Add files using upload-large-folder tool

llava/lib/python3.10/site-packages/pip/_vendor/rich/_fileno.py

@@ -0,0 +1,24 @@
+from __future__ import annotations
+
+from typing import IO, Callable
+
+
+def get_fileno(file_like: IO[str]) -> int | None:
+    """Get fileno() from a file, accounting for poorly implemented file-like objects.
+
+    Args:
+        file_like (IO): A file-like object.
+
+    Returns:
+        int | None: The result of fileno if available, or None if operation failed.
+    """
+    fileno: Callable[[], int] | None = getattr(file_like, "fileno", None)
+    if fileno is not None:
+        try:
+            return fileno()
+        except Exception:
+            # `fileno` is documented as potentially raising a OSError
+            # Alas, from the issues, there are so many poorly implemented file-like objects,
+            # that `fileno()` can raise just about anything.
+            return None
+    return None

llava/lib/python3.10/site-packages/pip/_vendor/rich/_windows_renderer.py

@@ -0,0 +1,56 @@
+from typing import Iterable, Sequence, Tuple, cast
+
+from pip._vendor.rich._win32_console import LegacyWindowsTerm, WindowsCoordinates
+from pip._vendor.rich.segment import ControlCode, ControlType, Segment
+
+
+def legacy_windows_render(buffer: Iterable[Segment], term: LegacyWindowsTerm) -> None:
+    """Makes appropriate Windows Console API calls based on the segments in the buffer.
+
+    Args:
+        buffer (Iterable[Segment]): Iterable of Segments to convert to Win32 API calls.
+        term (LegacyWindowsTerm): Used to call the Windows Console API.
+    """
+    for text, style, control in buffer:
+        if not control:
+            if style:
+                term.write_styled(text, style)
+            else:
+                term.write_text(text)
+        else:
+            control_codes: Sequence[ControlCode] = control
+            for control_code in control_codes:
+                control_type = control_code[0]
+                if control_type == ControlType.CURSOR_MOVE_TO:
+                    _, x, y = cast(Tuple[ControlType, int, int], control_code)
+                    term.move_cursor_to(WindowsCoordinates(row=y - 1, col=x - 1))
+                elif control_type == ControlType.CARRIAGE_RETURN:
+                    term.write_text("\r")
+                elif control_type == ControlType.HOME:
+                    term.move_cursor_to(WindowsCoordinates(0, 0))
+                elif control_type == ControlType.CURSOR_UP:
+                    term.move_cursor_up()
+                elif control_type == ControlType.CURSOR_DOWN:
+                    term.move_cursor_down()
+                elif control_type == ControlType.CURSOR_FORWARD:
+                    term.move_cursor_forward()
+                elif control_type == ControlType.CURSOR_BACKWARD:
+                    term.move_cursor_backward()
+                elif control_type == ControlType.CURSOR_MOVE_TO_COLUMN:
+                    _, column = cast(Tuple[ControlType, int], control_code)
+                    term.move_cursor_to_column(column - 1)
+                elif control_type == ControlType.HIDE_CURSOR:
+                    term.hide_cursor()
+                elif control_type == ControlType.SHOW_CURSOR:
+                    term.show_cursor()
+                elif control_type == ControlType.ERASE_IN_LINE:
+                    _, mode = cast(Tuple[ControlType, int], control_code)
+                    if mode == 0:
+                        term.erase_end_of_line()
+                    elif mode == 1:
+                        term.erase_start_of_line()
+                    elif mode == 2:
+                        term.erase_line()
+                elif control_type == ControlType.SET_WINDOW_TITLE:
+                    _, title = cast(Tuple[ControlType, str], control_code)
+                    term.set_title(title)

llava/lib/python3.10/site-packages/pip/_vendor/rich/align.py

@@ -0,0 +1,312 @@
+import sys
+from itertools import chain
+from typing import TYPE_CHECKING, Iterable, Optional
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+from .constrain import Constrain
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import StyleType
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+AlignMethod = Literal["left", "center", "right"]
+VerticalAlignMethod = Literal["top", "middle", "bottom"]
+
+
+class Align(JupyterMixin):
+    """Align a renderable by adding spaces if necessary.
+
+    Args:
+        renderable (RenderableType): A console renderable.
+        align (AlignMethod): One of "left", "center", or "right""
+        style (StyleType, optional): An optional style to apply to the background.
+        vertical (Optional[VerticalAlignMethod], optional): Optional vertical align, one of "top", "middle", or "bottom". Defaults to None.
+        pad (bool, optional): Pad the right with spaces. Defaults to True.
+        width (int, optional): Restrict contents to given width, or None to use default width. Defaults to None.
+        height (int, optional): Set height of align renderable, or None to fit to contents. Defaults to None.
+
+    Raises:
+        ValueError: if ``align`` is not one of the expected values.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        align: AlignMethod = "left",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> None:
+        if align not in ("left", "center", "right"):
+            raise ValueError(
+                f'invalid value for align, expected "left", "center", or "right" (not {align!r})'
+            )
+        if vertical is not None and vertical not in ("top", "middle", "bottom"):
+            raise ValueError(
+                f'invalid value for vertical, expected "top", "middle", or "bottom" (not {vertical!r})'
+            )
+        self.renderable = renderable
+        self.align = align
+        self.style = style
+        self.vertical = vertical
+        self.pad = pad
+        self.width = width
+        self.height = height
+
+    def __repr__(self) -> str:
+        return f"Align({self.renderable!r}, {self.align!r})"
+
+    @classmethod
+    def left(
+        cls,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> "Align":
+        """Align a renderable to the left."""
+        return cls(
+            renderable,
+            "left",
+            style=style,
+            vertical=vertical,
+            pad=pad,
+            width=width,
+            height=height,
+        )
+
+    @classmethod
+    def center(
+        cls,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> "Align":
+        """Align a renderable to the center."""
+        return cls(
+            renderable,
+            "center",
+            style=style,
+            vertical=vertical,
+            pad=pad,
+            width=width,
+            height=height,
+        )
+
+    @classmethod
+    def right(
+        cls,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> "Align":
+        """Align a renderable to the right."""
+        return cls(
+            renderable,
+            "right",
+            style=style,
+            vertical=vertical,
+            pad=pad,
+            width=width,
+            height=height,
+        )
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        align = self.align
+        width = console.measure(self.renderable, options=options).maximum
+        rendered = console.render(
+            Constrain(
+                self.renderable, width if self.width is None else min(width, self.width)
+            ),
+            options.update(height=None),
+        )
+        lines = list(Segment.split_lines(rendered))
+        width, height = Segment.get_shape(lines)
+        lines = Segment.set_shape(lines, width, height)
+        new_line = Segment.line()
+        excess_space = options.max_width - width
+        style = console.get_style(self.style) if self.style is not None else None
+
+        def generate_segments() -> Iterable[Segment]:
+            if excess_space <= 0:
+                # Exact fit
+                for line in lines:
+                    yield from line
+                    yield new_line
+
+            elif align == "left":
+                # Pad on the right
+                pad = Segment(" " * excess_space, style) if self.pad else None
+                for line in lines:
+                    yield from line
+                    if pad:
+                        yield pad
+                    yield new_line
+
+            elif align == "center":
+                # Pad left and right
+                left = excess_space // 2
+                pad = Segment(" " * left, style)
+                pad_right = (
+                    Segment(" " * (excess_space - left), style) if self.pad else None
+                )
+                for line in lines:
+                    if left:
+                        yield pad
+                    yield from line
+                    if pad_right:
+                        yield pad_right
+                    yield new_line
+
+            elif align == "right":
+                # Padding on left
+                pad = Segment(" " * excess_space, style)
+                for line in lines:
+                    yield pad
+                    yield from line
+                    yield new_line
+
+        blank_line = (
+            Segment(f"{' ' * (self.width or options.max_width)}\n", style)
+            if self.pad
+            else Segment("\n")
+        )
+
+        def blank_lines(count: int) -> Iterable[Segment]:
+            if count > 0:
+                for _ in range(count):
+                    yield blank_line
+
+        vertical_height = self.height or options.height
+        iter_segments: Iterable[Segment]
+        if self.vertical and vertical_height is not None:
+            if self.vertical == "top":
+                bottom_space = vertical_height - height
+                iter_segments = chain(generate_segments(), blank_lines(bottom_space))
+            elif self.vertical == "middle":
+                top_space = (vertical_height - height) // 2
+                bottom_space = vertical_height - top_space - height
+                iter_segments = chain(
+                    blank_lines(top_space),
+                    generate_segments(),
+                    blank_lines(bottom_space),
+                )
+            else:  #  self.vertical == "bottom":
+                top_space = vertical_height - height
+                iter_segments = chain(blank_lines(top_space), generate_segments())
+        else:
+            iter_segments = generate_segments()
+        if self.style:
+            style = console.get_style(self.style)
+            iter_segments = Segment.apply_style(iter_segments, style)
+        yield from iter_segments
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        measurement = Measurement.get(console, options, self.renderable)
+        return measurement
+
+
+class VerticalCenter(JupyterMixin):
+    """Vertically aligns a renderable.
+
+    Warn:
+        This class is deprecated and may be removed in a future version. Use Align class with
+        `vertical="middle"`.
+
+    Args:
+        renderable (RenderableType): A renderable object.
+        style (StyleType, optional): An optional style to apply to the background. Defaults to None.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+    ) -> None:
+        self.renderable = renderable
+        self.style = style
+
+    def __repr__(self) -> str:
+        return f"VerticalCenter({self.renderable!r})"
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        style = console.get_style(self.style) if self.style is not None else None
+        lines = console.render_lines(
+            self.renderable, options.update(height=None), pad=False
+        )
+        width, _height = Segment.get_shape(lines)
+        new_line = Segment.line()
+        height = options.height or options.size.height
+        top_space = (height - len(lines)) // 2
+        bottom_space = height - top_space - len(lines)
+        blank_line = Segment(f"{' ' * width}", style)
+
+        def blank_lines(count: int) -> Iterable[Segment]:
+            for _ in range(count):
+                yield blank_line
+                yield new_line
+
+        if top_space > 0:
+            yield from blank_lines(top_space)
+        for line in lines:
+            yield from line
+            yield new_line
+        if bottom_space > 0:
+            yield from blank_lines(bottom_space)
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        measurement = Measurement.get(console, options, self.renderable)
+        return measurement
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console, Group
+    from pip._vendor.rich.highlighter import ReprHighlighter
+    from pip._vendor.rich.panel import Panel
+
+    highlighter = ReprHighlighter()
+    console = Console()
+
+    panel = Panel(
+        Group(
+            Align.left(highlighter("align='left'")),
+            Align.center(highlighter("align='center'")),
+            Align.right(highlighter("align='right'")),
+        ),
+        width=60,
+        style="on dark_blue",
+        title="Align",
+    )
+
+    console.print(
+        Align.center(panel, vertical="middle", style="on red", height=console.height)
+    )

llava/lib/python3.10/site-packages/pip/_vendor/rich/bar.py

@@ -0,0 +1,93 @@
+from typing import Optional, Union
+
+from .color import Color
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style
+
+# There are left-aligned characters for 1/8 to 7/8, but
+# the right-aligned characters exist only for 1/8 and 4/8.
+BEGIN_BLOCK_ELEMENTS = ["█", "█", "█", "▐", "▐", "▐", "▕", "▕"]
+END_BLOCK_ELEMENTS = [" ", "▏", "▎", "▍", "▌", "▋", "▊", "▉"]
+FULL_BLOCK = "█"
+
+
+class Bar(JupyterMixin):
+    """Renders a solid block bar.
+
+    Args:
+        size (float): Value for the end of the bar.
+        begin (float): Begin point (between 0 and size, inclusive).
+        end (float): End point (between 0 and size, inclusive).
+        width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None.
+        color (Union[Color, str], optional): Color of the bar. Defaults to "default".
+        bgcolor (Union[Color, str], optional): Color of bar background. Defaults to "default".
+    """
+
+    def __init__(
+        self,
+        size: float,
+        begin: float,
+        end: float,
+        *,
+        width: Optional[int] = None,
+        color: Union[Color, str] = "default",
+        bgcolor: Union[Color, str] = "default",
+    ):
+        self.size = size
+        self.begin = max(begin, 0)
+        self.end = min(end, size)
+        self.width = width
+        self.style = Style(color=color, bgcolor=bgcolor)
+
+    def __repr__(self) -> str:
+        return f"Bar({self.size}, {self.begin}, {self.end})"
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        width = min(
+            self.width if self.width is not None else options.max_width,
+            options.max_width,
+        )
+
+        if self.begin >= self.end:
+            yield Segment(" " * width, self.style)
+            yield Segment.line()
+            return
+
+        prefix_complete_eights = int(width * 8 * self.begin / self.size)
+        prefix_bar_count = prefix_complete_eights // 8
+        prefix_eights_count = prefix_complete_eights % 8
+
+        body_complete_eights = int(width * 8 * self.end / self.size)
+        body_bar_count = body_complete_eights // 8
+        body_eights_count = body_complete_eights % 8
+
+        # When start and end fall into the same cell, we ideally should render
+        # a symbol that's "center-aligned", but there is no good symbol in Unicode.
+        # In this case, we fall back to right-aligned block symbol for simplicity.
+
+        prefix = " " * prefix_bar_count
+        if prefix_eights_count:
+            prefix += BEGIN_BLOCK_ELEMENTS[prefix_eights_count]
+
+        body = FULL_BLOCK * body_bar_count
+        if body_eights_count:
+            body += END_BLOCK_ELEMENTS[body_eights_count]
+
+        suffix = " " * (width - len(body))
+
+        yield Segment(prefix + body[len(prefix) :] + suffix, self.style)
+        yield Segment.line()
+
+    def __rich_measure__(
+        self, console: Console, options: ConsoleOptions
+    ) -> Measurement:
+        return (
+            Measurement(self.width, self.width)
+            if self.width is not None
+            else Measurement(4, options.max_width)
+        )

llava/lib/python3.10/site-packages/pip/_vendor/rich/box.py

@@ -0,0 +1,480 @@
+import sys
+from typing import TYPE_CHECKING, Iterable, List
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+
+from ._loop import loop_last
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.console import ConsoleOptions
+
+
+class Box:
+    """Defines characters to render boxes.
+
+    ┌─┬┐ top
+    │ ││ head
+    ├─┼┤ head_row
+    │ ││ mid
+    ├─┼┤ row
+    ├─┼┤ foot_row
+    │ ││ foot
+    └─┴┘ bottom
+
+    Args:
+        box (str): Characters making up box.
+        ascii (bool, optional): True if this box uses ascii characters only. Default is False.
+    """
+
+    def __init__(self, box: str, *, ascii: bool = False) -> None:
+        self._box = box
+        self.ascii = ascii
+        line1, line2, line3, line4, line5, line6, line7, line8 = box.splitlines()
+        # top
+        self.top_left, self.top, self.top_divider, self.top_right = iter(line1)
+        # head
+        self.head_left, _, self.head_vertical, self.head_right = iter(line2)
+        # head_row
+        (
+            self.head_row_left,
+            self.head_row_horizontal,
+            self.head_row_cross,
+            self.head_row_right,
+        ) = iter(line3)
+
+        # mid
+        self.mid_left, _, self.mid_vertical, self.mid_right = iter(line4)
+        # row
+        self.row_left, self.row_horizontal, self.row_cross, self.row_right = iter(line5)
+        # foot_row
+        (
+            self.foot_row_left,
+            self.foot_row_horizontal,
+            self.foot_row_cross,
+            self.foot_row_right,
+        ) = iter(line6)
+        # foot
+        self.foot_left, _, self.foot_vertical, self.foot_right = iter(line7)
+        # bottom
+        self.bottom_left, self.bottom, self.bottom_divider, self.bottom_right = iter(
+            line8
+        )
+
+    def __repr__(self) -> str:
+        return "Box(...)"
+
+    def __str__(self) -> str:
+        return self._box
+
+    def substitute(self, options: "ConsoleOptions", safe: bool = True) -> "Box":
+        """Substitute this box for another if it won't render due to platform issues.
+
+        Args:
+            options (ConsoleOptions): Console options used in rendering.
+            safe (bool, optional): Substitute this for another Box if there are known problems
+                displaying on the platform (currently only relevant on Windows). Default is True.
+
+        Returns:
+            Box: A different Box or the same Box.
+        """
+        box = self
+        if options.legacy_windows and safe:
+            box = LEGACY_WINDOWS_SUBSTITUTIONS.get(box, box)
+        if options.ascii_only and not box.ascii:
+            box = ASCII
+        return box
+
+    def get_plain_headed_box(self) -> "Box":
+        """If this box uses special characters for the borders of the header, then
+        return the equivalent box that does not.
+
+        Returns:
+            Box: The most similar Box that doesn't use header-specific box characters.
+                If the current Box already satisfies this criterion, then it's returned.
+        """
+        return PLAIN_HEADED_SUBSTITUTIONS.get(self, self)
+
+    def get_top(self, widths: Iterable[int]) -> str:
+        """Get the top of a simple box.
+
+        Args:
+            widths (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+
+        parts: List[str] = []
+        append = parts.append
+        append(self.top_left)
+        for last, width in loop_last(widths):
+            append(self.top * width)
+            if not last:
+                append(self.top_divider)
+        append(self.top_right)
+        return "".join(parts)
+
+    def get_row(
+        self,
+        widths: Iterable[int],
+        level: Literal["head", "row", "foot", "mid"] = "row",
+        edge: bool = True,
+    ) -> str:
+        """Get the top of a simple box.
+
+        Args:
+            width (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+        if level == "head":
+            left = self.head_row_left
+            horizontal = self.head_row_horizontal
+            cross = self.head_row_cross
+            right = self.head_row_right
+        elif level == "row":
+            left = self.row_left
+            horizontal = self.row_horizontal
+            cross = self.row_cross
+            right = self.row_right
+        elif level == "mid":
+            left = self.mid_left
+            horizontal = " "
+            cross = self.mid_vertical
+            right = self.mid_right
+        elif level == "foot":
+            left = self.foot_row_left
+            horizontal = self.foot_row_horizontal
+            cross = self.foot_row_cross
+            right = self.foot_row_right
+        else:
+            raise ValueError("level must be 'head', 'row' or 'foot'")
+
+        parts: List[str] = []
+        append = parts.append
+        if edge:
+            append(left)
+        for last, width in loop_last(widths):
+            append(horizontal * width)
+            if not last:
+                append(cross)
+        if edge:
+            append(right)
+        return "".join(parts)
+
+    def get_bottom(self, widths: Iterable[int]) -> str:
+        """Get the bottom of a simple box.
+
+        Args:
+            widths (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+
+        parts: List[str] = []
+        append = parts.append
+        append(self.bottom_left)
+        for last, width in loop_last(widths):
+            append(self.bottom * width)
+            if not last:
+                append(self.bottom_divider)
+        append(self.bottom_right)
+        return "".join(parts)
+
+
+# fmt: off
+ASCII: Box = Box(
+    "+--+\n"
+    "| ||\n"
+    "|-+|\n"
+    "| ||\n"
+    "|-+|\n"
+    "|-+|\n"
+    "| ||\n"
+    "+--+\n",
+    ascii=True,
+)
+
+ASCII2: Box = Box(
+    "+-++\n"
+    "| ||\n"
+    "+-++\n"
+    "| ||\n"
+    "+-++\n"
+    "+-++\n"
+    "| ||\n"
+    "+-++\n",
+    ascii=True,
+)
+
+ASCII_DOUBLE_HEAD: Box = Box(
+    "+-++\n"
+    "| ||\n"
+    "+=++\n"
+    "| ||\n"
+    "+-++\n"
+    "+-++\n"
+    "| ||\n"
+    "+-++\n",
+    ascii=True,
+)
+
+SQUARE: Box = Box(
+    "┌─┬┐\n"
+    "│ ││\n"
+    "├─┼┤\n"
+    "│ ││\n"
+    "├─┼┤\n"
+    "├─┼┤\n"
+    "│ ││\n"
+    "└─┴┘\n"
+)
+
+SQUARE_DOUBLE_HEAD: Box = Box(
+    "┌─┬┐\n"
+    "│ ││\n"
+    "╞═╪╡\n"
+    "│ ││\n"
+    "├─┼┤\n"
+    "├─┼┤\n"
+    "│ ││\n"
+    "└─┴┘\n"
+)
+
+MINIMAL: Box = Box(
+    "  ╷ \n"
+    "  │ \n"
+    "╶─┼╴\n"
+    "  │ \n"
+    "╶─┼╴\n"
+    "╶─┼╴\n"
+    "  │ \n"
+    "  ╵ \n"
+)
+
+
+MINIMAL_HEAVY_HEAD: Box = Box(
+    "  ╷ \n"
+    "  │ \n"
+    "╺━┿╸\n"
+    "  │ \n"
+    "╶─┼╴\n"
+    "╶─┼╴\n"
+    "  │ \n"
+    "  ╵ \n"
+)
+
+MINIMAL_DOUBLE_HEAD: Box = Box(
+    "  ╷ \n"
+    "  │ \n"
+    " ═╪ \n"
+    "  │ \n"
+    " ─┼ \n"
+    " ─┼ \n"
+    "  │ \n"
+    "  ╵ \n"
+)
+
+
+SIMPLE: Box = Box(
+    "    \n"
+    "    \n"
+    " ── \n"
+    "    \n"
+    "    \n"
+    " ── \n"
+    "    \n"
+    "    \n"
+)
+
+SIMPLE_HEAD: Box = Box(
+    "    \n"
+    "    \n"
+    " ── \n"
+    "    \n"
+    "    \n"
+    "    \n"
+    "    \n"
+    "    \n"
+)
+
+
+SIMPLE_HEAVY: Box = Box(
+    "    \n"
+    "    \n"
+    " ━━ \n"
+    "    \n"
+    "    \n"
+    " ━━ \n"
+    "    \n"
+    "    \n"
+)
+
+
+HORIZONTALS: Box = Box(
+    " ── \n"
+    "    \n"
+    " ── \n"
+    "    \n"
+    " ── \n"
+    " ── \n"
+    "    \n"
+    " ── \n"
+)
+
+ROUNDED: Box = Box(
+    "╭─┬╮\n"
+    "│ ││\n"
+    "├─┼┤\n"
+    "│ ││\n"
+    "├─┼┤\n"
+    "├─┼┤\n"
+    "│ ││\n"
+    "╰─┴╯\n"
+)
+
+HEAVY: Box = Box(
+    "┏━┳┓\n"
+    "┃ ┃┃\n"
+    "┣━╋┫\n"
+    "┃ ┃┃\n"
+    "┣━╋┫\n"
+    "┣━╋┫\n"
+    "┃ ┃┃\n"
+    "┗━┻┛\n"
+)
+
+HEAVY_EDGE: Box = Box(
+    "┏━┯┓\n"
+    "┃ │┃\n"
+    "┠─┼┨\n"
+    "┃ │┃\n"
+    "┠─┼┨\n"
+    "┠─┼┨\n"
+    "┃ │┃\n"
+    "┗━┷┛\n"
+)
+
+HEAVY_HEAD: Box = Box(
+    "┏━┳┓\n"
+    "┃ ┃┃\n"
+    "┡━╇┩\n"
+    "│ ││\n"
+    "├─┼┤\n"
+    "├─┼┤\n"
+    "│ ││\n"
+    "└─┴┘\n"
+)
+
+DOUBLE: Box = Box(
+    "╔═╦╗\n"
+    "║ ║║\n"
+    "╠═╬╣\n"
+    "║ ║║\n"
+    "╠═╬╣\n"
+    "╠═╬╣\n"
+    "║ ║║\n"
+    "╚═╩╝\n"
+)
+
+DOUBLE_EDGE: Box = Box(
+    "╔═╤╗\n"
+    "║ │║\n"
+    "╟─┼╢\n"
+    "║ │║\n"
+    "╟─┼╢\n"
+    "╟─┼╢\n"
+    "║ │║\n"
+    "╚═╧╝\n"
+)
+
+MARKDOWN: Box = Box(
+    "    \n"
+    "| ||\n"
+    "|-||\n"
+    "| ||\n"
+    "|-||\n"
+    "|-||\n"
+    "| ||\n"
+    "    \n",
+    ascii=True,
+)
+# fmt: on
+
+# Map Boxes that don't render with raster fonts on to equivalent that do
+LEGACY_WINDOWS_SUBSTITUTIONS = {
+    ROUNDED: SQUARE,
+    MINIMAL_HEAVY_HEAD: MINIMAL,
+    SIMPLE_HEAVY: SIMPLE,
+    HEAVY: SQUARE,
+    HEAVY_EDGE: SQUARE,
+    HEAVY_HEAD: SQUARE,
+}
+
+# Map headed boxes to their headerless equivalents
+PLAIN_HEADED_SUBSTITUTIONS = {
+    HEAVY_HEAD: SQUARE,
+    SQUARE_DOUBLE_HEAD: SQUARE,
+    MINIMAL_DOUBLE_HEAD: MINIMAL,
+    MINIMAL_HEAVY_HEAD: MINIMAL,
+    ASCII_DOUBLE_HEAD: ASCII2,
+}
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.columns import Columns
+    from pip._vendor.rich.panel import Panel
+
+    from . import box as box
+    from .console import Console
+    from .table import Table
+    from .text import Text
+
+    console = Console(record=True)
+
+    BOXES = [
+        "ASCII",
+        "ASCII2",
+        "ASCII_DOUBLE_HEAD",
+        "SQUARE",
+        "SQUARE_DOUBLE_HEAD",
+        "MINIMAL",
+        "MINIMAL_HEAVY_HEAD",
+        "MINIMAL_DOUBLE_HEAD",
+        "SIMPLE",
+        "SIMPLE_HEAD",
+        "SIMPLE_HEAVY",
+        "HORIZONTALS",
+        "ROUNDED",
+        "HEAVY",
+        "HEAVY_EDGE",
+        "HEAVY_HEAD",
+        "DOUBLE",
+        "DOUBLE_EDGE",
+        "MARKDOWN",
+    ]
+
+    console.print(Panel("[bold green]Box Constants", style="green"), justify="center")
+    console.print()
+
+    columns = Columns(expand=True, padding=2)
+    for box_name in sorted(BOXES):
+        table = Table(
+            show_footer=True, style="dim", border_style="not dim", expand=True
+        )
+        table.add_column("Header 1", "Footer 1")
+        table.add_column("Header 2", "Footer 2")
+        table.add_row("Cell", "Cell")
+        table.add_row("Cell", "Cell")
+        table.box = getattr(box, box_name)
+        table.title = Text(f"box.{box_name}", style="magenta")
+        columns.add_renderable(table)
+    console.print(columns)
+
+    # console.save_svg("box.svg")

llava/lib/python3.10/site-packages/pip/_vendor/rich/control.py

@@ -0,0 +1,225 @@
+import sys
+import time
+from typing import TYPE_CHECKING, Callable, Dict, Iterable, List, Union
+
+if sys.version_info >= (3, 8):
+    from typing import Final
+else:
+    from pip._vendor.typing_extensions import Final  # pragma: no cover
+
+from .segment import ControlCode, ControlType, Segment
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult
+
+STRIP_CONTROL_CODES: Final = [
+    7,  # Bell
+    8,  # Backspace
+    11,  # Vertical tab
+    12,  # Form feed
+    13,  # Carriage return
+]
+_CONTROL_STRIP_TRANSLATE: Final = {
+    _codepoint: None for _codepoint in STRIP_CONTROL_CODES
+}
+
+CONTROL_ESCAPE: Final = {
+    7: "\\a",
+    8: "\\b",
+    11: "\\v",
+    12: "\\f",
+    13: "\\r",
+}
+
+CONTROL_CODES_FORMAT: Dict[int, Callable[..., str]] = {
+    ControlType.BELL: lambda: "\x07",
+    ControlType.CARRIAGE_RETURN: lambda: "\r",
+    ControlType.HOME: lambda: "\x1b[H",
+    ControlType.CLEAR: lambda: "\x1b[2J",
+    ControlType.ENABLE_ALT_SCREEN: lambda: "\x1b[?1049h",
+    ControlType.DISABLE_ALT_SCREEN: lambda: "\x1b[?1049l",
+    ControlType.SHOW_CURSOR: lambda: "\x1b[?25h",
+    ControlType.HIDE_CURSOR: lambda: "\x1b[?25l",
+    ControlType.CURSOR_UP: lambda param: f"\x1b[{param}A",
+    ControlType.CURSOR_DOWN: lambda param: f"\x1b[{param}B",
+    ControlType.CURSOR_FORWARD: lambda param: f"\x1b[{param}C",
+    ControlType.CURSOR_BACKWARD: lambda param: f"\x1b[{param}D",
+    ControlType.CURSOR_MOVE_TO_COLUMN: lambda param: f"\x1b[{param+1}G",
+    ControlType.ERASE_IN_LINE: lambda param: f"\x1b[{param}K",
+    ControlType.CURSOR_MOVE_TO: lambda x, y: f"\x1b[{y+1};{x+1}H",
+    ControlType.SET_WINDOW_TITLE: lambda title: f"\x1b]0;{title}\x07",
+}
+
+
+class Control:
+    """A renderable that inserts a control code (non printable but may move cursor).
+
+    Args:
+        *codes (str): Positional arguments are either a :class:`~rich.segment.ControlType` enum or a
+            tuple of ControlType and an integer parameter
+    """
+
+    __slots__ = ["segment"]
+
+    def __init__(self, *codes: Union[ControlType, ControlCode]) -> None:
+        control_codes: List[ControlCode] = [
+            (code,) if isinstance(code, ControlType) else code for code in codes
+        ]
+        _format_map = CONTROL_CODES_FORMAT
+        rendered_codes = "".join(
+            _format_map[code](*parameters) for code, *parameters in control_codes
+        )
+        self.segment = Segment(rendered_codes, None, control_codes)
+
+    @classmethod
+    def bell(cls) -> "Control":
+        """Ring the 'bell'."""
+        return cls(ControlType.BELL)
+
+    @classmethod
+    def home(cls) -> "Control":
+        """Move cursor to 'home' position."""
+        return cls(ControlType.HOME)
+
+    @classmethod
+    def move(cls, x: int = 0, y: int = 0) -> "Control":
+        """Move cursor relative to current position.
+
+        Args:
+            x (int): X offset.
+            y (int): Y offset.
+
+        Returns:
+            ~Control: Control object.
+
+        """
+
+        def get_codes() -> Iterable[ControlCode]:
+            control = ControlType
+            if x:
+                yield (
+                    control.CURSOR_FORWARD if x > 0 else control.CURSOR_BACKWARD,
+                    abs(x),
+                )
+            if y:
+                yield (
+                    control.CURSOR_DOWN if y > 0 else control.CURSOR_UP,
+                    abs(y),
+                )
+
+        control = cls(*get_codes())
+        return control
+
+    @classmethod
+    def move_to_column(cls, x: int, y: int = 0) -> "Control":
+        """Move to the given column, optionally add offset to row.
+
+        Returns:
+            x (int): absolute x (column)
+            y (int): optional y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+
+        return (
+            cls(
+                (ControlType.CURSOR_MOVE_TO_COLUMN, x),
+                (
+                    ControlType.CURSOR_DOWN if y > 0 else ControlType.CURSOR_UP,
+                    abs(y),
+                ),
+            )
+            if y
+            else cls((ControlType.CURSOR_MOVE_TO_COLUMN, x))
+        )
+
+    @classmethod
+    def move_to(cls, x: int, y: int) -> "Control":
+        """Move cursor to absolute position.
+
+        Args:
+            x (int): x offset (column)
+            y (int): y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+        return cls((ControlType.CURSOR_MOVE_TO, x, y))
+
+    @classmethod
+    def clear(cls) -> "Control":
+        """Clear the screen."""
+        return cls(ControlType.CLEAR)
+
+    @classmethod
+    def show_cursor(cls, show: bool) -> "Control":
+        """Show or hide the cursor."""
+        return cls(ControlType.SHOW_CURSOR if show else ControlType.HIDE_CURSOR)
+
+    @classmethod
+    def alt_screen(cls, enable: bool) -> "Control":
+        """Enable or disable alt screen."""
+        if enable:
+            return cls(ControlType.ENABLE_ALT_SCREEN, ControlType.HOME)
+        else:
+            return cls(ControlType.DISABLE_ALT_SCREEN)
+
+    @classmethod
+    def title(cls, title: str) -> "Control":
+        """Set the terminal window title
+
+        Args:
+            title (str): The new terminal window title
+        """
+        return cls((ControlType.SET_WINDOW_TITLE, title))
+
+    def __str__(self) -> str:
+        return self.segment.text
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.segment.text:
+            yield self.segment
+
+
+def strip_control_codes(
+    text: str, _translate_table: Dict[int, None] = _CONTROL_STRIP_TRANSLATE
+) -> str:
+    """Remove control codes from text.
+
+    Args:
+        text (str): A string possibly contain control codes.
+
+    Returns:
+        str: String with control codes removed.
+    """
+    return text.translate(_translate_table)
+
+
+def escape_control_codes(
+    text: str,
+    _translate_table: Dict[int, str] = CONTROL_ESCAPE,
+) -> str:
+    """Replace control codes with their "escaped" equivalent in the given text.
+    (e.g. "\b" becomes "\\b")
+
+    Args:
+        text (str): A string possibly containing control codes.
+
+    Returns:
+        str: String with control codes replaced with their escaped version.
+    """
+    return text.translate(_translate_table)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+    console.print("Look at the title of your terminal window ^")
+    # console.print(Control((ControlType.SET_WINDOW_TITLE, "Hello, world!")))
+    for i in range(10):
+        console.set_window_title("🚀 Loading" + "." * i)
+        time.sleep(0.5)

llava/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py

@@ -0,0 +1,232 @@
+import re
+from abc import ABC, abstractmethod
+from typing import List, Union
+
+from .text import Span, Text
+
+
+def _combine_regex(*regexes: str) -> str:
+    """Combine a number of regexes in to a single regex.
+
+    Returns:
+        str: New regex with all regexes ORed together.
+    """
+    return "|".join(regexes)
+
+
+class Highlighter(ABC):
+    """Abstract base class for highlighters."""
+
+    def __call__(self, text: Union[str, Text]) -> Text:
+        """Highlight a str or Text instance.
+
+        Args:
+            text (Union[str, ~Text]): Text to highlight.
+
+        Raises:
+            TypeError: If not called with text or str.
+
+        Returns:
+            Text: A test instance with highlighting applied.
+        """
+        if isinstance(text, str):
+            highlight_text = Text(text)
+        elif isinstance(text, Text):
+            highlight_text = text.copy()
+        else:
+            raise TypeError(f"str or Text instance required, not {text!r}")
+        self.highlight(highlight_text)
+        return highlight_text
+
+    @abstractmethod
+    def highlight(self, text: Text) -> None:
+        """Apply highlighting in place to text.
+
+        Args:
+            text (~Text): A text object highlight.
+        """
+
+
+class NullHighlighter(Highlighter):
+    """A highlighter object that doesn't highlight.
+
+    May be used to disable highlighting entirely.
+
+    """
+
+    def highlight(self, text: Text) -> None:
+        """Nothing to do"""
+
+
+class RegexHighlighter(Highlighter):
+    """Applies highlighting from a list of regular expressions."""
+
+    highlights: List[str] = []
+    base_style: str = ""
+
+    def highlight(self, text: Text) -> None:
+        """Highlight :class:`rich.text.Text` using regular expressions.
+
+        Args:
+            text (~Text): Text to highlighted.
+
+        """
+
+        highlight_regex = text.highlight_regex
+        for re_highlight in self.highlights:
+            highlight_regex(re_highlight, style_prefix=self.base_style)
+
+
+class ReprHighlighter(RegexHighlighter):
+    """Highlights the text typically produced from ``__repr__`` methods."""
+
+    base_style = "repr."
+    highlights = [
+        r"(?P<tag_start><)(?P<tag_name>[-\w.:|]*)(?P<tag_contents>[\w\W]*)(?P<tag_end>>)",
+        r'(?P<attrib_name>[\w_]{1,50})=(?P<attrib_value>"?[\w_]+"?)?',
+        r"(?P<brace>[][{}()])",
+        _combine_regex(
+            r"(?P<ipv4>[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})",
+            r"(?P<ipv6>([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})",
+            r"(?P<eui64>(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})",
+            r"(?P<eui48>(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})",
+            r"(?P<uuid>[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})",
+            r"(?P<call>[\w.]*?)\(",
+            r"\b(?P<bool_true>True)\b|\b(?P<bool_false>False)\b|\b(?P<none>None)\b",
+            r"(?P<ellipsis>\.\.\.)",
+            r"(?P<number_complex>(?<!\w)(?:\-?[0-9]+\.?[0-9]*(?:e[-+]?\d+?)?)(?:[-+](?:[0-9]+\.?[0-9]*(?:e[-+]?\d+)?))?j)",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[-+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            r"(?P<path>\B(/[-\w._+]+)*\/)(?P<filename>[-\w._+]*)?",
+            r"(?<![\\\w])(?P<str>b?'''.*?(?<!\\)'''|b?'.*?(?<!\\)'|b?\"\"\".*?(?<!\\)\"\"\"|b?\".*?(?<!\\)\")",
+            r"(?P<url>(file|https|http|ws|wss)://[-0-9a-zA-Z$_+!`(),.?/;:&=%#~@]*)",
+        ),
+    ]
+
+
+class JSONHighlighter(RegexHighlighter):
+    """Highlights JSON"""
+
+    # Captures the start and end of JSON strings, handling escaped quotes
+    JSON_STR = r"(?<![\\\w])(?P<str>b?\".*?(?<!\\)\")"
+    JSON_WHITESPACE = {" ", "\n", "\r", "\t"}
+
+    base_style = "json."
+    highlights = [
+        _combine_regex(
+            r"(?P<brace>[\{\[\(\)\]\}])",
+            r"\b(?P<bool_true>true)\b|\b(?P<bool_false>false)\b|\b(?P<null>null)\b",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            JSON_STR,
+        ),
+    ]
+
+    def highlight(self, text: Text) -> None:
+        super().highlight(text)
+
+        # Additional work to handle highlighting JSON keys
+        plain = text.plain
+        append = text.spans.append
+        whitespace = self.JSON_WHITESPACE
+        for match in re.finditer(self.JSON_STR, plain):
+            start, end = match.span()
+            cursor = end
+            while cursor < len(plain):
+                char = plain[cursor]
+                cursor += 1
+                if char == ":":
+                    append(Span(start, end, "json.key"))
+                elif char in whitespace:
+                    continue
+                break
+
+
+class ISO8601Highlighter(RegexHighlighter):
+    """Highlights the ISO8601 date time strings.
+    Regex reference: https://www.oreilly.com/library/view/regular-expressions-cookbook/9781449327453/ch04s07.html
+    """
+
+    base_style = "iso8601."
+    highlights = [
+        #
+        # Dates
+        #
+        # Calendar month (e.g. 2008-08). The hyphen is required
+        r"^(?P<year>[0-9]{4})-(?P<month>1[0-2]|0[1-9])$",
+        # Calendar date w/o hyphens (e.g. 20080830)
+        r"^(?P<date>(?P<year>[0-9]{4})(?P<month>1[0-2]|0[1-9])(?P<day>3[01]|0[1-9]|[12][0-9]))$",
+        # Ordinal date (e.g. 2008-243). The hyphen is optional
+        r"^(?P<date>(?P<year>[0-9]{4})-?(?P<day>36[0-6]|3[0-5][0-9]|[12][0-9]{2}|0[1-9][0-9]|00[1-9]))$",
+        #
+        # Weeks
+        #
+        # Week of the year (e.g., 2008-W35). The hyphen is optional
+        r"^(?P<date>(?P<year>[0-9]{4})-?W(?P<week>5[0-3]|[1-4][0-9]|0[1-9]))$",
+        # Week date (e.g., 2008-W35-6). The hyphens are optional
+        r"^(?P<date>(?P<year>[0-9]{4})-?W(?P<week>5[0-3]|[1-4][0-9]|0[1-9])-?(?P<day>[1-7]))$",
+        #
+        # Times
+        #
+        # Hours and minutes (e.g., 17:21). The colon is optional
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9]):?(?P<minute>[0-5][0-9]))$",
+        # Hours, minutes, and seconds w/o colons (e.g., 172159)
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9])(?P<minute>[0-5][0-9])(?P<second>[0-5][0-9]))$",
+        # Time zone designator (e.g., Z, +07 or +07:00). The colons and the minutes are optional
+        r"^(?P<timezone>(Z|[+-](?:2[0-3]|[01][0-9])(?::?(?:[0-5][0-9]))?))$",
+        # Hours, minutes, and seconds with time zone designator (e.g., 17:21:59+07:00).
+        # All the colons are optional. The minutes in the time zone designator are also optional
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9])(?P<minute>[0-5][0-9])(?P<second>[0-5][0-9]))(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9])(?::?(?:[0-5][0-9]))?)$",
+        #
+        # Date and Time
+        #
+        # Calendar date with hours, minutes, and seconds (e.g., 2008-08-30 17:21:59 or 20080830 172159).
+        # A space is required between the date and the time. The hyphens and colons are optional.
+        # This regex matches dates and times that specify some hyphens or colons but omit others.
+        # This does not follow ISO 8601
+        r"^(?P<date>(?P<year>[0-9]{4})(?P<hyphen>-)?(?P<month>1[0-2]|0[1-9])(?(hyphen)-)(?P<day>3[01]|0[1-9]|[12][0-9])) (?P<time>(?P<hour>2[0-3]|[01][0-9])(?(hyphen):)(?P<minute>[0-5][0-9])(?(hyphen):)(?P<second>[0-5][0-9]))$",
+        #
+        # XML Schema dates and times
+        #
+        # Date, with optional time zone (e.g., 2008-08-30 or 2008-08-30+07:00).
+        # Hyphens are required. This is the XML Schema 'date' type
+        r"^(?P<date>(?P<year>-?(?:[1-9][0-9]*)?[0-9]{4})-(?P<month>1[0-2]|0[1-9])-(?P<day>3[01]|0[1-9]|[12][0-9]))(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9]):[0-5][0-9])?$",
+        # Time, with optional fractional seconds and time zone (e.g., 01:45:36 or 01:45:36.123+07:00).
+        # There is no limit on the number of digits for the fractional seconds. This is the XML Schema 'time' type
+        r"^(?P<time>(?P<hour>2[0-3]|[01][0-9]):(?P<minute>[0-5][0-9]):(?P<second>[0-5][0-9])(?P<frac>\.[0-9]+)?)(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9]):[0-5][0-9])?$",
+        # Date and time, with optional fractional seconds and time zone (e.g., 2008-08-30T01:45:36 or 2008-08-30T01:45:36.123Z).
+        # This is the XML Schema 'dateTime' type
+        r"^(?P<date>(?P<year>-?(?:[1-9][0-9]*)?[0-9]{4})-(?P<month>1[0-2]|0[1-9])-(?P<day>3[01]|0[1-9]|[12][0-9]))T(?P<time>(?P<hour>2[0-3]|[01][0-9]):(?P<minute>[0-5][0-9]):(?P<second>[0-5][0-9])(?P<ms>\.[0-9]+)?)(?P<timezone>Z|[+-](?:2[0-3]|[01][0-9]):[0-5][0-9])?$",
+    ]
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    console = Console()
+    console.print("[bold green]hello world![/bold green]")
+    console.print("'[bold green]hello world![/bold green]'")
+
+    console.print(" /foo")
+    console.print("/foo/")
+    console.print("/foo/bar")
+    console.print("foo/bar/baz")
+
+    console.print("/foo/bar/baz?foo=bar+egg&egg=baz")
+    console.print("/foo/bar/baz/")
+    console.print("/foo/bar/baz/egg")
+    console.print("/foo/bar/baz/egg.py")
+    console.print("/foo/bar/baz/egg.py word")
+    console.print(" /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/ba._++z/egg+.py word")
+    console.print("https://example.org?foo=bar#header")
+
+    console.print(1234567.34)
+    console.print(1 / 2)
+    console.print(-1 / 123123123123)
+
+    console.print(
+        "127.0.1.1 bar 192.168.1.4 2001:0db8:85a3:0000:0000:8a2e:0370:7334 foo"
+    )
+    import json
+
+    console.print_json(json.dumps(obj={"name": "apple", "count": 1}), indent=None)

llava/lib/python3.10/site-packages/pip/_vendor/rich/json.py

@@ -0,0 +1,139 @@
+from pathlib import Path
+from json import loads, dumps
+from typing import Any, Callable, Optional, Union
+
+from .text import Text
+from .highlighter import JSONHighlighter, NullHighlighter
+
+
+class JSON:
+    """A renderable which pretty prints JSON.
+
+    Args:
+        json (str): JSON encoded data.
+        indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2.
+        highlight (bool, optional): Enable highlighting. Defaults to True.
+        skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+        ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+        check_circular (bool, optional): Check for circular references. Defaults to True.
+        allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+        default (Callable, optional): A callable that converts values that can not be encoded
+            in to something that can be JSON encoded. Defaults to None.
+        sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+    """
+
+    def __init__(
+        self,
+        json: str,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = False,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> None:
+        data = loads(json)
+        json = dumps(
+            data,
+            indent=indent,
+            skipkeys=skip_keys,
+            ensure_ascii=ensure_ascii,
+            check_circular=check_circular,
+            allow_nan=allow_nan,
+            default=default,
+            sort_keys=sort_keys,
+        )
+        highlighter = JSONHighlighter() if highlight else NullHighlighter()
+        self.text = highlighter(json)
+        self.text.no_wrap = True
+        self.text.overflow = None
+
+    @classmethod
+    def from_data(
+        cls,
+        data: Any,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = False,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> "JSON":
+        """Encodes a JSON object from arbitrary data.
+
+        Args:
+            data (Any): An object that may be encoded in to JSON
+            indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2.
+            highlight (bool, optional): Enable highlighting. Defaults to True.
+            default (Callable, optional): Optional callable which will be called for objects that cannot be serialized. Defaults to None.
+            skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+            ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+            check_circular (bool, optional): Check for circular references. Defaults to True.
+            allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+            default (Callable, optional): A callable that converts values that can not be encoded
+                in to something that can be JSON encoded. Defaults to None.
+            sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+
+        Returns:
+            JSON: New JSON object from the given data.
+        """
+        json_instance: "JSON" = cls.__new__(cls)
+        json = dumps(
+            data,
+            indent=indent,
+            skipkeys=skip_keys,
+            ensure_ascii=ensure_ascii,
+            check_circular=check_circular,
+            allow_nan=allow_nan,
+            default=default,
+            sort_keys=sort_keys,
+        )
+        highlighter = JSONHighlighter() if highlight else NullHighlighter()
+        json_instance.text = highlighter(json)
+        json_instance.text.no_wrap = True
+        json_instance.text.overflow = None
+        return json_instance
+
+    def __rich__(self) -> Text:
+        return self.text
+
+
+if __name__ == "__main__":
+    import argparse
+    import sys
+
+    parser = argparse.ArgumentParser(description="Pretty print json")
+    parser.add_argument(
+        "path",
+        metavar="PATH",
+        help="path to file, or - for stdin",
+    )
+    parser.add_argument(
+        "-i",
+        "--indent",
+        metavar="SPACES",
+        type=int,
+        help="Number of spaces in an indent",
+        default=2,
+    )
+    args = parser.parse_args()
+
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+    error_console = Console(stderr=True)
+
+    try:
+        if args.path == "-":
+            json_data = sys.stdin.read()
+        else:
+            json_data = Path(args.path).read_text()
+    except Exception as error:
+        error_console.print(f"Unable to read {args.path!r}; {error}")
+        sys.exit(-1)
+
+    console.print(JSON(json_data, indent=args.indent), soft_wrap=True)

llava/lib/python3.10/site-packages/pip/_vendor/rich/palette.py

@@ -0,0 +1,100 @@
+from math import sqrt
+from functools import lru_cache
+from typing import Sequence, Tuple, TYPE_CHECKING
+
+from .color_triplet import ColorTriplet
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.table import Table
+
+
+class Palette:
+    """A palette of available colors."""
+
+    def __init__(self, colors: Sequence[Tuple[int, int, int]]):
+        self._colors = colors
+
+    def __getitem__(self, number: int) -> ColorTriplet:
+        return ColorTriplet(*self._colors[number])
+
+    def __rich__(self) -> "Table":
+        from pip._vendor.rich.color import Color
+        from pip._vendor.rich.style import Style
+        from pip._vendor.rich.text import Text
+        from pip._vendor.rich.table import Table
+
+        table = Table(
+            "index",
+            "RGB",
+            "Color",
+            title="Palette",
+            caption=f"{len(self._colors)} colors",
+            highlight=True,
+            caption_justify="right",
+        )
+        for index, color in enumerate(self._colors):
+            table.add_row(
+                str(index),
+                repr(color),
+                Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))),
+            )
+        return table
+
+    # This is somewhat inefficient and needs caching
+    @lru_cache(maxsize=1024)
+    def match(self, color: Tuple[int, int, int]) -> int:
+        """Find a color from a palette that most closely matches a given color.
+
+        Args:
+            color (Tuple[int, int, int]): RGB components in range 0 > 255.
+
+        Returns:
+            int: Index of closes matching color.
+        """
+        red1, green1, blue1 = color
+        _sqrt = sqrt
+        get_color = self._colors.__getitem__
+
+        def get_color_distance(index: int) -> float:
+            """Get the distance to a color."""
+            red2, green2, blue2 = get_color(index)
+            red_mean = (red1 + red2) // 2
+            red = red1 - red2
+            green = green1 - green2
+            blue = blue1 - blue2
+            return _sqrt(
+                (((512 + red_mean) * red * red) >> 8)
+                + 4 * green * green
+                + (((767 - red_mean) * blue * blue) >> 8)
+            )
+
+        min_index = min(range(len(self._colors)), key=get_color_distance)
+        return min_index
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import colorsys
+    from typing import Iterable
+    from pip._vendor.rich.color import Color
+    from pip._vendor.rich.console import Console, ConsoleOptions
+    from pip._vendor.rich.segment import Segment
+    from pip._vendor.rich.style import Style
+
+    class ColorBox:
+        def __rich_console__(
+            self, console: Console, options: ConsoleOptions
+        ) -> Iterable[Segment]:
+            height = console.size.height - 3
+            for y in range(0, height):
+                for x in range(options.max_width):
+                    h = x / options.max_width
+                    l = y / (height + 1)
+                    r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0)
+                    r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0)
+                    bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255)
+                    color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255)
+                    yield Segment("▄", Style(color=color, bgcolor=bgcolor))
+                yield Segment.line()
+
+    console = Console()
+    console.print(ColorBox())

llava/lib/python3.10/site-packages/pip/_vendor/rich/panel.py

@@ -0,0 +1,318 @@
+from typing import TYPE_CHECKING, Optional
+
+from .align import AlignMethod
+from .box import ROUNDED, Box
+from .cells import cell_len
+from .jupyter import JupyterMixin
+from .measure import Measurement, measure_renderables
+from .padding import Padding, PaddingDimensions
+from .segment import Segment
+from .style import Style, StyleType
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+
+class Panel(JupyterMixin):
+    """A console renderable that draws a border around its contents.
+
+    Example:
+        >>> console.print(Panel("Hello, World!"))
+
+    Args:
+        renderable (RenderableType): A console renderable object.
+        box (Box, optional): A Box instance that defines the look of the border (see :ref:`appendix_box`. Defaults to box.ROUNDED.
+        title (Optional[TextType], optional): Optional title displayed in panel header. Defaults to None.
+        title_align (AlignMethod, optional): Alignment of title. Defaults to "center".
+        subtitle (Optional[TextType], optional): Optional subtitle displayed in panel footer. Defaults to None.
+        subtitle_align (AlignMethod, optional): Alignment of subtitle. Defaults to "center".
+        safe_box (bool, optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True.
+        expand (bool, optional): If True the panel will stretch to fill the console width, otherwise it will be sized to fit the contents. Defaults to True.
+        style (str, optional): The style of the panel (border and contents). Defaults to "none".
+        border_style (str, optional): The style of the border. Defaults to "none".
+        width (Optional[int], optional): Optional width of panel. Defaults to None to auto-detect.
+        height (Optional[int], optional): Optional height of panel. Defaults to None to auto-detect.
+        padding (Optional[PaddingDimensions]): Optional padding around renderable. Defaults to 0.
+        highlight (bool, optional): Enable automatic highlighting of panel title (if str). Defaults to False.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        box: Box = ROUNDED,
+        *,
+        title: Optional[TextType] = None,
+        title_align: AlignMethod = "center",
+        subtitle: Optional[TextType] = None,
+        subtitle_align: AlignMethod = "center",
+        safe_box: Optional[bool] = None,
+        expand: bool = True,
+        style: StyleType = "none",
+        border_style: StyleType = "none",
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        padding: PaddingDimensions = (0, 1),
+        highlight: bool = False,
+    ) -> None:
+        self.renderable = renderable
+        self.box = box
+        self.title = title
+        self.title_align: AlignMethod = title_align
+        self.subtitle = subtitle
+        self.subtitle_align = subtitle_align
+        self.safe_box = safe_box
+        self.expand = expand
+        self.style = style
+        self.border_style = border_style
+        self.width = width
+        self.height = height
+        self.padding = padding
+        self.highlight = highlight
+
+    @classmethod
+    def fit(
+        cls,
+        renderable: "RenderableType",
+        box: Box = ROUNDED,
+        *,
+        title: Optional[TextType] = None,
+        title_align: AlignMethod = "center",
+        subtitle: Optional[TextType] = None,
+        subtitle_align: AlignMethod = "center",
+        safe_box: Optional[bool] = None,
+        style: StyleType = "none",
+        border_style: StyleType = "none",
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        padding: PaddingDimensions = (0, 1),
+        highlight: bool = False,
+    ) -> "Panel":
+        """An alternative constructor that sets expand=False."""
+        return cls(
+            renderable,
+            box,
+            title=title,
+            title_align=title_align,
+            subtitle=subtitle,
+            subtitle_align=subtitle_align,
+            safe_box=safe_box,
+            style=style,
+            border_style=border_style,
+            width=width,
+            height=height,
+            padding=padding,
+            highlight=highlight,
+            expand=False,
+        )
+
+    @property
+    def _title(self) -> Optional[Text]:
+        if self.title:
+            title_text = (
+                Text.from_markup(self.title)
+                if isinstance(self.title, str)
+                else self.title.copy()
+            )
+            title_text.end = ""
+            title_text.plain = title_text.plain.replace("\n", " ")
+            title_text.no_wrap = True
+            title_text.expand_tabs()
+            title_text.pad(1)
+            return title_text
+        return None
+
+    @property
+    def _subtitle(self) -> Optional[Text]:
+        if self.subtitle:
+            subtitle_text = (
+                Text.from_markup(self.subtitle)
+                if isinstance(self.subtitle, str)
+                else self.subtitle.copy()
+            )
+            subtitle_text.end = ""
+            subtitle_text.plain = subtitle_text.plain.replace("\n", " ")
+            subtitle_text.no_wrap = True
+            subtitle_text.expand_tabs()
+            subtitle_text.pad(1)
+            return subtitle_text
+        return None
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        _padding = Padding.unpack(self.padding)
+        renderable = (
+            Padding(self.renderable, _padding) if any(_padding) else self.renderable
+        )
+        style = console.get_style(self.style)
+        partial_border_style = console.get_style(self.border_style)
+        border_style = style + partial_border_style
+        width = (
+            options.max_width
+            if self.width is None
+            else min(options.max_width, self.width)
+        )
+
+        safe_box: bool = console.safe_box if self.safe_box is None else self.safe_box
+        box = self.box.substitute(options, safe=safe_box)
+
+        def align_text(
+            text: Text, width: int, align: str, character: str, style: Style
+        ) -> Text:
+            """Gets new aligned text.
+
+            Args:
+                text (Text): Title or subtitle text.
+                width (int): Desired width.
+                align (str): Alignment.
+                character (str): Character for alignment.
+                style (Style): Border style
+
+            Returns:
+                Text: New text instance
+            """
+            text = text.copy()
+            text.truncate(width)
+            excess_space = width - cell_len(text.plain)
+            if text.style:
+                text.stylize(console.get_style(text.style))
+
+            if excess_space:
+                if align == "left":
+                    return Text.assemble(
+                        text,
+                        (character * excess_space, style),
+                        no_wrap=True,
+                        end="",
+                    )
+                elif align == "center":
+                    left = excess_space // 2
+                    return Text.assemble(
+                        (character * left, style),
+                        text,
+                        (character * (excess_space - left), style),
+                        no_wrap=True,
+                        end="",
+                    )
+                else:
+                    return Text.assemble(
+                        (character * excess_space, style),
+                        text,
+                        no_wrap=True,
+                        end="",
+                    )
+            return text
+
+        title_text = self._title
+        if title_text is not None:
+            title_text.stylize_before(partial_border_style)
+
+        child_width = (
+            width - 2
+            if self.expand
+            else console.measure(
+                renderable, options=options.update_width(width - 2)
+            ).maximum
+        )
+        child_height = self.height or options.height or None
+        if child_height:
+            child_height -= 2
+        if title_text is not None:
+            child_width = min(
+                options.max_width - 2, max(child_width, title_text.cell_len + 2)
+            )
+
+        width = child_width + 2
+        child_options = options.update(
+            width=child_width, height=child_height, highlight=self.highlight
+        )
+        lines = console.render_lines(renderable, child_options, style=style)
+
+        line_start = Segment(box.mid_left, border_style)
+        line_end = Segment(f"{box.mid_right}", border_style)
+        new_line = Segment.line()
+        if title_text is None or width <= 4:
+            yield Segment(box.get_top([width - 2]), border_style)
+        else:
+            title_text = align_text(
+                title_text,
+                width - 4,
+                self.title_align,
+                box.top,
+                border_style,
+            )
+            yield Segment(box.top_left + box.top, border_style)
+            yield from console.render(title_text, child_options.update_width(width - 4))
+            yield Segment(box.top + box.top_right, border_style)
+
+        yield new_line
+        for line in lines:
+            yield line_start
+            yield from line
+            yield line_end
+            yield new_line
+
+        subtitle_text = self._subtitle
+        if subtitle_text is not None:
+            subtitle_text.stylize_before(partial_border_style)
+
+        if subtitle_text is None or width <= 4:
+            yield Segment(box.get_bottom([width - 2]), border_style)
+        else:
+            subtitle_text = align_text(
+                subtitle_text,
+                width - 4,
+                self.subtitle_align,
+                box.bottom,
+                border_style,
+            )
+            yield Segment(box.bottom_left + box.bottom, border_style)
+            yield from console.render(
+                subtitle_text, child_options.update_width(width - 4)
+            )
+            yield Segment(box.bottom + box.bottom_right, border_style)
+
+        yield new_line
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        _title = self._title
+        _, right, _, left = Padding.unpack(self.padding)
+        padding = left + right
+        renderables = [self.renderable, _title] if _title else [self.renderable]
+
+        if self.width is None:
+            width = (
+                measure_renderables(
+                    console,
+                    options.update_width(options.max_width - padding - 2),
+                    renderables,
+                ).maximum
+                + padding
+                + 2
+            )
+        else:
+            width = self.width
+        return Measurement(width, width)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    c = Console()
+
+    from .box import DOUBLE, ROUNDED
+    from .padding import Padding
+
+    p = Panel(
+        "Hello, World!",
+        title="rich.Panel",
+        style="white on blue",
+        box=DOUBLE,
+        padding=1,
+    )
+
+    c.print()
+    c.print(p)

llava/lib/python3.10/site-packages/pip/_vendor/rich/progress_bar.py

@@ -0,0 +1,223 @@
+import math
+from functools import lru_cache
+from time import monotonic
+from typing import Iterable, List, Optional
+
+from .color import Color, blend_rgb
+from .color_triplet import ColorTriplet
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleType
+
+# Number of characters before 'pulse' animation repeats
+PULSE_SIZE = 20
+
+
+class ProgressBar(JupyterMixin):
+    """Renders a (progress) bar. Used by rich.progress.
+
+    Args:
+        total (float, optional): Number of steps in the bar. Defaults to 100. Set to None to render a pulsing animation.
+        completed (float, optional): Number of steps completed. Defaults to 0.
+        width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None.
+        pulse (bool, optional): Enable pulse effect. Defaults to False. Will pulse if a None total was passed.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        animation_time (Optional[float], optional): Time in seconds to use for animation, or None to use system time.
+    """
+
+    def __init__(
+        self,
+        total: Optional[float] = 100.0,
+        completed: float = 0,
+        width: Optional[int] = None,
+        pulse: bool = False,
+        style: StyleType = "bar.back",
+        complete_style: StyleType = "bar.complete",
+        finished_style: StyleType = "bar.finished",
+        pulse_style: StyleType = "bar.pulse",
+        animation_time: Optional[float] = None,
+    ):
+        self.total = total
+        self.completed = completed
+        self.width = width
+        self.pulse = pulse
+        self.style = style
+        self.complete_style = complete_style
+        self.finished_style = finished_style
+        self.pulse_style = pulse_style
+        self.animation_time = animation_time
+
+        self._pulse_segments: Optional[List[Segment]] = None
+
+    def __repr__(self) -> str:
+        return f"<Bar {self.completed!r} of {self.total!r}>"
+
+    @property
+    def percentage_completed(self) -> Optional[float]:
+        """Calculate percentage complete."""
+        if self.total is None:
+            return None
+        completed = (self.completed / self.total) * 100.0
+        completed = min(100, max(0.0, completed))
+        return completed
+
+    @lru_cache(maxsize=16)
+    def _get_pulse_segments(
+        self,
+        fore_style: Style,
+        back_style: Style,
+        color_system: str,
+        no_color: bool,
+        ascii: bool = False,
+    ) -> List[Segment]:
+        """Get a list of segments to render a pulse animation.
+
+        Returns:
+            List[Segment]: A list of segments, one segment per character.
+        """
+        bar = "-" if ascii else "━"
+        segments: List[Segment] = []
+        if color_system not in ("standard", "eight_bit", "truecolor") or no_color:
+            segments += [Segment(bar, fore_style)] * (PULSE_SIZE // 2)
+            segments += [Segment(" " if no_color else bar, back_style)] * (
+                PULSE_SIZE - (PULSE_SIZE // 2)
+            )
+            return segments
+
+        append = segments.append
+        fore_color = (
+            fore_style.color.get_truecolor()
+            if fore_style.color
+            else ColorTriplet(255, 0, 255)
+        )
+        back_color = (
+            back_style.color.get_truecolor()
+            if back_style.color
+            else ColorTriplet(0, 0, 0)
+        )
+        cos = math.cos
+        pi = math.pi
+        _Segment = Segment
+        _Style = Style
+        from_triplet = Color.from_triplet
+
+        for index in range(PULSE_SIZE):
+            position = index / PULSE_SIZE
+            fade = 0.5 + cos(position * pi * 2) / 2.0
+            color = blend_rgb(fore_color, back_color, cross_fade=fade)
+            append(_Segment(bar, _Style(color=from_triplet(color))))
+        return segments
+
+    def update(self, completed: float, total: Optional[float] = None) -> None:
+        """Update progress with new values.
+
+        Args:
+            completed (float): Number of steps completed.
+            total (float, optional): Total number of steps, or ``None`` to not change. Defaults to None.
+        """
+        self.completed = completed
+        self.total = total if total is not None else self.total
+
+    def _render_pulse(
+        self, console: Console, width: int, ascii: bool = False
+    ) -> Iterable[Segment]:
+        """Renders the pulse animation.
+
+        Args:
+            console (Console): Console instance.
+            width (int): Width in characters of pulse animation.
+
+        Returns:
+            RenderResult: [description]
+
+        Yields:
+            Iterator[Segment]: Segments to render pulse
+        """
+        fore_style = console.get_style(self.pulse_style, default="white")
+        back_style = console.get_style(self.style, default="black")
+
+        pulse_segments = self._get_pulse_segments(
+            fore_style, back_style, console.color_system, console.no_color, ascii=ascii
+        )
+        segment_count = len(pulse_segments)
+        current_time = (
+            monotonic() if self.animation_time is None else self.animation_time
+        )
+        segments = pulse_segments * (int(width / segment_count) + 2)
+        offset = int(-current_time * 15) % segment_count
+        segments = segments[offset : offset + width]
+        yield from segments
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        width = min(self.width or options.max_width, options.max_width)
+        ascii = options.legacy_windows or options.ascii_only
+        should_pulse = self.pulse or self.total is None
+        if should_pulse:
+            yield from self._render_pulse(console, width, ascii=ascii)
+            return
+
+        completed: Optional[float] = (
+            min(self.total, max(0, self.completed)) if self.total is not None else None
+        )
+
+        bar = "-" if ascii else "━"
+        half_bar_right = " " if ascii else "╸"
+        half_bar_left = " " if ascii else "╺"
+        complete_halves = (
+            int(width * 2 * completed / self.total)
+            if self.total and completed is not None
+            else width * 2
+        )
+        bar_count = complete_halves // 2
+        half_bar_count = complete_halves % 2
+        style = console.get_style(self.style)
+        is_finished = self.total is None or self.completed >= self.total
+        complete_style = console.get_style(
+            self.finished_style if is_finished else self.complete_style
+        )
+        _Segment = Segment
+        if bar_count:
+            yield _Segment(bar * bar_count, complete_style)
+        if half_bar_count:
+            yield _Segment(half_bar_right * half_bar_count, complete_style)
+
+        if not console.no_color:
+            remaining_bars = width - bar_count - half_bar_count
+            if remaining_bars and console.color_system is not None:
+                if not half_bar_count and bar_count:
+                    yield _Segment(half_bar_left, style)
+                    remaining_bars -= 1
+                if remaining_bars:
+                    yield _Segment(bar * remaining_bars, style)
+
+    def __rich_measure__(
+        self, console: Console, options: ConsoleOptions
+    ) -> Measurement:
+        return (
+            Measurement(self.width, self.width)
+            if self.width is not None
+            else Measurement(4, options.max_width)
+        )
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console()
+    bar = ProgressBar(width=50, total=100)
+
+    import time
+
+    console.show_cursor(False)
+    for n in range(0, 101, 1):
+        bar.update(n)
+        console.print(bar)
+        console.file.write("\r")
+        time.sleep(0.05)
+    console.show_cursor(True)
+    console.print()

llava/lib/python3.10/site-packages/pip/_vendor/rich/prompt.py

@@ -0,0 +1,400 @@
+from typing import Any, Generic, List, Optional, TextIO, TypeVar, Union, overload
+
+from . import get_console
+from .console import Console
+from .text import Text, TextType
+
+PromptType = TypeVar("PromptType")
+DefaultType = TypeVar("DefaultType")
+
+
+class PromptError(Exception):
+    """Exception base class for prompt related errors."""
+
+
+class InvalidResponse(PromptError):
+    """Exception to indicate a response was invalid. Raise this within process_response() to indicate an error
+    and provide an error message.
+
+    Args:
+        message (Union[str, Text]): Error message.
+    """
+
+    def __init__(self, message: TextType) -> None:
+        self.message = message
+
+    def __rich__(self) -> TextType:
+        return self.message
+
+
+class PromptBase(Generic[PromptType]):
+    """Ask the user for input until a valid response is received. This is the base class, see one of
+    the concrete classes for examples.
+
+    Args:
+        prompt (TextType, optional): Prompt text. Defaults to "".
+        console (Console, optional): A Console instance or None to use global console. Defaults to None.
+        password (bool, optional): Enable password input. Defaults to False.
+        choices (List[str], optional): A list of valid choices. Defaults to None.
+        case_sensitive (bool, optional): Matching of choices should be case-sensitive. Defaults to True.
+        show_default (bool, optional): Show default in prompt. Defaults to True.
+        show_choices (bool, optional): Show choices in prompt. Defaults to True.
+    """
+
+    response_type: type = str
+
+    validate_error_message = "[prompt.invalid]Please enter a valid value"
+    illegal_choice_message = (
+        "[prompt.invalid.choice]Please select one of the available options"
+    )
+    prompt_suffix = ": "
+
+    choices: Optional[List[str]] = None
+
+    def __init__(
+        self,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        case_sensitive: bool = True,
+        show_default: bool = True,
+        show_choices: bool = True,
+    ) -> None:
+        self.console = console or get_console()
+        self.prompt = (
+            Text.from_markup(prompt, style="prompt")
+            if isinstance(prompt, str)
+            else prompt
+        )
+        self.password = password
+        if choices is not None:
+            self.choices = choices
+        self.case_sensitive = case_sensitive
+        self.show_default = show_default
+        self.show_choices = show_choices
+
+    @classmethod
+    @overload
+    def ask(
+        cls,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        case_sensitive: bool = True,
+        show_default: bool = True,
+        show_choices: bool = True,
+        default: DefaultType,
+        stream: Optional[TextIO] = None,
+    ) -> Union[DefaultType, PromptType]:
+        ...
+
+    @classmethod
+    @overload
+    def ask(
+        cls,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        case_sensitive: bool = True,
+        show_default: bool = True,
+        show_choices: bool = True,
+        stream: Optional[TextIO] = None,
+    ) -> PromptType:
+        ...
+
+    @classmethod
+    def ask(
+        cls,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        case_sensitive: bool = True,
+        show_default: bool = True,
+        show_choices: bool = True,
+        default: Any = ...,
+        stream: Optional[TextIO] = None,
+    ) -> Any:
+        """Shortcut to construct and run a prompt loop and return the result.
+
+        Example:
+            >>> filename = Prompt.ask("Enter a filename")
+
+        Args:
+            prompt (TextType, optional): Prompt text. Defaults to "".
+            console (Console, optional): A Console instance or None to use global console. Defaults to None.
+            password (bool, optional): Enable password input. Defaults to False.
+            choices (List[str], optional): A list of valid choices. Defaults to None.
+            case_sensitive (bool, optional): Matching of choices should be case-sensitive. Defaults to True.
+            show_default (bool, optional): Show default in prompt. Defaults to True.
+            show_choices (bool, optional): Show choices in prompt. Defaults to True.
+            stream (TextIO, optional): Optional text file open for reading to get input. Defaults to None.
+        """
+        _prompt = cls(
+            prompt,
+            console=console,
+            password=password,
+            choices=choices,
+            case_sensitive=case_sensitive,
+            show_default=show_default,
+            show_choices=show_choices,
+        )
+        return _prompt(default=default, stream=stream)
+
+    def render_default(self, default: DefaultType) -> Text:
+        """Turn the supplied default in to a Text instance.
+
+        Args:
+            default (DefaultType): Default value.
+
+        Returns:
+            Text: Text containing rendering of default value.
+        """
+        return Text(f"({default})", "prompt.default")
+
+    def make_prompt(self, default: DefaultType) -> Text:
+        """Make prompt text.
+
+        Args:
+            default (DefaultType): Default value.
+
+        Returns:
+            Text: Text to display in prompt.
+        """
+        prompt = self.prompt.copy()
+        prompt.end = ""
+
+        if self.show_choices and self.choices:
+            _choices = "/".join(self.choices)
+            choices = f"[{_choices}]"
+            prompt.append(" ")
+            prompt.append(choices, "prompt.choices")
+
+        if (
+            default != ...
+            and self.show_default
+            and isinstance(default, (str, self.response_type))
+        ):
+            prompt.append(" ")
+            _default = self.render_default(default)
+            prompt.append(_default)
+
+        prompt.append(self.prompt_suffix)
+
+        return prompt
+
+    @classmethod
+    def get_input(
+        cls,
+        console: Console,
+        prompt: TextType,
+        password: bool,
+        stream: Optional[TextIO] = None,
+    ) -> str:
+        """Get input from user.
+
+        Args:
+            console (Console): Console instance.
+            prompt (TextType): Prompt text.
+            password (bool): Enable password entry.
+
+        Returns:
+            str: String from user.
+        """
+        return console.input(prompt, password=password, stream=stream)
+
+    def check_choice(self, value: str) -> bool:
+        """Check value is in the list of valid choices.
+
+        Args:
+            value (str): Value entered by user.
+
+        Returns:
+            bool: True if choice was valid, otherwise False.
+        """
+        assert self.choices is not None
+        if self.case_sensitive:
+            return value.strip() in self.choices
+        return value.strip().lower() in [choice.lower() for choice in self.choices]
+
+    def process_response(self, value: str) -> PromptType:
+        """Process response from user, convert to prompt type.
+
+        Args:
+            value (str): String typed by user.
+
+        Raises:
+            InvalidResponse: If ``value`` is invalid.
+
+        Returns:
+            PromptType: The value to be returned from ask method.
+        """
+        value = value.strip()
+        try:
+            return_value: PromptType = self.response_type(value)
+        except ValueError:
+            raise InvalidResponse(self.validate_error_message)
+
+        if self.choices is not None:
+            if not self.check_choice(value):
+                raise InvalidResponse(self.illegal_choice_message)
+
+            if not self.case_sensitive:
+                # return the original choice, not the lower case version
+                return_value = self.response_type(
+                    self.choices[
+                        [choice.lower() for choice in self.choices].index(value.lower())
+                    ]
+                )
+        return return_value
+
+    def on_validate_error(self, value: str, error: InvalidResponse) -> None:
+        """Called to handle validation error.
+
+        Args:
+            value (str): String entered by user.
+            error (InvalidResponse): Exception instance the initiated the error.
+        """
+        self.console.print(error)
+
+    def pre_prompt(self) -> None:
+        """Hook to display something before the prompt."""
+
+    @overload
+    def __call__(self, *, stream: Optional[TextIO] = None) -> PromptType:
+        ...
+
+    @overload
+    def __call__(
+        self, *, default: DefaultType, stream: Optional[TextIO] = None
+    ) -> Union[PromptType, DefaultType]:
+        ...
+
+    def __call__(self, *, default: Any = ..., stream: Optional[TextIO] = None) -> Any:
+        """Run the prompt loop.
+
+        Args:
+            default (Any, optional): Optional default value.
+
+        Returns:
+            PromptType: Processed value.
+        """
+        while True:
+            self.pre_prompt()
+            prompt = self.make_prompt(default)
+            value = self.get_input(self.console, prompt, self.password, stream=stream)
+            if value == "" and default != ...:
+                return default
+            try:
+                return_value = self.process_response(value)
+            except InvalidResponse as error:
+                self.on_validate_error(value, error)
+                continue
+            else:
+                return return_value
+
+
+class Prompt(PromptBase[str]):
+    """A prompt that returns a str.
+
+    Example:
+        >>> name = Prompt.ask("Enter your name")
+
+
+    """
+
+    response_type = str
+
+
+class IntPrompt(PromptBase[int]):
+    """A prompt that returns an integer.
+
+    Example:
+        >>> burrito_count = IntPrompt.ask("How many burritos do you want to order")
+
+    """
+
+    response_type = int
+    validate_error_message = "[prompt.invalid]Please enter a valid integer number"
+
+
+class FloatPrompt(PromptBase[float]):
+    """A prompt that returns a float.
+
+    Example:
+        >>> temperature = FloatPrompt.ask("Enter desired temperature")
+
+    """
+
+    response_type = float
+    validate_error_message = "[prompt.invalid]Please enter a number"
+
+
+class Confirm(PromptBase[bool]):
+    """A yes / no confirmation prompt.
+
+    Example:
+        >>> if Confirm.ask("Continue"):
+                run_job()
+
+    """
+
+    response_type = bool
+    validate_error_message = "[prompt.invalid]Please enter Y or N"
+    choices: List[str] = ["y", "n"]
+
+    def render_default(self, default: DefaultType) -> Text:
+        """Render the default as (y) or (n) rather than True/False."""
+        yes, no = self.choices
+        return Text(f"({yes})" if default else f"({no})", style="prompt.default")
+
+    def process_response(self, value: str) -> bool:
+        """Convert choices to a bool."""
+        value = value.strip().lower()
+        if value not in self.choices:
+            raise InvalidResponse(self.validate_error_message)
+        return value == self.choices[0]
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich import print
+
+    if Confirm.ask("Run [i]prompt[/i] tests?", default=True):
+        while True:
+            result = IntPrompt.ask(
+                ":rocket: Enter a number between [b]1[/b] and [b]10[/b]", default=5
+            )
+            if result >= 1 and result <= 10:
+                break
+            print(":pile_of_poo: [prompt.invalid]Number must be between 1 and 10")
+        print(f"number={result}")
+
+        while True:
+            password = Prompt.ask(
+                "Please enter a password [cyan](must be at least 5 characters)",
+                password=True,
+            )
+            if len(password) >= 5:
+                break
+            print("[prompt.invalid]password too short")
+        print(f"password={password!r}")
+
+        fruit = Prompt.ask("Enter a fruit", choices=["apple", "orange", "pear"])
+        print(f"fruit={fruit!r}")
+
+        doggie = Prompt.ask(
+            "What's the best Dog? (Case INSENSITIVE)",
+            choices=["Border Terrier", "Collie", "Labradoodle"],
+            case_sensitive=False,
+        )
+        print(f"doggie={doggie!r}")
+
+    else:
+        print("[b]OK :loudly_crying_face:")

llava/lib/python3.10/site-packages/pip/_vendor/rich/protocol.py

@@ -0,0 +1,42 @@
+from typing import Any, cast, Set, TYPE_CHECKING
+from inspect import isclass
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.console import RenderableType
+
+_GIBBERISH = """aihwerij235234ljsdnp34ksodfipwoe234234jlskjdf"""
+
+
+def is_renderable(check_object: Any) -> bool:
+    """Check if an object may be rendered by Rich."""
+    return (
+        isinstance(check_object, str)
+        or hasattr(check_object, "__rich__")
+        or hasattr(check_object, "__rich_console__")
+    )
+
+
+def rich_cast(renderable: object) -> "RenderableType":
+    """Cast an object to a renderable by calling __rich__ if present.
+
+    Args:
+        renderable (object): A potentially renderable object
+
+    Returns:
+        object: The result of recursively calling __rich__.
+    """
+    from pip._vendor.rich.console import RenderableType
+
+    rich_visited_set: Set[type] = set()  # Prevent potential infinite loop
+    while hasattr(renderable, "__rich__") and not isclass(renderable):
+        # Detect object which claim to have all the attributes
+        if hasattr(renderable, _GIBBERISH):
+            return repr(renderable)
+        cast_method = getattr(renderable, "__rich__")
+        renderable = cast_method()
+        renderable_type = type(renderable)
+        if renderable_type in rich_visited_set:
+            break
+        rich_visited_set.add(renderable_type)
+
+    return cast(RenderableType, renderable)

llava/lib/python3.10/site-packages/pip/_vendor/rich/segment.py

@@ -0,0 +1,752 @@
+from enum import IntEnum
+from functools import lru_cache
+from itertools import filterfalse
+from logging import getLogger
+from operator import attrgetter
+from typing import (
+    TYPE_CHECKING,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Tuple,
+    Type,
+    Union,
+)
+
+from .cells import (
+    _is_single_cell_widths,
+    cached_cell_len,
+    cell_len,
+    get_character_cell_size,
+    set_cell_size,
+)
+from .repr import Result, rich_repr
+from .style import Style
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult
+
+log = getLogger("rich")
+
+
+class ControlType(IntEnum):
+    """Non-printable control codes which typically translate to ANSI codes."""
+
+    BELL = 1
+    CARRIAGE_RETURN = 2
+    HOME = 3
+    CLEAR = 4
+    SHOW_CURSOR = 5
+    HIDE_CURSOR = 6
+    ENABLE_ALT_SCREEN = 7
+    DISABLE_ALT_SCREEN = 8
+    CURSOR_UP = 9
+    CURSOR_DOWN = 10
+    CURSOR_FORWARD = 11
+    CURSOR_BACKWARD = 12
+    CURSOR_MOVE_TO_COLUMN = 13
+    CURSOR_MOVE_TO = 14
+    ERASE_IN_LINE = 15
+    SET_WINDOW_TITLE = 16
+
+
+ControlCode = Union[
+    Tuple[ControlType],
+    Tuple[ControlType, Union[int, str]],
+    Tuple[ControlType, int, int],
+]
+
+
+@rich_repr()
+class Segment(NamedTuple):
+    """A piece of text with associated style. Segments are produced by the Console render process and
+    are ultimately converted in to strings to be written to the terminal.
+
+    Args:
+        text (str): A piece of text.
+        style (:class:`~rich.style.Style`, optional): An optional style to apply to the text.
+        control (Tuple[ControlCode], optional): Optional sequence of control codes.
+
+    Attributes:
+        cell_length (int): The cell length of this Segment.
+    """
+
+    text: str
+    style: Optional[Style] = None
+    control: Optional[Sequence[ControlCode]] = None
+
+    @property
+    def cell_length(self) -> int:
+        """The number of terminal cells required to display self.text.
+
+        Returns:
+            int: A number of cells.
+        """
+        text, _style, control = self
+        return 0 if control else cell_len(text)
+
+    def __rich_repr__(self) -> Result:
+        yield self.text
+        if self.control is None:
+            if self.style is not None:
+                yield self.style
+        else:
+            yield self.style
+            yield self.control
+
+    def __bool__(self) -> bool:
+        """Check if the segment contains text."""
+        return bool(self.text)
+
+    @property
+    def is_control(self) -> bool:
+        """Check if the segment contains control codes."""
+        return self.control is not None
+
+    @classmethod
+    @lru_cache(1024 * 16)
+    def _split_cells(cls, segment: "Segment", cut: int) -> Tuple["Segment", "Segment"]:
+        """Split a segment in to two at a given cell position.
+
+        Note that splitting a double-width character, may result in that character turning
+        into two spaces.
+
+        Args:
+            segment (Segment): A segment to split.
+            cut (int): A cell position to cut on.
+
+        Returns:
+            A tuple of two segments.
+        """
+        text, style, control = segment
+        _Segment = Segment
+        cell_length = segment.cell_length
+        if cut >= cell_length:
+            return segment, _Segment("", style, control)
+
+        cell_size = get_character_cell_size
+
+        pos = int((cut / cell_length) * len(text))
+
+        while True:
+            before = text[:pos]
+            cell_pos = cell_len(before)
+            out_by = cell_pos - cut
+            if not out_by:
+                return (
+                    _Segment(before, style, control),
+                    _Segment(text[pos:], style, control),
+                )
+            if out_by == -1 and cell_size(text[pos]) == 2:
+                return (
+                    _Segment(text[:pos] + " ", style, control),
+                    _Segment(" " + text[pos + 1 :], style, control),
+                )
+            if out_by == +1 and cell_size(text[pos - 1]) == 2:
+                return (
+                    _Segment(text[: pos - 1] + " ", style, control),
+                    _Segment(" " + text[pos:], style, control),
+                )
+            if cell_pos < cut:
+                pos += 1
+            else:
+                pos -= 1
+
+    def split_cells(self, cut: int) -> Tuple["Segment", "Segment"]:
+        """Split segment in to two segments at the specified column.
+
+        If the cut point falls in the middle of a 2-cell wide character then it is replaced
+        by two spaces, to preserve the display width of the parent segment.
+
+        Args:
+            cut (int): Offset within the segment to cut.
+
+        Returns:
+            Tuple[Segment, Segment]: Two segments.
+        """
+        text, style, control = self
+        assert cut >= 0
+
+        if _is_single_cell_widths(text):
+            # Fast path with all 1 cell characters
+            if cut >= len(text):
+                return self, Segment("", style, control)
+            return (
+                Segment(text[:cut], style, control),
+                Segment(text[cut:], style, control),
+            )
+
+        return self._split_cells(self, cut)
+
+    @classmethod
+    def line(cls) -> "Segment":
+        """Make a new line segment."""
+        return cls("\n")
+
+    @classmethod
+    def apply_style(
+        cls,
+        segments: Iterable["Segment"],
+        style: Optional[Style] = None,
+        post_style: Optional[Style] = None,
+    ) -> Iterable["Segment"]:
+        """Apply style(s) to an iterable of segments.
+
+        Returns an iterable of segments where the style is replaced by ``style + segment.style + post_style``.
+
+        Args:
+            segments (Iterable[Segment]): Segments to process.
+            style (Style, optional): Base style. Defaults to None.
+            post_style (Style, optional): Style to apply on top of segment style. Defaults to None.
+
+        Returns:
+            Iterable[Segments]: A new iterable of segments (possibly the same iterable).
+        """
+        result_segments = segments
+        if style:
+            apply = style.__add__
+            result_segments = (
+                cls(text, None if control else apply(_style), control)
+                for text, _style, control in result_segments
+            )
+        if post_style:
+            result_segments = (
+                cls(
+                    text,
+                    (
+                        None
+                        if control
+                        else (_style + post_style if _style else post_style)
+                    ),
+                    control,
+                )
+                for text, _style, control in result_segments
+            )
+        return result_segments
+
+    @classmethod
+    def filter_control(
+        cls, segments: Iterable["Segment"], is_control: bool = False
+    ) -> Iterable["Segment"]:
+        """Filter segments by ``is_control`` attribute.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of Segment instances.
+            is_control (bool, optional): is_control flag to match in search.
+
+        Returns:
+            Iterable[Segment]: And iterable of Segment instances.
+
+        """
+        if is_control:
+            return filter(attrgetter("control"), segments)
+        else:
+            return filterfalse(attrgetter("control"), segments)
+
+    @classmethod
+    def split_lines(cls, segments: Iterable["Segment"]) -> Iterable[List["Segment"]]:
+        """Split a sequence of segments in to a list of lines.
+
+        Args:
+            segments (Iterable[Segment]): Segments potentially containing line feeds.
+
+        Yields:
+            Iterable[List[Segment]]: Iterable of segment lists, one per line.
+        """
+        line: List[Segment] = []
+        append = line.append
+
+        for segment in segments:
+            if "\n" in segment.text and not segment.control:
+                text, style, _ = segment
+                while text:
+                    _text, new_line, text = text.partition("\n")
+                    if _text:
+                        append(cls(_text, style))
+                    if new_line:
+                        yield line
+                        line = []
+                        append = line.append
+            else:
+                append(segment)
+        if line:
+            yield line
+
+    @classmethod
+    def split_and_crop_lines(
+        cls,
+        segments: Iterable["Segment"],
+        length: int,
+        style: Optional[Style] = None,
+        pad: bool = True,
+        include_new_lines: bool = True,
+    ) -> Iterable[List["Segment"]]:
+        """Split segments in to lines, and crop lines greater than a given length.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of segments, probably
+                generated from console.render.
+            length (int): Desired line length.
+            style (Style, optional): Style to use for any padding.
+            pad (bool): Enable padding of lines that are less than `length`.
+
+        Returns:
+            Iterable[List[Segment]]: An iterable of lines of segments.
+        """
+        line: List[Segment] = []
+        append = line.append
+
+        adjust_line_length = cls.adjust_line_length
+        new_line_segment = cls("\n")
+
+        for segment in segments:
+            if "\n" in segment.text and not segment.control:
+                text, segment_style, _ = segment
+                while text:
+                    _text, new_line, text = text.partition("\n")
+                    if _text:
+                        append(cls(_text, segment_style))
+                    if new_line:
+                        cropped_line = adjust_line_length(
+                            line, length, style=style, pad=pad
+                        )
+                        if include_new_lines:
+                            cropped_line.append(new_line_segment)
+                        yield cropped_line
+                        line.clear()
+            else:
+                append(segment)
+        if line:
+            yield adjust_line_length(line, length, style=style, pad=pad)
+
+    @classmethod
+    def adjust_line_length(
+        cls,
+        line: List["Segment"],
+        length: int,
+        style: Optional[Style] = None,
+        pad: bool = True,
+    ) -> List["Segment"]:
+        """Adjust a line to a given width (cropping or padding as required).
+
+        Args:
+            segments (Iterable[Segment]): A list of segments in a single line.
+            length (int): The desired width of the line.
+            style (Style, optional): The style of padding if used (space on the end). Defaults to None.
+            pad (bool, optional): Pad lines with spaces if they are shorter than `length`. Defaults to True.
+
+        Returns:
+            List[Segment]: A line of segments with the desired length.
+        """
+        line_length = sum(segment.cell_length for segment in line)
+        new_line: List[Segment]
+
+        if line_length < length:
+            if pad:
+                new_line = line + [cls(" " * (length - line_length), style)]
+            else:
+                new_line = line[:]
+        elif line_length > length:
+            new_line = []
+            append = new_line.append
+            line_length = 0
+            for segment in line:
+                segment_length = segment.cell_length
+                if line_length + segment_length < length or segment.control:
+                    append(segment)
+                    line_length += segment_length
+                else:
+                    text, segment_style, _ = segment
+                    text = set_cell_size(text, length - line_length)
+                    append(cls(text, segment_style))
+                    break
+        else:
+            new_line = line[:]
+        return new_line
+
+    @classmethod
+    def get_line_length(cls, line: List["Segment"]) -> int:
+        """Get the length of list of segments.
+
+        Args:
+            line (List[Segment]): A line encoded as a list of Segments (assumes no '\\\\n' characters),
+
+        Returns:
+            int: The length of the line.
+        """
+        _cell_len = cell_len
+        return sum(_cell_len(text) for text, style, control in line if not control)
+
+    @classmethod
+    def get_shape(cls, lines: List[List["Segment"]]) -> Tuple[int, int]:
+        """Get the shape (enclosing rectangle) of a list of lines.
+
+        Args:
+            lines (List[List[Segment]]): A list of lines (no '\\\\n' characters).
+
+        Returns:
+            Tuple[int, int]: Width and height in characters.
+        """
+        get_line_length = cls.get_line_length
+        max_width = max(get_line_length(line) for line in lines) if lines else 0
+        return (max_width, len(lines))
+
+    @classmethod
+    def set_shape(
+        cls,
+        lines: List[List["Segment"]],
+        width: int,
+        height: Optional[int] = None,
+        style: Optional[Style] = None,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Set the shape of a list of lines (enclosing rectangle).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style, optional): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        _height = height or len(lines)
+
+        blank = (
+            [cls(" " * width + "\n", style)] if new_lines else [cls(" " * width, style)]
+        )
+
+        adjust_line_length = cls.adjust_line_length
+        shaped_lines = lines[:_height]
+        shaped_lines[:] = [
+            adjust_line_length(line, width, style=style) for line in lines
+        ]
+        if len(shaped_lines) < _height:
+            shaped_lines.extend([blank] * (_height - len(shaped_lines)))
+        return shaped_lines
+
+    @classmethod
+    def align_top(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns lines to top (adds extra lines to bottom as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        lines = lines + [[blank]] * extra_lines
+        return lines
+
+    @classmethod
+    def align_bottom(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns render to bottom (adds extra lines above as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added. Defaults to None.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        lines = [[blank]] * extra_lines + lines
+        return lines
+
+    @classmethod
+    def align_middle(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns lines to middle (adds extra lines to above and below as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        top_lines = extra_lines // 2
+        bottom_lines = extra_lines - top_lines
+        lines = [[blank]] * top_lines + lines + [[blank]] * bottom_lines
+        return lines
+
+    @classmethod
+    def simplify(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Simplify an iterable of segments by combining contiguous segments with the same style.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of segments.
+
+        Returns:
+            Iterable[Segment]: A possibly smaller iterable of segments that will render the same way.
+        """
+        iter_segments = iter(segments)
+        try:
+            last_segment = next(iter_segments)
+        except StopIteration:
+            return
+
+        _Segment = Segment
+        for segment in iter_segments:
+            if last_segment.style == segment.style and not segment.control:
+                last_segment = _Segment(
+                    last_segment.text + segment.text, last_segment.style
+                )
+            else:
+                yield last_segment
+                last_segment = segment
+        yield last_segment
+
+    @classmethod
+    def strip_links(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all links from an iterable of styles.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with link removed.
+        """
+        for segment in segments:
+            if segment.control or segment.style is None:
+                yield segment
+            else:
+                text, style, _control = segment
+                yield cls(text, style.update_link(None) if style else None)
+
+    @classmethod
+    def strip_styles(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all styles from an iterable of segments.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with styles replace with None
+        """
+        for text, _style, control in segments:
+            yield cls(text, None, control)
+
+    @classmethod
+    def remove_color(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all color from an iterable of segments.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with colorless style.
+        """
+
+        cache: Dict[Style, Style] = {}
+        for text, style, control in segments:
+            if style:
+                colorless_style = cache.get(style)
+                if colorless_style is None:
+                    colorless_style = style.without_color
+                    cache[style] = colorless_style
+                yield cls(text, colorless_style, control)
+            else:
+                yield cls(text, None, control)
+
+    @classmethod
+    def divide(
+        cls, segments: Iterable["Segment"], cuts: Iterable[int]
+    ) -> Iterable[List["Segment"]]:
+        """Divides an iterable of segments in to portions.
+
+        Args:
+            cuts (Iterable[int]): Cell positions where to divide.
+
+        Yields:
+            [Iterable[List[Segment]]]: An iterable of Segments in List.
+        """
+        split_segments: List["Segment"] = []
+        add_segment = split_segments.append
+
+        iter_cuts = iter(cuts)
+
+        while True:
+            cut = next(iter_cuts, -1)
+            if cut == -1:
+                return
+            if cut != 0:
+                break
+            yield []
+        pos = 0
+
+        segments_clear = split_segments.clear
+        segments_copy = split_segments.copy
+
+        _cell_len = cached_cell_len
+        for segment in segments:
+            text, _style, control = segment
+            while text:
+                end_pos = pos if control else pos + _cell_len(text)
+                if end_pos < cut:
+                    add_segment(segment)
+                    pos = end_pos
+                    break
+
+                if end_pos == cut:
+                    add_segment(segment)
+                    yield segments_copy()
+                    segments_clear()
+                    pos = end_pos
+
+                    cut = next(iter_cuts, -1)
+                    if cut == -1:
+                        if split_segments:
+                            yield segments_copy()
+                        return
+
+                    break
+
+                else:
+                    before, segment = segment.split_cells(cut - pos)
+                    text, _style, control = segment
+                    add_segment(before)
+                    yield segments_copy()
+                    segments_clear()
+                    pos = cut
+
+                cut = next(iter_cuts, -1)
+                if cut == -1:
+                    if split_segments:
+                        yield segments_copy()
+                    return
+
+        yield segments_copy()
+
+
+class Segments:
+    """A simple renderable to render an iterable of segments. This class may be useful if
+    you want to print segments outside of a __rich_console__ method.
+
+    Args:
+        segments (Iterable[Segment]): An iterable of segments.
+        new_lines (bool, optional): Add new lines between segments. Defaults to False.
+    """
+
+    def __init__(self, segments: Iterable[Segment], new_lines: bool = False) -> None:
+        self.segments = list(segments)
+        self.new_lines = new_lines
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.new_lines:
+            line = Segment.line()
+            for segment in self.segments:
+                yield segment
+                yield line
+        else:
+            yield from self.segments
+
+
+class SegmentLines:
+    def __init__(self, lines: Iterable[List[Segment]], new_lines: bool = False) -> None:
+        """A simple renderable containing a number of lines of segments. May be used as an intermediate
+        in rendering process.
+
+        Args:
+            lines (Iterable[List[Segment]]): Lists of segments forming lines.
+            new_lines (bool, optional): Insert new lines after each line. Defaults to False.
+        """
+        self.lines = list(lines)
+        self.new_lines = new_lines
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.new_lines:
+            new_line = Segment.line()
+            for line in self.lines:
+                yield from line
+                yield new_line
+        else:
+            for line in self.lines:
+                yield from line
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+    from pip._vendor.rich.syntax import Syntax
+    from pip._vendor.rich.text import Text
+
+    code = """from rich.console import Console
+console = Console()
+text = Text.from_markup("Hello, [bold magenta]World[/]!")
+console.print(text)"""
+
+    text = Text.from_markup("Hello, [bold magenta]World[/]!")
+
+    console = Console()
+
+    console.rule("rich.Segment")
+    console.print(
+        "A Segment is the last step in the Rich render process before generating text with ANSI codes."
+    )
+    console.print("\nConsider the following code:\n")
+    console.print(Syntax(code, "python", line_numbers=True))
+    console.print()
+    console.print(
+        "When you call [b]print()[/b], Rich [i]renders[/i] the object in to the following:\n"
+    )
+    fragments = list(console.render(text))
+    console.print(fragments)
+    console.print()
+    console.print("The Segments are then processed to produce the following output:\n")
+    console.print(text)
+    console.print(
+        "\nYou will only need to know this if you are implementing your own Rich renderables."
+    )

llava/lib/python3.10/site-packages/pip/_vendor/rich/themes.py

@@ -0,0 +1,5 @@
+from .default_styles import DEFAULT_STYLES
+from .theme import Theme
+
+
+DEFAULT = Theme(DEFAULT_STYLES)

llava/lib/python3.10/site-packages/pip/_vendor/rich/tree.py

@@ -0,0 +1,257 @@
+from typing import Iterator, List, Optional, Tuple
+
+from ._loop import loop_first, loop_last
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleStack, StyleType
+from .styled import Styled
+
+GuideType = Tuple[str, str, str, str]
+
+
+class Tree(JupyterMixin):
+    """A renderable for a tree structure.
+
+    Attributes:
+        ASCII_GUIDES (GuideType): Guide lines used when Console.ascii_only is True.
+        TREE_GUIDES (List[GuideType, GuideType, GuideType]): Default guide lines.
+
+    Args:
+        label (RenderableType): The renderable or str for the tree label.
+        style (StyleType, optional): Style of this tree. Defaults to "tree".
+        guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line".
+        expanded (bool, optional): Also display children. Defaults to True.
+        highlight (bool, optional): Highlight renderable (if str). Defaults to False.
+        hide_root (bool, optional): Hide the root node. Defaults to False.
+    """
+
+    ASCII_GUIDES = ("    ", "|   ", "+-- ", "`-- ")
+    TREE_GUIDES = [
+        ("    ", "│   ", "├── ", "└── "),
+        ("    ", "┃   ", "┣━━ ", "┗━━ "),
+        ("    ", "║   ", "╠══ ", "╚══ "),
+    ]
+
+    def __init__(
+        self,
+        label: RenderableType,
+        *,
+        style: StyleType = "tree",
+        guide_style: StyleType = "tree.line",
+        expanded: bool = True,
+        highlight: bool = False,
+        hide_root: bool = False,
+    ) -> None:
+        self.label = label
+        self.style = style
+        self.guide_style = guide_style
+        self.children: List[Tree] = []
+        self.expanded = expanded
+        self.highlight = highlight
+        self.hide_root = hide_root
+
+    def add(
+        self,
+        label: RenderableType,
+        *,
+        style: Optional[StyleType] = None,
+        guide_style: Optional[StyleType] = None,
+        expanded: bool = True,
+        highlight: Optional[bool] = False,
+    ) -> "Tree":
+        """Add a child tree.
+
+        Args:
+            label (RenderableType): The renderable or str for the tree label.
+            style (StyleType, optional): Style of this tree. Defaults to "tree".
+            guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line".
+            expanded (bool, optional): Also display children. Defaults to True.
+            highlight (Optional[bool], optional): Highlight renderable (if str). Defaults to False.
+
+        Returns:
+            Tree: A new child Tree, which may be further modified.
+        """
+        node = Tree(
+            label,
+            style=self.style if style is None else style,
+            guide_style=self.guide_style if guide_style is None else guide_style,
+            expanded=expanded,
+            highlight=self.highlight if highlight is None else highlight,
+        )
+        self.children.append(node)
+        return node
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        stack: List[Iterator[Tuple[bool, Tree]]] = []
+        pop = stack.pop
+        push = stack.append
+        new_line = Segment.line()
+
+        get_style = console.get_style
+        null_style = Style.null()
+        guide_style = get_style(self.guide_style, default="") or null_style
+        SPACE, CONTINUE, FORK, END = range(4)
+
+        _Segment = Segment
+
+        def make_guide(index: int, style: Style) -> Segment:
+            """Make a Segment for a level of the guide lines."""
+            if options.ascii_only:
+                line = self.ASCII_GUIDES[index]
+            else:
+                guide = 1 if style.bold else (2 if style.underline2 else 0)
+                line = self.TREE_GUIDES[0 if options.legacy_windows else guide][index]
+            return _Segment(line, style)
+
+        levels: List[Segment] = [make_guide(CONTINUE, guide_style)]
+        push(iter(loop_last([self])))
+
+        guide_style_stack = StyleStack(get_style(self.guide_style))
+        style_stack = StyleStack(get_style(self.style))
+        remove_guide_styles = Style(bold=False, underline2=False)
+
+        depth = 0
+
+        while stack:
+            stack_node = pop()
+            try:
+                last, node = next(stack_node)
+            except StopIteration:
+                levels.pop()
+                if levels:
+                    guide_style = levels[-1].style or null_style
+                    levels[-1] = make_guide(FORK, guide_style)
+                    guide_style_stack.pop()
+                    style_stack.pop()
+                continue
+            push(stack_node)
+            if last:
+                levels[-1] = make_guide(END, levels[-1].style or null_style)
+
+            guide_style = guide_style_stack.current + get_style(node.guide_style)
+            style = style_stack.current + get_style(node.style)
+            prefix = levels[(2 if self.hide_root else 1) :]
+            renderable_lines = console.render_lines(
+                Styled(node.label, style),
+                options.update(
+                    width=options.max_width
+                    - sum(level.cell_length for level in prefix),
+                    highlight=self.highlight,
+                    height=None,
+                ),
+                pad=options.justify is not None,
+            )
+
+            if not (depth == 0 and self.hide_root):
+                for first, line in loop_first(renderable_lines):
+                    if prefix:
+                        yield from _Segment.apply_style(
+                            prefix,
+                            style.background_style,
+                            post_style=remove_guide_styles,
+                        )
+                    yield from line
+                    yield new_line
+                    if first and prefix:
+                        prefix[-1] = make_guide(
+                            SPACE if last else CONTINUE, prefix[-1].style or null_style
+                        )
+
+            if node.expanded and node.children:
+                levels[-1] = make_guide(
+                    SPACE if last else CONTINUE, levels[-1].style or null_style
+                )
+                levels.append(
+                    make_guide(END if len(node.children) == 1 else FORK, guide_style)
+                )
+                style_stack.push(get_style(node.style))
+                guide_style_stack.push(get_style(node.guide_style))
+                push(iter(loop_last(node.children)))
+                depth += 1
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        stack: List[Iterator[Tree]] = [iter([self])]
+        pop = stack.pop
+        push = stack.append
+        minimum = 0
+        maximum = 0
+        measure = Measurement.get
+        level = 0
+        while stack:
+            iter_tree = pop()
+            try:
+                tree = next(iter_tree)
+            except StopIteration:
+                level -= 1
+                continue
+            push(iter_tree)
+            min_measure, max_measure = measure(console, options, tree.label)
+            indent = level * 4
+            minimum = max(min_measure + indent, minimum)
+            maximum = max(max_measure + indent, maximum)
+            if tree.expanded and tree.children:
+                push(iter(tree.children))
+                level += 1
+        return Measurement(minimum, maximum)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Group
+    from pip._vendor.rich.markdown import Markdown
+    from pip._vendor.rich.panel import Panel
+    from pip._vendor.rich.syntax import Syntax
+    from pip._vendor.rich.table import Table
+
+    table = Table(row_styles=["", "dim"])
+
+    table.add_column("Released", style="cyan", no_wrap=True)
+    table.add_column("Title", style="magenta")
+    table.add_column("Box Office", justify="right", style="green")
+
+    table.add_row("Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$952,110,690")
+    table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347")
+    table.add_row("Dec 15, 2017", "Star Wars Ep. V111: The Last Jedi", "$1,332,539,889")
+    table.add_row("Dec 16, 2016", "Rogue One: A Star Wars Story", "$1,332,439,889")
+
+    code = """\
+class Segment(NamedTuple):
+    text: str = ""
+    style: Optional[Style] = None
+    is_control: bool = False
+"""
+    syntax = Syntax(code, "python", theme="monokai", line_numbers=True)
+
+    markdown = Markdown(
+        """\
+### example.md
+> Hello, World!
+>
+> Markdown _all_ the things
+"""
+    )
+
+    root = Tree("🌲 [b green]Rich Tree", highlight=True, hide_root=True)
+
+    node = root.add(":file_folder: Renderables", guide_style="red")
+    simple_node = node.add(":file_folder: [bold yellow]Atomic", guide_style="uu green")
+    simple_node.add(Group("📄 Syntax", syntax))
+    simple_node.add(Group("📄 Markdown", Panel(markdown, border_style="green")))
+
+    containers_node = node.add(
+        ":file_folder: [bold magenta]Containers", guide_style="bold magenta"
+    )
+    containers_node.expanded = True
+    panel = Panel.fit("Just a panel", border_style="red")
+    containers_node.add(Group("📄 Panels", panel))
+
+    containers_node.add(Group("📄 [b magenta]Table", table))
+
+    console = Console()
+
+    console.print(root)