |
+
definition: Optional[str]
|
| 124 |
+
docstring: Optional[str]
|
| 125 |
+
source: Optional[str]
|
| 126 |
+
init_definition: Optional[str]
|
| 127 |
+
class_docstring: Optional[str]
|
| 128 |
+
init_docstring: Optional[str]
|
| 129 |
+
call_def: Optional[str]
|
| 130 |
+
call_docstring: Optional[str]
|
| 131 |
+
subclasses: Optional[str]
|
| 132 |
+
# These won't be printed but will be used to determine how to
|
| 133 |
+
# format the object
|
| 134 |
+
ismagic: bool
|
| 135 |
+
isalias: bool
|
| 136 |
+
isclass: bool
|
| 137 |
+
found: bool
|
| 138 |
+
name: str
|
| 139 |
+
|
| 140 |
+
|
| 141 |
+
_info_fields = list(InfoDict.__annotations__.keys())
|
| 142 |
+
|
| 143 |
+
|
| 144 |
+
def __getattr__(name):
|
| 145 |
+
if name == "info_fields":
|
| 146 |
+
warnings.warn(
|
| 147 |
+
"IPython.core.oinspect's `info_fields` is considered for deprecation and may be removed in the Future. ",
|
| 148 |
+
DeprecationWarning,
|
| 149 |
+
stacklevel=2,
|
| 150 |
+
)
|
| 151 |
+
return _info_fields
|
| 152 |
+
|
| 153 |
+
raise AttributeError(f"module {__name__!r} has no attribute {name!r}")
|
| 154 |
+
|
| 155 |
+
|
| 156 |
+
@dataclass
|
| 157 |
+
class InspectorHookData:
|
| 158 |
+
"""Data passed to the mime hook"""
|
| 159 |
+
|
| 160 |
+
obj: Any
|
| 161 |
+
info: Optional[OInfo]
|
| 162 |
+
info_dict: InfoDict
|
| 163 |
+
detail_level: int
|
| 164 |
+
omit_sections: list[str]
|
| 165 |
+
|
| 166 |
+
|
| 167 |
+
@undoc
|
| 168 |
+
def object_info(
|
| 169 |
+
*,
|
| 170 |
+
name: str,
|
| 171 |
+
found: bool,
|
| 172 |
+
isclass: bool = False,
|
| 173 |
+
isalias: bool = False,
|
| 174 |
+
ismagic: bool = False,
|
| 175 |
+
**kw,
|
| 176 |
+
) -> InfoDict:
|
| 177 |
+
"""Make an object info dict with all fields present."""
|
| 178 |
+
infodict = kw
|
| 179 |
+
infodict = {k: None for k in _info_fields if k not in infodict}
|
| 180 |
+
infodict["name"] = name # type: ignore
|
| 181 |
+
infodict["found"] = found # type: ignore
|
| 182 |
+
infodict["isclass"] = isclass # type: ignore
|
| 183 |
+
infodict["isalias"] = isalias # type: ignore
|
| 184 |
+
infodict["ismagic"] = ismagic # type: ignore
|
| 185 |
+
|
| 186 |
+
return InfoDict(**infodict) # type:ignore
|
| 187 |
+
|
| 188 |
+
|
| 189 |
+
def get_encoding(obj):
|
| 190 |
+
"""Get encoding for python source file defining obj
|
| 191 |
+
|
| 192 |
+
Returns None if obj is not defined in a sourcefile.
|
| 193 |
+
"""
|
| 194 |
+
ofile = find_file(obj)
|
| 195 |
+
# run contents of file through pager starting at line where the object
|
| 196 |
+
# is defined, as long as the file isn't binary and is actually on the
|
| 197 |
+
# filesystem.
|
| 198 |
+
if ofile is None:
|
| 199 |
+
return None
|
| 200 |
+
elif ofile.endswith(('.so', '.dll', '.pyd')):
|
| 201 |
+
return None
|
| 202 |
+
elif not os.path.isfile(ofile):
|
| 203 |
+
return None
|
| 204 |
+
else:
|
| 205 |
+
# Print only text files, not extension binaries. Note that
|
| 206 |
+
# getsourcelines returns lineno with 1-offset and page() uses
|
| 207 |
+
# 0-offset, so we must adjust.
|
| 208 |
+
with stdlib_io.open(ofile, 'rb') as buffer: # Tweaked to use io.open for Python 2
|
| 209 |
+
encoding, _lines = openpy.detect_encoding(buffer.readline)
|
| 210 |
+
return encoding
|
| 211 |
+
|
| 212 |
+
|
| 213 |
+
def getdoc(obj) -> Union[str, None]:
|
| 214 |
+
"""Stable wrapper around inspect.getdoc.
|
| 215 |
+
|
| 216 |
+
This can't crash because of attribute problems.
|
| 217 |
+
|
| 218 |
+
It also attempts to call a getdoc() method on the given object. This
|
| 219 |
+
allows objects which provide their docstrings via non-standard mechanisms
|
| 220 |
+
(like Pyro proxies) to still be inspected by ipython's ? system.
|
| 221 |
+
"""
|
| 222 |
+
# Allow objects to offer customized documentation via a getdoc method:
|
| 223 |
+
try:
|
| 224 |
+
ds = obj.getdoc()
|
| 225 |
+
except Exception:
|
| 226 |
+
pass
|
| 227 |
+
else:
|
| 228 |
+
if isinstance(ds, str):
|
| 229 |
+
return inspect.cleandoc(ds)
|
| 230 |
+
docstr = inspect.getdoc(obj)
|
| 231 |
+
return docstr
|
| 232 |
+
|
| 233 |
+
|
| 234 |
+
def getsource(obj, oname='') -> Union[str,None]:
|
| 235 |
+
"""Wrapper around inspect.getsource.
|
| 236 |
+
|
| 237 |
+
This can be modified by other projects to provide customized source
|
| 238 |
+
extraction.
|
| 239 |
+
|
| 240 |
+
Parameters
|
| 241 |
+
----------
|
| 242 |
+
obj : object
|
| 243 |
+
an object whose source code we will attempt to extract
|
| 244 |
+
oname : str
|
| 245 |
+
(optional) a name under which the object is known
|
| 246 |
+
|
| 247 |
+
Returns
|
| 248 |
+
-------
|
| 249 |
+
src : unicode or None
|
| 250 |
+
|
| 251 |
+
"""
|
| 252 |
+
|
| 253 |
+
if isinstance(obj, property):
|
| 254 |
+
sources = []
|
| 255 |
+
for attrname in ['fget', 'fset', 'fdel']:
|
| 256 |
+
fn = getattr(obj, attrname)
|
| 257 |
+
if fn is not None:
|
| 258 |
+
encoding = get_encoding(fn)
|
| 259 |
+
oname_prefix = ('%s.' % oname) if oname else ''
|
| 260 |
+
sources.append(''.join(('# ', oname_prefix, attrname)))
|
| 261 |
+
if inspect.isfunction(fn):
|
| 262 |
+
_src = getsource(fn)
|
| 263 |
+
if _src:
|
| 264 |
+
# assert _src is not None, "please mypy"
|
| 265 |
+
sources.append(dedent(_src))
|
| 266 |
+
else:
|
| 267 |
+
# Default str/repr only prints function name,
|
| 268 |
+
# pretty.pretty prints module name too.
|
| 269 |
+
sources.append(
|
| 270 |
+
'%s%s = %s\n' % (oname_prefix, attrname, pretty(fn))
|
| 271 |
+
)
|
| 272 |
+
if sources:
|
| 273 |
+
return '\n'.join(sources)
|
| 274 |
+
else:
|
| 275 |
+
return None
|
| 276 |
+
|
| 277 |
+
else:
|
| 278 |
+
# Get source for non-property objects.
|
| 279 |
+
|
| 280 |
+
obj = _get_wrapped(obj)
|
| 281 |
+
|
| 282 |
+
try:
|
| 283 |
+
src = inspect.getsource(obj)
|
| 284 |
+
except TypeError:
|
| 285 |
+
# The object itself provided no meaningful source, try looking for
|
| 286 |
+
# its class definition instead.
|
| 287 |
+
try:
|
| 288 |
+
src = inspect.getsource(obj.__class__)
|
| 289 |
+
except (OSError, TypeError):
|
| 290 |
+
return None
|
| 291 |
+
except OSError:
|
| 292 |
+
return None
|
| 293 |
+
|
| 294 |
+
return src
|
| 295 |
+
|
| 296 |
+
|
| 297 |
+
def is_simple_callable(obj):
|
| 298 |
+
"""True if obj is a function ()"""
|
| 299 |
+
return (inspect.isfunction(obj) or inspect.ismethod(obj) or \
|
| 300 |
+
isinstance(obj, _builtin_func_type) or isinstance(obj, _builtin_meth_type))
|
| 301 |
+
|
| 302 |
+
@undoc
|
| 303 |
+
def getargspec(obj):
|
| 304 |
+
"""Wrapper around :func:`inspect.getfullargspec`
|
| 305 |
+
|
| 306 |
+
In addition to functions and methods, this can also handle objects with a
|
| 307 |
+
``__call__`` attribute.
|
| 308 |
+
|
| 309 |
+
DEPRECATED: Deprecated since 7.10. Do not use, will be removed.
|
| 310 |
+
"""
|
| 311 |
+
|
| 312 |
+
warnings.warn('`getargspec` function is deprecated as of IPython 7.10'
|
| 313 |
+
'and will be removed in future versions.', DeprecationWarning, stacklevel=2)
|
| 314 |
+
|
| 315 |
+
if safe_hasattr(obj, '__call__') and not is_simple_callable(obj):
|
| 316 |
+
obj = obj.__call__
|
| 317 |
+
|
| 318 |
+
return inspect.getfullargspec(obj)
|
| 319 |
+
|
| 320 |
+
@undoc
|
| 321 |
+
def format_argspec(argspec):
|
| 322 |
+
"""Format argspect, convenience wrapper around inspect's.
|
| 323 |
+
|
| 324 |
+
This takes a dict instead of ordered arguments and calls
|
| 325 |
+
inspect.format_argspec with the arguments in the necessary order.
|
| 326 |
+
|
| 327 |
+
DEPRECATED (since 7.10): Do not use; will be removed in future versions.
|
| 328 |
+
"""
|
| 329 |
+
|
| 330 |
+
warnings.warn('`format_argspec` function is deprecated as of IPython 7.10'
|
| 331 |
+
'and will be removed in future versions.', DeprecationWarning, stacklevel=2)
|
| 332 |
+
|
| 333 |
+
|
| 334 |
+
return inspect.formatargspec(argspec['args'], argspec['varargs'],
|
| 335 |
+
argspec['varkw'], argspec['defaults'])
|
| 336 |
+
|
| 337 |
+
@undoc
|
| 338 |
+
def call_tip(oinfo, format_call=True):
|
| 339 |
+
"""DEPRECATED since 6.0. Extract call tip data from an oinfo dict."""
|
| 340 |
+
warnings.warn(
|
| 341 |
+
"`call_tip` function is deprecated as of IPython 6.0"
|
| 342 |
+
"and will be removed in future versions.",
|
| 343 |
+
DeprecationWarning,
|
| 344 |
+
stacklevel=2,
|
| 345 |
+
)
|
| 346 |
+
# Get call definition
|
| 347 |
+
argspec = oinfo.get('argspec')
|
| 348 |
+
if argspec is None:
|
| 349 |
+
call_line = None
|
| 350 |
+
else:
|
| 351 |
+
# Callable objects will have 'self' as their first argument, prune
|
| 352 |
+
# it out if it's there for clarity (since users do *not* pass an
|
| 353 |
+
# extra first argument explicitly).
|
| 354 |
+
try:
|
| 355 |
+
has_self = argspec['args'][0] == 'self'
|
| 356 |
+
except (KeyError, IndexError):
|
| 357 |
+
pass
|
| 358 |
+
else:
|
| 359 |
+
if has_self:
|
| 360 |
+
argspec['args'] = argspec['args'][1:]
|
| 361 |
+
|
| 362 |
+
call_line = oinfo['name']+format_argspec(argspec)
|
| 363 |
+
|
| 364 |
+
# Now get docstring.
|
| 365 |
+
# The priority is: call docstring, constructor docstring, main one.
|
| 366 |
+
doc = oinfo.get('call_docstring')
|
| 367 |
+
if doc is None:
|
| 368 |
+
doc = oinfo.get('init_docstring')
|
| 369 |
+
if doc is None:
|
| 370 |
+
doc = oinfo.get('docstring','')
|
| 371 |
+
|
| 372 |
+
return call_line, doc
|
| 373 |
+
|
| 374 |
+
|
| 375 |
+
def _get_wrapped(obj):
|
| 376 |
+
"""Get the original object if wrapped in one or more @decorators
|
| 377 |
+
|
| 378 |
+
Some objects automatically construct similar objects on any unrecognised
|
| 379 |
+
attribute access (e.g. unittest.mock.call). To protect against infinite loops,
|
| 380 |
+
this will arbitrarily cut off after 100 levels of obj.__wrapped__
|
| 381 |
+
attribute access. --TK, Jan 2016
|
| 382 |
+
"""
|
| 383 |
+
orig_obj = obj
|
| 384 |
+
i = 0
|
| 385 |
+
while safe_hasattr(obj, '__wrapped__'):
|
| 386 |
+
obj = obj.__wrapped__
|
| 387 |
+
i += 1
|
| 388 |
+
if i > 100:
|
| 389 |
+
# __wrapped__ is probably a lie, so return the thing we started with
|
| 390 |
+
return orig_obj
|
| 391 |
+
return obj
|
| 392 |
+
|
| 393 |
+
def find_file(obj) -> Optional[str]:
|
| 394 |
+
"""Find the absolute path to the file where an object was defined.
|
| 395 |
+
|
| 396 |
+
This is essentially a robust wrapper around `inspect.getabsfile`.
|
| 397 |
+
|
| 398 |
+
Returns None if no file can be found.
|
| 399 |
+
|
| 400 |
+
Parameters
|
| 401 |
+
----------
|
| 402 |
+
obj : any Python object
|
| 403 |
+
|
| 404 |
+
Returns
|
| 405 |
+
-------
|
| 406 |
+
fname : str
|
| 407 |
+
The absolute path to the file where the object was defined.
|
| 408 |
+
"""
|
| 409 |
+
obj = _get_wrapped(obj)
|
| 410 |
+
|
| 411 |
+
fname: Optional[str] = None
|
| 412 |
+
try:
|
| 413 |
+
fname = inspect.getabsfile(obj)
|
| 414 |
+
except TypeError:
|
| 415 |
+
# For an instance, the file that matters is where its class was
|
| 416 |
+
# declared.
|
| 417 |
+
try:
|
| 418 |
+
fname = inspect.getabsfile(obj.__class__)
|
| 419 |
+
except (OSError, TypeError):
|
| 420 |
+
# Can happen for builtins
|
| 421 |
+
pass
|
| 422 |
+
except OSError:
|
| 423 |
+
pass
|
| 424 |
+
|
| 425 |
+
return fname
|
| 426 |
+
|
| 427 |
+
|
| 428 |
+
def find_source_lines(obj):
|
| 429 |
+
"""Find the line number in a file where an object was defined.
|
| 430 |
+
|
| 431 |
+
This is essentially a robust wrapper around `inspect.getsourcelines`.
|
| 432 |
+
|
| 433 |
+
Returns None if no file can be found.
|
| 434 |
+
|
| 435 |
+
Parameters
|
| 436 |
+
----------
|
| 437 |
+
obj : any Python object
|
| 438 |
+
|
| 439 |
+
Returns
|
| 440 |
+
-------
|
| 441 |
+
lineno : int
|
| 442 |
+
The line number where the object definition starts.
|
| 443 |
+
"""
|
| 444 |
+
obj = _get_wrapped(obj)
|
| 445 |
+
|
| 446 |
+
try:
|
| 447 |
+
lineno = inspect.getsourcelines(obj)[1]
|
| 448 |
+
except TypeError:
|
| 449 |
+
# For instances, try the class object like getsource() does
|
| 450 |
+
try:
|
| 451 |
+
lineno = inspect.getsourcelines(obj.__class__)[1]
|
| 452 |
+
except (OSError, TypeError):
|
| 453 |
+
return None
|
| 454 |
+
except OSError:
|
| 455 |
+
return None
|
| 456 |
+
|
| 457 |
+
return lineno
|
| 458 |
+
|
| 459 |
+
class Inspector(Colorable):
|
| 460 |
+
|
| 461 |
+
mime_hooks = traitlets.Dict(
|
| 462 |
+
config=True,
|
| 463 |
+
help="dictionary of mime to callable to add information into help mimebundle dict",
|
| 464 |
+
).tag(config=True)
|
| 465 |
+
|
| 466 |
+
def __init__(
|
| 467 |
+
self,
|
| 468 |
+
color_table=InspectColors,
|
| 469 |
+
code_color_table=PyColorize.ANSICodeColors,
|
| 470 |
+
scheme=None,
|
| 471 |
+
str_detail_level=0,
|
| 472 |
+
parent=None,
|
| 473 |
+
config=None,
|
| 474 |
+
):
|
| 475 |
+
super(Inspector, self).__init__(parent=parent, config=config)
|
| 476 |
+
self.color_table = color_table
|
| 477 |
+
self.parser = PyColorize.Parser(out='str', parent=self, style=scheme)
|
| 478 |
+
self.format = self.parser.format
|
| 479 |
+
self.str_detail_level = str_detail_level
|
| 480 |
+
self.set_active_scheme(scheme)
|
| 481 |
+
|
| 482 |
+
def _getdef(self,obj,oname='') -> Union[str,None]:
|
| 483 |
+
"""Return the call signature for any callable object.
|
| 484 |
+
|
| 485 |
+
If any exception is generated, None is returned instead and the
|
| 486 |
+
exception is suppressed."""
|
| 487 |
+
if not callable(obj):
|
| 488 |
+
return None
|
| 489 |
+
try:
|
| 490 |
+
return _render_signature(signature(obj), oname)
|
| 491 |
+
except:
|
| 492 |
+
return None
|
| 493 |
+
|
| 494 |
+
def __head(self,h) -> str:
|
| 495 |
+
"""Return a header string with proper colors."""
|
| 496 |
+
return '%s%s%s' % (self.color_table.active_colors.header,h,
|
| 497 |
+
self.color_table.active_colors.normal)
|
| 498 |
+
|
| 499 |
+
def set_active_scheme(self, scheme):
|
| 500 |
+
if scheme is not None:
|
| 501 |
+
self.color_table.set_active_scheme(scheme)
|
| 502 |
+
self.parser.color_table.set_active_scheme(scheme)
|
| 503 |
+
|
| 504 |
+
def noinfo(self, msg, oname):
|
| 505 |
+
"""Generic message when no information is found."""
|
| 506 |
+
print('No %s found' % msg, end=' ')
|
| 507 |
+
if oname:
|
| 508 |
+
print('for %s' % oname)
|
| 509 |
+
else:
|
| 510 |
+
print()
|
| 511 |
+
|
| 512 |
+
def pdef(self, obj, oname=''):
|
| 513 |
+
"""Print the call signature for any callable object.
|
| 514 |
+
|
| 515 |
+
If the object is a class, print the constructor information."""
|
| 516 |
+
|
| 517 |
+
if not callable(obj):
|
| 518 |
+
print('Object is not callable.')
|
| 519 |
+
return
|
| 520 |
+
|
| 521 |
+
header = ''
|
| 522 |
+
|
| 523 |
+
if inspect.isclass(obj):
|
| 524 |
+
header = self.__head('Class constructor information:\n')
|
| 525 |
+
|
| 526 |
+
|
| 527 |
+
output = self._getdef(obj,oname)
|
| 528 |
+
if output is None:
|
| 529 |
+
self.noinfo('definition header',oname)
|
| 530 |
+
else:
|
| 531 |
+
print(header,self.format(output), end=' ')
|
| 532 |
+
|
| 533 |
+
# In Python 3, all classes are new-style, so they all have __init__.
|
| 534 |
+
@skip_doctest
|
| 535 |
+
def pdoc(self, obj, oname='', formatter=None):
|
| 536 |
+
"""Print the docstring for any object.
|
| 537 |
+
|
| 538 |
+
Optional:
|
| 539 |
+
-formatter: a function to run the docstring through for specially
|
| 540 |
+
formatted docstrings.
|
| 541 |
+
|
| 542 |
+
Examples
|
| 543 |
+
--------
|
| 544 |
+
In [1]: class NoInit:
|
| 545 |
+
...: pass
|
| 546 |
+
|
| 547 |
+
In [2]: class NoDoc:
|
| 548 |
+
...: def __init__(self):
|
| 549 |
+
...: pass
|
| 550 |
+
|
| 551 |
+
In [3]: %pdoc NoDoc
|
| 552 |
+
No documentation found for NoDoc
|
| 553 |
+
|
| 554 |
+
In [4]: %pdoc NoInit
|
| 555 |
+
No documentation found for NoInit
|
| 556 |
+
|
| 557 |
+
In [5]: obj = NoInit()
|
| 558 |
+
|
| 559 |
+
In [6]: %pdoc obj
|
| 560 |
+
No documentation found for obj
|
| 561 |
+
|
| 562 |
+
In [5]: obj2 = NoDoc()
|
| 563 |
+
|
| 564 |
+
In [6]: %pdoc obj2
|
| 565 |
+
No documentation found for obj2
|
| 566 |
+
"""
|
| 567 |
+
|
| 568 |
+
head = self.__head # For convenience
|
| 569 |
+
lines = []
|
| 570 |
+
ds = getdoc(obj)
|
| 571 |
+
if formatter:
|
| 572 |
+
ds = formatter(ds).get('plain/text', ds)
|
| 573 |
+
if ds:
|
| 574 |
+
lines.append(head("Class docstring:"))
|
| 575 |
+
lines.append(indent(ds))
|
| 576 |
+
if inspect.isclass(obj) and hasattr(obj, '__init__'):
|
| 577 |
+
init_ds = getdoc(obj.__init__)
|
| 578 |
+
if init_ds is not None:
|
| 579 |
+
lines.append(head("Init docstring:"))
|
| 580 |
+
lines.append(indent(init_ds))
|
| 581 |
+
elif hasattr(obj,'__call__'):
|
| 582 |
+
call_ds = getdoc(obj.__call__)
|
| 583 |
+
if call_ds:
|
| 584 |
+
lines.append(head("Call docstring:"))
|
| 585 |
+
lines.append(indent(call_ds))
|
| 586 |
+
|
| 587 |
+
if not lines:
|
| 588 |
+
self.noinfo('documentation',oname)
|
| 589 |
+
else:
|
| 590 |
+
page.page('\n'.join(lines))
|
| 591 |
+
|
| 592 |
+
def psource(self, obj, oname=''):
|
| 593 |
+
"""Print the source code for an object."""
|
| 594 |
+
|
| 595 |
+
# Flush the source cache because inspect can return out-of-date source
|
| 596 |
+
linecache.checkcache()
|
| 597 |
+
try:
|
| 598 |
+
src = getsource(obj, oname=oname)
|
| 599 |
+
except Exception:
|
| 600 |
+
src = None
|
| 601 |
+
|
| 602 |
+
if src is None:
|
| 603 |
+
self.noinfo('source', oname)
|
| 604 |
+
else:
|
| 605 |
+
page.page(self.format(src))
|
| 606 |
+
|
| 607 |
+
def pfile(self, obj, oname=''):
|
| 608 |
+
"""Show the whole file where an object was defined."""
|
| 609 |
+
|
| 610 |
+
lineno = find_source_lines(obj)
|
| 611 |
+
if lineno is None:
|
| 612 |
+
self.noinfo('file', oname)
|
| 613 |
+
return
|
| 614 |
+
|
| 615 |
+
ofile = find_file(obj)
|
| 616 |
+
# run contents of file through pager starting at line where the object
|
| 617 |
+
# is defined, as long as the file isn't binary and is actually on the
|
| 618 |
+
# filesystem.
|
| 619 |
+
if ofile is None:
|
| 620 |
+
print("Could not find file for object")
|
| 621 |
+
elif ofile.endswith((".so", ".dll", ".pyd")):
|
| 622 |
+
print("File %r is binary, not printing." % ofile)
|
| 623 |
+
elif not os.path.isfile(ofile):
|
| 624 |
+
print('File %r does not exist, not printing.' % ofile)
|
| 625 |
+
else:
|
| 626 |
+
# Print only text files, not extension binaries. Note that
|
| 627 |
+
# getsourcelines returns lineno with 1-offset and page() uses
|
| 628 |
+
# 0-offset, so we must adjust.
|
| 629 |
+
page.page(self.format(openpy.read_py_file(ofile, skip_encoding_cookie=False)), lineno - 1)
|
| 630 |
+
|
| 631 |
+
|
| 632 |
+
def _mime_format(self, text:str, formatter=None) -> dict:
|
| 633 |
+
"""Return a mime bundle representation of the input text.
|
| 634 |
+
|
| 635 |
+
- if `formatter` is None, the returned mime bundle has
|
| 636 |
+
a ``text/plain`` field, with the input text.
|
| 637 |
+
a ``text/html`` field with a ``<pre>`` tag containing the input text.
|
| 638 |
+
|
| 639 |
+
- if ``formatter`` is not None, it must be a callable transforming the
|
| 640 |
+
input text into a mime bundle. Default values for ``text/plain`` and
|
| 641 |
+
``text/html`` representations are the ones described above.
|
| 642 |
+
|
| 643 |
+
Note:
|
| 644 |
+
|
| 645 |
+
Formatters returning strings are supported but this behavior is deprecated.
|
| 646 |
+
|
| 647 |
+
"""
|
| 648 |
+
defaults = {
|
| 649 |
+
"text/plain": text,
|
| 650 |
+
"text/html": f"<pre>{html.escape(text)}</pre>",
|
| 651 |
+
}
|
| 652 |
+
|
| 653 |
+
if formatter is None:
|
| 654 |
+
return defaults
|
| 655 |
+
else:
|
| 656 |
+
formatted = formatter(text)
|
| 657 |
+
|
| 658 |
+
if not isinstance(formatted, dict):
|
| 659 |
+
# Handle the deprecated behavior of a formatter returning
|
| 660 |
+
# a string instead of a mime bundle.
|
| 661 |
+
return {"text/plain": formatted, "text/html": f"<pre>{formatted}</pre>"}
|
| 662 |
+
|
| 663 |
+
else:
|
| 664 |
+
return dict(defaults, **formatted)
|
| 665 |
+
|
| 666 |
+
def format_mime(self, bundle: UnformattedBundle) -> Bundle:
|
| 667 |
+
"""Format a mimebundle being created by _make_info_unformatted into a real mimebundle"""
|
| 668 |
+
# Format text/plain mimetype
|
| 669 |
+
assert isinstance(bundle["text/plain"], list)
|
| 670 |
+
for item in bundle["text/plain"]:
|
| 671 |
+
assert isinstance(item, tuple)
|
| 672 |
+
|
| 673 |
+
new_b: Bundle = {}
|
| 674 |
+
lines = []
|
| 675 |
+
_len = max(len(h) for h, _ in bundle["text/plain"])
|
| 676 |
+
|
| 677 |
+
for head, body in bundle["text/plain"]:
|
| 678 |
+
body = body.strip("\n")
|
| 679 |
+
delim = "\n" if "\n" in body else " "
|
| 680 |
+
lines.append(
|
| 681 |
+
f"{self.__head(head+':')}{(_len - len(head))*' '}{delim}{body}"
|
| 682 |
+
)
|
| 683 |
+
|
| 684 |
+
new_b["text/plain"] = "\n".join(lines)
|
| 685 |
+
|
| 686 |
+
if "text/html" in bundle:
|
| 687 |
+
assert isinstance(bundle["text/html"], list)
|
| 688 |
+
for item in bundle["text/html"]:
|
| 689 |
+
assert isinstance(item, tuple)
|
| 690 |
+
# Format the text/html mimetype
|
| 691 |
+
if isinstance(bundle["text/html"], (list, tuple)):
|
| 692 |
+
# bundle['text/html'] is a list of (head, formatted body) pairs
|
| 693 |
+
new_b["text/html"] = "\n".join(
|
| 694 |
+
(f"<h1>{head}</h1>\n{body}" for (head, body) in bundle["text/html"])
|
| 695 |
+
)
|
| 696 |
+
|
| 697 |
+
for k in bundle.keys():
|
| 698 |
+
if k in ("text/html", "text/plain"):
|
| 699 |
+
continue
|
| 700 |
+
else:
|
| 701 |
+
new_b[k] = bundle[k] # type:ignore
|
| 702 |
+
return new_b
|
| 703 |
+
|
| 704 |
+
def _append_info_field(
|
| 705 |
+
self,
|
| 706 |
+
bundle: UnformattedBundle,
|
| 707 |
+
title: str,
|
| 708 |
+
key: str,
|
| 709 |
+
info,
|
| 710 |
+
omit_sections: List[str],
|
| 711 |
+
formatter,
|
| 712 |
+
):
|
| 713 |
+
"""Append an info value to the unformatted mimebundle being constructed by _make_info_unformatted"""
|
| 714 |
+
if title in omit_sections or key in omit_sections:
|
| 715 |
+
return
|
| 716 |
+
field = info[key]
|
| 717 |
+
if field is not None:
|
| 718 |
+
formatted_field = self._mime_format(field, formatter)
|
| 719 |
+
bundle["text/plain"].append((title, formatted_field["text/plain"]))
|
| 720 |
+
bundle["text/html"].append((title, formatted_field["text/html"]))
|
| 721 |
+
|
| 722 |
+
def _make_info_unformatted(
|
| 723 |
+
self, obj, info, formatter, detail_level, omit_sections
|
| 724 |
+
) -> UnformattedBundle:
|
| 725 |
+
"""Assemble the mimebundle as unformatted lists of information"""
|
| 726 |
+
bundle: UnformattedBundle = {
|
| 727 |
+
"text/plain": [],
|
| 728 |
+
"text/html": [],
|
| 729 |
+
}
|
| 730 |
+
|
| 731 |
+
# A convenience function to simplify calls below
|
| 732 |
+
def append_field(
|
| 733 |
+
bundle: UnformattedBundle, title: str, key: str, formatter=None
|
| 734 |
+
):
|
| 735 |
+
self._append_info_field(
|
| 736 |
+
bundle,
|
| 737 |
+
title=title,
|
| 738 |
+
key=key,
|
| 739 |
+
info=info,
|
| 740 |
+
omit_sections=omit_sections,
|
| 741 |
+
formatter=formatter,
|
| 742 |
+
)
|
| 743 |
+
|
| 744 |
+
def code_formatter(text) -> Bundle:
|
| 745 |
+
return {
|
| 746 |
+
'text/plain': self.format(text),
|
| 747 |
+
'text/html': pylight(text)
|
| 748 |
+
}
|
| 749 |
+
|
| 750 |
+
if info["isalias"]:
|
| 751 |
+
append_field(bundle, "Repr", "string_form")
|
| 752 |
+
|
| 753 |
+
elif info['ismagic']:
|
| 754 |
+
if detail_level > 0:
|
| 755 |
+
append_field(bundle, "Source", "source", code_formatter)
|
| 756 |
+
else:
|
| 757 |
+
append_field(bundle, "Docstring", "docstring", formatter)
|
| 758 |
+
append_field(bundle, "File", "file")
|
| 759 |
+
|
| 760 |
+
elif info['isclass'] or is_simple_callable(obj):
|
| 761 |
+
# Functions, methods, classes
|
| 762 |
+
append_field(bundle, "Signature", "definition", code_formatter)
|
| 763 |
+
append_field(bundle, "Init signature", "init_definition", code_formatter)
|
| 764 |
+
append_field(bundle, "Docstring", "docstring", formatter)
|
| 765 |
+
if detail_level > 0 and info["source"]:
|
| 766 |
+
append_field(bundle, "Source", "source", code_formatter)
|
| 767 |
+
else:
|
| 768 |
+
append_field(bundle, "Init docstring", "init_docstring", formatter)
|
| 769 |
+
|
| 770 |
+
append_field(bundle, "File", "file")
|
| 771 |
+
append_field(bundle, "Type", "type_name")
|
| 772 |
+
append_field(bundle, "Subclasses", "subclasses")
|
| 773 |
+
|
| 774 |
+
else:
|
| 775 |
+
# General Python objects
|
| 776 |
+
append_field(bundle, "Signature", "definition", code_formatter)
|
| 777 |
+
append_field(bundle, "Call signature", "call_def", code_formatter)
|
| 778 |
+
append_field(bundle, "Type", "type_name")
|
| 779 |
+
append_field(bundle, "String form", "string_form")
|
| 780 |
+
|
| 781 |
+
# Namespace
|
| 782 |
+
if info["namespace"] != "Interactive":
|
| 783 |
+
append_field(bundle, "Namespace", "namespace")
|
| 784 |
+
|
| 785 |
+
append_field(bundle, "Length", "length")
|
| 786 |
+
append_field(bundle, "File", "file")
|
| 787 |
+
|
| 788 |
+
# Source or docstring, depending on detail level and whether
|
| 789 |
+
# source found.
|
| 790 |
+
if detail_level > 0 and info["source"]:
|
| 791 |
+
append_field(bundle, "Source", "source", code_formatter)
|
| 792 |
+
else:
|
| 793 |
+
append_field(bundle, "Docstring", "docstring", formatter)
|
| 794 |
+
|
| 795 |
+
append_field(bundle, "Class docstring", "class_docstring", formatter)
|
| 796 |
+
append_field(bundle, "Init docstring", "init_docstring", formatter)
|
| 797 |
+
append_field(bundle, "Call docstring", "call_docstring", formatter)
|
| 798 |
+
return bundle
|
| 799 |
+
|
| 800 |
+
|
| 801 |
+
def _get_info(
|
| 802 |
+
self,
|
| 803 |
+
obj: Any,
|
| 804 |
+
oname: str = "",
|
| 805 |
+
formatter=None,
|
| 806 |
+
info: Optional[OInfo] = None,
|
| 807 |
+
detail_level: int = 0,
|
| 808 |
+
omit_sections: Union[List[str], Tuple[()]] = (),
|
| 809 |
+
) -> Bundle:
|
| 810 |
+
"""Retrieve an info dict and format it.
|
| 811 |
+
|
| 812 |
+
Parameters
|
| 813 |
+
----------
|
| 814 |
+
obj : any
|
| 815 |
+
Object to inspect and return info from
|
| 816 |
+
oname : str (default: ''):
|
| 817 |
+
Name of the variable pointing to `obj`.
|
| 818 |
+
formatter : callable
|
| 819 |
+
info
|
| 820 |
+
already computed information
|
| 821 |
+
detail_level : integer
|
| 822 |
+
Granularity of detail level, if set to 1, give more information.
|
| 823 |
+
omit_sections : list[str]
|
| 824 |
+
Titles or keys to omit from output (can be set, tuple, etc., anything supporting `in`)
|
| 825 |
+
"""
|
| 826 |
+
|
| 827 |
+
info_dict = self.info(obj, oname=oname, info=info, detail_level=detail_level)
|
| 828 |
+
omit_sections = list(omit_sections)
|
| 829 |
+
|
| 830 |
+
bundle = self._make_info_unformatted(
|
| 831 |
+
obj,
|
| 832 |
+
info_dict,
|
| 833 |
+
formatter,
|
| 834 |
+
detail_level=detail_level,
|
| 835 |
+
omit_sections=omit_sections,
|
| 836 |
+
)
|
| 837 |
+
if self.mime_hooks:
|
| 838 |
+
hook_data = InspectorHookData(
|
| 839 |
+
obj=obj,
|
| 840 |
+
info=info,
|
| 841 |
+
info_dict=info_dict,
|
| 842 |
+
detail_level=detail_level,
|
| 843 |
+
omit_sections=omit_sections,
|
| 844 |
+
)
|
| 845 |
+
for key, hook in self.mime_hooks.items(): # type:ignore
|
| 846 |
+
required_parameters = [
|
| 847 |
+
parameter
|
| 848 |
+
for parameter in inspect.signature(hook).parameters.values()
|
| 849 |
+
if parameter.default != inspect.Parameter.default
|
| 850 |
+
]
|
| 851 |
+
if len(required_parameters) == 1:
|
| 852 |
+
res = hook(hook_data)
|
| 853 |
+
else:
|
| 854 |
+
warnings.warn(
|
| 855 |
+
"MIME hook format changed in IPython 8.22; hooks should now accept"
|
| 856 |
+
" a single parameter (InspectorHookData); support for hooks requiring"
|
| 857 |
+
" two-parameters (obj and info) will be removed in a future version",
|
| 858 |
+
DeprecationWarning,
|
| 859 |
+
stacklevel=2,
|
| 860 |
+
)
|
| 861 |
+
res = hook(obj, info)
|
| 862 |
+
if res is not None:
|
| 863 |
+
bundle[key] = res
|
| 864 |
+
return self.format_mime(bundle)
|
| 865 |
+
|
| 866 |
+
def pinfo(
|
| 867 |
+
self,
|
| 868 |
+
obj,
|
| 869 |
+
oname="",
|
| 870 |
+
formatter=None,
|
| 871 |
+
info: Optional[OInfo] = None,
|
| 872 |
+
detail_level=0,
|
| 873 |
+
enable_html_pager=True,
|
| 874 |
+
omit_sections=(),
|
| 875 |
+
):
|
| 876 |
+
"""Show detailed information about an object.
|
| 877 |
+
|
| 878 |
+
Optional arguments:
|
| 879 |
+
|
| 880 |
+
- oname: name of the variable pointing to the object.
|
| 881 |
+
|
| 882 |
+
- formatter: callable (optional)
|
| 883 |
+
A special formatter for docstrings.
|
| 884 |
+
|
| 885 |
+
The formatter is a callable that takes a string as an input
|
| 886 |
+
and returns either a formatted string or a mime type bundle
|
| 887 |
+
in the form of a dictionary.
|
| 888 |
+
|
| 889 |
+
Although the support of custom formatter returning a string
|
| 890 |
+
instead of a mime type bundle is deprecated.
|
| 891 |
+
|
| 892 |
+
- info: a structure with some information fields which may have been
|
| 893 |
+
precomputed already.
|
| 894 |
+
|
| 895 |
+
- detail_level: if set to 1, more information is given.
|
| 896 |
+
|
| 897 |
+
- omit_sections: set of section keys and titles to omit
|
| 898 |
+
"""
|
| 899 |
+
assert info is not None
|
| 900 |
+
info_b: Bundle = self._get_info(
|
| 901 |
+
obj, oname, formatter, info, detail_level, omit_sections=omit_sections
|
| 902 |
+
)
|
| 903 |
+
if not enable_html_pager:
|
| 904 |
+
del info_b["text/html"]
|
| 905 |
+
page.page(info_b)
|
| 906 |
+
|
| 907 |
+
def _info(self, obj, oname="", info=None, detail_level=0):
|
| 908 |
+
"""
|
| 909 |
+
Inspector.info() was likely improperly marked as deprecated
|
| 910 |
+
while only a parameter was deprecated. We "un-deprecate" it.
|
| 911 |
+
"""
|
| 912 |
+
|
| 913 |
+
warnings.warn(
|
| 914 |
+
"The `Inspector.info()` method has been un-deprecated as of 8.0 "
|
| 915 |
+
"and the `formatter=` keyword removed. `Inspector._info` is now "
|
| 916 |
+
"an alias, and you can just call `.info()` directly.",
|
| 917 |
+
DeprecationWarning,
|
| 918 |
+
stacklevel=2,
|
| 919 |
+
)
|
| 920 |
+
return self.info(obj, oname=oname, info=info, detail_level=detail_level)
|
| 921 |
+
|
| 922 |
+
def info(self, obj, oname="", info=None, detail_level=0) -> InfoDict:
|
| 923 |
+
"""Compute a dict with detailed information about an object.
|
| 924 |
+
|
| 925 |
+
Parameters
|
| 926 |
+
----------
|
| 927 |
+
obj : any
|
| 928 |
+
An object to find information about
|
| 929 |
+
oname : str (default: '')
|
| 930 |
+
Name of the variable pointing to `obj`.
|
| 931 |
+
info : (default: None)
|
| 932 |
+
A struct (dict like with attr access) with some information fields
|
| 933 |
+
which may have been precomputed already.
|
| 934 |
+
detail_level : int (default:0)
|
| 935 |
+
If set to 1, more information is given.
|
| 936 |
+
|
| 937 |
+
Returns
|
| 938 |
+
-------
|
| 939 |
+
An object info dict with known fields from `info_fields` (see `InfoDict`).
|
| 940 |
+
"""
|
| 941 |
+
|
| 942 |
+
if info is None:
|
| 943 |
+
ismagic = False
|
| 944 |
+
isalias = False
|
| 945 |
+
ospace = ''
|
| 946 |
+
else:
|
| 947 |
+
ismagic = info.ismagic
|
| 948 |
+
isalias = info.isalias
|
| 949 |
+
ospace = info.namespace
|
| 950 |
+
|
| 951 |
+
# Get docstring, special-casing aliases:
|
| 952 |
+
att_name = oname.split(".")[-1]
|
| 953 |
+
parents_docs = None
|
| 954 |
+
prelude = ""
|
| 955 |
+
if info and info.parent is not None and hasattr(info.parent, HOOK_NAME):
|
| 956 |
+
parents_docs_dict = getattr(info.parent, HOOK_NAME)
|
| 957 |
+
parents_docs = parents_docs_dict.get(att_name, None)
|
| 958 |
+
out: InfoDict = cast(
|
| 959 |
+
InfoDict,
|
| 960 |
+
{
|
| 961 |
+
**{field: None for field in _info_fields},
|
| 962 |
+
**{
|
| 963 |
+
"name": oname,
|
| 964 |
+
"found": True,
|
| 965 |
+
"isalias": isalias,
|
| 966 |
+
"ismagic": ismagic,
|
| 967 |
+
"subclasses": None,
|
| 968 |
+
},
|
| 969 |
+
},
|
| 970 |
+
)
|
| 971 |
+
|
| 972 |
+
if parents_docs:
|
| 973 |
+
ds = parents_docs
|
| 974 |
+
elif isalias:
|
| 975 |
+
if not callable(obj):
|
| 976 |
+
try:
|
| 977 |
+
ds = "Alias to the system command:\n %s" % obj[1]
|
| 978 |
+
except:
|
| 979 |
+
ds = "Alias: " + str(obj)
|
| 980 |
+
else:
|
| 981 |
+
ds = "Alias to " + str(obj)
|
| 982 |
+
if obj.__doc__:
|
| 983 |
+
ds += "\nDocstring:\n" + obj.__doc__
|
| 984 |
+
else:
|
| 985 |
+
ds_or_None = getdoc(obj)
|
| 986 |
+
if ds_or_None is None:
|
| 987 |
+
ds = '<no docstring>'
|
| 988 |
+
else:
|
| 989 |
+
ds = ds_or_None
|
| 990 |
+
|
| 991 |
+
ds = prelude + ds
|
| 992 |
+
|
| 993 |
+
# store output in a dict, we initialize it here and fill it as we go
|
| 994 |
+
|
| 995 |
+
string_max = 200 # max size of strings to show (snipped if longer)
|
| 996 |
+
shalf = int((string_max - 5) / 2)
|
| 997 |
+
|
| 998 |
+
if ismagic:
|
| 999 |
+
out['type_name'] = 'Magic function'
|
| 1000 |
+
elif isalias:
|
| 1001 |
+
out['type_name'] = 'System alias'
|
| 1002 |
+
else:
|
| 1003 |
+
out['type_name'] = type(obj).__name__
|
| 1004 |
+
|
| 1005 |
+
try:
|
| 1006 |
+
bclass = obj.__class__
|
| 1007 |
+
out['base_class'] = str(bclass)
|
| 1008 |
+
except:
|
| 1009 |
+
pass
|
| 1010 |
+
|
| 1011 |
+
# String form, but snip if too long in ? form (full in ??)
|
| 1012 |
+
if detail_level >= self.str_detail_level:
|
| 1013 |
+
try:
|
| 1014 |
+
ostr = str(obj)
|
| 1015 |
+
if not detail_level and len(ostr) > string_max:
|
| 1016 |
+
ostr = ostr[:shalf] + ' <...> ' + ostr[-shalf:]
|
| 1017 |
+
# TODO: `'string_form'.expandtabs()` seems wrong, but
|
| 1018 |
+
# it was (nearly) like this since the first commit ever.
|
| 1019 |
+
ostr = ("\n" + " " * len("string_form".expandtabs())).join(
|
| 1020 |
+
q.strip() for q in ostr.split("\n")
|
| 1021 |
+
)
|
| 1022 |
+
out["string_form"] = ostr
|
| 1023 |
+
except:
|
| 1024 |
+
pass
|
| 1025 |
+
|
| 1026 |
+
if ospace:
|
| 1027 |
+
out['namespace'] = ospace
|
| 1028 |
+
|
| 1029 |
+
# Length (for strings and lists)
|
| 1030 |
+
try:
|
| 1031 |
+
out['length'] = str(len(obj))
|
| 1032 |
+
except Exception:
|
| 1033 |
+
pass
|
| 1034 |
+
|
| 1035 |
+
# Filename where object was defined
|
| 1036 |
+
binary_file = False
|
| 1037 |
+
fname = find_file(obj)
|
| 1038 |
+
if fname is None:
|
| 1039 |
+
# if anything goes wrong, we don't want to show source, so it's as
|
| 1040 |
+
# if the file was binary
|
| 1041 |
+
binary_file = True
|
| 1042 |
+
else:
|
| 1043 |
+
if fname.endswith(('.so', '.dll', '.pyd')):
|
| 1044 |
+
binary_file = True
|
| 1045 |
+
elif fname.endswith('<string>'):
|
| 1046 |
+
fname = 'Dynamically generated function. No source code available.'
|
| 1047 |
+
out['file'] = compress_user(fname)
|
| 1048 |
+
|
| 1049 |
+
# Original source code for a callable, class or property.
|
| 1050 |
+
if detail_level:
|
| 1051 |
+
# Flush the source cache because inspect can return out-of-date
|
| 1052 |
+
# source
|
| 1053 |
+
linecache.checkcache()
|
| 1054 |
+
try:
|
| 1055 |
+
if isinstance(obj, property) or not binary_file:
|
| 1056 |
+
src = getsource(obj, oname)
|
| 1057 |
+
if src is not None:
|
| 1058 |
+
src = src.rstrip()
|
| 1059 |
+
out['source'] = src
|
| 1060 |
+
|
| 1061 |
+
except Exception:
|
| 1062 |
+
pass
|
| 1063 |
+
|
| 1064 |
+
# Add docstring only if no source is to be shown (avoid repetitions).
|
| 1065 |
+
if ds and not self._source_contains_docstring(out.get('source'), ds):
|
| 1066 |
+
out['docstring'] = ds
|
| 1067 |
+
|
| 1068 |
+
# Constructor docstring for classes
|
| 1069 |
+
if inspect.isclass(obj):
|
| 1070 |
+
out['isclass'] = True
|
| 1071 |
+
|
| 1072 |
+
# get the init signature:
|
| 1073 |
+
try:
|
| 1074 |
+
init_def = self._getdef(obj, oname)
|
| 1075 |
+
except AttributeError:
|
| 1076 |
+
init_def = None
|
| 1077 |
+
|
| 1078 |
+
# get the __init__ docstring
|
| 1079 |
+
try:
|
| 1080 |
+
obj_init = obj.__init__
|
| 1081 |
+
except AttributeError:
|
| 1082 |
+
init_ds = None
|
| 1083 |
+
else:
|
| 1084 |
+
if init_def is None:
|
| 1085 |
+
# Get signature from init if top-level sig failed.
|
| 1086 |
+
# Can happen for built-in types (list, etc.).
|
| 1087 |
+
try:
|
| 1088 |
+
init_def = self._getdef(obj_init, oname)
|
| 1089 |
+
except AttributeError:
|
| 1090 |
+
pass
|
| 1091 |
+
init_ds = getdoc(obj_init)
|
| 1092 |
+
# Skip Python's auto-generated docstrings
|
| 1093 |
+
if init_ds == _object_init_docstring:
|
| 1094 |
+
init_ds = None
|
| 1095 |
+
|
| 1096 |
+
if init_def:
|
| 1097 |
+
out['init_definition'] = init_def
|
| 1098 |
+
|
| 1099 |
+
if init_ds:
|
| 1100 |
+
out['init_docstring'] = init_ds
|
| 1101 |
+
|
| 1102 |
+
names = [sub.__name__ for sub in type.__subclasses__(obj)]
|
| 1103 |
+
if len(names) < 10:
|
| 1104 |
+
all_names = ', '.join(names)
|
| 1105 |
+
else:
|
| 1106 |
+
all_names = ', '.join(names[:10]+['...'])
|
| 1107 |
+
out['subclasses'] = all_names
|
| 1108 |
+
# and class docstring for instances:
|
| 1109 |
+
else:
|
| 1110 |
+
# reconstruct the function definition and print it:
|
| 1111 |
+
defln = self._getdef(obj, oname)
|
| 1112 |
+
if defln:
|
| 1113 |
+
out['definition'] = defln
|
| 1114 |
+
|
| 1115 |
+
# First, check whether the instance docstring is identical to the
|
| 1116 |
+
# class one, and print it separately if they don't coincide. In
|
| 1117 |
+
# most cases they will, but it's nice to print all the info for
|
| 1118 |
+
# objects which use instance-customized docstrings.
|
| 1119 |
+
if ds:
|
| 1120 |
+
try:
|
| 1121 |
+
cls = getattr(obj,'__class__')
|
| 1122 |
+
except:
|
| 1123 |
+
class_ds = None
|
| 1124 |
+
else:
|
| 1125 |
+
class_ds = getdoc(cls)
|
| 1126 |
+
# Skip Python's auto-generated docstrings
|
| 1127 |
+
if class_ds in _builtin_type_docstrings:
|
| 1128 |
+
class_ds = None
|
| 1129 |
+
if class_ds and ds != class_ds:
|
| 1130 |
+
out['class_docstring'] = class_ds
|
| 1131 |
+
|
| 1132 |
+
# Next, try to show constructor docstrings
|
| 1133 |
+
try:
|
| 1134 |
+
init_ds = getdoc(obj.__init__)
|
| 1135 |
+
# Skip Python's auto-generated docstrings
|
| 1136 |
+
if init_ds == _object_init_docstring:
|
| 1137 |
+
init_ds = None
|
| 1138 |
+
except AttributeError:
|
| 1139 |
+
init_ds = None
|
| 1140 |
+
if init_ds:
|
| 1141 |
+
out['init_docstring'] = init_ds
|
| 1142 |
+
|
| 1143 |
+
# Call form docstring for callable instances
|
| 1144 |
+
if safe_hasattr(obj, '__call__') and not is_simple_callable(obj):
|
| 1145 |
+
call_def = self._getdef(obj.__call__, oname)
|
| 1146 |
+
if call_def and (call_def != out.get('definition')):
|
| 1147 |
+
# it may never be the case that call def and definition differ,
|
| 1148 |
+
# but don't include the same signature twice
|
| 1149 |
+
out['call_def'] = call_def
|
| 1150 |
+
call_ds = getdoc(obj.__call__)
|
| 1151 |
+
# Skip Python's auto-generated docstrings
|
| 1152 |
+
if call_ds == _func_call_docstring:
|
| 1153 |
+
call_ds = None
|
| 1154 |
+
if call_ds:
|
| 1155 |
+
out['call_docstring'] = call_ds
|
| 1156 |
+
|
| 1157 |
+
return out
|
| 1158 |
+
|
| 1159 |
+
@staticmethod
|
| 1160 |
+
def _source_contains_docstring(src, doc):
|
| 1161 |
+
"""
|
| 1162 |
+
Check whether the source *src* contains the docstring *doc*.
|
| 1163 |
+
|
| 1164 |
+
This is is helper function to skip displaying the docstring if the
|
| 1165 |
+
source already contains it, avoiding repetition of information.
|
| 1166 |
+
"""
|
| 1167 |
+
try:
|
| 1168 |
+
(def_node,) = ast.parse(dedent(src)).body
|
| 1169 |
+
return ast.get_docstring(def_node) == doc # type: ignore[arg-type]
|
| 1170 |
+
except Exception:
|
| 1171 |
+
# The source can become invalid or even non-existent (because it
|
| 1172 |
+
# is re-fetched from the source file) so the above code fail in
|
| 1173 |
+
# arbitrary ways.
|
| 1174 |
+
return False
|
| 1175 |
+
|
| 1176 |
+
def psearch(self,pattern,ns_table,ns_search=[],
|
| 1177 |
+
ignore_case=False,show_all=False, *, list_types=False):
|
| 1178 |
+
"""Search namespaces with wildcards for objects.
|
| 1179 |
+
|
| 1180 |
+
Arguments:
|
| 1181 |
+
|
| 1182 |
+
- pattern: string containing shell-like wildcards to use in namespace
|
| 1183 |
+
searches and optionally a type specification to narrow the search to
|
| 1184 |
+
objects of that type.
|
| 1185 |
+
|
| 1186 |
+
- ns_table: dict of name->namespaces for search.
|
| 1187 |
+
|
| 1188 |
+
Optional arguments:
|
| 1189 |
+
|
| 1190 |
+
- ns_search: list of namespace names to include in search.
|
| 1191 |
+
|
| 1192 |
+
- ignore_case(False): make the search case-insensitive.
|
| 1193 |
+
|
| 1194 |
+
- show_all(False): show all names, including those starting with
|
| 1195 |
+
underscores.
|
| 1196 |
+
|
| 1197 |
+
- list_types(False): list all available object types for object matching.
|
| 1198 |
+
"""
|
| 1199 |
+
# print('ps pattern:<%r>' % pattern) # dbg
|
| 1200 |
+
|
| 1201 |
+
# defaults
|
| 1202 |
+
type_pattern = 'all'
|
| 1203 |
+
filter = ''
|
| 1204 |
+
|
| 1205 |
+
# list all object types
|
| 1206 |
+
if list_types:
|
| 1207 |
+
page.page('\n'.join(sorted(typestr2type)))
|
| 1208 |
+
return
|
| 1209 |
+
|
| 1210 |
+
cmds = pattern.split()
|
| 1211 |
+
len_cmds = len(cmds)
|
| 1212 |
+
if len_cmds == 1:
|
| 1213 |
+
# Only filter pattern given
|
| 1214 |
+
filter = cmds[0]
|
| 1215 |
+
elif len_cmds == 2:
|
| 1216 |
+
# Both filter and type specified
|
| 1217 |
+
filter,type_pattern = cmds
|
| 1218 |
+
else:
|
| 1219 |
+
raise ValueError('invalid argument string for psearch: <%s>' %
|
| 1220 |
+
pattern)
|
| 1221 |
+
|
| 1222 |
+
# filter search namespaces
|
| 1223 |
+
for name in ns_search:
|
| 1224 |
+
if name not in ns_table:
|
| 1225 |
+
raise ValueError('invalid namespace <%s>. Valid names: %s' %
|
| 1226 |
+
(name,ns_table.keys()))
|
| 1227 |
+
|
| 1228 |
+
# print('type_pattern:',type_pattern) # dbg
|
| 1229 |
+
search_result, namespaces_seen = set(), set()
|
| 1230 |
+
for ns_name in ns_search:
|
| 1231 |
+
ns = ns_table[ns_name]
|
| 1232 |
+
# Normally, locals and globals are the same, so we just check one.
|
| 1233 |
+
if id(ns) in namespaces_seen:
|
| 1234 |
+
continue
|
| 1235 |
+
namespaces_seen.add(id(ns))
|
| 1236 |
+
tmp_res = list_namespace(ns, type_pattern, filter,
|
| 1237 |
+
ignore_case=ignore_case, show_all=show_all)
|
| 1238 |
+
search_result.update(tmp_res)
|
| 1239 |
+
|
| 1240 |
+
page.page('\n'.join(sorted(search_result)))
|
| 1241 |
+
|
| 1242 |
+
|
| 1243 |
+
def _render_signature(obj_signature, obj_name) -> str:
|
| 1244 |
+
"""
|
| 1245 |
+
This was mostly taken from inspect.Signature.__str__.
|
| 1246 |
+
Look there for the comments.
|
| 1247 |
+
The only change is to add linebreaks when this gets too long.
|
| 1248 |
+
"""
|
| 1249 |
+
result = []
|
| 1250 |
+
pos_only = False
|
| 1251 |
+
kw_only = True
|
| 1252 |
+
for param in obj_signature.parameters.values():
|
| 1253 |
+
if param.kind == inspect.Parameter.POSITIONAL_ONLY:
|
| 1254 |
+
pos_only = True
|
| 1255 |
+
elif pos_only:
|
| 1256 |
+
result.append('/')
|
| 1257 |
+
pos_only = False
|
| 1258 |
+
|
| 1259 |
+
if param.kind == inspect.Parameter.VAR_POSITIONAL:
|
| 1260 |
+
kw_only = False
|
| 1261 |
+
elif param.kind == inspect.Parameter.KEYWORD_ONLY and kw_only:
|
| 1262 |
+
result.append('*')
|
| 1263 |
+
kw_only = False
|
| 1264 |
+
|
| 1265 |
+
result.append(str(param))
|
| 1266 |
+
|
| 1267 |
+
if pos_only:
|
| 1268 |
+
result.append('/')
|
| 1269 |
+
|
| 1270 |
+
# add up name, parameters, braces (2), and commas
|
| 1271 |
+
if len(obj_name) + sum(len(r) + 2 for r in result) > 75:
|
| 1272 |
+
# This doesn’t fit behind “Signature: ” in an inspect window.
|
| 1273 |
+
rendered = '{}(\n{})'.format(obj_name, ''.join(
|
| 1274 |
+
' {},\n'.format(r) for r in result)
|
| 1275 |
+
)
|
| 1276 |
+
else:
|
| 1277 |
+
rendered = '{}({})'.format(obj_name, ', '.join(result))
|
| 1278 |
+
|
| 1279 |
+
if obj_signature.return_annotation is not inspect._empty:
|
| 1280 |
+
anno = inspect.formatannotation(obj_signature.return_annotation)
|
| 1281 |
+
rendered += ' -> {}'.format(anno)
|
| 1282 |
+
|
| 1283 |
+
return rendered
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/page.py
ADDED
|
@@ -0,0 +1,348 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
Paging capabilities for IPython.core
|
| 4 |
+
|
| 5 |
+
Notes
|
| 6 |
+
-----
|
| 7 |
+
|
| 8 |
+
For now this uses IPython hooks, so it can't be in IPython.utils. If we can get
|
| 9 |
+
rid of that dependency, we could move it there.
|
| 10 |
+
-----
|
| 11 |
+
"""
|
| 12 |
+
|
| 13 |
+
# Copyright (c) IPython Development Team.
|
| 14 |
+
# Distributed under the terms of the Modified BSD License.
|
| 15 |
+
|
| 16 |
+
|
| 17 |
+
import os
|
| 18 |
+
import io
|
| 19 |
+
import re
|
| 20 |
+
import sys
|
| 21 |
+
import tempfile
|
| 22 |
+
import subprocess
|
| 23 |
+
|
| 24 |
+
from io import UnsupportedOperation
|
| 25 |
+
from pathlib import Path
|
| 26 |
+
|
| 27 |
+
from IPython import get_ipython
|
| 28 |
+
from IPython.display import display
|
| 29 |
+
from IPython.core.error import TryNext
|
| 30 |
+
from IPython.utils.data import chop
|
| 31 |
+
from IPython.utils.process import system
|
| 32 |
+
from IPython.utils.terminal import get_terminal_size
|
| 33 |
+
from IPython.utils import py3compat
|
| 34 |
+
|
| 35 |
+
|
| 36 |
+
def display_page(strng, start=0, screen_lines=25):
|
| 37 |
+
"""Just display, no paging. screen_lines is ignored."""
|
| 38 |
+
if isinstance(strng, dict):
|
| 39 |
+
data = strng
|
| 40 |
+
else:
|
| 41 |
+
if start:
|
| 42 |
+
strng = u'\n'.join(strng.splitlines()[start:])
|
| 43 |
+
data = { 'text/plain': strng }
|
| 44 |
+
display(data, raw=True)
|
| 45 |
+
|
| 46 |
+
|
| 47 |
+
def as_hook(page_func):
|
| 48 |
+
"""Wrap a pager func to strip the `self` arg
|
| 49 |
+
|
| 50 |
+
so it can be called as a hook.
|
| 51 |
+
"""
|
| 52 |
+
return lambda self, *args, **kwargs: page_func(*args, **kwargs)
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
esc_re = re.compile(r"(\x1b[^m]+m)")
|
| 56 |
+
|
| 57 |
+
def page_dumb(strng, start=0, screen_lines=25):
|
| 58 |
+
"""Very dumb 'pager' in Python, for when nothing else works.
|
| 59 |
+
|
| 60 |
+
Only moves forward, same interface as page(), except for pager_cmd and
|
| 61 |
+
mode.
|
| 62 |
+
"""
|
| 63 |
+
if isinstance(strng, dict):
|
| 64 |
+
strng = strng.get('text/plain', '')
|
| 65 |
+
out_ln = strng.splitlines()[start:]
|
| 66 |
+
screens = chop(out_ln,screen_lines-1)
|
| 67 |
+
if len(screens) == 1:
|
| 68 |
+
print(os.linesep.join(screens[0]))
|
| 69 |
+
else:
|
| 70 |
+
last_escape = ""
|
| 71 |
+
for scr in screens[0:-1]:
|
| 72 |
+
hunk = os.linesep.join(scr)
|
| 73 |
+
print(last_escape + hunk)
|
| 74 |
+
if not page_more():
|
| 75 |
+
return
|
| 76 |
+
esc_list = esc_re.findall(hunk)
|
| 77 |
+
if len(esc_list) > 0:
|
| 78 |
+
last_escape = esc_list[-1]
|
| 79 |
+
print(last_escape + os.linesep.join(screens[-1]))
|
| 80 |
+
|
| 81 |
+
def _detect_screen_size(screen_lines_def):
|
| 82 |
+
"""Attempt to work out the number of lines on the screen.
|
| 83 |
+
|
| 84 |
+
This is called by page(). It can raise an error (e.g. when run in the
|
| 85 |
+
test suite), so it's separated out so it can easily be called in a try block.
|
| 86 |
+
"""
|
| 87 |
+
TERM = os.environ.get('TERM',None)
|
| 88 |
+
if not((TERM=='xterm' or TERM=='xterm-color') and sys.platform != 'sunos5'):
|
| 89 |
+
# curses causes problems on many terminals other than xterm, and
|
| 90 |
+
# some termios calls lock up on Sun OS5.
|
| 91 |
+
return screen_lines_def
|
| 92 |
+
|
| 93 |
+
try:
|
| 94 |
+
import termios
|
| 95 |
+
import curses
|
| 96 |
+
except ImportError:
|
| 97 |
+
return screen_lines_def
|
| 98 |
+
|
| 99 |
+
# There is a bug in curses, where *sometimes* it fails to properly
|
| 100 |
+
# initialize, and then after the endwin() call is made, the
|
| 101 |
+
# terminal is left in an unusable state. Rather than trying to
|
| 102 |
+
# check every time for this (by requesting and comparing termios
|
| 103 |
+
# flags each time), we just save the initial terminal state and
|
| 104 |
+
# unconditionally reset it every time. It's cheaper than making
|
| 105 |
+
# the checks.
|
| 106 |
+
try:
|
| 107 |
+
term_flags = termios.tcgetattr(sys.stdout)
|
| 108 |
+
except termios.error as err:
|
| 109 |
+
# can fail on Linux 2.6, pager_page will catch the TypeError
|
| 110 |
+
raise TypeError('termios error: {0}'.format(err)) from err
|
| 111 |
+
|
| 112 |
+
try:
|
| 113 |
+
scr = curses.initscr()
|
| 114 |
+
except AttributeError:
|
| 115 |
+
# Curses on Solaris may not be complete, so we can't use it there
|
| 116 |
+
return screen_lines_def
|
| 117 |
+
|
| 118 |
+
screen_lines_real,screen_cols = scr.getmaxyx()
|
| 119 |
+
curses.endwin()
|
| 120 |
+
|
| 121 |
+
# Restore terminal state in case endwin() didn't.
|
| 122 |
+
termios.tcsetattr(sys.stdout,termios.TCSANOW,term_flags)
|
| 123 |
+
# Now we have what we needed: the screen size in rows/columns
|
| 124 |
+
return screen_lines_real
|
| 125 |
+
# print('***Screen size:',screen_lines_real,'lines x',
|
| 126 |
+
# screen_cols,'columns.') # dbg
|
| 127 |
+
|
| 128 |
+
def pager_page(strng, start=0, screen_lines=0, pager_cmd=None) -> None:
|
| 129 |
+
"""Display a string, piping through a pager after a certain length.
|
| 130 |
+
|
| 131 |
+
strng can be a mime-bundle dict, supplying multiple representations,
|
| 132 |
+
keyed by mime-type.
|
| 133 |
+
|
| 134 |
+
The screen_lines parameter specifies the number of *usable* lines of your
|
| 135 |
+
terminal screen (total lines minus lines you need to reserve to show other
|
| 136 |
+
information).
|
| 137 |
+
|
| 138 |
+
If you set screen_lines to a number <=0, page() will try to auto-determine
|
| 139 |
+
your screen size and will only use up to (screen_size+screen_lines) for
|
| 140 |
+
printing, paging after that. That is, if you want auto-detection but need
|
| 141 |
+
to reserve the bottom 3 lines of the screen, use screen_lines = -3, and for
|
| 142 |
+
auto-detection without any lines reserved simply use screen_lines = 0.
|
| 143 |
+
|
| 144 |
+
If a string won't fit in the allowed lines, it is sent through the
|
| 145 |
+
specified pager command. If none given, look for PAGER in the environment,
|
| 146 |
+
and ultimately default to less.
|
| 147 |
+
|
| 148 |
+
If no system pager works, the string is sent through a 'dumb pager'
|
| 149 |
+
written in python, very simplistic.
|
| 150 |
+
"""
|
| 151 |
+
|
| 152 |
+
# for compatibility with mime-bundle form:
|
| 153 |
+
if isinstance(strng, dict):
|
| 154 |
+
strng = strng['text/plain']
|
| 155 |
+
|
| 156 |
+
# Ugly kludge, but calling curses.initscr() flat out crashes in emacs
|
| 157 |
+
TERM = os.environ.get('TERM','dumb')
|
| 158 |
+
if TERM in ['dumb','emacs'] and os.name != 'nt':
|
| 159 |
+
print(strng)
|
| 160 |
+
return
|
| 161 |
+
# chop off the topmost part of the string we don't want to see
|
| 162 |
+
str_lines = strng.splitlines()[start:]
|
| 163 |
+
str_toprint = os.linesep.join(str_lines)
|
| 164 |
+
num_newlines = len(str_lines)
|
| 165 |
+
len_str = len(str_toprint)
|
| 166 |
+
|
| 167 |
+
# Dumb heuristics to guesstimate number of on-screen lines the string
|
| 168 |
+
# takes. Very basic, but good enough for docstrings in reasonable
|
| 169 |
+
# terminals. If someone later feels like refining it, it's not hard.
|
| 170 |
+
numlines = max(num_newlines,int(len_str/80)+1)
|
| 171 |
+
|
| 172 |
+
screen_lines_def = get_terminal_size()[1]
|
| 173 |
+
|
| 174 |
+
# auto-determine screen size
|
| 175 |
+
if screen_lines <= 0:
|
| 176 |
+
try:
|
| 177 |
+
screen_lines += _detect_screen_size(screen_lines_def)
|
| 178 |
+
except (TypeError, UnsupportedOperation):
|
| 179 |
+
print(str_toprint)
|
| 180 |
+
return
|
| 181 |
+
|
| 182 |
+
# print('numlines',numlines,'screenlines',screen_lines) # dbg
|
| 183 |
+
if numlines <= screen_lines :
|
| 184 |
+
# print('*** normal print') # dbg
|
| 185 |
+
print(str_toprint)
|
| 186 |
+
else:
|
| 187 |
+
# Try to open pager and default to internal one if that fails.
|
| 188 |
+
# All failure modes are tagged as 'retval=1', to match the return
|
| 189 |
+
# value of a failed system command. If any intermediate attempt
|
| 190 |
+
# sets retval to 1, at the end we resort to our own page_dumb() pager.
|
| 191 |
+
pager_cmd = get_pager_cmd(pager_cmd)
|
| 192 |
+
pager_cmd += ' ' + get_pager_start(pager_cmd,start)
|
| 193 |
+
if os.name == 'nt':
|
| 194 |
+
if pager_cmd.startswith('type'):
|
| 195 |
+
# The default WinXP 'type' command is failing on complex strings.
|
| 196 |
+
retval = 1
|
| 197 |
+
else:
|
| 198 |
+
fd, tmpname = tempfile.mkstemp('.txt')
|
| 199 |
+
tmppath = Path(tmpname)
|
| 200 |
+
try:
|
| 201 |
+
os.close(fd)
|
| 202 |
+
with tmppath.open("wt", encoding="utf-8") as tmpfile:
|
| 203 |
+
tmpfile.write(strng)
|
| 204 |
+
cmd = "%s < %s" % (pager_cmd, tmppath)
|
| 205 |
+
# tmpfile needs to be closed for windows
|
| 206 |
+
if os.system(cmd):
|
| 207 |
+
retval = 1
|
| 208 |
+
else:
|
| 209 |
+
retval = None
|
| 210 |
+
finally:
|
| 211 |
+
Path.unlink(tmppath)
|
| 212 |
+
else:
|
| 213 |
+
try:
|
| 214 |
+
retval = None
|
| 215 |
+
# Emulate os.popen, but redirect stderr
|
| 216 |
+
proc = subprocess.Popen(
|
| 217 |
+
pager_cmd,
|
| 218 |
+
shell=True,
|
| 219 |
+
stdin=subprocess.PIPE,
|
| 220 |
+
stderr=subprocess.DEVNULL,
|
| 221 |
+
)
|
| 222 |
+
pager = os._wrap_close(
|
| 223 |
+
io.TextIOWrapper(proc.stdin, encoding="utf-8"), proc
|
| 224 |
+
)
|
| 225 |
+
try:
|
| 226 |
+
pager_encoding = pager.encoding or sys.stdout.encoding
|
| 227 |
+
pager.write(strng)
|
| 228 |
+
finally:
|
| 229 |
+
retval = pager.close()
|
| 230 |
+
except IOError as msg: # broken pipe when user quits
|
| 231 |
+
if msg.args == (32, 'Broken pipe'):
|
| 232 |
+
retval = None
|
| 233 |
+
else:
|
| 234 |
+
retval = 1
|
| 235 |
+
except OSError:
|
| 236 |
+
# Other strange problems, sometimes seen in Win2k/cygwin
|
| 237 |
+
retval = 1
|
| 238 |
+
if retval is not None:
|
| 239 |
+
page_dumb(strng,screen_lines=screen_lines)
|
| 240 |
+
|
| 241 |
+
|
| 242 |
+
def page(data, start: int = 0, screen_lines: int = 0, pager_cmd=None):
|
| 243 |
+
"""Display content in a pager, piping through a pager after a certain length.
|
| 244 |
+
|
| 245 |
+
data can be a mime-bundle dict, supplying multiple representations,
|
| 246 |
+
keyed by mime-type, or text.
|
| 247 |
+
|
| 248 |
+
Pager is dispatched via the `show_in_pager` IPython hook.
|
| 249 |
+
If no hook is registered, `pager_page` will be used.
|
| 250 |
+
"""
|
| 251 |
+
# Some routines may auto-compute start offsets incorrectly and pass a
|
| 252 |
+
# negative value. Offset to 0 for robustness.
|
| 253 |
+
start = max(0, start)
|
| 254 |
+
|
| 255 |
+
# first, try the hook
|
| 256 |
+
ip = get_ipython()
|
| 257 |
+
if ip:
|
| 258 |
+
try:
|
| 259 |
+
ip.hooks.show_in_pager(data, start=start, screen_lines=screen_lines)
|
| 260 |
+
return
|
| 261 |
+
except TryNext:
|
| 262 |
+
pass
|
| 263 |
+
|
| 264 |
+
# fallback on default pager
|
| 265 |
+
return pager_page(data, start, screen_lines, pager_cmd)
|
| 266 |
+
|
| 267 |
+
|
| 268 |
+
def page_file(fname, start=0, pager_cmd=None):
|
| 269 |
+
"""Page a file, using an optional pager command and starting line.
|
| 270 |
+
"""
|
| 271 |
+
|
| 272 |
+
pager_cmd = get_pager_cmd(pager_cmd)
|
| 273 |
+
pager_cmd += ' ' + get_pager_start(pager_cmd,start)
|
| 274 |
+
|
| 275 |
+
try:
|
| 276 |
+
if os.environ['TERM'] in ['emacs','dumb']:
|
| 277 |
+
raise EnvironmentError
|
| 278 |
+
system(pager_cmd + ' ' + fname)
|
| 279 |
+
except:
|
| 280 |
+
try:
|
| 281 |
+
if start > 0:
|
| 282 |
+
start -= 1
|
| 283 |
+
page(open(fname, encoding="utf-8").read(), start)
|
| 284 |
+
except:
|
| 285 |
+
print('Unable to show file',repr(fname))
|
| 286 |
+
|
| 287 |
+
|
| 288 |
+
def get_pager_cmd(pager_cmd=None):
|
| 289 |
+
"""Return a pager command.
|
| 290 |
+
|
| 291 |
+
Makes some attempts at finding an OS-correct one.
|
| 292 |
+
"""
|
| 293 |
+
if os.name == 'posix':
|
| 294 |
+
default_pager_cmd = 'less -R' # -R for color control sequences
|
| 295 |
+
elif os.name in ['nt','dos']:
|
| 296 |
+
default_pager_cmd = 'type'
|
| 297 |
+
|
| 298 |
+
if pager_cmd is None:
|
| 299 |
+
try:
|
| 300 |
+
pager_cmd = os.environ['PAGER']
|
| 301 |
+
except:
|
| 302 |
+
pager_cmd = default_pager_cmd
|
| 303 |
+
|
| 304 |
+
if pager_cmd == 'less' and '-r' not in os.environ.get('LESS', '').lower():
|
| 305 |
+
pager_cmd += ' -R'
|
| 306 |
+
|
| 307 |
+
return pager_cmd
|
| 308 |
+
|
| 309 |
+
|
| 310 |
+
def get_pager_start(pager, start):
|
| 311 |
+
"""Return the string for paging files with an offset.
|
| 312 |
+
|
| 313 |
+
This is the '+N' argument which less and more (under Unix) accept.
|
| 314 |
+
"""
|
| 315 |
+
|
| 316 |
+
if pager in ['less','more']:
|
| 317 |
+
if start:
|
| 318 |
+
start_string = '+' + str(start)
|
| 319 |
+
else:
|
| 320 |
+
start_string = ''
|
| 321 |
+
else:
|
| 322 |
+
start_string = ''
|
| 323 |
+
return start_string
|
| 324 |
+
|
| 325 |
+
|
| 326 |
+
# (X)emacs on win32 doesn't like to be bypassed with msvcrt.getch()
|
| 327 |
+
if os.name == 'nt' and os.environ.get('TERM','dumb') != 'emacs':
|
| 328 |
+
import msvcrt
|
| 329 |
+
def page_more():
|
| 330 |
+
""" Smart pausing between pages
|
| 331 |
+
|
| 332 |
+
@return: True if need print more lines, False if quit
|
| 333 |
+
"""
|
| 334 |
+
sys.stdout.write('---Return to continue, q to quit--- ')
|
| 335 |
+
ans = msvcrt.getwch()
|
| 336 |
+
if ans in ("q", "Q"):
|
| 337 |
+
result = False
|
| 338 |
+
else:
|
| 339 |
+
result = True
|
| 340 |
+
sys.stdout.write("\b"*37 + " "*37 + "\b"*37)
|
| 341 |
+
return result
|
| 342 |
+
else:
|
| 343 |
+
def page_more():
|
| 344 |
+
ans = py3compat.input('---Return to continue, q to quit--- ')
|
| 345 |
+
if ans.lower().startswith('q'):
|
| 346 |
+
return False
|
| 347 |
+
else:
|
| 348 |
+
return True
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/payloadpage.py
ADDED
|
@@ -0,0 +1,51 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""A payload based version of page."""
|
| 3 |
+
|
| 4 |
+
# Copyright (c) IPython Development Team.
|
| 5 |
+
# Distributed under the terms of the Modified BSD License.
|
| 6 |
+
|
| 7 |
+
import warnings
|
| 8 |
+
from IPython.core.getipython import get_ipython
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
def page(strng, start=0, screen_lines=0, pager_cmd=None):
|
| 12 |
+
"""Print a string, piping through a pager.
|
| 13 |
+
|
| 14 |
+
This version ignores the screen_lines and pager_cmd arguments and uses
|
| 15 |
+
IPython's payload system instead.
|
| 16 |
+
|
| 17 |
+
Parameters
|
| 18 |
+
----------
|
| 19 |
+
strng : str or mime-dict
|
| 20 |
+
Text to page, or a mime-type keyed dict of already formatted data.
|
| 21 |
+
start : int
|
| 22 |
+
Starting line at which to place the display.
|
| 23 |
+
"""
|
| 24 |
+
|
| 25 |
+
# Some routines may auto-compute start offsets incorrectly and pass a
|
| 26 |
+
# negative value. Offset to 0 for robustness.
|
| 27 |
+
start = max(0, start)
|
| 28 |
+
shell = get_ipython()
|
| 29 |
+
|
| 30 |
+
if isinstance(strng, dict):
|
| 31 |
+
data = strng
|
| 32 |
+
else:
|
| 33 |
+
data = {'text/plain' : strng}
|
| 34 |
+
payload = dict(
|
| 35 |
+
source='page',
|
| 36 |
+
data=data,
|
| 37 |
+
start=start,
|
| 38 |
+
)
|
| 39 |
+
shell.payload_manager.write_payload(payload)
|
| 40 |
+
|
| 41 |
+
|
| 42 |
+
def install_payload_page():
|
| 43 |
+
"""DEPRECATED, use show_in_pager hook
|
| 44 |
+
|
| 45 |
+
Install this version of page as IPython.core.page.page.
|
| 46 |
+
"""
|
| 47 |
+
warnings.warn("""install_payload_page is deprecated.
|
| 48 |
+
Use `ip.set_hook('show_in_pager, page.as_hook(payloadpage.page))`
|
| 49 |
+
""")
|
| 50 |
+
from IPython.core import page as corepage
|
| 51 |
+
corepage.page = page
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/prefilter.py
ADDED
|
@@ -0,0 +1,707 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
Prefiltering components.
|
| 4 |
+
|
| 5 |
+
Prefilters transform user input before it is exec'd by Python. These
|
| 6 |
+
transforms are used to implement additional syntax such as !ls and %magic.
|
| 7 |
+
"""
|
| 8 |
+
|
| 9 |
+
# Copyright (c) IPython Development Team.
|
| 10 |
+
# Distributed under the terms of the Modified BSD License.
|
| 11 |
+
|
| 12 |
+
from keyword import iskeyword
|
| 13 |
+
import re
|
| 14 |
+
|
| 15 |
+
from .autocall import IPyAutocall
|
| 16 |
+
from traitlets.config.configurable import Configurable
|
| 17 |
+
from .inputtransformer2 import (
|
| 18 |
+
ESC_MAGIC,
|
| 19 |
+
ESC_QUOTE,
|
| 20 |
+
ESC_QUOTE2,
|
| 21 |
+
ESC_PAREN,
|
| 22 |
+
)
|
| 23 |
+
from .macro import Macro
|
| 24 |
+
from .splitinput import LineInfo
|
| 25 |
+
|
| 26 |
+
from traitlets import (
|
| 27 |
+
List, Integer, Unicode, Bool, Instance, CRegExp
|
| 28 |
+
)
|
| 29 |
+
|
| 30 |
+
#-----------------------------------------------------------------------------
|
| 31 |
+
# Global utilities, errors and constants
|
| 32 |
+
#-----------------------------------------------------------------------------
|
| 33 |
+
|
| 34 |
+
|
| 35 |
+
class PrefilterError(Exception):
|
| 36 |
+
pass
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
# RegExp to identify potential function names
|
| 40 |
+
re_fun_name = re.compile(r'[^\W\d]([\w.]*) *$')
|
| 41 |
+
|
| 42 |
+
# RegExp to exclude strings with this start from autocalling. In
|
| 43 |
+
# particular, all binary operators should be excluded, so that if foo is
|
| 44 |
+
# callable, foo OP bar doesn't become foo(OP bar), which is invalid. The
|
| 45 |
+
# characters '!=()' don't need to be checked for, as the checkPythonChars
|
| 46 |
+
# routine explicitly does so, to catch direct calls and rebindings of
|
| 47 |
+
# existing names.
|
| 48 |
+
|
| 49 |
+
# Warning: the '-' HAS TO BE AT THE END of the first group, otherwise
|
| 50 |
+
# it affects the rest of the group in square brackets.
|
| 51 |
+
re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]'
|
| 52 |
+
r'|^is |^not |^in |^and |^or ')
|
| 53 |
+
|
| 54 |
+
# try to catch also methods for stuff in lists/tuples/dicts: off
|
| 55 |
+
# (experimental). For this to work, the line_split regexp would need
|
| 56 |
+
# to be modified so it wouldn't break things at '['. That line is
|
| 57 |
+
# nasty enough that I shouldn't change it until I can test it _well_.
|
| 58 |
+
#self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$')
|
| 59 |
+
|
| 60 |
+
|
| 61 |
+
# Handler Check Utilities
|
| 62 |
+
def is_shadowed(identifier, ip):
|
| 63 |
+
"""Is the given identifier defined in one of the namespaces which shadow
|
| 64 |
+
the alias and magic namespaces? Note that an identifier is different
|
| 65 |
+
than ifun, because it can not contain a '.' character."""
|
| 66 |
+
# This is much safer than calling ofind, which can change state
|
| 67 |
+
return (identifier in ip.user_ns \
|
| 68 |
+
or identifier in ip.user_global_ns \
|
| 69 |
+
or identifier in ip.ns_table['builtin']\
|
| 70 |
+
or iskeyword(identifier))
|
| 71 |
+
|
| 72 |
+
|
| 73 |
+
#-----------------------------------------------------------------------------
|
| 74 |
+
# Main Prefilter manager
|
| 75 |
+
#-----------------------------------------------------------------------------
|
| 76 |
+
|
| 77 |
+
|
| 78 |
+
class PrefilterManager(Configurable):
|
| 79 |
+
"""Main prefilter component.
|
| 80 |
+
|
| 81 |
+
The IPython prefilter is run on all user input before it is run. The
|
| 82 |
+
prefilter consumes lines of input and produces transformed lines of
|
| 83 |
+
input.
|
| 84 |
+
|
| 85 |
+
The implementation consists of two phases:
|
| 86 |
+
|
| 87 |
+
1. Transformers
|
| 88 |
+
2. Checkers and handlers
|
| 89 |
+
|
| 90 |
+
Over time, we plan on deprecating the checkers and handlers and doing
|
| 91 |
+
everything in the transformers.
|
| 92 |
+
|
| 93 |
+
The transformers are instances of :class:`PrefilterTransformer` and have
|
| 94 |
+
a single method :meth:`transform` that takes a line and returns a
|
| 95 |
+
transformed line. The transformation can be accomplished using any
|
| 96 |
+
tool, but our current ones use regular expressions for speed.
|
| 97 |
+
|
| 98 |
+
After all the transformers have been run, the line is fed to the checkers,
|
| 99 |
+
which are instances of :class:`PrefilterChecker`. The line is passed to
|
| 100 |
+
the :meth:`check` method, which either returns `None` or a
|
| 101 |
+
:class:`PrefilterHandler` instance. If `None` is returned, the other
|
| 102 |
+
checkers are tried. If an :class:`PrefilterHandler` instance is returned,
|
| 103 |
+
the line is passed to the :meth:`handle` method of the returned
|
| 104 |
+
handler and no further checkers are tried.
|
| 105 |
+
|
| 106 |
+
Both transformers and checkers have a `priority` attribute, that determines
|
| 107 |
+
the order in which they are called. Smaller priorities are tried first.
|
| 108 |
+
|
| 109 |
+
Both transformers and checkers also have `enabled` attribute, which is
|
| 110 |
+
a boolean that determines if the instance is used.
|
| 111 |
+
|
| 112 |
+
Users or developers can change the priority or enabled attribute of
|
| 113 |
+
transformers or checkers, but they must call the :meth:`sort_checkers`
|
| 114 |
+
or :meth:`sort_transformers` method after changing the priority.
|
| 115 |
+
"""
|
| 116 |
+
|
| 117 |
+
multi_line_specials = Bool(True).tag(config=True)
|
| 118 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
| 119 |
+
|
| 120 |
+
def __init__(self, shell=None, **kwargs):
|
| 121 |
+
super(PrefilterManager, self).__init__(shell=shell, **kwargs)
|
| 122 |
+
self.shell = shell
|
| 123 |
+
self._transformers = []
|
| 124 |
+
self.init_handlers()
|
| 125 |
+
self.init_checkers()
|
| 126 |
+
|
| 127 |
+
#-------------------------------------------------------------------------
|
| 128 |
+
# API for managing transformers
|
| 129 |
+
#-------------------------------------------------------------------------
|
| 130 |
+
|
| 131 |
+
def sort_transformers(self):
|
| 132 |
+
"""Sort the transformers by priority.
|
| 133 |
+
|
| 134 |
+
This must be called after the priority of a transformer is changed.
|
| 135 |
+
The :meth:`register_transformer` method calls this automatically.
|
| 136 |
+
"""
|
| 137 |
+
self._transformers.sort(key=lambda x: x.priority)
|
| 138 |
+
|
| 139 |
+
@property
|
| 140 |
+
def transformers(self):
|
| 141 |
+
"""Return a list of checkers, sorted by priority."""
|
| 142 |
+
return self._transformers
|
| 143 |
+
|
| 144 |
+
def register_transformer(self, transformer):
|
| 145 |
+
"""Register a transformer instance."""
|
| 146 |
+
if transformer not in self._transformers:
|
| 147 |
+
self._transformers.append(transformer)
|
| 148 |
+
self.sort_transformers()
|
| 149 |
+
|
| 150 |
+
def unregister_transformer(self, transformer):
|
| 151 |
+
"""Unregister a transformer instance."""
|
| 152 |
+
if transformer in self._transformers:
|
| 153 |
+
self._transformers.remove(transformer)
|
| 154 |
+
|
| 155 |
+
#-------------------------------------------------------------------------
|
| 156 |
+
# API for managing checkers
|
| 157 |
+
#-------------------------------------------------------------------------
|
| 158 |
+
|
| 159 |
+
def init_checkers(self):
|
| 160 |
+
"""Create the default checkers."""
|
| 161 |
+
self._checkers = []
|
| 162 |
+
for checker in _default_checkers:
|
| 163 |
+
checker(
|
| 164 |
+
shell=self.shell, prefilter_manager=self, parent=self
|
| 165 |
+
)
|
| 166 |
+
|
| 167 |
+
def sort_checkers(self):
|
| 168 |
+
"""Sort the checkers by priority.
|
| 169 |
+
|
| 170 |
+
This must be called after the priority of a checker is changed.
|
| 171 |
+
The :meth:`register_checker` method calls this automatically.
|
| 172 |
+
"""
|
| 173 |
+
self._checkers.sort(key=lambda x: x.priority)
|
| 174 |
+
|
| 175 |
+
@property
|
| 176 |
+
def checkers(self):
|
| 177 |
+
"""Return a list of checkers, sorted by priority."""
|
| 178 |
+
return self._checkers
|
| 179 |
+
|
| 180 |
+
def register_checker(self, checker):
|
| 181 |
+
"""Register a checker instance."""
|
| 182 |
+
if checker not in self._checkers:
|
| 183 |
+
self._checkers.append(checker)
|
| 184 |
+
self.sort_checkers()
|
| 185 |
+
|
| 186 |
+
def unregister_checker(self, checker):
|
| 187 |
+
"""Unregister a checker instance."""
|
| 188 |
+
if checker in self._checkers:
|
| 189 |
+
self._checkers.remove(checker)
|
| 190 |
+
|
| 191 |
+
#-------------------------------------------------------------------------
|
| 192 |
+
# API for managing handlers
|
| 193 |
+
#-------------------------------------------------------------------------
|
| 194 |
+
|
| 195 |
+
def init_handlers(self):
|
| 196 |
+
"""Create the default handlers."""
|
| 197 |
+
self._handlers = {}
|
| 198 |
+
self._esc_handlers = {}
|
| 199 |
+
for handler in _default_handlers:
|
| 200 |
+
handler(
|
| 201 |
+
shell=self.shell, prefilter_manager=self, parent=self
|
| 202 |
+
)
|
| 203 |
+
|
| 204 |
+
@property
|
| 205 |
+
def handlers(self):
|
| 206 |
+
"""Return a dict of all the handlers."""
|
| 207 |
+
return self._handlers
|
| 208 |
+
|
| 209 |
+
def register_handler(self, name, handler, esc_strings):
|
| 210 |
+
"""Register a handler instance by name with esc_strings."""
|
| 211 |
+
self._handlers[name] = handler
|
| 212 |
+
for esc_str in esc_strings:
|
| 213 |
+
self._esc_handlers[esc_str] = handler
|
| 214 |
+
|
| 215 |
+
def unregister_handler(self, name, handler, esc_strings):
|
| 216 |
+
"""Unregister a handler instance by name with esc_strings."""
|
| 217 |
+
try:
|
| 218 |
+
del self._handlers[name]
|
| 219 |
+
except KeyError:
|
| 220 |
+
pass
|
| 221 |
+
for esc_str in esc_strings:
|
| 222 |
+
h = self._esc_handlers.get(esc_str)
|
| 223 |
+
if h is handler:
|
| 224 |
+
del self._esc_handlers[esc_str]
|
| 225 |
+
|
| 226 |
+
def get_handler_by_name(self, name):
|
| 227 |
+
"""Get a handler by its name."""
|
| 228 |
+
return self._handlers.get(name)
|
| 229 |
+
|
| 230 |
+
def get_handler_by_esc(self, esc_str):
|
| 231 |
+
"""Get a handler by its escape string."""
|
| 232 |
+
return self._esc_handlers.get(esc_str)
|
| 233 |
+
|
| 234 |
+
#-------------------------------------------------------------------------
|
| 235 |
+
# Main prefiltering API
|
| 236 |
+
#-------------------------------------------------------------------------
|
| 237 |
+
|
| 238 |
+
def prefilter_line_info(self, line_info):
|
| 239 |
+
"""Prefilter a line that has been converted to a LineInfo object.
|
| 240 |
+
|
| 241 |
+
This implements the checker/handler part of the prefilter pipe.
|
| 242 |
+
"""
|
| 243 |
+
# print("prefilter_line_info: ", line_info)
|
| 244 |
+
handler = self.find_handler(line_info)
|
| 245 |
+
return handler.handle(line_info)
|
| 246 |
+
|
| 247 |
+
def find_handler(self, line_info):
|
| 248 |
+
"""Find a handler for the line_info by trying checkers."""
|
| 249 |
+
for checker in self.checkers:
|
| 250 |
+
if checker.enabled:
|
| 251 |
+
handler = checker.check(line_info)
|
| 252 |
+
if handler:
|
| 253 |
+
return handler
|
| 254 |
+
return self.get_handler_by_name('normal')
|
| 255 |
+
|
| 256 |
+
def transform_line(self, line, continue_prompt):
|
| 257 |
+
"""Calls the enabled transformers in order of increasing priority."""
|
| 258 |
+
for transformer in self.transformers:
|
| 259 |
+
if transformer.enabled:
|
| 260 |
+
line = transformer.transform(line, continue_prompt)
|
| 261 |
+
return line
|
| 262 |
+
|
| 263 |
+
def prefilter_line(self, line, continue_prompt=False):
|
| 264 |
+
"""Prefilter a single input line as text.
|
| 265 |
+
|
| 266 |
+
This method prefilters a single line of text by calling the
|
| 267 |
+
transformers and then the checkers/handlers.
|
| 268 |
+
"""
|
| 269 |
+
|
| 270 |
+
# print("prefilter_line: ", line, continue_prompt)
|
| 271 |
+
# All handlers *must* return a value, even if it's blank ('').
|
| 272 |
+
|
| 273 |
+
# save the line away in case we crash, so the post-mortem handler can
|
| 274 |
+
# record it
|
| 275 |
+
self.shell._last_input_line = line
|
| 276 |
+
|
| 277 |
+
if not line:
|
| 278 |
+
# Return immediately on purely empty lines, so that if the user
|
| 279 |
+
# previously typed some whitespace that started a continuation
|
| 280 |
+
# prompt, he can break out of that loop with just an empty line.
|
| 281 |
+
# This is how the default python prompt works.
|
| 282 |
+
return ''
|
| 283 |
+
|
| 284 |
+
# At this point, we invoke our transformers.
|
| 285 |
+
if not continue_prompt or (continue_prompt and self.multi_line_specials):
|
| 286 |
+
line = self.transform_line(line, continue_prompt)
|
| 287 |
+
|
| 288 |
+
# Now we compute line_info for the checkers and handlers
|
| 289 |
+
line_info = LineInfo(line, continue_prompt)
|
| 290 |
+
|
| 291 |
+
# the input history needs to track even empty lines
|
| 292 |
+
stripped = line.strip()
|
| 293 |
+
|
| 294 |
+
normal_handler = self.get_handler_by_name('normal')
|
| 295 |
+
if not stripped:
|
| 296 |
+
return normal_handler.handle(line_info)
|
| 297 |
+
|
| 298 |
+
# special handlers are only allowed for single line statements
|
| 299 |
+
if continue_prompt and not self.multi_line_specials:
|
| 300 |
+
return normal_handler.handle(line_info)
|
| 301 |
+
|
| 302 |
+
prefiltered = self.prefilter_line_info(line_info)
|
| 303 |
+
# print("prefiltered line: %r" % prefiltered)
|
| 304 |
+
return prefiltered
|
| 305 |
+
|
| 306 |
+
def prefilter_lines(self, lines, continue_prompt=False):
|
| 307 |
+
"""Prefilter multiple input lines of text.
|
| 308 |
+
|
| 309 |
+
This is the main entry point for prefiltering multiple lines of
|
| 310 |
+
input. This simply calls :meth:`prefilter_line` for each line of
|
| 311 |
+
input.
|
| 312 |
+
|
| 313 |
+
This covers cases where there are multiple lines in the user entry,
|
| 314 |
+
which is the case when the user goes back to a multiline history
|
| 315 |
+
entry and presses enter.
|
| 316 |
+
"""
|
| 317 |
+
llines = lines.rstrip('\n').split('\n')
|
| 318 |
+
# We can get multiple lines in one shot, where multiline input 'blends'
|
| 319 |
+
# into one line, in cases like recalling from the readline history
|
| 320 |
+
# buffer. We need to make sure that in such cases, we correctly
|
| 321 |
+
# communicate downstream which line is first and which are continuation
|
| 322 |
+
# ones.
|
| 323 |
+
if len(llines) > 1:
|
| 324 |
+
out = '\n'.join([self.prefilter_line(line, lnum>0)
|
| 325 |
+
for lnum, line in enumerate(llines) ])
|
| 326 |
+
else:
|
| 327 |
+
out = self.prefilter_line(llines[0], continue_prompt)
|
| 328 |
+
|
| 329 |
+
return out
|
| 330 |
+
|
| 331 |
+
#-----------------------------------------------------------------------------
|
| 332 |
+
# Prefilter transformers
|
| 333 |
+
#-----------------------------------------------------------------------------
|
| 334 |
+
|
| 335 |
+
|
| 336 |
+
class PrefilterTransformer(Configurable):
|
| 337 |
+
"""Transform a line of user input."""
|
| 338 |
+
|
| 339 |
+
priority = Integer(100).tag(config=True)
|
| 340 |
+
# Transformers don't currently use shell or prefilter_manager, but as we
|
| 341 |
+
# move away from checkers and handlers, they will need them.
|
| 342 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
| 343 |
+
prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True)
|
| 344 |
+
enabled = Bool(True).tag(config=True)
|
| 345 |
+
|
| 346 |
+
def __init__(self, shell=None, prefilter_manager=None, **kwargs):
|
| 347 |
+
super(PrefilterTransformer, self).__init__(
|
| 348 |
+
shell=shell, prefilter_manager=prefilter_manager, **kwargs
|
| 349 |
+
)
|
| 350 |
+
self.prefilter_manager.register_transformer(self)
|
| 351 |
+
|
| 352 |
+
def transform(self, line, continue_prompt):
|
| 353 |
+
"""Transform a line, returning the new one."""
|
| 354 |
+
return None
|
| 355 |
+
|
| 356 |
+
def __repr__(self):
|
| 357 |
+
return "<%s(priority=%r, enabled=%r)>" % (
|
| 358 |
+
self.__class__.__name__, self.priority, self.enabled)
|
| 359 |
+
|
| 360 |
+
|
| 361 |
+
#-----------------------------------------------------------------------------
|
| 362 |
+
# Prefilter checkers
|
| 363 |
+
#-----------------------------------------------------------------------------
|
| 364 |
+
|
| 365 |
+
|
| 366 |
+
class PrefilterChecker(Configurable):
|
| 367 |
+
"""Inspect an input line and return a handler for that line."""
|
| 368 |
+
|
| 369 |
+
priority = Integer(100).tag(config=True)
|
| 370 |
+
shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
| 371 |
+
prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True)
|
| 372 |
+
enabled = Bool(True).tag(config=True)
|
| 373 |
+
|
| 374 |
+
def __init__(self, shell=None, prefilter_manager=None, **kwargs):
|
| 375 |
+
super(PrefilterChecker, self).__init__(
|
| 376 |
+
shell=shell, prefilter_manager=prefilter_manager, **kwargs
|
| 377 |
+
)
|
| 378 |
+
self.prefilter_manager.register_checker(self)
|
| 379 |
+
|
| 380 |
+
def check(self, line_info):
|
| 381 |
+
"""Inspect line_info and return a handler instance or None."""
|
| 382 |
+
return None
|
| 383 |
+
|
| 384 |
+
def __repr__(self):
|
| 385 |
+
return "<%s(priority=%r, enabled=%r)>" % (
|
| 386 |
+
self.__class__.__name__, self.priority, self.enabled)
|
| 387 |
+
|
| 388 |
+
|
| 389 |
+
class EmacsChecker(PrefilterChecker):
|
| 390 |
+
|
| 391 |
+
priority = Integer(100).tag(config=True)
|
| 392 |
+
enabled = Bool(False).tag(config=True)
|
| 393 |
+
|
| 394 |
+
def check(self, line_info):
|
| 395 |
+
"Emacs ipython-mode tags certain input lines."
|
| 396 |
+
if line_info.line.endswith('# PYTHON-MODE'):
|
| 397 |
+
return self.prefilter_manager.get_handler_by_name('emacs')
|
| 398 |
+
else:
|
| 399 |
+
return None
|
| 400 |
+
|
| 401 |
+
|
| 402 |
+
class MacroChecker(PrefilterChecker):
|
| 403 |
+
|
| 404 |
+
priority = Integer(250).tag(config=True)
|
| 405 |
+
|
| 406 |
+
def check(self, line_info):
|
| 407 |
+
obj = self.shell.user_ns.get(line_info.ifun)
|
| 408 |
+
if isinstance(obj, Macro):
|
| 409 |
+
return self.prefilter_manager.get_handler_by_name('macro')
|
| 410 |
+
else:
|
| 411 |
+
return None
|
| 412 |
+
|
| 413 |
+
|
| 414 |
+
class IPyAutocallChecker(PrefilterChecker):
|
| 415 |
+
|
| 416 |
+
priority = Integer(300).tag(config=True)
|
| 417 |
+
|
| 418 |
+
def check(self, line_info):
|
| 419 |
+
"Instances of IPyAutocall in user_ns get autocalled immediately"
|
| 420 |
+
obj = self.shell.user_ns.get(line_info.ifun, None)
|
| 421 |
+
if isinstance(obj, IPyAutocall):
|
| 422 |
+
obj.set_ip(self.shell)
|
| 423 |
+
return self.prefilter_manager.get_handler_by_name('auto')
|
| 424 |
+
else:
|
| 425 |
+
return None
|
| 426 |
+
|
| 427 |
+
|
| 428 |
+
class AssignmentChecker(PrefilterChecker):
|
| 429 |
+
|
| 430 |
+
priority = Integer(600).tag(config=True)
|
| 431 |
+
|
| 432 |
+
def check(self, line_info):
|
| 433 |
+
"""Check to see if user is assigning to a var for the first time, in
|
| 434 |
+
which case we want to avoid any sort of automagic / autocall games.
|
| 435 |
+
|
| 436 |
+
This allows users to assign to either alias or magic names true python
|
| 437 |
+
variables (the magic/alias systems always take second seat to true
|
| 438 |
+
python code). E.g. ls='hi', or ls,that=1,2"""
|
| 439 |
+
if line_info.the_rest:
|
| 440 |
+
if line_info.the_rest[0] in '=,':
|
| 441 |
+
return self.prefilter_manager.get_handler_by_name('normal')
|
| 442 |
+
else:
|
| 443 |
+
return None
|
| 444 |
+
|
| 445 |
+
|
| 446 |
+
class AutoMagicChecker(PrefilterChecker):
|
| 447 |
+
|
| 448 |
+
priority = Integer(700).tag(config=True)
|
| 449 |
+
|
| 450 |
+
def check(self, line_info):
|
| 451 |
+
"""If the ifun is magic, and automagic is on, run it. Note: normal,
|
| 452 |
+
non-auto magic would already have been triggered via '%' in
|
| 453 |
+
check_esc_chars. This just checks for automagic. Also, before
|
| 454 |
+
triggering the magic handler, make sure that there is nothing in the
|
| 455 |
+
user namespace which could shadow it."""
|
| 456 |
+
if not self.shell.automagic or not self.shell.find_magic(line_info.ifun):
|
| 457 |
+
return None
|
| 458 |
+
|
| 459 |
+
# We have a likely magic method. Make sure we should actually call it.
|
| 460 |
+
if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials:
|
| 461 |
+
return None
|
| 462 |
+
|
| 463 |
+
head = line_info.ifun.split('.',1)[0]
|
| 464 |
+
if is_shadowed(head, self.shell):
|
| 465 |
+
return None
|
| 466 |
+
|
| 467 |
+
return self.prefilter_manager.get_handler_by_name('magic')
|
| 468 |
+
|
| 469 |
+
|
| 470 |
+
class PythonOpsChecker(PrefilterChecker):
|
| 471 |
+
|
| 472 |
+
priority = Integer(900).tag(config=True)
|
| 473 |
+
|
| 474 |
+
def check(self, line_info):
|
| 475 |
+
"""If the 'rest' of the line begins with a function call or pretty much
|
| 476 |
+
any python operator, we should simply execute the line (regardless of
|
| 477 |
+
whether or not there's a possible autocall expansion). This avoids
|
| 478 |
+
spurious (and very confusing) geattr() accesses."""
|
| 479 |
+
if line_info.the_rest and line_info.the_rest[0] in "!=()<>,+*/%^&|":
|
| 480 |
+
return self.prefilter_manager.get_handler_by_name("normal")
|
| 481 |
+
else:
|
| 482 |
+
return None
|
| 483 |
+
|
| 484 |
+
|
| 485 |
+
class AutocallChecker(PrefilterChecker):
|
| 486 |
+
|
| 487 |
+
priority = Integer(1000).tag(config=True)
|
| 488 |
+
|
| 489 |
+
function_name_regexp = CRegExp(re_fun_name,
|
| 490 |
+
help="RegExp to identify potential function names."
|
| 491 |
+
).tag(config=True)
|
| 492 |
+
exclude_regexp = CRegExp(re_exclude_auto,
|
| 493 |
+
help="RegExp to exclude strings with this start from autocalling."
|
| 494 |
+
).tag(config=True)
|
| 495 |
+
|
| 496 |
+
def check(self, line_info):
|
| 497 |
+
"Check if the initial word/function is callable and autocall is on."
|
| 498 |
+
if not self.shell.autocall:
|
| 499 |
+
return None
|
| 500 |
+
|
| 501 |
+
oinfo = line_info.ofind(self.shell) # This can mutate state via getattr
|
| 502 |
+
if not oinfo.found:
|
| 503 |
+
return None
|
| 504 |
+
|
| 505 |
+
ignored_funs = ['b', 'f', 'r', 'u', 'br', 'rb', 'fr', 'rf']
|
| 506 |
+
ifun = line_info.ifun
|
| 507 |
+
line = line_info.line
|
| 508 |
+
if ifun.lower() in ignored_funs and (line.startswith(ifun + "'") or line.startswith(ifun + '"')):
|
| 509 |
+
return None
|
| 510 |
+
|
| 511 |
+
if (
|
| 512 |
+
callable(oinfo.obj)
|
| 513 |
+
and (not self.exclude_regexp.match(line_info.the_rest))
|
| 514 |
+
and self.function_name_regexp.match(line_info.ifun)
|
| 515 |
+
and (
|
| 516 |
+
line_info.raw_the_rest.startswith(" ")
|
| 517 |
+
or not line_info.raw_the_rest.strip()
|
| 518 |
+
)
|
| 519 |
+
):
|
| 520 |
+
return self.prefilter_manager.get_handler_by_name("auto")
|
| 521 |
+
else:
|
| 522 |
+
return None
|
| 523 |
+
|
| 524 |
+
|
| 525 |
+
#-----------------------------------------------------------------------------
|
| 526 |
+
# Prefilter handlers
|
| 527 |
+
#-----------------------------------------------------------------------------
|
| 528 |
+
|
| 529 |
+
|
| 530 |
+
class PrefilterHandler(Configurable):
|
| 531 |
+
handler_name = Unicode("normal")
|
| 532 |
+
esc_strings: List = List([])
|
| 533 |
+
shell = Instance(
|
| 534 |
+
"IPython.core.interactiveshell.InteractiveShellABC", allow_none=True
|
| 535 |
+
)
|
| 536 |
+
prefilter_manager = Instance(
|
| 537 |
+
"IPython.core.prefilter.PrefilterManager", allow_none=True
|
| 538 |
+
)
|
| 539 |
+
|
| 540 |
+
def __init__(self, shell=None, prefilter_manager=None, **kwargs):
|
| 541 |
+
super(PrefilterHandler, self).__init__(
|
| 542 |
+
shell=shell, prefilter_manager=prefilter_manager, **kwargs
|
| 543 |
+
)
|
| 544 |
+
self.prefilter_manager.register_handler(
|
| 545 |
+
self.handler_name,
|
| 546 |
+
self,
|
| 547 |
+
self.esc_strings
|
| 548 |
+
)
|
| 549 |
+
|
| 550 |
+
def handle(self, line_info):
|
| 551 |
+
# print("normal: ", line_info)
|
| 552 |
+
"""Handle normal input lines. Use as a template for handlers."""
|
| 553 |
+
|
| 554 |
+
# With autoindent on, we need some way to exit the input loop, and I
|
| 555 |
+
# don't want to force the user to have to backspace all the way to
|
| 556 |
+
# clear the line. The rule will be in this case, that either two
|
| 557 |
+
# lines of pure whitespace in a row, or a line of pure whitespace but
|
| 558 |
+
# of a size different to the indent level, will exit the input loop.
|
| 559 |
+
line = line_info.line
|
| 560 |
+
continue_prompt = line_info.continue_prompt
|
| 561 |
+
|
| 562 |
+
if (continue_prompt and
|
| 563 |
+
self.shell.autoindent and
|
| 564 |
+
line.isspace() and
|
| 565 |
+
0 < abs(len(line) - self.shell.indent_current_nsp) <= 2):
|
| 566 |
+
line = ''
|
| 567 |
+
|
| 568 |
+
return line
|
| 569 |
+
|
| 570 |
+
def __str__(self):
|
| 571 |
+
return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name)
|
| 572 |
+
|
| 573 |
+
|
| 574 |
+
class MacroHandler(PrefilterHandler):
|
| 575 |
+
handler_name = Unicode("macro")
|
| 576 |
+
|
| 577 |
+
def handle(self, line_info):
|
| 578 |
+
obj = self.shell.user_ns.get(line_info.ifun)
|
| 579 |
+
pre_space = line_info.pre_whitespace
|
| 580 |
+
line_sep = "\n" + pre_space
|
| 581 |
+
return pre_space + line_sep.join(obj.value.splitlines())
|
| 582 |
+
|
| 583 |
+
|
| 584 |
+
class MagicHandler(PrefilterHandler):
|
| 585 |
+
|
| 586 |
+
handler_name = Unicode('magic')
|
| 587 |
+
esc_strings = List([ESC_MAGIC])
|
| 588 |
+
|
| 589 |
+
def handle(self, line_info):
|
| 590 |
+
"""Execute magic functions."""
|
| 591 |
+
ifun = line_info.ifun
|
| 592 |
+
the_rest = line_info.the_rest
|
| 593 |
+
#Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args)
|
| 594 |
+
t_arg_s = ifun + " " + the_rest
|
| 595 |
+
t_magic_name, _, t_magic_arg_s = t_arg_s.partition(' ')
|
| 596 |
+
t_magic_name = t_magic_name.lstrip(ESC_MAGIC)
|
| 597 |
+
cmd = '%sget_ipython().run_line_magic(%r, %r)' % (line_info.pre_whitespace, t_magic_name, t_magic_arg_s)
|
| 598 |
+
return cmd
|
| 599 |
+
|
| 600 |
+
|
| 601 |
+
class AutoHandler(PrefilterHandler):
|
| 602 |
+
|
| 603 |
+
handler_name = Unicode('auto')
|
| 604 |
+
esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2])
|
| 605 |
+
|
| 606 |
+
def handle(self, line_info):
|
| 607 |
+
"""Handle lines which can be auto-executed, quoting if requested."""
|
| 608 |
+
line = line_info.line
|
| 609 |
+
ifun = line_info.ifun
|
| 610 |
+
the_rest = line_info.the_rest
|
| 611 |
+
esc = line_info.esc
|
| 612 |
+
continue_prompt = line_info.continue_prompt
|
| 613 |
+
obj = line_info.ofind(self.shell).obj
|
| 614 |
+
|
| 615 |
+
# This should only be active for single-line input!
|
| 616 |
+
if continue_prompt:
|
| 617 |
+
return line
|
| 618 |
+
|
| 619 |
+
force_auto = isinstance(obj, IPyAutocall)
|
| 620 |
+
|
| 621 |
+
# User objects sometimes raise exceptions on attribute access other
|
| 622 |
+
# than AttributeError (we've seen it in the past), so it's safest to be
|
| 623 |
+
# ultra-conservative here and catch all.
|
| 624 |
+
try:
|
| 625 |
+
auto_rewrite = obj.rewrite
|
| 626 |
+
except Exception:
|
| 627 |
+
auto_rewrite = True
|
| 628 |
+
|
| 629 |
+
if esc == ESC_QUOTE:
|
| 630 |
+
# Auto-quote splitting on whitespace
|
| 631 |
+
newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) )
|
| 632 |
+
elif esc == ESC_QUOTE2:
|
| 633 |
+
# Auto-quote whole string
|
| 634 |
+
newcmd = '%s("%s")' % (ifun,the_rest)
|
| 635 |
+
elif esc == ESC_PAREN:
|
| 636 |
+
newcmd = '%s(%s)' % (ifun,",".join(the_rest.split()))
|
| 637 |
+
else:
|
| 638 |
+
# Auto-paren.
|
| 639 |
+
if force_auto:
|
| 640 |
+
# Don't rewrite if it is already a call.
|
| 641 |
+
do_rewrite = not the_rest.startswith('(')
|
| 642 |
+
else:
|
| 643 |
+
if not the_rest:
|
| 644 |
+
# We only apply it to argument-less calls if the autocall
|
| 645 |
+
# parameter is set to 2.
|
| 646 |
+
do_rewrite = (self.shell.autocall >= 2)
|
| 647 |
+
elif the_rest.startswith('[') and hasattr(obj, '__getitem__'):
|
| 648 |
+
# Don't autocall in this case: item access for an object
|
| 649 |
+
# which is BOTH callable and implements __getitem__.
|
| 650 |
+
do_rewrite = False
|
| 651 |
+
else:
|
| 652 |
+
do_rewrite = True
|
| 653 |
+
|
| 654 |
+
# Figure out the rewritten command
|
| 655 |
+
if do_rewrite:
|
| 656 |
+
if the_rest.endswith(';'):
|
| 657 |
+
newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1])
|
| 658 |
+
else:
|
| 659 |
+
newcmd = '%s(%s)' % (ifun.rstrip(), the_rest)
|
| 660 |
+
else:
|
| 661 |
+
normal_handler = self.prefilter_manager.get_handler_by_name('normal')
|
| 662 |
+
return normal_handler.handle(line_info)
|
| 663 |
+
|
| 664 |
+
# Display the rewritten call
|
| 665 |
+
if auto_rewrite:
|
| 666 |
+
self.shell.auto_rewrite_input(newcmd)
|
| 667 |
+
|
| 668 |
+
return newcmd
|
| 669 |
+
|
| 670 |
+
|
| 671 |
+
class EmacsHandler(PrefilterHandler):
|
| 672 |
+
|
| 673 |
+
handler_name = Unicode('emacs')
|
| 674 |
+
esc_strings = List([])
|
| 675 |
+
|
| 676 |
+
def handle(self, line_info):
|
| 677 |
+
"""Handle input lines marked by python-mode."""
|
| 678 |
+
|
| 679 |
+
# Currently, nothing is done. Later more functionality can be added
|
| 680 |
+
# here if needed.
|
| 681 |
+
|
| 682 |
+
# The input cache shouldn't be updated
|
| 683 |
+
return line_info.line
|
| 684 |
+
|
| 685 |
+
|
| 686 |
+
#-----------------------------------------------------------------------------
|
| 687 |
+
# Defaults
|
| 688 |
+
#-----------------------------------------------------------------------------
|
| 689 |
+
|
| 690 |
+
|
| 691 |
+
_default_checkers = [
|
| 692 |
+
EmacsChecker,
|
| 693 |
+
MacroChecker,
|
| 694 |
+
IPyAutocallChecker,
|
| 695 |
+
AssignmentChecker,
|
| 696 |
+
AutoMagicChecker,
|
| 697 |
+
PythonOpsChecker,
|
| 698 |
+
AutocallChecker
|
| 699 |
+
]
|
| 700 |
+
|
| 701 |
+
_default_handlers = [
|
| 702 |
+
PrefilterHandler,
|
| 703 |
+
MacroHandler,
|
| 704 |
+
MagicHandler,
|
| 705 |
+
AutoHandler,
|
| 706 |
+
EmacsHandler
|
| 707 |
+
]
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/profile/README_STARTUP
ADDED
|
@@ -0,0 +1,11 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
This is the IPython startup directory
|
| 2 |
+
|
| 3 |
+
.py and .ipy files in this directory will be run *prior* to any code or files specified
|
| 4 |
+
via the exec_lines or exec_files configurables whenever you load this profile.
|
| 5 |
+
|
| 6 |
+
Files will be run in lexicographical order, so you can control the execution order of files
|
| 7 |
+
with a prefix, e.g.::
|
| 8 |
+
|
| 9 |
+
00-first.py
|
| 10 |
+
50-middle.py
|
| 11 |
+
99-last.ipy
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/profiledir.py
ADDED
|
@@ -0,0 +1,244 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""An object for managing IPython profile directories."""
|
| 3 |
+
|
| 4 |
+
# Copyright (c) IPython Development Team.
|
| 5 |
+
# Distributed under the terms of the Modified BSD License.
|
| 6 |
+
|
| 7 |
+
import os
|
| 8 |
+
import shutil
|
| 9 |
+
import errno
|
| 10 |
+
from pathlib import Path
|
| 11 |
+
|
| 12 |
+
from traitlets.config.configurable import LoggingConfigurable
|
| 13 |
+
from ..paths import get_ipython_package_dir
|
| 14 |
+
from ..utils.path import expand_path, ensure_dir_exists
|
| 15 |
+
from traitlets import Unicode, Bool, observe
|
| 16 |
+
|
| 17 |
+
from typing import Optional
|
| 18 |
+
|
| 19 |
+
#-----------------------------------------------------------------------------
|
| 20 |
+
# Module errors
|
| 21 |
+
#-----------------------------------------------------------------------------
|
| 22 |
+
|
| 23 |
+
class ProfileDirError(Exception):
|
| 24 |
+
pass
|
| 25 |
+
|
| 26 |
+
|
| 27 |
+
#-----------------------------------------------------------------------------
|
| 28 |
+
# Class for managing profile directories
|
| 29 |
+
#-----------------------------------------------------------------------------
|
| 30 |
+
|
| 31 |
+
class ProfileDir(LoggingConfigurable):
|
| 32 |
+
"""An object to manage the profile directory and its resources.
|
| 33 |
+
|
| 34 |
+
The profile directory is used by all IPython applications, to manage
|
| 35 |
+
configuration, logging and security.
|
| 36 |
+
|
| 37 |
+
This object knows how to find, create and manage these directories. This
|
| 38 |
+
should be used by any code that wants to handle profiles.
|
| 39 |
+
"""
|
| 40 |
+
|
| 41 |
+
security_dir_name = Unicode('security')
|
| 42 |
+
log_dir_name = Unicode('log')
|
| 43 |
+
startup_dir_name = Unicode('startup')
|
| 44 |
+
pid_dir_name = Unicode('pid')
|
| 45 |
+
static_dir_name = Unicode('static')
|
| 46 |
+
security_dir = Unicode(u'')
|
| 47 |
+
log_dir = Unicode(u'')
|
| 48 |
+
startup_dir = Unicode(u'')
|
| 49 |
+
pid_dir = Unicode(u'')
|
| 50 |
+
static_dir = Unicode(u'')
|
| 51 |
+
|
| 52 |
+
location = Unicode(u'',
|
| 53 |
+
help="""Set the profile location directly. This overrides the logic used by the
|
| 54 |
+
`profile` option.""",
|
| 55 |
+
).tag(config=True)
|
| 56 |
+
|
| 57 |
+
_location_isset = Bool(False) # flag for detecting multiply set location
|
| 58 |
+
@observe('location')
|
| 59 |
+
def _location_changed(self, change):
|
| 60 |
+
if self._location_isset:
|
| 61 |
+
raise RuntimeError("Cannot set profile location more than once.")
|
| 62 |
+
self._location_isset = True
|
| 63 |
+
new = change['new']
|
| 64 |
+
ensure_dir_exists(new)
|
| 65 |
+
|
| 66 |
+
# ensure config files exist:
|
| 67 |
+
self.security_dir = os.path.join(new, self.security_dir_name)
|
| 68 |
+
self.log_dir = os.path.join(new, self.log_dir_name)
|
| 69 |
+
self.startup_dir = os.path.join(new, self.startup_dir_name)
|
| 70 |
+
self.pid_dir = os.path.join(new, self.pid_dir_name)
|
| 71 |
+
self.static_dir = os.path.join(new, self.static_dir_name)
|
| 72 |
+
self.check_dirs()
|
| 73 |
+
|
| 74 |
+
def _mkdir(self, path: str, mode: Optional[int] = None) -> bool:
|
| 75 |
+
"""ensure a directory exists at a given path
|
| 76 |
+
|
| 77 |
+
This is a version of os.mkdir, with the following differences:
|
| 78 |
+
|
| 79 |
+
- returns whether the directory has been created or not.
|
| 80 |
+
- ignores EEXIST, protecting against race conditions where
|
| 81 |
+
the dir may have been created in between the check and
|
| 82 |
+
the creation
|
| 83 |
+
- sets permissions if requested and the dir already exists
|
| 84 |
+
|
| 85 |
+
Parameters
|
| 86 |
+
----------
|
| 87 |
+
path: str
|
| 88 |
+
path of the dir to create
|
| 89 |
+
mode: int
|
| 90 |
+
see `mode` of `os.mkdir`
|
| 91 |
+
|
| 92 |
+
Returns
|
| 93 |
+
-------
|
| 94 |
+
bool:
|
| 95 |
+
returns True if it created the directory, False otherwise
|
| 96 |
+
"""
|
| 97 |
+
|
| 98 |
+
if os.path.exists(path):
|
| 99 |
+
if mode and os.stat(path).st_mode != mode:
|
| 100 |
+
try:
|
| 101 |
+
os.chmod(path, mode)
|
| 102 |
+
except OSError:
|
| 103 |
+
self.log.warning(
|
| 104 |
+
"Could not set permissions on %s",
|
| 105 |
+
path
|
| 106 |
+
)
|
| 107 |
+
return False
|
| 108 |
+
try:
|
| 109 |
+
if mode:
|
| 110 |
+
os.mkdir(path, mode)
|
| 111 |
+
else:
|
| 112 |
+
os.mkdir(path)
|
| 113 |
+
except OSError as e:
|
| 114 |
+
if e.errno == errno.EEXIST:
|
| 115 |
+
return False
|
| 116 |
+
else:
|
| 117 |
+
raise
|
| 118 |
+
|
| 119 |
+
return True
|
| 120 |
+
|
| 121 |
+
@observe('log_dir')
|
| 122 |
+
def check_log_dir(self, change=None):
|
| 123 |
+
self._mkdir(self.log_dir)
|
| 124 |
+
|
| 125 |
+
@observe('startup_dir')
|
| 126 |
+
def check_startup_dir(self, change=None):
|
| 127 |
+
if self._mkdir(self.startup_dir):
|
| 128 |
+
readme = os.path.join(self.startup_dir, "README")
|
| 129 |
+
src = os.path.join(
|
| 130 |
+
get_ipython_package_dir(), "core", "profile", "README_STARTUP"
|
| 131 |
+
)
|
| 132 |
+
|
| 133 |
+
if os.path.exists(src):
|
| 134 |
+
if not os.path.exists(readme):
|
| 135 |
+
shutil.copy(src, readme)
|
| 136 |
+
else:
|
| 137 |
+
self.log.warning(
|
| 138 |
+
"Could not copy README_STARTUP to startup dir. Source file %s does not exist.",
|
| 139 |
+
src,
|
| 140 |
+
)
|
| 141 |
+
|
| 142 |
+
@observe('security_dir')
|
| 143 |
+
def check_security_dir(self, change=None):
|
| 144 |
+
self._mkdir(self.security_dir, 0o40700)
|
| 145 |
+
|
| 146 |
+
@observe('pid_dir')
|
| 147 |
+
def check_pid_dir(self, change=None):
|
| 148 |
+
self._mkdir(self.pid_dir, 0o40700)
|
| 149 |
+
|
| 150 |
+
def check_dirs(self):
|
| 151 |
+
self.check_security_dir()
|
| 152 |
+
self.check_log_dir()
|
| 153 |
+
self.check_pid_dir()
|
| 154 |
+
self.check_startup_dir()
|
| 155 |
+
|
| 156 |
+
def copy_config_file(self, config_file: str, path: Path, overwrite=False) -> bool:
|
| 157 |
+
"""Copy a default config file into the active profile directory.
|
| 158 |
+
|
| 159 |
+
Default configuration files are kept in :mod:`IPython.core.profile`.
|
| 160 |
+
This function moves these from that location to the working profile
|
| 161 |
+
directory.
|
| 162 |
+
"""
|
| 163 |
+
dst = Path(os.path.join(self.location, config_file))
|
| 164 |
+
if dst.exists() and not overwrite:
|
| 165 |
+
return False
|
| 166 |
+
if path is None:
|
| 167 |
+
path = os.path.join(get_ipython_package_dir(), u'core', u'profile', u'default')
|
| 168 |
+
assert isinstance(path, Path)
|
| 169 |
+
src = path / config_file
|
| 170 |
+
shutil.copy(src, dst)
|
| 171 |
+
return True
|
| 172 |
+
|
| 173 |
+
@classmethod
|
| 174 |
+
def create_profile_dir(cls, profile_dir, config=None):
|
| 175 |
+
"""Create a new profile directory given a full path.
|
| 176 |
+
|
| 177 |
+
Parameters
|
| 178 |
+
----------
|
| 179 |
+
profile_dir : str
|
| 180 |
+
The full path to the profile directory. If it does exist, it will
|
| 181 |
+
be used. If not, it will be created.
|
| 182 |
+
"""
|
| 183 |
+
return cls(location=profile_dir, config=config)
|
| 184 |
+
|
| 185 |
+
@classmethod
|
| 186 |
+
def create_profile_dir_by_name(cls, path, name=u'default', config=None):
|
| 187 |
+
"""Create a profile dir by profile name and path.
|
| 188 |
+
|
| 189 |
+
Parameters
|
| 190 |
+
----------
|
| 191 |
+
path : unicode
|
| 192 |
+
The path (directory) to put the profile directory in.
|
| 193 |
+
name : unicode
|
| 194 |
+
The name of the profile. The name of the profile directory will
|
| 195 |
+
be "profile_<profile>".
|
| 196 |
+
"""
|
| 197 |
+
if not os.path.isdir(path):
|
| 198 |
+
raise ProfileDirError('Directory not found: %s' % path)
|
| 199 |
+
profile_dir = os.path.join(path, u'profile_' + name)
|
| 200 |
+
return cls(location=profile_dir, config=config)
|
| 201 |
+
|
| 202 |
+
@classmethod
|
| 203 |
+
def find_profile_dir_by_name(cls, ipython_dir, name=u'default', config=None):
|
| 204 |
+
"""Find an existing profile dir by profile name, return its ProfileDir.
|
| 205 |
+
|
| 206 |
+
This searches through a sequence of paths for a profile dir. If it
|
| 207 |
+
is not found, a :class:`ProfileDirError` exception will be raised.
|
| 208 |
+
|
| 209 |
+
The search path algorithm is:
|
| 210 |
+
1. ``os.getcwd()`` # removed for security reason.
|
| 211 |
+
2. ``ipython_dir``
|
| 212 |
+
|
| 213 |
+
Parameters
|
| 214 |
+
----------
|
| 215 |
+
ipython_dir : unicode or str
|
| 216 |
+
The IPython directory to use.
|
| 217 |
+
name : unicode or str
|
| 218 |
+
The name of the profile. The name of the profile directory
|
| 219 |
+
will be "profile_<profile>".
|
| 220 |
+
"""
|
| 221 |
+
dirname = u'profile_' + name
|
| 222 |
+
paths = [ipython_dir]
|
| 223 |
+
for p in paths:
|
| 224 |
+
profile_dir = os.path.join(p, dirname)
|
| 225 |
+
if os.path.isdir(profile_dir):
|
| 226 |
+
return cls(location=profile_dir, config=config)
|
| 227 |
+
else:
|
| 228 |
+
raise ProfileDirError('Profile directory not found in paths: %s' % dirname)
|
| 229 |
+
|
| 230 |
+
@classmethod
|
| 231 |
+
def find_profile_dir(cls, profile_dir, config=None):
|
| 232 |
+
"""Find/create a profile dir and return its ProfileDir.
|
| 233 |
+
|
| 234 |
+
This will create the profile directory if it doesn't exist.
|
| 235 |
+
|
| 236 |
+
Parameters
|
| 237 |
+
----------
|
| 238 |
+
profile_dir : unicode or str
|
| 239 |
+
The path of the profile directory.
|
| 240 |
+
"""
|
| 241 |
+
profile_dir = expand_path(profile_dir)
|
| 242 |
+
if not os.path.isdir(profile_dir):
|
| 243 |
+
raise ProfileDirError('Profile directory not found: %s' % profile_dir)
|
| 244 |
+
return cls(location=profile_dir, config=config)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/pylabtools.py
ADDED
|
@@ -0,0 +1,542 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Pylab (matplotlib) support utilities."""
|
| 3 |
+
|
| 4 |
+
# Copyright (c) IPython Development Team.
|
| 5 |
+
# Distributed under the terms of the Modified BSD License.
|
| 6 |
+
|
| 7 |
+
from io import BytesIO
|
| 8 |
+
from binascii import b2a_base64
|
| 9 |
+
from functools import partial
|
| 10 |
+
import warnings
|
| 11 |
+
|
| 12 |
+
from IPython.core.display import _pngxy
|
| 13 |
+
from IPython.utils.decorators import flag_calls
|
| 14 |
+
|
| 15 |
+
|
| 16 |
+
# Matplotlib backend resolution functionality moved from IPython to Matplotlib
|
| 17 |
+
# in IPython 8.24 and Matplotlib 3.9.0. Need to keep `backends` and `backend2gui`
|
| 18 |
+
# here for earlier Matplotlib and for external backend libraries such as
|
| 19 |
+
# mplcairo that might rely upon it.
|
| 20 |
+
_deprecated_backends = {
|
| 21 |
+
"tk": "TkAgg",
|
| 22 |
+
"gtk": "GTKAgg",
|
| 23 |
+
"gtk3": "GTK3Agg",
|
| 24 |
+
"gtk4": "GTK4Agg",
|
| 25 |
+
"wx": "WXAgg",
|
| 26 |
+
"qt4": "Qt4Agg",
|
| 27 |
+
"qt5": "Qt5Agg",
|
| 28 |
+
"qt6": "QtAgg",
|
| 29 |
+
"qt": "QtAgg",
|
| 30 |
+
"osx": "MacOSX",
|
| 31 |
+
"nbagg": "nbAgg",
|
| 32 |
+
"webagg": "WebAgg",
|
| 33 |
+
"notebook": "nbAgg",
|
| 34 |
+
"agg": "agg",
|
| 35 |
+
"svg": "svg",
|
| 36 |
+
"pdf": "pdf",
|
| 37 |
+
"ps": "ps",
|
| 38 |
+
"inline": "module://matplotlib_inline.backend_inline",
|
| 39 |
+
"ipympl": "module://ipympl.backend_nbagg",
|
| 40 |
+
"widget": "module://ipympl.backend_nbagg",
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
# We also need a reverse backends2guis mapping that will properly choose which
|
| 44 |
+
# GUI support to activate based on the desired matplotlib backend. For the
|
| 45 |
+
# most part it's just a reverse of the above dict, but we also need to add a
|
| 46 |
+
# few others that map to the same GUI manually:
|
| 47 |
+
_deprecated_backend2gui = dict(
|
| 48 |
+
zip(_deprecated_backends.values(), _deprecated_backends.keys())
|
| 49 |
+
)
|
| 50 |
+
# In the reverse mapping, there are a few extra valid matplotlib backends that
|
| 51 |
+
# map to the same GUI support
|
| 52 |
+
_deprecated_backend2gui["GTK"] = _deprecated_backend2gui["GTKCairo"] = "gtk"
|
| 53 |
+
_deprecated_backend2gui["GTK3Cairo"] = "gtk3"
|
| 54 |
+
_deprecated_backend2gui["GTK4Cairo"] = "gtk4"
|
| 55 |
+
_deprecated_backend2gui["WX"] = "wx"
|
| 56 |
+
_deprecated_backend2gui["CocoaAgg"] = "osx"
|
| 57 |
+
# There needs to be a hysteresis here as the new QtAgg Matplotlib backend
|
| 58 |
+
# supports either Qt5 or Qt6 and the IPython qt event loop support Qt4, Qt5,
|
| 59 |
+
# and Qt6.
|
| 60 |
+
_deprecated_backend2gui["QtAgg"] = "qt"
|
| 61 |
+
_deprecated_backend2gui["Qt4Agg"] = "qt4"
|
| 62 |
+
_deprecated_backend2gui["Qt5Agg"] = "qt5"
|
| 63 |
+
|
| 64 |
+
# And some backends that don't need GUI integration
|
| 65 |
+
del _deprecated_backend2gui["nbAgg"]
|
| 66 |
+
del _deprecated_backend2gui["agg"]
|
| 67 |
+
del _deprecated_backend2gui["svg"]
|
| 68 |
+
del _deprecated_backend2gui["pdf"]
|
| 69 |
+
del _deprecated_backend2gui["ps"]
|
| 70 |
+
del _deprecated_backend2gui["module://matplotlib_inline.backend_inline"]
|
| 71 |
+
del _deprecated_backend2gui["module://ipympl.backend_nbagg"]
|
| 72 |
+
|
| 73 |
+
|
| 74 |
+
# Deprecated attributes backends and backend2gui mostly following PEP 562.
|
| 75 |
+
def __getattr__(name):
|
| 76 |
+
if name in ("backends", "backend2gui"):
|
| 77 |
+
warnings.warn(
|
| 78 |
+
f"{name} is deprecated since IPython 8.24, backends are managed "
|
| 79 |
+
"in matplotlib and can be externally registered.",
|
| 80 |
+
DeprecationWarning,
|
| 81 |
+
)
|
| 82 |
+
return globals()[f"_deprecated_{name}"]
|
| 83 |
+
raise AttributeError(f"module {__name__!r} has no attribute {name!r}")
|
| 84 |
+
|
| 85 |
+
|
| 86 |
+
#-----------------------------------------------------------------------------
|
| 87 |
+
# Matplotlib utilities
|
| 88 |
+
#-----------------------------------------------------------------------------
|
| 89 |
+
|
| 90 |
+
|
| 91 |
+
def getfigs(*fig_nums):
|
| 92 |
+
"""Get a list of matplotlib figures by figure numbers.
|
| 93 |
+
|
| 94 |
+
If no arguments are given, all available figures are returned. If the
|
| 95 |
+
argument list contains references to invalid figures, a warning is printed
|
| 96 |
+
but the function continues pasting further figures.
|
| 97 |
+
|
| 98 |
+
Parameters
|
| 99 |
+
----------
|
| 100 |
+
figs : tuple
|
| 101 |
+
A tuple of ints giving the figure numbers of the figures to return.
|
| 102 |
+
"""
|
| 103 |
+
from matplotlib._pylab_helpers import Gcf
|
| 104 |
+
if not fig_nums:
|
| 105 |
+
fig_managers = Gcf.get_all_fig_managers()
|
| 106 |
+
return [fm.canvas.figure for fm in fig_managers]
|
| 107 |
+
else:
|
| 108 |
+
figs = []
|
| 109 |
+
for num in fig_nums:
|
| 110 |
+
f = Gcf.figs.get(num)
|
| 111 |
+
if f is None:
|
| 112 |
+
print('Warning: figure %s not available.' % num)
|
| 113 |
+
else:
|
| 114 |
+
figs.append(f.canvas.figure)
|
| 115 |
+
return figs
|
| 116 |
+
|
| 117 |
+
|
| 118 |
+
def figsize(sizex, sizey):
|
| 119 |
+
"""Set the default figure size to be [sizex, sizey].
|
| 120 |
+
|
| 121 |
+
This is just an easy to remember, convenience wrapper that sets::
|
| 122 |
+
|
| 123 |
+
matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
|
| 124 |
+
"""
|
| 125 |
+
import matplotlib
|
| 126 |
+
matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
|
| 127 |
+
|
| 128 |
+
|
| 129 |
+
def print_figure(fig, fmt="png", bbox_inches="tight", base64=False, **kwargs):
|
| 130 |
+
"""Print a figure to an image, and return the resulting file data
|
| 131 |
+
|
| 132 |
+
Returned data will be bytes unless ``fmt='svg'``,
|
| 133 |
+
in which case it will be unicode.
|
| 134 |
+
|
| 135 |
+
Any keyword args are passed to fig.canvas.print_figure,
|
| 136 |
+
such as ``quality`` or ``bbox_inches``.
|
| 137 |
+
|
| 138 |
+
If `base64` is True, return base64-encoded str instead of raw bytes
|
| 139 |
+
for binary-encoded image formats
|
| 140 |
+
|
| 141 |
+
.. versionadded:: 7.29
|
| 142 |
+
base64 argument
|
| 143 |
+
"""
|
| 144 |
+
# When there's an empty figure, we shouldn't return anything, otherwise we
|
| 145 |
+
# get big blank areas in the qt console.
|
| 146 |
+
if not fig.axes and not fig.lines:
|
| 147 |
+
return
|
| 148 |
+
|
| 149 |
+
dpi = fig.dpi
|
| 150 |
+
if fmt == 'retina':
|
| 151 |
+
dpi = dpi * 2
|
| 152 |
+
fmt = 'png'
|
| 153 |
+
|
| 154 |
+
# build keyword args
|
| 155 |
+
kw = {
|
| 156 |
+
"format":fmt,
|
| 157 |
+
"facecolor":fig.get_facecolor(),
|
| 158 |
+
"edgecolor":fig.get_edgecolor(),
|
| 159 |
+
"dpi":dpi,
|
| 160 |
+
"bbox_inches":bbox_inches,
|
| 161 |
+
}
|
| 162 |
+
# **kwargs get higher priority
|
| 163 |
+
kw.update(kwargs)
|
| 164 |
+
|
| 165 |
+
bytes_io = BytesIO()
|
| 166 |
+
if fig.canvas is None:
|
| 167 |
+
from matplotlib.backend_bases import FigureCanvasBase
|
| 168 |
+
FigureCanvasBase(fig)
|
| 169 |
+
|
| 170 |
+
fig.canvas.print_figure(bytes_io, **kw)
|
| 171 |
+
data = bytes_io.getvalue()
|
| 172 |
+
if fmt == 'svg':
|
| 173 |
+
data = data.decode('utf-8')
|
| 174 |
+
elif base64:
|
| 175 |
+
data = b2a_base64(data, newline=False).decode("ascii")
|
| 176 |
+
return data
|
| 177 |
+
|
| 178 |
+
def retina_figure(fig, base64=False, **kwargs):
|
| 179 |
+
"""format a figure as a pixel-doubled (retina) PNG
|
| 180 |
+
|
| 181 |
+
If `base64` is True, return base64-encoded str instead of raw bytes
|
| 182 |
+
for binary-encoded image formats
|
| 183 |
+
|
| 184 |
+
.. versionadded:: 7.29
|
| 185 |
+
base64 argument
|
| 186 |
+
"""
|
| 187 |
+
pngdata = print_figure(fig, fmt="retina", base64=False, **kwargs)
|
| 188 |
+
# Make sure that retina_figure acts just like print_figure and returns
|
| 189 |
+
# None when the figure is empty.
|
| 190 |
+
if pngdata is None:
|
| 191 |
+
return
|
| 192 |
+
w, h = _pngxy(pngdata)
|
| 193 |
+
metadata = {"width": w//2, "height":h//2}
|
| 194 |
+
if base64:
|
| 195 |
+
pngdata = b2a_base64(pngdata, newline=False).decode("ascii")
|
| 196 |
+
return pngdata, metadata
|
| 197 |
+
|
| 198 |
+
|
| 199 |
+
# We need a little factory function here to create the closure where
|
| 200 |
+
# safe_execfile can live.
|
| 201 |
+
def mpl_runner(safe_execfile):
|
| 202 |
+
"""Factory to return a matplotlib-enabled runner for %run.
|
| 203 |
+
|
| 204 |
+
Parameters
|
| 205 |
+
----------
|
| 206 |
+
safe_execfile : function
|
| 207 |
+
This must be a function with the same interface as the
|
| 208 |
+
:meth:`safe_execfile` method of IPython.
|
| 209 |
+
|
| 210 |
+
Returns
|
| 211 |
+
-------
|
| 212 |
+
A function suitable for use as the ``runner`` argument of the %run magic
|
| 213 |
+
function.
|
| 214 |
+
"""
|
| 215 |
+
|
| 216 |
+
def mpl_execfile(fname,*where,**kw):
|
| 217 |
+
"""matplotlib-aware wrapper around safe_execfile.
|
| 218 |
+
|
| 219 |
+
Its interface is identical to that of the :func:`execfile` builtin.
|
| 220 |
+
|
| 221 |
+
This is ultimately a call to execfile(), but wrapped in safeties to
|
| 222 |
+
properly handle interactive rendering."""
|
| 223 |
+
|
| 224 |
+
import matplotlib
|
| 225 |
+
import matplotlib.pyplot as plt
|
| 226 |
+
|
| 227 |
+
# print('*** Matplotlib runner ***') # dbg
|
| 228 |
+
# turn off rendering until end of script
|
| 229 |
+
with matplotlib.rc_context({"interactive": False}):
|
| 230 |
+
safe_execfile(fname, *where, **kw)
|
| 231 |
+
|
| 232 |
+
if matplotlib.is_interactive():
|
| 233 |
+
plt.show()
|
| 234 |
+
|
| 235 |
+
# make rendering call now, if the user tried to do it
|
| 236 |
+
if plt.draw_if_interactive.called:
|
| 237 |
+
plt.draw()
|
| 238 |
+
plt.draw_if_interactive.called = False
|
| 239 |
+
|
| 240 |
+
# re-draw everything that is stale
|
| 241 |
+
try:
|
| 242 |
+
da = plt.draw_all
|
| 243 |
+
except AttributeError:
|
| 244 |
+
pass
|
| 245 |
+
else:
|
| 246 |
+
da()
|
| 247 |
+
|
| 248 |
+
return mpl_execfile
|
| 249 |
+
|
| 250 |
+
|
| 251 |
+
def _reshow_nbagg_figure(fig):
|
| 252 |
+
"""reshow an nbagg figure"""
|
| 253 |
+
try:
|
| 254 |
+
reshow = fig.canvas.manager.reshow
|
| 255 |
+
except AttributeError as e:
|
| 256 |
+
raise NotImplementedError() from e
|
| 257 |
+
else:
|
| 258 |
+
reshow()
|
| 259 |
+
|
| 260 |
+
|
| 261 |
+
def select_figure_formats(shell, formats, **kwargs):
|
| 262 |
+
"""Select figure formats for the inline backend.
|
| 263 |
+
|
| 264 |
+
Parameters
|
| 265 |
+
----------
|
| 266 |
+
shell : InteractiveShell
|
| 267 |
+
The main IPython instance.
|
| 268 |
+
formats : str or set
|
| 269 |
+
One or a set of figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'.
|
| 270 |
+
**kwargs : any
|
| 271 |
+
Extra keyword arguments to be passed to fig.canvas.print_figure.
|
| 272 |
+
"""
|
| 273 |
+
import matplotlib
|
| 274 |
+
from matplotlib.figure import Figure
|
| 275 |
+
|
| 276 |
+
svg_formatter = shell.display_formatter.formatters['image/svg+xml']
|
| 277 |
+
png_formatter = shell.display_formatter.formatters['image/png']
|
| 278 |
+
jpg_formatter = shell.display_formatter.formatters['image/jpeg']
|
| 279 |
+
pdf_formatter = shell.display_formatter.formatters['application/pdf']
|
| 280 |
+
|
| 281 |
+
if isinstance(formats, str):
|
| 282 |
+
formats = {formats}
|
| 283 |
+
# cast in case of list / tuple
|
| 284 |
+
formats = set(formats)
|
| 285 |
+
|
| 286 |
+
[ f.pop(Figure, None) for f in shell.display_formatter.formatters.values() ]
|
| 287 |
+
mplbackend = matplotlib.get_backend().lower()
|
| 288 |
+
if mplbackend in ("nbagg", "ipympl", "widget", "module://ipympl.backend_nbagg"):
|
| 289 |
+
formatter = shell.display_formatter.ipython_display_formatter
|
| 290 |
+
formatter.for_type(Figure, _reshow_nbagg_figure)
|
| 291 |
+
|
| 292 |
+
supported = {'png', 'png2x', 'retina', 'jpg', 'jpeg', 'svg', 'pdf'}
|
| 293 |
+
bad = formats.difference(supported)
|
| 294 |
+
if bad:
|
| 295 |
+
bs = "%s" % ','.join([repr(f) for f in bad])
|
| 296 |
+
gs = "%s" % ','.join([repr(f) for f in supported])
|
| 297 |
+
raise ValueError("supported formats are: %s not %s" % (gs, bs))
|
| 298 |
+
|
| 299 |
+
if "png" in formats:
|
| 300 |
+
png_formatter.for_type(
|
| 301 |
+
Figure, partial(print_figure, fmt="png", base64=True, **kwargs)
|
| 302 |
+
)
|
| 303 |
+
if "retina" in formats or "png2x" in formats:
|
| 304 |
+
png_formatter.for_type(Figure, partial(retina_figure, base64=True, **kwargs))
|
| 305 |
+
if "jpg" in formats or "jpeg" in formats:
|
| 306 |
+
jpg_formatter.for_type(
|
| 307 |
+
Figure, partial(print_figure, fmt="jpg", base64=True, **kwargs)
|
| 308 |
+
)
|
| 309 |
+
if "svg" in formats:
|
| 310 |
+
svg_formatter.for_type(Figure, partial(print_figure, fmt="svg", **kwargs))
|
| 311 |
+
if "pdf" in formats:
|
| 312 |
+
pdf_formatter.for_type(
|
| 313 |
+
Figure, partial(print_figure, fmt="pdf", base64=True, **kwargs)
|
| 314 |
+
)
|
| 315 |
+
|
| 316 |
+
#-----------------------------------------------------------------------------
|
| 317 |
+
# Code for initializing matplotlib and importing pylab
|
| 318 |
+
#-----------------------------------------------------------------------------
|
| 319 |
+
|
| 320 |
+
|
| 321 |
+
def find_gui_and_backend(gui=None, gui_select=None):
|
| 322 |
+
"""Given a gui string return the gui and mpl backend.
|
| 323 |
+
|
| 324 |
+
Parameters
|
| 325 |
+
----------
|
| 326 |
+
gui : str
|
| 327 |
+
Can be one of ('tk','gtk','wx','qt','qt4','inline','agg').
|
| 328 |
+
gui_select : str
|
| 329 |
+
Can be one of ('tk','gtk','wx','qt','qt4','inline').
|
| 330 |
+
This is any gui already selected by the shell.
|
| 331 |
+
|
| 332 |
+
Returns
|
| 333 |
+
-------
|
| 334 |
+
A tuple of (gui, backend) where backend is one of ('TkAgg','GTKAgg',
|
| 335 |
+
'WXAgg','Qt4Agg','module://matplotlib_inline.backend_inline','agg').
|
| 336 |
+
"""
|
| 337 |
+
|
| 338 |
+
import matplotlib
|
| 339 |
+
|
| 340 |
+
if _matplotlib_manages_backends():
|
| 341 |
+
backend_registry = matplotlib.backends.registry.backend_registry
|
| 342 |
+
|
| 343 |
+
# gui argument may be a gui event loop or may be a backend name.
|
| 344 |
+
if gui in ("auto", None):
|
| 345 |
+
backend = matplotlib.rcParamsOrig["backend"]
|
| 346 |
+
backend, gui = backend_registry.resolve_backend(backend)
|
| 347 |
+
else:
|
| 348 |
+
gui = _convert_gui_to_matplotlib(gui)
|
| 349 |
+
backend, gui = backend_registry.resolve_gui_or_backend(gui)
|
| 350 |
+
|
| 351 |
+
gui = _convert_gui_from_matplotlib(gui)
|
| 352 |
+
return gui, backend
|
| 353 |
+
|
| 354 |
+
# Fallback to previous behaviour (Matplotlib < 3.9)
|
| 355 |
+
mpl_version_info = getattr(matplotlib, "__version_info__", (0, 0))
|
| 356 |
+
has_unified_qt_backend = mpl_version_info >= (3, 5)
|
| 357 |
+
|
| 358 |
+
from IPython.core.pylabtools import backends
|
| 359 |
+
|
| 360 |
+
backends_ = dict(backends)
|
| 361 |
+
if not has_unified_qt_backend:
|
| 362 |
+
backends_["qt"] = "qt5agg"
|
| 363 |
+
|
| 364 |
+
if gui and gui != 'auto':
|
| 365 |
+
# select backend based on requested gui
|
| 366 |
+
backend = backends_[gui]
|
| 367 |
+
if gui == 'agg':
|
| 368 |
+
gui = None
|
| 369 |
+
else:
|
| 370 |
+
# We need to read the backend from the original data structure, *not*
|
| 371 |
+
# from mpl.rcParams, since a prior invocation of %matplotlib may have
|
| 372 |
+
# overwritten that.
|
| 373 |
+
# WARNING: this assumes matplotlib 1.1 or newer!!
|
| 374 |
+
backend = matplotlib.rcParamsOrig['backend']
|
| 375 |
+
# In this case, we need to find what the appropriate gui selection call
|
| 376 |
+
# should be for IPython, so we can activate inputhook accordingly
|
| 377 |
+
from IPython.core.pylabtools import backend2gui
|
| 378 |
+
gui = backend2gui.get(backend, None)
|
| 379 |
+
|
| 380 |
+
# If we have already had a gui active, we need it and inline are the
|
| 381 |
+
# ones allowed.
|
| 382 |
+
if gui_select and gui != gui_select:
|
| 383 |
+
gui = gui_select
|
| 384 |
+
backend = backends_[gui]
|
| 385 |
+
|
| 386 |
+
# Matplotlib before _matplotlib_manages_backends() can return "inline" for
|
| 387 |
+
# no gui event loop rather than the None that IPython >= 8.24.0 expects.
|
| 388 |
+
if gui == "inline":
|
| 389 |
+
gui = None
|
| 390 |
+
|
| 391 |
+
return gui, backend
|
| 392 |
+
|
| 393 |
+
|
| 394 |
+
def activate_matplotlib(backend):
|
| 395 |
+
"""Activate the given backend and set interactive to True."""
|
| 396 |
+
|
| 397 |
+
import matplotlib
|
| 398 |
+
matplotlib.interactive(True)
|
| 399 |
+
|
| 400 |
+
# Matplotlib had a bug where even switch_backend could not force
|
| 401 |
+
# the rcParam to update. This needs to be set *before* the module
|
| 402 |
+
# magic of switch_backend().
|
| 403 |
+
matplotlib.rcParams['backend'] = backend
|
| 404 |
+
|
| 405 |
+
# Due to circular imports, pyplot may be only partially initialised
|
| 406 |
+
# when this function runs.
|
| 407 |
+
# So avoid needing matplotlib attribute-lookup to access pyplot.
|
| 408 |
+
from matplotlib import pyplot as plt
|
| 409 |
+
|
| 410 |
+
plt.switch_backend(backend)
|
| 411 |
+
|
| 412 |
+
plt.show._needmain = False
|
| 413 |
+
# We need to detect at runtime whether show() is called by the user.
|
| 414 |
+
# For this, we wrap it into a decorator which adds a 'called' flag.
|
| 415 |
+
plt.draw_if_interactive = flag_calls(plt.draw_if_interactive)
|
| 416 |
+
|
| 417 |
+
|
| 418 |
+
def import_pylab(user_ns, import_all=True):
|
| 419 |
+
"""Populate the namespace with pylab-related values.
|
| 420 |
+
|
| 421 |
+
Imports matplotlib, pylab, numpy, and everything from pylab and numpy.
|
| 422 |
+
|
| 423 |
+
Also imports a few names from IPython (figsize, display, getfigs)
|
| 424 |
+
|
| 425 |
+
"""
|
| 426 |
+
|
| 427 |
+
# Import numpy as np/pyplot as plt are conventions we're trying to
|
| 428 |
+
# somewhat standardize on. Making them available to users by default
|
| 429 |
+
# will greatly help this.
|
| 430 |
+
s = ("import numpy\n"
|
| 431 |
+
"import matplotlib\n"
|
| 432 |
+
"from matplotlib import pylab, mlab, pyplot\n"
|
| 433 |
+
"np = numpy\n"
|
| 434 |
+
"plt = pyplot\n"
|
| 435 |
+
)
|
| 436 |
+
exec(s, user_ns)
|
| 437 |
+
|
| 438 |
+
if import_all:
|
| 439 |
+
s = ("from matplotlib.pylab import *\n"
|
| 440 |
+
"from numpy import *\n")
|
| 441 |
+
exec(s, user_ns)
|
| 442 |
+
|
| 443 |
+
# IPython symbols to add
|
| 444 |
+
user_ns['figsize'] = figsize
|
| 445 |
+
from IPython.display import display
|
| 446 |
+
# Add display and getfigs to the user's namespace
|
| 447 |
+
user_ns['display'] = display
|
| 448 |
+
user_ns['getfigs'] = getfigs
|
| 449 |
+
|
| 450 |
+
|
| 451 |
+
def configure_inline_support(shell, backend):
|
| 452 |
+
"""
|
| 453 |
+
.. deprecated:: 7.23
|
| 454 |
+
|
| 455 |
+
use `matplotlib_inline.backend_inline.configure_inline_support()`
|
| 456 |
+
|
| 457 |
+
Configure an IPython shell object for matplotlib use.
|
| 458 |
+
|
| 459 |
+
Parameters
|
| 460 |
+
----------
|
| 461 |
+
shell : InteractiveShell instance
|
| 462 |
+
backend : matplotlib backend
|
| 463 |
+
"""
|
| 464 |
+
warnings.warn(
|
| 465 |
+
"`configure_inline_support` is deprecated since IPython 7.23, directly "
|
| 466 |
+
"use `matplotlib_inline.backend_inline.configure_inline_support()`",
|
| 467 |
+
DeprecationWarning,
|
| 468 |
+
stacklevel=2,
|
| 469 |
+
)
|
| 470 |
+
|
| 471 |
+
from matplotlib_inline.backend_inline import (
|
| 472 |
+
configure_inline_support as configure_inline_support_orig,
|
| 473 |
+
)
|
| 474 |
+
|
| 475 |
+
configure_inline_support_orig(shell, backend)
|
| 476 |
+
|
| 477 |
+
|
| 478 |
+
# Determine if Matplotlib manages backends only if needed, and cache result.
|
| 479 |
+
# Do not read this directly, instead use _matplotlib_manages_backends().
|
| 480 |
+
_matplotlib_manages_backends_value: bool | None = None
|
| 481 |
+
|
| 482 |
+
|
| 483 |
+
def _matplotlib_manages_backends() -> bool:
|
| 484 |
+
"""Return True if Matplotlib manages backends, False otherwise.
|
| 485 |
+
|
| 486 |
+
If it returns True, the caller can be sure that
|
| 487 |
+
matplotlib.backends.registry.backend_registry is available along with
|
| 488 |
+
member functions resolve_gui_or_backend, resolve_backend, list_all, and
|
| 489 |
+
list_gui_frameworks.
|
| 490 |
+
|
| 491 |
+
This function can be removed as it will always return True when Python
|
| 492 |
+
3.12, the latest version supported by Matplotlib < 3.9, reaches
|
| 493 |
+
end-of-life in late 2028.
|
| 494 |
+
"""
|
| 495 |
+
global _matplotlib_manages_backends_value
|
| 496 |
+
if _matplotlib_manages_backends_value is None:
|
| 497 |
+
try:
|
| 498 |
+
from matplotlib.backends.registry import backend_registry
|
| 499 |
+
|
| 500 |
+
_matplotlib_manages_backends_value = hasattr(
|
| 501 |
+
backend_registry, "resolve_gui_or_backend"
|
| 502 |
+
)
|
| 503 |
+
except ImportError:
|
| 504 |
+
_matplotlib_manages_backends_value = False
|
| 505 |
+
|
| 506 |
+
return _matplotlib_manages_backends_value
|
| 507 |
+
|
| 508 |
+
|
| 509 |
+
def _list_matplotlib_backends_and_gui_loops() -> list[str]:
|
| 510 |
+
"""Return list of all Matplotlib backends and GUI event loops.
|
| 511 |
+
|
| 512 |
+
This is the list returned by
|
| 513 |
+
%matplotlib --list
|
| 514 |
+
"""
|
| 515 |
+
if _matplotlib_manages_backends():
|
| 516 |
+
from matplotlib.backends.registry import backend_registry
|
| 517 |
+
|
| 518 |
+
ret = backend_registry.list_all() + [
|
| 519 |
+
_convert_gui_from_matplotlib(gui)
|
| 520 |
+
for gui in backend_registry.list_gui_frameworks()
|
| 521 |
+
]
|
| 522 |
+
else:
|
| 523 |
+
from IPython.core import pylabtools
|
| 524 |
+
|
| 525 |
+
ret = list(pylabtools.backends.keys())
|
| 526 |
+
|
| 527 |
+
return sorted(["auto"] + ret)
|
| 528 |
+
|
| 529 |
+
|
| 530 |
+
# Matplotlib and IPython do not always use the same gui framework name.
|
| 531 |
+
# Always use the appropriate one of these conversion functions when passing a
|
| 532 |
+
# gui framework name to/from Matplotlib.
|
| 533 |
+
def _convert_gui_to_matplotlib(gui: str | None) -> str | None:
|
| 534 |
+
if gui and gui.lower() == "osx":
|
| 535 |
+
return "macosx"
|
| 536 |
+
return gui
|
| 537 |
+
|
| 538 |
+
|
| 539 |
+
def _convert_gui_from_matplotlib(gui: str | None) -> str | None:
|
| 540 |
+
if gui and gui.lower() == "macosx":
|
| 541 |
+
return "osx"
|
| 542 |
+
return gui
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/splitinput.py
ADDED
|
@@ -0,0 +1,145 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
"""
|
| 3 |
+
Simple utility for splitting user input. This is used by both inputsplitter and
|
| 4 |
+
prefilter.
|
| 5 |
+
|
| 6 |
+
Authors:
|
| 7 |
+
|
| 8 |
+
* Brian Granger
|
| 9 |
+
* Fernando Perez
|
| 10 |
+
"""
|
| 11 |
+
|
| 12 |
+
#-----------------------------------------------------------------------------
|
| 13 |
+
# Copyright (C) 2008-2011 The IPython Development Team
|
| 14 |
+
#
|
| 15 |
+
# Distributed under the terms of the BSD License. The full license is in
|
| 16 |
+
# the file COPYING, distributed as part of this software.
|
| 17 |
+
#-----------------------------------------------------------------------------
|
| 18 |
+
|
| 19 |
+
#-----------------------------------------------------------------------------
|
| 20 |
+
# Imports
|
| 21 |
+
#-----------------------------------------------------------------------------
|
| 22 |
+
|
| 23 |
+
import re
|
| 24 |
+
import sys
|
| 25 |
+
|
| 26 |
+
from IPython.utils import py3compat
|
| 27 |
+
from IPython.utils.encoding import get_stream_enc
|
| 28 |
+
from IPython.core.oinspect import OInfo
|
| 29 |
+
|
| 30 |
+
#-----------------------------------------------------------------------------
|
| 31 |
+
# Main function
|
| 32 |
+
#-----------------------------------------------------------------------------
|
| 33 |
+
|
| 34 |
+
# RegExp for splitting line contents into pre-char//first word-method//rest.
|
| 35 |
+
# For clarity, each group in on one line.
|
| 36 |
+
|
| 37 |
+
# WARNING: update the regexp if the escapes in interactiveshell are changed, as
|
| 38 |
+
# they are hardwired in.
|
| 39 |
+
|
| 40 |
+
# Although it's not solely driven by the regex, note that:
|
| 41 |
+
# ,;/% only trigger if they are the first character on the line
|
| 42 |
+
# ! and !! trigger if they are first char(s) *or* follow an indent
|
| 43 |
+
# ? triggers as first or last char.
|
| 44 |
+
|
| 45 |
+
line_split = re.compile(r"""
|
| 46 |
+
^(\s*) # any leading space
|
| 47 |
+
([,;/%]|!!?|\?\??)? # escape character or characters
|
| 48 |
+
\s*(%{0,2}[\w\.\*]*) # function/method, possibly with leading %
|
| 49 |
+
# to correctly treat things like '?%magic'
|
| 50 |
+
(.*?$|$) # rest of line
|
| 51 |
+
""", re.VERBOSE)
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
def split_user_input(line, pattern=None):
|
| 55 |
+
"""Split user input into initial whitespace, escape character, function part
|
| 56 |
+
and the rest.
|
| 57 |
+
"""
|
| 58 |
+
# We need to ensure that the rest of this routine deals only with unicode
|
| 59 |
+
encoding = get_stream_enc(sys.stdin, 'utf-8')
|
| 60 |
+
line = py3compat.cast_unicode(line, encoding)
|
| 61 |
+
|
| 62 |
+
if pattern is None:
|
| 63 |
+
pattern = line_split
|
| 64 |
+
match = pattern.match(line)
|
| 65 |
+
if not match:
|
| 66 |
+
# print("match failed for line '%s'" % line)
|
| 67 |
+
try:
|
| 68 |
+
ifun, the_rest = line.split(None,1)
|
| 69 |
+
except ValueError:
|
| 70 |
+
# print("split failed for line '%s'" % line)
|
| 71 |
+
ifun, the_rest = line, u''
|
| 72 |
+
pre = re.match(r'^(\s*)(.*)',line).groups()[0]
|
| 73 |
+
esc = ""
|
| 74 |
+
else:
|
| 75 |
+
pre, esc, ifun, the_rest = match.groups()
|
| 76 |
+
|
| 77 |
+
# print('line:<%s>' % line) # dbg
|
| 78 |
+
# print('pre <%s> ifun <%s> rest <%s>' % (pre,ifun.strip(),the_rest)) # dbg
|
| 79 |
+
return pre, esc or "", ifun.strip(), the_rest
|
| 80 |
+
|
| 81 |
+
|
| 82 |
+
class LineInfo(object):
|
| 83 |
+
"""A single line of input and associated info.
|
| 84 |
+
|
| 85 |
+
Includes the following as properties:
|
| 86 |
+
|
| 87 |
+
line
|
| 88 |
+
The original, raw line
|
| 89 |
+
|
| 90 |
+
continue_prompt
|
| 91 |
+
Is this line a continuation in a sequence of multiline input?
|
| 92 |
+
|
| 93 |
+
pre
|
| 94 |
+
Any leading whitespace.
|
| 95 |
+
|
| 96 |
+
esc
|
| 97 |
+
The escape character(s) in pre or the empty string if there isn't one.
|
| 98 |
+
Note that '!!' and '??' are possible values for esc. Otherwise it will
|
| 99 |
+
always be a single character.
|
| 100 |
+
|
| 101 |
+
ifun
|
| 102 |
+
The 'function part', which is basically the maximal initial sequence
|
| 103 |
+
of valid python identifiers and the '.' character. This is what is
|
| 104 |
+
checked for alias and magic transformations, used for auto-calling,
|
| 105 |
+
etc. In contrast to Python identifiers, it may start with "%" and contain
|
| 106 |
+
"*".
|
| 107 |
+
|
| 108 |
+
the_rest
|
| 109 |
+
Everything else on the line.
|
| 110 |
+
|
| 111 |
+
raw_the_rest
|
| 112 |
+
the_rest without whitespace stripped.
|
| 113 |
+
"""
|
| 114 |
+
def __init__(self, line, continue_prompt=False):
|
| 115 |
+
self.line = line
|
| 116 |
+
self.continue_prompt = continue_prompt
|
| 117 |
+
self.pre, self.esc, self.ifun, self.raw_the_rest = split_user_input(line)
|
| 118 |
+
self.the_rest = self.raw_the_rest.lstrip()
|
| 119 |
+
|
| 120 |
+
self.pre_char = self.pre.strip()
|
| 121 |
+
if self.pre_char:
|
| 122 |
+
self.pre_whitespace = '' # No whitespace allowed before esc chars
|
| 123 |
+
else:
|
| 124 |
+
self.pre_whitespace = self.pre
|
| 125 |
+
|
| 126 |
+
def ofind(self, ip) -> OInfo:
|
| 127 |
+
"""Do a full, attribute-walking lookup of the ifun in the various
|
| 128 |
+
namespaces for the given IPython InteractiveShell instance.
|
| 129 |
+
|
| 130 |
+
Return a dict with keys: {found, obj, ospace, ismagic}
|
| 131 |
+
|
| 132 |
+
Note: can cause state changes because of calling getattr, but should
|
| 133 |
+
only be run if autocall is on and if the line hasn't matched any
|
| 134 |
+
other, less dangerous handlers.
|
| 135 |
+
|
| 136 |
+
Does cache the results of the call, so can be called multiple times
|
| 137 |
+
without worrying about *further* damaging state.
|
| 138 |
+
"""
|
| 139 |
+
return ip._ofind(self.ifun)
|
| 140 |
+
|
| 141 |
+
def __str__(self):
|
| 142 |
+
return "LineInfo [%s|%s|%s|%s]" %(self.pre, self.esc, self.ifun, self.the_rest)
|
| 143 |
+
|
| 144 |
+
def __repr__(self):
|
| 145 |
+
return "<" + str(self) + ">"
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/__init__.py
ADDED
|
File without changes
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/print_argv.py
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import sys
|
| 2 |
+
|
| 3 |
+
print(sys.argv[1:])
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/simpleerr.py
ADDED
|
@@ -0,0 +1,33 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Error script. DO NOT EDIT FURTHER! It will break exception doctests!!!"""
|
| 2 |
+
import sys
|
| 3 |
+
|
| 4 |
+
def div0():
|
| 5 |
+
"foo"
|
| 6 |
+
x = 1
|
| 7 |
+
y = 0
|
| 8 |
+
x/y
|
| 9 |
+
|
| 10 |
+
def sysexit(stat, mode):
|
| 11 |
+
raise SystemExit(stat, f"Mode = {mode}")
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
def bar(mode):
|
| 15 |
+
"bar"
|
| 16 |
+
if mode=='div':
|
| 17 |
+
div0()
|
| 18 |
+
elif mode=='exit':
|
| 19 |
+
try:
|
| 20 |
+
stat = int(sys.argv[2])
|
| 21 |
+
except:
|
| 22 |
+
stat = 1
|
| 23 |
+
sysexit(stat, mode)
|
| 24 |
+
else:
|
| 25 |
+
raise ValueError('Unknown mode')
|
| 26 |
+
|
| 27 |
+
if __name__ == '__main__':
|
| 28 |
+
try:
|
| 29 |
+
mode = sys.argv[1]
|
| 30 |
+
except IndexError:
|
| 31 |
+
mode = 'div'
|
| 32 |
+
|
| 33 |
+
bar(mode)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_alias.py
ADDED
|
@@ -0,0 +1,66 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from IPython.utils.capture import capture_output
|
| 2 |
+
|
| 3 |
+
import pytest
|
| 4 |
+
|
| 5 |
+
def test_alias_lifecycle():
|
| 6 |
+
name = 'test_alias1'
|
| 7 |
+
cmd = 'echo "Hello"'
|
| 8 |
+
am = _ip.alias_manager
|
| 9 |
+
am.clear_aliases()
|
| 10 |
+
am.define_alias(name, cmd)
|
| 11 |
+
assert am.is_alias(name)
|
| 12 |
+
assert am.retrieve_alias(name) == cmd
|
| 13 |
+
assert (name, cmd) in am.aliases
|
| 14 |
+
|
| 15 |
+
# Test running the alias
|
| 16 |
+
orig_system = _ip.system
|
| 17 |
+
result = []
|
| 18 |
+
_ip.system = result.append
|
| 19 |
+
try:
|
| 20 |
+
_ip.run_cell('%{}'.format(name))
|
| 21 |
+
result = [c.strip() for c in result]
|
| 22 |
+
assert result == [cmd]
|
| 23 |
+
finally:
|
| 24 |
+
_ip.system = orig_system
|
| 25 |
+
|
| 26 |
+
# Test removing the alias
|
| 27 |
+
am.undefine_alias(name)
|
| 28 |
+
assert not am.is_alias(name)
|
| 29 |
+
with pytest.raises(ValueError):
|
| 30 |
+
am.retrieve_alias(name)
|
| 31 |
+
assert (name, cmd) not in am.aliases
|
| 32 |
+
|
| 33 |
+
|
| 34 |
+
def test_alias_args_error():
|
| 35 |
+
"""Error expanding with wrong number of arguments"""
|
| 36 |
+
_ip.alias_manager.define_alias('parts', 'echo first %s second %s')
|
| 37 |
+
# capture stderr:
|
| 38 |
+
with capture_output() as cap:
|
| 39 |
+
_ip.run_cell('parts 1')
|
| 40 |
+
|
| 41 |
+
assert cap.stderr.split(":")[0] == "UsageError"
|
| 42 |
+
|
| 43 |
+
|
| 44 |
+
def test_alias_args_commented():
|
| 45 |
+
"""Check that alias correctly ignores 'commented out' args"""
|
| 46 |
+
_ip.run_line_magic("alias", "commentarg echo this is %%s a commented out arg")
|
| 47 |
+
|
| 48 |
+
with capture_output() as cap:
|
| 49 |
+
_ip.run_cell("commentarg")
|
| 50 |
+
|
| 51 |
+
# strip() is for pytest compat; testing via iptest patch IPython shell
|
| 52 |
+
# in testing.globalipapp and replace the system call which messed up the
|
| 53 |
+
# \r\n
|
| 54 |
+
assert cap.stdout.strip() == 'this is %s a commented out arg'
|
| 55 |
+
|
| 56 |
+
def test_alias_args_commented_nargs():
|
| 57 |
+
"""Check that alias correctly counts args, excluding those commented out"""
|
| 58 |
+
am = _ip.alias_manager
|
| 59 |
+
alias_name = 'comargcount'
|
| 60 |
+
cmd = 'echo this is %%s a commented out arg and this is not %s'
|
| 61 |
+
|
| 62 |
+
am.define_alias(alias_name, cmd)
|
| 63 |
+
assert am.is_alias(alias_name)
|
| 64 |
+
|
| 65 |
+
thealias = am.get_alias(alias_name)
|
| 66 |
+
assert thealias.nargs == 1
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_autocall.py
ADDED
|
@@ -0,0 +1,68 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""These kinds of tests are less than ideal, but at least they run.
|
| 2 |
+
|
| 3 |
+
This was an old test that was being run interactively in the top-level tests/
|
| 4 |
+
directory, which we are removing. For now putting this here ensures at least
|
| 5 |
+
we do run the test, though ultimately this functionality should all be tested
|
| 6 |
+
with better-isolated tests that don't rely on the global instance in iptest.
|
| 7 |
+
"""
|
| 8 |
+
|
| 9 |
+
from IPython.core.splitinput import LineInfo
|
| 10 |
+
from IPython.core.prefilter import AutocallChecker
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
def doctest_autocall():
|
| 14 |
+
"""
|
| 15 |
+
In [1]: def f1(a,b,c):
|
| 16 |
+
...: return a+b+c
|
| 17 |
+
...:
|
| 18 |
+
|
| 19 |
+
In [2]: def f2(a):
|
| 20 |
+
...: return a + a
|
| 21 |
+
...:
|
| 22 |
+
|
| 23 |
+
In [3]: def r(x):
|
| 24 |
+
...: return True
|
| 25 |
+
...:
|
| 26 |
+
|
| 27 |
+
In [4]: ;f2 a b c
|
| 28 |
+
Out[4]: 'a b ca b c'
|
| 29 |
+
|
| 30 |
+
In [5]: assert _ == "a b ca b c"
|
| 31 |
+
|
| 32 |
+
In [6]: ,f1 a b c
|
| 33 |
+
Out[6]: 'abc'
|
| 34 |
+
|
| 35 |
+
In [7]: assert _ == 'abc'
|
| 36 |
+
|
| 37 |
+
In [8]: print(_)
|
| 38 |
+
abc
|
| 39 |
+
|
| 40 |
+
In [9]: /f1 1,2,3
|
| 41 |
+
Out[9]: 6
|
| 42 |
+
|
| 43 |
+
In [10]: assert _ == 6
|
| 44 |
+
|
| 45 |
+
In [11]: /f2 4
|
| 46 |
+
Out[11]: 8
|
| 47 |
+
|
| 48 |
+
In [12]: assert _ == 8
|
| 49 |
+
|
| 50 |
+
In [12]: del f1, f2
|
| 51 |
+
|
| 52 |
+
In [13]: ,r a
|
| 53 |
+
Out[13]: True
|
| 54 |
+
|
| 55 |
+
In [14]: assert _ == True
|
| 56 |
+
|
| 57 |
+
In [15]: r'a'
|
| 58 |
+
Out[15]: 'a'
|
| 59 |
+
|
| 60 |
+
In [16]: assert _ == 'a'
|
| 61 |
+
"""
|
| 62 |
+
|
| 63 |
+
|
| 64 |
+
def test_autocall_should_ignore_raw_strings():
|
| 65 |
+
line_info = LineInfo("r'a'")
|
| 66 |
+
pm = ip.prefilter_manager
|
| 67 |
+
ac = AutocallChecker(shell=pm.shell, prefilter_manager=pm, config=pm.config)
|
| 68 |
+
assert ac.check(line_info) is None
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_compilerop.py
ADDED
|
@@ -0,0 +1,68 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# coding: utf-8
|
| 2 |
+
"""Tests for the compilerop module.
|
| 3 |
+
"""
|
| 4 |
+
#-----------------------------------------------------------------------------
|
| 5 |
+
# Copyright (C) 2010-2011 The IPython Development Team.
|
| 6 |
+
#
|
| 7 |
+
# Distributed under the terms of the BSD License.
|
| 8 |
+
#
|
| 9 |
+
# The full license is in the file COPYING.txt, distributed with this software.
|
| 10 |
+
#-----------------------------------------------------------------------------
|
| 11 |
+
|
| 12 |
+
#-----------------------------------------------------------------------------
|
| 13 |
+
# Imports
|
| 14 |
+
#-----------------------------------------------------------------------------
|
| 15 |
+
|
| 16 |
+
# Stdlib imports
|
| 17 |
+
import linecache
|
| 18 |
+
import sys
|
| 19 |
+
|
| 20 |
+
# Our own imports
|
| 21 |
+
from IPython.core import compilerop
|
| 22 |
+
|
| 23 |
+
#-----------------------------------------------------------------------------
|
| 24 |
+
# Test functions
|
| 25 |
+
#-----------------------------------------------------------------------------
|
| 26 |
+
|
| 27 |
+
def test_code_name():
|
| 28 |
+
code = 'x=1'
|
| 29 |
+
name = compilerop.code_name(code)
|
| 30 |
+
assert name.startswith("<ipython-input-0")
|
| 31 |
+
|
| 32 |
+
|
| 33 |
+
def test_code_name2():
|
| 34 |
+
code = 'x=1'
|
| 35 |
+
name = compilerop.code_name(code, 9)
|
| 36 |
+
assert name.startswith("<ipython-input-9")
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
def test_cache():
|
| 40 |
+
"""Test the compiler correctly compiles and caches inputs
|
| 41 |
+
"""
|
| 42 |
+
cp = compilerop.CachingCompiler()
|
| 43 |
+
ncache = len(linecache.cache)
|
| 44 |
+
cp.cache('x=1')
|
| 45 |
+
assert len(linecache.cache) > ncache
|
| 46 |
+
|
| 47 |
+
def test_proper_default_encoding():
|
| 48 |
+
# Check we're in a proper Python 2 environment (some imports, such
|
| 49 |
+
# as GTK, can change the default encoding, which can hide bugs.)
|
| 50 |
+
assert sys.getdefaultencoding() == "utf-8"
|
| 51 |
+
|
| 52 |
+
def test_cache_unicode():
|
| 53 |
+
cp = compilerop.CachingCompiler()
|
| 54 |
+
ncache = len(linecache.cache)
|
| 55 |
+
cp.cache(u"t = 'žćčšđ'")
|
| 56 |
+
assert len(linecache.cache) > ncache
|
| 57 |
+
|
| 58 |
+
def test_compiler_check_cache():
|
| 59 |
+
"""Test the compiler properly manages the cache.
|
| 60 |
+
"""
|
| 61 |
+
# Rather simple-minded tests that just exercise the API
|
| 62 |
+
cp = compilerop.CachingCompiler()
|
| 63 |
+
cp.cache('x=1', 99)
|
| 64 |
+
# Ensure now that after clearing the cache, our entries survive
|
| 65 |
+
linecache.checkcache()
|
| 66 |
+
assert any(
|
| 67 |
+
k.startswith("<ipython-input-99") for k in linecache.cache
|
| 68 |
+
), "Entry for input-99 missing from linecache"
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_display.py
ADDED
|
@@ -0,0 +1,513 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Copyright (c) IPython Development Team.
|
| 2 |
+
# Distributed under the terms of the Modified BSD License.
|
| 3 |
+
|
| 4 |
+
import json
|
| 5 |
+
import os
|
| 6 |
+
import warnings
|
| 7 |
+
|
| 8 |
+
from unittest import mock
|
| 9 |
+
|
| 10 |
+
import pytest
|
| 11 |
+
|
| 12 |
+
from IPython import display
|
| 13 |
+
from IPython.core.getipython import get_ipython
|
| 14 |
+
from IPython.utils.io import capture_output
|
| 15 |
+
from IPython.utils.tempdir import NamedFileInTemporaryDirectory
|
| 16 |
+
from IPython import paths as ipath
|
| 17 |
+
from IPython.testing.tools import AssertNotPrints
|
| 18 |
+
|
| 19 |
+
import IPython.testing.decorators as dec
|
| 20 |
+
|
| 21 |
+
def test_image_size():
|
| 22 |
+
"""Simple test for display.Image(args, width=x,height=y)"""
|
| 23 |
+
thisurl = 'http://www.google.fr/images/srpr/logo3w.png'
|
| 24 |
+
img = display.Image(url=thisurl, width=200, height=200)
|
| 25 |
+
assert '<img src="%s" width="200" height="200"/>' % (thisurl) == img._repr_html_()
|
| 26 |
+
img = display.Image(url=thisurl, metadata={'width':200, 'height':200})
|
| 27 |
+
assert '<img src="%s" width="200" height="200"/>' % (thisurl) == img._repr_html_()
|
| 28 |
+
img = display.Image(url=thisurl, width=200)
|
| 29 |
+
assert '<img src="%s" width="200"/>' % (thisurl) == img._repr_html_()
|
| 30 |
+
img = display.Image(url=thisurl)
|
| 31 |
+
assert '<img src="%s"/>' % (thisurl) == img._repr_html_()
|
| 32 |
+
img = display.Image(url=thisurl, unconfined=True)
|
| 33 |
+
assert '<img src="%s" class="unconfined"/>' % (thisurl) == img._repr_html_()
|
| 34 |
+
|
| 35 |
+
|
| 36 |
+
def test_image_mimes():
|
| 37 |
+
fmt = get_ipython().display_formatter.format
|
| 38 |
+
for format in display.Image._ACCEPTABLE_EMBEDDINGS:
|
| 39 |
+
mime = display.Image._MIMETYPES[format]
|
| 40 |
+
img = display.Image(b'garbage', format=format)
|
| 41 |
+
data, metadata = fmt(img)
|
| 42 |
+
assert sorted(data) == sorted([mime, "text/plain"])
|
| 43 |
+
|
| 44 |
+
|
| 45 |
+
def test_geojson():
|
| 46 |
+
|
| 47 |
+
gj = display.GeoJSON(data={
|
| 48 |
+
"type": "Feature",
|
| 49 |
+
"geometry": {
|
| 50 |
+
"type": "Point",
|
| 51 |
+
"coordinates": [-81.327, 296.038]
|
| 52 |
+
},
|
| 53 |
+
"properties": {
|
| 54 |
+
"name": "Inca City"
|
| 55 |
+
}
|
| 56 |
+
},
|
| 57 |
+
url_template="http://s3-eu-west-1.amazonaws.com/whereonmars.cartodb.net/{basemap_id}/{z}/{x}/{y}.png",
|
| 58 |
+
layer_options={
|
| 59 |
+
"basemap_id": "celestia_mars-shaded-16k_global",
|
| 60 |
+
"attribution": "Celestia/praesepe",
|
| 61 |
+
"minZoom": 0,
|
| 62 |
+
"maxZoom": 18,
|
| 63 |
+
},
|
| 64 |
+
)
|
| 65 |
+
assert "<IPython.core.display.GeoJSON object>" == str(gj)
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
def test_retina_png():
|
| 69 |
+
here = os.path.dirname(__file__)
|
| 70 |
+
img = display.Image(os.path.join(here, "2x2.png"), retina=True)
|
| 71 |
+
assert img.height == 1
|
| 72 |
+
assert img.width == 1
|
| 73 |
+
data, md = img._repr_png_()
|
| 74 |
+
assert md["width"] == 1
|
| 75 |
+
assert md["height"] == 1
|
| 76 |
+
|
| 77 |
+
|
| 78 |
+
def test_embed_svg_url():
|
| 79 |
+
import gzip
|
| 80 |
+
from io import BytesIO
|
| 81 |
+
svg_data = b'<svg><circle x="0" y="0" r="1"/></svg>'
|
| 82 |
+
url = 'http://test.com/circle.svg'
|
| 83 |
+
|
| 84 |
+
gzip_svg = BytesIO()
|
| 85 |
+
with gzip.open(gzip_svg, 'wb') as fp:
|
| 86 |
+
fp.write(svg_data)
|
| 87 |
+
gzip_svg = gzip_svg.getvalue()
|
| 88 |
+
|
| 89 |
+
def mocked_urlopen(*args, **kwargs):
|
| 90 |
+
class MockResponse:
|
| 91 |
+
def __init__(self, svg):
|
| 92 |
+
self._svg_data = svg
|
| 93 |
+
self.headers = {'content-type': 'image/svg+xml'}
|
| 94 |
+
|
| 95 |
+
def read(self):
|
| 96 |
+
return self._svg_data
|
| 97 |
+
|
| 98 |
+
if args[0] == url:
|
| 99 |
+
return MockResponse(svg_data)
|
| 100 |
+
elif args[0] == url + "z":
|
| 101 |
+
ret = MockResponse(gzip_svg)
|
| 102 |
+
ret.headers["content-encoding"] = "gzip"
|
| 103 |
+
return ret
|
| 104 |
+
return MockResponse(None)
|
| 105 |
+
|
| 106 |
+
with mock.patch('urllib.request.urlopen', side_effect=mocked_urlopen):
|
| 107 |
+
svg = display.SVG(url=url)
|
| 108 |
+
assert svg._repr_svg_().startswith("<svg") is True
|
| 109 |
+
svg = display.SVG(url=url + "z")
|
| 110 |
+
assert svg._repr_svg_().startswith("<svg") is True
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
def test_retina_jpeg():
|
| 114 |
+
here = os.path.dirname(__file__)
|
| 115 |
+
img = display.Image(os.path.join(here, "2x2.jpg"), retina=True)
|
| 116 |
+
assert img.height == 1
|
| 117 |
+
assert img.width == 1
|
| 118 |
+
data, md = img._repr_jpeg_()
|
| 119 |
+
assert md["width"] == 1
|
| 120 |
+
assert md["height"] == 1
|
| 121 |
+
|
| 122 |
+
|
| 123 |
+
def test_base64image():
|
| 124 |
+
display.Image("iVBORw0KGgoAAAANSUhEUgAAAAEAAAABAQMAAAAl21bKAAAAA1BMVEUAAACnej3aAAAAAWJLR0QAiAUdSAAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB94BCRQnOqNu0b4AAAAKSURBVAjXY2AAAAACAAHiIbwzAAAAAElFTkSuQmCC")
|
| 125 |
+
|
| 126 |
+
def test_image_filename_defaults():
|
| 127 |
+
'''test format constraint, and validity of jpeg and png'''
|
| 128 |
+
tpath = ipath.get_ipython_package_dir()
|
| 129 |
+
pytest.raises(
|
| 130 |
+
ValueError,
|
| 131 |
+
display.Image,
|
| 132 |
+
filename=os.path.join(tpath, "testing/tests/badformat.zip"),
|
| 133 |
+
embed=True,
|
| 134 |
+
)
|
| 135 |
+
pytest.raises(ValueError, display.Image)
|
| 136 |
+
pytest.raises(
|
| 137 |
+
ValueError,
|
| 138 |
+
display.Image,
|
| 139 |
+
data="this is not an image",
|
| 140 |
+
format="badformat",
|
| 141 |
+
embed=True,
|
| 142 |
+
)
|
| 143 |
+
# check both paths to allow packages to test at build and install time
|
| 144 |
+
imgfile = os.path.join(tpath, 'core/tests/2x2.png')
|
| 145 |
+
img = display.Image(filename=imgfile)
|
| 146 |
+
assert "png" == img.format
|
| 147 |
+
assert img._repr_png_() is not None
|
| 148 |
+
img = display.Image(
|
| 149 |
+
filename=os.path.join(tpath, "testing/tests/logo.jpg"), embed=False
|
| 150 |
+
)
|
| 151 |
+
assert "jpeg" == img.format
|
| 152 |
+
assert img._repr_jpeg_() is None
|
| 153 |
+
|
| 154 |
+
def _get_inline_config():
|
| 155 |
+
from matplotlib_inline.config import InlineBackend
|
| 156 |
+
return InlineBackend.instance()
|
| 157 |
+
|
| 158 |
+
|
| 159 |
+
@dec.skip_without("matplotlib")
|
| 160 |
+
def test_set_matplotlib_close():
|
| 161 |
+
cfg = _get_inline_config()
|
| 162 |
+
cfg.close_figures = False
|
| 163 |
+
with pytest.deprecated_call():
|
| 164 |
+
display.set_matplotlib_close()
|
| 165 |
+
assert cfg.close_figures
|
| 166 |
+
with pytest.deprecated_call():
|
| 167 |
+
display.set_matplotlib_close(False)
|
| 168 |
+
assert not cfg.close_figures
|
| 169 |
+
|
| 170 |
+
_fmt_mime_map = {
|
| 171 |
+
'png': 'image/png',
|
| 172 |
+
'jpeg': 'image/jpeg',
|
| 173 |
+
'pdf': 'application/pdf',
|
| 174 |
+
'retina': 'image/png',
|
| 175 |
+
'svg': 'image/svg+xml',
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
@dec.skip_without('matplotlib')
|
| 179 |
+
def test_set_matplotlib_formats():
|
| 180 |
+
from matplotlib.figure import Figure
|
| 181 |
+
formatters = get_ipython().display_formatter.formatters
|
| 182 |
+
for formats in [
|
| 183 |
+
('png',),
|
| 184 |
+
('pdf', 'svg'),
|
| 185 |
+
('jpeg', 'retina', 'png'),
|
| 186 |
+
(),
|
| 187 |
+
]:
|
| 188 |
+
active_mimes = {_fmt_mime_map[fmt] for fmt in formats}
|
| 189 |
+
with pytest.deprecated_call():
|
| 190 |
+
display.set_matplotlib_formats(*formats)
|
| 191 |
+
for mime, f in formatters.items():
|
| 192 |
+
if mime in active_mimes:
|
| 193 |
+
assert Figure in f
|
| 194 |
+
else:
|
| 195 |
+
assert Figure not in f
|
| 196 |
+
|
| 197 |
+
|
| 198 |
+
@dec.skip_without("matplotlib")
|
| 199 |
+
def test_set_matplotlib_formats_kwargs():
|
| 200 |
+
from matplotlib.figure import Figure
|
| 201 |
+
ip = get_ipython()
|
| 202 |
+
cfg = _get_inline_config()
|
| 203 |
+
cfg.print_figure_kwargs.update(dict(foo='bar'))
|
| 204 |
+
kwargs = dict(dpi=150)
|
| 205 |
+
with pytest.deprecated_call():
|
| 206 |
+
display.set_matplotlib_formats("png", **kwargs)
|
| 207 |
+
formatter = ip.display_formatter.formatters["image/png"]
|
| 208 |
+
f = formatter.lookup_by_type(Figure)
|
| 209 |
+
formatter_kwargs = f.keywords
|
| 210 |
+
expected = kwargs
|
| 211 |
+
expected["base64"] = True
|
| 212 |
+
expected["fmt"] = "png"
|
| 213 |
+
expected.update(cfg.print_figure_kwargs)
|
| 214 |
+
assert formatter_kwargs == expected
|
| 215 |
+
|
| 216 |
+
def test_display_available():
|
| 217 |
+
"""
|
| 218 |
+
Test that display is available without import
|
| 219 |
+
|
| 220 |
+
We don't really care if it's in builtin or anything else, but it should
|
| 221 |
+
always be available.
|
| 222 |
+
"""
|
| 223 |
+
ip = get_ipython()
|
| 224 |
+
with AssertNotPrints('NameError'):
|
| 225 |
+
ip.run_cell('display')
|
| 226 |
+
try:
|
| 227 |
+
ip.run_cell('del display')
|
| 228 |
+
except NameError:
|
| 229 |
+
pass # it's ok, it might be in builtins
|
| 230 |
+
# even if deleted it should be back
|
| 231 |
+
with AssertNotPrints('NameError'):
|
| 232 |
+
ip.run_cell('display')
|
| 233 |
+
|
| 234 |
+
def test_textdisplayobj_pretty_repr():
|
| 235 |
+
p = display.Pretty("This is a simple test")
|
| 236 |
+
assert repr(p) == "<IPython.core.display.Pretty object>"
|
| 237 |
+
assert p.data == "This is a simple test"
|
| 238 |
+
|
| 239 |
+
p._show_mem_addr = True
|
| 240 |
+
assert repr(p) == object.__repr__(p)
|
| 241 |
+
|
| 242 |
+
|
| 243 |
+
def test_displayobject_repr():
|
| 244 |
+
h = display.HTML("<br />")
|
| 245 |
+
assert repr(h) == "<IPython.core.display.HTML object>"
|
| 246 |
+
h._show_mem_addr = True
|
| 247 |
+
assert repr(h) == object.__repr__(h)
|
| 248 |
+
h._show_mem_addr = False
|
| 249 |
+
assert repr(h) == "<IPython.core.display.HTML object>"
|
| 250 |
+
|
| 251 |
+
j = display.Javascript("")
|
| 252 |
+
assert repr(j) == "<IPython.core.display.Javascript object>"
|
| 253 |
+
j._show_mem_addr = True
|
| 254 |
+
assert repr(j) == object.__repr__(j)
|
| 255 |
+
j._show_mem_addr = False
|
| 256 |
+
assert repr(j) == "<IPython.core.display.Javascript object>"
|
| 257 |
+
|
| 258 |
+
@mock.patch('warnings.warn')
|
| 259 |
+
def test_encourage_iframe_over_html(m_warn):
|
| 260 |
+
display.HTML()
|
| 261 |
+
m_warn.assert_not_called()
|
| 262 |
+
|
| 263 |
+
display.HTML('<br />')
|
| 264 |
+
m_warn.assert_not_called()
|
| 265 |
+
|
| 266 |
+
display.HTML('<html><p>Lots of content here</p><iframe src="http://a.com"></iframe>')
|
| 267 |
+
m_warn.assert_not_called()
|
| 268 |
+
|
| 269 |
+
display.HTML('<iframe src="http://a.com"></iframe>')
|
| 270 |
+
m_warn.assert_called_with('Consider using IPython.display.IFrame instead')
|
| 271 |
+
|
| 272 |
+
m_warn.reset_mock()
|
| 273 |
+
display.HTML('<IFRAME SRC="http://a.com"></IFRAME>')
|
| 274 |
+
m_warn.assert_called_with('Consider using IPython.display.IFrame instead')
|
| 275 |
+
|
| 276 |
+
def test_progress():
|
| 277 |
+
p = display.ProgressBar(10)
|
| 278 |
+
assert "0/10" in repr(p)
|
| 279 |
+
p.html_width = "100%"
|
| 280 |
+
p.progress = 5
|
| 281 |
+
assert (
|
| 282 |
+
p._repr_html_() == "<progress style='width:100%' max='10' value='5'></progress>"
|
| 283 |
+
)
|
| 284 |
+
|
| 285 |
+
|
| 286 |
+
def test_progress_iter():
|
| 287 |
+
with capture_output(display=False) as captured:
|
| 288 |
+
for i in display.ProgressBar(5):
|
| 289 |
+
out = captured.stdout
|
| 290 |
+
assert "{0}/5".format(i) in out
|
| 291 |
+
out = captured.stdout
|
| 292 |
+
assert "5/5" in out
|
| 293 |
+
|
| 294 |
+
|
| 295 |
+
def test_json():
|
| 296 |
+
d = {'a': 5}
|
| 297 |
+
lis = [d]
|
| 298 |
+
metadata = [
|
| 299 |
+
{'expanded': False, 'root': 'root'},
|
| 300 |
+
{'expanded': True, 'root': 'root'},
|
| 301 |
+
{'expanded': False, 'root': 'custom'},
|
| 302 |
+
{'expanded': True, 'root': 'custom'},
|
| 303 |
+
]
|
| 304 |
+
json_objs = [
|
| 305 |
+
display.JSON(d),
|
| 306 |
+
display.JSON(d, expanded=True),
|
| 307 |
+
display.JSON(d, root='custom'),
|
| 308 |
+
display.JSON(d, expanded=True, root='custom'),
|
| 309 |
+
]
|
| 310 |
+
for j, md in zip(json_objs, metadata):
|
| 311 |
+
assert j._repr_json_() == (d, md)
|
| 312 |
+
|
| 313 |
+
with warnings.catch_warnings(record=True) as w:
|
| 314 |
+
warnings.simplefilter("always")
|
| 315 |
+
j = display.JSON(json.dumps(d))
|
| 316 |
+
assert len(w) == 1
|
| 317 |
+
assert j._repr_json_() == (d, metadata[0])
|
| 318 |
+
|
| 319 |
+
json_objs = [
|
| 320 |
+
display.JSON(lis),
|
| 321 |
+
display.JSON(lis, expanded=True),
|
| 322 |
+
display.JSON(lis, root='custom'),
|
| 323 |
+
display.JSON(lis, expanded=True, root='custom'),
|
| 324 |
+
]
|
| 325 |
+
for j, md in zip(json_objs, metadata):
|
| 326 |
+
assert j._repr_json_() == (lis, md)
|
| 327 |
+
|
| 328 |
+
with warnings.catch_warnings(record=True) as w:
|
| 329 |
+
warnings.simplefilter("always")
|
| 330 |
+
j = display.JSON(json.dumps(lis))
|
| 331 |
+
assert len(w) == 1
|
| 332 |
+
assert j._repr_json_() == (lis, metadata[0])
|
| 333 |
+
|
| 334 |
+
|
| 335 |
+
def test_video_embedding():
|
| 336 |
+
"""use a tempfile, with dummy-data, to ensure that video embedding doesn't crash"""
|
| 337 |
+
v = display.Video("http://ignored")
|
| 338 |
+
assert not v.embed
|
| 339 |
+
html = v._repr_html_()
|
| 340 |
+
assert 'src="data:' not in html
|
| 341 |
+
assert 'src="http://ignored"' in html
|
| 342 |
+
|
| 343 |
+
with pytest.raises(ValueError):
|
| 344 |
+
v = display.Video(b'abc')
|
| 345 |
+
|
| 346 |
+
with NamedFileInTemporaryDirectory('test.mp4') as f:
|
| 347 |
+
f.write(b'abc')
|
| 348 |
+
f.close()
|
| 349 |
+
|
| 350 |
+
v = display.Video(f.name)
|
| 351 |
+
assert not v.embed
|
| 352 |
+
html = v._repr_html_()
|
| 353 |
+
assert 'src="data:' not in html
|
| 354 |
+
|
| 355 |
+
v = display.Video(f.name, embed=True)
|
| 356 |
+
html = v._repr_html_()
|
| 357 |
+
assert 'src="data:video/mp4;base64,YWJj"' in html
|
| 358 |
+
|
| 359 |
+
v = display.Video(f.name, embed=True, mimetype='video/other')
|
| 360 |
+
html = v._repr_html_()
|
| 361 |
+
assert 'src="data:video/other;base64,YWJj"' in html
|
| 362 |
+
|
| 363 |
+
v = display.Video(b'abc', embed=True, mimetype='video/mp4')
|
| 364 |
+
html = v._repr_html_()
|
| 365 |
+
assert 'src="data:video/mp4;base64,YWJj"' in html
|
| 366 |
+
|
| 367 |
+
v = display.Video(u'YWJj', embed=True, mimetype='video/xyz')
|
| 368 |
+
html = v._repr_html_()
|
| 369 |
+
assert 'src="data:video/xyz;base64,YWJj"' in html
|
| 370 |
+
|
| 371 |
+
def test_html_metadata():
|
| 372 |
+
s = "<h1>Test</h1>"
|
| 373 |
+
h = display.HTML(s, metadata={"isolated": True})
|
| 374 |
+
assert h._repr_html_() == (s, {"isolated": True})
|
| 375 |
+
|
| 376 |
+
|
| 377 |
+
def test_display_id():
|
| 378 |
+
ip = get_ipython()
|
| 379 |
+
with mock.patch.object(ip.display_pub, 'publish') as pub:
|
| 380 |
+
handle = display.display('x')
|
| 381 |
+
assert handle is None
|
| 382 |
+
handle = display.display('y', display_id='secret')
|
| 383 |
+
assert isinstance(handle, display.DisplayHandle)
|
| 384 |
+
handle2 = display.display('z', display_id=True)
|
| 385 |
+
assert isinstance(handle2, display.DisplayHandle)
|
| 386 |
+
assert handle.display_id != handle2.display_id
|
| 387 |
+
|
| 388 |
+
assert pub.call_count == 3
|
| 389 |
+
args, kwargs = pub.call_args_list[0]
|
| 390 |
+
assert args == ()
|
| 391 |
+
assert kwargs == {
|
| 392 |
+
'data': {
|
| 393 |
+
'text/plain': repr('x')
|
| 394 |
+
},
|
| 395 |
+
'metadata': {},
|
| 396 |
+
}
|
| 397 |
+
args, kwargs = pub.call_args_list[1]
|
| 398 |
+
assert args == ()
|
| 399 |
+
assert kwargs == {
|
| 400 |
+
'data': {
|
| 401 |
+
'text/plain': repr('y')
|
| 402 |
+
},
|
| 403 |
+
'metadata': {},
|
| 404 |
+
'transient': {
|
| 405 |
+
'display_id': handle.display_id,
|
| 406 |
+
},
|
| 407 |
+
}
|
| 408 |
+
args, kwargs = pub.call_args_list[2]
|
| 409 |
+
assert args == ()
|
| 410 |
+
assert kwargs == {
|
| 411 |
+
'data': {
|
| 412 |
+
'text/plain': repr('z')
|
| 413 |
+
},
|
| 414 |
+
'metadata': {},
|
| 415 |
+
'transient': {
|
| 416 |
+
'display_id': handle2.display_id,
|
| 417 |
+
},
|
| 418 |
+
}
|
| 419 |
+
|
| 420 |
+
|
| 421 |
+
def test_update_display():
|
| 422 |
+
ip = get_ipython()
|
| 423 |
+
with mock.patch.object(ip.display_pub, 'publish') as pub:
|
| 424 |
+
with pytest.raises(TypeError):
|
| 425 |
+
display.update_display('x')
|
| 426 |
+
display.update_display('x', display_id='1')
|
| 427 |
+
display.update_display('y', display_id='2')
|
| 428 |
+
args, kwargs = pub.call_args_list[0]
|
| 429 |
+
assert args == ()
|
| 430 |
+
assert kwargs == {
|
| 431 |
+
'data': {
|
| 432 |
+
'text/plain': repr('x')
|
| 433 |
+
},
|
| 434 |
+
'metadata': {},
|
| 435 |
+
'transient': {
|
| 436 |
+
'display_id': '1',
|
| 437 |
+
},
|
| 438 |
+
'update': True,
|
| 439 |
+
}
|
| 440 |
+
args, kwargs = pub.call_args_list[1]
|
| 441 |
+
assert args == ()
|
| 442 |
+
assert kwargs == {
|
| 443 |
+
'data': {
|
| 444 |
+
'text/plain': repr('y')
|
| 445 |
+
},
|
| 446 |
+
'metadata': {},
|
| 447 |
+
'transient': {
|
| 448 |
+
'display_id': '2',
|
| 449 |
+
},
|
| 450 |
+
'update': True,
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
|
| 454 |
+
def test_display_handle():
|
| 455 |
+
ip = get_ipython()
|
| 456 |
+
handle = display.DisplayHandle()
|
| 457 |
+
assert isinstance(handle.display_id, str)
|
| 458 |
+
handle = display.DisplayHandle("my-id")
|
| 459 |
+
assert handle.display_id == "my-id"
|
| 460 |
+
with mock.patch.object(ip.display_pub, "publish") as pub:
|
| 461 |
+
handle.display("x")
|
| 462 |
+
handle.update("y")
|
| 463 |
+
|
| 464 |
+
args, kwargs = pub.call_args_list[0]
|
| 465 |
+
assert args == ()
|
| 466 |
+
assert kwargs == {
|
| 467 |
+
'data': {
|
| 468 |
+
'text/plain': repr('x')
|
| 469 |
+
},
|
| 470 |
+
'metadata': {},
|
| 471 |
+
'transient': {
|
| 472 |
+
'display_id': handle.display_id,
|
| 473 |
+
}
|
| 474 |
+
}
|
| 475 |
+
args, kwargs = pub.call_args_list[1]
|
| 476 |
+
assert args == ()
|
| 477 |
+
assert kwargs == {
|
| 478 |
+
'data': {
|
| 479 |
+
'text/plain': repr('y')
|
| 480 |
+
},
|
| 481 |
+
'metadata': {},
|
| 482 |
+
'transient': {
|
| 483 |
+
'display_id': handle.display_id,
|
| 484 |
+
},
|
| 485 |
+
'update': True,
|
| 486 |
+
}
|
| 487 |
+
|
| 488 |
+
|
| 489 |
+
def test_image_alt_tag():
|
| 490 |
+
"""Simple test for display.Image(args, alt=x,)"""
|
| 491 |
+
thisurl = "http://example.com/image.png"
|
| 492 |
+
img = display.Image(url=thisurl, alt="an image")
|
| 493 |
+
assert '<img src="%s" alt="an image"/>' % (thisurl) == img._repr_html_()
|
| 494 |
+
img = display.Image(url=thisurl, unconfined=True, alt="an image")
|
| 495 |
+
assert (
|
| 496 |
+
'<img src="%s" class="unconfined" alt="an image"/>' % (thisurl)
|
| 497 |
+
== img._repr_html_()
|
| 498 |
+
)
|
| 499 |
+
img = display.Image(url=thisurl, alt='>"& <')
|
| 500 |
+
assert '<img src="%s" alt=">"& <"/>' % (thisurl) == img._repr_html_()
|
| 501 |
+
|
| 502 |
+
img = display.Image(url=thisurl, metadata={"alt": "an image"})
|
| 503 |
+
assert img.alt == "an image"
|
| 504 |
+
here = os.path.dirname(__file__)
|
| 505 |
+
img = display.Image(os.path.join(here, "2x2.png"), alt="an image")
|
| 506 |
+
assert img.alt == "an image"
|
| 507 |
+
_, md = img._repr_png_()
|
| 508 |
+
assert md["alt"] == "an image"
|
| 509 |
+
|
| 510 |
+
|
| 511 |
+
def test_image_bad_filename_raises_proper_exception():
|
| 512 |
+
with pytest.raises(FileNotFoundError):
|
| 513 |
+
display.Image("/this/file/does/not/exist/")._repr_png_()
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_formatters.py
ADDED
|
@@ -0,0 +1,545 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Tests for the Formatters."""
|
| 2 |
+
|
| 3 |
+
from math import pi
|
| 4 |
+
|
| 5 |
+
try:
|
| 6 |
+
import numpy
|
| 7 |
+
except:
|
| 8 |
+
numpy = None
|
| 9 |
+
import pytest
|
| 10 |
+
|
| 11 |
+
from IPython import get_ipython
|
| 12 |
+
from traitlets.config import Config
|
| 13 |
+
from IPython.core.formatters import (
|
| 14 |
+
PlainTextFormatter, HTMLFormatter, PDFFormatter, _mod_name_key,
|
| 15 |
+
DisplayFormatter, JSONFormatter,
|
| 16 |
+
)
|
| 17 |
+
from IPython.utils.io import capture_output
|
| 18 |
+
|
| 19 |
+
class A(object):
|
| 20 |
+
def __repr__(self):
|
| 21 |
+
return 'A()'
|
| 22 |
+
|
| 23 |
+
class B(A):
|
| 24 |
+
def __repr__(self):
|
| 25 |
+
return 'B()'
|
| 26 |
+
|
| 27 |
+
class C:
|
| 28 |
+
pass
|
| 29 |
+
|
| 30 |
+
class BadRepr(object):
|
| 31 |
+
def __repr__(self):
|
| 32 |
+
raise ValueError("bad repr")
|
| 33 |
+
|
| 34 |
+
class BadPretty(object):
|
| 35 |
+
_repr_pretty_ = None
|
| 36 |
+
|
| 37 |
+
class GoodPretty(object):
|
| 38 |
+
def _repr_pretty_(self, pp, cycle):
|
| 39 |
+
pp.text('foo')
|
| 40 |
+
|
| 41 |
+
def __repr__(self):
|
| 42 |
+
return 'GoodPretty()'
|
| 43 |
+
|
| 44 |
+
def foo_printer(obj, pp, cycle):
|
| 45 |
+
pp.text('foo')
|
| 46 |
+
|
| 47 |
+
def test_pretty():
|
| 48 |
+
f = PlainTextFormatter()
|
| 49 |
+
f.for_type(A, foo_printer)
|
| 50 |
+
assert f(A()) == "foo"
|
| 51 |
+
assert f(B()) == "B()"
|
| 52 |
+
assert f(GoodPretty()) == "foo"
|
| 53 |
+
# Just don't raise an exception for the following:
|
| 54 |
+
f(BadPretty())
|
| 55 |
+
|
| 56 |
+
f.pprint = False
|
| 57 |
+
assert f(A()) == "A()"
|
| 58 |
+
assert f(B()) == "B()"
|
| 59 |
+
assert f(GoodPretty()) == "GoodPretty()"
|
| 60 |
+
|
| 61 |
+
|
| 62 |
+
def test_deferred():
|
| 63 |
+
f = PlainTextFormatter()
|
| 64 |
+
|
| 65 |
+
def test_precision():
|
| 66 |
+
"""test various values for float_precision."""
|
| 67 |
+
f = PlainTextFormatter()
|
| 68 |
+
assert f(pi) == repr(pi)
|
| 69 |
+
f.float_precision = 0
|
| 70 |
+
if numpy:
|
| 71 |
+
po = numpy.get_printoptions()
|
| 72 |
+
assert po["precision"] == 0
|
| 73 |
+
assert f(pi) == "3"
|
| 74 |
+
f.float_precision = 2
|
| 75 |
+
if numpy:
|
| 76 |
+
po = numpy.get_printoptions()
|
| 77 |
+
assert po["precision"] == 2
|
| 78 |
+
assert f(pi) == "3.14"
|
| 79 |
+
f.float_precision = "%g"
|
| 80 |
+
if numpy:
|
| 81 |
+
po = numpy.get_printoptions()
|
| 82 |
+
assert po["precision"] == 2
|
| 83 |
+
assert f(pi) == "3.14159"
|
| 84 |
+
f.float_precision = "%e"
|
| 85 |
+
assert f(pi) == "3.141593e+00"
|
| 86 |
+
f.float_precision = ""
|
| 87 |
+
if numpy:
|
| 88 |
+
po = numpy.get_printoptions()
|
| 89 |
+
assert po["precision"] == 8
|
| 90 |
+
assert f(pi) == repr(pi)
|
| 91 |
+
|
| 92 |
+
|
| 93 |
+
def test_bad_precision():
|
| 94 |
+
"""test various invalid values for float_precision."""
|
| 95 |
+
f = PlainTextFormatter()
|
| 96 |
+
def set_fp(p):
|
| 97 |
+
f.float_precision = p
|
| 98 |
+
|
| 99 |
+
pytest.raises(ValueError, set_fp, "%")
|
| 100 |
+
pytest.raises(ValueError, set_fp, "%.3f%i")
|
| 101 |
+
pytest.raises(ValueError, set_fp, "foo")
|
| 102 |
+
pytest.raises(ValueError, set_fp, -1)
|
| 103 |
+
|
| 104 |
+
def test_for_type():
|
| 105 |
+
f = PlainTextFormatter()
|
| 106 |
+
|
| 107 |
+
# initial return, None
|
| 108 |
+
assert f.for_type(C, foo_printer) is None
|
| 109 |
+
# no func queries
|
| 110 |
+
assert f.for_type(C) is foo_printer
|
| 111 |
+
# shouldn't change anything
|
| 112 |
+
assert f.for_type(C) is foo_printer
|
| 113 |
+
# None should do the same
|
| 114 |
+
assert f.for_type(C, None) is foo_printer
|
| 115 |
+
assert f.for_type(C, None) is foo_printer
|
| 116 |
+
|
| 117 |
+
def test_for_type_string():
|
| 118 |
+
f = PlainTextFormatter()
|
| 119 |
+
|
| 120 |
+
type_str = '%s.%s' % (C.__module__, 'C')
|
| 121 |
+
|
| 122 |
+
# initial return, None
|
| 123 |
+
assert f.for_type(type_str, foo_printer) is None
|
| 124 |
+
# no func queries
|
| 125 |
+
assert f.for_type(type_str) is foo_printer
|
| 126 |
+
assert _mod_name_key(C) in f.deferred_printers
|
| 127 |
+
assert f.for_type(C) is foo_printer
|
| 128 |
+
assert _mod_name_key(C) not in f.deferred_printers
|
| 129 |
+
assert C in f.type_printers
|
| 130 |
+
|
| 131 |
+
def test_for_type_by_name():
|
| 132 |
+
f = PlainTextFormatter()
|
| 133 |
+
|
| 134 |
+
mod = C.__module__
|
| 135 |
+
|
| 136 |
+
# initial return, None
|
| 137 |
+
assert f.for_type_by_name(mod, "C", foo_printer) is None
|
| 138 |
+
# no func queries
|
| 139 |
+
assert f.for_type_by_name(mod, "C") is foo_printer
|
| 140 |
+
# shouldn't change anything
|
| 141 |
+
assert f.for_type_by_name(mod, "C") is foo_printer
|
| 142 |
+
# None should do the same
|
| 143 |
+
assert f.for_type_by_name(mod, "C", None) is foo_printer
|
| 144 |
+
assert f.for_type_by_name(mod, "C", None) is foo_printer
|
| 145 |
+
|
| 146 |
+
|
| 147 |
+
def test_lookup():
|
| 148 |
+
f = PlainTextFormatter()
|
| 149 |
+
|
| 150 |
+
f.for_type(C, foo_printer)
|
| 151 |
+
assert f.lookup(C()) is foo_printer
|
| 152 |
+
with pytest.raises(KeyError):
|
| 153 |
+
f.lookup(A())
|
| 154 |
+
|
| 155 |
+
def test_lookup_string():
|
| 156 |
+
f = PlainTextFormatter()
|
| 157 |
+
type_str = '%s.%s' % (C.__module__, 'C')
|
| 158 |
+
|
| 159 |
+
f.for_type(type_str, foo_printer)
|
| 160 |
+
assert f.lookup(C()) is foo_printer
|
| 161 |
+
# should move from deferred to imported dict
|
| 162 |
+
assert _mod_name_key(C) not in f.deferred_printers
|
| 163 |
+
assert C in f.type_printers
|
| 164 |
+
|
| 165 |
+
def test_lookup_by_type():
|
| 166 |
+
f = PlainTextFormatter()
|
| 167 |
+
f.for_type(C, foo_printer)
|
| 168 |
+
assert f.lookup_by_type(C) is foo_printer
|
| 169 |
+
with pytest.raises(KeyError):
|
| 170 |
+
f.lookup_by_type(A)
|
| 171 |
+
|
| 172 |
+
def test_lookup_by_type_string():
|
| 173 |
+
f = PlainTextFormatter()
|
| 174 |
+
type_str = '%s.%s' % (C.__module__, 'C')
|
| 175 |
+
f.for_type(type_str, foo_printer)
|
| 176 |
+
|
| 177 |
+
# verify insertion
|
| 178 |
+
assert _mod_name_key(C) in f.deferred_printers
|
| 179 |
+
assert C not in f.type_printers
|
| 180 |
+
|
| 181 |
+
assert f.lookup_by_type(type_str) is foo_printer
|
| 182 |
+
# lookup by string doesn't cause import
|
| 183 |
+
assert _mod_name_key(C) in f.deferred_printers
|
| 184 |
+
assert C not in f.type_printers
|
| 185 |
+
|
| 186 |
+
assert f.lookup_by_type(C) is foo_printer
|
| 187 |
+
# should move from deferred to imported dict
|
| 188 |
+
assert _mod_name_key(C) not in f.deferred_printers
|
| 189 |
+
assert C in f.type_printers
|
| 190 |
+
|
| 191 |
+
def test_in_formatter():
|
| 192 |
+
f = PlainTextFormatter()
|
| 193 |
+
f.for_type(C, foo_printer)
|
| 194 |
+
type_str = '%s.%s' % (C.__module__, 'C')
|
| 195 |
+
assert C in f
|
| 196 |
+
assert type_str in f
|
| 197 |
+
|
| 198 |
+
def test_string_in_formatter():
|
| 199 |
+
f = PlainTextFormatter()
|
| 200 |
+
type_str = '%s.%s' % (C.__module__, 'C')
|
| 201 |
+
f.for_type(type_str, foo_printer)
|
| 202 |
+
assert type_str in f
|
| 203 |
+
assert C in f
|
| 204 |
+
|
| 205 |
+
def test_pop():
|
| 206 |
+
f = PlainTextFormatter()
|
| 207 |
+
f.for_type(C, foo_printer)
|
| 208 |
+
assert f.lookup_by_type(C) is foo_printer
|
| 209 |
+
assert f.pop(C, None) is foo_printer
|
| 210 |
+
f.for_type(C, foo_printer)
|
| 211 |
+
assert f.pop(C) is foo_printer
|
| 212 |
+
with pytest.raises(KeyError):
|
| 213 |
+
f.lookup_by_type(C)
|
| 214 |
+
with pytest.raises(KeyError):
|
| 215 |
+
f.pop(C)
|
| 216 |
+
with pytest.raises(KeyError):
|
| 217 |
+
f.pop(A)
|
| 218 |
+
assert f.pop(A, None) is None
|
| 219 |
+
|
| 220 |
+
def test_pop_string():
|
| 221 |
+
f = PlainTextFormatter()
|
| 222 |
+
type_str = '%s.%s' % (C.__module__, 'C')
|
| 223 |
+
|
| 224 |
+
with pytest.raises(KeyError):
|
| 225 |
+
f.pop(type_str)
|
| 226 |
+
|
| 227 |
+
f.for_type(type_str, foo_printer)
|
| 228 |
+
f.pop(type_str)
|
| 229 |
+
with pytest.raises(KeyError):
|
| 230 |
+
f.lookup_by_type(C)
|
| 231 |
+
with pytest.raises(KeyError):
|
| 232 |
+
f.pop(type_str)
|
| 233 |
+
|
| 234 |
+
f.for_type(C, foo_printer)
|
| 235 |
+
assert f.pop(type_str, None) is foo_printer
|
| 236 |
+
with pytest.raises(KeyError):
|
| 237 |
+
f.lookup_by_type(C)
|
| 238 |
+
with pytest.raises(KeyError):
|
| 239 |
+
f.pop(type_str)
|
| 240 |
+
assert f.pop(type_str, None) is None
|
| 241 |
+
|
| 242 |
+
|
| 243 |
+
def test_error_method():
|
| 244 |
+
f = HTMLFormatter()
|
| 245 |
+
class BadHTML(object):
|
| 246 |
+
def _repr_html_(self):
|
| 247 |
+
raise ValueError("Bad HTML")
|
| 248 |
+
bad = BadHTML()
|
| 249 |
+
with capture_output() as captured:
|
| 250 |
+
result = f(bad)
|
| 251 |
+
assert result is None
|
| 252 |
+
assert "Traceback" in captured.stdout
|
| 253 |
+
assert "Bad HTML" in captured.stdout
|
| 254 |
+
assert "_repr_html_" in captured.stdout
|
| 255 |
+
|
| 256 |
+
def test_nowarn_notimplemented():
|
| 257 |
+
f = HTMLFormatter()
|
| 258 |
+
class HTMLNotImplemented(object):
|
| 259 |
+
def _repr_html_(self):
|
| 260 |
+
raise NotImplementedError
|
| 261 |
+
h = HTMLNotImplemented()
|
| 262 |
+
with capture_output() as captured:
|
| 263 |
+
result = f(h)
|
| 264 |
+
assert result is None
|
| 265 |
+
assert "" == captured.stderr
|
| 266 |
+
assert "" == captured.stdout
|
| 267 |
+
|
| 268 |
+
|
| 269 |
+
def test_warn_error_for_type():
|
| 270 |
+
f = HTMLFormatter()
|
| 271 |
+
f.for_type(int, lambda i: name_error)
|
| 272 |
+
with capture_output() as captured:
|
| 273 |
+
result = f(5)
|
| 274 |
+
assert result is None
|
| 275 |
+
assert "Traceback" in captured.stdout
|
| 276 |
+
assert "NameError" in captured.stdout
|
| 277 |
+
assert "name_error" in captured.stdout
|
| 278 |
+
|
| 279 |
+
def test_error_pretty_method():
|
| 280 |
+
f = PlainTextFormatter()
|
| 281 |
+
class BadPretty(object):
|
| 282 |
+
def _repr_pretty_(self):
|
| 283 |
+
return "hello"
|
| 284 |
+
bad = BadPretty()
|
| 285 |
+
with capture_output() as captured:
|
| 286 |
+
result = f(bad)
|
| 287 |
+
assert result is None
|
| 288 |
+
assert "Traceback" in captured.stdout
|
| 289 |
+
assert "_repr_pretty_" in captured.stdout
|
| 290 |
+
assert "given" in captured.stdout
|
| 291 |
+
assert "argument" in captured.stdout
|
| 292 |
+
|
| 293 |
+
|
| 294 |
+
def test_bad_repr_traceback():
|
| 295 |
+
f = PlainTextFormatter()
|
| 296 |
+
bad = BadRepr()
|
| 297 |
+
with capture_output() as captured:
|
| 298 |
+
result = f(bad)
|
| 299 |
+
# catches error, returns None
|
| 300 |
+
assert result is None
|
| 301 |
+
assert "Traceback" in captured.stdout
|
| 302 |
+
assert "__repr__" in captured.stdout
|
| 303 |
+
assert "ValueError" in captured.stdout
|
| 304 |
+
|
| 305 |
+
|
| 306 |
+
class MakePDF(object):
|
| 307 |
+
def _repr_pdf_(self):
|
| 308 |
+
return 'PDF'
|
| 309 |
+
|
| 310 |
+
def test_pdf_formatter():
|
| 311 |
+
pdf = MakePDF()
|
| 312 |
+
f = PDFFormatter()
|
| 313 |
+
assert f(pdf) == "PDF"
|
| 314 |
+
|
| 315 |
+
|
| 316 |
+
def test_print_method_bound():
|
| 317 |
+
f = HTMLFormatter()
|
| 318 |
+
class MyHTML(object):
|
| 319 |
+
def _repr_html_(self):
|
| 320 |
+
return "hello"
|
| 321 |
+
with capture_output() as captured:
|
| 322 |
+
result = f(MyHTML)
|
| 323 |
+
assert result is None
|
| 324 |
+
assert "FormatterWarning" not in captured.stderr
|
| 325 |
+
|
| 326 |
+
with capture_output() as captured:
|
| 327 |
+
result = f(MyHTML())
|
| 328 |
+
assert result == "hello"
|
| 329 |
+
assert captured.stderr == ""
|
| 330 |
+
|
| 331 |
+
|
| 332 |
+
def test_print_method_weird():
|
| 333 |
+
|
| 334 |
+
class TextMagicHat(object):
|
| 335 |
+
def __getattr__(self, key):
|
| 336 |
+
return key
|
| 337 |
+
|
| 338 |
+
f = HTMLFormatter()
|
| 339 |
+
|
| 340 |
+
text_hat = TextMagicHat()
|
| 341 |
+
assert text_hat._repr_html_ == "_repr_html_"
|
| 342 |
+
with capture_output() as captured:
|
| 343 |
+
result = f(text_hat)
|
| 344 |
+
|
| 345 |
+
assert result is None
|
| 346 |
+
assert "FormatterWarning" not in captured.stderr
|
| 347 |
+
|
| 348 |
+
class CallableMagicHat(object):
|
| 349 |
+
def __getattr__(self, key):
|
| 350 |
+
return lambda : key
|
| 351 |
+
|
| 352 |
+
call_hat = CallableMagicHat()
|
| 353 |
+
with capture_output() as captured:
|
| 354 |
+
result = f(call_hat)
|
| 355 |
+
|
| 356 |
+
assert result is None
|
| 357 |
+
|
| 358 |
+
class BadReprArgs(object):
|
| 359 |
+
def _repr_html_(self, extra, args):
|
| 360 |
+
return "html"
|
| 361 |
+
|
| 362 |
+
bad = BadReprArgs()
|
| 363 |
+
with capture_output() as captured:
|
| 364 |
+
result = f(bad)
|
| 365 |
+
|
| 366 |
+
assert result is None
|
| 367 |
+
assert "FormatterWarning" not in captured.stderr
|
| 368 |
+
|
| 369 |
+
|
| 370 |
+
def test_format_config():
|
| 371 |
+
"""config objects don't pretend to support fancy reprs with lazy attrs"""
|
| 372 |
+
f = HTMLFormatter()
|
| 373 |
+
cfg = Config()
|
| 374 |
+
with capture_output() as captured:
|
| 375 |
+
result = f(cfg)
|
| 376 |
+
assert result is None
|
| 377 |
+
assert captured.stderr == ""
|
| 378 |
+
|
| 379 |
+
with capture_output() as captured:
|
| 380 |
+
result = f(Config)
|
| 381 |
+
assert result is None
|
| 382 |
+
assert captured.stderr == ""
|
| 383 |
+
|
| 384 |
+
|
| 385 |
+
def test_pretty_max_seq_length():
|
| 386 |
+
f = PlainTextFormatter(max_seq_length=1)
|
| 387 |
+
lis = list(range(3))
|
| 388 |
+
text = f(lis)
|
| 389 |
+
assert text == "[0, ...]"
|
| 390 |
+
f.max_seq_length = 0
|
| 391 |
+
text = f(lis)
|
| 392 |
+
assert text == "[0, 1, 2]"
|
| 393 |
+
text = f(list(range(1024)))
|
| 394 |
+
lines = text.splitlines()
|
| 395 |
+
assert len(lines) == 1024
|
| 396 |
+
|
| 397 |
+
|
| 398 |
+
def test_ipython_display_formatter():
|
| 399 |
+
"""Objects with _ipython_display_ defined bypass other formatters"""
|
| 400 |
+
f = get_ipython().display_formatter
|
| 401 |
+
catcher = []
|
| 402 |
+
class SelfDisplaying(object):
|
| 403 |
+
def _ipython_display_(self):
|
| 404 |
+
catcher.append(self)
|
| 405 |
+
|
| 406 |
+
class NotSelfDisplaying(object):
|
| 407 |
+
def __repr__(self):
|
| 408 |
+
return "NotSelfDisplaying"
|
| 409 |
+
|
| 410 |
+
def _ipython_display_(self):
|
| 411 |
+
raise NotImplementedError
|
| 412 |
+
|
| 413 |
+
save_enabled = f.ipython_display_formatter.enabled
|
| 414 |
+
f.ipython_display_formatter.enabled = True
|
| 415 |
+
|
| 416 |
+
yes = SelfDisplaying()
|
| 417 |
+
no = NotSelfDisplaying()
|
| 418 |
+
|
| 419 |
+
d, md = f.format(no)
|
| 420 |
+
assert d == {"text/plain": repr(no)}
|
| 421 |
+
assert md == {}
|
| 422 |
+
assert catcher == []
|
| 423 |
+
|
| 424 |
+
d, md = f.format(yes)
|
| 425 |
+
assert d == {}
|
| 426 |
+
assert md == {}
|
| 427 |
+
assert catcher == [yes]
|
| 428 |
+
|
| 429 |
+
f.ipython_display_formatter.enabled = save_enabled
|
| 430 |
+
|
| 431 |
+
|
| 432 |
+
def test_repr_mime():
|
| 433 |
+
class HasReprMime(object):
|
| 434 |
+
def _repr_mimebundle_(self, include=None, exclude=None):
|
| 435 |
+
return {
|
| 436 |
+
'application/json+test.v2': {
|
| 437 |
+
'x': 'y'
|
| 438 |
+
},
|
| 439 |
+
'plain/text' : '<HasReprMime>',
|
| 440 |
+
'image/png' : 'i-overwrite'
|
| 441 |
+
}
|
| 442 |
+
|
| 443 |
+
def _repr_png_(self):
|
| 444 |
+
return 'should-be-overwritten'
|
| 445 |
+
def _repr_html_(self):
|
| 446 |
+
return '<b>hi!</b>'
|
| 447 |
+
|
| 448 |
+
f = get_ipython().display_formatter
|
| 449 |
+
html_f = f.formatters['text/html']
|
| 450 |
+
save_enabled = html_f.enabled
|
| 451 |
+
html_f.enabled = True
|
| 452 |
+
obj = HasReprMime()
|
| 453 |
+
d, md = f.format(obj)
|
| 454 |
+
html_f.enabled = save_enabled
|
| 455 |
+
|
| 456 |
+
assert sorted(d) == [
|
| 457 |
+
"application/json+test.v2",
|
| 458 |
+
"image/png",
|
| 459 |
+
"plain/text",
|
| 460 |
+
"text/html",
|
| 461 |
+
"text/plain",
|
| 462 |
+
]
|
| 463 |
+
assert md == {}
|
| 464 |
+
|
| 465 |
+
d, md = f.format(obj, include={"image/png"})
|
| 466 |
+
assert list(d.keys()) == [
|
| 467 |
+
"image/png"
|
| 468 |
+
], "Include should filter out even things from repr_mimebundle"
|
| 469 |
+
|
| 470 |
+
assert d["image/png"] == "i-overwrite", "_repr_mimebundle_ take precedence"
|
| 471 |
+
|
| 472 |
+
|
| 473 |
+
def test_pass_correct_include_exclude():
|
| 474 |
+
class Tester(object):
|
| 475 |
+
|
| 476 |
+
def __init__(self, include=None, exclude=None):
|
| 477 |
+
self.include = include
|
| 478 |
+
self.exclude = exclude
|
| 479 |
+
|
| 480 |
+
def _repr_mimebundle_(self, include, exclude, **kwargs):
|
| 481 |
+
if include and (include != self.include):
|
| 482 |
+
raise ValueError('include got modified: display() may be broken.')
|
| 483 |
+
if exclude and (exclude != self.exclude):
|
| 484 |
+
raise ValueError('exclude got modified: display() may be broken.')
|
| 485 |
+
|
| 486 |
+
return None
|
| 487 |
+
|
| 488 |
+
include = {'a', 'b', 'c'}
|
| 489 |
+
exclude = {'c', 'e' , 'f'}
|
| 490 |
+
|
| 491 |
+
f = get_ipython().display_formatter
|
| 492 |
+
f.format(Tester(include=include, exclude=exclude), include=include, exclude=exclude)
|
| 493 |
+
f.format(Tester(exclude=exclude), exclude=exclude)
|
| 494 |
+
f.format(Tester(include=include), include=include)
|
| 495 |
+
|
| 496 |
+
|
| 497 |
+
def test_repr_mime_meta():
|
| 498 |
+
class HasReprMimeMeta(object):
|
| 499 |
+
def _repr_mimebundle_(self, include=None, exclude=None):
|
| 500 |
+
data = {
|
| 501 |
+
'image/png': 'base64-image-data',
|
| 502 |
+
}
|
| 503 |
+
metadata = {
|
| 504 |
+
'image/png': {
|
| 505 |
+
'width': 5,
|
| 506 |
+
'height': 10,
|
| 507 |
+
}
|
| 508 |
+
}
|
| 509 |
+
return (data, metadata)
|
| 510 |
+
|
| 511 |
+
f = get_ipython().display_formatter
|
| 512 |
+
obj = HasReprMimeMeta()
|
| 513 |
+
d, md = f.format(obj)
|
| 514 |
+
assert sorted(d) == ["image/png", "text/plain"]
|
| 515 |
+
assert md == {
|
| 516 |
+
"image/png": {
|
| 517 |
+
"width": 5,
|
| 518 |
+
"height": 10,
|
| 519 |
+
}
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
|
| 523 |
+
def test_repr_mime_failure():
|
| 524 |
+
class BadReprMime(object):
|
| 525 |
+
def _repr_mimebundle_(self, include=None, exclude=None):
|
| 526 |
+
raise RuntimeError
|
| 527 |
+
|
| 528 |
+
f = get_ipython().display_formatter
|
| 529 |
+
obj = BadReprMime()
|
| 530 |
+
d, md = f.format(obj)
|
| 531 |
+
assert "text/plain" in d
|
| 532 |
+
|
| 533 |
+
|
| 534 |
+
def test_custom_repr_namedtuple_partialmethod():
|
| 535 |
+
from functools import partialmethod
|
| 536 |
+
from typing import NamedTuple
|
| 537 |
+
|
| 538 |
+
class Foo(NamedTuple): ...
|
| 539 |
+
|
| 540 |
+
Foo.__repr__ = partialmethod(lambda obj: "Hello World")
|
| 541 |
+
foo = Foo()
|
| 542 |
+
|
| 543 |
+
f = PlainTextFormatter()
|
| 544 |
+
assert f.pprint
|
| 545 |
+
assert f(foo) == "Hello World"
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_hooks.py
ADDED
|
@@ -0,0 +1,76 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Tests for CommandChainDispatcher."""
|
| 3 |
+
|
| 4 |
+
|
| 5 |
+
#-----------------------------------------------------------------------------
|
| 6 |
+
# Imports
|
| 7 |
+
#-----------------------------------------------------------------------------
|
| 8 |
+
|
| 9 |
+
import pytest
|
| 10 |
+
from IPython.core.error import TryNext
|
| 11 |
+
from IPython.core.hooks import CommandChainDispatcher
|
| 12 |
+
|
| 13 |
+
#-----------------------------------------------------------------------------
|
| 14 |
+
# Local utilities
|
| 15 |
+
#-----------------------------------------------------------------------------
|
| 16 |
+
|
| 17 |
+
# Define two classes, one which succeeds and one which raises TryNext. Each
|
| 18 |
+
# sets the attribute `called` to True when it is called.
|
| 19 |
+
class Okay(object):
|
| 20 |
+
def __init__(self, message):
|
| 21 |
+
self.message = message
|
| 22 |
+
self.called = False
|
| 23 |
+
def __call__(self):
|
| 24 |
+
self.called = True
|
| 25 |
+
return self.message
|
| 26 |
+
|
| 27 |
+
class Fail(object):
|
| 28 |
+
def __init__(self, message):
|
| 29 |
+
self.message = message
|
| 30 |
+
self.called = False
|
| 31 |
+
def __call__(self):
|
| 32 |
+
self.called = True
|
| 33 |
+
raise TryNext(self.message)
|
| 34 |
+
|
| 35 |
+
#-----------------------------------------------------------------------------
|
| 36 |
+
# Test functions
|
| 37 |
+
#-----------------------------------------------------------------------------
|
| 38 |
+
|
| 39 |
+
def test_command_chain_dispatcher_ff():
|
| 40 |
+
"""Test two failing hooks"""
|
| 41 |
+
fail1 = Fail("fail1")
|
| 42 |
+
fail2 = Fail("fail2")
|
| 43 |
+
dp = CommandChainDispatcher([(0, fail1), (10, fail2)])
|
| 44 |
+
|
| 45 |
+
with pytest.raises(TryNext) as e:
|
| 46 |
+
dp()
|
| 47 |
+
assert str(e.value) == "fail2"
|
| 48 |
+
|
| 49 |
+
assert fail1.called is True
|
| 50 |
+
assert fail2.called is True
|
| 51 |
+
|
| 52 |
+
def test_command_chain_dispatcher_fofo():
|
| 53 |
+
"""Test a mixture of failing and succeeding hooks."""
|
| 54 |
+
fail1 = Fail("fail1")
|
| 55 |
+
fail2 = Fail("fail2")
|
| 56 |
+
okay1 = Okay("okay1")
|
| 57 |
+
okay2 = Okay("okay2")
|
| 58 |
+
|
| 59 |
+
dp = CommandChainDispatcher([(0, fail1),
|
| 60 |
+
# (5, okay1), # add this later
|
| 61 |
+
(10, fail2),
|
| 62 |
+
(15, okay2)])
|
| 63 |
+
dp.add(okay1, 5)
|
| 64 |
+
|
| 65 |
+
assert dp() == "okay1"
|
| 66 |
+
|
| 67 |
+
assert fail1.called is True
|
| 68 |
+
assert okay1.called is True
|
| 69 |
+
assert fail2.called is False
|
| 70 |
+
assert okay2.called is False
|
| 71 |
+
|
| 72 |
+
def test_command_chain_dispatcher_eq_priority():
|
| 73 |
+
okay1 = Okay(u'okay1')
|
| 74 |
+
okay2 = Okay(u'okay2')
|
| 75 |
+
dp = CommandChainDispatcher([(1, okay1)])
|
| 76 |
+
dp.add(okay2, 1)
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_imports.py
ADDED
|
@@ -0,0 +1,52 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# encoding: utf-8
|
| 2 |
+
|
| 3 |
+
def test_import_completer():
|
| 4 |
+
from IPython.core import completer
|
| 5 |
+
|
| 6 |
+
def test_import_crashhandler():
|
| 7 |
+
from IPython.core import crashhandler
|
| 8 |
+
|
| 9 |
+
def test_import_debugger():
|
| 10 |
+
from IPython.core import debugger
|
| 11 |
+
|
| 12 |
+
def test_import_excolors():
|
| 13 |
+
from IPython.core import excolors
|
| 14 |
+
|
| 15 |
+
def test_import_history():
|
| 16 |
+
from IPython.core import history
|
| 17 |
+
|
| 18 |
+
def test_import_hooks():
|
| 19 |
+
from IPython.core import hooks
|
| 20 |
+
|
| 21 |
+
def test_import_getipython():
|
| 22 |
+
from IPython.core import getipython
|
| 23 |
+
|
| 24 |
+
def test_import_interactiveshell():
|
| 25 |
+
from IPython.core import interactiveshell
|
| 26 |
+
|
| 27 |
+
def test_import_logger():
|
| 28 |
+
from IPython.core import logger
|
| 29 |
+
|
| 30 |
+
def test_import_macro():
|
| 31 |
+
from IPython.core import macro
|
| 32 |
+
|
| 33 |
+
def test_import_magic():
|
| 34 |
+
from IPython.core import magic
|
| 35 |
+
|
| 36 |
+
def test_import_oinspect():
|
| 37 |
+
from IPython.core import oinspect
|
| 38 |
+
|
| 39 |
+
def test_import_prefilter():
|
| 40 |
+
from IPython.core import prefilter
|
| 41 |
+
|
| 42 |
+
def test_import_prompts():
|
| 43 |
+
from IPython.core import prompts
|
| 44 |
+
|
| 45 |
+
def test_import_release():
|
| 46 |
+
from IPython.core import release
|
| 47 |
+
|
| 48 |
+
def test_import_ultratb():
|
| 49 |
+
from IPython.core import ultratb
|
| 50 |
+
|
| 51 |
+
def test_import_usage():
|
| 52 |
+
from IPython.core import usage
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_inputsplitter.py
ADDED
|
@@ -0,0 +1,643 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Tests for the inputsplitter module."""
|
| 3 |
+
|
| 4 |
+
|
| 5 |
+
# Copyright (c) IPython Development Team.
|
| 6 |
+
# Distributed under the terms of the Modified BSD License.
|
| 7 |
+
|
| 8 |
+
import unittest
|
| 9 |
+
import pytest
|
| 10 |
+
import sys
|
| 11 |
+
|
| 12 |
+
with pytest.warns(DeprecationWarning, match="inputsplitter"):
|
| 13 |
+
from IPython.core import inputsplitter as isp
|
| 14 |
+
from IPython.core.inputtransformer import InputTransformer
|
| 15 |
+
from IPython.core.tests.test_inputtransformer import syntax, syntax_ml
|
| 16 |
+
from IPython.testing import tools as tt
|
| 17 |
+
|
| 18 |
+
#-----------------------------------------------------------------------------
|
| 19 |
+
# Semi-complete examples (also used as tests)
|
| 20 |
+
#-----------------------------------------------------------------------------
|
| 21 |
+
|
| 22 |
+
# Note: at the bottom, there's a slightly more complete version of this that
|
| 23 |
+
# can be useful during development of code here.
|
| 24 |
+
|
| 25 |
+
def mini_interactive_loop(input_func):
|
| 26 |
+
"""Minimal example of the logic of an interactive interpreter loop.
|
| 27 |
+
|
| 28 |
+
This serves as an example, and it is used by the test system with a fake
|
| 29 |
+
raw_input that simulates interactive input."""
|
| 30 |
+
|
| 31 |
+
from IPython.core.inputsplitter import InputSplitter
|
| 32 |
+
|
| 33 |
+
isp = InputSplitter()
|
| 34 |
+
# In practice, this input loop would be wrapped in an outside loop to read
|
| 35 |
+
# input indefinitely, until some exit/quit command was issued. Here we
|
| 36 |
+
# only illustrate the basic inner loop.
|
| 37 |
+
while isp.push_accepts_more():
|
| 38 |
+
indent = ' '*isp.get_indent_spaces()
|
| 39 |
+
prompt = '>>> ' + indent
|
| 40 |
+
line = indent + input_func(prompt)
|
| 41 |
+
isp.push(line)
|
| 42 |
+
|
| 43 |
+
# Here we just return input so we can use it in a test suite, but a real
|
| 44 |
+
# interpreter would instead send it for execution somewhere.
|
| 45 |
+
src = isp.source_reset()
|
| 46 |
+
# print('Input source was:\n', src) # dbg
|
| 47 |
+
return src
|
| 48 |
+
|
| 49 |
+
#-----------------------------------------------------------------------------
|
| 50 |
+
# Test utilities, just for local use
|
| 51 |
+
#-----------------------------------------------------------------------------
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
def pseudo_input(lines):
|
| 55 |
+
"""Return a function that acts like raw_input but feeds the input list."""
|
| 56 |
+
ilines = iter(lines)
|
| 57 |
+
def raw_in(prompt):
|
| 58 |
+
try:
|
| 59 |
+
return next(ilines)
|
| 60 |
+
except StopIteration:
|
| 61 |
+
return ''
|
| 62 |
+
return raw_in
|
| 63 |
+
|
| 64 |
+
#-----------------------------------------------------------------------------
|
| 65 |
+
# Tests
|
| 66 |
+
#-----------------------------------------------------------------------------
|
| 67 |
+
def test_spaces():
|
| 68 |
+
tests = [('', 0),
|
| 69 |
+
(' ', 1),
|
| 70 |
+
('\n', 0),
|
| 71 |
+
(' \n', 1),
|
| 72 |
+
('x', 0),
|
| 73 |
+
(' x', 1),
|
| 74 |
+
(' x',2),
|
| 75 |
+
(' x',4),
|
| 76 |
+
# Note: tabs are counted as a single whitespace!
|
| 77 |
+
('\tx', 1),
|
| 78 |
+
('\t x', 2),
|
| 79 |
+
]
|
| 80 |
+
with pytest.warns(PendingDeprecationWarning):
|
| 81 |
+
tt.check_pairs(isp.num_ini_spaces, tests)
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
def test_remove_comments():
|
| 85 |
+
tests = [('text', 'text'),
|
| 86 |
+
('text # comment', 'text '),
|
| 87 |
+
('text # comment\n', 'text \n'),
|
| 88 |
+
('text # comment \n', 'text \n'),
|
| 89 |
+
('line # c \nline\n','line \nline\n'),
|
| 90 |
+
('line # c \nline#c2 \nline\nline #c\n\n',
|
| 91 |
+
'line \nline\nline\nline \n\n'),
|
| 92 |
+
]
|
| 93 |
+
tt.check_pairs(isp.remove_comments, tests)
|
| 94 |
+
|
| 95 |
+
|
| 96 |
+
def test_get_input_encoding():
|
| 97 |
+
encoding = isp.get_input_encoding()
|
| 98 |
+
assert isinstance(encoding, str)
|
| 99 |
+
# simple-minded check that at least encoding a simple string works with the
|
| 100 |
+
# encoding we got.
|
| 101 |
+
assert "test".encode(encoding) == b"test"
|
| 102 |
+
|
| 103 |
+
|
| 104 |
+
class NoInputEncodingTestCase(unittest.TestCase):
|
| 105 |
+
def setUp(self):
|
| 106 |
+
self.old_stdin = sys.stdin
|
| 107 |
+
class X: pass
|
| 108 |
+
fake_stdin = X()
|
| 109 |
+
sys.stdin = fake_stdin
|
| 110 |
+
|
| 111 |
+
def test(self):
|
| 112 |
+
# Verify that if sys.stdin has no 'encoding' attribute we do the right
|
| 113 |
+
# thing
|
| 114 |
+
enc = isp.get_input_encoding()
|
| 115 |
+
self.assertEqual(enc, 'ascii')
|
| 116 |
+
|
| 117 |
+
def tearDown(self):
|
| 118 |
+
sys.stdin = self.old_stdin
|
| 119 |
+
|
| 120 |
+
|
| 121 |
+
class InputSplitterTestCase(unittest.TestCase):
|
| 122 |
+
def setUp(self):
|
| 123 |
+
self.isp = isp.InputSplitter()
|
| 124 |
+
|
| 125 |
+
def test_reset(self):
|
| 126 |
+
isp = self.isp
|
| 127 |
+
isp.push('x=1')
|
| 128 |
+
isp.reset()
|
| 129 |
+
self.assertEqual(isp._buffer, [])
|
| 130 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 131 |
+
self.assertEqual(isp.source, '')
|
| 132 |
+
self.assertEqual(isp.code, None)
|
| 133 |
+
self.assertEqual(isp._is_complete, False)
|
| 134 |
+
|
| 135 |
+
def test_source(self):
|
| 136 |
+
self.isp._store('1')
|
| 137 |
+
self.isp._store('2')
|
| 138 |
+
self.assertEqual(self.isp.source, '1\n2\n')
|
| 139 |
+
self.assertEqual(len(self.isp._buffer)>0, True)
|
| 140 |
+
self.assertEqual(self.isp.source_reset(), '1\n2\n')
|
| 141 |
+
self.assertEqual(self.isp._buffer, [])
|
| 142 |
+
self.assertEqual(self.isp.source, '')
|
| 143 |
+
|
| 144 |
+
def test_indent(self):
|
| 145 |
+
isp = self.isp # shorthand
|
| 146 |
+
isp.push('x=1')
|
| 147 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 148 |
+
isp.push('if 1:\n x=1')
|
| 149 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 150 |
+
isp.push('y=2\n')
|
| 151 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 152 |
+
|
| 153 |
+
def test_indent2(self):
|
| 154 |
+
isp = self.isp
|
| 155 |
+
isp.push('if 1:')
|
| 156 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 157 |
+
isp.push(' x=1')
|
| 158 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 159 |
+
# Blank lines shouldn't change the indent level
|
| 160 |
+
isp.push(' '*2)
|
| 161 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 162 |
+
|
| 163 |
+
def test_indent3(self):
|
| 164 |
+
isp = self.isp
|
| 165 |
+
# When a multiline statement contains parens or multiline strings, we
|
| 166 |
+
# shouldn't get confused.
|
| 167 |
+
isp.push("if 1:")
|
| 168 |
+
isp.push(" x = (1+\n 2)")
|
| 169 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 170 |
+
|
| 171 |
+
def test_indent4(self):
|
| 172 |
+
isp = self.isp
|
| 173 |
+
# whitespace after ':' should not screw up indent level
|
| 174 |
+
isp.push('if 1: \n x=1')
|
| 175 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 176 |
+
isp.push('y=2\n')
|
| 177 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 178 |
+
isp.push('if 1:\t\n x=1')
|
| 179 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 180 |
+
isp.push('y=2\n')
|
| 181 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 182 |
+
|
| 183 |
+
def test_dedent_pass(self):
|
| 184 |
+
isp = self.isp # shorthand
|
| 185 |
+
# should NOT cause dedent
|
| 186 |
+
isp.push('if 1:\n passes = 5')
|
| 187 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 188 |
+
isp.push('if 1:\n pass')
|
| 189 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 190 |
+
isp.push('if 1:\n pass ')
|
| 191 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 192 |
+
|
| 193 |
+
def test_dedent_break(self):
|
| 194 |
+
isp = self.isp # shorthand
|
| 195 |
+
# should NOT cause dedent
|
| 196 |
+
isp.push('while 1:\n breaks = 5')
|
| 197 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 198 |
+
isp.push('while 1:\n break')
|
| 199 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 200 |
+
isp.push('while 1:\n break ')
|
| 201 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 202 |
+
|
| 203 |
+
def test_dedent_continue(self):
|
| 204 |
+
isp = self.isp # shorthand
|
| 205 |
+
# should NOT cause dedent
|
| 206 |
+
isp.push('while 1:\n continues = 5')
|
| 207 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 208 |
+
isp.push('while 1:\n continue')
|
| 209 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 210 |
+
isp.push('while 1:\n continue ')
|
| 211 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 212 |
+
|
| 213 |
+
def test_dedent_raise(self):
|
| 214 |
+
isp = self.isp # shorthand
|
| 215 |
+
# should NOT cause dedent
|
| 216 |
+
isp.push('if 1:\n raised = 4')
|
| 217 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 218 |
+
isp.push('if 1:\n raise TypeError()')
|
| 219 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 220 |
+
isp.push('if 1:\n raise')
|
| 221 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 222 |
+
isp.push('if 1:\n raise ')
|
| 223 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 224 |
+
|
| 225 |
+
def test_dedent_return(self):
|
| 226 |
+
isp = self.isp # shorthand
|
| 227 |
+
# should NOT cause dedent
|
| 228 |
+
isp.push('if 1:\n returning = 4')
|
| 229 |
+
self.assertEqual(isp.get_indent_spaces(), 4)
|
| 230 |
+
isp.push('if 1:\n return 5 + 493')
|
| 231 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 232 |
+
isp.push('if 1:\n return')
|
| 233 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 234 |
+
isp.push('if 1:\n return ')
|
| 235 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 236 |
+
isp.push('if 1:\n return(0)')
|
| 237 |
+
self.assertEqual(isp.get_indent_spaces(), 0)
|
| 238 |
+
|
| 239 |
+
def test_push(self):
|
| 240 |
+
isp = self.isp
|
| 241 |
+
self.assertEqual(isp.push('x=1'), True)
|
| 242 |
+
|
| 243 |
+
def test_push2(self):
|
| 244 |
+
isp = self.isp
|
| 245 |
+
self.assertEqual(isp.push('if 1:'), False)
|
| 246 |
+
for line in [' x=1', '# a comment', ' y=2']:
|
| 247 |
+
print(line)
|
| 248 |
+
self.assertEqual(isp.push(line), True)
|
| 249 |
+
|
| 250 |
+
def test_push3(self):
|
| 251 |
+
isp = self.isp
|
| 252 |
+
isp.push('if True:')
|
| 253 |
+
isp.push(' a = 1')
|
| 254 |
+
self.assertEqual(isp.push('b = [1,'), False)
|
| 255 |
+
|
| 256 |
+
def test_push_accepts_more(self):
|
| 257 |
+
isp = self.isp
|
| 258 |
+
isp.push('x=1')
|
| 259 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 260 |
+
|
| 261 |
+
def test_push_accepts_more2(self):
|
| 262 |
+
isp = self.isp
|
| 263 |
+
isp.push('if 1:')
|
| 264 |
+
self.assertEqual(isp.push_accepts_more(), True)
|
| 265 |
+
isp.push(' x=1')
|
| 266 |
+
self.assertEqual(isp.push_accepts_more(), True)
|
| 267 |
+
isp.push('')
|
| 268 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 269 |
+
|
| 270 |
+
def test_push_accepts_more3(self):
|
| 271 |
+
isp = self.isp
|
| 272 |
+
isp.push("x = (2+\n3)")
|
| 273 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 274 |
+
|
| 275 |
+
def test_push_accepts_more4(self):
|
| 276 |
+
isp = self.isp
|
| 277 |
+
# When a multiline statement contains parens or multiline strings, we
|
| 278 |
+
# shouldn't get confused.
|
| 279 |
+
# FIXME: we should be able to better handle de-dents in statements like
|
| 280 |
+
# multiline strings and multiline expressions (continued with \ or
|
| 281 |
+
# parens). Right now we aren't handling the indentation tracking quite
|
| 282 |
+
# correctly with this, though in practice it may not be too much of a
|
| 283 |
+
# problem. We'll need to see.
|
| 284 |
+
isp.push("if 1:")
|
| 285 |
+
isp.push(" x = (2+")
|
| 286 |
+
isp.push(" 3)")
|
| 287 |
+
self.assertEqual(isp.push_accepts_more(), True)
|
| 288 |
+
isp.push(" y = 3")
|
| 289 |
+
self.assertEqual(isp.push_accepts_more(), True)
|
| 290 |
+
isp.push('')
|
| 291 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 292 |
+
|
| 293 |
+
def test_push_accepts_more5(self):
|
| 294 |
+
isp = self.isp
|
| 295 |
+
isp.push('try:')
|
| 296 |
+
isp.push(' a = 5')
|
| 297 |
+
isp.push('except:')
|
| 298 |
+
isp.push(' raise')
|
| 299 |
+
# We want to be able to add an else: block at this point, so it should
|
| 300 |
+
# wait for a blank line.
|
| 301 |
+
self.assertEqual(isp.push_accepts_more(), True)
|
| 302 |
+
|
| 303 |
+
def test_continuation(self):
|
| 304 |
+
isp = self.isp
|
| 305 |
+
isp.push("import os, \\")
|
| 306 |
+
self.assertEqual(isp.push_accepts_more(), True)
|
| 307 |
+
isp.push("sys")
|
| 308 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 309 |
+
|
| 310 |
+
def test_syntax_error(self):
|
| 311 |
+
isp = self.isp
|
| 312 |
+
# Syntax errors immediately produce a 'ready' block, so the invalid
|
| 313 |
+
# Python can be sent to the kernel for evaluation with possible ipython
|
| 314 |
+
# special-syntax conversion.
|
| 315 |
+
isp.push('run foo')
|
| 316 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 317 |
+
|
| 318 |
+
def test_unicode(self):
|
| 319 |
+
self.isp.push(u"Pérez")
|
| 320 |
+
self.isp.push(u'\xc3\xa9')
|
| 321 |
+
self.isp.push(u"u'\xc3\xa9'")
|
| 322 |
+
|
| 323 |
+
@pytest.mark.xfail(
|
| 324 |
+
reason="Bug in python 3.9.8 – bpo 45738",
|
| 325 |
+
condition=sys.version_info in [(3, 11, 0, "alpha", 2)],
|
| 326 |
+
raises=SystemError,
|
| 327 |
+
strict=True,
|
| 328 |
+
)
|
| 329 |
+
def test_line_continuation(self):
|
| 330 |
+
""" Test issue #2108."""
|
| 331 |
+
isp = self.isp
|
| 332 |
+
# A blank line after a line continuation should not accept more
|
| 333 |
+
isp.push("1 \\\n\n")
|
| 334 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 335 |
+
# Whitespace after a \ is a SyntaxError. The only way to test that
|
| 336 |
+
# here is to test that push doesn't accept more (as with
|
| 337 |
+
# test_syntax_error() above).
|
| 338 |
+
isp.push(r"1 \ ")
|
| 339 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 340 |
+
# Even if the line is continuable (c.f. the regular Python
|
| 341 |
+
# interpreter)
|
| 342 |
+
isp.push(r"(1 \ ")
|
| 343 |
+
self.assertEqual(isp.push_accepts_more(), False)
|
| 344 |
+
|
| 345 |
+
def test_check_complete(self):
|
| 346 |
+
isp = self.isp
|
| 347 |
+
self.assertEqual(isp.check_complete("a = 1"), ('complete', None))
|
| 348 |
+
self.assertEqual(isp.check_complete("for a in range(5):"), ('incomplete', 4))
|
| 349 |
+
self.assertEqual(isp.check_complete("raise = 2"), ('invalid', None))
|
| 350 |
+
self.assertEqual(isp.check_complete("a = [1,\n2,"), ('incomplete', 0))
|
| 351 |
+
self.assertEqual(isp.check_complete("def a():\n x=1\n global x"), ('invalid', None))
|
| 352 |
+
|
| 353 |
+
class InteractiveLoopTestCase(unittest.TestCase):
|
| 354 |
+
"""Tests for an interactive loop like a python shell.
|
| 355 |
+
"""
|
| 356 |
+
def check_ns(self, lines, ns):
|
| 357 |
+
"""Validate that the given input lines produce the resulting namespace.
|
| 358 |
+
|
| 359 |
+
Note: the input lines are given exactly as they would be typed in an
|
| 360 |
+
auto-indenting environment, as mini_interactive_loop above already does
|
| 361 |
+
auto-indenting and prepends spaces to the input.
|
| 362 |
+
"""
|
| 363 |
+
src = mini_interactive_loop(pseudo_input(lines))
|
| 364 |
+
test_ns = {}
|
| 365 |
+
exec(src, test_ns)
|
| 366 |
+
# We can't check that the provided ns is identical to the test_ns,
|
| 367 |
+
# because Python fills test_ns with extra keys (copyright, etc). But
|
| 368 |
+
# we can check that the given dict is *contained* in test_ns
|
| 369 |
+
for k,v in ns.items():
|
| 370 |
+
self.assertEqual(test_ns[k], v)
|
| 371 |
+
|
| 372 |
+
def test_simple(self):
|
| 373 |
+
self.check_ns(['x=1'], dict(x=1))
|
| 374 |
+
|
| 375 |
+
def test_simple2(self):
|
| 376 |
+
self.check_ns(['if 1:', 'x=2'], dict(x=2))
|
| 377 |
+
|
| 378 |
+
def test_xy(self):
|
| 379 |
+
self.check_ns(['x=1; y=2'], dict(x=1, y=2))
|
| 380 |
+
|
| 381 |
+
def test_abc(self):
|
| 382 |
+
self.check_ns(['if 1:','a=1','b=2','c=3'], dict(a=1, b=2, c=3))
|
| 383 |
+
|
| 384 |
+
def test_multi(self):
|
| 385 |
+
self.check_ns(['x =(1+','1+','2)'], dict(x=4))
|
| 386 |
+
|
| 387 |
+
|
| 388 |
+
class IPythonInputTestCase(InputSplitterTestCase):
|
| 389 |
+
"""By just creating a new class whose .isp is a different instance, we
|
| 390 |
+
re-run the same test battery on the new input splitter.
|
| 391 |
+
|
| 392 |
+
In addition, this runs the tests over the syntax and syntax_ml dicts that
|
| 393 |
+
were tested by individual functions, as part of the OO interface.
|
| 394 |
+
|
| 395 |
+
It also makes some checks on the raw buffer storage.
|
| 396 |
+
"""
|
| 397 |
+
|
| 398 |
+
def setUp(self):
|
| 399 |
+
self.isp = isp.IPythonInputSplitter()
|
| 400 |
+
|
| 401 |
+
def test_syntax(self):
|
| 402 |
+
"""Call all single-line syntax tests from the main object"""
|
| 403 |
+
isp = self.isp
|
| 404 |
+
for example in syntax.values():
|
| 405 |
+
for raw, out_t in example:
|
| 406 |
+
if raw.startswith(' '):
|
| 407 |
+
continue
|
| 408 |
+
|
| 409 |
+
isp.push(raw+'\n')
|
| 410 |
+
out_raw = isp.source_raw
|
| 411 |
+
out = isp.source_reset()
|
| 412 |
+
self.assertEqual(out.rstrip(), out_t,
|
| 413 |
+
tt.pair_fail_msg.format("inputsplitter",raw, out_t, out))
|
| 414 |
+
self.assertEqual(out_raw.rstrip(), raw.rstrip())
|
| 415 |
+
|
| 416 |
+
def test_syntax_multiline(self):
|
| 417 |
+
isp = self.isp
|
| 418 |
+
for example in syntax_ml.values():
|
| 419 |
+
for line_pairs in example:
|
| 420 |
+
out_t_parts = []
|
| 421 |
+
raw_parts = []
|
| 422 |
+
for lraw, out_t_part in line_pairs:
|
| 423 |
+
if out_t_part is not None:
|
| 424 |
+
out_t_parts.append(out_t_part)
|
| 425 |
+
|
| 426 |
+
if lraw is not None:
|
| 427 |
+
isp.push(lraw)
|
| 428 |
+
raw_parts.append(lraw)
|
| 429 |
+
|
| 430 |
+
out_raw = isp.source_raw
|
| 431 |
+
out = isp.source_reset()
|
| 432 |
+
out_t = '\n'.join(out_t_parts).rstrip()
|
| 433 |
+
raw = '\n'.join(raw_parts).rstrip()
|
| 434 |
+
self.assertEqual(out.rstrip(), out_t)
|
| 435 |
+
self.assertEqual(out_raw.rstrip(), raw)
|
| 436 |
+
|
| 437 |
+
def test_syntax_multiline_cell(self):
|
| 438 |
+
isp = self.isp
|
| 439 |
+
for example in syntax_ml.values():
|
| 440 |
+
|
| 441 |
+
out_t_parts = []
|
| 442 |
+
for line_pairs in example:
|
| 443 |
+
raw = '\n'.join(r for r, _ in line_pairs if r is not None)
|
| 444 |
+
out_t = '\n'.join(t for _,t in line_pairs if t is not None)
|
| 445 |
+
out = isp.transform_cell(raw)
|
| 446 |
+
# Match ignoring trailing whitespace
|
| 447 |
+
self.assertEqual(out.rstrip(), out_t.rstrip())
|
| 448 |
+
|
| 449 |
+
def test_cellmagic_preempt(self):
|
| 450 |
+
isp = self.isp
|
| 451 |
+
for raw, name, line, cell in [
|
| 452 |
+
("%%cellm a\nIn[1]:", u'cellm', u'a', u'In[1]:'),
|
| 453 |
+
("%%cellm \nline\n>>> hi", u'cellm', u'', u'line\n>>> hi'),
|
| 454 |
+
(">>> %%cellm \nline\n>>> hi", u'cellm', u'', u'line\nhi'),
|
| 455 |
+
("%%cellm \n>>> hi", u'cellm', u'', u'>>> hi'),
|
| 456 |
+
("%%cellm \nline1\nline2", u'cellm', u'', u'line1\nline2'),
|
| 457 |
+
("%%cellm \nline1\\\\\nline2", u'cellm', u'', u'line1\\\\\nline2'),
|
| 458 |
+
]:
|
| 459 |
+
expected = "get_ipython().run_cell_magic(%r, %r, %r)" % (
|
| 460 |
+
name, line, cell
|
| 461 |
+
)
|
| 462 |
+
out = isp.transform_cell(raw)
|
| 463 |
+
self.assertEqual(out.rstrip(), expected.rstrip())
|
| 464 |
+
|
| 465 |
+
def test_multiline_passthrough(self):
|
| 466 |
+
isp = self.isp
|
| 467 |
+
class CommentTransformer(InputTransformer):
|
| 468 |
+
def __init__(self):
|
| 469 |
+
self._lines = []
|
| 470 |
+
|
| 471 |
+
def push(self, line):
|
| 472 |
+
self._lines.append(line + '#')
|
| 473 |
+
|
| 474 |
+
def reset(self):
|
| 475 |
+
text = '\n'.join(self._lines)
|
| 476 |
+
self._lines = []
|
| 477 |
+
return text
|
| 478 |
+
|
| 479 |
+
isp.physical_line_transforms.insert(0, CommentTransformer())
|
| 480 |
+
|
| 481 |
+
for raw, expected in [
|
| 482 |
+
("a=5", "a=5#"),
|
| 483 |
+
("%ls foo", "get_ipython().run_line_magic(%r, %r)" % (u'ls', u'foo#')),
|
| 484 |
+
("!ls foo\n%ls bar", "get_ipython().system(%r)\nget_ipython().run_line_magic(%r, %r)" % (
|
| 485 |
+
u'ls foo#', u'ls', u'bar#'
|
| 486 |
+
)),
|
| 487 |
+
("1\n2\n3\n%ls foo\n4\n5", "1#\n2#\n3#\nget_ipython().run_line_magic(%r, %r)\n4#\n5#" % (u'ls', u'foo#')),
|
| 488 |
+
]:
|
| 489 |
+
out = isp.transform_cell(raw)
|
| 490 |
+
self.assertEqual(out.rstrip(), expected.rstrip())
|
| 491 |
+
|
| 492 |
+
#-----------------------------------------------------------------------------
|
| 493 |
+
# Main - use as a script, mostly for developer experiments
|
| 494 |
+
#-----------------------------------------------------------------------------
|
| 495 |
+
|
| 496 |
+
if __name__ == '__main__':
|
| 497 |
+
# A simple demo for interactive experimentation. This code will not get
|
| 498 |
+
# picked up by any test suite.
|
| 499 |
+
from IPython.core.inputsplitter import IPythonInputSplitter
|
| 500 |
+
|
| 501 |
+
# configure here the syntax to use, prompt and whether to autoindent
|
| 502 |
+
#isp, start_prompt = InputSplitter(), '>>> '
|
| 503 |
+
isp, start_prompt = IPythonInputSplitter(), 'In> '
|
| 504 |
+
|
| 505 |
+
autoindent = True
|
| 506 |
+
#autoindent = False
|
| 507 |
+
|
| 508 |
+
try:
|
| 509 |
+
while True:
|
| 510 |
+
prompt = start_prompt
|
| 511 |
+
while isp.push_accepts_more():
|
| 512 |
+
indent = ' '*isp.get_indent_spaces()
|
| 513 |
+
if autoindent:
|
| 514 |
+
line = indent + input(prompt+indent)
|
| 515 |
+
else:
|
| 516 |
+
line = input(prompt)
|
| 517 |
+
isp.push(line)
|
| 518 |
+
prompt = '... '
|
| 519 |
+
|
| 520 |
+
# Here we just return input so we can use it in a test suite, but a
|
| 521 |
+
# real interpreter would instead send it for execution somewhere.
|
| 522 |
+
#src = isp.source; raise EOFError # dbg
|
| 523 |
+
raw = isp.source_raw
|
| 524 |
+
src = isp.source_reset()
|
| 525 |
+
print('Input source was:\n', src)
|
| 526 |
+
print('Raw source was:\n', raw)
|
| 527 |
+
except EOFError:
|
| 528 |
+
print('Bye')
|
| 529 |
+
|
| 530 |
+
# Tests for cell magics support
|
| 531 |
+
|
| 532 |
+
def test_last_blank():
|
| 533 |
+
assert isp.last_blank("") is False
|
| 534 |
+
assert isp.last_blank("abc") is False
|
| 535 |
+
assert isp.last_blank("abc\n") is False
|
| 536 |
+
assert isp.last_blank("abc\na") is False
|
| 537 |
+
|
| 538 |
+
assert isp.last_blank("\n") is True
|
| 539 |
+
assert isp.last_blank("\n ") is True
|
| 540 |
+
assert isp.last_blank("abc\n ") is True
|
| 541 |
+
assert isp.last_blank("abc\n\n") is True
|
| 542 |
+
assert isp.last_blank("abc\nd\n\n") is True
|
| 543 |
+
assert isp.last_blank("abc\nd\ne\n\n") is True
|
| 544 |
+
assert isp.last_blank("abc \n \n \n\n") is True
|
| 545 |
+
|
| 546 |
+
|
| 547 |
+
def test_last_two_blanks():
|
| 548 |
+
assert isp.last_two_blanks("") is False
|
| 549 |
+
assert isp.last_two_blanks("abc") is False
|
| 550 |
+
assert isp.last_two_blanks("abc\n") is False
|
| 551 |
+
assert isp.last_two_blanks("abc\n\na") is False
|
| 552 |
+
assert isp.last_two_blanks("abc\n \n") is False
|
| 553 |
+
assert isp.last_two_blanks("abc\n\n") is False
|
| 554 |
+
|
| 555 |
+
assert isp.last_two_blanks("\n\n") is True
|
| 556 |
+
assert isp.last_two_blanks("\n\n ") is True
|
| 557 |
+
assert isp.last_two_blanks("\n \n") is True
|
| 558 |
+
assert isp.last_two_blanks("abc\n\n ") is True
|
| 559 |
+
assert isp.last_two_blanks("abc\n\n\n") is True
|
| 560 |
+
assert isp.last_two_blanks("abc\n\n \n") is True
|
| 561 |
+
assert isp.last_two_blanks("abc\n\n \n ") is True
|
| 562 |
+
assert isp.last_two_blanks("abc\n\n \n \n") is True
|
| 563 |
+
assert isp.last_two_blanks("abc\nd\n\n\n") is True
|
| 564 |
+
assert isp.last_two_blanks("abc\nd\ne\nf\n\n\n") is True
|
| 565 |
+
|
| 566 |
+
|
| 567 |
+
class CellMagicsCommon(object):
|
| 568 |
+
|
| 569 |
+
def test_whole_cell(self):
|
| 570 |
+
src = "%%cellm line\nbody\n"
|
| 571 |
+
out = self.sp.transform_cell(src)
|
| 572 |
+
ref = "get_ipython().run_cell_magic('cellm', 'line', 'body')\n"
|
| 573 |
+
assert out == ref
|
| 574 |
+
|
| 575 |
+
def test_cellmagic_help(self):
|
| 576 |
+
self.sp.push('%%cellm?')
|
| 577 |
+
assert self.sp.push_accepts_more() is False
|
| 578 |
+
|
| 579 |
+
def tearDown(self):
|
| 580 |
+
self.sp.reset()
|
| 581 |
+
|
| 582 |
+
|
| 583 |
+
class CellModeCellMagics(CellMagicsCommon, unittest.TestCase):
|
| 584 |
+
sp = isp.IPythonInputSplitter(line_input_checker=False)
|
| 585 |
+
|
| 586 |
+
def test_incremental(self):
|
| 587 |
+
sp = self.sp
|
| 588 |
+
sp.push("%%cellm firstline\n")
|
| 589 |
+
assert sp.push_accepts_more() is True # 1
|
| 590 |
+
sp.push("line2\n")
|
| 591 |
+
assert sp.push_accepts_more() is True # 2
|
| 592 |
+
sp.push("\n")
|
| 593 |
+
# This should accept a blank line and carry on until the cell is reset
|
| 594 |
+
assert sp.push_accepts_more() is True # 3
|
| 595 |
+
|
| 596 |
+
def test_no_strip_coding(self):
|
| 597 |
+
src = '\n'.join([
|
| 598 |
+
'%%writefile foo.py',
|
| 599 |
+
'# coding: utf-8',
|
| 600 |
+
'print(u"üñîçø∂é")',
|
| 601 |
+
])
|
| 602 |
+
out = self.sp.transform_cell(src)
|
| 603 |
+
assert "# coding: utf-8" in out
|
| 604 |
+
|
| 605 |
+
|
| 606 |
+
class LineModeCellMagics(CellMagicsCommon, unittest.TestCase):
|
| 607 |
+
sp = isp.IPythonInputSplitter(line_input_checker=True)
|
| 608 |
+
|
| 609 |
+
def test_incremental(self):
|
| 610 |
+
sp = self.sp
|
| 611 |
+
sp.push("%%cellm line2\n")
|
| 612 |
+
assert sp.push_accepts_more() is True # 1
|
| 613 |
+
sp.push("\n")
|
| 614 |
+
# In this case, a blank line should end the cell magic
|
| 615 |
+
assert sp.push_accepts_more() is False # 2
|
| 616 |
+
|
| 617 |
+
|
| 618 |
+
indentation_samples = [
|
| 619 |
+
('a = 1', 0),
|
| 620 |
+
('for a in b:', 4),
|
| 621 |
+
('def f():', 4),
|
| 622 |
+
('def f(): #comment', 4),
|
| 623 |
+
('a = ":#not a comment"', 0),
|
| 624 |
+
('def f():\n a = 1', 4),
|
| 625 |
+
('def f():\n return 1', 0),
|
| 626 |
+
('for a in b:\n'
|
| 627 |
+
' if a < 0:'
|
| 628 |
+
' continue', 3),
|
| 629 |
+
('a = {', 4),
|
| 630 |
+
('a = {\n'
|
| 631 |
+
' 1,', 5),
|
| 632 |
+
('b = """123', 0),
|
| 633 |
+
('', 0),
|
| 634 |
+
('def f():\n pass', 0),
|
| 635 |
+
('class Bar:\n def f():\n pass', 4),
|
| 636 |
+
('class Bar:\n def f():\n raise', 4),
|
| 637 |
+
]
|
| 638 |
+
|
| 639 |
+
def test_find_next_indent():
|
| 640 |
+
for code, exp in indentation_samples:
|
| 641 |
+
res = isp.find_next_indent(code)
|
| 642 |
+
msg = "{!r} != {!r} (expected)\n Code: {!r}".format(res, exp, code)
|
| 643 |
+
assert res == exp, msg
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_inputtransformer2.py
ADDED
|
@@ -0,0 +1,448 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Tests for the token-based transformers in IPython.core.inputtransformer2
|
| 2 |
+
|
| 3 |
+
Line-based transformers are the simpler ones; token-based transformers are
|
| 4 |
+
more complex. See test_inputtransformer2_line for tests for line-based
|
| 5 |
+
transformations.
|
| 6 |
+
"""
|
| 7 |
+
|
| 8 |
+
import platform
|
| 9 |
+
import string
|
| 10 |
+
import sys
|
| 11 |
+
from textwrap import dedent
|
| 12 |
+
|
| 13 |
+
import pytest
|
| 14 |
+
|
| 15 |
+
from IPython.core import inputtransformer2 as ipt2
|
| 16 |
+
from IPython.core.inputtransformer2 import _find_assign_op, make_tokens_by_line
|
| 17 |
+
|
| 18 |
+
MULTILINE_MAGIC = (
|
| 19 |
+
"""\
|
| 20 |
+
a = f()
|
| 21 |
+
%foo \\
|
| 22 |
+
bar
|
| 23 |
+
g()
|
| 24 |
+
""".splitlines(
|
| 25 |
+
keepends=True
|
| 26 |
+
),
|
| 27 |
+
(2, 0),
|
| 28 |
+
"""\
|
| 29 |
+
a = f()
|
| 30 |
+
get_ipython().run_line_magic('foo', ' bar')
|
| 31 |
+
g()
|
| 32 |
+
""".splitlines(
|
| 33 |
+
keepends=True
|
| 34 |
+
),
|
| 35 |
+
)
|
| 36 |
+
|
| 37 |
+
INDENTED_MAGIC = (
|
| 38 |
+
"""\
|
| 39 |
+
for a in range(5):
|
| 40 |
+
%ls
|
| 41 |
+
""".splitlines(
|
| 42 |
+
keepends=True
|
| 43 |
+
),
|
| 44 |
+
(2, 4),
|
| 45 |
+
"""\
|
| 46 |
+
for a in range(5):
|
| 47 |
+
get_ipython().run_line_magic('ls', '')
|
| 48 |
+
""".splitlines(
|
| 49 |
+
keepends=True
|
| 50 |
+
),
|
| 51 |
+
)
|
| 52 |
+
|
| 53 |
+
CRLF_MAGIC = (
|
| 54 |
+
["a = f()\n", "%ls\r\n", "g()\n"],
|
| 55 |
+
(2, 0),
|
| 56 |
+
["a = f()\n", "get_ipython().run_line_magic('ls', '')\n", "g()\n"],
|
| 57 |
+
)
|
| 58 |
+
|
| 59 |
+
MULTILINE_MAGIC_ASSIGN = (
|
| 60 |
+
"""\
|
| 61 |
+
a = f()
|
| 62 |
+
b = %foo \\
|
| 63 |
+
bar
|
| 64 |
+
g()
|
| 65 |
+
""".splitlines(
|
| 66 |
+
keepends=True
|
| 67 |
+
),
|
| 68 |
+
(2, 4),
|
| 69 |
+
"""\
|
| 70 |
+
a = f()
|
| 71 |
+
b = get_ipython().run_line_magic('foo', ' bar')
|
| 72 |
+
g()
|
| 73 |
+
""".splitlines(
|
| 74 |
+
keepends=True
|
| 75 |
+
),
|
| 76 |
+
)
|
| 77 |
+
|
| 78 |
+
MULTILINE_SYSTEM_ASSIGN = ("""\
|
| 79 |
+
a = f()
|
| 80 |
+
b = !foo \\
|
| 81 |
+
bar
|
| 82 |
+
g()
|
| 83 |
+
""".splitlines(keepends=True), (2, 4), """\
|
| 84 |
+
a = f()
|
| 85 |
+
b = get_ipython().getoutput('foo bar')
|
| 86 |
+
g()
|
| 87 |
+
""".splitlines(keepends=True))
|
| 88 |
+
|
| 89 |
+
#####
|
| 90 |
+
|
| 91 |
+
MULTILINE_SYSTEM_ASSIGN_AFTER_DEDENT = (
|
| 92 |
+
"""\
|
| 93 |
+
def test():
|
| 94 |
+
for i in range(1):
|
| 95 |
+
print(i)
|
| 96 |
+
res =! ls
|
| 97 |
+
""".splitlines(
|
| 98 |
+
keepends=True
|
| 99 |
+
),
|
| 100 |
+
(4, 7),
|
| 101 |
+
"""\
|
| 102 |
+
def test():
|
| 103 |
+
for i in range(1):
|
| 104 |
+
print(i)
|
| 105 |
+
res =get_ipython().getoutput(\' ls\')
|
| 106 |
+
""".splitlines(
|
| 107 |
+
keepends=True
|
| 108 |
+
),
|
| 109 |
+
)
|
| 110 |
+
|
| 111 |
+
######
|
| 112 |
+
|
| 113 |
+
AUTOCALL_QUOTE = ([",f 1 2 3\n"], (1, 0), ['f("1", "2", "3")\n'])
|
| 114 |
+
|
| 115 |
+
AUTOCALL_QUOTE2 = ([";f 1 2 3\n"], (1, 0), ['f("1 2 3")\n'])
|
| 116 |
+
|
| 117 |
+
AUTOCALL_PAREN = (["/f 1 2 3\n"], (1, 0), ["f(1, 2, 3)\n"])
|
| 118 |
+
|
| 119 |
+
SIMPLE_HELP = (["foo?\n"], (1, 0), ["get_ipython().run_line_magic('pinfo', 'foo')\n"])
|
| 120 |
+
|
| 121 |
+
DETAILED_HELP = (
|
| 122 |
+
["foo??\n"],
|
| 123 |
+
(1, 0),
|
| 124 |
+
["get_ipython().run_line_magic('pinfo2', 'foo')\n"],
|
| 125 |
+
)
|
| 126 |
+
|
| 127 |
+
MAGIC_HELP = (["%foo?\n"], (1, 0), ["get_ipython().run_line_magic('pinfo', '%foo')\n"])
|
| 128 |
+
|
| 129 |
+
HELP_IN_EXPR = (
|
| 130 |
+
["a = b + c?\n"],
|
| 131 |
+
(1, 0),
|
| 132 |
+
["get_ipython().run_line_magic('pinfo', 'c')\n"],
|
| 133 |
+
)
|
| 134 |
+
|
| 135 |
+
HELP_CONTINUED_LINE = (
|
| 136 |
+
"""\
|
| 137 |
+
a = \\
|
| 138 |
+
zip?
|
| 139 |
+
""".splitlines(
|
| 140 |
+
keepends=True
|
| 141 |
+
),
|
| 142 |
+
(1, 0),
|
| 143 |
+
[r"get_ipython().run_line_magic('pinfo', 'zip')" + "\n"],
|
| 144 |
+
)
|
| 145 |
+
|
| 146 |
+
HELP_MULTILINE = (
|
| 147 |
+
"""\
|
| 148 |
+
(a,
|
| 149 |
+
b) = zip?
|
| 150 |
+
""".splitlines(
|
| 151 |
+
keepends=True
|
| 152 |
+
),
|
| 153 |
+
(1, 0),
|
| 154 |
+
[r"get_ipython().run_line_magic('pinfo', 'zip')" + "\n"],
|
| 155 |
+
)
|
| 156 |
+
|
| 157 |
+
HELP_UNICODE = (
|
| 158 |
+
["π.foo?\n"],
|
| 159 |
+
(1, 0),
|
| 160 |
+
["get_ipython().run_line_magic('pinfo', 'π.foo')\n"],
|
| 161 |
+
)
|
| 162 |
+
|
| 163 |
+
|
| 164 |
+
def null_cleanup_transformer(lines):
|
| 165 |
+
"""
|
| 166 |
+
A cleanup transform that returns an empty list.
|
| 167 |
+
"""
|
| 168 |
+
return []
|
| 169 |
+
|
| 170 |
+
|
| 171 |
+
def test_check_make_token_by_line_never_ends_empty():
|
| 172 |
+
"""
|
| 173 |
+
Check that not sequence of single or double characters ends up leading to en empty list of tokens
|
| 174 |
+
"""
|
| 175 |
+
from string import printable
|
| 176 |
+
|
| 177 |
+
for c in printable:
|
| 178 |
+
assert make_tokens_by_line(c)[-1] != []
|
| 179 |
+
for k in printable:
|
| 180 |
+
assert make_tokens_by_line(c + k)[-1] != []
|
| 181 |
+
|
| 182 |
+
|
| 183 |
+
def check_find(transformer, case, match=True):
|
| 184 |
+
sample, expected_start, _ = case
|
| 185 |
+
tbl = make_tokens_by_line(sample)
|
| 186 |
+
res = transformer.find(tbl)
|
| 187 |
+
if match:
|
| 188 |
+
# start_line is stored 0-indexed, expected values are 1-indexed
|
| 189 |
+
assert (res.start_line + 1, res.start_col) == expected_start
|
| 190 |
+
return res
|
| 191 |
+
else:
|
| 192 |
+
assert res is None
|
| 193 |
+
|
| 194 |
+
|
| 195 |
+
def check_transform(transformer_cls, case):
|
| 196 |
+
lines, start, expected = case
|
| 197 |
+
transformer = transformer_cls(start)
|
| 198 |
+
assert transformer.transform(lines) == expected
|
| 199 |
+
|
| 200 |
+
|
| 201 |
+
def test_continued_line():
|
| 202 |
+
lines = MULTILINE_MAGIC_ASSIGN[0]
|
| 203 |
+
assert ipt2.find_end_of_continued_line(lines, 1) == 2
|
| 204 |
+
|
| 205 |
+
assert ipt2.assemble_continued_line(lines, (1, 5), 2) == "foo bar"
|
| 206 |
+
|
| 207 |
+
|
| 208 |
+
def test_find_assign_magic():
|
| 209 |
+
check_find(ipt2.MagicAssign, MULTILINE_MAGIC_ASSIGN)
|
| 210 |
+
check_find(ipt2.MagicAssign, MULTILINE_SYSTEM_ASSIGN, match=False)
|
| 211 |
+
check_find(ipt2.MagicAssign, MULTILINE_SYSTEM_ASSIGN_AFTER_DEDENT, match=False)
|
| 212 |
+
|
| 213 |
+
|
| 214 |
+
def test_transform_assign_magic():
|
| 215 |
+
check_transform(ipt2.MagicAssign, MULTILINE_MAGIC_ASSIGN)
|
| 216 |
+
|
| 217 |
+
|
| 218 |
+
def test_find_assign_system():
|
| 219 |
+
check_find(ipt2.SystemAssign, MULTILINE_SYSTEM_ASSIGN)
|
| 220 |
+
check_find(ipt2.SystemAssign, MULTILINE_SYSTEM_ASSIGN_AFTER_DEDENT)
|
| 221 |
+
check_find(ipt2.SystemAssign, (["a = !ls\n"], (1, 5), None))
|
| 222 |
+
check_find(ipt2.SystemAssign, (["a=!ls\n"], (1, 2), None))
|
| 223 |
+
check_find(ipt2.SystemAssign, MULTILINE_MAGIC_ASSIGN, match=False)
|
| 224 |
+
|
| 225 |
+
|
| 226 |
+
def test_transform_assign_system():
|
| 227 |
+
check_transform(ipt2.SystemAssign, MULTILINE_SYSTEM_ASSIGN)
|
| 228 |
+
check_transform(ipt2.SystemAssign, MULTILINE_SYSTEM_ASSIGN_AFTER_DEDENT)
|
| 229 |
+
|
| 230 |
+
|
| 231 |
+
def test_find_magic_escape():
|
| 232 |
+
check_find(ipt2.EscapedCommand, MULTILINE_MAGIC)
|
| 233 |
+
check_find(ipt2.EscapedCommand, INDENTED_MAGIC)
|
| 234 |
+
check_find(ipt2.EscapedCommand, MULTILINE_MAGIC_ASSIGN, match=False)
|
| 235 |
+
|
| 236 |
+
|
| 237 |
+
def test_transform_magic_escape():
|
| 238 |
+
check_transform(ipt2.EscapedCommand, MULTILINE_MAGIC)
|
| 239 |
+
check_transform(ipt2.EscapedCommand, INDENTED_MAGIC)
|
| 240 |
+
check_transform(ipt2.EscapedCommand, CRLF_MAGIC)
|
| 241 |
+
|
| 242 |
+
|
| 243 |
+
def test_find_autocalls():
|
| 244 |
+
for case in [AUTOCALL_QUOTE, AUTOCALL_QUOTE2, AUTOCALL_PAREN]:
|
| 245 |
+
print("Testing %r" % case[0])
|
| 246 |
+
check_find(ipt2.EscapedCommand, case)
|
| 247 |
+
|
| 248 |
+
|
| 249 |
+
def test_transform_autocall():
|
| 250 |
+
for case in [AUTOCALL_QUOTE, AUTOCALL_QUOTE2, AUTOCALL_PAREN]:
|
| 251 |
+
print("Testing %r" % case[0])
|
| 252 |
+
check_transform(ipt2.EscapedCommand, case)
|
| 253 |
+
|
| 254 |
+
|
| 255 |
+
def test_find_help():
|
| 256 |
+
for case in [SIMPLE_HELP, DETAILED_HELP, MAGIC_HELP, HELP_IN_EXPR]:
|
| 257 |
+
check_find(ipt2.HelpEnd, case)
|
| 258 |
+
|
| 259 |
+
tf = check_find(ipt2.HelpEnd, HELP_CONTINUED_LINE)
|
| 260 |
+
assert tf.q_line == 1
|
| 261 |
+
assert tf.q_col == 3
|
| 262 |
+
|
| 263 |
+
tf = check_find(ipt2.HelpEnd, HELP_MULTILINE)
|
| 264 |
+
assert tf.q_line == 1
|
| 265 |
+
assert tf.q_col == 8
|
| 266 |
+
|
| 267 |
+
# ? in a comment does not trigger help
|
| 268 |
+
check_find(ipt2.HelpEnd, (["foo # bar?\n"], None, None), match=False)
|
| 269 |
+
# Nor in a string
|
| 270 |
+
check_find(ipt2.HelpEnd, (["foo = '''bar?\n"], None, None), match=False)
|
| 271 |
+
|
| 272 |
+
|
| 273 |
+
def test_transform_help():
|
| 274 |
+
tf = ipt2.HelpEnd((1, 0), (1, 9))
|
| 275 |
+
assert tf.transform(HELP_IN_EXPR[0]) == HELP_IN_EXPR[2]
|
| 276 |
+
|
| 277 |
+
tf = ipt2.HelpEnd((1, 0), (2, 3))
|
| 278 |
+
assert tf.transform(HELP_CONTINUED_LINE[0]) == HELP_CONTINUED_LINE[2]
|
| 279 |
+
|
| 280 |
+
tf = ipt2.HelpEnd((1, 0), (2, 8))
|
| 281 |
+
assert tf.transform(HELP_MULTILINE[0]) == HELP_MULTILINE[2]
|
| 282 |
+
|
| 283 |
+
tf = ipt2.HelpEnd((1, 0), (1, 0))
|
| 284 |
+
assert tf.transform(HELP_UNICODE[0]) == HELP_UNICODE[2]
|
| 285 |
+
|
| 286 |
+
|
| 287 |
+
def test_find_assign_op_dedent():
|
| 288 |
+
"""
|
| 289 |
+
be careful that empty token like dedent are not counted as parens
|
| 290 |
+
"""
|
| 291 |
+
|
| 292 |
+
class Tk:
|
| 293 |
+
def __init__(self, s):
|
| 294 |
+
self.string = s
|
| 295 |
+
|
| 296 |
+
assert _find_assign_op([Tk(s) for s in ("", "a", "=", "b")]) == 2
|
| 297 |
+
assert (
|
| 298 |
+
_find_assign_op([Tk(s) for s in ("", "(", "a", "=", "b", ")", "=", "5")]) == 6
|
| 299 |
+
)
|
| 300 |
+
|
| 301 |
+
|
| 302 |
+
extra_closing_paren_param = (
|
| 303 |
+
pytest.param("(\n))", "invalid", None)
|
| 304 |
+
if sys.version_info >= (3, 12)
|
| 305 |
+
else pytest.param("(\n))", "incomplete", 0)
|
| 306 |
+
)
|
| 307 |
+
examples = [
|
| 308 |
+
pytest.param("a = 1", "complete", None),
|
| 309 |
+
pytest.param("for a in range(5):", "incomplete", 4),
|
| 310 |
+
pytest.param("for a in range(5):\n if a > 0:", "incomplete", 8),
|
| 311 |
+
pytest.param("raise = 2", "invalid", None),
|
| 312 |
+
pytest.param("a = [1,\n2,", "incomplete", 0),
|
| 313 |
+
extra_closing_paren_param,
|
| 314 |
+
pytest.param("\\\r\n", "incomplete", 0),
|
| 315 |
+
pytest.param("a = '''\n hi", "incomplete", 3),
|
| 316 |
+
pytest.param("def a():\n x=1\n global x", "invalid", None),
|
| 317 |
+
pytest.param(
|
| 318 |
+
"a \\ ",
|
| 319 |
+
"invalid",
|
| 320 |
+
None,
|
| 321 |
+
marks=pytest.mark.xfail(
|
| 322 |
+
reason="Bug in python 3.9.8 – bpo 45738",
|
| 323 |
+
condition=sys.version_info in [(3, 11, 0, "alpha", 2)],
|
| 324 |
+
raises=SystemError,
|
| 325 |
+
strict=True,
|
| 326 |
+
),
|
| 327 |
+
), # Nothing allowed after backslash,
|
| 328 |
+
pytest.param("1\\\n+2", "complete", None),
|
| 329 |
+
]
|
| 330 |
+
|
| 331 |
+
|
| 332 |
+
@pytest.mark.parametrize("code, expected, number", examples)
|
| 333 |
+
def test_check_complete_param(code, expected, number):
|
| 334 |
+
cc = ipt2.TransformerManager().check_complete
|
| 335 |
+
assert cc(code) == (expected, number)
|
| 336 |
+
|
| 337 |
+
|
| 338 |
+
@pytest.mark.xfail(platform.python_implementation() == "PyPy", reason="fail on pypy")
|
| 339 |
+
@pytest.mark.xfail(
|
| 340 |
+
reason="Bug in python 3.9.8 – bpo 45738",
|
| 341 |
+
condition=sys.version_info in [(3, 11, 0, "alpha", 2)],
|
| 342 |
+
raises=SystemError,
|
| 343 |
+
strict=True,
|
| 344 |
+
)
|
| 345 |
+
def test_check_complete():
|
| 346 |
+
cc = ipt2.TransformerManager().check_complete
|
| 347 |
+
|
| 348 |
+
example = dedent(
|
| 349 |
+
"""
|
| 350 |
+
if True:
|
| 351 |
+
a=1"""
|
| 352 |
+
)
|
| 353 |
+
|
| 354 |
+
assert cc(example) == ("incomplete", 4)
|
| 355 |
+
assert cc(example + "\n") == ("complete", None)
|
| 356 |
+
assert cc(example + "\n ") == ("complete", None)
|
| 357 |
+
|
| 358 |
+
# no need to loop on all the letters/numbers.
|
| 359 |
+
short = "12abAB" + string.printable[62:]
|
| 360 |
+
for c in short:
|
| 361 |
+
# test does not raise:
|
| 362 |
+
cc(c)
|
| 363 |
+
for k in short:
|
| 364 |
+
cc(c + k)
|
| 365 |
+
|
| 366 |
+
assert cc("def f():\n x=0\n \\\n ") == ("incomplete", 2)
|
| 367 |
+
|
| 368 |
+
|
| 369 |
+
@pytest.mark.xfail(platform.python_implementation() == "PyPy", reason="fail on pypy")
|
| 370 |
+
@pytest.mark.parametrize(
|
| 371 |
+
"value, expected",
|
| 372 |
+
[
|
| 373 |
+
('''def foo():\n """''', ("incomplete", 4)),
|
| 374 |
+
("""async with example:\n pass""", ("incomplete", 4)),
|
| 375 |
+
("""async with example:\n pass\n """, ("complete", None)),
|
| 376 |
+
],
|
| 377 |
+
)
|
| 378 |
+
def test_check_complete_II(value, expected):
|
| 379 |
+
"""
|
| 380 |
+
Test that multiple line strings are properly handled.
|
| 381 |
+
|
| 382 |
+
Separate test function for convenience
|
| 383 |
+
|
| 384 |
+
"""
|
| 385 |
+
cc = ipt2.TransformerManager().check_complete
|
| 386 |
+
assert cc(value) == expected
|
| 387 |
+
|
| 388 |
+
|
| 389 |
+
@pytest.mark.parametrize(
|
| 390 |
+
"value, expected",
|
| 391 |
+
[
|
| 392 |
+
(")", ("invalid", None)),
|
| 393 |
+
("]", ("invalid", None)),
|
| 394 |
+
("}", ("invalid", None)),
|
| 395 |
+
(")(", ("invalid", None)),
|
| 396 |
+
("][", ("invalid", None)),
|
| 397 |
+
("}{", ("invalid", None)),
|
| 398 |
+
("]()(", ("invalid", None)),
|
| 399 |
+
("())(", ("invalid", None)),
|
| 400 |
+
(")[](", ("invalid", None)),
|
| 401 |
+
("()](", ("invalid", None)),
|
| 402 |
+
],
|
| 403 |
+
)
|
| 404 |
+
def test_check_complete_invalidates_sunken_brackets(value, expected):
|
| 405 |
+
"""
|
| 406 |
+
Test that a single line with more closing brackets than the opening ones is
|
| 407 |
+
interpreted as invalid
|
| 408 |
+
"""
|
| 409 |
+
cc = ipt2.TransformerManager().check_complete
|
| 410 |
+
assert cc(value) == expected
|
| 411 |
+
|
| 412 |
+
|
| 413 |
+
def test_null_cleanup_transformer():
|
| 414 |
+
manager = ipt2.TransformerManager()
|
| 415 |
+
manager.cleanup_transforms.insert(0, null_cleanup_transformer)
|
| 416 |
+
assert manager.transform_cell("") == ""
|
| 417 |
+
|
| 418 |
+
|
| 419 |
+
def test_side_effects_I():
|
| 420 |
+
count = 0
|
| 421 |
+
|
| 422 |
+
def counter(lines):
|
| 423 |
+
nonlocal count
|
| 424 |
+
count += 1
|
| 425 |
+
return lines
|
| 426 |
+
|
| 427 |
+
counter.has_side_effects = True
|
| 428 |
+
|
| 429 |
+
manager = ipt2.TransformerManager()
|
| 430 |
+
manager.cleanup_transforms.insert(0, counter)
|
| 431 |
+
assert manager.check_complete("a=1\n") == ("complete", None)
|
| 432 |
+
assert count == 0
|
| 433 |
+
|
| 434 |
+
|
| 435 |
+
def test_side_effects_II():
|
| 436 |
+
count = 0
|
| 437 |
+
|
| 438 |
+
def counter(lines):
|
| 439 |
+
nonlocal count
|
| 440 |
+
count += 1
|
| 441 |
+
return lines
|
| 442 |
+
|
| 443 |
+
counter.has_side_effects = True
|
| 444 |
+
|
| 445 |
+
manager = ipt2.TransformerManager()
|
| 446 |
+
manager.line_transforms.insert(0, counter)
|
| 447 |
+
assert manager.check_complete("b=1\n") == ("complete", None)
|
| 448 |
+
assert count == 0
|
evalkit_eagle/lib/python3.10/site-packages/IPython/core/tests/test_magic.py
ADDED
|
@@ -0,0 +1,1556 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# -*- coding: utf-8 -*-
|
| 2 |
+
"""Tests for various magic functions."""
|
| 3 |
+
|
| 4 |
+
import gc
|
| 5 |
+
import io
|
| 6 |
+
import os
|
| 7 |
+
import re
|
| 8 |
+
import shlex
|
| 9 |
+
import sys
|
| 10 |
+
import warnings
|
| 11 |
+
from importlib import invalidate_caches
|
| 12 |
+
from io import StringIO
|
| 13 |
+
from pathlib import Path
|
| 14 |
+
from textwrap import dedent
|
| 15 |
+
from unittest import TestCase, mock
|
| 16 |
+
|
| 17 |
+
import pytest
|
| 18 |
+
|
| 19 |
+
from IPython import get_ipython
|
| 20 |
+
from IPython.core import magic
|
| 21 |
+
from IPython.core.error import UsageError
|
| 22 |
+
from IPython.core.magic import (
|
| 23 |
+
Magics,
|
| 24 |
+
cell_magic,
|
| 25 |
+
line_magic,
|
| 26 |
+
magics_class,
|
| 27 |
+
register_cell_magic,
|
| 28 |
+
register_line_magic,
|
| 29 |
+
)
|
| 30 |
+
from IPython.core.magics import code, execution, logging, osm, script
|
| 31 |
+
from IPython.testing import decorators as dec
|
| 32 |
+
from IPython.testing import tools as tt
|
| 33 |
+
from IPython.utils.io import capture_output
|
| 34 |
+
from IPython.utils.process import find_cmd
|
| 35 |
+
from IPython.utils.tempdir import TemporaryDirectory, TemporaryWorkingDirectory
|
| 36 |
+
from IPython.utils.syspathcontext import prepended_to_syspath
|
| 37 |
+
|
| 38 |
+
from .test_debugger import PdbTestInput
|
| 39 |
+
|
| 40 |
+
from tempfile import NamedTemporaryFile
|
| 41 |
+
|
| 42 |
+
@magic.magics_class
|
| 43 |
+
class DummyMagics(magic.Magics): pass
|
| 44 |
+
|
| 45 |
+
def test_extract_code_ranges():
|
| 46 |
+
instr = "1 3 5-6 7-9 10:15 17: :10 10- -13 :"
|
| 47 |
+
expected = [
|
| 48 |
+
(0, 1),
|
| 49 |
+
(2, 3),
|
| 50 |
+
(4, 6),
|
| 51 |
+
(6, 9),
|
| 52 |
+
(9, 14),
|
| 53 |
+
(16, None),
|
| 54 |
+
(None, 9),
|
| 55 |
+
(9, None),
|
| 56 |
+
(None, 13),
|
| 57 |
+
(None, None),
|
| 58 |
+
]
|
| 59 |
+
actual = list(code.extract_code_ranges(instr))
|
| 60 |
+
assert actual == expected
|
| 61 |
+
|
| 62 |
+
def test_extract_symbols():
|
| 63 |
+
source = """import foo\na = 10\ndef b():\n return 42\n\n\nclass A: pass\n\n\n"""
|
| 64 |
+
symbols_args = ["a", "b", "A", "A,b", "A,a", "z"]
|
| 65 |
+
expected = [([], ['a']),
|
| 66 |
+
(["def b():\n return 42\n"], []),
|
| 67 |
+
(["class A: pass\n"], []),
|
| 68 |
+
(["class A: pass\n", "def b():\n return 42\n"], []),
|
| 69 |
+
(["class A: pass\n"], ['a']),
|
| 70 |
+
([], ['z'])]
|
| 71 |
+
for symbols, exp in zip(symbols_args, expected):
|
| 72 |
+
assert code.extract_symbols(source, symbols) == exp
|
| 73 |
+
|
| 74 |
+
|
| 75 |
+
def test_extract_symbols_raises_exception_with_non_python_code():
|
| 76 |
+
source = ("=begin A Ruby program :)=end\n"
|
| 77 |
+
"def hello\n"
|
| 78 |
+
"puts 'Hello world'\n"
|
| 79 |
+
"end")
|
| 80 |
+
with pytest.raises(SyntaxError):
|
| 81 |
+
code.extract_symbols(source, "hello")
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
def test_magic_not_found():
|
| 85 |
+
# magic not found raises UsageError
|
| 86 |
+
with pytest.raises(UsageError):
|
| 87 |
+
_ip.run_line_magic("doesntexist", "")
|
| 88 |
+
|
| 89 |
+
# ensure result isn't success when a magic isn't found
|
| 90 |
+
result = _ip.run_cell('%doesntexist')
|
| 91 |
+
assert isinstance(result.error_in_exec, UsageError)
|
| 92 |
+
|
| 93 |
+
|
| 94 |
+
def test_cell_magic_not_found():
|
| 95 |
+
# magic not found raises UsageError
|
| 96 |
+
with pytest.raises(UsageError):
|
| 97 |
+
_ip.run_cell_magic('doesntexist', 'line', 'cell')
|
| 98 |
+
|
| 99 |
+
# ensure result isn't success when a magic isn't found
|
| 100 |
+
result = _ip.run_cell('%%doesntexist')
|
| 101 |
+
assert isinstance(result.error_in_exec, UsageError)
|
| 102 |
+
|
| 103 |
+
|
| 104 |
+
def test_magic_error_status():
|
| 105 |
+
def fail(shell):
|
| 106 |
+
1/0
|
| 107 |
+
_ip.register_magic_function(fail)
|
| 108 |
+
result = _ip.run_cell('%fail')
|
| 109 |
+
assert isinstance(result.error_in_exec, ZeroDivisionError)
|
| 110 |
+
|
| 111 |
+
|
| 112 |
+
def test_config():
|
| 113 |
+
""" test that config magic does not raise
|
| 114 |
+
can happen if Configurable init is moved too early into
|
| 115 |
+
Magics.__init__ as then a Config object will be registered as a
|
| 116 |
+
magic.
|
| 117 |
+
"""
|
| 118 |
+
## should not raise.
|
| 119 |
+
_ip.run_line_magic("config", "")
|
| 120 |
+
|
| 121 |
+
|
| 122 |
+
def test_config_available_configs():
|
| 123 |
+
""" test that config magic prints available configs in unique and
|
| 124 |
+
sorted order. """
|
| 125 |
+
with capture_output() as captured:
|
| 126 |
+
_ip.run_line_magic("config", "")
|
| 127 |
+
|
| 128 |
+
stdout = captured.stdout
|
| 129 |
+
config_classes = stdout.strip().split('\n')[1:]
|
| 130 |
+
assert config_classes == sorted(set(config_classes))
|
| 131 |
+
|
| 132 |
+
def test_config_print_class():
|
| 133 |
+
""" test that config with a classname prints the class's options. """
|
| 134 |
+
with capture_output() as captured:
|
| 135 |
+
_ip.run_line_magic("config", "TerminalInteractiveShell")
|
| 136 |
+
|
| 137 |
+
stdout = captured.stdout
|
| 138 |
+
assert re.match(
|
| 139 |
+
"TerminalInteractiveShell.* options", stdout.splitlines()[0]
|
| 140 |
+
), f"{stdout}\n\n1st line of stdout not like 'TerminalInteractiveShell.* options'"
|
| 141 |
+
|
| 142 |
+
|
| 143 |
+
def test_rehashx():
|
| 144 |
+
# clear up everything
|
| 145 |
+
_ip.alias_manager.clear_aliases()
|
| 146 |
+
del _ip.db['syscmdlist']
|
| 147 |
+
|
| 148 |
+
_ip.run_line_magic("rehashx", "")
|
| 149 |
+
# Practically ALL ipython development systems will have more than 10 aliases
|
| 150 |
+
|
| 151 |
+
assert len(_ip.alias_manager.aliases) > 10
|
| 152 |
+
for name, cmd in _ip.alias_manager.aliases:
|
| 153 |
+
# we must strip dots from alias names
|
| 154 |
+
assert "." not in name
|
| 155 |
+
|
| 156 |
+
# rehashx must fill up syscmdlist
|
| 157 |
+
scoms = _ip.db['syscmdlist']
|
| 158 |
+
assert len(scoms) > 10
|
| 159 |
+
|
| 160 |
+
|
| 161 |
+
def test_magic_parse_options():
|
| 162 |
+
"""Test that we don't mangle paths when parsing magic options."""
|
| 163 |
+
ip = get_ipython()
|
| 164 |
+
path = 'c:\\x'
|
| 165 |
+
m = DummyMagics(ip)
|
| 166 |
+
opts = m.parse_options('-f %s' % path,'f:')[0]
|
| 167 |
+
# argv splitting is os-dependent
|
| 168 |
+
if os.name == 'posix':
|
| 169 |
+
expected = 'c:x'
|
| 170 |
+
else:
|
| 171 |
+
expected = path
|
| 172 |
+
assert opts["f"] == expected
|
| 173 |
+
|
| 174 |
+
|
| 175 |
+
def test_magic_parse_long_options():
|
| 176 |
+
"""Magic.parse_options can handle --foo=bar long options"""
|
| 177 |
+
ip = get_ipython()
|
| 178 |
+
m = DummyMagics(ip)
|
| 179 |
+
opts, _ = m.parse_options("--foo --bar=bubble", "a", "foo", "bar=")
|
| 180 |
+
assert "foo" in opts
|
| 181 |
+
assert "bar" in opts
|
| 182 |
+
assert opts["bar"] == "bubble"
|
| 183 |
+
|
| 184 |
+
|
| 185 |
+
def doctest_hist_f():
|
| 186 |
+
"""Test %hist -f with temporary filename.
|
| 187 |
+
|
| 188 |
+
In [9]: import tempfile
|
| 189 |
+
|
| 190 |
+
In [10]: tfile = tempfile.mktemp('.py','tmp-ipython-')
|
| 191 |
+
|
| 192 |
+
In [11]: %hist -nl -f $tfile 3
|
| 193 |
+
|
| 194 |
+
In [13]: import os; os.unlink(tfile)
|
| 195 |
+
"""
|
| 196 |
+
|
| 197 |
+
|
| 198 |
+
def doctest_hist_op():
|
| 199 |
+
"""Test %hist -op
|
| 200 |
+
|
| 201 |
+
In [1]: class b(float):
|
| 202 |
+
...: pass
|
| 203 |
+
...:
|
| 204 |
+
|
| 205 |
+
In [2]: class s(object):
|
| 206 |
+
...: def __str__(self):
|
| 207 |
+
...: return 's'
|
| 208 |
+
...:
|
| 209 |
+
|
| 210 |
+
In [3]:
|
| 211 |
+
|
| 212 |
+
In [4]: class r(b):
|
| 213 |
+
...: def __repr__(self):
|
| 214 |
+
...: return 'r'
|
| 215 |
+
...:
|
| 216 |
+
|
| 217 |
+
In [5]: class sr(s,r): pass
|
| 218 |
+
...:
|
| 219 |
+
|
| 220 |
+
In [6]:
|
| 221 |
+
|
| 222 |
+
In [7]: bb=b()
|
| 223 |
+
|
| 224 |
+
In [8]: ss=s()
|
| 225 |
+
|
| 226 |
+
In [9]: rr=r()
|
| 227 |
+
|
| 228 |
+
In [10]: ssrr=sr()
|
| 229 |
+
|
| 230 |
+
In [11]: 4.5
|
| 231 |
+
Out[11]: 4.5
|
| 232 |
+
|
| 233 |
+
In [12]: str(ss)
|
| 234 |
+
Out[12]: 's'
|
| 235 |
+
|
| 236 |
+
In [13]:
|
| 237 |
+
|
| 238 |
+
In [14]: %hist -op
|
| 239 |
+
>>> class b:
|
| 240 |
+
... pass
|
| 241 |
+
...
|
| 242 |
+
>>> class s(b):
|
| 243 |
+
... def __str__(self):
|
| 244 |
+
... return 's'
|
| 245 |
+
...
|
| 246 |
+
>>>
|
| 247 |
+
>>> class r(b):
|
| 248 |
+
... def __repr__(self):
|
| 249 |
+
... return 'r'
|
| 250 |
+
...
|
| 251 |
+
>>> class sr(s,r): pass
|
| 252 |
+
>>>
|
| 253 |
+
>>> bb=b()
|
| 254 |
+
>>> ss=s()
|
| 255 |
+
>>> rr=r()
|
| 256 |
+
>>> ssrr=sr()
|
| 257 |
+
>>> 4.5
|
| 258 |
+
4.5
|
| 259 |
+
>>> str(ss)
|
| 260 |
+
's'
|
| 261 |
+
>>>
|
| 262 |
+
"""
|
| 263 |
+
|
| 264 |
+
def test_hist_pof():
|
| 265 |
+
ip = get_ipython()
|
| 266 |
+
ip.run_cell("1+2", store_history=True)
|
| 267 |
+
#raise Exception(ip.history_manager.session_number)
|
| 268 |
+
#raise Exception(list(ip.history_manager._get_range_session()))
|
| 269 |
+
with TemporaryDirectory() as td:
|
| 270 |
+
tf = os.path.join(td, 'hist.py')
|
| 271 |
+
ip.run_line_magic('history', '-pof %s' % tf)
|
| 272 |
+
assert os.path.isfile(tf)
|
| 273 |
+
|
| 274 |
+
|
| 275 |
+
def test_macro():
|
| 276 |
+
ip = get_ipython()
|
| 277 |
+
ip.history_manager.reset() # Clear any existing history.
|
| 278 |
+
cmds = ["a=1", "def b():\n return a**2", "print(a,b())"]
|
| 279 |
+
for i, cmd in enumerate(cmds, start=1):
|
| 280 |
+
ip.history_manager.store_inputs(i, cmd)
|
| 281 |
+
ip.run_line_magic("macro", "test 1-3")
|
| 282 |
+
assert ip.user_ns["test"].value == "\n".join(cmds) + "\n"
|
| 283 |
+
|
| 284 |
+
# List macros
|
| 285 |
+
assert "test" in ip.run_line_magic("macro", "")
|
| 286 |
+
|
| 287 |
+
|
| 288 |
+
def test_macro_run():
|
| 289 |
+
"""Test that we can run a multi-line macro successfully."""
|
| 290 |
+
ip = get_ipython()
|
| 291 |
+
ip.history_manager.reset()
|
| 292 |
+
cmds = ["a=10", "a+=1", "print(a)", "%macro test 2-3"]
|
| 293 |
+
for cmd in cmds:
|
| 294 |
+
ip.run_cell(cmd, store_history=True)
|
| 295 |
+
assert ip.user_ns["test"].value == "a+=1\nprint(a)\n"
|
| 296 |
+
with tt.AssertPrints("12"):
|
| 297 |
+
ip.run_cell("test")
|
| 298 |
+
with tt.AssertPrints("13"):
|
| 299 |
+
ip.run_cell("test")
|
| 300 |
+
|
| 301 |
+
|
| 302 |
+
def test_magic_magic():
|
| 303 |
+
"""Test %magic"""
|
| 304 |
+
ip = get_ipython()
|
| 305 |
+
with capture_output() as captured:
|
| 306 |
+
ip.run_line_magic("magic", "")
|
| 307 |
+
|
| 308 |
+
stdout = captured.stdout
|
| 309 |
+
assert "%magic" in stdout
|
| 310 |
+
assert "IPython" in stdout
|
| 311 |
+
assert "Available" in stdout
|
| 312 |
+
|
| 313 |
+
|
| 314 |
+
@dec.skipif_not_numpy
|
| 315 |
+
def test_numpy_reset_array_undec():
|
| 316 |
+
"Test '%reset array' functionality"
|
| 317 |
+
_ip.ex("import numpy as np")
|
| 318 |
+
_ip.ex("a = np.empty(2)")
|
| 319 |
+
assert "a" in _ip.user_ns
|
| 320 |
+
_ip.run_line_magic("reset", "-f array")
|
| 321 |
+
assert "a" not in _ip.user_ns
|
| 322 |
+
|
| 323 |
+
|
| 324 |
+
def test_reset_out():
|
| 325 |
+
"Test '%reset out' magic"
|
| 326 |
+
_ip.run_cell("parrot = 'dead'", store_history=True)
|
| 327 |
+
# test '%reset -f out', make an Out prompt
|
| 328 |
+
_ip.run_cell("parrot", store_history=True)
|
| 329 |
+
assert "dead" in [_ip.user_ns[x] for x in ("_", "__", "___")]
|
| 330 |
+
_ip.run_line_magic("reset", "-f out")
|
| 331 |
+
assert "dead" not in [_ip.user_ns[x] for x in ("_", "__", "___")]
|
| 332 |
+
assert len(_ip.user_ns["Out"]) == 0
|
| 333 |
+
|
| 334 |
+
|
| 335 |
+
def test_reset_in():
|
| 336 |
+
"Test '%reset in' magic"
|
| 337 |
+
# test '%reset -f in'
|
| 338 |
+
_ip.run_cell("parrot", store_history=True)
|
| 339 |
+
assert "parrot" in [_ip.user_ns[x] for x in ("_i", "_ii", "_iii")]
|
| 340 |
+
_ip.run_line_magic("reset", "-f in")
|
| 341 |
+
assert "parrot" not in [_ip.user_ns[x] for x in ("_i", "_ii", "_iii")]
|
| 342 |
+
assert len(set(_ip.user_ns["In"])) == 1
|
| 343 |
+
|
| 344 |
+
|
| 345 |
+
def test_reset_dhist():
|
| 346 |
+
"Test '%reset dhist' magic"
|
| 347 |
+
_ip.run_cell("tmp = [d for d in _dh]") # copy before clearing
|
| 348 |
+
_ip.run_line_magic("cd", os.path.dirname(pytest.__file__))
|
| 349 |
+
_ip.run_line_magic("cd", "-")
|
| 350 |
+
assert len(_ip.user_ns["_dh"]) > 0
|
| 351 |
+
_ip.run_line_magic("reset", "-f dhist")
|
| 352 |
+
assert len(_ip.user_ns["_dh"]) == 0
|
| 353 |
+
_ip.run_cell("_dh = [d for d in tmp]") # restore
|
| 354 |
+
|
| 355 |
+
|
| 356 |
+
def test_reset_in_length():
|
| 357 |
+
"Test that '%reset in' preserves In[] length"
|
| 358 |
+
_ip.run_cell("print 'foo'")
|
| 359 |
+
_ip.run_cell("reset -f in")
|
| 360 |
+
assert len(_ip.user_ns["In"]) == _ip.displayhook.prompt_count + 1
|
| 361 |
+
|
| 362 |
+
|
| 363 |
+
class TestResetErrors(TestCase):
|
| 364 |
+
|
| 365 |
+
def test_reset_redefine(self):
|
| 366 |
+
|
| 367 |
+
@magics_class
|
| 368 |
+
class KernelMagics(Magics):
|
| 369 |
+
@line_magic
|
| 370 |
+
def less(self, shell): pass
|
| 371 |
+
|
| 372 |
+
_ip.register_magics(KernelMagics)
|
| 373 |
+
|
| 374 |
+
with self.assertLogs() as cm:
|
| 375 |
+
# hack, we want to just capture logs, but assertLogs fails if not
|
| 376 |
+
# logs get produce.
|
| 377 |
+
# so log one things we ignore.
|
| 378 |
+
import logging as log_mod
|
| 379 |
+
log = log_mod.getLogger()
|
| 380 |
+
log.info('Nothing')
|
| 381 |
+
# end hack.
|
| 382 |
+
_ip.run_cell("reset -f")
|
| 383 |
+
|
| 384 |
+
assert len(cm.output) == 1
|
| 385 |
+
for out in cm.output:
|
| 386 |
+
assert "Invalid alias" not in out
|
| 387 |
+
|
| 388 |
+
def test_tb_syntaxerror():
|
| 389 |
+
"""test %tb after a SyntaxError"""
|
| 390 |
+
ip = get_ipython()
|
| 391 |
+
ip.run_cell("for")
|
| 392 |
+
|
| 393 |
+
# trap and validate stdout
|
| 394 |
+
save_stdout = sys.stdout
|
| 395 |
+
try:
|
| 396 |
+
sys.stdout = StringIO()
|
| 397 |
+
ip.run_cell("%tb")
|
| 398 |
+
out = sys.stdout.getvalue()
|
| 399 |
+
finally:
|
| 400 |
+
sys.stdout = save_stdout
|
| 401 |
+
# trim output, and only check the last line
|
| 402 |
+
last_line = out.rstrip().splitlines()[-1].strip()
|
| 403 |
+
assert last_line == "SyntaxError: invalid syntax"
|
| 404 |
+
|
| 405 |
+
|
| 406 |
+
def test_time():
|
| 407 |
+
ip = get_ipython()
|
| 408 |
+
|
| 409 |
+
with tt.AssertPrints("Wall time: "):
|
| 410 |
+
ip.run_cell("%time None")
|
| 411 |
+
|
| 412 |
+
ip.run_cell("def f(kmjy):\n"
|
| 413 |
+
" %time print (2*kmjy)")
|
| 414 |
+
|
| 415 |
+
with tt.AssertPrints("Wall time: "):
|
| 416 |
+
with tt.AssertPrints("hihi", suppress=False):
|
| 417 |
+
ip.run_cell("f('hi')")
|
| 418 |
+
|
| 419 |
+
|
| 420 |
+
# ';' at the end of %time prevents instruction value to be printed.
|
| 421 |
+
# This tests fix for #13837.
|
| 422 |
+
def test_time_no_output_with_semicolon():
|
| 423 |
+
ip = get_ipython()
|
| 424 |
+
|
| 425 |
+
# Test %time cases
|
| 426 |
+
with tt.AssertPrints(" 123456"):
|
| 427 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 428 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 429 |
+
ip.run_cell("%time 123000+456")
|
| 430 |
+
|
| 431 |
+
with tt.AssertNotPrints(" 123456"):
|
| 432 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 433 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 434 |
+
ip.run_cell("%time 123000+456;")
|
| 435 |
+
|
| 436 |
+
with tt.AssertPrints(" 123456"):
|
| 437 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 438 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 439 |
+
ip.run_cell("%time 123000+456 # Comment")
|
| 440 |
+
|
| 441 |
+
with tt.AssertNotPrints(" 123456"):
|
| 442 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 443 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 444 |
+
ip.run_cell("%time 123000+456; # Comment")
|
| 445 |
+
|
| 446 |
+
with tt.AssertPrints(" 123456"):
|
| 447 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 448 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 449 |
+
ip.run_cell("%time 123000+456 # ;Comment")
|
| 450 |
+
|
| 451 |
+
# Test %%time cases
|
| 452 |
+
with tt.AssertPrints("123456"):
|
| 453 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 454 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 455 |
+
ip.run_cell("%%time\n123000+456\n\n\n")
|
| 456 |
+
|
| 457 |
+
with tt.AssertNotPrints("123456"):
|
| 458 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 459 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 460 |
+
ip.run_cell("%%time\n123000+456;\n\n\n")
|
| 461 |
+
|
| 462 |
+
with tt.AssertPrints("123456"):
|
| 463 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 464 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 465 |
+
ip.run_cell("%%time\n123000+456 # Comment\n\n\n")
|
| 466 |
+
|
| 467 |
+
with tt.AssertNotPrints("123456"):
|
| 468 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 469 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 470 |
+
ip.run_cell("%%time\n123000+456; # Comment\n\n\n")
|
| 471 |
+
|
| 472 |
+
with tt.AssertPrints("123456"):
|
| 473 |
+
with tt.AssertPrints("Wall time: ", suppress=False):
|
| 474 |
+
with tt.AssertPrints("CPU times: ", suppress=False):
|
| 475 |
+
ip.run_cell("%%time\n123000+456 # ;Comment\n\n\n")
|
| 476 |
+
|
| 477 |
+
|
| 478 |
+
def test_time_last_not_expression():
|
| 479 |
+
ip.run_cell("%%time\n"
|
| 480 |
+
"var_1 = 1\n"
|
| 481 |
+
"var_2 = 2\n")
|
| 482 |
+
assert ip.user_ns['var_1'] == 1
|
| 483 |
+
del ip.user_ns['var_1']
|
| 484 |
+
assert ip.user_ns['var_2'] == 2
|
| 485 |
+
del ip.user_ns['var_2']
|
| 486 |
+
|
| 487 |
+
|
| 488 |
+
@dec.skip_win32
|
| 489 |
+
def test_time2():
|
| 490 |
+
ip = get_ipython()
|
| 491 |
+
|
| 492 |
+
with tt.AssertPrints("CPU times: user "):
|
| 493 |
+
ip.run_cell("%time None")
|
| 494 |
+
|
| 495 |
+
def test_time3():
|
| 496 |
+
"""Erroneous magic function calls, issue gh-3334"""
|
| 497 |
+
ip = get_ipython()
|
| 498 |
+
ip.user_ns.pop('run', None)
|
| 499 |
+
|
| 500 |
+
with tt.AssertNotPrints("not found", channel='stderr'):
|
| 501 |
+
ip.run_cell("%%time\n"
|
| 502 |
+
"run = 0\n"
|
| 503 |
+
"run += 1")
|
| 504 |
+
|
| 505 |
+
def test_multiline_time():
|
| 506 |
+
"""Make sure last statement from time return a value."""
|
| 507 |
+
ip = get_ipython()
|
| 508 |
+
ip.user_ns.pop('run', None)
|
| 509 |
+
|
| 510 |
+
ip.run_cell(
|
| 511 |
+
dedent(
|
| 512 |
+
"""\
|
| 513 |
+
%%time
|
| 514 |
+
a = "ho"
|
| 515 |
+
b = "hey"
|
| 516 |
+
a+b
|
| 517 |
+
"""
|
| 518 |
+
)
|
| 519 |
+
)
|
| 520 |
+
assert ip.user_ns_hidden["_"] == "hohey"
|
| 521 |
+
|
| 522 |
+
|
| 523 |
+
def test_time_local_ns():
|
| 524 |
+
"""
|
| 525 |
+
Test that local_ns is actually global_ns when running a cell magic
|
| 526 |
+
"""
|
| 527 |
+
ip = get_ipython()
|
| 528 |
+
ip.run_cell("%%time\n" "myvar = 1")
|
| 529 |
+
assert ip.user_ns["myvar"] == 1
|
| 530 |
+
del ip.user_ns["myvar"]
|
| 531 |
+
|
| 532 |
+
|
| 533 |
+
def test_time_microseconds_display():
|
| 534 |
+
"""Ensure ASCII is used when necessary"""
|
| 535 |
+
with mock.patch("sys.stdout", io.TextIOWrapper(StringIO(), encoding="utf-8")):
|
| 536 |
+
assert execution._format_time(0.000001) == "1 \u03bcs"
|
| 537 |
+
with mock.patch("sys.stdout", io.TextIOWrapper(StringIO(), encoding="ascii")):
|
| 538 |
+
assert execution._format_time(0.000001) == "1 us"
|
| 539 |
+
|
| 540 |
+
|
| 541 |
+
# Test %%capture magic. Added to test issue #13926
|
| 542 |
+
def test_capture():
|
| 543 |
+
ip = get_ipython()
|
| 544 |
+
|
| 545 |
+
# Test %%capture nominal case
|
| 546 |
+
ip.run_cell("%%capture abc\n1+2")
|
| 547 |
+
with tt.AssertPrints("True", suppress=False):
|
| 548 |
+
ip.run_cell("'abc' in locals()")
|
| 549 |
+
with tt.AssertPrints("True", suppress=False):
|
| 550 |
+
ip.run_cell("'outputs' in dir(abc)")
|
| 551 |
+
with tt.AssertPrints("3", suppress=False):
|
| 552 |
+
ip.run_cell("abc.outputs[0]")
|
| 553 |
+
|
| 554 |
+
# Test %%capture with ';' at end of expression
|
| 555 |
+
ip.run_cell("%%capture abc\n7+8;")
|
| 556 |
+
with tt.AssertPrints("False", suppress=False):
|
| 557 |
+
ip.run_cell("'abc' in locals()")
|
| 558 |
+
|
| 559 |
+
|
| 560 |
+
def test_doctest_mode():
|
| 561 |
+
"Toggle doctest_mode twice, it should be a no-op and run without error"
|
| 562 |
+
_ip.run_line_magic("doctest_mode", "")
|
| 563 |
+
_ip.run_line_magic("doctest_mode", "")
|
| 564 |
+
|
| 565 |
+
|
| 566 |
+
def test_parse_options():
|
| 567 |
+
"""Tests for basic options parsing in magics."""
|
| 568 |
+
# These are only the most minimal of tests, more should be added later. At
|
| 569 |
+
# the very least we check that basic text/unicode calls work OK.
|
| 570 |
+
m = DummyMagics(_ip)
|
| 571 |
+
assert m.parse_options("foo", "")[1] == "foo"
|
| 572 |
+
assert m.parse_options("foo", "")[1] == "foo"
|
| 573 |
+
|
| 574 |
+
|
| 575 |
+
def test_parse_options_preserve_non_option_string():
|
| 576 |
+
"""Test to assert preservation of non-option part of magic-block, while parsing magic options."""
|
| 577 |
+
m = DummyMagics(_ip)
|
| 578 |
+
opts, stmt = m.parse_options(
|
| 579 |
+
" -n1 -r 13 _ = 314 + foo", "n:r:", preserve_non_opts=True
|
| 580 |
+
)
|
| 581 |
+
assert opts == {"n": "1", "r": "13"}
|
| 582 |
+
assert stmt == "_ = 314 + foo"
|
| 583 |
+
|
| 584 |
+
|
| 585 |
+
def test_run_magic_preserve_code_block():
|
| 586 |
+
"""Test to assert preservation of non-option part of magic-block, while running magic."""
|
| 587 |
+
_ip.user_ns["spaces"] = []
|
| 588 |
+
_ip.run_line_magic(
|
| 589 |
+
"timeit", "-n1 -r1 spaces.append([s.count(' ') for s in ['document']])"
|
| 590 |
+
)
|
| 591 |
+
assert _ip.user_ns["spaces"] == [[0]]
|
| 592 |
+
|
| 593 |
+
|
| 594 |
+
def test_dirops():
|
| 595 |
+
"""Test various directory handling operations."""
|
| 596 |
+
# curpath = lambda :os.path.splitdrive(os.getcwd())[1].replace('\\','/')
|
| 597 |
+
curpath = os.getcwd
|
| 598 |
+
startdir = os.getcwd()
|
| 599 |
+
ipdir = os.path.realpath(_ip.ipython_dir)
|
| 600 |
+
try:
|
| 601 |
+
_ip.run_line_magic("cd", '"%s"' % ipdir)
|
| 602 |
+
assert curpath() == ipdir
|
| 603 |
+
_ip.run_line_magic("cd", "-")
|
| 604 |
+
assert curpath() == startdir
|
| 605 |
+
_ip.run_line_magic("pushd", '"%s"' % ipdir)
|
| 606 |
+
assert curpath() == ipdir
|
| 607 |
+
_ip.run_line_magic("popd", "")
|
| 608 |
+
assert curpath() == startdir
|
| 609 |
+
finally:
|
| 610 |
+
os.chdir(startdir)
|
| 611 |
+
|
| 612 |
+
|
| 613 |
+
def test_cd_force_quiet():
|
| 614 |
+
"""Test OSMagics.cd_force_quiet option"""
|
| 615 |
+
_ip.config.OSMagics.cd_force_quiet = True
|
| 616 |
+
osmagics = osm.OSMagics(shell=_ip)
|
| 617 |
+
|
| 618 |
+
startdir = os.getcwd()
|
| 619 |
+
ipdir = os.path.realpath(_ip.ipython_dir)
|
| 620 |
+
|
| 621 |
+
try:
|
| 622 |
+
with tt.AssertNotPrints(ipdir):
|
| 623 |
+
osmagics.cd('"%s"' % ipdir)
|
| 624 |
+
with tt.AssertNotPrints(startdir):
|
| 625 |
+
osmagics.cd('-')
|
| 626 |
+
finally:
|
| 627 |
+
os.chdir(startdir)
|
| 628 |
+
|
| 629 |
+
|
| 630 |
+
def test_xmode():
|
| 631 |
+
# Calling xmode three times should be a no-op
|
| 632 |
+
xmode = _ip.InteractiveTB.mode
|
| 633 |
+
for i in range(4):
|
| 634 |
+
_ip.run_line_magic("xmode", "")
|
| 635 |
+
assert _ip.InteractiveTB.mode == xmode
|
| 636 |
+
|
| 637 |
+
def test_reset_hard():
|
| 638 |
+
monitor = []
|
| 639 |
+
class A(object):
|
| 640 |
+
def __del__(self):
|
| 641 |
+
monitor.append(1)
|
| 642 |
+
def __repr__(self):
|
| 643 |
+
return "<A instance>"
|
| 644 |
+
|
| 645 |
+
_ip.user_ns["a"] = A()
|
| 646 |
+
_ip.run_cell("a")
|
| 647 |
+
|
| 648 |
+
assert monitor == []
|
| 649 |
+
_ip.run_line_magic("reset", "-f")
|
| 650 |
+
assert monitor == [1]
|
| 651 |
+
|
| 652 |
+
class TestXdel(tt.TempFileMixin):
|
| 653 |
+
def test_xdel(self):
|
| 654 |
+
"""Test that references from %run are cleared by xdel."""
|
| 655 |
+
src = ("class A(object):\n"
|
| 656 |
+
" monitor = []\n"
|
| 657 |
+
" def __del__(self):\n"
|
| 658 |
+
" self.monitor.append(1)\n"
|
| 659 |
+
"a = A()\n")
|
| 660 |
+
self.mktmp(src)
|
| 661 |
+
# %run creates some hidden references...
|
| 662 |
+
_ip.run_line_magic("run", "%s" % self.fname)
|
| 663 |
+
# ... as does the displayhook.
|
| 664 |
+
_ip.run_cell("a")
|
| 665 |
+
|
| 666 |
+
monitor = _ip.user_ns["A"].monitor
|
| 667 |
+
assert monitor == []
|
| 668 |
+
|
| 669 |
+
_ip.run_line_magic("xdel", "a")
|
| 670 |
+
|
| 671 |
+
# Check that a's __del__ method has been called.
|
| 672 |
+
gc.collect(0)
|
| 673 |
+
assert monitor == [1]
|
| 674 |
+
|
| 675 |
+
def doctest_who():
|
| 676 |
+
"""doctest for %who
|
| 677 |
+
|
| 678 |
+
In [1]: %reset -sf
|
| 679 |
+
|
| 680 |
+
In [2]: alpha = 123
|
| 681 |
+
|
| 682 |
+
In [3]: beta = 'beta'
|
| 683 |
+
|
| 684 |
+
In [4]: %who int
|
| 685 |
+
alpha
|
| 686 |
+
|
| 687 |
+
In [5]: %who str
|
| 688 |
+
beta
|
| 689 |
+
|
| 690 |
+
In [6]: %whos
|
| 691 |
+
Variable Type Data/Info
|
| 692 |
+
----------------------------
|
| 693 |
+
alpha int 123
|
| 694 |
+
beta str beta
|
| 695 |
+
|
| 696 |
+
In [7]: %who_ls
|
| 697 |
+
Out[7]: ['alpha', 'beta']
|
| 698 |
+
"""
|
| 699 |
+
|
| 700 |
+
def test_whos():
|
| 701 |
+
"""Check that whos is protected against objects where repr() fails."""
|
| 702 |
+
class A(object):
|
| 703 |
+
def __repr__(self):
|
| 704 |
+
raise Exception()
|
| 705 |
+
_ip.user_ns['a'] = A()
|
| 706 |
+
_ip.run_line_magic("whos", "")
|
| 707 |
+
|
| 708 |
+
def doctest_precision():
|
| 709 |
+
"""doctest for %precision
|
| 710 |
+
|
| 711 |
+
In [1]: f = get_ipython().display_formatter.formatters['text/plain']
|
| 712 |
+
|
| 713 |
+
In [2]: %precision 5
|
| 714 |
+
Out[2]: '%.5f'
|
| 715 |
+
|
| 716 |
+
In [3]: f.float_format
|
| 717 |
+
Out[3]: '%.5f'
|
| 718 |
+
|
| 719 |
+
In [4]: %precision %e
|
| 720 |
+
Out[4]: '%e'
|
| 721 |
+
|
| 722 |
+
In [5]: f(3.1415927)
|
| 723 |
+
Out[5]: '3.141593e+00'
|
| 724 |
+
"""
|
| 725 |
+
|
| 726 |
+
|
| 727 |
+
def test_debug_magic():
|
| 728 |
+
"""Test debugging a small code with %debug
|
| 729 |
+
|
| 730 |
+
In [1]: with PdbTestInput(['c']):
|
| 731 |
+
...: %debug print("a b") #doctest: +ELLIPSIS
|
| 732 |
+
...:
|
| 733 |
+
...
|
| 734 |
+
ipdb> c
|
| 735 |
+
a b
|
| 736 |
+
In [2]:
|
| 737 |
+
"""
|
| 738 |
+
|
| 739 |
+
|
| 740 |
+
def test_debug_magic_locals():
|
| 741 |
+
"""Test debugging a small code with %debug with locals
|
| 742 |
+
|
| 743 |
+
In [1]: with PdbTestInput(['c']):
|
| 744 |
+
...: def fun():
|
| 745 |
+
...: res = 1
|
| 746 |
+
...: %debug print(res)
|
| 747 |
+
...: fun()
|
| 748 |
+
...:
|
| 749 |
+
...
|
| 750 |
+
ipdb> c
|
| 751 |
+
1
|
| 752 |
+
In [2]:
|
| 753 |
+
"""
|
| 754 |
+
|
| 755 |
+
def test_psearch():
|
| 756 |
+
with tt.AssertPrints("dict.fromkeys"):
|
| 757 |
+
_ip.run_cell("dict.fr*?")
|
| 758 |
+
with tt.AssertPrints("π.is_integer"):
|
| 759 |
+
_ip.run_cell("π = 3.14;\nπ.is_integ*?")
|
| 760 |
+
|
| 761 |
+
def test_timeit_shlex():
|
| 762 |
+
"""test shlex issues with timeit (#1109)"""
|
| 763 |
+
_ip.ex("def f(*a,**kw): pass")
|
| 764 |
+
_ip.run_line_magic("timeit", '-n1 "this is a bug".count(" ")')
|
| 765 |
+
_ip.run_line_magic("timeit", '-r1 -n1 f(" ", 1)')
|
| 766 |
+
_ip.run_line_magic("timeit", '-r1 -n1 f(" ", 1, " ", 2, " ")')
|
| 767 |
+
_ip.run_line_magic("timeit", '-r1 -n1 ("a " + "b")')
|
| 768 |
+
_ip.run_line_magic("timeit", '-r1 -n1 f("a " + "b")')
|
| 769 |
+
_ip.run_line_magic("timeit", '-r1 -n1 f("a " + "b ")')
|
| 770 |
+
|
| 771 |
+
|
| 772 |
+
def test_timeit_special_syntax():
|
| 773 |
+
"Test %%timeit with IPython special syntax"
|
| 774 |
+
@register_line_magic
|
| 775 |
+
def lmagic(line):
|
| 776 |
+
ip = get_ipython()
|
| 777 |
+
ip.user_ns['lmagic_out'] = line
|
| 778 |
+
|
| 779 |
+
# line mode test
|
| 780 |
+
_ip.run_line_magic("timeit", "-n1 -r1 %lmagic my line")
|
| 781 |
+
assert _ip.user_ns["lmagic_out"] == "my line"
|
| 782 |
+
# cell mode test
|
| 783 |
+
_ip.run_cell_magic("timeit", "-n1 -r1", "%lmagic my line2")
|
| 784 |
+
assert _ip.user_ns["lmagic_out"] == "my line2"
|
| 785 |
+
|
| 786 |
+
|
| 787 |
+
def test_timeit_return():
|
| 788 |
+
"""
|
| 789 |
+
test whether timeit -o return object
|
| 790 |
+
"""
|
| 791 |
+
|
| 792 |
+
res = _ip.run_line_magic('timeit','-n10 -r10 -o 1')
|
| 793 |
+
assert(res is not None)
|
| 794 |
+
|
| 795 |
+
def test_timeit_quiet():
|
| 796 |
+
"""
|
| 797 |
+
test quiet option of timeit magic
|
| 798 |
+
"""
|
| 799 |
+
with tt.AssertNotPrints("loops"):
|
| 800 |
+
_ip.run_cell("%timeit -n1 -r1 -q 1")
|
| 801 |
+
|
| 802 |
+
def test_timeit_return_quiet():
|
| 803 |
+
with tt.AssertNotPrints("loops"):
|
| 804 |
+
res = _ip.run_line_magic('timeit', '-n1 -r1 -q -o 1')
|
| 805 |
+
assert (res is not None)
|
| 806 |
+
|
| 807 |
+
def test_timeit_invalid_return():
|
| 808 |
+
with pytest.raises(SyntaxError):
|
| 809 |
+
_ip.run_line_magic('timeit', 'return')
|
| 810 |
+
|
| 811 |
+
@dec.skipif(execution.profile is None)
|
| 812 |
+
def test_prun_special_syntax():
|
| 813 |
+
"Test %%prun with IPython special syntax"
|
| 814 |
+
@register_line_magic
|
| 815 |
+
def lmagic(line):
|
| 816 |
+
ip = get_ipython()
|
| 817 |
+
ip.user_ns['lmagic_out'] = line
|
| 818 |
+
|
| 819 |
+
# line mode test
|
| 820 |
+
_ip.run_line_magic("prun", "-q %lmagic my line")
|
| 821 |
+
assert _ip.user_ns["lmagic_out"] == "my line"
|
| 822 |
+
# cell mode test
|
| 823 |
+
_ip.run_cell_magic("prun", "-q", "%lmagic my line2")
|
| 824 |
+
assert _ip.user_ns["lmagic_out"] == "my line2"
|
| 825 |
+
|
| 826 |
+
|
| 827 |
+
@dec.skipif(execution.profile is None)
|
| 828 |
+
def test_prun_quotes():
|
| 829 |
+
"Test that prun does not clobber string escapes (GH #1302)"
|
| 830 |
+
_ip.run_line_magic("prun", r"-q x = '\t'")
|
| 831 |
+
assert _ip.user_ns["x"] == "\t"
|
| 832 |
+
|
| 833 |
+
|
| 834 |
+
def test_extension():
|
| 835 |
+
# Debugging information for failures of this test
|
| 836 |
+
print('sys.path:')
|
| 837 |
+
for p in sys.path:
|
| 838 |
+
print(' ', p)
|
| 839 |
+
print('CWD', os.getcwd())
|
| 840 |
+
|
| 841 |
+
pytest.raises(ImportError, _ip.run_line_magic, "load_ext", "daft_extension")
|
| 842 |
+
daft_path = os.path.join(os.path.dirname(__file__), "daft_extension")
|
| 843 |
+
sys.path.insert(0, daft_path)
|
| 844 |
+
try:
|
| 845 |
+
_ip.user_ns.pop('arq', None)
|
| 846 |
+
invalidate_caches() # Clear import caches
|
| 847 |
+
_ip.run_line_magic("load_ext", "daft_extension")
|
| 848 |
+
assert _ip.user_ns["arq"] == 185
|
| 849 |
+
_ip.run_line_magic("unload_ext", "daft_extension")
|
| 850 |
+
assert 'arq' not in _ip.user_ns
|
| 851 |
+
finally:
|
| 852 |
+
sys.path.remove(daft_path)
|
| 853 |
+
|
| 854 |
+
|
| 855 |
+
def test_notebook_export_json():
|
| 856 |
+
pytest.importorskip("nbformat")
|
| 857 |
+
_ip = get_ipython()
|
| 858 |
+
_ip.history_manager.reset() # Clear any existing history.
|
| 859 |
+
cmds = ["a=1", "def b():\n return a**2", "print('noël, été', b())"]
|
| 860 |
+
for i, cmd in enumerate(cmds, start=1):
|
| 861 |
+
_ip.history_manager.store_inputs(i, cmd)
|
| 862 |
+
with TemporaryDirectory() as td:
|
| 863 |
+
outfile = os.path.join(td, "nb.ipynb")
|
| 864 |
+
_ip.run_line_magic("notebook", "%s" % outfile)
|
| 865 |
+
|
| 866 |
+
|
| 867 |
+
class TestEnv(TestCase):
|
| 868 |
+
|
| 869 |
+
def test_env(self):
|
| 870 |
+
env = _ip.run_line_magic("env", "")
|
| 871 |
+
self.assertTrue(isinstance(env, dict))
|
| 872 |
+
|
| 873 |
+
def test_env_secret(self):
|
| 874 |
+
env = _ip.run_line_magic("env", "")
|
| 875 |
+
hidden = "<hidden>"
|
| 876 |
+
with mock.patch.dict(
|
| 877 |
+
os.environ,
|
| 878 |
+
{
|
| 879 |
+
"API_KEY": "abc123",
|
| 880 |
+
"SECRET_THING": "ssshhh",
|
| 881 |
+
"JUPYTER_TOKEN": "",
|
| 882 |
+
"VAR": "abc"
|
| 883 |
+
}
|
| 884 |
+
):
|
| 885 |
+
env = _ip.run_line_magic("env", "")
|
| 886 |
+
assert env["API_KEY"] == hidden
|
| 887 |
+
assert env["SECRET_THING"] == hidden
|
| 888 |
+
assert env["JUPYTER_TOKEN"] == hidden
|
| 889 |
+
assert env["VAR"] == "abc"
|
| 890 |
+
|
| 891 |
+
def test_env_get_set_simple(self):
|
| 892 |
+
env = _ip.run_line_magic("env", "var val1")
|
| 893 |
+
self.assertEqual(env, None)
|
| 894 |
+
self.assertEqual(os.environ["var"], "val1")
|
| 895 |
+
self.assertEqual(_ip.run_line_magic("env", "var"), "val1")
|
| 896 |
+
env = _ip.run_line_magic("env", "var=val2")
|
| 897 |
+
self.assertEqual(env, None)
|
| 898 |
+
self.assertEqual(os.environ['var'], 'val2')
|
| 899 |
+
|
| 900 |
+
def test_env_get_set_complex(self):
|
| 901 |
+
env = _ip.run_line_magic("env", "var 'val1 '' 'val2")
|
| 902 |
+
self.assertEqual(env, None)
|
| 903 |
+
self.assertEqual(os.environ['var'], "'val1 '' 'val2")
|
| 904 |
+
self.assertEqual(_ip.run_line_magic("env", "var"), "'val1 '' 'val2")
|
| 905 |
+
env = _ip.run_line_magic("env", 'var=val2 val3="val4')
|
| 906 |
+
self.assertEqual(env, None)
|
| 907 |
+
self.assertEqual(os.environ['var'], 'val2 val3="val4')
|
| 908 |
+
|
| 909 |
+
def test_env_set_bad_input(self):
|
| 910 |
+
self.assertRaises(UsageError, lambda: _ip.run_line_magic("set_env", "var"))
|
| 911 |
+
|
| 912 |
+
def test_env_set_whitespace(self):
|
| 913 |
+
self.assertRaises(UsageError, lambda: _ip.run_line_magic("env", "var A=B"))
|
| 914 |
+
|
| 915 |
+
|
| 916 |
+
class CellMagicTestCase(TestCase):
|
| 917 |
+
|
| 918 |
+
def check_ident(self, magic):
|
| 919 |
+
# Manually called, we get the result
|
| 920 |
+
out = _ip.run_cell_magic(magic, "a", "b")
|
| 921 |
+
assert out == ("a", "b")
|
| 922 |
+
# Via run_cell, it goes into the user's namespace via displayhook
|
| 923 |
+
_ip.run_cell("%%" + magic + " c\nd\n")
|
| 924 |
+
assert _ip.user_ns["_"] == ("c", "d\n")
|
| 925 |
+
|
| 926 |
+
def test_cell_magic_func_deco(self):
|
| 927 |
+
"Cell magic using simple decorator"
|
| 928 |
+
@register_cell_magic
|
| 929 |
+
def cellm(line, cell):
|
| 930 |
+
return line, cell
|
| 931 |
+
|
| 932 |
+
self.check_ident('cellm')
|
| 933 |
+
|
| 934 |
+
def test_cell_magic_reg(self):
|
| 935 |
+
"Cell magic manually registered"
|
| 936 |
+
def cellm(line, cell):
|
| 937 |
+
return line, cell
|
| 938 |
+
|
| 939 |
+
_ip.register_magic_function(cellm, 'cell', 'cellm2')
|
| 940 |
+
self.check_ident('cellm2')
|
| 941 |
+
|
| 942 |
+
def test_cell_magic_class(self):
|
| 943 |
+
"Cell magics declared via a class"
|
| 944 |
+
@magics_class
|
| 945 |
+
class MyMagics(Magics):
|
| 946 |
+
|
| 947 |
+
@cell_magic
|
| 948 |
+
def cellm3(self, line, cell):
|
| 949 |
+
return line, cell
|
| 950 |
+
|
| 951 |
+
_ip.register_magics(MyMagics)
|
| 952 |
+
self.check_ident('cellm3')
|
| 953 |
+
|
| 954 |
+
def test_cell_magic_class2(self):
|
| 955 |
+
"Cell magics declared via a class, #2"
|
| 956 |
+
@magics_class
|
| 957 |
+
class MyMagics2(Magics):
|
| 958 |
+
|
| 959 |
+
@cell_magic('cellm4')
|
| 960 |
+
def cellm33(self, line, cell):
|
| 961 |
+
return line, cell
|
| 962 |
+
|
| 963 |
+
_ip.register_magics(MyMagics2)
|
| 964 |
+
self.check_ident('cellm4')
|
| 965 |
+
# Check that nothing is registered as 'cellm33'
|
| 966 |
+
c33 = _ip.find_cell_magic('cellm33')
|
| 967 |
+
assert c33 == None
|
| 968 |
+
|
| 969 |
+
def test_file():
|
| 970 |
+
"""Basic %%writefile"""
|
| 971 |
+
ip = get_ipython()
|
| 972 |
+
with TemporaryDirectory() as td:
|
| 973 |
+
fname = os.path.join(td, "file1")
|
| 974 |
+
ip.run_cell_magic(
|
| 975 |
+
"writefile",
|
| 976 |
+
fname,
|
| 977 |
+
"\n".join(
|
| 978 |
+
[
|
| 979 |
+
"line1",
|
| 980 |
+
"line2",
|
| 981 |
+
]
|
| 982 |
+
),
|
| 983 |
+
)
|
| 984 |
+
s = Path(fname).read_text(encoding="utf-8")
|
| 985 |
+
assert "line1\n" in s
|
| 986 |
+
assert "line2" in s
|
| 987 |
+
|
| 988 |
+
|
| 989 |
+
@dec.skip_win32
|
| 990 |
+
def test_file_single_quote():
|
| 991 |
+
"""Basic %%writefile with embedded single quotes"""
|
| 992 |
+
ip = get_ipython()
|
| 993 |
+
with TemporaryDirectory() as td:
|
| 994 |
+
fname = os.path.join(td, "'file1'")
|
| 995 |
+
ip.run_cell_magic(
|
| 996 |
+
"writefile",
|
| 997 |
+
fname,
|
| 998 |
+
"\n".join(
|
| 999 |
+
[
|
| 1000 |
+
"line1",
|
| 1001 |
+
"line2",
|
| 1002 |
+
]
|
| 1003 |
+
),
|
| 1004 |
+
)
|
| 1005 |
+
s = Path(fname).read_text(encoding="utf-8")
|
| 1006 |
+
assert "line1\n" in s
|
| 1007 |
+
assert "line2" in s
|
| 1008 |
+
|
| 1009 |
+
|
| 1010 |
+
@dec.skip_win32
|
| 1011 |
+
def test_file_double_quote():
|
| 1012 |
+
"""Basic %%writefile with embedded double quotes"""
|
| 1013 |
+
ip = get_ipython()
|
| 1014 |
+
with TemporaryDirectory() as td:
|
| 1015 |
+
fname = os.path.join(td, '"file1"')
|
| 1016 |
+
ip.run_cell_magic(
|
| 1017 |
+
"writefile",
|
| 1018 |
+
fname,
|
| 1019 |
+
"\n".join(
|
| 1020 |
+
[
|
| 1021 |
+
"line1",
|
| 1022 |
+
"line2",
|
| 1023 |
+
]
|
| 1024 |
+
),
|
| 1025 |
+
)
|
| 1026 |
+
s = Path(fname).read_text(encoding="utf-8")
|
| 1027 |
+
assert "line1\n" in s
|
| 1028 |
+
assert "line2" in s
|
| 1029 |
+
|
| 1030 |
+
|
| 1031 |
+
def test_file_var_expand():
|
| 1032 |
+
"""%%writefile $filename"""
|
| 1033 |
+
ip = get_ipython()
|
| 1034 |
+
with TemporaryDirectory() as td:
|
| 1035 |
+
fname = os.path.join(td, "file1")
|
| 1036 |
+
ip.user_ns["filename"] = fname
|
| 1037 |
+
ip.run_cell_magic(
|
| 1038 |
+
"writefile",
|
| 1039 |
+
"$filename",
|
| 1040 |
+
"\n".join(
|
| 1041 |
+
[
|
| 1042 |
+
"line1",
|
| 1043 |
+
"line2",
|
| 1044 |
+
]
|
| 1045 |
+
),
|
| 1046 |
+
)
|
| 1047 |
+
s = Path(fname).read_text(encoding="utf-8")
|
| 1048 |
+
assert "line1\n" in s
|
| 1049 |
+
assert "line2" in s
|
| 1050 |
+
|
| 1051 |
+
|
| 1052 |
+
def test_file_unicode():
|
| 1053 |
+
"""%%writefile with unicode cell"""
|
| 1054 |
+
ip = get_ipython()
|
| 1055 |
+
with TemporaryDirectory() as td:
|
| 1056 |
+
fname = os.path.join(td, 'file1')
|
| 1057 |
+
ip.run_cell_magic("writefile", fname, u'\n'.join([
|
| 1058 |
+
u'liné1',
|
| 1059 |
+
u'liné2',
|
| 1060 |
+
]))
|
| 1061 |
+
with io.open(fname, encoding='utf-8') as f:
|
| 1062 |
+
s = f.read()
|
| 1063 |
+
assert "liné1\n" in s
|
| 1064 |
+
assert "liné2" in s
|
| 1065 |
+
|
| 1066 |
+
|
| 1067 |
+
def test_file_amend():
|
| 1068 |
+
"""%%writefile -a amends files"""
|
| 1069 |
+
ip = get_ipython()
|
| 1070 |
+
with TemporaryDirectory() as td:
|
| 1071 |
+
fname = os.path.join(td, "file2")
|
| 1072 |
+
ip.run_cell_magic(
|
| 1073 |
+
"writefile",
|
| 1074 |
+
fname,
|
| 1075 |
+
"\n".join(
|
| 1076 |
+
[
|
| 1077 |
+
"line1",
|
| 1078 |
+
"line2",
|
| 1079 |
+
]
|
| 1080 |
+
),
|
| 1081 |
+
)
|
| 1082 |
+
ip.run_cell_magic(
|
| 1083 |
+
"writefile",
|
| 1084 |
+
"-a %s" % fname,
|
| 1085 |
+
"\n".join(
|
| 1086 |
+
[
|
| 1087 |
+
"line3",
|
| 1088 |
+
"line4",
|
| 1089 |
+
]
|
| 1090 |
+
),
|
| 1091 |
+
)
|
| 1092 |
+
s = Path(fname).read_text(encoding="utf-8")
|
| 1093 |
+
assert "line1\n" in s
|
| 1094 |
+
assert "line3\n" in s
|
| 1095 |
+
|
| 1096 |
+
|
| 1097 |
+
def test_file_spaces():
|
| 1098 |
+
"""%%file with spaces in filename"""
|
| 1099 |
+
ip = get_ipython()
|
| 1100 |
+
with TemporaryWorkingDirectory() as td:
|
| 1101 |
+
fname = "file name"
|
| 1102 |
+
ip.run_cell_magic(
|
| 1103 |
+
"file",
|
| 1104 |
+
'"%s"' % fname,
|
| 1105 |
+
"\n".join(
|
| 1106 |
+
[
|
| 1107 |
+
"line1",
|
| 1108 |
+
"line2",
|
| 1109 |
+
]
|
| 1110 |
+
),
|
| 1111 |
+
)
|
| 1112 |
+
s = Path(fname).read_text(encoding="utf-8")
|
| 1113 |
+
assert "line1\n" in s
|
| 1114 |
+
assert "line2" in s
|
| 1115 |
+
|
| 1116 |
+
|
| 1117 |
+
def test_script_config():
|
| 1118 |
+
ip = get_ipython()
|
| 1119 |
+
ip.config.ScriptMagics.script_magics = ['whoda']
|
| 1120 |
+
sm = script.ScriptMagics(shell=ip)
|
| 1121 |
+
assert "whoda" in sm.magics["cell"]
|
| 1122 |
+
|
| 1123 |
+
|
| 1124 |
+
def test_script_out():
|
| 1125 |
+
ip = get_ipython()
|
| 1126 |
+
ip.run_cell_magic("script", f"--out output {sys.executable}", "print('hi')")
|
| 1127 |
+
assert ip.user_ns["output"].strip() == "hi"
|
| 1128 |
+
|
| 1129 |
+
|
| 1130 |
+
def test_script_err():
|
| 1131 |
+
ip = get_ipython()
|
| 1132 |
+
ip.run_cell_magic(
|
| 1133 |
+
"script",
|
| 1134 |
+
f"--err error {sys.executable}",
|
| 1135 |
+
"import sys; print('hello', file=sys.stderr)",
|
| 1136 |
+
)
|
| 1137 |
+
assert ip.user_ns["error"].strip() == "hello"
|
| 1138 |
+
|
| 1139 |
+
|
| 1140 |
+
def test_script_out_err():
|
| 1141 |
+
ip = get_ipython()
|
| 1142 |
+
ip.run_cell_magic(
|
| 1143 |
+
"script",
|
| 1144 |
+
f"--out output --err error {sys.executable}",
|
| 1145 |
+
"\n".join(
|
| 1146 |
+
[
|
| 1147 |
+
"import sys",
|
| 1148 |
+
"print('hi')",
|
| 1149 |
+
"print('hello', file=sys.stderr)",
|
| 1150 |
+
]
|
| 1151 |
+
),
|
| 1152 |
+
)
|
| 1153 |
+
assert ip.user_ns["output"].strip() == "hi"
|
| 1154 |
+
assert ip.user_ns["error"].strip() == "hello"
|
| 1155 |
+
|
| 1156 |
+
|
| 1157 |
+
async def test_script_bg_out():
|
| 1158 |
+
ip = get_ipython()
|
| 1159 |
+
ip.run_cell_magic("script", f"--bg --out output {sys.executable}", "print('hi')")
|
| 1160 |
+
assert (await ip.user_ns["output"].read()).strip() == b"hi"
|
| 1161 |
+
assert ip.user_ns["output"].at_eof()
|
| 1162 |
+
|
| 1163 |
+
|
| 1164 |
+
async def test_script_bg_err():
|
| 1165 |
+
ip = get_ipython()
|
| 1166 |
+
ip.run_cell_magic(
|
| 1167 |
+
"script",
|
| 1168 |
+
f"--bg --err error {sys.executable}",
|
| 1169 |
+
"import sys; print('hello', file=sys.stderr)",
|
| 1170 |
+
)
|
| 1171 |
+
assert (await ip.user_ns["error"].read()).strip() == b"hello"
|
| 1172 |
+
assert ip.user_ns["error"].at_eof()
|
| 1173 |
+
|
| 1174 |
+
|
| 1175 |
+
async def test_script_bg_out_err():
|
| 1176 |
+
ip = get_ipython()
|
| 1177 |
+
ip.run_cell_magic(
|
| 1178 |
+
"script",
|
| 1179 |
+
f"--bg --out output --err error {sys.executable}",
|
| 1180 |
+
"\n".join(
|
| 1181 |
+
[
|
| 1182 |
+
"import sys",
|
| 1183 |
+
"print('hi')",
|
| 1184 |
+
"print('hello', file=sys.stderr)",
|
| 1185 |
+
]
|
| 1186 |
+
),
|
| 1187 |
+
)
|
| 1188 |
+
assert (await ip.user_ns["output"].read()).strip() == b"hi"
|
| 1189 |
+
assert (await ip.user_ns["error"].read()).strip() == b"hello"
|
| 1190 |
+
assert ip.user_ns["output"].at_eof()
|
| 1191 |
+
assert ip.user_ns["error"].at_eof()
|
| 1192 |
+
|
| 1193 |
+
|
| 1194 |
+
async def test_script_bg_proc():
|
| 1195 |
+
ip = get_ipython()
|
| 1196 |
+
ip.run_cell_magic(
|
| 1197 |
+
"script",
|
| 1198 |
+
f"--bg --out output --proc p {sys.executable}",
|
| 1199 |
+
"\n".join(
|
| 1200 |
+
[
|
| 1201 |
+
"import sys",
|
| 1202 |
+
"print('hi')",
|
| 1203 |
+
"print('hello', file=sys.stderr)",
|
| 1204 |
+
]
|
| 1205 |
+
),
|
| 1206 |
+
)
|
| 1207 |
+
p = ip.user_ns["p"]
|
| 1208 |
+
await p.wait()
|
| 1209 |
+
assert p.returncode == 0
|
| 1210 |
+
assert (await p.stdout.read()).strip() == b"hi"
|
| 1211 |
+
# not captured, so empty
|
| 1212 |
+
assert (await p.stderr.read()) == b""
|
| 1213 |
+
assert p.stdout.at_eof()
|
| 1214 |
+
assert p.stderr.at_eof()
|
| 1215 |
+
|
| 1216 |
+
|
| 1217 |
+
def test_script_defaults():
|
| 1218 |
+
ip = get_ipython()
|
| 1219 |
+
for cmd in ['sh', 'bash', 'perl', 'ruby']:
|
| 1220 |
+
try:
|
| 1221 |
+
find_cmd(cmd)
|
| 1222 |
+
except Exception:
|
| 1223 |
+
pass
|
| 1224 |
+
else:
|
| 1225 |
+
assert cmd in ip.magics_manager.magics["cell"]
|
| 1226 |
+
|
| 1227 |
+
|
| 1228 |
+
@magics_class
|
| 1229 |
+
class FooFoo(Magics):
|
| 1230 |
+
"""class with both %foo and %%foo magics"""
|
| 1231 |
+
@line_magic('foo')
|
| 1232 |
+
def line_foo(self, line):
|
| 1233 |
+
"I am line foo"
|
| 1234 |
+
pass
|
| 1235 |
+
|
| 1236 |
+
@cell_magic("foo")
|
| 1237 |
+
def cell_foo(self, line, cell):
|
| 1238 |
+
"I am cell foo, not line foo"
|
| 1239 |
+
pass
|
| 1240 |
+
|
| 1241 |
+
def test_line_cell_info():
|
| 1242 |
+
"""%%foo and %foo magics are distinguishable to inspect"""
|
| 1243 |
+
ip = get_ipython()
|
| 1244 |
+
ip.magics_manager.register(FooFoo)
|
| 1245 |
+
oinfo = ip.object_inspect("foo")
|
| 1246 |
+
assert oinfo["found"] is True
|
| 1247 |
+
assert oinfo["ismagic"] is True
|
| 1248 |
+
|
| 1249 |
+
oinfo = ip.object_inspect("%%foo")
|
| 1250 |
+
assert oinfo["found"] is True
|
| 1251 |
+
assert oinfo["ismagic"] is True
|
| 1252 |
+
assert oinfo["docstring"] == FooFoo.cell_foo.__doc__
|
| 1253 |
+
|
| 1254 |
+
oinfo = ip.object_inspect("%foo")
|
| 1255 |
+
assert oinfo["found"] is True
|
| 1256 |
+
assert oinfo["ismagic"] is True
|
| 1257 |
+
assert oinfo["docstring"] == FooFoo.line_foo.__doc__
|
| 1258 |
+
|
| 1259 |
+
|
| 1260 |
+
def test_multiple_magics():
|
| 1261 |
+
ip = get_ipython()
|
| 1262 |
+
foo1 = FooFoo(ip)
|
| 1263 |
+
foo2 = FooFoo(ip)
|
| 1264 |
+
mm = ip.magics_manager
|
| 1265 |
+
mm.register(foo1)
|
| 1266 |
+
assert mm.magics["line"]["foo"].__self__ is foo1
|
| 1267 |
+
mm.register(foo2)
|
| 1268 |
+
assert mm.magics["line"]["foo"].__self__ is foo2
|
| 1269 |
+
|
| 1270 |
+
|
| 1271 |
+
def test_alias_magic():
|
| 1272 |
+
"""Test %alias_magic."""
|
| 1273 |
+
ip = get_ipython()
|
| 1274 |
+
mm = ip.magics_manager
|
| 1275 |
+
|
| 1276 |
+
# Basic operation: both cell and line magics are created, if possible.
|
| 1277 |
+
ip.run_line_magic("alias_magic", "timeit_alias timeit")
|
| 1278 |
+
assert "timeit_alias" in mm.magics["line"]
|
| 1279 |
+
assert "timeit_alias" in mm.magics["cell"]
|
| 1280 |
+
|
| 1281 |
+
# --cell is specified, line magic not created.
|
| 1282 |
+
ip.run_line_magic("alias_magic", "--cell timeit_cell_alias timeit")
|
| 1283 |
+
assert "timeit_cell_alias" not in mm.magics["line"]
|
| 1284 |
+
assert "timeit_cell_alias" in mm.magics["cell"]
|
| 1285 |
+
|
| 1286 |
+
# Test that line alias is created successfully.
|
| 1287 |
+
ip.run_line_magic("alias_magic", "--line env_alias env")
|
| 1288 |
+
assert ip.run_line_magic("env", "") == ip.run_line_magic("env_alias", "")
|
| 1289 |
+
|
| 1290 |
+
# Test that line alias with parameters passed in is created successfully.
|
| 1291 |
+
ip.run_line_magic(
|
| 1292 |
+
"alias_magic", "--line history_alias history --params " + shlex.quote("3")
|
| 1293 |
+
)
|
| 1294 |
+
assert "history_alias" in mm.magics["line"]
|
| 1295 |
+
|
| 1296 |
+
|
| 1297 |
+
def test_save():
|
| 1298 |
+
"""Test %save."""
|
| 1299 |
+
ip = get_ipython()
|
| 1300 |
+
ip.history_manager.reset() # Clear any existing history.
|
| 1301 |
+
cmds = ["a=1", "def b():\n return a**2", "print(a, b())"]
|
| 1302 |
+
for i, cmd in enumerate(cmds, start=1):
|
| 1303 |
+
ip.history_manager.store_inputs(i, cmd)
|
| 1304 |
+
with TemporaryDirectory() as tmpdir:
|
| 1305 |
+
file = os.path.join(tmpdir, "testsave.py")
|
| 1306 |
+
ip.run_line_magic("save", "%s 1-10" % file)
|
| 1307 |
+
content = Path(file).read_text(encoding="utf-8")
|
| 1308 |
+
assert content.count(cmds[0]) == 1
|
| 1309 |
+
assert "coding: utf-8" in content
|
| 1310 |
+
ip.run_line_magic("save", "-a %s 1-10" % file)
|
| 1311 |
+
content = Path(file).read_text(encoding="utf-8")
|
| 1312 |
+
assert content.count(cmds[0]) == 2
|
| 1313 |
+
assert "coding: utf-8" in content
|
| 1314 |
+
|
| 1315 |
+
|
| 1316 |
+
def test_save_with_no_args():
|
| 1317 |
+
ip = get_ipython()
|
| 1318 |
+
ip.history_manager.reset() # Clear any existing history.
|
| 1319 |
+
cmds = ["a=1", "def b():\n return a**2", "print(a, b())", "%save"]
|
| 1320 |
+
for i, cmd in enumerate(cmds, start=1):
|
| 1321 |
+
ip.history_manager.store_inputs(i, cmd)
|
| 1322 |
+
|
| 1323 |
+
with TemporaryDirectory() as tmpdir:
|
| 1324 |
+
path = os.path.join(tmpdir, "testsave.py")
|
| 1325 |
+
ip.run_line_magic("save", path)
|
| 1326 |
+
content = Path(path).read_text(encoding="utf-8")
|
| 1327 |
+
expected_content = dedent(
|
| 1328 |
+
"""\
|
| 1329 |
+
# coding: utf-8
|
| 1330 |
+
a=1
|
| 1331 |
+
def b():
|
| 1332 |
+
return a**2
|
| 1333 |
+
print(a, b())
|
| 1334 |
+
"""
|
| 1335 |
+
)
|
| 1336 |
+
assert content == expected_content
|
| 1337 |
+
|
| 1338 |
+
|
| 1339 |
+
def test_store():
|
| 1340 |
+
"""Test %store."""
|
| 1341 |
+
ip = get_ipython()
|
| 1342 |
+
ip.run_line_magic('load_ext', 'storemagic')
|
| 1343 |
+
|
| 1344 |
+
# make sure the storage is empty
|
| 1345 |
+
ip.run_line_magic("store", "-z")
|
| 1346 |
+
ip.user_ns["var"] = 42
|
| 1347 |
+
ip.run_line_magic("store", "var")
|
| 1348 |
+
ip.user_ns["var"] = 39
|
| 1349 |
+
ip.run_line_magic("store", "-r")
|
| 1350 |
+
assert ip.user_ns["var"] == 42
|
| 1351 |
+
|
| 1352 |
+
ip.run_line_magic("store", "-d var")
|
| 1353 |
+
ip.user_ns["var"] = 39
|
| 1354 |
+
ip.run_line_magic("store", "-r")
|
| 1355 |
+
assert ip.user_ns["var"] == 39
|
| 1356 |
+
|
| 1357 |
+
|
| 1358 |
+
def _run_edit_test(arg_s, exp_filename=None,
|
| 1359 |
+
exp_lineno=-1,
|
| 1360 |
+
exp_contents=None,
|
| 1361 |
+
exp_is_temp=None):
|
| 1362 |
+
ip = get_ipython()
|
| 1363 |
+
M = code.CodeMagics(ip)
|
| 1364 |
+
last_call = ['','']
|
| 1365 |
+
opts,args = M.parse_options(arg_s,'prxn:')
|
| 1366 |
+
filename, lineno, is_temp = M._find_edit_target(ip, args, opts, last_call)
|
| 1367 |
+
|
| 1368 |
+
if exp_filename is not None:
|
| 1369 |
+
assert exp_filename == filename
|
| 1370 |
+
if exp_contents is not None:
|
| 1371 |
+
with io.open(filename, 'r', encoding='utf-8') as f:
|
| 1372 |
+
contents = f.read()
|
| 1373 |
+
assert exp_contents == contents
|
| 1374 |
+
if exp_lineno != -1:
|
| 1375 |
+
assert exp_lineno == lineno
|
| 1376 |
+
if exp_is_temp is not None:
|
| 1377 |
+
assert exp_is_temp == is_temp
|
| 1378 |
+
|
| 1379 |
+
|
| 1380 |
+
def test_edit_interactive():
|
| 1381 |
+
"""%edit on interactively defined objects"""
|
| 1382 |
+
ip = get_ipython()
|
| 1383 |
+
n = ip.execution_count
|
| 1384 |
+
ip.run_cell("def foo(): return 1", store_history=True)
|
| 1385 |
+
|
| 1386 |
+
with pytest.raises(code.InteractivelyDefined) as e:
|
| 1387 |
+
_run_edit_test("foo")
|
| 1388 |
+
assert e.value.index == n
|
| 1389 |
+
|
| 1390 |
+
|
| 1391 |
+
def test_edit_cell():
|
| 1392 |
+
"""%edit [cell id]"""
|
| 1393 |
+
ip = get_ipython()
|
| 1394 |
+
|
| 1395 |
+
ip.run_cell("def foo(): return 1", store_history=True)
|
| 1396 |
+
|
| 1397 |
+
# test
|
| 1398 |
+
_run_edit_test("1", exp_contents=ip.user_ns['In'][1], exp_is_temp=True)
|
| 1399 |
+
|
| 1400 |
+
def test_edit_fname():
|
| 1401 |
+
"""%edit file"""
|
| 1402 |
+
# test
|
| 1403 |
+
_run_edit_test("test file.py", exp_filename="test file.py")
|
| 1404 |
+
|
| 1405 |
+
def test_bookmark():
|
| 1406 |
+
ip = get_ipython()
|
| 1407 |
+
ip.run_line_magic('bookmark', 'bmname')
|
| 1408 |
+
with tt.AssertPrints('bmname'):
|
| 1409 |
+
ip.run_line_magic('bookmark', '-l')
|
| 1410 |
+
ip.run_line_magic('bookmark', '-d bmname')
|
| 1411 |
+
|
| 1412 |
+
def test_ls_magic():
|
| 1413 |
+
ip = get_ipython()
|
| 1414 |
+
json_formatter = ip.display_formatter.formatters['application/json']
|
| 1415 |
+
json_formatter.enabled = True
|
| 1416 |
+
lsmagic = ip.run_line_magic("lsmagic", "")
|
| 1417 |
+
with warnings.catch_warnings(record=True) as w:
|
| 1418 |
+
j = json_formatter(lsmagic)
|
| 1419 |
+
assert sorted(j) == ["cell", "line"]
|
| 1420 |
+
assert w == [] # no warnings
|
| 1421 |
+
|
| 1422 |
+
|
| 1423 |
+
def test_strip_initial_indent():
|
| 1424 |
+
def sii(s):
|
| 1425 |
+
lines = s.splitlines()
|
| 1426 |
+
return '\n'.join(code.strip_initial_indent(lines))
|
| 1427 |
+
|
| 1428 |
+
assert sii(" a = 1\nb = 2") == "a = 1\nb = 2"
|
| 1429 |
+
assert sii(" a\n b\nc") == "a\n b\nc"
|
| 1430 |
+
assert sii("a\n b") == "a\n b"
|
| 1431 |
+
|
| 1432 |
+
def test_logging_magic_quiet_from_arg():
|
| 1433 |
+
_ip.config.LoggingMagics.quiet = False
|
| 1434 |
+
lm = logging.LoggingMagics(shell=_ip)
|
| 1435 |
+
with TemporaryDirectory() as td:
|
| 1436 |
+
try:
|
| 1437 |
+
with tt.AssertNotPrints(re.compile("Activating.*")):
|
| 1438 |
+
lm.logstart('-q {}'.format(
|
| 1439 |
+
os.path.join(td, "quiet_from_arg.log")))
|
| 1440 |
+
finally:
|
| 1441 |
+
_ip.logger.logstop()
|
| 1442 |
+
|
| 1443 |
+
def test_logging_magic_quiet_from_config():
|
| 1444 |
+
_ip.config.LoggingMagics.quiet = True
|
| 1445 |
+
lm = logging.LoggingMagics(shell=_ip)
|
| 1446 |
+
with TemporaryDirectory() as td:
|
| 1447 |
+
try:
|
| 1448 |
+
with tt.AssertNotPrints(re.compile("Activating.*")):
|
| 1449 |
+
lm.logstart(os.path.join(td, "quiet_from_config.log"))
|
| 1450 |
+
finally:
|
| 1451 |
+
_ip.logger.logstop()
|
| 1452 |
+
|
| 1453 |
+
|
| 1454 |
+
def test_logging_magic_not_quiet():
|
| 1455 |
+
_ip.config.LoggingMagics.quiet = False
|
| 1456 |
+
lm = logging.LoggingMagics(shell=_ip)
|
| 1457 |
+
with TemporaryDirectory() as td:
|
| 1458 |
+
try:
|
| 1459 |
+
with tt.AssertPrints(re.compile("Activating.*")):
|
| 1460 |
+
lm.logstart(os.path.join(td, "not_quiet.log"))
|
| 1461 |
+
finally:
|
| 1462 |
+
_ip.logger.logstop()
|
| 1463 |
+
|
| 1464 |
+
|
| 1465 |
+
def test_time_no_var_expand():
|
| 1466 |
+
_ip.user_ns["a"] = 5
|
| 1467 |
+
_ip.user_ns["b"] = []
|
| 1468 |
+
_ip.run_line_magic("time", 'b.append("{a}")')
|
| 1469 |
+
assert _ip.user_ns["b"] == ["{a}"]
|
| 1470 |
+
|
| 1471 |
+
|
| 1472 |
+
# this is slow, put at the end for local testing.
|
| 1473 |
+
def test_timeit_arguments():
|
| 1474 |
+
"Test valid timeit arguments, should not cause SyntaxError (GH #1269)"
|
| 1475 |
+
_ip.run_line_magic("timeit", "-n1 -r1 a=('#')")
|
| 1476 |
+
|
| 1477 |
+
|
| 1478 |
+
MINIMAL_LAZY_MAGIC = """
|
| 1479 |
+
from IPython.core.magic import (
|
| 1480 |
+
Magics,
|
| 1481 |
+
magics_class,
|
| 1482 |
+
line_magic,
|
| 1483 |
+
cell_magic,
|
| 1484 |
+
)
|
| 1485 |
+
|
| 1486 |
+
|
| 1487 |
+
@magics_class
|
| 1488 |
+
class LazyMagics(Magics):
|
| 1489 |
+
@line_magic
|
| 1490 |
+
def lazy_line(self, line):
|
| 1491 |
+
print("Lazy Line")
|
| 1492 |
+
|
| 1493 |
+
@cell_magic
|
| 1494 |
+
def lazy_cell(self, line, cell):
|
| 1495 |
+
print("Lazy Cell")
|
| 1496 |
+
|
| 1497 |
+
|
| 1498 |
+
def load_ipython_extension(ipython):
|
| 1499 |
+
ipython.register_magics(LazyMagics)
|
| 1500 |
+
"""
|
| 1501 |
+
|
| 1502 |
+
|
| 1503 |
+
def test_lazy_magics():
|
| 1504 |
+
with pytest.raises(UsageError):
|
| 1505 |
+
ip.run_line_magic("lazy_line", "")
|
| 1506 |
+
|
| 1507 |
+
startdir = os.getcwd()
|
| 1508 |
+
|
| 1509 |
+
with TemporaryDirectory() as tmpdir:
|
| 1510 |
+
with prepended_to_syspath(tmpdir):
|
| 1511 |
+
ptempdir = Path(tmpdir)
|
| 1512 |
+
tf = ptempdir / "lazy_magic_module.py"
|
| 1513 |
+
tf.write_text(MINIMAL_LAZY_MAGIC)
|
| 1514 |
+
ip.magics_manager.register_lazy("lazy_line", Path(tf.name).name[:-3])
|
| 1515 |
+
with tt.AssertPrints("Lazy Line"):
|
| 1516 |
+
ip.run_line_magic("lazy_line", "")
|
| 1517 |
+
|
| 1518 |
+
|
| 1519 |
+
TEST_MODULE = """
|
| 1520 |
+
print('Loaded my_tmp')
|
| 1521 |
+
if __name__ == "__main__":
|
| 1522 |
+
print('I just ran a script')
|
| 1523 |
+
"""
|
| 1524 |
+
|
| 1525 |
+
def test_run_module_from_import_hook():
|
| 1526 |
+
"Test that a module can be loaded via an import hook"
|
| 1527 |
+
with TemporaryDirectory() as tmpdir:
|
| 1528 |
+
fullpath = os.path.join(tmpdir, "my_tmp.py")
|
| 1529 |
+
Path(fullpath).write_text(TEST_MODULE, encoding="utf-8")
|
| 1530 |
+
|
| 1531 |
+
import importlib.abc
|
| 1532 |
+
import importlib.util
|
| 1533 |
+
|
| 1534 |
+
class MyTempImporter(importlib.abc.MetaPathFinder, importlib.abc.SourceLoader):
|
| 1535 |
+
def find_spec(self, fullname, path, target=None):
|
| 1536 |
+
if fullname == "my_tmp":
|
| 1537 |
+
return importlib.util.spec_from_loader(fullname, self)
|
| 1538 |
+
|
| 1539 |
+
def get_filename(self, fullname):
|
| 1540 |
+
assert fullname == "my_tmp"
|
| 1541 |
+
return fullpath
|
| 1542 |
+
|
| 1543 |
+
def get_data(self, path):
|
| 1544 |
+
assert Path(path).samefile(fullpath)
|
| 1545 |
+
return Path(fullpath).read_text(encoding="utf-8")
|
| 1546 |
+
|
| 1547 |
+
sys.meta_path.insert(0, MyTempImporter())
|
| 1548 |
+
|
| 1549 |
+
with capture_output() as captured:
|
| 1550 |
+
_ip.run_line_magic("run", "-m my_tmp")
|
| 1551 |
+
_ip.run_cell("import my_tmp")
|
| 1552 |
+
|
| 1553 |
+
output = "Loaded my_tmp\nI just ran a script\nLoaded my_tmp\n"
|
| 1554 |
+
assert output == captured.stdout
|
| 1555 |
+
|
| 1556 |
+
sys.meta_path.pop(0)
|